1 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/frontends/xforms/FormDocument.C (class_update): fix setting
6 2000-10-31 Juergen Vigna <jug@sad.it>
8 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
10 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
11 xposition to the Edit call.
13 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
15 * src/trans.C (AddDeadkey): cast explicitly to char.
17 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
19 * src/tabular.C (AsciiBottomHLine): simplify?
20 (AsciiTopHLine): simplify?
21 (print_n_chars): simplify
22 (DocBook): remove most of the << endl; we should flush the stream
23 as seldom as possible.
25 (TeXBottomHLine): ditto
28 (write_attribute): try a templified version.
29 (set_row_column_number_info): lesson scope of variables
31 * src/support/lstrings.h (tostr): new specialization of tostr
33 * src/trans.C (AddDeadkey): slightly cleaner fix.
35 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
37 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
38 '%%' in Toc menu labels.
41 * src/insets/insetlatexaccent.C (draw): Correct rendering when
42 font_norm is iso10646-1.
44 * src/font.C (ascent): Fixed for 16bit fonts
45 (descent,lbearing,rbearing): ditto
47 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
49 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
50 (getFeedback): new static method.
52 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
53 Now use combox rather than choice to display languages.
54 Feedback is now output using a new timer callback mechanism, identical
55 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
57 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
59 * src/minibuffer.C: fix for older compilers
61 2000-10-30 Juergen Vigna <jug@sad.it>
63 * src/insets/insettext.C (InsertInset): fixed this as the cursor
64 has to be Left of the inset otherwise LyXText won't find it!
66 * src/BufferView2.C (open_new_inset): delete the inset if it can
69 2000-10-30 Rob Lahaye <lahaye@postech.edu>
73 2000-10-29 Marko Vendelin <markov@ioc.ee>
74 * src/frontends/gnome/FormCitation.C
75 * src/frontends/gnome/FormCitation.h
76 * src/frontends/gnome/FormCopyright.C
77 * src/frontends/gnome/FormCopyright.h
78 * src/frontends/gnome/FormError.C
79 * src/frontends/gnome/FormError.h
80 * src/frontends/gnome/FormIndex.C
81 * src/frontends/gnome/FormIndex.h
82 * src/frontends/gnome/FormPrint.C
83 * src/frontends/gnome/FormPrint.h
84 * src/frontends/gnome/FormRef.C
85 * src/frontends/gnome/FormRef.h
86 * src/frontends/gnome/FormToc.C
87 * src/frontends/gnome/FormToc.h
88 * src/frontends/gnome/FormUrl.C
89 * src/frontends/gnome/FormUrl.h
90 * src/frontends/gnome/Menubar_pimpl.C
91 * src/frontends/gnome/mainapp.C
92 * src/frontends/gnome/mainapp.h
93 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
94 changing update() to updateSlot() where appropriate
96 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
98 * src/frontends/xforms/FormPreferences.[Ch]:
99 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
102 2000-10-28 Juergen Vigna <jug@sad.it>
104 * src/insets/insettabular.C (draw): fixed drawing bug.
106 * src/insets/insettext.C (clear):
108 (SetParagraphData): clearing the TEXT buffers when deleting the
109 paragraphs used by it.
111 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
113 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
115 2000-10-27 Juergen Vigna <jug@sad.it>
117 * src/tabular.C (~LyXTabular): removed not needed anymore.
119 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
122 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
124 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
127 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
130 * src/frontends/xforms/FormPreferences.[Ch]:
131 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
132 Reorganised as modules based on tabs. Much easier to follow the
133 flow and to add new tabs. Added warning and feedback messages.
136 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
138 * src/tabular.h (DocBook): add std:: qualifier.
140 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
142 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
143 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
146 * insettabular.C (DocBook): uses the tabular methods to export
149 * src/insets/insettext.h
150 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
152 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
154 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
157 * src/lyxfunc.C (MenuNew): lessen the scope of fname
158 moved misplaced AllowInput two lines up.
160 * src/buffer.C (readFile): compare float with float, not with int
162 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
164 * src/minibuffer.C: add "using SigC::slot" statement.
166 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
168 * src/frontends/xforms/forms/README: updated section about make.
170 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
171 Tidied some forms up, made two of form_tabular's tabs more
172 self-consistent, fixed Jean-Marc's size problem in form_preferences,
173 fixed translation problem with "Column".
175 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
177 * src/minibuffer.h: use Timeout instead of the xforms timer
179 (setTimer) rewrite for the Timeout, change to unsigned arg
180 (set): change to unsigned timer arg
183 * src/minibuffer.C (TimerCB): removed func
184 (C_MiniBuffer_TimerCB): removed func
185 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
186 (peek_event): use a switch statement
187 (add): don't use fl_add_timer.
188 (Set): rewrite to use the Timeout
191 * src/Timeout.[Ch] (setType): return a Timeout &
192 (setTimeout): ditto, change to unsigned arg for timeout
194 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
196 * src/mathed/formula.C (mathed_string_width): Use string instead
197 of a constant size char array.
199 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
201 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
202 the two recently added operator<< for SMInput and State.
204 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
206 (OkCancelPolicy): ditto
207 (OkCancelReadOnlyPolicy): ditto
208 (NoRepeatedApplyReadOnlyPolicy): ditto
209 (OkApplyCancelReadOnlyPolicy): ditto
210 (OkApplyCancelPolicy): ditto
211 (NoRepeatedApplyPolicy): ditto
213 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
215 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
216 add the usual std:: qualifiers.
218 2000-10-25 Juergen Vigna <jug@sad.it>
220 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
222 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
224 * src/support/filetools.C (MakeRelPath): change some types to
227 * src/frontends/ButtonPolicies.h (operator<<): new operator for
228 ButtonPolicy::SMInput and ButtonPolicy::State.
230 * src/FontLoader.C (reset): small cleanup
231 (unload): small cleanup
233 * src/FontInfo.C (getFontname): initialize error to 10000.0
235 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
237 * src/frontends/xforms/FormPreferences.[Ch]:
238 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
239 TeX encoding and default paper size sections.
241 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
243 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
246 * src/frontends/xforms/FormError.C (disconnect): use erase() to
247 make the message_ empty.
248 (FormError): don't initialize message_ in initializer list.
250 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
252 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
254 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
256 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
258 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
260 * src/frontends/kde/*data.[Ch]: _("") is not
263 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
265 * src/buffer.C: removed redundant using directive.
267 * src/frontends/DialogBase.h: revert to original definition of
270 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
271 stuff into two classes, one for each dialog, requires a new
272 element in the dialogs vector, FormTabularCreate.
274 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
277 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
278 method. Continues Allan's idea, but means that derived classes
279 don't need to worry about "update or hide?".
281 * src/frontends/xforms/FormError.C (showInset): add connection
284 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
285 one for each dialog. FormTabular now contains main tabular dialog
288 * src/frontends/xforms/FormTabularCreate.[Ch]:
289 * src/frontends/xforms/forms/form_tabular_create.fd: the create
292 * src/frontends/xforms/FormGraphics.[Ch]:
293 * src/frontends/xforms/forms/form_graphics.fd
294 * src/frontends/xforms/FormTabular.[Ch]:
295 * src/frontends/xforms/forms/form_tabular.fd: made daughter
296 classes of FormInset.
298 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
299 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
301 * src/frontends/xforms/Makefile.am:
302 * src/frontends/xforms/forms/makefile: added new files.
304 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
305 variable. added Signal0 hide signal, in keeping with other GUI-I
308 * src/support/lstrings.h: removed redundant std:: qualifier as
309 it's already declared in Lsstream.h.
311 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
313 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
317 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
319 * src/tabular.C (Ascii): minimize scope of cell.
321 * src/BufferView2.C (nextWord): return string() instead of 0;
323 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
325 * src/converter.h: add a std:: qualifier
327 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
329 * src/importer.[Ch]: New files. Used for importing files into LyX.
331 * src/lyxfunc.C (doImport): Use the new Importer class.
333 * src/converter.h: Add shortcut member to the Format class.
334 Used for holding the menu shortcut.
336 * src/converter.C and other files: Made a distinction between
337 format name and format extension. New formats can be defined using
338 the \format lyxrc tag.
339 Added two new converter flags: latex and disable.
341 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
343 * src/support/lyxlib.h: unify namespace/struct implementation.
344 Remove extra declarations.
346 * src/support/chdir.C (chdir): remove version taking char const *
348 * src/support/rename.C: ditto.
349 * src/support/lyxsum.C: ditto.
351 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
353 * src/frontends/xforms/FormBase.[Ch]:
354 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
355 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
356 work only for the next call to fl_show_form(). The correct place to set
357 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
358 done. FormBase also stores minw_, minh_ itself. All dialogs derived
359 from FormBase have the minimum size set; no more stupid crashes with
362 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
364 * lib/ui/default.ui: fix shortcut for Insert->Include File.
366 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
368 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
370 * src/support/lyxlib.h: changed second argument of mkdir to
371 unsigned long int (unsigned int would probably have been enough,
372 but...). Removed <sys/types.h> header.
373 * src/support/mkdir.C (mkdir): ditto.
377 2000-10-19 Juergen Vigna <jug@sad.it>
379 * src/lyxfunc.C (MenuNew): small fix (form John)
381 * src/screen.C (Update): removed unneeded code.
383 * src/tabular.C (Ascii): refixed int != uint bug!
385 * src/support/lyxlib.h: added sys/types.h include for now permits
386 compiling, but I don't like this!
388 2000-10-18 Juergen Vigna <jug@sad.it>
390 * src/text2.C (ClearSelection): if we clear the selection we need
391 more refresh so set the status apropriately
393 * src/insets/insettext.C (draw): hopefully finally fixed draw
396 2000-10-12 Juergen Vigna <jug@sad.it>
398 * src/insets/insettext.C (draw): another small fix and make a block
399 so that variables are localized.
401 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
403 * src/support/lstrings.C (lowercase, uppercase):
404 use explicit casts to remove compiler warnings.
406 * src/support/LRegex.C (Impl):
407 * src/support/StrPool.C (add):
408 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
409 (AddPath, MakeDisplayPath):
410 * src/support/lstrings.C (prefixIs, subst):
411 use correct type to remove compiler warnings.
413 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
415 * src/support/lyxlib.h:
416 * src/support/mkdir.C (mkdir): change parameter to mode_t for
417 portability and to remove compiler warning with DEC cxx.
419 * src/support/FileInfo.[Ch] (flagRWX): ditto.
421 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
423 * src/minibuffer.C (peek_event): retun 1 when there has been a
424 mouseclick in the minibuffer.
428 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
430 * src/frontends/xforms/FormParagraph.C: more space above/below
433 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
435 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
436 a char only if real_current_font was changed.
438 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
440 * NEWS: update somewhat for 1.1.6
442 * lib/ui/default.ui: clean up.
444 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
446 * lib/CREDITS: clean up
448 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
450 * src/combox.[Ch] (select): changed argument back to int
451 * src/combox.C (peek_event): removed num_bytes as it is declared but
454 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
455 modified calls to Combox::select() to remove warnings about type
458 * src/insets/insetbutton.C (width): explicit cast to remove warning
459 about type conversion.
461 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
464 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
465 sel_pos_end, refering to cursor position are changed to
466 LyXParagraph::size_type.
468 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
469 consistent with LyXCursor::pos().
470 (inset_pos): changed to LyXParagraph::size_type for same reason.
472 * src/insets/insettext.C (resizeLyXText): changed some temporary
473 variables refing to cursor position to LyXParagraph::size_type.
475 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
477 * src/frontends/kde/<various>: The Great Renaming,
480 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
482 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
484 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
486 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
487 0 when there are no arguments.
489 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
491 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
492 to segfaults when pressing Ok in InsetBibtex dialog.
494 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
496 * forms/layout_forms.fd:
497 * src/layout_forms.C (create_form_form_character): small change to use
498 labelframe rather than engraved frame + text
500 * src/lyx_gui.C (create_forms): initialise choice_language with some
501 arbitrary value to prevent segfault when dialog is shown.
503 2000-10-16 Baruch Even <baruch.even@writeme.com>
505 * src/converter.C (runLaTeX, scanLog): Added a warning when there
506 is no resulting file. This pertains only to LaTeX output.
508 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
510 * src/text.C (Backspace): Make sure that the row of the cursor is
513 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
516 * src/lyx_gui.C (init): Prevent a crash when only one font from
517 menu/popup fonts is not found.
519 * lib/lyxrc.example: Add an example for binding a key for language
522 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
524 * src/converter.C (GetReachable): Changed the returned type to
526 (IsReachable): New method
528 * src/MenuBackend.C (expand): Handle formats that appear more
531 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
533 * src/frontends/support/Makefile.am
534 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
537 * lib/CREDITS: add Garst Reese.
539 * src/support/snprintf.h: add extern "C" {} around the definitions.
541 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
543 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
546 * src/frontends/xforms/FormDocument.C:
547 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
548 compile without "conversion to integral type of smaller size"
551 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
553 * src/text.C (GetColumnNearX): Fixed disabled code.
555 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
557 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
560 * src/support/snprintf.[ch]: new files
562 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
564 * src/frontends/kde/formprintdialog.C: add
565 file browser for selecting postscript output
567 * src/frontends/kde/formprintdialogdata.C:
568 * src/frontends/kde/formprintdialogdata.h: re-generate
571 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
573 * src/frontends/gnome/Makefile.am:
574 * src/frontends/kde/Makefile.am: FormCommand.C
575 disappeared from xforms
577 * src/frontends/kde/FormCitation.C:
578 * src/frontends/kde/FormIndex.C: read-only
581 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
583 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
586 * src/bufferlist.C: add using directive.
588 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
590 * src/support/lyxfunctional.h: version of class_fun for void
591 returns added, const versions of back_inseter_fun and compare_fun
594 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
596 * src/frontends/xforms/FormInset.C (showInset): fix typo.
598 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
600 * ChangeLog: cleanup.
602 * lib/CREDITS: update to add all the contributors we've forgotten.
603 I have obviously missed some, so tell me whether there were
606 2000-10-13 Marko Vendelin <markov@ioc.ee>
608 * src/frontends/gnome/FormCitation.C
609 * src/frontends/gnome/FormCitation.h
610 * src/frontends/gnome/FormError.C
611 * src/frontends/gnome/FormIndex.C
612 * src/frontends/gnome/FormRef.C
613 * src/frontends/gnome/FormRef.h
614 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
616 * src/frontends/gnome/FormCitation.C
617 * src/frontends/gnome/FormCopyright.C
618 * src/frontends/gnome/FormError.C
619 * src/frontends/gnome/FormIndex.C
620 * src/frontends/gnome/FormRef.C
621 * src/frontends/gnome/FormToc.C
622 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
625 * src/frontends/gnome/Menubar_pimpl.C
626 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
629 2000-10-11 Baruch Even <baruch.even@writeme.com>
632 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
633 to convey its real action.
635 * src/minibuffer.C (peek_event): Added action when mouse clicks to
636 clear the minibuffer and prepare to enter a command.
638 * src/mathed/formula.C (LocalDispatch): Changed to conform with
639 the rename from ExecCommand to PrepareForCommand.
640 * src/lyxfunc.C (Dispatch): ditto.
642 2000-10-11 Baruch Even <baruch.even@writeme.com>
644 * src/buffer.C (writeFile): Added test for errors on writing, this
645 catches all errors and not only file system full errors as intended.
647 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
649 * src/lyx_gui.C (create_forms): better fix for crash with
650 translated interface.
652 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
654 * src/frontends/kde/Makefile.am:
655 * src/frontends/kde/FormCopyright.C:
656 * src/frontends/kde/formcopyrightdialog.C:
657 * src/frontends/kde/formcopyrightdialog.h:
658 * src/frontends/kde/formcopyrightdialogdata.C:
659 * src/frontends/kde/formcopyrightdialogdata.h:
660 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
661 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
662 copyright to use qtarch
664 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
666 * src/encoding.C (read): Fixed bug that caused an error message at
669 * po/Makefile.in.in: Fixed rule for ext_l10n.h
671 * lib/lyxrc.example: Fixed hebrew example.
673 2000-10-13 Allan Rae <rae@lyx.org>
675 * src/frontends/xforms/FormPreferences.C (input): reworking the
677 (build, update, apply): New inputs in various tabfolders
679 * src/frontends/xforms/FormToc.C: use new button policy.
680 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
681 dialogs that either can't use any existing policy or where it just
684 * src/frontends/xforms/FormTabular.h: removed copyright notice that
687 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
688 added a bool parameter which is ignored.
690 * src/buffer.C (setReadonly):
691 * src/BufferView_pimpl.C (buffer):
692 * src/frontends/kde/FormCopyright.h (update):
693 * src/frontends/kde/FormCitation.[Ch] (update):
694 * src/frontends/kde/FormIndex.[Ch] (update):
695 * src/frontends/kde/FormPrint.[Ch] (update):
696 * src/frontends/kde/FormRef.[Ch] (update):
697 * src/frontends/kde/FormToc.[Ch] (update):
698 * src/frontends/kde/FormUrl.[Ch] (update):
699 * src/frontends/gnome/FormCopyright.h (update):
700 * src/frontends/gnome/FormCitation.[Ch] (update):
701 * src/frontends/gnome/FormError.[Ch] (update):
702 * src/frontends/gnome/FormIndex.[Ch] (update):
703 * src/frontends/gnome/FormPrint.[Ch] (update):
704 * src/frontends/gnome/FormRef.h (update):
705 * src/frontends/gnome/FormToc.[Ch] (update):
706 * src/frontends/gnome/FormUrl.[Ch] (update):
707 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
708 to updateBufferDependent and DialogBase
710 * src/frontends/xforms/FormCitation.[hC]:
711 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
712 * src/frontends/xforms/FormError.[Ch]:
713 * src/frontends/xforms/FormGraphics.[Ch]:
714 * src/frontends/xforms/FormIndex.[Ch]:
715 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
716 and fixed readOnly handling.
717 * src/frontends/xforms/FormPrint.[Ch]:
718 * src/frontends/xforms/FormRef.[Ch]:
719 * src/frontends/xforms/FormTabular.[Ch]:
720 * src/frontends/xforms/FormToc.[Ch]:
721 * src/frontends/xforms/FormUrl.[Ch]:
722 * src/frontends/xforms/FormInset.[Ch]:
723 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
724 form of updateBufferDependent.
726 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
727 if form()->visible just in case someone does stuff to the form in a
730 * src/frontends/DialogBase.h (enum): removed enum since we can now use
731 the buttoncontroller for everything the enum used to be used for.
732 (update) It would seem we need to force all dialogs to use a bool
733 parameter or have two update functions. I chose to go with one.
734 I did try removing update() from here and FormBase and defining the
735 appropriate update signatures in FormBaseB[DI] but then ran into the
736 problem of the update() call in FormBase::show(). Whatever I did
737 to get around that would require another function and that just
738 got more confusing. Hence the decision to make everyone have an
739 update(bool). An alternative might have been to override show() in
740 FormBaseB[DI] and that would allow the different and appropriate
743 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
744 true == buffer change occurred. I decided against using a default
745 template parameter since not all compilers support that at present.
747 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
749 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
750 army knife" by removing functionality.
751 (clearStore): removed. All such housekeeping on hide()ing the dialog
752 is to be carried out by overloaded disconnect() methods.
753 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
754 superceded by Baruch's neat test (FormGraphics) to update an existing
755 dialog if a new signal is recieved rather than block all new signals
757 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
758 only to Inset dialogs.
759 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
760 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
762 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
764 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
765 as a base class to all inset dialogs. Used solely to connect/disconnect
766 the Inset::hide signal and to define what action to take on receipt of
767 a UpdateBufferDependent signal.
768 (FormCommand): now derived from FormInset.
770 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
773 * src/frontends/xforms/FormCopyright.[Ch]:
774 * src/frontends/xforms/FormPreferences.[Ch]:
775 now derived from FormBaseBI.
777 * src/frontends/xforms/FormDocument.[Ch]:
778 * src/frontends/xforms/FormParagraph.[Ch]:
779 * src/frontends/xforms/FormPrint.[Ch]:
780 now derived from FormBaseBD.
782 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
784 * src/frontends/xforms/FormCitation.[Ch]:
785 * src/frontends/xforms/FormError.[Ch]:
786 * src/frontends/xforms/FormRef.[Ch]:
787 * src/frontends/xforms/FormToc.[Ch]:
788 (clearStore): reworked as disconnect().
790 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
793 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
795 * src/converter.C (runLaTeX): constify buffer argument
798 * src/frontends/support/Makefile.am (INCLUDES): fix.
800 * src/buffer.h: add std:: qualifier
801 * src/insets/figinset.C (addpidwait): ditto
802 * src/MenuBackend.C: ditto
803 * src/buffer.C: ditto
804 * src/bufferlist.C: ditto
805 * src/layout.C: ditto
806 * src/lyxfunc.C: ditto
808 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
810 * src/lyxtext.h (bidi_level): change return type to
811 LyXParagraph::size_type.
813 * src/lyxparagraph.h: change size_type to
814 TextContainer::difference_type. This should really be
815 TextContainer::size_type, but we need currently to support signed
818 2000-10-11 Marko Vendelin <markov@ioc.ee>
819 * src/frontends/gnome/FormError.h
820 * src/frontends/gnome/FormRef.C
821 * src/frontends/gnome/FormRef.h
822 * src/frontends/gnome/FormError.C
823 * src/frontends/gnome/Makefile.am
824 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
825 to Gnome frontend. Both dialogs use "action" area.
827 2000-10-12 Baruch Even <baruch.even@writeme.com>
829 * src/graphics/GraphicsCacheItem_pimpl.C:
830 * src/graphics/Renderer.C:
831 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
834 2000-10-12 Juergen Vigna <jug@sad.it>
836 * src/insets/insettext.C (draw): fixed drawing bug (specifically
837 visible when selecting).
839 * development/Code_rules/Rules: fixed some typos.
841 2000-10-09 Baruch Even <baruch.even@writeme.com>
843 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
844 compiling on egcs 1.1.2 possible.
846 * src/filedlg.C (comp_direntry::operator() ): ditto.
848 2000-08-31 Baruch Even <baruch.even@writeme.com>
850 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
853 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
854 transient it now only gets freed when the object is destructed.
856 2000-08-24 Baruch Even <baruch.even@writeme.com>
858 * src/frontends/FormGraphics.h:
859 * src/frontends/FormGraphics.C: Changed to use ButtonController and
862 2000-08-20 Baruch Even <baruch.even@writeme.com>
864 * src/insets/insetgraphics.C:
865 (draw): Added messages to the drawn rectangle to report status.
866 (updateInset): Disabled the use of the inline graphics,
869 2000-08-17 Baruch Even <baruch.even@writeme.com>
871 * src/frontends/support: Directory added for the support of GUII LyX.
873 * src/frontends/support/LyXImage.h:
874 * src/frontends/support/LyXImage.C: Base class for GUII holding of
877 * src/frontends/support/LyXImage_X.h:
878 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
879 version of LyXImage, this uses the Xlib Pixmap.
884 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
885 replacement to Pixmap.
887 * src/insets/insetgraphics.h:
888 * src/insets/insetgraphics.C:
889 * src/graphics/GraphicsCacheItem.h:
890 * src/graphics/GraphicsCacheItem.C:
891 * src/graphics/GraphicsCacheItem_pimpl.h:
892 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
895 * src/graphics/GraphicsCacheItem.h:
896 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
897 another copy of the object.
899 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
900 of cacheHandle, this fixed a bug that sent LyX crashing.
902 * src/graphics/XPM_Renderer.h:
903 * src/graphics/XPM_Renderer.C:
904 * src/graphics/EPS_Renderer.h:
905 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
907 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
909 * src/lyxfunc.C (processKeySym): only handle the
910 lockinginset/inset stuff if we have a buffer and text loaded...
912 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
914 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
916 * src/support/lyxfunctional.h: add operator= that takes a reference
918 * src/lyxserver.C (mkfifo): make first arg const
920 * src/layout.h: renamed name(...) to setName(...) to work around
923 * src/buffer.C (setFileName): had to change name of function to
924 work around bugs in egcs. (renamed from fileName)
926 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
928 * src/support/translator.h: move helper template classes to
929 lyxfunctional.h, include "support/lyxfunctional.h"
931 * src/support/lyxmanip.h: add delaration of fmt
933 * src/support/lyxfunctional.h: new file
934 (class_fun_t): new template class
935 (class_fun): helper template function
936 (back_insert_fun_iterator): new template class
937 (back_inserter_fun): helper template function
938 (compare_memfun_t): new template class
939 (compare_memfun): helper template function
940 (equal_1st_in_pair): moved here from translator
941 (equal_2nd_in_pair): moved here from translator
943 * src/support/fmt.C: new file
944 (fmt): new func, can be used for a printf substitute when still
945 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
947 * src/support/StrPool.C: add some comments
949 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
952 * src/insets/figinset.C (addpidwait): use std::copy with
953 ostream_iterator to fill the pidwaitlist
955 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
957 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
960 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
963 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
965 * src/frontends/xforms/FormDocument.C (build): remove c_str()
966 (class_update): ditto
968 (CheckChoiceClass): move initialization of tc and tct
970 * src/tabular.C: remove current_view
971 (OldFormatRead): similar to right below [istream::ignore]
973 * src/lyxlex_pimpl.C (next): add code for faster skipping of
974 chars, unfortunately this is buggy on gcc 2.95.2, so currently
975 unused [istream::ignore]
977 * src/lyxfunc.C: include "support/lyxfunctional.h"
978 (getInsetByCode): use std::find_if and compare_memfun
980 * src/lyxfont.C (stateText): remove c_str()
982 * src/lyx_main.C (setDebuggingLevel): make static
983 (commandLineHelp): make static
985 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
986 Screen* together with fl_get_display() and fl_screen
988 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
989 togheter with fl_get_display() and fl_screen
990 (create_forms): remove c_str()
992 * src/layout.C: include "support/lyxfunctional.h"
993 (hasLayout): use std::find_if and compare_memfun
994 (GetLayout): use std::find_if and comapre_memfun
995 (delete_layout): use std::remove_if and compare_memfun
996 (NumberOfClass): use std:.find_if and compare_memfun
998 * src/gettext.h: change for the new functions
1000 * src/gettext.C: new file, make _(char const * str) and _(string
1001 const & str) real functions.
1003 * src/font.C (width): rewrite slightly to avoid one extra variable
1005 * src/debug.C: initialize Debug::ANY here
1007 * src/commandtags.h: update number comments
1009 * src/combox.h (get): make const func
1011 (getline): make const
1013 * src/combox.C (input_cb): handle case where fl_get_input can
1016 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1017 "support/lyxfunctional.h", remove current_view variable.
1018 (resize): use std::for_each with std::mem_fun
1019 (getFileNames): use std::copy with back_inserter_fun
1020 (getBuffer): change arg type to unsigned int
1021 (emergencyWriteAll): call emergencyWrite with std::for_each and
1023 (emergencyWrite): new method, the for loop in emergencyWriteAll
1025 (exists): use std::find_if with compare_memfun
1026 (getBuffer): use std::find_if and compare_memfun
1028 * src/buffer.h: add typedefs for iterator_category, value_type
1029 difference_type, pointer and reference for inset_iterator
1030 add postfix ++ for inset_iterator
1031 make inset_iterator::getPos() const
1033 * src/buffer.C: added support/lyxmanip.h
1034 (readFile): use lyxerr << fmt instead of printf
1035 (makeLaTeXFile): use std::copy to write out encodings
1037 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1039 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1040 free and the char * temp.
1041 (hasMenu): use std::find_if and compare_memfun
1044 * src/Makefile.am (lyx_SOURCES): added gettext.C
1046 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1047 string::insert small change to avoid temporary
1049 * src/LColor.C (getGUIName): remove c_str()
1051 * several files: change all occurrences of fl_display to
1054 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1055 that -pedantic is not used for gcc 2.97 (cvs gcc)
1057 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1059 2000-10-11 Allan Rae <rae@lyx.org>
1061 * src/frontends/xforms/FormPreferences.C (input): template path must be
1062 a readable directory. It doesn't need to be writeable.
1063 (build, delete, update, apply): New inputs in the various tabfolders
1065 * src/frontends/xforms/forms/form_preferences.fd:
1066 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1067 several new entries to existing folders. Shuffled some existing stuff
1070 * src/frontends/xforms/forms/form_print.fd:
1071 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1072 Should probably rework PrinterParams as well. Note that the switch to
1073 collated is effectively the same as !unsorted so changing PrinterParams
1074 will require a lot of fiddly changes to reverse the existing logic.
1076 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1078 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1080 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1082 2000-10-10 Allan Rae <rae@lyx.org>
1085 * src/lyxfunc.C (Dispatch):
1087 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1090 * src/lyxrc.C (output): Only write the differences between system lyxrc
1091 and the users settings.
1094 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1096 I'll rewrite this later, after 1.1.6 probably, to keep a single
1097 LyXRC but two instances of a LyXRCStruct.
1099 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1101 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1103 * src/tabular.h: add a few std:: qualifiers.
1105 * src/encoding.C: add using directive.
1106 * src/language.C: ditto.
1108 * src/insets/insetquotes.C (Validate): use languages->lang()
1109 instead of only language.
1111 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1113 * lib/languages: New file.
1115 * lib/encodings: New file.
1117 * src/language.C (Languages): New class.
1118 (read): New method. Reads the languages from the 'languages' file.
1120 * src/encoding.C (Encodings): New class.
1121 (read): New method. Reads the encodings from the 'encodings' file.
1123 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1126 * src/bufferparams.h and a lot of files: Deleted the member language,
1127 and renamed language_info to language
1129 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1130 * src/lyxfont.C (latexWriteStartChanges): ditto.
1131 * src/paragraph.C (validate,TeXOnePar): ditto.
1133 * src/lyxfont.C (update): Restored deleted code.
1135 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1137 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1139 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1141 * src/insets/figinset.[Ch]:
1142 * src/insets/insetinclude.[Ch]:
1143 * src/insets/insetinclude.[Ch]:
1144 * src/insets/insetparent.[Ch]:
1145 * src/insets/insetref.[Ch]:
1146 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1148 * src/insets/*.[Ch]:
1149 * src/mathed/formula.[Ch]:
1150 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1152 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1153 * src/lyx_cb.C (FigureApplyCB):
1154 * src/lyxfunc.C (getStatus, Dispatch):
1155 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1158 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1160 * src/converter.[Ch] (Formats::View):
1161 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1163 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1164 *current_view->buffer(). This will change later, but this patch is way
1167 2000-10-09 Juergen Vigna <jug@sad.it>
1169 * src/text.C (GetRow): small fix.
1171 * src/BufferView_pimpl.C (cursorPrevious):
1172 (cursorNext): added LyXText parameter to function.
1174 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1175 keypress depending on cursor position.
1177 2000-10-06 Juergen Vigna <jug@sad.it>
1179 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1180 (copySelection): redone this function and also copy ascii representa-
1183 * src/tabular.C (Ascii):
1187 (print_n_chars): new functions to realize the ascii export of tabulars.
1189 2000-10-05 Juergen Vigna <jug@sad.it>
1191 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1192 if we don't have a buffer.
1194 2000-10-10 Allan Rae <rae@lyx.org>
1196 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1197 with closing dialog. It seems that nested tabfolders require hiding
1198 of inner tabfolders before hiding the dialog itself. Actually all I
1199 did was hide the active outer folder.
1201 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1202 unless there really is a buffer. hideBufferDependent is called
1205 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1206 POTFILES.in stays in $(srcdir).
1208 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1210 * lib/lyxrc.example: Few changes.
1212 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1214 * src/BufferView_pimpl.C (buffer): only need one the
1215 updateBufferDependent signal to be emitted once! Moved to the end of
1216 the method to allow bv_->text to be updated first.
1218 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1219 and hSignal_ with Dialogs * and BufferDependency variables.
1220 New Buffer * parent_, initialised when the dialog is launched. Used to
1221 check whether to update() or hide() dialog in the new, private
1222 updateOrHide() method that is connected to the updateBufferDependent
1223 signal. Daughter classes dictate what to do using the
1224 ChangedBufferAction enum, passed to the c-tor.
1226 * src/frontends/xforms/FormCitation.C:
1227 * src/frontends/xforms/FormCommand.C:
1228 * src/frontends/xforms/FormCopyright.C:
1229 * src/frontends/xforms/FormDocument.C:
1230 * src/frontends/xforms/FormError.C:
1231 * src/frontends/xforms/FormIndex.C:
1232 * src/frontends/xforms/FormPreferences.C:
1233 * src/frontends/xforms/FormPrint.C:
1234 * src/frontends/xforms/FormRef.C:
1235 * src/frontends/xforms/FormToc.C:
1236 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1239 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1240 ChangedBufferAction enum.
1242 * src/frontends/xforms/FormParagraph.[Ch]
1243 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1246 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1248 * lib/bind/cua.bind: fix a bit.
1249 * lib/bind/emacs.bind: ditto.
1251 * lib/bind/menus.bind: remove real menu entries from there.
1253 * src/spellchecker.C: make sure we only include strings.h when
1256 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1258 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1259 function. It enlarges the maximum number of pup when needed.
1260 (add_toc2): Open a new menu if maximum number of items per menu has
1263 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1265 * src/frontends/kde/FormPrint.C: fix error reporting
1267 * src/frontends/xforms/FormDocument.C: fix compiler
1270 * lib/.cvsignore: add Literate.nw
1272 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1275 * bufferview_funcs.[Ch]
1278 * text2.C: Add support for numbers in RTL text.
1280 2000-10-06 Allan Rae <rae@lyx.org>
1282 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1283 to be gettext.m4 friendly again. ext_l10n.h is now
1284 generated into $top_srcdir instead of $top_builddir
1285 so that lyx.pot will be built correctly -- without
1286 duplicate parsing of ext_l10n.h.
1288 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1290 * src/frontends/kde/FormCitation.C: make the dialog
1291 behave more sensibly
1293 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1295 * config/kde.m4: fix consecutive ./configure runs,
1296 look for qtarch, fix library order
1298 * src/frontends/kde/Makefile.am: tidy up,
1299 add Print dialog, add .dlg dependencies
1301 * src/frontends/kde/FormPrint.C:
1302 * src/frontends/kde/FormPrint.h:
1303 * src/frontends/kde/formprintdialog.C:
1304 * src/frontends/kde/formprintdialog.h:
1305 * src/frontends/kde/formprintdialogdata.C:
1306 * src/frontends/kde/formprintdialogdata.h:
1307 * src/frontends/kde/dlg/formprintdialog.dlg: add
1310 * src/frontends/kde/dlg/README: Added explanatory readme
1312 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1313 script to double-check qtarch's output
1315 * src/frontends/kde/formindexdialog.C:
1316 * src/frontends/kde/formindexdialogdata.C:
1317 * src/frontends/kde/formindexdialogdata.h:
1318 * src/frontends/kde/dlg/formindexdialog.dlg: update
1319 for qtarch, minor fixes
1321 2000-10-05 Allan Rae <rae@lyx.org>
1323 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1324 dialogs when switching buffers update them instead. It's up to each
1325 dialog to decide if it should still be visible or not.
1326 update() should return a bool to control visiblity within show().
1327 Or perhaps better to set a member variable and use that to control
1330 * lib/build-listerrors: create an empty "listerrors" file just to stop
1331 make trying to regenerate it all the time if you don't have noweb
1334 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1336 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1337 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1338 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1339 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1340 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1342 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1344 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1346 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1347 deleting buffer. Closes all buffer-dependent dialogs.
1349 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1351 * src/frontends/xforms/FormCitation.[Ch]:
1352 * src/frontends/xforms/FormPreferences.[Ch]:
1353 * src/frontends/xforms/FormPrint.[Ch]:
1354 * src/frontends/xforms/FormRef.[Ch]:
1355 * src/frontends/xforms/FormUrl.[Ch]: ditto
1357 * src/frontends/xforms/FormDocument.[Ch]:
1358 * src/frontends/xforms/forms/form_document.C.patch:
1359 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1360 pass through a single input() function.
1362 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1364 * lib/build-listerrors: return status as OK
1366 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1368 * lib/lyxrc.example: Updated to new export code
1370 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1372 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1375 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1378 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1379 LyX-Code is defined.
1380 * lib/layouts/amsbook.layout: ditto.
1382 * boost/Makefile.am: fix typo.
1384 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1386 (add_lastfiles): removed.
1387 (add_documents): removed.
1388 (add_formats): removed.
1390 * src/frontends/Menubar.C: remove useless "using" directive.
1392 * src/MenuBackend.h: add a new MenuItem constructor.
1394 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1397 2000-10-04 Allan Rae <rae@lyx.org>
1399 * lib/Makefile.am (listerrors):
1400 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1401 I haven't got notangle installed so Kayvan please test. The output
1402 should end up in $builddir. This also allows people who don't have
1403 noweb installed to complete the make process without error.
1405 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1406 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1407 by JMarc's picky compiler.
1409 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1412 * src/insets/insettabular.C (setPos): change for loop to not use
1413 sequencing operator. Please check this Jürgen.
1415 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1417 * src/insets/insetcite.C (getScreenLabel): ditto
1418 * src/support/filetools.C (QuoteName): ditto
1419 (ChangeExtension): ditto
1421 * src/BufferView_pimpl.C (scrollCB): make heigt int
1423 * src/BufferView2.C (insertInset): comment out unused arg
1425 * boost/Makefile.am (EXTRADIST): new variable
1427 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1429 * src/exporter.C (IsExportable): Fixed
1431 * lib/configure.m4: Small fix
1433 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1435 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1436 * src/insets/insetbib.C (bibitemWidest): ditto.
1437 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1439 2000-10-03 Juergen Vigna <jug@sad.it>
1441 * src/BufferView2.C (theLockingInset): removed const because of
1442 Agnus's compile problems.
1444 * src/insets/insettext.C (LocalDispatch): set the language of the
1445 surronding paragraph on inserting the first character.
1447 * various files: changed use of BufferView::the_locking_inset.
1449 * src/BufferView2.C (theLockingInset):
1450 (theLockingInset): new functions.
1452 * src/BufferView.h: removed the_locking_inset.
1454 * src/lyxtext.h: added the_locking_inset
1456 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1458 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1460 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1462 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1463 * src/mathed/math_cursor.C (IsAlpha): ditto.
1464 * src/mathed/math_inset.C (strnew): ditto.
1465 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1466 (IMetrics): cxp set but never used; removed.
1467 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1468 that the variable in question has been removed also!
1471 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1472 using the Buffer * passed to Latex(), using the BufferView * passed to
1473 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1475 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1476 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1478 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1479 * src/buffer.C (readInset): used new InsetBibtex c-tor
1480 * (getBibkeyList): used new InsetBibtex::getKeys
1482 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1485 * lib/build-listerrors
1487 * src/exporter.C: Add literate programming support to the export code
1490 * src/lyx_cb.C: Remove old literate code.
1492 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1495 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1496 * src/converter.C (View, Convert): Use QuoteName.
1498 * src/insets/figinset.C (Preview): Use Formats::View.
1500 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1502 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1504 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1505 the top of the function, because compaq cxx complains that the
1506 "goto exit_with_message" when the function is disabled bypasses
1508 (MenuNew): try a better fix for the generation of new file names.
1509 This time, I used AddName() instead of AddPath(), hoping Juergen
1512 2000-10-03 Allan Rae <rae@lyx.org>
1514 * src/frontends/xforms/forms/form_preferences.fd:
1515 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1516 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1517 "Look and Feel"->"General" but will need to be split up further into
1518 general output and general input tabs. Current plan is for four outer
1519 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1520 stuff; "Inputs" for input and import configuration; "Outputs" for
1521 output and export configuration; and one more whatever is left over
1522 called "General". The leftovers at present look like being which
1523 viewers to use, spellchecker, language support and might be better
1524 named "Support". I've put "Paths" in "Inputs" for the moment as this
1525 seems reasonable for now at least.
1526 One problem remains: X error kills LyX when you close Preferences.
1528 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1530 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1531 qualifier from form()
1532 * src/frontends/xforms/FormCitation.[Ch]:
1533 * src/frontends/xforms/FormCopyright.[Ch]:
1534 * src/frontends/xforms/FormDocument.[Ch]:
1535 * src/frontends/xforms/FormError.[Ch]:
1536 * src/frontends/xforms/FormIndex.[Ch]:
1537 * src/frontends/xforms/FormPreferences.[Ch]:
1538 * src/frontends/xforms/FormPrint.[Ch]:
1539 * src/frontends/xforms/FormRef.[Ch]:
1540 * src/frontends/xforms/FormToc.[Ch]:
1541 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1543 * src/frontends/xforms/FormCitation.[Ch]:
1544 * src/frontends/xforms/FormIndex.[Ch]:
1545 * src/frontends/xforms/FormRef.[Ch]:
1546 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1547 with Allan's naming policy
1549 * src/frontends/xforms/FormCitation.C: some static casts to remove
1552 2000-10-02 Juergen Vigna <jug@sad.it>
1554 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1555 now you can type or do stuff inside the table-cell also when in dummy
1556 position, fixed visible cursor.
1558 * src/insets/insettext.C (Edit): fixing cursor-view position.
1560 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1561 be used for equal functions in lyxfunc and insettext.
1563 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1565 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1567 * src/frontends/gnome/FormCitation.h:
1568 * src/frontends/gnome/FormCopyright.h:
1569 * src/frontends/gnome/FormIndex.h:
1570 * src/frontends/gnome/FormPrint.h:
1571 * src/frontends/gnome/FormToc.h:
1572 * src/frontends/gnome/FormUrl.h:
1573 * src/frontends/kde/FormCitation.h:
1574 * src/frontends/kde/FormCopyright.h:
1575 * src/frontends/kde/FormIndex.h:
1576 * src/frontends/kde/FormRef.h:
1577 * src/frontends/kde/FormToc.h:
1578 * src/frontends/kde/FormUrl.h: fix remaining users of
1581 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1583 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1584 from depth argument.
1585 (DocBookHandleCaption): ditto.
1586 (DocBookHandleFootnote): ditto.
1587 (SimpleDocBookOnePar): ditto.
1589 * src/frontends/xforms/FormDocument.h (form): remove extra
1590 FormDocument:: qualifier.
1592 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1594 * sigc++/handle.h: ditto.
1596 * src/lyx_gui_misc.C: add "using" directive.
1598 * src/cheaders/cstddef: new file, needed by the boost library (for
1601 2000-10-02 Juergen Vigna <jug@sad.it>
1603 * src/insets/insettext.C (SetFont): better support.
1605 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1607 * src/screen.C (DrawOneRow): some uint refixes!
1609 2000-10-02 Allan Rae <rae@lyx.org>
1611 * boost/.cvsignore: ignore Makefile as well
1613 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1614 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1616 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1617 Left this one out by accident.
1619 * src/frontends/xforms/FormBase.h (restore): default to calling
1620 update() since that will restore the original/currently-applied values.
1621 Any input() triggered error messages will require the derived classes
1622 to redefine restore().
1624 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1625 avoid a segfault. combo_doc_class is the main concern.
1627 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1629 * Simplify build-listerrors in view of GUI-less export ability!
1631 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1633 * src/lyx_main.C (easyParse): Disable gui when exporting
1635 * src/insets/figinset.C:
1638 * src/lyx_gui_misc.C
1639 * src/tabular.C: Changes to allow no-gui.
1641 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1643 * src/support/utility.hpp: removed file
1644 * src/support/block.h: removed file
1646 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1649 * src/mathed/formula.C: add support/lyxlib.h
1650 * src/mathed/formulamacro.C: ditto
1652 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1653 * src/lyxparagraph.h: ditto
1655 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1656 * src/frontends/Makefile.am (INCLUDES): ditto
1657 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1658 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1659 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1660 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1661 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1662 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1664 * src/BufferView.h: use boost/utility.hpp
1665 * src/LColor.h: ditto
1666 * src/LaTeX.h: ditto
1667 * src/LyXAction.h: ditto
1668 * src/LyXView.h: ditto
1669 * src/bufferlist.h: ditto
1670 * src/lastfiles.h: ditto
1671 * src/layout.h: ditto
1672 * src/lyx_gui.h: ditto
1673 * src/lyx_main.h: ditto
1674 * src/lyxlex.h: ditto
1675 * src/lyxrc.h: ditto
1676 * src/frontends/ButtonPolicies.h: ditto
1677 * src/frontends/Dialogs.h: ditto
1678 * src/frontends/xforms/FormBase.h: ditto
1679 * src/frontends/xforms/FormGraphics.h: ditto
1680 * src/frontends/xforms/FormParagraph.h: ditto
1681 * src/frontends/xforms/FormTabular.h: ditto
1682 * src/graphics/GraphicsCache.h: ditto
1683 * src/graphics/Renderer.h: ditto
1684 * src/insets/ExternalTemplate.h: ditto
1685 * src/insets/insetcommand.h: ditto
1686 * src/support/path.h: ditto
1688 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1689 and introduce clause for 2.97.
1691 * boost/libs/README: new file
1693 * boost/boost/utility.hpp: new file
1695 * boost/boost/config.hpp: new file
1697 * boost/boost/array.hpp: new file
1699 * boost/Makefile.am: new file
1701 * boost/.cvsignore: new file
1703 * configure.in (AC_OUTPUT): add boost/Makefile
1705 * Makefile.am (SUBDIRS): add boost
1707 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1709 * src/support/lstrings.C (suffixIs): Fixed.
1711 2000-10-01 Allan Rae <rae@lyx.org>
1713 * src/PrinterParams.h: moved things around to avoid the "can't
1714 inline call" warning.
1716 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1717 into doc++ documentation.
1719 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1721 * src/frontends/xforms/FormRef.C: make use of button controller
1722 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1723 cleaned up button controller usage.
1724 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1725 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1726 use the button controller
1728 * src/frontends/xforms/forms/*.fd: and associated generated files
1729 updated to reflect changes to FormBase. Some other FormXxxx files
1730 also got minor updates to reflect changes to FormBase.
1732 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1733 (hide): made virtual.
1734 (input): return a bool. true == valid input
1735 (RestoreCB, restore): new
1736 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1737 Changes to allow derived dialogs to use a ButtonController and
1738 make sense when doing so: OK button calls ok() and so on.
1740 * src/frontends/xforms/ButtonController.h (class ButtonController):
1741 Switch from template implementation to taking Policy parameter.
1742 Allows FormBase to provide a ButtonController for any dialog.
1744 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1745 Probably should rename connect and disconnect.
1746 (apply): use the radio button groups
1747 (form): needed by FormBase
1748 (build): setup the radio button groups
1750 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1752 * several files: type changes to reduce the number of warnings and
1753 to unify type hangling a bit. Still much to do.
1755 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1757 * lib/images/*: rename a bunch of icons to match Dekel converter
1760 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1763 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1765 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1767 * sigc++/handle.h: ditto for class Handle.
1769 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1771 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1773 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1775 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1776 removal of the "default" language.
1778 * src/combox.h (getline): Check that sel > 0
1780 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1782 * lib/examples/docbook_example.lyx
1783 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1785 * lib/layouts/docbook-book.layout: new docbook book layout.
1787 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1789 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1791 * src/insets/figinset.C (DocBook):fixed small typo.
1793 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1795 * src/insets/insetinclude.h: string include_label doesn't need to be
1798 2000-09-29 Allan Rae <rae@lyx.org>
1800 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1801 Allow derived type to control connection and disconnection from signals
1802 of its choice if desired.
1804 2000-09-28 Juergen Vigna <jug@sad.it>
1806 * src/insets/insettabular.C (update): fixed cursor setting when
1807 the_locking_inset changed.
1808 (draw): made this a bit cleaner.
1809 (InsetButtonPress): fixed!
1811 * various files: added LyXText Parameter to fitCursor call.
1813 * src/BufferView.C (fitCursor): added LyXText parameter.
1815 * src/insets/insettabular.C (draw): small draw fix.
1817 * src/tabular.C: right setting of left/right celllines.
1819 * src/tabular.[Ch]: fixed various types in funcions and structures.
1820 * src/insets/insettabular.C: ditto
1821 * src/frontends/xforms/FormTabular.C: ditto
1823 2000-09-28 Allan Rae <rae@lyx.org>
1825 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1826 that the #ifdef's had been applied to part of what should have been
1827 a complete condition. It's possible there are other tests that
1828 were specific to tables that are also wrong now that InsetTabular is
1829 being used. Now we need to fix the output of '\n' after a table in a
1830 float for the same reason as the original condition:
1831 "don't insert this if we would be adding it before or after a table
1832 in a float. This little trick is needed in order to allow use of
1833 tables in \subfigures or \subtables."
1834 Juergen can you check this?
1836 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1838 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1839 output to the ostream.
1841 * several files: fixed types based on warnings from cxx
1843 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1845 * src/frontends/kde/Makefile.am: fix rule for
1846 formindexdialogdata_moc.C
1848 * src/.cvsignore: add ext_l10n.h to ignore
1850 * acconfig.h: stop messing with __STRICT_ANSI__
1851 * config/gnome.m4: remove option to set -ansi
1852 * config/kde.m4: remove option to set -ansi
1853 * config/lyxinclude.m4: don't set -ansi
1855 2000-09-27 Juergen Vigna <jug@sad.it>
1857 * various files: remove "default" language check.
1859 * src/insets/insetquotes.C: removed use of current_view.
1861 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1862 the one should have red ears by now!
1864 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1865 in more then one paragraph. Fixed cursor-movement/selection.
1867 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1868 paragraphs inside a text inset.
1870 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1871 text-inset if this owner is an inset.
1873 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1875 * src/Bullet.h: changed type of font, character and size to int
1877 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1879 * src/insets/inseturl.[Ch]:
1880 * src/insets/insetref.[Ch]:
1881 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1883 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1885 * src/buffer.C (readFile): block-if statement rearranged to minimise
1886 bloat. Patch does not reverse Jean-Marc's change ;-)
1888 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1889 Class rewritten to store pointers to hide/update signals directly,
1890 rather than Dialogs *. Also defined an enum to ease use. All xforms
1891 forms can now be derived from this class.
1893 * src/frontends/xforms/FormCommand.[Ch]
1894 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1896 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1899 * src/frontends/xforms/forms/form_citation.fd
1900 * src/frontends/xforms/forms/form_copyright.fd
1901 * src/frontends/xforms/forms/form_error.fd
1902 * src/frontends/xforms/forms/form_index.fd
1903 * src/frontends/xforms/forms/form_ref.fd
1904 * src/frontends/xforms/forms/form_toc.fd
1905 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1907 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1909 * src/insets/insetfoot.C: removed redundent using directive.
1911 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1913 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1914 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1916 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1917 created in the constructors in different groups. Then set() just
1918 have to show the groups as needed. This fixes the redraw problems
1919 (and is how the old menu code worked).
1921 * src/support/lyxlib.h: declare the methods as static when we do
1922 not have namespaces.
1924 2000-09-26 Juergen Vigna <jug@sad.it>
1926 * src/buffer.C (asciiParagraph): new function.
1927 (writeFileAscii): new function with parameter ostream.
1928 (writeFileAscii): use now asciiParagraph.
1930 * various inset files: added the linelen parameter to the Ascii-func.
1932 * src/tabular.C (Write): fixed error in writing file introduced by
1933 the last changes from Lars.
1935 * lib/bind/menus.bind: removed not supported functions.
1937 * src/insets/insettext.C (Ascii): implemented this function.
1939 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1941 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1942 (Write): use of the write_attribute functions.
1944 * src/bufferlist.C (close): fixed reasking question!
1946 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1948 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1949 new files use the everwhere possible.
1952 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1953 src/log_form.C src/lyx.C:
1956 * src/buffer.C (runLaTeX): remove func
1958 * src/PaperLayout.C: removed file
1959 * src/ParagraphExtra.C: likewise
1960 * src/bullet_forms.C: likewise
1961 * src/bullet_forms.h: likewise
1962 * src/bullet_forms_cb.C: likewise
1964 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1965 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1968 * several files: remove all traces of the old fd_form_paragraph,
1969 and functions belonging to that.
1971 * several files: remove all traces of the old fd_form_document,
1972 and functions belonging to that.
1974 * several files: constify local variables were possible.
1976 * several files: remove all code that was dead when NEW_EXPORT was
1979 * several files: removed string::c_str in as many places as
1982 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1983 (e): be a bit more outspoken when patching
1984 (updatesrc): only move files if changed.
1986 * forms/layout_forms.h.patch: regenerated
1988 * forms/layout_forms.fd: remove form_document and form_paragraph
1989 and form_quotes and form_paper and form_table_options and
1990 form_paragraph_extra
1992 * forms/form1.fd: remove form_table
1994 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1995 the fdui->... rewrite. Update some comments to xforms 0.88
1997 * forms/bullet_forms.C.patch: removed file
1998 * forms/bullet_forms.fd: likewise
1999 * forms/bullet_forms.h.patch: likewise
2001 * development/Code_rules/Rules: added a section on switch
2002 statements. Updated some comment to xforms 0.88.
2004 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2006 * src/buffer.C (readFile): make sure that the whole version number
2007 is read after \lyxformat (even when it contains a comma)
2009 * lib/ui/default.ui: change shortcut of math menu to M-a.
2011 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2013 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2016 * src/LyXView.C (updateWindowTitle): show the full files name in
2017 window title, limited to 30 characters.
2019 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2020 When a number of characters has been given, we should not assume
2021 that the string is 0-terminated.
2023 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2024 calls (fixes some memory leaks)
2026 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2027 trans member on exit.
2029 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2031 * src/converter.C (GetReachable): fix typo.
2033 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2034 understand ',' instead of '.'.
2035 (GetInteger): rewrite to use strToInt().
2037 2000-09-26 Juergen Vigna <jug@sad.it>
2039 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2040 better visibility and error-message on wrong VSpace input.
2042 * src/language.C (initL): added english again.
2044 2000-09-25 Juergen Vigna <jug@sad.it>
2046 * src/frontends/kde/Dialogs.C (Dialogs):
2047 * src/frontends/gnome/Dialogs.C (Dialogs):
2048 * src/frontends/kde/Makefile.am:
2049 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2051 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2053 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2055 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2057 * src/frontends/xforms/FormParagraph.C:
2058 * src/frontends/xforms/FormParagraph.h:
2059 * src/frontends/xforms/form_paragraph.C:
2060 * src/frontends/xforms/form_paragraph.h:
2061 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2064 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2066 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2067 Paragraph-Data after use.
2069 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2070 non breakable paragraphs.
2072 2000-09-25 Garst R. Reese <reese@isn.net>
2074 * src/language.C (initL): added missing language_country codes.
2076 2000-09-25 Juergen Vigna <jug@sad.it>
2078 * src/insets/insettext.C (InsetText):
2079 (deleteLyXText): remove the not released LyXText structure!
2081 2000-09-24 Marko Vendelin <markov@ioc.ee>
2083 * src/frontends/gnome/mainapp.C
2084 * src/frontends/gnome/mainapp.h: added support for keyboard
2087 * src/frontends/gnome/FormCitation.C
2088 * src/frontends/gnome/FormCitation.h
2089 * src/frontends/gnome/Makefile.am
2090 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2091 FormCitation to use "action area" in mainapp window
2093 * src/frontends/gnome/Menubar_pimpl.C
2094 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2097 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2099 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2100 width/descent/ascent values if name is empty.
2101 (mathed_string_height): Use std::max.
2103 2000-09-25 Allan Rae <rae@lyx.org>
2105 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2106 segfault. This will be completely redesigned soon.
2108 * sigc++: updated libsigc++. Fixes struct timespec bug.
2110 * development/tools/makeLyXsigc.sh: .cvsignore addition
2112 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2114 * several files: removed almost all traces of the old table
2117 * src/TableLayout.C: removed file
2119 2000-09-22 Juergen Vigna <jug@sad.it>
2121 * src/frontends/kde/Dialogs.C: added credits forms.
2123 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2125 * src/frontends/gnome/Dialogs.C: added some forms.
2127 * src/spellchecker.C (init_spell_checker): set language in pspell code
2128 (RunSpellChecker): some modifications for setting language string.
2130 * src/language.[Ch]: added language_country code.
2132 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2134 * src/frontends/Dialogs.h: added new signal showError.
2135 Rearranged existing signals in some sort of alphabetical order.
2137 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2138 FormError.[Ch], form_error.[Ch]
2139 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2140 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2142 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2143 dialogs. I think that this can be used as the base to all these
2146 * src/frontends/xforms/FormError.[Ch]
2147 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2148 implementation of InsetError dialog.
2150 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2152 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2153 * src/frontends/kde/Makefile.am: ditto
2155 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2157 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2158 macrobf. This fixes a bug of invisible text.
2160 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2162 * lib/doc/LaTeXConfig.lyx.in: updated.
2164 * src/language.C (initL): remove language "francais" and change a
2165 bit the names of the two other french variations.
2167 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2168 string that may not be 0-terminated.
2170 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2172 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2174 2000-09-20 Marko Vendelin <markov@ioc.ee>
2176 * src/frontends/gnome/FormCitation.C
2177 * src/frontends/gnome/FormIndex.C
2178 * src/frontends/gnome/FormToc.C
2179 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2180 the variable initialization to shut up the warnings
2182 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2184 * src/table.[Ch]: deleted files
2186 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2189 2000-09-18 Juergen Vigna <jug@sad.it>
2191 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2192 problems with selection. Inserted new LFUN_PASTESELECTION.
2193 (InsetButtonPress): inserted handling of middle mouse-button paste.
2195 * src/spellchecker.C: changed word to word.c_str().
2197 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2199 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2200 included in the ``make dist'' tarball.
2202 2000-09-15 Juergen Vigna <jug@sad.it>
2204 * src/CutAndPaste.C (cutSelection): small fix return the right
2205 end position after cut inside one paragraph only.
2207 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2208 we are locked as otherwise we don't have a valid cursor position!
2210 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2212 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2214 * src/frontends/kde/FormRef.C: added using directive.
2215 * src/frontends/kde/FormToc.C: ditto
2217 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2219 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2221 2000-09-19 Marko Vendelin <markov@ioc.ee>
2223 * src/frontends/gnome/Menubar_pimpl.C
2224 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2225 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2227 * src/frontends/gnome/mainapp.C
2228 * src/frontends/gnome/mainapp.h: support for menu update used
2231 * src/frontends/gnome/mainapp.C
2232 * src/frontends/gnome/mainapp.h: support for "action" area in the
2233 main window. This area is used by small simple dialogs, such as
2236 * src/frontends/gnome/FormIndex.C
2237 * src/frontends/gnome/FormIndex.h
2238 * src/frontends/gnome/FormUrl.C
2239 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2242 * src/frontends/gnome/FormCitation.C
2243 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2244 action area. Only "Insert new citation" is implemented.
2246 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2248 * src/buffer.C (Dispatch): fix call to Dispatch
2249 * src/insets/insetref.C (Edit): likewise
2250 * src/insets/insetparent.C (Edit): likewise
2251 * src/insets/insetinclude.C (include_cb): likewise
2252 * src/frontends/xforms/FormUrl.C (apply): likewise
2253 * src/frontends/xforms/FormToc.C (apply): likewise
2254 * src/frontends/xforms/FormRef.C (apply): likewise
2255 * src/frontends/xforms/FormIndex.C (apply): likewise
2256 * src/frontends/xforms/FormCitation.C (apply): likewise
2257 * src/lyxserver.C (callback): likewise
2258 * src/lyxfunc.C (processKeySym): likewise
2259 (Dispatch): likewise
2260 (Dispatch): likewise
2261 * src/lyx_cb.C (LayoutsCB): likewise
2263 * Makefile.am (sourcedoc): small change
2265 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2267 * src/main.C (main): Don't make an empty GUIRunTime object. all
2268 methods are static. constify a bit remove unneded using + headers.
2270 * src/tabular.C: some more const to local vars move some loop vars
2272 * src/spellchecker.C: added some c_str after some word for pspell
2274 * src/frontends/GUIRunTime.h: add new static method setDefaults
2275 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2276 * src/frontends/kde/GUIRunTime.C (setDefaults):
2277 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2279 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2280 with strnew in arg, use correct emptystring when calling SetName.
2282 * several files: remove all commented code with relation to
2283 HAVE_SSTREAM beeing false. We now only support stringstream and
2286 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2288 * src/lyxfunc.C: construct correctly the automatic new file
2291 * src/text2.C (IsStringInText): change type of variable i to shut
2294 * src/support/sstream.h: do not use namespaces if the compiler
2295 does not support them.
2297 2000-09-15 Marko Vendelin <markov@ioc.ee>
2298 * src/frontends/gnome/FormCitation.C
2299 * src/frontends/gnome/FormCitation.h
2300 * src/frontends/gnome/diainsertcitation_interface.c
2301 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2302 regexp support to FormCitation [Gnome].
2304 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2307 * configure.in: remove unused KDE/GTKGUI define
2309 * src/frontends/kde/FormRef.C
2310 * src/frontends/kde/FormRef.h
2311 * src/frontends/kde/formrefdialog.C
2312 * src/frontends/kde/formrefdialog.h: double click will
2313 go to reference, now it is possible to change a cross-ref
2316 * src/frontends/kde/FormToc.C
2317 * src/frontends/kde/FormToc.h
2318 * src/frontends/kde/formtocdialog.C
2319 * src/frontends/kde/formtocdialog.h: add a depth
2322 * src/frontends/kde/Makefile.am: add QtLyXView.h
2325 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2327 * src/frontends/kde/FormCitation.h: added some using directives.
2329 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2331 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2334 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2337 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2339 * src/buffer.C (pop_tag): revert for the second time a change by
2340 Lars, who seems to really hate having non-local loop variables :)
2342 * src/Lsstream.h: add "using" statements.
2344 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2345 * src/buffer.C (writeFile): ditto
2347 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2349 * src/buffer.C (writeFile): try to fix the locale modified format
2350 number to always be as we want it.
2352 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2353 in XForms 0.89. C-space is now working again.
2355 * src/Lsstream.h src/support/sstream.h: new files.
2357 * also commented out all cases where strstream were used.
2359 * src/Bullet.h (c_str): remove method.
2361 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2363 * a lot of files: get rid of "char const *" and "char *" is as
2364 many places as possible. We only want to use them in interaction
2365 with system of other libraries, not inside lyx.
2367 * a lot of files: return const object is not of pod type. This
2368 helps ensure that temporary objects is not modified. And fits well
2369 with "programming by contract".
2371 * configure.in: check for the locale header too
2373 * Makefile.am (sourcedoc): new tag for generation of doc++
2376 2000-09-14 Juergen Vigna <jug@sad.it>
2378 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2379 callback to check which combo called it and do the right action.
2381 * src/combox.C (combo_cb): added combo * to the callbacks.
2382 (Hide): moved call of callback after Ungrab of the pointer.
2384 * src/intl.h: removed LCombo2 function.
2386 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2387 function as this can now be handled in one function.
2389 * src/combox.h: added Combox * to callback prototype.
2391 * src/frontends/xforms/Toolbar_pimpl.C:
2392 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2394 2000-09-14 Garst Reese <reese@isn.net>
2396 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2397 moved usepackage{xxx}'s to beginning of file. Changed left margin
2398 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2399 underlining from title. Thanks to John Culleton for useful suggestions.
2401 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2403 * src/lyxlex_pimpl.C (setFile): change error message to debug
2406 2000-09-13 Juergen Vigna <jug@sad.it>
2408 * src/frontends/xforms/FormDocument.C: implemented choice_class
2409 as combox and give callback to combo_language so OK/Apply is activated
2412 * src/bufferlist.C (newFile): small fix so already named files
2413 (via an open call) are not requested to be named again on the
2416 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2418 * src/frontends/kde/Makefile.am
2419 * src/frontends/kde/FormRef.C
2420 * src/frontends/kde/FormRef.h
2421 * src/frontends/kde/formrefdialog.C
2422 * src/frontends/kde/formrefdialog.h: implement
2425 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2427 * src/frontends/kde/formtocdialog.C
2428 * src/frontends/kde/formtocdialog.h
2429 * src/frontends/kde/FormToc.C
2430 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2432 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2434 * src/frontends/kde/FormCitation.C: fix thinko
2435 where we didn't always display the reference text
2438 * src/frontends/kde/formurldialog.C
2439 * src/frontends/kde/formurldialog.h
2440 * src/frontends/kde/FormUrl.C
2441 * src/frontends/kde/FormUrl.h: minor cleanups
2443 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2445 * src/frontends/kde/Makefile.am
2446 * src/frontends/kde/FormToc.C
2447 * src/frontends/kde/FormToc.h
2448 * src/frontends/kde/FormCitation.C
2449 * src/frontends/kde/FormCitation.h
2450 * src/frontends/kde/FormIndex.C
2451 * src/frontends/kde/FormIndex.h
2452 * src/frontends/kde/formtocdialog.C
2453 * src/frontends/kde/formtocdialog.h
2454 * src/frontends/kde/formcitationdialog.C
2455 * src/frontends/kde/formcitationdialog.h
2456 * src/frontends/kde/formindexdialog.C
2457 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2459 2000-09-12 Juergen Vigna <jug@sad.it>
2461 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2464 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2466 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2469 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2471 * src/converter.C (Add, Convert): Added support for converter flags:
2472 needaux, resultdir, resultfile.
2473 (Convert): Added new parameter view_file.
2474 (dvips_options): Fixed letter paper option.
2476 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2477 (Export, GetExportableFormats, GetViewableFormats): Added support
2480 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2482 (easyParse): Fixed to work with new export code.
2484 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2487 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2489 * lib/bind/*.bind: Replaced
2490 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2491 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2493 2000-09-11 Juergen Vigna <jug@sad.it>
2495 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2497 * src/main.C (main): now GUII defines global guiruntime!
2499 * src/frontends/gnome/GUIRunTime.C (initApplication):
2500 * src/frontends/kde/GUIRunTime.C (initApplication):
2501 * src/frontends/xforms/GUIRunTime.C (initApplication):
2502 * src/frontends/GUIRunTime.h: added new function initApplication.
2504 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2506 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2508 2000-09-08 Juergen Vigna <jug@sad.it>
2510 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2511 we have already "Reset".
2513 * src/language.C (initL): inserted "default" language and made this
2514 THE default language (and not american!)
2516 * src/paragraph.C: inserted handling of "default" language!
2518 * src/lyxfont.C: ditto
2522 * src/paragraph.C: output the \\par only if we have a following
2523 paragraph otherwise it's not needed.
2525 2000-09-05 Juergen Vigna <jug@sad.it>
2527 * config/pspell.m4: added entry to lyx-flags
2529 * src/spellchecker.C: modified version from Kevin for using pspell
2531 2000-09-01 Marko Vendelin <markov@ioc.ee>
2532 * src/frontends/gnome/Makefile.am
2533 * src/frontends/gnome/FormCitation.C
2534 * src/frontends/gnome/FormCitation.h
2535 * src/frontends/gnome/diainsertcitation_callbacks.c
2536 * src/frontends/gnome/diainsertcitation_callbacks.h
2537 * src/frontends/gnome/diainsertcitation_interface.c
2538 * src/frontends/gnome/diainsertcitation_interface.h
2539 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2540 dialog for Gnome frontend
2542 * src/main.C: Gnome libraries require keeping application name
2543 and its version as strings
2545 * src/frontends/gnome/mainapp.C: Change the name of the main window
2546 from GnomeLyX to PACKAGE
2548 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2550 * src/frontends/Liason.C: add "using: declaration.
2552 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2554 * src/mathed/math_macro.C (Metrics): Set the size of the template
2556 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2558 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2560 * src/converter.C (add_options): New function.
2561 (SetViewer): Change $$FName into '$$FName'.
2562 (View): Add options when running xdvi
2563 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2564 (Convert): The 3rd parameter is now the desired filename. Converts
2565 calls to lyx::rename if necessary.
2566 Add options when running dvips.
2567 (dvi_papersize,dvips_options): New methods.
2569 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2571 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2572 using a call to Converter::dvips_options.
2573 Fixed to work with nex export code.
2575 * src/support/copy.C
2576 * src/support/rename.C: New files
2578 * src/support/syscall.h
2579 * src/support/syscall.C: Added Starttype SystemDontWait.
2581 * lib/ui/default.ui: Changed to work with new export code
2583 * lib/configure.m4: Changed to work with new export code
2585 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2587 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2589 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2590 so that code compiles with DEC cxx.
2592 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2593 to work correctly! Also now supports the additional elements
2596 2000-09-01 Allan Rae <rae@lyx.org>
2598 * src/frontends/ButtonPolicies.C: renamed all the references to
2599 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2601 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2602 since it's a const not a type.
2604 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2606 2000-08-31 Juergen Vigna <jug@sad.it>
2608 * src/insets/figinset.C: Various changes to look if the filename has
2609 an extension and if not add it for inline previewing.
2611 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2613 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2614 make buttonStatus and isReadOnly be const methods. (also reflect
2615 this in derived classes.)
2617 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2618 (nextState): change to be static inline, pass the StateMachine as
2620 (PreferencesPolicy): remove casts
2621 (OkCancelPolicy): remvoe casts
2622 (OkCancelReadOnlyPolicy): remove casts
2623 (NoRepeatedApplyReadOnlyPolicy): remove casts
2624 (OkApplyCancelReadOnlyPolicy): remove casts
2625 (OkApplyCancelPolicy): remove casts
2626 (NoRepeatedApplyPolicy): remove casts
2628 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2630 * src/converter.C: added some using directives
2632 * src/frontends/ButtonPolicies.C: changes to overcome
2633 "need lvalue" error with DEC c++
2635 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2636 to WMHideCB for DEC c++
2638 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2640 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2641 to BulletBMTableCB for DEC c++
2643 2000-08-31 Allan Rae <rae@lyx.org>
2645 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2646 character dialog separately from old document dialogs combo_language.
2649 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2651 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2652 Removed LFUN_REF_CREATE.
2654 * src/MenuBackend.C: Added new tags: toc and references
2656 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2657 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2659 (add_toc, add_references): New methods.
2660 (create_submenu): Handle correctly the case when there is a
2661 seperator after optional menu items.
2663 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2664 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2665 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2667 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2669 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2671 * src/converter.[Ch]: New file for converting between different
2674 * src/export.[Ch]: New file for exporting a LyX file to different
2677 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2678 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2679 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2680 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2681 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2682 RunDocBook, MenuExport.
2684 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2685 Exporter::Preview methods if NEW_EXPORT is defined.
2687 * src/buffer.C (Dispatch): Use Exporter::Export.
2689 * src/lyxrc.C: Added new tags: \converter and \viewer.
2692 * src/LyXAction.C: Define new lyx-function: buffer-update.
2693 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2694 when NEW_EXPORT is defined.
2696 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2698 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2700 * lib/ui/default.ui: Added submenus "view" and "update" to the
2703 * src/filetools.C (GetExtension): New function.
2705 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2707 2000-08-29 Allan Rae <rae@lyx.org>
2709 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2711 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2712 (EnableDocumentLayout): removed
2713 (DisableDocumentLayout): removed
2714 (build): make use of ButtonController's read-only handling to
2715 de/activate various objects. Replaces both of the above functions.
2717 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2718 (readOnly): was read_only
2719 (refresh): fixed dumb mistakes with read_only_ handling
2721 * src/frontends/xforms/forms/form_document.fd:
2722 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2723 tabbed dialogs so the tabs look more like tabs and so its easier to
2724 work out which is the current tab.
2726 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2727 segfault with form_table
2729 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2731 2000-08-28 Juergen Vigna <jug@sad.it>
2733 * acconfig.h: added USE_PSPELL.
2735 * src/config.h.in: added USE_PSPELL.
2737 * autogen.sh: added pspell.m4
2739 * config/pspell.m4: new file.
2741 * src/spellchecker.C: implemented support for pspell libary.
2743 2000-08-25 Juergen Vigna <jug@sad.it>
2745 * src/LyXAction.C (init): renamed LFUN_TABLE to
2746 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2748 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2750 * src/lyxscreen.h: add force_clear variable and fuction to force
2751 a clear area when redrawing in LyXText.
2753 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2755 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2757 * some whitespace and comment changes.
2759 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2761 * src/buffer.C: up te LYX_FORMAT to 2.17
2763 2000-08-23 Juergen Vigna <jug@sad.it>
2765 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2768 * src/insets/insettabular.C (pasteSelection): delete the insets
2769 LyXText as it is not valid anymore.
2770 (copySelection): new function.
2771 (pasteSelection): new function.
2772 (cutSelection): new function.
2773 (LocalDispatch): implemented cut/copy/paste of cell selections.
2775 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2776 don't have a LyXText.
2778 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2780 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2783 2000-08-22 Juergen Vigna <jug@sad.it>
2785 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2786 ifdef form_table out if NEW_TABULAR.
2788 2000-08-21 Juergen Vigna <jug@sad.it>
2790 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2791 (draw): fixed draw position so that the cursor is positioned in the
2793 (InsetMotionNotify): hide/show cursor so the position is updated.
2794 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2795 using cellstart() function where it should be used.
2797 * src/insets/insettext.C (draw): ditto.
2799 * src/tabular.C: fixed initialization of some missing variables and
2800 made BoxType into an enum.
2802 2000-08-22 Marko Vendelin <markov@ioc.ee>
2803 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2804 stock menu item using action numerical value, not its string
2808 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2810 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2811 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2813 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2815 * src/frontends/xforms/GUIRunTime.C: new file
2817 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2818 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2820 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2822 * src/frontends/kde/GUIRunTime.C: new file
2824 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2825 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2827 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2829 * src/frontends/gnome/GUIRunTime.C: new file
2831 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2834 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2835 small change to documetentation.
2837 * src/frontends/GUIRunTime.C: removed file
2839 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2841 * src/lyxparagraph.h: enable NEW_TABULAR as default
2843 * src/lyxfunc.C (processKeySym): remove some commented code
2845 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2846 NEW_TABULAR around the fd_form_table_options.
2848 * src/lyx_gui.C (runTime): call the static member function as
2849 GUIRunTime::runTime().
2851 2000-08-21 Allan Rae <rae@lyx.org>
2853 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2856 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2858 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2860 2000-08-21 Allan Rae <rae@lyx.org>
2862 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2863 keep Garst happy ;-)
2864 * src/frontends/xforms/FormPreferences.C (build): use setOK
2865 * src/frontends/xforms/FormDocument.C (build): use setOK
2866 (FormDocument): use the appropriate policy.
2868 2000-08-21 Allan Rae <rae@lyx.org>
2870 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2871 automatic [de]activation of arbitrary objects when in a read-only state.
2873 * src/frontends/ButtonPolicies.h: More documentation
2874 (isReadOnly): added to support the above.
2876 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2878 2000-08-18 Juergen Vigna <jug@sad.it>
2880 * src/insets/insettabular.C (getStatus): changed to return func_status.
2882 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2883 display toggle menu entries if they are.
2885 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2886 new document layout now.
2888 * src/lyxfunc.C: ditto
2890 * src/lyx_gui_misc.C: ditto
2892 * src/lyx_gui.C: ditto
2894 * lib/ui/default.ui: removed paper and quotes layout as they are now
2895 all in the document layout tabbed folder.
2897 * src/frontends/xforms/forms/form_document.fd: added Restore
2898 button and callbacks for all inputs for Allan's ButtonPolicy.
2900 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2901 (CheckChoiceClass): added missing params setting on class change.
2902 (UpdateLayoutDocument): added for updating the layout on params.
2903 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2904 (FormDocument): Implemented Allan's ButtonPolicy with the
2907 2000-08-17 Allan Rae <rae@lyx.org>
2909 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2910 so we can at least see the credits again.
2912 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2913 controller calls for the appropriate callbacks. Note that since Ok
2914 calls apply followed by cancel, and apply isn't a valid input for the
2915 APPLIED state, the bc_ calls have to be made in the static callback not
2916 within each of the real callbacks.
2918 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2919 (setOk): renamed from setOkay()
2921 2000-08-17 Juergen Vigna <jug@sad.it>
2923 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2924 in the implementation part.
2925 (composeUIInfo): don't show optional menu-items.
2927 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2929 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2931 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2932 text-state when in a text-inset.
2934 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2936 2000-08-17 Marko Vendelin <markov@ioc.ee>
2937 * src/frontends/gnome/FormIndex.C
2938 * src/frontends/gnome/FormIndex.h
2939 * src/frontends/gnome/FormToc.C
2940 * src/frontends/gnome/FormToc.h
2941 * src/frontends/gnome/dialogs
2942 * src/frontends/gnome/diatoc_callbacks.c
2943 * src/frontends/gnome/diatoc_callbacks.h
2944 * src/frontends/gnome/diainsertindex_callbacks.h
2945 * src/frontends/gnome/diainsertindex_callbacks.c
2946 * src/frontends/gnome/diainsertindex_interface.c
2947 * src/frontends/gnome/diainsertindex_interface.h
2948 * src/frontends/gnome/diatoc_interface.h
2949 * src/frontends/gnome/diatoc_interface.c
2950 * src/frontends/gnome/Makefile.am: Table of Contents and
2951 Insert Index dialogs implementation for Gnome frontend
2953 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2955 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2957 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2960 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2962 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2963 destructor. Don't definde if you don't need it
2964 (processEvents): made static, non-blocking events processing for
2966 (runTime): static method. event loop for xforms
2967 * similar as above for kde and gnome.
2969 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2970 new Pimpl is correct
2971 (runTime): new method calss the real frontends runtime func.
2973 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2975 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2977 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2979 2000-08-16 Juergen Vigna <jug@sad.it>
2981 * src/lyx_gui.C (runTime): added GUII RunTime support.
2983 * src/frontends/Makefile.am:
2984 * src/frontends/GUIRunTime.[Ch]:
2985 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2986 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2987 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2989 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2991 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2992 as this is already set in ${FRONTEND_INCLUDE} if needed.
2994 * configure.in (CPPFLAGS): setting the include dir for the frontend
2995 directory and don't set FRONTEND=xforms for now as this is executed
2998 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3000 * src/frontends/kde/Makefile.am:
3001 * src/frontends/kde/FormUrl.C:
3002 * src/frontends/kde/FormUrl.h:
3003 * src/frontends/kde/formurldialog.h:
3004 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3006 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3008 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3010 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3012 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3015 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3017 * src/WorkArea.C (work_area_handler): more work to get te
3018 FL_KEYBOARD to work with xforms 0.88 too, please test.
3020 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3022 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3024 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3027 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3029 * src/Timeout.h: remove Qt::emit hack.
3031 * several files: changes to allo doc++ compilation
3033 * src/lyxfunc.C (processKeySym): new method
3034 (processKeyEvent): comment out if FL_REVISION < 89
3036 * src/WorkArea.C: change some debugging levels.
3037 (WorkArea): set wantkey to FL_KEY_ALL
3038 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3039 clearer code and the use of compose with XForms 0.89. Change to
3040 use signals instead of calling methods in bufferview directly.
3042 * src/Painter.C: change some debugging levels.
3044 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3047 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3048 (workAreaKeyPress): new method
3050 2000-08-14 Juergen Vigna <jug@sad.it>
3052 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3054 * config/kde.m4: addes some features
3056 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3057 include missing xforms dialogs.
3059 * src/Timeout.h: a hack to be able to compile with qt/kde.
3061 * sigc++/.cvsignore: added acinclude.m4
3063 * lib/.cvsignore: added listerros
3065 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3066 xforms tree as objects are needed for other frontends.
3068 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3069 linking with not yet implemented xforms objects.
3071 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3073 2000-08-14 Baruch Even <baruch.even@writeme.com>
3075 * src/frontends/xforms/FormGraphics.h:
3076 * src/frontends/xforms/FormGraphics.C:
3077 * src/frontends/xforms/RadioButtonGroup.h:
3078 * src/frontends/xforms/RadioButtonGroup.C:
3079 * src/insets/insetgraphics.h:
3080 * src/insets/insetgraphics.C:
3081 * src/insets/insetgraphicsParams.h:
3082 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3083 instead of spaces, and various other indentation issues to make the
3084 sources more consistent.
3086 2000-08-14 Marko Vendelin <markov@ioc.ee>
3088 * src/frontends/gnome/dialogs/diaprint.glade
3089 * src/frontends/gnome/FormPrint.C
3090 * src/frontends/gnome/FormPrint.h
3091 * src/frontends/gnome/diaprint_callbacks.c
3092 * src/frontends/gnome/diaprint_callbacks.h
3093 * src/frontends/gnome/diaprint_interface.c
3094 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3097 * src/frontends/gnome/dialogs/diainserturl.glade
3098 * src/frontends/gnome/FormUrl.C
3099 * src/frontends/gnome/FormUrl.h
3100 * src/frontends/gnome/diainserturl_callbacks.c
3101 * src/frontends/gnome/diainserturl_callbacks.h
3102 * src/frontends/gnome/diainserturl_interface.c
3103 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3104 Gnome implementation
3106 * src/frontends/gnome/Dialogs.C
3107 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3108 all other dialogs. Copy all unimplemented dialogs from Xforms
3111 * src/frontends/gnome/support.c
3112 * src/frontends/gnome/support.h: support files generated by Glade
3116 * config/gnome.m4: Gnome configuration scripts
3118 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3119 configure --help message
3121 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3122 only if there are no events pendling in Gnome/Gtk. This enhances
3123 the performance of menus.
3126 2000-08-14 Allan Rae <rae@lyx.org>
3128 * lib/Makefile.am: listerrors cleaning
3130 * lib/listerrors: removed -- generated file
3131 * acinclude.m4: ditto
3132 * sigc++/acinclude.m4: ditto
3134 * src/frontends/xforms/forms/form_citation.fd:
3135 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3138 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3139 `updatesrc` and now we have a `test` target that does what `updatesrc`
3140 used to do. I didn't like having an install target that wasn't related
3143 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3144 on all except FormGraphics. This may yet happen. Followed by a major
3145 cleanup including using FL_TRANSIENT for most of the dialogs. More
3146 changes to come when the ButtonController below is introduced.
3148 * src/frontends/xforms/ButtonController.h: New file for managing up to
3149 four buttons on a dialog according to an externally defined policy.
3150 * src/frontends/xforms/Makefile.am: added above
3152 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3153 Apply and Cancel/Close buttons and everything in between and beyond.
3154 * src/frontends/Makefile.am: added above.
3156 * src/frontends/xforms/forms/form_preferences.fd:
3157 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3158 and removed variable 'status' as a result. Fixed the set_minsize thing.
3159 Use the new screen-font-update after checking screen fonts were changed
3160 Added a "Restore" button to restore the original lyxrc values while
3161 editing. This restores everything not just the last input changed.
3162 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3164 * src/LyXAction.C: screen-font-update added for updating buffers after
3165 screen font settings have been changed.
3166 * src/commandtags.h: ditto
3167 * src/lyxfunc.C: ditto
3169 * forms/lyx.fd: removed screen fonts dialog.
3170 * src/lyx_gui.C: ditto
3171 * src/menus.[Ch]: ditto
3172 * src/lyx.[Ch]: ditto
3173 * src/lyx_cb.C: ditto + code from here moved to make
3174 screen-font-update. And people wonder why progress on GUII is
3175 slow. Look at how scattered this stuff was! It takes forever
3178 * forms/fdfix.sh: Fixup the spacing after commas.
3179 * forms/makefile: Remove date from generated files. Fewer clashes now.
3180 * forms/bullet_forms.C.patch: included someones handwritten changes
3182 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3183 once I've discovered why LyXRC was made noncopyable.
3184 * src/lyx_main.C: ditto
3186 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3188 * src/frontends/xforms/forms/fdfix.sh:
3189 * src/frontends/xforms/forms/fdfixh.sed:
3190 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3191 * src/frontends/xforms/Form*.[hC]:
3192 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3193 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3194 provide a destructor for the struct FD_form_xxxx. Another version of
3195 the set_[max|min]size workaround and a few other cleanups. Actually,
3196 Angus' patch from 20000809.
3198 2000-08-13 Baruch Even <baruch.even@writeme.com>
3200 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3203 2000-08-11 Juergen Vigna <jug@sad.it>
3205 * src/insets/insetgraphics.C (InsetGraphics): changing init
3206 order because of warnings.
3208 * src/frontends/xforms/forms/makefile: adding patching .C with
3211 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3212 from .C.patch to .c.patch
3214 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3215 order because of warning.
3217 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3219 * src/frontends/Liason.C (setMinibuffer): new helper function
3221 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3223 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3225 * lib/ui/default.ui: commented out PaperLayout entry
3227 * src/frontends/xforms/form_document.[Ch]: new added files
3229 * src/frontends/xforms/FormDocument.[Ch]: ditto
3231 * src/frontends/xforms/forms/form_document.fd: ditto
3233 * src/frontends/xforms/forms/form_document.C.patch: ditto
3235 2000-08-10 Juergen Vigna <jug@sad.it>
3237 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3238 (InsetGraphics): initialized cacheHandle to 0.
3239 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3241 2000-08-10 Baruch Even <baruch.even@writeme.com>
3243 * src/graphics/GraphicsCache.h:
3244 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3245 correctly as a cache.
3247 * src/graphics/GraphicsCacheItem.h:
3248 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3251 * src/graphics/GraphicsCacheItem_pimpl.h:
3252 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3255 * src/insets/insetgraphics.h:
3256 * src/insets/insetgraphics.C: Changed from using a signal notification
3257 to polling when image is not loaded.
3259 2000-08-10 Allan Rae <rae@lyx.org>
3261 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3262 that there are two functions that have to been taken out of line by
3263 hand and aren't taken care of in the script. (Just a reminder note)
3265 * sigc++/macros/*.h.m4: Updated as above.
3267 2000-08-09 Juergen Vigna <jug@sad.it>
3269 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3271 * src/insets/insettabular.C: make drawing of single cell smarter.
3273 2000-08-09 Marko Vendelin <markov@ioc.ee>
3274 * src/frontends/gnome/Menubar_pimpl.C
3275 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3276 implementation: new files
3278 * src/frontends/gnome/mainapp.C
3279 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3282 * src/main.C: create Gnome main window
3284 * src/frontends/xforms/Menubar_pimpl.h
3285 * src/frontends/Menubar.C
3286 * src/frontends/Menubar.h: added method Menubar::update that calls
3287 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3289 * src/LyXView.C: calls Menubar::update to update the state
3292 * src/frontends/gnome/Makefile.am: added new files
3294 * src/frontends/Makefile.am: added frontend compiler options
3296 2000-08-08 Juergen Vigna <jug@sad.it>
3298 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3300 * src/bufferlist.C (close):
3301 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3302 documents if exiting without saving.
3304 * src/buffer.C (save): use removeAutosaveFile()
3306 * src/support/filetools.C (removeAutosaveFile): new function.
3308 * src/lyx_cb.C (MenuWrite): returns a bool now.
3309 (MenuWriteAs): check if file could really be saved and revert to the
3311 (MenuWriteAs): removing old autosavefile if existant.
3313 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3314 before Goto toggle declaration, because of compiler warning.
3316 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3318 * src/lyxfunc.C (MenuNew): small fix.
3320 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3322 * src/bufferlist.C (newFile):
3323 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3325 * src/lyxrc.C: added new_ask_filename tag
3327 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3329 * src/lyx.fd: removed code pertaining to form_ref
3330 * src/lyx.[Ch]: ditto
3331 * src/lyx_cb.C: ditto
3332 * src/lyx_gui.C: ditto
3333 * src/lyx_gui_misc.C: ditto
3335 * src/BufferView_pimpl.C (restorePosition): update buffer only
3338 * src/commandtags.h (LFUN_REFTOGGLE): removed
3339 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3340 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3341 (LFUN_REFBACK): renamed LFUN_REF_BACK
3343 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3344 * src/menus.C: ditto
3345 * src/lyxfunc.C (Dispatch): ditto.
3346 InsertRef dialog is now GUI-independent.
3348 * src/texrow.C: added using std::endl;
3350 * src/insets/insetref.[Ch]: strip out large amounts of code.
3351 The inset is now a container and this functionality is now
3352 managed by a new FormRef dialog
3354 * src/frontends/Dialogs.h (showRef, createRef): new signals
3356 * src/frontends/xforms/FormIndex.[Ch],
3357 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3358 when setting dialog's min/max size
3359 * src/frontends/xforms/FormIndex.[Ch]: ditto
3361 * src/frontends/xforms/FormRef.[Ch],
3362 src/frontends/xforms/forms/form_ref.fd: new xforms
3363 implementation of an InsetRef dialog
3365 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3368 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3369 ios::nocreate is not part of the standard. Removed.
3371 2000-08-07 Baruch Even <baruch.even@writeme.com>
3373 * src/graphics/Renderer.h:
3374 * src/graphics/Renderer.C: Added base class for rendering of different
3375 image formats into Pixmaps.
3377 * src/graphics/XPM_Renderer.h:
3378 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3379 in a different class.
3381 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3382 easily add support for other formats.
3384 * src/insets/figinset.C: plugged a leak of an X resource.
3386 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3388 * src/CutAndPaste.[Ch]: make all metods static.
3390 * development/Code_rules/Rules: more work, added section on
3391 Exceptions, and a References section.
3393 * a lot of header files: work to make doc++ able to generate the
3394 source documentation, some workarounds of doc++ problems. Doc++ is
3395 now able to generate the documentation.
3397 2000-08-07 Juergen Vigna <jug@sad.it>
3399 * src/insets/insettabular.C (recomputeTextInsets): removed function
3401 * src/tabular.C (SetWidthOfMulticolCell):
3403 (calculate_width_of_column_NMC): fixed return value so that it really
3404 only returns true if the column-width has changed (there where
3405 problems with muliticolumn-cells in this column).
3407 2000-08-04 Juergen Vigna <jug@sad.it>
3409 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3410 also on the scrollstatus of the inset.
3411 (workAreaMotionNotify): ditto.
3413 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3415 2000-08-01 Juergen Vigna <jug@sad.it>
3417 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3419 * src/commandtags.h:
3420 * src/LyXAction.C (init):
3421 * src/insets/inset.C (LocalDispatch): added support for
3424 * src/insets/inset.C (scroll): new functions.
3426 * src/insets/insettext.C (removeNewlines): new function.
3427 (SetAutoBreakRows): removes forced newlines in the text of the
3428 paragraph if autoBreakRows is set to false.
3430 * src/tabular.C (Latex): generates a parbox around the cell contents
3433 * src/frontends/xforms/FormTabular.C (local_update): removed
3434 the radio_useparbox button.
3436 * src/tabular.C (UseParbox): new function
3438 2000-08-06 Baruch Even <baruch.even@writeme.com>
3440 * src/graphics/GraphicsCache.h:
3441 * src/graphics/GraphicsCache.C:
3442 * src/graphics/GraphicsCacheItem.h:
3443 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3446 * src/insets/insetgraphics.h:
3447 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3448 and the drawing of the inline image.
3450 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3451 loaded into the wrong position.
3453 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3456 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3458 * src/support/translator.h: move all typedefs to public section
3460 * src/support/filetools.C (MakeLatexName): return string const
3462 (TmpFileName): ditto
3463 (FileOpenSearch): ditto
3465 (LibFileSearch): ditto
3466 (i18nLibFileSearch): ditto
3469 (CreateTmpDir): ditto
3470 (CreateBufferTmpDir): ditto
3471 (CreateLyXTmpDir): ditto
3474 (MakeAbsPath): ditto
3476 (OnlyFilename): ditto
3478 (NormalizePath): ditto
3479 (CleanupPath): ditto
3480 (GetFileContents): ditto
3481 (ReplaceEnvironmentPath): ditto
3482 (MakeRelPath): ditto
3484 (ChangeExtension): ditto
3485 (MakeDisplayPath): ditto
3486 (do_popen): return cmdret const
3487 (findtexfile): return string const
3489 * src/support/DebugStream.h: add some /// to please doc++
3491 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3493 * src/texrow.C (same_rownumber): functor to use with find_if
3494 (getIdFromRow): rewritten to use find_if and to not update the
3495 positions. return true if row is found
3496 (increasePos): new method, use to update positions
3498 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3500 * src/lyxlex_pimpl.C (verifyTable): new method
3503 (GetString): return string const
3504 (pushTable): rewrite to use std::stack
3506 (setFile): better check
3509 * src/lyxlex.h: make LyXLex noncopyable
3511 * src/lyxlex.C (text): return char const * const
3512 (GetString): return string const
3513 (getLongString): return string const
3515 * src/lyx_gui_misc.C (askForText): return pair<...> const
3517 * src/lastfiles.[Ch] (operator): return string const
3519 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3520 istringstream not char const *.
3521 move token.end() out of loop.
3522 (readFile): move initializaton of token
3524 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3525 getIdFromRow is successful.
3527 * lib/bind/emacs.bind: don't include menus bind
3529 * development/Code_rules/Rules: the beginnings of making this
3530 better and covering more of the unwritten rules that we have.
3532 * development/Code_rules/Recommendations: a couple of wording
3535 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3537 * src/support/strerror.c: remove C++ comment.
3539 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3541 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3542 LFUN_INDEX_INSERT_LAST
3544 * src/texrow.C (getIdFromRow): changed from const_iterator to
3545 iterator, allowing code to compile with DEC cxx
3547 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3548 stores part of the class, as suggested by Allan. Will allow
3550 (apply): test to apply uses InsetCommandParams operator!=
3552 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3553 (apply): test to apply uses InsetCommandParams operator!=
3555 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3556 stores part of the class.
3557 (update): removed limits on min/max size.
3559 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3560 (apply): test to apply uses InsetCommandParams operator!=
3562 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3563 (Read, Write, scanCommand, getCommand): moved functionality
3564 into InsetCommandParams.
3566 (getScreenLabel): made pure virtual
3567 new InsetCommandParams operators== and !=
3569 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3570 c-tors based on InsetCommandParams. Removed others.
3571 * src/insets/insetinclude.[Ch]: ditto
3572 * src/insets/insetlabel.[Ch]: ditto
3573 * src/insets/insetparent.[Ch]: ditto
3574 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3576 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3577 insets derived from InsetCommand created using similar c-tors
3578 based on InsetCommandParams
3579 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3580 * src/menus.C (ShowRefsMenu): ditto
3581 * src/paragraph.C (Clone): ditto
3582 * src/text2.C (SetCounter): ditto
3583 * src/lyxfunc.C (Dispatch) ditto
3584 Also recreated old InsetIndex behaviour exactly. Can now
3585 index-insert at the start of a paragraph and index-insert-last
3586 without launching the pop-up.
3588 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3590 * lib/lyxrc.example: mark te pdf options as non functional.
3592 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3593 (isStrDbl): move tmpstr.end() out of loop.
3594 (strToDbl): move intialization of tmpstr
3595 (lowercase): return string const and move tmp.end() out of loop.
3596 (uppercase): return string const and move tmp.edn() out of loop.
3597 (prefixIs): add assertion
3602 (containsOnly): ditto
3603 (containsOnly): ditto
3604 (containsOnly): ditto
3605 (countChar): make last arg char not char const
3606 (token): return string const
3607 (subst): return string const, move tmp.end() out of loop.
3608 (subst): return string const, add assertion
3609 (strip): return string const
3610 (frontStrip): return string const, add assertion
3611 (frontStrip): return string const
3616 * src/support/lstrings.C: add inclde "LAssert.h"
3617 (isStrInt): move tmpstr.end() out of loop.
3619 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3620 toollist.end() out of loop.
3621 (deactivate): move toollist.end() out of loop.
3622 (update): move toollist.end() out of loop.
3623 (updateLayoutList): move tc.end() out of loop.
3624 (add): move toollist.end() out of loop.
3626 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3627 md.end() out of loop.
3629 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3631 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3634 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3635 (Erase): move insetlist.end() out of loop.
3637 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3638 ref to const string as first arg. Move initialization of some
3639 variables, whitespace changes.
3641 * src/kbmap.C (defkey): move table.end() out of loop.
3642 (kb_keymap): move table.end() out of loop.
3643 (findbinding): move table.end() out of loop.
3645 * src/MenuBackend.C (hasMenu): move end() out of loop.
3646 (getMenu): move end() out of loop.
3647 (getMenu): move menulist_.end() out of loop.
3649 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3651 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3654 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3655 (getFromLyXName): move infotab.end() out of loop.
3657 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3658 -fvtable-thunks -ffunction-sections -fdata-sections
3660 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3662 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3665 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3667 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3669 * src/frontends/xforms/FormCitation.[Ch],
3670 src/frontends/xforms/FormIndex.[Ch],
3671 src/frontends/xforms/FormToc.[Ch],
3672 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3674 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3676 * src/commandtags.h: renamed, created some flags for citation
3679 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3681 * src/lyxfunc.C (dispatch): use signals to insert index entry
3683 * src/frontends/Dialogs.h: new signal createIndex
3685 * src/frontends/xforms/FormCommand.[Ch],
3686 src/frontends/xforms/FormCitation.[Ch],
3687 src/frontends/xforms/FormToc.[Ch],
3688 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3690 * src/insets/insetindex.[Ch]: GUI-independent
3692 * src/frontends/xforms/FormIndex.[Ch],
3693 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3696 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3698 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3699 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3701 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3703 * src/insets/insetref.C (Latex): rewrite so that there is now
3704 question that a initialization is requested.
3706 * src/insets/insetcommand.h: reenable the hide signal
3708 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3710 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3711 fix handling of shortcuts (many bugs :)
3712 (add_lastfiles): ditto.
3714 * lib/ui/default.ui: fix a few shortcuts.
3716 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3718 * Makefile.am: Fix ``rpmdist'' target to return the exit
3719 status of the ``rpm'' command, instead of the last command in
3720 the chain (the ``rm lyx.xpm'' command, which always returns
3723 2000-08-02 Allan Rae <rae@lyx.org>
3725 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3726 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3727 * src/frontends/xforms/FormToc.C (FormToc): ditto
3729 * src/frontends/xforms/Makefile.am: A few forgotten files
3731 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3732 Signals-not-copyable-problem Lars' started commenting out.
3734 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3736 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3738 * src/insets/insetcommand.h: Signals is not copyable so anoter
3739 scheme for automatic hiding of forms must be used.
3741 * src/frontends/xforms/FormCitation.h: don't inerit from
3742 noncopyable, FormCommand already does that.
3743 * src/frontends/xforms/FormToc.h: ditto
3744 * src/frontends/xforms/FormUrl.h: ditto
3746 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3748 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3750 * src/insets/insetcommand.h (hide): new SigC::Signal0
3751 (d-tor) new virtual destructor emits hide signal
3753 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3754 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3756 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3757 LOF and LOT. Inset is now GUI-independent
3759 * src/insets/insetloa.[Ch]: redundant
3760 * src/insets/insetlof.[Ch]: ditto
3761 * src/insets/insetlot.[Ch]: ditto
3763 * src/frontends/xforms/forms/form_url.fd: tweaked!
3764 * src/frontends/xforms/forms/form_citation.fd: ditto
3766 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3767 dialogs dealing with InsetCommand insets
3769 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3770 FormCommand base class
3771 * src/frontends/xforms/FormUrl.[Ch]: ditto
3773 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3775 * src/frontends/xforms/FormToc.[Ch]: ditto
3777 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3778 passed a generic InsetCommand pointer
3779 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3781 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3782 and modified InsetTOC class
3783 * src/buffer.C: ditto
3785 * forms/lyx.fd: strip out old FD_form_toc code
3786 * src/lyx_gui_misc.C: ditto
3787 * src/lyx_gui.C: ditto
3788 * src/lyx_cb.C: ditto
3789 * src/lyx.[Ch]: ditto
3791 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3793 * src/support/utility.hpp: tr -d '\r'
3795 2000-08-01 Juergen Vigna <jug@sad.it>
3797 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3799 * src/commandtags.h:
3800 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3801 LFUN_TABULAR_FEATURES.
3803 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3804 LFUN_LAYOUT_TABULAR.
3806 * src/insets/insettabular.C (getStatus): implemented helper function.
3808 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3810 2000-07-31 Juergen Vigna <jug@sad.it>
3812 * src/text.C (draw): fixed screen update problem for text-insets.
3814 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3815 something changed probably this has to be added in various other
3818 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3820 2000-07-31 Baruch Even <baruch.even@writeme.com>
3822 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3823 templates to satisfy compaq cxx.
3826 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3828 * src/support/translator.h (equal_1st_in_pair::operator()): take
3829 const ref pair_type as arg.
3830 (equal_2nd_in_pair::operator()): ditto
3831 (Translator::~Translator): remove empty d-tor.
3833 * src/graphics/GraphicsCache.C: move include config.h to top, also
3834 put initialization of GraphicsCache::singleton here.
3835 (~GraphicsCache): move here
3836 (addFile): take const ref as arg
3839 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3841 * src/BufferView2.C (insertLyXFile): change te with/without header
3844 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3846 * src/frontends/xforms/FormGraphics.C (apply): add some
3847 static_cast. Not very nice, but required by compaq cxx.
3849 * src/frontends/xforms/RadioButtonGroup.h: include header
3850 <utility> instead of <pair.h>
3852 * src/insets/insetgraphicsParams.C: add using directive.
3853 (readResize): change return type to void.
3854 (readOrigin): ditto.
3856 * src/lyxfunc.C (getStatus): add missing break for build-program
3857 function; add test for Literate for export functions.
3859 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3860 entries in Options menu.
3862 2000-07-31 Baruch Even <baruch.even@writeme.com>
3864 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3865 protect against auto-allocation; release icon when needed.
3867 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3869 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3870 on usual typewriter.
3872 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3873 earlier czech.kmap), useful only for programming.
3875 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3877 * src/frontends/xforms/FormCitation.h: fix conditioning around
3880 2000-07-31 Juergen Vigna <jug@sad.it>
3882 * src/frontends/xforms/FormTabular.C (local_update): changed
3883 radio_linebreaks to radio_useparbox and added radio_useminipage.
3885 * src/tabular.C: made support for using minipages/parboxes.
3887 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3889 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3891 (descent): so the cursor is in the middle.
3892 (width): bit smaller box.
3894 * src/insets/insetgraphics.h: added display() function.
3896 2000-07-31 Baruch Even <baruch.even@writeme.com>
3898 * src/frontends/Dialogs.h: Added showGraphics signals.
3900 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3901 xforms form definition of the graphics dialog.
3903 * src/frontends/xforms/FormGraphics.h:
3904 * src/frontends/xforms/FormGraphics.C: Added files, the
3905 GUIndependent code of InsetGraphics
3907 * src/insets/insetgraphics.h:
3908 * src/insets/insetgraphics.C: Major writing to make it work.
3910 * src/insets/insetgraphicsParams.h:
3911 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3912 struct between InsetGraphics and GUI.
3914 * src/LaTeXFeatures.h:
3915 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3916 support for graphicx package.
3918 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3919 for the graphics inset.
3921 * src/support/translator.h: Added file, used in
3922 InsetGraphicsParams. this is a template to translate between two
3925 * src/frontends/xforms/RadioButtonGroup.h:
3926 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3927 way to easily control a radio button group.
3929 2000-07-28 Juergen Vigna <jug@sad.it>
3931 * src/insets/insettabular.C (LocalDispatch):
3932 (TabularFeatures): added support for lyx-functions of tabular features.
3933 (cellstart): refixed this function after someone wrongly changed it.
3935 * src/commandtags.h:
3936 * src/LyXAction.C (init): added support for tabular-features
3938 2000-07-28 Allan Rae <rae@lyx.org>
3940 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3941 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3942 triggers the callback for input checking. As a result we sometimes get
3943 "LyX: This shouldn't happen..." printed to cerr.
3944 (input): Started using status variable since I only free() on
3945 destruction. Some input checking for paths and font sizes.
3947 * src/frontends/xforms/FormPreferences.h: Use status to control
3948 activation of Ok and Apply
3950 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3951 callback. Also resized to stop segfaults with 0.88. The problem is
3952 that xforms-0.88 requires the folder to be wide enough to fit all the
3953 tabs. If it isn't it causes all sorts of problems.
3955 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3957 * src/frontends/xforms/forms/README: Reflect reality.
3959 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3960 * src/frontends/xforms/forms/makefile: ditto.
3962 * src/commandtags.h: Get access to new Preferences dialog
3963 * src/LyXAction.C: ditto
3964 * src/lyxfunc.C: ditto
3965 * lib/ui/default.ui: ditto
3967 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3969 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3971 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3974 * src/frontends/xforms/form_url.[Ch]: added.
3976 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3978 * src/insets/insetbib.h: fixed bug in previous commit
3980 * src/frontends/xforms/FormUrl.h: ditto
3982 * src/frontends/xforms/FormPrint.h: ditto
3984 * src/frontends/xforms/FormPreferences.h: ditto
3986 * src/frontends/xforms/FormCopyright.h: ditto
3988 * src/frontends/xforms/FormCitation.C: ditto
3990 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3991 private copyconstructor and private default contructor
3993 * src/support/Makefile.am: add utility.hpp
3995 * src/support/utility.hpp: new file from boost
3997 * src/insets/insetbib.h: set owner in clone
3999 * src/frontends/xforms/FormCitation.C: added missing include
4002 * src/insets/form_url.[Ch]: removed
4004 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4006 * development/lyx.spec.in
4007 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4008 file/directory re-organization.
4010 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4012 * src/insets/insetcommand.[Ch]: moved the string data and
4013 associated manipulation methods into a new stand-alone class
4014 InsetCommandParams. This class has two additional methods
4015 getAsString() and setFromString() allowing the contents to be
4016 moved around as a single string.
4017 (addContents) method removed.
4018 (setContents) method no longer virtual.
4020 * src/buffer.C (readInset): made use of new InsetCitation,
4021 InsetUrl constructors based on InsetCommandParams.
4023 * src/commandtags.h: add LFUN_INSERT_URL
4025 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4026 independent InsetUrl and use InsetCommandParams to extract
4027 string info and create new Insets.
4029 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4031 * src/frontends/xforms/FormCitation.C (apply): uses
4034 * src/frontends/xforms/form_url.C
4035 * src/frontends/xforms/form_url.h
4036 * src/frontends/xforms/FormUrl.h
4037 * src/frontends/xforms/FormUrl.C
4038 * src/frontends/xforms/forms/form_url.fd: new files
4040 * src/insets/insetcite.[Ch]: removed unused constructors.
4042 * src/insets/insetinclude.[Ch]: no longer store filename
4044 * src/insets/inseturl.[Ch]: GUI-independent.
4046 2000-07-26 Juergen Vigna <jug@sad.it>
4047 * renamed frontend from gtk to gnome as it is that what is realized
4048 and did the necessary changes in the files.
4050 2000-07-26 Marko Vendelin <markov@ioc.ee>
4052 * configure.in: cleaning up gnome configuration scripts
4054 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4056 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4057 shortcuts syndrom by redrawing them explicitely (a better solution
4058 would be appreciated).
4060 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4062 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4065 * src/lyx_cb.C (MenuExport): change html export to do the right
4066 thing depending of the document type (instead of having
4067 html-linuxdoc and html-docbook).
4068 * src/lyxfunc.C (getStatus): update for html
4069 * lib/ui/default.ui: simplify due to the above change.
4070 * src/menus.C (ShowFileMenu): update too (in case we need it).
4072 * src/MenuBackend.C (read): if a menu is defined twice, add the
4073 new entries to the exiting one.
4075 2000-07-26 Juergen Vigna <jug@sad.it>
4077 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4079 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4080 and return a bool if it did actual save the file.
4081 (AutoSave): don't autosave a unnamed doc.
4083 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4084 check if this is an UNNAMED new file and react to it.
4085 (newFile): set buffer to unnamed and change to not mark a new
4086 buffer dirty if I didn't do anything with it.
4088 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4090 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4092 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4093 friend as per Angus's patch posted to lyx-devel.
4095 * src/ext_l10n.h: updated
4097 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4098 gettext on the style string right before inserting them into the
4101 * autogen.sh: add code to extract style strings form layout files,
4102 not good enough yet.
4104 * src/frontends/gtk/.cvsignore: add MAKEFILE
4106 * src/MenuBackend.C (read): run the label strings through gettext
4107 before storing them in the containers.
4109 * src/ext_l10n.h: new file
4111 * autogen.sh : generate the ext_l10n.h file here
4113 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4115 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4118 * lib/ui/default.ui: fix a couple of typos.
4120 * config/gnome/gtk.m4: added (and added to the list of files in
4123 * src/insets/insetinclude.C (unique_id): fix when we are using
4124 lyxstring instead of basic_string<>.
4125 * src/insets/insettext.C (LocalDispatch): ditto.
4126 * src/support/filetools.C: ditto.
4128 * lib/configure.m4: create the ui/ directory if necessary.
4130 * src/LyXView.[Ch] (updateToolbar): new method.
4132 * src/BufferView_pimpl.C (buffer): update the toolbar when
4133 opening/closing buffer.
4135 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4137 * src/LyXAction.C (getActionName): enhance to return also the name
4138 and options of pseudo-actions.
4139 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4141 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4142 as an example of what is possible). Used in File->Build too (more
4143 useful) and in the import/export menus (to mimick the complicated
4144 handling of linuxdoc and friends). Try to update all the entries.
4146 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4149 * src/MenuBackend.C (read): Parse the new OptItem tag.
4151 * src/MenuBackend.h: Add a new optional_ data member (used if the
4152 entry should be omitted when the lyxfunc is disabled).
4154 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4155 function, used as a shortcut.
4156 (create_submenu): align correctly the shortcuts on the widest
4159 * src/MenuBackend.h: MenuItem.label() only returns the label of
4160 the menu without shortcut; new method shortcut().
4162 2000-07-14 Marko Vendelin <markov@ioc.ee>
4164 * src/frontends/gtk/Dialogs.C:
4165 * src/frontends/gtk/FormCopyright.C:
4166 * src/frontends/gtk/FormCopyright.h:
4167 * src/frontends/gtk/Makefile.am: added these source-files for the
4168 Gtk/Gnome support of the Copyright-Dialog.
4170 * src/main.C: added Gnome::Main initialization if using
4171 Gtk/Gnome frontend-GUI.
4173 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4175 * config/gnome/aclocal-include.m4
4176 * config/gnome/compiler-flags.m4
4177 * config/gnome/curses.m4
4178 * config/gnome/gnome--.m4
4179 * config/gnome/gnome-bonobo-check.m4
4180 * config/gnome/gnome-common.m4
4181 * config/gnome/gnome-fileutils.m4
4182 * config/gnome/gnome-ghttp-check.m4
4183 * config/gnome/gnome-gnorba-check.m4
4184 * config/gnome/gnome-guile-checks.m4
4185 * config/gnome/gnome-libgtop-check.m4
4186 * config/gnome/gnome-objc-checks.m4
4187 * config/gnome/gnome-orbit-check.m4
4188 * config/gnome/gnome-print-check.m4
4189 * config/gnome/gnome-pthread-check.m4
4190 * config/gnome/gnome-support.m4
4191 * config/gnome/gnome-undelfs.m4
4192 * config/gnome/gnome-vfs.m4
4193 * config/gnome/gnome-x-checks.m4
4194 * config/gnome/gnome-xml-check.m4
4195 * config/gnome/gnome.m4
4196 * config/gnome/gperf-check.m4
4197 * config/gnome/gtk--.m4
4198 * config/gnome/linger.m4
4199 * config/gnome/need-declaration.m4: added configuration scripts
4200 for Gtk/Gnome frontend-GUI
4202 * configure.in: added support for the --with-frontend=gtk option
4204 * autogen.sh: added config/gnome/* to list of config-files
4206 * acconfig.h: added define for GTKGUI-support
4208 * config/lyxinclude.m4: added --with-frontend[=value] option value
4209 for Gtk/Gnome frontend-GUI support.
4211 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4213 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4217 * src/paragraph.C (GetChar): remove non-const version
4219 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4220 (search_kw): use it.
4222 * src/lyx_main.C (init): if "preferences" exist, read that instead
4224 (ReadRcFile): return bool if the file could be read ok.
4225 (ReadUIFile): add a check to see if lex file is set ok.
4227 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4228 bastring can be used instead of lyxstring (still uses the old code
4229 if std::string is good enough or if lyxstring is used.)
4231 * src/encoding.C: make the arrays static, move ininle functions
4233 * src/encoding.h: from here.
4235 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4236 (parseSingleLyXformat2Token): move inset parsing to separate method
4237 (readInset): new private method
4239 * src/Variables.h: remove virtual from get().
4241 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4242 access to NEW_INSETS and NEW_TABULAR
4244 * src/MenuBackend.h: remove superfluous forward declaration of
4245 MenuItem. Add documentations tags "///", remove empty MenuItem
4246 destructor, remove private default contructor.
4248 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4250 (read): more string mlabel and mname to where they are used
4251 (read): remove unused variables mlabel and mname
4252 (defaults): unconditional clear, make menusetup take advantage of
4253 add returning Menu &.
4255 * src/LyXView.h: define NEW_MENUBAR as default
4257 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4258 to NEW_INSETS and NEW_TABULAR.
4259 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4260 defined. Change some of the "xxxx-inset-insert" functions names to
4263 * several files: more enahncements to NEW_INSETS and the resulting
4266 * lib/lyxrc.example (\date_insert_format): move to misc section
4268 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4269 bastring and use AC_CACHE_CHECK.
4270 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4271 the system have the newest methods. uses AC_CACHE_CHECK
4272 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4273 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4274 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4276 * configure.in: add LYX_CXX_GOOD_STD_STRING
4278 * acinclude.m4: recreated
4280 2000-07-24 Amir Karger <karger@lyx.org>
4282 * README: add Hebrew, Arabic kmaps
4285 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4287 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4290 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4292 * Lot of files: add pragma interface/implementation.
4294 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4296 * lib/ui/default.ui: new file (ans new directory). Contains the
4297 default menu and toolbar.
4299 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4300 global space. Toolbars are now read (as menus) in ui files.
4302 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4304 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4305 is disabled because the document is read-only. We want to have the
4306 toggle state of the function anyway.
4307 (getStatus): add code for LFUN_VC* functions (mimicking what is
4308 done in old-style menus)
4310 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4311 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4313 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4314 * src/BufferView_pimpl.C: ditto.
4315 * src/lyxfunc.C: ditto.
4317 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4318 default). This replaces old-style menus by new ones.
4320 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4321 MenuItem. Contain the data structure of a menu.
4323 * src/insets/insettext.C: use LyXView::setLayout instead of
4324 accessing directly the toolbar combox.
4325 * src/lyxfunc.C (Dispatch): ditto.
4327 * src/LyXView.C (setLayout): new method, which just calls
4328 Toolbar::setLayout().
4329 (updateLayoutChoice): move part of this method in Toolbar.
4331 * src/toolbar.[Ch]: removed.
4333 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4334 implementation the toolbar.
4336 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4337 the toolbar. It might make sense to merge it with ToolbarDefaults
4339 (setLayout): new function.
4340 (updateLayoutList): ditto.
4341 (openLayoutList): ditto.
4343 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4344 xforms implementation of the toolbar.
4345 (get_toolbar_func): comment out, since I do not
4346 know what it is good for.
4348 * src/ToolbarDefaults.h: Add the ItemType enum.
4350 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4351 for a list of allocated C strings. Used in Menubar xforms
4352 implementation to avoid memory leaks.
4354 * src/support/lstrings.[Ch] (uppercase): new version taking and
4358 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4359 * lib/bind/emacs.bind: ditto.
4361 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4363 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4364 forward decl of LyXView.
4366 * src/toolbar.C (toolbarItem): moved from toolbar.h
4367 (toolbarItem::clean): ditto
4368 (toolbarItem::~toolbarItem): ditto
4369 (toolbarItem::operator): ditto
4371 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4373 * src/paragraph.h: control the NEW_TABULAR define from here
4375 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4376 USE_TABULAR_INSETS to NEW_TABULAR
4378 * src/ToolbarDefaults.C: add include "lyxlex.h"
4380 * files using the old table/tabular: use NEW_TABULAR to control
4381 compilation of old tabular stuff.
4383 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4386 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4387 planemet in reading of old style floats, fix the \end_deeper
4388 problem when reading old style floats.
4390 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4392 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4394 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4396 * lib/bind/sciword.bind: updated.
4398 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4400 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4401 layout write problem
4403 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4405 * src/Makefile.am (INCLUDES): remove image directory from include
4408 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4409 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4411 * src/LyXView.C (create_form_form_main): read the application icon
4414 * lib/images/*.xpm: change the icons to use transparent color for
4417 * src/toolbar.C (update): change the color of the button when it
4420 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4422 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4423 setting explicitely the minibuffer.
4424 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4426 * src/LyXView.C (showState): new function. Shows font information
4427 in minibuffer and update toolbar state.
4428 (LyXView): call Toolbar::update after creating the
4431 * src/toolbar.C: change toollist to be a vector instead of a
4433 (BubbleTimerCB): get help string directly from the callback
4434 argument of the corresponding icon (which is the action)
4435 (set): remove unnecessary ugliness.
4436 (update): new function. update the icons (depressed, disabled)
4437 depending of the status of the corresponding action.
4439 * src/toolbar.h: remove help in toolbarItem
4441 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4443 * src/Painter.C (text): Added code for using symbol glyphs from
4444 iso10646 fonts. Currently diabled.
4446 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4449 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4450 magyar,turkish and usorbian.
4452 * src/paragraph.C (isMultiLingual): Made more efficient.
4454 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4457 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4458 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4459 Also changed the prototype to "bool math_insert_greek(char)".
4461 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4463 * lots of files: apply the NEW_INSETS on all code that will not be
4464 needed when we move to use the new insets. Enable the define in
4465 lyxparagrah.h to try it.
4467 * src/insets/insettabular.C (cellstart): change to be a static
4469 (InsetTabular): initialize buffer in the initializer list.
4471 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4473 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4474 form_print.h out of the header file. Replaced with forward
4475 declarations of the relevant struct.
4477 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4480 * src/commandtags.h: do not include "debug.h" which does not
4481 belong there. #include it in some other places because of this
4484 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4486 * src/insets/insetcaption.C: add a couple "using" directives.
4488 * src/toolbar.C (add): get the help text directly from lyxaction.
4490 (setPixmap): new function. Loads from disk and sets a pixmap on a
4491 botton; the name of the pixmap file is derived from the command
4494 * src/toolbar.h: remove members isBitmap and pixmap from
4497 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4498 * lib/images/: move many files from images/banner.xpm.
4500 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4502 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4503 * src/toolbar.C: ditto.
4504 * configure.in: ditto.
4505 * INSTALL: document.
4507 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4508 the spellchecker popup is closed from the WM.
4510 2000-07-19 Juergen Vigna <jug@sad.it>
4512 * src/insets/insetfloat.C (Write): small fix because we use the
4513 insetname for the type now!
4515 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4517 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4520 * src/frontends/Dialogs.h: removed hideCitation signal
4522 * src/insets/insetcite.h: added hide signal
4524 * src/insets/insetcite.C (~InsetCitation): emits new signal
4525 (getScreenLabel): "intelligent" label should now fit on the screen!
4527 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4529 * src/frontends/xforms/FormCitation.C (showInset): connects
4530 hide() to the inset's hide signal
4531 (show): modified to use fl_set_object_position rather than
4532 fl_set_object_geometry wherever possible
4534 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4536 * src/insets/lyxinset.h: add caption code
4538 * src/insets/insetfloat.C (type): new method
4540 * src/insets/insetcaption.C (Write): new method
4542 (LyxCode): new method
4544 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4545 to get it right together with using the FloatList.
4547 * src/commandtags.h: add LFUN_INSET_CAPTION
4548 * src/lyxfunc.C (Dispatch): handle it
4550 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4553 * src/Variables.[Ch]: make expand take a const reference, remove
4554 the destructor, some whitespace changes.
4556 * src/LyXAction.C (init): add caption-inset-insert
4558 * src/FloatList.C (FloatList): update the default floats a bit.
4560 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4562 * src/Variables.[Ch]: new files. Intended to be used for language
4563 specific strings (like \chaptername) and filename substitution in
4566 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4568 * lib/kbd/american.kmap: update
4570 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4572 * src/bufferparams.[Ch]: remove member allowAccents.
4574 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4576 * src/LaTeXLog.C: use the log_form.h header.
4577 * src/lyx_gui.C: ditto.
4578 * src/lyx_gui_misc.C: ditto.
4579 * src/lyxvc.h: ditto.
4581 * forms/log_form.fd: new file, created from latexoptions.fd. I
4582 kept the log popup and nuked the options form.
4584 * src/{la,}texoptions.[Ch]: removed.
4585 * src/lyx_cb.C (LaTeXOptions): ditto
4587 * src/lyx_gui.C (create_forms): do not handle the
4588 fd_latex_options form.
4590 2000-07-18 Juergen Vigna <jug@sad.it>
4592 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4593 name of the inset so that it can be requested outside (text2.C).
4595 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4598 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4600 * src/mathed/formula.h (ConvertFont): constify
4602 * src/mathed/formula.C (Read): add warning if \end_inset is not
4603 found on expected place.
4605 * src/insets/lyxinset.h (ConvertFont): consify
4607 * src/insets/insetquotes.C (ConvertFont): constify
4608 * src/insets/insetquotes.h: ditto
4610 * src/insets/insetinfo.h: add labelfont
4612 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4613 (ascent): use labelfont
4617 (Write): make .lyx file a bit nicer
4619 * src/insets/insetfloat.C (Write): simplify somewhat...
4620 (Read): add warning if arg is not found
4622 * src/insets/insetcollapsable.C: add using std::max
4623 (Read): move string token and add warning in arg is not found
4624 (draw): use std::max to get the right ty
4625 (getMaxWidth): simplify by using std::max
4627 * src/insets/insetsection.h: new file
4628 * src/insets/insetsection.C: new file
4629 * src/insets/insetcaption.h: new file
4630 * src/insets/insetcaption.C: new file
4632 * src/insets/inset.C (ConvertFont): constify signature
4634 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4635 insetcaption.[Ch] and insetsection.[Ch]
4637 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4638 uses to use LABEL_COUNTER_CHAPTER instead.
4639 * src/text2.C (SetCounter): here
4641 * src/counters.h: new file
4642 * src/counters.C: new file
4643 * src/Sectioning.h: new file
4644 * src/Sectioning.C: new file
4646 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4648 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4650 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4653 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4656 2000-07-17 Juergen Vigna <jug@sad.it>
4658 * src/tabular.C (Validate): check if array-package is needed.
4659 (SetVAlignment): added support for vertical alignment.
4660 (SetLTFoot): better support for longtable header/footers
4661 (Latex): modified to support added features.
4663 * src/LaTeXFeatures.[Ch]: added array-package.
4665 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4667 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4670 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4672 * configure.in: do not forget to put a space after -isystem.
4674 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4676 * lib/kbd/arabic.kmap: a few fixes.
4678 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4680 * some whitespace chagnes to a number of files.
4682 * src/support/DebugStream.h: change to make it easier for
4683 doc++ to parse correctly.
4684 * src/support/lyxstring.h: ditto
4686 * src/mathed/math_utils.C (compara): change to have only one
4688 (MathedLookupBOP): change because of the above.
4690 * src/mathed/math_delim.C (math_deco_compare): change to have only
4692 (search_deco): change becasue of the above.
4694 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4695 instead of manually coded one.
4697 * src/insets/insetquotes.C (Read): read the \end_inset too
4699 * src/insets/insetlatex.h: remove file
4700 * src/insets/insetlatex.C: remove file
4702 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4704 (InsetPrintIndex): remove destructor
4706 * src/insets/insetinclude.h: remove default constructor
4708 * src/insets/insetfloat.C: work to make it work better
4710 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4712 * src/insets/insetcite.h (InsetCitation): remove default constructor
4714 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4716 * src/text.C (GetColumnNearX): comment out some currently unused code.
4718 * src/paragraph.C (writeFile): move some initializations closer to
4720 (CutIntoMinibuffer): small change to use new matchIT operator
4724 (InsertInset): ditto
4727 (InsetIterator): ditto
4728 (Erase): small change to use new matchFT operator
4730 (GetFontSettings): ditto
4731 (HighestFontInRange): ditto
4734 * src/lyxparagraph.h: some chars changed to value_type
4735 (matchIT): because of some stronger checking (perhaps too strong)
4736 in SGI STL, the two operator() unified to one.
4739 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4741 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4742 the last inset read added
4743 (parseSingleLyXformat2Token): some more (future) compability code added
4744 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4745 (parseSingleLyXformat2Token): set last_inset_read
4746 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4747 (parseSingleLyXformat2Token): don't double intializw string next_token
4749 * src/TextCache.C (text_fits::operator()): add const's to the signature
4750 (has_buffer::operator()): ditto
4752 * src/Floating.h: add some comments on the class
4754 * src/FloatList.[Ch] (typeExist): new method
4757 * src/BackStack.h: added default constructor, wanted by Gcc.
4759 2000-07-14 Juergen Vigna <jug@sad.it>
4761 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4763 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4765 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4766 do a redraw when the window is resized!
4767 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4769 * src/insets/insettext.C (resizeLyXText): added function to correctly
4770 being able to resize the LyXWindow.
4772 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4774 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4776 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4777 crashes when closing dialog to a deleted inset.
4779 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4780 method! Now similar to other insets.
4782 2000-07-13 Juergen Vigna <jug@sad.it>
4784 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4786 * lib/examples/Literate.lyx: small patch!
4788 * src/insets/insetbib.C (Read): added this function because of wrong
4789 Write (without [begin|end]_inset).
4791 2000-07-11 Juergen Vigna <jug@sad.it>
4793 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4794 as the insertInset could not be good!
4796 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4797 the bool param should not be last.
4799 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4801 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4802 did submit that to Karl).
4804 * configure.in: use -isystem instead of -I for X headers. This
4805 fixes a problem on solaris with a recent gcc;
4806 put the front-end code after the X detection code;
4807 configure in sigc++ before lib/
4809 * src/lyx_main.C (commandLineHelp): remove -display from command
4812 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4814 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4815 Also put in Makefile rules for building the ``listerrors''
4816 program for parsing errors from literate programs written in LyX.
4818 * lib/build-listerrors: Added small shell script as part of compile
4819 process. This builds a working ``listerrors'' binary if noweb is
4820 installed and either 1) the VNC X server is installed on the machine,
4821 or 2) the user is compiling from within a GUI. The existence of a GUI
4822 is necessary to use the ``lyx --export'' feature for now. This
4823 hack can be removed once ``lyx --export'' no longer requires a GUI to
4826 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4828 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4829 now passed back correctly from gcc and placed "under" error
4830 buttons in a Literate LyX source.
4832 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4834 * src/text.C (GetColumnNearX): Better behavior when a RTL
4835 paragraph is ended by LTR text.
4837 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4840 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4842 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4843 true when clipboard is empty.
4845 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4847 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4848 row of the paragraph.
4849 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4850 to prevent calculation of bidi tables
4852 2000-07-07 Juergen Vigna <jug@sad.it>
4854 * src/screen.C (ToggleSelection): added y_offset and x_offset
4857 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4860 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4862 * src/insets/insettext.C: fixed Layout-Display!
4864 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4866 * configure.in: add check for strings.h header.
4868 * src/spellchecker.C: include <strings.h> in order to have a
4869 definition for bzero().
4871 2000-07-07 Juergen Vigna <jug@sad.it>
4873 * src/insets/insettext.C (draw): set the status of the bv->text to
4874 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4876 * src/screen.C (DrawOneRow):
4877 (DrawFromTo): redraw the actual row if something has changed in it
4880 * src/text.C (draw): call an update of the toplevel-inset if something
4881 has changed inside while drawing.
4883 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4885 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4887 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4888 processing inside class.
4890 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4891 processing inside class.
4893 * src/insets/insetindex.h new struct Holder, consistent with other
4896 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4897 citation dialog from main code and placed it in src/frontends/xforms.
4898 Dialog launched through signals instead of callbacks
4900 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4902 * lyx.man: update the options description.
4904 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4906 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4907 handle neg values, set min width to 590, add doc about -display
4909 2000-07-05 Juergen Vigna <jug@sad.it>
4911 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4912 calls to BufferView *.
4914 * src/insets/insettext.C (checkAndActivateInset): small fix non
4915 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4917 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4918 their \end_inset token!
4920 2000-07-04 edscott <edscott@imp.mx>
4922 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4923 lib/lyxrc.example: added option \wheel_jump
4925 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4927 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4928 remove support for -width,-height,-xpos and -ypos.
4930 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4932 * src/encoding.[Ch]: New files.
4934 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4935 (text): Call to the underline() method only when needed.
4937 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4939 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4940 encoding(s) for the document.
4942 * src/bufferparams.C (BufferParams): Changed default value of
4945 * src/language.C (newLang): Removed.
4946 (items[]): Added encoding information for all defined languages.
4948 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4949 encoding choice button.
4951 * src/lyxrc.h (font_norm_type): New member variable.
4952 (set_font_norm_type): New method.
4954 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4955 paragraphs with different encodings.
4957 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4958 (TransformChar): Changed to work correctly with Arabic points.
4959 (draw): Added support for drawing Arabic points.
4960 (draw): Removed code for drawing underbars (this is done by
4963 * src/support/textutils.h (IsPrintableNonspace): New function.
4965 * src/BufferView_pimpl.h: Added "using SigC::Object".
4966 * src/LyXView.h: ditto.
4968 * src/insets/insetinclude.h (include_label): Changed to mutable.
4970 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4972 * src/mathed/math_iter.h: remove empty destructor
4974 * src/mathed/math_cursor.h: remove empty destructor
4976 * src/insets/lyxinset.h: add THEOREM_CODE
4978 * src/insets/insettheorem.[Ch]: new files
4980 * src/insets/insetminipage.C: (InsertInset): remove
4982 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4984 (InsertInset): remove
4986 * src/insets/insetlist.C: (InsertList): remove
4988 * src/insets/insetfootlike.[Ch]: new files
4990 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4993 (InsertInset): ditto
4995 * src/insets/insetert.C: remove include Painter.h, reindent
4996 (InsertInset): move to header
4998 * src/insets/insetcollapsable.h: remove explicit from default
4999 contructor, remove empty destructor, add InsertInset
5001 * src/insets/insetcollapsable.C (InsertInset): new func
5003 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5005 * src/vspace.h: add explicit to constructor
5007 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5008 \textcompwordmark, please test this.
5010 * src/lyxrc.C: set ascii_linelen to 65 by default
5012 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5014 * src/commandtags.h: add LFUN_INSET_THEOREM
5016 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5017 (makeLinuxDocFile): remove _some_ of the nice logic
5018 (makeDocBookFile): ditto
5020 * src/Painter.[Ch]: (~Painter): removed
5022 * src/LyXAction.C (init): entry for insettheorem added
5024 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5026 (deplog): code to detect files generated by LaTeX, needs testing
5029 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5031 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5033 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5035 * src/LaTeX.C (deplog): Add a check for files that are going to be
5036 created by the first latex run, part of the project to remove the
5039 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5040 contents to the extension list.
5042 2000-07-04 Juergen Vigna <jug@sad.it>
5044 * src/text.C (NextBreakPoint): added support for needFullRow()
5046 * src/insets/lyxinset.h: added needFullRow()
5048 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5051 * src/insets/insettext.C: lots of changes for update!
5053 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5055 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5057 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5059 * src/insets/insetinclude.C (InsetInclude): fixed
5060 initialization of include_label.
5061 (unique_id): now returns a string.
5063 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5065 * src/LaTeXFeatures.h: new member IncludedFiles, for
5066 a map of key, included file name.
5068 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5069 with the included files for inclusion in SGML preamble,
5070 i. e., linuxdoc and docbook.
5073 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5074 nice (is the generated linuxdoc code to be exported?), that
5075 allows to remove column, and only_body that will be true for
5076 slave documents. Insets are allowed inside SGML font type.
5077 New handling of the SGML preamble for included files.
5078 (makeDocBookFile): the same for docbook.
5080 * src/insets/insetinclude.h:
5081 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5083 (DocBook): new export methods.
5085 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5086 and makeDocBookFile.
5088 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5089 formats to export with command line argument -x.
5091 2000-06-29 Juergen Vigna <jug@sad.it>
5093 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5094 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5096 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5097 region could already been cleared by an inset!
5099 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5101 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5104 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5106 (cursorToggle): remove special handling of lyx focus.
5108 2000-06-28 Juergen Vigna <jug@sad.it>
5110 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5113 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5115 * src/insets/insetindex.C (Edit): add a callback when popup is
5118 * src/insets/insettext.C (LocalDispatch):
5119 * src/insets/insetmarginal.h:
5120 * src/insets/insetlist.h:
5121 * src/insets/insetfoot.h:
5122 * src/insets/insetfloat.h:
5123 * src/insets/insetert.h: add a missing std:: qualifier.
5125 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5127 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5130 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5132 * src/insets/insettext.C (Read): remove tmptok unused variable
5133 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5134 (InsertInset): change for new InsetInset code
5136 * src/insets/insettext.h: add TEXT inline method
5138 * src/insets/insettext.C: remove TEXT macro
5140 * src/insets/insetmarginal.C (Write): new method
5141 (Latex): change output slightly
5143 * src/insets/insetfoot.C (Write): new method
5144 (Latex): change output slightly (don't use endl when no need)
5146 * src/insets/insetert.C (Write): new method
5148 * src/insets/insetcollapsable.h: make button_length, button_top_y
5149 and button_bottm_y protected.
5151 * src/insets/insetcollapsable.C (Write): simplify code by using
5152 tostr. Also do not output the float name, the children class
5153 should to that to get control over own arguments
5155 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5156 src/insets/insetminipage.[Ch]:
5159 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5161 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5163 * src/Makefile.am (lyx_SOURCES): add the new files
5165 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5166 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5167 * src/commandtags.h: ditto
5169 * src/LaTeXFeatures.h: add a std::set of used floattypes
5171 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5173 * src/FloatList.[Ch] src/Floating.h: new files
5175 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5177 * src/lyx_cb.C (TableApplyCB): ditto
5179 * src/text2.C: ditto
5180 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5181 (parseSingleLyXformat2Token): ditto + add code for
5182 backwards compability for old float styles + add code for new insets
5184 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5186 (InsertInset(size_type, Inset *, LyXFont)): new method
5187 (InsetChar(size_type, char)): changed to use the other InsetChar
5188 with a LyXFont(ALL_INHERIT).
5189 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5190 insert the META_INSET.
5192 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5194 * sigc++/thread.h (Threads): from here
5196 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5197 definition out of line
5198 * sigc++/scope.h: from here
5200 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5202 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5203 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5205 * Makefile.am (bindist): new target.
5207 * INSTALL: add instructions for doing a binary distribution.
5209 * development/tools/README.bin.example: update a bit.
5211 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5214 * lib/lyxrc.example: new lyxrc tag \set_color.
5216 * src/lyxfunc.C (Dispatch):
5217 * src/commandtags.h:
5218 * src/LyXAction.C: new lyxfunc "set-color".
5220 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5221 and an x11name given as strings.
5223 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5224 cache when a color is changed.
5226 2000-06-26 Juergen Vigna <jug@sad.it>
5228 * src/lyxrow.C (width): added this functions and variable.
5230 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5233 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5235 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5237 * images/undo_bw.xpm: new icon.
5238 * images/redo_bw.xpm: ditto.
5240 * configure.in (INSTALL_SCRIPT): change value to
5241 ${INSTALL} to avoid failures of install-script target.
5242 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5244 * src/BufferView.h: add a magic "friend" declaration to please
5247 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5249 * forms/cite.fd: modified to allow resizing without messing
5252 * src/insetcite.C: Uses code from cite.fd almost without
5254 User can now resize dialog in the x-direction.
5255 Resizing the dialog in the y-direction is prevented, as the
5256 code does this intelligently already.
5258 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5260 * INSTALL: remove obsolete entry in "problems" section.
5262 * lib/examples/sl_*.lyx: update of the slovenian examples.
5264 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5266 2000-06-23 Juergen Vigna <jug@sad.it>
5268 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5270 * src/buffer.C (resize): delete the LyXText of textinsets.
5272 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5274 * src/insets/lyxinset.h: added another parameter 'cleared' to
5275 the draw() function.
5277 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5278 unlocking inset in inset.
5280 2000-06-22 Juergen Vigna <jug@sad.it>
5282 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5283 of insets and moved first to LyXText.
5285 * src/mathed/formulamacro.[Ch]:
5286 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5288 2000-06-21 Juergen Vigna <jug@sad.it>
5290 * src/text.C (GetVisibleRow): look if I should clear the area or not
5291 using Inset::doClearArea() function.
5293 * src/insets/lyxinset.h: added doClearArea() function and
5294 modified draw(Painter &, ...) to draw(BufferView *, ...)
5296 * src/text2.C (UpdateInset): return bool insted of int
5298 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5300 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5301 combox in the character popup
5303 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5304 BufferParams const & params
5306 2000-06-20 Juergen Vigna <jug@sad.it>
5308 * src/insets/insettext.C (SetParagraphData): set insetowner on
5311 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5313 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5314 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5316 (form_main_): remove
5318 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5319 (create_form_form_main): remove FD_form_main stuff, connect to
5320 autosave_timeout signal
5322 * src/LyXView.[Ch] (getMainForm): remove
5323 (UpdateTimerCB): remove
5324 * src/BufferView_pimpl.h: inherit from SigC::Object
5326 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5327 signal instead of callback
5329 * src/BufferView.[Ch] (cursorToggleCB): remove
5331 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5333 * src/BufferView_pimpl.C: changes because of the one below
5335 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5336 instead of storing a pointer to a LyXText.
5338 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5340 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5342 * src/lyxparagraph.h
5344 * src/paragraph.C: Changed fontlist to a sorted vector.
5346 2000-06-19 Juergen Vigna <jug@sad.it>
5348 * src/BufferView.h: added screen() function.
5350 * src/insets/insettext.C (LocalDispatch): some selection code
5353 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5355 * src/insets/insettext.C (SetParagraphData):
5357 (InsetText): fixes for multiple paragraphs.
5359 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5361 * development/lyx.spec.in: Call configure with ``--without-warnings''
5362 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5363 This should be fine, however, since we generally don't want to be
5364 verbose when making an RPM.
5366 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5368 * lib/scripts/fig2pstex.py: New file
5370 2000-06-16 Juergen Vigna <jug@sad.it>
5372 * src/insets/insettabular.C (UpdateLocal):
5373 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5374 (LocalDispatch): Changed all functions to use LyXText.
5376 2000-06-15 Juergen Vigna <jug@sad.it>
5378 * src/text.C (SetHeightOfRow): call inset::update before requesting
5381 * src/insets/insettext.C (update):
5382 * src/insets/insettabular.C (update): added implementation
5384 * src/insets/lyxinset.h: added update function
5386 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5388 * src/text.C (SelectNextWord): protect against null pointers with
5389 old-style string streams. (fix from Paul Theo Gonciari
5392 * src/cite.[Ch]: remove erroneous files.
5394 * lib/configure.m4: update the list of created directories.
5396 * src/lyxrow.C: include <config.h>
5397 * src/lyxcursor.C: ditto.
5399 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5401 * lib/examples/decimal.lyx: new example file from Mike.
5403 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5404 to find template definitions (from Dekel)
5406 * src/frontends/.cvsignore: add a few things.
5408 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5410 * src/Timeout.C (TimeOut): remove default argument.
5412 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5415 * src/insets/ExternalTemplate.C: add a "using" directive.
5417 * src/lyx_main.h: remove the act_ struct, which seems unused
5420 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5422 * LyX Developers Meeting: All files changed, due to random C++ (by
5423 coincidence) code generator script.
5425 - external inset (cool!)
5426 - initial online editing of preferences
5427 - insettabular breaks insettext(s contents)
5429 - some DocBook fixes
5430 - example files update
5431 - other cool stuff, create a diff and look for yourself.
5433 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5435 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5436 -1 this is a non-line-breaking textinset.
5438 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5439 if there is no width set.
5441 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5443 * Lots of files: Merged the dialogbase branch.
5445 2000-06-09 Allan Rae <rae@lyx.org>
5447 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5448 and the Dispatch methods that used it.
5450 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5451 access to functions formerly kept in Dispatch.
5453 2000-05-19 Allan Rae <rae@lyx.org>
5455 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5456 made to_page and count_copies integers again. from_page remains a
5457 string however because I want to allow entry of a print range like
5458 "1,4,22-25" using this field.
5460 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5461 and printer-params-get. These aren't useful from the minibuffer but
5462 could be used by a script/LyXServer app provided it passes a suitable
5463 auto_mem_buffer. I guess I should take a look at how the LyXServer
5464 works and make it support xtl buffers.
5466 * sigc++/: updated to libsigc++-1.0.1
5468 * src/xtl/: updated to xtl-1.3.pl.11
5470 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5471 those changes done to the files in src/ are actually recreated when
5472 they get regenerated. Please don't ever accept a patch that changes a
5473 dialog unless that patch includes the changes to the corresponding *.fd
5476 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5477 stringOnlyContains, renamed it and generalised it.
5479 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5480 branch. Removed the remaining old form_print code.
5482 2000-04-26 Allan Rae <rae@lyx.org>
5484 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5485 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5487 2000-04-25 Allan Rae <rae@lyx.org>
5489 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5490 against a base of xtl-1.3.pl.4
5492 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5493 filter the Id: entries so they still show the xtl version number
5496 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5497 into the src/xtl code. Patch still pending with José (XTL)
5499 2000-04-24 Allan Rae <rae@lyx.org>
5501 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5502 both more generic and much safer. Use the new template functions.
5503 * src/buffer.[Ch] (Dispatch): ditto.
5505 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5506 and mem buffer more intelligently. Also a little general cleanup.
5509 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5510 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5511 * src/xtl/Makefile.am: ditto.
5512 * src/xtl/.cvsignore: ditto.
5513 * src/Makefile.am: ditto.
5515 * src/PrinterParams.h: Removed the macros member functions. Added a
5516 testInvariant member function. A bit of tidying up and commenting.
5517 Included Angus's idea for fixing operation with egcs-1.1.2.
5519 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5520 cool expansion of XTL's mem_buffer to support automatic memory
5521 management within the buffer itself. Removed the various macros and
5522 replaced them with template functions that use either auto_mem_buffer
5523 or mem_buffer depending on a #define. The mem_buffer support will
5524 disappear as soon as the auto_mem_buffer is confirmed to be good on
5525 other platforms/compilers. That is, it's there so you've got something
5528 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5529 effectively forked XTL. However I expect José will include my code
5530 into the next major release. Also fixed a memory leak.
5531 * src/xtl/text.h: ditto.
5532 * src/xtl/xdr.h: ditto.
5533 * src/xtl/giop.h: ditto.
5535 2000-04-16 Allan Rae <rae@lyx.org>
5537 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5538 by autogen.sh and removed by maintainer-clean anyway.
5539 * .cvsignore, sigc++/.cvsignore: Support the above.
5541 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5543 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5545 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5546 macros, renamed static callback-target member functions to suit new
5547 scheme and made them public.
5548 * src/frontends/xforms/forms/form_print.fd: ditto.
5549 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5551 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5554 * src/xtl/: New directory containing a minimal distribution of XTL.
5555 This is XTL-1.3.pl.4.
5557 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5559 2000-04-15 Allan Rae <rae@lyx.org>
5561 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5563 * sigc++/: Updated to libsigc++-1.0.0
5565 2000-04-14 Allan Rae <rae@lyx.org>
5567 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5568 use the generic ones in future. I'll modify my conversion script.
5570 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5572 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5573 (CloseAllBufferRelatedDialogs): Renamed.
5574 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5576 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5577 of the generic ones. These are the same ones my conversion script
5580 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5581 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5582 * src/buffer.C (Dispatch): ditto
5584 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5585 functions for updating and hiding buffer dependent dialogs.
5586 * src/BufferView.C (buffer): ditto
5587 * src/buffer.C (setReadonly): ditto
5588 * src/lyxfunc.C (CloseBuffer): ditto
5590 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5591 Dialogs.h, and hence all the SigC stuff, into every file that includes
5592 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5594 * src/BufferView2.C: reduce the number of headers included by buffer.h
5596 2000-04-11 Allan Rae <rae@lyx.org>
5598 * src/frontends/xforms/xform_macros.h: A small collection of macros
5599 for building C callbacks.
5601 * src/frontends/xforms/Makefile.am: Added above file.
5603 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5604 scheme again. This time it should work for JMarc. If this is
5605 successful I'll revise my conversion script to automate some of this.
5606 The static member functions in the class also have to be public for
5607 this scheme will work. If the scheme works (it's almost identical to
5608 the way BufferView::cursorToggleCB is handled so it should work) then
5609 FormCopyright and FormPrint will be ready for inclusion into the main
5610 trunk immediately after 1.1.5 is released -- provided we're prepared
5611 for complaints about lame compilers not handling XTL.
5613 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5615 2000-04-07 Allan Rae <rae@lyx.org>
5617 * config/lyxinclude.m4: A bit more tidying up (Angus)
5619 * src/LString.h: JMarc's <string> header fix
5621 * src/PrinterParams.h: Used string for most data to remove some
5622 ugly code in the Print dialog and avoid even uglier code when
5623 appending the ints to a string for output.
5625 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5626 and moved "default:" back to the end of switch statement. Cleaned
5627 up the printing so it uses the right function calls and so the
5628 "print to file" option actually puts the file in the right directory.
5630 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5632 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5633 and Ok+Apply button control into a separate method: input (Angus).
5634 (input) Cleaned it up and improved it to be very thorough now.
5635 (All CB) static_cast used instead of C style cast (Angus). This will
5636 probably change again once we've worked out how to keep gcc-2.8.1 happy
5637 with real C callbacks.
5638 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5639 ignore some of the bool settings and has random numbers instead. Needs
5640 some more investigation. Added other input length checks and checking
5641 of file and printer names.
5643 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5644 would link (Angus). Seems the old code doesn't compile with the pragma
5645 statement either. Separated callback entries from internal methods.
5647 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5649 2000-03-17 Allan Rae <rae@lyx.org>
5651 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5652 need it? Maybe it could go in Dialogs instead? I could make it a
5653 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5654 values to get the bool return value.
5655 (Dispatch): New overloaded method for xtl support.
5657 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5658 extern "C" callback instead of static member functions. Hopefully,
5659 JMarc will be able to compile this. I haven't changed
5660 forms/form_copyright.fd yet. Breaking one of my own rules already.
5662 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5663 because they aren't useful from the minibuffer. Maybe a LyXServer
5664 might want a help message though?
5666 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5668 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5669 xtl which needs both rtti and exceptions.
5671 * src/support/Makefile.am:
5672 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5674 * src/frontends/xforms/input_validators.[ch]: input filters and
5675 validators. These conrol what keys are valid in input boxes.
5676 Use them and write some more. Much better idea than waiting till
5677 after the user has pressed Ok to say that the input fields don't make
5680 * src/frontends/xforms/Makefile.am:
5681 * src/frontends/xforms/forms/form_print.fd:
5682 * src/frontends/xforms/forms/makefile:
5683 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5684 new scheme. Still have to make sure I haven't missed anything from
5685 the current implementation.
5687 * src/Makefile.am, src/PrinterParams.h: New data store.
5689 * other files: Added a couple of copyright notices.
5691 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5693 * src/insets/insetbib.h: move Holder struct in public space.
5695 * src/frontends/include/DialogBase.h: use SigC:: only when
5696 SIGC_CXX_NAMESPACES is defined.
5697 * src/frontends/include/Dialogs.h: ditto.
5699 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5701 * src/frontends/xforms/FormCopyright.[Ch]: do not
5702 mention SigC:: explicitely.
5704 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5706 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5707 deals with testing KDE in main configure.in
5708 * configure.in: ditto.
5710 2000-02-22 Allan Rae <rae@lyx.org>
5712 * Lots of files: Merged from HEAD
5714 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5715 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5717 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5719 * sigc++/: new minidist.
5721 2000-02-14 Allan Rae <rae@lyx.org>
5723 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5725 2000-02-08 Juergen Vigna <jug@sad.it>
5727 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5728 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5730 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5731 for this port and so it is much easier for other people to port
5732 dialogs in a common development environment.
5734 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5735 the QT/KDE implementation.
5737 * src/frontends/kde/Dialogs.C:
5738 * src/frontends/kde/FormCopyright.C:
5739 * src/frontends/kde/FormCopyright.h:
5740 * src/frontends/kde/Makefile.am:
5741 * src/frontends/kde/formcopyrightdialog.C:
5742 * src/frontends/kde/formcopyrightdialog.h:
5743 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5744 for the kde support of the Copyright-Dialog.
5746 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5747 subdir-substitution instead of hardcoded 'xforms' as we now have also
5750 * src/frontends/include/DialogBase.h (Object): just commented the
5751 label after #endif (nasty warning and I don't like warnings ;)
5753 * src/main.C (main): added KApplication initialization if using
5756 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5757 For now only the KDE event-loop is added if frontend==kde.
5759 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5761 * configure.in: added support for the --with-frontend[=value] option
5763 * autogen.sh: added kde.m4 file to list of config-files
5765 * acconfig.h: added define for KDEGUI-support
5767 * config/kde.m4: added configuration functions for KDE-port
5769 * config/lyxinclude.m4: added --with-frontend[=value] option with
5770 support for xforms and KDE.
5772 2000-02-08 Allan Rae <rae@lyx.org>
5774 * all Makefile.am: Fixed up so the make targets dist, distclean,
5775 install and uninstall all work even if builddir != srcdir. Still
5776 have a new sigc++ minidist update to come.
5778 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5780 2000-02-01 Allan Rae <rae@lyx.org>
5782 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5783 Many mods to get builddir != srcdir working.
5785 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5786 for building on NT and so we can do the builddir != srcdir stuff.
5788 2000-01-30 Allan Rae <rae@lyx.org>
5790 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5791 This will stay in "rae" branch. We probably don't really need it in
5792 the main trunk as anyone who wants to help programming it should get
5793 a full library installed also. So they can check both included and
5794 system supplied library compilation.
5796 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5797 Added a 'mini' distribution of libsigc++. If you feel the urge to
5798 change something in these directories - Resist it. If you can't
5799 resist the urge then you should modify the following script and rebuild
5800 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5801 all happen. Still uses a hacked version of libsigc++'s configure.in.
5802 I'm quite happy with the results. I'm not sure the extra work to turn
5803 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5804 worth the trouble and would probably lead to extra maintenance
5806 I haven't tested the following important make targets: install, dist.
5807 Not ready for prime time but very close. Maybe 1.1.5.
5809 * development/tools/makeLyXsigc.sh: A shell script to automatically
5810 generate our mini-dist of libsigc++. It can only be used with a CVS
5811 checkout of libsigc++ not a tarball distribution. It's well commented.
5812 This will end up as part of the libsigc++ distribution so other apps
5813 can easily have an included mini-dist. If someone makes mods to the
5814 sigc++ subpackage without modifying this script to generate those
5815 changes I'll be very upset!
5817 * src/frontends/: Started the gui/system indep structure.
5819 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5820 to access the gui-indep dialogs are in this class. Much improved
5821 design compared to previous revision. Lars, please refrain from
5822 moving this header into src/ like you did with Popups.h last time.
5824 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5826 * src/frontends/xforms/: Started the gui-indep system with a single
5827 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5830 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5831 Here you'll find a very useful makefile and automated fdfix.sh that
5832 makes updating dailogs a no-brainer -- provided you follow the rules
5833 set out in the README. I'm thinking about adding another script to
5834 automatically generate skeleton code for a new dialog given just the
5837 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5838 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5839 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5841 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5843 * src/support/LSubstring.C (operator): simplify
5845 * src/lyxtext.h: removed bparams, use buffer_->params instead
5847 * src/lyxrow.h: make Row a real class, move all variables to
5848 private and use accessors.
5850 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5852 (isRightToLeftPar): ditto
5853 (ChangeLanguage): ditto
5854 (isMultiLingual): ditto
5857 (SimpleTeXOnePar): ditto
5858 (TeXEnvironment): ditto
5859 (GetEndLabel): ditto
5861 (SetOnlyLayout): ditto
5862 (BreakParagraph): ditto
5863 (BreakParagraphConservative): ditto
5864 (GetFontSettings): ditto
5866 (CopyIntoMinibuffer): ditto
5867 (CutIntoMinibuffer): ditto
5868 (PasteParagraph): ditto
5869 (SetPExtraType): ditto
5870 (UnsetPExtraType): ditto
5871 (DocBookContTableRows): ditto
5872 (SimpleDocBookOneTablePar): ditto
5874 (TeXFootnote): ditto
5875 (SimpleTeXOneTablePar): ditto
5876 (TeXContTableRows): ditto
5877 (SimpleTeXSpecialChars): ditto
5880 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5881 to private and use accessors.
5883 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5884 this, we did not use it anymore and has not been for ages. Just a
5885 waste of cpu cycles.
5887 * src/language.h: make Language a real class, move all variables
5888 to private and use accessors.
5890 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5891 (create_view): remove
5892 (update): some changes for new timer
5893 (cursorToggle): use new timer
5894 (beforeChange): change for new timer
5896 * src/BufferView.h (cursorToggleCB): removed last paramter because
5899 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5900 (cursorToggleCB): change because of new timer code
5902 * lib/CREDITS: updated own mailaddress
5904 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5906 * src/support/filetools.C (PutEnv): fix the code in case neither
5907 putenv() nor setenv() have been found.
5909 * INSTALL: mention the install-strip Makefile target.
5911 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5912 read-only documents.
5914 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5916 * lib/reLyX/configure.in (VERSION): avoid using a previously
5917 generated reLyX wrapper to find out $prefix.
5919 * lib/examples/eu_adibide_lyx-atua.lyx:
5920 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5921 translation of the Tutorial (Dooteo)
5923 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5925 * forms/cite.fd: new citation dialog
5927 * src/insetcite.[Ch]: the new citation dialog is moved into
5930 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5933 * src/insets/insetcommand.h: data members made private.
5935 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5937 * LyX 1.1.5 released
5939 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5941 * src/version.h (LYX_RELEASE): to 1.1.5
5943 * src/spellchecker.C (RunSpellChecker): return false if the
5944 spellchecker dies upon creation.
5946 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5948 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5949 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5953 * lib/CREDITS: update entry for Martin Vermeer.
5955 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5957 * src/text.C (draw): Draw foreign language bars at the bottom of
5958 the row instead of at the baseline.
5960 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5962 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5964 * lib/bind/de_menus.bind: updated
5966 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5968 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5970 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5972 * src/menus.C (Limit_string_length): New function
5973 (ShowTocMenu): Limit the number of items/length of items in the
5976 * src/paragraph.C (String): Correct result for a paragraph inside
5979 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5981 * src/bufferlist.C (close): test of buf->getuser() == NULL
5983 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5985 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5986 Do not call to SetCursor when the paragraph is a closed footnote!
5988 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5990 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5993 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5995 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5998 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5999 reference popup, that activates the reference-back action
6001 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6003 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6004 the menus. Also fixed a bug.
6006 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6007 the math panels when switching buffers (unless new buffer is readonly).
6009 * src/BufferView.C (NoSavedPositions)
6010 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6012 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6014 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6015 less of dvi dirty or not.
6017 * src/trans_mgr.[Ch] (insert): change first parameter to string
6020 * src/chset.[Ch] (encodeString): add const to first parameter
6022 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6024 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6028 * src/LaTeX.C (deplog): better searching for dependency files in
6029 the latex log. Uses now regexps.
6031 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6032 instead of the box hack or \hfill.
6034 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6036 * src/lyxfunc.C (doImportHelper): do not create the file before
6037 doing the actual import.
6038 (doImportASCIIasLines): create a new file before doing the insert.
6039 (doImportASCIIasParagraphs): ditto.
6041 * lib/lyxrc.example: remove mention of non-existing commands
6043 * lyx.man: remove mention of color-related switches.
6045 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6047 * src/lyx_gui.C: remove all the color-related ressources, which
6048 are not used anymore.
6050 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6053 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6055 * src/lyxrc.C (read): Add a missing break in the switch
6057 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6059 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6061 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6064 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6066 * src/text.C (draw): draw bars under foreign language words.
6068 * src/LColor.[Ch]: add LColor::language
6070 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6072 * src/lyxcursor.h (boundary): New member variable
6074 * src/text.C (IsBoundary): New methods
6076 * src/text.C: Use the above for currect cursor movement when there
6077 is both RTL & LTR text.
6079 * src/text2.C: ditto
6081 * src/bufferview_funcs.C (ToggleAndShow): ditto
6083 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6085 * src/text.C (DeleteLineForward): set selection to true to avoid
6086 that DeleteEmptyParagraphMechanism does some magic. This is how it
6087 is done in all other functions, and seems reasonable.
6088 (DeleteWordForward): do not jump over non-word stuff, since
6089 CursorRightOneWord() already does it.
6091 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6092 DeleteWordBackward, since they seem safe to me (since selection is
6093 set to "true") DeleteEmptyParagraphMechanism does nothing.
6095 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6097 * src/lyx_main.C (easyParse): simplify the code by factoring the
6098 part that removes parameters from the command line.
6099 (LyX): check wether wrong command line options have been given.
6101 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6103 * src/lyx_main.C : add support for specifying user LyX
6104 directory via command line option -userdir.
6106 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6108 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6109 the number of items per popup.
6110 (Add_to_refs_menu): Ditto.
6112 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6114 * src/lyxparagraph.h: renamed ClearParagraph() to
6115 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6116 textclass as parameter, and do nothing if free_spacing is
6117 true. This fixes part of the line-delete-forward problems.
6119 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6120 (pasteSelection): ditto.
6121 (SwitchLayoutsBetweenClasses): more translatable strings.
6123 * src/text2.C (CutSelection): use StripLeadingSpaces.
6124 (PasteSelection): ditto.
6125 (DeleteEmptyParagraphMechanism): ditto.
6127 2000-05-26 Juergen Vigna <jug@sad.it>
6129 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6130 is not needed in tabular insets.
6132 * src/insets/insettabular.C (TabularFeatures): added missing features.
6134 * src/tabular.C (DeleteColumn):
6136 (AppendRow): implemented this functions
6137 (cellsturct::operator=): clone the inset too;
6139 2000-05-23 Juergen Vigna <jug@sad.it>
6141 * src/insets/insettabular.C (LocalDispatch): better selection support
6142 when having multicolumn-cells.
6144 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6146 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6148 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6150 * src/ColorHandler.C (getGCForeground): put more test into _()
6152 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6155 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6158 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6160 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6161 there are no labels, or when buffer is readonly.
6163 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6164 there are no labels, buffer is SGML, or when buffer is readonly.
6166 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6168 * src/LColor.C (LColor): change a couple of grey40 to grey60
6169 (LColor): rewore initalization to make compiles go some magnitude
6171 (getGUIName): don't use gettext until we need the string.
6173 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6175 * src/Bullet.[Ch]: Fixed a small bug.
6177 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6179 * src/paragraph.C (String): Several fixes/improvements
6181 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6183 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6185 * src/paragraph.C (String): give more correct output.
6187 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6189 * src/lyxfont.C (stateText) Do not output the language if it is
6190 eqaul to the language of the document.
6192 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6193 between two paragraphs with the same language.
6195 * src/paragraph.C (getParLanguage) Return a correct answer for an
6196 empty dummy paragraph.
6198 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6201 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6204 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6205 the menus/popup, if requested fonts are unavailable.
6207 2000-05-22 Juergen Vigna <jug@sad.it>
6209 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6210 movement support (Up/Down/Tab/Shift-Tab).
6211 (LocalDispatch): added also preliminari cursor-selection.
6213 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6215 * src/paragraph.C (PasteParagraph): Hopefully now right!
6217 2000-05-22 Garst R. Reese <reese@isn.net>
6219 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6220 of list, change all references to Environment to Command
6221 * tex/hollywood.cls : rewrite environments as commands, add
6222 \uppercase to interiorshot and exteriorshot to force uppecase.
6223 * tex/broadway.cls : rewrite environments as commands. Tweak
6226 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6228 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6229 size of items: use a constant intead of the hardcoded 40, and more
6230 importantly do not remove the %m and %x tags added at the end.
6231 (Add_to_refs_menu): use vector::size_type instead of
6232 unsigned int as basic types for the variables. _Please_ do not
6233 assume that size_t is equal to unsigned int. On an alpha, this is
6234 unsigned long, which is _not_ the same.
6236 * src/language.C (initL): remove language "hungarian", since it
6237 seems that "magyar" is better.
6239 2000-05-22 Juergen Vigna <jug@sad.it>
6241 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6243 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6246 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6247 next was deleted but not set to 0.
6249 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6251 * src/language.C (initL): change the initialization of languages
6252 so that compiles goes _fast_.
6254 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6257 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6259 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6263 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6265 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6267 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6271 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6274 * src/insets/insetlo*.[Ch]: Made editable
6276 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6278 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6279 the current selection.
6281 * src/BufferView_pimpl.C (stuffClipboard): new method
6283 * src/BufferView.C (stuffClipboard): new method
6285 * src/paragraph.C (String): new method
6287 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6288 LColor::ignore when lyxname is not found.
6290 * src/BufferView.C (pasteSelection): new method
6292 * src/BufferView_pimpl.C (pasteSelection): new method
6294 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6296 * src/WorkArea.C (request_clipboard_cb): new static function
6297 (getClipboard): new method
6298 (putClipboard): new method
6300 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6302 * LyX 1.1.5pre2 released
6304 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6306 * src/vspace.C (operator=): removed
6307 (operator=): removed
6309 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6311 * src/layout.C (NumberOfClass): manually set the type in make_pair
6312 (NumberOfLayout): ditto
6314 * src/language.C: use the Language constructor for ignore_lang
6316 * src/language.h: add constructors to struct Language
6318 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6320 * src/text2.C (SetCursorIntern): comment out #warning
6322 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6324 * src/mathed/math_iter.h: initialize sx and sw to 0
6326 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6328 * forms/lyx.fd: Redesign of form_ref
6330 * src/LaTeXFeatures.[Ch]
6334 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6337 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6338 and Buffer::inset_iterator.
6340 * src/menus.C: Added new menus: TOC and Refs.
6342 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6344 * src/buffer.C (getTocList): New method.
6346 * src/BufferView2.C (ChangeRefs): New method.
6348 * src/buffer.C (getLabelList): New method. It replaces the old
6349 getReferenceList. The return type is vector<string> instead of
6352 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6353 the old getLabel() and GetNumberOfLabels() methods.
6354 * src/insets/insetlabel.C (getLabelList): ditto
6355 * src/mathed/formula.C (getLabelList): ditto
6357 * src/paragraph.C (String): New method.
6359 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6360 Uses the new getTocList() method.
6361 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6362 which automatically updates the contents of the browser.
6363 (RefUpdateCB): Use the new getLabelList method.
6365 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6367 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6369 * src/spellchecker.C: Added using std::reverse;
6371 2000-05-19 Juergen Vigna <jug@sad.it>
6373 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6375 * src/insets/insettext.C (computeTextRows): small fix for display of
6376 1 character after a newline.
6378 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6381 2000-05-18 Juergen Vigna <jug@sad.it>
6383 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6384 when changing width of column.
6386 * src/tabular.C (set_row_column_number_info): setting of
6387 autobreak rows if necessary.
6389 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6391 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6393 * src/vc-backend.*: renamed stat() to status() and vcstat to
6394 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6395 compilation broke. The new name seems more relevant, anyway.
6397 2000-05-17 Juergen Vigna <jug@sad.it>
6399 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6400 which was wrong if the removing caused removing of rows!
6402 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6403 (pushToken): new function.
6405 * src/text2.C (CutSelection): fix problem discovered with purify
6407 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6409 * src/debug.C (showTags): enlarge the first column, now that we
6410 have 6-digits debug codes.
6412 * lib/layouts/hollywood.layout:
6413 * lib/tex/hollywood.cls:
6414 * lib/tex/brodway.cls:
6415 * lib/layouts/brodway.layout: more commands and fewer
6416 environments. Preambles moved in the .cls files. Broadway now has
6417 more options on scene numbering and less whitespace (from Garst)
6419 * src/insets/insetbib.C (getKeys): make sure that we are in the
6420 document directory, in case the bib file is there.
6422 * src/insets/insetbib.C (Latex): revert bogus change.
6424 2000-05-16 Juergen Vigna <jug@sad.it>
6426 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6427 the TabularLayout on cursor move.
6429 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6431 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6434 (draw): fixed cursor position and drawing so that the cursor is
6435 visible when before the tabular-inset.
6437 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6438 when creating from old insettext.
6440 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6442 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6444 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6445 * lib/tex/brodway.cls: ditto
6447 * lib/layouts/brodway.layout: change alignment of parenthical
6450 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6452 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6453 versions 0.88 and 0.89 are supported.
6455 2000-05-15 Juergen Vigna <jug@sad.it>
6457 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6460 * src/insets/insettext.C (computeTextRows): redone completely this
6461 function in a much cleaner way, because of problems when having a
6463 (draw): added a frame border when the inset is locked.
6464 (SetDrawLockedFrame): this sets if we draw the border or not.
6465 (SetFrameColor): this sets the frame color (default=insetframe).
6467 * src/insets/lyxinset.h: added x() and y() functions which return
6468 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6469 function which is needed to see if we have a locking inset of some
6470 type in this inset (needed for now in insettabular).
6472 * src/vspace.C (inPixels): the same function also without a BufferView
6473 parameter as so it is easier to use it in some ocasions.
6475 * src/lyxfunc.C: changed all places where insertInset was used so
6476 that now if it couldn't be inserted it is deleted!
6478 * src/TabularLayout.C:
6479 * src/TableLayout.C: added support for new tabular-inset!
6481 * src/BufferView2.C (insertInset): this now returns a bool if the
6482 inset was really inserted!!!
6484 * src/tabular.C (GetLastCellInRow):
6485 (GetFirstCellInRow): new helper functions.
6486 (Latex): implemented for new tabular class.
6490 (TeXTopHLine): new Latex() helper functions.
6492 2000-05-12 Juergen Vigna <jug@sad.it>
6494 * src/mathed/formulamacro.C (Read):
6495 * src/mathed/formula.C (Read): read also the \end_inset here!
6497 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6499 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6500 crush when saving formulae with unbalanced parenthesis.
6502 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6504 * src/layout.C: Add new keyword "endlabelstring" to layout file
6506 * src/text.C (GetVisibleRow): Draw endlabel string.
6508 * lib/layouts/broadway.layout
6509 * lib/layouts/hollywood.layout: Added endlabel for the
6510 Parenthetical layout.
6512 * lib/layouts/heb-article.layout: Do not use slanted font shape
6513 for Theorem like environments.
6515 * src/buffer.C (makeLaTeXFile): Always add "american" to
6516 the UsedLanguages list if document language is RTL.
6518 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6520 * add addendum to README.OS2 and small patch (from SMiyata)
6522 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6524 * many files: correct the calls to ChangeExtension().
6526 * src/support/filetools.C (ChangeExtension): remove the no_path
6527 argument, which does not belong there. Use OnlyFileName() instead.
6529 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6530 files when LaTeXing a non-nice latex file.
6532 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6533 a chain of "if". Return false when deadkeys are not handled.
6535 * src/lyx_main.C (LyX): adapted the code for default bindings.
6537 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6538 bindings for basic functionality (except deadkeys).
6539 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6541 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6542 several methods: handle override_x_deadkeys.
6544 * src/lyxrc.h: remove the "bindings" map, which did not make much
6545 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6547 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6549 * src/lyxfont.C (stateText): use a saner method to determine
6550 whether the font is "default". Seems to fix the crash with DEC
6553 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6555 2000-05-08 Juergen Vigna <jug@sad.it>
6557 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6558 TabularLayoutMenu with mouse-button-3
6559 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6561 * src/TabularLayout.C: added this file for having a Layout for
6564 2000-05-05 Juergen Vigna <jug@sad.it>
6566 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6567 recalculating inset-widths.
6568 (TabularFeatures): activated this function so that I can change
6569 tabular-features via menu.
6571 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6572 that I can test some functions with the Table menu.
6574 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6576 * src/lyxfont.C (stateText): guard against stupid c++libs.
6578 * src/tabular.C: add using std::vector
6579 some whitespace changes, + removed som autogenerated code.
6581 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6583 2000-05-05 Juergen Vigna <jug@sad.it>
6585 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6586 row, columns and cellstructures.
6588 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6590 * lib/lyxrc.example: remove obsolete entries.
6592 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6593 reading of protected_separator for free_spacing.
6595 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6597 * src/text.C (draw): do not display an exclamation mark in the
6598 margin for margin notes. This is confusing, ugly and
6601 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6602 AMS math' is checked.
6604 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6605 name to see whether including the amsmath package is needed.
6607 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6609 * src/paragraph.C (validate): Compute UsedLanguages correctly
6610 (don't insert the american language if it doesn't appear in the
6613 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6614 The argument of \thanks{} command is considered moving argument
6616 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6619 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6621 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6622 for appendix/minipage/depth. The lines can be now both in the footnote
6623 frame, and outside the frame.
6625 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6628 2000-05-05 Juergen Vigna <jug@sad.it>
6630 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6631 neede only in tabular.[Ch].
6633 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6635 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6637 (Write): write '~' for PROTECTED_SEPARATOR
6639 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6641 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6644 * src/mathed/formula.C (drawStr): rename size to siz.
6646 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6647 possibly fix a bug by not changing the pflags = flags to piflags =
6650 2000-05-05 Juergen Vigna <jug@sad.it>
6652 * src/insets/insetbib.C: moved using directive
6654 * src/ImportNoweb.C: small fix for being able to compile (missing
6657 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6659 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6660 to use clear, since we don't depend on this in the code. Add test
6663 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6665 * (various *.C files): add using std::foo directives to please dec
6668 * replace calls to string::clear() to string::erase() (Angus)
6670 * src/cheaders/cmath: modified to provide std::abs.
6672 2000-05-04 Juergen Vigna <jug@sad.it>
6674 * src/insets/insettext.C: Prepared all for inserting of multiple
6675 paragraphs. Still display stuff to do (alignment and other things),
6676 but I would like to use LyXText to do this when we cleaned out the
6677 table-support stuff.
6679 * src/insets/insettabular.C: Changed lot of stuff and added lots
6680 of functionality still a lot to do.
6682 * src/tabular.C: Various functions changed name and moved to be
6683 const functions. Added new Read and Write functions and changed
6684 lots of things so it works good with tabular-insets (also removed
6685 some stuff which is not needed anymore * hacks *).
6687 * src/lyxcursor.h: added operators == and != which just look if
6688 par and pos are (not) equal.
6690 * src/buffer.C (latexParagraphs): inserted this function to latex
6691 all paragraphs form par to endpar as then I can use this too for
6694 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6695 so that I can call this to from text insets with their own cursor.
6697 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6698 output off all paragraphs (because of the fix below)!
6700 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6701 the very last paragraph (this could be also the last paragraph of an
6704 * src/texrow.h: added rows() call which returns the count-variable.
6706 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6708 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6710 * lib/configure.m4: better autodetection of DocBook tools.
6712 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6714 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6716 * src/lyx_cb.C: add using std::reverse;
6718 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6721 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6722 selected files. Should fix repeated errors from generated files.
6724 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6726 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6728 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6729 the spellchecker popup.
6731 * lib/lyxrc.example: Removed the \number_inset section
6733 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6735 * src/insets/figinset.C (various): Use IsFileReadable() to make
6736 sure that the file actually exist. Relying on ghostscripts errors
6737 is a bad idea since they can lead to X server crashes.
6739 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6741 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6744 * lib/lyxrc.example: smallish typo in description of
6745 \view_dvi_paper_option
6747 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6750 * src/lyxfunc.C: doImportHelper to factor out common code of the
6751 various import methods. New functions doImportASCIIasLines,
6752 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6753 doImportLinuxDoc for the format specific parts.
6756 * buffer.C: Dispatch returns now a bool to indicate success
6759 * lyx_gui.C: Add getLyXView() for member access
6761 * lyx_main.C: Change logic for batch commands: First try
6762 Buffer::Dispatch (possibly without GUI), if that fails, use
6765 * lyx_main.C: Add support for --import command line switch.
6766 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6767 Available Formats: Everything accepted by 'buffer-import <format>'
6769 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6771 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6774 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6775 documents will be reformatted upon reentry.
6777 2000-04-27 Juergen Vigna <jug@sad.it>
6779 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6780 correctly only last pos this was a bug.
6782 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6784 * release of lyx-1.1.5pre1
6786 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6788 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6790 * src/menus.C: revert the change of naming (Figure->Graphic...)
6791 from 2000-04-11. It was incomplete and bad.
6793 * src/LColor.[Ch]: add LColor::depthbar.
6794 * src/text.C (GetVisibleRow): use it.
6796 * README: update the languages list.
6798 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6800 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6803 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6805 * README: remove sections that were just wrong.
6807 * src/text2.C (GetRowNearY): remove currentrow code
6809 * src/text.C (GetRow): remove currentrow code
6811 * src/screen.C (Update): rewritten a bit.
6812 (SmallUpdate): removed func
6814 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6816 (FullRebreak): return bool
6817 (currentrow): remove var
6818 (currentrow_y): ditto
6820 * src/lyxscreen.h (Draw): change arg to unsigned long
6821 (FitCursor): return bool
6822 (FitManualCursor): ditto
6823 (Smallpdate): remove func
6824 (first): change to unsigned long
6825 (DrawOneRow): change second arg to long (from long &)
6826 (screen_refresh_y): remove var
6827 (scree_refresh_row): ditto
6829 * src/lyxrow.h: change baseline to usigned int from unsigned
6830 short, this brings some implicit/unsigned issues out in the open.
6832 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6834 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6835 instead of smallUpdate.
6837 * src/lyxcursor.h: change y to unsigned long
6839 * src/buffer.h: don't call updateScrollbar after fitcursor
6841 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6842 where they are used. Removed "\\direction", this was not present
6843 in 1.1.4 and is already obsolete. Commented out some code that I
6844 believe to never be called.
6845 (runLiterate): don't call updateScrollbar after fitCursor
6847 (buildProgram): ditto
6850 * src/WorkArea.h (workWidth): change return val to unsigned
6853 (redraw): remove the button redraws
6854 (setScrollbarValue): change for scrollbar
6855 (getScrollbarValue): change for scrollbar
6856 (getScrollbarBounds): change for scrollbar
6858 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6859 (C_WorkArea_down_cb): removed func
6860 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6861 (resize): change for scrollbar
6862 (setScrollbar): ditto
6863 (setScrollbarBounds): ditto
6864 (setScrollbarIncrements): ditto
6865 (up_cb): removed func
6866 (down_cb): removed func
6867 (scroll_cb): change for scrollbar
6868 (work_area_handler): ditto
6870 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6871 when FitCursor did something.
6872 (updateScrollbar): some unsigned changes
6873 (downCB): removed func
6874 (scrollUpOnePage): removed func
6875 (scrollDownOnePage): remvoed func
6876 (workAreaMotionNotify): don't call screen->FitCursor but use
6877 fitCursor instead. and bool return val
6878 (workAreaButtonPress): ditto
6879 (workAreaButtonRelease): some unsigned changes
6880 (checkInsetHit): ditto
6881 (workAreaExpose): ditto
6882 (update): parts rewritten, comments about the signed char arg added
6883 (smallUpdate): removed func
6884 (cursorPrevious): call needed updateScrollbar
6887 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6890 * src/BufferView.[Ch] (upCB): removed func
6891 (downCB): removed func
6892 (smallUpdate): removed func
6894 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6896 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6897 currentrow, currentrow_y optimization. This did not help a lot and
6898 if we want to do this kind of optimization we should rather use
6899 cursor.row instead of the currentrow.
6901 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6902 buffer spacing and klyx spacing support.
6904 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6906 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6909 2000-04-26 Juergen Vigna <jug@sad.it>
6911 * src/insets/figinset.C: fixes to Lars sstream changes!
6913 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6915 * A lot of files: Added Ascii(ostream &) methods to all inset
6916 classes. Used when exporting to ASCII.
6918 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6919 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6922 * src/text2.C (ToggleFree): Disabled implicit word selection when
6923 there is a change in the language
6925 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6926 no output was generated for end-of-sentence inset.
6928 * src/insets/lyxinset.h
6931 * src/paragraph.C: Removed the insetnumber code
6933 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6935 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6937 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6938 no_babel and no_epsfig completely from the file.
6939 (parseSingleLyXformat2Token): add handling for per-paragraph
6940 spacing as written by klyx.
6942 * src/insets/figinset.C: applied patch by Andre. Made it work with
6945 2000-04-20 Juergen Vigna <jug@sad.it>
6947 * src/insets/insettext.C (cutSelection):
6948 (copySelection): Fixed with selection from right to left.
6949 (draw): now the rows are not recalculated at every draw.
6950 (computeTextRows): for now reset the inset-owner here (this is
6951 important for an undo or copy where the inset-owner is not set
6954 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6955 motion to the_locking_inset screen->first was forgotten, this was
6956 not important till we got multiline insets.
6958 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6960 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6961 code seems to be alright (it is code changed by Dekel, and the
6962 intent is indeed that all macros should be defined \protect'ed)
6964 * NEWS: a bit of reorganisation of the new user-visible features.
6966 2000-04-19 Juergen Vigna <jug@sad.it>
6968 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6969 position. Set the inset_owner of the used paragraph so that it knows
6970 that it is inside an inset. Fixed cursor handling with mouse and
6971 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6972 and cleanups to make TextInsets work better.
6974 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6975 Changed parameters of various functions and added LockInsetInInset().
6977 * src/insets/insettext.C:
6979 * src/insets/insetcollapsable.h:
6980 * src/insets/insetcollapsable.C:
6981 * src/insets/insetfoot.h:
6982 * src/insets/insetfoot.C:
6983 * src/insets/insetert.h:
6984 * src/insets/insetert.C: cleaned up the code so that it works now
6985 correctly with insettext.
6987 * src/insets/inset.C:
6988 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6989 that insets in insets are supported right.
6992 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6994 * src/paragraph.C: some small fixes
6996 * src/debug.h: inserted INSETS debug info
6998 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6999 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7001 * src/commandtags.h:
7002 * src/LyXAction.C: insert code for InsetTabular.
7004 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7005 not Button1MotionMask.
7006 (workAreaButtonRelease): send always a InsetButtonRelease event to
7008 (checkInsetHit): some setCursor fixes (always with insets).
7010 * src/BufferView2.C (lockInset): returns a bool now and extended for
7011 locking insets inside insets.
7012 (showLockedInsetCursor): it is important to have the cursor always
7013 before the locked inset.
7014 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7016 * src/BufferView.h: made lockInset return a bool.
7018 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7020 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7021 that is used also internally but can be called as public to have back
7022 a cursor pos which is not set internally.
7023 (SetCursorIntern): Changed to use above function.
7025 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7027 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7032 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7033 patches for things that should be in or should be changed.
7035 * src/* [insetfiles]: change "usigned char fragile" to bool
7036 fragile. There was only one point that could that be questioned
7037 and that is commented in formulamacro.C. Grep for "CHECK".
7039 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7040 (DeleteBuffer): take it out of CutAndPaste and make it static.
7042 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7044 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7045 output the spacing envir commands. Also the new commands used in
7046 the LaTeX output makes the result better.
7048 * src/Spacing.C (writeEnvirBegin): new method
7049 (writeEnvirEnd): new method
7051 2000-04-18 Juergen Vigna <jug@sad.it>
7053 * src/CutAndPaste.C: made textclass a static member of the class
7054 as otherwise it is not accesed right!!!
7056 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7058 * forms/layout_forms.fd
7059 * src/layout_forms.h
7060 * src/layout_forms.C (create_form_form_character)
7061 * src/lyx_cb.C (UserFreeFont)
7062 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7063 documents (in the layout->character popup).
7065 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7067 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7068 \spell_command was in fact not honored (from Kevin Atkinson).
7070 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7073 * src/lyx_gui.h: make lyxViews private (Angus)
7075 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7077 * src/mathed/math_write.C
7078 (MathMatrixInset::Write) Put \protect before \begin{array} and
7079 \end{array} if fragile
7080 (MathParInset::Write): Put \protect before \\ if fragile
7082 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7084 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7085 initialization if the LyXColorHandler must be done after the
7086 connections to the XServer has been established.
7088 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7089 get the background pixel from the lyxColorhandler so that the
7090 figures are rendered with the correct background color.
7091 (NextToken): removed functions.
7092 (GetPSSizes): use ifs >> string instead of NextToken.
7094 * src/Painter.[Ch]: the color cache moved out of this file.
7096 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7099 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7101 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7102 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7104 * src/BufferView.C (enterView): new func
7105 (leaveView): new func
7107 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7109 (leaveView): new func, undefines xterm cursor when approp.
7111 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7112 (AllowInput): delete the Workarea cursor handling from this func.
7114 * src/Painter.C (underline): draw a slimer underline in most cases.
7116 * src/lyx_main.C (error_handler): use extern "C"
7118 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7120 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7121 sent directly to me.
7123 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7124 to the list by Dekel.
7126 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7129 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7130 methods from lyx_cb.here.
7132 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7135 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7137 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7138 instead of using current_view directly.
7140 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7142 * src/LyXAction.C (init): add the paragraph-spacing command.
7144 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7146 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7148 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7149 different from the documents.
7151 * src/text.C (SetHeightOfRow): take paragraph spacing into
7152 account, paragraph spacing takes precedence over buffer spacing
7153 (GetVisibleRow): ditto
7155 * src/paragraph.C (writeFile): output the spacing parameter too.
7156 (validate): set the correct features if spacing is used in the
7158 (Clear): set spacing to default
7159 (MakeSameLayout): spacing too
7160 (HasSameLayout): spacing too
7161 (SetLayout): spacing too
7162 (TeXOnePar): output the spacing commands
7164 * src/lyxparagraph.h: added a spacing variable for use with
7165 per-paragraph spacing.
7167 * src/Spacing.h: add a Default spacing and a method to check if
7168 the current spacing is default. also added an operator==
7170 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7173 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7175 * src/lyxserver.C (callback): fix dispatch of functions
7177 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7178 printf() into lyxerr call.
7180 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7183 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7184 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7185 the "Float" from each of the subitems.
7186 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7188 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7189 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7190 documented the change so that the workaround can be nuked later.
7192 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7195 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7197 * src/buffer.C (getLatexName): ditto
7198 (setReadonly): ditto
7200 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7202 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7203 avoid some uses of current_view. Added also a bufferParams()
7204 method to get at this.
7206 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7208 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7210 * src/lyxparagraph.[Ch]: removed
7211 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7212 with operators used by lower_bound and
7213 upper_bound in InsetTable's
7214 Make struct InsetTable private again. Used matchpos.
7216 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7218 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7219 document, the language of existing text is changed (unless the
7220 document is multi-lingual)
7222 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7224 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7226 * A lot of files: A rewrite of the Right-to-Left support.
7228 2000-04-10 Juergen Vigna <jug@sad.it>
7230 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7231 misplaced cursor when inset in inset is locked.
7233 * src/insets/insettext.C (LocalDispatch): small fix so that a
7234 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7236 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7237 footnote font should be decreased in size twice when displaying.
7239 * src/insets/insettext.C (GetDrawFont): inserted this function as
7240 the drawing-font may differ from the real paragraph font.
7242 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7243 insets (inset in inset!).
7245 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7246 function here because we don't want footnotes inside footnotes.
7248 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7250 (init): now set the inset_owner in paragraph.C
7251 (LocalDispatch): added some resetPos() in the right position
7254 (pasteSelection): changed to use the new CutAndPaste-Class.
7256 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7257 which tells if it is allowed to insert another inset inside this one.
7259 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7260 SwitchLayoutsBetweenClasses.
7262 * src/text2.C (InsertInset): checking of the new paragraph-function
7264 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7265 is not needed anymore here!
7268 (PasteSelection): redone (also with #ifdef) so that now this uses
7269 the CutAndPaste-Class.
7270 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7273 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7274 from/to text/insets.
7276 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7277 so that the paragraph knows if it is inside an (text)-inset.
7278 (InsertFromMinibuffer): changed return-value to bool as now it
7279 may happen that an inset is not inserted in the paragraph.
7280 (InsertInsetAllowed): this checks if it is allowed to insert an
7281 inset in this paragraph.
7283 (BreakParagraphConservative):
7284 (BreakParagraph) : small change for the above change of the return
7285 value of InsertFromMinibuffer.
7287 * src/lyxparagraph.h: added inset_owner and the functions to handle
7288 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7290 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7292 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7293 functions from BufferView to BufferView::Pimpl to ease maintence.
7295 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7296 correctly. Also use SetCursorIntern instead of SetCursor.
7298 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7301 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7303 * src/WorkArea.C (belowMouse): manually implement below mouse.
7305 * src/*: Add "explicit" on several constructors, I added probably
7306 some unneeded ones. A couple of changes to code because of this.
7308 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7309 implementation and private parts from the users of BufferView. Not
7312 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7313 implementation and private parts from the users of LyXLex. Not
7316 * src/BufferView_pimpl.[Ch]: new files
7318 * src/lyxlex_pimpl.[Ch]: new files
7320 * src/LyXView.[Ch]: some inline functions move out-of-line
7322 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7324 * src/lyxparagraph.h: make struct InsetTable public.
7326 * src/support/lyxstring.h: change lyxstring::difference_type to be
7327 ptrdiff_t. Add std:: modifiers to streams.
7329 * src/font.C: include the <cctype> header, for islower() and
7332 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7334 * src/font.[Ch]: new files. Contains the metric functions for
7335 fonts, takes a LyXFont as parameter. Better separation of concepts.
7337 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7338 changes because of this.
7340 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7342 * src/*: compile with -Winline and move functions that don't
7345 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7348 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7350 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7351 (various files changed because of this)
7353 * src/Painter.C (text): fixed the drawing of smallcaps.
7355 * src/lyxfont.[Ch] (drawText): removed unused member func.
7358 * src/*.C: added needed "using" statements and "std::" qualifiers.
7360 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7362 * src/*.h: removed all use of "using" from header files use
7363 qualifier std:: instead.
7365 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7367 * src/text.C (Backspace): some additional cleanups (we already
7368 know whether cursor.pos is 0 or not).
7370 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7371 automake does not provide one).
7373 * src/bmtable.h: replace C++ comments with C comments.
7375 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7377 * src/screen.C (ShowCursor): Change the shape of the cursor if
7378 the current language is not equal to the language of the document.
7379 (If the cursor change its shape unexpectedly, then you've found a bug)
7381 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7384 * src/insets/insetnumber.[Ch]: New files.
7386 * src/LyXAction.C (init)
7387 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7390 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7392 * src/lyxparagraph.h
7393 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7394 (the vector is kept sorted).
7396 * src/text.C (GetVisibleRow): Draw selection correctly when there
7397 is both LTR and RTL text.
7399 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7400 which is much faster.
7402 * src/text.C (GetVisibleRow and other): Do not draw the last space
7403 in a row if the direction of the last letter is not equal to the
7404 direction of the paragraph.
7406 * src/lyxfont.C (latexWriteStartChanges):
7407 Check that font language is not equal to basefont language.
7408 (latexWriteEndChanges): ditto
7410 * src/lyx_cb.C (StyleReset): Don't change the language while using
7411 the font-default command.
7413 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7414 empty paragraph before a footnote.
7416 * src/insets/insetcommand.C (draw): Increase x correctly.
7418 * src/screen.C (ShowCursor): Change cursor shape if
7419 current language != document language.
7421 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7423 2000-03-31 Juergen Vigna <jug@sad.it>
7425 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7426 (Clone): changed mode how the paragraph-data is copied to the
7427 new clone-paragraph.
7429 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7430 GetInset(pos) with no inset anymore there (in inset UNDO)
7432 * src/insets/insetcommand.C (draw): small fix as here x is
7433 incremented not as much as width() returns (2 before, 2 behind = 4)
7435 2000-03-30 Juergen Vigna <jug@sad.it>
7437 * src/insets/insettext.C (InsetText): small fix in initialize
7438 widthOffset (should not be done in the init() function)
7440 2000-03-29 Amir Karger <karger@lyx.org>
7442 * lib/examples/it_ItemizeBullets.lyx: translation by
7445 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7447 2000-03-29 Juergen Vigna <jug@sad.it>
7449 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7451 * src/insets/insetfoot.C (Clone): small change as for the below
7452 new init function in the text-inset
7454 * src/insets/insettext.C (init): new function as I've seen that
7455 clone did not copy the Paragraph-Data!
7456 (LocalDispatch): Added code so that now we have some sort of Undo
7457 functionality (well actually we HAVE Undo ;)
7459 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7461 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7463 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7466 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7468 * src/main.C: added a runtime check that verifies that the xforms
7469 header used when building LyX and the library used when running
7470 LyX match. Exit with a message if they don't match. This is a
7471 version number check only.
7473 * src/buffer.C (save): Don't allocate memory on the heap for
7474 struct utimbuf times.
7476 * *: some using changes, use iosfwd instead of the real headers.
7478 * src/lyxfont.C use char const * instead of string for the static
7479 strings. Rewrite some functions to use sstream.
7481 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7483 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7486 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7488 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7489 of Geodesy (from Martin Vermeer)
7491 * lib/layouts/svjour.inc: include file for the Springer svjour
7492 class. It can be used to support journals other than JoG.
7494 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7495 Miskiewicz <misiek@pld.org.pl>)
7496 * lib/reLyX/Makefile.am: ditto.
7498 2000-03-27 Juergen Vigna <jug@sad.it>
7500 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7501 also some modifications with operations on selected text.
7503 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7504 problems with clicking on insets (last famous words ;)
7506 * src/insets/insetcommand.C (draw):
7507 (width): Changed to have a bit of space before and after the inset so
7508 that the blinking cursor can be seen (otherwise it was hidden)
7510 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7512 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7513 would not be added to the link list when an installed gettext (not
7514 part of libc) is found.
7516 2000-03-24 Juergen Vigna <jug@sad.it>
7518 * src/insets/insetcollapsable.C (Edit):
7519 * src/mathed/formula.C (InsetButtonRelease):
7520 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7523 * src/BufferView.C (workAreaButtonPress):
7524 (workAreaButtonRelease):
7525 (checkInsetHit): Finally fixed the clicking on insets be handled
7528 * src/insets/insetert.C (Edit): inserted this call so that ERT
7529 insets work always with LaTeX-font
7531 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7533 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7534 caused lyx to startup with no GUI in place, causing in a crash
7535 upon startup when called with arguments.
7537 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7539 * src/FontLoader.C: better initialization of dummyXFontStruct.
7541 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7543 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7544 for linuxdoc and docbook import and export format options.
7546 * lib/lyxrc.example Example of default values for the previous flags.
7548 * src/lyx_cb.C Use those flags instead of the hardwired values for
7549 linuxdoc and docbook export.
7551 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7554 * src/menus.C Added menus entries for the new import/exports formats.
7556 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7558 * src/lyxrc.*: Added support for running without Gui
7561 * src/FontLoader.C: sensible defaults if no fonts are needed
7563 * src/lyx_cb.C: New function ShowMessage (writes either to the
7564 minibuffer or cout in case of no gui
7565 New function AskOverwrite for common stuff
7566 Consequently various changes to call these functions
7568 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7569 wild guess at sensible screen resolution when having no gui
7571 * src/lyxfont.C: no gui, no fonts... set some defaults
7573 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7575 * src/LColor.C: made the command inset background a bit lighter.
7577 2000-03-20 Hartmut Goebel <goebel@noris.net>
7579 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7580 stdstruct.inc. Koma-Script added some title elements which
7581 otherwise have been listed below "bibliography". This split allows
7582 adding title elements to where they belong.
7584 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7585 define the additional title elements and then include
7588 * many other layout files: changed to include stdtitle.inc just
7589 before stdstruct.inc.
7591 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7593 * src/buffer.C: (save) Added the option to store all backup files
7594 in a single directory
7596 * src/lyxrc.[Ch]: Added variable \backupdir_path
7598 * lib/lyxrc.example: Added descriptions of recently added variables
7600 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7601 bibtex inset, not closing the bibtex popup when deleting the inset)
7603 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7605 * src/lyx_cb.C: add a couple using directives.
7607 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7608 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7609 import based on the filename.
7611 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7612 file would be imported at start, if the filename where of a sgml file.
7614 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7616 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7618 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7619 * src/lyxfont.h Replaced the member variable bits.direction by the
7620 member variable lang. Made many changes in other files.
7621 This allows having a multi-lingual document
7623 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7624 that change the current language to <l>.
7625 Removed the command "font-rtl"
7627 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7628 format for Hebrew documents)
7630 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7631 When auto_mathmode is "true", pressing a digit key in normal mode
7632 will cause entering into mathmode.
7633 If auto_mathmode is "rtl" then this behavior will be active only
7634 when writing right-to-left text.
7636 * src/text2.C (InsertStringA) The string is inserted using the
7639 * src/paragraph.C (GetEndLabel) Gives a correct result for
7640 footnote paragraphs.
7642 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7644 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7646 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7647 front of PasteParagraph. Never insert a ' '. This should at least
7648 fix some cause for the segfaults that we have been experiencing,
7649 it also fixes backspace behaviour slightly. (Phu!)
7651 * src/support/lstrings.C (compare_no_case): some change to make it
7652 compile with gcc 2.95.2 and stdlibc++-v3
7654 * src/text2.C (MeltFootnoteEnvironment): change type o
7655 first_footnote_par_is_not_empty to bool.
7657 * src/lyxparagraph.h: make text private. Changes in other files
7659 (fitToSize): new function
7660 (setContentsFromPar): new function
7661 (clearContents): new function
7662 (SetChar): new function
7664 * src/paragraph.C (readSimpleWholeFile): deleted.
7666 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7667 the file, just use a simple string instead. Also read the file in
7668 a more maintainable manner.
7670 * src/text2.C (InsertStringA): deleted.
7671 (InsertStringB): deleted.
7673 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7675 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7676 RedoParagraphs from the doublespace handling part, just set status
7677 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7678 done, but perhaps not like this.)
7680 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7682 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7683 character when inserting an inset.
7685 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7687 * src/bufferparams.C (readLanguage): now takes "default" into
7690 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7691 also initialize the toplevel_keymap with the default bindings from
7694 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7696 * all files using lyxrc: have lyxrc as a real variable and not a
7697 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7700 * src/lyxrc.C: remove double call to defaultKeyBindings
7702 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7703 toolbar defauls using lyxlex. Remove enums, structs, functions
7706 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7707 toolbar defaults. Also store default keybindings in a map.
7709 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7710 storing the toolbar defaults without any xforms dependencies.
7712 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7713 applied. Changed to use iterators.
7715 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7717 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7718 systems that don't have LINGUAS set to begin with.
7720 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7722 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7723 the list by Dekel Tsur.
7725 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7727 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7728 * src/insets/form_graphics.C: ditto.
7730 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7732 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7734 * src/bufferparams.C (readLanguage): use the new language map
7736 * src/intl.C (InitKeyMapper): use the new language map
7738 * src/lyx_gui.C (create_forms): use the new language map
7740 * src/language.[Ch]: New files. Used for holding the information
7741 about each language. Now! Use this new language map enhance it and
7742 make it really usable for our needs.
7744 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7746 * screen.C (ShowCursor): Removed duplicate code.
7747 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7748 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7750 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7753 * src/text.C Added TransformChar method. Used for rendering Arabic
7754 text correctly (change the glyphs of the letter according to the
7755 position in the word)
7760 * src/lyxrc.C Added lyxrc command {language_command_begin,
7761 language_command_end,language_command_ltr,language_command_rtl,
7762 language_package} which allows the use of either arabtex or Omega
7765 * src/lyx_gui.C (init)
7767 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7768 to use encoding for menu fonts which is different than the encoding
7771 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7772 do not load the babel package.
7773 To write an English document with Hebrew/Arabic, change the document
7774 language to "english".
7776 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7777 (alphaCounter): changed to return char
7778 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7780 * lib/lyxrc.example Added examples for Hebrew/Arabic
7783 * src/layout.C Added layout command endlabeltype
7785 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7787 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7789 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7791 * src/mathed/math_delim.C (search_deco): return a
7792 math_deco_struct* instead of index.
7794 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7796 * All files with a USE_OSTREAM_ONLY within: removed all code that
7797 was unused when USE_OSTREAM_ONLY is defined.
7799 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7800 of any less. Removed header and using.
7802 * src/text.C (GetVisibleRow): draw the string "Page Break
7803 (top/bottom)" on screen when drawing a pagebreak line.
7805 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7807 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7809 * src/mathed/math_macro.C (draw): do some cast magic.
7812 * src/mathed/math_defs.h: change byte* argument to byte const*.
7814 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7816 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7817 know it is right to return InsetFoot* too, but cxx does not like
7820 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7822 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7824 * src/mathed/math_delim.C: change == to proper assignment.
7826 2000-03-09 Juergen Vigna <jug@sad.it>
7828 * src/insets/insettext.C (setPos): fixed various cursor positioning
7829 problems (via mouse and cursor-keys)
7830 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7831 inset (still a small display problem but it works ;)
7833 * src/insets/insetcollapsable.C (draw): added button_top_y and
7834 button_bottom_y to have correct values for clicking on the inset.
7836 * src/support/lyxalgo.h: commented out 'using std::less'
7838 2000-03-08 Juergen Vigna <jug@sad.it>
7840 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7841 Button-Release event closes as it is alos the Release-Event
7844 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7846 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7848 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7849 can add multiple spaces in Scrap (literate programming) styles...
7850 which, by the way, is how I got hooked on LyX to begin with.
7852 * src/mathed/formula.C (Write): Added dummy variable to an
7853 inset::Latex() call.
7854 (Latex): Add free_spacing boolean to inset::Latex()
7856 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7858 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7859 virtual function to include the free_spacing boolean from
7860 the containing paragraph's style.
7862 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7863 Added free_spacing boolean arg to match inset.h
7865 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7866 Added free_spacing boolean arg to match inset.h
7868 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7869 Added free_spacing boolean and made sure that if in a free_spacing
7870 paragraph, that we output normal space if there is a protected space.
7872 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7873 Added free_spacing boolean arg to match inset.h
7875 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7876 Added free_spacing boolean arg to match inset.h
7878 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7879 Added free_spacing boolean arg to match inset.h
7881 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7882 Added free_spacing boolean arg to match inset.h
7884 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7885 Added free_spacing boolean arg to match inset.h
7887 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7888 free_spacing boolean arg to match inset.h
7890 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7891 Added free_spacing boolean arg to match inset.h
7893 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7894 Added free_spacing boolean arg to match inset.h
7896 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7897 Added free_spacing boolean arg to match inset.h
7899 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7900 Added free_spacing boolean arg to match inset.h
7902 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7903 Added free_spacing boolean arg to match inset.h
7905 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7906 free_spacing boolean arg to match inset.h
7908 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7909 free_spacing boolean arg to match inset.h
7911 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7912 ignore free_spacing paragraphs. The user's spaces are left
7915 * src/text.C (InsertChar): Fixed the free_spacing layout
7916 attribute behavior. Now, if free_spacing is set, you can
7917 add multiple spaces in a paragraph with impunity (and they
7918 get output verbatim).
7919 (SelectSelectedWord): Added dummy argument to inset::Latex()
7922 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7925 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7926 paragraph layouts now only input a simple space instead.
7927 Special character insets don't make any sense in free-spacing
7930 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7931 hard-spaces in the *input* file to simple spaces if the layout
7932 is free-spacing. This converts old files which had to have
7933 hard-spaces in free-spacing layouts where a simple space was
7935 (writeFileAscii): Added free_spacing check to pass to the newly
7936 reworked inset::Latex(...) methods. The inset::Latex() code
7937 ensures that hard-spaces in free-spacing paragraphs get output
7938 as spaces (rather than "~").
7940 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7942 * src/mathed/math_delim.C (draw): draw the empty placeholder
7943 delims with a onoffdash line.
7944 (struct math_deco_compare): struct that holds the "functors" used
7945 for the sort and the binary search in math_deco_table.
7946 (class init_deco_table): class used for initial sort of the
7948 (search_deco): use lower_bound to do a binary search in the
7951 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7953 * src/lyxrc.C: a small secret thingie...
7955 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7956 and to not flush the stream as often as it used to.
7958 * src/support/lyxalgo.h: new file
7959 (sorted): template function used for checking if a sequence is
7960 sorted or not. Two versions with and without user supplied
7961 compare. Uses same compare as std::sort.
7963 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7964 it and give warning on lyxerr.
7966 (struct compare_tags): struct with function operators used for
7967 checking if sorted, sorting and lower_bound.
7968 (search_kw): use lower_bound instead of manually implemented
7971 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7973 * src/insets/insetcollapsable.h: fix Clone() declaration.
7974 * src/insets/insetfoot.h: ditto.
7976 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7978 2000-03-08 Juergen Vigna <jug@sad.it>
7980 * src/insets/lyxinset.h: added owner call which tells us if
7981 this inset is inside another inset. Changed also the return-type
7982 of Editable to an enum so it tells clearer what the return-value is.
7984 * src/insets/insettext.C (computeTextRows): fixed computing of
7985 textinsets which split automatically on more rows.
7987 * src/insets/insetert.[Ch]: changed this to be of BaseType
7990 * src/insets/insetfoot.[Ch]: added footnote inset
7992 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7993 collapsable insets (like footnote, ert, ...)
7995 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7997 * src/lyxdraw.h: remvoe file
7999 * src/lyxdraw.C: remove file
8001 * src/insets/insettext.C: added <algorithm>.
8003 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8005 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8006 (matrix_cb): case MM_OK use string stream
8008 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8011 * src/mathed/math_macro.C (draw): use string stream
8012 (Metrics): use string stream
8014 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8015 directly to the ostream.
8017 * src/vspace.C (asString): use string stream.
8018 (asString): use string stream
8019 (asLatexString): use string stream
8021 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8022 setting Spacing::Other.
8024 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8025 sprintf when creating the stretch vale.
8027 * src/text2.C (alphaCounter): changed to return a string and to
8028 not use a static variable internally. Also fixed a one-off bug.
8029 (SetCounter): changed the drawing of the labels to use string
8030 streams instead of sprintf.
8032 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8033 manipulator to use a scheme that does not require library support.
8034 This is also the way it is done in the new GNU libstdc++. Should
8035 work with DEC cxx now.
8037 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8039 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8040 end. This fixes a bug.
8042 * src/mathed (all files concerned with file writing): apply the
8043 USE_OSTREAM_ONLY changes to mathed too.
8045 * src/support/DebugStream.h: make the constructor explicit.
8047 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8048 count and ostream squashed.
8050 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8052 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8054 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8055 ostringstream uses STL strings, and we might not.
8057 * src/insets/insetspecialchar.C: add using directive.
8058 * src/insets/insettext.C: ditto.
8060 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8062 * lib/layouts/seminar.layout: feeble attempt at a layout for
8063 seminar.cls, far from completet and could really use some looking
8064 at from people used to write layout files.
8066 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8067 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8068 a lot nicer and works nicely with ostreams.
8070 * src/mathed/formula.C (draw): a slightly different solution that
8071 the one posted to the list, but I think this one works too. (font
8072 size wrong in headers.)
8074 * src/insets/insettext.C (computeTextRows): some fiddling on
8075 Jürgens turf, added some comments that he should read.
8077 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8078 used and it gave compiler warnings.
8079 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8082 * src/lyx_gui.C (create_forms): do the right thing when
8083 show_banner is true/false.
8085 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8086 show_banner is false.
8088 * most file writing files: Now use iostreams to do almost all of
8089 the writing. Also instead of passing string &, we now use
8090 stringstreams. mathed output is still not adapted to iostreams.
8091 This change can be turned off by commenting out all the occurences
8092 of the "#define USE_OSTREAM_ONLY 1" lines.
8094 * src/WorkArea.C (createPixmap): don't output debug messages.
8095 (WorkArea): don't output debug messages.
8097 * lib/lyxrc.example: added a comment about the new variable
8100 * development/Code_rules/Rules: Added some more commente about how
8101 to build class interfaces and on how better encapsulation can be
8104 2000-03-03 Juergen Vigna <jug@sad.it>
8106 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8107 automatically with the width of the LyX-Window
8109 * src/insets/insettext.C (computeTextRows): fixed update bug in
8110 displaying text-insets (scrollvalues where not initialized!)
8112 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8114 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8115 id in the check of the result from lower_bound is not enough since
8116 lower_bound can return last too, and then res->id will not be a
8119 * all insets and some code that use them: I have conditionalized
8120 removed the Latex(string & out, ...) this means that only the
8121 Latex(ostream &, ...) will be used. This is a work in progress to
8122 move towards using streams for all output of files.
8124 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8127 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8129 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8130 routine (this fixes bug where greek letters were surrounded by too
8133 * src/support/filetools.C (findtexfile): change a bit the search
8134 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8135 no longer passed to kpsewhich, we may have to change that later.
8137 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8138 warning options to avoid problems with X header files (from Angus
8140 * acinclude.m4: regenerated.
8142 2000-03-02 Juergen Vigna <jug@sad.it>
8144 * src/insets/insettext.C (WriteParagraphData): Using the
8145 par->writeFile() function for writing paragraph-data.
8146 (Read): Using buffer->parseSingleLyXformat2Token()-function
8147 for parsing paragraph data!
8149 * src/buffer.C (readLyXformat2): removed all parse data and using
8150 the new parseSingleLyXformat2Token()-function.
8151 (parseSingleLyXformat2Token): added this function to parse (read)
8152 lyx-file-format (this is called also from text-insets now!)
8154 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8156 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8159 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8160 directly instead of going through a func. One very bad thing: a
8161 static LyXFindReplace, but I don't know where to place it.
8163 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8164 string instead of char[]. Also changed to static.
8165 (GetSelectionOrWordAtCursor): changed to static inline
8166 (SetSelectionOverLenChars): ditto.
8168 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8169 current_view and global variables. both classes has changed names
8170 and LyXFindReplace is not inherited from SearchForm.
8172 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8173 fl_form_search form.
8175 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8177 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8179 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8180 bound (from Kayvan).
8182 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8184 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8186 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8188 * some things that I should comment but the local pub says head to
8191 * comment out all code that belongs to the Roff code for Ascii
8192 export of tables. (this is unused)
8194 * src/LyXView.C: use correct type for global variable
8195 current_layout. (LyXTextClass::size_type)
8197 * some code to get the new insetgraphics closer to working I'd be
8198 grateful for any help.
8200 * src/BufferView2.C (insertInset): use the return type of
8201 NumberOfLayout properly. (also changes in other files)
8203 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8204 this as a test. I want to know what breaks because of this.
8206 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8208 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8210 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8211 to use a \makebox in the label, this allows proper justification
8212 with out using protected spaces or multiple hfills. Now it is
8213 "label" for left justified, "\hfill label\hfill" for center, and
8214 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8215 should be changed accordingly.
8217 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8219 * src/lyxtext.h: change SetLayout() to take a
8220 LyXTextClass::size_type instead of a char (when there is more than
8221 127 layouts in a class); also change type of copylayouttype.
8222 * src/text2.C (SetLayout): ditto.
8223 * src/LyXView.C (updateLayoutChoice): ditto.
8225 * src/LaTeX.C (scanLogFile): errors where the line number was not
8226 given just after the '!'-line were ignored (from Dekel Tsur).
8228 * lib/lyxrc.example: fix description of \date_insert_format
8230 * lib/layouts/llncs.layout: new layout, contributed by Martin
8233 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8235 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8236 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8237 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8238 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8239 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8240 paragraph.C, text.C, text2.C)
8242 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8244 * src/insets/insettext.C (LocalDispatch): remove extra break
8247 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8248 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8250 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8251 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8253 * src/insets/insetbib.h: move InsetBibkey::Holder and
8254 InsetCitation::Holder in public space.
8256 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8258 * src/insets/insettext.h: small change to get the new files from
8259 Juergen to compile (use "string", not "class string").
8261 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8262 const & as parameter to LocalDispatch, use LyXFont const & as
8263 paramter to some other func. This also had impacto on lyxinsets.h
8264 and the two mathed insets.
8266 2000-02-24 Juergen Vigna <jug@sad.it>
8269 * src/commandtags.h:
8271 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8275 * src/BufferView2.C: added/updated code for various inset-functions
8277 * src/insets/insetert.[Ch]: added implementation of InsetERT
8279 * src/insets/insettext.[Ch]: added implementation of InsetText
8281 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8282 (draw): added preliminary code for inset scrolling not finshed yet
8284 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8285 as it is in lyxfunc.C now
8287 * src/insets/lyxinset.h: Added functions for text-insets
8289 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8291 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8292 BufferView and reimplement the list as a queue put inside its own
8295 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8297 * several files: use the new interface to the "updateinsetlist"
8299 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8301 (work_area_handler): call BufferView::trippleClick on trippleclick.
8303 * src/BufferView.C (doubleClick): new function, selects word on
8305 (trippleClick): new function, selects line on trippleclick.
8307 2000-02-22 Allan Rae <rae@lyx.org>
8309 * lib/bind/xemacs.bind: buffer-previous not supported
8311 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8313 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8316 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8318 * src/bufferlist.C: get rid of current_view from this file
8320 * src/spellchecker.C: get rid of current_view from this file
8322 * src/vspace.C: get rid of current_view from this file
8323 (inPixels): added BufferView parameter for this func
8324 (asLatexCommand): added a BufferParams for this func
8326 * src/text.C src/text2.C: get rid of current_view from these
8329 * src/lyxfont.C (getFontDirection): move this function here from
8332 * src/bufferparams.C (getDocumentDirection): move this function
8335 * src/paragraph.C (getParDirection): move this function here from
8337 (getLetterDirection): ditto
8339 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8341 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8342 resize due to wrong pixmap beeing used. Also took the opurtunity
8343 to make the LyXScreen stateless on regard to WorkArea and some
8344 general cleanup in the same files.
8346 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8348 * src/Makefile.am: add missing direction.h
8350 * src/PainterBase.h: made the width functions const.
8352 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8355 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8357 * src/insets/insetlatexaccent.C (draw): make the accents draw
8358 better, at present this will only work well with iso8859-1.
8360 * several files: remove the old drawing code, now we use the new
8363 * several files: remove support for mono_video, reverse_video and
8366 2000-02-17 Juergen Vigna <jug@sad.it>
8368 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8369 int ** as we have to return the pointer, otherwise we have only
8370 NULL pointers in the returning function.
8372 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8374 * src/LaTeX.C (operator()): quote file name when running latex.
8376 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8378 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8379 (bubble tip), this removes our special handling of this.
8381 * Remove all code that is unused now that we have the new
8382 workarea. (Code that are not active when NEW_WA is defined.)
8384 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8386 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8388 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8389 nonexisting layout; correctly redirect obsoleted layouts.
8391 * lib/lyxrc.example: document \view_dvi_paper_option
8393 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8396 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8397 (PreviewDVI): handle the view_dvi_paper_option variable.
8398 [Both from Roland Krause]
8400 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8402 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8403 char const *, int, LyXFont)
8404 (text(int, int, string, LyXFont)): ditto
8406 * src/text.C (InsertCharInTable): attempt to fix the double-space
8407 feature in tables too.
8408 (BackspaceInTable): ditto.
8409 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8411 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8413 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8415 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8416 newly found text in textcache to this.
8417 (buffer): set the owner of the text put into the textcache to 0
8419 * src/insets/figinset.C (draw): fixed the drawing of figures with
8422 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8423 drawing of mathframe, hfills, protected space, table lines. I have
8424 now no outstanding drawing problems with the new Painter code.
8426 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8428 * src/PainterBase.C (ellipse, circle): do not specify the default
8431 * src/LColor.h: add using directive.
8433 * src/Painter.[Ch]: change return type of methods from Painter& to
8434 PainterBase&. Add a using directive.
8436 * src/WorkArea.C: wrap xforms callbacks in C functions
8439 * lib/layouts/foils.layout: font fix and simplifications from Carl
8442 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8444 * a lot of files: The Painter, LColor and WorkArea from the old
8445 devel branch has been ported to lyx-devel. Some new files and a
8446 lot of #ifdeffed code. The new workarea is enabled by default, but
8447 if you want to test the new Painter and LColor you have to compile
8448 with USE_PAINTER defined (do this in config.h f.ex.) There are
8449 still some rought edges, and I'd like some help to clear those
8450 out. It looks stable (loads and displays the Userguide very well).
8453 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8455 * src/buffer.C (pop_tag): revert to the previous implementation
8456 (use a global variable for both loops).
8458 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8460 * src/lyxrc.C (LyXRC): change slightly default date format.
8462 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8463 there is an English text with a footnote that starts with a Hebrew
8464 paragraph, or vice versa.
8465 (TeXFootnote): ditto.
8467 * src/text.C (LeftMargin): allow for negative values for
8468 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8471 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8472 for input encoding (cyrillic)
8474 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8476 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8479 * src/toolbar.C (set): ditto
8480 * src/insets/insetbib.C (create_form_citation_form): ditto
8482 * lib/CREDITS: added Dekel Tsur.
8484 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8485 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8486 hebrew supports files from Dekel Tsur.
8488 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8489 <tzafrir@technion.ac.il>
8491 * src/lyxrc.C: put \date_insert_format at the right place.
8493 * src/buffer.C (makeLaTeXFile): fix the handling of
8494 BufferParams::sides when writing out latex files.
8496 * src/BufferView2.C: add a "using" directive.
8498 * src/support/lyxsum.C (sum): when we use lyxstring,
8499 ostringstream::str needs an additional .c_str().
8501 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8503 * src/support/filetools.C (ChangeExtension): patch from Etienne
8506 * src/TextCache.C (show): remove const_cast and make second
8507 parameter non-const LyXText *.
8509 * src/TextCache.h: use non const LyXText in show.
8511 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8514 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8516 * src/support/lyxsum.C: rework to be more flexible.
8518 * several places: don't check if a pointer is 0 if you are going
8521 * src/text.C: remove some dead code.
8523 * src/insets/figinset.C: remove some dead code
8525 * src/buffer.C: move the BufferView funcs to BufferView2.C
8526 remove all support for insetlatexdel
8527 remove support for oldpapersize stuff
8528 made some member funcs const
8530 * src/kbmap.C: use a std::list to store the bindings in.
8532 * src/BufferView2.C: new file
8534 * src/kbsequence.[Ch]: new files
8536 * src/LyXAction.C + others: remove all trace of buffer-previous
8538 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8539 only have one copy in the binary of this table.
8541 * hebrew patch: moved some functions from LyXText to more
8542 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8544 * several files: remove support for XForms older than 0.88
8546 remove some #if 0 #endif code
8548 * src/TextCache.[Ch]: new file. Holds the textcache.
8550 * src/BufferView.C: changes to use the new TextCache interface.
8551 (waitForX): remove the now unused code.
8553 * src/BackStack.h: remove some commented code
8555 * lib/bind/emacs.bind: remove binding for buffer-previous
8557 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8559 * applied the hebrew patch.
8561 * src/lyxrow.h: make sure that all Row variables are initialized.
8563 * src/text2.C (TextHandleUndo): comment out a delete, this might
8564 introduce a memory leak, but should also help us to not try to
8565 read freed memory. We need to look at this one.
8567 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8568 (LyXParagraph): initalize footnotekind.
8570 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8571 forgot this when applying the patch. Please heed the warnings.
8573 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8574 (aka. reformat problem)
8576 * src/bufferlist.C (exists): made const, and use const_iterator
8577 (isLoaded): new func.
8578 (release): use std::find to find the correct buffer.
8580 * src/bufferlist.h: made getState a const func.
8581 made empty a const func.
8582 made exists a const func.
8585 2000-02-01 Juergen Vigna <jug@sad.it>
8587 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8589 * po/it.po: updated a bit the italian po file and also changed the
8590 'file nuovo' for newfile to 'filenuovo' without a space, this did
8593 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8594 for the new insert_date command.
8596 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8597 from jdblair, to insert a date into the current text conforming to
8598 a strftime format (for now only considering the locale-set and not
8599 the document-language).
8601 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8603 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8604 Bounds Read error seen by purify. The problem was that islower is
8605 a macros which takes an unsigned char and uses it as an index for
8606 in array of characters properties (and is thus subject to the
8610 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8611 correctly the paper sides radio buttons.
8612 (UpdateDocumentButtons): ditto.
8614 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8616 * src/kbmap.C (getsym + others): change to return unsigned int,
8617 returning a long can give problems on 64 bit systems. (I assume
8618 that int is 32bit on 64bit systems)
8620 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8622 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8623 LyXLookupString to be zero-terminated. Really fixes problems seen
8626 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8628 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8629 write a (char*)0 to the lyxerr stream.
8631 * src/lastfiles.C: move algorithm before the using statemets.
8633 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8635 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8636 complains otherwise).
8637 * src/table.C: ditto
8639 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8642 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8643 that I removed earlier... It is really needed.
8645 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8647 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8649 * INSTALL: update xforms home page URL.
8651 * lib/configure.m4: fix a bug with unreadable layout files.
8653 * src/table.C (calculate_width_of_column): add "using std::max"
8656 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8658 * several files: marked several lines with "DEL LINE", this is
8659 lines that can be deleted without changing anything.
8660 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8661 checks this anyway */
8664 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8666 * src/DepTable.C (update): add a "+" at the end when the checksum
8667 is different. (debugging string only)
8669 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8670 the next inset to not be displayed. This should also fix the list
8671 of labels in the "Insert Crossreference" dialog.
8673 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8675 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8676 when regex was not found.
8678 * src/support/lstrings.C (lowercase): use handcoded transform always.
8681 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8682 old_cursor.par->prev could be 0.
8684 * several files: changed post inc/dec to pre inc/dec
8686 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8687 write the lastfiles to file.
8689 * src/BufferView.C (buffer): only show TextCache info when debugging
8691 (resizeCurrentBuffer): ditto
8692 (workAreaExpose): ditto
8694 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8696 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8698 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8699 a bit better by removing the special case for \i and \j.
8701 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8703 * src/lyx_main.C (easyParse): remove test for bad comand line
8704 options, since this broke all xforms-related parsing.
8706 * src/kbmap.C (getsym): set return type to unsigned long, as
8707 declared in header. On an alpha, long is _not_ the same as int.
8709 * src/support/LOstream.h: add a "using std::flush;"
8711 * src/insets/figinset.C: ditto.
8713 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8715 * src/bufferlist.C (write): use blinding fast file copy instead of
8716 "a char at a time", now we are doing it the C++ way.
8718 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8719 std::list<int> instead.
8720 (addpidwait): reflect move to std::list<int>
8721 (sigchldchecker): ditto
8723 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8726 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8727 that obviously was wrong...
8729 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8730 c, this avoids warnings with purify and islower.
8732 * src/insets/figinset.C: rename struct queue to struct
8733 queue_element and rewrite to use a std::queue. gsqueue is now a
8734 std::queue<queue_element>
8735 (runqueue): reflect move to std::queue
8738 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8739 we would get "1" "0" instead of "true" "false. Also make the tostr
8742 2000-01-21 Juergen Vigna <jug@sad.it>
8744 * src/buffer.C (writeFileAscii): Disabled code for special groff
8745 handling of tabulars till I fix this in table.C
8747 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8749 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8751 * src/support/lyxlib.h: ditto.
8753 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8755 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8756 and 'j' look better. This might fix the "macron" bug that has been
8759 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8760 functions as one template function. Delete the old versions.
8762 * src/support/lyxsum.C: move using std::ifstream inside
8765 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8768 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8770 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8772 * src/insets/figinset.C (InitFigures): use new instead of malloc
8773 to allocate memory for figures and bitmaps.
8774 (DoneFigures): use delete[] instead of free to deallocate memory
8775 for figures and bitmaps.
8776 (runqueue): use new to allocate
8777 (getfigdata): use new/delete[] instead of malloc/free
8778 (RegisterFigure): ditto
8780 * some files: moved some declarations closer to first use, small
8781 whitespace changes use preincrement instead of postincrement where
8782 it does not make a difference.
8784 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8785 step on the way to use stl::containers for key maps.
8787 * src/bufferlist.h: add a typedef for const_iterator and const
8788 versions of begin and end.
8790 * src/bufferlist.[Ch]: change name of member variable _state to
8791 state_. (avoid reserved names)
8793 (getFileNames): returns the filenames of the buffers in a vector.
8795 * configure.in (ALL_LINGUAS): added ro
8797 * src/support/putenv.C: new file
8799 * src/support/mkdir.C: new file
8801 2000-01-20 Allan Rae <rae@lyx.org>
8803 * lib/layouts/IEEEtran.layout: Added several theorem environments
8805 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8806 couple of minor additions.
8808 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8809 (except for those in footnotes of course)
8811 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8813 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8815 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8816 std::sort and std::lower_bound instead of qsort and handwritten
8818 (struct compara): struct that holds the functors used by std::sort
8819 and std::lower_bound in MathedLookupBOP.
8821 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8823 * src/support/LAssert.h: do not do partial specialization. We do
8826 * src/support/lyxlib.h: note that lyx::getUserName() and
8827 lyx::date() are not in use right now. Should these be suppressed?
8829 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8830 (makeLinuxDocFile): do not put date and user name in linuxdoc
8833 * src/support/lyxlib.h (kill): change first argument to long int,
8834 since that's what solaris uses.
8836 * src/support/kill.C (kill): fix declaration to match prototype.
8838 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8839 actually check whether namespaces are supported. This is not what
8842 * src/support/lyxsum.C: add a using directive.
8844 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8846 * src/support/kill.C: if we have namespace support we don't have
8847 to include lyxlib.h.
8849 * src/support/lyxlib.h: use namespace lyx if supported.
8851 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8853 * src/support/date.C: new file
8855 * src/support/chdir.C: new file
8857 * src/support/getUserName.C: new file
8859 * src/support/getcwd.C: new file
8861 * src/support/abort.C: new file
8863 * src/support/kill.C: new file
8865 * src/support/lyxlib.h: moved all the functions in this file
8866 insede struct lyx. Added also kill and abort to this struct. This
8867 is a way to avoid the "kill is not defined in <csignal>", we make
8868 C++ wrappers for functions that are not ANSI C or ANSI C++.
8870 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8871 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8872 lyx it has been renamed to sum.
8874 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8876 * src/text.C: add using directives for std::min and std::max.
8878 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8880 * src/texrow.C (getIdFromRow): actually return something useful in
8881 id and pos. Hopefully fixes the bug with positionning of errorbox
8884 * src/lyx_main.C (easyParse): output an error and exit if an
8885 incorrect command line option has been given.
8887 * src/spellchecker.C (ispell_check_word): document a memory leak.
8889 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8890 where a "struct utimbuf" is allocated with "new" and deleted with
8893 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8895 * src/text2.C (CutSelection): don't delete double spaces.
8896 (PasteSelection): ditto
8897 (CopySelection): ditto
8899 * src/text.C (Backspace): don't delete double spaces.
8901 * src/lyxlex.C (next): fix a bug that were only present with
8902 conformant std::istream::get to read comment lines, use
8903 std::istream::getline instead. This seems to fix the problem.
8905 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8907 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8908 allowed to insert space before space" editing problem. Please read
8909 commends at the beginning of the function. Comments about usage
8912 * src/text.C (InsertChar): fix for the "not allowed to insert
8913 space before space" editing problem.
8915 * src/text2.C (DeleteEmptyParagraphMechanism): when
8916 IsEmptyTableRow can only return false this last "else if" will
8917 always be a no-op. Commented out.
8919 * src/text.C (RedoParagraph): As far as I can understand tmp
8920 cursor is not really needed.
8922 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8923 present it could only return false anyway.
8924 (several functions): Did something not so smart...added a const
8925 specifier on a lot of methods.
8927 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8928 and add a tmp->text.resize. The LyXParagraph constructor does the
8930 (BreakParagraphConservative): ditto
8932 * src/support/path.h (Path): add a define so that the wrong usage
8933 "Path("/tmp") will be flagged as a compilation error:
8934 "`unnamed_Path' undeclared (first use this function)"
8936 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8938 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8939 which was bogus for several reasons.
8941 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8945 * autogen.sh: do not use "type -path" (what's that anyway?).
8947 * src/support/filetools.C (findtexfile): remove extraneous space
8948 which caused a kpsewhich warning (at least with kpathsea version
8951 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8953 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8955 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8957 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8959 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8961 * src/paragraph.C (BreakParagraph): do not reserve space on text
8962 if we don't need to (otherwise, if pos_end < pos, we end up
8963 reserving huge amounts of memory due to bad unsigned karma).
8964 (BreakParagraphConservative): ditto, although I have not seen
8965 evidence the bug can happen here.
8967 * src/lyxparagraph.h: add a using std::list.
8969 2000-01-11 Juergen Vigna <jug@sad.it>
8971 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8974 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8976 * src/vc-backend.C (doVCCommand): change to be static and take one
8977 more parameter: the path to chdir too be fore executing the command.
8978 (retrive): new function equiv to "co -r"
8980 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8981 file_not_found_hook is true.
8983 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8985 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8986 if a file is readwrite,readonly...anything else.
8988 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8990 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8991 (CreatePostscript): name change from MenuRunDVIPS (or something)
8992 (PreviewPostscript): name change from MenuPreviewPS
8993 (PreviewDVI): name change from MenuPreviewDVI
8995 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8996 \view_pdf_command., \pdf_to_ps_command
8998 * lib/configure.m4: added search for PDF viewer, and search for
8999 PDF to PS converter.
9000 (lyxrc.defaults output): add \pdflatex_command,
9001 \view_pdf_command and \pdf_to_ps_command.
9003 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9005 * src/bufferlist.C (write): we don't use blocksize for anything so
9008 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9010 * src/support/block.h: disable operator T* (), since it causes
9011 problems with both compilers I tried. See comments in the file.
9013 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9016 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9017 variable LYX_DIR_10x to LYX_DIR_11x.
9019 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9021 * INSTALL: document --with-lyxname.
9024 * configure.in: new configure flag --with-lyxname which allows to
9025 choose the name under which lyx is installed. Default is "lyx", of
9026 course. It used to be possible to do this with --program-suffix,
9027 but the later has in fact a different meaning for autoconf.
9029 * src/support/lstrings.h (lstrchr): reformat a bit.
9031 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9032 * src/mathed/math_defs.h: ditto.
9034 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9036 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9037 true, decides if we create a backup file or not when saving. New
9038 tag and variable \pdf_mode, defaults to false. New tag and
9039 variable \pdflatex_command, defaults to pdflatex. New tag and
9040 variable \view_pdf_command, defaults to xpdf. New tag and variable
9041 \pdf_to_ps_command, defaults to pdf2ps.
9043 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9045 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9046 does not have a BufferView.
9047 (unlockInset): ditto + don't access the_locking_inset if the
9048 buffer does not have a BufferView.
9050 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9051 certain circumstances so that we don't continue a keyboard
9052 operation long after the key was released. Try f.ex. to load a
9053 large document, press PageDown for some seconds and then release
9054 it. Before this change the document would contine to scroll for
9055 some time, with this change it stops imidiatly.
9057 * src/support/block.h: don't allocate more space than needed. As
9058 long as we don't try to write to the arr[x] in a array_type arr[x]
9059 it is perfectly ok. (if you write to it you might segfault).
9060 added operator value_type*() so that is possible to pass the array
9061 to functions expecting a C-pointer.
9063 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9066 * intl/*: updated to gettext 0.10.35, tried to add our own
9067 required modifications. Please verify.
9069 * po/*: updated to gettext 0.10.35, tried to add our own required
9070 modifications. Please verify.
9072 * src/support/lstrings.C (tostr): go at fixing the problem with
9073 cxx and stringstream. When stringstream is used return
9074 oss.str().c_str() so that problems with lyxstring and basic_string
9075 are avoided. Note that the best solution would be for cxx to use
9076 basic_string all the way, but it is not conformant yet. (it seems)
9078 * src/lyx_cb.C + other files: moved several global functions to
9079 class BufferView, some have been moved to BufferView.[Ch] others
9080 are still located in lyx_cb.C. Code changes because of this. (part
9081 of "get rid of current_view project".)
9083 * src/buffer.C + other files: moved several Buffer functions to
9084 class BufferView, the functions are still present in buffer.C.
9085 Code changes because of this.
9087 * config/lcmessage.m4: updated to most recent. used when creating
9090 * config/progtest.m4: updated to most recent. used when creating
9093 * config/gettext.m4: updated to most recent. applied patch for
9096 * config/gettext.m4.patch: new file that shows what changes we
9097 have done to the local copy of gettext.m4.
9099 * config/libtool.m4: new file, used in creation of acinclude.m4
9101 * config/lyxinclude.m4: new file, this is the lyx created m4
9102 macros, used in making acinclude.m4.
9104 * autogen.sh: GNU m4 discovered as a separate task not as part of
9105 the lib/configure creation.
9106 Generate acinlucde from files in config. Actually cat
9107 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9108 easier to upgrade .m4 files that really are external.
9110 * src/Spacing.h: moved using std::istringstream to right after
9111 <sstream>. This should fix the problem seen with some compilers.
9113 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9115 * src/lyx_cb.C: began some work to remove the dependency a lot of
9116 functions have on BufferView::text, even if not really needed.
9117 (GetCurrentTextClass): removed this func, it only hid the
9120 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9121 forgot this in last commit.
9123 * src/Bullet.C (bulletEntry): use static char const *[] for the
9124 tables, becuase of this the return arg had to change to string.
9126 (~Bullet): removed unneeded destructor
9128 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9129 (insetSleep): moved from Buffer
9130 (insetWakeup): moved from Buffer
9131 (insetUnlock): moved from Buffer
9133 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9134 from Buffer to BufferView.
9136 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9138 * config/ltmain.sh: updated to version 1.3.4 of libtool
9140 * config/ltconfig: updated to version 1.3.4 of libtool
9142 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9145 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9146 Did I get that right?
9148 * src/lyxlex.h: add a "using" directive or two.
9149 * src/Spacing.h: ditto.
9150 * src/insets/figinset.C: ditto.
9151 * src/support/filetools.C: ditto.
9152 * src/support/lstrings.C: ditto.
9153 * src/BufferView.C: ditto.
9154 * src/bufferlist.C: ditto.
9155 * src/lyx_cb.C: ditto.
9156 * src/lyxlex.C: ditto.
9158 * NEWS: add some changes for 1.1.4.
9160 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9162 * src/BufferView.C: first go at a TextCache to speed up switching
9165 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9167 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9168 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9169 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9170 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9173 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9174 members of the struct are correctly initialized to 0 (detected by
9176 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9177 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9179 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9180 pidwait, since it was allocated with "new". This was potentially
9181 very bad. Thanks to Michael Schmitt for running purify for us.
9184 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9186 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9188 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9190 1999-12-30 Allan Rae <rae@lyx.org>
9192 * lib/templates/IEEEtran.lyx: minor change
9194 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9195 src/mathed/formula.C (LocalDispatch): askForText changes
9197 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9198 know when a user has cancelled input. Fixes annoying problems with
9199 inserting labels and version control.
9201 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9203 * src/support/lstrings.C (tostr): rewritten to use strstream and
9206 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9208 * src/support/filetools.C (IsFileWriteable): use fstream to check
9209 (IsDirWriteable): use fileinfo to check
9211 * src/support/filetools.h (FilePtr): whole class deleted
9213 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9215 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9217 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9219 * src/bufferlist.C (write): use ifstream and ofstream instead of
9222 * src/Spacing.h: use istrstream instead of sscanf
9224 * src/mathed/math_defs.h: change first arg to istream from FILE*
9226 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9228 * src/mathed/math_parser.C: have yyis to be an istream
9229 (LexGetArg): use istream (yyis)
9231 (mathed_parse): ditto
9232 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9234 * src/mathed/formula.C (Read): rewritten to use istream
9236 * src/mathed/formulamacro.C (Read): rewritten to use istream
9238 * src/lyxlex.h (~LyXLex): deleted desturctor
9239 (getStream): new function, returns an istream
9240 (getFile): deleted funtion
9241 (IsOK): return is.good();
9243 * src/lyxlex.C (LyXLex): delete file and owns_file
9244 (setFile): open an filebuf and assign that to a istream instead of
9246 (setStream): new function, takes an istream as arg.
9247 (setFile): deleted function
9248 (EatLine): rewritten us use istream instead of FILE*
9252 * src/table.C (LyXTable): use istream instead of FILE*
9253 (Read): rewritten to take an istream instead of FILE*
9255 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9257 * src/buffer.C (Dispatch): remove an extraneous break statement.
9259 * src/support/filetools.C (QuoteName): change to do simple
9260 'quoting'. More work is necessary. Also changed to do nothing
9261 under emx (needs fix too).
9262 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9264 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9265 config.h.in to the AC_DEFINE_UNQUOTED() call.
9266 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9267 needs char * as argument (because Solaris 7 declares it like
9270 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9271 remove definition of BZERO.
9273 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9275 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9276 defined, "lyxregex.h" if not.
9278 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9280 (REGEX): new variable that is set to regex.c lyxregex.h when
9281 AM_CONDITIONAL USE_REGEX is set.
9282 (libsupport_la_SOURCES): add $(REGEX)
9284 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9287 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9290 * configure.in: add call to LYX_REGEX
9292 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9293 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9295 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9297 * lib/bind/fi_menus.bind: new file, from
9298 pauli.virtanen@saunalahti.fi.
9300 * src/buffer.C (getBibkeyList): pass the parameter delim to
9301 InsetInclude::getKeys and InsetBibtex::getKeys.
9303 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9304 is passed to Buffer::getBibkeyList
9306 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9307 instead of the hardcoded comma.
9309 * src/insets/insetbib.C (getKeys): make sure that there are not
9310 leading blanks in bibtex keys. Normal latex does not care, but
9311 harvard.sty seems to dislike blanks at the beginning of citation
9312 keys. In particular, the retturn value of the function is
9314 * INSTALL: make it clear that libstdc++ is needed and that gcc
9315 2.7.x probably does not work.
9317 * src/support/filetools.C (findtexfile): make debug message go to
9319 * src/insets/insetbib.C (getKeys): ditto
9321 * src/debug.C (showTags): make sure that the output is correctly
9324 * configure.in: add a comment for TWO_COLOR_ICON define.
9326 * acconfig.h: remove all the entries that already defined in
9327 configure.in or acinclude.m4.
9329 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9330 to avoid user name, date and copyright.
9332 1999-12-21 Juergen Vigna <jug@sad.it>
9334 * src/table.C (Read): Now read bogus row format informations
9335 if the format is < 5 so that afterwards the table can
9336 be read by lyx but without any format-info. Fixed the
9337 crash we experienced when not doing this.
9339 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9341 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9342 (RedoDrawingOfParagraph): ditto
9343 (RedoParagraphs): ditto
9344 (RemoveTableRow): ditto
9346 * src/text.C (Fill): rename arg paperwidth -> paper_width
9348 * src/buffer.C (insertLyXFile): rename var filename -> fname
9349 (writeFile): rename arg filename -> fname
9350 (writeFileAscii): ditto
9351 (makeLaTeXFile): ditto
9352 (makeLinuxDocFile): ditto
9353 (makeDocBookFile): ditto
9355 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9358 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9360 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9363 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9364 compiled by a C compiler not C++.
9366 * src/layout.h (LyXTextClass): added typedef for const_iterator
9367 (LyXTextClassList): added typedef for const_iterator + member
9368 functions begin and end.
9370 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9371 iterators to fill the choice_class.
9372 (updateLayoutChoice): rewritten to use iterators to fill the
9373 layoutlist in the toolbar.
9375 * src/BufferView.h (BufferView::work_area_width): removed unused
9378 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9380 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9381 (sgmlCloseTag): ditto
9383 * src/support/lstrings.h: return type of countChar changed to
9386 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9387 what version of this func to use. Also made to return unsigned int.
9389 * configure.in: call LYX_STD_COUNT
9391 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9392 conforming std::count.
9394 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9396 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9397 and a subscript would give bad display (patch from Dekel Tsur
9398 <dekel@math.tau.ac.il>).
9400 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9402 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9405 * src/chset.h: add a few 'using' directives
9407 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9408 triggered when no buffer is active
9410 * src/layout.C: removed `break' after `return' in switch(), since
9413 * src/lyx_main.C (init): make sure LyX can be ran in place even
9414 when libtool has done its magic with shared libraries. Fix the
9415 test for the case when the system directory has not been found.
9417 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9418 name for the latex file.
9419 (MenuMakeHTML): ditto
9421 * src/buffer.h: add an optional boolean argument, which is passed
9424 1999-12-20 Allan Rae <rae@lyx.org>
9426 * lib/templates/IEEEtran.lyx: small correction and update.
9428 * configure.in: Attempted to use LYX_PATH_HEADER
9430 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9432 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9433 input from JMarc. Now use preprocessor to find the header.
9434 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9435 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9436 LYX_STL_STRING_FWD. See comments in file.
9438 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9440 * The global MiniBuffer * minibuffer variable is dead.
9442 * The global FD_form_main * fd_form_main variable is dead.
9444 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9446 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9448 * src/table.h: add the LOstream.h header
9449 * src/debug.h: ditto
9451 * src/LyXAction.h: change the explaination of the ReadOnly
9452 attribute: is indicates that the function _can_ be used.
9454 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9457 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9459 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9465 * src/paragraph.C (GetWord): assert on pos>=0
9468 * src/support/lyxstring.C: condition the use of an invariant on
9470 * src/support/lyxstring.h: ditto
9472 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9473 Use LAssert.h instead of plain assert().
9475 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9477 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9478 * src/support/filetools.C: ditto
9480 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9483 * INSTALL: document the new configure flags
9485 * configure.in: suppress --with-debug; add --enable-assertions
9487 * acinclude.m4: various changes in alignment of help strings.
9489 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9491 * src/kbmap.C: commented out the use of the hash map in kb_map,
9492 beginning of movement to a stl::container.
9494 * several files: removed code that was not in effect when
9495 MOVE_TEXT was defined.
9497 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9498 for escaping should not be used. We can discuss if the string
9499 should be enclosed in f.ex. [] instead of "".
9501 * src/trans_mgr.C (insert): use the new returned value from
9502 encodeString to get deadkeys and keymaps done correctly.
9504 * src/chset.C (encodeString): changed to return a pair, to tell
9505 what to use if we know the string.
9507 * src/lyxscreen.h (fillArc): new function.
9509 * src/FontInfo.C (resize): rewritten to use more std::string like
9510 structore, especially string::replace.
9512 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9515 * configure.in (chmod +x some scripts): remove config/gcc-hack
9517 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9519 * src/buffer.C (writeFile): change once again the top comment in a
9520 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9521 instead of an hardcoded version number.
9522 (makeDocBookFile): ditto
9524 * src/version.h: add new define LYX_DOCVERSION
9526 * po/de.po: update from Pit Sütterlin
9527 * lib/bind/de_menus.bind: ditto.
9529 * src/lyxfunc.C (Dispatch): call MenuExport()
9530 * src/buffer.C (Dispatch): ditto
9532 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9533 LyXFunc::Dispatch().
9534 (MenuExport): new function, moved from
9535 LyXFunc::Dispatch().
9537 * src/trans_mgr.C (insert): small cleanup
9538 * src/chset.C (loadFile): ditto
9540 * lib/kbd/iso8859-1.cdef: add missing backslashes
9542 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9544 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9545 help with placing the manually drawn accents better.
9547 (Draw): x2 and hg changed to float to minimize rounding errors and
9548 help place the accents better.
9550 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9551 unsigned short to char is just wrong...cast the char to unsigned
9552 char instead so that the two values can compare sanely. This
9553 should also make the display of insetlatexaccents better and
9554 perhaps also some other insets.
9556 (lbearing): new function
9559 1999-12-15 Allan Rae <rae@lyx.org>
9561 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9562 header that provides a wrapper around the very annoying SGI STL header
9565 * src/support/lyxstring.C, src/LString.h:
9566 removed old SGI-STL-compatability attempts.
9568 * configure.in: Use LYX_STL_STRING_FWD.
9570 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9571 stl_string_fwd.h is around and try to determine it's location.
9572 Major improvement over previous SGI STL 3.2 compatability.
9573 Three small problems remain with this function due to my zero
9574 knowledge of autoconf. JMarc and lgb see the comments in the code.
9576 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9578 * src/broken_const.h, config/hack-gcc, config/README: removed
9580 * configure.in: remove --with-gcc-hack option; do not call
9583 * INSTALL: remove documentation of --with-broken-const and
9586 * acconfig.h: remove all trace of BROKEN_CONST define
9588 * src/buffer.C (makeDocBookFile): update version number in output
9590 (SimpleDocBookOnePar): fix an assert when trying to a character
9591 access beyond string length
9594 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9596 * po/de.po: fix the Export menu
9598 * lyx.man: update the description of -dbg
9600 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9601 (commandLineHelp): updated
9602 (easyParse): show list of available debug levels if -dbg is passed
9605 * src/Makefile.am: add debug.C
9607 * src/debug.h: moved some code to debug.C
9609 * src/debug.C: new file. Contains code to set and show debug
9612 * src/layout.C: remove 'break' after 'continue' in switch
9613 statements, since these cannot be reached.
9615 1999-12-13 Allan Rae <rae@lyx.org>
9617 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9618 (in_word_set): hash() -> math_hash()
9620 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9622 * acconfig.h: Added a test for whether we are using exceptions in the
9623 current compilation run. If so USING_EXCEPTIONS is defined.
9625 * config.in: Check for existance of stl_string_fwd.h
9626 * src/LString.h: If compiling --with-included-string and SGI's
9627 STL version 3.2 is present (see above test) we need to block their
9628 forward declaration of string and supply a __get_c_string().
9629 However, it turns out this is only necessary if compiling with
9630 exceptions enabled so I've a bit more to add yet.
9632 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9633 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9634 src/support/LRegex.h, src/undo.h:
9635 Shuffle the order of the included files a little to ensure that
9636 LString.h gets included before anything that includes stl_string_fwd.h
9638 * src/support/lyxstring.C: We need to #include LString.h instead of
9639 lyxstring.h to get the necessary definition of __get_c_string.
9640 (__get_c_string): New function. This is defined static just like SGI's
9641 although why they need to do this I'm not sure. Perhaps it should be
9642 in lstrings.C instead.
9644 * lib/templates/IEEEtran.lyx: New template file.
9646 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9648 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9649 * intl/Makefile.in (MKINSTALLDIRS): ditto
9651 * src/LyXAction.C (init): changed to hold the LFUN data in a
9652 automatic array in stead of in callso to newFunc, this speeds up
9653 compilation a lot. Also all the memory used by the array is
9654 returned when the init is completed.
9656 * a lot of files: compiled with -Wold-style-cast, changed most of
9657 the reported offenders to C++ style casts. Did not change the
9658 offenders in C files.
9660 * src/trans.h (Match): change argument type to unsigned int.
9662 * src/support/DebugStream.C: fix some types on the streambufs so
9663 that it works on a conforming implementation.
9665 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9667 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9669 * src/support/lyxstring.C: remove the inline added earlier since
9670 they cause a bunch of unsatisfied symbols when linking with dec
9671 cxx. Cxx likes to have the body of inlines at the place where they
9674 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9675 accessing negative bounds in array. This fixes the crash when
9676 inserting accented characters.
9677 * src/trans.h (Match): ditto
9679 * src/buffer.C (Dispatch): since this is a void, it should not try
9680 to return anything...
9682 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9684 * src/buffer.h: removed the two friends from Buffer. Some changes
9685 because of this. Buffer::getFileName and Buffer::setFileName
9686 renamed to Buffer::fileName() and Buffer::fileName(...).
9688 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9690 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9691 and Buffer::update(short) to BufferView. This move is currently
9692 controlled by a define MOVE_TEXT, this will be removed when all
9693 shows to be ok. This move paves the way for better separation
9694 between buffer contents and buffer view. One side effect is that
9695 the BufferView needs a rebreak when swiching buffers, if we want
9696 to avoid this we can add a cache that holds pointers to LyXText's
9697 that is not currently in use.
9699 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9702 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9704 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9706 * lyx_main.C: new command line option -x (or --execute) and
9707 -e (or --export). Now direct conversion from .lyx to .tex
9708 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9709 Unfortunately, X is still needed and the GUI pops up during the
9712 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9714 * src/Spacing.C: add a using directive to bring stream stuff into
9716 * src/paragraph.C: ditto
9717 * src/buffer.C: ditto
9719 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9720 from Lars' announcement).
9722 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9723 example files from Tino Meinen.
9725 1999-12-06 Allan Rae <rae@lyx.org>
9727 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9729 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9731 * src/support/lyxstring.C: added a lot of inline for no good
9734 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9735 latexWriteEndChanges, they were not used.
9737 * src/layout.h (operator<<): output operator for PageSides
9739 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9741 * some example files: loaded in LyX 1.0.4 and saved again to update
9742 certain constructs (table format)
9744 * a lot of files: did the change to use fstream/iostream for all
9745 writing of files. Done with a close look at Andre Poenitz's patch.
9747 * some files: whitespace changes.
9749 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9751 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9752 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9753 architecture, we provide our own. It is used unconditionnally, but
9754 I do not think this is a performance problem. Thanks to Angus
9755 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9756 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9758 (GetInset): use my_memcpy.
9762 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9763 it is easier to understand, but it uses less TeX-only constructs now.
9765 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9766 elements contain spaces
9768 * lib/configure: regenerated
9770 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9771 elements contain spaces; display the list of programs that are
9774 * autogen.sh: make sure lib/configure is executable
9776 * lib/examples/*: rename the tutorial examples to begin with the
9777 two-letters language code.
9779 * src/lyxfunc.C (getStatus): do not query current font if no
9782 * src/lyx_cb.C (RunScript): use QuoteName
9783 (MenuRunDvips): ditto
9784 (PrintApplyCB): ditto
9786 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9787 around argument, so that it works well with the current shell.
9788 Does not work properly with OS/2 shells currently.
9790 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9791 * src/LyXSendto.C (SendtoApplyCB): ditto
9792 * src/lyxfunc.C (Dispatch): ditto
9793 * src/buffer.C (runLaTeX): ditto
9794 (runLiterate): ditto
9795 (buildProgram): ditto
9797 * src/lyx_cb.C (RunScript): ditto
9798 (MenuMakeLaTeX): ditto
9800 * src/buffer.h (getLatexName): new method
9802 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9804 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9806 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9807 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9808 (create_math_panel): ditto
9810 * src/lyxfunc.C (getStatus): re-activate the code which gets
9811 current font and cursor; add test for export to html.
9813 * src/lyxrc.C (read): remove unreachable break statements; add a
9816 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9818 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9820 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9821 introduced by faulty regex.
9822 * src/buffer.C: ditto
9823 * src/lastfiles.C: ditto
9824 * src/paragraph.C: ditto
9825 * src/table.C: ditto
9826 * src/vspace.C: ditto
9827 * src/insets/figinset.C: ditto
9828 Note: most of these is absolutely harmless, except the one in
9829 src/mathed formula.C.
9831 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9833 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9834 operation, yielding correct results for the reLyX command.
9836 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9838 * src/support/filetools.C (ExpandPath): removed an over eager
9840 (ReplaceEnvironmentPath): ditto
9842 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9843 shows that we are doing something fishy in our code...
9847 * src/lyxrc.C (read): use a double switch trick to get more help
9848 from the compiler. (the same trick is used in layout.C)
9849 (write): new function. opens a ofstream and pass that to output
9850 (output): new function, takes a ostream and writes the lyxrc
9851 elemts to it. uses a dummy switch to make sure no elements are
9854 * src/lyxlex.h: added a struct pushpophelper for use in functions
9855 with more than one exit point.
9857 * src/lyxlex.[Ch] (GetInteger): made it const
9861 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9863 * src/layout.[hC] : LayoutTags splitted into several enums, new
9864 methods created, better error handling cleaner use of lyxlex. Read
9867 * src/bmtable.[Ch]: change some member prototypes because of the
9868 image const changes.
9870 * commandtags.h, src/LyXAction.C (init): new function:
9871 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9872 This file is not read automatically but you can add \input
9873 preferences to your lyxrc if you want to. We need to discuss how
9876 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9877 in .aux, also remove .bib and .bst files from dependencies when
9880 * src/BufferView.C, src/LyXView.C: add const_cast several places
9881 because of changes to images.
9883 * lib/images/*: same change as for images/*
9885 * lib/lyxrc.example: Default for accept_compound is false not no.
9887 * images/*: changed to be const, however I have som misgivings
9888 about this change so it might be changed back.
9890 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9892 * lib/configure, po/POTFILES.in: regenerated
9894 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9896 * config/lib_configure.m4: removed
9898 * lib/configure.m4: new file (was config/lib_configure.m4)
9900 * configure.in: do not test for rtti, since we do not use it.
9902 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9904 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9905 doubling of allocated space scheme. This makes it faster for large
9906 strings end to use less memory for small strings. xtra rememoved.
9908 * src/insets/figinset.C (waitalarm): commented out.
9909 (GhostscriptMsg): use static_cast
9910 (GhostscriptMsg): use new instead of malloc to allocate memory for
9911 cmap. also delete the memory after use.
9913 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9915 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9916 for changes in bibtex database or style.
9917 (runBibTeX): remove all .bib and .bst files from dep before we
9919 (run): use scanAuc in when dep file already exist.
9921 * src/DepTable.C (remove_files_with_extension): new method
9924 * src/DepTable.[Ch]: made many of the methods const.
9926 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9928 * src/bufferparams.C: make sure that the default textclass is
9929 "article". It used to be the first one by description order, but
9930 now the first one is "docbook".
9932 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9933 string; call Debug::value.
9934 (easyParse): pass complete argument to setDebuggingLevel().
9936 * src/debug.h (value): fix the code that parses debug levels.
9938 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9941 * src/LyXAction.C: use Debug::ACTION as debug channel.
9943 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9945 * NEWS: updated for the future 1.1.3 release.
9947 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9948 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9949 it should. This is of course a controversial change (since many
9950 people will find that their lyx workscreen is suddenly full of
9951 red), but done for the sake of correctness.
9953 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9954 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9956 * src/insets/inseterror.h, src/insets/inseturl.h,
9957 src/insets/insetinfo.h, src/insets/figinset.h,
9958 src/mathed/formulamacro.h, src/mathed/math_macro.h
9959 (EditMessage): add a missing const and add _() to make sure that
9962 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9963 src/insets/insetbib.C, src/support/filetools.C: add `using'
9966 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9967 doing 'Insert index of last word' at the beginning of a paragraph.
9969 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9971 * several files: white-space changes.
9973 * src/mathed/formula.C: removed IsAlpha and IsDigit
9975 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9976 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9979 * src/insets/figinset.C (GetPSSizes): don't break when
9980 "EndComments" is seen. But break when a boundingbox is read.
9982 * all classes inherited from Inset: return value of Clone
9983 changed back to Inset *.
9985 * all classes inherited form MathInset: return value of Clone
9986 changed back to MathedInset *.
9988 * src/insets/figinset.C (runqueue): use a ofstream to output the
9989 gs/ps file. Might need some setpresicion or setw. However I can
9990 see no problem with the current code.
9991 (runqueue): use sleep instead of the alarm/signal code. I just
9992 can't see the difference.
9994 * src/paragraph.C (LyXParagraph): reserve space in the new
9995 paragraph and resize the inserted paragraph to just fit.
9997 * src/lyxfunc.h (operator|=): added operator for func_status.
9999 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10000 check for readable file.
10002 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10003 check for readable file.
10004 (MenuMakeLinuxDoc): ditto
10005 (MenuMakeDocBook): ditto
10006 (MenuMakeAscii): ditto
10007 (InsertAsciiFile): split the test for openable and readable
10009 * src/bmtable.C (draw_bitmaptable): use
10010 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10012 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10013 findtexfile from LaTeX to filetools.
10015 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10016 instead of FilePtr. Needs to be verified by a literate user.
10018 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10020 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10021 (EditMessage): likewise.
10023 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10024 respectively as \textasciitilde and \textasciicircum.
10026 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10028 * src/support/lyxstring.h: made the methods that take iterators
10029 use const_iterator.
10031 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10032 (regexMatch): made is use the real regex class.
10034 * src/support/Makefile.am: changed to use libtool
10036 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10038 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10040 (MathIsInset ++): changed several macros to be inline functions
10043 * src/mathed/Makefile.am: changed to use libtool
10045 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10047 * src/insets/inset* : Clone changed to const and return type is
10048 the true insettype not just Inset*.
10050 * src/insets/Makefile.am: changed to use libtool
10052 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10054 * src/undo.[Ch] : added empty() and changed some of the method
10057 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10059 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10060 setID use block<> for the bullets array, added const several places.
10062 * src/lyxfunc.C (getStatus): new function
10064 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10065 LyXAction, added const to several funtions.
10067 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10068 a std::map, and to store the dir items in a vector.
10070 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10073 * src/LyXView.[Ch] + other files : changed currentView to view.
10075 * src/LyXAction.[Ch] : ported from the old devel branch.
10077 * src/.cvsignore: added .libs and a.out
10079 * configure.in : changes to use libtool.
10081 * acinclude.m4 : inserted libtool.m4
10083 * .cvsignore: added libtool
10085 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10087 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10088 file name in insets and mathed directories (otherwise the
10089 dependency is not taken in account under cygwin).
10091 * src/text2.C (InsertString[AB]): make sure that we do not try to
10092 read characters past the string length.
10094 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10096 * lib/doc/LaTeXConfig.lyx.in,
10097 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10099 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10100 file saying who created them and when this heppened; this is
10101 useless and annoys tools like cvs.
10103 * lib/layouts/g-brief-{en,de}.layout,
10104 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10105 from Thomas Hartkens <thomas@hartkens.de>.
10107 * src/{insets,mathed}/Makefile.am: do not declare an empty
10108 LDFLAGS, so that it can be set at configure time (useful on Irix
10111 * lib/reLyX/configure.in: make sure that the prefix is set
10112 correctly in LYX_DIR.
10114 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10116 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10117 be used by 'command-sequence' this allows to bind a key to a
10118 sequence of LyX-commands
10119 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10121 * src/LyXAction.C: add "command-sequence"
10123 * src/LyXFunction.C: handling of "command-sequence"
10125 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10126 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10128 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10130 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10132 * src/buffer.C (writeFile): Do not output a comment giving user
10133 and date at the beginning of a .lyx file. This is useless and
10134 annoys cvs anyway; update version number to 1.1.
10136 * src/Makefile.am (LYX_DIR): add this definition, so that a
10137 default path is hardcoded in LyX.
10139 * configure.in: Use LYX_GNU_GETTEXT.
10141 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10142 AM_GNU_GETTEXT with a bug fixed.
10144 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10146 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10148 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10149 which is used to point to LyX data is now LYX_DIR_11x.
10151 * lyx.man: convert to a unix text file; small updates.
10153 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10155 * src/support/LSubstring.[Ch]: made the second arg of most of the
10156 constructors be a const reference.
10158 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10161 * src/support/lyxstring.[Ch] (swap): added missing member function
10162 and specialization of swap(str, str);
10164 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10166 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10167 trace of the old one.
10169 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10170 put the member definitions in undo.C.
10172 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10173 NEW_TEXT and have now only code that was included when this was
10176 * src/intl.C (LCombo): use static_cast
10178 (DispatchCallback): ditto
10180 * src/definitions.h: removed whole file
10182 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10184 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10185 parsing and stores in a std:map. a regex defines the file format.
10186 removed unneeded members.
10188 * src/bufferparams.h: added several enums from definitions.h here.
10189 Removed unsused destructor. Changed some types to use proper enum
10190 types. use block to have the temp_bullets and user_defined_bullets
10191 and to make the whole class assignable.
10193 * src/bufferparams.C (Copy): removed this functions, use a default
10194 assignment instead.
10196 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10199 * src/buffer.C (readLyXformat2): commend out all that have with
10200 oldpapersize to do. also comment out all that hve to do with
10201 insetlatex and insetlatexdel.
10202 (setOldPaperStuff): commented out
10204 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10206 * src/LyXAction.C: remove use of inset-latex-insert
10208 * src/mathed/math_panel.C (button_cb): use static_cast
10210 * src/insets/Makefile.am (insets_o_SOURCES): removed
10213 * src/support/lyxstring.C (helper): use the unsigned long
10214 specifier, UL, instead of a static_cast.
10216 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10218 * src/support/block.h: new file. to be used as a c-style array in
10219 classes, so that the class can be assignable.
10221 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10223 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10224 NULL, make sure to return an empty string (it is not possible to
10225 set a string to NULL).
10227 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10229 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10231 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10233 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10234 link line, so that Irix users (for example) can set it explicitely to
10237 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10238 it can be overidden at make time (static or dynamic link, for
10241 * src/vc-backend.C, src/LaTeXFeatures.h,
10242 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10243 statements to bring templates to global namespace.
10245 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10247 * src/support/lyxstring.C (operator[] const): make it standard
10250 * src/minibuffer.C (Init): changed to reflect that more
10251 information is given from the lyxvc and need not be provided here.
10253 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10255 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10257 * src/LyXView.C (UpdateTimerCB): use static_cast
10258 (KeyPressMask_raw_callback): ditto
10260 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10261 buffer_, a lot of changes because of this. currentBuffer() ->
10262 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10263 also changes to other files because of this.
10265 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10267 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10268 have no support for RCS and partial support for CVS, will be
10271 * src/insets/ several files: changes because of function name
10272 changes in Bufferview and LyXView.
10274 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10276 * src/support/LSubstring.[Ch]: new files. These implement a
10277 Substring that can be very convenient to use. i.e. is this
10279 string a = "Mary had a little sheep";
10280 Substring(a, "sheep") = "lamb";
10281 a is now "Mary has a little lamb".
10283 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10284 out patterns and subpatterns of strings. It is used by LSubstring
10285 and also by vc-backend.C
10287 * src/support/lyxstring.C: went over all the assertions used and
10288 tried to correct the wrong ones and flag which of them is required
10289 by the standard. some bugs found because of this. Also removed a
10290 couple of assertions.
10292 * src/support/Makefile.am (libsupport_a_SOURCES): added
10293 LSubstring.[Ch] and LRegex.[Ch]
10295 * src/support/FileInfo.h: have struct stat buf as an object and
10296 not a pointer to one, some changes because of this.
10298 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10299 information in layout when adding the layouts preamble to the
10300 textclass preamble.
10302 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10305 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10306 because of bug in OS/2.
10308 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10310 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10311 \verbatim@font instead of \ttfamily, so that it can be redefined.
10313 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10314 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10315 src/layout.h, src/text2.C: add 'using' directive to bring the
10316 STL templates we need from the std:: namespace to the global one.
10317 Needed by DEC cxx in strict ansi mode.
10319 * src/support/LIstream.h,src/support/LOstream.h,
10320 src/support/lyxstring.h,src/table.h,
10321 src/lyxlookup.h: do not include <config.h> in header
10322 files. This should be done in the .C files only.
10324 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10328 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10330 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10331 from Kayvan to fix the tth invokation.
10333 * development/lyx.spec.in: updates from Kayvan to reflect the
10334 changes of file names.
10336 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10338 * src/text2.C (InsertStringB): use std::copy
10339 (InsertStringA): use std::copy
10341 * src/bufferlist.C: use a vector to store the buffers in. This is
10342 an internal change and should not affect any other thing.
10344 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10347 * src/text.C (Fill): fix potential bug, one off bug.
10349 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10351 * src/Makefile.am (lyx_main.o): add more files it depends on.
10353 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10355 * src/support/lyxstring.C: use size_t for the reference count,
10356 size, reserved memory and xtra.
10357 (internal_compare): new private member function. Now the compare
10358 functions should work for std::strings that have embedded '\0'
10360 (compare): all compare functions rewritten to use
10363 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10365 * src/support/lyxstring.C (compare): pass c_str()
10366 (compare): pass c_str
10367 (compare): pass c_str
10369 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10371 * src/support/DebugStream.C: <config.h> was not included correctly.
10373 * lib/configure: forgot to re-generate it :( I'll make this file
10374 auto generated soon.
10376 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10378 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10381 * src/support/lyxstring.C: some changes from length() to rep->sz.
10382 avoids a function call.
10384 * src/support/filetools.C (SpaceLess): yet another version of the
10385 algorithm...now per Jean-Marc's suggestions.
10387 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10389 * src/layout.C (less_textclass_desc): functor for use in sorting
10391 (LyXTextClass::Read): sort the textclasses after reading.
10393 * src/support/filetools.C (SpaceLess): new version of the
10394 SpaceLess functions. What problems does this one give? Please
10397 * images/banner_bw.xbm: made the arrays unsigned char *
10399 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10401 * src/support/lyxstring.C (find): remove bogus assertion in the
10402 two versions of find where this has not been done yet.
10404 * src/support/lyxlib.h: add missing int return type to
10407 * src/menus.C (ShowFileMenu): disable exporting to html if no
10408 html export command is present.
10410 * config/lib_configure.m4: add a test for an HTML converter. The
10411 programs checked for are, in this order: tth, latex2html and
10414 * lib/configure: generated from config/lib_configure.m4.
10416 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10417 html converter. The parameters are now passed through $$FName and
10418 $$OutName, instead of standard input/output.
10420 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10422 * lib/lyxrc.example: update description of \html_command.
10423 add "quotes" around \screen_font_xxx font setting examples to help
10424 people who use fonts with spaces in their names.
10426 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10428 * Distribution files: updates for v1.1.2
10430 * src/support/lyxstring.C (find): remove bogus assert and return
10431 npos for the same condition.
10433 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10435 * added patch for OS/2 from SMiyata.
10437 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10439 * src/text2.C (CutSelection): make space_wrapped a bool
10440 (CutSelection): dont declare int i until we have to.
10441 (alphaCounter): return a char const *.
10443 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10445 * src/support/syscall.C (Systemcalls::kill):
10446 src/support/filetools.C (PutEnv, PutEnvPath):
10447 src/lyx_cb.C (addNewlineAndDepth):
10448 src/FontInfo.C (FontInfo::resize): condition some #warning
10449 directives with WITH_WARNINGS.
10452 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10454 * src/layout.[Ch] + several files: access to class variables
10455 limited and made accessor functions instead a lot of code changed
10456 becuase of this. Also instead of returning pointers often a const
10457 reference is returned instead.
10459 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10461 * src/Makefile.am (dist-hook): added used to remove the CVS from
10462 cheaders upon creating a dist
10463 (EXTRA_DIST): added cheaders
10465 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10466 a character not as a small integer.
10468 * src/support/lyxstring.C (find): removed Assert and added i >=
10469 rep->sz to the first if.
10471 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10473 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10474 src/LyXView.C src/buffer.C src/bufferparams.C
10475 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10476 src/text2.C src/insets/insetinclude.C:
10477 lyxlayout renamed to textclasslist.
10479 * src/layout.C: some lyxerr changes.
10481 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10482 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10483 (LyXLayoutList): removed all traces of this class.
10484 (LyXTextClass::Read): rewrote LT_STYLE
10485 (LyXTextClass::hasLayout): new function
10486 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10487 both const and nonconst version.
10488 (LyXTextClass::delete_layout): new function.
10489 (LyXTextClassList::Style): bug fix. do the right thing if layout
10491 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10492 (LyXTextClassList::NameOfLayout): ditto
10493 (LyXTextClassList::Load): ditto
10495 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10497 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10499 * src/LyXAction.C (LookupFunc): added a workaround for sun
10500 compiler, on the other hand...we don't know if the current code
10501 compiles on sun at all...
10503 * src/support/filetools.C (CleanupPath): subst fix
10505 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10508 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10509 complained about this one?
10511 * src/insets/insetinclude.C (Latex): subst fix
10513 * src/insets/insetbib.C (getKeys): subst fix
10515 * src/LyXSendto.C (SendtoApplyCB): subst fix
10517 * src/lyx_main.C (init): subst fix
10519 * src/layout.C (Read): subst fix
10521 * src/lyx_sendfax_main.C (button_send): subst fix
10523 * src/buffer.C (RoffAsciiTable): subst fix
10525 * src/lyx_cb.C (MenuFax): subst fix
10526 (PrintApplyCB): subst fix
10528 1999-10-26 Juergen Vigna <jug@sad.it>
10530 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10532 (Read): Cleaned up this code so now we read only format vestion >= 5
10534 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10536 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10537 come nobody has complained about this one?
10539 * src/insets/insetinclude.C (Latex): subst fix
10541 * src/insets/insetbib.C (getKeys): subst fix
10543 * src/lyx_main.C (init): subst fix
10545 * src/layout.C (Read): subst fix
10547 * src/buffer.C (RoffAsciiTable): subst fix
10549 * src/lyx_cb.C (MenuFax): subst fix.
10551 * src/layout.[hC] + some other files: rewrote to use
10552 std::container to store textclasses and layouts in.
10553 Simplified, removed a lot of code. Make all classes
10554 assignable. Further simplifications and review of type
10555 use still to be one.
10557 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10558 lastfiles to create the lastfiles partr of the menu.
10560 * src/lastfiles.[Ch]: rewritten to use deque to store the
10561 lastfiles in. Uses fstream for reading and writing. Simplifies
10564 * src/support/syscall.C: remove explicit cast.
10566 * src/BufferView.C (CursorToggleCB): removed code snippets that
10567 were commented out.
10568 use explicat C++ style casts instead of C style casts. also use
10569 u_vdata instea of passing pointers in longs.
10571 * src/PaperLayout.C: removed code snippets that were commented out.
10573 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10575 * src/lyx_main.C: removed code snippets that wer commented out.
10577 * src/paragraph.C: removed code snippets that were commented out.
10579 * src/lyxvc.C (logClose): use static_cast
10581 (viewLog): remove explicit cast to void*
10582 (showLog): removed old commented code
10584 * src/menus.C: use static_cast instead of C style casts. use
10585 u_vdata instead of u_ldata. remove explicit cast to (long) for
10586 pointers. Removed old code that was commented out.
10588 * src/insets/inset.C: removed old commented func
10590 * src/insets/insetref.C (InsetRef): removed old code that had been
10591 commented out for a long time.
10593 (escape): removed C style cast
10595 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10597 * src/insets/insetlatex.C (Draw): removed old commented code
10598 (Read): rewritten to use string
10600 * src/insets/insetlabel.C (escape): removed C style cast
10602 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10604 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10605 old commented code.
10607 * src/insets/insetinclude.h: removed a couple of stupid bools
10609 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10610 (Clone): remove C style cast
10611 (getKeys): changed list to lst because of std::list
10613 * src/insets/inseterror.C (Draw): removed som old commented code.
10615 * src/insets/insetcommand.C (Draw): removed some old commented code.
10617 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10618 commented out forever.
10619 (bibitem_cb): use static_cast instead of C style cast
10620 use of vdata changed to u_vdata.
10622 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10624 (CloseUrlCB): use static_cast instead of C style cast.
10625 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10627 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10628 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10629 (CloseInfoCB): static_cast from ob->u_vdata instead.
10630 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10633 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10634 (C_InsetError_CloseErrorCB): forward the ob parameter
10635 (CloseErrorCB): static_cast from ob->u_vdata instead.
10637 * src/vspace.h: include LString.h since we use string in this class.
10639 * src/vspace.C (lyx_advance): changed name from advance because of
10640 nameclash with stl. And since we cannot use namespaces yet...I
10641 used a lyx_ prefix instead. Expect this to change when we begin
10644 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10646 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10647 and removed now defunct constructor and deconstructor.
10649 * src/BufferView.h: have backstack as a object not as a pointer.
10650 removed initialization from constructor. added include for BackStack
10652 * development/lyx.spec.in (%build): add CFLAGS also.
10654 * src/screen.C (drawFrame): removed another warning.
10656 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10658 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10659 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10660 README and ANNOUNCE a bit for the next release. More work is
10663 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10664 unbreakable if we are in freespacing mode (LyX-Code), but not in
10667 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10669 * src/BackStack.h: fixed initialization order in constructor
10671 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10673 * acinclude.m4 (VERSION): new rules for when a version is
10674 development, added also a variable for prerelease.
10675 (warnings): we set with_warnings=yes for prereleases
10676 (lyx_opt): prereleases compile with same optimization as development
10677 (CXXFLAGS): only use pedantic if we are a development version
10679 * src/BufferView.C (restorePosition): don't do anything if the
10680 backstack is empty.
10682 * src/BackStack.h: added member empty, use this to test if there
10683 is anything to pop...
10685 1999-10-25 Juergen Vigna <jug@sad.it>
10688 * forms/layout_forms.fd +
10689 * forms/latexoptions.fd +
10690 * lyx.fd: changed for various form resize issues
10692 * src/mathed/math_panel.C +
10693 * src/insets/inseterror.C +
10694 * src/insets/insetinfo.C +
10695 * src/insets/inseturl.C +
10696 * src/insets/inseturl.h +
10698 * src/LyXSendto.C +
10699 * src/PaperLayout.C +
10700 * src/ParagraphExtra.C +
10701 * src/TableLayout.C +
10703 * src/layout_forms.C +
10710 * src/menus.C: fixed various resize issues. So now forms can be
10711 resized savely or not be resized at all.
10713 * forms/form_url.fd +
10714 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10717 * src/insets/Makefile.am: added files form_url.[Ch]
10719 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10721 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10722 (and presumably 6.2).
10724 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10725 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10726 remaining static member callbacks.
10728 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10731 * src/support/lyxstring.h: declare struct Srep as friend of
10732 lyxstring, since DEC cxx complains otherwise.
10734 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10736 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10738 * src/LaTeX.C (run): made run_bibtex also depend on files with
10740 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10741 are put into the dependency file.
10743 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10744 the code has shown itself to work
10745 (create_ispell_pipe): removed another warning, added a comment
10748 * src/minibuffer.C (ExecutingCB): removed code that has been
10749 commented out a long time
10751 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10752 out code + a warning.
10754 * src/support/lyxstring.h: comment out the three private
10755 operators, when compiling with string ansi conforming compilers
10756 they make problems.
10758 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10760 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10761 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10764 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10767 * src/mathed/math_panel.C (create_math_panel): remove explicit
10770 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10773 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10774 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10775 to XCreatePixmapFromBitmapData
10776 (fl_set_bmtable_data): change the last argument to be unsigned
10778 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10779 and bh to be unsigned int, remove explicit casts in call to
10780 XReadBitmapFileData.
10782 * images/arrows.xbm: made the arrays unsigned char *
10783 * images/varsz.xbm: ditto
10784 * images/misc.xbm: ditto
10785 * images/greek.xbm: ditto
10786 * images/dots.xbm: ditto
10787 * images/brel.xbm: ditto
10788 * images/bop.xbm: ditto
10790 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10792 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10793 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10794 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10796 (LYX_CXX_CHEADERS): added <clocale> to the test.
10798 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10800 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10802 * src/support/lyxstring.C (append): fixed something that must be a
10803 bug, rep->assign was used instead of rep->append.
10805 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10808 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10809 lyx insert double chars. Fix spotted by Kayvan.
10811 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10813 * Fixed the tth support. I messed up with the Emacs patch apply feature
10814 and omitted the changes in lyxrc.C.
10816 1999-10-22 Juergen Vigna <jug@sad.it>
10818 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10820 * src/lyx_cb.C (MenuInsertRef) +
10821 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10822 the form cannot be resized under it limits (fixes a segfault)
10824 * src/lyx.C (create_form_form_ref) +
10825 * forms/lyx.fd: Changed Gravity on name input field so that it is
10828 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10830 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10831 <ostream> and <istream>.
10833 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10834 whether <fstream> provides the latest standard features, or if we
10835 have an oldstyle library (like in egcs).
10836 (LYX_CXX_STL_STRING): fix the test.
10838 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10839 code on MODERN_STL_STREAM.
10841 * src/support/lyxstring.h: use L{I,O}stream.h.
10843 * src/support/L{I,O}stream.h: new files, designed to setup
10844 correctly streams for our use
10845 - includes the right header depending on STL capabilities
10846 - puts std::ostream and std::endl (for LOStream.h) or
10847 std::istream (LIStream.h) in toplevel namespace.
10849 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10851 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10852 was a bib file that had been changed we ensure that bibtex is run.
10853 (runBibTeX): enhanced to extract the names of the bib files and
10854 getting their absolute path and enter them into the dep file.
10855 (findtexfile): static func that is used to look for tex-files,
10856 checks for absolute patchs and tries also with kpsewhich.
10857 Alternative ways of finding the correct files are wanted. Will
10859 (do_popen): function that runs a command using popen and returns
10860 the whole output of that command in a string. Should be moved to
10863 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10864 file with extension ext has changed.
10866 * src/insets/figinset.C: added ifdef guards around the fl_free
10867 code that jug commented out. Now it is commented out when
10868 compiling with XForms == 0.89.
10870 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10871 to lyxstring.C, and only keep a forward declaration in
10872 lyxstring.h. Simplifies the header file a bit and should help a
10873 bit on compile time too. Also changes to Srep will not mandate a
10874 recompile of code just using string.
10875 (~lyxstring): definition moved here since it uses srep.
10876 (size): definition moved here since it uses srep.
10878 * src/support/lyxstring.h: removed a couple of "inline" that should
10881 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10883 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10886 1999-10-21 Juergen Vigna <jug@sad.it>
10888 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10889 set to left if I just remove the width entry (or it is empty).
10891 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10892 paragraph when having dummy paragraphs.
10894 1999-10-20 Juergen Vigna <jug@sad.it>
10896 * src/insets/figinset.C: just commented some fl_free_form calls
10897 and added warnings so that this calls should be activated later
10898 again. This avoids for now a segfault, but we have a memory leak!
10900 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10901 'const char * argument' to 'string argument', this should
10902 fix some Asserts() in lyxstring.C.
10904 * src/lyxfunc.h: Removed the function argAsString(const char *)
10905 as it is not used anymore.
10907 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10909 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10912 * src/Literate.h: some funcs moved from public to private to make
10913 interface clearer. Unneeded args removed.
10915 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10917 (scanBuildLogFile): ditto
10919 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10920 normal TeX Error. Still room for improvement.
10922 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10924 * src/buffer.C (insertErrors): changes to make the error
10925 desctription show properly.
10927 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10930 * src/support/lyxstring.C (helper): changed to use
10931 sizeof(object->rep->ref).
10932 (operator>>): changed to use a pointer instead.
10934 * src/support/lyxstring.h: changed const reference & to value_type
10935 const & lets see if that helps.
10937 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10939 * Makefile.am (rpmdist): fixed to have non static package and
10942 * src/support/lyxstring.C: removed the compilation guards
10944 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10947 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10948 conditional compile of lyxstring.Ch
10950 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10951 stupid check, but it is a lot better than the bastring hack.
10952 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10954 * several files: changed string::erase into string::clear. Not
10957 * src/chset.C (encodeString): use a char temporary instead
10959 * src/table.C (TexEndOfCell): added tostr around
10960 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10961 (TexEndOfCell): ditto
10962 (TexEndOfCell): ditto
10963 (TexEndOfCell): ditto
10964 (DocBookEndOfCell): ditto
10965 (DocBookEndOfCell): ditto
10966 (DocBookEndOfCell): ditto
10967 (DocBookEndOfCell): ditto
10969 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10971 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10973 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10974 (MenuBuildProg): added tostr around ret
10975 (MenuRunChktex): added tostr around ret
10976 (DocumentApplyCB): added tostr around ret
10978 * src/chset.C (encodeString): added tostr around t->ic
10980 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10981 (makeLaTeXFile): added tostr around tocdepth
10982 (makeLaTeXFile): added tostr around ftcound - 1
10984 * src/insets/insetbib.C (setCounter): added tostr around counter.
10986 * src/support/lyxstring.h: added an operator+=(int) to catch more
10989 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10990 (lyxstring): We DON'T allow NULL pointers.
10992 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10994 * src/mathed/math_macro.C (MathMacroArgument::Write,
10995 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10996 when writing them out.
10998 * src/LString.C: remove, since it is not used anymore.
11000 * src/support/lyxstring.C: condition the content to
11001 USE_INCLUDED_STRING macro.
11003 * src/mathed/math_symbols.C, src/support/lstrings.C,
11004 src/support/lyxstring.C: add `using' directive to specify what
11005 we need in <algorithm>. I do not think that we need to
11006 conditionalize this, but any thought is appreciated.
11008 * many files: change all callback functions to "C" linkage
11009 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11010 strict_ansi. Those who were static are now global.
11011 The case of callbacks which are static class members is
11012 trickier, since we have to make C wrappers around them (see
11013 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11014 did not finish this yet, since it defeats the purpose of
11015 encapsulation, and I am not sure what the best route is.
11017 1999-10-19 Juergen Vigna <jug@sad.it>
11019 * src/support/lyxstring.C (lyxstring): we permit to have a null
11020 pointer as assignment value and just don't assign it.
11022 * src/vspace.C (nextToken): corrected this function substituting
11023 find_first(_not)_of with find_last_of.
11025 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11026 (TableOptCloseCB) (TableSpeCloseCB):
11027 inserted fl_set_focus call for problem with fl_hide_form() in
11030 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11032 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11035 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11037 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11038 LyXLex::next() and not eatline() to get its argument.
11040 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11042 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11043 instead, use fstreams for io of the depfile, removed unneeded
11044 functions and variables.
11046 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11047 vector instead, removed all functions and variables that is not in
11050 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11052 * src/buffer.C (insertErrors): use new interface to TeXError
11054 * Makefile.am (rpmdist): added a rpmdist target
11056 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11057 per Kayvan's instructions.
11059 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11061 * src/Makefile.am: add a definition for localedir, so that locales
11062 are found after installation (Kayvan)
11064 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11066 * development/.cvsignore: new file.
11068 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11070 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11071 C++ compiler provides wrappers for C headers and use our alternate
11074 * configure.in: use LYX_CXX_CHEADERS.
11076 * src/cheader/: new directory, populated with cname headers from
11077 libstdc++-2.8.1. They are a bit old, but probably good enough for
11078 what we want (support compilers who lack them).
11080 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11081 from includes. It turns out is was stupid.
11083 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11085 * lib/Makefile.am (install-data-local): forgot a ';'
11086 (install-data-local): forgot a '\'
11087 (libinstalldirs): needed after all. reintroduced.
11089 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11091 * configure.in (AC_OUTPUT): added lyx.spec
11093 * development/lyx.spec: removed file
11095 * development/lyx.spec.in: new file
11097 * po/*.po: merged with lyx.pot becuase of make distcheck
11099 * lib/Makefile.am (dist-hook): added dist-hook so that
11100 documentation files will be included when doing a make
11101 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11102 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11104 more: tried to make install do the right thing, exclude CVS dirs
11107 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11108 Path would fit in more nicely.
11110 * all files that used to use pathstack: uses now Path instead.
11111 This change was a lot easier than expected.
11113 * src/support/path.h: new file
11115 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11117 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11119 * src/support/lyxstring.C (getline): Default arg was given for
11122 * Configure.cmd: removed file
11124 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11126 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11127 streams classes and types, add the proper 'using' statements when
11128 MODERN_STL is defined.
11130 * src/debug.h: move the << operator definition after the inclusion
11133 * src/support/filetools.C: include "LAssert.h", which is needed
11136 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11139 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11140 include "debug.h" to define a proper ostream.
11142 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11144 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11145 method to the SystemCall class which can kill a process, but it's
11146 not fully implemented yet.
11148 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11150 * src/support/FileInfo.h: Better documentation
11152 * src/lyxfunc.C: Added support for buffer-export html
11154 * src/menus.C: Added Export->As HTML...
11156 * lib/bind/*.bind: Added short-cut for buffer-export html
11158 * src/lyxrc.*: Added support for new \tth_command
11160 * lib/lyxrc.example: Added stuff for new \tth_command
11162 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11164 * lib/Makefile.am (IMAGES): removed images/README
11165 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11166 installes in correct place. Check permisions is installed
11169 * src/LaTeX.C: some no-op changes moved declaration of some
11172 * src/LaTeX.h (LATEX_H): changed include guard name
11174 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11176 * lib/reLyX/Makefile.am: install noweb2lyx.
11178 * lib/Makefile.am: install configure.
11180 * lib/reLyX/configure.in: declare a config aux dir; set package
11181 name to lyx (not sure what the best solution is); generate noweb2lyx.
11183 * lib/layouts/egs.layout: fix the bibliography layout.
11185 1999-10-08 Jürgen Vigna <jug@sad.it>
11187 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11188 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11189 it returned without continuing to search the path.
11191 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11193 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11194 also fixes a bug. It is not allowed to do tricks with std::strings
11195 like: string a("hei"); &a[e]; this will not give what you
11196 think... Any reason for the complexity in this func?
11198 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11200 * Updated README and INSTALL a bit, mostly to check that my
11201 CVS rights are correctly set up.
11203 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11205 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11206 does not allow '\0' chars but lyxstring and std::string does.
11208 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11210 * autogen.sh (AUTOCONF): let the autogen script create the
11211 POTFILES.in file too. POTFILES.in should perhaps now not be
11212 included in the cvs module.
11214 * some more files changed to use C++ includes instead of C ones.
11216 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11218 (Reread): added tostr to nlink. buggy output otherwise.
11219 (Reread): added a string() around szMode when assigning to Buffer,
11220 without this I got a log of garbled info strings.
11222 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11225 * I have added several ostream & operator<<(ostream &, some_type)
11226 functions. This has been done to avoid casting and warnings when
11227 outputting enums to lyxerr. This as thus eliminated a lot of
11228 explicit casts and has made the code clearer. Among the enums
11229 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11230 mathed enums, some font enum the Debug::type enum.
11232 * src/support/lyxstring.h (clear): missing method. equivalent of
11235 * all files that contained "stderr": rewrote constructs that used
11236 stderr to use lyxerr instead. (except bmtable)
11238 * src/support/DebugStream.h (level): and the passed t with
11239 Debug::ANY to avoid spurious bits set.
11241 * src/debug.h (Debug::type value): made it accept strings of the
11242 type INFO,INIT,KEY.
11244 * configure.in (Check for programs): Added a check for kpsewhich,
11245 the latex generation will use this later to better the dicovery of
11248 * src/BufferView.C (create_view): we don't need to cast this to
11249 (void*) that is done automatically.
11250 (WorkAreaButtonPress): removed some dead code.
11252 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11254 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11255 is not overwritten when translated (David Sua'rez de Lis).
11257 * lib/CREDITS: Added David Sua'rez de Lis
11259 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11261 * src/bufferparams.C (BufferParams): default input encoding is now
11264 * acinclude.m4 (cross_compiling): comment out macro
11265 LYX_GXX_STRENGTH_REDUCE.
11267 * acconfig.h: make sure that const is not defined (to empty) when
11268 we are compiling C++. Remove commented out code using SIZEOF_xx
11271 * configure.in : move the test for const and inline as late as
11272 possible so that these C tests do not interefere with C++ ones.
11273 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11274 has not been proven.
11276 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11278 * src/table.C (getDocBookAlign): remove bad default value for
11279 isColumn parameter.
11281 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11283 (ShowFileMenu2): ditto.
11285 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11286 of files to ignore.
11288 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11290 * Most files: finished the change from the old error code to use
11291 DebugStream for all lyxerr debugging. Only minor changes remain
11292 (e.g. the setting of debug levels using strings instead of number)
11294 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11296 * src/layout.C (Add): Changed to use compare_no_case instead of
11299 * src/FontInfo.C: changed loop variable type too string::size_type.
11301 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11303 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11304 set ETAGS_ARGS to --c++
11306 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11308 * src/table.C (DocBookEndOfCell): commented out two unused variables
11310 * src/paragraph.C: commented out four unused variables.
11312 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11313 insed a if clause with type string::size_type.
11315 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11318 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11320 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11321 variable, also changed loop to go from 0 to lenght + 1, instead of
11322 -1 to length. This should be correct.
11324 * src/LaTeX.C (scanError): use string::size_type as loop variable
11327 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11328 (l.896) since y_tmp and row was not used anyway.
11330 * src/insets/insetref.C (escape): use string::size_type as loop
11333 * src/insets/insetquotes.C (Width): use string::size_type as loop
11335 (Draw): use string::size_type as loop variable type.
11337 * src/insets/insetlatexaccent.C (checkContents): use
11338 string::size_type as loop variable type.
11340 * src/insets/insetlabel.C (escape): use string::size_type as loop
11343 * src/insets/insetinfo.C: added an extern for current_view.
11345 * src/insets/insetcommand.C (scanCommand): use string::size_type
11346 as loop variable type.
11348 * most files: removed the RCS tags. With them we had to recompile
11349 a lot of files after a simple cvs commit. Also we have never used
11350 them for anything meaningful.
11352 * most files: tags-query-replace NULL 0. As adviced several plases
11353 we now use "0" instead of "NULL" in our code.
11355 * src/support/filetools.C (SpaceLess): use string::size_type as
11356 loop variable type.
11358 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11360 * src/paragraph.C: fixed up some more string stuff.
11362 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11364 * src/support/filetools.h: make modestr a std::string.
11366 * src/filetools.C (GetEnv): made ch really const.
11368 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11369 made code that used these use max/min from <algorithm> instead.
11371 * changed several c library include files to their equivalent c++
11372 library include files. All is not changed yet.
11374 * created a support subdir in src, put lyxstring and lstrings
11375 there + the extra files atexit, fileblock, strerror. Created
11376 Makefile.am. edited configure.in and src/Makefile.am to use this
11377 new subdir. More files moved to support.
11379 * imported som of the functions from repository lyx, filetools
11381 * ran tags-query-replace on LString -> string, corrected the bogus
11382 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11383 is still some errors in there. This is errors where too much or
11384 too litle get deleted from strings (string::erase, string::substr,
11385 string::replace), there can also be some off by one errors, or
11386 just plain wrong use of functions from lstrings. Viewing of quotes
11389 * LyX is now running fairly well with string, but there are
11390 certainly some bugs yet (see above) also string is quite different
11391 from LString among others in that it does not allow null pointers
11392 passed in and will abort if it gets any.
11394 * Added the revtex4 files I forgot when setting up the repository.
11396 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11398 * All over: Tried to clean everything up so that only the files
11399 that we really need are included in the cvs repository.
11400 * Switched to use automake.
11401 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11402 * Install has not been checked.
11404 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11406 * po/pt.po: Three errors:
11407 l.533 and l.538 format specification error
11408 l. 402 duplicate entry, I just deleted it.