1 2000-11-20 Marko Vendelin <markov@ioc.ee>
3 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
5 * src/frontends/gnome/Makefile.am: updated list of XForms object files
7 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
10 * src/lyxrc.C (getDescription): changed some comments as suggested by
13 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
14 disconnect the redrawGUI signal in best-practice fashion.
16 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
17 long_opts_tab to reflect the change in name of this tabfolder, as
18 suggested by Rob Lahaye.
19 (connect, disconnect): new methods. Don't do much at present other than
20 ensuring that we can't resize the dialog. This just makes xforms go
22 (lots of methods in Colors): made void rather than bool. The idea is
23 to have an isOk() function that keeps track of whether any input is
24 genuinely invalid and should therefore block Save, Apply.
25 Easier to manipulate the counters rapidly.
26 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
27 compiler will like this code. Much cleaner way of doing things.
29 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
31 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
32 rather than simple counters, following suggestion by Rob Lahaye.
34 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
35 than engraved frame + text.
37 * src/frontends/xforms/forms/makefile: removed spurious command.
39 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
41 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
43 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
46 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
48 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
49 see what Lars has changed and what is just white space!
50 Now used X directly to ascertain the RGB color associated with the
52 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
54 Added some sort capability.
55 The X11 color name database input is only displayed if the database
56 isn't found in the standard place.
57 Got rid of struct compare_converter; it wasn't used.
58 Probably some other stuff that I've forgotten.
60 * src/frontends/xforms/FormPreferences.h: changed the names of some
61 methods in the Colors struct. Added a couple of structs to help sort
62 colors by name and by RGBColor.
64 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
65 functions into a new class RWInfo.
67 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
68 The dialog is now almost navigable using the keyboard. Unfortunately,
69 the cursor has to be inside a browser for it to be activated. There is
70 no visual feedback for the key shortcuts to the arrow keys (use
71 Alt-appropriate arrow key, Alt-x).
73 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
76 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
77 xform_helpers.[Ch]. See above.
79 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
81 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
83 * src/screen.C (setCursorColor): new method. Sets the color of the
85 (ShowManualCursor): call it.
86 Constify some local variables.
88 * src/LColor.[Ch] (LColor): add entry for cursor
89 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
92 2000-11-19 Juergen Vigna <jug@sad.it>
94 * src/insets/insettabular.C (draw): fixed text border redraw problem.
95 (calculate_dimensions_of_cells): try to boost up when inserting chars.
97 2000-11-15 Rob Lahaye <lahaye@postech.edu>
99 * lib/ui/default.ui: OptItem used for Fax entry
101 2000-11-17 Matej Cepl <cepl@bigfoot.com>
103 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
105 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
107 * src/vspace.C (nextToken): fix so it can handle length phrases like
108 "10mm+-20mm", "40inplus16mmminus10cm" etc.
110 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
112 * src/frontends/xforms/FormPreferences.C: constify several variables
113 (BrowserLyX): rewrite to not need the choice variable
114 (Modify): rewrite to not need the choide variable
115 (compare_converter): make operator const
117 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
118 correct the writing of \set_color
119 (getDescription): return a const string
121 * src/kbsequence.[Ch] (addkey): remove dead code
123 * src/Painter.C (text): remove some commented code
125 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
127 * src/ColorHandler.[Ch]: removed some header files from .h file.
128 Included LColor.h in .C file.
130 * src/LColor.[Ch]: made class copyable so that I could create a
131 system_lcolor instance.
133 * src/Painter.h: removed LColor.h.
135 * src/lyx_gui.C (create_forms): used AddName.
137 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
138 of user preferences/lyxrc file.
140 * src/lyxrc.C (output): output changes to lcolor.
142 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
144 Moved class xformColor to files xform_helpers.[Ch]. These files,
145 Color.[Ch], could now be moved into src if they would be useful to
148 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
149 Also moved FormPreferences::browseFile here as it can be used by any
150 xform dialog with a "Browse" button. FormGraphics is a perfect example.
152 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
153 ReadableFile): changed the FormPreferences methods a little and moved
154 them here as they'll be useful elsewhere also.
156 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
157 Removed some header files and used forward declarations instead.
159 Removed some methods as they'll be useful elsewhere (see above).
161 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
162 Can also now modify the LyX LColors. However, for reasons that I don't
163 yet understand, it appears that we can use
164 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
165 present. The problem appears to lie in ColorHandler, because I can
166 change the color using LColor.SetColor(). Similarly, when reading in a
167 preferences file with some set_color instances, I'll get a warning
168 like: Color sea green is undefined or may not be redefined
169 Bad lyxrc set_color for sea green
171 Once the buffer is loaded, however, I can happily change to this color.
173 Finally, it appears that I have to set the color of "inset frame"
174 explicitly, or it oscillates from "black" to "indian red" with each
177 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
179 * ANNOUNCE: corrected a spelling mistake.
181 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
184 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
186 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
188 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
191 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
192 match the requirements from the standard better. This is required
193 to work with gnu libstdc++-v3
195 * src/frontends/xforms/FormPreferences.C: add explict pair
196 arguments to browse calls. include support/lyxmanip.h remvoe
197 extern fmt. whitespace changes. reorder variables in
198 FormPreferences.h, to match initalizaton order.
200 * several files: constify more local variables.
202 * src/buffer.C: remove some commented functions.
204 * src/DepTable.C (remove_files_with_extension): temporary
205 work around for gcc 2.97
206 * src/filedlg.C (find): ditto
207 * src/Variables.C (set): ditto
208 * src/LyXAction.C (searchActionArg): ditto
209 (retrieveActionArg): ditto
211 * configure.in: check for mktemp too
213 * UPGRADING: prepare for 1.1.6
215 * Makefile.am (lgbtags): add backup tags for when etags are
216 different than usual.
218 * ANNOUNCE: prepare for 1.1.6
220 * src/support/tempname.C (make_tempfile): new function, wrapper
221 around mkstemp and mktemp. Only mkstemp has been tested.
224 2000-11-14 Rob Lahaye <lahaye@postech.edu>
226 * default.ui: capitalized some menu items to improve shortcuts.
228 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
230 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
232 * src/frontends/xforms/Dialogs.C: add "using" directive.
234 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
236 * src/filedlg.C (Select): highlight suggested file in browser, if
239 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
240 each tab folder is encapsulated in its own class.
241 The Language keymaps are now chosen using a text input and a
242 browser button, rather than a Combox.
243 All the browser buttons are now functional, although LyXFileDlg
244 still needs to be modified to make it straighhtforward to return a
245 directory if that is what is desired.
247 * src/frontends/xforms/forms/form_preferences.fd: use text input
248 and browse button to input the Language keymaps. Add a few
249 callbacks for the browse buttons.
251 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
253 * src/support/tempname.C (tempName): small changes to make it
254 safer. remove the '.' before XXXXXX
256 * src/support/filetools.C (TmpFileName): remove func
259 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
260 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
261 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
262 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
264 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
267 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
270 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
271 for bp (this fixes a reproducible hard crash)
273 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
276 * src/frontends/xforms/FormBase.h: make bp_ private
277 (FormBaseBI): remove default for bp
280 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
283 * src/frontends/xforms/Color.C (RGBColor): made several vars
284 const, changed initialization of j to allow it to be const
287 * several files: added const to local variables.
289 * src/lyx_cb.C: removed several function prototypes and moved them
293 (UpdateLayoutPreamble):
295 (MenuInsertLabel): add BufferView as arguemnt
296 (LayoutsCB): make tmp const
298 * src/layout_forms.h: regenerated
300 * src/debug.C: add Debug::FILES
301 (showLevel) (showTags): translate the desc
303 * src/debug.h: add FILES as debug target
305 * src/bufferlist.C: use current_view as an interim measure becuase
306 of added arguments to MenuWrite and MenuWriteAs
308 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
310 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
312 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
313 libstdc++ is compiled with.
315 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
317 * lib/layouts/docbook-book.layout
318 * lib/layouts/docbook.layout
319 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
320 those paragraphs are expresse as SGML comments <!-- -->.
322 * src/LaTeXFeatures.h
323 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
324 parameter, this allows to express all the include files as relative
325 paths to the master buffer. The verbatim insert works as the other
328 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
330 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
332 (MakeDocBookFile): top_element is always written. Some clean up, as
333 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
335 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
336 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
337 a reference is written instead of the name.
338 (Validate): use the relative path for the filename.
340 * src/insets/insetlabel.C (DocBook): write end tag, for XML
343 * src/support/filetools.h
344 * src/support/filetools.C (IsSGMLFilename): added.
347 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
349 * development/OS2/quick_fix.patch:
351 * README.OS2: quick update to the OS/2 port.
353 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
355 * src/converter.C: add "using" directive.
357 * src/frontends/xforms/FormPreferences.C: add "using" directive.
358 (compare_converter): add "int" as return type.
360 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
363 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
365 * src/lyx_gui.C (create_forms): map the xform colours, should a
366 mapping exist. Ie, call XformColor::read().
368 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
369 and struct HSV as HSVColor.
370 (XformColor::read, XformColor::write) : new methods that
371 input/output any changes to the cform GUI colors.
373 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
376 * src/frontends/xforms/FormPreferences.C Lots of little changes
377 associated with the changed name of the RGB and HSV structs. Can
378 now save changes to xforms GUI to file. Commented out
379 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
380 used currently anyway.
382 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
384 * src/converter.C: A lot of changes:
385 - It is no longer possible to choose between two or more ways to
386 export to some format (the new code uses only the shortest path).
387 However, it is still possible to choose between pdflatex/ps2pdf
388 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
389 - Added several methods that makes the FormPreferences code simpler.
390 - Changed the tokens $$FName and $$OutName to $$i and $$o.
392 * src/exporter.C (Export): lyxrc.use_pdf is set before
393 makeLaTeXFile is called. This works but not very nice.
395 * src/frontends/xforms/FormPreferences.C: The formats/converters
396 tabs are now fully functional.
398 * src/buffer.C (getTocList): Add numbers to the captions.
400 * lib/lyxrc.example: Removed fax section
402 * src/support/rename.C (rename): Delete the old file if lyx::copy
405 2000-11-13 Rob Lahaye <lahaye@postech.edu>
407 * lib/ui/default.ui: minor polishing.
409 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
411 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
414 * lib/Makefile.am (DOCINST): do not install everything in the
415 documentation directory.
417 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
419 * src/bufferlist.C (newFile): set the filename to the constructed
422 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
423 constructed "newfileXX.lyx" name to the dialog
425 * src/frontends/DialogBase.h: make update() non-abstract so
426 KDE doesn't need to implement two update methods for every form
428 * src/frontends/kde/Makefile.am: add missing xforms objects
431 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
433 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
435 * src/frontends/xforms/Color.[Ch]: new files, defining the color
436 structs RGB and HSV. May not be the best place for these files.
437 Perhaps move them into src ?
439 * src/frontends/xforms/Makefile.am: added new files.
441 * src/frontends/xforms/forms/form_preferences.fd:
442 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
443 replaced all instances of "colour" with "color"!
445 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
448 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
449 tab. Can now alter the colors of the xform's GUI on the fly. With
450 the aid of a single static Signal (see below), can "Apply" these
451 changes to all currently open dialogs. (Well, to all of the NEW
452 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
453 subsequently opened dialogs will, of course, also have the new
454 color scheme. Cannot yet save (or load) the choices to file, so
455 they are lost when exiting LyX.
457 * src/frontends/Dialogs.h:
458 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
459 Used to trigger a redraw of any dialogs connected to it because,
460 for example, the GUI colours have been re-mapped.
462 * src/frontends/xforms/FormBase.[Ch]:
463 * src/frontends/xforms/FormDocument.[Ch]:
464 * src/frontends/xforms/FormParagraph.[Ch]:
465 * src/frontends/xforms/FormPreferences.[Ch]:
466 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
467 method, to be connected to Dialogs::redrawGUI. Method must be
468 virtual, because dialogs with tabbed folders need to redraw the
469 forms of each tab folder.
471 * src/LyXView.C (d-tor):
472 * src/frontends/xforms/FormBase.C (d-tor): connected
473 Dialogs::redrawGUI signal to redraw().
475 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
476 removed Assert, because it is identical to that in FormBase.
478 2000-11-10 Rob Lahaye <lahaye@postech.edu>
480 * lib/ui/default.ui: minor polishing.
482 2000-11-10 Juergen Vigna <jug@sad.it>
484 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
485 (deleteLyXText): ditto
487 * src/insets/insettabular.C (InsetButtonPress): don't clear the
488 selection on mouse-button-3.
490 * src/insets/insettabular.h: new function clearSelection(), use this
491 functions inside insettabular.C.
493 * src/insets/insettabular.C (TabularFeatures): clear the selection
494 on remove_row/column.
496 * src/insets/inset.C (scroll): fixed some scroll stuff.
498 * src/insets/insettabular.C (draw): fixed another minor draw problem.
500 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
502 * lib/CREDITS: add Yves Bastide
504 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
506 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
507 check whether C library functions are in the global namespace.
509 * configure.in: calls it.
511 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
514 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
516 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
517 iterators to prevent crash.
519 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
521 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
523 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
524 shortcut for xforms CB to the preemptive or post-handler function.
526 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
527 removed the HIDDEN_TIMER as it's no longer used.
528 Various other small changes.
530 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
531 preemptive handler to obtain feedback, rather than the post-handler.
532 (ColoursLoadBrowser): find "black" and "white" based on RGB values
534 Formats tab is now complete. Converters tab is nearly so.
536 2000-11-09 Juergen Vigna <jug@sad.it>
538 * src/insets/insettext.C (~InsetText):
541 (SetParagraphData): set cache.second to 0 after deleting it!
542 (getLyXText): check if cache.second is not 0 if finding it.
544 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
546 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
547 lyxlex to parse the rgb.txt file.
550 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
551 replace the default '#' comment character.
553 * src/support/tempname.C: add "using" directive
554 * src/frontends/ButtonPolicies.C: ditto.
556 * src/support/filetools.C (DirList): add an explicit cast to avoid
557 a compile error (probably not the right fix)
559 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
561 * src/support/filetools.C (DirList): implement using system functions
563 * src/support/tempname.C: new file
565 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
567 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
569 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
572 * src/frontends/xforms/ButtonController.C: new file
574 * src/os2_defines.h: remove getcwd define
576 * src/lyxvc.C: include support/lyxlib.h
577 (showLog): use lyx::tempName
579 * src/lyx_cb.C: comment out includes that we don't need
580 (AutoSave): use lyx::tempName
582 * src/filedlg.C: include support/lyxlib.h
583 (Reread): use lyx::getcwd
585 * src/converter.C: include support/filetools.h
586 (add_options): change to static inline, make tail const
587 (Add): make old_viewer const
588 (GetAllFormats): make it a const method, use const_iterator
589 (enable): make static inline
590 (SplitFormat): make using_format const
592 * src/LaTeX.C (run): use lyx::getcwd
594 * configure.in: check for mkstemp as well
596 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
598 * src/converter.[Ch] (GetAllCommands): new method.
600 * src/support/filetools.[Ch] (DirList): new method.
602 * src/frontends/xforms/FormPreferences.C: started (just!) adding
603 functionality to the converters tab.
604 The formats tab is now nearly complete.
605 The kbmap choices in Languages tab now display the contents of
606 system_lyxdir/kbd/*.kmap in readable form.
608 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
609 Moved some variables into the class.
611 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
612 inactive tab folder to FL_COL1. Haven't yet worked out how to change
613 colour of active folder to lighter grey instead. Any takers?
614 (form_colours): added an "Apply" button.
615 (form_converters): added a "Flags" input field.
616 (form_formats): added a "Shortcut" input field. Note that we can't use
617 names such as "input_shortcut" as this buggers up the sed script stuff.
619 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
627 * src/lyx_sendfax_main.C:
630 * src/spellchecker.C:
631 * src/insets/figinset.C:
632 * src/insets/insetbib.C:
633 * src/insets/insetexternal.C:
634 * src/insets/insetinclude.C:
635 * src/insets/insetinfo.C:
636 * src/mathed/math_panel.C:
637 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
638 all "daughter" dialogs now have identical "feel".
640 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
642 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
643 used (and was only used in one place prior to this patch. Incorrectly!)
645 * src/frontends/xforms/FormDocument.C: changed some instances of
646 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
647 sense. Also added fl_set_input_return() for class_->input_doc_extra and
648 for options_->input_float_placement. This fixes a bug reported by
651 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
652 functionality into d-tor.
654 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
655 input of numerals also.
657 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
658 fl_set_form_atclose(). Can now close dialog from window manager,
659 fixing a bug reported by Rob Lahaye.
661 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
663 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
664 are no longer dark. Haven't yet worked out how to lighten the colour of
665 the active tabfolder. Any ideas anybody?
666 Adjusted Colours tab a little.
667 Added Shortcut field to converters tab. Note that we can't create an
668 fdesign label like "input_shortcut" as this buggers up the sed-script
671 * src/frontends/xforms/FormPreferences.[Ch]:
672 (feedback): fixed crash due to to ob=0.
673 (LanguagesXXX): the kbmap choices now contain the files
674 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
675 be replaced by an input with a file browse button, but since the browse
676 buttons don'y yet work, this'll do for the moment.
677 (FormatsXXX): think that this is now nearly fully functional.
678 Some points/questions though:
679 1. Does "Apply" remove formats if no longer present?
680 2. I think that the browser should list the GUI names rather than the
682 3. Must ensure that we can't delete Formats used by an existing
685 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
686 if this is the best way to do this.
688 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
690 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
692 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
693 for variable assignment.
695 2000-11-07 Rob Lahaye <lahaye@postech.edu>
697 * src/lib/ui/default.ui: added sub/superscripts to menu as
698 Insert->Special characters and cleaned-up the file a bit
700 2000-11-07 Allan Rae <rae@lyx.org>
702 * src/frontends/xforms/FormPreferences.C (feedback): make sure
703 ob isn't 0 before using it. See comments in function.
705 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
707 * src/frontends/xforms/form_*.C: regenerated
709 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
711 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
713 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
714 compiling with gcc-2.96
716 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
718 * src/support/lyxstring.C: add a couple "using" directives.
720 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
721 a .c_str() here too for good measure.
722 * src/Spacing.C (set): ditto.
723 * src/lyxfunc.C (Dispatch): ditto.
725 * src/insets/insettabular.C (copySelection): change .str() to
726 .str().c_str() to fix problems with lyxstring.
727 * src/support/filetools.C (GetFileContents): ditto.
728 * src/buffer.C (asciiParagraph): ditto.
729 * src/paragraph.C (String): ditto.
731 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
732 * lib/bind/sciword.bind: ditto.
734 * src/LyXAction.C (init): remove "symbol-insert" function, which
735 shared LFUN_INSERT_MATH with "math-insert".
737 * lib/configure.m4: == is not a valid operator for command test.
739 * src/lyxrc.C: add using directive.
741 * src/converter.h: add std:: qualifier.
743 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
745 * src/converter.[Ch] and other files: Change the Format class to a
746 real class, and create two instances: formats and system_format.
748 * src/lyxrc.C (output): Output the difference between formats and
751 * src/frontends/xforms/FormPreferences.C (input): Simplify.
752 (buildFormats): Insert formats into browser.
753 (inputFormats): Made the browser and add button functional.
754 (applyFormats): Update formats from format_vec.
756 * src/converter.C: Changed all (*it). to it->
757 (Format::dummy): New method.
758 (Format::importer): New format flag.
759 (Formats::GetAllFormats): New method.
760 (Formats::Add): Delete format from the map if prettyname is empty.
761 (Converter::Convert): Print an error message if moving the file fails.
762 (Converter::GetReachableTo): New method
764 * src/MenuBackend.[Ch]: Add support for importformats tag.
766 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
768 * lib/configure.m4: Add word->tex and ps->fax converters.
770 * lib/ui/default.ui: Use ImportFormats on file->import menu.
771 Return fax to file menu.
775 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
777 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
780 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
783 * src/lyxfunc.C (processKeyEvent): removed
785 * src/bufferlist.C (emergencyWrite): removed the out commented
786 emergency write code.
788 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
790 * src/LyXView.[Ch]: remove the outcommented raw_callback code
792 * many files: change formatting to be a bit more uniform for
793 if,while,for,switch statements, remove some parantesis not needed.
796 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
798 * config/kde.m4: make config more robust when KDEDIR is set
800 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
802 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
803 not returned a pixmap for "math-insert".
805 * src/LyXAction.C (init): sort the entries a bit.
807 2000-11-03 Juergen Vigna <jug@sad.it>
809 * src/insets/insettabular.h: added fixed number to update codes so
810 that update is only in one direction.
812 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
815 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
816 before call to edit because of redraw.
818 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
820 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
822 * lib/ui/default.ui: Populate "edit_float" menu
824 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
826 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
827 "floats-operate". The name is ugly (and the func also), but this
828 is just a band-aid until we switch to new insets.
830 2000-11-03 Rob Lahaye <lahaye@postech.edu>
832 * lib/ui/default.ui: update again the menu layout (fix some
835 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
837 * src/MenuBackend.h (fulllabel): new method.
839 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
840 the menu shortcuts of a menu are unique and whether they
841 correspond to a letter of the label.
842 (expand): call checkShortcuts when debugging.
844 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
846 * src/insets/insettext.C (InsetButtonPress): shut off warning.
848 2000-11-02 Lior Silberman <lior@Princeton.EDU>
850 * lib/examples/*.lyx : '\language default' => '\language english'
852 * lib/examples/it_splash.lyx : except where it should be italian
854 * lib/templates/*.lyx : the same
856 * doc/*.lyx* : the same
858 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
860 * lib/bind/menus.bind: remove the Layout menu entries, which I
861 somehow forgot earlier.
863 2000-11-03 Rob Lahaye <lahaye@postech.edu>
865 * lib/ui/old-default.ui: keep the old one here for reference (to
868 * lib/ui/default.ui: update the menu layout
870 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
872 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
873 Can now Apply to different insets without closing the dialog.
875 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
876 Can't actually DO anything with them yet, but I'd like a little
879 * src/frontends/xforms/input_validators.[ch]
880 (fl_lowercase_filter): new.
882 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
884 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
885 of MATH_CODE. This fixes a bug with math-macros in RTL text.
887 * src/text.C (PrepareToPrint): Show math-macros block aligned.
889 2000-11-02 Juergen Vigna <jug@sad.it>
891 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
892 on char insertion as it has already be updated by bv->updateInset().
894 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
895 if an inset inside was updated.
897 * lib/configure.cmd: commented out fax-search code
899 2000-11-01 Yves Bastide <stid@acm.org>
901 * src/tabular.C (OldFormatRead): set tabular language to the
904 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
906 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
907 class names with non-letter characters (from Yves Bastide).
909 * lib/ui/default.ui: change Item to OptItem in import menu.
910 Comment out fax stuff.
912 * lib/configure.m4: comment out fax-related stuff.
914 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
916 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
917 useful xforms helper functions. At present contains only formatted().
918 Input a string and it returns it with line breaks so that in fits
921 * src/frontends/xforms/Makefile.am: add new files.
923 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
924 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
927 * src/frontends/xforms/FormPreferences.[Ch]:
928 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
929 but lots of little clean ups. Removed enum State. Make use of
930 formatted(). Constify lots of methods. Perhaps best of all: removed
931 requirement for that horrible reinterpret_cast from pointer to long in
934 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
936 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
937 conditionalize build on xforms < 0.89
939 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
941 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
943 * src/LyXAction.C (init): comment out fax
945 * src/lyxrc.h: comment out the fax enums
946 comment out the fax variables
948 * src/commandtags.h: comment out LFUN_FAX
950 * src/lyxrc.C: disable fax variables.
951 (read): disable parsing of fax variables
952 (output): disable writing of fax variables
953 (getFeedback): now description for fax variables
955 * src/lyxfunc.C: comment out MenuFax
956 (Dispatch): disable LFUN_FAX
958 * src/lyx_cb.C (MenuFax): comment out
960 * src/WorkArea.C: add <cctype>
961 (work_area_handler): better key handling, should be ok now.
962 for accented chars + etc
964 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
965 lyx_sendfax.h and lyx_sendfax_man.C
967 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
968 (show): don't call InitLyXLookup when using xforms 0.89
970 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
972 * src/trans.C (AddDeadkey): better fix, the other one could crash...
974 * src/support/filetools.C (GetFileContents): close to dummy change
976 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
978 * src/trans.C (AddDeadkey): workaround stupid compilers.
980 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
982 * src/frontends/xforms/FormDocument.C (class_update): fix setting
983 of two-sided document.
985 2000-10-31 Juergen Vigna <jug@sad.it>
987 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
989 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
990 xposition to the Edit call.
992 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
994 * src/trans.C (AddDeadkey): cast explicitly to char.
996 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
998 * src/tabular.C (AsciiBottomHLine): simplify?
999 (AsciiTopHLine): simplify?
1000 (print_n_chars): simplify
1001 (DocBook): remove most of the << endl; we should flush the stream
1002 as seldom as possible.
1004 (TeXBottomHLine): ditto
1005 (TeXTopHLine): ditto
1007 (write_attribute): try a templified version.
1008 (set_row_column_number_info): lesson scope of variables
1010 * src/support/lstrings.h (tostr): new specialization of tostr
1012 * src/trans.C (AddDeadkey): slightly cleaner fix.
1014 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1016 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1017 '%%' in Toc menu labels.
1020 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1021 font_norm is iso10646-1.
1023 * src/font.C (ascent): Fixed for 16bit fonts
1024 (descent,lbearing,rbearing): ditto
1026 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1028 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1029 (getFeedback): new static method.
1031 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1032 Now use combox rather than choice to display languages.
1033 Feedback is now output using a new timer callback mechanism, identical
1034 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1036 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1038 * src/minibuffer.C: fix for older compilers
1040 2000-10-30 Juergen Vigna <jug@sad.it>
1042 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1043 has to be Left of the inset otherwise LyXText won't find it!
1045 * src/BufferView2.C (open_new_inset): delete the inset if it can
1048 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1050 * lyx.man: fix typo.
1052 2000-10-29 Marko Vendelin <markov@ioc.ee>
1053 * src/frontends/gnome/FormCitation.C
1054 * src/frontends/gnome/FormCitation.h
1055 * src/frontends/gnome/FormCopyright.C
1056 * src/frontends/gnome/FormCopyright.h
1057 * src/frontends/gnome/FormError.C
1058 * src/frontends/gnome/FormError.h
1059 * src/frontends/gnome/FormIndex.C
1060 * src/frontends/gnome/FormIndex.h
1061 * src/frontends/gnome/FormPrint.C
1062 * src/frontends/gnome/FormPrint.h
1063 * src/frontends/gnome/FormRef.C
1064 * src/frontends/gnome/FormRef.h
1065 * src/frontends/gnome/FormToc.C
1066 * src/frontends/gnome/FormToc.h
1067 * src/frontends/gnome/FormUrl.C
1068 * src/frontends/gnome/FormUrl.h
1069 * src/frontends/gnome/Menubar_pimpl.C
1070 * src/frontends/gnome/mainapp.C
1071 * src/frontends/gnome/mainapp.h
1072 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1073 changing update() to updateSlot() where appropriate
1075 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1077 * src/frontends/xforms/FormPreferences.[Ch]:
1078 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1081 2000-10-28 Juergen Vigna <jug@sad.it>
1083 * src/insets/insettabular.C (draw): fixed drawing bug.
1085 * src/insets/insettext.C (clear):
1087 (SetParagraphData): clearing the TEXT buffers when deleting the
1088 paragraphs used by it.
1090 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1092 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1094 2000-10-27 Juergen Vigna <jug@sad.it>
1096 * src/tabular.C (~LyXTabular): removed not needed anymore.
1098 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1101 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1103 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1106 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1109 * src/frontends/xforms/FormPreferences.[Ch]:
1110 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1111 Reorganised as modules based on tabs. Much easier to follow the
1112 flow and to add new tabs. Added warning and feedback messages.
1115 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1117 * src/tabular.h (DocBook): add std:: qualifier.
1119 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1121 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1122 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1125 * insettabular.C (DocBook): uses the tabular methods to export
1128 * src/insets/insettext.h
1129 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1131 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1133 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1136 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1137 moved misplaced AllowInput two lines up.
1139 * src/buffer.C (readFile): compare float with float, not with int
1141 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1143 * src/minibuffer.C: add "using SigC::slot" statement.
1145 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1147 * src/frontends/xforms/forms/README: updated section about make.
1149 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1150 Tidied some forms up, made two of form_tabular's tabs more
1151 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1152 fixed translation problem with "Column".
1154 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1156 * src/minibuffer.h: use Timeout instead of the xforms timer
1158 (setTimer) rewrite for the Timeout, change to unsigned arg
1159 (set): change to unsigned timer arg
1162 * src/minibuffer.C (TimerCB): removed func
1163 (C_MiniBuffer_TimerCB): removed func
1164 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1165 (peek_event): use a switch statement
1166 (add): don't use fl_add_timer.
1167 (Set): rewrite to use the Timeout
1170 * src/Timeout.[Ch] (setType): return a Timeout &
1171 (setTimeout): ditto, change to unsigned arg for timeout
1173 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1175 * src/mathed/formula.C (mathed_string_width): Use string instead
1176 of a constant size char array.
1178 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1180 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1181 the two recently added operator<< for SMInput and State.
1183 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1185 (OkCancelPolicy): ditto
1186 (OkCancelReadOnlyPolicy): ditto
1187 (NoRepeatedApplyReadOnlyPolicy): ditto
1188 (OkApplyCancelReadOnlyPolicy): ditto
1189 (OkApplyCancelPolicy): ditto
1190 (NoRepeatedApplyPolicy): ditto
1192 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1194 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1195 add the usual std:: qualifiers.
1197 2000-10-25 Juergen Vigna <jug@sad.it>
1199 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1201 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1203 * src/support/filetools.C (MakeRelPath): change some types to
1206 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1207 ButtonPolicy::SMInput and ButtonPolicy::State.
1209 * src/FontLoader.C (reset): small cleanup
1210 (unload): small cleanup
1212 * src/FontInfo.C (getFontname): initialize error to 10000.0
1214 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1216 * src/frontends/xforms/FormPreferences.[Ch]:
1217 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1218 TeX encoding and default paper size sections.
1220 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1222 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1225 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1226 make the message_ empty.
1227 (FormError): don't initialize message_ in initializer list.
1229 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1231 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1233 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1235 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1237 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1239 * src/frontends/kde/*data.[Ch]: _("") is not
1242 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1244 * src/buffer.C: removed redundant using directive.
1246 * src/frontends/DialogBase.h: revert to original definition of
1249 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1250 stuff into two classes, one for each dialog, requires a new
1251 element in the dialogs vector, FormTabularCreate.
1253 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1256 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1257 method. Continues Allan's idea, but means that derived classes
1258 don't need to worry about "update or hide?".
1260 * src/frontends/xforms/FormError.C (showInset): add connection
1263 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1264 one for each dialog. FormTabular now contains main tabular dialog
1267 * src/frontends/xforms/FormTabularCreate.[Ch]:
1268 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1271 * src/frontends/xforms/FormGraphics.[Ch]:
1272 * src/frontends/xforms/forms/form_graphics.fd
1273 * src/frontends/xforms/FormTabular.[Ch]:
1274 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1275 classes of FormInset.
1277 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1278 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1280 * src/frontends/xforms/Makefile.am:
1281 * src/frontends/xforms/forms/makefile: added new files.
1283 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1284 variable. added Signal0 hide signal, in keeping with other GUI-I
1287 * src/support/lstrings.h: removed redundant std:: qualifier as
1288 it's already declared in Lsstream.h.
1290 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1292 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1296 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1298 * src/tabular.C (Ascii): minimize scope of cell.
1300 * src/BufferView2.C (nextWord): return string() instead of 0;
1302 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1304 * src/converter.h: add a std:: qualifier
1306 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1308 * src/importer.[Ch]: New files. Used for importing files into LyX.
1310 * src/lyxfunc.C (doImport): Use the new Importer class.
1312 * src/converter.h: Add shortcut member to the Format class.
1313 Used for holding the menu shortcut.
1315 * src/converter.C and other files: Made a distinction between
1316 format name and format extension. New formats can be defined using
1317 the \format lyxrc tag.
1318 Added two new converter flags: latex and disable.
1320 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1322 * src/support/lyxlib.h: unify namespace/struct implementation.
1323 Remove extra declarations.
1325 * src/support/chdir.C (chdir): remove version taking char const *
1327 * src/support/rename.C: ditto.
1328 * src/support/lyxsum.C: ditto.
1330 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1332 * src/frontends/xforms/FormBase.[Ch]:
1333 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1334 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1335 work only for the next call to fl_show_form(). The correct place to set
1336 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1337 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1338 from FormBase have the minimum size set; no more stupid crashes with
1341 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1343 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1345 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1347 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1349 * src/support/lyxlib.h: changed second argument of mkdir to
1350 unsigned long int (unsigned int would probably have been enough,
1351 but...). Removed <sys/types.h> header.
1352 * src/support/mkdir.C (mkdir): ditto.
1356 2000-10-19 Juergen Vigna <jug@sad.it>
1358 * src/lyxfunc.C (MenuNew): small fix (form John)
1360 * src/screen.C (Update): removed unneeded code.
1362 * src/tabular.C (Ascii): refixed int != uint bug!
1364 * src/support/lyxlib.h: added sys/types.h include for now permits
1365 compiling, but I don't like this!
1367 2000-10-18 Juergen Vigna <jug@sad.it>
1369 * src/text2.C (ClearSelection): if we clear the selection we need
1370 more refresh so set the status apropriately
1372 * src/insets/insettext.C (draw): hopefully finally fixed draw
1375 2000-10-12 Juergen Vigna <jug@sad.it>
1377 * src/insets/insettext.C (draw): another small fix and make a block
1378 so that variables are localized.
1380 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1382 * src/support/lstrings.C (lowercase, uppercase):
1383 use explicit casts to remove compiler warnings.
1385 * src/support/LRegex.C (Impl):
1386 * src/support/StrPool.C (add):
1387 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1388 (AddPath, MakeDisplayPath):
1389 * src/support/lstrings.C (prefixIs, subst):
1390 use correct type to remove compiler warnings.
1392 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1394 * src/support/lyxlib.h:
1395 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1396 portability and to remove compiler warning with DEC cxx.
1398 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1400 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1402 * src/minibuffer.C (peek_event): retun 1 when there has been a
1403 mouseclick in the minibuffer.
1407 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1409 * src/frontends/xforms/FormParagraph.C: more space above/below
1412 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1414 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1415 a char only if real_current_font was changed.
1417 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1419 * NEWS: update somewhat for 1.1.6
1421 * lib/ui/default.ui: clean up.
1423 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1425 * lib/CREDITS: clean up
1427 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1429 * src/combox.[Ch] (select): changed argument back to int
1430 * src/combox.C (peek_event): removed num_bytes as it is declared but
1433 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1434 modified calls to Combox::select() to remove warnings about type
1437 * src/insets/insetbutton.C (width): explicit cast to remove warning
1438 about type conversion.
1440 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1443 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1444 sel_pos_end, refering to cursor position are changed to
1445 LyXParagraph::size_type.
1447 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1448 consistent with LyXCursor::pos().
1449 (inset_pos): changed to LyXParagraph::size_type for same reason.
1451 * src/insets/insettext.C (resizeLyXText): changed some temporary
1452 variables refing to cursor position to LyXParagraph::size_type.
1454 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1456 * src/frontends/kde/<various>: The Great Renaming,
1459 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1461 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1463 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1465 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1466 0 when there are no arguments.
1468 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1470 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1471 to segfaults when pressing Ok in InsetBibtex dialog.
1473 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1475 * forms/layout_forms.fd:
1476 * src/layout_forms.C (create_form_form_character): small change to use
1477 labelframe rather than engraved frame + text
1479 * src/lyx_gui.C (create_forms): initialise choice_language with some
1480 arbitrary value to prevent segfault when dialog is shown.
1482 2000-10-16 Baruch Even <baruch.even@writeme.com>
1484 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1485 is no resulting file. This pertains only to LaTeX output.
1487 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1489 * src/text.C (Backspace): Make sure that the row of the cursor is
1492 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1495 * src/lyx_gui.C (init): Prevent a crash when only one font from
1496 menu/popup fonts is not found.
1498 * lib/lyxrc.example: Add an example for binding a key for language
1501 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1503 * src/converter.C (GetReachable): Changed the returned type to
1505 (IsReachable): New method
1507 * src/MenuBackend.C (expand): Handle formats that appear more
1510 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1512 * src/frontends/support/Makefile.am
1513 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1516 * lib/CREDITS: add Garst Reese.
1518 * src/support/snprintf.h: add extern "C" {} around the definitions.
1520 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1522 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1525 * src/frontends/xforms/FormDocument.C:
1526 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1527 compile without "conversion to integral type of smaller size"
1530 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1532 * src/text.C (GetColumnNearX): Fixed disabled code.
1534 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1536 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1539 * src/support/snprintf.[ch]: new files
1541 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1543 * src/frontends/kde/formprintdialog.C: add
1544 file browser for selecting postscript output
1546 * src/frontends/kde/formprintdialogdata.C:
1547 * src/frontends/kde/formprintdialogdata.h: re-generate
1550 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1552 * src/frontends/gnome/Makefile.am:
1553 * src/frontends/kde/Makefile.am: FormCommand.C
1554 disappeared from xforms
1556 * src/frontends/kde/FormCitation.C:
1557 * src/frontends/kde/FormIndex.C: read-only
1560 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1562 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1565 * src/bufferlist.C: add using directive.
1567 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1569 * src/support/lyxfunctional.h: version of class_fun for void
1570 returns added, const versions of back_inseter_fun and compare_fun
1573 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1575 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1577 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1579 * ChangeLog: cleanup.
1581 * lib/CREDITS: update to add all the contributors we've forgotten.
1582 I have obviously missed some, so tell me whether there were
1585 2000-10-13 Marko Vendelin <markov@ioc.ee>
1587 * src/frontends/gnome/FormCitation.C
1588 * src/frontends/gnome/FormCitation.h
1589 * src/frontends/gnome/FormError.C
1590 * src/frontends/gnome/FormIndex.C
1591 * src/frontends/gnome/FormRef.C
1592 * src/frontends/gnome/FormRef.h
1593 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1595 * src/frontends/gnome/FormCitation.C
1596 * src/frontends/gnome/FormCopyright.C
1597 * src/frontends/gnome/FormError.C
1598 * src/frontends/gnome/FormIndex.C
1599 * src/frontends/gnome/FormRef.C
1600 * src/frontends/gnome/FormToc.C
1601 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1604 * src/frontends/gnome/Menubar_pimpl.C
1605 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1608 2000-10-11 Baruch Even <baruch.even@writeme.com>
1611 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1612 to convey its real action.
1614 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1615 clear the minibuffer and prepare to enter a command.
1617 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1618 the rename from ExecCommand to PrepareForCommand.
1619 * src/lyxfunc.C (Dispatch): ditto.
1621 2000-10-11 Baruch Even <baruch.even@writeme.com>
1623 * src/buffer.C (writeFile): Added test for errors on writing, this
1624 catches all errors and not only file system full errors as intended.
1626 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1628 * src/lyx_gui.C (create_forms): better fix for crash with
1629 translated interface.
1631 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1633 * src/frontends/kde/Makefile.am:
1634 * src/frontends/kde/FormCopyright.C:
1635 * src/frontends/kde/formcopyrightdialog.C:
1636 * src/frontends/kde/formcopyrightdialog.h:
1637 * src/frontends/kde/formcopyrightdialogdata.C:
1638 * src/frontends/kde/formcopyrightdialogdata.h:
1639 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1640 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1641 copyright to use qtarch
1643 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1645 * src/encoding.C (read): Fixed bug that caused an error message at
1646 the end of the file.
1648 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1650 * lib/lyxrc.example: Fixed hebrew example.
1652 2000-10-13 Allan Rae <rae@lyx.org>
1654 * src/frontends/xforms/FormPreferences.C (input): reworking the
1656 (build, update, apply): New inputs in various tabfolders
1658 * src/frontends/xforms/FormToc.C: use new button policy.
1659 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1660 dialogs that either can't use any existing policy or where it just
1663 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1666 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1667 added a bool parameter which is ignored.
1669 * src/buffer.C (setReadonly):
1670 * src/BufferView_pimpl.C (buffer):
1671 * src/frontends/kde/FormCopyright.h (update):
1672 * src/frontends/kde/FormCitation.[Ch] (update):
1673 * src/frontends/kde/FormIndex.[Ch] (update):
1674 * src/frontends/kde/FormPrint.[Ch] (update):
1675 * src/frontends/kde/FormRef.[Ch] (update):
1676 * src/frontends/kde/FormToc.[Ch] (update):
1677 * src/frontends/kde/FormUrl.[Ch] (update):
1678 * src/frontends/gnome/FormCopyright.h (update):
1679 * src/frontends/gnome/FormCitation.[Ch] (update):
1680 * src/frontends/gnome/FormError.[Ch] (update):
1681 * src/frontends/gnome/FormIndex.[Ch] (update):
1682 * src/frontends/gnome/FormPrint.[Ch] (update):
1683 * src/frontends/gnome/FormRef.h (update):
1684 * src/frontends/gnome/FormToc.[Ch] (update):
1685 * src/frontends/gnome/FormUrl.[Ch] (update):
1686 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1687 to updateBufferDependent and DialogBase
1689 * src/frontends/xforms/FormCitation.[hC]:
1690 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1691 * src/frontends/xforms/FormError.[Ch]:
1692 * src/frontends/xforms/FormGraphics.[Ch]:
1693 * src/frontends/xforms/FormIndex.[Ch]:
1694 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1695 and fixed readOnly handling.
1696 * src/frontends/xforms/FormPrint.[Ch]:
1697 * src/frontends/xforms/FormRef.[Ch]:
1698 * src/frontends/xforms/FormTabular.[Ch]:
1699 * src/frontends/xforms/FormToc.[Ch]:
1700 * src/frontends/xforms/FormUrl.[Ch]:
1701 * src/frontends/xforms/FormInset.[Ch]:
1702 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1703 form of updateBufferDependent.
1705 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1706 if form()->visible just in case someone does stuff to the form in a
1709 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1710 the buttoncontroller for everything the enum used to be used for.
1711 (update) It would seem we need to force all dialogs to use a bool
1712 parameter or have two update functions. I chose to go with one.
1713 I did try removing update() from here and FormBase and defining the
1714 appropriate update signatures in FormBaseB[DI] but then ran into the
1715 problem of the update() call in FormBase::show(). Whatever I did
1716 to get around that would require another function and that just
1717 got more confusing. Hence the decision to make everyone have an
1718 update(bool). An alternative might have been to override show() in
1719 FormBaseB[DI] and that would allow the different and appropriate
1722 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1723 true == buffer change occurred. I decided against using a default
1724 template parameter since not all compilers support that at present.
1726 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1728 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1729 army knife" by removing functionality.
1730 (clearStore): removed. All such housekeeping on hide()ing the dialog
1731 is to be carried out by overloaded disconnect() methods.
1732 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1733 superceded by Baruch's neat test (FormGraphics) to update an existing
1734 dialog if a new signal is recieved rather than block all new signals
1736 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1737 only to Inset dialogs.
1738 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1739 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1741 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1743 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1744 as a base class to all inset dialogs. Used solely to connect/disconnect
1745 the Inset::hide signal and to define what action to take on receipt of
1746 a UpdateBufferDependent signal.
1747 (FormCommand): now derived from FormInset.
1749 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1752 * src/frontends/xforms/FormCopyright.[Ch]:
1753 * src/frontends/xforms/FormPreferences.[Ch]:
1754 now derived from FormBaseBI.
1756 * src/frontends/xforms/FormDocument.[Ch]:
1757 * src/frontends/xforms/FormParagraph.[Ch]:
1758 * src/frontends/xforms/FormPrint.[Ch]:
1759 now derived from FormBaseBD.
1761 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1763 * src/frontends/xforms/FormCitation.[Ch]:
1764 * src/frontends/xforms/FormError.[Ch]:
1765 * src/frontends/xforms/FormRef.[Ch]:
1766 * src/frontends/xforms/FormToc.[Ch]:
1767 (clearStore): reworked as disconnect().
1769 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1772 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1774 * src/converter.C (runLaTeX): constify buffer argument
1777 * src/frontends/support/Makefile.am (INCLUDES): fix.
1779 * src/buffer.h: add std:: qualifier
1780 * src/insets/figinset.C (addpidwait): ditto
1781 * src/MenuBackend.C: ditto
1782 * src/buffer.C: ditto
1783 * src/bufferlist.C: ditto
1784 * src/layout.C: ditto
1785 * src/lyxfunc.C: ditto
1787 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1789 * src/lyxtext.h (bidi_level): change return type to
1790 LyXParagraph::size_type.
1792 * src/lyxparagraph.h: change size_type to
1793 TextContainer::difference_type. This should really be
1794 TextContainer::size_type, but we need currently to support signed
1797 2000-10-11 Marko Vendelin <markov@ioc.ee>
1798 * src/frontends/gnome/FormError.h
1799 * src/frontends/gnome/FormRef.C
1800 * src/frontends/gnome/FormRef.h
1801 * src/frontends/gnome/FormError.C
1802 * src/frontends/gnome/Makefile.am
1803 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1804 to Gnome frontend. Both dialogs use "action" area.
1806 2000-10-12 Baruch Even <baruch.even@writeme.com>
1808 * src/graphics/GraphicsCacheItem_pimpl.C:
1809 * src/graphics/Renderer.C:
1810 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1813 2000-10-12 Juergen Vigna <jug@sad.it>
1815 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1816 visible when selecting).
1818 * development/Code_rules/Rules: fixed some typos.
1820 2000-10-09 Baruch Even <baruch.even@writeme.com>
1822 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1823 compiling on egcs 1.1.2 possible.
1825 * src/filedlg.C (comp_direntry::operator() ): ditto.
1827 2000-08-31 Baruch Even <baruch.even@writeme.com>
1829 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1832 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1833 transient it now only gets freed when the object is destructed.
1835 2000-08-24 Baruch Even <baruch.even@writeme.com>
1837 * src/frontends/FormGraphics.h:
1838 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1841 2000-08-20 Baruch Even <baruch.even@writeme.com>
1843 * src/insets/insetgraphics.C:
1844 (draw): Added messages to the drawn rectangle to report status.
1845 (updateInset): Disabled the use of the inline graphics,
1848 2000-08-17 Baruch Even <baruch.even@writeme.com>
1850 * src/frontends/support: Directory added for the support of GUII LyX.
1852 * src/frontends/support/LyXImage.h:
1853 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1856 * src/frontends/support/LyXImage_X.h:
1857 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1858 version of LyXImage, this uses the Xlib Pixmap.
1860 * src/PainterBase.h:
1861 * src/PainterBase.C:
1863 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1864 replacement to Pixmap.
1866 * src/insets/insetgraphics.h:
1867 * src/insets/insetgraphics.C:
1868 * src/graphics/GraphicsCacheItem.h:
1869 * src/graphics/GraphicsCacheItem.C:
1870 * src/graphics/GraphicsCacheItem_pimpl.h:
1871 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1874 * src/graphics/GraphicsCacheItem.h:
1875 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1876 another copy of the object.
1878 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1879 of cacheHandle, this fixed a bug that sent LyX crashing.
1881 * src/graphics/XPM_Renderer.h:
1882 * src/graphics/XPM_Renderer.C:
1883 * src/graphics/EPS_Renderer.h:
1884 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1886 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1888 * src/lyxfunc.C (processKeySym): only handle the
1889 lockinginset/inset stuff if we have a buffer and text loaded...
1891 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1893 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1895 * src/support/lyxfunctional.h: add operator= that takes a reference
1897 * src/lyxserver.C (mkfifo): make first arg const
1899 * src/layout.h: renamed name(...) to setName(...) to work around
1902 * src/buffer.C (setFileName): had to change name of function to
1903 work around bugs in egcs. (renamed from fileName)
1905 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1907 * src/support/translator.h: move helper template classes to
1908 lyxfunctional.h, include "support/lyxfunctional.h"
1910 * src/support/lyxmanip.h: add delaration of fmt
1912 * src/support/lyxfunctional.h: new file
1913 (class_fun_t): new template class
1914 (class_fun): helper template function
1915 (back_insert_fun_iterator): new template class
1916 (back_inserter_fun): helper template function
1917 (compare_memfun_t): new template class
1918 (compare_memfun): helper template function
1919 (equal_1st_in_pair): moved here from translator
1920 (equal_2nd_in_pair): moved here from translator
1922 * src/support/fmt.C: new file
1923 (fmt): new func, can be used for a printf substitute when still
1924 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1926 * src/support/StrPool.C: add some comments
1928 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1931 * src/insets/figinset.C (addpidwait): use std::copy with
1932 ostream_iterator to fill the pidwaitlist
1934 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1936 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1939 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1942 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1944 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1945 (class_update): ditto
1946 (BulletPanel): ditto
1947 (CheckChoiceClass): move initialization of tc and tct
1949 * src/tabular.C: remove current_view
1950 (OldFormatRead): similar to right below [istream::ignore]
1952 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1953 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1954 unused [istream::ignore]
1956 * src/lyxfunc.C: include "support/lyxfunctional.h"
1957 (getInsetByCode): use std::find_if and compare_memfun
1959 * src/lyxfont.C (stateText): remove c_str()
1961 * src/lyx_main.C (setDebuggingLevel): make static
1962 (commandLineHelp): make static
1964 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1965 Screen* together with fl_get_display() and fl_screen
1967 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1968 togheter with fl_get_display() and fl_screen
1969 (create_forms): remove c_str()
1971 * src/layout.C: include "support/lyxfunctional.h"
1972 (hasLayout): use std::find_if and compare_memfun
1973 (GetLayout): use std::find_if and comapre_memfun
1974 (delete_layout): use std::remove_if and compare_memfun
1975 (NumberOfClass): use std:.find_if and compare_memfun
1977 * src/gettext.h: change for the new functions
1979 * src/gettext.C: new file, make _(char const * str) and _(string
1980 const & str) real functions.
1982 * src/font.C (width): rewrite slightly to avoid one extra variable
1984 * src/debug.C: initialize Debug::ANY here
1986 * src/commandtags.h: update number comments
1988 * src/combox.h (get): make const func
1990 (getline): make const
1992 * src/combox.C (input_cb): handle case where fl_get_input can
1995 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1996 "support/lyxfunctional.h", remove current_view variable.
1997 (resize): use std::for_each with std::mem_fun
1998 (getFileNames): use std::copy with back_inserter_fun
1999 (getBuffer): change arg type to unsigned int
2000 (emergencyWriteAll): call emergencyWrite with std::for_each and
2002 (emergencyWrite): new method, the for loop in emergencyWriteAll
2004 (exists): use std::find_if with compare_memfun
2005 (getBuffer): use std::find_if and compare_memfun
2007 * src/buffer.h: add typedefs for iterator_category, value_type
2008 difference_type, pointer and reference for inset_iterator
2009 add postfix ++ for inset_iterator
2010 make inset_iterator::getPos() const
2012 * src/buffer.C: added support/lyxmanip.h
2013 (readFile): use lyxerr << fmt instead of printf
2014 (makeLaTeXFile): use std::copy to write out encodings
2016 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2018 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2019 free and the char * temp.
2020 (hasMenu): use std::find_if and compare_memfun
2023 * src/Makefile.am (lyx_SOURCES): added gettext.C
2025 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2026 string::insert small change to avoid temporary
2028 * src/LColor.C (getGUIName): remove c_str()
2030 * several files: change all occurrences of fl_display to
2033 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2034 that -pedantic is not used for gcc 2.97 (cvs gcc)
2036 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2038 2000-10-11 Allan Rae <rae@lyx.org>
2040 * src/frontends/xforms/FormPreferences.C (input): template path must be
2041 a readable directory. It doesn't need to be writeable.
2042 (build, delete, update, apply): New inputs in the various tabfolders
2044 * src/frontends/xforms/forms/form_preferences.fd:
2045 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2046 several new entries to existing folders. Shuffled some existing stuff
2049 * src/frontends/xforms/forms/form_print.fd:
2050 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2051 Should probably rework PrinterParams as well. Note that the switch to
2052 collated is effectively the same as !unsorted so changing PrinterParams
2053 will require a lot of fiddly changes to reverse the existing logic.
2055 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2057 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2059 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2061 2000-10-10 Allan Rae <rae@lyx.org>
2064 * src/lyxfunc.C (Dispatch):
2066 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2069 * src/lyxrc.C (output): Only write the differences between system lyxrc
2070 and the users settings.
2073 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2075 I'll rewrite this later, after 1.1.6 probably, to keep a single
2076 LyXRC but two instances of a LyXRCStruct.
2078 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2080 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2082 * src/tabular.h: add a few std:: qualifiers.
2084 * src/encoding.C: add using directive.
2085 * src/language.C: ditto.
2087 * src/insets/insetquotes.C (Validate): use languages->lang()
2088 instead of only language.
2090 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2092 * lib/languages: New file.
2094 * lib/encodings: New file.
2096 * src/language.C (Languages): New class.
2097 (read): New method. Reads the languages from the 'languages' file.
2099 * src/encoding.C (Encodings): New class.
2100 (read): New method. Reads the encodings from the 'encodings' file.
2102 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2105 * src/bufferparams.h and a lot of files: Deleted the member language,
2106 and renamed language_info to language
2108 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2109 * src/lyxfont.C (latexWriteStartChanges): ditto.
2110 * src/paragraph.C (validate,TeXOnePar): ditto.
2112 * src/lyxfont.C (update): Restored deleted code.
2114 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2116 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2118 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2120 * src/insets/figinset.[Ch]:
2121 * src/insets/insetinclude.[Ch]:
2122 * src/insets/insetinclude.[Ch]:
2123 * src/insets/insetparent.[Ch]:
2124 * src/insets/insetref.[Ch]:
2125 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2127 * src/insets/*.[Ch]:
2128 * src/mathed/formula.[Ch]:
2129 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2131 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2132 * src/lyx_cb.C (FigureApplyCB):
2133 * src/lyxfunc.C (getStatus, Dispatch):
2134 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2137 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2139 * src/converter.[Ch] (Formats::View):
2140 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2142 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2143 *current_view->buffer(). This will change later, but this patch is way
2146 2000-10-09 Juergen Vigna <jug@sad.it>
2148 * src/text.C (GetRow): small fix.
2150 * src/BufferView_pimpl.C (cursorPrevious):
2151 (cursorNext): added LyXText parameter to function.
2153 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2154 keypress depending on cursor position.
2156 2000-10-06 Juergen Vigna <jug@sad.it>
2158 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2159 (copySelection): redone this function and also copy ascii representa-
2162 * src/tabular.C (Ascii):
2166 (print_n_chars): new functions to realize the ascii export of tabulars.
2168 2000-10-05 Juergen Vigna <jug@sad.it>
2170 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2171 if we don't have a buffer.
2173 2000-10-10 Allan Rae <rae@lyx.org>
2175 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2176 with closing dialog. It seems that nested tabfolders require hiding
2177 of inner tabfolders before hiding the dialog itself. Actually all I
2178 did was hide the active outer folder.
2180 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2181 unless there really is a buffer. hideBufferDependent is called
2184 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2185 POTFILES.in stays in $(srcdir).
2187 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2189 * lib/lyxrc.example: Few changes.
2191 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2193 * src/BufferView_pimpl.C (buffer): only need one the
2194 updateBufferDependent signal to be emitted once! Moved to the end of
2195 the method to allow bv_->text to be updated first.
2197 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2198 and hSignal_ with Dialogs * and BufferDependency variables.
2199 New Buffer * parent_, initialised when the dialog is launched. Used to
2200 check whether to update() or hide() dialog in the new, private
2201 updateOrHide() method that is connected to the updateBufferDependent
2202 signal. Daughter classes dictate what to do using the
2203 ChangedBufferAction enum, passed to the c-tor.
2205 * src/frontends/xforms/FormCitation.C:
2206 * src/frontends/xforms/FormCommand.C:
2207 * src/frontends/xforms/FormCopyright.C:
2208 * src/frontends/xforms/FormDocument.C:
2209 * src/frontends/xforms/FormError.C:
2210 * src/frontends/xforms/FormIndex.C:
2211 * src/frontends/xforms/FormPreferences.C:
2212 * src/frontends/xforms/FormPrint.C:
2213 * src/frontends/xforms/FormRef.C:
2214 * src/frontends/xforms/FormToc.C:
2215 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2218 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2219 ChangedBufferAction enum.
2221 * src/frontends/xforms/FormParagraph.[Ch]
2222 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2225 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2227 * lib/bind/cua.bind: fix a bit.
2228 * lib/bind/emacs.bind: ditto.
2230 * lib/bind/menus.bind: remove real menu entries from there.
2232 * src/spellchecker.C: make sure we only include strings.h when
2235 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2237 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2238 function. It enlarges the maximum number of pup when needed.
2239 (add_toc2): Open a new menu if maximum number of items per menu has
2242 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2244 * src/frontends/kde/FormPrint.C: fix error reporting
2246 * src/frontends/xforms/FormDocument.C: fix compiler
2249 * lib/.cvsignore: add Literate.nw
2251 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2254 * bufferview_funcs.[Ch]
2257 * text2.C: Add support for numbers in RTL text.
2259 2000-10-06 Allan Rae <rae@lyx.org>
2261 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2262 to be gettext.m4 friendly again. ext_l10n.h is now
2263 generated into $top_srcdir instead of $top_builddir
2264 so that lyx.pot will be built correctly -- without
2265 duplicate parsing of ext_l10n.h.
2267 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2269 * src/frontends/kde/FormCitation.C: make the dialog
2270 behave more sensibly
2272 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2274 * config/kde.m4: fix consecutive ./configure runs,
2275 look for qtarch, fix library order
2277 * src/frontends/kde/Makefile.am: tidy up,
2278 add Print dialog, add .dlg dependencies
2280 * src/frontends/kde/FormPrint.C:
2281 * src/frontends/kde/FormPrint.h:
2282 * src/frontends/kde/formprintdialog.C:
2283 * src/frontends/kde/formprintdialog.h:
2284 * src/frontends/kde/formprintdialogdata.C:
2285 * src/frontends/kde/formprintdialogdata.h:
2286 * src/frontends/kde/dlg/formprintdialog.dlg: add
2289 * src/frontends/kde/dlg/README: Added explanatory readme
2291 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2292 script to double-check qtarch's output
2294 * src/frontends/kde/formindexdialog.C:
2295 * src/frontends/kde/formindexdialogdata.C:
2296 * src/frontends/kde/formindexdialogdata.h:
2297 * src/frontends/kde/dlg/formindexdialog.dlg: update
2298 for qtarch, minor fixes
2300 2000-10-05 Allan Rae <rae@lyx.org>
2302 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2303 dialogs when switching buffers update them instead. It's up to each
2304 dialog to decide if it should still be visible or not.
2305 update() should return a bool to control visiblity within show().
2306 Or perhaps better to set a member variable and use that to control
2309 * lib/build-listerrors: create an empty "listerrors" file just to stop
2310 make trying to regenerate it all the time if you don't have noweb
2313 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2315 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2316 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2317 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2318 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2319 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2321 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2323 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2325 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2326 deleting buffer. Closes all buffer-dependent dialogs.
2328 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2330 * src/frontends/xforms/FormCitation.[Ch]:
2331 * src/frontends/xforms/FormPreferences.[Ch]:
2332 * src/frontends/xforms/FormPrint.[Ch]:
2333 * src/frontends/xforms/FormRef.[Ch]:
2334 * src/frontends/xforms/FormUrl.[Ch]: ditto
2336 * src/frontends/xforms/FormDocument.[Ch]:
2337 * src/frontends/xforms/forms/form_document.C.patch:
2338 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2339 pass through a single input() function.
2341 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2343 * lib/build-listerrors: return status as OK
2345 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2347 * lib/lyxrc.example: Updated to new export code
2349 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2351 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2354 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2357 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2358 LyX-Code is defined.
2359 * lib/layouts/amsbook.layout: ditto.
2361 * boost/Makefile.am: fix typo.
2363 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2365 (add_lastfiles): removed.
2366 (add_documents): removed.
2367 (add_formats): removed.
2369 * src/frontends/Menubar.C: remove useless "using" directive.
2371 * src/MenuBackend.h: add a new MenuItem constructor.
2373 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2376 2000-10-04 Allan Rae <rae@lyx.org>
2378 * lib/Makefile.am (listerrors):
2379 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2380 I haven't got notangle installed so Kayvan please test. The output
2381 should end up in $builddir. This also allows people who don't have
2382 noweb installed to complete the make process without error.
2384 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2385 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2386 by JMarc's picky compiler.
2388 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2391 * src/insets/insettabular.C (setPos): change for loop to not use
2392 sequencing operator. Please check this Jürgen.
2394 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2396 * src/insets/insetcite.C (getScreenLabel): ditto
2397 * src/support/filetools.C (QuoteName): ditto
2398 (ChangeExtension): ditto
2400 * src/BufferView_pimpl.C (scrollCB): make heigt int
2402 * src/BufferView2.C (insertInset): comment out unused arg
2404 * boost/Makefile.am (EXTRADIST): new variable
2406 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2408 * src/exporter.C (IsExportable): Fixed
2410 * lib/configure.m4: Small fix
2412 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2414 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2415 * src/insets/insetbib.C (bibitemWidest): ditto.
2416 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2418 2000-10-03 Juergen Vigna <jug@sad.it>
2420 * src/BufferView2.C (theLockingInset): removed const because of
2421 Agnus's compile problems.
2423 * src/insets/insettext.C (LocalDispatch): set the language of the
2424 surronding paragraph on inserting the first character.
2426 * various files: changed use of BufferView::the_locking_inset.
2428 * src/BufferView2.C (theLockingInset):
2429 (theLockingInset): new functions.
2431 * src/BufferView.h: removed the_locking_inset.
2433 * src/lyxtext.h: added the_locking_inset
2435 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2437 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2439 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2441 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2442 * src/mathed/math_cursor.C (IsAlpha): ditto.
2443 * src/mathed/math_inset.C (strnew): ditto.
2444 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2445 (IMetrics): cxp set but never used; removed.
2446 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2447 that the variable in question has been removed also!
2450 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2451 using the Buffer * passed to Latex(), using the BufferView * passed to
2452 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2454 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2455 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2457 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2458 * src/buffer.C (readInset): used new InsetBibtex c-tor
2459 * (getBibkeyList): used new InsetBibtex::getKeys
2461 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2464 * lib/build-listerrors
2466 * src/exporter.C: Add literate programming support to the export code
2469 * src/lyx_cb.C: Remove old literate code.
2471 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2474 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2475 * src/converter.C (View, Convert): Use QuoteName.
2477 * src/insets/figinset.C (Preview): Use Formats::View.
2479 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2481 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2483 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2484 the top of the function, because compaq cxx complains that the
2485 "goto exit_with_message" when the function is disabled bypasses
2487 (MenuNew): try a better fix for the generation of new file names.
2488 This time, I used AddName() instead of AddPath(), hoping Juergen
2491 2000-10-03 Allan Rae <rae@lyx.org>
2493 * src/frontends/xforms/forms/form_preferences.fd:
2494 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2495 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2496 "Look and Feel"->"General" but will need to be split up further into
2497 general output and general input tabs. Current plan is for four outer
2498 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2499 stuff; "Inputs" for input and import configuration; "Outputs" for
2500 output and export configuration; and one more whatever is left over
2501 called "General". The leftovers at present look like being which
2502 viewers to use, spellchecker, language support and might be better
2503 named "Support". I've put "Paths" in "Inputs" for the moment as this
2504 seems reasonable for now at least.
2505 One problem remains: X error kills LyX when you close Preferences.
2507 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2509 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2510 qualifier from form()
2511 * src/frontends/xforms/FormCitation.[Ch]:
2512 * src/frontends/xforms/FormCopyright.[Ch]:
2513 * src/frontends/xforms/FormDocument.[Ch]:
2514 * src/frontends/xforms/FormError.[Ch]:
2515 * src/frontends/xforms/FormIndex.[Ch]:
2516 * src/frontends/xforms/FormPreferences.[Ch]:
2517 * src/frontends/xforms/FormPrint.[Ch]:
2518 * src/frontends/xforms/FormRef.[Ch]:
2519 * src/frontends/xforms/FormToc.[Ch]:
2520 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2522 * src/frontends/xforms/FormCitation.[Ch]:
2523 * src/frontends/xforms/FormIndex.[Ch]:
2524 * src/frontends/xforms/FormRef.[Ch]:
2525 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2526 with Allan's naming policy
2528 * src/frontends/xforms/FormCitation.C: some static casts to remove
2531 2000-10-02 Juergen Vigna <jug@sad.it>
2533 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2534 now you can type or do stuff inside the table-cell also when in dummy
2535 position, fixed visible cursor.
2537 * src/insets/insettext.C (Edit): fixing cursor-view position.
2539 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2540 be used for equal functions in lyxfunc and insettext.
2542 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2544 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2546 * src/frontends/gnome/FormCitation.h:
2547 * src/frontends/gnome/FormCopyright.h:
2548 * src/frontends/gnome/FormIndex.h:
2549 * src/frontends/gnome/FormPrint.h:
2550 * src/frontends/gnome/FormToc.h:
2551 * src/frontends/gnome/FormUrl.h:
2552 * src/frontends/kde/FormCitation.h:
2553 * src/frontends/kde/FormCopyright.h:
2554 * src/frontends/kde/FormIndex.h:
2555 * src/frontends/kde/FormRef.h:
2556 * src/frontends/kde/FormToc.h:
2557 * src/frontends/kde/FormUrl.h: fix remaining users of
2560 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2562 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2563 from depth argument.
2564 (DocBookHandleCaption): ditto.
2565 (DocBookHandleFootnote): ditto.
2566 (SimpleDocBookOnePar): ditto.
2568 * src/frontends/xforms/FormDocument.h (form): remove extra
2569 FormDocument:: qualifier.
2571 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2573 * sigc++/handle.h: ditto.
2575 * src/lyx_gui_misc.C: add "using" directive.
2577 * src/cheaders/cstddef: new file, needed by the boost library (for
2580 2000-10-02 Juergen Vigna <jug@sad.it>
2582 * src/insets/insettext.C (SetFont): better support.
2584 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2586 * src/screen.C (DrawOneRow): some uint refixes!
2588 2000-10-02 Allan Rae <rae@lyx.org>
2590 * boost/.cvsignore: ignore Makefile as well
2592 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2593 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2595 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2596 Left this one out by accident.
2598 * src/frontends/xforms/FormBase.h (restore): default to calling
2599 update() since that will restore the original/currently-applied values.
2600 Any input() triggered error messages will require the derived classes
2601 to redefine restore().
2603 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2604 avoid a segfault. combo_doc_class is the main concern.
2606 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2608 * Simplify build-listerrors in view of GUI-less export ability!
2610 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2612 * src/lyx_main.C (easyParse): Disable gui when exporting
2614 * src/insets/figinset.C:
2617 * src/lyx_gui_misc.C
2618 * src/tabular.C: Changes to allow no-gui.
2620 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2622 * src/support/utility.hpp: removed file
2623 * src/support/block.h: removed file
2625 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2628 * src/mathed/formula.C: add support/lyxlib.h
2629 * src/mathed/formulamacro.C: ditto
2631 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2632 * src/lyxparagraph.h: ditto
2634 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2635 * src/frontends/Makefile.am (INCLUDES): ditto
2636 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2637 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2638 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2639 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2640 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2641 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2643 * src/BufferView.h: use boost/utility.hpp
2644 * src/LColor.h: ditto
2645 * src/LaTeX.h: ditto
2646 * src/LyXAction.h: ditto
2647 * src/LyXView.h: ditto
2648 * src/bufferlist.h: ditto
2649 * src/lastfiles.h: ditto
2650 * src/layout.h: ditto
2651 * src/lyx_gui.h: ditto
2652 * src/lyx_main.h: ditto
2653 * src/lyxlex.h: ditto
2654 * src/lyxrc.h: ditto
2655 * src/frontends/ButtonPolicies.h: ditto
2656 * src/frontends/Dialogs.h: ditto
2657 * src/frontends/xforms/FormBase.h: ditto
2658 * src/frontends/xforms/FormGraphics.h: ditto
2659 * src/frontends/xforms/FormParagraph.h: ditto
2660 * src/frontends/xforms/FormTabular.h: ditto
2661 * src/graphics/GraphicsCache.h: ditto
2662 * src/graphics/Renderer.h: ditto
2663 * src/insets/ExternalTemplate.h: ditto
2664 * src/insets/insetcommand.h: ditto
2665 * src/support/path.h: ditto
2667 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2668 and introduce clause for 2.97.
2670 * boost/libs/README: new file
2672 * boost/boost/utility.hpp: new file
2674 * boost/boost/config.hpp: new file
2676 * boost/boost/array.hpp: new file
2678 * boost/Makefile.am: new file
2680 * boost/.cvsignore: new file
2682 * configure.in (AC_OUTPUT): add boost/Makefile
2684 * Makefile.am (SUBDIRS): add boost
2686 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2688 * src/support/lstrings.C (suffixIs): Fixed.
2690 2000-10-01 Allan Rae <rae@lyx.org>
2692 * src/PrinterParams.h: moved things around to avoid the "can't
2693 inline call" warning.
2695 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2696 into doc++ documentation.
2698 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2700 * src/frontends/xforms/FormRef.C: make use of button controller
2701 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2702 cleaned up button controller usage.
2703 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2704 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2705 use the button controller
2707 * src/frontends/xforms/forms/*.fd: and associated generated files
2708 updated to reflect changes to FormBase. Some other FormXxxx files
2709 also got minor updates to reflect changes to FormBase.
2711 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2712 (hide): made virtual.
2713 (input): return a bool. true == valid input
2714 (RestoreCB, restore): new
2715 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2716 Changes to allow derived dialogs to use a ButtonController and
2717 make sense when doing so: OK button calls ok() and so on.
2719 * src/frontends/xforms/ButtonController.h (class ButtonController):
2720 Switch from template implementation to taking Policy parameter.
2721 Allows FormBase to provide a ButtonController for any dialog.
2723 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2724 Probably should rename connect and disconnect.
2725 (apply): use the radio button groups
2726 (form): needed by FormBase
2727 (build): setup the radio button groups
2729 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2731 * several files: type changes to reduce the number of warnings and
2732 to unify type hangling a bit. Still much to do.
2734 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2736 * lib/images/*: rename a bunch of icons to match Dekel converter
2739 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2742 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2744 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2746 * sigc++/handle.h: ditto for class Handle.
2748 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2750 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2752 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2754 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2755 removal of the "default" language.
2757 * src/combox.h (getline): Check that sel > 0
2759 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2761 * lib/examples/docbook_example.lyx
2762 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2764 * lib/layouts/docbook-book.layout: new docbook book layout.
2766 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2768 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2770 * src/insets/figinset.C (DocBook):fixed small typo.
2772 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2774 * src/insets/insetinclude.h: string include_label doesn't need to be
2777 2000-09-29 Allan Rae <rae@lyx.org>
2779 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2780 Allow derived type to control connection and disconnection from signals
2781 of its choice if desired.
2783 2000-09-28 Juergen Vigna <jug@sad.it>
2785 * src/insets/insettabular.C (update): fixed cursor setting when
2786 the_locking_inset changed.
2787 (draw): made this a bit cleaner.
2788 (InsetButtonPress): fixed!
2790 * various files: added LyXText Parameter to fitCursor call.
2792 * src/BufferView.C (fitCursor): added LyXText parameter.
2794 * src/insets/insettabular.C (draw): small draw fix.
2796 * src/tabular.C: right setting of left/right celllines.
2798 * src/tabular.[Ch]: fixed various types in funcions and structures.
2799 * src/insets/insettabular.C: ditto
2800 * src/frontends/xforms/FormTabular.C: ditto
2802 2000-09-28 Allan Rae <rae@lyx.org>
2804 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2805 that the #ifdef's had been applied to part of what should have been
2806 a complete condition. It's possible there are other tests that
2807 were specific to tables that are also wrong now that InsetTabular is
2808 being used. Now we need to fix the output of '\n' after a table in a
2809 float for the same reason as the original condition:
2810 "don't insert this if we would be adding it before or after a table
2811 in a float. This little trick is needed in order to allow use of
2812 tables in \subfigures or \subtables."
2813 Juergen can you check this?
2815 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2817 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2818 output to the ostream.
2820 * several files: fixed types based on warnings from cxx
2822 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2824 * src/frontends/kde/Makefile.am: fix rule for
2825 formindexdialogdata_moc.C
2827 * src/.cvsignore: add ext_l10n.h to ignore
2829 * acconfig.h: stop messing with __STRICT_ANSI__
2830 * config/gnome.m4: remove option to set -ansi
2831 * config/kde.m4: remove option to set -ansi
2832 * config/lyxinclude.m4: don't set -ansi
2834 2000-09-27 Juergen Vigna <jug@sad.it>
2836 * various files: remove "default" language check.
2838 * src/insets/insetquotes.C: removed use of current_view.
2840 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2841 the one should have red ears by now!
2843 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2844 in more then one paragraph. Fixed cursor-movement/selection.
2846 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2847 paragraphs inside a text inset.
2849 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2850 text-inset if this owner is an inset.
2852 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2854 * src/Bullet.h: changed type of font, character and size to int
2856 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2858 * src/insets/inseturl.[Ch]:
2859 * src/insets/insetref.[Ch]:
2860 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2862 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2864 * src/buffer.C (readFile): block-if statement rearranged to minimise
2865 bloat. Patch does not reverse Jean-Marc's change ;-)
2867 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2868 Class rewritten to store pointers to hide/update signals directly,
2869 rather than Dialogs *. Also defined an enum to ease use. All xforms
2870 forms can now be derived from this class.
2872 * src/frontends/xforms/FormCommand.[Ch]
2873 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2875 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2878 * src/frontends/xforms/forms/form_citation.fd
2879 * src/frontends/xforms/forms/form_copyright.fd
2880 * src/frontends/xforms/forms/form_error.fd
2881 * src/frontends/xforms/forms/form_index.fd
2882 * src/frontends/xforms/forms/form_ref.fd
2883 * src/frontends/xforms/forms/form_toc.fd
2884 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2886 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2888 * src/insets/insetfoot.C: removed redundent using directive.
2890 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2892 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2893 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2895 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2896 created in the constructors in different groups. Then set() just
2897 have to show the groups as needed. This fixes the redraw problems
2898 (and is how the old menu code worked).
2900 * src/support/lyxlib.h: declare the methods as static when we do
2901 not have namespaces.
2903 2000-09-26 Juergen Vigna <jug@sad.it>
2905 * src/buffer.C (asciiParagraph): new function.
2906 (writeFileAscii): new function with parameter ostream.
2907 (writeFileAscii): use now asciiParagraph.
2909 * various inset files: added the linelen parameter to the Ascii-func.
2911 * src/tabular.C (Write): fixed error in writing file introduced by
2912 the last changes from Lars.
2914 * lib/bind/menus.bind: removed not supported functions.
2916 * src/insets/insettext.C (Ascii): implemented this function.
2918 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2920 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2921 (Write): use of the write_attribute functions.
2923 * src/bufferlist.C (close): fixed reasking question!
2925 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2927 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2928 new files use the everwhere possible.
2931 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2932 src/log_form.C src/lyx.C:
2935 * src/buffer.C (runLaTeX): remove func
2937 * src/PaperLayout.C: removed file
2938 * src/ParagraphExtra.C: likewise
2939 * src/bullet_forms.C: likewise
2940 * src/bullet_forms.h: likewise
2941 * src/bullet_forms_cb.C: likewise
2943 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2944 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2947 * several files: remove all traces of the old fd_form_paragraph,
2948 and functions belonging to that.
2950 * several files: remove all traces of the old fd_form_document,
2951 and functions belonging to that.
2953 * several files: constify local variables were possible.
2955 * several files: remove all code that was dead when NEW_EXPORT was
2958 * several files: removed string::c_str in as many places as
2961 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2962 (e): be a bit more outspoken when patching
2963 (updatesrc): only move files if changed.
2965 * forms/layout_forms.h.patch: regenerated
2967 * forms/layout_forms.fd: remove form_document and form_paragraph
2968 and form_quotes and form_paper and form_table_options and
2969 form_paragraph_extra
2971 * forms/form1.fd: remove form_table
2973 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2974 the fdui->... rewrite. Update some comments to xforms 0.88
2976 * forms/bullet_forms.C.patch: removed file
2977 * forms/bullet_forms.fd: likewise
2978 * forms/bullet_forms.h.patch: likewise
2980 * development/Code_rules/Rules: added a section on switch
2981 statements. Updated some comment to xforms 0.88.
2983 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2985 * src/buffer.C (readFile): make sure that the whole version number
2986 is read after \lyxformat (even when it contains a comma)
2988 * lib/ui/default.ui: change shortcut of math menu to M-a.
2990 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2992 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2995 * src/LyXView.C (updateWindowTitle): show the full files name in
2996 window title, limited to 30 characters.
2998 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2999 When a number of characters has been given, we should not assume
3000 that the string is 0-terminated.
3002 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3003 calls (fixes some memory leaks)
3005 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3006 trans member on exit.
3008 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3010 * src/converter.C (GetReachable): fix typo.
3012 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3013 understand ',' instead of '.'.
3014 (GetInteger): rewrite to use strToInt().
3016 2000-09-26 Juergen Vigna <jug@sad.it>
3018 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3019 better visibility and error-message on wrong VSpace input.
3021 * src/language.C (initL): added english again.
3023 2000-09-25 Juergen Vigna <jug@sad.it>
3025 * src/frontends/kde/Dialogs.C (Dialogs):
3026 * src/frontends/gnome/Dialogs.C (Dialogs):
3027 * src/frontends/kde/Makefile.am:
3028 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3030 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3032 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3034 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3036 * src/frontends/xforms/FormParagraph.C:
3037 * src/frontends/xforms/FormParagraph.h:
3038 * src/frontends/xforms/form_paragraph.C:
3039 * src/frontends/xforms/form_paragraph.h:
3040 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3043 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3045 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3046 Paragraph-Data after use.
3048 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3049 non breakable paragraphs.
3051 2000-09-25 Garst R. Reese <reese@isn.net>
3053 * src/language.C (initL): added missing language_country codes.
3055 2000-09-25 Juergen Vigna <jug@sad.it>
3057 * src/insets/insettext.C (InsetText):
3058 (deleteLyXText): remove the not released LyXText structure!
3060 2000-09-24 Marko Vendelin <markov@ioc.ee>
3062 * src/frontends/gnome/mainapp.C
3063 * src/frontends/gnome/mainapp.h: added support for keyboard
3066 * src/frontends/gnome/FormCitation.C
3067 * src/frontends/gnome/FormCitation.h
3068 * src/frontends/gnome/Makefile.am
3069 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3070 FormCitation to use "action area" in mainapp window
3072 * src/frontends/gnome/Menubar_pimpl.C
3073 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3076 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3078 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3079 width/descent/ascent values if name is empty.
3080 (mathed_string_height): Use std::max.
3082 2000-09-25 Allan Rae <rae@lyx.org>
3084 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3085 segfault. This will be completely redesigned soon.
3087 * sigc++: updated libsigc++. Fixes struct timespec bug.
3089 * development/tools/makeLyXsigc.sh: .cvsignore addition
3091 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3093 * several files: removed almost all traces of the old table
3096 * src/TableLayout.C: removed file
3098 2000-09-22 Juergen Vigna <jug@sad.it>
3100 * src/frontends/kde/Dialogs.C: added credits forms.
3102 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3104 * src/frontends/gnome/Dialogs.C: added some forms.
3106 * src/spellchecker.C (init_spell_checker): set language in pspell code
3107 (RunSpellChecker): some modifications for setting language string.
3109 * src/language.[Ch]: added language_country code.
3111 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3113 * src/frontends/Dialogs.h: added new signal showError.
3114 Rearranged existing signals in some sort of alphabetical order.
3116 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3117 FormError.[Ch], form_error.[Ch]
3118 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3119 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3121 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3122 dialogs. I think that this can be used as the base to all these
3125 * src/frontends/xforms/FormError.[Ch]
3126 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3127 implementation of InsetError dialog.
3129 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3131 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3132 * src/frontends/kde/Makefile.am: ditto
3134 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3136 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3137 macrobf. This fixes a bug of invisible text.
3139 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3141 * lib/doc/LaTeXConfig.lyx.in: updated.
3143 * src/language.C (initL): remove language "francais" and change a
3144 bit the names of the two other french variations.
3146 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3147 string that may not be 0-terminated.
3149 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3151 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3153 2000-09-20 Marko Vendelin <markov@ioc.ee>
3155 * src/frontends/gnome/FormCitation.C
3156 * src/frontends/gnome/FormIndex.C
3157 * src/frontends/gnome/FormToc.C
3158 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3159 the variable initialization to shut up the warnings
3161 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3163 * src/table.[Ch]: deleted files
3165 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3168 2000-09-18 Juergen Vigna <jug@sad.it>
3170 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3171 problems with selection. Inserted new LFUN_PASTESELECTION.
3172 (InsetButtonPress): inserted handling of middle mouse-button paste.
3174 * src/spellchecker.C: changed word to word.c_str().
3176 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3178 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3179 included in the ``make dist'' tarball.
3181 2000-09-15 Juergen Vigna <jug@sad.it>
3183 * src/CutAndPaste.C (cutSelection): small fix return the right
3184 end position after cut inside one paragraph only.
3186 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3187 we are locked as otherwise we don't have a valid cursor position!
3189 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3191 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3193 * src/frontends/kde/FormRef.C: added using directive.
3194 * src/frontends/kde/FormToc.C: ditto
3196 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3198 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3200 2000-09-19 Marko Vendelin <markov@ioc.ee>
3202 * src/frontends/gnome/Menubar_pimpl.C
3203 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3204 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3206 * src/frontends/gnome/mainapp.C
3207 * src/frontends/gnome/mainapp.h: support for menu update used
3210 * src/frontends/gnome/mainapp.C
3211 * src/frontends/gnome/mainapp.h: support for "action" area in the
3212 main window. This area is used by small simple dialogs, such as
3215 * src/frontends/gnome/FormIndex.C
3216 * src/frontends/gnome/FormIndex.h
3217 * src/frontends/gnome/FormUrl.C
3218 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3221 * src/frontends/gnome/FormCitation.C
3222 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3223 action area. Only "Insert new citation" is implemented.
3225 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3227 * src/buffer.C (Dispatch): fix call to Dispatch
3228 * src/insets/insetref.C (Edit): likewise
3229 * src/insets/insetparent.C (Edit): likewise
3230 * src/insets/insetinclude.C (include_cb): likewise
3231 * src/frontends/xforms/FormUrl.C (apply): likewise
3232 * src/frontends/xforms/FormToc.C (apply): likewise
3233 * src/frontends/xforms/FormRef.C (apply): likewise
3234 * src/frontends/xforms/FormIndex.C (apply): likewise
3235 * src/frontends/xforms/FormCitation.C (apply): likewise
3236 * src/lyxserver.C (callback): likewise
3237 * src/lyxfunc.C (processKeySym): likewise
3238 (Dispatch): likewise
3239 (Dispatch): likewise
3240 * src/lyx_cb.C (LayoutsCB): likewise
3242 * Makefile.am (sourcedoc): small change
3244 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3246 * src/main.C (main): Don't make an empty GUIRunTime object. all
3247 methods are static. constify a bit remove unneded using + headers.
3249 * src/tabular.C: some more const to local vars move some loop vars
3251 * src/spellchecker.C: added some c_str after some word for pspell
3253 * src/frontends/GUIRunTime.h: add new static method setDefaults
3254 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3255 * src/frontends/kde/GUIRunTime.C (setDefaults):
3256 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3258 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3259 with strnew in arg, use correct emptystring when calling SetName.
3261 * several files: remove all commented code with relation to
3262 HAVE_SSTREAM beeing false. We now only support stringstream and
3265 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3267 * src/lyxfunc.C: construct correctly the automatic new file
3270 * src/text2.C (IsStringInText): change type of variable i to shut
3273 * src/support/sstream.h: do not use namespaces if the compiler
3274 does not support them.
3276 2000-09-15 Marko Vendelin <markov@ioc.ee>
3277 * src/frontends/gnome/FormCitation.C
3278 * src/frontends/gnome/FormCitation.h
3279 * src/frontends/gnome/diainsertcitation_interface.c
3280 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3281 regexp support to FormCitation [Gnome].
3283 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3286 * configure.in: remove unused KDE/GTKGUI define
3288 * src/frontends/kde/FormRef.C
3289 * src/frontends/kde/FormRef.h
3290 * src/frontends/kde/formrefdialog.C
3291 * src/frontends/kde/formrefdialog.h: double click will
3292 go to reference, now it is possible to change a cross-ref
3295 * src/frontends/kde/FormToc.C
3296 * src/frontends/kde/FormToc.h
3297 * src/frontends/kde/formtocdialog.C
3298 * src/frontends/kde/formtocdialog.h: add a depth
3301 * src/frontends/kde/Makefile.am: add QtLyXView.h
3304 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3306 * src/frontends/kde/FormCitation.h: added some using directives.
3308 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3310 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3313 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3316 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3318 * src/buffer.C (pop_tag): revert for the second time a change by
3319 Lars, who seems to really hate having non-local loop variables :)
3321 * src/Lsstream.h: add "using" statements.
3323 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3324 * src/buffer.C (writeFile): ditto
3326 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3328 * src/buffer.C (writeFile): try to fix the locale modified format
3329 number to always be as we want it.
3331 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3332 in XForms 0.89. C-space is now working again.
3334 * src/Lsstream.h src/support/sstream.h: new files.
3336 * also commented out all cases where strstream were used.
3338 * src/Bullet.h (c_str): remove method.
3340 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3342 * a lot of files: get rid of "char const *" and "char *" is as
3343 many places as possible. We only want to use them in interaction
3344 with system of other libraries, not inside lyx.
3346 * a lot of files: return const object is not of pod type. This
3347 helps ensure that temporary objects is not modified. And fits well
3348 with "programming by contract".
3350 * configure.in: check for the locale header too
3352 * Makefile.am (sourcedoc): new tag for generation of doc++
3355 2000-09-14 Juergen Vigna <jug@sad.it>
3357 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3358 callback to check which combo called it and do the right action.
3360 * src/combox.C (combo_cb): added combo * to the callbacks.
3361 (Hide): moved call of callback after Ungrab of the pointer.
3363 * src/intl.h: removed LCombo2 function.
3365 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3366 function as this can now be handled in one function.
3368 * src/combox.h: added Combox * to callback prototype.
3370 * src/frontends/xforms/Toolbar_pimpl.C:
3371 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3373 2000-09-14 Garst Reese <reese@isn.net>
3375 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3376 moved usepackage{xxx}'s to beginning of file. Changed left margin
3377 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3378 underlining from title. Thanks to John Culleton for useful suggestions.
3380 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3382 * src/lyxlex_pimpl.C (setFile): change error message to debug
3385 2000-09-13 Juergen Vigna <jug@sad.it>
3387 * src/frontends/xforms/FormDocument.C: implemented choice_class
3388 as combox and give callback to combo_language so OK/Apply is activated
3391 * src/bufferlist.C (newFile): small fix so already named files
3392 (via an open call) are not requested to be named again on the
3395 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3397 * src/frontends/kde/Makefile.am
3398 * src/frontends/kde/FormRef.C
3399 * src/frontends/kde/FormRef.h
3400 * src/frontends/kde/formrefdialog.C
3401 * src/frontends/kde/formrefdialog.h: implement
3404 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3406 * src/frontends/kde/formtocdialog.C
3407 * src/frontends/kde/formtocdialog.h
3408 * src/frontends/kde/FormToc.C
3409 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3411 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3413 * src/frontends/kde/FormCitation.C: fix thinko
3414 where we didn't always display the reference text
3417 * src/frontends/kde/formurldialog.C
3418 * src/frontends/kde/formurldialog.h
3419 * src/frontends/kde/FormUrl.C
3420 * src/frontends/kde/FormUrl.h: minor cleanups
3422 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3424 * src/frontends/kde/Makefile.am
3425 * src/frontends/kde/FormToc.C
3426 * src/frontends/kde/FormToc.h
3427 * src/frontends/kde/FormCitation.C
3428 * src/frontends/kde/FormCitation.h
3429 * src/frontends/kde/FormIndex.C
3430 * src/frontends/kde/FormIndex.h
3431 * src/frontends/kde/formtocdialog.C
3432 * src/frontends/kde/formtocdialog.h
3433 * src/frontends/kde/formcitationdialog.C
3434 * src/frontends/kde/formcitationdialog.h
3435 * src/frontends/kde/formindexdialog.C
3436 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3438 2000-09-12 Juergen Vigna <jug@sad.it>
3440 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3443 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3445 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3448 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3450 * src/converter.C (Add, Convert): Added support for converter flags:
3451 needaux, resultdir, resultfile.
3452 (Convert): Added new parameter view_file.
3453 (dvips_options): Fixed letter paper option.
3455 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3456 (Export, GetExportableFormats, GetViewableFormats): Added support
3459 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3461 (easyParse): Fixed to work with new export code.
3463 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3466 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3468 * lib/bind/*.bind: Replaced
3469 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3470 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3472 2000-09-11 Juergen Vigna <jug@sad.it>
3474 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3476 * src/main.C (main): now GUII defines global guiruntime!
3478 * src/frontends/gnome/GUIRunTime.C (initApplication):
3479 * src/frontends/kde/GUIRunTime.C (initApplication):
3480 * src/frontends/xforms/GUIRunTime.C (initApplication):
3481 * src/frontends/GUIRunTime.h: added new function initApplication.
3483 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3485 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3487 2000-09-08 Juergen Vigna <jug@sad.it>
3489 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3490 we have already "Reset".
3492 * src/language.C (initL): inserted "default" language and made this
3493 THE default language (and not american!)
3495 * src/paragraph.C: inserted handling of "default" language!
3497 * src/lyxfont.C: ditto
3501 * src/paragraph.C: output the \\par only if we have a following
3502 paragraph otherwise it's not needed.
3504 2000-09-05 Juergen Vigna <jug@sad.it>
3506 * config/pspell.m4: added entry to lyx-flags
3508 * src/spellchecker.C: modified version from Kevin for using pspell
3510 2000-09-01 Marko Vendelin <markov@ioc.ee>
3511 * src/frontends/gnome/Makefile.am
3512 * src/frontends/gnome/FormCitation.C
3513 * src/frontends/gnome/FormCitation.h
3514 * src/frontends/gnome/diainsertcitation_callbacks.c
3515 * src/frontends/gnome/diainsertcitation_callbacks.h
3516 * src/frontends/gnome/diainsertcitation_interface.c
3517 * src/frontends/gnome/diainsertcitation_interface.h
3518 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3519 dialog for Gnome frontend
3521 * src/main.C: Gnome libraries require keeping application name
3522 and its version as strings
3524 * src/frontends/gnome/mainapp.C: Change the name of the main window
3525 from GnomeLyX to PACKAGE
3527 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3529 * src/frontends/Liason.C: add "using: declaration.
3531 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3533 * src/mathed/math_macro.C (Metrics): Set the size of the template
3535 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3537 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3539 * src/converter.C (add_options): New function.
3540 (SetViewer): Change $$FName into '$$FName'.
3541 (View): Add options when running xdvi
3542 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3543 (Convert): The 3rd parameter is now the desired filename. Converts
3544 calls to lyx::rename if necessary.
3545 Add options when running dvips.
3546 (dvi_papersize,dvips_options): New methods.
3548 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3550 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3551 using a call to Converter::dvips_options.
3552 Fixed to work with nex export code.
3554 * src/support/copy.C
3555 * src/support/rename.C: New files
3557 * src/support/syscall.h
3558 * src/support/syscall.C: Added Starttype SystemDontWait.
3560 * lib/ui/default.ui: Changed to work with new export code
3562 * lib/configure.m4: Changed to work with new export code
3564 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3566 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3568 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3569 so that code compiles with DEC cxx.
3571 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3572 to work correctly! Also now supports the additional elements
3575 2000-09-01 Allan Rae <rae@lyx.org>
3577 * src/frontends/ButtonPolicies.C: renamed all the references to
3578 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3580 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3581 since it's a const not a type.
3583 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3585 2000-08-31 Juergen Vigna <jug@sad.it>
3587 * src/insets/figinset.C: Various changes to look if the filename has
3588 an extension and if not add it for inline previewing.
3590 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3592 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3593 make buttonStatus and isReadOnly be const methods. (also reflect
3594 this in derived classes.)
3596 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3597 (nextState): change to be static inline, pass the StateMachine as
3599 (PreferencesPolicy): remove casts
3600 (OkCancelPolicy): remvoe casts
3601 (OkCancelReadOnlyPolicy): remove casts
3602 (NoRepeatedApplyReadOnlyPolicy): remove casts
3603 (OkApplyCancelReadOnlyPolicy): remove casts
3604 (OkApplyCancelPolicy): remove casts
3605 (NoRepeatedApplyPolicy): remove casts
3607 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3609 * src/converter.C: added some using directives
3611 * src/frontends/ButtonPolicies.C: changes to overcome
3612 "need lvalue" error with DEC c++
3614 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3615 to WMHideCB for DEC c++
3617 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3619 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3620 to BulletBMTableCB for DEC c++
3622 2000-08-31 Allan Rae <rae@lyx.org>
3624 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3625 character dialog separately from old document dialogs combo_language.
3628 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3630 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3631 Removed LFUN_REF_CREATE.
3633 * src/MenuBackend.C: Added new tags: toc and references
3635 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3636 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3638 (add_toc, add_references): New methods.
3639 (create_submenu): Handle correctly the case when there is a
3640 seperator after optional menu items.
3642 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3643 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3644 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3646 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3648 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3650 * src/converter.[Ch]: New file for converting between different
3653 * src/export.[Ch]: New file for exporting a LyX file to different
3656 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3657 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3658 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3659 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3660 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3661 RunDocBook, MenuExport.
3663 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3664 Exporter::Preview methods if NEW_EXPORT is defined.
3666 * src/buffer.C (Dispatch): Use Exporter::Export.
3668 * src/lyxrc.C: Added new tags: \converter and \viewer.
3671 * src/LyXAction.C: Define new lyx-function: buffer-update.
3672 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3673 when NEW_EXPORT is defined.
3675 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3677 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3679 * lib/ui/default.ui: Added submenus "view" and "update" to the
3682 * src/filetools.C (GetExtension): New function.
3684 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3686 2000-08-29 Allan Rae <rae@lyx.org>
3688 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3690 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3691 (EnableDocumentLayout): removed
3692 (DisableDocumentLayout): removed
3693 (build): make use of ButtonController's read-only handling to
3694 de/activate various objects. Replaces both of the above functions.
3696 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3697 (readOnly): was read_only
3698 (refresh): fixed dumb mistakes with read_only_ handling
3700 * src/frontends/xforms/forms/form_document.fd:
3701 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3702 tabbed dialogs so the tabs look more like tabs and so its easier to
3703 work out which is the current tab.
3705 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3706 segfault with form_table
3708 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3710 2000-08-28 Juergen Vigna <jug@sad.it>
3712 * acconfig.h: added USE_PSPELL.
3714 * src/config.h.in: added USE_PSPELL.
3716 * autogen.sh: added pspell.m4
3718 * config/pspell.m4: new file.
3720 * src/spellchecker.C: implemented support for pspell libary.
3722 2000-08-25 Juergen Vigna <jug@sad.it>
3724 * src/LyXAction.C (init): renamed LFUN_TABLE to
3725 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3727 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3729 * src/lyxscreen.h: add force_clear variable and fuction to force
3730 a clear area when redrawing in LyXText.
3732 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3734 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3736 * some whitespace and comment changes.
3738 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3740 * src/buffer.C: up te LYX_FORMAT to 2.17
3742 2000-08-23 Juergen Vigna <jug@sad.it>
3744 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3747 * src/insets/insettabular.C (pasteSelection): delete the insets
3748 LyXText as it is not valid anymore.
3749 (copySelection): new function.
3750 (pasteSelection): new function.
3751 (cutSelection): new function.
3752 (LocalDispatch): implemented cut/copy/paste of cell selections.
3754 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3755 don't have a LyXText.
3757 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3759 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3762 2000-08-22 Juergen Vigna <jug@sad.it>
3764 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3765 ifdef form_table out if NEW_TABULAR.
3767 2000-08-21 Juergen Vigna <jug@sad.it>
3769 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3770 (draw): fixed draw position so that the cursor is positioned in the
3772 (InsetMotionNotify): hide/show cursor so the position is updated.
3773 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3774 using cellstart() function where it should be used.
3776 * src/insets/insettext.C (draw): ditto.
3778 * src/tabular.C: fixed initialization of some missing variables and
3779 made BoxType into an enum.
3781 2000-08-22 Marko Vendelin <markov@ioc.ee>
3782 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3783 stock menu item using action numerical value, not its string
3787 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3789 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3790 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3792 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3794 * src/frontends/xforms/GUIRunTime.C: new file
3796 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3797 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3799 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3801 * src/frontends/kde/GUIRunTime.C: new file
3803 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3804 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3806 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3808 * src/frontends/gnome/GUIRunTime.C: new file
3810 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3813 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3814 small change to documetentation.
3816 * src/frontends/GUIRunTime.C: removed file
3818 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3820 * src/lyxparagraph.h: enable NEW_TABULAR as default
3822 * src/lyxfunc.C (processKeySym): remove some commented code
3824 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3825 NEW_TABULAR around the fd_form_table_options.
3827 * src/lyx_gui.C (runTime): call the static member function as
3828 GUIRunTime::runTime().
3830 2000-08-21 Allan Rae <rae@lyx.org>
3832 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3835 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3837 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3839 2000-08-21 Allan Rae <rae@lyx.org>
3841 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3842 keep Garst happy ;-)
3843 * src/frontends/xforms/FormPreferences.C (build): use setOK
3844 * src/frontends/xforms/FormDocument.C (build): use setOK
3845 (FormDocument): use the appropriate policy.
3847 2000-08-21 Allan Rae <rae@lyx.org>
3849 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3850 automatic [de]activation of arbitrary objects when in a read-only state.
3852 * src/frontends/ButtonPolicies.h: More documentation
3853 (isReadOnly): added to support the above.
3855 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3857 2000-08-18 Juergen Vigna <jug@sad.it>
3859 * src/insets/insettabular.C (getStatus): changed to return func_status.
3861 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3862 display toggle menu entries if they are.
3864 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3865 new document layout now.
3867 * src/lyxfunc.C: ditto
3869 * src/lyx_gui_misc.C: ditto
3871 * src/lyx_gui.C: ditto
3873 * lib/ui/default.ui: removed paper and quotes layout as they are now
3874 all in the document layout tabbed folder.
3876 * src/frontends/xforms/forms/form_document.fd: added Restore
3877 button and callbacks for all inputs for Allan's ButtonPolicy.
3879 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3880 (CheckChoiceClass): added missing params setting on class change.
3881 (UpdateLayoutDocument): added for updating the layout on params.
3882 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3883 (FormDocument): Implemented Allan's ButtonPolicy with the
3886 2000-08-17 Allan Rae <rae@lyx.org>
3888 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3889 so we can at least see the credits again.
3891 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3892 controller calls for the appropriate callbacks. Note that since Ok
3893 calls apply followed by cancel, and apply isn't a valid input for the
3894 APPLIED state, the bc_ calls have to be made in the static callback not
3895 within each of the real callbacks.
3897 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3898 (setOk): renamed from setOkay()
3900 2000-08-17 Juergen Vigna <jug@sad.it>
3902 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3903 in the implementation part.
3904 (composeUIInfo): don't show optional menu-items.
3906 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3908 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3910 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3911 text-state when in a text-inset.
3913 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3915 2000-08-17 Marko Vendelin <markov@ioc.ee>
3916 * src/frontends/gnome/FormIndex.C
3917 * src/frontends/gnome/FormIndex.h
3918 * src/frontends/gnome/FormToc.C
3919 * src/frontends/gnome/FormToc.h
3920 * src/frontends/gnome/dialogs
3921 * src/frontends/gnome/diatoc_callbacks.c
3922 * src/frontends/gnome/diatoc_callbacks.h
3923 * src/frontends/gnome/diainsertindex_callbacks.h
3924 * src/frontends/gnome/diainsertindex_callbacks.c
3925 * src/frontends/gnome/diainsertindex_interface.c
3926 * src/frontends/gnome/diainsertindex_interface.h
3927 * src/frontends/gnome/diatoc_interface.h
3928 * src/frontends/gnome/diatoc_interface.c
3929 * src/frontends/gnome/Makefile.am: Table of Contents and
3930 Insert Index dialogs implementation for Gnome frontend
3932 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3934 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3936 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3939 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3941 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3942 destructor. Don't definde if you don't need it
3943 (processEvents): made static, non-blocking events processing for
3945 (runTime): static method. event loop for xforms
3946 * similar as above for kde and gnome.
3948 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3949 new Pimpl is correct
3950 (runTime): new method calss the real frontends runtime func.
3952 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3954 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3956 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3958 2000-08-16 Juergen Vigna <jug@sad.it>
3960 * src/lyx_gui.C (runTime): added GUII RunTime support.
3962 * src/frontends/Makefile.am:
3963 * src/frontends/GUIRunTime.[Ch]:
3964 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3965 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3966 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3968 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3970 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3971 as this is already set in ${FRONTEND_INCLUDE} if needed.
3973 * configure.in (CPPFLAGS): setting the include dir for the frontend
3974 directory and don't set FRONTEND=xforms for now as this is executed
3977 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3979 * src/frontends/kde/Makefile.am:
3980 * src/frontends/kde/FormUrl.C:
3981 * src/frontends/kde/FormUrl.h:
3982 * src/frontends/kde/formurldialog.h:
3983 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3985 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3987 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3989 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3991 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3994 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3996 * src/WorkArea.C (work_area_handler): more work to get te
3997 FL_KEYBOARD to work with xforms 0.88 too, please test.
3999 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4001 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4003 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4006 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4008 * src/Timeout.h: remove Qt::emit hack.
4010 * several files: changes to allo doc++ compilation
4012 * src/lyxfunc.C (processKeySym): new method
4013 (processKeyEvent): comment out if FL_REVISION < 89
4015 * src/WorkArea.C: change some debugging levels.
4016 (WorkArea): set wantkey to FL_KEY_ALL
4017 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4018 clearer code and the use of compose with XForms 0.89. Change to
4019 use signals instead of calling methods in bufferview directly.
4021 * src/Painter.C: change some debugging levels.
4023 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4026 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4027 (workAreaKeyPress): new method
4029 2000-08-14 Juergen Vigna <jug@sad.it>
4031 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4033 * config/kde.m4: addes some features
4035 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4036 include missing xforms dialogs.
4038 * src/Timeout.h: a hack to be able to compile with qt/kde.
4040 * sigc++/.cvsignore: added acinclude.m4
4042 * lib/.cvsignore: added listerros
4044 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4045 xforms tree as objects are needed for other frontends.
4047 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4048 linking with not yet implemented xforms objects.
4050 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4052 2000-08-14 Baruch Even <baruch.even@writeme.com>
4054 * src/frontends/xforms/FormGraphics.h:
4055 * src/frontends/xforms/FormGraphics.C:
4056 * src/frontends/xforms/RadioButtonGroup.h:
4057 * src/frontends/xforms/RadioButtonGroup.C:
4058 * src/insets/insetgraphics.h:
4059 * src/insets/insetgraphics.C:
4060 * src/insets/insetgraphicsParams.h:
4061 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4062 instead of spaces, and various other indentation issues to make the
4063 sources more consistent.
4065 2000-08-14 Marko Vendelin <markov@ioc.ee>
4067 * src/frontends/gnome/dialogs/diaprint.glade
4068 * src/frontends/gnome/FormPrint.C
4069 * src/frontends/gnome/FormPrint.h
4070 * src/frontends/gnome/diaprint_callbacks.c
4071 * src/frontends/gnome/diaprint_callbacks.h
4072 * src/frontends/gnome/diaprint_interface.c
4073 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4076 * src/frontends/gnome/dialogs/diainserturl.glade
4077 * src/frontends/gnome/FormUrl.C
4078 * src/frontends/gnome/FormUrl.h
4079 * src/frontends/gnome/diainserturl_callbacks.c
4080 * src/frontends/gnome/diainserturl_callbacks.h
4081 * src/frontends/gnome/diainserturl_interface.c
4082 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4083 Gnome implementation
4085 * src/frontends/gnome/Dialogs.C
4086 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4087 all other dialogs. Copy all unimplemented dialogs from Xforms
4090 * src/frontends/gnome/support.c
4091 * src/frontends/gnome/support.h: support files generated by Glade
4095 * config/gnome.m4: Gnome configuration scripts
4097 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4098 configure --help message
4100 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4101 only if there are no events pendling in Gnome/Gtk. This enhances
4102 the performance of menus.
4105 2000-08-14 Allan Rae <rae@lyx.org>
4107 * lib/Makefile.am: listerrors cleaning
4109 * lib/listerrors: removed -- generated file
4110 * acinclude.m4: ditto
4111 * sigc++/acinclude.m4: ditto
4113 * src/frontends/xforms/forms/form_citation.fd:
4114 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4117 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4118 `updatesrc` and now we have a `test` target that does what `updatesrc`
4119 used to do. I didn't like having an install target that wasn't related
4122 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4123 on all except FormGraphics. This may yet happen. Followed by a major
4124 cleanup including using FL_TRANSIENT for most of the dialogs. More
4125 changes to come when the ButtonController below is introduced.
4127 * src/frontends/xforms/ButtonController.h: New file for managing up to
4128 four buttons on a dialog according to an externally defined policy.
4129 * src/frontends/xforms/Makefile.am: added above
4131 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4132 Apply and Cancel/Close buttons and everything in between and beyond.
4133 * src/frontends/Makefile.am: added above.
4135 * src/frontends/xforms/forms/form_preferences.fd:
4136 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4137 and removed variable 'status' as a result. Fixed the set_minsize thing.
4138 Use the new screen-font-update after checking screen fonts were changed
4139 Added a "Restore" button to restore the original lyxrc values while
4140 editing. This restores everything not just the last input changed.
4141 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4143 * src/LyXAction.C: screen-font-update added for updating buffers after
4144 screen font settings have been changed.
4145 * src/commandtags.h: ditto
4146 * src/lyxfunc.C: ditto
4148 * forms/lyx.fd: removed screen fonts dialog.
4149 * src/lyx_gui.C: ditto
4150 * src/menus.[Ch]: ditto
4151 * src/lyx.[Ch]: ditto
4152 * src/lyx_cb.C: ditto + code from here moved to make
4153 screen-font-update. And people wonder why progress on GUII is
4154 slow. Look at how scattered this stuff was! It takes forever
4157 * forms/fdfix.sh: Fixup the spacing after commas.
4158 * forms/makefile: Remove date from generated files. Fewer clashes now.
4159 * forms/bullet_forms.C.patch: included someones handwritten changes
4161 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4162 once I've discovered why LyXRC was made noncopyable.
4163 * src/lyx_main.C: ditto
4165 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4167 * src/frontends/xforms/forms/fdfix.sh:
4168 * src/frontends/xforms/forms/fdfixh.sed:
4169 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4170 * src/frontends/xforms/Form*.[hC]:
4171 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4172 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4173 provide a destructor for the struct FD_form_xxxx. Another version of
4174 the set_[max|min]size workaround and a few other cleanups. Actually,
4175 Angus' patch from 20000809.
4177 2000-08-13 Baruch Even <baruch.even@writeme.com>
4179 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4182 2000-08-11 Juergen Vigna <jug@sad.it>
4184 * src/insets/insetgraphics.C (InsetGraphics): changing init
4185 order because of warnings.
4187 * src/frontends/xforms/forms/makefile: adding patching .C with
4190 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4191 from .C.patch to .c.patch
4193 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4194 order because of warning.
4196 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4198 * src/frontends/Liason.C (setMinibuffer): new helper function
4200 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4202 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4204 * lib/ui/default.ui: commented out PaperLayout entry
4206 * src/frontends/xforms/form_document.[Ch]: new added files
4208 * src/frontends/xforms/FormDocument.[Ch]: ditto
4210 * src/frontends/xforms/forms/form_document.fd: ditto
4212 * src/frontends/xforms/forms/form_document.C.patch: ditto
4214 2000-08-10 Juergen Vigna <jug@sad.it>
4216 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4217 (InsetGraphics): initialized cacheHandle to 0.
4218 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4220 2000-08-10 Baruch Even <baruch.even@writeme.com>
4222 * src/graphics/GraphicsCache.h:
4223 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4224 correctly as a cache.
4226 * src/graphics/GraphicsCacheItem.h:
4227 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4230 * src/graphics/GraphicsCacheItem_pimpl.h:
4231 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4234 * src/insets/insetgraphics.h:
4235 * src/insets/insetgraphics.C: Changed from using a signal notification
4236 to polling when image is not loaded.
4238 2000-08-10 Allan Rae <rae@lyx.org>
4240 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4241 that there are two functions that have to been taken out of line by
4242 hand and aren't taken care of in the script. (Just a reminder note)
4244 * sigc++/macros/*.h.m4: Updated as above.
4246 2000-08-09 Juergen Vigna <jug@sad.it>
4248 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4250 * src/insets/insettabular.C: make drawing of single cell smarter.
4252 2000-08-09 Marko Vendelin <markov@ioc.ee>
4253 * src/frontends/gnome/Menubar_pimpl.C
4254 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4255 implementation: new files
4257 * src/frontends/gnome/mainapp.C
4258 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4261 * src/main.C: create Gnome main window
4263 * src/frontends/xforms/Menubar_pimpl.h
4264 * src/frontends/Menubar.C
4265 * src/frontends/Menubar.h: added method Menubar::update that calls
4266 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4268 * src/LyXView.C: calls Menubar::update to update the state
4271 * src/frontends/gnome/Makefile.am: added new files
4273 * src/frontends/Makefile.am: added frontend compiler options
4275 2000-08-08 Juergen Vigna <jug@sad.it>
4277 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4279 * src/bufferlist.C (close):
4280 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4281 documents if exiting without saving.
4283 * src/buffer.C (save): use removeAutosaveFile()
4285 * src/support/filetools.C (removeAutosaveFile): new function.
4287 * src/lyx_cb.C (MenuWrite): returns a bool now.
4288 (MenuWriteAs): check if file could really be saved and revert to the
4290 (MenuWriteAs): removing old autosavefile if existant.
4292 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4293 before Goto toggle declaration, because of compiler warning.
4295 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4297 * src/lyxfunc.C (MenuNew): small fix.
4299 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4301 * src/bufferlist.C (newFile):
4302 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4304 * src/lyxrc.C: added new_ask_filename tag
4306 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4308 * src/lyx.fd: removed code pertaining to form_ref
4309 * src/lyx.[Ch]: ditto
4310 * src/lyx_cb.C: ditto
4311 * src/lyx_gui.C: ditto
4312 * src/lyx_gui_misc.C: ditto
4314 * src/BufferView_pimpl.C (restorePosition): update buffer only
4317 * src/commandtags.h (LFUN_REFTOGGLE): removed
4318 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4319 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4320 (LFUN_REFBACK): renamed LFUN_REF_BACK
4322 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4323 * src/menus.C: ditto
4324 * src/lyxfunc.C (Dispatch): ditto.
4325 InsertRef dialog is now GUI-independent.
4327 * src/texrow.C: added using std::endl;
4329 * src/insets/insetref.[Ch]: strip out large amounts of code.
4330 The inset is now a container and this functionality is now
4331 managed by a new FormRef dialog
4333 * src/frontends/Dialogs.h (showRef, createRef): new signals
4335 * src/frontends/xforms/FormIndex.[Ch],
4336 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4337 when setting dialog's min/max size
4338 * src/frontends/xforms/FormIndex.[Ch]: ditto
4340 * src/frontends/xforms/FormRef.[Ch],
4341 src/frontends/xforms/forms/form_ref.fd: new xforms
4342 implementation of an InsetRef dialog
4344 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4347 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4348 ios::nocreate is not part of the standard. Removed.
4350 2000-08-07 Baruch Even <baruch.even@writeme.com>
4352 * src/graphics/Renderer.h:
4353 * src/graphics/Renderer.C: Added base class for rendering of different
4354 image formats into Pixmaps.
4356 * src/graphics/XPM_Renderer.h:
4357 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4358 in a different class.
4360 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4361 easily add support for other formats.
4363 * src/insets/figinset.C: plugged a leak of an X resource.
4365 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4367 * src/CutAndPaste.[Ch]: make all metods static.
4369 * development/Code_rules/Rules: more work, added section on
4370 Exceptions, and a References section.
4372 * a lot of header files: work to make doc++ able to generate the
4373 source documentation, some workarounds of doc++ problems. Doc++ is
4374 now able to generate the documentation.
4376 2000-08-07 Juergen Vigna <jug@sad.it>
4378 * src/insets/insettabular.C (recomputeTextInsets): removed function
4380 * src/tabular.C (SetWidthOfMulticolCell):
4382 (calculate_width_of_column_NMC): fixed return value so that it really
4383 only returns true if the column-width has changed (there where
4384 problems with muliticolumn-cells in this column).
4386 2000-08-04 Juergen Vigna <jug@sad.it>
4388 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4389 also on the scrollstatus of the inset.
4390 (workAreaMotionNotify): ditto.
4392 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4394 2000-08-01 Juergen Vigna <jug@sad.it>
4396 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4398 * src/commandtags.h:
4399 * src/LyXAction.C (init):
4400 * src/insets/inset.C (LocalDispatch): added support for
4403 * src/insets/inset.C (scroll): new functions.
4405 * src/insets/insettext.C (removeNewlines): new function.
4406 (SetAutoBreakRows): removes forced newlines in the text of the
4407 paragraph if autoBreakRows is set to false.
4409 * src/tabular.C (Latex): generates a parbox around the cell contents
4412 * src/frontends/xforms/FormTabular.C (local_update): removed
4413 the radio_useparbox button.
4415 * src/tabular.C (UseParbox): new function
4417 2000-08-06 Baruch Even <baruch.even@writeme.com>
4419 * src/graphics/GraphicsCache.h:
4420 * src/graphics/GraphicsCache.C:
4421 * src/graphics/GraphicsCacheItem.h:
4422 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4425 * src/insets/insetgraphics.h:
4426 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4427 and the drawing of the inline image.
4429 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4430 loaded into the wrong position.
4432 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4435 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4437 * src/support/translator.h: move all typedefs to public section
4439 * src/support/filetools.C (MakeLatexName): return string const
4441 (TmpFileName): ditto
4442 (FileOpenSearch): ditto
4444 (LibFileSearch): ditto
4445 (i18nLibFileSearch): ditto
4448 (CreateTmpDir): ditto
4449 (CreateBufferTmpDir): ditto
4450 (CreateLyXTmpDir): ditto
4453 (MakeAbsPath): ditto
4455 (OnlyFilename): ditto
4457 (NormalizePath): ditto
4458 (CleanupPath): ditto
4459 (GetFileContents): ditto
4460 (ReplaceEnvironmentPath): ditto
4461 (MakeRelPath): ditto
4463 (ChangeExtension): ditto
4464 (MakeDisplayPath): ditto
4465 (do_popen): return cmdret const
4466 (findtexfile): return string const
4468 * src/support/DebugStream.h: add some /// to please doc++
4470 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4472 * src/texrow.C (same_rownumber): functor to use with find_if
4473 (getIdFromRow): rewritten to use find_if and to not update the
4474 positions. return true if row is found
4475 (increasePos): new method, use to update positions
4477 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4479 * src/lyxlex_pimpl.C (verifyTable): new method
4482 (GetString): return string const
4483 (pushTable): rewrite to use std::stack
4485 (setFile): better check
4488 * src/lyxlex.h: make LyXLex noncopyable
4490 * src/lyxlex.C (text): return char const * const
4491 (GetString): return string const
4492 (getLongString): return string const
4494 * src/lyx_gui_misc.C (askForText): return pair<...> const
4496 * src/lastfiles.[Ch] (operator): return string const
4498 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4499 istringstream not char const *.
4500 move token.end() out of loop.
4501 (readFile): move initializaton of token
4503 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4504 getIdFromRow is successful.
4506 * lib/bind/emacs.bind: don't include menus bind
4508 * development/Code_rules/Rules: the beginnings of making this
4509 better and covering more of the unwritten rules that we have.
4511 * development/Code_rules/Recommendations: a couple of wording
4514 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4516 * src/support/strerror.c: remove C++ comment.
4518 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4520 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4521 LFUN_INDEX_INSERT_LAST
4523 * src/texrow.C (getIdFromRow): changed from const_iterator to
4524 iterator, allowing code to compile with DEC cxx
4526 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4527 stores part of the class, as suggested by Allan. Will allow
4529 (apply): test to apply uses InsetCommandParams operator!=
4531 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4532 (apply): test to apply uses InsetCommandParams operator!=
4534 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4535 stores part of the class.
4536 (update): removed limits on min/max size.
4538 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4539 (apply): test to apply uses InsetCommandParams operator!=
4541 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4542 (Read, Write, scanCommand, getCommand): moved functionality
4543 into InsetCommandParams.
4545 (getScreenLabel): made pure virtual
4546 new InsetCommandParams operators== and !=
4548 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4549 c-tors based on InsetCommandParams. Removed others.
4550 * src/insets/insetinclude.[Ch]: ditto
4551 * src/insets/insetlabel.[Ch]: ditto
4552 * src/insets/insetparent.[Ch]: ditto
4553 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4555 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4556 insets derived from InsetCommand created using similar c-tors
4557 based on InsetCommandParams
4558 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4559 * src/menus.C (ShowRefsMenu): ditto
4560 * src/paragraph.C (Clone): ditto
4561 * src/text2.C (SetCounter): ditto
4562 * src/lyxfunc.C (Dispatch) ditto
4563 Also recreated old InsetIndex behaviour exactly. Can now
4564 index-insert at the start of a paragraph and index-insert-last
4565 without launching the pop-up.
4567 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4569 * lib/lyxrc.example: mark te pdf options as non functional.
4571 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4572 (isStrDbl): move tmpstr.end() out of loop.
4573 (strToDbl): move intialization of tmpstr
4574 (lowercase): return string const and move tmp.end() out of loop.
4575 (uppercase): return string const and move tmp.edn() out of loop.
4576 (prefixIs): add assertion
4581 (containsOnly): ditto
4582 (containsOnly): ditto
4583 (containsOnly): ditto
4584 (countChar): make last arg char not char const
4585 (token): return string const
4586 (subst): return string const, move tmp.end() out of loop.
4587 (subst): return string const, add assertion
4588 (strip): return string const
4589 (frontStrip): return string const, add assertion
4590 (frontStrip): return string const
4595 * src/support/lstrings.C: add inclde "LAssert.h"
4596 (isStrInt): move tmpstr.end() out of loop.
4598 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4599 toollist.end() out of loop.
4600 (deactivate): move toollist.end() out of loop.
4601 (update): move toollist.end() out of loop.
4602 (updateLayoutList): move tc.end() out of loop.
4603 (add): move toollist.end() out of loop.
4605 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4606 md.end() out of loop.
4608 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4610 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4613 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4614 (Erase): move insetlist.end() out of loop.
4616 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4617 ref to const string as first arg. Move initialization of some
4618 variables, whitespace changes.
4620 * src/kbmap.C (defkey): move table.end() out of loop.
4621 (kb_keymap): move table.end() out of loop.
4622 (findbinding): move table.end() out of loop.
4624 * src/MenuBackend.C (hasMenu): move end() out of loop.
4625 (getMenu): move end() out of loop.
4626 (getMenu): move menulist_.end() out of loop.
4628 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4630 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4633 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4634 (getFromLyXName): move infotab.end() out of loop.
4636 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4637 -fvtable-thunks -ffunction-sections -fdata-sections
4639 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4641 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4644 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4646 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4648 * src/frontends/xforms/FormCitation.[Ch],
4649 src/frontends/xforms/FormIndex.[Ch],
4650 src/frontends/xforms/FormToc.[Ch],
4651 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4653 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4655 * src/commandtags.h: renamed, created some flags for citation
4658 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4660 * src/lyxfunc.C (dispatch): use signals to insert index entry
4662 * src/frontends/Dialogs.h: new signal createIndex
4664 * src/frontends/xforms/FormCommand.[Ch],
4665 src/frontends/xforms/FormCitation.[Ch],
4666 src/frontends/xforms/FormToc.[Ch],
4667 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4669 * src/insets/insetindex.[Ch]: GUI-independent
4671 * src/frontends/xforms/FormIndex.[Ch],
4672 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4675 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4677 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4678 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4680 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4682 * src/insets/insetref.C (Latex): rewrite so that there is now
4683 question that a initialization is requested.
4685 * src/insets/insetcommand.h: reenable the hide signal
4687 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4689 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4690 fix handling of shortcuts (many bugs :)
4691 (add_lastfiles): ditto.
4693 * lib/ui/default.ui: fix a few shortcuts.
4695 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4697 * Makefile.am: Fix ``rpmdist'' target to return the exit
4698 status of the ``rpm'' command, instead of the last command in
4699 the chain (the ``rm lyx.xpm'' command, which always returns
4702 2000-08-02 Allan Rae <rae@lyx.org>
4704 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4705 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4706 * src/frontends/xforms/FormToc.C (FormToc): ditto
4708 * src/frontends/xforms/Makefile.am: A few forgotten files
4710 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4711 Signals-not-copyable-problem Lars' started commenting out.
4713 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4715 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4717 * src/insets/insetcommand.h: Signals is not copyable so anoter
4718 scheme for automatic hiding of forms must be used.
4720 * src/frontends/xforms/FormCitation.h: don't inerit from
4721 noncopyable, FormCommand already does that.
4722 * src/frontends/xforms/FormToc.h: ditto
4723 * src/frontends/xforms/FormUrl.h: ditto
4725 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4727 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4729 * src/insets/insetcommand.h (hide): new SigC::Signal0
4730 (d-tor) new virtual destructor emits hide signal
4732 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4733 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4735 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4736 LOF and LOT. Inset is now GUI-independent
4738 * src/insets/insetloa.[Ch]: redundant
4739 * src/insets/insetlof.[Ch]: ditto
4740 * src/insets/insetlot.[Ch]: ditto
4742 * src/frontends/xforms/forms/form_url.fd: tweaked!
4743 * src/frontends/xforms/forms/form_citation.fd: ditto
4745 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4746 dialogs dealing with InsetCommand insets
4748 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4749 FormCommand base class
4750 * src/frontends/xforms/FormUrl.[Ch]: ditto
4752 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4754 * src/frontends/xforms/FormToc.[Ch]: ditto
4756 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4757 passed a generic InsetCommand pointer
4758 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4760 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4761 and modified InsetTOC class
4762 * src/buffer.C: ditto
4764 * forms/lyx.fd: strip out old FD_form_toc code
4765 * src/lyx_gui_misc.C: ditto
4766 * src/lyx_gui.C: ditto
4767 * src/lyx_cb.C: ditto
4768 * src/lyx.[Ch]: ditto
4770 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4772 * src/support/utility.hpp: tr -d '\r'
4774 2000-08-01 Juergen Vigna <jug@sad.it>
4776 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4778 * src/commandtags.h:
4779 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4780 LFUN_TABULAR_FEATURES.
4782 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4783 LFUN_LAYOUT_TABULAR.
4785 * src/insets/insettabular.C (getStatus): implemented helper function.
4787 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4789 2000-07-31 Juergen Vigna <jug@sad.it>
4791 * src/text.C (draw): fixed screen update problem for text-insets.
4793 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4794 something changed probably this has to be added in various other
4797 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4799 2000-07-31 Baruch Even <baruch.even@writeme.com>
4801 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4802 templates to satisfy compaq cxx.
4805 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4807 * src/support/translator.h (equal_1st_in_pair::operator()): take
4808 const ref pair_type as arg.
4809 (equal_2nd_in_pair::operator()): ditto
4810 (Translator::~Translator): remove empty d-tor.
4812 * src/graphics/GraphicsCache.C: move include config.h to top, also
4813 put initialization of GraphicsCache::singleton here.
4814 (~GraphicsCache): move here
4815 (addFile): take const ref as arg
4818 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4820 * src/BufferView2.C (insertLyXFile): change te with/without header
4823 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4825 * src/frontends/xforms/FormGraphics.C (apply): add some
4826 static_cast. Not very nice, but required by compaq cxx.
4828 * src/frontends/xforms/RadioButtonGroup.h: include header
4829 <utility> instead of <pair.h>
4831 * src/insets/insetgraphicsParams.C: add using directive.
4832 (readResize): change return type to void.
4833 (readOrigin): ditto.
4835 * src/lyxfunc.C (getStatus): add missing break for build-program
4836 function; add test for Literate for export functions.
4838 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4839 entries in Options menu.
4841 2000-07-31 Baruch Even <baruch.even@writeme.com>
4843 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4844 protect against auto-allocation; release icon when needed.
4846 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4848 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4849 on usual typewriter.
4851 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4852 earlier czech.kmap), useful only for programming.
4854 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4856 * src/frontends/xforms/FormCitation.h: fix conditioning around
4859 2000-07-31 Juergen Vigna <jug@sad.it>
4861 * src/frontends/xforms/FormTabular.C (local_update): changed
4862 radio_linebreaks to radio_useparbox and added radio_useminipage.
4864 * src/tabular.C: made support for using minipages/parboxes.
4866 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4868 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4870 (descent): so the cursor is in the middle.
4871 (width): bit smaller box.
4873 * src/insets/insetgraphics.h: added display() function.
4875 2000-07-31 Baruch Even <baruch.even@writeme.com>
4877 * src/frontends/Dialogs.h: Added showGraphics signals.
4879 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4880 xforms form definition of the graphics dialog.
4882 * src/frontends/xforms/FormGraphics.h:
4883 * src/frontends/xforms/FormGraphics.C: Added files, the
4884 GUIndependent code of InsetGraphics
4886 * src/insets/insetgraphics.h:
4887 * src/insets/insetgraphics.C: Major writing to make it work.
4889 * src/insets/insetgraphicsParams.h:
4890 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4891 struct between InsetGraphics and GUI.
4893 * src/LaTeXFeatures.h:
4894 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4895 support for graphicx package.
4897 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4898 for the graphics inset.
4900 * src/support/translator.h: Added file, used in
4901 InsetGraphicsParams. this is a template to translate between two
4904 * src/frontends/xforms/RadioButtonGroup.h:
4905 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4906 way to easily control a radio button group.
4908 2000-07-28 Juergen Vigna <jug@sad.it>
4910 * src/insets/insettabular.C (LocalDispatch):
4911 (TabularFeatures): added support for lyx-functions of tabular features.
4912 (cellstart): refixed this function after someone wrongly changed it.
4914 * src/commandtags.h:
4915 * src/LyXAction.C (init): added support for tabular-features
4917 2000-07-28 Allan Rae <rae@lyx.org>
4919 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4920 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4921 triggers the callback for input checking. As a result we sometimes get
4922 "LyX: This shouldn't happen..." printed to cerr.
4923 (input): Started using status variable since I only free() on
4924 destruction. Some input checking for paths and font sizes.
4926 * src/frontends/xforms/FormPreferences.h: Use status to control
4927 activation of Ok and Apply
4929 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4930 callback. Also resized to stop segfaults with 0.88. The problem is
4931 that xforms-0.88 requires the folder to be wide enough to fit all the
4932 tabs. If it isn't it causes all sorts of problems.
4934 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4936 * src/frontends/xforms/forms/README: Reflect reality.
4938 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4939 * src/frontends/xforms/forms/makefile: ditto.
4941 * src/commandtags.h: Get access to new Preferences dialog
4942 * src/LyXAction.C: ditto
4943 * src/lyxfunc.C: ditto
4944 * lib/ui/default.ui: ditto
4946 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4948 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4950 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4953 * src/frontends/xforms/form_url.[Ch]: added.
4955 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4957 * src/insets/insetbib.h: fixed bug in previous commit
4959 * src/frontends/xforms/FormUrl.h: ditto
4961 * src/frontends/xforms/FormPrint.h: ditto
4963 * src/frontends/xforms/FormPreferences.h: ditto
4965 * src/frontends/xforms/FormCopyright.h: ditto
4967 * src/frontends/xforms/FormCitation.C: ditto
4969 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4970 private copyconstructor and private default contructor
4972 * src/support/Makefile.am: add utility.hpp
4974 * src/support/utility.hpp: new file from boost
4976 * src/insets/insetbib.h: set owner in clone
4978 * src/frontends/xforms/FormCitation.C: added missing include
4981 * src/insets/form_url.[Ch]: removed
4983 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4985 * development/lyx.spec.in
4986 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4987 file/directory re-organization.
4989 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4991 * src/insets/insetcommand.[Ch]: moved the string data and
4992 associated manipulation methods into a new stand-alone class
4993 InsetCommandParams. This class has two additional methods
4994 getAsString() and setFromString() allowing the contents to be
4995 moved around as a single string.
4996 (addContents) method removed.
4997 (setContents) method no longer virtual.
4999 * src/buffer.C (readInset): made use of new InsetCitation,
5000 InsetUrl constructors based on InsetCommandParams.
5002 * src/commandtags.h: add LFUN_INSERT_URL
5004 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5005 independent InsetUrl and use InsetCommandParams to extract
5006 string info and create new Insets.
5008 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5010 * src/frontends/xforms/FormCitation.C (apply): uses
5013 * src/frontends/xforms/form_url.C
5014 * src/frontends/xforms/form_url.h
5015 * src/frontends/xforms/FormUrl.h
5016 * src/frontends/xforms/FormUrl.C
5017 * src/frontends/xforms/forms/form_url.fd: new files
5019 * src/insets/insetcite.[Ch]: removed unused constructors.
5021 * src/insets/insetinclude.[Ch]: no longer store filename
5023 * src/insets/inseturl.[Ch]: GUI-independent.
5025 2000-07-26 Juergen Vigna <jug@sad.it>
5026 * renamed frontend from gtk to gnome as it is that what is realized
5027 and did the necessary changes in the files.
5029 2000-07-26 Marko Vendelin <markov@ioc.ee>
5031 * configure.in: cleaning up gnome configuration scripts
5033 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5035 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5036 shortcuts syndrom by redrawing them explicitely (a better solution
5037 would be appreciated).
5039 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5041 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5044 * src/lyx_cb.C (MenuExport): change html export to do the right
5045 thing depending of the document type (instead of having
5046 html-linuxdoc and html-docbook).
5047 * src/lyxfunc.C (getStatus): update for html
5048 * lib/ui/default.ui: simplify due to the above change.
5049 * src/menus.C (ShowFileMenu): update too (in case we need it).
5051 * src/MenuBackend.C (read): if a menu is defined twice, add the
5052 new entries to the exiting one.
5054 2000-07-26 Juergen Vigna <jug@sad.it>
5056 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5058 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5059 and return a bool if it did actual save the file.
5060 (AutoSave): don't autosave a unnamed doc.
5062 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5063 check if this is an UNNAMED new file and react to it.
5064 (newFile): set buffer to unnamed and change to not mark a new
5065 buffer dirty if I didn't do anything with it.
5067 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5069 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5071 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5072 friend as per Angus's patch posted to lyx-devel.
5074 * src/ext_l10n.h: updated
5076 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5077 gettext on the style string right before inserting them into the
5080 * autogen.sh: add code to extract style strings form layout files,
5081 not good enough yet.
5083 * src/frontends/gtk/.cvsignore: add MAKEFILE
5085 * src/MenuBackend.C (read): run the label strings through gettext
5086 before storing them in the containers.
5088 * src/ext_l10n.h: new file
5090 * autogen.sh : generate the ext_l10n.h file here
5092 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5094 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5097 * lib/ui/default.ui: fix a couple of typos.
5099 * config/gnome/gtk.m4: added (and added to the list of files in
5102 * src/insets/insetinclude.C (unique_id): fix when we are using
5103 lyxstring instead of basic_string<>.
5104 * src/insets/insettext.C (LocalDispatch): ditto.
5105 * src/support/filetools.C: ditto.
5107 * lib/configure.m4: create the ui/ directory if necessary.
5109 * src/LyXView.[Ch] (updateToolbar): new method.
5111 * src/BufferView_pimpl.C (buffer): update the toolbar when
5112 opening/closing buffer.
5114 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5116 * src/LyXAction.C (getActionName): enhance to return also the name
5117 and options of pseudo-actions.
5118 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5120 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5121 as an example of what is possible). Used in File->Build too (more
5122 useful) and in the import/export menus (to mimick the complicated
5123 handling of linuxdoc and friends). Try to update all the entries.
5125 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5128 * src/MenuBackend.C (read): Parse the new OptItem tag.
5130 * src/MenuBackend.h: Add a new optional_ data member (used if the
5131 entry should be omitted when the lyxfunc is disabled).
5133 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5134 function, used as a shortcut.
5135 (create_submenu): align correctly the shortcuts on the widest
5138 * src/MenuBackend.h: MenuItem.label() only returns the label of
5139 the menu without shortcut; new method shortcut().
5141 2000-07-14 Marko Vendelin <markov@ioc.ee>
5143 * src/frontends/gtk/Dialogs.C:
5144 * src/frontends/gtk/FormCopyright.C:
5145 * src/frontends/gtk/FormCopyright.h:
5146 * src/frontends/gtk/Makefile.am: added these source-files for the
5147 Gtk/Gnome support of the Copyright-Dialog.
5149 * src/main.C: added Gnome::Main initialization if using
5150 Gtk/Gnome frontend-GUI.
5152 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5154 * config/gnome/aclocal-include.m4
5155 * config/gnome/compiler-flags.m4
5156 * config/gnome/curses.m4
5157 * config/gnome/gnome--.m4
5158 * config/gnome/gnome-bonobo-check.m4
5159 * config/gnome/gnome-common.m4
5160 * config/gnome/gnome-fileutils.m4
5161 * config/gnome/gnome-ghttp-check.m4
5162 * config/gnome/gnome-gnorba-check.m4
5163 * config/gnome/gnome-guile-checks.m4
5164 * config/gnome/gnome-libgtop-check.m4
5165 * config/gnome/gnome-objc-checks.m4
5166 * config/gnome/gnome-orbit-check.m4
5167 * config/gnome/gnome-print-check.m4
5168 * config/gnome/gnome-pthread-check.m4
5169 * config/gnome/gnome-support.m4
5170 * config/gnome/gnome-undelfs.m4
5171 * config/gnome/gnome-vfs.m4
5172 * config/gnome/gnome-x-checks.m4
5173 * config/gnome/gnome-xml-check.m4
5174 * config/gnome/gnome.m4
5175 * config/gnome/gperf-check.m4
5176 * config/gnome/gtk--.m4
5177 * config/gnome/linger.m4
5178 * config/gnome/need-declaration.m4: added configuration scripts
5179 for Gtk/Gnome frontend-GUI
5181 * configure.in: added support for the --with-frontend=gtk option
5183 * autogen.sh: added config/gnome/* to list of config-files
5185 * acconfig.h: added define for GTKGUI-support
5187 * config/lyxinclude.m4: added --with-frontend[=value] option value
5188 for Gtk/Gnome frontend-GUI support.
5190 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5192 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5196 * src/paragraph.C (GetChar): remove non-const version
5198 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5199 (search_kw): use it.
5201 * src/lyx_main.C (init): if "preferences" exist, read that instead
5203 (ReadRcFile): return bool if the file could be read ok.
5204 (ReadUIFile): add a check to see if lex file is set ok.
5206 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5207 bastring can be used instead of lyxstring (still uses the old code
5208 if std::string is good enough or if lyxstring is used.)
5210 * src/encoding.C: make the arrays static, move ininle functions
5212 * src/encoding.h: from here.
5214 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5215 (parseSingleLyXformat2Token): move inset parsing to separate method
5216 (readInset): new private method
5218 * src/Variables.h: remove virtual from get().
5220 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5221 access to NEW_INSETS and NEW_TABULAR
5223 * src/MenuBackend.h: remove superfluous forward declaration of
5224 MenuItem. Add documentations tags "///", remove empty MenuItem
5225 destructor, remove private default contructor.
5227 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5229 (read): more string mlabel and mname to where they are used
5230 (read): remove unused variables mlabel and mname
5231 (defaults): unconditional clear, make menusetup take advantage of
5232 add returning Menu &.
5234 * src/LyXView.h: define NEW_MENUBAR as default
5236 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5237 to NEW_INSETS and NEW_TABULAR.
5238 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5239 defined. Change some of the "xxxx-inset-insert" functions names to
5242 * several files: more enahncements to NEW_INSETS and the resulting
5245 * lib/lyxrc.example (\date_insert_format): move to misc section
5247 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5248 bastring and use AC_CACHE_CHECK.
5249 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5250 the system have the newest methods. uses AC_CACHE_CHECK
5251 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5252 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5253 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5255 * configure.in: add LYX_CXX_GOOD_STD_STRING
5257 * acinclude.m4: recreated
5259 2000-07-24 Amir Karger <karger@lyx.org>
5261 * README: add Hebrew, Arabic kmaps
5264 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5266 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5269 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5271 * Lot of files: add pragma interface/implementation.
5273 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5275 * lib/ui/default.ui: new file (ans new directory). Contains the
5276 default menu and toolbar.
5278 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5279 global space. Toolbars are now read (as menus) in ui files.
5281 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5283 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5284 is disabled because the document is read-only. We want to have the
5285 toggle state of the function anyway.
5286 (getStatus): add code for LFUN_VC* functions (mimicking what is
5287 done in old-style menus)
5289 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5290 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5292 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5293 * src/BufferView_pimpl.C: ditto.
5294 * src/lyxfunc.C: ditto.
5296 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5297 default). This replaces old-style menus by new ones.
5299 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5300 MenuItem. Contain the data structure of a menu.
5302 * src/insets/insettext.C: use LyXView::setLayout instead of
5303 accessing directly the toolbar combox.
5304 * src/lyxfunc.C (Dispatch): ditto.
5306 * src/LyXView.C (setLayout): new method, which just calls
5307 Toolbar::setLayout().
5308 (updateLayoutChoice): move part of this method in Toolbar.
5310 * src/toolbar.[Ch]: removed.
5312 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5313 implementation the toolbar.
5315 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5316 the toolbar. It might make sense to merge it with ToolbarDefaults
5318 (setLayout): new function.
5319 (updateLayoutList): ditto.
5320 (openLayoutList): ditto.
5322 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5323 xforms implementation of the toolbar.
5324 (get_toolbar_func): comment out, since I do not
5325 know what it is good for.
5327 * src/ToolbarDefaults.h: Add the ItemType enum.
5329 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5330 for a list of allocated C strings. Used in Menubar xforms
5331 implementation to avoid memory leaks.
5333 * src/support/lstrings.[Ch] (uppercase): new version taking and
5337 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5338 * lib/bind/emacs.bind: ditto.
5340 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5342 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5343 forward decl of LyXView.
5345 * src/toolbar.C (toolbarItem): moved from toolbar.h
5346 (toolbarItem::clean): ditto
5347 (toolbarItem::~toolbarItem): ditto
5348 (toolbarItem::operator): ditto
5350 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5352 * src/paragraph.h: control the NEW_TABULAR define from here
5354 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5355 USE_TABULAR_INSETS to NEW_TABULAR
5357 * src/ToolbarDefaults.C: add include "lyxlex.h"
5359 * files using the old table/tabular: use NEW_TABULAR to control
5360 compilation of old tabular stuff.
5362 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5365 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5366 planemet in reading of old style floats, fix the \end_deeper
5367 problem when reading old style floats.
5369 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5371 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5373 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5375 * lib/bind/sciword.bind: updated.
5377 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5379 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5380 layout write problem
5382 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5384 * src/Makefile.am (INCLUDES): remove image directory from include
5387 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5388 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5390 * src/LyXView.C (create_form_form_main): read the application icon
5393 * lib/images/*.xpm: change the icons to use transparent color for
5396 * src/toolbar.C (update): change the color of the button when it
5399 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5401 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5402 setting explicitely the minibuffer.
5403 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5405 * src/LyXView.C (showState): new function. Shows font information
5406 in minibuffer and update toolbar state.
5407 (LyXView): call Toolbar::update after creating the
5410 * src/toolbar.C: change toollist to be a vector instead of a
5412 (BubbleTimerCB): get help string directly from the callback
5413 argument of the corresponding icon (which is the action)
5414 (set): remove unnecessary ugliness.
5415 (update): new function. update the icons (depressed, disabled)
5416 depending of the status of the corresponding action.
5418 * src/toolbar.h: remove help in toolbarItem
5420 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5422 * src/Painter.C (text): Added code for using symbol glyphs from
5423 iso10646 fonts. Currently diabled.
5425 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5428 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5429 magyar,turkish and usorbian.
5431 * src/paragraph.C (isMultiLingual): Made more efficient.
5433 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5436 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5437 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5438 Also changed the prototype to "bool math_insert_greek(char)".
5440 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5442 * lots of files: apply the NEW_INSETS on all code that will not be
5443 needed when we move to use the new insets. Enable the define in
5444 lyxparagrah.h to try it.
5446 * src/insets/insettabular.C (cellstart): change to be a static
5448 (InsetTabular): initialize buffer in the initializer list.
5450 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5452 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5453 form_print.h out of the header file. Replaced with forward
5454 declarations of the relevant struct.
5456 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5459 * src/commandtags.h: do not include "debug.h" which does not
5460 belong there. #include it in some other places because of this
5463 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5465 * src/insets/insetcaption.C: add a couple "using" directives.
5467 * src/toolbar.C (add): get the help text directly from lyxaction.
5469 (setPixmap): new function. Loads from disk and sets a pixmap on a
5470 botton; the name of the pixmap file is derived from the command
5473 * src/toolbar.h: remove members isBitmap and pixmap from
5476 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5477 * lib/images/: move many files from images/banner.xpm.
5479 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5481 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5482 * src/toolbar.C: ditto.
5483 * configure.in: ditto.
5484 * INSTALL: document.
5486 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5487 the spellchecker popup is closed from the WM.
5489 2000-07-19 Juergen Vigna <jug@sad.it>
5491 * src/insets/insetfloat.C (Write): small fix because we use the
5492 insetname for the type now!
5494 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5496 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5499 * src/frontends/Dialogs.h: removed hideCitation signal
5501 * src/insets/insetcite.h: added hide signal
5503 * src/insets/insetcite.C (~InsetCitation): emits new signal
5504 (getScreenLabel): "intelligent" label should now fit on the screen!
5506 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5508 * src/frontends/xforms/FormCitation.C (showInset): connects
5509 hide() to the inset's hide signal
5510 (show): modified to use fl_set_object_position rather than
5511 fl_set_object_geometry wherever possible
5513 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5515 * src/insets/lyxinset.h: add caption code
5517 * src/insets/insetfloat.C (type): new method
5519 * src/insets/insetcaption.C (Write): new method
5521 (LyxCode): new method
5523 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5524 to get it right together with using the FloatList.
5526 * src/commandtags.h: add LFUN_INSET_CAPTION
5527 * src/lyxfunc.C (Dispatch): handle it
5529 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5532 * src/Variables.[Ch]: make expand take a const reference, remove
5533 the destructor, some whitespace changes.
5535 * src/LyXAction.C (init): add caption-inset-insert
5537 * src/FloatList.C (FloatList): update the default floats a bit.
5539 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5541 * src/Variables.[Ch]: new files. Intended to be used for language
5542 specific strings (like \chaptername) and filename substitution in
5545 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5547 * lib/kbd/american.kmap: update
5549 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5551 * src/bufferparams.[Ch]: remove member allowAccents.
5553 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5555 * src/LaTeXLog.C: use the log_form.h header.
5556 * src/lyx_gui.C: ditto.
5557 * src/lyx_gui_misc.C: ditto.
5558 * src/lyxvc.h: ditto.
5560 * forms/log_form.fd: new file, created from latexoptions.fd. I
5561 kept the log popup and nuked the options form.
5563 * src/{la,}texoptions.[Ch]: removed.
5564 * src/lyx_cb.C (LaTeXOptions): ditto
5566 * src/lyx_gui.C (create_forms): do not handle the
5567 fd_latex_options form.
5569 2000-07-18 Juergen Vigna <jug@sad.it>
5571 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5572 name of the inset so that it can be requested outside (text2.C).
5574 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5577 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5579 * src/mathed/formula.h (ConvertFont): constify
5581 * src/mathed/formula.C (Read): add warning if \end_inset is not
5582 found on expected place.
5584 * src/insets/lyxinset.h (ConvertFont): consify
5586 * src/insets/insetquotes.C (ConvertFont): constify
5587 * src/insets/insetquotes.h: ditto
5589 * src/insets/insetinfo.h: add labelfont
5591 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5592 (ascent): use labelfont
5596 (Write): make .lyx file a bit nicer
5598 * src/insets/insetfloat.C (Write): simplify somewhat...
5599 (Read): add warning if arg is not found
5601 * src/insets/insetcollapsable.C: add using std::max
5602 (Read): move string token and add warning in arg is not found
5603 (draw): use std::max to get the right ty
5604 (getMaxWidth): simplify by using std::max
5606 * src/insets/insetsection.h: new file
5607 * src/insets/insetsection.C: new file
5608 * src/insets/insetcaption.h: new file
5609 * src/insets/insetcaption.C: new file
5611 * src/insets/inset.C (ConvertFont): constify signature
5613 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5614 insetcaption.[Ch] and insetsection.[Ch]
5616 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5617 uses to use LABEL_COUNTER_CHAPTER instead.
5618 * src/text2.C (SetCounter): here
5620 * src/counters.h: new file
5621 * src/counters.C: new file
5622 * src/Sectioning.h: new file
5623 * src/Sectioning.C: new file
5625 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5627 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5629 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5632 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5635 2000-07-17 Juergen Vigna <jug@sad.it>
5637 * src/tabular.C (Validate): check if array-package is needed.
5638 (SetVAlignment): added support for vertical alignment.
5639 (SetLTFoot): better support for longtable header/footers
5640 (Latex): modified to support added features.
5642 * src/LaTeXFeatures.[Ch]: added array-package.
5644 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5646 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5649 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5651 * configure.in: do not forget to put a space after -isystem.
5653 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5655 * lib/kbd/arabic.kmap: a few fixes.
5657 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5659 * some whitespace chagnes to a number of files.
5661 * src/support/DebugStream.h: change to make it easier for
5662 doc++ to parse correctly.
5663 * src/support/lyxstring.h: ditto
5665 * src/mathed/math_utils.C (compara): change to have only one
5667 (MathedLookupBOP): change because of the above.
5669 * src/mathed/math_delim.C (math_deco_compare): change to have only
5671 (search_deco): change becasue of the above.
5673 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5674 instead of manually coded one.
5676 * src/insets/insetquotes.C (Read): read the \end_inset too
5678 * src/insets/insetlatex.h: remove file
5679 * src/insets/insetlatex.C: remove file
5681 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5683 (InsetPrintIndex): remove destructor
5685 * src/insets/insetinclude.h: remove default constructor
5687 * src/insets/insetfloat.C: work to make it work better
5689 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5691 * src/insets/insetcite.h (InsetCitation): remove default constructor
5693 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5695 * src/text.C (GetColumnNearX): comment out some currently unused code.
5697 * src/paragraph.C (writeFile): move some initializations closer to
5699 (CutIntoMinibuffer): small change to use new matchIT operator
5703 (InsertInset): ditto
5706 (InsetIterator): ditto
5707 (Erase): small change to use new matchFT operator
5709 (GetFontSettings): ditto
5710 (HighestFontInRange): ditto
5713 * src/lyxparagraph.h: some chars changed to value_type
5714 (matchIT): because of some stronger checking (perhaps too strong)
5715 in SGI STL, the two operator() unified to one.
5718 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5720 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5721 the last inset read added
5722 (parseSingleLyXformat2Token): some more (future) compability code added
5723 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5724 (parseSingleLyXformat2Token): set last_inset_read
5725 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5726 (parseSingleLyXformat2Token): don't double intializw string next_token
5728 * src/TextCache.C (text_fits::operator()): add const's to the signature
5729 (has_buffer::operator()): ditto
5731 * src/Floating.h: add some comments on the class
5733 * src/FloatList.[Ch] (typeExist): new method
5736 * src/BackStack.h: added default constructor, wanted by Gcc.
5738 2000-07-14 Juergen Vigna <jug@sad.it>
5740 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5742 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5744 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5745 do a redraw when the window is resized!
5746 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5748 * src/insets/insettext.C (resizeLyXText): added function to correctly
5749 being able to resize the LyXWindow.
5751 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5753 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5755 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5756 crashes when closing dialog to a deleted inset.
5758 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5759 method! Now similar to other insets.
5761 2000-07-13 Juergen Vigna <jug@sad.it>
5763 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5765 * lib/examples/Literate.lyx: small patch!
5767 * src/insets/insetbib.C (Read): added this function because of wrong
5768 Write (without [begin|end]_inset).
5770 2000-07-11 Juergen Vigna <jug@sad.it>
5772 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5773 as the insertInset could not be good!
5775 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5776 the bool param should not be last.
5778 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5780 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5781 did submit that to Karl).
5783 * configure.in: use -isystem instead of -I for X headers. This
5784 fixes a problem on solaris with a recent gcc;
5785 put the front-end code after the X detection code;
5786 configure in sigc++ before lib/
5788 * src/lyx_main.C (commandLineHelp): remove -display from command
5791 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5793 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5794 Also put in Makefile rules for building the ``listerrors''
5795 program for parsing errors from literate programs written in LyX.
5797 * lib/build-listerrors: Added small shell script as part of compile
5798 process. This builds a working ``listerrors'' binary if noweb is
5799 installed and either 1) the VNC X server is installed on the machine,
5800 or 2) the user is compiling from within a GUI. The existence of a GUI
5801 is necessary to use the ``lyx --export'' feature for now. This
5802 hack can be removed once ``lyx --export'' no longer requires a GUI to
5805 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5807 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5808 now passed back correctly from gcc and placed "under" error
5809 buttons in a Literate LyX source.
5811 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5813 * src/text.C (GetColumnNearX): Better behavior when a RTL
5814 paragraph is ended by LTR text.
5816 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5819 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5821 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5822 true when clipboard is empty.
5824 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5826 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5827 row of the paragraph.
5828 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5829 to prevent calculation of bidi tables
5831 2000-07-07 Juergen Vigna <jug@sad.it>
5833 * src/screen.C (ToggleSelection): added y_offset and x_offset
5836 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5839 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5841 * src/insets/insettext.C: fixed Layout-Display!
5843 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5845 * configure.in: add check for strings.h header.
5847 * src/spellchecker.C: include <strings.h> in order to have a
5848 definition for bzero().
5850 2000-07-07 Juergen Vigna <jug@sad.it>
5852 * src/insets/insettext.C (draw): set the status of the bv->text to
5853 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5855 * src/screen.C (DrawOneRow):
5856 (DrawFromTo): redraw the actual row if something has changed in it
5859 * src/text.C (draw): call an update of the toplevel-inset if something
5860 has changed inside while drawing.
5862 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5864 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5866 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5867 processing inside class.
5869 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5870 processing inside class.
5872 * src/insets/insetindex.h new struct Holder, consistent with other
5875 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5876 citation dialog from main code and placed it in src/frontends/xforms.
5877 Dialog launched through signals instead of callbacks
5879 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5881 * lyx.man: update the options description.
5883 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5885 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5886 handle neg values, set min width to 590, add doc about -display
5888 2000-07-05 Juergen Vigna <jug@sad.it>
5890 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5891 calls to BufferView *.
5893 * src/insets/insettext.C (checkAndActivateInset): small fix non
5894 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5896 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5897 their \end_inset token!
5899 2000-07-04 edscott <edscott@imp.mx>
5901 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5902 lib/lyxrc.example: added option \wheel_jump
5904 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5906 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5907 remove support for -width,-height,-xpos and -ypos.
5909 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5911 * src/encoding.[Ch]: New files.
5913 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5914 (text): Call to the underline() method only when needed.
5916 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5918 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5919 encoding(s) for the document.
5921 * src/bufferparams.C (BufferParams): Changed default value of
5924 * src/language.C (newLang): Removed.
5925 (items[]): Added encoding information for all defined languages.
5927 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5928 encoding choice button.
5930 * src/lyxrc.h (font_norm_type): New member variable.
5931 (set_font_norm_type): New method.
5933 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5934 paragraphs with different encodings.
5936 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5937 (TransformChar): Changed to work correctly with Arabic points.
5938 (draw): Added support for drawing Arabic points.
5939 (draw): Removed code for drawing underbars (this is done by
5942 * src/support/textutils.h (IsPrintableNonspace): New function.
5944 * src/BufferView_pimpl.h: Added "using SigC::Object".
5945 * src/LyXView.h: ditto.
5947 * src/insets/insetinclude.h (include_label): Changed to mutable.
5949 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5951 * src/mathed/math_iter.h: remove empty destructor
5953 * src/mathed/math_cursor.h: remove empty destructor
5955 * src/insets/lyxinset.h: add THEOREM_CODE
5957 * src/insets/insettheorem.[Ch]: new files
5959 * src/insets/insetminipage.C: (InsertInset): remove
5961 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5963 (InsertInset): remove
5965 * src/insets/insetlist.C: (InsertList): remove
5967 * src/insets/insetfootlike.[Ch]: new files
5969 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5972 (InsertInset): ditto
5974 * src/insets/insetert.C: remove include Painter.h, reindent
5975 (InsertInset): move to header
5977 * src/insets/insetcollapsable.h: remove explicit from default
5978 contructor, remove empty destructor, add InsertInset
5980 * src/insets/insetcollapsable.C (InsertInset): new func
5982 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5984 * src/vspace.h: add explicit to constructor
5986 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5987 \textcompwordmark, please test this.
5989 * src/lyxrc.C: set ascii_linelen to 65 by default
5991 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5993 * src/commandtags.h: add LFUN_INSET_THEOREM
5995 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5996 (makeLinuxDocFile): remove _some_ of the nice logic
5997 (makeDocBookFile): ditto
5999 * src/Painter.[Ch]: (~Painter): removed
6001 * src/LyXAction.C (init): entry for insettheorem added
6003 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6005 (deplog): code to detect files generated by LaTeX, needs testing
6008 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6010 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6012 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6014 * src/LaTeX.C (deplog): Add a check for files that are going to be
6015 created by the first latex run, part of the project to remove the
6018 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6019 contents to the extension list.
6021 2000-07-04 Juergen Vigna <jug@sad.it>
6023 * src/text.C (NextBreakPoint): added support for needFullRow()
6025 * src/insets/lyxinset.h: added needFullRow()
6027 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6030 * src/insets/insettext.C: lots of changes for update!
6032 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6034 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6036 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6038 * src/insets/insetinclude.C (InsetInclude): fixed
6039 initialization of include_label.
6040 (unique_id): now returns a string.
6042 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6044 * src/LaTeXFeatures.h: new member IncludedFiles, for
6045 a map of key, included file name.
6047 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6048 with the included files for inclusion in SGML preamble,
6049 i. e., linuxdoc and docbook.
6052 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6053 nice (is the generated linuxdoc code to be exported?), that
6054 allows to remove column, and only_body that will be true for
6055 slave documents. Insets are allowed inside SGML font type.
6056 New handling of the SGML preamble for included files.
6057 (makeDocBookFile): the same for docbook.
6059 * src/insets/insetinclude.h:
6060 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6062 (DocBook): new export methods.
6064 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6065 and makeDocBookFile.
6067 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6068 formats to export with command line argument -x.
6070 2000-06-29 Juergen Vigna <jug@sad.it>
6072 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6073 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6075 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6076 region could already been cleared by an inset!
6078 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6080 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6083 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6085 (cursorToggle): remove special handling of lyx focus.
6087 2000-06-28 Juergen Vigna <jug@sad.it>
6089 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6092 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6094 * src/insets/insetindex.C (Edit): add a callback when popup is
6097 * src/insets/insettext.C (LocalDispatch):
6098 * src/insets/insetmarginal.h:
6099 * src/insets/insetlist.h:
6100 * src/insets/insetfoot.h:
6101 * src/insets/insetfloat.h:
6102 * src/insets/insetert.h: add a missing std:: qualifier.
6104 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6106 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6109 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6111 * src/insets/insettext.C (Read): remove tmptok unused variable
6112 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6113 (InsertInset): change for new InsetInset code
6115 * src/insets/insettext.h: add TEXT inline method
6117 * src/insets/insettext.C: remove TEXT macro
6119 * src/insets/insetmarginal.C (Write): new method
6120 (Latex): change output slightly
6122 * src/insets/insetfoot.C (Write): new method
6123 (Latex): change output slightly (don't use endl when no need)
6125 * src/insets/insetert.C (Write): new method
6127 * src/insets/insetcollapsable.h: make button_length, button_top_y
6128 and button_bottm_y protected.
6130 * src/insets/insetcollapsable.C (Write): simplify code by using
6131 tostr. Also do not output the float name, the children class
6132 should to that to get control over own arguments
6134 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6135 src/insets/insetminipage.[Ch]:
6138 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6140 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6142 * src/Makefile.am (lyx_SOURCES): add the new files
6144 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6145 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6146 * src/commandtags.h: ditto
6148 * src/LaTeXFeatures.h: add a std::set of used floattypes
6150 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6152 * src/FloatList.[Ch] src/Floating.h: new files
6154 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6156 * src/lyx_cb.C (TableApplyCB): ditto
6158 * src/text2.C: ditto
6159 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6160 (parseSingleLyXformat2Token): ditto + add code for
6161 backwards compability for old float styles + add code for new insets
6163 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6165 (InsertInset(size_type, Inset *, LyXFont)): new method
6166 (InsetChar(size_type, char)): changed to use the other InsetChar
6167 with a LyXFont(ALL_INHERIT).
6168 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6169 insert the META_INSET.
6171 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6173 * sigc++/thread.h (Threads): from here
6175 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6176 definition out of line
6177 * sigc++/scope.h: from here
6179 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6181 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6182 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6184 * Makefile.am (bindist): new target.
6186 * INSTALL: add instructions for doing a binary distribution.
6188 * development/tools/README.bin.example: update a bit.
6190 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6193 * lib/lyxrc.example: new lyxrc tag \set_color.
6195 * src/lyxfunc.C (Dispatch):
6196 * src/commandtags.h:
6197 * src/LyXAction.C: new lyxfunc "set-color".
6199 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6200 and an x11name given as strings.
6202 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6203 cache when a color is changed.
6205 2000-06-26 Juergen Vigna <jug@sad.it>
6207 * src/lyxrow.C (width): added this functions and variable.
6209 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6212 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6214 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6216 * images/undo_bw.xpm: new icon.
6217 * images/redo_bw.xpm: ditto.
6219 * configure.in (INSTALL_SCRIPT): change value to
6220 ${INSTALL} to avoid failures of install-script target.
6221 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6223 * src/BufferView.h: add a magic "friend" declaration to please
6226 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6228 * forms/cite.fd: modified to allow resizing without messing
6231 * src/insetcite.C: Uses code from cite.fd almost without
6233 User can now resize dialog in the x-direction.
6234 Resizing the dialog in the y-direction is prevented, as the
6235 code does this intelligently already.
6237 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6239 * INSTALL: remove obsolete entry in "problems" section.
6241 * lib/examples/sl_*.lyx: update of the slovenian examples.
6243 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6245 2000-06-23 Juergen Vigna <jug@sad.it>
6247 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6249 * src/buffer.C (resize): delete the LyXText of textinsets.
6251 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6253 * src/insets/lyxinset.h: added another parameter 'cleared' to
6254 the draw() function.
6256 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6257 unlocking inset in inset.
6259 2000-06-22 Juergen Vigna <jug@sad.it>
6261 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6262 of insets and moved first to LyXText.
6264 * src/mathed/formulamacro.[Ch]:
6265 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6267 2000-06-21 Juergen Vigna <jug@sad.it>
6269 * src/text.C (GetVisibleRow): look if I should clear the area or not
6270 using Inset::doClearArea() function.
6272 * src/insets/lyxinset.h: added doClearArea() function and
6273 modified draw(Painter &, ...) to draw(BufferView *, ...)
6275 * src/text2.C (UpdateInset): return bool insted of int
6277 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6279 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6280 combox in the character popup
6282 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6283 BufferParams const & params
6285 2000-06-20 Juergen Vigna <jug@sad.it>
6287 * src/insets/insettext.C (SetParagraphData): set insetowner on
6290 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6292 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6293 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6295 (form_main_): remove
6297 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6298 (create_form_form_main): remove FD_form_main stuff, connect to
6299 autosave_timeout signal
6301 * src/LyXView.[Ch] (getMainForm): remove
6302 (UpdateTimerCB): remove
6303 * src/BufferView_pimpl.h: inherit from SigC::Object
6305 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6306 signal instead of callback
6308 * src/BufferView.[Ch] (cursorToggleCB): remove
6310 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6312 * src/BufferView_pimpl.C: changes because of the one below
6314 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6315 instead of storing a pointer to a LyXText.
6317 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6319 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6321 * src/lyxparagraph.h
6323 * src/paragraph.C: Changed fontlist to a sorted vector.
6325 2000-06-19 Juergen Vigna <jug@sad.it>
6327 * src/BufferView.h: added screen() function.
6329 * src/insets/insettext.C (LocalDispatch): some selection code
6332 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6334 * src/insets/insettext.C (SetParagraphData):
6336 (InsetText): fixes for multiple paragraphs.
6338 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6340 * development/lyx.spec.in: Call configure with ``--without-warnings''
6341 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6342 This should be fine, however, since we generally don't want to be
6343 verbose when making an RPM.
6345 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6347 * lib/scripts/fig2pstex.py: New file
6349 2000-06-16 Juergen Vigna <jug@sad.it>
6351 * src/insets/insettabular.C (UpdateLocal):
6352 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6353 (LocalDispatch): Changed all functions to use LyXText.
6355 2000-06-15 Juergen Vigna <jug@sad.it>
6357 * src/text.C (SetHeightOfRow): call inset::update before requesting
6360 * src/insets/insettext.C (update):
6361 * src/insets/insettabular.C (update): added implementation
6363 * src/insets/lyxinset.h: added update function
6365 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6367 * src/text.C (SelectNextWord): protect against null pointers with
6368 old-style string streams. (fix from Paul Theo Gonciari
6371 * src/cite.[Ch]: remove erroneous files.
6373 * lib/configure.m4: update the list of created directories.
6375 * src/lyxrow.C: include <config.h>
6376 * src/lyxcursor.C: ditto.
6378 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6380 * lib/examples/decimal.lyx: new example file from Mike.
6382 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6383 to find template definitions (from Dekel)
6385 * src/frontends/.cvsignore: add a few things.
6387 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6389 * src/Timeout.C (TimeOut): remove default argument.
6391 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6394 * src/insets/ExternalTemplate.C: add a "using" directive.
6396 * src/lyx_main.h: remove the act_ struct, which seems unused
6399 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6401 * LyX Developers Meeting: All files changed, due to random C++ (by
6402 coincidence) code generator script.
6404 - external inset (cool!)
6405 - initial online editing of preferences
6406 - insettabular breaks insettext(s contents)
6408 - some DocBook fixes
6409 - example files update
6410 - other cool stuff, create a diff and look for yourself.
6412 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6414 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6415 -1 this is a non-line-breaking textinset.
6417 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6418 if there is no width set.
6420 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6422 * Lots of files: Merged the dialogbase branch.
6424 2000-06-09 Allan Rae <rae@lyx.org>
6426 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6427 and the Dispatch methods that used it.
6429 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6430 access to functions formerly kept in Dispatch.
6432 2000-05-19 Allan Rae <rae@lyx.org>
6434 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6435 made to_page and count_copies integers again. from_page remains a
6436 string however because I want to allow entry of a print range like
6437 "1,4,22-25" using this field.
6439 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6440 and printer-params-get. These aren't useful from the minibuffer but
6441 could be used by a script/LyXServer app provided it passes a suitable
6442 auto_mem_buffer. I guess I should take a look at how the LyXServer
6443 works and make it support xtl buffers.
6445 * sigc++/: updated to libsigc++-1.0.1
6447 * src/xtl/: updated to xtl-1.3.pl.11
6449 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6450 those changes done to the files in src/ are actually recreated when
6451 they get regenerated. Please don't ever accept a patch that changes a
6452 dialog unless that patch includes the changes to the corresponding *.fd
6455 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6456 stringOnlyContains, renamed it and generalised it.
6458 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6459 branch. Removed the remaining old form_print code.
6461 2000-04-26 Allan Rae <rae@lyx.org>
6463 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6464 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6466 2000-04-25 Allan Rae <rae@lyx.org>
6468 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6469 against a base of xtl-1.3.pl.4
6471 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6472 filter the Id: entries so they still show the xtl version number
6475 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6476 into the src/xtl code. Patch still pending with José (XTL)
6478 2000-04-24 Allan Rae <rae@lyx.org>
6480 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6481 both more generic and much safer. Use the new template functions.
6482 * src/buffer.[Ch] (Dispatch): ditto.
6484 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6485 and mem buffer more intelligently. Also a little general cleanup.
6488 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6489 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6490 * src/xtl/Makefile.am: ditto.
6491 * src/xtl/.cvsignore: ditto.
6492 * src/Makefile.am: ditto.
6494 * src/PrinterParams.h: Removed the macros member functions. Added a
6495 testInvariant member function. A bit of tidying up and commenting.
6496 Included Angus's idea for fixing operation with egcs-1.1.2.
6498 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6499 cool expansion of XTL's mem_buffer to support automatic memory
6500 management within the buffer itself. Removed the various macros and
6501 replaced them with template functions that use either auto_mem_buffer
6502 or mem_buffer depending on a #define. The mem_buffer support will
6503 disappear as soon as the auto_mem_buffer is confirmed to be good on
6504 other platforms/compilers. That is, it's there so you've got something
6507 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6508 effectively forked XTL. However I expect José will include my code
6509 into the next major release. Also fixed a memory leak.
6510 * src/xtl/text.h: ditto.
6511 * src/xtl/xdr.h: ditto.
6512 * src/xtl/giop.h: ditto.
6514 2000-04-16 Allan Rae <rae@lyx.org>
6516 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6517 by autogen.sh and removed by maintainer-clean anyway.
6518 * .cvsignore, sigc++/.cvsignore: Support the above.
6520 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6522 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6524 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6525 macros, renamed static callback-target member functions to suit new
6526 scheme and made them public.
6527 * src/frontends/xforms/forms/form_print.fd: ditto.
6528 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6530 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6533 * src/xtl/: New directory containing a minimal distribution of XTL.
6534 This is XTL-1.3.pl.4.
6536 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6538 2000-04-15 Allan Rae <rae@lyx.org>
6540 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6542 * sigc++/: Updated to libsigc++-1.0.0
6544 2000-04-14 Allan Rae <rae@lyx.org>
6546 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6547 use the generic ones in future. I'll modify my conversion script.
6549 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6551 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6552 (CloseAllBufferRelatedDialogs): Renamed.
6553 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6555 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6556 of the generic ones. These are the same ones my conversion script
6559 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6560 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6561 * src/buffer.C (Dispatch): ditto
6563 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6564 functions for updating and hiding buffer dependent dialogs.
6565 * src/BufferView.C (buffer): ditto
6566 * src/buffer.C (setReadonly): ditto
6567 * src/lyxfunc.C (CloseBuffer): ditto
6569 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6570 Dialogs.h, and hence all the SigC stuff, into every file that includes
6571 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6573 * src/BufferView2.C: reduce the number of headers included by buffer.h
6575 2000-04-11 Allan Rae <rae@lyx.org>
6577 * src/frontends/xforms/xform_macros.h: A small collection of macros
6578 for building C callbacks.
6580 * src/frontends/xforms/Makefile.am: Added above file.
6582 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6583 scheme again. This time it should work for JMarc. If this is
6584 successful I'll revise my conversion script to automate some of this.
6585 The static member functions in the class also have to be public for
6586 this scheme will work. If the scheme works (it's almost identical to
6587 the way BufferView::cursorToggleCB is handled so it should work) then
6588 FormCopyright and FormPrint will be ready for inclusion into the main
6589 trunk immediately after 1.1.5 is released -- provided we're prepared
6590 for complaints about lame compilers not handling XTL.
6592 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6594 2000-04-07 Allan Rae <rae@lyx.org>
6596 * config/lyxinclude.m4: A bit more tidying up (Angus)
6598 * src/LString.h: JMarc's <string> header fix
6600 * src/PrinterParams.h: Used string for most data to remove some
6601 ugly code in the Print dialog and avoid even uglier code when
6602 appending the ints to a string for output.
6604 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6605 and moved "default:" back to the end of switch statement. Cleaned
6606 up the printing so it uses the right function calls and so the
6607 "print to file" option actually puts the file in the right directory.
6609 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6611 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6612 and Ok+Apply button control into a separate method: input (Angus).
6613 (input) Cleaned it up and improved it to be very thorough now.
6614 (All CB) static_cast used instead of C style cast (Angus). This will
6615 probably change again once we've worked out how to keep gcc-2.8.1 happy
6616 with real C callbacks.
6617 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6618 ignore some of the bool settings and has random numbers instead. Needs
6619 some more investigation. Added other input length checks and checking
6620 of file and printer names.
6622 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6623 would link (Angus). Seems the old code doesn't compile with the pragma
6624 statement either. Separated callback entries from internal methods.
6626 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6628 2000-03-17 Allan Rae <rae@lyx.org>
6630 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6631 need it? Maybe it could go in Dialogs instead? I could make it a
6632 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6633 values to get the bool return value.
6634 (Dispatch): New overloaded method for xtl support.
6636 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6637 extern "C" callback instead of static member functions. Hopefully,
6638 JMarc will be able to compile this. I haven't changed
6639 forms/form_copyright.fd yet. Breaking one of my own rules already.
6641 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6642 because they aren't useful from the minibuffer. Maybe a LyXServer
6643 might want a help message though?
6645 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6647 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6648 xtl which needs both rtti and exceptions.
6650 * src/support/Makefile.am:
6651 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6653 * src/frontends/xforms/input_validators.[ch]: input filters and
6654 validators. These conrol what keys are valid in input boxes.
6655 Use them and write some more. Much better idea than waiting till
6656 after the user has pressed Ok to say that the input fields don't make
6659 * src/frontends/xforms/Makefile.am:
6660 * src/frontends/xforms/forms/form_print.fd:
6661 * src/frontends/xforms/forms/makefile:
6662 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6663 new scheme. Still have to make sure I haven't missed anything from
6664 the current implementation.
6666 * src/Makefile.am, src/PrinterParams.h: New data store.
6668 * other files: Added a couple of copyright notices.
6670 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6672 * src/insets/insetbib.h: move Holder struct in public space.
6674 * src/frontends/include/DialogBase.h: use SigC:: only when
6675 SIGC_CXX_NAMESPACES is defined.
6676 * src/frontends/include/Dialogs.h: ditto.
6678 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6680 * src/frontends/xforms/FormCopyright.[Ch]: do not
6681 mention SigC:: explicitely.
6683 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6685 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6686 deals with testing KDE in main configure.in
6687 * configure.in: ditto.
6689 2000-02-22 Allan Rae <rae@lyx.org>
6691 * Lots of files: Merged from HEAD
6693 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6694 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6696 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6698 * sigc++/: new minidist.
6700 2000-02-14 Allan Rae <rae@lyx.org>
6702 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6704 2000-02-08 Juergen Vigna <jug@sad.it>
6706 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6707 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6709 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6710 for this port and so it is much easier for other people to port
6711 dialogs in a common development environment.
6713 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6714 the QT/KDE implementation.
6716 * src/frontends/kde/Dialogs.C:
6717 * src/frontends/kde/FormCopyright.C:
6718 * src/frontends/kde/FormCopyright.h:
6719 * src/frontends/kde/Makefile.am:
6720 * src/frontends/kde/formcopyrightdialog.C:
6721 * src/frontends/kde/formcopyrightdialog.h:
6722 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6723 for the kde support of the Copyright-Dialog.
6725 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6726 subdir-substitution instead of hardcoded 'xforms' as we now have also
6729 * src/frontends/include/DialogBase.h (Object): just commented the
6730 label after #endif (nasty warning and I don't like warnings ;)
6732 * src/main.C (main): added KApplication initialization if using
6735 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6736 For now only the KDE event-loop is added if frontend==kde.
6738 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6740 * configure.in: added support for the --with-frontend[=value] option
6742 * autogen.sh: added kde.m4 file to list of config-files
6744 * acconfig.h: added define for KDEGUI-support
6746 * config/kde.m4: added configuration functions for KDE-port
6748 * config/lyxinclude.m4: added --with-frontend[=value] option with
6749 support for xforms and KDE.
6751 2000-02-08 Allan Rae <rae@lyx.org>
6753 * all Makefile.am: Fixed up so the make targets dist, distclean,
6754 install and uninstall all work even if builddir != srcdir. Still
6755 have a new sigc++ minidist update to come.
6757 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6759 2000-02-01 Allan Rae <rae@lyx.org>
6761 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6762 Many mods to get builddir != srcdir working.
6764 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6765 for building on NT and so we can do the builddir != srcdir stuff.
6767 2000-01-30 Allan Rae <rae@lyx.org>
6769 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6770 This will stay in "rae" branch. We probably don't really need it in
6771 the main trunk as anyone who wants to help programming it should get
6772 a full library installed also. So they can check both included and
6773 system supplied library compilation.
6775 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6776 Added a 'mini' distribution of libsigc++. If you feel the urge to
6777 change something in these directories - Resist it. If you can't
6778 resist the urge then you should modify the following script and rebuild
6779 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6780 all happen. Still uses a hacked version of libsigc++'s configure.in.
6781 I'm quite happy with the results. I'm not sure the extra work to turn
6782 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6783 worth the trouble and would probably lead to extra maintenance
6785 I haven't tested the following important make targets: install, dist.
6786 Not ready for prime time but very close. Maybe 1.1.5.
6788 * development/tools/makeLyXsigc.sh: A shell script to automatically
6789 generate our mini-dist of libsigc++. It can only be used with a CVS
6790 checkout of libsigc++ not a tarball distribution. It's well commented.
6791 This will end up as part of the libsigc++ distribution so other apps
6792 can easily have an included mini-dist. If someone makes mods to the
6793 sigc++ subpackage without modifying this script to generate those
6794 changes I'll be very upset!
6796 * src/frontends/: Started the gui/system indep structure.
6798 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6799 to access the gui-indep dialogs are in this class. Much improved
6800 design compared to previous revision. Lars, please refrain from
6801 moving this header into src/ like you did with Popups.h last time.
6803 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6805 * src/frontends/xforms/: Started the gui-indep system with a single
6806 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6809 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6810 Here you'll find a very useful makefile and automated fdfix.sh that
6811 makes updating dailogs a no-brainer -- provided you follow the rules
6812 set out in the README. I'm thinking about adding another script to
6813 automatically generate skeleton code for a new dialog given just the
6816 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6817 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6818 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6820 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6822 * src/support/LSubstring.C (operator): simplify
6824 * src/lyxtext.h: removed bparams, use buffer_->params instead
6826 * src/lyxrow.h: make Row a real class, move all variables to
6827 private and use accessors.
6829 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6831 (isRightToLeftPar): ditto
6832 (ChangeLanguage): ditto
6833 (isMultiLingual): ditto
6836 (SimpleTeXOnePar): ditto
6837 (TeXEnvironment): ditto
6838 (GetEndLabel): ditto
6840 (SetOnlyLayout): ditto
6841 (BreakParagraph): ditto
6842 (BreakParagraphConservative): ditto
6843 (GetFontSettings): ditto
6845 (CopyIntoMinibuffer): ditto
6846 (CutIntoMinibuffer): ditto
6847 (PasteParagraph): ditto
6848 (SetPExtraType): ditto
6849 (UnsetPExtraType): ditto
6850 (DocBookContTableRows): ditto
6851 (SimpleDocBookOneTablePar): ditto
6853 (TeXFootnote): ditto
6854 (SimpleTeXOneTablePar): ditto
6855 (TeXContTableRows): ditto
6856 (SimpleTeXSpecialChars): ditto
6859 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6860 to private and use accessors.
6862 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6863 this, we did not use it anymore and has not been for ages. Just a
6864 waste of cpu cycles.
6866 * src/language.h: make Language a real class, move all variables
6867 to private and use accessors.
6869 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6870 (create_view): remove
6871 (update): some changes for new timer
6872 (cursorToggle): use new timer
6873 (beforeChange): change for new timer
6875 * src/BufferView.h (cursorToggleCB): removed last paramter because
6878 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6879 (cursorToggleCB): change because of new timer code
6881 * lib/CREDITS: updated own mailaddress
6883 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6885 * src/support/filetools.C (PutEnv): fix the code in case neither
6886 putenv() nor setenv() have been found.
6888 * INSTALL: mention the install-strip Makefile target.
6890 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6891 read-only documents.
6893 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6895 * lib/reLyX/configure.in (VERSION): avoid using a previously
6896 generated reLyX wrapper to find out $prefix.
6898 * lib/examples/eu_adibide_lyx-atua.lyx:
6899 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6900 translation of the Tutorial (Dooteo)
6902 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6904 * forms/cite.fd: new citation dialog
6906 * src/insetcite.[Ch]: the new citation dialog is moved into
6909 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6912 * src/insets/insetcommand.h: data members made private.
6914 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6916 * LyX 1.1.5 released
6918 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6920 * src/version.h (LYX_RELEASE): to 1.1.5
6922 * src/spellchecker.C (RunSpellChecker): return false if the
6923 spellchecker dies upon creation.
6925 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6927 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6928 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6932 * lib/CREDITS: update entry for Martin Vermeer.
6934 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6936 * src/text.C (draw): Draw foreign language bars at the bottom of
6937 the row instead of at the baseline.
6939 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6941 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6943 * lib/bind/de_menus.bind: updated
6945 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6947 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6949 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6951 * src/menus.C (Limit_string_length): New function
6952 (ShowTocMenu): Limit the number of items/length of items in the
6955 * src/paragraph.C (String): Correct result for a paragraph inside
6958 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6960 * src/bufferlist.C (close): test of buf->getuser() == NULL
6962 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6964 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6965 Do not call to SetCursor when the paragraph is a closed footnote!
6967 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6969 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6972 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6974 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6977 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6978 reference popup, that activates the reference-back action
6980 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6982 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6983 the menus. Also fixed a bug.
6985 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6986 the math panels when switching buffers (unless new buffer is readonly).
6988 * src/BufferView.C (NoSavedPositions)
6989 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6991 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6993 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6994 less of dvi dirty or not.
6996 * src/trans_mgr.[Ch] (insert): change first parameter to string
6999 * src/chset.[Ch] (encodeString): add const to first parameter
7001 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7003 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7007 * src/LaTeX.C (deplog): better searching for dependency files in
7008 the latex log. Uses now regexps.
7010 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7011 instead of the box hack or \hfill.
7013 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7015 * src/lyxfunc.C (doImportHelper): do not create the file before
7016 doing the actual import.
7017 (doImportASCIIasLines): create a new file before doing the insert.
7018 (doImportASCIIasParagraphs): ditto.
7020 * lib/lyxrc.example: remove mention of non-existing commands
7022 * lyx.man: remove mention of color-related switches.
7024 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7026 * src/lyx_gui.C: remove all the color-related ressources, which
7027 are not used anymore.
7029 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7032 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7034 * src/lyxrc.C (read): Add a missing break in the switch
7036 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7038 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7040 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7043 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7045 * src/text.C (draw): draw bars under foreign language words.
7047 * src/LColor.[Ch]: add LColor::language
7049 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7051 * src/lyxcursor.h (boundary): New member variable
7053 * src/text.C (IsBoundary): New methods
7055 * src/text.C: Use the above for currect cursor movement when there
7056 is both RTL & LTR text.
7058 * src/text2.C: ditto
7060 * src/bufferview_funcs.C (ToggleAndShow): ditto
7062 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7064 * src/text.C (DeleteLineForward): set selection to true to avoid
7065 that DeleteEmptyParagraphMechanism does some magic. This is how it
7066 is done in all other functions, and seems reasonable.
7067 (DeleteWordForward): do not jump over non-word stuff, since
7068 CursorRightOneWord() already does it.
7070 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7071 DeleteWordBackward, since they seem safe to me (since selection is
7072 set to "true") DeleteEmptyParagraphMechanism does nothing.
7074 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7076 * src/lyx_main.C (easyParse): simplify the code by factoring the
7077 part that removes parameters from the command line.
7078 (LyX): check wether wrong command line options have been given.
7080 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7082 * src/lyx_main.C : add support for specifying user LyX
7083 directory via command line option -userdir.
7085 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7087 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7088 the number of items per popup.
7089 (Add_to_refs_menu): Ditto.
7091 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7093 * src/lyxparagraph.h: renamed ClearParagraph() to
7094 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7095 textclass as parameter, and do nothing if free_spacing is
7096 true. This fixes part of the line-delete-forward problems.
7098 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7099 (pasteSelection): ditto.
7100 (SwitchLayoutsBetweenClasses): more translatable strings.
7102 * src/text2.C (CutSelection): use StripLeadingSpaces.
7103 (PasteSelection): ditto.
7104 (DeleteEmptyParagraphMechanism): ditto.
7106 2000-05-26 Juergen Vigna <jug@sad.it>
7108 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7109 is not needed in tabular insets.
7111 * src/insets/insettabular.C (TabularFeatures): added missing features.
7113 * src/tabular.C (DeleteColumn):
7115 (AppendRow): implemented this functions
7116 (cellsturct::operator=): clone the inset too;
7118 2000-05-23 Juergen Vigna <jug@sad.it>
7120 * src/insets/insettabular.C (LocalDispatch): better selection support
7121 when having multicolumn-cells.
7123 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7125 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7127 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7129 * src/ColorHandler.C (getGCForeground): put more test into _()
7131 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7134 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7137 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7139 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7140 there are no labels, or when buffer is readonly.
7142 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7143 there are no labels, buffer is SGML, or when buffer is readonly.
7145 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7147 * src/LColor.C (LColor): change a couple of grey40 to grey60
7148 (LColor): rewore initalization to make compiles go some magnitude
7150 (getGUIName): don't use gettext until we need the string.
7152 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7154 * src/Bullet.[Ch]: Fixed a small bug.
7156 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7158 * src/paragraph.C (String): Several fixes/improvements
7160 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7162 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7164 * src/paragraph.C (String): give more correct output.
7166 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7168 * src/lyxfont.C (stateText) Do not output the language if it is
7169 eqaul to the language of the document.
7171 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7172 between two paragraphs with the same language.
7174 * src/paragraph.C (getParLanguage) Return a correct answer for an
7175 empty dummy paragraph.
7177 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7180 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7183 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7184 the menus/popup, if requested fonts are unavailable.
7186 2000-05-22 Juergen Vigna <jug@sad.it>
7188 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7189 movement support (Up/Down/Tab/Shift-Tab).
7190 (LocalDispatch): added also preliminari cursor-selection.
7192 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7194 * src/paragraph.C (PasteParagraph): Hopefully now right!
7196 2000-05-22 Garst R. Reese <reese@isn.net>
7198 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7199 of list, change all references to Environment to Command
7200 * tex/hollywood.cls : rewrite environments as commands, add
7201 \uppercase to interiorshot and exteriorshot to force uppecase.
7202 * tex/broadway.cls : rewrite environments as commands. Tweak
7205 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7207 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7208 size of items: use a constant intead of the hardcoded 40, and more
7209 importantly do not remove the %m and %x tags added at the end.
7210 (Add_to_refs_menu): use vector::size_type instead of
7211 unsigned int as basic types for the variables. _Please_ do not
7212 assume that size_t is equal to unsigned int. On an alpha, this is
7213 unsigned long, which is _not_ the same.
7215 * src/language.C (initL): remove language "hungarian", since it
7216 seems that "magyar" is better.
7218 2000-05-22 Juergen Vigna <jug@sad.it>
7220 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7222 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7225 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7226 next was deleted but not set to 0.
7228 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7230 * src/language.C (initL): change the initialization of languages
7231 so that compiles goes _fast_.
7233 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7236 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7238 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7242 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7244 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7246 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7250 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7253 * src/insets/insetlo*.[Ch]: Made editable
7255 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7257 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7258 the current selection.
7260 * src/BufferView_pimpl.C (stuffClipboard): new method
7262 * src/BufferView.C (stuffClipboard): new method
7264 * src/paragraph.C (String): new method
7266 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7267 LColor::ignore when lyxname is not found.
7269 * src/BufferView.C (pasteSelection): new method
7271 * src/BufferView_pimpl.C (pasteSelection): new method
7273 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7275 * src/WorkArea.C (request_clipboard_cb): new static function
7276 (getClipboard): new method
7277 (putClipboard): new method
7279 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7281 * LyX 1.1.5pre2 released
7283 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7285 * src/vspace.C (operator=): removed
7286 (operator=): removed
7288 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7290 * src/layout.C (NumberOfClass): manually set the type in make_pair
7291 (NumberOfLayout): ditto
7293 * src/language.C: use the Language constructor for ignore_lang
7295 * src/language.h: add constructors to struct Language
7297 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7299 * src/text2.C (SetCursorIntern): comment out #warning
7301 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7303 * src/mathed/math_iter.h: initialize sx and sw to 0
7305 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7307 * forms/lyx.fd: Redesign of form_ref
7309 * src/LaTeXFeatures.[Ch]
7313 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7316 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7317 and Buffer::inset_iterator.
7319 * src/menus.C: Added new menus: TOC and Refs.
7321 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7323 * src/buffer.C (getTocList): New method.
7325 * src/BufferView2.C (ChangeRefs): New method.
7327 * src/buffer.C (getLabelList): New method. It replaces the old
7328 getReferenceList. The return type is vector<string> instead of
7331 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7332 the old getLabel() and GetNumberOfLabels() methods.
7333 * src/insets/insetlabel.C (getLabelList): ditto
7334 * src/mathed/formula.C (getLabelList): ditto
7336 * src/paragraph.C (String): New method.
7338 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7339 Uses the new getTocList() method.
7340 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7341 which automatically updates the contents of the browser.
7342 (RefUpdateCB): Use the new getLabelList method.
7344 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7346 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7348 * src/spellchecker.C: Added using std::reverse;
7350 2000-05-19 Juergen Vigna <jug@sad.it>
7352 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7354 * src/insets/insettext.C (computeTextRows): small fix for display of
7355 1 character after a newline.
7357 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7360 2000-05-18 Juergen Vigna <jug@sad.it>
7362 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7363 when changing width of column.
7365 * src/tabular.C (set_row_column_number_info): setting of
7366 autobreak rows if necessary.
7368 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7370 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7372 * src/vc-backend.*: renamed stat() to status() and vcstat to
7373 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7374 compilation broke. The new name seems more relevant, anyway.
7376 2000-05-17 Juergen Vigna <jug@sad.it>
7378 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7379 which was wrong if the removing caused removing of rows!
7381 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7382 (pushToken): new function.
7384 * src/text2.C (CutSelection): fix problem discovered with purify
7386 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7388 * src/debug.C (showTags): enlarge the first column, now that we
7389 have 6-digits debug codes.
7391 * lib/layouts/hollywood.layout:
7392 * lib/tex/hollywood.cls:
7393 * lib/tex/brodway.cls:
7394 * lib/layouts/brodway.layout: more commands and fewer
7395 environments. Preambles moved in the .cls files. Broadway now has
7396 more options on scene numbering and less whitespace (from Garst)
7398 * src/insets/insetbib.C (getKeys): make sure that we are in the
7399 document directory, in case the bib file is there.
7401 * src/insets/insetbib.C (Latex): revert bogus change.
7403 2000-05-16 Juergen Vigna <jug@sad.it>
7405 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7406 the TabularLayout on cursor move.
7408 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7410 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7413 (draw): fixed cursor position and drawing so that the cursor is
7414 visible when before the tabular-inset.
7416 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7417 when creating from old insettext.
7419 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7421 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7423 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7424 * lib/tex/brodway.cls: ditto
7426 * lib/layouts/brodway.layout: change alignment of parenthical
7429 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7431 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7432 versions 0.88 and 0.89 are supported.
7434 2000-05-15 Juergen Vigna <jug@sad.it>
7436 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7439 * src/insets/insettext.C (computeTextRows): redone completely this
7440 function in a much cleaner way, because of problems when having a
7442 (draw): added a frame border when the inset is locked.
7443 (SetDrawLockedFrame): this sets if we draw the border or not.
7444 (SetFrameColor): this sets the frame color (default=insetframe).
7446 * src/insets/lyxinset.h: added x() and y() functions which return
7447 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7448 function which is needed to see if we have a locking inset of some
7449 type in this inset (needed for now in insettabular).
7451 * src/vspace.C (inPixels): the same function also without a BufferView
7452 parameter as so it is easier to use it in some ocasions.
7454 * src/lyxfunc.C: changed all places where insertInset was used so
7455 that now if it couldn't be inserted it is deleted!
7457 * src/TabularLayout.C:
7458 * src/TableLayout.C: added support for new tabular-inset!
7460 * src/BufferView2.C (insertInset): this now returns a bool if the
7461 inset was really inserted!!!
7463 * src/tabular.C (GetLastCellInRow):
7464 (GetFirstCellInRow): new helper functions.
7465 (Latex): implemented for new tabular class.
7469 (TeXTopHLine): new Latex() helper functions.
7471 2000-05-12 Juergen Vigna <jug@sad.it>
7473 * src/mathed/formulamacro.C (Read):
7474 * src/mathed/formula.C (Read): read also the \end_inset here!
7476 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7478 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7479 crush when saving formulae with unbalanced parenthesis.
7481 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7483 * src/layout.C: Add new keyword "endlabelstring" to layout file
7485 * src/text.C (GetVisibleRow): Draw endlabel string.
7487 * lib/layouts/broadway.layout
7488 * lib/layouts/hollywood.layout: Added endlabel for the
7489 Parenthetical layout.
7491 * lib/layouts/heb-article.layout: Do not use slanted font shape
7492 for Theorem like environments.
7494 * src/buffer.C (makeLaTeXFile): Always add "american" to
7495 the UsedLanguages list if document language is RTL.
7497 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7499 * add addendum to README.OS2 and small patch (from SMiyata)
7501 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7503 * many files: correct the calls to ChangeExtension().
7505 * src/support/filetools.C (ChangeExtension): remove the no_path
7506 argument, which does not belong there. Use OnlyFileName() instead.
7508 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7509 files when LaTeXing a non-nice latex file.
7511 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7512 a chain of "if". Return false when deadkeys are not handled.
7514 * src/lyx_main.C (LyX): adapted the code for default bindings.
7516 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7517 bindings for basic functionality (except deadkeys).
7518 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7520 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7521 several methods: handle override_x_deadkeys.
7523 * src/lyxrc.h: remove the "bindings" map, which did not make much
7524 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7526 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7528 * src/lyxfont.C (stateText): use a saner method to determine
7529 whether the font is "default". Seems to fix the crash with DEC
7532 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7534 2000-05-08 Juergen Vigna <jug@sad.it>
7536 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7537 TabularLayoutMenu with mouse-button-3
7538 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7540 * src/TabularLayout.C: added this file for having a Layout for
7543 2000-05-05 Juergen Vigna <jug@sad.it>
7545 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7546 recalculating inset-widths.
7547 (TabularFeatures): activated this function so that I can change
7548 tabular-features via menu.
7550 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7551 that I can test some functions with the Table menu.
7553 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7555 * src/lyxfont.C (stateText): guard against stupid c++libs.
7557 * src/tabular.C: add using std::vector
7558 some whitespace changes, + removed som autogenerated code.
7560 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7562 2000-05-05 Juergen Vigna <jug@sad.it>
7564 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7565 row, columns and cellstructures.
7567 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7569 * lib/lyxrc.example: remove obsolete entries.
7571 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7572 reading of protected_separator for free_spacing.
7574 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7576 * src/text.C (draw): do not display an exclamation mark in the
7577 margin for margin notes. This is confusing, ugly and
7580 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7581 AMS math' is checked.
7583 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7584 name to see whether including the amsmath package is needed.
7586 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7588 * src/paragraph.C (validate): Compute UsedLanguages correctly
7589 (don't insert the american language if it doesn't appear in the
7592 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7593 The argument of \thanks{} command is considered moving argument
7595 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7598 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7600 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7601 for appendix/minipage/depth. The lines can be now both in the footnote
7602 frame, and outside the frame.
7604 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7607 2000-05-05 Juergen Vigna <jug@sad.it>
7609 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7610 neede only in tabular.[Ch].
7612 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7614 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7616 (Write): write '~' for PROTECTED_SEPARATOR
7618 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7620 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7623 * src/mathed/formula.C (drawStr): rename size to siz.
7625 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7626 possibly fix a bug by not changing the pflags = flags to piflags =
7629 2000-05-05 Juergen Vigna <jug@sad.it>
7631 * src/insets/insetbib.C: moved using directive
7633 * src/ImportNoweb.C: small fix for being able to compile (missing
7636 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7638 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7639 to use clear, since we don't depend on this in the code. Add test
7642 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7644 * (various *.C files): add using std::foo directives to please dec
7647 * replace calls to string::clear() to string::erase() (Angus)
7649 * src/cheaders/cmath: modified to provide std::abs.
7651 2000-05-04 Juergen Vigna <jug@sad.it>
7653 * src/insets/insettext.C: Prepared all for inserting of multiple
7654 paragraphs. Still display stuff to do (alignment and other things),
7655 but I would like to use LyXText to do this when we cleaned out the
7656 table-support stuff.
7658 * src/insets/insettabular.C: Changed lot of stuff and added lots
7659 of functionality still a lot to do.
7661 * src/tabular.C: Various functions changed name and moved to be
7662 const functions. Added new Read and Write functions and changed
7663 lots of things so it works good with tabular-insets (also removed
7664 some stuff which is not needed anymore * hacks *).
7666 * src/lyxcursor.h: added operators == and != which just look if
7667 par and pos are (not) equal.
7669 * src/buffer.C (latexParagraphs): inserted this function to latex
7670 all paragraphs form par to endpar as then I can use this too for
7673 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7674 so that I can call this to from text insets with their own cursor.
7676 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7677 output off all paragraphs (because of the fix below)!
7679 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7680 the very last paragraph (this could be also the last paragraph of an
7683 * src/texrow.h: added rows() call which returns the count-variable.
7685 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7687 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7689 * lib/configure.m4: better autodetection of DocBook tools.
7691 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7693 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7695 * src/lyx_cb.C: add using std::reverse;
7697 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7700 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7701 selected files. Should fix repeated errors from generated files.
7703 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7705 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7707 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7708 the spellchecker popup.
7710 * lib/lyxrc.example: Removed the \number_inset section
7712 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7714 * src/insets/figinset.C (various): Use IsFileReadable() to make
7715 sure that the file actually exist. Relying on ghostscripts errors
7716 is a bad idea since they can lead to X server crashes.
7718 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7720 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7723 * lib/lyxrc.example: smallish typo in description of
7724 \view_dvi_paper_option
7726 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7729 * src/lyxfunc.C: doImportHelper to factor out common code of the
7730 various import methods. New functions doImportASCIIasLines,
7731 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7732 doImportLinuxDoc for the format specific parts.
7735 * buffer.C: Dispatch returns now a bool to indicate success
7738 * lyx_gui.C: Add getLyXView() for member access
7740 * lyx_main.C: Change logic for batch commands: First try
7741 Buffer::Dispatch (possibly without GUI), if that fails, use
7744 * lyx_main.C: Add support for --import command line switch.
7745 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7746 Available Formats: Everything accepted by 'buffer-import <format>'
7748 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7750 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7753 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7754 documents will be reformatted upon reentry.
7756 2000-04-27 Juergen Vigna <jug@sad.it>
7758 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7759 correctly only last pos this was a bug.
7761 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7763 * release of lyx-1.1.5pre1
7765 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7767 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7769 * src/menus.C: revert the change of naming (Figure->Graphic...)
7770 from 2000-04-11. It was incomplete and bad.
7772 * src/LColor.[Ch]: add LColor::depthbar.
7773 * src/text.C (GetVisibleRow): use it.
7775 * README: update the languages list.
7777 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7779 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7782 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7784 * README: remove sections that were just wrong.
7786 * src/text2.C (GetRowNearY): remove currentrow code
7788 * src/text.C (GetRow): remove currentrow code
7790 * src/screen.C (Update): rewritten a bit.
7791 (SmallUpdate): removed func
7793 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7795 (FullRebreak): return bool
7796 (currentrow): remove var
7797 (currentrow_y): ditto
7799 * src/lyxscreen.h (Draw): change arg to unsigned long
7800 (FitCursor): return bool
7801 (FitManualCursor): ditto
7802 (Smallpdate): remove func
7803 (first): change to unsigned long
7804 (DrawOneRow): change second arg to long (from long &)
7805 (screen_refresh_y): remove var
7806 (scree_refresh_row): ditto
7808 * src/lyxrow.h: change baseline to usigned int from unsigned
7809 short, this brings some implicit/unsigned issues out in the open.
7811 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7813 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7814 instead of smallUpdate.
7816 * src/lyxcursor.h: change y to unsigned long
7818 * src/buffer.h: don't call updateScrollbar after fitcursor
7820 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7821 where they are used. Removed "\\direction", this was not present
7822 in 1.1.4 and is already obsolete. Commented out some code that I
7823 believe to never be called.
7824 (runLiterate): don't call updateScrollbar after fitCursor
7826 (buildProgram): ditto
7829 * src/WorkArea.h (workWidth): change return val to unsigned
7832 (redraw): remove the button redraws
7833 (setScrollbarValue): change for scrollbar
7834 (getScrollbarValue): change for scrollbar
7835 (getScrollbarBounds): change for scrollbar
7837 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7838 (C_WorkArea_down_cb): removed func
7839 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7840 (resize): change for scrollbar
7841 (setScrollbar): ditto
7842 (setScrollbarBounds): ditto
7843 (setScrollbarIncrements): ditto
7844 (up_cb): removed func
7845 (down_cb): removed func
7846 (scroll_cb): change for scrollbar
7847 (work_area_handler): ditto
7849 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7850 when FitCursor did something.
7851 (updateScrollbar): some unsigned changes
7852 (downCB): removed func
7853 (scrollUpOnePage): removed func
7854 (scrollDownOnePage): remvoed func
7855 (workAreaMotionNotify): don't call screen->FitCursor but use
7856 fitCursor instead. and bool return val
7857 (workAreaButtonPress): ditto
7858 (workAreaButtonRelease): some unsigned changes
7859 (checkInsetHit): ditto
7860 (workAreaExpose): ditto
7861 (update): parts rewritten, comments about the signed char arg added
7862 (smallUpdate): removed func
7863 (cursorPrevious): call needed updateScrollbar
7866 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7869 * src/BufferView.[Ch] (upCB): removed func
7870 (downCB): removed func
7871 (smallUpdate): removed func
7873 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7875 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7876 currentrow, currentrow_y optimization. This did not help a lot and
7877 if we want to do this kind of optimization we should rather use
7878 cursor.row instead of the currentrow.
7880 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7881 buffer spacing and klyx spacing support.
7883 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7885 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7888 2000-04-26 Juergen Vigna <jug@sad.it>
7890 * src/insets/figinset.C: fixes to Lars sstream changes!
7892 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7894 * A lot of files: Added Ascii(ostream &) methods to all inset
7895 classes. Used when exporting to ASCII.
7897 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7898 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7901 * src/text2.C (ToggleFree): Disabled implicit word selection when
7902 there is a change in the language
7904 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7905 no output was generated for end-of-sentence inset.
7907 * src/insets/lyxinset.h
7910 * src/paragraph.C: Removed the insetnumber code
7912 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7914 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7916 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7917 no_babel and no_epsfig completely from the file.
7918 (parseSingleLyXformat2Token): add handling for per-paragraph
7919 spacing as written by klyx.
7921 * src/insets/figinset.C: applied patch by Andre. Made it work with
7924 2000-04-20 Juergen Vigna <jug@sad.it>
7926 * src/insets/insettext.C (cutSelection):
7927 (copySelection): Fixed with selection from right to left.
7928 (draw): now the rows are not recalculated at every draw.
7929 (computeTextRows): for now reset the inset-owner here (this is
7930 important for an undo or copy where the inset-owner is not set
7933 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7934 motion to the_locking_inset screen->first was forgotten, this was
7935 not important till we got multiline insets.
7937 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7939 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7940 code seems to be alright (it is code changed by Dekel, and the
7941 intent is indeed that all macros should be defined \protect'ed)
7943 * NEWS: a bit of reorganisation of the new user-visible features.
7945 2000-04-19 Juergen Vigna <jug@sad.it>
7947 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7948 position. Set the inset_owner of the used paragraph so that it knows
7949 that it is inside an inset. Fixed cursor handling with mouse and
7950 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7951 and cleanups to make TextInsets work better.
7953 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7954 Changed parameters of various functions and added LockInsetInInset().
7956 * src/insets/insettext.C:
7958 * src/insets/insetcollapsable.h:
7959 * src/insets/insetcollapsable.C:
7960 * src/insets/insetfoot.h:
7961 * src/insets/insetfoot.C:
7962 * src/insets/insetert.h:
7963 * src/insets/insetert.C: cleaned up the code so that it works now
7964 correctly with insettext.
7966 * src/insets/inset.C:
7967 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7968 that insets in insets are supported right.
7971 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7973 * src/paragraph.C: some small fixes
7975 * src/debug.h: inserted INSETS debug info
7977 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7978 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7980 * src/commandtags.h:
7981 * src/LyXAction.C: insert code for InsetTabular.
7983 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7984 not Button1MotionMask.
7985 (workAreaButtonRelease): send always a InsetButtonRelease event to
7987 (checkInsetHit): some setCursor fixes (always with insets).
7989 * src/BufferView2.C (lockInset): returns a bool now and extended for
7990 locking insets inside insets.
7991 (showLockedInsetCursor): it is important to have the cursor always
7992 before the locked inset.
7993 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7995 * src/BufferView.h: made lockInset return a bool.
7997 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7999 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8000 that is used also internally but can be called as public to have back
8001 a cursor pos which is not set internally.
8002 (SetCursorIntern): Changed to use above function.
8004 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8006 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8011 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8012 patches for things that should be in or should be changed.
8014 * src/* [insetfiles]: change "usigned char fragile" to bool
8015 fragile. There was only one point that could that be questioned
8016 and that is commented in formulamacro.C. Grep for "CHECK".
8018 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8019 (DeleteBuffer): take it out of CutAndPaste and make it static.
8021 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8023 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8024 output the spacing envir commands. Also the new commands used in
8025 the LaTeX output makes the result better.
8027 * src/Spacing.C (writeEnvirBegin): new method
8028 (writeEnvirEnd): new method
8030 2000-04-18 Juergen Vigna <jug@sad.it>
8032 * src/CutAndPaste.C: made textclass a static member of the class
8033 as otherwise it is not accesed right!!!
8035 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8037 * forms/layout_forms.fd
8038 * src/layout_forms.h
8039 * src/layout_forms.C (create_form_form_character)
8040 * src/lyx_cb.C (UserFreeFont)
8041 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8042 documents (in the layout->character popup).
8044 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8046 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8047 \spell_command was in fact not honored (from Kevin Atkinson).
8049 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8052 * src/lyx_gui.h: make lyxViews private (Angus)
8054 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8056 * src/mathed/math_write.C
8057 (MathMatrixInset::Write) Put \protect before \begin{array} and
8058 \end{array} if fragile
8059 (MathParInset::Write): Put \protect before \\ if fragile
8061 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8063 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8064 initialization if the LyXColorHandler must be done after the
8065 connections to the XServer has been established.
8067 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8068 get the background pixel from the lyxColorhandler so that the
8069 figures are rendered with the correct background color.
8070 (NextToken): removed functions.
8071 (GetPSSizes): use ifs >> string instead of NextToken.
8073 * src/Painter.[Ch]: the color cache moved out of this file.
8075 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8078 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8080 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8081 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8083 * src/BufferView.C (enterView): new func
8084 (leaveView): new func
8086 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8088 (leaveView): new func, undefines xterm cursor when approp.
8090 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8091 (AllowInput): delete the Workarea cursor handling from this func.
8093 * src/Painter.C (underline): draw a slimer underline in most cases.
8095 * src/lyx_main.C (error_handler): use extern "C"
8097 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8099 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8100 sent directly to me.
8102 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8103 to the list by Dekel.
8105 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8108 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8109 methods from lyx_cb.here.
8111 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8114 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8116 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8117 instead of using current_view directly.
8119 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8121 * src/LyXAction.C (init): add the paragraph-spacing command.
8123 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8125 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8127 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8128 different from the documents.
8130 * src/text.C (SetHeightOfRow): take paragraph spacing into
8131 account, paragraph spacing takes precedence over buffer spacing
8132 (GetVisibleRow): ditto
8134 * src/paragraph.C (writeFile): output the spacing parameter too.
8135 (validate): set the correct features if spacing is used in the
8137 (Clear): set spacing to default
8138 (MakeSameLayout): spacing too
8139 (HasSameLayout): spacing too
8140 (SetLayout): spacing too
8141 (TeXOnePar): output the spacing commands
8143 * src/lyxparagraph.h: added a spacing variable for use with
8144 per-paragraph spacing.
8146 * src/Spacing.h: add a Default spacing and a method to check if
8147 the current spacing is default. also added an operator==
8149 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8152 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8154 * src/lyxserver.C (callback): fix dispatch of functions
8156 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8157 printf() into lyxerr call.
8159 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8162 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8163 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8164 the "Float" from each of the subitems.
8165 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8167 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8168 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8169 documented the change so that the workaround can be nuked later.
8171 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8174 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8176 * src/buffer.C (getLatexName): ditto
8177 (setReadonly): ditto
8179 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8181 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8182 avoid some uses of current_view. Added also a bufferParams()
8183 method to get at this.
8185 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8187 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8189 * src/lyxparagraph.[Ch]: removed
8190 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8191 with operators used by lower_bound and
8192 upper_bound in InsetTable's
8193 Make struct InsetTable private again. Used matchpos.
8195 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8197 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8198 document, the language of existing text is changed (unless the
8199 document is multi-lingual)
8201 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8203 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8205 * A lot of files: A rewrite of the Right-to-Left support.
8207 2000-04-10 Juergen Vigna <jug@sad.it>
8209 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8210 misplaced cursor when inset in inset is locked.
8212 * src/insets/insettext.C (LocalDispatch): small fix so that a
8213 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8215 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8216 footnote font should be decreased in size twice when displaying.
8218 * src/insets/insettext.C (GetDrawFont): inserted this function as
8219 the drawing-font may differ from the real paragraph font.
8221 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8222 insets (inset in inset!).
8224 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8225 function here because we don't want footnotes inside footnotes.
8227 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8229 (init): now set the inset_owner in paragraph.C
8230 (LocalDispatch): added some resetPos() in the right position
8233 (pasteSelection): changed to use the new CutAndPaste-Class.
8235 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8236 which tells if it is allowed to insert another inset inside this one.
8238 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8239 SwitchLayoutsBetweenClasses.
8241 * src/text2.C (InsertInset): checking of the new paragraph-function
8243 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8244 is not needed anymore here!
8247 (PasteSelection): redone (also with #ifdef) so that now this uses
8248 the CutAndPaste-Class.
8249 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8252 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8253 from/to text/insets.
8255 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8256 so that the paragraph knows if it is inside an (text)-inset.
8257 (InsertFromMinibuffer): changed return-value to bool as now it
8258 may happen that an inset is not inserted in the paragraph.
8259 (InsertInsetAllowed): this checks if it is allowed to insert an
8260 inset in this paragraph.
8262 (BreakParagraphConservative):
8263 (BreakParagraph) : small change for the above change of the return
8264 value of InsertFromMinibuffer.
8266 * src/lyxparagraph.h: added inset_owner and the functions to handle
8267 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8269 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8271 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8272 functions from BufferView to BufferView::Pimpl to ease maintence.
8274 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8275 correctly. Also use SetCursorIntern instead of SetCursor.
8277 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8280 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8282 * src/WorkArea.C (belowMouse): manually implement below mouse.
8284 * src/*: Add "explicit" on several constructors, I added probably
8285 some unneeded ones. A couple of changes to code because of this.
8287 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8288 implementation and private parts from the users of BufferView. Not
8291 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8292 implementation and private parts from the users of LyXLex. Not
8295 * src/BufferView_pimpl.[Ch]: new files
8297 * src/lyxlex_pimpl.[Ch]: new files
8299 * src/LyXView.[Ch]: some inline functions move out-of-line
8301 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8303 * src/lyxparagraph.h: make struct InsetTable public.
8305 * src/support/lyxstring.h: change lyxstring::difference_type to be
8306 ptrdiff_t. Add std:: modifiers to streams.
8308 * src/font.C: include the <cctype> header, for islower() and
8311 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8313 * src/font.[Ch]: new files. Contains the metric functions for
8314 fonts, takes a LyXFont as parameter. Better separation of concepts.
8316 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8317 changes because of this.
8319 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8321 * src/*: compile with -Winline and move functions that don't
8324 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8327 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8329 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8330 (various files changed because of this)
8332 * src/Painter.C (text): fixed the drawing of smallcaps.
8334 * src/lyxfont.[Ch] (drawText): removed unused member func.
8337 * src/*.C: added needed "using" statements and "std::" qualifiers.
8339 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8341 * src/*.h: removed all use of "using" from header files use
8342 qualifier std:: instead.
8344 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8346 * src/text.C (Backspace): some additional cleanups (we already
8347 know whether cursor.pos is 0 or not).
8349 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8350 automake does not provide one).
8352 * src/bmtable.h: replace C++ comments with C comments.
8354 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8356 * src/screen.C (ShowCursor): Change the shape of the cursor if
8357 the current language is not equal to the language of the document.
8358 (If the cursor change its shape unexpectedly, then you've found a bug)
8360 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8363 * src/insets/insetnumber.[Ch]: New files.
8365 * src/LyXAction.C (init)
8366 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8369 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8371 * src/lyxparagraph.h
8372 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8373 (the vector is kept sorted).
8375 * src/text.C (GetVisibleRow): Draw selection correctly when there
8376 is both LTR and RTL text.
8378 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8379 which is much faster.
8381 * src/text.C (GetVisibleRow and other): Do not draw the last space
8382 in a row if the direction of the last letter is not equal to the
8383 direction of the paragraph.
8385 * src/lyxfont.C (latexWriteStartChanges):
8386 Check that font language is not equal to basefont language.
8387 (latexWriteEndChanges): ditto
8389 * src/lyx_cb.C (StyleReset): Don't change the language while using
8390 the font-default command.
8392 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8393 empty paragraph before a footnote.
8395 * src/insets/insetcommand.C (draw): Increase x correctly.
8397 * src/screen.C (ShowCursor): Change cursor shape if
8398 current language != document language.
8400 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8402 2000-03-31 Juergen Vigna <jug@sad.it>
8404 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8405 (Clone): changed mode how the paragraph-data is copied to the
8406 new clone-paragraph.
8408 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8409 GetInset(pos) with no inset anymore there (in inset UNDO)
8411 * src/insets/insetcommand.C (draw): small fix as here x is
8412 incremented not as much as width() returns (2 before, 2 behind = 4)
8414 2000-03-30 Juergen Vigna <jug@sad.it>
8416 * src/insets/insettext.C (InsetText): small fix in initialize
8417 widthOffset (should not be done in the init() function)
8419 2000-03-29 Amir Karger <karger@lyx.org>
8421 * lib/examples/it_ItemizeBullets.lyx: translation by
8424 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8426 2000-03-29 Juergen Vigna <jug@sad.it>
8428 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8430 * src/insets/insetfoot.C (Clone): small change as for the below
8431 new init function in the text-inset
8433 * src/insets/insettext.C (init): new function as I've seen that
8434 clone did not copy the Paragraph-Data!
8435 (LocalDispatch): Added code so that now we have some sort of Undo
8436 functionality (well actually we HAVE Undo ;)
8438 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8440 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8442 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8445 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8447 * src/main.C: added a runtime check that verifies that the xforms
8448 header used when building LyX and the library used when running
8449 LyX match. Exit with a message if they don't match. This is a
8450 version number check only.
8452 * src/buffer.C (save): Don't allocate memory on the heap for
8453 struct utimbuf times.
8455 * *: some using changes, use iosfwd instead of the real headers.
8457 * src/lyxfont.C use char const * instead of string for the static
8458 strings. Rewrite some functions to use sstream.
8460 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8462 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8465 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8467 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8468 of Geodesy (from Martin Vermeer)
8470 * lib/layouts/svjour.inc: include file for the Springer svjour
8471 class. It can be used to support journals other than JoG.
8473 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8474 Miskiewicz <misiek@pld.org.pl>)
8475 * lib/reLyX/Makefile.am: ditto.
8477 2000-03-27 Juergen Vigna <jug@sad.it>
8479 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8480 also some modifications with operations on selected text.
8482 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8483 problems with clicking on insets (last famous words ;)
8485 * src/insets/insetcommand.C (draw):
8486 (width): Changed to have a bit of space before and after the inset so
8487 that the blinking cursor can be seen (otherwise it was hidden)
8489 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8491 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8492 would not be added to the link list when an installed gettext (not
8493 part of libc) is found.
8495 2000-03-24 Juergen Vigna <jug@sad.it>
8497 * src/insets/insetcollapsable.C (Edit):
8498 * src/mathed/formula.C (InsetButtonRelease):
8499 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8502 * src/BufferView.C (workAreaButtonPress):
8503 (workAreaButtonRelease):
8504 (checkInsetHit): Finally fixed the clicking on insets be handled
8507 * src/insets/insetert.C (Edit): inserted this call so that ERT
8508 insets work always with LaTeX-font
8510 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8512 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8513 caused lyx to startup with no GUI in place, causing in a crash
8514 upon startup when called with arguments.
8516 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8518 * src/FontLoader.C: better initialization of dummyXFontStruct.
8520 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8522 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8523 for linuxdoc and docbook import and export format options.
8525 * lib/lyxrc.example Example of default values for the previous flags.
8527 * src/lyx_cb.C Use those flags instead of the hardwired values for
8528 linuxdoc and docbook export.
8530 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8533 * src/menus.C Added menus entries for the new import/exports formats.
8535 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8537 * src/lyxrc.*: Added support for running without Gui
8540 * src/FontLoader.C: sensible defaults if no fonts are needed
8542 * src/lyx_cb.C: New function ShowMessage (writes either to the
8543 minibuffer or cout in case of no gui
8544 New function AskOverwrite for common stuff
8545 Consequently various changes to call these functions
8547 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8548 wild guess at sensible screen resolution when having no gui
8550 * src/lyxfont.C: no gui, no fonts... set some defaults
8552 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8554 * src/LColor.C: made the command inset background a bit lighter.
8556 2000-03-20 Hartmut Goebel <goebel@noris.net>
8558 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8559 stdstruct.inc. Koma-Script added some title elements which
8560 otherwise have been listed below "bibliography". This split allows
8561 adding title elements to where they belong.
8563 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8564 define the additional title elements and then include
8567 * many other layout files: changed to include stdtitle.inc just
8568 before stdstruct.inc.
8570 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8572 * src/buffer.C: (save) Added the option to store all backup files
8573 in a single directory
8575 * src/lyxrc.[Ch]: Added variable \backupdir_path
8577 * lib/lyxrc.example: Added descriptions of recently added variables
8579 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8580 bibtex inset, not closing the bibtex popup when deleting the inset)
8582 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8584 * src/lyx_cb.C: add a couple using directives.
8586 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8587 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8588 import based on the filename.
8590 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8591 file would be imported at start, if the filename where of a sgml file.
8593 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8595 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8597 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8598 * src/lyxfont.h Replaced the member variable bits.direction by the
8599 member variable lang. Made many changes in other files.
8600 This allows having a multi-lingual document
8602 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8603 that change the current language to <l>.
8604 Removed the command "font-rtl"
8606 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8607 format for Hebrew documents)
8609 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8610 When auto_mathmode is "true", pressing a digit key in normal mode
8611 will cause entering into mathmode.
8612 If auto_mathmode is "rtl" then this behavior will be active only
8613 when writing right-to-left text.
8615 * src/text2.C (InsertStringA) The string is inserted using the
8618 * src/paragraph.C (GetEndLabel) Gives a correct result for
8619 footnote paragraphs.
8621 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8623 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8625 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8626 front of PasteParagraph. Never insert a ' '. This should at least
8627 fix some cause for the segfaults that we have been experiencing,
8628 it also fixes backspace behaviour slightly. (Phu!)
8630 * src/support/lstrings.C (compare_no_case): some change to make it
8631 compile with gcc 2.95.2 and stdlibc++-v3
8633 * src/text2.C (MeltFootnoteEnvironment): change type o
8634 first_footnote_par_is_not_empty to bool.
8636 * src/lyxparagraph.h: make text private. Changes in other files
8638 (fitToSize): new function
8639 (setContentsFromPar): new function
8640 (clearContents): new function
8641 (SetChar): new function
8643 * src/paragraph.C (readSimpleWholeFile): deleted.
8645 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8646 the file, just use a simple string instead. Also read the file in
8647 a more maintainable manner.
8649 * src/text2.C (InsertStringA): deleted.
8650 (InsertStringB): deleted.
8652 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8654 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8655 RedoParagraphs from the doublespace handling part, just set status
8656 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8657 done, but perhaps not like this.)
8659 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8661 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8662 character when inserting an inset.
8664 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8666 * src/bufferparams.C (readLanguage): now takes "default" into
8669 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8670 also initialize the toplevel_keymap with the default bindings from
8673 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8675 * all files using lyxrc: have lyxrc as a real variable and not a
8676 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8679 * src/lyxrc.C: remove double call to defaultKeyBindings
8681 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8682 toolbar defauls using lyxlex. Remove enums, structs, functions
8685 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8686 toolbar defaults. Also store default keybindings in a map.
8688 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8689 storing the toolbar defaults without any xforms dependencies.
8691 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8692 applied. Changed to use iterators.
8694 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8696 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8697 systems that don't have LINGUAS set to begin with.
8699 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8701 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8702 the list by Dekel Tsur.
8704 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8706 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8707 * src/insets/form_graphics.C: ditto.
8709 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8711 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8713 * src/bufferparams.C (readLanguage): use the new language map
8715 * src/intl.C (InitKeyMapper): use the new language map
8717 * src/lyx_gui.C (create_forms): use the new language map
8719 * src/language.[Ch]: New files. Used for holding the information
8720 about each language. Now! Use this new language map enhance it and
8721 make it really usable for our needs.
8723 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8725 * screen.C (ShowCursor): Removed duplicate code.
8726 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8727 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8729 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8732 * src/text.C Added TransformChar method. Used for rendering Arabic
8733 text correctly (change the glyphs of the letter according to the
8734 position in the word)
8739 * src/lyxrc.C Added lyxrc command {language_command_begin,
8740 language_command_end,language_command_ltr,language_command_rtl,
8741 language_package} which allows the use of either arabtex or Omega
8744 * src/lyx_gui.C (init)
8746 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8747 to use encoding for menu fonts which is different than the encoding
8750 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8751 do not load the babel package.
8752 To write an English document with Hebrew/Arabic, change the document
8753 language to "english".
8755 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8756 (alphaCounter): changed to return char
8757 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8759 * lib/lyxrc.example Added examples for Hebrew/Arabic
8762 * src/layout.C Added layout command endlabeltype
8764 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8766 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8768 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8770 * src/mathed/math_delim.C (search_deco): return a
8771 math_deco_struct* instead of index.
8773 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8775 * All files with a USE_OSTREAM_ONLY within: removed all code that
8776 was unused when USE_OSTREAM_ONLY is defined.
8778 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8779 of any less. Removed header and using.
8781 * src/text.C (GetVisibleRow): draw the string "Page Break
8782 (top/bottom)" on screen when drawing a pagebreak line.
8784 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8786 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8788 * src/mathed/math_macro.C (draw): do some cast magic.
8791 * src/mathed/math_defs.h: change byte* argument to byte const*.
8793 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8795 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8796 know it is right to return InsetFoot* too, but cxx does not like
8799 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8801 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8803 * src/mathed/math_delim.C: change == to proper assignment.
8805 2000-03-09 Juergen Vigna <jug@sad.it>
8807 * src/insets/insettext.C (setPos): fixed various cursor positioning
8808 problems (via mouse and cursor-keys)
8809 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8810 inset (still a small display problem but it works ;)
8812 * src/insets/insetcollapsable.C (draw): added button_top_y and
8813 button_bottom_y to have correct values for clicking on the inset.
8815 * src/support/lyxalgo.h: commented out 'using std::less'
8817 2000-03-08 Juergen Vigna <jug@sad.it>
8819 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8820 Button-Release event closes as it is alos the Release-Event
8823 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8825 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8827 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8828 can add multiple spaces in Scrap (literate programming) styles...
8829 which, by the way, is how I got hooked on LyX to begin with.
8831 * src/mathed/formula.C (Write): Added dummy variable to an
8832 inset::Latex() call.
8833 (Latex): Add free_spacing boolean to inset::Latex()
8835 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8837 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8838 virtual function to include the free_spacing boolean from
8839 the containing paragraph's style.
8841 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8842 Added free_spacing boolean arg to match inset.h
8844 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8845 Added free_spacing boolean arg to match inset.h
8847 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8848 Added free_spacing boolean and made sure that if in a free_spacing
8849 paragraph, that we output normal space if there is a protected space.
8851 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8852 Added free_spacing boolean arg to match inset.h
8854 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8855 Added free_spacing boolean arg to match inset.h
8857 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8858 Added free_spacing boolean arg to match inset.h
8860 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8861 Added free_spacing boolean arg to match inset.h
8863 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8864 Added free_spacing boolean arg to match inset.h
8866 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8867 free_spacing boolean arg to match inset.h
8869 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8870 Added free_spacing boolean arg to match inset.h
8872 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8873 Added free_spacing boolean arg to match inset.h
8875 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8876 Added free_spacing boolean arg to match inset.h
8878 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8879 Added free_spacing boolean arg to match inset.h
8881 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8882 Added free_spacing boolean arg to match inset.h
8884 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8885 free_spacing boolean arg to match inset.h
8887 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8888 free_spacing boolean arg to match inset.h
8890 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8891 ignore free_spacing paragraphs. The user's spaces are left
8894 * src/text.C (InsertChar): Fixed the free_spacing layout
8895 attribute behavior. Now, if free_spacing is set, you can
8896 add multiple spaces in a paragraph with impunity (and they
8897 get output verbatim).
8898 (SelectSelectedWord): Added dummy argument to inset::Latex()
8901 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8904 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8905 paragraph layouts now only input a simple space instead.
8906 Special character insets don't make any sense in free-spacing
8909 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8910 hard-spaces in the *input* file to simple spaces if the layout
8911 is free-spacing. This converts old files which had to have
8912 hard-spaces in free-spacing layouts where a simple space was
8914 (writeFileAscii): Added free_spacing check to pass to the newly
8915 reworked inset::Latex(...) methods. The inset::Latex() code
8916 ensures that hard-spaces in free-spacing paragraphs get output
8917 as spaces (rather than "~").
8919 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8921 * src/mathed/math_delim.C (draw): draw the empty placeholder
8922 delims with a onoffdash line.
8923 (struct math_deco_compare): struct that holds the "functors" used
8924 for the sort and the binary search in math_deco_table.
8925 (class init_deco_table): class used for initial sort of the
8927 (search_deco): use lower_bound to do a binary search in the
8930 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8932 * src/lyxrc.C: a small secret thingie...
8934 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8935 and to not flush the stream as often as it used to.
8937 * src/support/lyxalgo.h: new file
8938 (sorted): template function used for checking if a sequence is
8939 sorted or not. Two versions with and without user supplied
8940 compare. Uses same compare as std::sort.
8942 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8943 it and give warning on lyxerr.
8945 (struct compare_tags): struct with function operators used for
8946 checking if sorted, sorting and lower_bound.
8947 (search_kw): use lower_bound instead of manually implemented
8950 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8952 * src/insets/insetcollapsable.h: fix Clone() declaration.
8953 * src/insets/insetfoot.h: ditto.
8955 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8957 2000-03-08 Juergen Vigna <jug@sad.it>
8959 * src/insets/lyxinset.h: added owner call which tells us if
8960 this inset is inside another inset. Changed also the return-type
8961 of Editable to an enum so it tells clearer what the return-value is.
8963 * src/insets/insettext.C (computeTextRows): fixed computing of
8964 textinsets which split automatically on more rows.
8966 * src/insets/insetert.[Ch]: changed this to be of BaseType
8969 * src/insets/insetfoot.[Ch]: added footnote inset
8971 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8972 collapsable insets (like footnote, ert, ...)
8974 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8976 * src/lyxdraw.h: remvoe file
8978 * src/lyxdraw.C: remove file
8980 * src/insets/insettext.C: added <algorithm>.
8982 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8984 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8985 (matrix_cb): case MM_OK use string stream
8987 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8990 * src/mathed/math_macro.C (draw): use string stream
8991 (Metrics): use string stream
8993 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8994 directly to the ostream.
8996 * src/vspace.C (asString): use string stream.
8997 (asString): use string stream
8998 (asLatexString): use string stream
9000 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9001 setting Spacing::Other.
9003 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9004 sprintf when creating the stretch vale.
9006 * src/text2.C (alphaCounter): changed to return a string and to
9007 not use a static variable internally. Also fixed a one-off bug.
9008 (SetCounter): changed the drawing of the labels to use string
9009 streams instead of sprintf.
9011 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9012 manipulator to use a scheme that does not require library support.
9013 This is also the way it is done in the new GNU libstdc++. Should
9014 work with DEC cxx now.
9016 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9018 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9019 end. This fixes a bug.
9021 * src/mathed (all files concerned with file writing): apply the
9022 USE_OSTREAM_ONLY changes to mathed too.
9024 * src/support/DebugStream.h: make the constructor explicit.
9026 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9027 count and ostream squashed.
9029 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9031 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9033 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9034 ostringstream uses STL strings, and we might not.
9036 * src/insets/insetspecialchar.C: add using directive.
9037 * src/insets/insettext.C: ditto.
9039 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9041 * lib/layouts/seminar.layout: feeble attempt at a layout for
9042 seminar.cls, far from completet and could really use some looking
9043 at from people used to write layout files.
9045 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9046 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9047 a lot nicer and works nicely with ostreams.
9049 * src/mathed/formula.C (draw): a slightly different solution that
9050 the one posted to the list, but I think this one works too. (font
9051 size wrong in headers.)
9053 * src/insets/insettext.C (computeTextRows): some fiddling on
9054 Jürgens turf, added some comments that he should read.
9056 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9057 used and it gave compiler warnings.
9058 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9061 * src/lyx_gui.C (create_forms): do the right thing when
9062 show_banner is true/false.
9064 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9065 show_banner is false.
9067 * most file writing files: Now use iostreams to do almost all of
9068 the writing. Also instead of passing string &, we now use
9069 stringstreams. mathed output is still not adapted to iostreams.
9070 This change can be turned off by commenting out all the occurences
9071 of the "#define USE_OSTREAM_ONLY 1" lines.
9073 * src/WorkArea.C (createPixmap): don't output debug messages.
9074 (WorkArea): don't output debug messages.
9076 * lib/lyxrc.example: added a comment about the new variable
9079 * development/Code_rules/Rules: Added some more commente about how
9080 to build class interfaces and on how better encapsulation can be
9083 2000-03-03 Juergen Vigna <jug@sad.it>
9085 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9086 automatically with the width of the LyX-Window
9088 * src/insets/insettext.C (computeTextRows): fixed update bug in
9089 displaying text-insets (scrollvalues where not initialized!)
9091 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9093 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9094 id in the check of the result from lower_bound is not enough since
9095 lower_bound can return last too, and then res->id will not be a
9098 * all insets and some code that use them: I have conditionalized
9099 removed the Latex(string & out, ...) this means that only the
9100 Latex(ostream &, ...) will be used. This is a work in progress to
9101 move towards using streams for all output of files.
9103 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9106 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9108 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9109 routine (this fixes bug where greek letters were surrounded by too
9112 * src/support/filetools.C (findtexfile): change a bit the search
9113 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9114 no longer passed to kpsewhich, we may have to change that later.
9116 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9117 warning options to avoid problems with X header files (from Angus
9119 * acinclude.m4: regenerated.
9121 2000-03-02 Juergen Vigna <jug@sad.it>
9123 * src/insets/insettext.C (WriteParagraphData): Using the
9124 par->writeFile() function for writing paragraph-data.
9125 (Read): Using buffer->parseSingleLyXformat2Token()-function
9126 for parsing paragraph data!
9128 * src/buffer.C (readLyXformat2): removed all parse data and using
9129 the new parseSingleLyXformat2Token()-function.
9130 (parseSingleLyXformat2Token): added this function to parse (read)
9131 lyx-file-format (this is called also from text-insets now!)
9133 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9135 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9138 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9139 directly instead of going through a func. One very bad thing: a
9140 static LyXFindReplace, but I don't know where to place it.
9142 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9143 string instead of char[]. Also changed to static.
9144 (GetSelectionOrWordAtCursor): changed to static inline
9145 (SetSelectionOverLenChars): ditto.
9147 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9148 current_view and global variables. both classes has changed names
9149 and LyXFindReplace is not inherited from SearchForm.
9151 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9152 fl_form_search form.
9154 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9156 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9158 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9159 bound (from Kayvan).
9161 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9163 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9165 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9167 * some things that I should comment but the local pub says head to
9170 * comment out all code that belongs to the Roff code for Ascii
9171 export of tables. (this is unused)
9173 * src/LyXView.C: use correct type for global variable
9174 current_layout. (LyXTextClass::size_type)
9176 * some code to get the new insetgraphics closer to working I'd be
9177 grateful for any help.
9179 * src/BufferView2.C (insertInset): use the return type of
9180 NumberOfLayout properly. (also changes in other files)
9182 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9183 this as a test. I want to know what breaks because of this.
9185 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9187 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9189 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9190 to use a \makebox in the label, this allows proper justification
9191 with out using protected spaces or multiple hfills. Now it is
9192 "label" for left justified, "\hfill label\hfill" for center, and
9193 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9194 should be changed accordingly.
9196 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9198 * src/lyxtext.h: change SetLayout() to take a
9199 LyXTextClass::size_type instead of a char (when there is more than
9200 127 layouts in a class); also change type of copylayouttype.
9201 * src/text2.C (SetLayout): ditto.
9202 * src/LyXView.C (updateLayoutChoice): ditto.
9204 * src/LaTeX.C (scanLogFile): errors where the line number was not
9205 given just after the '!'-line were ignored (from Dekel Tsur).
9207 * lib/lyxrc.example: fix description of \date_insert_format
9209 * lib/layouts/llncs.layout: new layout, contributed by Martin
9212 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9214 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9215 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9216 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9217 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9218 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9219 paragraph.C, text.C, text2.C)
9221 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9223 * src/insets/insettext.C (LocalDispatch): remove extra break
9226 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9227 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9229 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9230 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9232 * src/insets/insetbib.h: move InsetBibkey::Holder and
9233 InsetCitation::Holder in public space.
9235 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9237 * src/insets/insettext.h: small change to get the new files from
9238 Juergen to compile (use "string", not "class string").
9240 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9241 const & as parameter to LocalDispatch, use LyXFont const & as
9242 paramter to some other func. This also had impacto on lyxinsets.h
9243 and the two mathed insets.
9245 2000-02-24 Juergen Vigna <jug@sad.it>
9248 * src/commandtags.h:
9250 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9254 * src/BufferView2.C: added/updated code for various inset-functions
9256 * src/insets/insetert.[Ch]: added implementation of InsetERT
9258 * src/insets/insettext.[Ch]: added implementation of InsetText
9260 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9261 (draw): added preliminary code for inset scrolling not finshed yet
9263 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9264 as it is in lyxfunc.C now
9266 * src/insets/lyxinset.h: Added functions for text-insets
9268 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9270 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9271 BufferView and reimplement the list as a queue put inside its own
9274 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9276 * several files: use the new interface to the "updateinsetlist"
9278 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9280 (work_area_handler): call BufferView::trippleClick on trippleclick.
9282 * src/BufferView.C (doubleClick): new function, selects word on
9284 (trippleClick): new function, selects line on trippleclick.
9286 2000-02-22 Allan Rae <rae@lyx.org>
9288 * lib/bind/xemacs.bind: buffer-previous not supported
9290 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9292 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9295 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9297 * src/bufferlist.C: get rid of current_view from this file
9299 * src/spellchecker.C: get rid of current_view from this file
9301 * src/vspace.C: get rid of current_view from this file
9302 (inPixels): added BufferView parameter for this func
9303 (asLatexCommand): added a BufferParams for this func
9305 * src/text.C src/text2.C: get rid of current_view from these
9308 * src/lyxfont.C (getFontDirection): move this function here from
9311 * src/bufferparams.C (getDocumentDirection): move this function
9314 * src/paragraph.C (getParDirection): move this function here from
9316 (getLetterDirection): ditto
9318 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9320 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9321 resize due to wrong pixmap beeing used. Also took the opurtunity
9322 to make the LyXScreen stateless on regard to WorkArea and some
9323 general cleanup in the same files.
9325 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9327 * src/Makefile.am: add missing direction.h
9329 * src/PainterBase.h: made the width functions const.
9331 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9334 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9336 * src/insets/insetlatexaccent.C (draw): make the accents draw
9337 better, at present this will only work well with iso8859-1.
9339 * several files: remove the old drawing code, now we use the new
9342 * several files: remove support for mono_video, reverse_video and
9345 2000-02-17 Juergen Vigna <jug@sad.it>
9347 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9348 int ** as we have to return the pointer, otherwise we have only
9349 NULL pointers in the returning function.
9351 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9353 * src/LaTeX.C (operator()): quote file name when running latex.
9355 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9357 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9358 (bubble tip), this removes our special handling of this.
9360 * Remove all code that is unused now that we have the new
9361 workarea. (Code that are not active when NEW_WA is defined.)
9363 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9365 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9367 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9368 nonexisting layout; correctly redirect obsoleted layouts.
9370 * lib/lyxrc.example: document \view_dvi_paper_option
9372 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9375 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9376 (PreviewDVI): handle the view_dvi_paper_option variable.
9377 [Both from Roland Krause]
9379 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9381 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9382 char const *, int, LyXFont)
9383 (text(int, int, string, LyXFont)): ditto
9385 * src/text.C (InsertCharInTable): attempt to fix the double-space
9386 feature in tables too.
9387 (BackspaceInTable): ditto.
9388 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9390 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9392 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9394 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9395 newly found text in textcache to this.
9396 (buffer): set the owner of the text put into the textcache to 0
9398 * src/insets/figinset.C (draw): fixed the drawing of figures with
9401 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9402 drawing of mathframe, hfills, protected space, table lines. I have
9403 now no outstanding drawing problems with the new Painter code.
9405 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9407 * src/PainterBase.C (ellipse, circle): do not specify the default
9410 * src/LColor.h: add using directive.
9412 * src/Painter.[Ch]: change return type of methods from Painter& to
9413 PainterBase&. Add a using directive.
9415 * src/WorkArea.C: wrap xforms callbacks in C functions
9418 * lib/layouts/foils.layout: font fix and simplifications from Carl
9421 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9423 * a lot of files: The Painter, LColor and WorkArea from the old
9424 devel branch has been ported to lyx-devel. Some new files and a
9425 lot of #ifdeffed code. The new workarea is enabled by default, but
9426 if you want to test the new Painter and LColor you have to compile
9427 with USE_PAINTER defined (do this in config.h f.ex.) There are
9428 still some rought edges, and I'd like some help to clear those
9429 out. It looks stable (loads and displays the Userguide very well).
9432 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9434 * src/buffer.C (pop_tag): revert to the previous implementation
9435 (use a global variable for both loops).
9437 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9439 * src/lyxrc.C (LyXRC): change slightly default date format.
9441 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9442 there is an English text with a footnote that starts with a Hebrew
9443 paragraph, or vice versa.
9444 (TeXFootnote): ditto.
9446 * src/text.C (LeftMargin): allow for negative values for
9447 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9450 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9451 for input encoding (cyrillic)
9453 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9455 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9458 * src/toolbar.C (set): ditto
9459 * src/insets/insetbib.C (create_form_citation_form): ditto
9461 * lib/CREDITS: added Dekel Tsur.
9463 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9464 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9465 hebrew supports files from Dekel Tsur.
9467 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9468 <tzafrir@technion.ac.il>
9470 * src/lyxrc.C: put \date_insert_format at the right place.
9472 * src/buffer.C (makeLaTeXFile): fix the handling of
9473 BufferParams::sides when writing out latex files.
9475 * src/BufferView2.C: add a "using" directive.
9477 * src/support/lyxsum.C (sum): when we use lyxstring,
9478 ostringstream::str needs an additional .c_str().
9480 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9482 * src/support/filetools.C (ChangeExtension): patch from Etienne
9485 * src/TextCache.C (show): remove const_cast and make second
9486 parameter non-const LyXText *.
9488 * src/TextCache.h: use non const LyXText in show.
9490 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9493 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9495 * src/support/lyxsum.C: rework to be more flexible.
9497 * several places: don't check if a pointer is 0 if you are going
9500 * src/text.C: remove some dead code.
9502 * src/insets/figinset.C: remove some dead code
9504 * src/buffer.C: move the BufferView funcs to BufferView2.C
9505 remove all support for insetlatexdel
9506 remove support for oldpapersize stuff
9507 made some member funcs const
9509 * src/kbmap.C: use a std::list to store the bindings in.
9511 * src/BufferView2.C: new file
9513 * src/kbsequence.[Ch]: new files
9515 * src/LyXAction.C + others: remove all trace of buffer-previous
9517 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9518 only have one copy in the binary of this table.
9520 * hebrew patch: moved some functions from LyXText to more
9521 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9523 * several files: remove support for XForms older than 0.88
9525 remove some #if 0 #endif code
9527 * src/TextCache.[Ch]: new file. Holds the textcache.
9529 * src/BufferView.C: changes to use the new TextCache interface.
9530 (waitForX): remove the now unused code.
9532 * src/BackStack.h: remove some commented code
9534 * lib/bind/emacs.bind: remove binding for buffer-previous
9536 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9538 * applied the hebrew patch.
9540 * src/lyxrow.h: make sure that all Row variables are initialized.
9542 * src/text2.C (TextHandleUndo): comment out a delete, this might
9543 introduce a memory leak, but should also help us to not try to
9544 read freed memory. We need to look at this one.
9546 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9547 (LyXParagraph): initalize footnotekind.
9549 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9550 forgot this when applying the patch. Please heed the warnings.
9552 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9553 (aka. reformat problem)
9555 * src/bufferlist.C (exists): made const, and use const_iterator
9556 (isLoaded): new func.
9557 (release): use std::find to find the correct buffer.
9559 * src/bufferlist.h: made getState a const func.
9560 made empty a const func.
9561 made exists a const func.
9564 2000-02-01 Juergen Vigna <jug@sad.it>
9566 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9568 * po/it.po: updated a bit the italian po file and also changed the
9569 'file nuovo' for newfile to 'filenuovo' without a space, this did
9572 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9573 for the new insert_date command.
9575 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9576 from jdblair, to insert a date into the current text conforming to
9577 a strftime format (for now only considering the locale-set and not
9578 the document-language).
9580 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9582 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9583 Bounds Read error seen by purify. The problem was that islower is
9584 a macros which takes an unsigned char and uses it as an index for
9585 in array of characters properties (and is thus subject to the
9589 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9590 correctly the paper sides radio buttons.
9591 (UpdateDocumentButtons): ditto.
9593 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9595 * src/kbmap.C (getsym + others): change to return unsigned int,
9596 returning a long can give problems on 64 bit systems. (I assume
9597 that int is 32bit on 64bit systems)
9599 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9601 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9602 LyXLookupString to be zero-terminated. Really fixes problems seen
9605 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9607 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9608 write a (char*)0 to the lyxerr stream.
9610 * src/lastfiles.C: move algorithm before the using statemets.
9612 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9614 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9615 complains otherwise).
9616 * src/table.C: ditto
9618 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9621 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9622 that I removed earlier... It is really needed.
9624 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9626 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9628 * INSTALL: update xforms home page URL.
9630 * lib/configure.m4: fix a bug with unreadable layout files.
9632 * src/table.C (calculate_width_of_column): add "using std::max"
9635 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9637 * several files: marked several lines with "DEL LINE", this is
9638 lines that can be deleted without changing anything.
9639 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9640 checks this anyway */
9643 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9645 * src/DepTable.C (update): add a "+" at the end when the checksum
9646 is different. (debugging string only)
9648 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9649 the next inset to not be displayed. This should also fix the list
9650 of labels in the "Insert Crossreference" dialog.
9652 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9654 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9655 when regex was not found.
9657 * src/support/lstrings.C (lowercase): use handcoded transform always.
9660 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9661 old_cursor.par->prev could be 0.
9663 * several files: changed post inc/dec to pre inc/dec
9665 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9666 write the lastfiles to file.
9668 * src/BufferView.C (buffer): only show TextCache info when debugging
9670 (resizeCurrentBuffer): ditto
9671 (workAreaExpose): ditto
9673 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9675 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9677 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9678 a bit better by removing the special case for \i and \j.
9680 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9682 * src/lyx_main.C (easyParse): remove test for bad comand line
9683 options, since this broke all xforms-related parsing.
9685 * src/kbmap.C (getsym): set return type to unsigned long, as
9686 declared in header. On an alpha, long is _not_ the same as int.
9688 * src/support/LOstream.h: add a "using std::flush;"
9690 * src/insets/figinset.C: ditto.
9692 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9694 * src/bufferlist.C (write): use blinding fast file copy instead of
9695 "a char at a time", now we are doing it the C++ way.
9697 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9698 std::list<int> instead.
9699 (addpidwait): reflect move to std::list<int>
9700 (sigchldchecker): ditto
9702 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9705 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9706 that obviously was wrong...
9708 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9709 c, this avoids warnings with purify and islower.
9711 * src/insets/figinset.C: rename struct queue to struct
9712 queue_element and rewrite to use a std::queue. gsqueue is now a
9713 std::queue<queue_element>
9714 (runqueue): reflect move to std::queue
9717 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9718 we would get "1" "0" instead of "true" "false. Also make the tostr
9721 2000-01-21 Juergen Vigna <jug@sad.it>
9723 * src/buffer.C (writeFileAscii): Disabled code for special groff
9724 handling of tabulars till I fix this in table.C
9726 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9728 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9730 * src/support/lyxlib.h: ditto.
9732 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9734 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9735 and 'j' look better. This might fix the "macron" bug that has been
9738 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9739 functions as one template function. Delete the old versions.
9741 * src/support/lyxsum.C: move using std::ifstream inside
9744 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9747 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9749 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9751 * src/insets/figinset.C (InitFigures): use new instead of malloc
9752 to allocate memory for figures and bitmaps.
9753 (DoneFigures): use delete[] instead of free to deallocate memory
9754 for figures and bitmaps.
9755 (runqueue): use new to allocate
9756 (getfigdata): use new/delete[] instead of malloc/free
9757 (RegisterFigure): ditto
9759 * some files: moved some declarations closer to first use, small
9760 whitespace changes use preincrement instead of postincrement where
9761 it does not make a difference.
9763 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9764 step on the way to use stl::containers for key maps.
9766 * src/bufferlist.h: add a typedef for const_iterator and const
9767 versions of begin and end.
9769 * src/bufferlist.[Ch]: change name of member variable _state to
9770 state_. (avoid reserved names)
9772 (getFileNames): returns the filenames of the buffers in a vector.
9774 * configure.in (ALL_LINGUAS): added ro
9776 * src/support/putenv.C: new file
9778 * src/support/mkdir.C: new file
9780 2000-01-20 Allan Rae <rae@lyx.org>
9782 * lib/layouts/IEEEtran.layout: Added several theorem environments
9784 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9785 couple of minor additions.
9787 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9788 (except for those in footnotes of course)
9790 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9792 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9794 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9795 std::sort and std::lower_bound instead of qsort and handwritten
9797 (struct compara): struct that holds the functors used by std::sort
9798 and std::lower_bound in MathedLookupBOP.
9800 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9802 * src/support/LAssert.h: do not do partial specialization. We do
9805 * src/support/lyxlib.h: note that lyx::getUserName() and
9806 lyx::date() are not in use right now. Should these be suppressed?
9808 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9809 (makeLinuxDocFile): do not put date and user name in linuxdoc
9812 * src/support/lyxlib.h (kill): change first argument to long int,
9813 since that's what solaris uses.
9815 * src/support/kill.C (kill): fix declaration to match prototype.
9817 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9818 actually check whether namespaces are supported. This is not what
9821 * src/support/lyxsum.C: add a using directive.
9823 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9825 * src/support/kill.C: if we have namespace support we don't have
9826 to include lyxlib.h.
9828 * src/support/lyxlib.h: use namespace lyx if supported.
9830 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9832 * src/support/date.C: new file
9834 * src/support/chdir.C: new file
9836 * src/support/getUserName.C: new file
9838 * src/support/getcwd.C: new file
9840 * src/support/abort.C: new file
9842 * src/support/kill.C: new file
9844 * src/support/lyxlib.h: moved all the functions in this file
9845 insede struct lyx. Added also kill and abort to this struct. This
9846 is a way to avoid the "kill is not defined in <csignal>", we make
9847 C++ wrappers for functions that are not ANSI C or ANSI C++.
9849 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9850 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9851 lyx it has been renamed to sum.
9853 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9855 * src/text.C: add using directives for std::min and std::max.
9857 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9859 * src/texrow.C (getIdFromRow): actually return something useful in
9860 id and pos. Hopefully fixes the bug with positionning of errorbox
9863 * src/lyx_main.C (easyParse): output an error and exit if an
9864 incorrect command line option has been given.
9866 * src/spellchecker.C (ispell_check_word): document a memory leak.
9868 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9869 where a "struct utimbuf" is allocated with "new" and deleted with
9872 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9874 * src/text2.C (CutSelection): don't delete double spaces.
9875 (PasteSelection): ditto
9876 (CopySelection): ditto
9878 * src/text.C (Backspace): don't delete double spaces.
9880 * src/lyxlex.C (next): fix a bug that were only present with
9881 conformant std::istream::get to read comment lines, use
9882 std::istream::getline instead. This seems to fix the problem.
9884 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9886 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9887 allowed to insert space before space" editing problem. Please read
9888 commends at the beginning of the function. Comments about usage
9891 * src/text.C (InsertChar): fix for the "not allowed to insert
9892 space before space" editing problem.
9894 * src/text2.C (DeleteEmptyParagraphMechanism): when
9895 IsEmptyTableRow can only return false this last "else if" will
9896 always be a no-op. Commented out.
9898 * src/text.C (RedoParagraph): As far as I can understand tmp
9899 cursor is not really needed.
9901 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9902 present it could only return false anyway.
9903 (several functions): Did something not so smart...added a const
9904 specifier on a lot of methods.
9906 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9907 and add a tmp->text.resize. The LyXParagraph constructor does the
9909 (BreakParagraphConservative): ditto
9911 * src/support/path.h (Path): add a define so that the wrong usage
9912 "Path("/tmp") will be flagged as a compilation error:
9913 "`unnamed_Path' undeclared (first use this function)"
9915 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9917 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9918 which was bogus for several reasons.
9920 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9924 * autogen.sh: do not use "type -path" (what's that anyway?).
9926 * src/support/filetools.C (findtexfile): remove extraneous space
9927 which caused a kpsewhich warning (at least with kpathsea version
9930 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9932 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9934 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9936 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9938 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9940 * src/paragraph.C (BreakParagraph): do not reserve space on text
9941 if we don't need to (otherwise, if pos_end < pos, we end up
9942 reserving huge amounts of memory due to bad unsigned karma).
9943 (BreakParagraphConservative): ditto, although I have not seen
9944 evidence the bug can happen here.
9946 * src/lyxparagraph.h: add a using std::list.
9948 2000-01-11 Juergen Vigna <jug@sad.it>
9950 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9953 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9955 * src/vc-backend.C (doVCCommand): change to be static and take one
9956 more parameter: the path to chdir too be fore executing the command.
9957 (retrive): new function equiv to "co -r"
9959 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9960 file_not_found_hook is true.
9962 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9964 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9965 if a file is readwrite,readonly...anything else.
9967 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9969 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9970 (CreatePostscript): name change from MenuRunDVIPS (or something)
9971 (PreviewPostscript): name change from MenuPreviewPS
9972 (PreviewDVI): name change from MenuPreviewDVI
9974 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9975 \view_pdf_command., \pdf_to_ps_command
9977 * lib/configure.m4: added search for PDF viewer, and search for
9978 PDF to PS converter.
9979 (lyxrc.defaults output): add \pdflatex_command,
9980 \view_pdf_command and \pdf_to_ps_command.
9982 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9984 * src/bufferlist.C (write): we don't use blocksize for anything so
9987 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9989 * src/support/block.h: disable operator T* (), since it causes
9990 problems with both compilers I tried. See comments in the file.
9992 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9995 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9996 variable LYX_DIR_10x to LYX_DIR_11x.
9998 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10000 * INSTALL: document --with-lyxname.
10003 * configure.in: new configure flag --with-lyxname which allows to
10004 choose the name under which lyx is installed. Default is "lyx", of
10005 course. It used to be possible to do this with --program-suffix,
10006 but the later has in fact a different meaning for autoconf.
10008 * src/support/lstrings.h (lstrchr): reformat a bit.
10010 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10011 * src/mathed/math_defs.h: ditto.
10013 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10015 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10016 true, decides if we create a backup file or not when saving. New
10017 tag and variable \pdf_mode, defaults to false. New tag and
10018 variable \pdflatex_command, defaults to pdflatex. New tag and
10019 variable \view_pdf_command, defaults to xpdf. New tag and variable
10020 \pdf_to_ps_command, defaults to pdf2ps.
10022 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10024 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10025 does not have a BufferView.
10026 (unlockInset): ditto + don't access the_locking_inset if the
10027 buffer does not have a BufferView.
10029 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10030 certain circumstances so that we don't continue a keyboard
10031 operation long after the key was released. Try f.ex. to load a
10032 large document, press PageDown for some seconds and then release
10033 it. Before this change the document would contine to scroll for
10034 some time, with this change it stops imidiatly.
10036 * src/support/block.h: don't allocate more space than needed. As
10037 long as we don't try to write to the arr[x] in a array_type arr[x]
10038 it is perfectly ok. (if you write to it you might segfault).
10039 added operator value_type*() so that is possible to pass the array
10040 to functions expecting a C-pointer.
10042 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10045 * intl/*: updated to gettext 0.10.35, tried to add our own
10046 required modifications. Please verify.
10048 * po/*: updated to gettext 0.10.35, tried to add our own required
10049 modifications. Please verify.
10051 * src/support/lstrings.C (tostr): go at fixing the problem with
10052 cxx and stringstream. When stringstream is used return
10053 oss.str().c_str() so that problems with lyxstring and basic_string
10054 are avoided. Note that the best solution would be for cxx to use
10055 basic_string all the way, but it is not conformant yet. (it seems)
10057 * src/lyx_cb.C + other files: moved several global functions to
10058 class BufferView, some have been moved to BufferView.[Ch] others
10059 are still located in lyx_cb.C. Code changes because of this. (part
10060 of "get rid of current_view project".)
10062 * src/buffer.C + other files: moved several Buffer functions to
10063 class BufferView, the functions are still present in buffer.C.
10064 Code changes because of this.
10066 * config/lcmessage.m4: updated to most recent. used when creating
10069 * config/progtest.m4: updated to most recent. used when creating
10072 * config/gettext.m4: updated to most recent. applied patch for
10075 * config/gettext.m4.patch: new file that shows what changes we
10076 have done to the local copy of gettext.m4.
10078 * config/libtool.m4: new file, used in creation of acinclude.m4
10080 * config/lyxinclude.m4: new file, this is the lyx created m4
10081 macros, used in making acinclude.m4.
10083 * autogen.sh: GNU m4 discovered as a separate task not as part of
10084 the lib/configure creation.
10085 Generate acinlucde from files in config. Actually cat
10086 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10087 easier to upgrade .m4 files that really are external.
10089 * src/Spacing.h: moved using std::istringstream to right after
10090 <sstream>. This should fix the problem seen with some compilers.
10092 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10094 * src/lyx_cb.C: began some work to remove the dependency a lot of
10095 functions have on BufferView::text, even if not really needed.
10096 (GetCurrentTextClass): removed this func, it only hid the
10099 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10100 forgot this in last commit.
10102 * src/Bullet.C (bulletEntry): use static char const *[] for the
10103 tables, becuase of this the return arg had to change to string.
10104 (bulletSize): ditto
10105 (~Bullet): removed unneeded destructor
10107 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10108 (insetSleep): moved from Buffer
10109 (insetWakeup): moved from Buffer
10110 (insetUnlock): moved from Buffer
10112 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10113 from Buffer to BufferView.
10115 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10117 * config/ltmain.sh: updated to version 1.3.4 of libtool
10119 * config/ltconfig: updated to version 1.3.4 of libtool
10121 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10124 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10125 Did I get that right?
10127 * src/lyxlex.h: add a "using" directive or two.
10128 * src/Spacing.h: ditto.
10129 * src/insets/figinset.C: ditto.
10130 * src/support/filetools.C: ditto.
10131 * src/support/lstrings.C: ditto.
10132 * src/BufferView.C: ditto.
10133 * src/bufferlist.C: ditto.
10134 * src/lyx_cb.C: ditto.
10135 * src/lyxlex.C: ditto.
10137 * NEWS: add some changes for 1.1.4.
10139 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10141 * src/BufferView.C: first go at a TextCache to speed up switching
10144 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10146 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10147 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10148 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10149 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10152 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10153 members of the struct are correctly initialized to 0 (detected by
10155 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10156 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10158 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10159 pidwait, since it was allocated with "new". This was potentially
10160 very bad. Thanks to Michael Schmitt for running purify for us.
10163 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10165 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10167 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10169 1999-12-30 Allan Rae <rae@lyx.org>
10171 * lib/templates/IEEEtran.lyx: minor change
10173 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10174 src/mathed/formula.C (LocalDispatch): askForText changes
10176 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10177 know when a user has cancelled input. Fixes annoying problems with
10178 inserting labels and version control.
10180 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10182 * src/support/lstrings.C (tostr): rewritten to use strstream and
10185 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10187 * src/support/filetools.C (IsFileWriteable): use fstream to check
10188 (IsDirWriteable): use fileinfo to check
10190 * src/support/filetools.h (FilePtr): whole class deleted
10192 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10194 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10196 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10198 * src/bufferlist.C (write): use ifstream and ofstream instead of
10201 * src/Spacing.h: use istrstream instead of sscanf
10203 * src/mathed/math_defs.h: change first arg to istream from FILE*
10205 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10207 * src/mathed/math_parser.C: have yyis to be an istream
10208 (LexGetArg): use istream (yyis)
10210 (mathed_parse): ditto
10211 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10213 * src/mathed/formula.C (Read): rewritten to use istream
10215 * src/mathed/formulamacro.C (Read): rewritten to use istream
10217 * src/lyxlex.h (~LyXLex): deleted desturctor
10218 (getStream): new function, returns an istream
10219 (getFile): deleted funtion
10220 (IsOK): return is.good();
10222 * src/lyxlex.C (LyXLex): delete file and owns_file
10223 (setFile): open an filebuf and assign that to a istream instead of
10225 (setStream): new function, takes an istream as arg.
10226 (setFile): deleted function
10227 (EatLine): rewritten us use istream instead of FILE*
10231 * src/table.C (LyXTable): use istream instead of FILE*
10232 (Read): rewritten to take an istream instead of FILE*
10234 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10236 * src/buffer.C (Dispatch): remove an extraneous break statement.
10238 * src/support/filetools.C (QuoteName): change to do simple
10239 'quoting'. More work is necessary. Also changed to do nothing
10240 under emx (needs fix too).
10241 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10243 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10244 config.h.in to the AC_DEFINE_UNQUOTED() call.
10245 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10246 needs char * as argument (because Solaris 7 declares it like
10249 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10250 remove definition of BZERO.
10252 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10254 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10255 defined, "lyxregex.h" if not.
10257 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10259 (REGEX): new variable that is set to regex.c lyxregex.h when
10260 AM_CONDITIONAL USE_REGEX is set.
10261 (libsupport_la_SOURCES): add $(REGEX)
10263 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10266 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10269 * configure.in: add call to LYX_REGEX
10271 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10272 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10274 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10276 * lib/bind/fi_menus.bind: new file, from
10277 pauli.virtanen@saunalahti.fi.
10279 * src/buffer.C (getBibkeyList): pass the parameter delim to
10280 InsetInclude::getKeys and InsetBibtex::getKeys.
10282 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10283 is passed to Buffer::getBibkeyList
10285 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10286 instead of the hardcoded comma.
10288 * src/insets/insetbib.C (getKeys): make sure that there are not
10289 leading blanks in bibtex keys. Normal latex does not care, but
10290 harvard.sty seems to dislike blanks at the beginning of citation
10291 keys. In particular, the retturn value of the function is
10293 * INSTALL: make it clear that libstdc++ is needed and that gcc
10294 2.7.x probably does not work.
10296 * src/support/filetools.C (findtexfile): make debug message go to
10298 * src/insets/insetbib.C (getKeys): ditto
10300 * src/debug.C (showTags): make sure that the output is correctly
10303 * configure.in: add a comment for TWO_COLOR_ICON define.
10305 * acconfig.h: remove all the entries that already defined in
10306 configure.in or acinclude.m4.
10308 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10309 to avoid user name, date and copyright.
10311 1999-12-21 Juergen Vigna <jug@sad.it>
10313 * src/table.C (Read): Now read bogus row format informations
10314 if the format is < 5 so that afterwards the table can
10315 be read by lyx but without any format-info. Fixed the
10316 crash we experienced when not doing this.
10318 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10320 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10321 (RedoDrawingOfParagraph): ditto
10322 (RedoParagraphs): ditto
10323 (RemoveTableRow): ditto
10325 * src/text.C (Fill): rename arg paperwidth -> paper_width
10327 * src/buffer.C (insertLyXFile): rename var filename -> fname
10328 (writeFile): rename arg filename -> fname
10329 (writeFileAscii): ditto
10330 (makeLaTeXFile): ditto
10331 (makeLinuxDocFile): ditto
10332 (makeDocBookFile): ditto
10334 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10337 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10339 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10342 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10343 compiled by a C compiler not C++.
10345 * src/layout.h (LyXTextClass): added typedef for const_iterator
10346 (LyXTextClassList): added typedef for const_iterator + member
10347 functions begin and end.
10349 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10350 iterators to fill the choice_class.
10351 (updateLayoutChoice): rewritten to use iterators to fill the
10352 layoutlist in the toolbar.
10354 * src/BufferView.h (BufferView::work_area_width): removed unused
10357 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10359 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10360 (sgmlCloseTag): ditto
10362 * src/support/lstrings.h: return type of countChar changed to
10365 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10366 what version of this func to use. Also made to return unsigned int.
10368 * configure.in: call LYX_STD_COUNT
10370 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10371 conforming std::count.
10373 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10375 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10376 and a subscript would give bad display (patch from Dekel Tsur
10377 <dekel@math.tau.ac.il>).
10379 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10381 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10384 * src/chset.h: add a few 'using' directives
10386 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10387 triggered when no buffer is active
10389 * src/layout.C: removed `break' after `return' in switch(), since
10392 * src/lyx_main.C (init): make sure LyX can be ran in place even
10393 when libtool has done its magic with shared libraries. Fix the
10394 test for the case when the system directory has not been found.
10396 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10397 name for the latex file.
10398 (MenuMakeHTML): ditto
10400 * src/buffer.h: add an optional boolean argument, which is passed
10401 to ChangeExtension.
10403 1999-12-20 Allan Rae <rae@lyx.org>
10405 * lib/templates/IEEEtran.lyx: small correction and update.
10407 * configure.in: Attempted to use LYX_PATH_HEADER
10409 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10411 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10412 input from JMarc. Now use preprocessor to find the header.
10413 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10414 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10415 LYX_STL_STRING_FWD. See comments in file.
10417 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10419 * The global MiniBuffer * minibuffer variable is dead.
10421 * The global FD_form_main * fd_form_main variable is dead.
10423 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10425 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10427 * src/table.h: add the LOstream.h header
10428 * src/debug.h: ditto
10430 * src/LyXAction.h: change the explaination of the ReadOnly
10431 attribute: is indicates that the function _can_ be used.
10433 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10436 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10438 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10444 * src/paragraph.C (GetWord): assert on pos>=0
10447 * src/support/lyxstring.C: condition the use of an invariant on
10449 * src/support/lyxstring.h: ditto
10451 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10452 Use LAssert.h instead of plain assert().
10454 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10456 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10457 * src/support/filetools.C: ditto
10459 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10462 * INSTALL: document the new configure flags
10464 * configure.in: suppress --with-debug; add --enable-assertions
10466 * acinclude.m4: various changes in alignment of help strings.
10468 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10470 * src/kbmap.C: commented out the use of the hash map in kb_map,
10471 beginning of movement to a stl::container.
10473 * several files: removed code that was not in effect when
10474 MOVE_TEXT was defined.
10476 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10477 for escaping should not be used. We can discuss if the string
10478 should be enclosed in f.ex. [] instead of "".
10480 * src/trans_mgr.C (insert): use the new returned value from
10481 encodeString to get deadkeys and keymaps done correctly.
10483 * src/chset.C (encodeString): changed to return a pair, to tell
10484 what to use if we know the string.
10486 * src/lyxscreen.h (fillArc): new function.
10488 * src/FontInfo.C (resize): rewritten to use more std::string like
10489 structore, especially string::replace.
10491 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10494 * configure.in (chmod +x some scripts): remove config/gcc-hack
10496 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10498 * src/buffer.C (writeFile): change once again the top comment in a
10499 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10500 instead of an hardcoded version number.
10501 (makeDocBookFile): ditto
10503 * src/version.h: add new define LYX_DOCVERSION
10505 * po/de.po: update from Pit Sütterlin
10506 * lib/bind/de_menus.bind: ditto.
10508 * src/lyxfunc.C (Dispatch): call MenuExport()
10509 * src/buffer.C (Dispatch): ditto
10511 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10512 LyXFunc::Dispatch().
10513 (MenuExport): new function, moved from
10514 LyXFunc::Dispatch().
10516 * src/trans_mgr.C (insert): small cleanup
10517 * src/chset.C (loadFile): ditto
10519 * lib/kbd/iso8859-1.cdef: add missing backslashes
10521 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10523 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10524 help with placing the manually drawn accents better.
10526 (Draw): x2 and hg changed to float to minimize rounding errors and
10527 help place the accents better.
10529 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10530 unsigned short to char is just wrong...cast the char to unsigned
10531 char instead so that the two values can compare sanely. This
10532 should also make the display of insetlatexaccents better and
10533 perhaps also some other insets.
10535 (lbearing): new function
10538 1999-12-15 Allan Rae <rae@lyx.org>
10540 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10541 header that provides a wrapper around the very annoying SGI STL header
10544 * src/support/lyxstring.C, src/LString.h:
10545 removed old SGI-STL-compatability attempts.
10547 * configure.in: Use LYX_STL_STRING_FWD.
10549 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10550 stl_string_fwd.h is around and try to determine it's location.
10551 Major improvement over previous SGI STL 3.2 compatability.
10552 Three small problems remain with this function due to my zero
10553 knowledge of autoconf. JMarc and lgb see the comments in the code.
10555 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10557 * src/broken_const.h, config/hack-gcc, config/README: removed
10559 * configure.in: remove --with-gcc-hack option; do not call
10562 * INSTALL: remove documentation of --with-broken-const and
10565 * acconfig.h: remove all trace of BROKEN_CONST define
10567 * src/buffer.C (makeDocBookFile): update version number in output
10569 (SimpleDocBookOnePar): fix an assert when trying to a character
10570 access beyond string length
10573 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10575 * po/de.po: fix the Export menu
10577 * lyx.man: update the description of -dbg
10579 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10580 (commandLineHelp): updated
10581 (easyParse): show list of available debug levels if -dbg is passed
10584 * src/Makefile.am: add debug.C
10586 * src/debug.h: moved some code to debug.C
10588 * src/debug.C: new file. Contains code to set and show debug
10591 * src/layout.C: remove 'break' after 'continue' in switch
10592 statements, since these cannot be reached.
10594 1999-12-13 Allan Rae <rae@lyx.org>
10596 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10597 (in_word_set): hash() -> math_hash()
10599 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10601 * acconfig.h: Added a test for whether we are using exceptions in the
10602 current compilation run. If so USING_EXCEPTIONS is defined.
10604 * config.in: Check for existance of stl_string_fwd.h
10605 * src/LString.h: If compiling --with-included-string and SGI's
10606 STL version 3.2 is present (see above test) we need to block their
10607 forward declaration of string and supply a __get_c_string().
10608 However, it turns out this is only necessary if compiling with
10609 exceptions enabled so I've a bit more to add yet.
10611 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10612 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10613 src/support/LRegex.h, src/undo.h:
10614 Shuffle the order of the included files a little to ensure that
10615 LString.h gets included before anything that includes stl_string_fwd.h
10617 * src/support/lyxstring.C: We need to #include LString.h instead of
10618 lyxstring.h to get the necessary definition of __get_c_string.
10619 (__get_c_string): New function. This is defined static just like SGI's
10620 although why they need to do this I'm not sure. Perhaps it should be
10621 in lstrings.C instead.
10623 * lib/templates/IEEEtran.lyx: New template file.
10625 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10627 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10628 * intl/Makefile.in (MKINSTALLDIRS): ditto
10630 * src/LyXAction.C (init): changed to hold the LFUN data in a
10631 automatic array in stead of in callso to newFunc, this speeds up
10632 compilation a lot. Also all the memory used by the array is
10633 returned when the init is completed.
10635 * a lot of files: compiled with -Wold-style-cast, changed most of
10636 the reported offenders to C++ style casts. Did not change the
10637 offenders in C files.
10639 * src/trans.h (Match): change argument type to unsigned int.
10641 * src/support/DebugStream.C: fix some types on the streambufs so
10642 that it works on a conforming implementation.
10644 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10646 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10648 * src/support/lyxstring.C: remove the inline added earlier since
10649 they cause a bunch of unsatisfied symbols when linking with dec
10650 cxx. Cxx likes to have the body of inlines at the place where they
10653 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10654 accessing negative bounds in array. This fixes the crash when
10655 inserting accented characters.
10656 * src/trans.h (Match): ditto
10658 * src/buffer.C (Dispatch): since this is a void, it should not try
10659 to return anything...
10661 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10663 * src/buffer.h: removed the two friends from Buffer. Some changes
10664 because of this. Buffer::getFileName and Buffer::setFileName
10665 renamed to Buffer::fileName() and Buffer::fileName(...).
10667 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10669 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10670 and Buffer::update(short) to BufferView. This move is currently
10671 controlled by a define MOVE_TEXT, this will be removed when all
10672 shows to be ok. This move paves the way for better separation
10673 between buffer contents and buffer view. One side effect is that
10674 the BufferView needs a rebreak when swiching buffers, if we want
10675 to avoid this we can add a cache that holds pointers to LyXText's
10676 that is not currently in use.
10678 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10681 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10683 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10685 * lyx_main.C: new command line option -x (or --execute) and
10686 -e (or --export). Now direct conversion from .lyx to .tex
10687 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10688 Unfortunately, X is still needed and the GUI pops up during the
10691 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10693 * src/Spacing.C: add a using directive to bring stream stuff into
10695 * src/paragraph.C: ditto
10696 * src/buffer.C: ditto
10698 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10699 from Lars' announcement).
10701 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10702 example files from Tino Meinen.
10704 1999-12-06 Allan Rae <rae@lyx.org>
10706 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10708 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10710 * src/support/lyxstring.C: added a lot of inline for no good
10713 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10714 latexWriteEndChanges, they were not used.
10716 * src/layout.h (operator<<): output operator for PageSides
10718 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10720 * some example files: loaded in LyX 1.0.4 and saved again to update
10721 certain constructs (table format)
10723 * a lot of files: did the change to use fstream/iostream for all
10724 writing of files. Done with a close look at Andre Poenitz's patch.
10726 * some files: whitespace changes.
10728 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10730 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10731 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10732 architecture, we provide our own. It is used unconditionnally, but
10733 I do not think this is a performance problem. Thanks to Angus
10734 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10735 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10737 (GetInset): use my_memcpy.
10741 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10742 it is easier to understand, but it uses less TeX-only constructs now.
10744 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10745 elements contain spaces
10747 * lib/configure: regenerated
10749 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10750 elements contain spaces; display the list of programs that are
10753 * autogen.sh: make sure lib/configure is executable
10755 * lib/examples/*: rename the tutorial examples to begin with the
10756 two-letters language code.
10758 * src/lyxfunc.C (getStatus): do not query current font if no
10761 * src/lyx_cb.C (RunScript): use QuoteName
10762 (MenuRunDvips): ditto
10763 (PrintApplyCB): ditto
10765 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10766 around argument, so that it works well with the current shell.
10767 Does not work properly with OS/2 shells currently.
10769 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10770 * src/LyXSendto.C (SendtoApplyCB): ditto
10771 * src/lyxfunc.C (Dispatch): ditto
10772 * src/buffer.C (runLaTeX): ditto
10773 (runLiterate): ditto
10774 (buildProgram): ditto
10776 * src/lyx_cb.C (RunScript): ditto
10777 (MenuMakeLaTeX): ditto
10779 * src/buffer.h (getLatexName): new method
10781 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10783 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10785 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10786 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10787 (create_math_panel): ditto
10789 * src/lyxfunc.C (getStatus): re-activate the code which gets
10790 current font and cursor; add test for export to html.
10792 * src/lyxrc.C (read): remove unreachable break statements; add a
10795 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10797 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10799 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10800 introduced by faulty regex.
10801 * src/buffer.C: ditto
10802 * src/lastfiles.C: ditto
10803 * src/paragraph.C: ditto
10804 * src/table.C: ditto
10805 * src/vspace.C: ditto
10806 * src/insets/figinset.C: ditto
10807 Note: most of these is absolutely harmless, except the one in
10808 src/mathed formula.C.
10810 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10812 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10813 operation, yielding correct results for the reLyX command.
10815 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10817 * src/support/filetools.C (ExpandPath): removed an over eager
10819 (ReplaceEnvironmentPath): ditto
10821 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10822 shows that we are doing something fishy in our code...
10823 (BubblePost): ditto
10826 * src/lyxrc.C (read): use a double switch trick to get more help
10827 from the compiler. (the same trick is used in layout.C)
10828 (write): new function. opens a ofstream and pass that to output
10829 (output): new function, takes a ostream and writes the lyxrc
10830 elemts to it. uses a dummy switch to make sure no elements are
10833 * src/lyxlex.h: added a struct pushpophelper for use in functions
10834 with more than one exit point.
10836 * src/lyxlex.[Ch] (GetInteger): made it const
10840 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10842 * src/layout.[hC] : LayoutTags splitted into several enums, new
10843 methods created, better error handling cleaner use of lyxlex. Read
10846 * src/bmtable.[Ch]: change some member prototypes because of the
10847 image const changes.
10849 * commandtags.h, src/LyXAction.C (init): new function:
10850 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10851 This file is not read automatically but you can add \input
10852 preferences to your lyxrc if you want to. We need to discuss how
10855 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10856 in .aux, also remove .bib and .bst files from dependencies when
10859 * src/BufferView.C, src/LyXView.C: add const_cast several places
10860 because of changes to images.
10862 * lib/images/*: same change as for images/*
10864 * lib/lyxrc.example: Default for accept_compound is false not no.
10866 * images/*: changed to be const, however I have som misgivings
10867 about this change so it might be changed back.
10869 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10871 * lib/configure, po/POTFILES.in: regenerated
10873 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10875 * config/lib_configure.m4: removed
10877 * lib/configure.m4: new file (was config/lib_configure.m4)
10879 * configure.in: do not test for rtti, since we do not use it.
10881 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10883 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10884 doubling of allocated space scheme. This makes it faster for large
10885 strings end to use less memory for small strings. xtra rememoved.
10887 * src/insets/figinset.C (waitalarm): commented out.
10888 (GhostscriptMsg): use static_cast
10889 (GhostscriptMsg): use new instead of malloc to allocate memory for
10890 cmap. also delete the memory after use.
10892 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10894 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10895 for changes in bibtex database or style.
10896 (runBibTeX): remove all .bib and .bst files from dep before we
10898 (run): use scanAuc in when dep file already exist.
10900 * src/DepTable.C (remove_files_with_extension): new method
10901 (exist): new method
10903 * src/DepTable.[Ch]: made many of the methods const.
10905 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10907 * src/bufferparams.C: make sure that the default textclass is
10908 "article". It used to be the first one by description order, but
10909 now the first one is "docbook".
10911 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10912 string; call Debug::value.
10913 (easyParse): pass complete argument to setDebuggingLevel().
10915 * src/debug.h (value): fix the code that parses debug levels.
10917 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10920 * src/LyXAction.C: use Debug::ACTION as debug channel.
10922 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10924 * NEWS: updated for the future 1.1.3 release.
10926 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10927 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10928 it should. This is of course a controversial change (since many
10929 people will find that their lyx workscreen is suddenly full of
10930 red), but done for the sake of correctness.
10932 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10933 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10935 * src/insets/inseterror.h, src/insets/inseturl.h,
10936 src/insets/insetinfo.h, src/insets/figinset.h,
10937 src/mathed/formulamacro.h, src/mathed/math_macro.h
10938 (EditMessage): add a missing const and add _() to make sure that
10939 translation happens
10941 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10942 src/insets/insetbib.C, src/support/filetools.C: add `using'
10943 directives for cxx.
10945 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10946 doing 'Insert index of last word' at the beginning of a paragraph.
10948 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10950 * several files: white-space changes.
10952 * src/mathed/formula.C: removed IsAlpha and IsDigit
10954 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10955 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10958 * src/insets/figinset.C (GetPSSizes): don't break when
10959 "EndComments" is seen. But break when a boundingbox is read.
10961 * all classes inherited from Inset: return value of Clone
10962 changed back to Inset *.
10964 * all classes inherited form MathInset: return value of Clone
10965 changed back to MathedInset *.
10967 * src/insets/figinset.C (runqueue): use a ofstream to output the
10968 gs/ps file. Might need some setpresicion or setw. However I can
10969 see no problem with the current code.
10970 (runqueue): use sleep instead of the alarm/signal code. I just
10971 can't see the difference.
10973 * src/paragraph.C (LyXParagraph): reserve space in the new
10974 paragraph and resize the inserted paragraph to just fit.
10976 * src/lyxfunc.h (operator|=): added operator for func_status.
10978 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10979 check for readable file.
10981 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10982 check for readable file.
10983 (MenuMakeLinuxDoc): ditto
10984 (MenuMakeDocBook): ditto
10985 (MenuMakeAscii): ditto
10986 (InsertAsciiFile): split the test for openable and readable
10988 * src/bmtable.C (draw_bitmaptable): use
10989 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10991 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10992 findtexfile from LaTeX to filetools.
10994 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10995 instead of FilePtr. Needs to be verified by a literate user.
10997 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10999 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11000 (EditMessage): likewise.
11002 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11003 respectively as \textasciitilde and \textasciicircum.
11005 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11007 * src/support/lyxstring.h: made the methods that take iterators
11008 use const_iterator.
11010 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11011 (regexMatch): made is use the real regex class.
11013 * src/support/Makefile.am: changed to use libtool
11015 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11017 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11019 (MathIsInset ++): changed several macros to be inline functions
11022 * src/mathed/Makefile.am: changed to use libtool
11024 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11026 * src/insets/inset* : Clone changed to const and return type is
11027 the true insettype not just Inset*.
11029 * src/insets/Makefile.am: changed to use libtool
11031 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11033 * src/undo.[Ch] : added empty() and changed some of the method
11036 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11038 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11039 setID use block<> for the bullets array, added const several places.
11041 * src/lyxfunc.C (getStatus): new function
11043 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11044 LyXAction, added const to several funtions.
11046 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11047 a std::map, and to store the dir items in a vector.
11049 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11052 * src/LyXView.[Ch] + other files : changed currentView to view.
11054 * src/LyXAction.[Ch] : ported from the old devel branch.
11056 * src/.cvsignore: added .libs and a.out
11058 * configure.in : changes to use libtool.
11060 * acinclude.m4 : inserted libtool.m4
11062 * .cvsignore: added libtool
11064 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11066 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11067 file name in insets and mathed directories (otherwise the
11068 dependency is not taken in account under cygwin).
11070 * src/text2.C (InsertString[AB]): make sure that we do not try to
11071 read characters past the string length.
11073 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11075 * lib/doc/LaTeXConfig.lyx.in,
11076 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11078 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11079 file saying who created them and when this heppened; this is
11080 useless and annoys tools like cvs.
11082 * lib/layouts/g-brief-{en,de}.layout,
11083 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11084 from Thomas Hartkens <thomas@hartkens.de>.
11086 * src/{insets,mathed}/Makefile.am: do not declare an empty
11087 LDFLAGS, so that it can be set at configure time (useful on Irix
11090 * lib/reLyX/configure.in: make sure that the prefix is set
11091 correctly in LYX_DIR.
11093 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11095 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11096 be used by 'command-sequence' this allows to bind a key to a
11097 sequence of LyX-commands
11098 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11100 * src/LyXAction.C: add "command-sequence"
11102 * src/LyXFunction.C: handling of "command-sequence"
11104 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11105 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11107 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11109 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11111 * src/buffer.C (writeFile): Do not output a comment giving user
11112 and date at the beginning of a .lyx file. This is useless and
11113 annoys cvs anyway; update version number to 1.1.
11115 * src/Makefile.am (LYX_DIR): add this definition, so that a
11116 default path is hardcoded in LyX.
11118 * configure.in: Use LYX_GNU_GETTEXT.
11120 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11121 AM_GNU_GETTEXT with a bug fixed.
11123 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11125 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11127 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11128 which is used to point to LyX data is now LYX_DIR_11x.
11130 * lyx.man: convert to a unix text file; small updates.
11132 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11134 * src/support/LSubstring.[Ch]: made the second arg of most of the
11135 constructors be a const reference.
11137 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11140 * src/support/lyxstring.[Ch] (swap): added missing member function
11141 and specialization of swap(str, str);
11143 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11145 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11146 trace of the old one.
11148 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11149 put the member definitions in undo.C.
11151 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11152 NEW_TEXT and have now only code that was included when this was
11155 * src/intl.C (LCombo): use static_cast
11157 (DispatchCallback): ditto
11159 * src/definitions.h: removed whole file
11161 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11163 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11164 parsing and stores in a std:map. a regex defines the file format.
11165 removed unneeded members.
11167 * src/bufferparams.h: added several enums from definitions.h here.
11168 Removed unsused destructor. Changed some types to use proper enum
11169 types. use block to have the temp_bullets and user_defined_bullets
11170 and to make the whole class assignable.
11172 * src/bufferparams.C (Copy): removed this functions, use a default
11173 assignment instead.
11175 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11178 * src/buffer.C (readLyXformat2): commend out all that have with
11179 oldpapersize to do. also comment out all that hve to do with
11180 insetlatex and insetlatexdel.
11181 (setOldPaperStuff): commented out
11183 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11185 * src/LyXAction.C: remove use of inset-latex-insert
11187 * src/mathed/math_panel.C (button_cb): use static_cast
11189 * src/insets/Makefile.am (insets_o_SOURCES): removed
11192 * src/support/lyxstring.C (helper): use the unsigned long
11193 specifier, UL, instead of a static_cast.
11195 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11197 * src/support/block.h: new file. to be used as a c-style array in
11198 classes, so that the class can be assignable.
11200 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11202 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11203 NULL, make sure to return an empty string (it is not possible to
11204 set a string to NULL).
11206 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11208 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11210 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11212 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11213 link line, so that Irix users (for example) can set it explicitely to
11216 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11217 it can be overidden at make time (static or dynamic link, for
11220 * src/vc-backend.C, src/LaTeXFeatures.h,
11221 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11222 statements to bring templates to global namespace.
11224 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11226 * src/support/lyxstring.C (operator[] const): make it standard
11229 * src/minibuffer.C (Init): changed to reflect that more
11230 information is given from the lyxvc and need not be provided here.
11232 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11234 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11236 * src/LyXView.C (UpdateTimerCB): use static_cast
11237 (KeyPressMask_raw_callback): ditto
11239 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11240 buffer_, a lot of changes because of this. currentBuffer() ->
11241 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11242 also changes to other files because of this.
11244 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11246 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11247 have no support for RCS and partial support for CVS, will be
11250 * src/insets/ several files: changes because of function name
11251 changes in Bufferview and LyXView.
11253 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11255 * src/support/LSubstring.[Ch]: new files. These implement a
11256 Substring that can be very convenient to use. i.e. is this
11258 string a = "Mary had a little sheep";
11259 Substring(a, "sheep") = "lamb";
11260 a is now "Mary has a little lamb".
11262 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11263 out patterns and subpatterns of strings. It is used by LSubstring
11264 and also by vc-backend.C
11266 * src/support/lyxstring.C: went over all the assertions used and
11267 tried to correct the wrong ones and flag which of them is required
11268 by the standard. some bugs found because of this. Also removed a
11269 couple of assertions.
11271 * src/support/Makefile.am (libsupport_a_SOURCES): added
11272 LSubstring.[Ch] and LRegex.[Ch]
11274 * src/support/FileInfo.h: have struct stat buf as an object and
11275 not a pointer to one, some changes because of this.
11277 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11278 information in layout when adding the layouts preamble to the
11279 textclass preamble.
11281 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11284 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11285 because of bug in OS/2.
11287 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11289 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11290 \verbatim@font instead of \ttfamily, so that it can be redefined.
11292 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11293 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11294 src/layout.h, src/text2.C: add 'using' directive to bring the
11295 STL templates we need from the std:: namespace to the global one.
11296 Needed by DEC cxx in strict ansi mode.
11298 * src/support/LIstream.h,src/support/LOstream.h,
11299 src/support/lyxstring.h,src/table.h,
11300 src/lyxlookup.h: do not include <config.h> in header
11301 files. This should be done in the .C files only.
11303 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11307 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11309 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11310 from Kayvan to fix the tth invokation.
11312 * development/lyx.spec.in: updates from Kayvan to reflect the
11313 changes of file names.
11315 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11317 * src/text2.C (InsertStringB): use std::copy
11318 (InsertStringA): use std::copy
11320 * src/bufferlist.C: use a vector to store the buffers in. This is
11321 an internal change and should not affect any other thing.
11323 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11326 * src/text.C (Fill): fix potential bug, one off bug.
11328 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11330 * src/Makefile.am (lyx_main.o): add more files it depends on.
11332 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11334 * src/support/lyxstring.C: use size_t for the reference count,
11335 size, reserved memory and xtra.
11336 (internal_compare): new private member function. Now the compare
11337 functions should work for std::strings that have embedded '\0'
11339 (compare): all compare functions rewritten to use
11342 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11344 * src/support/lyxstring.C (compare): pass c_str()
11345 (compare): pass c_str
11346 (compare): pass c_str
11348 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11350 * src/support/DebugStream.C: <config.h> was not included correctly.
11352 * lib/configure: forgot to re-generate it :( I'll make this file
11353 auto generated soon.
11355 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11357 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11360 * src/support/lyxstring.C: some changes from length() to rep->sz.
11361 avoids a function call.
11363 * src/support/filetools.C (SpaceLess): yet another version of the
11364 algorithm...now per Jean-Marc's suggestions.
11366 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11368 * src/layout.C (less_textclass_desc): functor for use in sorting
11370 (LyXTextClass::Read): sort the textclasses after reading.
11372 * src/support/filetools.C (SpaceLess): new version of the
11373 SpaceLess functions. What problems does this one give? Please
11376 * images/banner_bw.xbm: made the arrays unsigned char *
11378 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11380 * src/support/lyxstring.C (find): remove bogus assertion in the
11381 two versions of find where this has not been done yet.
11383 * src/support/lyxlib.h: add missing int return type to
11386 * src/menus.C (ShowFileMenu): disable exporting to html if no
11387 html export command is present.
11389 * config/lib_configure.m4: add a test for an HTML converter. The
11390 programs checked for are, in this order: tth, latex2html and
11393 * lib/configure: generated from config/lib_configure.m4.
11395 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11396 html converter. The parameters are now passed through $$FName and
11397 $$OutName, instead of standard input/output.
11399 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11401 * lib/lyxrc.example: update description of \html_command.
11402 add "quotes" around \screen_font_xxx font setting examples to help
11403 people who use fonts with spaces in their names.
11405 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11407 * Distribution files: updates for v1.1.2
11409 * src/support/lyxstring.C (find): remove bogus assert and return
11410 npos for the same condition.
11412 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11414 * added patch for OS/2 from SMiyata.
11416 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11418 * src/text2.C (CutSelection): make space_wrapped a bool
11419 (CutSelection): dont declare int i until we have to.
11420 (alphaCounter): return a char const *.
11422 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11424 * src/support/syscall.C (Systemcalls::kill):
11425 src/support/filetools.C (PutEnv, PutEnvPath):
11426 src/lyx_cb.C (addNewlineAndDepth):
11427 src/FontInfo.C (FontInfo::resize): condition some #warning
11428 directives with WITH_WARNINGS.
11431 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11433 * src/layout.[Ch] + several files: access to class variables
11434 limited and made accessor functions instead a lot of code changed
11435 becuase of this. Also instead of returning pointers often a const
11436 reference is returned instead.
11438 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11440 * src/Makefile.am (dist-hook): added used to remove the CVS from
11441 cheaders upon creating a dist
11442 (EXTRA_DIST): added cheaders
11444 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11445 a character not as a small integer.
11447 * src/support/lyxstring.C (find): removed Assert and added i >=
11448 rep->sz to the first if.
11450 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11452 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11453 src/LyXView.C src/buffer.C src/bufferparams.C
11454 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11455 src/text2.C src/insets/insetinclude.C:
11456 lyxlayout renamed to textclasslist.
11458 * src/layout.C: some lyxerr changes.
11460 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11461 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11462 (LyXLayoutList): removed all traces of this class.
11463 (LyXTextClass::Read): rewrote LT_STYLE
11464 (LyXTextClass::hasLayout): new function
11465 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11466 both const and nonconst version.
11467 (LyXTextClass::delete_layout): new function.
11468 (LyXTextClassList::Style): bug fix. do the right thing if layout
11470 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11471 (LyXTextClassList::NameOfLayout): ditto
11472 (LyXTextClassList::Load): ditto
11474 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11476 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11478 * src/LyXAction.C (LookupFunc): added a workaround for sun
11479 compiler, on the other hand...we don't know if the current code
11480 compiles on sun at all...
11482 * src/support/filetools.C (CleanupPath): subst fix
11484 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11487 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11488 complained about this one?
11490 * src/insets/insetinclude.C (Latex): subst fix
11492 * src/insets/insetbib.C (getKeys): subst fix
11494 * src/LyXSendto.C (SendtoApplyCB): subst fix
11496 * src/lyx_main.C (init): subst fix
11498 * src/layout.C (Read): subst fix
11500 * src/lyx_sendfax_main.C (button_send): subst fix
11502 * src/buffer.C (RoffAsciiTable): subst fix
11504 * src/lyx_cb.C (MenuFax): subst fix
11505 (PrintApplyCB): subst fix
11507 1999-10-26 Juergen Vigna <jug@sad.it>
11509 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11511 (Read): Cleaned up this code so now we read only format vestion >= 5
11513 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11515 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11516 come nobody has complained about this one?
11518 * src/insets/insetinclude.C (Latex): subst fix
11520 * src/insets/insetbib.C (getKeys): subst fix
11522 * src/lyx_main.C (init): subst fix
11524 * src/layout.C (Read): subst fix
11526 * src/buffer.C (RoffAsciiTable): subst fix
11528 * src/lyx_cb.C (MenuFax): subst fix.
11530 * src/layout.[hC] + some other files: rewrote to use
11531 std::container to store textclasses and layouts in.
11532 Simplified, removed a lot of code. Make all classes
11533 assignable. Further simplifications and review of type
11534 use still to be one.
11536 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11537 lastfiles to create the lastfiles partr of the menu.
11539 * src/lastfiles.[Ch]: rewritten to use deque to store the
11540 lastfiles in. Uses fstream for reading and writing. Simplifies
11543 * src/support/syscall.C: remove explicit cast.
11545 * src/BufferView.C (CursorToggleCB): removed code snippets that
11546 were commented out.
11547 use explicat C++ style casts instead of C style casts. also use
11548 u_vdata instea of passing pointers in longs.
11550 * src/PaperLayout.C: removed code snippets that were commented out.
11552 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11554 * src/lyx_main.C: removed code snippets that wer commented out.
11556 * src/paragraph.C: removed code snippets that were commented out.
11558 * src/lyxvc.C (logClose): use static_cast
11560 (viewLog): remove explicit cast to void*
11561 (showLog): removed old commented code
11563 * src/menus.C: use static_cast instead of C style casts. use
11564 u_vdata instead of u_ldata. remove explicit cast to (long) for
11565 pointers. Removed old code that was commented out.
11567 * src/insets/inset.C: removed old commented func
11569 * src/insets/insetref.C (InsetRef): removed old code that had been
11570 commented out for a long time.
11572 (escape): removed C style cast
11574 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11576 * src/insets/insetlatex.C (Draw): removed old commented code
11577 (Read): rewritten to use string
11579 * src/insets/insetlabel.C (escape): removed C style cast
11581 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11583 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11584 old commented code.
11586 * src/insets/insetinclude.h: removed a couple of stupid bools
11588 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11589 (Clone): remove C style cast
11590 (getKeys): changed list to lst because of std::list
11592 * src/insets/inseterror.C (Draw): removed som old commented code.
11594 * src/insets/insetcommand.C (Draw): removed some old commented code.
11596 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11597 commented out forever.
11598 (bibitem_cb): use static_cast instead of C style cast
11599 use of vdata changed to u_vdata.
11601 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11603 (CloseUrlCB): use static_cast instead of C style cast.
11604 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11606 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11607 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11608 (CloseInfoCB): static_cast from ob->u_vdata instead.
11609 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11612 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11613 (C_InsetError_CloseErrorCB): forward the ob parameter
11614 (CloseErrorCB): static_cast from ob->u_vdata instead.
11616 * src/vspace.h: include LString.h since we use string in this class.
11618 * src/vspace.C (lyx_advance): changed name from advance because of
11619 nameclash with stl. And since we cannot use namespaces yet...I
11620 used a lyx_ prefix instead. Expect this to change when we begin
11623 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11625 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11626 and removed now defunct constructor and deconstructor.
11628 * src/BufferView.h: have backstack as a object not as a pointer.
11629 removed initialization from constructor. added include for BackStack
11631 * development/lyx.spec.in (%build): add CFLAGS also.
11633 * src/screen.C (drawFrame): removed another warning.
11635 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11637 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11638 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11639 README and ANNOUNCE a bit for the next release. More work is
11642 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11643 unbreakable if we are in freespacing mode (LyX-Code), but not in
11646 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11648 * src/BackStack.h: fixed initialization order in constructor
11650 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11652 * acinclude.m4 (VERSION): new rules for when a version is
11653 development, added also a variable for prerelease.
11654 (warnings): we set with_warnings=yes for prereleases
11655 (lyx_opt): prereleases compile with same optimization as development
11656 (CXXFLAGS): only use pedantic if we are a development version
11658 * src/BufferView.C (restorePosition): don't do anything if the
11659 backstack is empty.
11661 * src/BackStack.h: added member empty, use this to test if there
11662 is anything to pop...
11664 1999-10-25 Juergen Vigna <jug@sad.it>
11667 * forms/layout_forms.fd +
11668 * forms/latexoptions.fd +
11669 * lyx.fd: changed for various form resize issues
11671 * src/mathed/math_panel.C +
11672 * src/insets/inseterror.C +
11673 * src/insets/insetinfo.C +
11674 * src/insets/inseturl.C +
11675 * src/insets/inseturl.h +
11677 * src/LyXSendto.C +
11678 * src/PaperLayout.C +
11679 * src/ParagraphExtra.C +
11680 * src/TableLayout.C +
11682 * src/layout_forms.C +
11689 * src/menus.C: fixed various resize issues. So now forms can be
11690 resized savely or not be resized at all.
11692 * forms/form_url.fd +
11693 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11696 * src/insets/Makefile.am: added files form_url.[Ch]
11698 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11700 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11701 (and presumably 6.2).
11703 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11704 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11705 remaining static member callbacks.
11707 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11710 * src/support/lyxstring.h: declare struct Srep as friend of
11711 lyxstring, since DEC cxx complains otherwise.
11713 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11715 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11717 * src/LaTeX.C (run): made run_bibtex also depend on files with
11719 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11720 are put into the dependency file.
11722 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11723 the code has shown itself to work
11724 (create_ispell_pipe): removed another warning, added a comment
11727 * src/minibuffer.C (ExecutingCB): removed code that has been
11728 commented out a long time
11730 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11731 out code + a warning.
11733 * src/support/lyxstring.h: comment out the three private
11734 operators, when compiling with string ansi conforming compilers
11735 they make problems.
11737 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11739 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11740 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11743 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11746 * src/mathed/math_panel.C (create_math_panel): remove explicit
11749 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11752 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11753 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11754 to XCreatePixmapFromBitmapData
11755 (fl_set_bmtable_data): change the last argument to be unsigned
11757 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11758 and bh to be unsigned int, remove explicit casts in call to
11759 XReadBitmapFileData.
11761 * images/arrows.xbm: made the arrays unsigned char *
11762 * images/varsz.xbm: ditto
11763 * images/misc.xbm: ditto
11764 * images/greek.xbm: ditto
11765 * images/dots.xbm: ditto
11766 * images/brel.xbm: ditto
11767 * images/bop.xbm: ditto
11769 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11771 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11772 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11773 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11775 (LYX_CXX_CHEADERS): added <clocale> to the test.
11777 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11779 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11781 * src/support/lyxstring.C (append): fixed something that must be a
11782 bug, rep->assign was used instead of rep->append.
11784 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11787 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11788 lyx insert double chars. Fix spotted by Kayvan.
11790 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11792 * Fixed the tth support. I messed up with the Emacs patch apply feature
11793 and omitted the changes in lyxrc.C.
11795 1999-10-22 Juergen Vigna <jug@sad.it>
11797 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11799 * src/lyx_cb.C (MenuInsertRef) +
11800 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11801 the form cannot be resized under it limits (fixes a segfault)
11803 * src/lyx.C (create_form_form_ref) +
11804 * forms/lyx.fd: Changed Gravity on name input field so that it is
11807 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11809 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11810 <ostream> and <istream>.
11812 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11813 whether <fstream> provides the latest standard features, or if we
11814 have an oldstyle library (like in egcs).
11815 (LYX_CXX_STL_STRING): fix the test.
11817 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11818 code on MODERN_STL_STREAM.
11820 * src/support/lyxstring.h: use L{I,O}stream.h.
11822 * src/support/L{I,O}stream.h: new files, designed to setup
11823 correctly streams for our use
11824 - includes the right header depending on STL capabilities
11825 - puts std::ostream and std::endl (for LOStream.h) or
11826 std::istream (LIStream.h) in toplevel namespace.
11828 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11830 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11831 was a bib file that had been changed we ensure that bibtex is run.
11832 (runBibTeX): enhanced to extract the names of the bib files and
11833 getting their absolute path and enter them into the dep file.
11834 (findtexfile): static func that is used to look for tex-files,
11835 checks for absolute patchs and tries also with kpsewhich.
11836 Alternative ways of finding the correct files are wanted. Will
11838 (do_popen): function that runs a command using popen and returns
11839 the whole output of that command in a string. Should be moved to
11842 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11843 file with extension ext has changed.
11845 * src/insets/figinset.C: added ifdef guards around the fl_free
11846 code that jug commented out. Now it is commented out when
11847 compiling with XForms == 0.89.
11849 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11850 to lyxstring.C, and only keep a forward declaration in
11851 lyxstring.h. Simplifies the header file a bit and should help a
11852 bit on compile time too. Also changes to Srep will not mandate a
11853 recompile of code just using string.
11854 (~lyxstring): definition moved here since it uses srep.
11855 (size): definition moved here since it uses srep.
11857 * src/support/lyxstring.h: removed a couple of "inline" that should
11860 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11862 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11865 1999-10-21 Juergen Vigna <jug@sad.it>
11867 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11868 set to left if I just remove the width entry (or it is empty).
11870 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11871 paragraph when having dummy paragraphs.
11873 1999-10-20 Juergen Vigna <jug@sad.it>
11875 * src/insets/figinset.C: just commented some fl_free_form calls
11876 and added warnings so that this calls should be activated later
11877 again. This avoids for now a segfault, but we have a memory leak!
11879 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11880 'const char * argument' to 'string argument', this should
11881 fix some Asserts() in lyxstring.C.
11883 * src/lyxfunc.h: Removed the function argAsString(const char *)
11884 as it is not used anymore.
11886 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11888 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11891 * src/Literate.h: some funcs moved from public to private to make
11892 interface clearer. Unneeded args removed.
11894 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11896 (scanBuildLogFile): ditto
11898 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11899 normal TeX Error. Still room for improvement.
11901 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11903 * src/buffer.C (insertErrors): changes to make the error
11904 desctription show properly.
11906 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11909 * src/support/lyxstring.C (helper): changed to use
11910 sizeof(object->rep->ref).
11911 (operator>>): changed to use a pointer instead.
11913 * src/support/lyxstring.h: changed const reference & to value_type
11914 const & lets see if that helps.
11916 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11918 * Makefile.am (rpmdist): fixed to have non static package and
11921 * src/support/lyxstring.C: removed the compilation guards
11923 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11926 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11927 conditional compile of lyxstring.Ch
11929 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11930 stupid check, but it is a lot better than the bastring hack.
11931 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11933 * several files: changed string::erase into string::clear. Not
11936 * src/chset.C (encodeString): use a char temporary instead
11938 * src/table.C (TexEndOfCell): added tostr around
11939 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11940 (TexEndOfCell): ditto
11941 (TexEndOfCell): ditto
11942 (TexEndOfCell): ditto
11943 (DocBookEndOfCell): ditto
11944 (DocBookEndOfCell): ditto
11945 (DocBookEndOfCell): ditto
11946 (DocBookEndOfCell): ditto
11948 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11950 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11952 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11953 (MenuBuildProg): added tostr around ret
11954 (MenuRunChktex): added tostr around ret
11955 (DocumentApplyCB): added tostr around ret
11957 * src/chset.C (encodeString): added tostr around t->ic
11959 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11960 (makeLaTeXFile): added tostr around tocdepth
11961 (makeLaTeXFile): added tostr around ftcound - 1
11963 * src/insets/insetbib.C (setCounter): added tostr around counter.
11965 * src/support/lyxstring.h: added an operator+=(int) to catch more
11968 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11969 (lyxstring): We DON'T allow NULL pointers.
11971 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11973 * src/mathed/math_macro.C (MathMacroArgument::Write,
11974 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11975 when writing them out.
11977 * src/LString.C: remove, since it is not used anymore.
11979 * src/support/lyxstring.C: condition the content to
11980 USE_INCLUDED_STRING macro.
11982 * src/mathed/math_symbols.C, src/support/lstrings.C,
11983 src/support/lyxstring.C: add `using' directive to specify what
11984 we need in <algorithm>. I do not think that we need to
11985 conditionalize this, but any thought is appreciated.
11987 * many files: change all callback functions to "C" linkage
11988 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11989 strict_ansi. Those who were static are now global.
11990 The case of callbacks which are static class members is
11991 trickier, since we have to make C wrappers around them (see
11992 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11993 did not finish this yet, since it defeats the purpose of
11994 encapsulation, and I am not sure what the best route is.
11996 1999-10-19 Juergen Vigna <jug@sad.it>
11998 * src/support/lyxstring.C (lyxstring): we permit to have a null
11999 pointer as assignment value and just don't assign it.
12001 * src/vspace.C (nextToken): corrected this function substituting
12002 find_first(_not)_of with find_last_of.
12004 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12005 (TableOptCloseCB) (TableSpeCloseCB):
12006 inserted fl_set_focus call for problem with fl_hide_form() in
12009 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12011 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12014 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12016 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12017 LyXLex::next() and not eatline() to get its argument.
12019 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12021 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12022 instead, use fstreams for io of the depfile, removed unneeded
12023 functions and variables.
12025 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12026 vector instead, removed all functions and variables that is not in
12029 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12031 * src/buffer.C (insertErrors): use new interface to TeXError
12033 * Makefile.am (rpmdist): added a rpmdist target
12035 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12036 per Kayvan's instructions.
12038 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12040 * src/Makefile.am: add a definition for localedir, so that locales
12041 are found after installation (Kayvan)
12043 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12045 * development/.cvsignore: new file.
12047 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12049 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12050 C++ compiler provides wrappers for C headers and use our alternate
12053 * configure.in: use LYX_CXX_CHEADERS.
12055 * src/cheader/: new directory, populated with cname headers from
12056 libstdc++-2.8.1. They are a bit old, but probably good enough for
12057 what we want (support compilers who lack them).
12059 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12060 from includes. It turns out is was stupid.
12062 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12064 * lib/Makefile.am (install-data-local): forgot a ';'
12065 (install-data-local): forgot a '\'
12066 (libinstalldirs): needed after all. reintroduced.
12068 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12070 * configure.in (AC_OUTPUT): added lyx.spec
12072 * development/lyx.spec: removed file
12074 * development/lyx.spec.in: new file
12076 * po/*.po: merged with lyx.pot becuase of make distcheck
12078 * lib/Makefile.am (dist-hook): added dist-hook so that
12079 documentation files will be included when doing a make
12080 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12081 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12083 more: tried to make install do the right thing, exclude CVS dirs
12086 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12087 Path would fit in more nicely.
12089 * all files that used to use pathstack: uses now Path instead.
12090 This change was a lot easier than expected.
12092 * src/support/path.h: new file
12094 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12096 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12098 * src/support/lyxstring.C (getline): Default arg was given for
12101 * Configure.cmd: removed file
12103 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12105 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12106 streams classes and types, add the proper 'using' statements when
12107 MODERN_STL is defined.
12109 * src/debug.h: move the << operator definition after the inclusion
12112 * src/support/filetools.C: include "LAssert.h", which is needed
12115 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12118 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12119 include "debug.h" to define a proper ostream.
12121 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12123 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12124 method to the SystemCall class which can kill a process, but it's
12125 not fully implemented yet.
12127 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12129 * src/support/FileInfo.h: Better documentation
12131 * src/lyxfunc.C: Added support for buffer-export html
12133 * src/menus.C: Added Export->As HTML...
12135 * lib/bind/*.bind: Added short-cut for buffer-export html
12137 * src/lyxrc.*: Added support for new \tth_command
12139 * lib/lyxrc.example: Added stuff for new \tth_command
12141 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12143 * lib/Makefile.am (IMAGES): removed images/README
12144 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12145 installes in correct place. Check permisions is installed
12148 * src/LaTeX.C: some no-op changes moved declaration of some
12151 * src/LaTeX.h (LATEX_H): changed include guard name
12153 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12155 * lib/reLyX/Makefile.am: install noweb2lyx.
12157 * lib/Makefile.am: install configure.
12159 * lib/reLyX/configure.in: declare a config aux dir; set package
12160 name to lyx (not sure what the best solution is); generate noweb2lyx.
12162 * lib/layouts/egs.layout: fix the bibliography layout.
12164 1999-10-08 Jürgen Vigna <jug@sad.it>
12166 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12167 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12168 it returned without continuing to search the path.
12170 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12172 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12173 also fixes a bug. It is not allowed to do tricks with std::strings
12174 like: string a("hei"); &a[e]; this will not give what you
12175 think... Any reason for the complexity in this func?
12177 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12179 * Updated README and INSTALL a bit, mostly to check that my
12180 CVS rights are correctly set up.
12182 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12184 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12185 does not allow '\0' chars but lyxstring and std::string does.
12187 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12189 * autogen.sh (AUTOCONF): let the autogen script create the
12190 POTFILES.in file too. POTFILES.in should perhaps now not be
12191 included in the cvs module.
12193 * some more files changed to use C++ includes instead of C ones.
12195 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12197 (Reread): added tostr to nlink. buggy output otherwise.
12198 (Reread): added a string() around szMode when assigning to Buffer,
12199 without this I got a log of garbled info strings.
12201 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12204 * I have added several ostream & operator<<(ostream &, some_type)
12205 functions. This has been done to avoid casting and warnings when
12206 outputting enums to lyxerr. This as thus eliminated a lot of
12207 explicit casts and has made the code clearer. Among the enums
12208 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12209 mathed enums, some font enum the Debug::type enum.
12211 * src/support/lyxstring.h (clear): missing method. equivalent of
12214 * all files that contained "stderr": rewrote constructs that used
12215 stderr to use lyxerr instead. (except bmtable)
12217 * src/support/DebugStream.h (level): and the passed t with
12218 Debug::ANY to avoid spurious bits set.
12220 * src/debug.h (Debug::type value): made it accept strings of the
12221 type INFO,INIT,KEY.
12223 * configure.in (Check for programs): Added a check for kpsewhich,
12224 the latex generation will use this later to better the dicovery of
12227 * src/BufferView.C (create_view): we don't need to cast this to
12228 (void*) that is done automatically.
12229 (WorkAreaButtonPress): removed some dead code.
12231 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12233 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12234 is not overwritten when translated (David Sua'rez de Lis).
12236 * lib/CREDITS: Added David Sua'rez de Lis
12238 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12240 * src/bufferparams.C (BufferParams): default input encoding is now
12243 * acinclude.m4 (cross_compiling): comment out macro
12244 LYX_GXX_STRENGTH_REDUCE.
12246 * acconfig.h: make sure that const is not defined (to empty) when
12247 we are compiling C++. Remove commented out code using SIZEOF_xx
12250 * configure.in : move the test for const and inline as late as
12251 possible so that these C tests do not interefere with C++ ones.
12252 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12253 has not been proven.
12255 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12257 * src/table.C (getDocBookAlign): remove bad default value for
12258 isColumn parameter.
12260 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12262 (ShowFileMenu2): ditto.
12264 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12265 of files to ignore.
12267 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12269 * Most files: finished the change from the old error code to use
12270 DebugStream for all lyxerr debugging. Only minor changes remain
12271 (e.g. the setting of debug levels using strings instead of number)
12273 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12275 * src/layout.C (Add): Changed to use compare_no_case instead of
12278 * src/FontInfo.C: changed loop variable type too string::size_type.
12280 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12282 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12283 set ETAGS_ARGS to --c++
12285 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12287 * src/table.C (DocBookEndOfCell): commented out two unused variables
12289 * src/paragraph.C: commented out four unused variables.
12291 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12292 insed a if clause with type string::size_type.
12294 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12297 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12299 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12300 variable, also changed loop to go from 0 to lenght + 1, instead of
12301 -1 to length. This should be correct.
12303 * src/LaTeX.C (scanError): use string::size_type as loop variable
12306 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12307 (l.896) since y_tmp and row was not used anyway.
12309 * src/insets/insetref.C (escape): use string::size_type as loop
12312 * src/insets/insetquotes.C (Width): use string::size_type as loop
12314 (Draw): use string::size_type as loop variable type.
12316 * src/insets/insetlatexaccent.C (checkContents): use
12317 string::size_type as loop variable type.
12319 * src/insets/insetlabel.C (escape): use string::size_type as loop
12322 * src/insets/insetinfo.C: added an extern for current_view.
12324 * src/insets/insetcommand.C (scanCommand): use string::size_type
12325 as loop variable type.
12327 * most files: removed the RCS tags. With them we had to recompile
12328 a lot of files after a simple cvs commit. Also we have never used
12329 them for anything meaningful.
12331 * most files: tags-query-replace NULL 0. As adviced several plases
12332 we now use "0" instead of "NULL" in our code.
12334 * src/support/filetools.C (SpaceLess): use string::size_type as
12335 loop variable type.
12337 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12339 * src/paragraph.C: fixed up some more string stuff.
12341 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12343 * src/support/filetools.h: make modestr a std::string.
12345 * src/filetools.C (GetEnv): made ch really const.
12347 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12348 made code that used these use max/min from <algorithm> instead.
12350 * changed several c library include files to their equivalent c++
12351 library include files. All is not changed yet.
12353 * created a support subdir in src, put lyxstring and lstrings
12354 there + the extra files atexit, fileblock, strerror. Created
12355 Makefile.am. edited configure.in and src/Makefile.am to use this
12356 new subdir. More files moved to support.
12358 * imported som of the functions from repository lyx, filetools
12360 * ran tags-query-replace on LString -> string, corrected the bogus
12361 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12362 is still some errors in there. This is errors where too much or
12363 too litle get deleted from strings (string::erase, string::substr,
12364 string::replace), there can also be some off by one errors, or
12365 just plain wrong use of functions from lstrings. Viewing of quotes
12368 * LyX is now running fairly well with string, but there are
12369 certainly some bugs yet (see above) also string is quite different
12370 from LString among others in that it does not allow null pointers
12371 passed in and will abort if it gets any.
12373 * Added the revtex4 files I forgot when setting up the repository.
12375 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12377 * All over: Tried to clean everything up so that only the files
12378 that we really need are included in the cvs repository.
12379 * Switched to use automake.
12380 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12381 * Install has not been checked.
12383 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12385 * po/pt.po: Three errors:
12386 l.533 and l.538 format specification error
12387 l. 402 duplicate entry, I just deleted it.