1 2000-10-12 <larsbj@baywatch.lyx.org>
3 * src/support/lyxfunctional.h: add operator= that takes a reference
5 * src/lyxserver.C (mkfifo): make first arg const
7 * src/layout.h: renamed name(...) to setName(...) to work around
10 * src/buffer.C (setFileName): had to change name of function to
11 work around bugs in egcs. (renamed from fileName)
13 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
15 * src/support/translator.h: move helper template clsses to
16 lyxfunctional.h, inlcude 2support/lyxfunctional.h"
18 * src/support/lyxmanip.h: add delaration of fmt
20 * src/support/lyxfunctional.h: new file
21 (class_fun_t): new template class
22 (class_fun): helper template function
23 (back_insert_fun_iterator): new template class
24 (back_inserter_fun): helper template function
25 (compare_memfun_t): new template class
26 (compare_memfun): helper template function
27 (equal_1st_in_pair): moved here from translator
28 (equal_2nd_in_pair): moved here from translatro
30 * src/support/fmt.C: new file
31 (fmt): new func, can be used for a printf substute when still
32 using iostreams ex. lyxerr << fmg("Hello %s", "Jürgen") << endl;
34 * src/support/StrPool.C: add some comment
36 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
39 * src/insets/figinset.C (addpidwait): use std::copy with
40 ostream_iterator to fill the pidwaitlist
42 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
44 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
47 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
50 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
52 * src/frontends/xforms/FormDocument.C (build): remove c_str()
55 (CheckChoiceClass): move initialization of tc and tct
57 * src/tabular.C: remove current_view
58 (OldFormatRead): similar to right below [istream::ignore]
60 * src/lyxlex_pimpl.C (next): add code for faster skipping of
61 chars, unfortunately this is buggy on gcc 2.95.2, so currently
62 unused [istream::ignore]
64 * src/lyxfunc.C: include "support/lyxfunctional.h"
65 (getInsetByCode): use std::find_if and compare_memfun
67 * src/lyxfont.C (stateText): remove c_str()
69 * src/lyx_main.C (setDebuggingLevel): make static
70 (commandLineHelp): make static
72 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
73 Screen* together with fl_get_display() and fl_screen
75 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
76 togheter with fl_get_display() and fl_screen
77 (create_forms): remove c_str()
79 * src/layout.C: include "support/lyxfunctional.h"
80 (hasLayout): use std::find_if and compare_memfun
81 (GetLayout): use std::find_if and comapre_memfun
82 (delete_layout): use std::remove_if and compare_memfun
83 (NumberOfClass): use std:.find_if and compare_memfun
85 * src/gettext.h: change for the new functions
87 * src/gettext.C: new file, make _(char const * str) and _(string
88 const & str) real functions.
90 * src/font.C (width): rewrite slightly to avoid one extra variable
92 * src/debug.C: initialize Debug::ANY here
94 * src/commandtags.h: update number comments
96 * src/combox.h (get): make const func
100 * src/combox.C (input_cb): handle case where fl_get_input can
103 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
104 "support/lyxfunctional.h", remove currentview variable.
105 (resize): use std::for_each with std::mem_fun
106 (getFileNames): use std::copy with back_inserter_fun
107 (getBuffer): change arg type to unsigned int
108 (emergencyWriteAll): call emergencyWrite with std::for_each and
110 (emergencyWrite): new method, the for loop in emergencyWriteAll
112 (exists): use std::find_if with compare_memfun
113 (getBuffer): use std::find_if and compare_memfun
115 * src/buffer.h: add typedefs for iterator_category, value_type
116 difference_type, pointer and reference for inset_iterator
117 add postfix ++ for inset_iterator
118 make isnet_iterator::getPos() const
120 * src/buffer.C: added support/lyxmanip.h
121 (readFile): use lyxerr << fmt instead of printf
122 (makeLaTeXFile): use std::copy to write out encodings
125 * src/Painter.C (text): rewrite slightly to avoid extra font variable
127 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
128 free and the char * temp.
129 (hasMenu): use std::find_if and compare_memfun
132 * src/Makefile.am (lyx_SOURCES): added gettext.C
134 * src/LyXAction.C (retrieveActionArg): clear the arg, use
135 string::insert small change to avoid temporary
137 * src/LColor.C (getGUIName): remove c_str()
139 * several files: change all occurances of fl_display to
142 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
143 that -pedantid is not used for gcc 2.97 (cvs gcc)
145 * boost/Makefile.am: begin slowly to prepare for a real boost lib
147 2000-10-11 Allan Rae <rae@lyx.org>
149 * src/frontends/xforms/FormPreferences.C (input): template path must be
150 a readable directory. It doesn't need to be writeable.
151 (build, delete, update, apply): New inputs in the various tabfolders
153 * src/frontends/xforms/forms/form_preferences.fd:
154 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
155 several new entries to existing folders. Shuffled some existing stuff
158 * src/frontends/xforms/forms/form_print.fd:
159 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
160 Should probably rework PrinterParams as well. Note that the switch to
161 collated is effectively the same as !unsorted so changing PrinterParams
162 will require a lot of fiddly changes to reverse the existing logic.
164 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
166 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
168 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
170 2000-10-10 Allan Rae <rae@lyx.org>
173 * src/lyxfunc.C (Dispatch):
175 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
178 * src/lyxrc.C (output): Only write the differences between system lyxrc
179 and the users settings.
182 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
184 I'll rewrite this later, after 1.1.6 probably, to keep a single
185 LyXRC but two instances of a LyXRCStruct.
187 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
189 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
191 * src/tabular.h: add a few std:: qualifiers.
193 * src/encoding.C: add using directive.
194 * src/language.C: ditto.
196 * src/insets/insetquotes.C (Validate): use languages->lang()
197 instead of only language.
199 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
201 * lib/languages: New file.
203 * lib/encodings: New file.
205 * src/language.C (Languages): New class.
206 (read): New method. Reads the languages from the 'languages' file.
208 * src/encoding.C (Encodings): New class.
209 (read): New method. Reads the encodings from the 'encodings' file.
211 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
214 * src/bufferparams.h and a lot of files: Deleted the member language,
215 and renamed language_info to language
217 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
218 * src/lyxfont.C (latexWriteStartChanges): ditto.
219 * src/paragraph.C (validate,TeXOnePar): ditto.
221 * src/lyxfont.C (update): Restored deleted code.
223 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
225 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
227 * src/BufferView_pimpl.C (buffer): cleaned up a little.
229 * src/insets/figinset.[Ch]:
230 * src/insets/insetinclude.[Ch]:
231 * src/insets/insetinclude.[Ch]:
232 * src/insets/insetparent.[Ch]:
233 * src/insets/insetref.[Ch]:
234 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
237 * src/mathed/formula.[Ch]:
238 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
240 * src/buffer.C (parseSingleLyXformat2Token, readInset):
241 * src/lyx_cb.C (FigureApplyCB):
242 * src/lyxfunc.C (getStatus, Dispatch):
243 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
246 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
248 * src/converter.[Ch] (Formats::View):
249 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
251 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
252 *current_view->buffer(). This will change later, but this patch is way
255 2000-10-09 Juergen Vigna <jug@sad.it>
257 * src/text.C (GetRow): small fix.
259 * src/BufferView_pimpl.C (cursorPrevious):
260 (cursorNext): added LyXText parameter to function.
262 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
263 keypress depending on cursor position.
265 2000-10-06 Juergen Vigna <jug@sad.it>
267 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
268 (copySelection): redone this function and also copy ascii representa-
271 * src/tabular.C (Ascii):
275 (print_n_chars): new functions to realize the ascii export of tabulars.
277 2000-10-05 Juergen Vigna <jug@sad.it>
279 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
280 if we don't have a buffer.
282 2000-10-10 Allan Rae <rae@lyx.org>
284 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
285 with closing dialog. It seems that nested tabfolders require hiding
286 of inner tabfolders before hiding the dialog itself. Actually all I
287 did was hide the active outer folder.
289 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
290 unless there really is a buffer. hideBufferDependent is called
293 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
294 POTFILES.in stays in $(srcdir).
296 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
298 * lib/lyxrc.example: Few changes.
300 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
302 * src/BufferView_pimpl.C (buffer): only need one the
303 updateBufferDependent signal to be emitted once! Moved to the end of
304 the method to allow bv_->text to be updated first.
306 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
307 and hSignal_ with Dialogs * and BufferDependency variables.
308 New Buffer * parent_, initialised when the dialog is launched. Used to
309 check whether to update() or hide() dialog in the new, private
310 updateOrHide() method that is connected to the updateBufferDependent
311 signal. Daughter classes dictate what to do using the
312 ChangedBufferAction enum, passed to the c-tor.
314 * src/frontends/xforms/FormCitation.C:
315 * src/frontends/xforms/FormCommand.C:
316 * src/frontends/xforms/FormCopyright.C:
317 * src/frontends/xforms/FormDocument.C:
318 * src/frontends/xforms/FormError.C:
319 * src/frontends/xforms/FormIndex.C:
320 * src/frontends/xforms/FormPreferences.C:
321 * src/frontends/xforms/FormPrint.C:
322 * src/frontends/xforms/FormRef.C:
323 * src/frontends/xforms/FormToc.C:
324 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
327 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
328 ChangedBufferAction enum.
330 * src/frontends/xforms/FormParagraph.[Ch]
331 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
334 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
336 * lib/bind/cua.bind: fix a bit.
337 * lib/bind/emacs.bind: ditto.
339 * lib/bind/menus.bind: remove real menu entries from there.
341 * src/spellchecker.C: make sure we only include strings.h when
344 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
346 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
347 function. It enlarges the maximum number of pup when needed.
348 (add_toc2): Open a new menu if maximum number of items per menu has
351 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
353 * src/frontends/kde/FormPrint.C: fix error reporting
355 * src/frontends/xforms/FormDocument.C: fix compiler
358 * lib/.cvsignore: add Literate.nw
360 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
363 * bufferview_funcs.[Ch]
366 * text2.C: Add support for numbers in RTL text.
368 2000-10-06 Allan Rae <rae@lyx.org>
370 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
371 to be gettext.m4 friendly again. ext_l10n.h is now
372 generated into $top_srcdir instead of $top_builddir
373 so that lyx.pot will be built correctly -- without
374 duplicate parsing of ext_l10n.h.
376 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
378 * src/frontends/kde/FormCitation.C: make the dialog
381 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
383 * config/kde.m4: fix consecutive ./configure runs,
384 look for qtarch, fix library order
386 * src/frontends/kde/Makefile.am: tidy up,
387 add Print dialog, add .dlg dependencies
389 * src/frontends/kde/FormPrint.C:
390 * src/frontends/kde/FormPrint.h:
391 * src/frontends/kde/formprintdialog.C:
392 * src/frontends/kde/formprintdialog.h:
393 * src/frontends/kde/formprintdialogdata.C:
394 * src/frontends/kde/formprintdialogdata.h:
395 * src/frontends/kde/dlg/formprintdialog.dlg: add
398 * src/frontends/kde/dlg/README: Added explanatory readme
400 * src/frontends/kde/dlg/checkinitorder.pl: small perl
401 script to double-check qtarch's output
403 * src/frontends/kde/formindexdialog.C:
404 * src/frontends/kde/formindexdialogdata.C:
405 * src/frontends/kde/formindexdialogdata.h:
406 * src/frontends/kde/dlg/formindexdialog.dlg: update
407 for qtarch, minor fixes
409 2000-10-05 Allan Rae <rae@lyx.org>
411 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
412 dialogs when switching buffers update them instead. It's up to each
413 dialog to decide if it should still be visible or not.
414 update() should return a bool to control visiblity within show().
415 Or perhaps better to set a member variable and use that to control
418 * lib/build-listerrors: create an empty "listerrors" file just to stop
419 make trying to regenerate it all the time if you don't have noweb
422 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
424 * po/Makefile.in.in (ext_l10n.h): added a rule to build
425 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
426 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
427 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
428 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
430 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
432 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
434 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
435 deleting buffer. Closes all buffer-dependent dialogs.
437 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
439 * src/frontends/xforms/FormCitation.[Ch]:
440 * src/frontends/xforms/FormPreferences.[Ch]:
441 * src/frontends/xforms/FormPrint.[Ch]:
442 * src/frontends/xforms/FormRef.[Ch]:
443 * src/frontends/xforms/FormUrl.[Ch]: ditto
445 * src/frontends/xforms/FormDocument.[Ch]:
446 * src/frontends/xforms/forms/form_document.C.patch:
447 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
448 pass through a single input() function.
450 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
452 * lib/build-listerrors: return status as OK
454 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
456 * lib/lyxrc.example: Updated to new export code
458 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
460 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
463 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
466 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
468 * lib/layouts/amsbook.layout: ditto.
470 * boost/Makefile.am: fix typo.
472 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
474 (add_lastfiles): removed.
475 (add_documents): removed.
476 (add_formats): removed.
478 * src/frontends/Menubar.C: remove useless "using" directive.
480 * src/MenuBackend.h: add a new MenuItem constructor.
482 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
485 2000-10-04 Allan Rae <rae@lyx.org>
487 * lib/Makefile.am (listerrors):
488 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
489 I haven't got notangle installed so Kayvan please test. The output
490 should end up in $builddir. This also allows people who don't have
491 noweb installed to complete the make process without error.
493 * src/frontends/xforms/FormCommand.[Ch] (showInset):
494 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
495 by JMarc's picky compiler.
497 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
500 * src/insets/insettabular.C (setPos): change for loop to not use
501 sequencing operator. Please check this Jürgen.
503 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
505 * src/insets/insetcite.C (getScreenLabel): ditto
506 * src/support/filetools.C (QuoteName): ditto
507 (ChangeExtension): ditto
509 * src/BufferView_pimpl.C (scrollCB): make heigt int
511 * src/BufferView2.C (insertInset): comment out unused arg
513 * boost/Makefile.am (EXTRADIST): new variable
515 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
517 * src/exporter.C (IsExportable): Fixed
519 * lib/configure.m4: Small fix
521 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
523 * src/insets/insetbutton.C (width): Changed to work with no GUI.
524 * src/insets/insetbib.C (bibitemWidest): ditto.
525 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
527 2000-10-03 Juergen Vigna <jug@sad.it>
529 * src/BufferView2.C (theLockingInset): removed const because of
530 Agnus's compile problems.
532 * src/insets/insettext.C (LocalDispatch): set the language of the
533 surronding paragraph on inserting the first character.
535 * various files: changed use of BufferView::the_locking_inset.
537 * src/BufferView2.C (theLockingInset):
538 (theLockingInset): new functions.
540 * src/BufferView.h: removed the_locking_inset.
542 * src/lyxtext.h: added the_locking_inset
544 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
546 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
548 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
550 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
551 * src/mathed/math_cursor.C (IsAlpha): ditto.
552 * src/mathed/math_inset.C (strnew): ditto.
553 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
554 (IMetrics): cxp set but never used; removed.
555 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
556 that the variable in question has been removed also!
559 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
560 using the Buffer * passed to Latex(), using the BufferView * passed to
561 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
563 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
564 Linuxdoc() and DocBook() rather than the stored Buffer * master.
566 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
567 * src/buffer.C (readInset): used new InsetBibtex c-tor
568 * (getBibkeyList): used new InsetBibtex::getKeys
570 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
573 * lib/build-listerrors
575 * src/exporter.C: Add literate programming support to the export code
578 * src/lyx_cb.C: Remove old literate code.
580 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
583 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
584 * src/converter.C (View, Convert): Use QuoteName.
586 * src/insets/figinset.C (Preview): Use Formats::View.
588 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
590 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
592 * src/lyxfunc.C (Dispatch): move declaration of text variable at
593 the top of the function, because compaq cxx complains that the
594 "goto exit_with_message" when the function is disabled bypasses
596 (MenuNew): try a better fix for the generation of new file names.
597 This time, I used AddName() instead of AddPath(), hoping Juergen
600 2000-10-03 Allan Rae <rae@lyx.org>
602 * src/frontends/xforms/forms/form_preferences.fd:
603 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
604 nested tabfolders has begun. The old "Miscellaneous" was renamed as
605 "Look and Feel"->"General" but will need to be split up further into
606 general output and general input tabs. Current plan is for four outer
607 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
608 stuff; "Inputs" for input and import configuration; "Outputs" for
609 output and export configuration; and one more whatever is left over
610 called "General". The leftovers at present look like being which
611 viewers to use, spellchecker, language support and might be better
612 named "Support". I've put "Paths" in "Inputs" for the moment as this
613 seems reasonable for now at least.
614 One problem remains: X error kills LyX when you close Preferences.
616 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
618 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
619 qualifier from form()
620 * src/frontends/xforms/FormCitation.[Ch]:
621 * src/frontends/xforms/FormCopyright.[Ch]:
622 * src/frontends/xforms/FormDocument.[Ch]:
623 * src/frontends/xforms/FormError.[Ch]:
624 * src/frontends/xforms/FormIndex.[Ch]:
625 * src/frontends/xforms/FormPreferences.[Ch]:
626 * src/frontends/xforms/FormPrint.[Ch]:
627 * src/frontends/xforms/FormRef.[Ch]:
628 * src/frontends/xforms/FormToc.[Ch]:
629 * src/frontends/xforms/FormUrl.[Ch]: ditto.
631 * src/frontends/xforms/FormCitation.[Ch]:
632 * src/frontends/xforms/FormIndex.[Ch]:
633 * src/frontends/xforms/FormRef.[Ch]:
634 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
635 with Allan's naming policy
637 * src/frontends/xforms/FormCitation.C: some static casts to remove
640 2000-10-02 Juergen Vigna <jug@sad.it>
642 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
643 now you can type or do stuff inside the table-cell also when in dummy
644 position, fixed visible cursor.
646 * src/insets/insettext.C (Edit): fixing cursor-view position.
648 * src/lyxfunc.C (Dispatch): use * text variable so that it can
649 be used for equal functions in lyxfunc and insettext.
651 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
653 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
655 * src/frontends/gnome/FormCitation.h:
656 * src/frontends/gnome/FormCopyright.h:
657 * src/frontends/gnome/FormIndex.h:
658 * src/frontends/gnome/FormPrint.h:
659 * src/frontends/gnome/FormToc.h:
660 * src/frontends/gnome/FormUrl.h:
661 * src/frontends/kde/FormCitation.h:
662 * src/frontends/kde/FormCopyright.h:
663 * src/frontends/kde/FormIndex.h:
664 * src/frontends/kde/FormRef.h:
665 * src/frontends/kde/FormToc.h:
666 * src/frontends/kde/FormUrl.h: fix remaining users of
669 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
671 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
673 (DocBookHandleCaption): ditto.
674 (DocBookHandleFootnote): ditto.
675 (SimpleDocBookOnePar): ditto.
677 * src/frontends/xforms/FormDocument.h (form): remove extra
678 FormDocument:: qualifier.
680 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
682 * sigc++/handle.h: ditto.
684 * src/lyx_gui_misc.C: add "using" directive.
686 * src/cheaders/cstddef: new file, needed by the boost library (for
689 2000-10-02 Juergen Vigna <jug@sad.it>
691 * src/insets/insettext.C (SetFont): better support.
693 * src/insets/insettabular.C (draw): fixed drawing of single cell.
695 * src/screen.C (DrawOneRow): some uint refixes!
697 2000-10-02 Allan Rae <rae@lyx.org>
699 * boost/.cvsignore: ignore Makefile as well
701 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
702 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
704 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
705 Left this one out by accident.
707 * src/frontends/xforms/FormBase.h (restore): default to calling
708 update() since that will restore the original/currently-applied values.
709 Any input() triggered error messages will require the derived classes
710 to redefine restore().
712 * src/frontends/xforms/FormDocument.C: initialize a few variables to
713 avoid a segfault. combo_doc_class is the main concern.
715 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
717 * Simplify build-listerrors in view of GUI-less export ability!
719 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
721 * src/lyx_main.C (easyParse): Disable gui when exporting
723 * src/insets/figinset.C:
727 * src/tabular.C: Changes to allow no-gui.
729 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
731 * src/support/utility.hpp: removed file
732 * src/support/block.h: removed file
734 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
737 * src/mathed/formula.C: add support/lyxlib.h
738 * src/mathed/formulamacro.C: ditto
740 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
741 * src/lyxparagraph.h: ditto
743 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
744 * src/frontends/Makefile.am (INCLUDES): ditto
745 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
746 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
747 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
748 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
749 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
750 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
752 * src/BufferView.h: use boost/utility.hpp
753 * src/LColor.h: ditto
755 * src/LyXAction.h: ditto
756 * src/LyXView.h: ditto
757 * src/bufferlist.h: ditto
758 * src/lastfiles.h: ditto
759 * src/layout.h: ditto
760 * src/lyx_gui.h: ditto
761 * src/lyx_main.h: ditto
762 * src/lyxlex.h: ditto
764 * src/frontends/ButtonPolicies.h: ditto
765 * src/frontends/Dialogs.h: ditto
766 * src/frontends/xforms/FormBase.h: ditto
767 * src/frontends/xforms/FormGraphics.h: ditto
768 * src/frontends/xforms/FormParagraph.h: ditto
769 * src/frontends/xforms/FormTabular.h: ditto
770 * src/graphics/GraphicsCache.h: ditto
771 * src/graphics/Renderer.h: ditto
772 * src/insets/ExternalTemplate.h: ditto
773 * src/insets/insetcommand.h: ditto
774 * src/support/path.h: ditto
776 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
777 and introduce clause for 2.97.
779 * boost/libs/README: new file
781 * boost/boost/utility.hpp: new file
783 * boost/boost/config.hpp: new file
785 * boost/boost/array.hpp: new file
787 * boost/Makefile.am: new file
789 * boost/.cvsignore: new file
791 * configure.in (AC_OUTPUT): add boost/Makefile
793 * Makefile.am (SUBDIRS): add boost
795 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
797 * src/support/lstrings.C (suffixIs): Fixed.
799 2000-10-01 Allan Rae <rae@lyx.org>
801 * src/PrinterParams.h: moved things around to avoid the "can't
802 inline call" warning.
804 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
805 into doc++ documentation.
807 * src/frontends/xforms/FormCommand.[Ch]: support button policy
809 * src/frontends/xforms/FormRef.C: make use of button controller
810 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
811 cleaned up button controller usage.
812 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
813 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
814 use the button controller
816 * src/frontends/xforms/forms/*.fd: and associated generated files
817 updated to reflect changes to FormBase. Some other FormXxxx files
818 also got minor updates to reflect changes to FormBase.
820 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
821 (hide): made virtual.
822 (input): return a bool. true == valid input
823 (RestoreCB, restore): new
824 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
825 Changes to allow derived dialogs to use a ButtonController and
826 make sense when doing so: OK button calls ok() and so on.
828 * src/frontends/xforms/ButtonController.h (class ButtonController):
829 Switch from template implementation to taking Policy parameter.
830 Allows FormBase to provide a ButtonController for any dialog.
832 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
833 Probably should rename connect and disconnect.
834 (apply): use the radio button groups
835 (form): needed by FormBase
836 (build): setup the radio button groups
838 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
840 * several files: type changes to reduce the number of warnings and
841 to unify type hangling a bit. Still much to do.
843 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
845 * lib/images/*: rename a bunch of icons to match Dekel converter
848 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
851 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
853 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
855 * sigc++/handle.h: ditto for class Handle.
857 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
859 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
861 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
863 * src/intl.C (InitKeyMapper): Correct the value of n due to the
864 removal of the "default" language.
866 * src/combox.h (getline): Check that sel > 0
868 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
870 * lib/examples/docbook_example.lyx
871 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
873 * lib/layouts/docbook-book.layout: new docbook book layout.
875 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
877 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
879 * src/insets/figinset.C (DocBook):fixed small typo.
881 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
883 * src/insets/insetinclude.h: string include_label doesn't need to be
886 2000-09-29 Allan Rae <rae@lyx.org>
888 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
889 Allow derived type to control connection and disconnection from signals
890 of its choice if desired.
892 2000-09-28 Juergen Vigna <jug@sad.it>
894 * src/insets/insettabular.C (update): fixed cursor setting when
895 the_locking_inset changed.
896 (draw): made this a bit cleaner.
897 (InsetButtonPress): fixed!
899 * various files: added LyXText Parameter to fitCursor call.
901 * src/BufferView.C (fitCursor): added LyXText parameter.
903 * src/insets/insettabular.C (draw): small draw fix.
905 * src/tabular.C: right setting of left/right celllines.
907 * src/tabular.[Ch]: fixed various types in funcions and structures.
908 * src/insets/insettabular.C: ditto
909 * src/frontends/xforms/FormTabular.C: ditto
911 2000-09-28 Allan Rae <rae@lyx.org>
913 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
914 that the #ifdef's had been applied to part of what should have been
915 a complete condition. It's possible there are other tests that
916 were specific to tables that are also wrong now that InsetTabular is
917 being used. Now we need to fix the output of '\n' after a table in a
918 float for the same reason as the original condition:
919 "don't insert this if we would be adding it before or after a table
920 in a float. This little trick is needed in order to allow use of
921 tables in \subfigures or \subtables."
922 Juergen can you check this?
924 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
926 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
927 outputed to the ostream.
929 * several files: fixed types based on warnings from cxx
931 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
933 * src/frontends/kde/Makefile.am: fix rule for
934 formindexdialogdata_moc.C
936 * src/.cvsignore: add ext_l10n.h to ignore
938 * acconfig.h: stop messing with __STRICT_ANSI__
939 * config/gnome.m4: remove option to set -ansi
940 * config/kde.m4: remove option to set -ansi
941 * config/lyxinclude.m4: don't set -ansi
943 2000-09-27 Juergen Vigna <jug@sad.it>
945 * various files: remove "default" language check.
947 * src/insets/insetquotes.C: removed use of current_view.
949 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
950 the one should have red ears by now!
952 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
953 in more then one paragraph. Fixed cursor-movement/selection.
955 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
956 paragraphs inside a text inset.
958 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
959 text-inset if this owner is an inset.
961 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
963 * src/Bullet.h: changed type of font, character and size to int
965 * src/buffer.C (asciiParagraph): remove actcell and fname1.
967 * src/insets/inseturl.[Ch]:
968 * src/insets/insetref.[Ch]:
969 * src/insets/insetlabel.[Ch]: add linelen to Ascii
971 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
973 * src/buffer.C (readFile): block-if statement rearranged to minimise
974 bloat. Patch does not reverse Jean-Marc's change ;-)
976 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
977 Class rewritten to store pointers to hide/update signals directly,
978 rather than Dialogs *. Also defined an enum to ease use. All xforms
979 forms can now be derived from this class.
981 * src/frontends/xforms/FormCommand.[Ch]
982 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
984 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
987 * src/frontends/xforms/forms/form_citation.fd
988 * src/frontends/xforms/forms/form_copyright.fd
989 * src/frontends/xforms/forms/form_error.fd
990 * src/frontends/xforms/forms/form_index.fd
991 * src/frontends/xforms/forms/form_ref.fd
992 * src/frontends/xforms/forms/form_toc.fd
993 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
995 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
997 * src/insets/insetfoot.C: removed redundent using directive.
999 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1001 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1002 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1004 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1005 created in the constructors in different groups. Then set() just
1006 have to show the groups as needed. This fixes the redraw problems
1007 (and is how the old menu code worked).
1009 * src/support/lyxlib.h: declare the methods as static when we do
1010 not have namespaces.
1012 2000-09-26 Juergen Vigna <jug@sad.it>
1014 * src/buffer.C (asciiParagraph): new function.
1015 (writeFileAscii): new function with parameter ostream.
1016 (writeFileAscii): use now asciiParagraph.
1018 * various inset files: added the linelen parameter to the Ascii-func.
1020 * src/tabular.C (Write): fixed error in writing file introduced by
1021 the last changes from Lars.
1023 * lib/bind/menus.bind: removed not supported functions.
1025 * src/insets/insettext.C (Ascii): implemented this function.
1027 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1029 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1030 (Write): use of the write_attribute functions.
1032 * src/bufferlist.C (close): fixed reasking question!
1034 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1036 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1037 new files use the everwhere possible.
1040 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1041 src/log_form.C src/lyx.C:
1044 * src/buffer.C (runLaTeX): remove func
1046 * src/PaperLayout.C: removed file
1047 * src/ParagraphExtra.C: likewise
1048 * src/bullet_forms.C: likewise
1049 * src/bullet_forms.h: likewise
1050 * src/bullet_forms_cb.C: likewise
1052 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1053 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1056 * several files: remove all traces of the old fd_form_paragraph,
1057 and functions belonging to that.
1059 * several files: remove all traces of the old fd_form_document,
1060 and functions belonging to that.
1062 * several files: constify local variables were possible.
1064 * several files: remove all code that was dead when NEW_EXPORT was
1067 * several files: removed string::c_str in as many places as
1070 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1071 (e): be a bit more outspoken when patching
1072 (updatesrc): only move files if changed.
1074 * forms/layout_forms.h.patch: regenerated
1076 * forms/layout_forms.fd: remove form_document and form_paragraph
1077 and form_quotes and form_paper and form_table_options and
1078 form_paragraph_extra
1080 * forms/form1.fd: remove form_table
1082 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1083 the fdui->... rewrite. Update some comments to xforms 0.88
1085 * forms/bullet_forms.C.patch: removed file
1086 * forms/bullet_forms.fd: likewise
1087 * forms/bullet_forms.h.patch: likewise
1089 * development/Code_rules/Rules: added a section on switch
1090 statements. Updated some comment to xforms 0.88.
1092 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1094 * src/buffer.C (readFile): make sure that the whole version number
1095 is read after \lyxformat (even when it contains a comma)
1097 * lib/ui/default.ui: change shortcut of math menu to M-a.
1099 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1101 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1104 * src/LyXView.C (updateWindowTitle): show the full files name in
1105 window title, limited to 30 characters.
1107 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1108 When a number of characters has been given, we should not assume
1109 that the string is 0-terminated.
1111 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1112 calls (fixes some memory leaks)
1114 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1115 trans member on exit.
1117 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1119 * src/converter.C (GetReachable): fix typo.
1121 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1122 understand ',' instead of '.'.
1123 (GetInteger): rewrite to use strToInt().
1125 2000-09-26 Juergen Vigna <jug@sad.it>
1127 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1128 better visibility and error-message on wrong VSpace input.
1130 * src/language.C (initL): added english again.
1132 2000-09-25 Juergen Vigna <jug@sad.it>
1134 * src/frontends/kde/Dialogs.C (Dialogs):
1135 * src/frontends/gnome/Dialogs.C (Dialogs):
1136 * src/frontends/kde/Makefile.am:
1137 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1139 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1141 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1143 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1145 * src/frontends/xforms/FormParagraph.C:
1146 * src/frontends/xforms/FormParagraph.h:
1147 * src/frontends/xforms/form_paragraph.C:
1148 * src/frontends/xforms/form_paragraph.h:
1149 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1152 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1154 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1155 Paragraph-Data after use.
1157 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1158 non breakable paragraphs.
1160 2000-09-25 Garst R. Reese <reese@isn.net>
1162 * src/language.C (initL): added missing language_country codes.
1164 2000-09-25 Juergen Vigna <jug@sad.it>
1166 * src/insets/insettext.C (InsetText):
1167 (deleteLyXText): remove the not released LyXText structure!
1169 2000-09-24 Marko Vendelin <markov@ioc.ee>
1171 * src/frontends/gnome/mainapp.C
1172 * src/frontends/gnome/mainapp.h: added support for keyboard
1175 * src/frontends/gnome/FormCitation.C
1176 * src/frontends/gnome/FormCitation.h
1177 * src/frontends/gnome/Makefile.am
1178 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1179 FormCitation to use "action area" in mainapp window
1181 * src/frontends/gnome/Menubar_pimpl.C
1182 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1185 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1187 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1188 width/descent/ascent values if name is empty.
1189 (mathed_string_height): Use std::max.
1191 2000-09-25 Allan Rae <rae@lyx.org>
1193 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1194 segfault. This will be completely redesigned soon.
1196 * sigc++: updated libsigc++. Fixes struct timespec bug.
1198 * development/tools/makeLyXsigc.sh: .cvsignore addition
1200 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1202 * several files: removed almost all traces of the old table
1205 * src/TableLayout.C: removed file
1207 2000-09-22 Juergen Vigna <jug@sad.it>
1209 * src/frontends/kde/Dialogs.C: added credits forms.
1211 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1213 * src/frontends/gnome/Dialogs.C: added some forms.
1215 * src/spellchecker.C (init_spell_checker): set language in pspell code
1216 (RunSpellChecker): some modifications for setting language string.
1218 * src/language.[Ch]: added language_country code.
1220 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1222 * src/frontends/Dialogs.h: added new signal showError.
1223 Rearranged existing signals in some sort of alphabetical order.
1225 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1226 FormError.[Ch], form_error.[Ch]
1227 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1228 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1230 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1231 dialogs. I think that this can be used as the base to all these
1234 * src/frontends/xforms/FormError.[Ch]
1235 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1236 implementation of InsetError dialog.
1238 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1240 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1241 * src/frontends/kde/Makefile.am: ditto
1243 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1245 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1246 macrobf. This fixes a bug of invisible text.
1248 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1250 * lib/doc/LaTeXConfig.lyx.in: updated.
1252 * src/language.C (initL): remove language "francais" and change a
1253 bit the names of the two other french variations.
1255 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1256 string that may not be 0-terminated.
1258 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1260 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1262 2000-09-20 Marko Vendelin <markov@ioc.ee>
1264 * src/frontends/gnome/FormCitation.C
1265 * src/frontends/gnome/FormIndex.C
1266 * src/frontends/gnome/FormToc.C
1267 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1268 the variable initialization to shut up the warnings
1270 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1272 * src/table.[Ch]: deleted files
1274 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1277 2000-09-18 Juergen Vigna <jug@sad.it>
1279 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1280 problems with selection. Inserted new LFUN_PASTESELECTION.
1281 (InsetButtonPress): inserted handling of middle mouse-button paste.
1283 * src/spellchecker.C: changed word to word.c_str().
1285 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1287 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1288 included in the ``make dist'' tarball.
1290 2000-09-15 Juergen Vigna <jug@sad.it>
1292 * src/CutAndPaste.C (cutSelection): small fix return the right
1293 end position after cut inside one paragraph only.
1295 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1296 we are locked as otherwise we don't have a valid cursor position!
1298 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1300 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1302 * src/frontends/kde/FormRef.C: added using directive.
1303 * src/frontends/kde/FormToc.C: ditto
1305 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1307 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1309 2000-09-19 Marko Vendelin <markov@ioc.ee>
1311 * src/frontends/gnome/Menubar_pimpl.C
1312 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1313 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1315 * src/frontends/gnome/mainapp.C
1316 * src/frontends/gnome/mainapp.h: support for menu update used
1319 * src/frontends/gnome/mainapp.C
1320 * src/frontends/gnome/mainapp.h: support for "action" area in the
1321 main window. This area is used by small simple dialogs, such as
1324 * src/frontends/gnome/FormIndex.C
1325 * src/frontends/gnome/FormIndex.h
1326 * src/frontends/gnome/FormUrl.C
1327 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
1330 * src/frontends/gnome/FormCitation.C
1331 * src/frontends/gnome/FormCitation.h: rewrite to use main window
1332 action area. Only "Insert new citation" is implemented.
1334 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1336 * src/buffer.C (Dispatch): fix call to Dispatch
1337 * src/insets/insetref.C (Edit): likewise
1338 * src/insets/insetparent.C (Edit): likewise
1339 * src/insets/insetinclude.C (include_cb): likewise
1340 * src/frontends/xforms/FormUrl.C (apply): likewise
1341 * src/frontends/xforms/FormToc.C (apply): likewise
1342 * src/frontends/xforms/FormRef.C (apply): likewise
1343 * src/frontends/xforms/FormIndex.C (apply): likewise
1344 * src/frontends/xforms/FormCitation.C (apply): likewise
1345 * src/lyxserver.C (callback): likewise
1346 * src/lyxfunc.C (processKeySym): likewise
1347 (Dispatch): likewise
1348 (Dispatch): likewise
1349 * src/lyx_cb.C (LayoutsCB): likewise
1351 * Makefile.am (sourcedoc): small change
1353 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1355 * src/main.C (main): Don't make an empty GUIRunTime object. all
1356 methods are static. constify a bit remove unneded using + headers.
1358 * src/tabular.C: some more const to local vars move some loop vars
1360 * src/spellchecker.C: added some c_str after some word for pspell
1362 * src/frontends/GUIRunTime.h: add new static method setDefaults
1363 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1364 * src/frontends/kde/GUIRunTime.C (setDefaults):
1365 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1367 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1368 with strnew in arg, use correct emptystring when calling SetName.
1370 * several files: remove all commented code with relation to
1371 HAVE_SSTREAM beeing false. We now only support stringstream and
1374 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1376 * src/lyxfunc.C: construct correctly the automatic new file
1379 * src/text2.C (IsStringInText): change type of variable i to shut
1382 * src/support/sstream.h: do not use namespaces if the compiler
1383 does not support them.
1385 2000-09-15 Marko Vendelin <markov@ioc.ee>
1386 * src/frontends/gnome/FormCitation.C
1387 * src/frontends/gnome/FormCitation.h
1388 * src/frontends/gnome/diainsertcitation_interface.c
1389 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1390 regexp support to FormCitation [Gnome].
1392 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1395 * configure.in: remove unused KDE/GTKGUI define
1397 * src/frontends/kde/FormRef.C
1398 * src/frontends/kde/FormRef.h
1399 * src/frontends/kde/formrefdialog.C
1400 * src/frontends/kde/formrefdialog.h: double click will
1401 go to reference, now it is possible to change a cross-ref
1404 * src/frontends/kde/FormToc.C
1405 * src/frontends/kde/FormToc.h
1406 * src/frontends/kde/formtocdialog.C
1407 * src/frontends/kde/formtocdialog.h: add a depth
1410 * src/frontends/kde/Makefile.am: add QtLyXView.h
1413 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1415 * src/frontends/kde/FormCitation.h: added some using directives.
1417 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1419 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1422 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1425 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1427 * src/buffer.C (pop_tag): revert for the second time a change by
1428 Lars, who seems to really hate having non-local loop variables :)
1430 * src/Lsstream.h: add "using" statements.
1432 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1433 * src/buffer.C (writeFile): ditto
1435 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1437 * src/buffer.C (writeFile): try to fix the locale modified format
1438 number to always be as we want it.
1440 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1441 in XForms 0.89. C-space is now working again.
1443 * src/Lsstream.h src/support/sstream.h: new files.
1445 * also commented out all cases where strstream were used.
1447 * src/Bullet.h (c_str): remove method.
1449 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1451 * a lot of files: get rid of "char const *" and "char *" is as
1452 many places as possible. We only want to use them in interaction
1453 with system of other libraries, not inside lyx.
1455 * a lot of files: return const object is not of pod type. This
1456 helps ensure that temporary objects is not modified. And fits well
1457 with "programming by contract".
1459 * configure.in: check for the locale header too
1461 * Makefile.am (sourcedoc): new tag for generation of doc++
1464 2000-09-14 Juergen Vigna <jug@sad.it>
1466 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1467 callback to check which combo called it and do the right action.
1469 * src/combox.C (combo_cb): added combo * to the callbacks.
1470 (Hide): moved call of callback after Ungrab of the pointer.
1472 * src/intl.h: removed LCombo2 function.
1474 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1475 function as this can now be handled in one function.
1477 * src/combox.h: added Combox * to callback prototype.
1479 * src/frontends/xforms/Toolbar_pimpl.C:
1480 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1482 2000-09-14 Garst Reese <reese@isn.net>
1484 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1485 moved usepackage{xxx}'s to beginning of file. Changed left margin
1486 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1487 underlining from title. Thanks to John Culleton for useful suggestions.
1489 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1491 * src/lyxlex_pimpl.C (setFile): change error message to debug
1494 2000-09-13 Juergen Vigna <jug@sad.it>
1496 * src/frontends/xforms/FormDocument.C: implemented choice_class
1497 as combox and give callback to combo_language so OK/Apply is activated
1500 * src/bufferlist.C (newFile): small fix so already named files
1501 (via an open call) are not requested to be named again on the
1504 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1506 * src/frontends/kde/Makefile.am
1507 * src/frontends/kde/FormRef.C
1508 * src/frontends/kde/FormRef.h
1509 * src/frontends/kde/formrefdialog.C
1510 * src/frontends/kde/formrefdialog.h: implement
1513 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1515 * src/frontends/kde/formtocdialog.C
1516 * src/frontends/kde/formtocdialog.h
1517 * src/frontends/kde/FormToc.C
1518 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1520 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1522 * src/frontends/kde/FormCitation.C: fix thinko
1523 where we didn't always display the reference text
1526 * src/frontends/kde/formurldialog.C
1527 * src/frontends/kde/formurldialog.h
1528 * src/frontends/kde/FormUrl.C
1529 * src/frontends/kde/FormUrl.h: minor cleanups
1531 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
1533 * src/frontends/kde/Makefile.am
1534 * src/frontends/kde/FormToc.C
1535 * src/frontends/kde/FormToc.h
1536 * src/frontends/kde/FormCitation.C
1537 * src/frontends/kde/FormCitation.h
1538 * src/frontends/kde/FormIndex.C
1539 * src/frontends/kde/FormIndex.h
1540 * src/frontends/kde/formtocdialog.C
1541 * src/frontends/kde/formtocdialog.h
1542 * src/frontends/kde/formcitationdialog.C
1543 * src/frontends/kde/formcitationdialog.h
1544 * src/frontends/kde/formindexdialog.C
1545 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1547 2000-09-12 Juergen Vigna <jug@sad.it>
1549 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1552 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1554 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1557 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1559 * src/converter.C (Add, Convert): Added support for converter flags:
1560 needaux, resultdir, resultfile.
1561 (Convert): Added new parameter view_file.
1562 (dvips_options): Fixed letter paper option.
1564 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1565 (Export, GetExportableFormats, GetViewableFormats): Added support
1568 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1570 (easyParse): Fixed to work with new export code.
1572 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
1575 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
1577 * lib/bind/*.bind: Replaced
1578 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
1579 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
1581 2000-09-11 Juergen Vigna <jug@sad.it>
1583 * src/lyx_gui.C (runTime): uses global guiruntime variable.
1585 * src/main.C (main): now GUII defines global guiruntime!
1587 * src/frontends/gnome/GUIRunTime.C (initApplication):
1588 * src/frontends/kde/GUIRunTime.C (initApplication):
1589 * src/frontends/xforms/GUIRunTime.C (initApplication):
1590 * src/frontends/GUIRunTime.h: added new function initApplication.
1592 * src/spellchecker.C (sc_accept_word): change to add_to_session.
1594 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
1596 2000-09-08 Juergen Vigna <jug@sad.it>
1598 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1599 we have already "Reset".
1601 * src/language.C (initL): inserted "default" language and made this
1602 THE default language (and not american!)
1604 * src/paragraph.C: inserted handling of "default" language!
1606 * src/lyxfont.C: ditto
1610 * src/paragraph.C: output the \\par only if we have a following
1611 paragraph otherwise it's not needed.
1613 2000-09-05 Juergen Vigna <jug@sad.it>
1615 * config/pspell.m4: added entry to lyx-flags
1617 * src/spellchecker.C: modified version from Kevin for using pspell
1619 2000-09-01 Marko Vendelin <markov@ioc.ee>
1620 * src/frontends/gnome/Makefile.am
1621 * src/frontends/gnome/FormCitation.C
1622 * src/frontends/gnome/FormCitation.h
1623 * src/frontends/gnome/diainsertcitation_callbacks.c
1624 * src/frontends/gnome/diainsertcitation_callbacks.h
1625 * src/frontends/gnome/diainsertcitation_interface.c
1626 * src/frontends/gnome/diainsertcitation_interface.h
1627 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1628 dialog for Gnome frontend
1630 * src/main.C: Gnome libraries require keeping application name
1631 and its version as strings
1633 * src/frontends/gnome/mainapp.C: Change the name of the main window
1634 from GnomeLyX to PACKAGE
1636 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1638 * src/frontends/Liason.C: add "using: declaration.
1640 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1642 * src/mathed/math_macro.C (Metrics): Set the size of the template
1644 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1646 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1648 * src/converter.C (add_options): New function.
1649 (SetViewer): Change $$FName into '$$FName'.
1650 (View): Add options when running xdvi
1651 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
1652 (Convert): The 3rd parameter is now the desired filename. Converts
1653 calls to lyx::rename if necessary.
1654 Add options when running dvips.
1655 (dvi_papersize,dvips_options): New methods.
1657 * src/exporter.C (Export): Use getLatexName() instead of fileName().
1659 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
1660 using a call to Converter::dvips_options.
1661 Fixed to work with nex export code.
1663 * src/support/copy.C
1664 * src/support/rename.C: New files
1666 * src/support/syscall.h
1667 * src/support/syscall.C: Added Starttype SystemDontWait.
1669 * lib/ui/default.ui: Changed to work with new export code
1671 * lib/configure.m4: Changed to work with new export code
1673 * src/encoding.C: Changed latex name for iso8859_7 encoding.
1675 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
1677 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
1678 so that code compiles with DEC cxx.
1680 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
1681 to work correctly! Also now supports the additional elements
1684 2000-09-01 Allan Rae <rae@lyx.org>
1686 * src/frontends/ButtonPolicies.C: renamed all the references to
1687 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
1689 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
1690 since it's a const not a type.
1692 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
1694 2000-08-31 Juergen Vigna <jug@sad.it>
1696 * src/insets/figinset.C: Various changes to look if the filename has
1697 an extension and if not add it for inline previewing.
1699 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1701 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1702 make buttonStatus and isReadOnly be const methods. (also reflect
1703 this in derived classes.)
1705 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1706 (nextState): change to be static inline, pass the StateMachine as
1708 (PreferencesPolicy): remove casts
1709 (OkCancelPolicy): remvoe casts
1710 (OkCancelReadOnlyPolicy): remove casts
1711 (NoRepeatedApplyReadOnlyPolicy): remove casts
1712 (OkApplyCancelReadOnlyPolicy): remove casts
1713 (OkApplyCancelPolicy): remove casts
1714 (NoRepeatedApplyPolicy): remove casts
1716 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1718 * src/converter.C: added some using directives
1720 * src/frontends/ButtonPolicies.C: changes to overcome
1721 "need lvalue" error with DEC c++
1723 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1724 to WMHideCB for DEC c++
1726 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1728 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1729 to BulletBMTableCB for DEC c++
1731 2000-08-31 Allan Rae <rae@lyx.org>
1733 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1734 character dialog separately from old document dialogs combo_language.
1737 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1739 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1740 Removed LFUN_REF_CREATE.
1742 * src/MenuBackend.C: Added new tags: toc and references
1744 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1745 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1747 (add_toc, add_references): New methods.
1748 (create_submenu): Handle correctly the case when there is a
1749 seperator after optional menu items.
1751 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1752 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1753 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1755 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1757 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1759 * src/converter.[Ch]: New file for converting between different
1762 * src/export.[Ch]: New file for exporting a LyX file to different
1765 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1766 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1767 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1768 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1769 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1770 RunDocBook, MenuExport.
1772 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1773 Exporter::Preview methods if NEW_EXPORT is defined.
1775 * src/buffer.C (Dispatch): Use Exporter::Export.
1777 * src/lyxrc.C: Added new tags: \converter and \viewer.
1780 * src/LyXAction.C: Define new lyx-function: buffer-update.
1781 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1782 when NEW_EXPORT is defined.
1784 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1786 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1788 * lib/ui/default.ui: Added submenus "view" and "update" to the
1791 * src/filetools.C (GetExtension): New function.
1793 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1795 2000-08-29 Allan Rae <rae@lyx.org>
1797 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1799 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1800 (EnableDocumentLayout): removed
1801 (DisableDocumentLayout): removed
1802 (build): make use of ButtonController's read-only handling to
1803 de/activate various objects. Replaces both of the above functions.
1805 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1806 (readOnly): was read_only
1807 (refresh): fixed dumb mistakes with read_only_ handling
1809 * src/frontends/xforms/forms/form_document.fd:
1810 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1811 tabbed dialogs so the tabs look more like tabs and so its easier to
1812 work out which is the current tab.
1814 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1815 segfault with form_table
1817 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1819 2000-08-28 Juergen Vigna <jug@sad.it>
1821 * acconfig.h: added USE_PSPELL.
1823 * src/config.h.in: added USE_PSPELL.
1825 * autogen.sh: added pspell.m4
1827 * config/pspell.m4: new file.
1829 * src/spellchecker.C: implemented support for pspell libary.
1831 2000-08-25 Juergen Vigna <jug@sad.it>
1833 * src/LyXAction.C (init): renamed LFUN_TABLE to
1834 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1836 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1838 * src/lyxscreen.h: add force_clear variable and fuction to force
1839 a clear area when redrawing in LyXText.
1841 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1843 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1845 * some whitespace and comment changes.
1847 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1849 * src/buffer.C: up te LYX_FORMAT to 2.17
1851 2000-08-23 Juergen Vigna <jug@sad.it>
1853 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1856 * src/insets/insettabular.C (pasteSelection): delete the insets
1857 LyXText as it is not valid anymore.
1858 (copySelection): new function.
1859 (pasteSelection): new function.
1860 (cutSelection): new function.
1861 (LocalDispatch): implemented cut/copy/paste of cell selections.
1863 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1864 don't have a LyXText.
1866 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1868 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1871 2000-08-22 Juergen Vigna <jug@sad.it>
1873 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1874 ifdef form_table out if NEW_TABULAR.
1876 2000-08-21 Juergen Vigna <jug@sad.it>
1878 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1879 (draw): fixed draw position so that the cursor is positioned in the
1881 (InsetMotionNotify): hide/show cursor so the position is updated.
1882 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1883 using cellstart() function where it should be used.
1885 * src/insets/insettext.C (draw): ditto.
1887 * src/tabular.C: fixed initialization of some missing variables and
1888 made BoxType into an enum.
1890 2000-08-22 Marko Vendelin <markov@ioc.ee>
1891 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1892 stock menu item using action numerical value, not its string
1896 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1898 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1899 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1901 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1903 * src/frontends/xforms/GUIRunTime.C: new file
1905 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1906 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1908 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1910 * src/frontends/kde/GUIRunTime.C: new file
1912 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1913 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1915 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1917 * src/frontends/gnome/GUIRunTime.C: new file
1919 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1922 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1923 small change to documetentation.
1925 * src/frontends/GUIRunTime.C: removed file
1927 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1929 * src/lyxparagraph.h: enable NEW_TABULAR as default
1931 * src/lyxfunc.C (processKeySym): remove some commented code
1933 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1934 NEW_TABULAR around the fd_form_table_options.
1936 * src/lyx_gui.C (runTime): call the static member function as
1937 GUIRunTime::runTime().
1939 2000-08-21 Allan Rae <rae@lyx.org>
1941 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1944 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1946 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1948 2000-08-21 Allan Rae <rae@lyx.org>
1950 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1951 keep Garst happy ;-)
1952 * src/frontends/xforms/FormPreferences.C (build): use setOK
1953 * src/frontends/xforms/FormDocument.C (build): use setOK
1954 (FormDocument): use the appropriate policy.
1956 2000-08-21 Allan Rae <rae@lyx.org>
1958 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1959 automatic [de]activation of arbitrary objects when in a read-only state.
1961 * src/frontends/ButtonPolicies.h: More documentation
1962 (isReadOnly): added to support the above.
1964 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1966 2000-08-18 Juergen Vigna <jug@sad.it>
1968 * src/insets/insettabular.C (getStatus): changed to return func_status.
1970 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1971 display toggle menu entries if they are.
1973 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1974 new document layout now.
1976 * src/lyxfunc.C: ditto
1978 * src/lyx_gui_misc.C: ditto
1980 * src/lyx_gui.C: ditto
1982 * lib/ui/default.ui: removed paper and quotes layout as they are now
1983 all in the document layout tabbed folder.
1985 * src/frontends/xforms/forms/form_document.fd: added Restore
1986 button and callbacks for all inputs for Allan's ButtonPolicy.
1988 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1989 (CheckChoiceClass): added missing params setting on class change.
1990 (UpdateLayoutDocument): added for updating the layout on params.
1991 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1992 (FormDocument): Implemented Allan's ButtonPolicy with the
1995 2000-08-17 Allan Rae <rae@lyx.org>
1997 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1998 so we can at least see the credits again.
2000 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2001 controller calls for the appropriate callbacks. Note that since Ok
2002 calls apply followed by cancel, and apply isn't a valid input for the
2003 APPLIED state, the bc_ calls have to be made in the static callback not
2004 within each of the real callbacks.
2006 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2007 (setOk): renamed from setOkay()
2009 2000-08-17 Juergen Vigna <jug@sad.it>
2011 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2012 in the implementation part.
2013 (composeUIInfo): don't show optional menu-items.
2015 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2017 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2019 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2020 text-state when in a text-inset.
2022 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2024 2000-08-17 Marko Vendelin <markov@ioc.ee>
2025 * src/frontends/gnome/FormIndex.C
2026 * src/frontends/gnome/FormIndex.h
2027 * src/frontends/gnome/FormToc.C
2028 * src/frontends/gnome/FormToc.h
2029 * src/frontends/gnome/dialogs
2030 * src/frontends/gnome/diatoc_callbacks.c
2031 * src/frontends/gnome/diatoc_callbacks.h
2032 * src/frontends/gnome/diainsertindex_callbacks.h
2033 * src/frontends/gnome/diainsertindex_callbacks.c
2034 * src/frontends/gnome/diainsertindex_interface.c
2035 * src/frontends/gnome/diainsertindex_interface.h
2036 * src/frontends/gnome/diatoc_interface.h
2037 * src/frontends/gnome/diatoc_interface.c
2038 * src/frontends/gnome/Makefile.am: Table of Contents and
2039 Insert Index dialogs implementation for Gnome frontend
2041 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2043 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2045 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2048 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2050 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2051 destructor. Don't definde if you don't need it
2052 (processEvents): made static, non-blocking events processing for
2054 (runTime): static method. event loop for xforms
2055 * similar as above for kde and gnome.
2057 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2058 new Pimpl is correct
2059 (runTime): new method calss the real frontends runtime func.
2061 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2063 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2065 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2067 2000-08-16 Juergen Vigna <jug@sad.it>
2069 * src/lyx_gui.C (runTime): added GUII RunTime support.
2071 * src/frontends/Makefile.am:
2072 * src/frontends/GUIRunTime.[Ch]:
2073 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2074 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2075 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2077 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2079 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2080 as this is already set in ${FRONTEND_INCLUDE} if needed.
2082 * configure.in (CPPFLAGS): setting the include dir for the frontend
2083 directory and don't set FRONTEND=xforms for now as this is executed
2086 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2088 * src/frontends/kde/Makefile.am:
2089 * src/frontends/kde/FormUrl.C:
2090 * src/frontends/kde/FormUrl.h:
2091 * src/frontends/kde/formurldialog.h:
2092 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2094 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2096 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2098 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2100 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2103 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2105 * src/WorkArea.C (work_area_handler): more work to get te
2106 FL_KEYBOARD to work with xforms 0.88 too, please test.
2108 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2110 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2112 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2115 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2117 * src/Timeout.h: remove Qt::emit hack.
2119 * several files: changes to allo doc++ compilation
2121 * src/lyxfunc.C (processKeySym): new method
2122 (processKeyEvent): comment out if FL_REVISION < 89
2124 * src/WorkArea.C: change some debugging levels.
2125 (WorkArea): set wantkey to FL_KEY_ALL
2126 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2127 clearer code and the use of compose with XForms 0.89. Change to
2128 use signals instead of calling methods in bufferview directly.
2130 * src/Painter.C: change some debugging levels.
2132 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2135 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2136 (workAreaKeyPress): new method
2138 2000-08-14 Juergen Vigna <jug@sad.it>
2140 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2142 * config/kde.m4: addes some features
2144 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2145 include missing xforms dialogs.
2147 * src/Timeout.h: a hack to be able to compile with qt/kde.
2149 * sigc++/.cvsignore: added acinclude.m4
2151 * lib/.cvsignore: added listerros
2153 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2154 xforms tree as objects are needed for other frontends.
2156 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2157 linking with not yet implemented xforms objects.
2159 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2161 2000-08-14 Baruch Even <baruch.even@writeme.com>
2163 * src/frontends/xforms/FormGraphics.h:
2164 * src/frontends/xforms/FormGraphics.C:
2165 * src/frontends/xforms/RadioButtonGroup.h:
2166 * src/frontends/xforms/RadioButtonGroup.C:
2167 * src/insets/insetgraphics.h:
2168 * src/insets/insetgraphics.C:
2169 * src/insets/insetgraphicsParams.h:
2170 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2171 instead of spaces, and various other indentation issues to make the
2172 sources more consistent.
2174 2000-08-14 Marko Vendelin <markov@ioc.ee>
2176 * src/frontends/gnome/dialogs/diaprint.glade
2177 * src/frontends/gnome/FormPrint.C
2178 * src/frontends/gnome/FormPrint.h
2179 * src/frontends/gnome/diaprint_callbacks.c
2180 * src/frontends/gnome/diaprint_callbacks.h
2181 * src/frontends/gnome/diaprint_interface.c
2182 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2185 * src/frontends/gnome/dialogs/diainserturl.glade
2186 * src/frontends/gnome/FormUrl.C
2187 * src/frontends/gnome/FormUrl.h
2188 * src/frontends/gnome/diainserturl_callbacks.c
2189 * src/frontends/gnome/diainserturl_callbacks.h
2190 * src/frontends/gnome/diainserturl_interface.c
2191 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2192 Gnome implementation
2194 * src/frontends/gnome/Dialogs.C
2195 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2196 all other dialogs. Copy all unimplemented dialogs from Xforms
2199 * src/frontends/gnome/support.c
2200 * src/frontends/gnome/support.h: support files generated by Glade
2204 * config/gnome.m4: Gnome configuration scripts
2206 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2207 configure --help message
2209 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2210 only if there are no events pendling in Gnome/Gtk. This enhances
2211 the performance of menus.
2214 2000-08-14 Allan Rae <rae@lyx.org>
2216 * lib/Makefile.am: listerrors cleaning
2218 * lib/listerrors: removed -- generated file
2219 * acinclude.m4: ditto
2220 * sigc++/acinclude.m4: ditto
2222 * src/frontends/xforms/forms/form_citation.fd:
2223 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2226 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2227 `updatesrc` and now we have a `test` target that does what `updatesrc`
2228 used to do. I didn't like having an install target that wasn't related
2231 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2232 on all except FormGraphics. This may yet happen. Followed by a major
2233 cleanup including using FL_TRANSIENT for most of the dialogs. More
2234 changes to come when the ButtonController below is introduced.
2236 * src/frontends/xforms/ButtonController.h: New file for managing up to
2237 four buttons on a dialog according to an externally defined policy.
2238 * src/frontends/xforms/Makefile.am: added above
2240 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2241 Apply and Cancel/Close buttons and everything in between and beyond.
2242 * src/frontends/Makefile.am: added above.
2244 * src/frontends/xforms/forms/form_preferences.fd:
2245 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2246 and removed variable 'status' as a result. Fixed the set_minsize thing.
2247 Use the new screen-font-update after checking screen fonts were changed
2248 Added a "Restore" button to restore the original lyxrc values while
2249 editing. This restores everything not just the last input changed.
2250 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2252 * src/LyXAction.C: screen-font-update added for updating buffers after
2253 screen font settings have been changed.
2254 * src/commandtags.h: ditto
2255 * src/lyxfunc.C: ditto
2257 * forms/lyx.fd: removed screen fonts dialog.
2258 * src/lyx_gui.C: ditto
2259 * src/menus.[Ch]: ditto
2260 * src/lyx.[Ch]: ditto
2261 * src/lyx_cb.C: ditto + code from here moved to make
2262 screen-font-update. And people wonder why progress on GUII is
2263 slow. Look at how scattered this stuff was! It takes forever
2266 * forms/fdfix.sh: Fixup the spacing after commas.
2267 * forms/makefile: Remove date from generated files. Fewer clashes now.
2268 * forms/bullet_forms.C.patch: included someones handwritten changes
2270 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2271 once I've discovered why LyXRC was made noncopyable.
2272 * src/lyx_main.C: ditto
2274 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2276 * src/frontends/xforms/forms/fdfix.sh:
2277 * src/frontends/xforms/forms/fdfixh.sed:
2278 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2279 * src/frontends/xforms/Form*.[hC]:
2280 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2281 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2282 provide a destructor for the struct FD_form_xxxx. Another version of
2283 the set_[max|min]size workaround and a few other cleanups. Actually,
2284 Angus' patch from 20000809.
2286 2000-08-13 Baruch Even <baruch.even@writeme.com>
2288 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2291 2000-08-11 Juergen Vigna <jug@sad.it>
2293 * src/insets/insetgraphics.C (InsetGraphics): changing init
2294 order because of warnings.
2296 * src/frontends/xforms/forms/makefile: adding patching .C with
2299 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2300 from .C.patch to .c.patch
2302 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2303 order because of warning.
2305 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2307 * src/frontends/Liason.C (setMinibuffer): new helper function
2309 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2311 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2313 * lib/ui/default.ui: commented out PaperLayout entry
2315 * src/frontends/xforms/form_document.[Ch]: new added files
2317 * src/frontends/xforms/FormDocument.[Ch]: ditto
2319 * src/frontends/xforms/forms/form_document.fd: ditto
2321 * src/frontends/xforms/forms/form_document.C.patch: ditto
2323 2000-08-10 Juergen Vigna <jug@sad.it>
2325 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2326 (InsetGraphics): initialized cacheHandle to 0.
2327 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2329 2000-08-10 Baruch Even <baruch.even@writeme.com>
2331 * src/graphics/GraphicsCache.h:
2332 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2333 correctly as a cache.
2335 * src/graphics/GraphicsCacheItem.h:
2336 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2339 * src/graphics/GraphicsCacheItem_pimpl.h:
2340 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2343 * src/insets/insetgraphics.h:
2344 * src/insets/insetgraphics.C: Changed from using a signal notification
2345 to polling when image is not loaded.
2347 2000-08-10 Allan Rae <rae@lyx.org>
2349 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2350 that there are two functions that have to been taken out of line by
2351 hand and aren't taken care of in the script. (Just a reminder note)
2353 * sigc++/macros/*.h.m4: Updated as above.
2355 2000-08-09 Juergen Vigna <jug@sad.it>
2357 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2359 * src/insets/insettabular.C: make drawing of single cell smarter.
2361 2000-08-09 Marko Vendelin <markov@ioc.ee>
2362 * src/frontends/gnome/Menubar_pimpl.C
2363 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2364 implementation: new files
2366 * src/frontends/gnome/mainapp.C
2367 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2370 * src/main.C: create Gnome main window
2372 * src/frontends/xforms/Menubar_pimpl.h
2373 * src/frontends/Menubar.C
2374 * src/frontends/Menubar.h: added method Menubar::update that calls
2375 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2377 * src/LyXView.C: calls Menubar::update to update the state
2380 * src/frontends/gnome/Makefile.am: added new files
2382 * src/frontends/Makefile.am: added frontend compiler options
2384 2000-08-08 Juergen Vigna <jug@sad.it>
2386 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2388 * src/bufferlist.C (close):
2389 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2390 documents if exiting without saving.
2392 * src/buffer.C (save): use removeAutosaveFile()
2394 * src/support/filetools.C (removeAutosaveFile): new function.
2396 * src/lyx_cb.C (MenuWrite): returns a bool now.
2397 (MenuWriteAs): check if file could really be saved and revert to the
2399 (MenuWriteAs): removing old autosavefile if existant.
2401 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2402 before Goto toggle declaration, because of compiler warning.
2404 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2406 * src/lyxfunc.C (MenuNew): small fix.
2408 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2410 * src/bufferlist.C (newFile):
2411 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2413 * src/lyxrc.C: added new_ask_filename tag
2415 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2417 * src/lyx.fd: removed code pertaining to form_ref
2418 * src/lyx.[Ch]: ditto
2419 * src/lyx_cb.C: ditto
2420 * src/lyx_gui.C: ditto
2421 * src/lyx_gui_misc.C: ditto
2423 * src/BufferView_pimpl.C (restorePosition): update buffer only
2426 * src/commandtags.h (LFUN_REFTOGGLE): removed
2427 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2428 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2429 (LFUN_REFBACK): renamed LFUN_REF_BACK
2431 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2432 * src/menus.C: ditto
2433 * src/lyxfunc.C (Dispatch): ditto.
2434 InsertRef dialog is now GUI-independent.
2436 * src/texrow.C: added using std::endl;
2438 * src/insets/insetref.[Ch]: strip out large amounts of code.
2439 The inset is now a container and this functionality is now
2440 managed by a new FormRef dialog
2442 * src/frontends/Dialogs.h (showRef, createRef): new signals
2444 * src/frontends/xforms/FormIndex.[Ch],
2445 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2446 when setting dialog's min/max size
2447 * src/frontends/xforms/FormIndex.[Ch]: ditto
2449 * src/frontends/xforms/FormRef.[Ch],
2450 src/frontends/xforms/forms/form_ref.fd: new xforms
2451 implementation of an InsetRef dialog
2453 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2456 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2457 ios::nocreate is not part of the standard. Removed.
2459 2000-08-07 Baruch Even <baruch.even@writeme.com>
2461 * src/graphics/Renderer.h:
2462 * src/graphics/Renderer.C: Added base class for rendering of different
2463 image formats into Pixmaps.
2465 * src/graphics/XPM_Renderer.h:
2466 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2467 in a different class.
2469 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2470 easily add support for other formats.
2472 * src/insets/figinset.C: plugged a leak of an X resource.
2474 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2476 * src/CutAndPaste.[Ch]: make all metods static.
2478 * development/Code_rules/Rules: more work, added section on
2479 Exceptions, and a References section.
2481 * a lot of header files: work to make doc++ able to generate the
2482 source documentation, some workarounds of doc++ problems. Doc++ is
2483 now able to generate the documentation.
2485 2000-08-07 Juergen Vigna <jug@sad.it>
2487 * src/insets/insettabular.C (recomputeTextInsets): removed function
2489 * src/tabular.C (SetWidthOfMulticolCell):
2491 (calculate_width_of_column_NMC): fixed return value so that it really
2492 only returns true if the column-width has changed (there where
2493 problems with muliticolumn-cells in this column).
2495 2000-08-04 Juergen Vigna <jug@sad.it>
2497 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2498 also on the scrollstatus of the inset.
2499 (workAreaMotionNotify): ditto.
2501 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2503 2000-08-01 Juergen Vigna <jug@sad.it>
2505 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2507 * src/commandtags.h:
2508 * src/LyXAction.C (init):
2509 * src/insets/inset.C (LocalDispatch): added support for
2512 * src/insets/inset.C (scroll): new functions.
2514 * src/insets/insettext.C (removeNewlines): new function.
2515 (SetAutoBreakRows): removes forced newlines in the text of the
2516 paragraph if autoBreakRows is set to false.
2518 * src/tabular.C (Latex): generates a parbox around the cell contents
2521 * src/frontends/xforms/FormTabular.C (local_update): removed
2522 the radio_useparbox button.
2524 * src/tabular.C (UseParbox): new function
2526 2000-08-06 Baruch Even <baruch.even@writeme.com>
2528 * src/graphics/GraphicsCache.h:
2529 * src/graphics/GraphicsCache.C:
2530 * src/graphics/GraphicsCacheItem.h:
2531 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
2534 * src/insets/insetgraphics.h:
2535 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
2536 drawing of the inline image.
2538 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
2539 into the wrong position.
2541 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
2544 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2546 * src/support/translator.h: move all typedefs to public section
2548 * src/support/filetools.C (MakeLatexName): return string const
2550 (TmpFileName): ditto
2551 (FileOpenSearch): ditto
2553 (LibFileSearch): ditto
2554 (i18nLibFileSearch): ditto
2557 (CreateTmpDir): ditto
2558 (CreateBufferTmpDir): ditto
2559 (CreateLyXTmpDir): ditto
2562 (MakeAbsPath): ditto
2564 (OnlyFilename): ditto
2566 (NormalizePath): ditto
2567 (CleanupPath): ditto
2568 (GetFileContents): ditto
2569 (ReplaceEnvironmentPath): ditto
2570 (MakeRelPath): ditto
2572 (ChangeExtension): ditto
2573 (MakeDisplayPath): ditto
2574 (do_popen): return cmdret const
2575 (findtexfile): return string const
2577 * src/support/DebugStream.h: add some /// to please doc++
2579 * src/frontends/DialogBase.h (endif): add some /// to please doc++
2581 * src/texrow.C (same_rownumber): functor to use with find_if
2582 (getIdFromRow): rewritten to use find_if and to not update the
2583 positions. return true if row is found
2584 (increasePos): new method, use to update positions
2586 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
2588 * src/lyxlex_pimpl.C (verifyTable): new method
2591 (GetString): return string const
2592 (pushTable): rewrite to use std::stack
2594 (setFile): better check
2597 * src/lyxlex.h: make LyXLex noncopyable
2599 * src/lyxlex.C (text): return char const * const
2600 (GetString): return string const
2601 (getLongString): return string const
2603 * src/lyx_gui_misc.C (askForText): return pair<...> const
2605 * src/lastfiles.[Ch] (operator): return string const
2607 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2608 istringstream not char const *.
2609 move token.end() out of loop.
2610 (readFile): move initializaton of token
2612 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2613 getIdFromRow is successful.
2615 * lib/bind/emacs.bind: don't include menus bind
2617 * development/Code_rules/Rules: the beginnings of making this
2618 better and covering more of the unwritten rules that we have.
2620 * development/Code_rules/Recommendations: a couple of wording
2623 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2625 * src/support/strerror.c: remove C++ comment.
2627 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2629 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2630 LFUN_INDEX_INSERT_LAST
2632 * src/texrow.C (getIdFromRow): changed from const_iterator to
2633 iterator, allowing code to compile with DEC cxx
2635 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2636 stores part of the class, as suggested by Allan. Will allow
2638 (apply): test to apply uses InsetCommandParams operator!=
2640 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2641 (apply): test to apply uses InsetCommandParams operator!=
2643 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2644 stores part of the class.
2645 (update): removed limits on min/max size.
2647 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2648 (apply): test to apply uses InsetCommandParams operator!=
2650 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
2651 (Read, Write, scanCommand, getCommand): moved functionality
2652 into InsetCommandParams.
2654 (getScreenLabel): made pure virtual
2655 new InsetCommandParams operators== and !=
2657 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
2658 c-tors based on InsetCommandParams. Removed others.
2659 * src/insets/insetinclude.[Ch]: ditto
2660 * src/insets/insetlabel.[Ch]: ditto
2661 * src/insets/insetparent.[Ch]: ditto
2662 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
2664 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
2665 insets derived from InsetCommand created using similar c-tors
2666 based on InsetCommandParams
2667 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
2668 * src/menus.C (ShowRefsMenu): ditto
2669 * src/paragraph.C (Clone): ditto
2670 * src/text2.C (SetCounter): ditto
2671 * src/lyxfunc.C (Dispatch) ditto
2672 Also recreated old InsetIndex behaviour exactly. Can now
2673 index-insert at the start of a paragraph and index-insert-last
2674 without launching the pop-up.
2676 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2678 * lib/lyxrc.example: mark te pdf options as non functional.
2680 * src/support/lstrings.C (strToInt): move initalization of tmpstr
2681 (isStrDbl): move tmpstr.end() out of loop.
2682 (strToDbl): move intialization of tmpstr
2683 (lowercase): return string const and move tmp.end() out of loop.
2684 (uppercase): return string const and move tmp.edn() out of loop.
2685 (prefixIs): add assertion
2690 (containsOnly): ditto
2691 (containsOnly): ditto
2692 (containsOnly): ditto
2693 (countChar): make last arg char not char const
2694 (token): return string const
2695 (subst): return string const, move tmp.end() out of loop.
2696 (subst): return string const, add assertion
2697 (strip): return string const
2698 (frontStrip): return string const, add assertion
2699 (frontStrip): return string const
2704 * src/support/lstrings.C: add inclde "LAssert.h"
2705 (isStrInt): move tmpstr.end() out of loop.
2707 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2708 toollist.end() out of loop.
2709 (deactivate): move toollist.end() out of loop.
2710 (update): move toollist.end() out of loop.
2711 (updateLayoutList): move tc.end() out of loop.
2712 (add): move toollist.end() out of loop.
2714 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2715 md.end() out of loop.
2717 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2719 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2722 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2723 (Erase): move insetlist.end() out of loop.
2725 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2726 ref to const string as first arg. Move initialization of some
2727 variables, whitespace changes.
2729 * src/kbmap.C (defkey): move table.end() out of loop.
2730 (kb_keymap): move table.end() out of loop.
2731 (findbinding): move table.end() out of loop.
2733 * src/MenuBackend.C (hasMenu): move end() out of loop.
2734 (getMenu): move end() out of loop.
2735 (getMenu): move menulist_.end() out of loop.
2737 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2739 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2742 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2743 (getFromLyXName): move infotab.end() out of loop.
2745 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2746 -fvtable-thunks -ffunction-sections -fdata-sections
2748 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2750 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2753 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2755 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2757 * src/frontends/xforms/FormCitation.[Ch],
2758 src/frontends/xforms/FormIndex.[Ch],
2759 src/frontends/xforms/FormToc.[Ch],
2760 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2762 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2764 * src/commandtags.h: renamed, created some flags for citation
2767 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2769 * src/lyxfunc.C (dispatch): use signals to insert index entry
2771 * src/frontends/Dialogs.h: new signal createIndex
2773 * src/frontends/xforms/FormCommand.[Ch],
2774 src/frontends/xforms/FormCitation.[Ch],
2775 src/frontends/xforms/FormToc.[Ch],
2776 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2778 * src/insets/insetindex.[Ch]: GUI-independent
2780 * src/frontends/xforms/FormIndex.[Ch],
2781 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2784 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2786 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2787 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2789 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2791 * src/insets/insetref.C (Latex): rewrite so that there is now
2792 question that a initialization is requested.
2794 * src/insets/insetcommand.h: reenable the hide signal
2796 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2798 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2799 fix handling of shortcuts (many bugs :)
2800 (add_lastfiles): ditto.
2802 * lib/ui/default.ui: fix a few shortcuts.
2804 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2806 * Makefile.am: Fix ``rpmdist'' target to return the exit
2807 status of the ``rpm'' command, instead of the last command in
2808 the chain (the ``rm lyx.xpm'' command, which always returns
2811 2000-08-02 Allan Rae <rae@lyx.org>
2813 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2814 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2815 * src/frontends/xforms/FormToc.C (FormToc): ditto
2817 * src/frontends/xforms/Makefile.am: A few forgotten files
2819 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2820 Signals-not-copyable-problem Lars' started commenting out.
2822 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2824 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2826 * src/insets/insetcommand.h: Signals is not copyable so anoter
2827 scheme for automatic hiding of forms must be used.
2829 * src/frontends/xforms/FormCitation.h: don't inerit from
2830 noncopyable, FormCommand already does that.
2831 * src/frontends/xforms/FormToc.h: ditto
2832 * src/frontends/xforms/FormUrl.h: ditto
2834 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2836 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2838 * src/insets/insetcommand.h (hide): new SigC::Signal0
2839 (d-tor) new virtual destructor emits hide signal
2841 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2842 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2844 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2845 LOF and LOT. Inset is now GUI-independent
2847 * src/insets/insetloa.[Ch]: redundant
2848 * src/insets/insetlof.[Ch]: ditto
2849 * src/insets/insetlot.[Ch]: ditto
2851 * src/frontends/xforms/forms/form_url.fd: tweaked!
2852 * src/frontends/xforms/forms/form_citation.fd: ditto
2854 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2855 dialogs dealing with InsetCommand insets
2857 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2858 FormCommand base class
2859 * src/frontends/xforms/FormUrl.[Ch]: ditto
2861 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2863 * src/frontends/xforms/FormToc.[Ch]: ditto
2865 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2866 passed a generic InsetCommand pointer
2867 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2869 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2870 and modified InsetTOC class
2871 * src/buffer.C: ditto
2873 * forms/lyx.fd: strip out old FD_form_toc code
2874 * src/lyx_gui_misc.C: ditto
2875 * src/lyx_gui.C: ditto
2876 * src/lyx_cb.C: ditto
2877 * src/lyx.[Ch]: ditto
2879 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2881 * src/support/utility.hpp: tr -d '\r'
2883 2000-08-01 Juergen Vigna <jug@sad.it>
2885 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2887 * src/commandtags.h:
2888 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2889 LFUN_TABULAR_FEATURES.
2891 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2892 LFUN_LAYOUT_TABULAR.
2894 * src/insets/insettabular.C (getStatus): implemented helper function.
2896 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2898 2000-07-31 Juergen Vigna <jug@sad.it>
2900 * src/text.C (draw): fixed screen update problem for text-insets.
2902 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2903 something changed probably this has to be added in various other
2906 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2908 2000-07-31 Baruch Even <baruch.even@writeme.com>
2910 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2911 templates to satisfy compaq cxx.
2914 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2916 * src/support/translator.h (equal_1st_in_pair::operator()): take
2917 const ref pair_type as arg.
2918 (equal_2nd_in_pair::operator()): ditto
2919 (Translator::~Translator): remove empty d-tor.
2921 * src/graphics/GraphicsCache.C: move include config.h to top, also
2922 put initialization of GraphicsCache::singleton here.
2923 (~GraphicsCache): move here
2924 (addFile): take const ref as arg
2927 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2929 * src/BufferView2.C (insertLyXFile): change te with/without header
2932 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2934 * src/frontends/xforms/FormGraphics.C (apply): add some
2935 static_cast. Not very nice, but required by compaq cxx.
2937 * src/frontends/xforms/RadioButtonGroup.h: include header
2938 <utility> instead of <pair.h>
2940 * src/insets/insetgraphicsParams.C: add using directive.
2941 (readResize): change return type to void.
2942 (readOrigin): ditto.
2944 * src/lyxfunc.C (getStatus): add missing break for build-program
2945 function; add test for Literate for export functions.
2947 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2948 entries in Options menu.
2950 2000-07-31 Baruch Even <baruch.even@writeme.com>
2952 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2953 protect against auto-allocation; release icon when needed.
2955 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2957 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2958 on usual typewriter.
2960 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2961 earlier czech.kmap), useful only for programming.
2963 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2965 * src/frontends/xforms/FormCitation.h: fix conditioning around
2968 2000-07-31 Juergen Vigna <jug@sad.it>
2970 * src/frontends/xforms/FormTabular.C (local_update): changed
2971 radio_linebreaks to radio_useparbox and added radio_useminipage.
2973 * src/tabular.C: made support for using minipages/parboxes.
2975 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2977 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2979 (descent): so the cursor is in the middle.
2980 (width): bit smaller box.
2982 * src/insets/insetgraphics.h: added display() function.
2984 2000-07-31 Baruch Even <baruch.even@writeme.com>
2986 * src/frontends/Dialogs.h: Added showGraphics signals.
2988 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2989 xforms form definition of the graphics dialog.
2991 * src/frontends/xforms/FormGraphics.h:
2992 * src/frontends/xforms/FormGraphics.C: Added files, the
2993 GUIndependent code of InsetGraphics
2995 * src/insets/insetgraphics.h:
2996 * src/insets/insetgraphics.C: Major writing to make it work.
2998 * src/insets/insetgraphicsParams.h:
2999 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3000 struct between InsetGraphics and GUI.
3002 * src/LaTeXFeatures.h:
3003 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3004 support for graphicx package.
3006 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3007 for the graphics inset.
3009 * src/support/translator.h: Added file, used in
3010 InsetGraphicsParams. this is a template to translate between two
3013 * src/frontends/xforms/RadioButtonGroup.h:
3014 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3015 way to easily control a radio button group.
3017 2000-07-28 Juergen Vigna <jug@sad.it>
3019 * src/insets/insettabular.C (LocalDispatch):
3020 (TabularFeatures): added support for lyx-functions of tabular features.
3021 (cellstart): refixed this function after someone wrongly changed it.
3023 * src/commandtags.h:
3024 * src/LyXAction.C (init): added support for tabular-features
3026 2000-07-28 Allan Rae <rae@lyx.org>
3028 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3029 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3030 triggers the callback for input checking. As a result we sometimes get
3031 "LyX: This shouldn't happen..." printed to cerr.
3032 (input): Started using status variable since I only free() on
3033 destruction. Some input checking for paths and font sizes.
3035 * src/frontends/xforms/FormPreferences.h: Use status to control
3036 activation of Ok and Apply
3038 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3039 callback. Also resized to stop segfaults with 0.88. The problem is
3040 that xforms-0.88 requires the folder to be wide enough to fit all the
3041 tabs. If it isn't it causes all sorts of problems.
3043 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3045 * src/frontends/xforms/forms/README: Reflect reality.
3047 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3048 * src/frontends/xforms/forms/makefile: ditto.
3050 * src/commandtags.h: Get access to new Preferences dialog
3051 * src/LyXAction.C: ditto
3052 * src/lyxfunc.C: ditto
3053 * lib/ui/default.ui: ditto
3055 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3057 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3059 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3062 * src/frontends/xforms/form_url.[Ch]: added.
3064 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3066 * src/insets/insetbib.h: fixed bug in previous commit
3068 * src/frontends/xforms/FormUrl.h: ditto
3070 * src/frontends/xforms/FormPrint.h: ditto
3072 * src/frontends/xforms/FormPreferences.h: ditto
3074 * src/frontends/xforms/FormCopyright.h: ditto
3076 * src/frontends/xforms/FormCitation.C: ditto
3078 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3079 private copyconstructor and private default contructor
3081 * src/support/Makefile.am: add utility.hpp
3083 * src/support/utility.hpp: new file from boost
3085 * src/insets/insetbib.h: set owner in clone
3087 * src/frontends/xforms/FormCitation.C: added missing include
3090 * src/insets/form_url.[Ch]: removed
3092 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3094 * development/lyx.spec.in
3095 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3096 file/directory re-organization.
3098 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3100 * src/insets/insetcommand.[Ch]: moved the string data and
3101 associated manipulation methods into a new stand-alone class
3102 InsetCommandParams. This class has two additional methods
3103 getAsString() and setFromString() allowing the contents to be
3104 moved around as a single string.
3105 (addContents) method removed.
3106 (setContents) method no longer virtual.
3108 * src/buffer.C (readInset): made use of new InsetCitation,
3109 InsetUrl constructors based on InsetCommandParams.
3111 * src/commandtags.h: add LFUN_INSERT_URL
3113 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3114 independent InsetUrl and use InsetCommandParams to extract
3115 string info and create new Insets.
3117 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3119 * src/frontends/xforms/FormCitation.C (apply): uses
3122 * src/frontends/xforms/form_url.C
3123 * src/frontends/xforms/form_url.h
3124 * src/frontends/xforms/FormUrl.h
3125 * src/frontends/xforms/FormUrl.C
3126 * src/frontends/xforms/forms/form_url.fd: new files
3128 * src/insets/insetcite.[Ch]: removed unused constructors.
3130 * src/insets/insetinclude.[Ch]: no longer store filename
3132 * src/insets/inseturl.[Ch]: GUI-independent.
3134 2000-07-26 Juergen Vigna <jug@sad.it>
3135 * renamed frontend from gtk to gnome as it is that what is realized
3136 and did the necessary changes in the files.
3138 2000-07-26 Marko Vendelin <markov@ioc.ee>
3140 * configure.in: cleaning up gnome configuration scripts
3142 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3144 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3145 shortcuts syndrom by redrawing them explicitely (a better solution
3146 would be appreciated).
3148 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3150 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3153 * src/lyx_cb.C (MenuExport): change html export to do the right
3154 thing depending of the document type (instead of having
3155 html-linuxdoc and html-docbook).
3156 * src/lyxfunc.C (getStatus): update for html
3157 * lib/ui/default.ui: simplify due to the above change.
3158 * src/menus.C (ShowFileMenu): update too (in case we need it).
3160 * src/MenuBackend.C (read): if a menu is defined twice, add the
3161 new entries to the exiting one.
3163 2000-07-26 Juergen Vigna <jug@sad.it>
3165 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3167 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3168 and return a bool if it did actual save the file.
3169 (AutoSave): don't autosave a unnamed doc.
3171 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3172 check if this is an UNNAMED new file and react to it.
3173 (newFile): set buffer to unnamed and change to not mark a new
3174 buffer dirty if I didn't do anything with it.
3176 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3178 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3180 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3181 friend as per Angus's patch posted to lyx-devel.
3183 * src/ext_l10n.h: updated
3185 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3186 gettext on the style string right before inserting them into the
3189 * autogen.sh: add code to extract style strings form layout files,
3190 not good enough yet.
3192 * src/frontends/gtk/.cvsignore: add MAKEFILE
3194 * src/MenuBackend.C (read): run the label strings through gettext
3195 before storing them in the containers.
3197 * src/ext_l10n.h: new file
3199 * autogen.sh : generate the ext_l10n.h file here
3201 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3203 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3206 * lib/ui/default.ui: fix a couple of typos.
3208 * config/gnome/gtk.m4: added (and added to the list of files in
3211 * src/insets/insetinclude.C (unique_id): fix when we are using
3212 lyxstring instead of basic_string<>.
3213 * src/insets/insettext.C (LocalDispatch): ditto.
3214 * src/support/filetools.C: ditto.
3216 * lib/configure.m4: create the ui/ directory if necessary.
3218 * src/LyXView.[Ch] (updateToolbar): new method.
3220 * src/BufferView_pimpl.C (buffer): update the toolbar when
3221 opening/closing buffer.
3223 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3225 * src/LyXAction.C (getActionName): enhance to return also the name
3226 and options of pseudo-actions.
3227 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3229 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3230 as an example of what is possible). Used in File->Build too (more
3231 useful) and in the import/export menus (to mimick the complicated
3232 handling of linuxdoc and friends). Try to update all the entries.
3234 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3237 * src/MenuBackend.C (read): Parse the new OptItem tag.
3239 * src/MenuBackend.h: Add a new optional_ data member (used if the
3240 entry should be omitted when the lyxfunc is disabled).
3242 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3243 function, used as a shortcut.
3244 (create_submenu): align correctly the shortcuts on the widest
3247 * src/MenuBackend.h: MenuItem.label() only returns the label of
3248 the menu without shortcut; new method shortcut().
3250 2000-07-14 Marko Vendelin <markov@ioc.ee>
3252 * src/frontends/gtk/Dialogs.C:
3253 * src/frontends/gtk/FormCopyright.C:
3254 * src/frontends/gtk/FormCopyright.h:
3255 * src/frontends/gtk/Makefile.am: added these source-files for the
3256 Gtk/Gnome support of the Copyright-Dialog.
3258 * src/main.C: added Gnome::Main initialization if using
3259 Gtk/Gnome frontend-GUI.
3261 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3263 * config/gnome/aclocal-include.m4
3264 * config/gnome/compiler-flags.m4
3265 * config/gnome/curses.m4
3266 * config/gnome/gnome--.m4
3267 * config/gnome/gnome-bonobo-check.m4
3268 * config/gnome/gnome-common.m4
3269 * config/gnome/gnome-fileutils.m4
3270 * config/gnome/gnome-ghttp-check.m4
3271 * config/gnome/gnome-gnorba-check.m4
3272 * config/gnome/gnome-guile-checks.m4
3273 * config/gnome/gnome-libgtop-check.m4
3274 * config/gnome/gnome-objc-checks.m4
3275 * config/gnome/gnome-orbit-check.m4
3276 * config/gnome/gnome-print-check.m4
3277 * config/gnome/gnome-pthread-check.m4
3278 * config/gnome/gnome-support.m4
3279 * config/gnome/gnome-undelfs.m4
3280 * config/gnome/gnome-vfs.m4
3281 * config/gnome/gnome-x-checks.m4
3282 * config/gnome/gnome-xml-check.m4
3283 * config/gnome/gnome.m4
3284 * config/gnome/gperf-check.m4
3285 * config/gnome/gtk--.m4
3286 * config/gnome/linger.m4
3287 * config/gnome/need-declaration.m4: added configuration scripts
3288 for Gtk/Gnome frontend-GUI
3290 * configure.in: added support for the --with-frontend=gtk option
3292 * autogen.sh: added config/gnome/* to list of config-files
3294 * acconfig.h: added define for GTKGUI-support
3296 * config/lyxinclude.m4: added --with-frontend[=value] option value
3297 for Gtk/Gnome frontend-GUI support.
3299 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3301 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3305 * src/paragraph.C (GetChar): remove non-const version
3307 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3308 (search_kw): use it.
3310 * src/lyx_main.C (init): if "preferences" exist, read that instead
3312 (ReadRcFile): return bool if the file could be read ok.
3313 (ReadUIFile): add a check to see if lex file is set ok.
3315 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3316 bastring can be used instead of lyxstring (still uses the old code
3317 if std::string is good enough or if lyxstring is used.)
3319 * src/encoding.C: make the arrays static, move ininle functions
3321 * src/encoding.h: from here.
3323 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3324 (parseSingleLyXformat2Token): move inset parsing to separate method
3325 (readInset): new private method
3327 * src/Variables.h: remove virtual from get().
3329 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
3330 access to NEW_INSETS and NEW_TABULAR
3332 * src/MenuBackend.h: remove superfluous forward declaration of
3333 MenuItem. Add documentations tags "///", remove empty MenuItem
3334 destructor, remove private default contructor.
3336 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3338 (read): more string mlabel and mname to where they are used
3339 (read): remove unused variables mlabel and mname
3340 (defaults): unconditional clear, make menusetup take advantage of
3341 add returning Menu &.
3343 * src/LyXView.h: define NEW_MENUBAR as default
3345 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3346 to NEW_INSETS and NEW_TABULAR.
3347 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3348 defined. Change some of the "xxxx-inset-insert" functions names to
3351 * several files: more enahncements to NEW_INSETS and the resulting
3354 * lib/lyxrc.example (\date_insert_format): move to misc section
3356 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3357 bastring and use AC_CACHE_CHECK.
3358 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3359 the system have the newest methods. uses AC_CACHE_CHECK
3360 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3361 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3362 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3364 * configure.in: add LYX_CXX_GOOD_STD_STRING
3366 * acinclude.m4: recreated
3368 2000-07-24 Amir Karger
3370 * README: add Hebrew, Arabic kmaps
3373 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3375 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3378 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3380 * Lot of files: add pragma interface/implementation.
3382 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3384 * lib/ui/default.ui: new file (ans new directory). Contains the
3385 default menu and toolbar.
3387 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3388 global space. Toolbars are now read (as menus) in ui files.
3390 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3392 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3393 is disabled because the document is read-only. We want to have the
3394 toggle state of the function anyway.
3395 (getStatus): add code for LFUN_VC* functions (mimicking what is
3396 done in old-style menus)
3398 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3399 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3401 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3402 * src/BufferView_pimpl.C: ditto.
3403 * src/lyxfunc.C: ditto.
3405 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3406 default). This replaces old-style menus by new ones.
3408 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3409 MenuItem. Contain the data structure of a menu.
3411 * src/insets/insettext.C: use LyXView::setLayout instead of
3412 accessing directly the toolbar combox.
3413 * src/lyxfunc.C (Dispatch): ditto.
3415 * src/LyXView.C (setLayout): new method, which just calls
3416 Toolbar::setLayout().
3417 (updateLayoutChoice): move part of this method in Toolbar.
3419 * src/toolbar.[Ch]: removed.
3421 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3422 implementation the toolbar.
3424 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3425 the toolbar. It might make sense to merge it with ToolbarDefaults
3427 (setLayout): new function.
3428 (updateLayoutList): ditto.
3429 (openLayoutList): ditto.
3431 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3432 xforms implementation of the toolbar.
3433 (get_toolbar_func): comment out, since I do not
3434 know what it is good for.
3436 * src/ToolbarDefaults.h: Add the ItemType enum.
3438 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3439 for a list of allocated C strings. Used in Menubar xforms
3440 implementation to avoid memory leaks.
3442 * src/support/lstrings.[Ch] (uppercase): new version taking and
3446 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3447 * lib/bind/emacs.bind: ditto.
3449 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3451 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3452 forward decl of LyXView.
3454 * src/toolbar.C (toolbarItem): moved from toolbar.h
3455 (toolbarItem::clean): ditto
3456 (toolbarItem::~toolbarItem): ditto
3457 (toolbarItem::operator): ditto
3459 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3461 * src/paragraph.h: control the NEW_TABULAR define from here
3463 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3464 USE_TABULAR_INSETS to NEW_TABULAR
3466 * src/ToolbarDefaults.C: add include "lyxlex.h"
3468 * files using the old table/tabular: use NEW_TABULAR to control
3469 compilation of old tabular stuff.
3471 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3474 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3475 planemet in reading of old style floats, fix the \end_deeper
3476 problem when reading old style floats.
3478 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3480 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3482 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3484 * lib/bind/sciword.bind: updated.
3486 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3488 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3489 layout write problem
3491 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3493 * src/Makefile.am (INCLUDES): remove image directory from include
3496 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3497 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3499 * src/LyXView.C (create_form_form_main): read the application icon
3502 * lib/images/*.xpm: change the icons to use transparent color for
3505 * src/toolbar.C (update): change the color of the button when it
3508 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3510 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3511 setting explicitely the minibuffer.
3512 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3514 * src/LyXView.C (showState): new function. Shows font information
3515 in minibuffer and update toolbar state.
3516 (LyXView): call Toolbar::update after creating the
3519 * src/toolbar.C: change toollist to be a vector instead of a
3521 (BubbleTimerCB): get help string directly from the callback
3522 argument of the corresponding icon (which is the action)
3523 (set): remove unnecessary ugliness.
3524 (update): new function. update the icons (depressed, disabled)
3525 depending of the status of the corresponding action.
3527 * src/toolbar.h: remove help in toolbarItem
3529 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
3531 * src/Painter.C (text): Added code for using symbol glyphs from
3532 iso10646 fonts. Currently diabled.
3534 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
3537 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
3538 magyar,turkish and usorbian.
3540 * src/paragraph.C (isMultiLingual): Made more efficient.
3542 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
3545 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
3546 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3547 Also changed the prototype to "bool math_insert_greek(char)".
3549 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3551 * lots of files: apply the NEW_INSETS on all code that will not be
3552 needed when we move to use the new insets. Enable the define in
3553 lyxparagrah.h to try it.
3555 * src/insets/insettabular.C (cellstart): change to be a static
3557 (InsetTabular): initialize buffer in the initializer list.
3559 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3561 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3562 form_print.h out of the header file. Replaced with forward
3563 declarations of the relevant struct.
3565 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3568 * src/commandtags.h: do not include "debug.h" which does not
3569 belong there. #include it in some other places because of this
3572 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3574 * src/insets/insetcaption.C: add a couple "using" directives.
3576 * src/toolbar.C (add): get the help text directly from lyxaction.
3578 (setPixmap): new function. Loads from disk and sets a pixmap on a
3579 botton; the name of the pixmap file is derived from the command
3582 * src/toolbar.h: remove members isBitmap and pixmap from
3585 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
3586 * lib/images/: move many files from images/banner.xpm.
3588 * src/lyx_gui.C (create_forms): read banner pixmap from file.
3590 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
3591 * src/toolbar.C: ditto.
3592 * configure.in: ditto.
3593 * INSTALL: document.
3595 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
3596 the spellchecker popup is closed from the WM.
3598 2000-07-19 Juergen Vigna <jug@sad.it>
3600 * src/insets/insetfloat.C (Write): small fix because we use the
3601 insetname for the type now!
3603 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3605 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3608 * src/frontends/Dialogs.h: removed hideCitation signal
3610 * src/insets/insetcite.h: added hide signal
3612 * src/insets/insetcite.C (~InsetCitation): emits new signal
3613 (getScreenLabel): "intelligent" label should now fit on the screen!
3615 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3617 * src/frontends/xforms/FormCitation.C (showInset): connects
3618 hide() to the inset's hide signal
3619 (show): modified to use fl_set_object_position rather than
3620 fl_set_object_geometry wherever possible
3622 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3624 * src/insets/lyxinset.h: add caption code
3626 * src/insets/insetfloat.C (type): new method
3628 * src/insets/insetcaption.C (Write): new method
3630 (LyxCode): new method
3632 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3633 to get it right together with using the FloatList.
3635 * src/commandtags.h: add LFUN_INSET_CAPTION
3636 * src/lyxfunc.C (Dispatch): handle it
3638 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3641 * src/Variables.[Ch]: make expand take a const reference, remove
3642 the destructor, some whitespace changes.
3644 * src/LyXAction.C (init): add caption-inset-insert
3646 * src/FloatList.C (FloatList): update the default floats a bit.
3648 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3650 * src/Variables.[Ch]: new files. Intended to be used for language
3651 specific strings (like \chaptername) and filename substitution in
3654 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
3656 * lib/kbd/american.kmap: update
3658 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
3660 * src/bufferparams.[Ch]: remove member allowAccents.
3662 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
3664 * src/LaTeXLog.C: use the log_form.h header.
3665 * src/lyx_gui.C: ditto.
3666 * src/lyx_gui_misc.C: ditto.
3667 * src/lyxvc.h: ditto.
3669 * forms/log_form.fd: new file, created from latexoptions.fd. I
3670 kept the log popup and nuked the options form.
3672 * src/{la,}texoptions.[Ch]: removed.
3673 * src/lyx_cb.C (LaTeXOptions): ditto
3675 * src/lyx_gui.C (create_forms): do not handle the
3676 fd_latex_options form.
3678 2000-07-18 Juergen Vigna <jug@sad.it>
3680 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
3681 name of the inset so that it can be requested outside (text2.C).
3683 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
3686 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3688 * src/mathed/formula.h (ConvertFont): constify
3690 * src/mathed/formula.C (Read): add warning if \end_inset is not
3691 found on expected place.
3693 * src/insets/lyxinset.h (ConvertFont): consify
3695 * src/insets/insetquotes.C (ConvertFont): constify
3696 * src/insets/insetquotes.h: ditto
3698 * src/insets/insetinfo.h: add labelfont
3700 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3701 (ascent): use labelfont
3705 (Write): make .lyx file a bit nicer
3707 * src/insets/insetfloat.C (Write): simplify somewhat...
3708 (Read): add warning if arg is not found
3710 * src/insets/insetcollapsable.C: add using std::max
3711 (Read): move string token and add warning in arg is not found
3712 (draw): use std::max to get the right ty
3713 (getMaxWidth): simplify by using std::max
3715 * src/insets/insetsection.h: new file
3716 * src/insets/insetsection.C: new file
3717 * src/insets/insetcaption.h: new file
3718 * src/insets/insetcaption.C: new file
3720 * src/insets/inset.C (ConvertFont): constify signature
3722 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3723 insetcaption.[Ch] and insetsection.[Ch]
3725 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3726 uses to use LABEL_COUNTER_CHAPTER instead.
3727 * src/text2.C (SetCounter): here
3729 * src/counters.h: new file
3730 * src/counters.C: new file
3731 * src/Sectioning.h: new file
3732 * src/Sectioning.C: new file
3734 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3736 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3738 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3741 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3744 2000-07-17 Juergen Vigna <jug@sad.it>
3746 * src/tabular.C (Validate): check if array-package is needed.
3747 (SetVAlignment): added support for vertical alignment.
3748 (SetLTFoot): better support for longtable header/footers
3749 (Latex): modified to support added features.
3751 * src/LaTeXFeatures.[Ch]: added array-package.
3753 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3755 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3758 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3760 * configure.in: do not forget to put a space after -isystem.
3762 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3764 * lib/kbd/arabic.kmap: a few fixes.
3766 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3768 * some whitespace chagnes to a number of files.
3770 * src/support/DebugStream.h: change to make it easier for
3771 doc++ to parse correctly.
3772 * src/support/lyxstring.h: ditto
3774 * src/mathed/math_utils.C (compara): change to have only one
3776 (MathedLookupBOP): change because of the above.
3778 * src/mathed/math_delim.C (math_deco_compare): change to have only
3780 (search_deco): change becasue of the above.
3782 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3783 instead of manually coded one.
3785 * src/insets/insetquotes.C (Read): read the \end_inset too
3787 * src/insets/insetlatex.h: remove file
3788 * src/insets/insetlatex.C: remove file
3790 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3792 (InsetPrintIndex): remove destructor
3794 * src/insets/insetinclude.h: remove default constructor
3796 * src/insets/insetfloat.C: work to make it work better
3798 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3800 * src/insets/insetcite.h (InsetCitation): remove default constructor
3802 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3804 * src/text.C (GetColumnNearX): comment out some currently unused code.
3806 * src/paragraph.C (writeFile): move some initializations closer to
3808 (CutIntoMinibuffer): small change to use new matchIT operator
3812 (InsertInset): ditto
3815 (InsetIterator): ditto
3816 (Erase): small change to use new matchFT operator
3818 (GetFontSettings): ditto
3819 (HighestFontInRange): ditto
3822 * src/lyxparagraph.h: some chars changed to value_type
3823 (matchIT): because of some stronger checking (perhaps too strong)
3824 in SGI STL, the two operator() unified to one.
3827 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3829 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3830 the last inset read added
3831 (parseSingleLyXformat2Token): some more (future) compability code added
3832 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3833 (parseSingleLyXformat2Token): set last_inset_read
3834 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3835 (parseSingleLyXformat2Token): don't double intializw string next_token
3837 * src/TextCache.C (text_fits::operator()): add const's to the signature
3838 (has_buffer::operator()): ditto
3840 * src/Floating.h: add some comments on the class
3842 * src/FloatList.[Ch] (typeExist): new method
3845 * src/BackStack.h: added default constructor, wanted by Gcc.
3847 2000-07-14 Juergen Vigna <jug@sad.it>
3849 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3851 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3853 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3854 do a redraw when the window is resized!
3855 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3857 * src/insets/insettext.C (resizeLyXText): added function to correctly
3858 being able to resize the LyXWindow.
3860 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3862 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3864 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3865 crashes when closing dialog to a deleted inset.
3867 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3868 method! Now similar to other insets.
3870 2000-07-13 Juergen Vigna <jug@sad.it>
3872 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3874 * lib/examples/Literate.lyx: small patch!
3876 * src/insets/insetbib.C (Read): added this function because of wrong
3877 Write (without [begin|end]_inset).
3879 2000-07-11 Juergen Vigna <jug@sad.it>
3881 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3882 as the insertInset could not be good!
3884 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3885 the bool param should not be last.
3887 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3889 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3890 did submit that to Karl).
3892 * configure.in: use -isystem instead of -I for X headers. This
3893 fixes a problem on solaris with a recent gcc;
3894 put the front-end code after the X detection code;
3895 configure in sigc++ before lib/
3897 * src/lyx_main.C (commandLineHelp): remove -display from command
3900 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3902 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3903 Also put in Makefile rules for building the ``listerrors''
3904 program for parsing errors from literate programs written in LyX.
3906 * lib/build-listerrors: Added small shell script as part of compile
3907 process. This builds a working ``listerrors'' binary if noweb is
3908 installed and either 1) the VNC X server is installed on the machine,
3909 or 2) the user is compiling from within a GUI. The existence of a GUI
3910 is necessary to use the ``lyx --export'' feature for now. This
3911 hack can be removed once ``lyx --export'' no longer requires a GUI to
3914 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3916 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3917 now passed back correctly from gcc and placed "under" error
3918 buttons in a Literate LyX source.
3920 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3922 * src/text.C (GetColumnNearX): Better behavior when a RTL
3923 paragraph is ended by LTR text.
3925 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3928 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3930 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3931 true when clipboard is empty.
3933 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3935 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3936 row of the paragraph.
3937 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3938 to prevent calculation of bidi tables
3940 2000-07-07 Juergen Vigna <jug@sad.it>
3942 * src/screen.C (ToggleSelection): added y_offset and x_offset
3945 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3948 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3950 * src/insets/insettext.C: fixed Layout-Display!
3952 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3954 * configure.in: add check for strings.h header.
3956 * src/spellchecker.C: include <strings.h> in order to have a
3957 definition for bzero().
3959 2000-07-07 Juergen Vigna <jug@sad.it>
3961 * src/insets/insettext.C (draw): set the status of the bv->text to
3962 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3964 * src/screen.C (DrawOneRow):
3965 (DrawFromTo): redraw the actual row if something has changed in it
3968 * src/text.C (draw): call an update of the toplevel-inset if something
3969 has changed inside while drawing.
3971 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3973 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3975 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3976 processing inside class.
3978 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3979 processing inside class.
3981 * src/insets/insetindex.h new struct Holder, consistent with other
3984 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3985 citation dialog from main code and placed it in src/frontends/xforms.
3986 Dialog launched through signals instead of callbacks
3988 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3990 * lyx.man: update the options description.
3992 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3994 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3995 handle neg values, set min width to 590, add doc about -display
3997 2000-07-05 Juergen Vigna <jug@sad.it>
3999 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4000 calls to BufferView *.
4002 * src/insets/insettext.C (checkAndActivateInset): small fix non
4003 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4005 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4006 their \end_inset token!
4008 2000-07-04 edscott <edscott@imp.mx>
4010 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4011 lib/lyxrc.example: added option \wheel_jump
4013 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4015 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4016 remove support for -width,-height,-xpos and -ypos.
4018 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4020 * src/encoding.[Ch]: New files.
4022 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4023 (text): Call to the underline() method only when needed.
4025 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4027 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4028 encoding(s) for the document.
4030 * src/bufferparams.C (BufferParams): Changed default value of
4033 * src/language.C (newLang): Removed.
4034 (items[]): Added encoding information for all defined languages.
4036 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4037 encoding choice button.
4039 * src/lyxrc.h (font_norm_type): New member variable.
4040 (set_font_norm_type): New method.
4042 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4043 paragraphs with different encodings.
4045 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4046 (TransformChar): Changed to work correctly with Arabic points.
4047 (draw): Added support for drawing Arabic points.
4048 (draw): Removed code for drawing underbars (this is done by
4051 * src/support/textutils.h (IsPrintableNonspace): New function.
4053 * src/BufferView_pimpl.h: Added "using SigC::Object".
4054 * src/LyXView.h: ditto.
4056 * src/insets/insetinclude.h (include_label): Changed to mutable.
4058 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4060 * src/mathed/math_iter.h: remove empty destructor
4062 * src/mathed/math_cursor.h: remove empty destructor
4064 * src/insets/lyxinset.h: add THEOREM_CODE
4066 * src/insets/insettheorem.[Ch]: new files
4068 * src/insets/insetminipage.C: (InsertInset): remove
4070 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4072 (InsertInset): remove
4074 * src/insets/insetlist.C: (InsertList): remove
4076 * src/insets/insetfootlike.[Ch]: new files
4078 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4081 (InsertInset): ditto
4083 * src/insets/insetert.C: remove include Painter.h, reindent
4084 (InsertInset): move to header
4086 * src/insets/insetcollapsable.h: remove explicit from default
4087 contructor, remove empty destructor, add InsertInset
4089 * src/insets/insetcollapsable.C (InsertInset): new func
4091 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4093 * src/vspace.h: add explicit to constructor
4095 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4096 \textcompwordmark, please test this.
4098 * src/lyxrc.C: set ascii_linelen to 65 by default
4100 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4102 * src/commandtags.h: add LFUN_INSET_THEOREM
4104 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4105 (makeLinuxDocFile): remove _some_ of the nice logic
4106 (makeDocBookFile): ditto
4108 * src/Painter.[Ch]: (~Painter): removed
4110 * src/LyXAction.C (init): entry for insettheorem added
4112 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4114 (deplog): code to detect files generated by LaTeX, needs testing
4117 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4119 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4121 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4123 * src/LaTeX.C (deplog): Add a check for files that are going to be
4124 created by the first latex run, part of the project to remove the
4127 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4128 contents to the extension list.
4130 2000-07-04 Juergen Vigna <jug@sad.it>
4132 * src/text.C (NextBreakPoint): added support for needFullRow()
4134 * src/insets/lyxinset.h: added needFullRow()
4136 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4139 * src/insets/insettext.C: lots of changes for update!
4141 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4143 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4145 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4147 * src/insets/insetinclude.C (InsetInclude): fixed
4148 initialization of include_label.
4149 (unique_id): now returns a string.
4151 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4153 * src/LaTeXFeatures.h: new member IncludedFiles, for
4154 a map of key, included file name.
4156 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4157 with the included files for inclusion in SGML preamble,
4158 i. e., linuxdoc and docbook.
4161 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4162 nice (is the generated linuxdoc code to be exported?), that
4163 allows to remove column, and only_body that will be true for
4164 slave documents. Insets are allowed inside SGML font type.
4165 New handling of the SGML preamble for included files.
4166 (makeDocBookFile): the same for docbook.
4168 * src/insets/insetinclude.h:
4169 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4171 (DocBook): new export methods.
4173 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4174 and makeDocBookFile.
4176 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4177 formats to export with command line argument -x.
4179 2000-06-29 Juergen Vigna <jug@sad.it>
4181 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4182 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4184 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4185 region could already been cleared by an inset!
4187 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4189 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4192 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4194 (cursorToggle): remove special handling of lyx focus.
4196 2000-06-28 Juergen Vigna <jug@sad.it>
4198 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4201 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4203 * src/insets/insetindex.C (Edit): add a callback when popup is
4206 * src/insets/insettext.C (LocalDispatch):
4207 * src/insets/insetmarginal.h:
4208 * src/insets/insetlist.h:
4209 * src/insets/insetfoot.h:
4210 * src/insets/insetfloat.h:
4211 * src/insets/insetert.h: add a missing std:: qualifier.
4213 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4215 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4218 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4220 * src/insets/insettext.C (Read): remove tmptok unused variable
4221 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4222 (InsertInset): change for new InsetInset code
4224 * src/insets/insettext.h: add TEXT inline method
4226 * src/insets/insettext.C: remove TEXT macro
4228 * src/insets/insetmarginal.C (Write): new method
4229 (Latex): change output slightly
4231 * src/insets/insetfoot.C (Write): new method
4232 (Latex): change output slightly (don't use endl when no need)
4234 * src/insets/insetert.C (Write): new method
4236 * src/insets/insetcollapsable.h: make button_length, button_top_y
4237 and button_bottm_y protected.
4239 * src/insets/insetcollapsable.C (Write): simplify code by using
4240 tostr. Also do not output the float name, the children class
4241 should to that to get control over own arguments
4243 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4244 src/insets/insetminipage.[Ch]:
4247 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4249 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4251 * src/Makefile.am (lyx_SOURCES): add the new files
4253 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4254 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4255 * src/commandtags.h: ditto
4257 * src/LaTeXFeatures.h: add a std::set of used floattypes
4259 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4261 * src/FloatList.[Ch] src/Floating.h: new files
4263 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4265 * src/lyx_cb.C (TableApplyCB): ditto
4267 * src/text2.C: ditto
4268 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4269 (parseSingleLyXformat2Token): ditto + add code for
4270 backwards compability for old float styles + add code for new insets
4272 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4274 (InsertInset(size_type, Inset *, LyXFont)): new method
4275 (InsetChar(size_type, char)): changed to use the other InsetChar
4276 with a LyXFont(ALL_INHERIT).
4277 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4278 insert the META_INSET.
4280 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4282 * sigc++/thread.h (Threads): from here
4284 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4285 definition out of line
4286 * sigc++/scope.h: from here
4288 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4290 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4291 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4293 * Makefile.am (bindist): new target.
4295 * INSTALL: add instructions for doing a binary distribution.
4297 * development/tools/README.bin.example: update a bit.
4299 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4302 * lib/lyxrc.example: new lyxrc tag \set_color.
4304 * src/lyxfunc.C (Dispatch):
4305 * src/commandtags.h:
4306 * src/LyXAction.C: new lyxfunc "set-color".
4308 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4309 and an x11name given as strings.
4311 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4312 cache when a color is changed.
4314 2000-06-26 Juergen Vigna <jug@sad.it>
4316 * src/lyxrow.C (width): added this functions and variable.
4318 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4321 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4323 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4325 * images/undo_bw.xpm: new icon.
4326 * images/redo_bw.xpm: ditto.
4328 * configure.in (INSTALL_SCRIPT): change value to
4329 ${INSTALL} to avoid failures of install-script target.
4330 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
4332 * src/BufferView.h: add a magic "friend" declaration to please
4335 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4337 * forms/cite.fd: modified to allow resizing without messing
4340 * src/insetcite.C: Uses code from cite.fd almost without
4342 User can now resize dialog in the x-direction.
4343 Resizing the dialog in the y-direction is prevented, as the
4344 code does this intelligently already.
4346 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4348 * INSTALL: remove obsolete entry in "problems" section.
4350 * lib/examples/sl_*.lyx: update of the slovenian examples.
4352 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4354 2000-06-23 Juergen Vigna <jug@sad.it>
4356 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4358 * src/buffer.C (resize): delete the LyXText of textinsets.
4360 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4362 * src/insets/lyxinset.h: added another parameter 'cleared' to
4363 the draw() function.
4365 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4366 unlocking inset in inset.
4368 2000-06-22 Juergen Vigna <jug@sad.it>
4370 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4371 of insets and moved first to LyXText.
4373 * src/mathed/formulamacro.[Ch]:
4374 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4376 2000-06-21 Juergen Vigna <jug@sad.it>
4378 * src/text.C (GetVisibleRow): look if I should clear the area or not
4379 using Inset::doClearArea() function.
4381 * src/insets/lyxinset.h: added doClearArea() function and
4382 modified draw(Painter &, ...) to draw(BufferView *, ...)
4384 * src/text2.C (UpdateInset): return bool insted of int
4386 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4388 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4389 combox in the character popup
4391 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4392 BufferParams const & params
4394 2000-06-20 Juergen Vigna <jug@sad.it>
4396 * src/insets/insettext.C (SetParagraphData): set insetowner on
4399 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4401 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4402 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4404 (form_main_): remove
4406 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4407 (create_form_form_main): remove FD_form_main stuff, connect to
4408 autosave_timeout signal
4410 * src/LyXView.[Ch] (getMainForm): remove
4411 (UpdateTimerCB): remove
4412 * src/BufferView_pimpl.h: inherit from SigC::Object
4414 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4415 signal instead of callback
4417 * src/BufferView.[Ch] (cursorToggleCB): remove
4419 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4421 * src/BufferView_pimpl.C: changes because of the one below
4423 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4424 instead of storing a pointer to a LyXText.
4426 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4428 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4430 * src/lyxparagraph.h
4432 * src/paragraph.C: Changed fontlist to a sorted vector.
4434 2000-06-19 Juergen Vigna <jug@sad.it>
4436 * src/BufferView.h: added screen() function.
4438 * src/insets/insettext.C (LocalDispatch): some selection code
4441 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4443 * src/insets/insettext.C (SetParagraphData):
4445 (InsetText): fixes for multiple paragraphs.
4447 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4449 * development/lyx.spec.in: Call configure with ``--without-warnings''
4450 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4451 This should be fine, however, since we generally don't want to be
4452 verbose when making an RPM.
4454 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4456 * lib/scripts/fig2pstex.py: New file
4458 2000-06-16 Juergen Vigna <jug@sad.it>
4460 * src/insets/insettabular.C (UpdateLocal):
4461 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4462 (LocalDispatch): Changed all functions to use LyXText.
4464 2000-06-15 Juergen Vigna <jug@sad.it>
4466 * src/text.C (SetHeightOfRow): call inset::update before requesting
4469 * src/insets/insettext.C (update):
4470 * src/insets/insettabular.C (update): added implementation
4472 * src/insets/lyxinset.h: added update function
4474 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4476 * src/text.C (SelectNextWord): protect against null pointers with
4477 old-style string streams. (fix from Paul Theo Gonciari
4480 * src/cite.[Ch]: remove erroneous files.
4482 * lib/configure.m4: update the list of created directories.
4484 * src/lyxrow.C: include <config.h>
4485 * src/lyxcursor.C: ditto.
4487 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4489 * lib/examples/decimal.lyx: new example file from Mike.
4491 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4492 to find template definitions (from Dekel)
4494 * src/frontends/.cvsignore: add a few things.
4496 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4498 * src/Timeout.C (TimeOut): remove default argument.
4500 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4503 * src/insets/ExternalTemplate.C: add a "using" directive.
4505 * src/lyx_main.h: remove the act_ struct, which seems unused
4508 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4510 * LyX Developers Meeting: All files changed, due to random C++ (by
4511 coincidence) code generator script.
4513 - external inset (cool!)
4514 - initial online editing of preferences
4515 - insettabular breaks insettext(s contents)
4517 - some DocBook fixes
4518 - example files update
4519 - other cool stuff, create a diff and look for yourself.
4521 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4523 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4524 -1 this is a non-line-breaking textinset.
4526 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
4527 if there is no width set.
4529 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4531 * Lots of files: Merged the dialogbase branch.
4533 2000-06-09 Allan Rae <rae@lyx.org>
4535 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
4536 and the Dispatch methods that used it.
4538 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
4539 access to functions formerly kept in Dispatch.
4541 2000-05-19 Allan Rae <rae@lyx.org>
4543 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
4544 made to_page and count_copies integers again. from_page remains a
4545 string however because I want to allow entry of a print range like
4546 "1,4,22-25" using this field.
4548 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4549 and printer-params-get. These aren't useful from the minibuffer but
4550 could be used by a script/LyXServer app provided it passes a suitable
4551 auto_mem_buffer. I guess I should take a look at how the LyXServer
4552 works and make it support xtl buffers.
4554 * sigc++/: updated to libsigc++-1.0.1
4556 * src/xtl/: updated to xtl-1.3.pl.11
4558 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4559 those changes done to the files in src/ are actually recreated when
4560 they get regenerated. Please don't ever accept a patch that changes a
4561 dialog unless that patch includes the changes to the corresponding *.fd
4564 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4565 stringOnlyContains, renamed it and generalised it.
4567 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4568 branch. Removed the remaining old form_print code.
4570 2000-04-26 Allan Rae <rae@lyx.org>
4572 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
4573 trap I was trying to fix with the ID: fields in src/xtl/ :-)
4575 2000-04-25 Allan Rae <rae@lyx.org>
4577 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
4578 against a base of xtl-1.3.pl.4
4580 * development/tools/lxtl.sh: fixed a couple of silly typos and now
4581 filter the Id: entries so they still show the xtl version number
4584 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
4585 into the src/xtl code. Patch still pending with José (XTL)
4587 2000-04-24 Allan Rae <rae@lyx.org>
4589 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
4590 both more generic and much safer. Use the new template functions.
4591 * src/buffer.[Ch] (Dispatch): ditto.
4593 * src/frontends/xforms/FormPrint.C (update): Use new template functions
4594 and mem buffer more intelligently. Also a little general cleanup.
4597 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
4598 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4599 * src/xtl/Makefile.am: ditto.
4600 * src/xtl/.cvsignore: ditto.
4601 * src/Makefile.am: ditto.
4603 * src/PrinterParams.h: Removed the macros member functions. Added a
4604 testInvariant member function. A bit of tidying up and commenting.
4605 Included Angus's idea for fixing operation with egcs-1.1.2.
4607 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4608 cool expansion of XTL's mem_buffer to support automatic memory
4609 management within the buffer itself. Removed the various macros and
4610 replaced them with template functions that use either auto_mem_buffer
4611 or mem_buffer depending on a #define. The mem_buffer support will
4612 disappear as soon as the auto_mem_buffer is confirmed to be good on
4613 other platforms/compilers. That is, it's there so you've got something
4616 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4617 effectively forked XTL. However I expect José will include my code
4618 into the next major release. Also fixed a memory leak.
4619 * src/xtl/text.h: ditto.
4620 * src/xtl/xdr.h: ditto.
4621 * src/xtl/giop.h: ditto.
4623 2000-04-16 Allan Rae <rae@lyx.org>
4625 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4626 by autogen.sh and removed by maintainer-clean anyway.
4627 * .cvsignore, sigc++/.cvsignore: Support the above.
4629 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4631 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4633 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4634 macros, renamed static callback-target member functions to suit new
4635 scheme and made them public.
4636 * src/frontends/xforms/forms/form_print.fd: ditto.
4637 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4639 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4642 * src/xtl/: New directory containing a minimal distribution of XTL.
4643 This is XTL-1.3.pl.4.
4645 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4647 2000-04-15 Allan Rae <rae@lyx.org>
4649 * development/tools/makeLyXsigc.sh: Remove the library version numbers
4651 * sigc++/: Updated to libsigc++-1.0.0
4653 2000-04-14 Allan Rae <rae@lyx.org>
4655 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
4656 use the generic ones in future. I'll modify my conversion script.
4658 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
4660 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
4661 (CloseAllBufferRelatedDialogs): Renamed.
4662 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
4664 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
4665 of the generic ones. These are the same ones my conversion script
4668 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
4669 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
4670 * src/buffer.C (Dispatch): ditto
4672 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
4673 functions for updating and hiding buffer dependent dialogs.
4674 * src/BufferView.C (buffer): ditto
4675 * src/buffer.C (setReadonly): ditto
4676 * src/lyxfunc.C (CloseBuffer): ditto
4678 * src/buffer.h: Take setReadonly() out of line so I don't have to include
4679 Dialogs.h, and hence all the SigC stuff, into every file that includes
4680 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
4682 * src/BufferView2.C: reduce the number of headers included by buffer.h
4684 2000-04-11 Allan Rae <rae@lyx.org>
4686 * src/frontends/xforms/xform_macros.h: A small collection of macros
4687 for building C callbacks.
4689 * src/frontends/xforms/Makefile.am: Added above file.
4691 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
4692 scheme again. This time it should work for JMarc. If this is
4693 successful I'll revise my conversion script to automate some of this.
4694 The static member functions in the class also have to be public for
4695 this scheme will work. If the scheme works (it's almost identical to
4696 the way BufferView::cursorToggleCB is handled so it should work) then
4697 FormCopyright and FormPrint will be ready for inclusion into the main
4698 trunk immediately after 1.1.5 is released -- provided we're prepared
4699 for complaints about lame compilers not handling XTL.
4701 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4703 2000-04-07 Allan Rae <rae@lyx.org>
4705 * config/lyxinclude.m4: A bit more tidying up (Angus)
4707 * src/LString.h: JMarc's <string> header fix
4709 * src/PrinterParams.h: Used string for most data to remove some
4710 ugly code in the Print dialog and avoid even uglier code when
4711 appending the ints to a string for output.
4713 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4714 and moved "default:" back to the end of switch statement. Cleaned
4715 up the printing so it uses the right function calls and so the
4716 "print to file" option actually puts the file in the right directory.
4718 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4720 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4721 and Ok+Apply button control into a separate method: input (Angus).
4722 (input) Cleaned it up and improved it to be very thorough now.
4723 (All CB) static_cast used instead of C style cast (Angus). This will
4724 probably change again once we've worked out how to keep gcc-2.8.1 happy
4725 with real C callbacks.
4726 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4727 ignore some of the bool settings and has random numbers instead. Needs
4728 some more investigation. Added other input length checks and checking
4729 of file and printer names.
4731 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4732 would link (Angus). Seems the old code doesn't compile with the pragma
4733 statement either. Separated callback entries from internal methods.
4735 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4737 2000-03-17 Allan Rae <rae@lyx.org>
4739 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4740 need it? Maybe it could go in Dialogs instead? I could make it a
4741 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4742 values to get the bool return value.
4743 (Dispatch): New overloaded method for xtl support.
4745 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4746 extern "C" callback instead of static member functions. Hopefully,
4747 JMarc will be able to compile this. I haven't changed
4748 forms/form_copyright.fd yet. Breaking one of my own rules already.
4750 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4751 because they aren't useful from the minibuffer. Maybe a LyXServer
4752 might want a help message though?
4754 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4756 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4757 xtl which needs both rtti and exceptions.
4759 * src/support/Makefile.am:
4760 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4762 * src/frontends/xforms/input_validators.[ch]: input filters and
4763 validators. These conrol what keys are valid in input boxes.
4764 Use them and write some more. Much better idea than waiting till
4765 after the user has pressed Ok to say that the input fields don't make
4768 * src/frontends/xforms/Makefile.am:
4769 * src/frontends/xforms/forms/form_print.fd:
4770 * src/frontends/xforms/forms/makefile:
4771 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4772 new scheme. Still have to make sure I haven't missed anything from
4773 the current implementation.
4775 * src/Makefile.am, src/PrinterParams.h: New data store.
4777 * other files: Added a couple of copyright notices.
4779 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4781 * src/insets/insetbib.h: move Holder struct in public space.
4783 * src/frontends/include/DialogBase.h: use SigC:: only when
4784 SIGC_CXX_NAMESPACES is defined.
4785 * src/frontends/include/Dialogs.h: ditto.
4787 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4789 * src/frontends/xforms/FormCopyright.[Ch]: do not
4790 mention SigC:: explicitely.
4792 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4794 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4795 deals with testing KDE in main configure.in
4796 * configure.in: ditto.
4798 2000-02-22 Allan Rae <rae@lyx.org>
4800 * Lots of files: Merged from HEAD
4802 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4803 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4805 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4807 * sigc++/: new minidist.
4809 2000-02-14 Allan Rae <rae@lyx.org>
4811 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4813 2000-02-08 Juergen Vigna <jug@sad.it>
4815 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4816 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4818 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4819 for this port and so it is much easier for other people to port
4820 dialogs in a common development environment.
4822 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4823 the QT/KDE implementation.
4825 * src/frontends/kde/Dialogs.C:
4826 * src/frontends/kde/FormCopyright.C:
4827 * src/frontends/kde/FormCopyright.h:
4828 * src/frontends/kde/Makefile.am:
4829 * src/frontends/kde/formcopyrightdialog.C:
4830 * src/frontends/kde/formcopyrightdialog.h:
4831 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4832 for the kde support of the Copyright-Dialog.
4834 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4835 subdir-substitution instead of hardcoded 'xforms' as we now have also
4838 * src/frontends/include/DialogBase.h (Object): just commented the
4839 label after #endif (nasty warning and I don't like warnings ;)
4841 * src/main.C (main): added KApplication initialization if using
4844 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4845 For now only the KDE event-loop is added if frontend==kde.
4847 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4849 * configure.in: added support for the --with-frontend[=value] option
4851 * autogen.sh: added kde.m4 file to list of config-files
4853 * acconfig.h: added define for KDEGUI-support
4855 * config/kde.m4: added configuration functions for KDE-port
4857 * config/lyxinclude.m4: added --with-frontend[=value] option with
4858 support for xforms and KDE.
4860 2000-02-08 Allan Rae <rae@lyx.org>
4862 * all Makefile.am: Fixed up so the make targets dist, distclean,
4863 install and uninstall all work even if builddir != srcdir. Still
4864 have a new sigc++ minidist update to come.
4866 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4868 2000-02-01 Allan Rae <rae@lyx.org>
4870 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4871 Many mods to get builddir != srcdir working.
4873 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4874 for building on NT and so we can do the builddir != srcdir stuff.
4876 2000-01-30 Allan Rae <rae@lyx.org>
4878 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4879 This will stay in "rae" branch. We probably don't really need it in
4880 the main trunk as anyone who wants to help programming it should get
4881 a full library installed also. So they can check both included and
4882 system supplied library compilation.
4884 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4885 Added a 'mini' distribution of libsigc++. If you feel the urge to
4886 change something in these directories - Resist it. If you can't
4887 resist the urge then you should modify the following script and rebuild
4888 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4889 all happen. Still uses a hacked version of libsigc++'s configure.in.
4890 I'm quite happy with the results. I'm not sure the extra work to turn
4891 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4892 worth the trouble and would probably lead to extra maintenance
4894 I haven't tested the following important make targets: install, dist.
4895 Not ready for prime time but very close. Maybe 1.1.5.
4897 * development/tools/makeLyXsigc.sh: A shell script to automatically
4898 generate our mini-dist of libsigc++. It can only be used with a CVS
4899 checkout of libsigc++ not a tarball distribution. It's well commented.
4900 This will end up as part of the libsigc++ distribution so other apps
4901 can easily have an included mini-dist. If someone makes mods to the
4902 sigc++ subpackage without modifying this script to generate those
4903 changes I'll be very upset!
4905 * src/frontends/: Started the gui/system indep structure.
4907 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4908 to access the gui-indep dialogs are in this class. Much improved
4909 design compared to previous revision. Lars, please refrain from
4910 moving this header into src/ like you did with Popups.h last time.
4912 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4914 * src/frontends/xforms/: Started the gui-indep system with a single
4915 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4918 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4919 Here you'll find a very useful makefile and automated fdfix.sh that
4920 makes updating dailogs a no-brainer -- provided you follow the rules
4921 set out in the README. I'm thinking about adding another script to
4922 automatically generate skeleton code for a new dialog given just the
4925 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4926 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4927 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4929 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4931 * src/support/LSubstring.C (operator): simplify
4933 * src/lyxtext.h: removed bparams, use buffer_->params instead
4935 * src/lyxrow.h: make Row a real class, move all variables to
4936 private and use accessors.
4938 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4940 (isRightToLeftPar): ditto
4941 (ChangeLanguage): ditto
4942 (isMultiLingual): ditto
4945 (SimpleTeXOnePar): ditto
4946 (TeXEnvironment): ditto
4947 (GetEndLabel): ditto
4949 (SetOnlyLayout): ditto
4950 (BreakParagraph): ditto
4951 (BreakParagraphConservative): ditto
4952 (GetFontSettings): ditto
4954 (CopyIntoMinibuffer): ditto
4955 (CutIntoMinibuffer): ditto
4956 (PasteParagraph): ditto
4957 (SetPExtraType): ditto
4958 (UnsetPExtraType): ditto
4959 (DocBookContTableRows): ditto
4960 (SimpleDocBookOneTablePar): ditto
4962 (TeXFootnote): ditto
4963 (SimpleTeXOneTablePar): ditto
4964 (TeXContTableRows): ditto
4965 (SimpleTeXSpecialChars): ditto
4968 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4969 to private and use accessors.
4971 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4972 this, we did not use it anymore and has not been for ages. Just a
4973 waste of cpu cycles.
4975 * src/language.h: make Language a real class, move all variables
4976 to private and use accessors.
4978 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4979 (create_view): remove
4980 (update): some changes for new timer
4981 (cursorToggle): use new timer
4982 (beforeChange): change for new timer
4984 * src/BufferView.h (cursorToggleCB): removed last paramter because
4987 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4988 (cursorToggleCB): change because of new timer code
4990 * lib/CREDITS: updated own mailaddress
4992 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4994 * src/support/filetools.C (PutEnv): fix the code in case neither
4995 putenv() nor setenv() have been found.
4997 * INSTALL: mention the install-strip Makefile target.
4999 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5000 read-only documents.
5002 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5004 * lib/reLyX/configure.in (VERSION): avoid using a previously
5005 generated reLyX wrapper to find out $prefix.
5007 * lib/examples/eu_adibide_lyx-atua.lyx:
5008 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5009 translation of the Tutorial (Dooteo)
5011 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5013 * forms/cite.fd: new citation dialog
5015 * src/insetcite.[Ch]: the new citation dialog is moved into
5018 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5021 * src/insets/insetcommand.h: data members made private.
5023 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5025 * LyX 1.1.5 released
5027 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5029 * src/version.h (LYX_RELEASE): to 1.1.5
5031 * src/spellchecker.C (RunSpellChecker): return false if the
5032 spellchecker dies upon creation.
5034 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5036 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5037 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5041 * lib/CREDITS: update entry for Martin Vermeer.
5043 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5045 * src/text.C (draw): Draw foreign language bars at the bottom of
5046 the row instead of at the baseline.
5048 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5050 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5052 * lib/bind/de_menus.bind: updated
5054 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5056 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5058 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5060 * src/menus.C (Limit_string_length): New function
5061 (ShowTocMenu): Limit the number of items/length of items in the
5064 * src/paragraph.C (String): Correct result for a paragraph inside
5067 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5069 * src/bufferlist.C (close): test of buf->getuser() == NULL
5071 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5073 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5074 Do not call to SetCursor when the paragraph is a closed footnote!
5076 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5078 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5081 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5083 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5086 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5087 reference popup, that activates the reference-back action
5089 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5091 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5092 the menus. Also fixed a bug.
5094 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5095 the math panels when switching buffers (unless new buffer is readonly).
5097 * src/BufferView.C (NoSavedPositions)
5098 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5100 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5102 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5103 less of dvi dirty or not.
5105 * src/trans_mgr.[Ch] (insert): change first parameter to string
5108 * src/chset.[Ch] (encodeString): add const to first parameter
5110 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5112 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5116 * src/LaTeX.C (deplog): better searching for dependency files in
5117 the latex log. Uses now regexps.
5119 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5120 instead of the box hack or \hfill.
5122 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5124 * src/lyxfunc.C (doImportHelper): do not create the file before
5125 doing the actual import.
5126 (doImportASCIIasLines): create a new file before doing the insert.
5127 (doImportASCIIasParagraphs): ditto.
5129 * lib/lyxrc.example: remove mention of non-existing commands
5131 * lyx.man: remove mention of color-related switches.
5133 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5135 * src/lyx_gui.C: remove all the color-related ressources, which
5136 are not used anymore.
5138 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5141 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5143 * src/lyxrc.C (read): Add a missing break in the switch
5145 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5147 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5149 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5152 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5154 * src/text.C (draw): draw bars under foreign language words.
5156 * src/LColor.[Ch]: add LColor::language
5158 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5160 * src/lyxcursor.h (boundary): New member variable
5162 * src/text.C (IsBoundary): New methods
5164 * src/text.C: Use the above for currect cursor movement when there
5165 is both RTL & LTR text.
5167 * src/text2.C: ditto
5169 * src/bufferview_funcs.C (ToggleAndShow): ditto
5171 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5173 * src/text.C (DeleteLineForward): set selection to true to avoid
5174 that DeleteEmptyParagraphMechanism does some magic. This is how it
5175 is done in all other functions, and seems reasonable.
5176 (DeleteWordForward): do not jump over non-word stuff, since
5177 CursorRightOneWord() already does it.
5179 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5180 DeleteWordBackward, since they seem safe to me (since selection is
5181 set to "true") DeleteEmptyParagraphMechanism does nothing.
5183 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5185 * src/lyx_main.C (easyParse): simplify the code by factoring the
5186 part that removes parameters from the command line.
5187 (LyX): check wether wrong command line options have been given.
5189 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5191 * src/lyx_main.C : add support for specifying user LyX
5192 directory via command line option -userdir.
5194 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5196 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5197 the number of items per popup.
5198 (Add_to_refs_menu): Ditto.
5200 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5202 * src/lyxparagraph.h: renamed ClearParagraph() to
5203 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5204 textclass as parameter, and do nothing if free_spacing is
5205 true. This fixes part of the line-delete-forward problems.
5207 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5208 (pasteSelection): ditto.
5209 (SwitchLayoutsBetweenClasses): more translatable strings.
5211 * src/text2.C (CutSelection): use StripLeadingSpaces.
5212 (PasteSelection): ditto.
5213 (DeleteEmptyParagraphMechanism): ditto.
5215 2000-05-26 Juergen Vigna <jug@sad.it>
5217 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5218 is not needed in tabular insets.
5220 * src/insets/insettabular.C (TabularFeatures): added missing features.
5222 * src/tabular.C (DeleteColumn):
5224 (AppendRow): implemented this functions
5225 (cellsturct::operator=): clone the inset too;
5227 2000-05-23 Juergen Vigna <jug@sad.it>
5229 * src/insets/insettabular.C (LocalDispatch): better selection support
5230 when having multicolumn-cells.
5232 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5234 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5236 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5238 * src/ColorHandler.C (getGCForeground): put more test into _()
5240 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5243 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5246 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5248 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5249 there are no labels, or when buffer is readonly.
5251 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5252 there are no labels, buffer is SGML, or when buffer is readonly.
5254 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5256 * src/LColor.C (LColor): change a couple of grey40 to grey60
5257 (LColor): rewore initalization to make compiles go some magnitude
5259 (getGUIName): don't use gettext until we need the string.
5261 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5263 * src/Bullet.[Ch]: Fixed a small bug.
5265 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5267 * src/paragraph.C (String): Several fixes/improvements
5269 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5271 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5273 * src/paragraph.C (String): give more correct output.
5275 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5277 * src/lyxfont.C (stateText) Do not output the language if it is
5278 eqaul to the language of the document.
5280 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5281 between two paragraphs with the same language.
5283 * src/paragraph.C (getParLanguage) Return a correct answer for an
5284 empty dummy paragraph.
5286 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5289 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5292 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5293 the menus/popup, if requested fonts are unavailable.
5295 2000-05-22 Juergen Vigna <jug@sad.it>
5297 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5298 movement support (Up/Down/Tab/Shift-Tab).
5299 (LocalDispatch): added also preliminari cursor-selection.
5301 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5303 * src/paragraph.C (PasteParagraph): Hopefully now right!
5305 2000-05-22 Garst R. Reese <reese@isn.net>
5307 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5308 of list, change all references to Environment to Command
5309 * tex/hollywood.cls : rewrite environments as commands, add
5310 \uppercase to interiorshot and exteriorshot to force uppecase.
5311 * tex/broadway.cls : rewrite environments as commands. Tweak
5314 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5316 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5317 size of items: use a constant intead of the hardcoded 40, and more
5318 importantly do not remove the %m and %x tags added at the end.
5319 (Add_to_refs_menu): use vector::size_type instead of
5320 unsigned int as basic types for the variables. _Please_ do not
5321 assume that size_t is equal to unsigned int. On an alpha, this is
5322 unsigned long, which is _not_ the same.
5324 * src/language.C (initL): remove language "hungarian", since it
5325 seems that "magyar" is better.
5327 2000-05-22 Juergen Vigna <jug@sad.it>
5329 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
5331 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5334 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5335 next was deleted but not set to 0.
5337 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5339 * src/language.C (initL): change the initialization of languages
5340 so that compiles goes _fast_.
5342 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5345 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5347 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5351 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5353 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5355 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5359 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5362 * src/insets/insetlo*.[Ch]: Made editable
5364 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5366 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5367 the current selection.
5369 * src/BufferView_pimpl.C (stuffClipboard): new method
5371 * src/BufferView.C (stuffClipboard): new method
5373 * src/paragraph.C (String): new method
5375 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5376 LColor::ignore when lyxname is not found.
5378 * src/BufferView.C (pasteSelection): new method
5380 * src/BufferView_pimpl.C (pasteSelection): new method
5382 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5384 * src/WorkArea.C (request_clipboard_cb): new static function
5385 (getClipboard): new method
5386 (putClipboard): new method
5388 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5390 * LyX 1.1.5pre2 released
5392 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5394 * src/vspace.C (operator=): removed
5395 (operator=): removed
5397 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5399 * src/layout.C (NumberOfClass): manually set the type in make_pair
5400 (NumberOfLayout): ditto
5402 * src/language.C: use the Language constructor for ignore_lang
5404 * src/language.h: add constructors to struct Language
5406 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5408 * src/text2.C (SetCursorIntern): comment out #warning
5410 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5412 * src/mathed/math_iter.h: initialize sx and sw to 0
5414 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5416 * forms/lyx.fd: Redesign of form_ref
5418 * src/LaTeXFeatures.[Ch]
5422 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5425 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5426 and Buffer::inset_iterator.
5428 * src/menus.C: Added new menus: TOC and Refs.
5430 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5432 * src/buffer.C (getTocList): New method.
5434 * src/BufferView2.C (ChangeRefs): New method.
5436 * src/buffer.C (getLabelList): New method. It replaces the old
5437 getReferenceList. The return type is vector<string> instead of
5440 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5441 the old getLabel() and GetNumberOfLabels() methods.
5442 * src/insets/insetlabel.C (getLabelList): ditto
5443 * src/mathed/formula.C (getLabelList): ditto
5445 * src/paragraph.C (String): New method.
5447 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5448 Uses the new getTocList() method.
5449 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5450 which automatically updates the contents of the browser.
5451 (RefUpdateCB): Use the new getLabelList method.
5453 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5455 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5457 * src/spellchecker.C: Added using std::reverse;
5459 2000-05-19 Juergen Vigna <jug@sad.it>
5461 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5463 * src/insets/insettext.C (computeTextRows): small fix for display of
5464 1 character after a newline.
5466 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5469 2000-05-18 Juergen Vigna <jug@sad.it>
5471 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5472 when changing width of column.
5474 * src/tabular.C (set_row_column_number_info): setting of
5475 autobreak rows if necessary.
5477 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5479 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5481 * src/vc-backend.*: renamed stat() to status() and vcstat to
5482 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5483 compilation broke. The new name seems more relevant, anyway.
5485 2000-05-17 Juergen Vigna <jug@sad.it>
5487 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5488 which was wrong if the removing caused removing of rows!
5490 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5491 (pushToken): new function.
5493 * src/text2.C (CutSelection): fix problem discovered with purify
5495 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5497 * src/debug.C (showTags): enlarge the first column, now that we
5498 have 6-digits debug codes.
5500 * lib/layouts/hollywood.layout:
5501 * lib/tex/hollywood.cls:
5502 * lib/tex/brodway.cls:
5503 * lib/layouts/brodway.layout: more commands and fewer
5504 environments. Preambles moved in the .cls files. Broadway now has
5505 more options on scene numbering and less whitespace (from Garst)
5507 * src/insets/insetbib.C (getKeys): make sure that we are in the
5508 document directory, in case the bib file is there.
5510 * src/insets/insetbib.C (Latex): revert bogus change.
5512 2000-05-16 Juergen Vigna <jug@sad.it>
5514 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5515 the TabularLayout on cursor move.
5517 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5519 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5522 (draw): fixed cursor position and drawing so that the cursor is
5523 visible when before the tabular-inset.
5525 * src/insets/insettext.C (init): drawLockedFrame was not initialized
5526 when creating from old insettext.
5528 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
5530 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5532 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
5533 * lib/tex/brodway.cls: ditto
5535 * lib/layouts/brodway.layout: change alignment of parenthical
5538 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5540 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
5541 versions 0.88 and 0.89 are supported.
5543 2000-05-15 Juergen Vigna <jug@sad.it>
5545 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5548 * src/insets/insettext.C (computeTextRows): redone completely this
5549 function in a much cleaner way, because of problems when having a
5551 (draw): added a frame border when the inset is locked.
5552 (SetDrawLockedFrame): this sets if we draw the border or not.
5553 (SetFrameColor): this sets the frame color (default=insetframe).
5555 * src/insets/lyxinset.h: added x() and y() functions which return
5556 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5557 function which is needed to see if we have a locking inset of some
5558 type in this inset (needed for now in insettabular).
5560 * src/vspace.C (inPixels): the same function also without a BufferView
5561 parameter as so it is easier to use it in some ocasions.
5563 * src/lyxfunc.C: changed all places where insertInset was used so
5564 that now if it couldn't be inserted it is deleted!
5566 * src/TabularLayout.C:
5567 * src/TableLayout.C: added support for new tabular-inset!
5569 * src/BufferView2.C (insertInset): this now returns a bool if the
5570 inset was really inserted!!!
5572 * src/tabular.C (GetLastCellInRow):
5573 (GetFirstCellInRow): new helper functions.
5574 (Latex): implemented for new tabular class.
5578 (TeXTopHLine): new Latex() helper functions.
5580 2000-05-12 Juergen Vigna <jug@sad.it>
5582 * src/mathed/formulamacro.C (Read):
5583 * src/mathed/formula.C (Read): read also the \end_inset here!
5585 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5587 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
5588 crush when saving formulae with unbalanced parenthesis.
5590 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
5592 * src/layout.C: Add new keyword "endlabelstring" to layout file
5594 * src/text.C (GetVisibleRow): Draw endlabel string.
5596 * lib/layouts/broadway.layout
5597 * lib/layouts/hollywood.layout: Added endlabel for the
5598 Parenthetical layout.
5600 * lib/layouts/heb-article.layout: Do not use slanted font shape
5601 for Theorem like environments.
5603 * src/buffer.C (makeLaTeXFile): Always add "american" to
5604 the UsedLanguages list if document language is RTL.
5606 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5608 * add addendum to README.OS2 and small patch (from SMiyata)
5610 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5612 * many files: correct the calls to ChangeExtension().
5614 * src/support/filetools.C (ChangeExtension): remove the no_path
5615 argument, which does not belong there. Use OnlyFileName() instead.
5617 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5618 files when LaTeXing a non-nice latex file.
5620 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5621 a chain of "if". Return false when deadkeys are not handled.
5623 * src/lyx_main.C (LyX): adapted the code for default bindings.
5625 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5626 bindings for basic functionality (except deadkeys).
5627 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5629 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5630 several methods: handle override_x_deadkeys.
5632 * src/lyxrc.h: remove the "bindings" map, which did not make much
5633 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5635 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5637 * src/lyxfont.C (stateText): use a saner method to determine
5638 whether the font is "default". Seems to fix the crash with DEC
5641 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5643 2000-05-08 Juergen Vigna <jug@sad.it>
5645 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5646 TabularLayoutMenu with mouse-button-3
5647 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
5649 * src/TabularLayout.C: added this file for having a Layout for
5652 2000-05-05 Juergen Vigna <jug@sad.it>
5654 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
5655 recalculating inset-widths.
5656 (TabularFeatures): activated this function so that I can change
5657 tabular-features via menu.
5659 * src/menus.C (ShowEditMenu): inserted support for insettabular so
5660 that I can test some functions with the Table menu.
5662 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5664 * src/lyxfont.C (stateText): guard against stupid c++libs.
5666 * src/tabular.C: add using std::vector
5667 some whitespace changes, + removed som autogenerated code.
5669 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
5671 2000-05-05 Juergen Vigna <jug@sad.it>
5673 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
5674 row, columns and cellstructures.
5676 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5678 * lib/lyxrc.example: remove obsolete entries.
5680 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
5681 reading of protected_separator for free_spacing.
5683 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5685 * src/text.C (draw): do not display an exclamation mark in the
5686 margin for margin notes. This is confusing, ugly and
5689 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
5690 AMS math' is checked.
5692 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
5693 name to see whether including the amsmath package is needed.
5695 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5697 * src/paragraph.C (validate): Compute UsedLanguages correctly
5698 (don't insert the american language if it doesn't appear in the
5701 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5702 The argument of \thanks{} command is considered moving argument
5704 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5707 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5709 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5710 for appendix/minipage/depth. The lines can be now both in the footnote
5711 frame, and outside the frame.
5713 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5716 2000-05-05 Juergen Vigna <jug@sad.it>
5718 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5719 neede only in tabular.[Ch].
5721 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5723 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5725 (Write): write '~' for PROTECTED_SEPARATOR
5727 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5729 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5732 * src/mathed/formula.C (drawStr): rename size to siz.
5734 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5735 possibly fix a bug by not changing the pflags = flags to piflags =
5738 2000-05-05 Juergen Vigna <jug@sad.it>
5740 * src/insets/insetbib.C: moved using directive
5742 * src/ImportNoweb.C: small fix for being able to compile (missing
5745 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5747 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5748 to use clear, since we don't depend on this in the code. Add test
5751 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5753 * (various *.C files): add using std::foo directives to please dec
5756 * replace calls to string::clear() to string::erase() (Angus)
5758 * src/cheaders/cmath: modified to provide std::abs.
5760 2000-05-04 Juergen Vigna <jug@sad.it>
5762 * src/insets/insettext.C: Prepared all for inserting of multiple
5763 paragraphs. Still display stuff to do (alignment and other things),
5764 but I would like to use LyXText to do this when we cleaned out the
5765 table-support stuff.
5767 * src/insets/insettabular.C: Changed lot of stuff and added lots
5768 of functionality still a lot to do.
5770 * src/tabular.C: Various functions changed name and moved to be
5771 const functions. Added new Read and Write functions and changed
5772 lots of things so it works good with tabular-insets (also removed
5773 some stuff which is not needed anymore * hacks *).
5775 * src/lyxcursor.h: added operators == and != which just look if
5776 par and pos are (not) equal.
5778 * src/buffer.C (latexParagraphs): inserted this function to latex
5779 all paragraphs form par to endpar as then I can use this too for
5782 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5783 so that I can call this to from text insets with their own cursor.
5785 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5786 output off all paragraphs (because of the fix below)!
5788 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5789 the very last paragraph (this could be also the last paragraph of an
5792 * src/texrow.h: added rows() call which returns the count-variable.
5794 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5796 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5798 * lib/configure.m4: better autodetection of DocBook tools.
5800 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5802 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5804 * src/lyx_cb.C: add using std::reverse;
5806 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5809 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5810 selected files. Should fix repeated errors from generated files.
5812 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5814 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5816 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5817 the spellchecker popup.
5819 * lib/lyxrc.example: Removed the \number_inset section
5821 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5823 * src/insets/figinset.C (various): Use IsFileReadable() to make
5824 sure that the file actually exist. Relying on ghostscripts errors
5825 is a bad idea since they can lead to X server crashes.
5827 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5829 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5832 * lib/lyxrc.example: smallish typo in description of
5833 \view_dvi_paper_option
5835 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5838 * src/lyxfunc.C: doImportHelper to factor out common code of the
5839 various import methods. New functions doImportASCIIasLines,
5840 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5841 doImportLinuxDoc for the format specific parts.
5844 * buffer.C: Dispatch returns now a bool to indicate success
5847 * lyx_gui.C: Add getLyXView() for member access
5849 * lyx_main.C: Change logic for batch commands: First try
5850 Buffer::Dispatch (possibly without GUI), if that fails, use
5853 * lyx_main.C: Add support for --import command line switch.
5854 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5855 Available Formats: Everything accepted by 'buffer-import <format>'
5857 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5859 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5862 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5863 documents will be reformatted upon reentry.
5865 2000-04-27 Juergen Vigna <jug@sad.it>
5867 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5868 correctly only last pos this was a bug.
5870 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5872 * release of lyx-1.1.5pre1
5874 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5876 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5878 * src/menus.C: revert the change of naming (Figure->Graphic...)
5879 from 2000-04-11. It was incomplete and bad.
5881 * src/LColor.[Ch]: add LColor::depthbar.
5882 * src/text.C (GetVisibleRow): use it.
5884 * README: update the languages list.
5886 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5888 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5891 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5893 * README: remove sections that were just wrong.
5895 * src/text2.C (GetRowNearY): remove currentrow code
5897 * src/text.C (GetRow): remove currentrow code
5899 * src/screen.C (Update): rewritten a bit.
5900 (SmallUpdate): removed func
5902 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5904 (FullRebreak): return bool
5905 (currentrow): remove var
5906 (currentrow_y): ditto
5908 * src/lyxscreen.h (Draw): change arg to unsigned long
5909 (FitCursor): return bool
5910 (FitManualCursor): ditto
5911 (Smallpdate): remove func
5912 (first): change to unsigned long
5913 (DrawOneRow): change second arg to long (from long &)
5914 (screen_refresh_y): remove var
5915 (scree_refresh_row): ditto
5917 * src/lyxrow.h: change baseline to usigned int from unsigned
5918 short, this brings some implicit/unsigned issues out in the open.
5920 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5922 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5923 instead of smallUpdate.
5925 * src/lyxcursor.h: change y to unsigned long
5927 * src/buffer.h: don't call updateScrollbar after fitcursor
5929 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5930 where they are used. Removed "\\direction", this was not present
5931 in 1.1.4 and is already obsolete. Commented out some code that I
5932 believe to never be called.
5933 (runLiterate): don't call updateScrollbar after fitCursor
5935 (buildProgram): ditto
5938 * src/WorkArea.h (workWidth): change return val to unsigned
5941 (redraw): remove the button redraws
5942 (setScrollbarValue): change for scrollbar
5943 (getScrollbarValue): change for scrollbar
5944 (getScrollbarBounds): change for scrollbar
5946 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5947 (C_WorkArea_down_cb): removed func
5948 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5949 (resize): change for scrollbar
5950 (setScrollbar): ditto
5951 (setScrollbarBounds): ditto
5952 (setScrollbarIncrements): ditto
5953 (up_cb): removed func
5954 (down_cb): removed func
5955 (scroll_cb): change for scrollbar
5956 (work_area_handler): ditto
5958 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5959 when FitCursor did something.
5960 (updateScrollbar): some unsigned changes
5961 (downCB): removed func
5962 (scrollUpOnePage): removed func
5963 (scrollDownOnePage): remvoed func
5964 (workAreaMotionNotify): don't call screen->FitCursor but use
5965 fitCursor instead. and bool return val
5966 (workAreaButtonPress): ditto
5967 (workAreaButtonRelease): some unsigned changes
5968 (checkInsetHit): ditto
5969 (workAreaExpose): ditto
5970 (update): parts rewritten, comments about the signed char arg added
5971 (smallUpdate): removed func
5972 (cursorPrevious): call needed updateScrollbar
5975 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5978 * src/BufferView.[Ch] (upCB): removed func
5979 (downCB): removed func
5980 (smallUpdate): removed func
5982 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5984 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5985 currentrow, currentrow_y optimization. This did not help a lot and
5986 if we want to do this kind of optimization we should rather use
5987 cursor.row instead of the currentrow.
5989 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5990 buffer spacing and klyx spacing support.
5992 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5994 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5997 2000-04-26 Juergen Vigna <jug@sad.it>
5999 * src/insets/figinset.C: fixes to Lars sstream changes!
6001 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6003 * A lot of files: Added Ascii(ostream &) methods to all inset
6004 classes. Used when exporting to ASCII.
6006 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6007 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6010 * src/text2.C (ToggleFree): Disabled implicit word selection when
6011 there is a change in the language
6013 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6014 no output was generated for end-of-sentence inset.
6016 * src/insets/lyxinset.h
6019 * src/paragraph.C: Removed the insetnumber code
6021 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6023 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6025 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6026 no_babel and no_epsfig completely from the file.
6027 (parseSingleLyXformat2Token): add handling for per-paragraph
6028 spacing as written by klyx.
6030 * src/insets/figinset.C: applied patch by Andre. Made it work with
6033 2000-04-20 Juergen Vigna <jug@sad.it>
6035 * src/insets/insettext.C (cutSelection):
6036 (copySelection): Fixed with selection from right to left.
6037 (draw): now the rows are not recalculated at every draw.
6038 (computeTextRows): for now reset the inset-owner here (this is
6039 important for an undo or copy where the inset-owner is not set
6042 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6043 motion to the_locking_inset screen->first was forgotten, this was
6044 not important till we got multiline insets.
6046 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6048 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6049 code seems to be alright (it is code changed by Dekel, and the
6050 intent is indeed that all macros should be defined \protect'ed)
6052 * NEWS: a bit of reorganisation of the new user-visible features.
6054 2000-04-19 Juergen Vigna <jug@sad.it>
6056 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6057 position. Set the inset_owner of the used paragraph so that it knows
6058 that it is inside an inset. Fixed cursor handling with mouse and
6059 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6060 and cleanups to make TextInsets work better.
6062 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6063 Changed parameters of various functions and added LockInsetInInset().
6065 * src/insets/insettext.C:
6067 * src/insets/insetcollapsable.h:
6068 * src/insets/insetcollapsable.C:
6069 * src/insets/insetfoot.h:
6070 * src/insets/insetfoot.C:
6071 * src/insets/insetert.h:
6072 * src/insets/insetert.C: cleaned up the code so that it works now
6073 correctly with insettext.
6075 * src/insets/inset.C:
6076 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6077 that insets in insets are supported right.
6080 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6082 * src/paragraph.C: some small fixes
6084 * src/debug.h: inserted INSETS debug info
6086 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6087 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6089 * src/commandtags.h:
6090 * src/LyXAction.C: insert code for InsetTabular.
6092 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6093 not Button1MotionMask.
6094 (workAreaButtonRelease): send always a InsetButtonRelease event to
6096 (checkInsetHit): some setCursor fixes (always with insets).
6098 * src/BufferView2.C (lockInset): returns a bool now and extended for
6099 locking insets inside insets.
6100 (showLockedInsetCursor): it is important to have the cursor always
6101 before the locked inset.
6102 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6104 * src/BufferView.h: made lockInset return a bool.
6106 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6108 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6109 that is used also internally but can be called as public to have back
6110 a cursor pos which is not set internally.
6111 (SetCursorIntern): Changed to use above function.
6113 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6115 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6120 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6121 patches for things that should be in or should be changed.
6123 * src/* [insetfiles]: change "usigned char fragile" to bool
6124 fragile. There was only one point that could that be questioned
6125 and that is commented in formulamacro.C. Grep for "CHECK".
6127 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6128 (DeleteBuffer): take it out of CutAndPaste and make it static.
6130 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6132 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6133 output the spacing envir commands. Also the new commands used in
6134 the LaTeX output makes the result better.
6136 * src/Spacing.C (writeEnvirBegin): new method
6137 (writeEnvirEnd): new method
6139 2000-04-18 Juergen Vigna <jug@sad.it>
6141 * src/CutAndPaste.C: made textclass a static member of the class
6142 as otherwise it is not accesed right!!!
6144 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6146 * forms/layout_forms.fd
6147 * src/layout_forms.h
6148 * src/layout_forms.C (create_form_form_character)
6149 * src/lyx_cb.C (UserFreeFont)
6150 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6151 documents (in the layout->character popup).
6153 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6155 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6156 \spell_command was in fact not honored (from Kevin Atkinson).
6158 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6161 * src/lyx_gui.h: make lyxViews private (Angus)
6163 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6165 * src/mathed/math_write.C
6166 (MathMatrixInset::Write) Put \protect before \begin{array} and
6167 \end{array} if fragile
6168 (MathParInset::Write): Put \protect before \\ if fragile
6170 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6172 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6173 initialization if the LyXColorHandler must be done after the
6174 connections to the XServer has been established.
6176 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6177 get the background pixel from the lyxColorhandler so that the
6178 figures are rendered with the correct background color.
6179 (NextToken): removed functions.
6180 (GetPSSizes): use ifs >> string instead of NextToken.
6182 * src/Painter.[Ch]: the color cache moved out of this file.
6184 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6187 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6189 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6190 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6192 * src/BufferView.C (enterView): new func
6193 (leaveView): new func
6195 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6197 (leaveView): new func, undefines xterm cursor when approp.
6199 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6200 (AllowInput): delete the Workarea cursor handling from this func.
6202 * src/Painter.C (underline): draw a slimer underline in most cases.
6204 * src/lyx_main.C (error_handler): use extern "C"
6206 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6208 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6209 sent directly to me.
6211 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6212 to the list by Dekel.
6214 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6217 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6218 methods from lyx_cb.here.
6220 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6223 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6225 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6226 instead of using current_view directly.
6228 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6230 * src/LyXAction.C (init): add the paragraph-spacing command.
6232 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6234 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6236 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6237 different from the documents.
6239 * src/text.C (SetHeightOfRow): take paragraph spacing into
6240 account, paragraph spacing takes precedence over buffer spacing
6241 (GetVisibleRow): ditto
6243 * src/paragraph.C (writeFile): output the spacing parameter too.
6244 (validate): set the correct features if spacing is used in the
6246 (Clear): set spacing to default
6247 (MakeSameLayout): spacing too
6248 (HasSameLayout): spacing too
6249 (SetLayout): spacing too
6250 (TeXOnePar): output the spacing commands
6252 * src/lyxparagraph.h: added a spacing variable for use with
6253 per-paragraph spacing.
6255 * src/Spacing.h: add a Default spacing and a method to check if
6256 the current spacing is default. also added an operator==
6258 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6261 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6263 * src/lyxserver.C (callback): fix dispatch of functions
6265 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6266 printf() into lyxerr call.
6268 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6271 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6272 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6273 the "Float" from each of the subitems.
6274 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6276 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6277 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6278 documented the change so that the workaround can be nuked later.
6280 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6283 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6285 * src/buffer.C (getLatexName): ditto
6286 (setReadonly): ditto
6288 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6290 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6291 avoid some uses of current_view. Added also a bufferParams()
6292 method to get at this.
6294 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6296 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6298 * src/lyxparagraph.[Ch]: removed
6299 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6300 with operators used by lower_bound and
6301 upper_bound in InsetTable's
6302 Make struct InsetTable private again. Used matchpos.
6304 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6306 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6307 document, the language of existing text is changed (unless the
6308 document is multi-lingual)
6310 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6312 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6314 * A lot of files: A rewrite of the Right-to-Left support.
6316 2000-04-10 Juergen Vigna <jug@sad.it>
6318 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6319 misplaced cursor when inset in inset is locked.
6321 * src/insets/insettext.C (LocalDispatch): small fix so that a
6322 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6324 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6325 footnote font should be decreased in size twice when displaying.
6327 * src/insets/insettext.C (GetDrawFont): inserted this function as
6328 the drawing-font may differ from the real paragraph font.
6330 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
6331 insets (inset in inset!).
6333 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6334 function here because we don't want footnotes inside footnotes.
6336 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6338 (init): now set the inset_owner in paragraph.C
6339 (LocalDispatch): added some resetPos() in the right position
6342 (pasteSelection): changed to use the new CutAndPaste-Class.
6344 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6345 which tells if it is allowed to insert another inset inside this one.
6347 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6348 SwitchLayoutsBetweenClasses.
6350 * src/text2.C (InsertInset): checking of the new paragraph-function
6352 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6353 is not needed anymore here!
6356 (PasteSelection): redone (also with #ifdef) so that now this uses
6357 the CutAndPaste-Class.
6358 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6361 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6362 from/to text/insets.
6364 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6365 so that the paragraph knows if it is inside an (text)-inset.
6366 (InsertFromMinibuffer): changed return-value to bool as now it
6367 may happen that an inset is not inserted in the paragraph.
6368 (InsertInsetAllowed): this checks if it is allowed to insert an
6369 inset in this paragraph.
6371 (BreakParagraphConservative):
6372 (BreakParagraph) : small change for the above change of the return
6373 value of InsertFromMinibuffer.
6375 * src/lyxparagraph.h: added inset_owner and the functions to handle
6376 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6378 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6380 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6381 functions from BufferView to BufferView::Pimpl to ease maintence.
6383 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6384 correctly. Also use SetCursorIntern instead of SetCursor.
6386 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6389 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6391 * src/WorkArea.C (belowMouse): manually implement below mouse.
6393 * src/*: Add "explicit" on several constructors, I added probably
6394 some unneeded ones. A couple of changes to code because of this.
6396 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6397 implementation and private parts from the users of BufferView. Not
6400 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6401 implementation and private parts from the users of LyXLex. Not
6404 * src/BufferView_pimpl.[Ch]: new files
6406 * src/lyxlex_pimpl.[Ch]: new files
6408 * src/LyXView.[Ch]: some inline functions move out-of-line
6410 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6412 * src/lyxparagraph.h: make struct InsetTable public.
6414 * src/support/lyxstring.h: change lyxstring::difference_type to be
6415 ptrdiff_t. Add std:: modifiers to streams.
6417 * src/font.C: include the <cctype> header, for islower() and
6420 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6422 * src/font.[Ch]: new files. Contains the metric functions for
6423 fonts, takes a LyXFont as parameter. Better separation of concepts.
6425 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6426 changes because of this.
6428 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6430 * src/*: compile with -Winline and move functions that don't
6433 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6436 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6438 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6439 (various files changed because of this)
6441 * src/Painter.C (text): fixed the drawing of smallcaps.
6443 * src/lyxfont.[Ch] (drawText): removed unused member func.
6446 * src/*.C: added needed "using" statements and "std::" qualifiers.
6448 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6450 * src/*.h: removed all use of "using" from header files use
6451 qualifier std:: instead.
6453 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6455 * src/text.C (Backspace): some additional cleanups (we already
6456 know whether cursor.pos is 0 or not).
6458 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6459 automake does not provide one).
6461 * src/bmtable.h: replace C++ comments with C comments.
6463 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6465 * src/screen.C (ShowCursor): Change the shape of the cursor if
6466 the current language is not equal to the language of the document.
6467 (If the cursor change its shape unexpectedly, then you've found a bug)
6469 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6472 * src/insets/insetnumber.[Ch]: New files.
6474 * src/LyXAction.C (init)
6475 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6478 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6480 * src/lyxparagraph.h
6481 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6482 (the vector is kept sorted).
6484 * src/text.C (GetVisibleRow): Draw selection correctly when there
6485 is both LTR and RTL text.
6487 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6488 which is much faster.
6490 * src/text.C (GetVisibleRow and other): Do not draw the last space
6491 in a row if the direction of the last letter is not equal to the
6492 direction of the paragraph.
6494 * src/lyxfont.C (latexWriteStartChanges):
6495 Check that font language is not equal to basefont language.
6496 (latexWriteEndChanges): ditto
6498 * src/lyx_cb.C (StyleReset): Don't change the language while using
6499 the font-default command.
6501 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6502 empty paragraph before a footnote.
6504 * src/insets/insetcommand.C (draw): Increase x correctly.
6506 * src/screen.C (ShowCursor): Change cursor shape if
6507 current language != document language.
6509 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6511 2000-03-31 Juergen Vigna <jug@sad.it>
6513 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6514 (Clone): changed mode how the paragraph-data is copied to the
6515 new clone-paragraph.
6517 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6518 GetInset(pos) with no inset anymore there (in inset UNDO)
6520 * src/insets/insetcommand.C (draw): small fix as here x is
6521 incremented not as much as width() returns (2 before, 2 behind = 4)
6523 2000-03-30 Juergen Vigna <jug@sad.it>
6525 * src/insets/insettext.C (InsetText): small fix in initialize
6526 widthOffset (should not be done in the init() function)
6528 2000-03-29 Amir Karger <karger@lyx.org>
6530 * lib/examples/it_ItemizeBullets.lyx: translation by
6533 * Implemented \textasciitilde and fixed a tiny bug in reLyX
6535 2000-03-29 Juergen Vigna <jug@sad.it>
6537 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
6539 * src/insets/insetfoot.C (Clone): small change as for the below
6540 new init function in the text-inset
6542 * src/insets/insettext.C (init): new function as I've seen that
6543 clone did not copy the Paragraph-Data!
6544 (LocalDispatch): Added code so that now we have some sort of Undo
6545 functionality (well actually we HAVE Undo ;)
6547 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6549 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6551 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6554 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6556 * src/main.C: added a runtime check that verifies that the xforms
6557 header used when building LyX and the library used when running
6558 LyX match. Exit with a message if they don't match. This is a
6559 version number check only.
6561 * src/buffer.C (save): Don't allocate memory on the heap for
6562 struct utimbuf times.
6564 * *: some using changes, use iosfwd instead of the real headers.
6566 * src/lyxfont.C use char const * instead of string for the static
6567 strings. Rewrite some functions to use sstream.
6569 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6571 * src/text.C (Backspace): hopefully fix the dreaded backaspace
6574 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6576 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
6577 of Geodesy (from Martin Vermeer)
6579 * lib/layouts/svjour.inc: include file for the Springer svjour
6580 class. It can be used to support journals other than JoG.
6582 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
6583 Miskiewicz <misiek@pld.org.pl>)
6584 * lib/reLyX/Makefile.am: ditto.
6586 2000-03-27 Juergen Vigna <jug@sad.it>
6588 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
6589 also some modifications with operations on selected text.
6591 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
6592 problems with clicking on insets (last famous words ;)
6594 * src/insets/insetcommand.C (draw):
6595 (width): Changed to have a bit of space before and after the inset so
6596 that the blinking cursor can be seen (otherwise it was hidden)
6598 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6600 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6601 would not be added to the link list when an installed gettext (not
6602 part of libc) is found.
6604 2000-03-24 Juergen Vigna <jug@sad.it>
6606 * src/insets/insetcollapsable.C (Edit):
6607 * src/mathed/formula.C (InsetButtonRelease):
6608 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6611 * src/BufferView.C (workAreaButtonPress):
6612 (workAreaButtonRelease):
6613 (checkInsetHit): Finally fixed the clicking on insets be handled
6616 * src/insets/insetert.C (Edit): inserted this call so that ERT
6617 insets work always with LaTeX-font
6619 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6621 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6622 caused lyx to startup with no GUI in place, causing in a crash
6623 upon startup when called with arguments.
6625 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6627 * src/FontLoader.C: better initialization of dummyXFontStruct.
6629 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6631 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6632 for linuxdoc and docbook import and export format options.
6634 * lib/lyxrc.example Example of default values for the previous flags.
6636 * src/lyx_cb.C Use those flags instead of the hardwired values for
6637 linuxdoc and docbook export.
6639 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6642 * src/menus.C Added menus entries for the new import/exports formats.
6644 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6646 * src/lyxrc.*: Added support for running without Gui
6649 * src/FontLoader.C: sensible defaults if no fonts are needed
6651 * src/lyx_cb.C: New function ShowMessage (writes either to the
6652 minibuffer or cout in case of no gui
6653 New function AskOverwrite for common stuff
6654 Consequently various changes to call these functions
6656 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
6657 wild guess at sensible screen resolution when having no gui
6659 * src/lyxfont.C: no gui, no fonts... set some defaults
6661 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6663 * src/LColor.C: made the command inset background a bit lighter.
6665 2000-03-20 Hartmut Goebel <goebel@noris.net>
6667 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
6668 stdstruct.inc. Koma-Script added some title elements which
6669 otherwise have been listed below "bibliography". This split allows
6670 adding title elements to where they belong.
6672 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
6673 define the additional tilte elements and then include
6676 * many other layout files: changed to include stdtitle.inc just
6677 before stdstruct.inc.
6679 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
6681 * src/buffer.C: (save) Added the option to store all backup files
6682 in a single directory
6684 * src/lyxrc.[Ch]: Added variable \backupdir_path
6686 * lib/lyxrc.example: Added descriptions of recently added variables
6688 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
6689 bibtex inset, not closing the bibtex popup when deleting the inset)
6691 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6693 * src/lyx_cb.C: add a couple using directives.
6695 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6696 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6697 import based on the filename.
6699 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6700 file would be imported at start, if the filename where of a sgml file.
6702 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6704 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6706 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6707 * src/lyxfont.h Replaced the member variable bits.direction by the
6708 member variable lang. Made many changes in other files.
6709 This allows having a multi-lingual document
6711 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6712 that change the current language to <l>.
6713 Removed the command "font-rtl"
6715 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6716 format for Hebrew documents)
6718 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6719 When auto_mathmode is "true", pressing a digit key in normal mode
6720 will cause entering into mathmode.
6721 If auto_mathmode is "rtl" then this behavior will be active only
6722 when writing right-to-left text.
6724 * src/text2.C (InsertStringA) The string is inserted using the
6727 * src/paragraph.C (GetEndLabel) Gives a correct result for
6728 footnote paragraphs.
6730 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6732 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6734 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6735 front of PasteParagraph. Never insert a ' '. This should at least
6736 fix some cause for the segfaults that we have been experiencing,
6737 it also fixes backspace behaviour slightly. (Phu!)
6739 * src/support/lstrings.C (compare_no_case): some change to make it
6740 compile with gcc 2.95.2 and stdlibc++-v3
6742 * src/text2.C (MeltFootnoteEnvironment): change type o
6743 first_footnote_par_is_not_empty to bool.
6745 * src/lyxparagraph.h: make text private. Changes in other files
6747 (fitToSize): new function
6748 (setContentsFromPar): new function
6749 (clearContents): new function
6750 (SetChar): new function
6752 * src/paragraph.C (readSimpleWholeFile): deleted.
6754 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6755 the file, just use a simple string instead. Also read the file in
6756 a more maintainable manner.
6758 * src/text2.C (InsertStringA): deleted.
6759 (InsertStringB): deleted.
6761 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6763 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6764 RedoParagraphs from the doublespace handling part, just set status
6765 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6766 done, but perhaps not like this.)
6768 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6770 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6771 character when inserting an inset.
6773 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6775 * src/bufferparams.C (readLanguage): now takes "default" into
6778 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6779 also initialize the toplevel_keymap with the default bindings from
6782 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6784 * all files using lyxrc: have lyxrc as a real variable and not a
6785 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6788 * src/lyxrc.C: remove double call to defaultKeyBindings
6790 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6791 toolbar defauls using lyxlex. Remove enums, structs, functions
6794 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6795 toolbar defaults. Also store default keybindings in a map.
6797 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6798 storing the toolbar defaults without any xforms dependencies.
6800 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6801 applied. Changed to use iterators.
6803 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6805 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6806 systems that don't have LINGUAS set to begin with.
6808 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6810 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6811 the list by Dekel Tsur.
6813 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6815 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6816 * src/insets/form_graphics.C: ditto.
6818 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6820 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6822 * src/bufferparams.C (readLanguage): use the new language map
6824 * src/intl.C (InitKeyMapper): use the new language map
6826 * src/lyx_gui.C (create_forms): use the new language map
6828 * src/language.[Ch]: New files. Used for holding the information
6829 about each language. Now! Use this new language map enhance it and
6830 make it really usable for our needs.
6832 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6834 * screen.C (ShowCursor): Removed duplicate code.
6835 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6836 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6838 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6841 * src/text.C Added TransformChar method. Used for rendering Arabic
6842 text correctly (change the glyphs of the letter according to the
6843 position in the word)
6848 * src/lyxrc.C Added lyxrc command {language_command_begin,
6849 language_command_end,language_command_ltr,language_command_rtl,
6850 language_package} which allows the use of either arabtex or Omega
6853 * src/lyx_gui.C (init)
6855 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6856 to use encoding for menu fonts which is different than the encoding
6859 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6860 do not load the babel package.
6861 To write an English document with Hebrew/Arabic, change the document
6862 language to "english".
6864 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6865 (alphaCounter): changed to return char
6866 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6868 * lib/lyxrc.example Added examples for Hebrew/Arabic
6871 * src/layout.C Added layout command endlabeltype
6873 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6875 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6877 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6879 * src/mathed/math_delim.C (search_deco): return a
6880 math_deco_struct* instead of index.
6882 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6884 * All files with a USE_OSTREAM_ONLY within: removed all code that
6885 was unused when USE_OSTREAM_ONLY is defined.
6887 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6888 of any less. Removed header and using.
6890 * src/text.C (GetVisibleRow): draw the string "Page Break
6891 (top/bottom)" on screen when drawing a pagebreak line.
6893 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6895 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6897 * src/mathed/math_macro.C (draw): do some cast magic.
6900 * src/mathed/math_defs.h: change byte* argument to byte const*.
6902 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6904 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6905 know it is right to return InsetFoot* too, but cxx does not like
6908 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6910 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6912 * src/mathed/math_delim.C: change == to proper assignment.
6914 2000-03-09 Juergen Vigna <jug@sad.it>
6916 * src/insets/insettext.C (setPos): fixed various cursor positioning
6917 problems (via mouse and cursor-keys)
6918 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6919 inset (still a small display problem but it works ;)
6921 * src/insets/insetcollapsable.C (draw): added button_top_y and
6922 button_bottom_y to have correct values for clicking on the inset.
6924 * src/support/lyxalgo.h: commented out 'using std::less'
6926 2000-03-08 Juergen Vigna <jug@sad.it>
6928 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6929 Button-Release event closes as it is alos the Release-Event
6932 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6934 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6936 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6937 can add multiple spaces in Scrap (literate programming) styles...
6938 which, by the way, is how I got hooked on LyX to begin with.
6940 * src/mathed/formula.C (Write): Added dummy variable to an
6941 inset::Latex() call.
6942 (Latex): Add free_spacing boolean to inset::Latex()
6944 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6946 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6947 virtual function to include the free_spacing boolean from
6948 the containing paragraph's style.
6950 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6951 Added free_spacing boolean arg to match inset.h
6953 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6954 Added free_spacing boolean arg to match inset.h
6956 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6957 Added free_spacing boolean and made sure that if in a free_spacing
6958 paragraph, that we output normal space if there is a protected space.
6960 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6961 Added free_spacing boolean arg to match inset.h
6963 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6964 Added free_spacing boolean arg to match inset.h
6966 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6967 Added free_spacing boolean arg to match inset.h
6969 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6970 Added free_spacing boolean arg to match inset.h
6972 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6973 Added free_spacing boolean arg to match inset.h
6975 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6976 free_spacing boolean arg to match inset.h
6978 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6979 Added free_spacing boolean arg to match inset.h
6981 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6982 Added free_spacing boolean arg to match inset.h
6984 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6985 Added free_spacing boolean arg to match inset.h
6987 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6988 Added free_spacing boolean arg to match inset.h
6990 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6991 Added free_spacing boolean arg to match inset.h
6993 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6994 free_spacing boolean arg to match inset.h
6996 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6997 free_spacing boolean arg to match inset.h
6999 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7000 ignore free_spacing paragraphs. The user's spaces are left
7003 * src/text.C (InsertChar): Fixed the free_spacing layout
7004 attribute behavior. Now, if free_spacing is set, you can
7005 add multiple spaces in a paragraph with impunity (and they
7006 get output verbatim).
7007 (SelectSelectedWord): Added dummy argument to inset::Latex()
7010 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7013 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7014 paragraph layouts now only input a simple space instead.
7015 Special character insets don't make any sense in free-spacing
7018 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7019 hard-spaces in the *input* file to simple spaces if the layout
7020 is free-spacing. This converts old files which had to have
7021 hard-spaces in free-spacing layouts where a simple space was
7023 (writeFileAscii): Added free_spacing check to pass to the newly
7024 reworked inset::Latex(...) methods. The inset::Latex() code
7025 ensures that hard-spaces in free-spacing paragraphs get output
7026 as spaces (rather than "~").
7028 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7030 * src/mathed/math_delim.C (draw): draw the empty placeholder
7031 delims with a onoffdash line.
7032 (struct math_deco_compare): struct that holds the "functors" used
7033 for the sort and the binary search in math_deco_table.
7034 (class init_deco_table): class used for initial sort of the
7036 (search_deco): use lower_bound to do a binary search in the
7039 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7041 * src/lyxrc.C: a small secret thingie...
7043 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7044 and to not flush the stream as often as it used to.
7046 * src/support/lyxalgo.h: new file
7047 (sorted): template function used for checking if a sequence is
7048 sorted or not. Two versions with and without user supplied
7049 compare. Uses same compare as std::sort.
7051 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7052 it and give warning on lyxerr.
7054 (struct compare_tags): struct with function operators used for
7055 checking if sorted, sorting and lower_bound.
7056 (search_kw): use lower_bound instead of manually implemented
7059 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7061 * src/insets/insetcollapsable.h: fix Clone() declaration.
7062 * src/insets/insetfoot.h: ditto.
7064 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7066 2000-03-08 Juergen Vigna <jug@sad.it>
7068 * src/insets/lyxinset.h: added owner call which tells us if
7069 this inset is inside another inset. Changed also the return-type
7070 of Editable to an enum so it tells clearer what the return-value is.
7072 * src/insets/insettext.C (computeTextRows): fixed computing of
7073 textinsets which split automatically on more rows.
7075 * src/insets/insetert.[Ch]: changed this to be of BaseType
7078 * src/insets/insetfoot.[Ch]: added footnote inset
7080 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7081 collapsable insets (like footnote, ert, ...)
7083 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7085 * src/lyxdraw.h: remvoe file
7087 * src/lyxdraw.C: remove file
7089 * src/insets/insettext.C: added <algorithm>.
7091 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7093 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7094 (matrix_cb): case MM_OK use string stream
7096 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7099 * src/mathed/math_macro.C (draw): use string stream
7100 (Metrics): use string stream
7102 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7103 directly to the ostream.
7105 * src/vspace.C (asString): use string stream.
7106 (asString): use string stream
7107 (asLatexString): use string stream
7109 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7110 setting Spacing::Other.
7112 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7113 sprintf when creating the stretch vale.
7115 * src/text2.C (alphaCounter): changed to return a string and to
7116 not use a static variable internally. Also fixed a one-off bug.
7117 (SetCounter): changed the drawing of the labels to use string
7118 streams instead of sprintf.
7120 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7121 manipulator to use a scheme that does not require library support.
7122 This is also the way it is done in the new GNU libstdc++. Should
7123 work with DEC cxx now.
7125 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7127 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7128 end. This fixes a bug.
7130 * src/mathed (all files concerned with file writing): apply the
7131 USE_OSTREAM_ONLY changes to mathed too.
7133 * src/support/DebugStream.h: make the constructor explicit.
7135 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7136 count and ostream squashed.
7138 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7140 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7142 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7143 ostringstream uses STL strings, and we might not.
7145 * src/insets/insetspecialchar.C: add using directive.
7146 * src/insets/insettext.C: ditto.
7148 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7150 * lib/layouts/seminar.layout: feeble attempt at a layout for
7151 seminar.cls, far from completet and could really use some looking
7152 at from people used to write layout files.
7154 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7155 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7156 a lot nicer and works nicely with ostreams.
7158 * src/mathed/formula.C (draw): a slightly different solution that
7159 the one posted to the list, but I think this one works too. (font
7160 size wrong in headers.)
7162 * src/insets/insettext.C (computeTextRows): some fiddling on
7163 Jürgens turf, added some comments that he should read.
7165 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7166 used and it gave compiler warnings.
7167 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7170 * src/lyx_gui.C (create_forms): do the right thing when
7171 show_banner is true/false.
7173 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7174 show_banner is false.
7176 * most file writing files: Now use iostreams to do almost all of
7177 the writing. Also instead of passing string &, we now use
7178 stringstreams. mathed output is still not adapted to iostreams.
7179 This change can be turned off by commenting out all the occurences
7180 of the "#define USE_OSTREAM_ONLY 1" lines.
7182 * src/WorkArea.C (createPixmap): don't output debug messages.
7183 (WorkArea): don't output debug messages.
7185 * lib/lyxrc.example: added a comment about the new variable
7188 * development/Code_rules/Rules: Added some more commente about how
7189 to build class interfaces and on how better encapsulation can be
7192 2000-03-03 Juergen Vigna <jug@sad.it>
7194 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7195 automatically with the width of the LyX-Window
7197 * src/insets/insettext.C (computeTextRows): fixed update bug in
7198 displaying text-insets (scrollvalues where not initialized!)
7200 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7202 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7203 id in the check of the result from lower_bound is not enough since
7204 lower_bound can return last too, and then res->id will not be a
7207 * all insets and some code that use them: I have conditionalized
7208 removed the Latex(string & out, ...) this means that only the
7209 Latex(ostream &, ...) will be used. This is a work in progress to
7210 move towards using streams for all output of files.
7212 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7215 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7217 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7218 routine (this fixes bug where greek letters were surrounded by too
7221 * src/support/filetools.C (findtexfile): change a bit the search
7222 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7223 no longer passed to kpsewhich, we may have to change that later.
7225 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7226 warning options to avoid problems with X header files (from Angus
7228 * acinclude.m4: regenerated.
7230 2000-03-02 Juergen Vigna <jug@sad.it>
7232 * src/insets/insettext.C (WriteParagraphData): Using the
7233 par->writeFile() function for writing paragraph-data.
7234 (Read): Using buffer->parseSingleLyXformat2Token()-function
7235 for parsing paragraph data!
7237 * src/buffer.C (readLyXformat2): removed all parse data and using
7238 the new parseSingleLyXformat2Token()-function.
7239 (parseSingleLyXformat2Token): added this function to parse (read)
7240 lyx-file-format (this is called also from text-insets now!)
7242 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7244 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7247 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7248 directly instead of going through a func. One very bad thing: a
7249 static LyXFindReplace, but I don't know where to place it.
7251 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7252 string instead of char[]. Also changed to static.
7253 (GetSelectionOrWordAtCursor): changed to static inline
7254 (SetSelectionOverLenChars): ditto.
7256 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7257 current_view and global variables. both classes has changed names
7258 and LyXFindReplace is not inherited from SearchForm.
7260 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7261 fl_form_search form.
7263 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7265 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7267 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7268 bound (from Kayvan).
7270 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7272 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7274 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7276 * some things that I should comment but the local pub says head to
7279 * comment out all code that belongs to the Roff code for Ascii
7280 export of tables. (this is unused)
7282 * src/LyXView.C: use correct type for global variable
7283 current_layout. (LyXTextClass::size_type)
7285 * some code to get the new insetgraphics closer to working I'd be
7286 grateful for any help.
7288 * src/BufferView2.C (insertInset): use the return type of
7289 NumberOfLayout properly. (also changes in other files)
7291 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7292 this as a test. I want to know what breaks because of this.
7294 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7296 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7298 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7299 to use a \makebox in the label, this allows proper justification
7300 with out using protected spaces or multiple hfills. Now it is
7301 "label" for left justified, "\hfill label\hfill" for center, and
7302 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7303 should be changed accordingly.
7305 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7307 * src/lyxtext.h: change SetLayout() to take a
7308 LyXTextClass::size_type instead of a char (when there is more than
7309 127 layouts in a class); also change type of copylayouttype.
7310 * src/text2.C (SetLayout): ditto.
7311 * src/LyXView.C (updateLayoutChoice): ditto.
7313 * src/LaTeX.C (scanLogFile): errors where the line number was not
7314 given just after the '!'-line were ignored (from Dekel Tsur).
7316 * lib/lyxrc.example: fix description of \date_insert_format
7318 * lib/layouts/llncs.layout: new layout, contributed by Martin
7321 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7323 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7324 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7325 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7326 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7327 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
7328 paragraph.C, text.C, text2.C)
7330 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7332 * src/insets/insettext.C (LocalDispatch): remove extra break
7335 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7336 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7338 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7339 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7341 * src/insets/insetbib.h: move InsetBibkey::Holder and
7342 InsetCitation::Holder in public space.
7344 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7346 * src/insets/insettext.h: small change to get the new files from
7347 Juergen to compile (use "string", not "class string").
7349 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7350 const & as parameter to LocalDispatch, use LyXFont const & as
7351 paramter to some other func. This also had impacto on lyxinsets.h
7352 and the two mathed insets.
7354 2000-02-24 Juergen Vigna <jug@sad.it>
7357 * src/commandtags.h:
7359 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7363 * src/BufferView2.C: added/updated code for various inset-functions
7365 * src/insets/insetert.[Ch]: added implementation of InsetERT
7367 * src/insets/insettext.[Ch]: added implementation of InsetText
7369 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7370 (draw): added preliminary code for inset scrolling not finshed yet
7372 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7373 as it is in lyxfunc.C now
7375 * src/insets/lyxinset.h: Added functions for text-insets
7377 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7379 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7380 BufferView and reimplement the list as a queue put inside its own
7383 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7385 * several files: use the new interface to the "updateinsetlist"
7387 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7389 (work_area_handler): call BufferView::trippleClick on trippleclick.
7391 * src/BufferView.C (doubleClick): new function, selects word on
7393 (trippleClick): new function, selects line on trippleclick.
7395 2000-02-22 Allan Rae <rae@lyx.org>
7397 * lib/bind/xemacs.bind: buffer-previous not supported
7399 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7401 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7404 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7406 * src/bufferlist.C: get rid of current_view from this file
7408 * src/spellchecker.C: get rid of current_view from this file
7410 * src/vspace.C: get rid of current_view from this file
7411 (inPixels): added BufferView parameter for this func
7412 (asLatexCommand): added a BufferParams for this func
7414 * src/text.C src/text2.C: get rid of current_view from these
7417 * src/lyxfont.C (getFontDirection): move this function here from
7420 * src/bufferparams.C (getDocumentDirection): move this function
7423 * src/paragraph.C (getParDirection): move this function here from
7425 (getLetterDirection): ditto
7427 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7429 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7430 resize due to wrong pixmap beeing used. Also took the opurtunity
7431 to make the LyXScreen stateless on regard to WorkArea and some
7432 general cleanup in the same files.
7434 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7436 * src/Makefile.am: add missing direction.h
7438 * src/PainterBase.h: made the width functions const.
7440 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7443 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7445 * src/insets/insetlatexaccent.C (draw): make the accents draw
7446 better, at present this will only work well with iso8859-1.
7448 * several files: remove the old drawing code, now we use the new
7451 * several files: remove support for mono_video, reverse_video and
7454 2000-02-17 Juergen Vigna <jug@sad.it>
7456 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7457 int ** as we have to return the pointer, otherwise we have only
7458 NULL pointers in the returning function.
7460 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7462 * src/LaTeX.C (operator()): quote file name when running latex.
7464 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7466 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7467 (bubble tip), this removes our special handling of this.
7469 * Remove all code that is unused now that we have the new
7470 workarea. (Code that are not active when NEW_WA is defined.)
7472 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7474 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7476 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7477 nonexisting layout; correctly redirect obsoleted layouts.
7479 * lib/lyxrc.example: document \view_dvi_paper_option
7481 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7484 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7485 (PreviewDVI): handle the view_dvi_paper_option variable.
7486 [Both from Roland Krause]
7488 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7490 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7491 char const *, int, LyXFont)
7492 (text(int, int, string, LyXFont)): ditto
7494 * src/text.C (InsertCharInTable): attempt to fix the double-space
7495 feature in tables too.
7496 (BackspaceInTable): ditto.
7497 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7499 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7501 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7503 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7504 newly found text in textcache to this.
7505 (buffer): set the owner of the text put into the textcache to 0
7507 * src/insets/figinset.C (draw): fixed the drawing of figures with
7510 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7511 drawing of mathframe, hfills, protected space, table lines. I have
7512 now no outstanding drawing problems with the new Painter code.
7514 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7516 * src/PainterBase.C (ellipse, circle): do not specify the default
7519 * src/LColor.h: add using directive.
7521 * src/Painter.[Ch]: change return type of methods from Painter& to
7522 PainterBase&. Add a using directive.
7524 * src/WorkArea.C: wrap xforms callbacks in C functions
7527 * lib/layouts/foils.layout: font fix and simplifications from Carl
7530 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7532 * a lot of files: The Painter, LColor and WorkArea from the old
7533 devel branch has been ported to lyx-devel. Some new files and a
7534 lot of #ifdeffed code. The new workarea is enabled by default, but
7535 if you want to test the new Painter and LColor you have to compile
7536 with USE_PAINTER defined (do this in config.h f.ex.) There are
7537 still some rought edges, and I'd like some help to clear those
7538 out. It looks stable (loads and displays the Userguide very well).
7541 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7543 * src/buffer.C (pop_tag): revert to the previous implementation
7544 (use a global variable for both loops).
7546 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7548 * src/lyxrc.C (LyXRC): change slightly default date format.
7550 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7551 there is an English text with a footnote that starts with a Hebrew
7552 paragraph, or vice versa.
7553 (TeXFootnote): ditto.
7555 * src/text.C (LeftMargin): allow for negative values for
7556 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7559 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7560 for input encoding (cyrillic)
7562 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7564 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7567 * src/toolbar.C (set): ditto
7568 * src/insets/insetbib.C (create_form_citation_form): ditto
7570 * lib/CREDITS: added Dekel Tsur.
7572 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
7573 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
7574 hebrew supports files from Dekel Tsur.
7576 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
7577 <tzafrir@technion.ac.il>
7579 * src/lyxrc.C: put \date_insert_format at the right place.
7581 * src/buffer.C (makeLaTeXFile): fix the handling of
7582 BufferParams::sides when writing out latex files.
7584 * src/BufferView2.C: add a "using" directive.
7586 * src/support/lyxsum.C (sum): when we use lyxstring,
7587 ostringstream::str needs an additional .c_str().
7589 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7591 * src/support/filetools.C (ChangeExtension): patch from Etienne
7594 * src/TextCache.C (show): remove const_cast and make second
7595 parameter non-const LyXText *.
7597 * src/TextCache.h: use non const LyXText in show.
7599 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7602 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7604 * src/support/lyxsum.C: rework to be more flexible.
7606 * several places: don't check if a pointer is 0 if you are going
7609 * src/text.C: remove some dead code.
7611 * src/insets/figinset.C: remove some dead code
7613 * src/buffer.C: move the BufferView funcs to BufferView2.C
7614 remove all support for insetlatexdel
7615 remove support for oldpapersize stuff
7616 made some member funcs const
7618 * src/kbmap.C: use a std::list to store the bindings in.
7620 * src/BufferView2.C: new file
7622 * src/kbsequence.[Ch]: new files
7624 * src/LyXAction.C + others: remove all trace of buffer-previous
7626 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7627 only have one copy in the binary of this table.
7629 * hebrew patch: moved some functions from LyXText to more
7630 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7632 * several files: remove support for XForms older than 0.88
7634 remove some #if 0 #endif code
7636 * src/TextCache.[Ch]: new file. Holds the textcache.
7638 * src/BufferView.C: changes to use the new TextCache interface.
7639 (waitForX): remove the now unused code.
7641 * src/BackStack.h: remove some commented code
7643 * lib/bind/emacs.bind: remove binding for buffer-previous
7645 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7647 * applied the hebrew patch.
7649 * src/lyxrow.h: make sure that all Row variables are initialized.
7651 * src/text2.C (TextHandleUndo): comment out a delete, this might
7652 introduce a memory leak, but should also help us to not try to
7653 read freed memory. We need to look at this one.
7655 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
7656 (LyXParagraph): initalize footnotekind.
7658 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
7659 forgot this when applying the patch. Please heed the warnings.
7661 * src/BufferView.C (buffer): a fix for the buffer-reload problem
7662 (aka. reformat problem)
7664 * src/bufferlist.C (exists): made const, and use const_iterator
7665 (isLoaded): new func.
7666 (release): use std::find to find the correct buffer.
7668 * src/bufferlist.h: made getState a const func.
7669 made empty a const func.
7670 made exists a const func.
7673 2000-02-01 Juergen Vigna <jug@sad.it>
7675 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
7677 * po/it.po: updated a bit the italian po file and also changed the
7678 'file nuovo' for newfile to 'filenuovo' without a space, this did
7681 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
7682 for the new insert_date command.
7684 * src/lyxfunc.C (Dispatch): added support for a insert_date function
7685 from jdblair, to insert a date into the current text conforming to
7686 a strftime format (for now only considering the locale-set and not
7687 the document-language).
7689 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7691 * src/lyxfont.C (textWidth): hopefully better fix for the Array
7692 Bounds Read error seen by purify. The problem was that islower is
7693 a macros which takes an unsigned char and uses it as an index for
7694 in array of characters properties (and is thus subject to the
7698 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7699 correctly the paper sides radio buttons.
7700 (UpdateDocumentButtons): ditto.
7702 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7704 * src/kbmap.C (getsym + others): change to return unsigned int,
7705 returning a long can give problems on 64 bit systems. (I assume
7706 that int is 32bit on 64bit systems)
7708 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7710 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7711 LyXLookupString to be zero-terminated. Really fixes problems seen
7714 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7716 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7717 write a (char*)0 to the lyxerr stream.
7719 * src/lastfiles.C: move algorithm before the using statemets.
7721 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7723 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7724 complains otherwise).
7725 * src/table.C: ditto
7727 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7730 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7731 that I removed earlier... It is really needed.
7733 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7735 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7737 * INSTALL: update xforms home page URL.
7739 * lib/configure.m4: fix a bug with unreadable layout files.
7741 * src/table.C (calculate_width_of_column): add "using std::max"
7744 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7746 * several files: marked several lines with "DEL LINE", this is
7747 lines that can be deleted without changing anything.
7748 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7749 checks this anyway */
7752 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7754 * src/DepTable.C (update): add a "+" at the end when the checksum
7755 is different. (debugging string only)
7757 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7758 the next inset to not be displayed. This should also fix the list
7759 of labels in the "Insert Crossreference" dialog.
7761 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7763 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7764 when regex was not found.
7766 * src/support/lstrings.C (lowercase): use handcoded transform always.
7769 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7770 old_cursor.par->prev could be 0.
7772 * several files: changed post inc/dec to pre inc/dec
7774 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7775 write the lastfiles to file.
7777 * src/BufferView.C (buffer): only show TextCache info when debugging
7779 (resizeCurrentBuffer): ditto
7780 (workAreaExpose): ditto
7782 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7784 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7786 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7787 a bit better by removing the special case for \i and \j.
7789 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7791 * src/lyx_main.C (easyParse): remove test for bad comand line
7792 options, since this broke all xforms-related parsing.
7794 * src/kbmap.C (getsym): set return type to unsigned long, as
7795 declared in header. On an alpha, long is _not_ the same as int.
7797 * src/support/LOstream.h: add a "using std::flush;"
7799 * src/insets/figinset.C: ditto.
7801 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7803 * src/bufferlist.C (write): use blinding fast file copy instead of
7804 "a char at a time", now we are doing it the C++ way.
7806 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7807 std::list<int> instead.
7808 (addpidwait): reflect move to std::list<int>
7809 (sigchldchecker): ditto
7811 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7814 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7815 that obviously was wrong...
7817 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7818 c, this avoids warnings with purify and islower.
7820 * src/insets/figinset.C: rename struct queue to struct
7821 queue_element and rewrite to use a std::queue. gsqueue is now a
7822 std::queue<queue_element>
7823 (runqueue): reflect move to std::queue
7826 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7827 we would get "1" "0" instead of "true" "false. Also make the tostr
7830 2000-01-21 Juergen Vigna <jug@sad.it>
7832 * src/buffer.C (writeFileAscii): Disabled code for special groff
7833 handling of tabulars till I fix this in table.C
7835 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7837 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7839 * src/support/lyxlib.h: ditto.
7841 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7843 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7844 and 'j' look better. This might fix the "macron" bug that has been
7847 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7848 functions as one template function. Delete the old versions.
7850 * src/support/lyxsum.C: move using std::ifstream inside
7853 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7856 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7858 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7860 * src/insets/figinset.C (InitFigures): use new instead of malloc
7861 to allocate memory for figures and bitmaps.
7862 (DoneFigures): use delete[] instead of free to deallocate memory
7863 for figures and bitmaps.
7864 (runqueue): use new to allocate
7865 (getfigdata): use new/delete[] instead of malloc/free
7866 (RegisterFigure): ditto
7868 * some files: moved some declarations closer to first use, small
7869 whitespace changes use preincrement instead of postincrement where
7870 it does not make a difference.
7872 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7873 step on the way to use stl::containers for key maps.
7875 * src/bufferlist.h: add a typedef for const_iterator and const
7876 versions of begin and end.
7878 * src/bufferlist.[Ch]: change name of member variable _state to
7879 state_. (avoid reserved names)
7881 (getFileNames): returns the filenames of the buffers in a vector.
7883 * configure.in (ALL_LINGUAS): added ro
7885 * src/support/putenv.C: new file
7887 * src/support/mkdir.C: new file
7889 2000-01-20 Allan Rae <rae@lyx.org>
7891 * lib/layouts/IEEEtran.layout: Added several theorem environments
7893 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7894 couple of minor additions.
7896 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7897 (except for those in footnotes of course)
7899 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7901 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7903 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7904 std::sort and std::lower_bound instead of qsort and handwritten
7906 (struct compara): struct that holds the functors used by std::sort
7907 and std::lower_bound in MathedLookupBOP.
7909 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7911 * src/support/LAssert.h: do not do partial specialization. We do
7914 * src/support/lyxlib.h: note that lyx::getUserName() and
7915 lyx::date() are not in use right now. Should these be suppressed?
7917 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7918 (makeLinuxDocFile): do not put date and user name in linuxdoc
7921 * src/support/lyxlib.h (kill): change first argument to long int,
7922 since that's what solaris uses.
7924 * src/support/kill.C (kill): fix declaration to match prototype.
7926 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7927 actually check whether namespaces are supported. This is not what
7930 * src/support/lyxsum.C: add a using directive.
7932 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7934 * src/support/kill.C: if we have namespace support we don't have
7935 to include lyxlib.h.
7937 * src/support/lyxlib.h: use namespace lyx if supported.
7939 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7941 * src/support/date.C: new file
7943 * src/support/chdir.C: new file
7945 * src/support/getUserName.C: new file
7947 * src/support/getcwd.C: new file
7949 * src/support/abort.C: new file
7951 * src/support/kill.C: new file
7953 * src/support/lyxlib.h: moved all the functions in this file
7954 insede struct lyx. Added also kill and abort to this struct. This
7955 is a way to avoid the "kill is not defined in <csignal>", we make
7956 C++ wrappers for functions that are not ANSI C or ANSI C++.
7958 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7959 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7960 lyx it has been renamed to sum.
7962 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7964 * src/text.C: add using directives for std::min and std::max.
7966 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7968 * src/texrow.C (getIdFromRow): actually return something useful in
7969 id and pos. Hopefully fixes the bug with positionning of errorbox
7972 * src/lyx_main.C (easyParse): output an error and exit if an
7973 incorrect command line option has been given.
7975 * src/spellchecker.C (ispell_check_word): document a memory leak.
7977 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7978 where a "struct utimbuf" is allocated with "new" and deleted with
7981 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7983 * src/text2.C (CutSelection): don't delete double spaces.
7984 (PasteSelection): ditto
7985 (CopySelection): ditto
7987 * src/text.C (Backspace): don't delete double spaces.
7989 * src/lyxlex.C (next): fix a bug that were only present with
7990 conformant std::istream::get to read comment lines, use
7991 std::istream::getline instead. This seems to fix the problem.
7993 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7995 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7996 allowed to insert space before space" editing problem. Please read
7997 commends at the beginning of the function. Comments about usage
8000 * src/text.C (InsertChar): fix for the "not allowed to insert
8001 space before space" editing problem.
8003 * src/text2.C (DeleteEmptyParagraphMechanism): when
8004 IsEmptyTableRow can only return false this last "else if" will
8005 always be a no-op. Commented out.
8007 * src/text.C (RedoParagraph): As far as I can understand tmp
8008 cursor is not really needed.
8010 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8011 present it could only return false anyway.
8012 (several functions): Did something not so smart...added a const
8013 specifier on a lot of methods.
8015 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8016 and add a tmp->text.resize. The LyXParagraph constructor does the
8018 (BreakParagraphConservative): ditto
8020 * src/support/path.h (Path): add a define so that the wrong usage
8021 "Path("/tmp") will be flagged as a compilation error:
8022 "`unnamed_Path' undeclared (first use this function)"
8024 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8026 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8027 which was bogus for several reasons.
8029 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8033 * autogen.sh: do not use "type -path" (what's that anyway?).
8035 * src/support/filetools.C (findtexfile): remove extraneous space
8036 which caused a kpsewhich warning (at least with kpathsea version
8039 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8041 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8043 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8045 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8047 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8049 * src/paragraph.C (BreakParagraph): do not reserve space on text
8050 if we don't need to (otherwise, if pos_end < pos, we end up
8051 reserving huge amounts of memory due to bad unsigned karma).
8052 (BreakParagraphConservative): ditto, although I have not seen
8053 evidence the bug can happen here.
8055 * src/lyxparagraph.h: add a using std::list.
8057 2000-01-11 Juergen Vigna <jug@sad.it>
8059 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8062 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8064 * src/vc-backend.C (doVCCommand): change to be static and take one
8065 more parameter: the path to chdir too be fore executing the command.
8066 (retrive): new function equiv to "co -r"
8068 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8069 file_not_found_hook is true.
8071 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8073 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8074 if a file is readwrite,readonly...anything else.
8076 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8078 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8079 (CreatePostscript): name change from MenuRunDVIPS (or something)
8080 (PreviewPostscript): name change from MenuPreviewPS
8081 (PreviewDVI): name change from MenuPreviewDVI
8083 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8084 \view_pdf_command., \pdf_to_ps_command
8086 * lib/configure.m4: added search for PDF viewer, and search for
8087 PDF to PS converter.
8088 (lyxrc.defaults output): add \pdflatex_command,
8089 \view_pdf_command and \pdf_to_ps_command.
8091 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8093 * src/bufferlist.C (write): we don't use blocksize for anything so
8096 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8098 * src/support/block.h: disable operator T* (), since it causes
8099 problems with both compilers I tried. See comments in the file.
8101 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8104 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8105 variable LYX_DIR_10x to LYX_DIR_11x.
8107 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8109 * INSTALL: document --with-lyxname.
8112 * configure.in: new configure flag --with-lyxname which allows to
8113 choose the name under which lyx is installed. Default is "lyx", of
8114 course. It used to be possible to do this with --program-suffix,
8115 but the later has in fact a different meaning for autoconf.
8117 * src/support/lstrings.h (lstrchr): reformat a bit.
8119 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8120 * src/mathed/math_defs.h: ditto.
8122 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8124 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8125 true, decides if we create a backup file or not when saving. New
8126 tag and variable \pdf_mode, defaults to false. New tag and
8127 variable \pdflatex_command, defaults to pdflatex. New tag and
8128 variable \view_pdf_command, defaults to xpdf. New tag and variable
8129 \pdf_to_ps_command, defaults to pdf2ps.
8131 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8133 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8134 does not have a BufferView.
8135 (unlockInset): ditto + don't access the_locking_inset if the
8136 buffer does not have a BufferView.
8138 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8139 certain circumstances so that we don't continue a keyboard
8140 operation long after the key was released. Try f.ex. to load a
8141 large document, press PageDown for some seconds and then release
8142 it. Before this change the document would contine to scroll for
8143 some time, with this change it stops imidiatly.
8145 * src/support/block.h: don't allocate more space than needed. As
8146 long as we don't try to write to the arr[x] in a array_type arr[x]
8147 it is perfectly ok. (if you write to it you might segfault).
8148 added operator value_type*() so that is possible to pass the array
8149 to functions expecting a C-pointer.
8151 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8154 * intl/*: updated to gettext 0.10.35, tried to add our own
8155 required modifications. Please verify.
8157 * po/*: updated to gettext 0.10.35, tried to add our own required
8158 modifications. Please verify.
8160 * src/support/lstrings.C (tostr): go at fixing the problem with
8161 cxx and stringstream. When stringstream is used return
8162 oss.str().c_str() so that problems with lyxstring and basic_string
8163 are avoided. Note that the best solution would be for cxx to use
8164 basic_string all the way, but it is not conformant yet. (it seems)
8166 * src/lyx_cb.C + other files: moved several global functions to
8167 class BufferView, some have been moved to BufferView.[Ch] others
8168 are still located in lyx_cb.C. Code changes because of this. (part
8169 of "get rid of current_view project".)
8171 * src/buffer.C + other files: moved several Buffer functions to
8172 class BufferView, the functions are still present in buffer.C.
8173 Code changes because of this.
8175 * config/lcmessage.m4: updated to most recent. used when creating
8178 * config/progtest.m4: updated to most recent. used when creating
8181 * config/gettext.m4: updated to most recent. applied patch for
8184 * config/gettext.m4.patch: new file that shows what changes we
8185 have done to the local copy of gettext.m4.
8187 * config/libtool.m4: new file, used in creation of acinclude.m4
8189 * config/lyxinclude.m4: new file, this is the lyx created m4
8190 macros, used in making acinclude.m4.
8192 * autogen.sh: GNU m4 discovered as a separate task not as part of
8193 the lib/configure creation.
8194 Generate acinlucde from files in config. Actually cat
8195 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8196 easier to upgrade .m4 files that really are external.
8198 * src/Spacing.h: moved using std::istringstream to right after
8199 <sstream>. This should fix the problem seen with some compilers.
8201 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8203 * src/lyx_cb.C: began some work to remove the dependency a lot of
8204 functions have on BufferView::text, even if not really needed.
8205 (GetCurrentTextClass): removed this func, it only hid the
8208 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8209 forgot this in last commit.
8211 * src/Bullet.C (bulletEntry): use static char const *[] for the
8212 tables, becuase of this the return arg had to change to string.
8214 (~Bullet): removed unneeded destructor
8216 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8217 (insetSleep): moved from Buffer
8218 (insetWakeup): moved from Buffer
8219 (insetUnlock): moved from Buffer
8221 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8222 from Buffer to BufferView.
8224 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8226 * config/ltmain.sh: updated to version 1.3.4 of libtool
8228 * config/ltconfig: updated to version 1.3.4 of libtool
8230 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8233 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8234 Did I get that right?
8236 * src/lyxlex.h: add a "using" directive or two.
8237 * src/Spacing.h: ditto.
8238 * src/insets/figinset.C: ditto.
8239 * src/support/filetools.C: ditto.
8240 * src/support/lstrings.C: ditto.
8241 * src/BufferView.C: ditto.
8242 * src/bufferlist.C: ditto.
8243 * src/lyx_cb.C: ditto.
8244 * src/lyxlex.C: ditto.
8246 * NEWS: add some changes for 1.1.4.
8248 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8250 * src/BufferView.C: first go at a TextCache to speed up switching
8253 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8255 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8256 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8257 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8258 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8261 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8262 members of the struct are correctly initialized to 0 (detected by
8264 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8265 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8267 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8268 pidwait, since it was allocated with "new". This was potentially
8269 very bad. Thanks to Michael Schmitt for running purify for us.
8272 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8274 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8276 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8278 1999-12-30 Allan Rae <rae@lyx.org>
8280 * lib/templates/IEEEtran.lyx: minor change
8282 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8283 src/mathed/formula.C (LocalDispatch): askForText changes
8285 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8286 know when a user has cancelled input. Fixes annoying problems with
8287 inserting labels and version control.
8289 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8291 * src/support/lstrings.C (tostr): rewritten to use strstream and
8294 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8296 * src/support/filetools.C (IsFileWriteable): use fstream to check
8297 (IsDirWriteable): use fileinfo to check
8299 * src/support/filetools.h (FilePtr): whole class deleted
8301 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8303 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8305 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8307 * src/bufferlist.C (write): use ifstream and ofstream instead of
8310 * src/Spacing.h: use istrstream instead of sscanf
8312 * src/mathed/math_defs.h: change first arg to istream from FILE*
8314 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8316 * src/mathed/math_parser.C: have yyis to be an istream
8317 (LexGetArg): use istream (yyis)
8319 (mathed_parse): ditto
8320 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8322 * src/mathed/formula.C (Read): rewritten to use istream
8324 * src/mathed/formulamacro.C (Read): rewritten to use istream
8326 * src/lyxlex.h (~LyXLex): deleted desturctor
8327 (getStream): new function, returns an istream
8328 (getFile): deleted funtion
8329 (IsOK): return is.good();
8331 * src/lyxlex.C (LyXLex): delete file and owns_file
8332 (setFile): open an filebuf and assign that to a istream instead of
8334 (setStream): new function, takes an istream as arg.
8335 (setFile): deleted function
8336 (EatLine): rewritten us use istream instead of FILE*
8340 * src/table.C (LyXTable): use istream instead of FILE*
8341 (Read): rewritten to take an istream instead of FILE*
8343 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8345 * src/buffer.C (Dispatch): remove an extraneous break statement.
8347 * src/support/filetools.C (QuoteName): change to do simple
8348 'quoting'. More work is necessary. Also changed to do nothing
8349 under emx (needs fix too).
8350 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8352 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8353 config.h.in to the AC_DEFINE_UNQUOTED() call.
8354 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8355 needs char * as argument (because Solaris 7 declares it like
8358 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8359 remove definition of BZERO.
8361 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8363 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8364 defined, "lyxregex.h" if not.
8366 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8368 (REGEX): new variable that is set to regex.c lyxregex.h when
8369 AM_CONDITIONAL USE_REGEX is set.
8370 (libsupport_la_SOURCES): add $(REGEX)
8372 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8375 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8378 * configure.in: add call to LYX_REGEX
8380 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8381 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8383 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8385 * lib/bind/fi_menus.bind: new file, from
8386 pauli.virtanen@saunalahti.fi.
8388 * src/buffer.C (getBibkeyList): pass the parameter delim to
8389 InsetInclude::getKeys and InsetBibtex::getKeys.
8391 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8392 is passed to Buffer::getBibkeyList
8394 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8395 instead of the hardcoded comma.
8397 * src/insets/insetbib.C (getKeys): make sure that there are not
8398 leading blanks in bibtex keys. Normal latex does not care, but
8399 harvard.sty seems to dislike blanks at the beginning of citation
8400 keys. In particular, the retturn value of the function is
8402 * INSTALL: make it clear that libstdc++ is needed and that gcc
8403 2.7.x probably does not work.
8405 * src/support/filetools.C (findtexfile): make debug message go to
8407 * src/insets/insetbib.C (getKeys): ditto
8409 * src/debug.C (showTags): make sure that the output is correctly
8412 * configure.in: add a comment for TWO_COLOR_ICON define.
8414 * acconfig.h: remove all the entries that already defined in
8415 configure.in or acinclude.m4.
8417 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8418 to avoid user name, date and copyright.
8420 1999-12-21 Juergen Vigna <jug@sad.it>
8422 * src/table.C (Read): Now read bogus row format informations
8423 if the format is < 5 so that afterwards the table can
8424 be read by lyx but without any format-info. Fixed the
8425 crash we experienced when not doing this.
8427 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8429 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8430 (RedoDrawingOfParagraph): ditto
8431 (RedoParagraphs): ditto
8432 (RemoveTableRow): ditto
8434 * src/text.C (Fill): rename arg paperwidth -> paper_width
8436 * src/buffer.C (insertLyXFile): rename var filename -> fname
8437 (writeFile): rename arg filename -> fname
8438 (writeFileAscii): ditto
8439 (makeLaTeXFile): ditto
8440 (makeLinuxDocFile): ditto
8441 (makeDocBookFile): ditto
8443 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8446 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8448 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8451 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8452 compiled by a C compiler not C++.
8454 * src/layout.h (LyXTextClass): added typedef for const_iterator
8455 (LyXTextClassList): added typedef for const_iterator + member
8456 functions begin and end.
8458 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8459 iterators to fill the choice_class.
8460 (updateLayoutChoice): rewritten to use iterators to fill the
8461 layoutlist in the toolbar.
8463 * src/BufferView.h (BufferView::work_area_width): removed unused
8466 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8468 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8469 (sgmlCloseTag): ditto
8471 * src/support/lstrings.h: return type of countChar changed to
8474 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8475 what version of this func to use. Also made to return unsigned int.
8477 * configure.in: call LYX_STD_COUNT
8479 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8480 conforming std::count.
8482 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8484 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8485 and a subscript would give bad display (patch from Dekel Tsur
8486 <dekel@math.tau.ac.il>).
8488 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8490 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8493 * src/chset.h: add a few 'using' directives
8495 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8496 triggered when no buffer is active
8498 * src/layout.C: removed `break' after `return' in switch(), since
8501 * src/lyx_main.C (init): make sure LyX can be ran in place even
8502 when libtool has done its magic with shared libraries. Fix the
8503 test for the case when the system directory has not been found.
8505 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8506 name for the latex file.
8507 (MenuMakeHTML): ditto
8509 * src/buffer.h: add an optional boolean argument, which is passed
8512 1999-12-20 Allan Rae <rae@lyx.org>
8514 * lib/templates/IEEEtran.lyx: small correction and update.
8516 * configure.in: Attempted to use LYX_PATH_HEADER
8518 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8520 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8521 input from JMarc. Now use preprocessor to find the header.
8522 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8523 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8524 LYX_STL_STRING_FWD. See comments in file.
8526 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
8528 * The global MiniBuffer * minibuffer variable is dead.
8530 * The global FD_form_main * fd_form_main variable is dead.
8532 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8534 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
8536 * src/table.h: add the LOstream.h header
8537 * src/debug.h: ditto
8539 * src/LyXAction.h: change the explaination of the ReadOnly
8540 attribute: is indicates that the function _can_ be used.
8542 * src/LyXAction.C (init): find-replace _can_ be used in read-only
8545 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8547 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8553 * src/paragraph.C (GetWord): assert on pos>=0
8556 * src/support/lyxstring.C: condition the use of an invariant on
8558 * src/support/lyxstring.h: ditto
8560 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8561 Use LAssert.h instead of plain assert().
8563 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8565 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8566 * src/support/filetools.C: ditto
8568 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
8571 * INSTALL: document the new configure flags
8573 * configure.in: suppress --with-debug; add --enable-assertions
8575 * acinclude.m4: various changes in alignment of help strings.
8577 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8579 * src/kbmap.C: commented out the use of the hash map in kb_map,
8580 beginning of movement to a stl::container.
8582 * several files: removed code that was not in effect when
8583 MOVE_TEXT was defined.
8585 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
8586 for escaping should not be used. We can discuss if the string
8587 should be enclosed in f.ex. [] instead of "".
8589 * src/trans_mgr.C (insert): use the new returned value from
8590 encodeString to get deadkeys and keymaps done correctly.
8592 * src/chset.C (encodeString): changed to return a pair, to tell
8593 what to use if we know the string.
8595 * src/lyxscreen.h (fillArc): new function.
8597 * src/FontInfo.C (resize): rewritten to use more std::string like
8598 structore, especially string::replace.
8600 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8603 * configure.in (chmod +x some scripts): remove config/gcc-hack
8605 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8607 * src/buffer.C (writeFile): change once again the top comment in a
8608 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8609 instead of an hardcoded version number.
8610 (makeDocBookFile): ditto
8612 * src/version.h: add new define LYX_DOCVERSION
8614 * po/de.po: update from Pit Sütterlin
8615 * lib/bind/de_menus.bind: ditto.
8617 * src/lyxfunc.C (Dispatch): call MenuExport()
8618 * src/buffer.C (Dispatch): ditto
8620 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8621 LyXFunc::Dispatch().
8622 (MenuExport): new function, moved from
8623 LyXFunc::Dispatch().
8625 * src/trans_mgr.C (insert): small cleanup
8626 * src/chset.C (loadFile): ditto
8628 * lib/kbd/iso8859-1.cdef: add missing backslashes
8630 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8632 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8633 help with placing the manually drawn accents better.
8635 (Draw): x2 and hg changed to float to minimize rounding errors and
8636 help place the accents better.
8638 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8639 unsigned short to char is just wrong...cast the char to unsigned
8640 char instead so that the two values can compare sanely. This
8641 should also make the display of insetlatexaccents better and
8642 perhaps also some other insets.
8644 (lbearing): new function
8647 1999-12-15 Allan Rae <rae@lyx.org>
8649 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
8650 header that provides a wrapper around the very annoying SGI STL header
8653 * src/support/lyxstring.C, src/LString.h:
8654 removed old SGI-STL-compatability attempts.
8656 * configure.in: Use LYX_STL_STRING_FWD.
8658 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
8659 stl_string_fwd.h is around and try to determine it's location.
8660 Major improvement over previous SGI STL 3.2 compatability.
8661 Three small problems remain with this function due to my zero
8662 knowledge of autoconf. JMarc and lgb see the comments in the code.
8664 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8666 * src/broken_const.h, config/hack-gcc, config/README: removed
8668 * configure.in: remove --with-gcc-hack option; do not call
8671 * INSTALL: remove documentation of --with-broken-const and
8674 * acconfig.h: remove all trace of BROKEN_CONST define
8676 * src/buffer.C (makeDocBookFile): update version number in output
8678 (SimpleDocBookOnePar): fix an assert when trying to a character
8679 access beyond string length
8682 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8684 * po/de.po: fix the Export menu
8686 * lyx.man: update the description of -dbg
8688 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
8689 (commandLineHelp): updated
8690 (easyParse): show list of available debug levels if -dbg is passed
8693 * src/Makefile.am: add debug.C
8695 * src/debug.h: moved some code to debug.C
8697 * src/debug.C: new file. Contains code to set and show debug
8700 * src/layout.C: remove 'break' after 'continue' in switch
8701 statements, since these cannot be reached.
8703 1999-12-13 Allan Rae <rae@lyx.org>
8705 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8706 (in_word_set): hash() -> math_hash()
8708 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8710 * acconfig.h: Added a test for whether we are using exceptions in the
8711 current compilation run. If so USING_EXCEPTIONS is defined.
8713 * config.in: Check for existance of stl_string_fwd.h
8714 * src/LString.h: If compiling --with-included-string and SGI's
8715 STL version 3.2 is present (see above test) we need to block their
8716 forward declaration of string and supply a __get_c_string().
8717 However, it turns out this is only necessary if compiling with
8718 exceptions enabled so I've a bit more to add yet.
8720 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8721 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8722 src/support/LRegex.h, src/undo.h:
8723 Shuffle the order of the included files a little to ensure that
8724 LString.h gets included before anything that includes stl_string_fwd.h
8726 * src/support/lyxstring.C: We need to #include LString.h instead of
8727 lyxstring.h to get the necessary definition of __get_c_string.
8728 (__get_c_string): New function. This is defined static just like SGI's
8729 although why they need to do this I'm not sure. Perhaps it should be
8730 in lstrings.C instead.
8732 * lib/templates/IEEEtran.lyx: New template file.
8734 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8736 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8737 * intl/Makefile.in (MKINSTALLDIRS): ditto
8739 * src/LyXAction.C (init): changed to hold the LFUN data in a
8740 automatic array in stead of in callso to newFunc, this speeds up
8741 compilation a lot. Also all the memory used by the array is
8742 returned when the init is completed.
8744 * a lot of files: compiled with -Wold-style-cast, changed most of
8745 the reported offenders to C++ style casts. Did not change the
8746 offenders in C files.
8748 * src/trans.h (Match): change argument type to unsigned int.
8750 * src/support/DebugStream.C: fix some types on the streambufs so
8751 that it works on a conforming implementation.
8753 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8755 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8757 * src/support/lyxstring.C: remove the inline added earlier since
8758 they cause a bunch of unsatisfied symbols when linking with dec
8759 cxx. Cxx likes to have the body of inlines at the place where they
8762 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8763 accessing negative bounds in array. This fixes the crash when
8764 inserting accented characters.
8765 * src/trans.h (Match): ditto
8767 * src/buffer.C (Dispatch): since this is a void, it should not try
8768 to return anything...
8770 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8772 * src/buffer.h: removed the two friends from Buffer. Some changes
8773 because of this. Buffer::getFileName and Buffer::setFileName
8774 renamed to Buffer::fileName() and Buffer::fileName(...).
8776 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8778 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8779 and Buffer::update(short) to BufferView. This move is currently
8780 controlled by a define MOVE_TEXT, this will be removed when all
8781 shows to be ok. This move paves the way for better separation
8782 between buffer contents and buffer view. One side effect is that
8783 the BufferView needs a rebreak when swiching buffers, if we want
8784 to avoid this we can add a cache that holds pointers to LyXText's
8785 that is not currently in use.
8787 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8790 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8792 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8794 * lyx_main.C: new command line option -x (or --execute) and
8795 -e (or --export). Now direct conversion from .lyx to .tex
8796 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8797 Unfortunately, X is still needed and the GUI pops up during the
8800 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8802 * src/Spacing.C: add a using directive to bring stream stuff into
8804 * src/paragraph.C: ditto
8805 * src/buffer.C: ditto
8807 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8808 from Lars' announcement).
8810 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8811 example files from Tino Meinen.
8813 1999-12-06 Allan Rae <rae@lyx.org>
8815 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8817 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8819 * src/support/lyxstring.C: added a lot of inline for no good
8822 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8823 latexWriteEndChanges, they were not used.
8825 * src/layout.h (operator<<): output operator for PageSides
8827 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8829 * some example files: loaded in LyX 1.0.4 and saved again to update
8830 certain constructs (table format)
8832 * a lot of files: did the change to use fstream/iostream for all
8833 writing of files. Done with a close look at Andre Poenitz's patch.
8835 * some files: whitespace changes.
8837 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8839 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8840 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8841 architecture, we provide our own. It is used unconditionnally, but
8842 I do not think this is a performance problem. Thanks to Angus
8843 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8844 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8846 (GetInset): use my_memcpy.
8850 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8851 it is easier to understand, but it uses less TeX-only constructs now.
8853 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8854 elements contain spaces
8856 * lib/configure: regenerated
8858 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8859 elements contain spaces; display the list of programs that are
8862 * autogen.sh: make sure lib/configure is executable
8864 * lib/examples/*: rename the tutorial examples to begin with the
8865 two-letters language code.
8867 * src/lyxfunc.C (getStatus): do not query current font if no
8870 * src/lyx_cb.C (RunScript): use QuoteName
8871 (MenuRunDvips): ditto
8872 (PrintApplyCB): ditto
8874 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8875 around argument, so that it works well with the current shell.
8876 Does not work properly with OS/2 shells currently.
8878 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8879 * src/LyXSendto.C (SendtoApplyCB): ditto
8880 * src/lyxfunc.C (Dispatch): ditto
8881 * src/buffer.C (runLaTeX): ditto
8882 (runLiterate): ditto
8883 (buildProgram): ditto
8885 * src/lyx_cb.C (RunScript): ditto
8886 (MenuMakeLaTeX): ditto
8888 * src/buffer.h (getLatexName): new method
8890 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8892 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8894 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8895 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8896 (create_math_panel): ditto
8898 * src/lyxfunc.C (getStatus): re-activate the code which gets
8899 current font and cursor; add test for export to html.
8901 * src/lyxrc.C (read): remove unreachable break statements; add a
8904 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8906 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8908 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8909 introduced by faulty regex.
8910 * src/buffer.C: ditto
8911 * src/lastfiles.C: ditto
8912 * src/paragraph.C: ditto
8913 * src/table.C: ditto
8914 * src/vspace.C: ditto
8915 * src/insets/figinset.C: ditto
8916 Note: most of these is absolutely harmless, except the one in
8917 src/mathed formula.C.
8919 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8921 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8922 operation, yielding correct results for the reLyX command.
8924 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8926 * src/support/filetools.C (ExpandPath): removed an over eager
8928 (ReplaceEnvironmentPath): ditto
8930 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8931 shows that we are doing something fishy in our code...
8935 * src/lyxrc.C (read): use a double switch trick to get more help
8936 from the compiler. (the same trick is used in layout.C)
8937 (write): new function. opens a ofstream and pass that to output
8938 (output): new function, takes a ostream and writes the lyxrc
8939 elemts to it. uses a dummy switch to make sure no elements are
8942 * src/lyxlex.h: added a struct pushpophelper for use in functions
8943 with more than one exit point.
8945 * src/lyxlex.[Ch] (GetInteger): made it const
8949 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8951 * src/layout.[hC] : LayoutTags splitted into several enums, new
8952 methods created, better error handling cleaner use of lyxlex. Read
8955 * src/bmtable.[Ch]: change some member prototypes because of the
8956 image const changes.
8958 * commandtags.h, src/LyXAction.C (init): new function:
8959 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8960 This file is not read automatically but you can add \input
8961 preferences to your lyxrc if you want to. We need to discuss how
8964 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8965 in .aux, also remove .bib and .bst files from dependencies when
8968 * src/BufferView.C, src/LyXView.C: add const_cast several places
8969 because of changes to images.
8971 * lib/images/*: same change as for images/*
8973 * lib/lyxrc.example: Default for accept_compound is false not no.
8975 * images/*: changed to be const, however I have som misgivings
8976 about this change so it might be changed back.
8978 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8980 * lib/configure, po/POTFILES.in: regenerated
8982 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8984 * config/lib_configure.m4: removed
8986 * lib/configure.m4: new file (was config/lib_configure.m4)
8988 * configure.in: do not test for rtti, since we do not use it.
8990 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8992 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8993 doubling of allocated space scheme. This makes it faster for large
8994 strings end to use less memory for small strings. xtra rememoved.
8996 * src/insets/figinset.C (waitalarm): commented out.
8997 (GhostscriptMsg): use static_cast
8998 (GhostscriptMsg): use new instead of malloc to allocate memory for
8999 cmap. also delete the memory after use.
9001 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9003 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9004 for changes in bibtex database or style.
9005 (runBibTeX): remove all .bib and .bst files from dep before we
9007 (run): use scanAuc in when dep file already exist.
9009 * src/DepTable.C (remove_files_with_extension): new method
9012 * src/DepTable.[Ch]: made many of the methods const.
9014 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9016 * src/bufferparams.C: make sure that the default textclass is
9017 "article". It used to be the first one by description order, but
9018 now the first one is "docbook".
9020 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9021 string; call Debug::value.
9022 (easyParse): pass complete argument to setDebuggingLevel().
9024 * src/debug.h (value): fix the code that parses debug levels.
9026 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9029 * src/LyXAction.C: use Debug::ACTION as debug channel.
9031 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9033 * NEWS: updated for the future 1.1.3 release.
9035 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9036 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9037 it should. This is of course a controversial change (since many
9038 people will find that their lyx workscreen is suddenly full of
9039 red), but done for the sake of correctness.
9041 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9042 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9044 * src/insets/inseterror.h, src/insets/inseturl.h,
9045 src/insets/insetinfo.h, src/insets/figinset.h,
9046 src/mathed/formulamacro.h, src/mathed/math_macro.h
9047 (EditMessage): add a missing const and add _() to make sure that
9050 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9051 src/insets/insetbib.C, src/support/filetools.C: add `using'
9054 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9055 doing 'Insert index of last word' at the beginning of a paragraph.
9057 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9059 * several files: white-space changes.
9061 * src/mathed/formula.C: removed IsAlpha and IsDigit
9063 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9064 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9067 * src/insets/figinset.C (GetPSSizes): don't break when
9068 "EndComments" is seen. But break when a boundingbox is read.
9070 * all classes inherited from Inset: return value of Clone
9071 changed back to Inset *.
9073 * all classes inherited form MathInset: return value of Clone
9074 changed back to MathedInset *.
9076 * src/insets/figinset.C (runqueue): use a ofstream to output the
9077 gs/ps file. Might need some setpresicion or setw. However I can
9078 see no problem with the current code.
9079 (runqueue): use sleep instead of the alarm/signal code. I just
9080 can't see the difference.
9082 * src/paragraph.C (LyXParagraph): reserve space in the new
9083 paragraph and resize the inserted paragraph to just fit.
9085 * src/lyxfunc.h (operator|=): added operator for func_status.
9087 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9088 check for readable file.
9090 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9091 check for readable file.
9092 (MenuMakeLinuxDoc): ditto
9093 (MenuMakeDocBook): ditto
9094 (MenuMakeAscii): ditto
9095 (InsertAsciiFile): split the test for openable and readable
9097 * src/bmtable.C (draw_bitmaptable): use
9098 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9100 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9101 findtexfile from LaTeX to filetools.
9103 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9104 instead of FilePtr. Needs to be verified by a literate user.
9106 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9108 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9109 (EditMessage): likewise.
9111 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9112 respectively as \textasciitilde and \textasciicircum.
9114 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9116 * src/support/lyxstring.h: made the methods that take iterators
9119 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9120 (regexMatch): made is use the real regex class.
9122 * src/support/Makefile.am: changed to use libtool
9124 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9126 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9128 (MathIsInset ++): changed several macros to be inline functions
9131 * src/mathed/Makefile.am: changed to use libtool
9133 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9135 * src/insets/inset* : Clone changed to const and return type is
9136 the true insettype not just Inset*.
9138 * src/insets/Makefile.am: changed to use libtool
9140 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9142 * src/undo.[Ch] : added empty() and changed some of the method
9145 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9147 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9148 setID use block<> for the bullets array, added const several places.
9150 * src/lyxfunc.C (getStatus): new function
9152 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9153 LyXAction, added const to several funtions.
9155 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9156 a std::map, and to store the dir items in a vector.
9158 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9161 * src/LyXView.[Ch] + other files : changed currentView to view.
9163 * src/LyXAction.[Ch] : ported from the old devel branch.
9165 * src/.cvsignore: added .libs and a.out
9167 * configure.in : changes to use libtool.
9169 * acinclude.m4 : inserted libtool.m4
9171 * .cvsignore: added libtool
9173 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9175 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9176 file name in insets and mathed directories (otherwise the
9177 dependency is not taken in account under cygwin).
9179 * src/text2.C (InsertString[AB]): make sure that we do not try to
9180 read characters past the string length.
9182 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9184 * lib/doc/LaTeXConfig.lyx.in,
9185 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9187 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9188 file saying who created them and when this heppened; this is
9189 useless and annoys tools like cvs.
9191 * lib/layouts/g-brief-{en,de}.layout,
9192 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9193 from Thomas Hartkens <thomas@hartkens.de>.
9195 * src/{insets,mathed}/Makefile.am: do not declare an empty
9196 LDFLAGS, so that it can be set at configure time (useful on Irix
9199 * lib/reLyX/configure.in: make sure that the prefix is set
9200 correctly in LYX_DIR.
9202 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9204 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9205 be used by 'command-sequence' this allows to bind a key to a
9206 sequence of LyX-commands
9207 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9209 * src/LyXAction.C: add "command-sequence"
9211 * src/LyXFunction.C: handling of "command-sequence"
9213 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9214 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9216 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9218 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9220 * src/buffer.C (writeFile): Do not output a comment giving user
9221 and date at the beginning of a .lyx file. This is useless and
9222 annoys cvs anyway; update version number to 1.1.
9224 * src/Makefile.am (LYX_DIR): add this definition, so that a
9225 default path is hardcoded in LyX.
9227 * configure.in: Use LYX_GNU_GETTEXT.
9229 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9230 AM_GNU_GETTEXT with a bug fixed.
9232 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9234 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9236 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9237 which is used to point to LyX data is now LYX_DIR_11x.
9239 * lyx.man: convert to a unix text file; small updates.
9241 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9243 * src/support/LSubstring.[Ch]: made the second arg of most of the
9244 constructors be a const reference.
9246 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9249 * src/support/lyxstring.[Ch] (swap): added missing member function
9250 and specialization of swap(str, str);
9252 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9254 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9255 trace of the old one.
9257 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9258 put the member definitions in undo.C.
9260 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9261 NEW_TEXT and have now only code that was included when this was
9264 * src/intl.C (LCombo): use static_cast
9266 (DispatchCallback): ditto
9268 * src/definitions.h: removed whole file
9270 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9272 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9273 parsing and stores in a std:map. a regex defines the file format.
9274 removed unneeded members.
9276 * src/bufferparams.h: added several enums from definitions.h here.
9277 Removed unsused destructor. Changed some types to use proper enum
9278 types. use block to have the temp_bullets and user_defined_bullets
9279 and to make the whole class assignable.
9281 * src/bufferparams.C (Copy): removed this functions, use a default
9284 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9287 * src/buffer.C (readLyXformat2): commend out all that have with
9288 oldpapersize to do. also comment out all that hve to do with
9289 insetlatex and insetlatexdel.
9290 (setOldPaperStuff): commented out
9292 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9294 * src/LyXAction.C: remove use of inset-latex-insert
9296 * src/mathed/math_panel.C (button_cb): use static_cast
9298 * src/insets/Makefile.am (insets_o_SOURCES): removed
9301 * src/support/lyxstring.C (helper): use the unsigned long
9302 specifier, UL, instead of a static_cast.
9304 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9306 * src/support/block.h: new file. to be used as a c-style array in
9307 classes, so that the class can be assignable.
9309 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9311 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9312 NULL, make sure to return an empty string (it is not possible to
9313 set a string to NULL).
9315 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9317 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9319 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9321 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9322 link line, so that Irix users (for example) can set it explicitely to
9325 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9326 it can be overidden at make time (static or dynamic link, for
9329 * src/vc-backend.C, src/LaTeXFeatures.h,
9330 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
9331 statements to bring templates to global namespace.
9333 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9335 * src/support/lyxstring.C (operator[] const): make it standard
9338 * src/minibuffer.C (Init): changed to reflect that more
9339 information is given from the lyxvc and need not be provided here.
9341 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9343 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9345 * src/LyXView.C (UpdateTimerCB): use static_cast
9346 (KeyPressMask_raw_callback): ditto
9348 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9349 buffer_, a lot of changes because of this. currentBuffer() ->
9350 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9351 also changes to other files because of this.
9353 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9355 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9356 have no support for RCS and partial support for CVS, will be
9359 * src/insets/ several files: changes because of function name
9360 changes in Bufferview and LyXView.
9362 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9364 * src/support/LSubstring.[Ch]: new files. These implement a
9365 Substring that can be very convenient to use. i.e. is this
9367 string a = "Mary had a little sheep";
9368 Substring(a, "sheep") = "lamb";
9369 a is now "Mary has a little lamb".
9371 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9372 out patterns and subpatterns of strings. It is used by LSubstring
9373 and also by vc-backend.C
9375 * src/support/lyxstring.C: went over all the assertions used and
9376 tried to correct the wrong ones and flag which of them is required
9377 by the standard. some bugs found because of this. Also removed a
9378 couple of assertions.
9380 * src/support/Makefile.am (libsupport_a_SOURCES): added
9381 LSubstring.[Ch] and LRegex.[Ch]
9383 * src/support/FileInfo.h: have struct stat buf as an object and
9384 not a pointer to one, some changes because of this.
9386 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9387 information in layout when adding the layouts preamble to the
9390 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9393 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9394 because of bug in OS/2.
9396 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9398 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9399 \verbatim@font instead of \ttfamily, so that it can be redefined.
9401 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9402 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9403 src/layout.h, src/text2.C: add 'using' directive to bring the
9404 STL templates we need from the std:: namespace to the global one.
9405 Needed by DEC cxx in strict ansi mode.
9407 * src/support/LIstream.h,src/support/LOstream.h,
9408 src/support/lyxstring.h,src/table.h,
9409 src/lyxlookup.h: do not include <config.h> in header
9410 files. This should be done in the .C files only.
9412 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9416 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9418 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9419 from Kayvan to fix the tth invokation.
9421 * development/lyx.spec.in: updates from Kayvan to reflect the
9422 changes of file names.
9424 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9426 * src/text2.C (InsertStringB): use std::copy
9427 (InsertStringA): use std::copy
9429 * src/bufferlist.C: use a vector to store the buffers in. This is
9430 an internal change and should not affect any other thing.
9432 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9435 * src/text.C (Fill): fix potential bug, one off bug.
9437 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9439 * src/Makefile.am (lyx_main.o): add more files it depends on.
9441 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9443 * src/support/lyxstring.C: use size_t for the reference count,
9444 size, reserved memory and xtra.
9445 (internal_compare): new private member function. Now the compare
9446 functions should work for std::strings that have embedded '\0'
9448 (compare): all compare functions rewritten to use
9451 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9453 * src/support/lyxstring.C (compare): pass c_str()
9454 (compare): pass c_str
9455 (compare): pass c_str
9457 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9459 * src/support/DebugStream.C: <config.h> was not included correctly.
9461 * lib/configure: forgot to re-generate it :( I'll make this file
9462 auto generated soon.
9464 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9466 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9469 * src/support/lyxstring.C: some changes from length() to rep->sz.
9470 avoids a function call.
9472 * src/support/filetools.C (SpaceLess): yet another version of the
9473 algorithm...now per Jean-Marc's suggestions.
9475 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9477 * src/layout.C (less_textclass_desc): functor for use in sorting
9479 (LyXTextClass::Read): sort the textclasses after reading.
9481 * src/support/filetools.C (SpaceLess): new version of the
9482 SpaceLess functions. What problems does this one give? Please
9485 * images/banner_bw.xbm: made the arrays unsigned char *
9487 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9489 * src/support/lyxstring.C (find): remove bogus assertion in the
9490 two versions of find where this has not been done yet.
9492 * src/support/lyxlib.h: add missing int return type to
9495 * src/menus.C (ShowFileMenu): disable exporting to html if no
9496 html export command is present.
9498 * config/lib_configure.m4: add a test for an HTML converter. The
9499 programs checked for are, in this order: tth, latex2html and
9502 * lib/configure: generated from config/lib_configure.m4.
9504 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9505 html converter. The parameters are now passed through $$FName and
9506 $$OutName, instead of standard input/output.
9508 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9510 * lib/lyxrc.example: update description of \html_command.
9511 add "quotes" around \screen_font_xxx font setting examples to help
9512 people who use fonts with spaces in their names.
9514 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9516 * Distribution files: updates for v1.1.2
9518 * src/support/lyxstring.C (find): remove bogus assert and return
9519 npos for the same condition.
9521 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9523 * added patch for OS/2 from SMiyata.
9525 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9527 * src/text2.C (CutSelection): make space_wrapped a bool
9528 (CutSelection): dont declare int i until we have to.
9529 (alphaCounter): return a char const *.
9531 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9533 * src/support/syscall.C (Systemcalls::kill):
9534 src/support/filetools.C (PutEnv, PutEnvPath):
9535 src/lyx_cb.C (addNewlineAndDepth):
9536 src/FontInfo.C (FontInfo::resize): condition some #warning
9537 directives with WITH_WARNINGS.
9540 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9542 * src/layout.[Ch] + several files: access to class variables
9543 limited and made accessor functions instead a lot of code changed
9544 becuase of this. Also instead of returning pointers often a const
9545 reference is returned instead.
9547 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9549 * src/Makefile.am (dist-hook): added used to remove the CVS from
9550 cheaders upon creating a dist
9551 (EXTRA_DIST): added cheaders
9553 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9554 a character not as a small integer.
9556 * src/support/lyxstring.C (find): removed Assert and added i >=
9557 rep->sz to the first if.
9559 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9561 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9562 src/LyXView.C src/buffer.C src/bufferparams.C
9563 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9564 src/text2.C src/insets/insetinclude.C:
9565 lyxlayout renamed to textclasslist.
9567 * src/layout.C: some lyxerr changes.
9569 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9570 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
9571 (LyXLayoutList): removed all traces of this class.
9572 (LyXTextClass::Read): rewrote LT_STYLE
9573 (LyXTextClass::hasLayout): new function
9574 (LyXTextClass::GetLayout): rewritten to return an iterator + has
9575 both const and nonconst version.
9576 (LyXTextClass::delete_layout): new function.
9577 (LyXTextClassList::Style): bug fix. do the right thing if layout
9579 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
9580 (LyXTextClassList::NameOfLayout): ditto
9581 (LyXTextClassList::Load): ditto
9583 * src/buffer.C (makeLaTeXFile): new access to layoutlist
9585 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
9587 * src/LyXAction.C (LookupFunc): added a workaround for sun
9588 compiler, on the other hand...we don't know if the current code
9589 compiles on sun at all...
9591 * src/support/filetools.C (CleanupPath): subst fix
9593 * src/insets/insetbib.C (delDatabase): subst fix, this looks
9596 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
9597 complained about this one?
9599 * src/insets/insetinclude.C (Latex): subst fix
9601 * src/insets/insetbib.C (getKeys): subst fix
9603 * src/LyXSendto.C (SendtoApplyCB): subst fix
9605 * src/lyx_main.C (init): subst fix
9607 * src/layout.C (Read): subst fix
9609 * src/lyx_sendfax_main.C (button_send): subst fix
9611 * src/buffer.C (RoffAsciiTable): subst fix
9613 * src/lyx_cb.C (MenuFax): subst fix
9614 (PrintApplyCB): subst fix
9616 1999-10-26 Juergen Vigna <jug@sad.it>
9618 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9620 (Read): Cleaned up this code so now we read only format vestion >= 5
9622 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9624 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9625 come nobody has complained about this one?
9627 * src/insets/insetinclude.C (Latex): subst fix
9629 * src/insets/insetbib.C (getKeys): subst fix
9631 * src/lyx_main.C (init): subst fix
9633 * src/layout.C (Read): subst fix
9635 * src/buffer.C (RoffAsciiTable): subst fix
9637 * src/lyx_cb.C (MenuFax): subst fix.
9639 * src/layout.[hC] + some other files: rewrote to use
9640 std::container to store textclasses and layouts in.
9641 Simplified, removed a lot of code. Make all classes
9642 assignable. Further simplifications and review of type
9643 use still to be one.
9645 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9646 lastfiles to create the lastfiles partr of the menu.
9648 * src/lastfiles.[Ch]: rewritten to use deque to store the
9649 lastfiles in. Uses fstream for reading and writing. Simplifies
9652 * src/support/syscall.C: remove explicit cast.
9654 * src/BufferView.C (CursorToggleCB): removed code snippets that
9656 use explicat C++ style casts instead of C style casts. also use
9657 u_vdata instea of passing pointers in longs.
9659 * src/PaperLayout.C: removed code snippets that were commented out.
9661 * src/lyx_gui_misc.C: removed code snippets that were commented out.
9663 * src/lyx_main.C: removed code snippets that wer commented out.
9665 * src/paragraph.C: removed code snippets that were commented out.
9667 * src/lyxvc.C (logClose): use static_cast
9669 (viewLog): remove explicit cast to void*
9670 (showLog): removed old commented code
9672 * src/menus.C: use static_cast instead of C style casts. use
9673 u_vdata instead of u_ldata. remove explicit cast to (long) for
9674 pointers. Removed old code that was commented out.
9676 * src/insets/inset.C: removed old commented func
9678 * src/insets/insetref.C (InsetRef): removed old code that had been
9679 commented out for a long time.
9681 (escape): removed C style cast
9683 * src/insets/insetlatexaccent.C (Draw): removed old commented code
9685 * src/insets/insetlatex.C (Draw): removed old commented code
9686 (Read): rewritten to use string
9688 * src/insets/insetlabel.C (escape): removed C style cast
9690 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
9692 * src/insets/insetindex.C: use static_cast and u_vdata, removed
9695 * src/insets/insetinclude.h: removed a couple of stupid bools
9697 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9698 (Clone): remove C style cast
9699 (getKeys): changed list to lst because of std::list
9701 * src/insets/inseterror.C (Draw): removed som old commented code.
9703 * src/insets/insetcommand.C (Draw): removed some old commented code.
9705 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9706 commented out forever.
9707 (bibitem_cb): use static_cast instead of C style cast
9708 use of vdata changed to u_vdata.
9710 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9712 (CloseUrlCB): use static_cast instead of C style cast.
9713 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9715 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9716 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9717 (CloseInfoCB): static_cast from ob->u_vdata instead.
9718 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9721 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9722 (C_InsetError_CloseErrorCB): forward the ob parameter
9723 (CloseErrorCB): static_cast from ob->u_vdata instead.
9725 * src/vspace.h: include LString.h since we use string in this class.
9727 * src/vspace.C (lyx_advance): changed name from advance because of
9728 nameclash with stl. And since we cannot use namespaces yet...I
9729 used a lyx_ prefix instead. Expect this to change when we begin
9732 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9734 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9735 and removed now defunct constructor and deconstructor.
9737 * src/BufferView.h: have backstack as a object not as a pointer.
9738 removed initialization from constructor. added include for BackStack
9740 * development/lyx.spec.in (%build): add CFLAGS also.
9742 * src/screen.C (drawFrame): removed another warning.
9744 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9746 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9747 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9748 README and ANNOUNCE a bit for the next release. More work is
9751 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9752 unbreakable if we are in freespacing mode (LyX-Code), but not in
9755 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9757 * src/BackStack.h: fixed initialization order in constructor
9759 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9761 * acinclude.m4 (VERSION): new rules for when a version is
9762 development, added also a variable for prerelease.
9763 (warnings): we set with_warnings=yes for prereleases
9764 (lyx_opt): prereleases compile with same optimization as development
9765 (CXXFLAGS): only use pedantic if we are a development version
9767 * src/BufferView.C (restorePosition): don't do anything if the
9770 * src/BackStack.h: added member empty, use this to test if there
9771 is anything to pop...
9773 1999-10-25 Juergen Vigna <jug@sad.it>
9776 * forms/layout_forms.fd +
9777 * forms/latexoptions.fd +
9778 * lyx.fd: changed for various form resize issues
9780 * src/mathed/math_panel.C +
9781 * src/insets/inseterror.C +
9782 * src/insets/insetinfo.C +
9783 * src/insets/inseturl.C +
9784 * src/insets/inseturl.h +
9787 * src/PaperLayout.C +
9788 * src/ParagraphExtra.C +
9789 * src/TableLayout.C +
9791 * src/layout_forms.C +
9798 * src/menus.C: fixed various resize issues. So now forms can be
9799 resized savely or not be resized at all.
9801 * forms/form_url.fd +
9802 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9805 * src/insets/Makefile.am: added files form_url.[Ch]
9807 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9809 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9810 (and presumably 6.2).
9812 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9813 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9814 remaining static member callbacks.
9816 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9819 * src/support/lyxstring.h: declare struct Srep as friend of
9820 lyxstring, since DEC cxx complains otherwise.
9822 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9824 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9826 * src/LaTeX.C (run): made run_bibtex also depend on files with
9828 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9829 are put into the dependency file.
9831 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9832 the code has shown itself to work
9833 (create_ispell_pipe): removed another warning, added a comment
9836 * src/minibuffer.C (ExecutingCB): removed code that has been
9837 commented out a long time
9839 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9840 out code + a warning.
9842 * src/support/lyxstring.h: comment out the three private
9843 operators, when compiling with string ansi conforming compilers
9846 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9848 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9849 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9852 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9855 * src/mathed/math_panel.C (create_math_panel): remove explicit
9858 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9861 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9862 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9863 to XCreatePixmapFromBitmapData
9864 (fl_set_bmtable_data): change the last argument to be unsigned
9866 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9867 and bh to be unsigned int, remove explicit casts in call to
9868 XReadBitmapFileData.
9870 * images/arrows.xbm: made the arrays unsigned char *
9871 * images/varsz.xbm: ditto
9872 * images/misc.xbm: ditto
9873 * images/greek.xbm: ditto
9874 * images/dots.xbm: ditto
9875 * images/brel.xbm: ditto
9876 * images/bop.xbm: ditto
9878 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9880 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9881 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9882 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9884 (LYX_CXX_CHEADERS): added <clocale> to the test.
9886 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9888 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9890 * src/support/lyxstring.C (append): fixed something that must be a
9891 bug, rep->assign was used instead of rep->append.
9893 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9896 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9897 lyx insert double chars. Fix spotted by Kayvan.
9899 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9901 * Fixed the tth support. I messed up with the Emacs patch apply feature
9902 and omitted the changes in lyxrc.C.
9904 1999-10-22 Juergen Vigna <jug@sad.it>
9906 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9908 * src/lyx_cb.C (MenuInsertRef) +
9909 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9910 the form cannot be resized under it limits (fixes a segfault)
9912 * src/lyx.C (create_form_form_ref) +
9913 * forms/lyx.fd: Changed Gravity on name input field so that it is
9916 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9918 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9919 <ostream> and <istream>.
9921 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9922 whether <fstream> provides the latest standard features, or if we
9923 have an oldstyle library (like in egcs).
9924 (LYX_CXX_STL_STRING): fix the test.
9926 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9927 code on MODERN_STL_STREAM.
9929 * src/support/lyxstring.h: use L{I,O}stream.h.
9931 * src/support/L{I,O}stream.h: new files, designed to setup
9932 correctly streams for our use
9933 - includes the right header depending on STL capabilities
9934 - puts std::ostream and std::endl (for LOStream.h) or
9935 std::istream (LIStream.h) in toplevel namespace.
9937 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9939 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9940 was a bib file that had been changed we ensure that bibtex is run.
9941 (runBibTeX): enhanced to extract the names of the bib files and
9942 getting their absolute path and enter them into the dep file.
9943 (findtexfile): static func that is used to look for tex-files,
9944 checks for absolute patchs and tries also with kpsewhich.
9945 Alternative ways of finding the correct files are wanted. Will
9947 (do_popen): function that runs a command using popen and returns
9948 the whole output of that command in a string. Should be moved to
9951 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9952 file with extension ext has changed.
9954 * src/insets/figinset.C: added ifdef guards around the fl_free
9955 code that jug commented out. Now it is commented out when
9956 compiling with XForms == 0.89.
9958 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9959 to lyxstring.C, and only keep a forward declaration in
9960 lyxstring.h. Simplifies the header file a bit and should help a
9961 bit on compile time too. Also changes to Srep will not mandate a
9962 recompile of code just using string.
9963 (~lyxstring): definition moved here since it uses srep.
9964 (size): definition moved here since it uses srep.
9966 * src/support/lyxstring.h: removed a couple of "inline" that should
9969 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9971 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9974 1999-10-21 Juergen Vigna <jug@sad.it>
9976 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9977 set to left if I just remove the width entry (or it is empty).
9979 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9980 paragraph when having dummy paragraphs.
9982 1999-10-20 Juergen Vigna <jug@sad.it>
9984 * src/insets/figinset.C: just commented some fl_free_form calls
9985 and added warnings so that this calls should be activated later
9986 again. This avoids for now a segfault, but we have a memory leak!
9988 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9989 'const char * argument' to 'string argument', this should
9990 fix some Asserts() in lyxstring.C.
9992 * src/lyxfunc.h: Removed the function argAsString(const char *)
9993 as it is not used anymore.
9995 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9997 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10000 * src/Literate.h: some funcs moved from public to private to make
10001 interface clearer. Unneeded args removed.
10003 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10005 (scanBuildLogFile): ditto
10007 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10008 normal TeX Error. Still room for improvement.
10010 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10012 * src/buffer.C (insertErrors): changes to make the error
10013 desctription show properly.
10015 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10018 * src/support/lyxstring.C (helper): changed to use
10019 sizeof(object->rep->ref).
10020 (operator>>): changed to use a pointer instead.
10022 * src/support/lyxstring.h: changed const reference & to value_type
10023 const & lets see if that helps.
10025 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10027 * Makefile.am (rpmdist): fixed to have non static package and
10030 * src/support/lyxstring.C: removed the compilation guards
10032 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10035 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10036 conditional compile of lyxstring.Ch
10038 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10039 stupid check, but it is a lot better than the bastring hack.
10040 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10042 * several files: changed string::erase into string::clear. Not
10045 * src/chset.C (encodeString): use a char temporary instead
10047 * src/table.C (TexEndOfCell): added tostr around
10048 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10049 (TexEndOfCell): ditto
10050 (TexEndOfCell): ditto
10051 (TexEndOfCell): ditto
10052 (DocBookEndOfCell): ditto
10053 (DocBookEndOfCell): ditto
10054 (DocBookEndOfCell): ditto
10055 (DocBookEndOfCell): ditto
10057 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10059 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10061 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10062 (MenuBuildProg): added tostr around ret
10063 (MenuRunChktex): added tostr around ret
10064 (DocumentApplyCB): added tostr around ret
10066 * src/chset.C (encodeString): added tostr around t->ic
10068 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10069 (makeLaTeXFile): added tostr around tocdepth
10070 (makeLaTeXFile): added tostr around ftcound - 1
10072 * src/insets/insetbib.C (setCounter): added tostr around counter.
10074 * src/support/lyxstring.h: added an operator+=(int) to catch more
10077 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10078 (lyxstring): We DON'T allow NULL pointers.
10080 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10082 * src/mathed/math_macro.C (MathMacroArgument::Write,
10083 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10084 when writing them out.
10086 * src/LString.C: remove, since it is not used anymore.
10088 * src/support/lyxstring.C: condition the content to
10089 USE_INCLUDED_STRING macro.
10091 * src/mathed/math_symbols.C, src/support/lstrings.C,
10092 src/support/lyxstring.C: add `using' directive to specify what
10093 we need in <algorithm>. I do not think that we need to
10094 conditionalize this, but any thought is appreciated.
10096 * many files: change all callback functions to "C" linkage
10097 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10098 strict_ansi. Those who were static are now global.
10099 The case of callbacks which are static class members is
10100 trickier, since we have to make C wrappers around them (see
10101 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10102 did not finish this yet, since it defeats the purpose of
10103 encapsulation, and I am not sure what the best route is.
10105 1999-10-19 Juergen Vigna <jug@sad.it>
10107 * src/support/lyxstring.C (lyxstring): we permit to have a null
10108 pointer as assignment value and just don't assign it.
10110 * src/vspace.C (nextToken): corrected this function substituting
10111 find_first(_not)_of with find_last_of.
10113 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10114 (TableOptCloseCB) (TableSpeCloseCB):
10115 inserted fl_set_focus call for problem with fl_hide_form() in
10118 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10120 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10123 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10125 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10126 LyXLex::next() and not eatline() to get its argument.
10128 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10130 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10131 instead, use fstreams for io of the depfile, removed unneeded
10132 functions and variables.
10134 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10135 vector instead, removed all functions and variables that is not in
10138 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10140 * src/buffer.C (insertErrors): use new interface to TeXError
10142 * Makefile.am (rpmdist): added a rpmdist target
10144 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10145 per Kayvan's instructions.
10147 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10149 * src/Makefile.am: add a definition for localedir, so that locales
10150 are found after installation (Kayvan)
10152 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10154 * development/.cvsignore: new file.
10156 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10158 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10159 C++ compiler provides wrappers for C headers and use our alternate
10162 * configure.in: use LYX_CXX_CHEADERS.
10164 * src/cheader/: new directory, populated with cname headers from
10165 libstdc++-2.8.1. They are a bit old, but probably good enough for
10166 what we want (support compilers who lack them).
10168 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10169 from includes. It turns out is was stupid.
10171 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10173 * lib/Makefile.am (install-data-local): forgot a ';'
10174 (install-data-local): forgot a '\'
10175 (libinstalldirs): needed after all. reintroduced.
10177 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10179 * configure.in (AC_OUTPUT): added lyx.spec
10181 * development/lyx.spec: removed file
10183 * development/lyx.spec.in: new file
10185 * po/*.po: merged with lyx.pot becuase of make distcheck
10187 * lib/Makefile.am (dist-hook): added dist-hook so that
10188 documentation files will be included when doing a make
10189 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10190 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10192 more: tried to make install do the right thing, exclude CVS dirs
10195 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10196 Path would fit in more nicely.
10198 * all files that used to use pathstack: uses now Path instead.
10199 This change was a lot easier than expected.
10201 * src/support/path.h: new file
10203 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10205 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10207 * src/support/lyxstring.C (getline): Default arg was given for
10210 * Configure.cmd: removed file
10212 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10214 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10215 streams classes and types, add the proper 'using' statements when
10216 MODERN_STL is defined.
10218 * src/debug.h: move the << operator definition after the inclusion
10221 * src/support/filetools.C: include "LAssert.h", which is needed
10224 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10227 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10228 include "debug.h" to define a proper ostream.
10230 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10232 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10233 method to the SystemCall class which can kill a process, but it's
10234 not fully implemented yet.
10236 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10238 * src/support/FileInfo.h: Better documentation
10240 * src/lyxfunc.C: Added support for buffer-export html
10242 * src/menus.C: Added Export->As HTML...
10244 * lib/bind/*.bind: Added short-cut for buffer-export html
10246 * src/lyxrc.*: Added support for new \tth_command
10248 * lib/lyxrc.example: Added stuff for new \tth_command
10250 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10252 * lib/Makefile.am (IMAGES): removed images/README
10253 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10254 installes in correct place. Check permisions is installed
10257 * src/LaTeX.C: some no-op changes moved declaration of some
10260 * src/LaTeX.h (LATEX_H): changed include guard name
10262 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10264 * lib/reLyX/Makefile.am: install noweb2lyx.
10266 * lib/Makefile.am: install configure.
10268 * lib/reLyX/configure.in: declare a config aux dir; set package
10269 name to lyx (not sure what the best solution is); generate noweb2lyx.
10271 * lib/layouts/egs.layout: fix the bibliography layout.
10273 1999-10-08 Jürgen Vigna <jug@sad.it>
10275 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10276 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10277 it returned without continuing to search the path.
10279 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10281 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10282 also fixes a bug. It is not allowed to do tricks with std::strings
10283 like: string a("hei"); &a[e]; this will not give what you
10284 think... Any reason for the complexity in this func?
10286 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10288 * Updated README and INSTALL a bit, mostly to check that my
10289 CVS rights are correctly set up.
10291 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10293 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10294 does not allow '\0' chars but lyxstring and std::string does.
10296 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10298 * autogen.sh (AUTOCONF): let the autogen script create the
10299 POTFILES.in file too. POTFILES.in should perhaps now not be
10300 included in the cvs module.
10302 * some more files changed to use C++ includes instead of C ones.
10304 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10306 (Reread): added tostr to nlink. buggy output otherwise.
10307 (Reread): added a string() around szMode when assigning to Buffer,
10308 without this I got a log of garbled info strings.
10310 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10313 * I have added several ostream & operator<<(ostream &, some_type)
10314 functions. This has been done to avoid casting and warnings when
10315 outputting enums to lyxerr. This as thus eliminated a lot of
10316 explicit casts and has made the code clearer. Among the enums
10317 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10318 mathed enums, some font enum the Debug::type enum.
10320 * src/support/lyxstring.h (clear): missing method. equivalent of
10323 * all files that contained "stderr": rewrote constructs that used
10324 stderr to use lyxerr instead. (except bmtable)
10326 * src/support/DebugStream.h (level): and the passed t with
10327 Debug::ANY to avoid spurious bits set.
10329 * src/debug.h (Debug::type value): made it accept strings of the
10330 type INFO,INIT,KEY.
10332 * configure.in (Check for programs): Added a check for kpsewhich,
10333 the latex generation will use this later to better the dicovery of
10336 * src/BufferView.C (create_view): we don't need to cast this to
10337 (void*) that is done automatically.
10338 (WorkAreaButtonPress): removed some dead code.
10340 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10342 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10343 is not overwritten when translated (David Sua'rez de Lis).
10345 * lib/CREDITS: Added David Sua'rez de Lis
10347 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10349 * src/bufferparams.C (BufferParams): default input encoding is now
10352 * acinclude.m4 (cross_compiling): comment out macro
10353 LYX_GXX_STRENGTH_REDUCE.
10355 * acconfig.h: make sure that const is not defined (to empty) when
10356 we are compiling C++. Remove commented out code using SIZEOF_xx
10359 * configure.in : move the test for const and inline as late as
10360 possible so that these C tests do not interefere with C++ ones.
10361 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10362 has not been proven.
10364 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10366 * src/table.C (getDocBookAlign): remove bad default value for
10367 isColumn parameter.
10369 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10371 (ShowFileMenu2): ditto.
10373 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10374 of files to ignore.
10376 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10378 * Most files: finished the change from the old error code to use
10379 DebugStream for all lyxerr debugging. Only minor changes remain
10380 (e.g. the setting of debug levels using strings instead of number)
10382 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10384 * src/layout.C (Add): Changed to use compare_no_case instead of
10387 * src/FontInfo.C: changed loop variable type too string::size_type.
10389 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10391 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10392 set ETAGS_ARGS to --c++
10394 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10396 * src/table.C (DocBookEndOfCell): commented out two unused variables
10398 * src/paragraph.C: commented out four unused variables.
10400 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10401 insed a if clause with type string::size_type.
10403 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10406 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10408 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10409 variable, also changed loop to go from 0 to lenght + 1, instead of
10410 -1 to length. This should be correct.
10412 * src/LaTeX.C (scanError): use string::size_type as loop variable
10415 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10416 (l.896) since y_tmp and row was not used anyway.
10418 * src/insets/insetref.C (escape): use string::size_type as loop
10421 * src/insets/insetquotes.C (Width): use string::size_type as loop
10423 (Draw): use string::size_type as loop variable type.
10425 * src/insets/insetlatexaccent.C (checkContents): use
10426 string::size_type as loop variable type.
10428 * src/insets/insetlabel.C (escape): use string::size_type as loop
10431 * src/insets/insetinfo.C: added an extern for current_view.
10433 * src/insets/insetcommand.C (scanCommand): use string::size_type
10434 as loop variable type.
10436 * most files: removed the RCS tags. With them we had to recompile
10437 a lot of files after a simple cvs commit. Also we have never used
10438 them for anything meaningful.
10440 * most files: tags-query-replace NULL 0. As adviced several plases
10441 we now use "0" instead of "NULL" in our code.
10443 * src/support/filetools.C (SpaceLess): use string::size_type as
10444 loop variable type.
10446 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10448 * src/paragraph.C: fixed up some more string stuff.
10450 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10452 * src/support/filetools.h: make modestr a std::string.
10454 * src/filetools.C (GetEnv): made ch really const.
10456 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10457 made code that used these use max/min from <algorithm> instead.
10459 * changed several c library include files to their equivalent c++
10460 library include files. All is not changed yet.
10462 * created a support subdir in src, put lyxstring and lstrings
10463 there + the extra files atexit, fileblock, strerror. Created
10464 Makefile.am. edited configure.in and src/Makefile.am to use this
10465 new subdir. More files moved to support.
10467 * imported som of the functions from repository lyx, filetools
10469 * ran tags-query-replace on LString -> string, corrected the bogus
10470 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10471 is still some errors in there. This is errors where too much or
10472 too litle get deleted from strings (string::erase, string::substr,
10473 string::replace), there can also be some off by one errors, or
10474 just plain wrong use of functions from lstrings. Viewing of quotes
10477 * LyX is now running fairly well with string, but there are
10478 certainly some bugs yet (see above) also string is quite different
10479 from LString among others in that it does not allow null pointers
10480 passed in and will abort if it gets any.
10482 * Added the revtex4 files I forgot when setting up the repository.
10484 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10486 * All over: Tried to clean everything up so that only the files
10487 that we really need are included in the cvs repository.
10488 * Switched to use automake.
10489 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10490 * Install has not been checked.
10492 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10494 * po/pt.po: Three errors:
10495 l.533 and l.538 format specification error
10496 l. 402 duplicate entry, I just deleted it.