1 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
6 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
9 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
11 * lib/layouts/amsbook.layout: ditto.
13 * boost/Makefile.am: fix typo.
15 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
17 (add_lastfiles): removed.
18 (add_documents): removed.
19 (add_formats): removed.
21 * src/frontends/Menubar.C: remove useless "using" directive.
23 * src/MenuBackend.h: add a new MenuItem constructor.
25 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
28 2000-10-04 Allan Rae <rae@lyx.org>
30 * lib/Makefile.am (listerrors):
31 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
32 I haven't got notangle installed so Kayvan please test. The output
33 should end up in $builddir. This also allows people who don't have
34 noweb installed to complete the make process without error.
36 * src/frontends/xforms/FormCommand.[Ch] (showInset):
37 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
38 by JMarc's picky compiler.
40 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
43 * src/insets/insettabular.C (setPos): change for loop to not use
44 sequencing operator. Please check this Jürgen.
46 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
48 * src/insets/insetcite.C (getScreenLabel): ditto
49 * src/support/filetools.C (QuoteName): ditto
50 (ChangeExtension): ditto
52 * src/BufferView_pimpl.C (scrollCB): make heigt int
54 * src/BufferView2.C (insertInset): comment out unused arg
56 * boost/Makefile.am (EXTRADIST): new variable
58 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
60 * src/exporter.C (IsExportable): Fixed
62 * lib/configure.m4: Small fix
64 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
66 * src/insets/insetbutton.C (width): Changed to work with no GUI.
67 * src/insets/insetbib.C (bibitemWidest): ditto.
68 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
70 2000-10-03 Juergen Vigna <jug@sad.it>
72 * src/BufferView2.C (theLockingInset): removed const because of
73 Agnus's compile problems.
75 * src/insets/insettext.C (LocalDispatch): set the language of the
76 surronding paragraph on inserting the first character.
78 * various files: changed use of BufferView::the_locking_inset.
80 * src/BufferView2.C (theLockingInset):
81 (theLockingInset): new functions.
83 * src/BufferView.h: removed the_locking_inset.
85 * src/lyxtext.h: added the_locking_inset
87 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
89 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
91 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
93 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
94 * src/mathed/math_cursor.C (IsAlpha): ditto.
95 * src/mathed/math_inset.C (strnew): ditto.
96 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
97 (IMetrics): cxp set but never used; removed.
98 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
99 that the variable in question has been removed also!
102 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
103 using the Buffer * passed to Latex(), using the BufferView * passed to
104 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
106 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
107 Linuxdoc() and DocBook() rather than the stored Buffer * master.
109 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
110 * src/buffer.C (readInset): used new InsetBibtex c-tor
111 * (getBibkeyList): used new InsetBibtex::getKeys
113 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
116 * lib/build-listerrors
118 * src/exporter.C: Add literate programming support to the export code
121 * src/lyx_cb.C: Remove old literate code.
123 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
126 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
127 * src/converter.C (View, Convert): Use QuoteName.
129 * src/insets/figinset.C (Preview): Use Formats::View.
131 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
133 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
135 * src/lyxfunc.C (Dispatch): move declaration of text variable at
136 the top of the function, because compaq cxx complains that the
137 "goto exit_with_message" when the function is disabled bypasses
139 (MenuNew): try a better fix for the generation of new file names.
140 This time, I used AddName() instead of AddPath(), hoping Juergen
143 2000-10-03 Allan Rae <rae@lyx.org>
145 * src/frontends/xforms/forms/form_preferences.fd:
146 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
147 nested tabfolders has begun. The old "Miscellaneous" was renamed as
148 "Look and Feel"->"General" but will need to be split up further into
149 general output and general input tabs. Current plan is for four outer
150 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
151 stuff; "Inputs" for input and import configuration; "Outputs" for
152 output and export configuration; and one more whatever is left over
153 called "General". The leftovers at present look like being which
154 viewers to use, spellchecker, language support and might be better
155 named "Support". I've put "Paths" in "Inputs" for the moment as this
156 seems reasonable for now at least.
157 One problem remains: X error kills LyX when you close Preferences.
159 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
161 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
162 qualifier from form()
163 * src/frontends/xforms/FormCitation.[Ch]:
164 * src/frontends/xforms/FormCopyright.[Ch]:
165 * src/frontends/xforms/FormDocument.[Ch]:
166 * src/frontends/xforms/FormError.[Ch]:
167 * src/frontends/xforms/FormIndex.[Ch]:
168 * src/frontends/xforms/FormPreferences.[Ch]:
169 * src/frontends/xforms/FormPrint.[Ch]:
170 * src/frontends/xforms/FormRef.[Ch]:
171 * src/frontends/xforms/FormToc.[Ch]:
172 * src/frontends/xforms/FormUrl.[Ch]: ditto.
174 * src/frontends/xforms/FormCitation.[Ch]:
175 * src/frontends/xforms/FormIndex.[Ch]:
176 * src/frontends/xforms/FormRef.[Ch]:
177 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
178 with Allan's naming policy
180 * src/frontends/xforms/FormCitation.C: some static casts to remove
183 2000-10-02 Juergen Vigna <jug@sad.it>
185 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
186 now you can type or do stuff inside the table-cell also when in dummy
187 position, fixed visible cursor.
189 * src/insets/insettext.C (Edit): fixing cursor-view position.
191 * src/lyxfunc.C (Dispatch): use * text variable so that it can
192 be used for equal functions in lyxfunc and insettext.
194 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
196 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
198 * src/frontends/gnome/FormCitation.h:
199 * src/frontends/gnome/FormCopyright.h:
200 * src/frontends/gnome/FormIndex.h:
201 * src/frontends/gnome/FormPrint.h:
202 * src/frontends/gnome/FormToc.h:
203 * src/frontends/gnome/FormUrl.h:
204 * src/frontends/kde/FormCitation.h:
205 * src/frontends/kde/FormCopyright.h:
206 * src/frontends/kde/FormIndex.h:
207 * src/frontends/kde/FormRef.h:
208 * src/frontends/kde/FormToc.h:
209 * src/frontends/kde/FormUrl.h: fix remaining users of
212 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
214 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
216 (DocBookHandleCaption): ditto.
217 (DocBookHandleFootnote): ditto.
218 (SimpleDocBookOnePar): ditto.
220 * src/frontends/xforms/FormDocument.h (form): remove extra
221 FormDocument:: qualifier.
223 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
225 * sigc++/handle.h: ditto.
227 * src/lyx_gui_misc.C: add "using" directive.
229 * src/cheaders/cstddef: new file, needed by the boost library (for
232 2000-10-02 Juergen Vigna <jug@sad.it>
234 * src/insets/insettext.C (SetFont): better support.
236 * src/insets/insettabular.C (draw): fixed drawing of single cell.
238 * src/screen.C (DrawOneRow): some uint refixes!
240 2000-10-02 Allan Rae <rae@lyx.org>
242 * boost/.cvsignore: ignore Makefile as well
244 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
245 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
247 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
248 Left this one out by accident.
250 * src/frontends/xforms/FormBase.h (restore): default to calling
251 update() since that will restore the original/currently-applied values.
252 Any input() triggered error messages will require the derived classes
253 to redefine restore().
255 * src/frontends/xforms/FormDocument.C: initialize a few variables to
256 avoid a segfault. combo_doc_class is the main concern.
258 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
260 * Simplify build-listerrors in view of GUI-less export ability!
262 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
264 * src/lyx_main.C (easyParse): Disable gui when exporting
266 * src/insets/figinset.C:
270 * src/tabular.C: Changes to allow no-gui.
272 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
274 * src/support/utility.hpp: removed file
275 * src/support/block.h: removed file
277 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
280 * src/mathed/formula.C: add support/lyxlib.h
281 * src/mathed/formulamacro.C: ditto
283 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
284 * src/lyxparagraph.h: ditto
286 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
287 * src/frontends/Makefile.am (INCLUDES): ditto
288 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
289 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
290 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
291 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
292 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
293 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
295 * src/BufferView.h: use boost/utility.hpp
296 * src/LColor.h: ditto
298 * src/LyXAction.h: ditto
299 * src/LyXView.h: ditto
300 * src/bufferlist.h: ditto
301 * src/lastfiles.h: ditto
302 * src/layout.h: ditto
303 * src/lyx_gui.h: ditto
304 * src/lyx_main.h: ditto
305 * src/lyxlex.h: ditto
307 * src/frontends/ButtonPolicies.h: ditto
308 * src/frontends/Dialogs.h: ditto
309 * src/frontends/xforms/FormBase.h: ditto
310 * src/frontends/xforms/FormGraphics.h: ditto
311 * src/frontends/xforms/FormParagraph.h: ditto
312 * src/frontends/xforms/FormTabular.h: ditto
313 * src/graphics/GraphicsCache.h: ditto
314 * src/graphics/Renderer.h: ditto
315 * src/insets/ExternalTemplate.h: ditto
316 * src/insets/insetcommand.h: ditto
317 * src/support/path.h: ditto
319 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
320 and introduce clause for 2.97.
322 * boost/libs/README: new file
324 * boost/boost/utility.hpp: new file
326 * boost/boost/config.hpp: new file
328 * boost/boost/array.hpp: new file
330 * boost/Makefile.am: new file
332 * boost/.cvsignore: new file
334 * configure.in (AC_OUTPUT): add boost/Makefile
336 * Makefile.am (SUBDIRS): add boost
338 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
340 * src/support/lstrings.C (suffixIs): Fixed.
342 2000-10-01 Allan Rae <rae@lyx.org>
344 * src/PrinterParams.h: moved things around to avoid the "can't
345 inline call" warning.
347 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
348 into doc++ documentation.
350 * src/frontends/xforms/FormCommand.[Ch]: support button policy
352 * src/frontends/xforms/FormRef.C: make use of button controller
353 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
354 cleaned up button controller usage.
355 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
356 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
357 use the button controller
359 * src/frontends/xforms/forms/*.fd: and associated generated files
360 updated to reflect changes to FormBase. Some other FormXxxx files
361 also got minor updates to reflect changes to FormBase.
363 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
364 (hide): made virtual.
365 (input): return a bool. true == valid input
366 (RestoreCB, restore): new
367 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
368 Changes to allow derived dialogs to use a ButtonController and
369 make sense when doing so: OK button calls ok() and so on.
371 * src/frontends/xforms/ButtonController.h (class ButtonController):
372 Switch from template implementation to taking Policy parameter.
373 Allows FormBase to provide a ButtonController for any dialog.
375 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
376 Probably should rename connect and disconnect.
377 (apply): use the radio button groups
378 (form): needed by FormBase
379 (build): setup the radio button groups
381 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
383 * several files: type changes to reduce the number of warnings and
384 to unify type hangling a bit. Still much to do.
386 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
388 * lib/images/*: rename a bunch of icons to match Dekel converter
391 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
394 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
396 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
398 * sigc++/handle.h: ditto for class Handle.
400 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
402 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
404 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
406 * src/intl.C (InitKeyMapper): Correct the value of n due to the
407 removal of the "default" language.
409 * src/combox.h (getline): Check that sel > 0
411 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
413 * lib/examples/docbook_example.lyx
414 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
416 * lib/layouts/docbook-book.layout: new docbook book layout.
418 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
420 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
422 * src/insets/figinset.C (DocBook):fixed small typo.
424 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
426 * src/insets/insetinclude.h: string include_label doesn't need to be
429 2000-09-29 Allan Rae <rae@lyx.org>
431 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
432 Allow derived type to control connection and disconnection from signals
433 of its choice if desired.
435 2000-09-28 Juergen Vigna <jug@sad.it>
437 * src/insets/insettabular.C (update): fixed cursor setting when
438 the_locking_inset changed.
439 (draw): made this a bit cleaner.
440 (InsetButtonPress): fixed!
442 * various files: added LyXText Parameter to fitCursor call.
444 * src/BufferView.C (fitCursor): added LyXText parameter.
446 * src/insets/insettabular.C (draw): small draw fix.
448 * src/tabular.C: right setting of left/right celllines.
450 * src/tabular.[Ch]: fixed various types in funcions and structures.
451 * src/insets/insettabular.C: ditto
452 * src/frontends/xforms/FormTabular.C: ditto
454 2000-09-28 Allan Rae <rae@lyx.org>
456 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
457 that the #ifdef's had been applied to part of what should have been
458 a complete condition. It's possible there are other tests that
459 were specific to tables that are also wrong now that InsetTabular is
460 being used. Now we need to fix the output of '\n' after a table in a
461 float for the same reason as the original condition:
462 "don't insert this if we would be adding it before or after a table
463 in a float. This little trick is needed in order to allow use of
464 tables in \subfigures or \subtables."
465 Juergen can you check this?
467 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
469 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
470 outputed to the ostream.
472 * several files: fixed types based on warnings from cxx
474 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
476 * src/frontends/kde/Makefile.am: fix rule for
477 formindexdialogdata_moc.C
479 * src/.cvsignore: add ext_l10n.h to ignore
481 * acconfig.h: stop messing with __STRICT_ANSI__
482 * config/gnome.m4: remove option to set -ansi
483 * config/kde.m4: remove option to set -ansi
484 * config/lyxinclude.m4: don't set -ansi
486 2000-09-27 Juergen Vigna <jug@sad.it>
488 * various files: remove "default" language check.
490 * src/insets/insetquotes.C: removed use of current_view.
492 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
493 the one should have red ears by now!
495 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
496 in more then one paragraph. Fixed cursor-movement/selection.
498 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
499 paragraphs inside a text inset.
501 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
502 text-inset if this owner is an inset.
504 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
506 * src/Bullet.h: changed type of font, character and size to int
508 * src/buffer.C (asciiParagraph): remove actcell and fname1.
510 * src/insets/inseturl.[Ch]:
511 * src/insets/insetref.[Ch]:
512 * src/insets/insetlabel.[Ch]: add linelen to Ascii
514 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
516 * src/buffer.C (readFile): block-if statement rearranged to minimise
517 bloat. Patch does not reverse Jean-Marc's change ;-)
519 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
520 Class rewritten to store pointers to hide/update signals directly,
521 rather than Dialogs *. Also defined an enum to ease use. All xforms
522 forms can now be derived from this class.
524 * src/frontends/xforms/FormCommand.[Ch]
525 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
527 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
530 * src/frontends/xforms/forms/form_citation.fd
531 * src/frontends/xforms/forms/form_copyright.fd
532 * src/frontends/xforms/forms/form_error.fd
533 * src/frontends/xforms/forms/form_index.fd
534 * src/frontends/xforms/forms/form_ref.fd
535 * src/frontends/xforms/forms/form_toc.fd
536 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
538 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
540 * src/insets/insetfoot.C: removed redundent using directive.
542 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
544 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
545 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
547 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
548 created in the constructors in different groups. Then set() just
549 have to show the groups as needed. This fixes the redraw problems
550 (and is how the old menu code worked).
552 * src/support/lyxlib.h: declare the methods as static when we do
555 2000-09-26 Juergen Vigna <jug@sad.it>
557 * src/buffer.C (asciiParagraph): new function.
558 (writeFileAscii): new function with parameter ostream.
559 (writeFileAscii): use now asciiParagraph.
561 * various inset files: added the linelen parameter to the Ascii-func.
563 * src/tabular.C (Write): fixed error in writing file introduced by
564 the last changes from Lars.
566 * lib/bind/menus.bind: removed not supported functions.
568 * src/insets/insettext.C (Ascii): implemented this function.
570 * src/insets/lyxinset.h (Ascii): added linelen parameter.
572 * src/tabular.C (write_attribute[int,string,bool]): new functions.
573 (Write): use of the write_attribute functions.
575 * src/bufferlist.C (close): fixed reasking question!
577 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
579 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
580 new files use the everwhere possible.
583 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
584 src/log_form.C src/lyx.C:
587 * src/buffer.C (runLaTeX): remove func
589 * src/PaperLayout.C: removed file
590 * src/ParagraphExtra.C: likewise
591 * src/bullet_forms.C: likewise
592 * src/bullet_forms.h: likewise
593 * src/bullet_forms_cb.C: likewise
595 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
596 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
599 * several files: remove all traces of the old fd_form_paragraph,
600 and functions belonging to that.
602 * several files: remove all traces of the old fd_form_document,
603 and functions belonging to that.
605 * several files: constify local variables were possible.
607 * several files: remove all code that was dead when NEW_EXPORT was
610 * several files: removed string::c_str in as many places as
613 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
614 (e): be a bit more outspoken when patching
615 (updatesrc): only move files if changed.
617 * forms/layout_forms.h.patch: regenerated
619 * forms/layout_forms.fd: remove form_document and form_paragraph
620 and form_quotes and form_paper and form_table_options and
623 * forms/form1.fd: remove form_table
625 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
626 the fdui->... rewrite. Update some comments to xforms 0.88
628 * forms/bullet_forms.C.patch: removed file
629 * forms/bullet_forms.fd: likewise
630 * forms/bullet_forms.h.patch: likewise
632 * development/Code_rules/Rules: added a section on switch
633 statements. Updated some comment to xforms 0.88.
635 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
637 * src/buffer.C (readFile): make sure that the whole version number
638 is read after \lyxformat (even when it contains a comma)
640 * lib/ui/default.ui: change shortcut of math menu to M-a.
642 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
644 * src/vspace.C (nextToken): use isStrDbl() to check for proper
647 * src/LyXView.C (updateWindowTitle): show the full files name in
648 window title, limited to 30 characters.
650 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
651 When a number of characters has been given, we should not assume
652 that the string is 0-terminated.
654 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
655 calls (fixes some memory leaks)
657 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
658 trans member on exit.
660 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
662 * src/converter.C (GetReachable): fix typo.
664 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
665 understand ',' instead of '.'.
666 (GetInteger): rewrite to use strToInt().
668 2000-09-26 Juergen Vigna <jug@sad.it>
670 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
671 better visibility and error-message on wrong VSpace input.
673 * src/language.C (initL): added english again.
675 2000-09-25 Juergen Vigna <jug@sad.it>
677 * src/frontends/kde/Dialogs.C (Dialogs):
678 * src/frontends/gnome/Dialogs.C (Dialogs):
679 * src/frontends/kde/Makefile.am:
680 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
682 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
684 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
686 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
688 * src/frontends/xforms/FormParagraph.C:
689 * src/frontends/xforms/FormParagraph.h:
690 * src/frontends/xforms/form_paragraph.C:
691 * src/frontends/xforms/form_paragraph.h:
692 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
695 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
697 * src/tabular.C (OldFormatRead): forgot to delete the temporary
698 Paragraph-Data after use.
700 * src/insets/insettext.C (LocalDispatch): don't set the layout on
701 non breakable paragraphs.
703 2000-09-25 Garst R. Reese <reese@isn.net>
705 * src/language.C (initL): added missing language_country codes.
707 2000-09-25 Juergen Vigna <jug@sad.it>
709 * src/insets/insettext.C (InsetText):
710 (deleteLyXText): remove the not released LyXText structure!
712 2000-09-24 Marko Vendelin <markov@ioc.ee>
714 * src/frontends/gnome/mainapp.C
715 * src/frontends/gnome/mainapp.h: added support for keyboard
718 * src/frontends/gnome/FormCitation.C
719 * src/frontends/gnome/FormCitation.h
720 * src/frontends/gnome/Makefile.am
721 * src/frontends/gnome/pixbutton.h: completed the rewrite of
722 FormCitation to use "action area" in mainapp window
724 * src/frontends/gnome/Menubar_pimpl.C
725 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
728 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
730 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
731 width/descent/ascent values if name is empty.
732 (mathed_string_height): Use std::max.
734 2000-09-25 Allan Rae <rae@lyx.org>
736 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
737 segfault. This will be completely redesigned soon.
739 * sigc++: updated libsigc++. Fixes struct timespec bug.
741 * development/tools/makeLyXsigc.sh: .cvsignore addition
743 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
745 * several files: removed almost all traces of the old table
748 * src/TableLayout.C: removed file
750 2000-09-22 Juergen Vigna <jug@sad.it>
752 * src/frontends/kde/Dialogs.C: added credits forms.
754 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
756 * src/frontends/gnome/Dialogs.C: added some forms.
758 * src/spellchecker.C (init_spell_checker): set language in pspell code
759 (RunSpellChecker): some modifications for setting language string.
761 * src/language.[Ch]: added language_country code.
763 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
765 * src/frontends/Dialogs.h: added new signal showError.
766 Rearranged existing signals in some sort of alphabetical order.
768 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
769 FormError.[Ch], form_error.[Ch]
770 * src/frontends/xforms/forms/makefile: added new file form_error.fd
771 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
773 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
774 dialogs. I think that this can be used as the base to all these
777 * src/frontends/xforms/FormError.[Ch]
778 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
779 implementation of InsetError dialog.
781 * src/insets/inseterror.[Ch]: rendered GUI-independent.
783 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
784 * src/frontends/kde/Makefile.am: ditto
786 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
788 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
789 macrobf. This fixes a bug of invisible text.
791 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
793 * lib/doc/LaTeXConfig.lyx.in: updated.
795 * src/language.C (initL): remove language "francais" and change a
796 bit the names of the two other french variations.
798 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
799 string that may not be 0-terminated.
801 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
803 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
805 2000-09-20 Marko Vendelin <markov@ioc.ee>
807 * src/frontends/gnome/FormCitation.C
808 * src/frontends/gnome/FormIndex.C
809 * src/frontends/gnome/FormToc.C
810 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
811 the variable initialization to shut up the warnings
813 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
815 * src/table.[Ch]: deleted files
817 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
820 2000-09-18 Juergen Vigna <jug@sad.it>
822 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
823 problems with selection. Inserted new LFUN_PASTESELECTION.
824 (InsetButtonPress): inserted handling of middle mouse-button paste.
826 * src/spellchecker.C: changed word to word.c_str().
828 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
830 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
831 included in the ``make dist'' tarball.
833 2000-09-15 Juergen Vigna <jug@sad.it>
835 * src/CutAndPaste.C (cutSelection): small fix return the right
836 end position after cut inside one paragraph only.
838 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
839 we are locked as otherwise we don't have a valid cursor position!
841 * src/insets/figinset.C (draw): small bugfix but why is this needed???
843 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
845 * src/frontends/kde/FormRef.C: added using directive.
846 * src/frontends/kde/FormToc.C: ditto
848 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
850 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
852 2000-09-19 Marko Vendelin <markov@ioc.ee>
854 * src/frontends/gnome/Menubar_pimpl.C
855 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
856 Toc, ViewFormats, UpdateFormats, and ExportFormats.
858 * src/frontends/gnome/mainapp.C
859 * src/frontends/gnome/mainapp.h: support for menu update used
862 * src/frontends/gnome/mainapp.C
863 * src/frontends/gnome/mainapp.h: support for "action" area in the
864 main window. This area is used by small simple dialogs, such as
867 * src/frontends/gnome/FormIndex.C
868 * src/frontends/gnome/FormIndex.h
869 * src/frontends/gnome/FormUrl.C
870 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
873 * src/frontends/gnome/FormCitation.C
874 * src/frontends/gnome/FormCitation.h: rewrite to use main window
875 action area. Only "Insert new citation" is implemented.
877 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
879 * src/buffer.C (Dispatch): fix call to Dispatch
880 * src/insets/insetref.C (Edit): likewise
881 * src/insets/insetparent.C (Edit): likewise
882 * src/insets/insetinclude.C (include_cb): likewise
883 * src/frontends/xforms/FormUrl.C (apply): likewise
884 * src/frontends/xforms/FormToc.C (apply): likewise
885 * src/frontends/xforms/FormRef.C (apply): likewise
886 * src/frontends/xforms/FormIndex.C (apply): likewise
887 * src/frontends/xforms/FormCitation.C (apply): likewise
888 * src/lyxserver.C (callback): likewise
889 * src/lyxfunc.C (processKeySym): likewise
892 * src/lyx_cb.C (LayoutsCB): likewise
894 * Makefile.am (sourcedoc): small change
896 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
898 * src/main.C (main): Don't make an empty GUIRunTime object. all
899 methods are static. constify a bit remove unneded using + headers.
901 * src/tabular.C: some more const to local vars move some loop vars
903 * src/spellchecker.C: added some c_str after some word for pspell
905 * src/frontends/GUIRunTime.h: add new static method setDefaults
906 * src/frontends/xforms/GUIRunTime.C (setDefaults):
907 * src/frontends/kde/GUIRunTime.C (setDefaults):
908 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
910 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
911 with strnew in arg, use correct emptystring when calling SetName.
913 * several files: remove all commented code with relation to
914 HAVE_SSTREAM beeing false. We now only support stringstream and
917 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
919 * src/lyxfunc.C: construct correctly the automatic new file
922 * src/text2.C (IsStringInText): change type of variable i to shut
925 * src/support/sstream.h: do not use namespaces if the compiler
926 does not support them.
928 2000-09-15 Marko Vendelin <markov@ioc.ee>
929 * src/frontends/gnome/FormCitation.C
930 * src/frontends/gnome/FormCitation.h
931 * src/frontends/gnome/diainsertcitation_interface.c
932 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
933 regexp support to FormCitation [Gnome].
935 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
938 * configure.in: remove unused KDE/GTKGUI define
940 * src/frontends/kde/FormRef.C
941 * src/frontends/kde/FormRef.h
942 * src/frontends/kde/formrefdialog.C
943 * src/frontends/kde/formrefdialog.h: double click will
944 go to reference, now it is possible to change a cross-ref
947 * src/frontends/kde/FormToc.C
948 * src/frontends/kde/FormToc.h
949 * src/frontends/kde/formtocdialog.C
950 * src/frontends/kde/formtocdialog.h: add a depth
953 * src/frontends/kde/Makefile.am: add QtLyXView.h
956 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
958 * src/frontends/kde/FormCitation.h: added some using directives.
960 * src/frontends/kde/FormToc.h: corrected definition of doTree.
962 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
965 * src/mathed/math_defs.h: redefine SetAlign to use string rather
968 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
970 * src/buffer.C (pop_tag): revert for the second time a change by
971 Lars, who seems to really hate having non-local loop variables :)
973 * src/Lsstream.h: add "using" statements.
975 * src/support/copy.C (copy): add a bunch of std:: qualifiers
976 * src/buffer.C (writeFile): ditto
978 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
980 * src/buffer.C (writeFile): try to fix the locale modified format
981 number to always be as we want it.
983 * src/WorkArea.C (work_area_handler): try to workaround the bugs
984 in XForms 0.89. C-space is now working again.
986 * src/Lsstream.h src/support/sstream.h: new files.
988 * also commented out all cases where strstream were used.
990 * src/Bullet.h (c_str): remove method.
992 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
994 * a lot of files: get rid of "char const *" and "char *" is as
995 many places as possible. We only want to use them in interaction
996 with system of other libraries, not inside lyx.
998 * a lot of files: return const object is not of pod type. This
999 helps ensure that temporary objects is not modified. And fits well
1000 with "programming by contract".
1002 * configure.in: check for the locale header too
1004 * Makefile.am (sourcedoc): new tag for generation of doc++
1007 2000-09-14 Juergen Vigna <jug@sad.it>
1009 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1010 callback to check which combo called it and do the right action.
1012 * src/combox.C (combo_cb): added combo * to the callbacks.
1013 (Hide): moved call of callback after Ungrab of the pointer.
1015 * src/intl.h: removed LCombo2 function.
1017 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1018 function as this can now be handled in one function.
1020 * src/combox.h: added Combox * to callback prototype.
1022 * src/frontends/xforms/Toolbar_pimpl.C:
1023 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1025 2000-09-14 Garst Reese <reese@isn.net>
1027 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1028 moved usepackage{xxx}'s to beginning of file. Changed left margin
1029 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1030 underlining from title. Thanks to John Culleton for useful suggestions.
1032 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1034 * src/lyxlex_pimpl.C (setFile): change error message to debug
1037 2000-09-13 Juergen Vigna <jug@sad.it>
1039 * src/frontends/xforms/FormDocument.C: implemented choice_class
1040 as combox and give callback to combo_language so OK/Apply is activated
1043 * src/bufferlist.C (newFile): small fix so already named files
1044 (via an open call) are not requested to be named again on the
1047 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1049 * src/frontends/kde/Makefile.am
1050 * src/frontends/kde/FormRef.C
1051 * src/frontends/kde/FormRef.h
1052 * src/frontends/kde/formrefdialog.C
1053 * src/frontends/kde/formrefdialog.h: implement
1056 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1058 * src/frontends/kde/formtocdialog.C
1059 * src/frontends/kde/formtocdialog.h
1060 * src/frontends/kde/FormToc.C
1061 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1063 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1065 * src/frontends/kde/FormCitation.C: fix thinko
1066 where we didn't always display the reference text
1069 * src/frontends/kde/formurldialog.C
1070 * src/frontends/kde/formurldialog.h
1071 * src/frontends/kde/FormUrl.C
1072 * src/frontends/kde/FormUrl.h: minor cleanups
1074 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
1076 * src/frontends/kde/Makefile.am
1077 * src/frontends/kde/FormToc.C
1078 * src/frontends/kde/FormToc.h
1079 * src/frontends/kde/FormCitation.C
1080 * src/frontends/kde/FormCitation.h
1081 * src/frontends/kde/FormIndex.C
1082 * src/frontends/kde/FormIndex.h
1083 * src/frontends/kde/formtocdialog.C
1084 * src/frontends/kde/formtocdialog.h
1085 * src/frontends/kde/formcitationdialog.C
1086 * src/frontends/kde/formcitationdialog.h
1087 * src/frontends/kde/formindexdialog.C
1088 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1090 2000-09-12 Juergen Vigna <jug@sad.it>
1092 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1095 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1097 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1100 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1102 * src/converter.C (Add, Convert): Added support for converter flags:
1103 needaux, resultdir, resultfile.
1104 (Convert): Added new parameter view_file.
1105 (dvips_options): Fixed letter paper option.
1107 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1108 (Export, GetExportableFormats, GetViewableFormats): Added support
1111 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1113 (easyParse): Fixed to work with new export code.
1115 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
1118 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
1120 * lib/bind/*.bind: Replaced
1121 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
1122 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
1124 2000-09-11 Juergen Vigna <jug@sad.it>
1126 * src/lyx_gui.C (runTime): uses global guiruntime variable.
1128 * src/main.C (main): now GUII defines global guiruntime!
1130 * src/frontends/gnome/GUIRunTime.C (initApplication):
1131 * src/frontends/kde/GUIRunTime.C (initApplication):
1132 * src/frontends/xforms/GUIRunTime.C (initApplication):
1133 * src/frontends/GUIRunTime.h: added new function initApplication.
1135 * src/spellchecker.C (sc_accept_word): change to add_to_session.
1137 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
1139 2000-09-08 Juergen Vigna <jug@sad.it>
1141 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1142 we have already "Reset".
1144 * src/language.C (initL): inserted "default" language and made this
1145 THE default language (and not american!)
1147 * src/paragraph.C: inserted handling of "default" language!
1149 * src/lyxfont.C: ditto
1153 * src/paragraph.C: output the \\par only if we have a following
1154 paragraph otherwise it's not needed.
1156 2000-09-05 Juergen Vigna <jug@sad.it>
1158 * config/pspell.m4: added entry to lyx-flags
1160 * src/spellchecker.C: modified version from Kevin for using pspell
1162 2000-09-01 Marko Vendelin <markov@ioc.ee>
1163 * src/frontends/gnome/Makefile.am
1164 * src/frontends/gnome/FormCitation.C
1165 * src/frontends/gnome/FormCitation.h
1166 * src/frontends/gnome/diainsertcitation_callbacks.c
1167 * src/frontends/gnome/diainsertcitation_callbacks.h
1168 * src/frontends/gnome/diainsertcitation_interface.c
1169 * src/frontends/gnome/diainsertcitation_interface.h
1170 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1171 dialog for Gnome frontend
1173 * src/main.C: Gnome libraries require keeping application name
1174 and its version as strings
1176 * src/frontends/gnome/mainapp.C: Change the name of the main window
1177 from GnomeLyX to PACKAGE
1179 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1181 * src/frontends/Liason.C: add "using: declaration.
1183 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1185 * src/mathed/math_macro.C (Metrics): Set the size of the template
1187 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1189 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1191 * src/converter.C (add_options): New function.
1192 (SetViewer): Change $$FName into '$$FName'.
1193 (View): Add options when running xdvi
1194 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
1195 (Convert): The 3rd parameter is now the desired filename. Converts
1196 calls to lyx::rename if necessary.
1197 Add options when running dvips.
1198 (dvi_papersize,dvips_options): New methods.
1200 * src/exporter.C (Export): Use getLatexName() instead of fileName().
1202 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
1203 using a call to Converter::dvips_options.
1204 Fixed to work with nex export code.
1206 * src/support/copy.C
1207 * src/support/rename.C: New files
1209 * src/support/syscall.h
1210 * src/support/syscall.C: Added Starttype SystemDontWait.
1212 * lib/ui/default.ui: Changed to work with new export code
1214 * lib/configure.m4: Changed to work with new export code
1216 * src/encoding.C: Changed latex name for iso8859_7 encoding.
1218 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
1220 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
1221 so that code compiles with DEC cxx.
1223 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
1224 to work correctly! Also now supports the additional elements
1227 2000-09-01 Allan Rae <rae@lyx.org>
1229 * src/frontends/ButtonPolicies.C: renamed all the references to
1230 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
1232 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
1233 since it's a const not a type.
1235 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
1237 2000-08-31 Juergen Vigna <jug@sad.it>
1239 * src/insets/figinset.C: Various changes to look if the filename has
1240 an extension and if not add it for inline previewing.
1242 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1244 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1245 make buttonStatus and isReadOnly be const methods. (also reflect
1246 this in derived classes.)
1248 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1249 (nextState): change to be static inline, pass the StateMachine as
1251 (PreferencesPolicy): remove casts
1252 (OkCancelPolicy): remvoe casts
1253 (OkCancelReadOnlyPolicy): remove casts
1254 (NoRepeatedApplyReadOnlyPolicy): remove casts
1255 (OkApplyCancelReadOnlyPolicy): remove casts
1256 (OkApplyCancelPolicy): remove casts
1257 (NoRepeatedApplyPolicy): remove casts
1259 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1261 * src/converter.C: added some using directives
1263 * src/frontends/ButtonPolicies.C: changes to overcome
1264 "need lvalue" error with DEC c++
1266 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1267 to WMHideCB for DEC c++
1269 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1271 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1272 to BulletBMTableCB for DEC c++
1274 2000-08-31 Allan Rae <rae@lyx.org>
1276 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1277 character dialog separately from old document dialogs combo_language.
1280 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1282 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1283 Removed LFUN_REF_CREATE.
1285 * src/MenuBackend.C: Added new tags: toc and references
1287 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1288 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1290 (add_toc, add_references): New methods.
1291 (create_submenu): Handle correctly the case when there is a
1292 seperator after optional menu items.
1294 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1295 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1296 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1298 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1300 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1302 * src/converter.[Ch]: New file for converting between different
1305 * src/export.[Ch]: New file for exporting a LyX file to different
1308 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1309 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1310 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1311 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1312 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1313 RunDocBook, MenuExport.
1315 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1316 Exporter::Preview methods if NEW_EXPORT is defined.
1318 * src/buffer.C (Dispatch): Use Exporter::Export.
1320 * src/lyxrc.C: Added new tags: \converter and \viewer.
1323 * src/LyXAction.C: Define new lyx-function: buffer-update.
1324 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1325 when NEW_EXPORT is defined.
1327 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1329 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1331 * lib/ui/default.ui: Added submenus "view" and "update" to the
1334 * src/filetools.C (GetExtension): New function.
1336 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1338 2000-08-29 Allan Rae <rae@lyx.org>
1340 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1342 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1343 (EnableDocumentLayout): removed
1344 (DisableDocumentLayout): removed
1345 (build): make use of ButtonController's read-only handling to
1346 de/activate various objects. Replaces both of the above functions.
1348 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1349 (readOnly): was read_only
1350 (refresh): fixed dumb mistakes with read_only_ handling
1352 * src/frontends/xforms/forms/form_document.fd:
1353 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1354 tabbed dialogs so the tabs look more like tabs and so its easier to
1355 work out which is the current tab.
1357 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1358 segfault with form_table
1360 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1362 2000-08-28 Juergen Vigna <jug@sad.it>
1364 * acconfig.h: added USE_PSPELL.
1366 * src/config.h.in: added USE_PSPELL.
1368 * autogen.sh: added pspell.m4
1370 * config/pspell.m4: new file.
1372 * src/spellchecker.C: implemented support for pspell libary.
1374 2000-08-25 Juergen Vigna <jug@sad.it>
1376 * src/LyXAction.C (init): renamed LFUN_TABLE to
1377 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1379 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1381 * src/lyxscreen.h: add force_clear variable and fuction to force
1382 a clear area when redrawing in LyXText.
1384 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1386 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1388 * some whitespace and comment changes.
1390 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1392 * src/buffer.C: up te LYX_FORMAT to 2.17
1394 2000-08-23 Juergen Vigna <jug@sad.it>
1396 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1399 * src/insets/insettabular.C (pasteSelection): delete the insets
1400 LyXText as it is not valid anymore.
1401 (copySelection): new function.
1402 (pasteSelection): new function.
1403 (cutSelection): new function.
1404 (LocalDispatch): implemented cut/copy/paste of cell selections.
1406 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1407 don't have a LyXText.
1409 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1411 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1414 2000-08-22 Juergen Vigna <jug@sad.it>
1416 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1417 ifdef form_table out if NEW_TABULAR.
1419 2000-08-21 Juergen Vigna <jug@sad.it>
1421 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1422 (draw): fixed draw position so that the cursor is positioned in the
1424 (InsetMotionNotify): hide/show cursor so the position is updated.
1425 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1426 using cellstart() function where it should be used.
1428 * src/insets/insettext.C (draw): ditto.
1430 * src/tabular.C: fixed initialization of some missing variables and
1431 made BoxType into an enum.
1433 2000-08-22 Marko Vendelin <markov@ioc.ee>
1434 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1435 stock menu item using action numerical value, not its string
1439 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1441 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1442 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1444 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1446 * src/frontends/xforms/GUIRunTime.C: new file
1448 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1449 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1451 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1453 * src/frontends/kde/GUIRunTime.C: new file
1455 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1456 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1458 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1460 * src/frontends/gnome/GUIRunTime.C: new file
1462 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1465 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1466 small change to documetentation.
1468 * src/frontends/GUIRunTime.C: removed file
1470 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1472 * src/lyxparagraph.h: enable NEW_TABULAR as default
1474 * src/lyxfunc.C (processKeySym): remove some commented code
1476 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1477 NEW_TABULAR around the fd_form_table_options.
1479 * src/lyx_gui.C (runTime): call the static member function as
1480 GUIRunTime::runTime().
1482 2000-08-21 Allan Rae <rae@lyx.org>
1484 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1487 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1489 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1491 2000-08-21 Allan Rae <rae@lyx.org>
1493 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1494 keep Garst happy ;-)
1495 * src/frontends/xforms/FormPreferences.C (build): use setOK
1496 * src/frontends/xforms/FormDocument.C (build): use setOK
1497 (FormDocument): use the appropriate policy.
1499 2000-08-21 Allan Rae <rae@lyx.org>
1501 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1502 automatic [de]activation of arbitrary objects when in a read-only state.
1504 * src/frontends/ButtonPolicies.h: More documentation
1505 (isReadOnly): added to support the above.
1507 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1509 2000-08-18 Juergen Vigna <jug@sad.it>
1511 * src/insets/insettabular.C (getStatus): changed to return func_status.
1513 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1514 display toggle menu entries if they are.
1516 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1517 new document layout now.
1519 * src/lyxfunc.C: ditto
1521 * src/lyx_gui_misc.C: ditto
1523 * src/lyx_gui.C: ditto
1525 * lib/ui/default.ui: removed paper and quotes layout as they are now
1526 all in the document layout tabbed folder.
1528 * src/frontends/xforms/forms/form_document.fd: added Restore
1529 button and callbacks for all inputs for Allan's ButtonPolicy.
1531 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1532 (CheckChoiceClass): added missing params setting on class change.
1533 (UpdateLayoutDocument): added for updating the layout on params.
1534 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1535 (FormDocument): Implemented Allan's ButtonPolicy with the
1538 2000-08-17 Allan Rae <rae@lyx.org>
1540 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1541 so we can at least see the credits again.
1543 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1544 controller calls for the appropriate callbacks. Note that since Ok
1545 calls apply followed by cancel, and apply isn't a valid input for the
1546 APPLIED state, the bc_ calls have to be made in the static callback not
1547 within each of the real callbacks.
1549 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1550 (setOk): renamed from setOkay()
1552 2000-08-17 Juergen Vigna <jug@sad.it>
1554 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1555 in the implementation part.
1556 (composeUIInfo): don't show optional menu-items.
1558 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1560 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1562 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1563 text-state when in a text-inset.
1565 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1567 2000-08-17 Marko Vendelin <markov@ioc.ee>
1568 * src/frontends/gnome/FormIndex.C
1569 * src/frontends/gnome/FormIndex.h
1570 * src/frontends/gnome/FormToc.C
1571 * src/frontends/gnome/FormToc.h
1572 * src/frontends/gnome/dialogs
1573 * src/frontends/gnome/diatoc_callbacks.c
1574 * src/frontends/gnome/diatoc_callbacks.h
1575 * src/frontends/gnome/diainsertindex_callbacks.h
1576 * src/frontends/gnome/diainsertindex_callbacks.c
1577 * src/frontends/gnome/diainsertindex_interface.c
1578 * src/frontends/gnome/diainsertindex_interface.h
1579 * src/frontends/gnome/diatoc_interface.h
1580 * src/frontends/gnome/diatoc_interface.c
1581 * src/frontends/gnome/Makefile.am: Table of Contents and
1582 Insert Index dialogs implementation for Gnome frontend
1584 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1586 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1588 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1591 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1593 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1594 destructor. Don't definde if you don't need it
1595 (processEvents): made static, non-blocking events processing for
1597 (runTime): static method. event loop for xforms
1598 * similar as above for kde and gnome.
1600 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1601 new Pimpl is correct
1602 (runTime): new method calss the real frontends runtime func.
1604 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1606 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1608 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1610 2000-08-16 Juergen Vigna <jug@sad.it>
1612 * src/lyx_gui.C (runTime): added GUII RunTime support.
1614 * src/frontends/Makefile.am:
1615 * src/frontends/GUIRunTime.[Ch]:
1616 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1617 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1618 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1620 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1622 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1623 as this is already set in ${FRONTEND_INCLUDE} if needed.
1625 * configure.in (CPPFLAGS): setting the include dir for the frontend
1626 directory and don't set FRONTEND=xforms for now as this is executed
1629 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1631 * src/frontends/kde/Makefile.am:
1632 * src/frontends/kde/FormUrl.C:
1633 * src/frontends/kde/FormUrl.h:
1634 * src/frontends/kde/formurldialog.h:
1635 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1637 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1639 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1641 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1643 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1646 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1648 * src/WorkArea.C (work_area_handler): more work to get te
1649 FL_KEYBOARD to work with xforms 0.88 too, please test.
1651 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1653 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1655 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1658 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1660 * src/Timeout.h: remove Qt::emit hack.
1662 * several files: changes to allo doc++ compilation
1664 * src/lyxfunc.C (processKeySym): new method
1665 (processKeyEvent): comment out if FL_REVISION < 89
1667 * src/WorkArea.C: change some debugging levels.
1668 (WorkArea): set wantkey to FL_KEY_ALL
1669 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1670 clearer code and the use of compose with XForms 0.89. Change to
1671 use signals instead of calling methods in bufferview directly.
1673 * src/Painter.C: change some debugging levels.
1675 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1678 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1679 (workAreaKeyPress): new method
1681 2000-08-14 Juergen Vigna <jug@sad.it>
1683 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1685 * config/kde.m4: addes some features
1687 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1688 include missing xforms dialogs.
1690 * src/Timeout.h: a hack to be able to compile with qt/kde.
1692 * sigc++/.cvsignore: added acinclude.m4
1694 * lib/.cvsignore: added listerros
1696 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1697 xforms tree as objects are needed for other frontends.
1699 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1700 linking with not yet implemented xforms objects.
1702 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1704 2000-08-14 Baruch Even <baruch.even@writeme.com>
1706 * src/frontends/xforms/FormGraphics.h:
1707 * src/frontends/xforms/FormGraphics.C:
1708 * src/frontends/xforms/RadioButtonGroup.h:
1709 * src/frontends/xforms/RadioButtonGroup.C:
1710 * src/insets/insetgraphics.h:
1711 * src/insets/insetgraphics.C:
1712 * src/insets/insetgraphicsParams.h:
1713 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1714 instead of spaces, and various other indentation issues to make the
1715 sources more consistent.
1717 2000-08-14 Marko Vendelin <markov@ioc.ee>
1719 * src/frontends/gnome/dialogs/diaprint.glade
1720 * src/frontends/gnome/FormPrint.C
1721 * src/frontends/gnome/FormPrint.h
1722 * src/frontends/gnome/diaprint_callbacks.c
1723 * src/frontends/gnome/diaprint_callbacks.h
1724 * src/frontends/gnome/diaprint_interface.c
1725 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1728 * src/frontends/gnome/dialogs/diainserturl.glade
1729 * src/frontends/gnome/FormUrl.C
1730 * src/frontends/gnome/FormUrl.h
1731 * src/frontends/gnome/diainserturl_callbacks.c
1732 * src/frontends/gnome/diainserturl_callbacks.h
1733 * src/frontends/gnome/diainserturl_interface.c
1734 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1735 Gnome implementation
1737 * src/frontends/gnome/Dialogs.C
1738 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1739 all other dialogs. Copy all unimplemented dialogs from Xforms
1742 * src/frontends/gnome/support.c
1743 * src/frontends/gnome/support.h: support files generated by Glade
1747 * config/gnome.m4: Gnome configuration scripts
1749 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1750 configure --help message
1752 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1753 only if there are no events pendling in Gnome/Gtk. This enhances
1754 the performance of menus.
1757 2000-08-14 Allan Rae <rae@lyx.org>
1759 * lib/Makefile.am: listerrors cleaning
1761 * lib/listerrors: removed -- generated file
1762 * acinclude.m4: ditto
1763 * sigc++/acinclude.m4: ditto
1765 * src/frontends/xforms/forms/form_citation.fd:
1766 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1769 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1770 `updatesrc` and now we have a `test` target that does what `updatesrc`
1771 used to do. I didn't like having an install target that wasn't related
1774 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1775 on all except FormGraphics. This may yet happen. Followed by a major
1776 cleanup including using FL_TRANSIENT for most of the dialogs. More
1777 changes to come when the ButtonController below is introduced.
1779 * src/frontends/xforms/ButtonController.h: New file for managing up to
1780 four buttons on a dialog according to an externally defined policy.
1781 * src/frontends/xforms/Makefile.am: added above
1783 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1784 Apply and Cancel/Close buttons and everything in between and beyond.
1785 * src/frontends/Makefile.am: added above.
1787 * src/frontends/xforms/forms/form_preferences.fd:
1788 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1789 and removed variable 'status' as a result. Fixed the set_minsize thing.
1790 Use the new screen-font-update after checking screen fonts were changed
1791 Added a "Restore" button to restore the original lyxrc values while
1792 editing. This restores everything not just the last input changed.
1793 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1795 * src/LyXAction.C: screen-font-update added for updating buffers after
1796 screen font settings have been changed.
1797 * src/commandtags.h: ditto
1798 * src/lyxfunc.C: ditto
1800 * forms/lyx.fd: removed screen fonts dialog.
1801 * src/lyx_gui.C: ditto
1802 * src/menus.[Ch]: ditto
1803 * src/lyx.[Ch]: ditto
1804 * src/lyx_cb.C: ditto + code from here moved to make
1805 screen-font-update. And people wonder why progress on GUII is
1806 slow. Look at how scattered this stuff was! It takes forever
1809 * forms/fdfix.sh: Fixup the spacing after commas.
1810 * forms/makefile: Remove date from generated files. Fewer clashes now.
1811 * forms/bullet_forms.C.patch: included someones handwritten changes
1813 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1814 once I've discovered why LyXRC was made noncopyable.
1815 * src/lyx_main.C: ditto
1817 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1819 * src/frontends/xforms/forms/fdfix.sh:
1820 * src/frontends/xforms/forms/fdfixh.sed:
1821 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1822 * src/frontends/xforms/Form*.[hC]:
1823 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1824 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1825 provide a destructor for the struct FD_form_xxxx. Another version of
1826 the set_[max|min]size workaround and a few other cleanups. Actually,
1827 Angus' patch from 20000809.
1829 2000-08-13 Baruch Even <baruch.even@writeme.com>
1831 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1834 2000-08-11 Juergen Vigna <jug@sad.it>
1836 * src/insets/insetgraphics.C (InsetGraphics): changing init
1837 order because of warnings.
1839 * src/frontends/xforms/forms/makefile: adding patching .C with
1842 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1843 from .C.patch to .c.patch
1845 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1846 order because of warning.
1848 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1850 * src/frontends/Liason.C (setMinibuffer): new helper function
1852 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1854 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1856 * lib/ui/default.ui: commented out PaperLayout entry
1858 * src/frontends/xforms/form_document.[Ch]: new added files
1860 * src/frontends/xforms/FormDocument.[Ch]: ditto
1862 * src/frontends/xforms/forms/form_document.fd: ditto
1864 * src/frontends/xforms/forms/form_document.C.patch: ditto
1866 2000-08-10 Juergen Vigna <jug@sad.it>
1868 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1869 (InsetGraphics): initialized cacheHandle to 0.
1870 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1872 2000-08-10 Baruch Even <baruch.even@writeme.com>
1874 * src/graphics/GraphicsCache.h:
1875 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1876 correctly as a cache.
1878 * src/graphics/GraphicsCacheItem.h:
1879 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1882 * src/graphics/GraphicsCacheItem_pimpl.h:
1883 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1886 * src/insets/insetgraphics.h:
1887 * src/insets/insetgraphics.C: Changed from using a signal notification
1888 to polling when image is not loaded.
1890 2000-08-10 Allan Rae <rae@lyx.org>
1892 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1893 that there are two functions that have to been taken out of line by
1894 hand and aren't taken care of in the script. (Just a reminder note)
1896 * sigc++/macros/*.h.m4: Updated as above.
1898 2000-08-09 Juergen Vigna <jug@sad.it>
1900 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1902 * src/insets/insettabular.C: make drawing of single cell smarter.
1904 2000-08-09 Marko Vendelin <markov@ioc.ee>
1905 * src/frontends/gnome/Menubar_pimpl.C
1906 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1907 implementation: new files
1909 * src/frontends/gnome/mainapp.C
1910 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1913 * src/main.C: create Gnome main window
1915 * src/frontends/xforms/Menubar_pimpl.h
1916 * src/frontends/Menubar.C
1917 * src/frontends/Menubar.h: added method Menubar::update that calls
1918 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1920 * src/LyXView.C: calls Menubar::update to update the state
1923 * src/frontends/gnome/Makefile.am: added new files
1925 * src/frontends/Makefile.am: added frontend compiler options
1927 2000-08-08 Juergen Vigna <jug@sad.it>
1929 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1931 * src/bufferlist.C (close):
1932 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1933 documents if exiting without saving.
1935 * src/buffer.C (save): use removeAutosaveFile()
1937 * src/support/filetools.C (removeAutosaveFile): new function.
1939 * src/lyx_cb.C (MenuWrite): returns a bool now.
1940 (MenuWriteAs): check if file could really be saved and revert to the
1942 (MenuWriteAs): removing old autosavefile if existant.
1944 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1945 before Goto toggle declaration, because of compiler warning.
1947 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1949 * src/lyxfunc.C (MenuNew): small fix.
1951 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1953 * src/bufferlist.C (newFile):
1954 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1956 * src/lyxrc.C: added new_ask_filename tag
1958 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1960 * src/lyx.fd: removed code pertaining to form_ref
1961 * src/lyx.[Ch]: ditto
1962 * src/lyx_cb.C: ditto
1963 * src/lyx_gui.C: ditto
1964 * src/lyx_gui_misc.C: ditto
1966 * src/BufferView_pimpl.C (restorePosition): update buffer only
1969 * src/commandtags.h (LFUN_REFTOGGLE): removed
1970 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1971 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1972 (LFUN_REFBACK): renamed LFUN_REF_BACK
1974 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1975 * src/menus.C: ditto
1976 * src/lyxfunc.C (Dispatch): ditto.
1977 InsertRef dialog is now GUI-independent.
1979 * src/texrow.C: added using std::endl;
1981 * src/insets/insetref.[Ch]: strip out large amounts of code.
1982 The inset is now a container and this functionality is now
1983 managed by a new FormRef dialog
1985 * src/frontends/Dialogs.h (showRef, createRef): new signals
1987 * src/frontends/xforms/FormIndex.[Ch],
1988 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1989 when setting dialog's min/max size
1990 * src/frontends/xforms/FormIndex.[Ch]: ditto
1992 * src/frontends/xforms/FormRef.[Ch],
1993 src/frontends/xforms/forms/form_ref.fd: new xforms
1994 implementation of an InsetRef dialog
1996 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1999 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2000 ios::nocreate is not part of the standard. Removed.
2002 2000-08-07 Baruch Even <baruch.even@writeme.com>
2004 * src/graphics/Renderer.h:
2005 * src/graphics/Renderer.C: Added base class for rendering of different
2006 image formats into Pixmaps.
2008 * src/graphics/XPM_Renderer.h:
2009 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2010 in a different class.
2012 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2013 easily add support for other formats.
2015 * src/insets/figinset.C: plugged a leak of an X resource.
2017 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2019 * src/CutAndPaste.[Ch]: make all metods static.
2021 * development/Code_rules/Rules: more work, added section on
2022 Exceptions, and a References section.
2024 * a lot of header files: work to make doc++ able to generate the
2025 source documentation, some workarounds of doc++ problems. Doc++ is
2026 now able to generate the documentation.
2028 2000-08-07 Juergen Vigna <jug@sad.it>
2030 * src/insets/insettabular.C (recomputeTextInsets): removed function
2032 * src/tabular.C (SetWidthOfMulticolCell):
2034 (calculate_width_of_column_NMC): fixed return value so that it really
2035 only returns true if the column-width has changed (there where
2036 problems with muliticolumn-cells in this column).
2038 2000-08-04 Juergen Vigna <jug@sad.it>
2040 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2041 also on the scrollstatus of the inset.
2042 (workAreaMotionNotify): ditto.
2044 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2046 2000-08-01 Juergen Vigna <jug@sad.it>
2048 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2050 * src/commandtags.h:
2051 * src/LyXAction.C (init):
2052 * src/insets/inset.C (LocalDispatch): added support for
2055 * src/insets/inset.C (scroll): new functions.
2057 * src/insets/insettext.C (removeNewlines): new function.
2058 (SetAutoBreakRows): removes forced newlines in the text of the
2059 paragraph if autoBreakRows is set to false.
2061 * src/tabular.C (Latex): generates a parbox around the cell contents
2064 * src/frontends/xforms/FormTabular.C (local_update): removed
2065 the radio_useparbox button.
2067 * src/tabular.C (UseParbox): new function
2069 2000-08-06 Baruch Even <baruch.even@writeme.com>
2071 * src/graphics/GraphicsCache.h:
2072 * src/graphics/GraphicsCache.C:
2073 * src/graphics/GraphicsCacheItem.h:
2074 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
2077 * src/insets/insetgraphics.h:
2078 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
2079 drawing of the inline image.
2081 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
2082 into the wrong position.
2084 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
2087 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2089 * src/support/translator.h: move all typedefs to public section
2091 * src/support/filetools.C (MakeLatexName): return string const
2093 (TmpFileName): ditto
2094 (FileOpenSearch): ditto
2096 (LibFileSearch): ditto
2097 (i18nLibFileSearch): ditto
2100 (CreateTmpDir): ditto
2101 (CreateBufferTmpDir): ditto
2102 (CreateLyXTmpDir): ditto
2105 (MakeAbsPath): ditto
2107 (OnlyFilename): ditto
2109 (NormalizePath): ditto
2110 (CleanupPath): ditto
2111 (GetFileContents): ditto
2112 (ReplaceEnvironmentPath): ditto
2113 (MakeRelPath): ditto
2115 (ChangeExtension): ditto
2116 (MakeDisplayPath): ditto
2117 (do_popen): return cmdret const
2118 (findtexfile): return string const
2120 * src/support/DebugStream.h: add some /// to please doc++
2122 * src/frontends/DialogBase.h (endif): add some /// to please doc++
2124 * src/texrow.C (same_rownumber): functor to use with find_if
2125 (getIdFromRow): rewritten to use find_if and to not update the
2126 positions. return true if row is found
2127 (increasePos): new method, use to update positions
2129 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
2131 * src/lyxlex_pimpl.C (verifyTable): new method
2134 (GetString): return string const
2135 (pushTable): rewrite to use std::stack
2137 (setFile): better check
2140 * src/lyxlex.h: make LyXLex noncopyable
2142 * src/lyxlex.C (text): return char const * const
2143 (GetString): return string const
2144 (getLongString): return string const
2146 * src/lyx_gui_misc.C (askForText): return pair<...> const
2148 * src/lastfiles.[Ch] (operator): return string const
2150 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2151 istringstream not char const *.
2152 move token.end() out of loop.
2153 (readFile): move initializaton of token
2155 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2156 getIdFromRow is successful.
2158 * lib/bind/emacs.bind: don't include menus bind
2160 * development/Code_rules/Rules: the beginnings of making this
2161 better and covering more of the unwritten rules that we have.
2163 * development/Code_rules/Recommendations: a couple of wording
2166 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2168 * src/support/strerror.c: remove C++ comment.
2170 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2172 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2173 LFUN_INDEX_INSERT_LAST
2175 * src/texrow.C (getIdFromRow): changed from const_iterator to
2176 iterator, allowing code to compile with DEC cxx
2178 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2179 stores part of the class, as suggested by Allan. Will allow
2181 (apply): test to apply uses InsetCommandParams operator!=
2183 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2184 (apply): test to apply uses InsetCommandParams operator!=
2186 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2187 stores part of the class.
2188 (update): removed limits on min/max size.
2190 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2191 (apply): test to apply uses InsetCommandParams operator!=
2193 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
2194 (Read, Write, scanCommand, getCommand): moved functionality
2195 into InsetCommandParams.
2197 (getScreenLabel): made pure virtual
2198 new InsetCommandParams operators== and !=
2200 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
2201 c-tors based on InsetCommandParams. Removed others.
2202 * src/insets/insetinclude.[Ch]: ditto
2203 * src/insets/insetlabel.[Ch]: ditto
2204 * src/insets/insetparent.[Ch]: ditto
2205 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
2207 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
2208 insets derived from InsetCommand created using similar c-tors
2209 based on InsetCommandParams
2210 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
2211 * src/menus.C (ShowRefsMenu): ditto
2212 * src/paragraph.C (Clone): ditto
2213 * src/text2.C (SetCounter): ditto
2214 * src/lyxfunc.C (Dispatch) ditto
2215 Also recreated old InsetIndex behaviour exactly. Can now
2216 index-insert at the start of a paragraph and index-insert-last
2217 without launching the pop-up.
2219 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2221 * lib/lyxrc.example: mark te pdf options as non functional.
2223 * src/support/lstrings.C (strToInt): move initalization of tmpstr
2224 (isStrDbl): move tmpstr.end() out of loop.
2225 (strToDbl): move intialization of tmpstr
2226 (lowercase): return string const and move tmp.end() out of loop.
2227 (uppercase): return string const and move tmp.edn() out of loop.
2228 (prefixIs): add assertion
2233 (containsOnly): ditto
2234 (containsOnly): ditto
2235 (containsOnly): ditto
2236 (countChar): make last arg char not char const
2237 (token): return string const
2238 (subst): return string const, move tmp.end() out of loop.
2239 (subst): return string const, add assertion
2240 (strip): return string const
2241 (frontStrip): return string const, add assertion
2242 (frontStrip): return string const
2247 * src/support/lstrings.C: add inclde "LAssert.h"
2248 (isStrInt): move tmpstr.end() out of loop.
2250 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2251 toollist.end() out of loop.
2252 (deactivate): move toollist.end() out of loop.
2253 (update): move toollist.end() out of loop.
2254 (updateLayoutList): move tc.end() out of loop.
2255 (add): move toollist.end() out of loop.
2257 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2258 md.end() out of loop.
2260 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2262 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2265 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2266 (Erase): move insetlist.end() out of loop.
2268 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2269 ref to const string as first arg. Move initialization of some
2270 variables, whitespace changes.
2272 * src/kbmap.C (defkey): move table.end() out of loop.
2273 (kb_keymap): move table.end() out of loop.
2274 (findbinding): move table.end() out of loop.
2276 * src/MenuBackend.C (hasMenu): move end() out of loop.
2277 (getMenu): move end() out of loop.
2278 (getMenu): move menulist_.end() out of loop.
2280 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2282 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2285 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2286 (getFromLyXName): move infotab.end() out of loop.
2288 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2289 -fvtable-thunks -ffunction-sections -fdata-sections
2291 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2293 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2296 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2298 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2300 * src/frontends/xforms/FormCitation.[Ch],
2301 src/frontends/xforms/FormIndex.[Ch],
2302 src/frontends/xforms/FormToc.[Ch],
2303 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2305 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2307 * src/commandtags.h: renamed, created some flags for citation
2310 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2312 * src/lyxfunc.C (dispatch): use signals to insert index entry
2314 * src/frontends/Dialogs.h: new signal createIndex
2316 * src/frontends/xforms/FormCommand.[Ch],
2317 src/frontends/xforms/FormCitation.[Ch],
2318 src/frontends/xforms/FormToc.[Ch],
2319 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2321 * src/insets/insetindex.[Ch]: GUI-independent
2323 * src/frontends/xforms/FormIndex.[Ch],
2324 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2327 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2329 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2330 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2332 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2334 * src/insets/insetref.C (Latex): rewrite so that there is now
2335 question that a initialization is requested.
2337 * src/insets/insetcommand.h: reenable the hide signal
2339 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2341 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2342 fix handling of shortcuts (many bugs :)
2343 (add_lastfiles): ditto.
2345 * lib/ui/default.ui: fix a few shortcuts.
2347 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2349 * Makefile.am: Fix ``rpmdist'' target to return the exit
2350 status of the ``rpm'' command, instead of the last command in
2351 the chain (the ``rm lyx.xpm'' command, which always returns
2354 2000-08-02 Allan Rae <rae@lyx.org>
2356 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2357 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2358 * src/frontends/xforms/FormToc.C (FormToc): ditto
2360 * src/frontends/xforms/Makefile.am: A few forgotten files
2362 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2363 Signals-not-copyable-problem Lars' started commenting out.
2365 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2367 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2369 * src/insets/insetcommand.h: Signals is not copyable so anoter
2370 scheme for automatic hiding of forms must be used.
2372 * src/frontends/xforms/FormCitation.h: don't inerit from
2373 noncopyable, FormCommand already does that.
2374 * src/frontends/xforms/FormToc.h: ditto
2375 * src/frontends/xforms/FormUrl.h: ditto
2377 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2379 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2381 * src/insets/insetcommand.h (hide): new SigC::Signal0
2382 (d-tor) new virtual destructor emits hide signal
2384 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2385 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2387 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2388 LOF and LOT. Inset is now GUI-independent
2390 * src/insets/insetloa.[Ch]: redundant
2391 * src/insets/insetlof.[Ch]: ditto
2392 * src/insets/insetlot.[Ch]: ditto
2394 * src/frontends/xforms/forms/form_url.fd: tweaked!
2395 * src/frontends/xforms/forms/form_citation.fd: ditto
2397 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2398 dialogs dealing with InsetCommand insets
2400 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2401 FormCommand base class
2402 * src/frontends/xforms/FormUrl.[Ch]: ditto
2404 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2406 * src/frontends/xforms/FormToc.[Ch]: ditto
2408 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2409 passed a generic InsetCommand pointer
2410 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2412 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2413 and modified InsetTOC class
2414 * src/buffer.C: ditto
2416 * forms/lyx.fd: strip out old FD_form_toc code
2417 * src/lyx_gui_misc.C: ditto
2418 * src/lyx_gui.C: ditto
2419 * src/lyx_cb.C: ditto
2420 * src/lyx.[Ch]: ditto
2422 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2424 * src/support/utility.hpp: tr -d '\r'
2426 2000-08-01 Juergen Vigna <jug@sad.it>
2428 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2430 * src/commandtags.h:
2431 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2432 LFUN_TABULAR_FEATURES.
2434 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2435 LFUN_LAYOUT_TABULAR.
2437 * src/insets/insettabular.C (getStatus): implemented helper function.
2439 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2441 2000-07-31 Juergen Vigna <jug@sad.it>
2443 * src/text.C (draw): fixed screen update problem for text-insets.
2445 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2446 something changed probably this has to be added in various other
2449 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2451 2000-07-31 Baruch Even <baruch.even@writeme.com>
2453 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2454 templates to satisfy compaq cxx.
2457 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2459 * src/support/translator.h (equal_1st_in_pair::operator()): take
2460 const ref pair_type as arg.
2461 (equal_2nd_in_pair::operator()): ditto
2462 (Translator::~Translator): remove empty d-tor.
2464 * src/graphics/GraphicsCache.C: move include config.h to top, also
2465 put initialization of GraphicsCache::singleton here.
2466 (~GraphicsCache): move here
2467 (addFile): take const ref as arg
2470 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2472 * src/BufferView2.C (insertLyXFile): change te with/without header
2475 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2477 * src/frontends/xforms/FormGraphics.C (apply): add some
2478 static_cast. Not very nice, but required by compaq cxx.
2480 * src/frontends/xforms/RadioButtonGroup.h: include header
2481 <utility> instead of <pair.h>
2483 * src/insets/insetgraphicsParams.C: add using directive.
2484 (readResize): change return type to void.
2485 (readOrigin): ditto.
2487 * src/lyxfunc.C (getStatus): add missing break for build-program
2488 function; add test for Literate for export functions.
2490 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2491 entries in Options menu.
2493 2000-07-31 Baruch Even <baruch.even@writeme.com>
2495 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2496 protect against auto-allocation; release icon when needed.
2498 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2500 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2501 on usual typewriter.
2503 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2504 earlier czech.kmap), useful only for programming.
2506 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2508 * src/frontends/xforms/FormCitation.h: fix conditioning around
2511 2000-07-31 Juergen Vigna <jug@sad.it>
2513 * src/frontends/xforms/FormTabular.C (local_update): changed
2514 radio_linebreaks to radio_useparbox and added radio_useminipage.
2516 * src/tabular.C: made support for using minipages/parboxes.
2518 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2520 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2522 (descent): so the cursor is in the middle.
2523 (width): bit smaller box.
2525 * src/insets/insetgraphics.h: added display() function.
2527 2000-07-31 Baruch Even <baruch.even@writeme.com>
2529 * src/frontends/Dialogs.h: Added showGraphics signals.
2531 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2532 xforms form definition of the graphics dialog.
2534 * src/frontends/xforms/FormGraphics.h:
2535 * src/frontends/xforms/FormGraphics.C: Added files, the
2536 GUIndependent code of InsetGraphics
2538 * src/insets/insetgraphics.h:
2539 * src/insets/insetgraphics.C: Major writing to make it work.
2541 * src/insets/insetgraphicsParams.h:
2542 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2543 struct between InsetGraphics and GUI.
2545 * src/LaTeXFeatures.h:
2546 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2547 support for graphicx package.
2549 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2550 for the graphics inset.
2552 * src/support/translator.h: Added file, used in
2553 InsetGraphicsParams. this is a template to translate between two
2556 * src/frontends/xforms/RadioButtonGroup.h:
2557 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2558 way to easily control a radio button group.
2560 2000-07-28 Juergen Vigna <jug@sad.it>
2562 * src/insets/insettabular.C (LocalDispatch):
2563 (TabularFeatures): added support for lyx-functions of tabular features.
2564 (cellstart): refixed this function after someone wrongly changed it.
2566 * src/commandtags.h:
2567 * src/LyXAction.C (init): added support for tabular-features
2569 2000-07-28 Allan Rae <rae@lyx.org>
2571 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2572 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2573 triggers the callback for input checking. As a result we sometimes get
2574 "LyX: This shouldn't happen..." printed to cerr.
2575 (input): Started using status variable since I only free() on
2576 destruction. Some input checking for paths and font sizes.
2578 * src/frontends/xforms/FormPreferences.h: Use status to control
2579 activation of Ok and Apply
2581 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2582 callback. Also resized to stop segfaults with 0.88. The problem is
2583 that xforms-0.88 requires the folder to be wide enough to fit all the
2584 tabs. If it isn't it causes all sorts of problems.
2586 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2588 * src/frontends/xforms/forms/README: Reflect reality.
2590 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2591 * src/frontends/xforms/forms/makefile: ditto.
2593 * src/commandtags.h: Get access to new Preferences dialog
2594 * src/LyXAction.C: ditto
2595 * src/lyxfunc.C: ditto
2596 * lib/ui/default.ui: ditto
2598 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2600 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2602 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2605 * src/frontends/xforms/form_url.[Ch]: added.
2607 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2609 * src/insets/insetbib.h: fixed bug in previous commit
2611 * src/frontends/xforms/FormUrl.h: ditto
2613 * src/frontends/xforms/FormPrint.h: ditto
2615 * src/frontends/xforms/FormPreferences.h: ditto
2617 * src/frontends/xforms/FormCopyright.h: ditto
2619 * src/frontends/xforms/FormCitation.C: ditto
2621 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2622 private copyconstructor and private default contructor
2624 * src/support/Makefile.am: add utility.hpp
2626 * src/support/utility.hpp: new file from boost
2628 * src/insets/insetbib.h: set owner in clone
2630 * src/frontends/xforms/FormCitation.C: added missing include
2633 * src/insets/form_url.[Ch]: removed
2635 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2637 * development/lyx.spec.in
2638 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2639 file/directory re-organization.
2641 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2643 * src/insets/insetcommand.[Ch]: moved the string data and
2644 associated manipulation methods into a new stand-alone class
2645 InsetCommandParams. This class has two additional methods
2646 getAsString() and setFromString() allowing the contents to be
2647 moved around as a single string.
2648 (addContents) method removed.
2649 (setContents) method no longer virtual.
2651 * src/buffer.C (readInset): made use of new InsetCitation,
2652 InsetUrl constructors based on InsetCommandParams.
2654 * src/commandtags.h: add LFUN_INSERT_URL
2656 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2657 independent InsetUrl and use InsetCommandParams to extract
2658 string info and create new Insets.
2660 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2662 * src/frontends/xforms/FormCitation.C (apply): uses
2665 * src/frontends/xforms/form_url.C
2666 * src/frontends/xforms/form_url.h
2667 * src/frontends/xforms/FormUrl.h
2668 * src/frontends/xforms/FormUrl.C
2669 * src/frontends/xforms/forms/form_url.fd: new files
2671 * src/insets/insetcite.[Ch]: removed unused constructors.
2673 * src/insets/insetinclude.[Ch]: no longer store filename
2675 * src/insets/inseturl.[Ch]: GUI-independent.
2677 2000-07-26 Juergen Vigna <jug@sad.it>
2678 * renamed frontend from gtk to gnome as it is that what is realized
2679 and did the necessary changes in the files.
2681 2000-07-26 Marko Vendelin <markov@ioc.ee>
2683 * configure.in: cleaning up gnome configuration scripts
2685 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2687 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2688 shortcuts syndrom by redrawing them explicitely (a better solution
2689 would be appreciated).
2691 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2693 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2696 * src/lyx_cb.C (MenuExport): change html export to do the right
2697 thing depending of the document type (instead of having
2698 html-linuxdoc and html-docbook).
2699 * src/lyxfunc.C (getStatus): update for html
2700 * lib/ui/default.ui: simplify due to the above change.
2701 * src/menus.C (ShowFileMenu): update too (in case we need it).
2703 * src/MenuBackend.C (read): if a menu is defined twice, add the
2704 new entries to the exiting one.
2706 2000-07-26 Juergen Vigna <jug@sad.it>
2708 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2710 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2711 and return a bool if it did actual save the file.
2712 (AutoSave): don't autosave a unnamed doc.
2714 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2715 check if this is an UNNAMED new file and react to it.
2716 (newFile): set buffer to unnamed and change to not mark a new
2717 buffer dirty if I didn't do anything with it.
2719 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2721 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2723 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2724 friend as per Angus's patch posted to lyx-devel.
2726 * src/ext_l10n.h: updated
2728 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2729 gettext on the style string right before inserting them into the
2732 * autogen.sh: add code to extract style strings form layout files,
2733 not good enough yet.
2735 * src/frontends/gtk/.cvsignore: add MAKEFILE
2737 * src/MenuBackend.C (read): run the label strings through gettext
2738 before storing them in the containers.
2740 * src/ext_l10n.h: new file
2742 * autogen.sh : generate the ext_l10n.h file here
2744 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2746 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2749 * lib/ui/default.ui: fix a couple of typos.
2751 * config/gnome/gtk.m4: added (and added to the list of files in
2754 * src/insets/insetinclude.C (unique_id): fix when we are using
2755 lyxstring instead of basic_string<>.
2756 * src/insets/insettext.C (LocalDispatch): ditto.
2757 * src/support/filetools.C: ditto.
2759 * lib/configure.m4: create the ui/ directory if necessary.
2761 * src/LyXView.[Ch] (updateToolbar): new method.
2763 * src/BufferView_pimpl.C (buffer): update the toolbar when
2764 opening/closing buffer.
2766 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2768 * src/LyXAction.C (getActionName): enhance to return also the name
2769 and options of pseudo-actions.
2770 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2772 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2773 as an example of what is possible). Used in File->Build too (more
2774 useful) and in the import/export menus (to mimick the complicated
2775 handling of linuxdoc and friends). Try to update all the entries.
2777 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2780 * src/MenuBackend.C (read): Parse the new OptItem tag.
2782 * src/MenuBackend.h: Add a new optional_ data member (used if the
2783 entry should be omitted when the lyxfunc is disabled).
2785 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2786 function, used as a shortcut.
2787 (create_submenu): align correctly the shortcuts on the widest
2790 * src/MenuBackend.h: MenuItem.label() only returns the label of
2791 the menu without shortcut; new method shortcut().
2793 2000-07-14 Marko Vendelin <markov@ioc.ee>
2795 * src/frontends/gtk/Dialogs.C:
2796 * src/frontends/gtk/FormCopyright.C:
2797 * src/frontends/gtk/FormCopyright.h:
2798 * src/frontends/gtk/Makefile.am: added these source-files for the
2799 Gtk/Gnome support of the Copyright-Dialog.
2801 * src/main.C: added Gnome::Main initialization if using
2802 Gtk/Gnome frontend-GUI.
2804 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2806 * config/gnome/aclocal-include.m4
2807 * config/gnome/compiler-flags.m4
2808 * config/gnome/curses.m4
2809 * config/gnome/gnome--.m4
2810 * config/gnome/gnome-bonobo-check.m4
2811 * config/gnome/gnome-common.m4
2812 * config/gnome/gnome-fileutils.m4
2813 * config/gnome/gnome-ghttp-check.m4
2814 * config/gnome/gnome-gnorba-check.m4
2815 * config/gnome/gnome-guile-checks.m4
2816 * config/gnome/gnome-libgtop-check.m4
2817 * config/gnome/gnome-objc-checks.m4
2818 * config/gnome/gnome-orbit-check.m4
2819 * config/gnome/gnome-print-check.m4
2820 * config/gnome/gnome-pthread-check.m4
2821 * config/gnome/gnome-support.m4
2822 * config/gnome/gnome-undelfs.m4
2823 * config/gnome/gnome-vfs.m4
2824 * config/gnome/gnome-x-checks.m4
2825 * config/gnome/gnome-xml-check.m4
2826 * config/gnome/gnome.m4
2827 * config/gnome/gperf-check.m4
2828 * config/gnome/gtk--.m4
2829 * config/gnome/linger.m4
2830 * config/gnome/need-declaration.m4: added configuration scripts
2831 for Gtk/Gnome frontend-GUI
2833 * configure.in: added support for the --with-frontend=gtk option
2835 * autogen.sh: added config/gnome/* to list of config-files
2837 * acconfig.h: added define for GTKGUI-support
2839 * config/lyxinclude.m4: added --with-frontend[=value] option value
2840 for Gtk/Gnome frontend-GUI support.
2842 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2844 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2848 * src/paragraph.C (GetChar): remove non-const version
2850 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2851 (search_kw): use it.
2853 * src/lyx_main.C (init): if "preferences" exist, read that instead
2855 (ReadRcFile): return bool if the file could be read ok.
2856 (ReadUIFile): add a check to see if lex file is set ok.
2858 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2859 bastring can be used instead of lyxstring (still uses the old code
2860 if std::string is good enough or if lyxstring is used.)
2862 * src/encoding.C: make the arrays static, move ininle functions
2864 * src/encoding.h: from here.
2866 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2867 (parseSingleLyXformat2Token): move inset parsing to separate method
2868 (readInset): new private method
2870 * src/Variables.h: remove virtual from get().
2872 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2873 access to NEW_INSETS and NEW_TABULAR
2875 * src/MenuBackend.h: remove superfluous forward declaration of
2876 MenuItem. Add documentations tags "///", remove empty MenuItem
2877 destructor, remove private default contructor.
2879 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2881 (read): more string mlabel and mname to where they are used
2882 (read): remove unused variables mlabel and mname
2883 (defaults): unconditional clear, make menusetup take advantage of
2884 add returning Menu &.
2886 * src/LyXView.h: define NEW_MENUBAR as default
2888 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2889 to NEW_INSETS and NEW_TABULAR.
2890 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2891 defined. Change some of the "xxxx-inset-insert" functions names to
2894 * several files: more enahncements to NEW_INSETS and the resulting
2897 * lib/lyxrc.example (\date_insert_format): move to misc section
2899 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2900 bastring and use AC_CACHE_CHECK.
2901 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2902 the system have the newest methods. uses AC_CACHE_CHECK
2903 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2904 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2905 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2907 * configure.in: add LYX_CXX_GOOD_STD_STRING
2909 * acinclude.m4: recreated
2911 2000-07-24 Amir Karger
2913 * README: add Hebrew, Arabic kmaps
2916 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2918 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2921 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2923 * Lot of files: add pragma interface/implementation.
2925 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2927 * lib/ui/default.ui: new file (ans new directory). Contains the
2928 default menu and toolbar.
2930 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2931 global space. Toolbars are now read (as menus) in ui files.
2933 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2935 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2936 is disabled because the document is read-only. We want to have the
2937 toggle state of the function anyway.
2938 (getStatus): add code for LFUN_VC* functions (mimicking what is
2939 done in old-style menus)
2941 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2942 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2944 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2945 * src/BufferView_pimpl.C: ditto.
2946 * src/lyxfunc.C: ditto.
2948 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2949 default). This replaces old-style menus by new ones.
2951 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2952 MenuItem. Contain the data structure of a menu.
2954 * src/insets/insettext.C: use LyXView::setLayout instead of
2955 accessing directly the toolbar combox.
2956 * src/lyxfunc.C (Dispatch): ditto.
2958 * src/LyXView.C (setLayout): new method, which just calls
2959 Toolbar::setLayout().
2960 (updateLayoutChoice): move part of this method in Toolbar.
2962 * src/toolbar.[Ch]: removed.
2964 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2965 implementation the toolbar.
2967 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2968 the toolbar. It might make sense to merge it with ToolbarDefaults
2970 (setLayout): new function.
2971 (updateLayoutList): ditto.
2972 (openLayoutList): ditto.
2974 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2975 xforms implementation of the toolbar.
2976 (get_toolbar_func): comment out, since I do not
2977 know what it is good for.
2979 * src/ToolbarDefaults.h: Add the ItemType enum.
2981 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2982 for a list of allocated C strings. Used in Menubar xforms
2983 implementation to avoid memory leaks.
2985 * src/support/lstrings.[Ch] (uppercase): new version taking and
2989 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2990 * lib/bind/emacs.bind: ditto.
2992 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2994 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2995 forward decl of LyXView.
2997 * src/toolbar.C (toolbarItem): moved from toolbar.h
2998 (toolbarItem::clean): ditto
2999 (toolbarItem::~toolbarItem): ditto
3000 (toolbarItem::operator): ditto
3002 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3004 * src/paragraph.h: control the NEW_TABULAR define from here
3006 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3007 USE_TABULAR_INSETS to NEW_TABULAR
3009 * src/ToolbarDefaults.C: add include "lyxlex.h"
3011 * files using the old table/tabular: use NEW_TABULAR to control
3012 compilation of old tabular stuff.
3014 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3017 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3018 planemet in reading of old style floats, fix the \end_deeper
3019 problem when reading old style floats.
3021 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3023 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3025 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3027 * lib/bind/sciword.bind: updated.
3029 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3031 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3032 layout write problem
3034 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3036 * src/Makefile.am (INCLUDES): remove image directory from include
3039 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3040 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3042 * src/LyXView.C (create_form_form_main): read the application icon
3045 * lib/images/*.xpm: change the icons to use transparent color for
3048 * src/toolbar.C (update): change the color of the button when it
3051 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3053 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3054 setting explicitely the minibuffer.
3055 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3057 * src/LyXView.C (showState): new function. Shows font information
3058 in minibuffer and update toolbar state.
3059 (LyXView): call Toolbar::update after creating the
3062 * src/toolbar.C: change toollist to be a vector instead of a
3064 (BubbleTimerCB): get help string directly from the callback
3065 argument of the corresponding icon (which is the action)
3066 (set): remove unnecessary ugliness.
3067 (update): new function. update the icons (depressed, disabled)
3068 depending of the status of the corresponding action.
3070 * src/toolbar.h: remove help in toolbarItem
3072 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
3074 * src/Painter.C (text): Added code for using symbol glyphs from
3075 iso10646 fonts. Currently diabled.
3077 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
3080 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
3081 magyar,turkish and usorbian.
3083 * src/paragraph.C (isMultiLingual): Made more efficient.
3085 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
3088 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
3089 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3090 Also changed the prototype to "bool math_insert_greek(char)".
3092 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3094 * lots of files: apply the NEW_INSETS on all code that will not be
3095 needed when we move to use the new insets. Enable the define in
3096 lyxparagrah.h to try it.
3098 * src/insets/insettabular.C (cellstart): change to be a static
3100 (InsetTabular): initialize buffer in the initializer list.
3102 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3104 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3105 form_print.h out of the header file. Replaced with forward
3106 declarations of the relevant struct.
3108 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3111 * src/commandtags.h: do not include "debug.h" which does not
3112 belong there. #include it in some other places because of this
3115 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3117 * src/insets/insetcaption.C: add a couple "using" directives.
3119 * src/toolbar.C (add): get the help text directly from lyxaction.
3121 (setPixmap): new function. Loads from disk and sets a pixmap on a
3122 botton; the name of the pixmap file is derived from the command
3125 * src/toolbar.h: remove members isBitmap and pixmap from
3128 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
3129 * lib/images/: move many files from images/banner.xpm.
3131 * src/lyx_gui.C (create_forms): read banner pixmap from file.
3133 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
3134 * src/toolbar.C: ditto.
3135 * configure.in: ditto.
3136 * INSTALL: document.
3138 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
3139 the spellchecker popup is closed from the WM.
3141 2000-07-19 Juergen Vigna <jug@sad.it>
3143 * src/insets/insetfloat.C (Write): small fix because we use the
3144 insetname for the type now!
3146 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3148 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3151 * src/frontends/Dialogs.h: removed hideCitation signal
3153 * src/insets/insetcite.h: added hide signal
3155 * src/insets/insetcite.C (~InsetCitation): emits new signal
3156 (getScreenLabel): "intelligent" label should now fit on the screen!
3158 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3160 * src/frontends/xforms/FormCitation.C (showInset): connects
3161 hide() to the inset's hide signal
3162 (show): modified to use fl_set_object_position rather than
3163 fl_set_object_geometry wherever possible
3165 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3167 * src/insets/lyxinset.h: add caption code
3169 * src/insets/insetfloat.C (type): new method
3171 * src/insets/insetcaption.C (Write): new method
3173 (LyxCode): new method
3175 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3176 to get it right together with using the FloatList.
3178 * src/commandtags.h: add LFUN_INSET_CAPTION
3179 * src/lyxfunc.C (Dispatch): handle it
3181 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3184 * src/Variables.[Ch]: make expand take a const reference, remove
3185 the destructor, some whitespace changes.
3187 * src/LyXAction.C (init): add caption-inset-insert
3189 * src/FloatList.C (FloatList): update the default floats a bit.
3191 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3193 * src/Variables.[Ch]: new files. Intended to be used for language
3194 specific strings (like \chaptername) and filename substitution in
3197 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
3199 * lib/kbd/american.kmap: update
3201 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
3203 * src/bufferparams.[Ch]: remove member allowAccents.
3205 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
3207 * src/LaTeXLog.C: use the log_form.h header.
3208 * src/lyx_gui.C: ditto.
3209 * src/lyx_gui_misc.C: ditto.
3210 * src/lyxvc.h: ditto.
3212 * forms/log_form.fd: new file, created from latexoptions.fd. I
3213 kept the log popup and nuked the options form.
3215 * src/{la,}texoptions.[Ch]: removed.
3216 * src/lyx_cb.C (LaTeXOptions): ditto
3218 * src/lyx_gui.C (create_forms): do not handle the
3219 fd_latex_options form.
3221 2000-07-18 Juergen Vigna <jug@sad.it>
3223 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
3224 name of the inset so that it can be requested outside (text2.C).
3226 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
3229 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3231 * src/mathed/formula.h (ConvertFont): constify
3233 * src/mathed/formula.C (Read): add warning if \end_inset is not
3234 found on expected place.
3236 * src/insets/lyxinset.h (ConvertFont): consify
3238 * src/insets/insetquotes.C (ConvertFont): constify
3239 * src/insets/insetquotes.h: ditto
3241 * src/insets/insetinfo.h: add labelfont
3243 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3244 (ascent): use labelfont
3248 (Write): make .lyx file a bit nicer
3250 * src/insets/insetfloat.C (Write): simplify somewhat...
3251 (Read): add warning if arg is not found
3253 * src/insets/insetcollapsable.C: add using std::max
3254 (Read): move string token and add warning in arg is not found
3255 (draw): use std::max to get the right ty
3256 (getMaxWidth): simplify by using std::max
3258 * src/insets/insetsection.h: new file
3259 * src/insets/insetsection.C: new file
3260 * src/insets/insetcaption.h: new file
3261 * src/insets/insetcaption.C: new file
3263 * src/insets/inset.C (ConvertFont): constify signature
3265 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3266 insetcaption.[Ch] and insetsection.[Ch]
3268 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3269 uses to use LABEL_COUNTER_CHAPTER instead.
3270 * src/text2.C (SetCounter): here
3272 * src/counters.h: new file
3273 * src/counters.C: new file
3274 * src/Sectioning.h: new file
3275 * src/Sectioning.C: new file
3277 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3279 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3281 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3284 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3287 2000-07-17 Juergen Vigna <jug@sad.it>
3289 * src/tabular.C (Validate): check if array-package is needed.
3290 (SetVAlignment): added support for vertical alignment.
3291 (SetLTFoot): better support for longtable header/footers
3292 (Latex): modified to support added features.
3294 * src/LaTeXFeatures.[Ch]: added array-package.
3296 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3298 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3301 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3303 * configure.in: do not forget to put a space after -isystem.
3305 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3307 * lib/kbd/arabic.kmap: a few fixes.
3309 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3311 * some whitespace chagnes to a number of files.
3313 * src/support/DebugStream.h: change to make it easier for
3314 doc++ to parse correctly.
3315 * src/support/lyxstring.h: ditto
3317 * src/mathed/math_utils.C (compara): change to have only one
3319 (MathedLookupBOP): change because of the above.
3321 * src/mathed/math_delim.C (math_deco_compare): change to have only
3323 (search_deco): change becasue of the above.
3325 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3326 instead of manually coded one.
3328 * src/insets/insetquotes.C (Read): read the \end_inset too
3330 * src/insets/insetlatex.h: remove file
3331 * src/insets/insetlatex.C: remove file
3333 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3335 (InsetPrintIndex): remove destructor
3337 * src/insets/insetinclude.h: remove default constructor
3339 * src/insets/insetfloat.C: work to make it work better
3341 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3343 * src/insets/insetcite.h (InsetCitation): remove default constructor
3345 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3347 * src/text.C (GetColumnNearX): comment out some currently unused code.
3349 * src/paragraph.C (writeFile): move some initializations closer to
3351 (CutIntoMinibuffer): small change to use new matchIT operator
3355 (InsertInset): ditto
3358 (InsetIterator): ditto
3359 (Erase): small change to use new matchFT operator
3361 (GetFontSettings): ditto
3362 (HighestFontInRange): ditto
3365 * src/lyxparagraph.h: some chars changed to value_type
3366 (matchIT): because of some stronger checking (perhaps too strong)
3367 in SGI STL, the two operator() unified to one.
3370 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3372 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3373 the last inset read added
3374 (parseSingleLyXformat2Token): some more (future) compability code added
3375 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3376 (parseSingleLyXformat2Token): set last_inset_read
3377 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3378 (parseSingleLyXformat2Token): don't double intializw string next_token
3380 * src/TextCache.C (text_fits::operator()): add const's to the signature
3381 (has_buffer::operator()): ditto
3383 * src/Floating.h: add some comments on the class
3385 * src/FloatList.[Ch] (typeExist): new method
3388 * src/BackStack.h: added default constructor, wanted by Gcc.
3390 2000-07-14 Juergen Vigna <jug@sad.it>
3392 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3394 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3396 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3397 do a redraw when the window is resized!
3398 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3400 * src/insets/insettext.C (resizeLyXText): added function to correctly
3401 being able to resize the LyXWindow.
3403 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3405 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3407 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3408 crashes when closing dialog to a deleted inset.
3410 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3411 method! Now similar to other insets.
3413 2000-07-13 Juergen Vigna <jug@sad.it>
3415 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3417 * lib/examples/Literate.lyx: small patch!
3419 * src/insets/insetbib.C (Read): added this function because of wrong
3420 Write (without [begin|end]_inset).
3422 2000-07-11 Juergen Vigna <jug@sad.it>
3424 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3425 as the insertInset could not be good!
3427 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3428 the bool param should not be last.
3430 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3432 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3433 did submit that to Karl).
3435 * configure.in: use -isystem instead of -I for X headers. This
3436 fixes a problem on solaris with a recent gcc;
3437 put the front-end code after the X detection code;
3438 configure in sigc++ before lib/
3440 * src/lyx_main.C (commandLineHelp): remove -display from command
3443 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3445 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3446 Also put in Makefile rules for building the ``listerrors''
3447 program for parsing errors from literate programs written in LyX.
3449 * lib/build-listerrors: Added small shell script as part of compile
3450 process. This builds a working ``listerrors'' binary if noweb is
3451 installed and either 1) the VNC X server is installed on the machine,
3452 or 2) the user is compiling from within a GUI. The existence of a GUI
3453 is necessary to use the ``lyx --export'' feature for now. This
3454 hack can be removed once ``lyx --export'' no longer requires a GUI to
3457 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3459 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3460 now passed back correctly from gcc and placed "under" error
3461 buttons in a Literate LyX source.
3463 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3465 * src/text.C (GetColumnNearX): Better behavior when a RTL
3466 paragraph is ended by LTR text.
3468 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3471 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3473 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3474 true when clipboard is empty.
3476 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3478 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3479 row of the paragraph.
3480 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3481 to prevent calculation of bidi tables
3483 2000-07-07 Juergen Vigna <jug@sad.it>
3485 * src/screen.C (ToggleSelection): added y_offset and x_offset
3488 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3491 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3493 * src/insets/insettext.C: fixed Layout-Display!
3495 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3497 * configure.in: add check for strings.h header.
3499 * src/spellchecker.C: include <strings.h> in order to have a
3500 definition for bzero().
3502 2000-07-07 Juergen Vigna <jug@sad.it>
3504 * src/insets/insettext.C (draw): set the status of the bv->text to
3505 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3507 * src/screen.C (DrawOneRow):
3508 (DrawFromTo): redraw the actual row if something has changed in it
3511 * src/text.C (draw): call an update of the toplevel-inset if something
3512 has changed inside while drawing.
3514 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3516 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3518 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3519 processing inside class.
3521 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3522 processing inside class.
3524 * src/insets/insetindex.h new struct Holder, consistent with other
3527 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3528 citation dialog from main code and placed it in src/frontends/xforms.
3529 Dialog launched through signals instead of callbacks
3531 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3533 * lyx.man: update the options description.
3535 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3537 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3538 handle neg values, set min width to 590, add doc about -display
3540 2000-07-05 Juergen Vigna <jug@sad.it>
3542 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3543 calls to BufferView *.
3545 * src/insets/insettext.C (checkAndActivateInset): small fix non
3546 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3548 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3549 their \end_inset token!
3551 2000-07-04 edscott <edscott@imp.mx>
3553 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3554 lib/lyxrc.example: added option \wheel_jump
3556 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3558 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3559 remove support for -width,-height,-xpos and -ypos.
3561 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3563 * src/encoding.[Ch]: New files.
3565 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3566 (text): Call to the underline() method only when needed.
3568 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3570 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3571 encoding(s) for the document.
3573 * src/bufferparams.C (BufferParams): Changed default value of
3576 * src/language.C (newLang): Removed.
3577 (items[]): Added encoding information for all defined languages.
3579 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3580 encoding choice button.
3582 * src/lyxrc.h (font_norm_type): New member variable.
3583 (set_font_norm_type): New method.
3585 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3586 paragraphs with different encodings.
3588 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3589 (TransformChar): Changed to work correctly with Arabic points.
3590 (draw): Added support for drawing Arabic points.
3591 (draw): Removed code for drawing underbars (this is done by
3594 * src/support/textutils.h (IsPrintableNonspace): New function.
3596 * src/BufferView_pimpl.h: Added "using SigC::Object".
3597 * src/LyXView.h: ditto.
3599 * src/insets/insetinclude.h (include_label): Changed to mutable.
3601 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3603 * src/mathed/math_iter.h: remove empty destructor
3605 * src/mathed/math_cursor.h: remove empty destructor
3607 * src/insets/lyxinset.h: add THEOREM_CODE
3609 * src/insets/insettheorem.[Ch]: new files
3611 * src/insets/insetminipage.C: (InsertInset): remove
3613 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3615 (InsertInset): remove
3617 * src/insets/insetlist.C: (InsertList): remove
3619 * src/insets/insetfootlike.[Ch]: new files
3621 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3624 (InsertInset): ditto
3626 * src/insets/insetert.C: remove include Painter.h, reindent
3627 (InsertInset): move to header
3629 * src/insets/insetcollapsable.h: remove explicit from default
3630 contructor, remove empty destructor, add InsertInset
3632 * src/insets/insetcollapsable.C (InsertInset): new func
3634 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3636 * src/vspace.h: add explicit to constructor
3638 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3639 \textcompwordmark, please test this.
3641 * src/lyxrc.C: set ascii_linelen to 65 by default
3643 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3645 * src/commandtags.h: add LFUN_INSET_THEOREM
3647 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3648 (makeLinuxDocFile): remove _some_ of the nice logic
3649 (makeDocBookFile): ditto
3651 * src/Painter.[Ch]: (~Painter): removed
3653 * src/LyXAction.C (init): entry for insettheorem added
3655 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3657 (deplog): code to detect files generated by LaTeX, needs testing
3660 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3662 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3664 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3666 * src/LaTeX.C (deplog): Add a check for files that are going to be
3667 created by the first latex run, part of the project to remove the
3670 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3671 contents to the extension list.
3673 2000-07-04 Juergen Vigna <jug@sad.it>
3675 * src/text.C (NextBreakPoint): added support for needFullRow()
3677 * src/insets/lyxinset.h: added needFullRow()
3679 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3682 * src/insets/insettext.C: lots of changes for update!
3684 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3686 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3688 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3690 * src/insets/insetinclude.C (InsetInclude): fixed
3691 initialization of include_label.
3692 (unique_id): now returns a string.
3694 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3696 * src/LaTeXFeatures.h: new member IncludedFiles, for
3697 a map of key, included file name.
3699 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3700 with the included files for inclusion in SGML preamble,
3701 i. e., linuxdoc and docbook.
3704 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3705 nice (is the generated linuxdoc code to be exported?), that
3706 allows to remove column, and only_body that will be true for
3707 slave documents. Insets are allowed inside SGML font type.
3708 New handling of the SGML preamble for included files.
3709 (makeDocBookFile): the same for docbook.
3711 * src/insets/insetinclude.h:
3712 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3714 (DocBook): new export methods.
3716 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3717 and makeDocBookFile.
3719 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3720 formats to export with command line argument -x.
3722 2000-06-29 Juergen Vigna <jug@sad.it>
3724 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3725 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3727 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3728 region could already been cleared by an inset!
3730 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3732 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3735 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3737 (cursorToggle): remove special handling of lyx focus.
3739 2000-06-28 Juergen Vigna <jug@sad.it>
3741 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3744 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3746 * src/insets/insetindex.C (Edit): add a callback when popup is
3749 * src/insets/insettext.C (LocalDispatch):
3750 * src/insets/insetmarginal.h:
3751 * src/insets/insetlist.h:
3752 * src/insets/insetfoot.h:
3753 * src/insets/insetfloat.h:
3754 * src/insets/insetert.h: add a missing std:: qualifier.
3756 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3758 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3761 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3763 * src/insets/insettext.C (Read): remove tmptok unused variable
3764 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3765 (InsertInset): change for new InsetInset code
3767 * src/insets/insettext.h: add TEXT inline method
3769 * src/insets/insettext.C: remove TEXT macro
3771 * src/insets/insetmarginal.C (Write): new method
3772 (Latex): change output slightly
3774 * src/insets/insetfoot.C (Write): new method
3775 (Latex): change output slightly (don't use endl when no need)
3777 * src/insets/insetert.C (Write): new method
3779 * src/insets/insetcollapsable.h: make button_length, button_top_y
3780 and button_bottm_y protected.
3782 * src/insets/insetcollapsable.C (Write): simplify code by using
3783 tostr. Also do not output the float name, the children class
3784 should to that to get control over own arguments
3786 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3787 src/insets/insetminipage.[Ch]:
3790 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3792 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3794 * src/Makefile.am (lyx_SOURCES): add the new files
3796 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3797 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3798 * src/commandtags.h: ditto
3800 * src/LaTeXFeatures.h: add a std::set of used floattypes
3802 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3804 * src/FloatList.[Ch] src/Floating.h: new files
3806 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3808 * src/lyx_cb.C (TableApplyCB): ditto
3810 * src/text2.C: ditto
3811 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3812 (parseSingleLyXformat2Token): ditto + add code for
3813 backwards compability for old float styles + add code for new insets
3815 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3817 (InsertInset(size_type, Inset *, LyXFont)): new method
3818 (InsetChar(size_type, char)): changed to use the other InsetChar
3819 with a LyXFont(ALL_INHERIT).
3820 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3821 insert the META_INSET.
3823 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3825 * sigc++/thread.h (Threads): from here
3827 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3828 definition out of line
3829 * sigc++/scope.h: from here
3831 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3833 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3834 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3836 * Makefile.am (bindist): new target.
3838 * INSTALL: add instructions for doing a binary distribution.
3840 * development/tools/README.bin.example: update a bit.
3842 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3845 * lib/lyxrc.example: new lyxrc tag \set_color.
3847 * src/lyxfunc.C (Dispatch):
3848 * src/commandtags.h:
3849 * src/LyXAction.C: new lyxfunc "set-color".
3851 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3852 and an x11name given as strings.
3854 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3855 cache when a color is changed.
3857 2000-06-26 Juergen Vigna <jug@sad.it>
3859 * src/lyxrow.C (width): added this functions and variable.
3861 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3864 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3866 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3868 * images/undo_bw.xpm: new icon.
3869 * images/redo_bw.xpm: ditto.
3871 * configure.in (INSTALL_SCRIPT): change value to
3872 ${INSTALL} to avoid failures of install-script target.
3873 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3875 * src/BufferView.h: add a magic "friend" declaration to please
3878 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3880 * forms/cite.fd: modified to allow resizing without messing
3883 * src/insetcite.C: Uses code from cite.fd almost without
3885 User can now resize dialog in the x-direction.
3886 Resizing the dialog in the y-direction is prevented, as the
3887 code does this intelligently already.
3889 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3891 * INSTALL: remove obsolete entry in "problems" section.
3893 * lib/examples/sl_*.lyx: update of the slovenian examples.
3895 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3897 2000-06-23 Juergen Vigna <jug@sad.it>
3899 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3901 * src/buffer.C (resize): delete the LyXText of textinsets.
3903 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3905 * src/insets/lyxinset.h: added another parameter 'cleared' to
3906 the draw() function.
3908 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3909 unlocking inset in inset.
3911 2000-06-22 Juergen Vigna <jug@sad.it>
3913 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3914 of insets and moved first to LyXText.
3916 * src/mathed/formulamacro.[Ch]:
3917 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3919 2000-06-21 Juergen Vigna <jug@sad.it>
3921 * src/text.C (GetVisibleRow): look if I should clear the area or not
3922 using Inset::doClearArea() function.
3924 * src/insets/lyxinset.h: added doClearArea() function and
3925 modified draw(Painter &, ...) to draw(BufferView *, ...)
3927 * src/text2.C (UpdateInset): return bool insted of int
3929 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3931 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3932 combox in the character popup
3934 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3935 BufferParams const & params
3937 2000-06-20 Juergen Vigna <jug@sad.it>
3939 * src/insets/insettext.C (SetParagraphData): set insetowner on
3942 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3944 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3945 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3947 (form_main_): remove
3949 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3950 (create_form_form_main): remove FD_form_main stuff, connect to
3951 autosave_timeout signal
3953 * src/LyXView.[Ch] (getMainForm): remove
3954 (UpdateTimerCB): remove
3955 * src/BufferView_pimpl.h: inherit from SigC::Object
3957 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3958 signal instead of callback
3960 * src/BufferView.[Ch] (cursorToggleCB): remove
3962 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3964 * src/BufferView_pimpl.C: changes because of the one below
3966 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3967 instead of storing a pointer to a LyXText.
3969 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3971 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3973 * src/lyxparagraph.h
3975 * src/paragraph.C: Changed fontlist to a sorted vector.
3977 2000-06-19 Juergen Vigna <jug@sad.it>
3979 * src/BufferView.h: added screen() function.
3981 * src/insets/insettext.C (LocalDispatch): some selection code
3984 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3986 * src/insets/insettext.C (SetParagraphData):
3988 (InsetText): fixes for multiple paragraphs.
3990 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3992 * development/lyx.spec.in: Call configure with ``--without-warnings''
3993 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3994 This should be fine, however, since we generally don't want to be
3995 verbose when making an RPM.
3997 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3999 * lib/scripts/fig2pstex.py: New file
4001 2000-06-16 Juergen Vigna <jug@sad.it>
4003 * src/insets/insettabular.C (UpdateLocal):
4004 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4005 (LocalDispatch): Changed all functions to use LyXText.
4007 2000-06-15 Juergen Vigna <jug@sad.it>
4009 * src/text.C (SetHeightOfRow): call inset::update before requesting
4012 * src/insets/insettext.C (update):
4013 * src/insets/insettabular.C (update): added implementation
4015 * src/insets/lyxinset.h: added update function
4017 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4019 * src/text.C (SelectNextWord): protect against null pointers with
4020 old-style string streams. (fix from Paul Theo Gonciari
4023 * src/cite.[Ch]: remove erroneous files.
4025 * lib/configure.m4: update the list of created directories.
4027 * src/lyxrow.C: include <config.h>
4028 * src/lyxcursor.C: ditto.
4030 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4032 * lib/examples/decimal.lyx: new example file from Mike.
4034 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4035 to find template definitions (from Dekel)
4037 * src/frontends/.cvsignore: add a few things.
4039 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4041 * src/Timeout.C (TimeOut): remove default argument.
4043 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4046 * src/insets/ExternalTemplate.C: add a "using" directive.
4048 * src/lyx_main.h: remove the act_ struct, which seems unused
4051 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4053 * LyX Developers Meeting: All files changed, due to random C++ (by
4054 coincidence) code generator script.
4056 - external inset (cool!)
4057 - initial online editing of preferences
4058 - insettabular breaks insettext(s contents)
4060 - some DocBook fixes
4061 - example files update
4062 - other cool stuff, create a diff and look for yourself.
4064 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4066 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4067 -1 this is a non-line-breaking textinset.
4069 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
4070 if there is no width set.
4072 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4074 * Lots of files: Merged the dialogbase branch.
4076 2000-06-09 Allan Rae <rae@lyx.org>
4078 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
4079 and the Dispatch methods that used it.
4081 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
4082 access to functions formerly kept in Dispatch.
4084 2000-05-19 Allan Rae <rae@lyx.org>
4086 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
4087 made to_page and count_copies integers again. from_page remains a
4088 string however because I want to allow entry of a print range like
4089 "1,4,22-25" using this field.
4091 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4092 and printer-params-get. These aren't useful from the minibuffer but
4093 could be used by a script/LyXServer app provided it passes a suitable
4094 auto_mem_buffer. I guess I should take a look at how the LyXServer
4095 works and make it support xtl buffers.
4097 * sigc++/: updated to libsigc++-1.0.1
4099 * src/xtl/: updated to xtl-1.3.pl.11
4101 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4102 those changes done to the files in src/ are actually recreated when
4103 they get regenerated. Please don't ever accept a patch that changes a
4104 dialog unless that patch includes the changes to the corresponding *.fd
4107 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4108 stringOnlyContains, renamed it and generalised it.
4110 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4111 branch. Removed the remaining old form_print code.
4113 2000-04-26 Allan Rae <rae@lyx.org>
4115 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
4116 trap I was trying to fix with the ID: fields in src/xtl/ :-)
4118 2000-04-25 Allan Rae <rae@lyx.org>
4120 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
4121 against a base of xtl-1.3.pl.4
4123 * development/tools/lxtl.sh: fixed a couple of silly typos and now
4124 filter the Id: entries so they still show the xtl version number
4127 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
4128 into the src/xtl code. Patch still pending with José (XTL)
4130 2000-04-24 Allan Rae <rae@lyx.org>
4132 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
4133 both more generic and much safer. Use the new template functions.
4134 * src/buffer.[Ch] (Dispatch): ditto.
4136 * src/frontends/xforms/FormPrint.C (update): Use new template functions
4137 and mem buffer more intelligently. Also a little general cleanup.
4140 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
4141 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4142 * src/xtl/Makefile.am: ditto.
4143 * src/xtl/.cvsignore: ditto.
4144 * src/Makefile.am: ditto.
4146 * src/PrinterParams.h: Removed the macros member functions. Added a
4147 testInvariant member function. A bit of tidying up and commenting.
4148 Included Angus's idea for fixing operation with egcs-1.1.2.
4150 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4151 cool expansion of XTL's mem_buffer to support automatic memory
4152 management within the buffer itself. Removed the various macros and
4153 replaced them with template functions that use either auto_mem_buffer
4154 or mem_buffer depending on a #define. The mem_buffer support will
4155 disappear as soon as the auto_mem_buffer is confirmed to be good on
4156 other platforms/compilers. That is, it's there so you've got something
4159 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4160 effectively forked XTL. However I expect José will include my code
4161 into the next major release. Also fixed a memory leak.
4162 * src/xtl/text.h: ditto.
4163 * src/xtl/xdr.h: ditto.
4164 * src/xtl/giop.h: ditto.
4166 2000-04-16 Allan Rae <rae@lyx.org>
4168 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4169 by autogen.sh and removed by maintainer-clean anyway.
4170 * .cvsignore, sigc++/.cvsignore: Support the above.
4172 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4174 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4176 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4177 macros, renamed static callback-target member functions to suit new
4178 scheme and made them public.
4179 * src/frontends/xforms/forms/form_print.fd: ditto.
4180 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4182 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4185 * src/xtl/: New directory containing a minimal distribution of XTL.
4186 This is XTL-1.3.pl.4.
4188 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4190 2000-04-15 Allan Rae <rae@lyx.org>
4192 * development/tools/makeLyXsigc.sh: Remove the library version numbers
4194 * sigc++/: Updated to libsigc++-1.0.0
4196 2000-04-14 Allan Rae <rae@lyx.org>
4198 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
4199 use the generic ones in future. I'll modify my conversion script.
4201 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
4203 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
4204 (CloseAllBufferRelatedDialogs): Renamed.
4205 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
4207 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
4208 of the generic ones. These are the same ones my conversion script
4211 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
4212 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
4213 * src/buffer.C (Dispatch): ditto
4215 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
4216 functions for updating and hiding buffer dependent dialogs.
4217 * src/BufferView.C (buffer): ditto
4218 * src/buffer.C (setReadonly): ditto
4219 * src/lyxfunc.C (CloseBuffer): ditto
4221 * src/buffer.h: Take setReadonly() out of line so I don't have to include
4222 Dialogs.h, and hence all the SigC stuff, into every file that includes
4223 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
4225 * src/BufferView2.C: reduce the number of headers included by buffer.h
4227 2000-04-11 Allan Rae <rae@lyx.org>
4229 * src/frontends/xforms/xform_macros.h: A small collection of macros
4230 for building C callbacks.
4232 * src/frontends/xforms/Makefile.am: Added above file.
4234 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
4235 scheme again. This time it should work for JMarc. If this is
4236 successful I'll revise my conversion script to automate some of this.
4237 The static member functions in the class also have to be public for
4238 this scheme will work. If the scheme works (it's almost identical to
4239 the way BufferView::cursorToggleCB is handled so it should work) then
4240 FormCopyright and FormPrint will be ready for inclusion into the main
4241 trunk immediately after 1.1.5 is released -- provided we're prepared
4242 for complaints about lame compilers not handling XTL.
4244 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4246 2000-04-07 Allan Rae <rae@lyx.org>
4248 * config/lyxinclude.m4: A bit more tidying up (Angus)
4250 * src/LString.h: JMarc's <string> header fix
4252 * src/PrinterParams.h: Used string for most data to remove some
4253 ugly code in the Print dialog and avoid even uglier code when
4254 appending the ints to a string for output.
4256 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4257 and moved "default:" back to the end of switch statement. Cleaned
4258 up the printing so it uses the right function calls and so the
4259 "print to file" option actually puts the file in the right directory.
4261 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4263 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4264 and Ok+Apply button control into a separate method: input (Angus).
4265 (input) Cleaned it up and improved it to be very thorough now.
4266 (All CB) static_cast used instead of C style cast (Angus). This will
4267 probably change again once we've worked out how to keep gcc-2.8.1 happy
4268 with real C callbacks.
4269 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4270 ignore some of the bool settings and has random numbers instead. Needs
4271 some more investigation. Added other input length checks and checking
4272 of file and printer names.
4274 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4275 would link (Angus). Seems the old code doesn't compile with the pragma
4276 statement either. Separated callback entries from internal methods.
4278 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4280 2000-03-17 Allan Rae <rae@lyx.org>
4282 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4283 need it? Maybe it could go in Dialogs instead? I could make it a
4284 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4285 values to get the bool return value.
4286 (Dispatch): New overloaded method for xtl support.
4288 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4289 extern "C" callback instead of static member functions. Hopefully,
4290 JMarc will be able to compile this. I haven't changed
4291 forms/form_copyright.fd yet. Breaking one of my own rules already.
4293 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4294 because they aren't useful from the minibuffer. Maybe a LyXServer
4295 might want a help message though?
4297 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4299 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4300 xtl which needs both rtti and exceptions.
4302 * src/support/Makefile.am:
4303 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4305 * src/frontends/xforms/input_validators.[ch]: input filters and
4306 validators. These conrol what keys are valid in input boxes.
4307 Use them and write some more. Much better idea than waiting till
4308 after the user has pressed Ok to say that the input fields don't make
4311 * src/frontends/xforms/Makefile.am:
4312 * src/frontends/xforms/forms/form_print.fd:
4313 * src/frontends/xforms/forms/makefile:
4314 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4315 new scheme. Still have to make sure I haven't missed anything from
4316 the current implementation.
4318 * src/Makefile.am, src/PrinterParams.h: New data store.
4320 * other files: Added a couple of copyright notices.
4322 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4324 * src/insets/insetbib.h: move Holder struct in public space.
4326 * src/frontends/include/DialogBase.h: use SigC:: only when
4327 SIGC_CXX_NAMESPACES is defined.
4328 * src/frontends/include/Dialogs.h: ditto.
4330 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4332 * src/frontends/xforms/FormCopyright.[Ch]: do not
4333 mention SigC:: explicitely.
4335 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4337 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4338 deals with testing KDE in main configure.in
4339 * configure.in: ditto.
4341 2000-02-22 Allan Rae <rae@lyx.org>
4343 * Lots of files: Merged from HEAD
4345 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4346 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4348 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4350 * sigc++/: new minidist.
4352 2000-02-14 Allan Rae <rae@lyx.org>
4354 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4356 2000-02-08 Juergen Vigna <jug@sad.it>
4358 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4359 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4361 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4362 for this port and so it is much easier for other people to port
4363 dialogs in a common development environment.
4365 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4366 the QT/KDE implementation.
4368 * src/frontends/kde/Dialogs.C:
4369 * src/frontends/kde/FormCopyright.C:
4370 * src/frontends/kde/FormCopyright.h:
4371 * src/frontends/kde/Makefile.am:
4372 * src/frontends/kde/formcopyrightdialog.C:
4373 * src/frontends/kde/formcopyrightdialog.h:
4374 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4375 for the kde support of the Copyright-Dialog.
4377 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4378 subdir-substitution instead of hardcoded 'xforms' as we now have also
4381 * src/frontends/include/DialogBase.h (Object): just commented the
4382 label after #endif (nasty warning and I don't like warnings ;)
4384 * src/main.C (main): added KApplication initialization if using
4387 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4388 For now only the KDE event-loop is added if frontend==kde.
4390 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4392 * configure.in: added support for the --with-frontend[=value] option
4394 * autogen.sh: added kde.m4 file to list of config-files
4396 * acconfig.h: added define for KDEGUI-support
4398 * config/kde.m4: added configuration functions for KDE-port
4400 * config/lyxinclude.m4: added --with-frontend[=value] option with
4401 support for xforms and KDE.
4403 2000-02-08 Allan Rae <rae@lyx.org>
4405 * all Makefile.am: Fixed up so the make targets dist, distclean,
4406 install and uninstall all work even if builddir != srcdir. Still
4407 have a new sigc++ minidist update to come.
4409 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4411 2000-02-01 Allan Rae <rae@lyx.org>
4413 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4414 Many mods to get builddir != srcdir working.
4416 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4417 for building on NT and so we can do the builddir != srcdir stuff.
4419 2000-01-30 Allan Rae <rae@lyx.org>
4421 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4422 This will stay in "rae" branch. We probably don't really need it in
4423 the main trunk as anyone who wants to help programming it should get
4424 a full library installed also. So they can check both included and
4425 system supplied library compilation.
4427 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4428 Added a 'mini' distribution of libsigc++. If you feel the urge to
4429 change something in these directories - Resist it. If you can't
4430 resist the urge then you should modify the following script and rebuild
4431 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4432 all happen. Still uses a hacked version of libsigc++'s configure.in.
4433 I'm quite happy with the results. I'm not sure the extra work to turn
4434 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4435 worth the trouble and would probably lead to extra maintenance
4437 I haven't tested the following important make targets: install, dist.
4438 Not ready for prime time but very close. Maybe 1.1.5.
4440 * development/tools/makeLyXsigc.sh: A shell script to automatically
4441 generate our mini-dist of libsigc++. It can only be used with a CVS
4442 checkout of libsigc++ not a tarball distribution. It's well commented.
4443 This will end up as part of the libsigc++ distribution so other apps
4444 can easily have an included mini-dist. If someone makes mods to the
4445 sigc++ subpackage without modifying this script to generate those
4446 changes I'll be very upset!
4448 * src/frontends/: Started the gui/system indep structure.
4450 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4451 to access the gui-indep dialogs are in this class. Much improved
4452 design compared to previous revision. Lars, please refrain from
4453 moving this header into src/ like you did with Popups.h last time.
4455 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4457 * src/frontends/xforms/: Started the gui-indep system with a single
4458 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4461 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4462 Here you'll find a very useful makefile and automated fdfix.sh that
4463 makes updating dailogs a no-brainer -- provided you follow the rules
4464 set out in the README. I'm thinking about adding another script to
4465 automatically generate skeleton code for a new dialog given just the
4468 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4469 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4470 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4472 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4474 * src/support/LSubstring.C (operator): simplify
4476 * src/lyxtext.h: removed bparams, use buffer_->params instead
4478 * src/lyxrow.h: make Row a real class, move all variables to
4479 private and use accessors.
4481 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4483 (isRightToLeftPar): ditto
4484 (ChangeLanguage): ditto
4485 (isMultiLingual): ditto
4488 (SimpleTeXOnePar): ditto
4489 (TeXEnvironment): ditto
4490 (GetEndLabel): ditto
4492 (SetOnlyLayout): ditto
4493 (BreakParagraph): ditto
4494 (BreakParagraphConservative): ditto
4495 (GetFontSettings): ditto
4497 (CopyIntoMinibuffer): ditto
4498 (CutIntoMinibuffer): ditto
4499 (PasteParagraph): ditto
4500 (SetPExtraType): ditto
4501 (UnsetPExtraType): ditto
4502 (DocBookContTableRows): ditto
4503 (SimpleDocBookOneTablePar): ditto
4505 (TeXFootnote): ditto
4506 (SimpleTeXOneTablePar): ditto
4507 (TeXContTableRows): ditto
4508 (SimpleTeXSpecialChars): ditto
4511 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4512 to private and use accessors.
4514 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4515 this, we did not use it anymore and has not been for ages. Just a
4516 waste of cpu cycles.
4518 * src/language.h: make Language a real class, move all variables
4519 to private and use accessors.
4521 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4522 (create_view): remove
4523 (update): some changes for new timer
4524 (cursorToggle): use new timer
4525 (beforeChange): change for new timer
4527 * src/BufferView.h (cursorToggleCB): removed last paramter because
4530 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4531 (cursorToggleCB): change because of new timer code
4533 * lib/CREDITS: updated own mailaddress
4535 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4537 * src/support/filetools.C (PutEnv): fix the code in case neither
4538 putenv() nor setenv() have been found.
4540 * INSTALL: mention the install-strip Makefile target.
4542 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4543 read-only documents.
4545 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4547 * lib/reLyX/configure.in (VERSION): avoid using a previously
4548 generated reLyX wrapper to find out $prefix.
4550 * lib/examples/eu_adibide_lyx-atua.lyx:
4551 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4552 translation of the Tutorial (Dooteo)
4554 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4556 * forms/cite.fd: new citation dialog
4558 * src/insetcite.[Ch]: the new citation dialog is moved into
4561 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4564 * src/insets/insetcommand.h: data members made private.
4566 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4568 * LyX 1.1.5 released
4570 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4572 * src/version.h (LYX_RELEASE): to 1.1.5
4574 * src/spellchecker.C (RunSpellChecker): return false if the
4575 spellchecker dies upon creation.
4577 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4579 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4580 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4584 * lib/CREDITS: update entry for Martin Vermeer.
4586 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4588 * src/text.C (draw): Draw foreign language bars at the bottom of
4589 the row instead of at the baseline.
4591 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4593 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4595 * lib/bind/de_menus.bind: updated
4597 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4599 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4601 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4603 * src/menus.C (Limit_string_length): New function
4604 (ShowTocMenu): Limit the number of items/length of items in the
4607 * src/paragraph.C (String): Correct result for a paragraph inside
4610 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4612 * src/bufferlist.C (close): test of buf->getuser() == NULL
4614 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4616 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4617 Do not call to SetCursor when the paragraph is a closed footnote!
4619 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4621 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4624 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4626 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4629 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4630 reference popup, that activates the reference-back action
4632 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4634 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4635 the menus. Also fixed a bug.
4637 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4638 the math panels when switching buffers (unless new buffer is readonly).
4640 * src/BufferView.C (NoSavedPositions)
4641 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4643 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4645 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4646 less of dvi dirty or not.
4648 * src/trans_mgr.[Ch] (insert): change first parameter to string
4651 * src/chset.[Ch] (encodeString): add const to first parameter
4653 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4655 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4659 * src/LaTeX.C (deplog): better searching for dependency files in
4660 the latex log. Uses now regexps.
4662 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4663 instead of the box hack or \hfill.
4665 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4667 * src/lyxfunc.C (doImportHelper): do not create the file before
4668 doing the actual import.
4669 (doImportASCIIasLines): create a new file before doing the insert.
4670 (doImportASCIIasParagraphs): ditto.
4672 * lib/lyxrc.example: remove mention of non-existing commands
4674 * lyx.man: remove mention of color-related switches.
4676 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4678 * src/lyx_gui.C: remove all the color-related ressources, which
4679 are not used anymore.
4681 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4684 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4686 * src/lyxrc.C (read): Add a missing break in the switch
4688 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4690 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4692 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4695 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4697 * src/text.C (draw): draw bars under foreign language words.
4699 * src/LColor.[Ch]: add LColor::language
4701 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4703 * src/lyxcursor.h (boundary): New member variable
4705 * src/text.C (IsBoundary): New methods
4707 * src/text.C: Use the above for currect cursor movement when there
4708 is both RTL & LTR text.
4710 * src/text2.C: ditto
4712 * src/bufferview_funcs.C (ToggleAndShow): ditto
4714 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4716 * src/text.C (DeleteLineForward): set selection to true to avoid
4717 that DeleteEmptyParagraphMechanism does some magic. This is how it
4718 is done in all other functions, and seems reasonable.
4719 (DeleteWordForward): do not jump over non-word stuff, since
4720 CursorRightOneWord() already does it.
4722 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4723 DeleteWordBackward, since they seem safe to me (since selection is
4724 set to "true") DeleteEmptyParagraphMechanism does nothing.
4726 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4728 * src/lyx_main.C (easyParse): simplify the code by factoring the
4729 part that removes parameters from the command line.
4730 (LyX): check wether wrong command line options have been given.
4732 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4734 * src/lyx_main.C : add support for specifying user LyX
4735 directory via command line option -userdir.
4737 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4739 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4740 the number of items per popup.
4741 (Add_to_refs_menu): Ditto.
4743 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4745 * src/lyxparagraph.h: renamed ClearParagraph() to
4746 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4747 textclass as parameter, and do nothing if free_spacing is
4748 true. This fixes part of the line-delete-forward problems.
4750 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4751 (pasteSelection): ditto.
4752 (SwitchLayoutsBetweenClasses): more translatable strings.
4754 * src/text2.C (CutSelection): use StripLeadingSpaces.
4755 (PasteSelection): ditto.
4756 (DeleteEmptyParagraphMechanism): ditto.
4758 2000-05-26 Juergen Vigna <jug@sad.it>
4760 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4761 is not needed in tabular insets.
4763 * src/insets/insettabular.C (TabularFeatures): added missing features.
4765 * src/tabular.C (DeleteColumn):
4767 (AppendRow): implemented this functions
4768 (cellsturct::operator=): clone the inset too;
4770 2000-05-23 Juergen Vigna <jug@sad.it>
4772 * src/insets/insettabular.C (LocalDispatch): better selection support
4773 when having multicolumn-cells.
4775 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4777 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4779 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4781 * src/ColorHandler.C (getGCForeground): put more test into _()
4783 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4786 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4789 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4791 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4792 there are no labels, or when buffer is readonly.
4794 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4795 there are no labels, buffer is SGML, or when buffer is readonly.
4797 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4799 * src/LColor.C (LColor): change a couple of grey40 to grey60
4800 (LColor): rewore initalization to make compiles go some magnitude
4802 (getGUIName): don't use gettext until we need the string.
4804 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4806 * src/Bullet.[Ch]: Fixed a small bug.
4808 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4810 * src/paragraph.C (String): Several fixes/improvements
4812 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4814 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4816 * src/paragraph.C (String): give more correct output.
4818 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4820 * src/lyxfont.C (stateText) Do not output the language if it is
4821 eqaul to the language of the document.
4823 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4824 between two paragraphs with the same language.
4826 * src/paragraph.C (getParLanguage) Return a correct answer for an
4827 empty dummy paragraph.
4829 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4832 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4835 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4836 the menus/popup, if requested fonts are unavailable.
4838 2000-05-22 Juergen Vigna <jug@sad.it>
4840 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4841 movement support (Up/Down/Tab/Shift-Tab).
4842 (LocalDispatch): added also preliminari cursor-selection.
4844 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4846 * src/paragraph.C (PasteParagraph): Hopefully now right!
4848 2000-05-22 Garst R. Reese <reese@isn.net>
4850 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4851 of list, change all references to Environment to Command
4852 * tex/hollywood.cls : rewrite environments as commands, add
4853 \uppercase to interiorshot and exteriorshot to force uppecase.
4854 * tex/broadway.cls : rewrite environments as commands. Tweak
4857 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4859 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4860 size of items: use a constant intead of the hardcoded 40, and more
4861 importantly do not remove the %m and %x tags added at the end.
4862 (Add_to_refs_menu): use vector::size_type instead of
4863 unsigned int as basic types for the variables. _Please_ do not
4864 assume that size_t is equal to unsigned int. On an alpha, this is
4865 unsigned long, which is _not_ the same.
4867 * src/language.C (initL): remove language "hungarian", since it
4868 seems that "magyar" is better.
4870 2000-05-22 Juergen Vigna <jug@sad.it>
4872 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4874 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4877 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4878 next was deleted but not set to 0.
4880 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4882 * src/language.C (initL): change the initialization of languages
4883 so that compiles goes _fast_.
4885 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4888 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4890 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4894 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4896 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4898 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4902 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4905 * src/insets/insetlo*.[Ch]: Made editable
4907 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4909 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4910 the current selection.
4912 * src/BufferView_pimpl.C (stuffClipboard): new method
4914 * src/BufferView.C (stuffClipboard): new method
4916 * src/paragraph.C (String): new method
4918 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4919 LColor::ignore when lyxname is not found.
4921 * src/BufferView.C (pasteSelection): new method
4923 * src/BufferView_pimpl.C (pasteSelection): new method
4925 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4927 * src/WorkArea.C (request_clipboard_cb): new static function
4928 (getClipboard): new method
4929 (putClipboard): new method
4931 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4933 * LyX 1.1.5pre2 released
4935 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4937 * src/vspace.C (operator=): removed
4938 (operator=): removed
4940 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4942 * src/layout.C (NumberOfClass): manually set the type in make_pair
4943 (NumberOfLayout): ditto
4945 * src/language.C: use the Language constructor for ignore_lang
4947 * src/language.h: add constructors to struct Language
4949 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4951 * src/text2.C (SetCursorIntern): comment out #warning
4953 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4955 * src/mathed/math_iter.h: initialize sx and sw to 0
4957 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4959 * forms/lyx.fd: Redesign of form_ref
4961 * src/LaTeXFeatures.[Ch]
4965 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4968 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4969 and Buffer::inset_iterator.
4971 * src/menus.C: Added new menus: TOC and Refs.
4973 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4975 * src/buffer.C (getTocList): New method.
4977 * src/BufferView2.C (ChangeRefs): New method.
4979 * src/buffer.C (getLabelList): New method. It replaces the old
4980 getReferenceList. The return type is vector<string> instead of
4983 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4984 the old getLabel() and GetNumberOfLabels() methods.
4985 * src/insets/insetlabel.C (getLabelList): ditto
4986 * src/mathed/formula.C (getLabelList): ditto
4988 * src/paragraph.C (String): New method.
4990 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4991 Uses the new getTocList() method.
4992 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4993 which automatically updates the contents of the browser.
4994 (RefUpdateCB): Use the new getLabelList method.
4996 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4998 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5000 * src/spellchecker.C: Added using std::reverse;
5002 2000-05-19 Juergen Vigna <jug@sad.it>
5004 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5006 * src/insets/insettext.C (computeTextRows): small fix for display of
5007 1 character after a newline.
5009 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5012 2000-05-18 Juergen Vigna <jug@sad.it>
5014 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5015 when changing width of column.
5017 * src/tabular.C (set_row_column_number_info): setting of
5018 autobreak rows if necessary.
5020 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5022 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5024 * src/vc-backend.*: renamed stat() to status() and vcstat to
5025 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5026 compilation broke. The new name seems more relevant, anyway.
5028 2000-05-17 Juergen Vigna <jug@sad.it>
5030 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5031 which was wrong if the removing caused removing of rows!
5033 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5034 (pushToken): new function.
5036 * src/text2.C (CutSelection): fix problem discovered with purify
5038 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5040 * src/debug.C (showTags): enlarge the first column, now that we
5041 have 6-digits debug codes.
5043 * lib/layouts/hollywood.layout:
5044 * lib/tex/hollywood.cls:
5045 * lib/tex/brodway.cls:
5046 * lib/layouts/brodway.layout: more commands and fewer
5047 environments. Preambles moved in the .cls files. Broadway now has
5048 more options on scene numbering and less whitespace (from Garst)
5050 * src/insets/insetbib.C (getKeys): make sure that we are in the
5051 document directory, in case the bib file is there.
5053 * src/insets/insetbib.C (Latex): revert bogus change.
5055 2000-05-16 Juergen Vigna <jug@sad.it>
5057 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5058 the TabularLayout on cursor move.
5060 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5062 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5065 (draw): fixed cursor position and drawing so that the cursor is
5066 visible when before the tabular-inset.
5068 * src/insets/insettext.C (init): drawLockedFrame was not initialized
5069 when creating from old insettext.
5071 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
5073 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5075 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
5076 * lib/tex/brodway.cls: ditto
5078 * lib/layouts/brodway.layout: change alignment of parenthical
5081 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5083 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
5084 versions 0.88 and 0.89 are supported.
5086 2000-05-15 Juergen Vigna <jug@sad.it>
5088 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5091 * src/insets/insettext.C (computeTextRows): redone completely this
5092 function in a much cleaner way, because of problems when having a
5094 (draw): added a frame border when the inset is locked.
5095 (SetDrawLockedFrame): this sets if we draw the border or not.
5096 (SetFrameColor): this sets the frame color (default=insetframe).
5098 * src/insets/lyxinset.h: added x() and y() functions which return
5099 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5100 function which is needed to see if we have a locking inset of some
5101 type in this inset (needed for now in insettabular).
5103 * src/vspace.C (inPixels): the same function also without a BufferView
5104 parameter as so it is easier to use it in some ocasions.
5106 * src/lyxfunc.C: changed all places where insertInset was used so
5107 that now if it couldn't be inserted it is deleted!
5109 * src/TabularLayout.C:
5110 * src/TableLayout.C: added support for new tabular-inset!
5112 * src/BufferView2.C (insertInset): this now returns a bool if the
5113 inset was really inserted!!!
5115 * src/tabular.C (GetLastCellInRow):
5116 (GetFirstCellInRow): new helper functions.
5117 (Latex): implemented for new tabular class.
5121 (TeXTopHLine): new Latex() helper functions.
5123 2000-05-12 Juergen Vigna <jug@sad.it>
5125 * src/mathed/formulamacro.C (Read):
5126 * src/mathed/formula.C (Read): read also the \end_inset here!
5128 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5130 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
5131 crush when saving formulae with unbalanced parenthesis.
5133 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
5135 * src/layout.C: Add new keyword "endlabelstring" to layout file
5137 * src/text.C (GetVisibleRow): Draw endlabel string.
5139 * lib/layouts/broadway.layout
5140 * lib/layouts/hollywood.layout: Added endlabel for the
5141 Parenthetical layout.
5143 * lib/layouts/heb-article.layout: Do not use slanted font shape
5144 for Theorem like environments.
5146 * src/buffer.C (makeLaTeXFile): Always add "american" to
5147 the UsedLanguages list if document language is RTL.
5149 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5151 * add addendum to README.OS2 and small patch (from SMiyata)
5153 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5155 * many files: correct the calls to ChangeExtension().
5157 * src/support/filetools.C (ChangeExtension): remove the no_path
5158 argument, which does not belong there. Use OnlyFileName() instead.
5160 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5161 files when LaTeXing a non-nice latex file.
5163 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5164 a chain of "if". Return false when deadkeys are not handled.
5166 * src/lyx_main.C (LyX): adapted the code for default bindings.
5168 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5169 bindings for basic functionality (except deadkeys).
5170 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5172 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5173 several methods: handle override_x_deadkeys.
5175 * src/lyxrc.h: remove the "bindings" map, which did not make much
5176 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5178 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5180 * src/lyxfont.C (stateText): use a saner method to determine
5181 whether the font is "default". Seems to fix the crash with DEC
5184 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5186 2000-05-08 Juergen Vigna <jug@sad.it>
5188 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5189 TabularLayoutMenu with mouse-button-3
5190 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
5192 * src/TabularLayout.C: added this file for having a Layout for
5195 2000-05-05 Juergen Vigna <jug@sad.it>
5197 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
5198 recalculating inset-widths.
5199 (TabularFeatures): activated this function so that I can change
5200 tabular-features via menu.
5202 * src/menus.C (ShowEditMenu): inserted support for insettabular so
5203 that I can test some functions with the Table menu.
5205 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5207 * src/lyxfont.C (stateText): guard against stupid c++libs.
5209 * src/tabular.C: add using std::vector
5210 some whitespace changes, + removed som autogenerated code.
5212 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
5214 2000-05-05 Juergen Vigna <jug@sad.it>
5216 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
5217 row, columns and cellstructures.
5219 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5221 * lib/lyxrc.example: remove obsolete entries.
5223 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
5224 reading of protected_separator for free_spacing.
5226 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5228 * src/text.C (draw): do not display an exclamation mark in the
5229 margin for margin notes. This is confusing, ugly and
5232 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
5233 AMS math' is checked.
5235 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
5236 name to see whether including the amsmath package is needed.
5238 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5240 * src/paragraph.C (validate): Compute UsedLanguages correctly
5241 (don't insert the american language if it doesn't appear in the
5244 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5245 The argument of \thanks{} command is considered moving argument
5247 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5250 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5252 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5253 for appendix/minipage/depth. The lines can be now both in the footnote
5254 frame, and outside the frame.
5256 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5259 2000-05-05 Juergen Vigna <jug@sad.it>
5261 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5262 neede only in tabular.[Ch].
5264 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5266 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5268 (Write): write '~' for PROTECTED_SEPARATOR
5270 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5272 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5275 * src/mathed/formula.C (drawStr): rename size to siz.
5277 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5278 possibly fix a bug by not changing the pflags = flags to piflags =
5281 2000-05-05 Juergen Vigna <jug@sad.it>
5283 * src/insets/insetbib.C: moved using directive
5285 * src/ImportNoweb.C: small fix for being able to compile (missing
5288 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5290 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5291 to use clear, since we don't depend on this in the code. Add test
5294 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5296 * (various *.C files): add using std::foo directives to please dec
5299 * replace calls to string::clear() to string::erase() (Angus)
5301 * src/cheaders/cmath: modified to provide std::abs.
5303 2000-05-04 Juergen Vigna <jug@sad.it>
5305 * src/insets/insettext.C: Prepared all for inserting of multiple
5306 paragraphs. Still display stuff to do (alignment and other things),
5307 but I would like to use LyXText to do this when we cleaned out the
5308 table-support stuff.
5310 * src/insets/insettabular.C: Changed lot of stuff and added lots
5311 of functionality still a lot to do.
5313 * src/tabular.C: Various functions changed name and moved to be
5314 const functions. Added new Read and Write functions and changed
5315 lots of things so it works good with tabular-insets (also removed
5316 some stuff which is not needed anymore * hacks *).
5318 * src/lyxcursor.h: added operators == and != which just look if
5319 par and pos are (not) equal.
5321 * src/buffer.C (latexParagraphs): inserted this function to latex
5322 all paragraphs form par to endpar as then I can use this too for
5325 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5326 so that I can call this to from text insets with their own cursor.
5328 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5329 output off all paragraphs (because of the fix below)!
5331 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5332 the very last paragraph (this could be also the last paragraph of an
5335 * src/texrow.h: added rows() call which returns the count-variable.
5337 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5339 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5341 * lib/configure.m4: better autodetection of DocBook tools.
5343 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5345 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5347 * src/lyx_cb.C: add using std::reverse;
5349 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5352 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5353 selected files. Should fix repeated errors from generated files.
5355 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5357 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5359 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5360 the spellchecker popup.
5362 * lib/lyxrc.example: Removed the \number_inset section
5364 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5366 * src/insets/figinset.C (various): Use IsFileReadable() to make
5367 sure that the file actually exist. Relying on ghostscripts errors
5368 is a bad idea since they can lead to X server crashes.
5370 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5372 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5375 * lib/lyxrc.example: smallish typo in description of
5376 \view_dvi_paper_option
5378 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5381 * src/lyxfunc.C: doImportHelper to factor out common code of the
5382 various import methods. New functions doImportASCIIasLines,
5383 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5384 doImportLinuxDoc for the format specific parts.
5387 * buffer.C: Dispatch returns now a bool to indicate success
5390 * lyx_gui.C: Add getLyXView() for member access
5392 * lyx_main.C: Change logic for batch commands: First try
5393 Buffer::Dispatch (possibly without GUI), if that fails, use
5396 * lyx_main.C: Add support for --import command line switch.
5397 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5398 Available Formats: Everything accepted by 'buffer-import <format>'
5400 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5402 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5405 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5406 documents will be reformatted upon reentry.
5408 2000-04-27 Juergen Vigna <jug@sad.it>
5410 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5411 correctly only last pos this was a bug.
5413 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5415 * release of lyx-1.1.5pre1
5417 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5419 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5421 * src/menus.C: revert the change of naming (Figure->Graphic...)
5422 from 2000-04-11. It was incomplete and bad.
5424 * src/LColor.[Ch]: add LColor::depthbar.
5425 * src/text.C (GetVisibleRow): use it.
5427 * README: update the languages list.
5429 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5431 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5434 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5436 * README: remove sections that were just wrong.
5438 * src/text2.C (GetRowNearY): remove currentrow code
5440 * src/text.C (GetRow): remove currentrow code
5442 * src/screen.C (Update): rewritten a bit.
5443 (SmallUpdate): removed func
5445 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5447 (FullRebreak): return bool
5448 (currentrow): remove var
5449 (currentrow_y): ditto
5451 * src/lyxscreen.h (Draw): change arg to unsigned long
5452 (FitCursor): return bool
5453 (FitManualCursor): ditto
5454 (Smallpdate): remove func
5455 (first): change to unsigned long
5456 (DrawOneRow): change second arg to long (from long &)
5457 (screen_refresh_y): remove var
5458 (scree_refresh_row): ditto
5460 * src/lyxrow.h: change baseline to usigned int from unsigned
5461 short, this brings some implicit/unsigned issues out in the open.
5463 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5465 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5466 instead of smallUpdate.
5468 * src/lyxcursor.h: change y to unsigned long
5470 * src/buffer.h: don't call updateScrollbar after fitcursor
5472 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5473 where they are used. Removed "\\direction", this was not present
5474 in 1.1.4 and is already obsolete. Commented out some code that I
5475 believe to never be called.
5476 (runLiterate): don't call updateScrollbar after fitCursor
5478 (buildProgram): ditto
5481 * src/WorkArea.h (workWidth): change return val to unsigned
5484 (redraw): remove the button redraws
5485 (setScrollbarValue): change for scrollbar
5486 (getScrollbarValue): change for scrollbar
5487 (getScrollbarBounds): change for scrollbar
5489 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5490 (C_WorkArea_down_cb): removed func
5491 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5492 (resize): change for scrollbar
5493 (setScrollbar): ditto
5494 (setScrollbarBounds): ditto
5495 (setScrollbarIncrements): ditto
5496 (up_cb): removed func
5497 (down_cb): removed func
5498 (scroll_cb): change for scrollbar
5499 (work_area_handler): ditto
5501 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5502 when FitCursor did something.
5503 (updateScrollbar): some unsigned changes
5504 (downCB): removed func
5505 (scrollUpOnePage): removed func
5506 (scrollDownOnePage): remvoed func
5507 (workAreaMotionNotify): don't call screen->FitCursor but use
5508 fitCursor instead. and bool return val
5509 (workAreaButtonPress): ditto
5510 (workAreaButtonRelease): some unsigned changes
5511 (checkInsetHit): ditto
5512 (workAreaExpose): ditto
5513 (update): parts rewritten, comments about the signed char arg added
5514 (smallUpdate): removed func
5515 (cursorPrevious): call needed updateScrollbar
5518 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5521 * src/BufferView.[Ch] (upCB): removed func
5522 (downCB): removed func
5523 (smallUpdate): removed func
5525 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5527 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5528 currentrow, currentrow_y optimization. This did not help a lot and
5529 if we want to do this kind of optimization we should rather use
5530 cursor.row instead of the currentrow.
5532 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5533 buffer spacing and klyx spacing support.
5535 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5537 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5540 2000-04-26 Juergen Vigna <jug@sad.it>
5542 * src/insets/figinset.C: fixes to Lars sstream changes!
5544 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5546 * A lot of files: Added Ascii(ostream &) methods to all inset
5547 classes. Used when exporting to ASCII.
5549 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5550 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5553 * src/text2.C (ToggleFree): Disabled implicit word selection when
5554 there is a change in the language
5556 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5557 no output was generated for end-of-sentence inset.
5559 * src/insets/lyxinset.h
5562 * src/paragraph.C: Removed the insetnumber code
5564 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5566 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5568 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5569 no_babel and no_epsfig completely from the file.
5570 (parseSingleLyXformat2Token): add handling for per-paragraph
5571 spacing as written by klyx.
5573 * src/insets/figinset.C: applied patch by Andre. Made it work with
5576 2000-04-20 Juergen Vigna <jug@sad.it>
5578 * src/insets/insettext.C (cutSelection):
5579 (copySelection): Fixed with selection from right to left.
5580 (draw): now the rows are not recalculated at every draw.
5581 (computeTextRows): for now reset the inset-owner here (this is
5582 important for an undo or copy where the inset-owner is not set
5585 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5586 motion to the_locking_inset screen->first was forgotten, this was
5587 not important till we got multiline insets.
5589 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5591 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5592 code seems to be alright (it is code changed by Dekel, and the
5593 intent is indeed that all macros should be defined \protect'ed)
5595 * NEWS: a bit of reorganisation of the new user-visible features.
5597 2000-04-19 Juergen Vigna <jug@sad.it>
5599 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5600 position. Set the inset_owner of the used paragraph so that it knows
5601 that it is inside an inset. Fixed cursor handling with mouse and
5602 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5603 and cleanups to make TextInsets work better.
5605 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5606 Changed parameters of various functions and added LockInsetInInset().
5608 * src/insets/insettext.C:
5610 * src/insets/insetcollapsable.h:
5611 * src/insets/insetcollapsable.C:
5612 * src/insets/insetfoot.h:
5613 * src/insets/insetfoot.C:
5614 * src/insets/insetert.h:
5615 * src/insets/insetert.C: cleaned up the code so that it works now
5616 correctly with insettext.
5618 * src/insets/inset.C:
5619 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5620 that insets in insets are supported right.
5623 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5625 * src/paragraph.C: some small fixes
5627 * src/debug.h: inserted INSETS debug info
5629 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5630 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5632 * src/commandtags.h:
5633 * src/LyXAction.C: insert code for InsetTabular.
5635 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5636 not Button1MotionMask.
5637 (workAreaButtonRelease): send always a InsetButtonRelease event to
5639 (checkInsetHit): some setCursor fixes (always with insets).
5641 * src/BufferView2.C (lockInset): returns a bool now and extended for
5642 locking insets inside insets.
5643 (showLockedInsetCursor): it is important to have the cursor always
5644 before the locked inset.
5645 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5647 * src/BufferView.h: made lockInset return a bool.
5649 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5651 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5652 that is used also internally but can be called as public to have back
5653 a cursor pos which is not set internally.
5654 (SetCursorIntern): Changed to use above function.
5656 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5658 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5663 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5664 patches for things that should be in or should be changed.
5666 * src/* [insetfiles]: change "usigned char fragile" to bool
5667 fragile. There was only one point that could that be questioned
5668 and that is commented in formulamacro.C. Grep for "CHECK".
5670 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5671 (DeleteBuffer): take it out of CutAndPaste and make it static.
5673 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5675 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5676 output the spacing envir commands. Also the new commands used in
5677 the LaTeX output makes the result better.
5679 * src/Spacing.C (writeEnvirBegin): new method
5680 (writeEnvirEnd): new method
5682 2000-04-18 Juergen Vigna <jug@sad.it>
5684 * src/CutAndPaste.C: made textclass a static member of the class
5685 as otherwise it is not accesed right!!!
5687 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5689 * forms/layout_forms.fd
5690 * src/layout_forms.h
5691 * src/layout_forms.C (create_form_form_character)
5692 * src/lyx_cb.C (UserFreeFont)
5693 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5694 documents (in the layout->character popup).
5696 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5698 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5699 \spell_command was in fact not honored (from Kevin Atkinson).
5701 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5704 * src/lyx_gui.h: make lyxViews private (Angus)
5706 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5708 * src/mathed/math_write.C
5709 (MathMatrixInset::Write) Put \protect before \begin{array} and
5710 \end{array} if fragile
5711 (MathParInset::Write): Put \protect before \\ if fragile
5713 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5715 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5716 initialization if the LyXColorHandler must be done after the
5717 connections to the XServer has been established.
5719 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5720 get the background pixel from the lyxColorhandler so that the
5721 figures are rendered with the correct background color.
5722 (NextToken): removed functions.
5723 (GetPSSizes): use ifs >> string instead of NextToken.
5725 * src/Painter.[Ch]: the color cache moved out of this file.
5727 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5730 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5732 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5733 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5735 * src/BufferView.C (enterView): new func
5736 (leaveView): new func
5738 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5740 (leaveView): new func, undefines xterm cursor when approp.
5742 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5743 (AllowInput): delete the Workarea cursor handling from this func.
5745 * src/Painter.C (underline): draw a slimer underline in most cases.
5747 * src/lyx_main.C (error_handler): use extern "C"
5749 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5751 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5752 sent directly to me.
5754 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5755 to the list by Dekel.
5757 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5760 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5761 methods from lyx_cb.here.
5763 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5766 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5768 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5769 instead of using current_view directly.
5771 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5773 * src/LyXAction.C (init): add the paragraph-spacing command.
5775 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5777 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5779 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5780 different from the documents.
5782 * src/text.C (SetHeightOfRow): take paragraph spacing into
5783 account, paragraph spacing takes precedence over buffer spacing
5784 (GetVisibleRow): ditto
5786 * src/paragraph.C (writeFile): output the spacing parameter too.
5787 (validate): set the correct features if spacing is used in the
5789 (Clear): set spacing to default
5790 (MakeSameLayout): spacing too
5791 (HasSameLayout): spacing too
5792 (SetLayout): spacing too
5793 (TeXOnePar): output the spacing commands
5795 * src/lyxparagraph.h: added a spacing variable for use with
5796 per-paragraph spacing.
5798 * src/Spacing.h: add a Default spacing and a method to check if
5799 the current spacing is default. also added an operator==
5801 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5804 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5806 * src/lyxserver.C (callback): fix dispatch of functions
5808 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5809 printf() into lyxerr call.
5811 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5814 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5815 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5816 the "Float" from each of the subitems.
5817 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5819 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5820 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5821 documented the change so that the workaround can be nuked later.
5823 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5826 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5828 * src/buffer.C (getLatexName): ditto
5829 (setReadonly): ditto
5831 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5833 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5834 avoid some uses of current_view. Added also a bufferParams()
5835 method to get at this.
5837 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5839 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5841 * src/lyxparagraph.[Ch]: removed
5842 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5843 with operators used by lower_bound and
5844 upper_bound in InsetTable's
5845 Make struct InsetTable private again. Used matchpos.
5847 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5849 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5850 document, the language of existing text is changed (unless the
5851 document is multi-lingual)
5853 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5855 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5857 * A lot of files: A rewrite of the Right-to-Left support.
5859 2000-04-10 Juergen Vigna <jug@sad.it>
5861 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5862 misplaced cursor when inset in inset is locked.
5864 * src/insets/insettext.C (LocalDispatch): small fix so that a
5865 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5867 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5868 footnote font should be decreased in size twice when displaying.
5870 * src/insets/insettext.C (GetDrawFont): inserted this function as
5871 the drawing-font may differ from the real paragraph font.
5873 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5874 insets (inset in inset!).
5876 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5877 function here because we don't want footnotes inside footnotes.
5879 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5881 (init): now set the inset_owner in paragraph.C
5882 (LocalDispatch): added some resetPos() in the right position
5885 (pasteSelection): changed to use the new CutAndPaste-Class.
5887 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5888 which tells if it is allowed to insert another inset inside this one.
5890 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5891 SwitchLayoutsBetweenClasses.
5893 * src/text2.C (InsertInset): checking of the new paragraph-function
5895 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5896 is not needed anymore here!
5899 (PasteSelection): redone (also with #ifdef) so that now this uses
5900 the CutAndPaste-Class.
5901 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5904 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5905 from/to text/insets.
5907 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5908 so that the paragraph knows if it is inside an (text)-inset.
5909 (InsertFromMinibuffer): changed return-value to bool as now it
5910 may happen that an inset is not inserted in the paragraph.
5911 (InsertInsetAllowed): this checks if it is allowed to insert an
5912 inset in this paragraph.
5914 (BreakParagraphConservative):
5915 (BreakParagraph) : small change for the above change of the return
5916 value of InsertFromMinibuffer.
5918 * src/lyxparagraph.h: added inset_owner and the functions to handle
5919 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5921 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5923 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5924 functions from BufferView to BufferView::Pimpl to ease maintence.
5926 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5927 correctly. Also use SetCursorIntern instead of SetCursor.
5929 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5932 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5934 * src/WorkArea.C (belowMouse): manually implement below mouse.
5936 * src/*: Add "explicit" on several constructors, I added probably
5937 some unneeded ones. A couple of changes to code because of this.
5939 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5940 implementation and private parts from the users of BufferView. Not
5943 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5944 implementation and private parts from the users of LyXLex. Not
5947 * src/BufferView_pimpl.[Ch]: new files
5949 * src/lyxlex_pimpl.[Ch]: new files
5951 * src/LyXView.[Ch]: some inline functions move out-of-line
5953 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5955 * src/lyxparagraph.h: make struct InsetTable public.
5957 * src/support/lyxstring.h: change lyxstring::difference_type to be
5958 ptrdiff_t. Add std:: modifiers to streams.
5960 * src/font.C: include the <cctype> header, for islower() and
5963 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5965 * src/font.[Ch]: new files. Contains the metric functions for
5966 fonts, takes a LyXFont as parameter. Better separation of concepts.
5968 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5969 changes because of this.
5971 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5973 * src/*: compile with -Winline and move functions that don't
5976 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5979 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5981 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5982 (various files changed because of this)
5984 * src/Painter.C (text): fixed the drawing of smallcaps.
5986 * src/lyxfont.[Ch] (drawText): removed unused member func.
5989 * src/*.C: added needed "using" statements and "std::" qualifiers.
5991 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5993 * src/*.h: removed all use of "using" from header files use
5994 qualifier std:: instead.
5996 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5998 * src/text.C (Backspace): some additional cleanups (we already
5999 know whether cursor.pos is 0 or not).
6001 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6002 automake does not provide one).
6004 * src/bmtable.h: replace C++ comments with C comments.
6006 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6008 * src/screen.C (ShowCursor): Change the shape of the cursor if
6009 the current language is not equal to the language of the document.
6010 (If the cursor change its shape unexpectedly, then you've found a bug)
6012 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6015 * src/insets/insetnumber.[Ch]: New files.
6017 * src/LyXAction.C (init)
6018 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6021 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6023 * src/lyxparagraph.h
6024 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6025 (the vector is kept sorted).
6027 * src/text.C (GetVisibleRow): Draw selection correctly when there
6028 is both LTR and RTL text.
6030 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6031 which is much faster.
6033 * src/text.C (GetVisibleRow and other): Do not draw the last space
6034 in a row if the direction of the last letter is not equal to the
6035 direction of the paragraph.
6037 * src/lyxfont.C (latexWriteStartChanges):
6038 Check that font language is not equal to basefont language.
6039 (latexWriteEndChanges): ditto
6041 * src/lyx_cb.C (StyleReset): Don't change the language while using
6042 the font-default command.
6044 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6045 empty paragraph before a footnote.
6047 * src/insets/insetcommand.C (draw): Increase x correctly.
6049 * src/screen.C (ShowCursor): Change cursor shape if
6050 current language != document language.
6052 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6054 2000-03-31 Juergen Vigna <jug@sad.it>
6056 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6057 (Clone): changed mode how the paragraph-data is copied to the
6058 new clone-paragraph.
6060 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6061 GetInset(pos) with no inset anymore there (in inset UNDO)
6063 * src/insets/insetcommand.C (draw): small fix as here x is
6064 incremented not as much as width() returns (2 before, 2 behind = 4)
6066 2000-03-30 Juergen Vigna <jug@sad.it>
6068 * src/insets/insettext.C (InsetText): small fix in initialize
6069 widthOffset (should not be done in the init() function)
6071 2000-03-29 Amir Karger <karger@lyx.org>
6073 * lib/examples/it_ItemizeBullets.lyx: translation by
6076 * Implemented \textasciitilde and fixed a tiny bug in reLyX
6078 2000-03-29 Juergen Vigna <jug@sad.it>
6080 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
6082 * src/insets/insetfoot.C (Clone): small change as for the below
6083 new init function in the text-inset
6085 * src/insets/insettext.C (init): new function as I've seen that
6086 clone did not copy the Paragraph-Data!
6087 (LocalDispatch): Added code so that now we have some sort of Undo
6088 functionality (well actually we HAVE Undo ;)
6090 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6092 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6094 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6097 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6099 * src/main.C: added a runtime check that verifies that the xforms
6100 header used when building LyX and the library used when running
6101 LyX match. Exit with a message if they don't match. This is a
6102 version number check only.
6104 * src/buffer.C (save): Don't allocate memory on the heap for
6105 struct utimbuf times.
6107 * *: some using changes, use iosfwd instead of the real headers.
6109 * src/lyxfont.C use char const * instead of string for the static
6110 strings. Rewrite some functions to use sstream.
6112 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6114 * src/text.C (Backspace): hopefully fix the dreaded backaspace
6117 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6119 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
6120 of Geodesy (from Martin Vermeer)
6122 * lib/layouts/svjour.inc: include file for the Springer svjour
6123 class. It can be used to support journals other than JoG.
6125 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
6126 Miskiewicz <misiek@pld.org.pl>)
6127 * lib/reLyX/Makefile.am: ditto.
6129 2000-03-27 Juergen Vigna <jug@sad.it>
6131 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
6132 also some modifications with operations on selected text.
6134 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
6135 problems with clicking on insets (last famous words ;)
6137 * src/insets/insetcommand.C (draw):
6138 (width): Changed to have a bit of space before and after the inset so
6139 that the blinking cursor can be seen (otherwise it was hidden)
6141 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6143 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6144 would not be added to the link list when an installed gettext (not
6145 part of libc) is found.
6147 2000-03-24 Juergen Vigna <jug@sad.it>
6149 * src/insets/insetcollapsable.C (Edit):
6150 * src/mathed/formula.C (InsetButtonRelease):
6151 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6154 * src/BufferView.C (workAreaButtonPress):
6155 (workAreaButtonRelease):
6156 (checkInsetHit): Finally fixed the clicking on insets be handled
6159 * src/insets/insetert.C (Edit): inserted this call so that ERT
6160 insets work always with LaTeX-font
6162 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6164 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6165 caused lyx to startup with no GUI in place, causing in a crash
6166 upon startup when called with arguments.
6168 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6170 * src/FontLoader.C: better initialization of dummyXFontStruct.
6172 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6174 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6175 for linuxdoc and docbook import and export format options.
6177 * lib/lyxrc.example Example of default values for the previous flags.
6179 * src/lyx_cb.C Use those flags instead of the hardwired values for
6180 linuxdoc and docbook export.
6182 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6185 * src/menus.C Added menus entries for the new import/exports formats.
6187 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6189 * src/lyxrc.*: Added support for running without Gui
6192 * src/FontLoader.C: sensible defaults if no fonts are needed
6194 * src/lyx_cb.C: New function ShowMessage (writes either to the
6195 minibuffer or cout in case of no gui
6196 New function AskOverwrite for common stuff
6197 Consequently various changes to call these functions
6199 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
6200 wild guess at sensible screen resolution when having no gui
6202 * src/lyxfont.C: no gui, no fonts... set some defaults
6204 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6206 * src/LColor.C: made the command inset background a bit lighter.
6208 2000-03-20 Hartmut Goebel <goebel@noris.net>
6210 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
6211 stdstruct.inc. Koma-Script added some title elements which
6212 otherwise have been listed below "bibliography". This split allows
6213 adding title elements to where they belong.
6215 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
6216 define the additional tilte elements and then include
6219 * many other layout files: changed to include stdtitle.inc just
6220 before stdstruct.inc.
6222 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
6224 * src/buffer.C: (save) Added the option to store all backup files
6225 in a single directory
6227 * src/lyxrc.[Ch]: Added variable \backupdir_path
6229 * lib/lyxrc.example: Added descriptions of recently added variables
6231 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
6232 bibtex inset, not closing the bibtex popup when deleting the inset)
6234 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6236 * src/lyx_cb.C: add a couple using directives.
6238 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6239 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6240 import based on the filename.
6242 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6243 file would be imported at start, if the filename where of a sgml file.
6245 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6247 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6249 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6250 * src/lyxfont.h Replaced the member variable bits.direction by the
6251 member variable lang. Made many changes in other files.
6252 This allows having a multi-lingual document
6254 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6255 that change the current language to <l>.
6256 Removed the command "font-rtl"
6258 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6259 format for Hebrew documents)
6261 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6262 When auto_mathmode is "true", pressing a digit key in normal mode
6263 will cause entering into mathmode.
6264 If auto_mathmode is "rtl" then this behavior will be active only
6265 when writing right-to-left text.
6267 * src/text2.C (InsertStringA) The string is inserted using the
6270 * src/paragraph.C (GetEndLabel) Gives a correct result for
6271 footnote paragraphs.
6273 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6275 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6277 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6278 front of PasteParagraph. Never insert a ' '. This should at least
6279 fix some cause for the segfaults that we have been experiencing,
6280 it also fixes backspace behaviour slightly. (Phu!)
6282 * src/support/lstrings.C (compare_no_case): some change to make it
6283 compile with gcc 2.95.2 and stdlibc++-v3
6285 * src/text2.C (MeltFootnoteEnvironment): change type o
6286 first_footnote_par_is_not_empty to bool.
6288 * src/lyxparagraph.h: make text private. Changes in other files
6290 (fitToSize): new function
6291 (setContentsFromPar): new function
6292 (clearContents): new function
6293 (SetChar): new function
6295 * src/paragraph.C (readSimpleWholeFile): deleted.
6297 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6298 the file, just use a simple string instead. Also read the file in
6299 a more maintainable manner.
6301 * src/text2.C (InsertStringA): deleted.
6302 (InsertStringB): deleted.
6304 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6306 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6307 RedoParagraphs from the doublespace handling part, just set status
6308 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6309 done, but perhaps not like this.)
6311 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6313 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6314 character when inserting an inset.
6316 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6318 * src/bufferparams.C (readLanguage): now takes "default" into
6321 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6322 also initialize the toplevel_keymap with the default bindings from
6325 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6327 * all files using lyxrc: have lyxrc as a real variable and not a
6328 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6331 * src/lyxrc.C: remove double call to defaultKeyBindings
6333 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6334 toolbar defauls using lyxlex. Remove enums, structs, functions
6337 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6338 toolbar defaults. Also store default keybindings in a map.
6340 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6341 storing the toolbar defaults without any xforms dependencies.
6343 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6344 applied. Changed to use iterators.
6346 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6348 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6349 systems that don't have LINGUAS set to begin with.
6351 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6353 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6354 the list by Dekel Tsur.
6356 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6358 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6359 * src/insets/form_graphics.C: ditto.
6361 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6363 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6365 * src/bufferparams.C (readLanguage): use the new language map
6367 * src/intl.C (InitKeyMapper): use the new language map
6369 * src/lyx_gui.C (create_forms): use the new language map
6371 * src/language.[Ch]: New files. Used for holding the information
6372 about each language. Now! Use this new language map enhance it and
6373 make it really usable for our needs.
6375 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6377 * screen.C (ShowCursor): Removed duplicate code.
6378 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6379 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6381 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6384 * src/text.C Added TransformChar method. Used for rendering Arabic
6385 text correctly (change the glyphs of the letter according to the
6386 position in the word)
6391 * src/lyxrc.C Added lyxrc command {language_command_begin,
6392 language_command_end,language_command_ltr,language_command_rtl,
6393 language_package} which allows the use of either arabtex or Omega
6396 * src/lyx_gui.C (init)
6398 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6399 to use encoding for menu fonts which is different than the encoding
6402 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6403 do not load the babel package.
6404 To write an English document with Hebrew/Arabic, change the document
6405 language to "english".
6407 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6408 (alphaCounter): changed to return char
6409 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6411 * lib/lyxrc.example Added examples for Hebrew/Arabic
6414 * src/layout.C Added layout command endlabeltype
6416 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6418 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6420 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6422 * src/mathed/math_delim.C (search_deco): return a
6423 math_deco_struct* instead of index.
6425 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6427 * All files with a USE_OSTREAM_ONLY within: removed all code that
6428 was unused when USE_OSTREAM_ONLY is defined.
6430 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6431 of any less. Removed header and using.
6433 * src/text.C (GetVisibleRow): draw the string "Page Break
6434 (top/bottom)" on screen when drawing a pagebreak line.
6436 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6438 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6440 * src/mathed/math_macro.C (draw): do some cast magic.
6443 * src/mathed/math_defs.h: change byte* argument to byte const*.
6445 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6447 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6448 know it is right to return InsetFoot* too, but cxx does not like
6451 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6453 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6455 * src/mathed/math_delim.C: change == to proper assignment.
6457 2000-03-09 Juergen Vigna <jug@sad.it>
6459 * src/insets/insettext.C (setPos): fixed various cursor positioning
6460 problems (via mouse and cursor-keys)
6461 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6462 inset (still a small display problem but it works ;)
6464 * src/insets/insetcollapsable.C (draw): added button_top_y and
6465 button_bottom_y to have correct values for clicking on the inset.
6467 * src/support/lyxalgo.h: commented out 'using std::less'
6469 2000-03-08 Juergen Vigna <jug@sad.it>
6471 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6472 Button-Release event closes as it is alos the Release-Event
6475 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6477 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6479 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6480 can add multiple spaces in Scrap (literate programming) styles...
6481 which, by the way, is how I got hooked on LyX to begin with.
6483 * src/mathed/formula.C (Write): Added dummy variable to an
6484 inset::Latex() call.
6485 (Latex): Add free_spacing boolean to inset::Latex()
6487 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6489 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6490 virtual function to include the free_spacing boolean from
6491 the containing paragraph's style.
6493 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6494 Added free_spacing boolean arg to match inset.h
6496 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6497 Added free_spacing boolean arg to match inset.h
6499 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6500 Added free_spacing boolean and made sure that if in a free_spacing
6501 paragraph, that we output normal space if there is a protected space.
6503 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6504 Added free_spacing boolean arg to match inset.h
6506 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6507 Added free_spacing boolean arg to match inset.h
6509 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6510 Added free_spacing boolean arg to match inset.h
6512 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6513 Added free_spacing boolean arg to match inset.h
6515 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6516 Added free_spacing boolean arg to match inset.h
6518 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6519 free_spacing boolean arg to match inset.h
6521 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6522 Added free_spacing boolean arg to match inset.h
6524 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6525 Added free_spacing boolean arg to match inset.h
6527 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6528 Added free_spacing boolean arg to match inset.h
6530 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6531 Added free_spacing boolean arg to match inset.h
6533 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6534 Added free_spacing boolean arg to match inset.h
6536 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6537 free_spacing boolean arg to match inset.h
6539 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6540 free_spacing boolean arg to match inset.h
6542 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6543 ignore free_spacing paragraphs. The user's spaces are left
6546 * src/text.C (InsertChar): Fixed the free_spacing layout
6547 attribute behavior. Now, if free_spacing is set, you can
6548 add multiple spaces in a paragraph with impunity (and they
6549 get output verbatim).
6550 (SelectSelectedWord): Added dummy argument to inset::Latex()
6553 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6556 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6557 paragraph layouts now only input a simple space instead.
6558 Special character insets don't make any sense in free-spacing
6561 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6562 hard-spaces in the *input* file to simple spaces if the layout
6563 is free-spacing. This converts old files which had to have
6564 hard-spaces in free-spacing layouts where a simple space was
6566 (writeFileAscii): Added free_spacing check to pass to the newly
6567 reworked inset::Latex(...) methods. The inset::Latex() code
6568 ensures that hard-spaces in free-spacing paragraphs get output
6569 as spaces (rather than "~").
6571 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6573 * src/mathed/math_delim.C (draw): draw the empty placeholder
6574 delims with a onoffdash line.
6575 (struct math_deco_compare): struct that holds the "functors" used
6576 for the sort and the binary search in math_deco_table.
6577 (class init_deco_table): class used for initial sort of the
6579 (search_deco): use lower_bound to do a binary search in the
6582 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6584 * src/lyxrc.C: a small secret thingie...
6586 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6587 and to not flush the stream as often as it used to.
6589 * src/support/lyxalgo.h: new file
6590 (sorted): template function used for checking if a sequence is
6591 sorted or not. Two versions with and without user supplied
6592 compare. Uses same compare as std::sort.
6594 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6595 it and give warning on lyxerr.
6597 (struct compare_tags): struct with function operators used for
6598 checking if sorted, sorting and lower_bound.
6599 (search_kw): use lower_bound instead of manually implemented
6602 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6604 * src/insets/insetcollapsable.h: fix Clone() declaration.
6605 * src/insets/insetfoot.h: ditto.
6607 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6609 2000-03-08 Juergen Vigna <jug@sad.it>
6611 * src/insets/lyxinset.h: added owner call which tells us if
6612 this inset is inside another inset. Changed also the return-type
6613 of Editable to an enum so it tells clearer what the return-value is.
6615 * src/insets/insettext.C (computeTextRows): fixed computing of
6616 textinsets which split automatically on more rows.
6618 * src/insets/insetert.[Ch]: changed this to be of BaseType
6621 * src/insets/insetfoot.[Ch]: added footnote inset
6623 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6624 collapsable insets (like footnote, ert, ...)
6626 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6628 * src/lyxdraw.h: remvoe file
6630 * src/lyxdraw.C: remove file
6632 * src/insets/insettext.C: added <algorithm>.
6634 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6636 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6637 (matrix_cb): case MM_OK use string stream
6639 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6642 * src/mathed/math_macro.C (draw): use string stream
6643 (Metrics): use string stream
6645 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6646 directly to the ostream.
6648 * src/vspace.C (asString): use string stream.
6649 (asString): use string stream
6650 (asLatexString): use string stream
6652 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6653 setting Spacing::Other.
6655 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6656 sprintf when creating the stretch vale.
6658 * src/text2.C (alphaCounter): changed to return a string and to
6659 not use a static variable internally. Also fixed a one-off bug.
6660 (SetCounter): changed the drawing of the labels to use string
6661 streams instead of sprintf.
6663 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6664 manipulator to use a scheme that does not require library support.
6665 This is also the way it is done in the new GNU libstdc++. Should
6666 work with DEC cxx now.
6668 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6670 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6671 end. This fixes a bug.
6673 * src/mathed (all files concerned with file writing): apply the
6674 USE_OSTREAM_ONLY changes to mathed too.
6676 * src/support/DebugStream.h: make the constructor explicit.
6678 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6679 count and ostream squashed.
6681 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6683 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6685 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6686 ostringstream uses STL strings, and we might not.
6688 * src/insets/insetspecialchar.C: add using directive.
6689 * src/insets/insettext.C: ditto.
6691 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6693 * lib/layouts/seminar.layout: feeble attempt at a layout for
6694 seminar.cls, far from completet and could really use some looking
6695 at from people used to write layout files.
6697 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6698 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6699 a lot nicer and works nicely with ostreams.
6701 * src/mathed/formula.C (draw): a slightly different solution that
6702 the one posted to the list, but I think this one works too. (font
6703 size wrong in headers.)
6705 * src/insets/insettext.C (computeTextRows): some fiddling on
6706 Jürgens turf, added some comments that he should read.
6708 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6709 used and it gave compiler warnings.
6710 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6713 * src/lyx_gui.C (create_forms): do the right thing when
6714 show_banner is true/false.
6716 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6717 show_banner is false.
6719 * most file writing files: Now use iostreams to do almost all of
6720 the writing. Also instead of passing string &, we now use
6721 stringstreams. mathed output is still not adapted to iostreams.
6722 This change can be turned off by commenting out all the occurences
6723 of the "#define USE_OSTREAM_ONLY 1" lines.
6725 * src/WorkArea.C (createPixmap): don't output debug messages.
6726 (WorkArea): don't output debug messages.
6728 * lib/lyxrc.example: added a comment about the new variable
6731 * development/Code_rules/Rules: Added some more commente about how
6732 to build class interfaces and on how better encapsulation can be
6735 2000-03-03 Juergen Vigna <jug@sad.it>
6737 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6738 automatically with the width of the LyX-Window
6740 * src/insets/insettext.C (computeTextRows): fixed update bug in
6741 displaying text-insets (scrollvalues where not initialized!)
6743 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6745 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6746 id in the check of the result from lower_bound is not enough since
6747 lower_bound can return last too, and then res->id will not be a
6750 * all insets and some code that use them: I have conditionalized
6751 removed the Latex(string & out, ...) this means that only the
6752 Latex(ostream &, ...) will be used. This is a work in progress to
6753 move towards using streams for all output of files.
6755 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6758 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6760 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6761 routine (this fixes bug where greek letters were surrounded by too
6764 * src/support/filetools.C (findtexfile): change a bit the search
6765 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6766 no longer passed to kpsewhich, we may have to change that later.
6768 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6769 warning options to avoid problems with X header files (from Angus
6771 * acinclude.m4: regenerated.
6773 2000-03-02 Juergen Vigna <jug@sad.it>
6775 * src/insets/insettext.C (WriteParagraphData): Using the
6776 par->writeFile() function for writing paragraph-data.
6777 (Read): Using buffer->parseSingleLyXformat2Token()-function
6778 for parsing paragraph data!
6780 * src/buffer.C (readLyXformat2): removed all parse data and using
6781 the new parseSingleLyXformat2Token()-function.
6782 (parseSingleLyXformat2Token): added this function to parse (read)
6783 lyx-file-format (this is called also from text-insets now!)
6785 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6787 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6790 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6791 directly instead of going through a func. One very bad thing: a
6792 static LyXFindReplace, but I don't know where to place it.
6794 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6795 string instead of char[]. Also changed to static.
6796 (GetSelectionOrWordAtCursor): changed to static inline
6797 (SetSelectionOverLenChars): ditto.
6799 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6800 current_view and global variables. both classes has changed names
6801 and LyXFindReplace is not inherited from SearchForm.
6803 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6804 fl_form_search form.
6806 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6808 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6810 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6811 bound (from Kayvan).
6813 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6815 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6817 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6819 * some things that I should comment but the local pub says head to
6822 * comment out all code that belongs to the Roff code for Ascii
6823 export of tables. (this is unused)
6825 * src/LyXView.C: use correct type for global variable
6826 current_layout. (LyXTextClass::size_type)
6828 * some code to get the new insetgraphics closer to working I'd be
6829 grateful for any help.
6831 * src/BufferView2.C (insertInset): use the return type of
6832 NumberOfLayout properly. (also changes in other files)
6834 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6835 this as a test. I want to know what breaks because of this.
6837 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6839 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6841 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6842 to use a \makebox in the label, this allows proper justification
6843 with out using protected spaces or multiple hfills. Now it is
6844 "label" for left justified, "\hfill label\hfill" for center, and
6845 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6846 should be changed accordingly.
6848 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6850 * src/lyxtext.h: change SetLayout() to take a
6851 LyXTextClass::size_type instead of a char (when there is more than
6852 127 layouts in a class); also change type of copylayouttype.
6853 * src/text2.C (SetLayout): ditto.
6854 * src/LyXView.C (updateLayoutChoice): ditto.
6856 * src/LaTeX.C (scanLogFile): errors where the line number was not
6857 given just after the '!'-line were ignored (from Dekel Tsur).
6859 * lib/lyxrc.example: fix description of \date_insert_format
6861 * lib/layouts/llncs.layout: new layout, contributed by Martin
6864 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6866 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6867 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6868 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6869 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6870 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6871 paragraph.C, text.C, text2.C)
6873 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6875 * src/insets/insettext.C (LocalDispatch): remove extra break
6878 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6879 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6881 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6882 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6884 * src/insets/insetbib.h: move InsetBibkey::Holder and
6885 InsetCitation::Holder in public space.
6887 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6889 * src/insets/insettext.h: small change to get the new files from
6890 Juergen to compile (use "string", not "class string").
6892 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6893 const & as parameter to LocalDispatch, use LyXFont const & as
6894 paramter to some other func. This also had impacto on lyxinsets.h
6895 and the two mathed insets.
6897 2000-02-24 Juergen Vigna <jug@sad.it>
6900 * src/commandtags.h:
6902 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6906 * src/BufferView2.C: added/updated code for various inset-functions
6908 * src/insets/insetert.[Ch]: added implementation of InsetERT
6910 * src/insets/insettext.[Ch]: added implementation of InsetText
6912 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6913 (draw): added preliminary code for inset scrolling not finshed yet
6915 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6916 as it is in lyxfunc.C now
6918 * src/insets/lyxinset.h: Added functions for text-insets
6920 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6922 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6923 BufferView and reimplement the list as a queue put inside its own
6926 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6928 * several files: use the new interface to the "updateinsetlist"
6930 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6932 (work_area_handler): call BufferView::trippleClick on trippleclick.
6934 * src/BufferView.C (doubleClick): new function, selects word on
6936 (trippleClick): new function, selects line on trippleclick.
6938 2000-02-22 Allan Rae <rae@lyx.org>
6940 * lib/bind/xemacs.bind: buffer-previous not supported
6942 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6944 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6947 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6949 * src/bufferlist.C: get rid of current_view from this file
6951 * src/spellchecker.C: get rid of current_view from this file
6953 * src/vspace.C: get rid of current_view from this file
6954 (inPixels): added BufferView parameter for this func
6955 (asLatexCommand): added a BufferParams for this func
6957 * src/text.C src/text2.C: get rid of current_view from these
6960 * src/lyxfont.C (getFontDirection): move this function here from
6963 * src/bufferparams.C (getDocumentDirection): move this function
6966 * src/paragraph.C (getParDirection): move this function here from
6968 (getLetterDirection): ditto
6970 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6972 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6973 resize due to wrong pixmap beeing used. Also took the opurtunity
6974 to make the LyXScreen stateless on regard to WorkArea and some
6975 general cleanup in the same files.
6977 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6979 * src/Makefile.am: add missing direction.h
6981 * src/PainterBase.h: made the width functions const.
6983 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6986 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6988 * src/insets/insetlatexaccent.C (draw): make the accents draw
6989 better, at present this will only work well with iso8859-1.
6991 * several files: remove the old drawing code, now we use the new
6994 * several files: remove support for mono_video, reverse_video and
6997 2000-02-17 Juergen Vigna <jug@sad.it>
6999 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7000 int ** as we have to return the pointer, otherwise we have only
7001 NULL pointers in the returning function.
7003 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7005 * src/LaTeX.C (operator()): quote file name when running latex.
7007 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7009 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7010 (bubble tip), this removes our special handling of this.
7012 * Remove all code that is unused now that we have the new
7013 workarea. (Code that are not active when NEW_WA is defined.)
7015 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7017 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7019 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7020 nonexisting layout; correctly redirect obsoleted layouts.
7022 * lib/lyxrc.example: document \view_dvi_paper_option
7024 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7027 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7028 (PreviewDVI): handle the view_dvi_paper_option variable.
7029 [Both from Roland Krause]
7031 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7033 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7034 char const *, int, LyXFont)
7035 (text(int, int, string, LyXFont)): ditto
7037 * src/text.C (InsertCharInTable): attempt to fix the double-space
7038 feature in tables too.
7039 (BackspaceInTable): ditto.
7040 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7042 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7044 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7046 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7047 newly found text in textcache to this.
7048 (buffer): set the owner of the text put into the textcache to 0
7050 * src/insets/figinset.C (draw): fixed the drawing of figures with
7053 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7054 drawing of mathframe, hfills, protected space, table lines. I have
7055 now no outstanding drawing problems with the new Painter code.
7057 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7059 * src/PainterBase.C (ellipse, circle): do not specify the default
7062 * src/LColor.h: add using directive.
7064 * src/Painter.[Ch]: change return type of methods from Painter& to
7065 PainterBase&. Add a using directive.
7067 * src/WorkArea.C: wrap xforms callbacks in C functions
7070 * lib/layouts/foils.layout: font fix and simplifications from Carl
7073 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7075 * a lot of files: The Painter, LColor and WorkArea from the old
7076 devel branch has been ported to lyx-devel. Some new files and a
7077 lot of #ifdeffed code. The new workarea is enabled by default, but
7078 if you want to test the new Painter and LColor you have to compile
7079 with USE_PAINTER defined (do this in config.h f.ex.) There are
7080 still some rought edges, and I'd like some help to clear those
7081 out. It looks stable (loads and displays the Userguide very well).
7084 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7086 * src/buffer.C (pop_tag): revert to the previous implementation
7087 (use a global variable for both loops).
7089 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7091 * src/lyxrc.C (LyXRC): change slightly default date format.
7093 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7094 there is an English text with a footnote that starts with a Hebrew
7095 paragraph, or vice versa.
7096 (TeXFootnote): ditto.
7098 * src/text.C (LeftMargin): allow for negative values for
7099 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7102 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7103 for input encoding (cyrillic)
7105 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7107 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7110 * src/toolbar.C (set): ditto
7111 * src/insets/insetbib.C (create_form_citation_form): ditto
7113 * lib/CREDITS: added Dekel Tsur.
7115 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
7116 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
7117 hebrew supports files from Dekel Tsur.
7119 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
7120 <tzafrir@technion.ac.il>
7122 * src/lyxrc.C: put \date_insert_format at the right place.
7124 * src/buffer.C (makeLaTeXFile): fix the handling of
7125 BufferParams::sides when writing out latex files.
7127 * src/BufferView2.C: add a "using" directive.
7129 * src/support/lyxsum.C (sum): when we use lyxstring,
7130 ostringstream::str needs an additional .c_str().
7132 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7134 * src/support/filetools.C (ChangeExtension): patch from Etienne
7137 * src/TextCache.C (show): remove const_cast and make second
7138 parameter non-const LyXText *.
7140 * src/TextCache.h: use non const LyXText in show.
7142 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7145 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7147 * src/support/lyxsum.C: rework to be more flexible.
7149 * several places: don't check if a pointer is 0 if you are going
7152 * src/text.C: remove some dead code.
7154 * src/insets/figinset.C: remove some dead code
7156 * src/buffer.C: move the BufferView funcs to BufferView2.C
7157 remove all support for insetlatexdel
7158 remove support for oldpapersize stuff
7159 made some member funcs const
7161 * src/kbmap.C: use a std::list to store the bindings in.
7163 * src/BufferView2.C: new file
7165 * src/kbsequence.[Ch]: new files
7167 * src/LyXAction.C + others: remove all trace of buffer-previous
7169 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7170 only have one copy in the binary of this table.
7172 * hebrew patch: moved some functions from LyXText to more
7173 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7175 * several files: remove support for XForms older than 0.88
7177 remove some #if 0 #endif code
7179 * src/TextCache.[Ch]: new file. Holds the textcache.
7181 * src/BufferView.C: changes to use the new TextCache interface.
7182 (waitForX): remove the now unused code.
7184 * src/BackStack.h: remove some commented code
7186 * lib/bind/emacs.bind: remove binding for buffer-previous
7188 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7190 * applied the hebrew patch.
7192 * src/lyxrow.h: make sure that all Row variables are initialized.
7194 * src/text2.C (TextHandleUndo): comment out a delete, this might
7195 introduce a memory leak, but should also help us to not try to
7196 read freed memory. We need to look at this one.
7198 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
7199 (LyXParagraph): initalize footnotekind.
7201 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
7202 forgot this when applying the patch. Please heed the warnings.
7204 * src/BufferView.C (buffer): a fix for the buffer-reload problem
7205 (aka. reformat problem)
7207 * src/bufferlist.C (exists): made const, and use const_iterator
7208 (isLoaded): new func.
7209 (release): use std::find to find the correct buffer.
7211 * src/bufferlist.h: made getState a const func.
7212 made empty a const func.
7213 made exists a const func.
7216 2000-02-01 Juergen Vigna <jug@sad.it>
7218 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
7220 * po/it.po: updated a bit the italian po file and also changed the
7221 'file nuovo' for newfile to 'filenuovo' without a space, this did
7224 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
7225 for the new insert_date command.
7227 * src/lyxfunc.C (Dispatch): added support for a insert_date function
7228 from jdblair, to insert a date into the current text conforming to
7229 a strftime format (for now only considering the locale-set and not
7230 the document-language).
7232 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7234 * src/lyxfont.C (textWidth): hopefully better fix for the Array
7235 Bounds Read error seen by purify. The problem was that islower is
7236 a macros which takes an unsigned char and uses it as an index for
7237 in array of characters properties (and is thus subject to the
7241 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7242 correctly the paper sides radio buttons.
7243 (UpdateDocumentButtons): ditto.
7245 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7247 * src/kbmap.C (getsym + others): change to return unsigned int,
7248 returning a long can give problems on 64 bit systems. (I assume
7249 that int is 32bit on 64bit systems)
7251 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7253 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7254 LyXLookupString to be zero-terminated. Really fixes problems seen
7257 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7259 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7260 write a (char*)0 to the lyxerr stream.
7262 * src/lastfiles.C: move algorithm before the using statemets.
7264 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7266 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7267 complains otherwise).
7268 * src/table.C: ditto
7270 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7273 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7274 that I removed earlier... It is really needed.
7276 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7278 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7280 * INSTALL: update xforms home page URL.
7282 * lib/configure.m4: fix a bug with unreadable layout files.
7284 * src/table.C (calculate_width_of_column): add "using std::max"
7287 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7289 * several files: marked several lines with "DEL LINE", this is
7290 lines that can be deleted without changing anything.
7291 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7292 checks this anyway */
7295 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7297 * src/DepTable.C (update): add a "+" at the end when the checksum
7298 is different. (debugging string only)
7300 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7301 the next inset to not be displayed. This should also fix the list
7302 of labels in the "Insert Crossreference" dialog.
7304 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7306 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7307 when regex was not found.
7309 * src/support/lstrings.C (lowercase): use handcoded transform always.
7312 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7313 old_cursor.par->prev could be 0.
7315 * several files: changed post inc/dec to pre inc/dec
7317 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7318 write the lastfiles to file.
7320 * src/BufferView.C (buffer): only show TextCache info when debugging
7322 (resizeCurrentBuffer): ditto
7323 (workAreaExpose): ditto
7325 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7327 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7329 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7330 a bit better by removing the special case for \i and \j.
7332 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7334 * src/lyx_main.C (easyParse): remove test for bad comand line
7335 options, since this broke all xforms-related parsing.
7337 * src/kbmap.C (getsym): set return type to unsigned long, as
7338 declared in header. On an alpha, long is _not_ the same as int.
7340 * src/support/LOstream.h: add a "using std::flush;"
7342 * src/insets/figinset.C: ditto.
7344 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7346 * src/bufferlist.C (write): use blinding fast file copy instead of
7347 "a char at a time", now we are doing it the C++ way.
7349 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7350 std::list<int> instead.
7351 (addpidwait): reflect move to std::list<int>
7352 (sigchldchecker): ditto
7354 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7357 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7358 that obviously was wrong...
7360 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7361 c, this avoids warnings with purify and islower.
7363 * src/insets/figinset.C: rename struct queue to struct
7364 queue_element and rewrite to use a std::queue. gsqueue is now a
7365 std::queue<queue_element>
7366 (runqueue): reflect move to std::queue
7369 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7370 we would get "1" "0" instead of "true" "false. Also make the tostr
7373 2000-01-21 Juergen Vigna <jug@sad.it>
7375 * src/buffer.C (writeFileAscii): Disabled code for special groff
7376 handling of tabulars till I fix this in table.C
7378 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7380 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7382 * src/support/lyxlib.h: ditto.
7384 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7386 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7387 and 'j' look better. This might fix the "macron" bug that has been
7390 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7391 functions as one template function. Delete the old versions.
7393 * src/support/lyxsum.C: move using std::ifstream inside
7396 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7399 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7401 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7403 * src/insets/figinset.C (InitFigures): use new instead of malloc
7404 to allocate memory for figures and bitmaps.
7405 (DoneFigures): use delete[] instead of free to deallocate memory
7406 for figures and bitmaps.
7407 (runqueue): use new to allocate
7408 (getfigdata): use new/delete[] instead of malloc/free
7409 (RegisterFigure): ditto
7411 * some files: moved some declarations closer to first use, small
7412 whitespace changes use preincrement instead of postincrement where
7413 it does not make a difference.
7415 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7416 step on the way to use stl::containers for key maps.
7418 * src/bufferlist.h: add a typedef for const_iterator and const
7419 versions of begin and end.
7421 * src/bufferlist.[Ch]: change name of member variable _state to
7422 state_. (avoid reserved names)
7424 (getFileNames): returns the filenames of the buffers in a vector.
7426 * configure.in (ALL_LINGUAS): added ro
7428 * src/support/putenv.C: new file
7430 * src/support/mkdir.C: new file
7432 2000-01-20 Allan Rae <rae@lyx.org>
7434 * lib/layouts/IEEEtran.layout: Added several theorem environments
7436 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7437 couple of minor additions.
7439 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7440 (except for those in footnotes of course)
7442 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7444 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7446 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7447 std::sort and std::lower_bound instead of qsort and handwritten
7449 (struct compara): struct that holds the functors used by std::sort
7450 and std::lower_bound in MathedLookupBOP.
7452 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7454 * src/support/LAssert.h: do not do partial specialization. We do
7457 * src/support/lyxlib.h: note that lyx::getUserName() and
7458 lyx::date() are not in use right now. Should these be suppressed?
7460 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7461 (makeLinuxDocFile): do not put date and user name in linuxdoc
7464 * src/support/lyxlib.h (kill): change first argument to long int,
7465 since that's what solaris uses.
7467 * src/support/kill.C (kill): fix declaration to match prototype.
7469 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7470 actually check whether namespaces are supported. This is not what
7473 * src/support/lyxsum.C: add a using directive.
7475 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7477 * src/support/kill.C: if we have namespace support we don't have
7478 to include lyxlib.h.
7480 * src/support/lyxlib.h: use namespace lyx if supported.
7482 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7484 * src/support/date.C: new file
7486 * src/support/chdir.C: new file
7488 * src/support/getUserName.C: new file
7490 * src/support/getcwd.C: new file
7492 * src/support/abort.C: new file
7494 * src/support/kill.C: new file
7496 * src/support/lyxlib.h: moved all the functions in this file
7497 insede struct lyx. Added also kill and abort to this struct. This
7498 is a way to avoid the "kill is not defined in <csignal>", we make
7499 C++ wrappers for functions that are not ANSI C or ANSI C++.
7501 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7502 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7503 lyx it has been renamed to sum.
7505 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7507 * src/text.C: add using directives for std::min and std::max.
7509 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7511 * src/texrow.C (getIdFromRow): actually return something useful in
7512 id and pos. Hopefully fixes the bug with positionning of errorbox
7515 * src/lyx_main.C (easyParse): output an error and exit if an
7516 incorrect command line option has been given.
7518 * src/spellchecker.C (ispell_check_word): document a memory leak.
7520 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7521 where a "struct utimbuf" is allocated with "new" and deleted with
7524 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7526 * src/text2.C (CutSelection): don't delete double spaces.
7527 (PasteSelection): ditto
7528 (CopySelection): ditto
7530 * src/text.C (Backspace): don't delete double spaces.
7532 * src/lyxlex.C (next): fix a bug that were only present with
7533 conformant std::istream::get to read comment lines, use
7534 std::istream::getline instead. This seems to fix the problem.
7536 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7538 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7539 allowed to insert space before space" editing problem. Please read
7540 commends at the beginning of the function. Comments about usage
7543 * src/text.C (InsertChar): fix for the "not allowed to insert
7544 space before space" editing problem.
7546 * src/text2.C (DeleteEmptyParagraphMechanism): when
7547 IsEmptyTableRow can only return false this last "else if" will
7548 always be a no-op. Commented out.
7550 * src/text.C (RedoParagraph): As far as I can understand tmp
7551 cursor is not really needed.
7553 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7554 present it could only return false anyway.
7555 (several functions): Did something not so smart...added a const
7556 specifier on a lot of methods.
7558 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7559 and add a tmp->text.resize. The LyXParagraph constructor does the
7561 (BreakParagraphConservative): ditto
7563 * src/support/path.h (Path): add a define so that the wrong usage
7564 "Path("/tmp") will be flagged as a compilation error:
7565 "`unnamed_Path' undeclared (first use this function)"
7567 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7569 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7570 which was bogus for several reasons.
7572 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7576 * autogen.sh: do not use "type -path" (what's that anyway?).
7578 * src/support/filetools.C (findtexfile): remove extraneous space
7579 which caused a kpsewhich warning (at least with kpathsea version
7582 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7584 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7586 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7588 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7590 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7592 * src/paragraph.C (BreakParagraph): do not reserve space on text
7593 if we don't need to (otherwise, if pos_end < pos, we end up
7594 reserving huge amounts of memory due to bad unsigned karma).
7595 (BreakParagraphConservative): ditto, although I have not seen
7596 evidence the bug can happen here.
7598 * src/lyxparagraph.h: add a using std::list.
7600 2000-01-11 Juergen Vigna <jug@sad.it>
7602 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7605 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7607 * src/vc-backend.C (doVCCommand): change to be static and take one
7608 more parameter: the path to chdir too be fore executing the command.
7609 (retrive): new function equiv to "co -r"
7611 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7612 file_not_found_hook is true.
7614 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7616 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7617 if a file is readwrite,readonly...anything else.
7619 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7621 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7622 (CreatePostscript): name change from MenuRunDVIPS (or something)
7623 (PreviewPostscript): name change from MenuPreviewPS
7624 (PreviewDVI): name change from MenuPreviewDVI
7626 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7627 \view_pdf_command., \pdf_to_ps_command
7629 * lib/configure.m4: added search for PDF viewer, and search for
7630 PDF to PS converter.
7631 (lyxrc.defaults output): add \pdflatex_command,
7632 \view_pdf_command and \pdf_to_ps_command.
7634 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7636 * src/bufferlist.C (write): we don't use blocksize for anything so
7639 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7641 * src/support/block.h: disable operator T* (), since it causes
7642 problems with both compilers I tried. See comments in the file.
7644 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7647 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7648 variable LYX_DIR_10x to LYX_DIR_11x.
7650 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7652 * INSTALL: document --with-lyxname.
7655 * configure.in: new configure flag --with-lyxname which allows to
7656 choose the name under which lyx is installed. Default is "lyx", of
7657 course. It used to be possible to do this with --program-suffix,
7658 but the later has in fact a different meaning for autoconf.
7660 * src/support/lstrings.h (lstrchr): reformat a bit.
7662 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7663 * src/mathed/math_defs.h: ditto.
7665 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7667 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7668 true, decides if we create a backup file or not when saving. New
7669 tag and variable \pdf_mode, defaults to false. New tag and
7670 variable \pdflatex_command, defaults to pdflatex. New tag and
7671 variable \view_pdf_command, defaults to xpdf. New tag and variable
7672 \pdf_to_ps_command, defaults to pdf2ps.
7674 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7676 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7677 does not have a BufferView.
7678 (unlockInset): ditto + don't access the_locking_inset if the
7679 buffer does not have a BufferView.
7681 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7682 certain circumstances so that we don't continue a keyboard
7683 operation long after the key was released. Try f.ex. to load a
7684 large document, press PageDown for some seconds and then release
7685 it. Before this change the document would contine to scroll for
7686 some time, with this change it stops imidiatly.
7688 * src/support/block.h: don't allocate more space than needed. As
7689 long as we don't try to write to the arr[x] in a array_type arr[x]
7690 it is perfectly ok. (if you write to it you might segfault).
7691 added operator value_type*() so that is possible to pass the array
7692 to functions expecting a C-pointer.
7694 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7697 * intl/*: updated to gettext 0.10.35, tried to add our own
7698 required modifications. Please verify.
7700 * po/*: updated to gettext 0.10.35, tried to add our own required
7701 modifications. Please verify.
7703 * src/support/lstrings.C (tostr): go at fixing the problem with
7704 cxx and stringstream. When stringstream is used return
7705 oss.str().c_str() so that problems with lyxstring and basic_string
7706 are avoided. Note that the best solution would be for cxx to use
7707 basic_string all the way, but it is not conformant yet. (it seems)
7709 * src/lyx_cb.C + other files: moved several global functions to
7710 class BufferView, some have been moved to BufferView.[Ch] others
7711 are still located in lyx_cb.C. Code changes because of this. (part
7712 of "get rid of current_view project".)
7714 * src/buffer.C + other files: moved several Buffer functions to
7715 class BufferView, the functions are still present in buffer.C.
7716 Code changes because of this.
7718 * config/lcmessage.m4: updated to most recent. used when creating
7721 * config/progtest.m4: updated to most recent. used when creating
7724 * config/gettext.m4: updated to most recent. applied patch for
7727 * config/gettext.m4.patch: new file that shows what changes we
7728 have done to the local copy of gettext.m4.
7730 * config/libtool.m4: new file, used in creation of acinclude.m4
7732 * config/lyxinclude.m4: new file, this is the lyx created m4
7733 macros, used in making acinclude.m4.
7735 * autogen.sh: GNU m4 discovered as a separate task not as part of
7736 the lib/configure creation.
7737 Generate acinlucde from files in config. Actually cat
7738 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7739 easier to upgrade .m4 files that really are external.
7741 * src/Spacing.h: moved using std::istringstream to right after
7742 <sstream>. This should fix the problem seen with some compilers.
7744 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7746 * src/lyx_cb.C: began some work to remove the dependency a lot of
7747 functions have on BufferView::text, even if not really needed.
7748 (GetCurrentTextClass): removed this func, it only hid the
7751 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7752 forgot this in last commit.
7754 * src/Bullet.C (bulletEntry): use static char const *[] for the
7755 tables, becuase of this the return arg had to change to string.
7757 (~Bullet): removed unneeded destructor
7759 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7760 (insetSleep): moved from Buffer
7761 (insetWakeup): moved from Buffer
7762 (insetUnlock): moved from Buffer
7764 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7765 from Buffer to BufferView.
7767 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7769 * config/ltmain.sh: updated to version 1.3.4 of libtool
7771 * config/ltconfig: updated to version 1.3.4 of libtool
7773 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7776 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7777 Did I get that right?
7779 * src/lyxlex.h: add a "using" directive or two.
7780 * src/Spacing.h: ditto.
7781 * src/insets/figinset.C: ditto.
7782 * src/support/filetools.C: ditto.
7783 * src/support/lstrings.C: ditto.
7784 * src/BufferView.C: ditto.
7785 * src/bufferlist.C: ditto.
7786 * src/lyx_cb.C: ditto.
7787 * src/lyxlex.C: ditto.
7789 * NEWS: add some changes for 1.1.4.
7791 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7793 * src/BufferView.C: first go at a TextCache to speed up switching
7796 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7798 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7799 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7800 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7801 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7804 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7805 members of the struct are correctly initialized to 0 (detected by
7807 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7808 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7810 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7811 pidwait, since it was allocated with "new". This was potentially
7812 very bad. Thanks to Michael Schmitt for running purify for us.
7815 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7817 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7819 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7821 1999-12-30 Allan Rae <rae@lyx.org>
7823 * lib/templates/IEEEtran.lyx: minor change
7825 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7826 src/mathed/formula.C (LocalDispatch): askForText changes
7828 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7829 know when a user has cancelled input. Fixes annoying problems with
7830 inserting labels and version control.
7832 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7834 * src/support/lstrings.C (tostr): rewritten to use strstream and
7837 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7839 * src/support/filetools.C (IsFileWriteable): use fstream to check
7840 (IsDirWriteable): use fileinfo to check
7842 * src/support/filetools.h (FilePtr): whole class deleted
7844 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7846 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7848 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7850 * src/bufferlist.C (write): use ifstream and ofstream instead of
7853 * src/Spacing.h: use istrstream instead of sscanf
7855 * src/mathed/math_defs.h: change first arg to istream from FILE*
7857 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7859 * src/mathed/math_parser.C: have yyis to be an istream
7860 (LexGetArg): use istream (yyis)
7862 (mathed_parse): ditto
7863 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7865 * src/mathed/formula.C (Read): rewritten to use istream
7867 * src/mathed/formulamacro.C (Read): rewritten to use istream
7869 * src/lyxlex.h (~LyXLex): deleted desturctor
7870 (getStream): new function, returns an istream
7871 (getFile): deleted funtion
7872 (IsOK): return is.good();
7874 * src/lyxlex.C (LyXLex): delete file and owns_file
7875 (setFile): open an filebuf and assign that to a istream instead of
7877 (setStream): new function, takes an istream as arg.
7878 (setFile): deleted function
7879 (EatLine): rewritten us use istream instead of FILE*
7883 * src/table.C (LyXTable): use istream instead of FILE*
7884 (Read): rewritten to take an istream instead of FILE*
7886 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7888 * src/buffer.C (Dispatch): remove an extraneous break statement.
7890 * src/support/filetools.C (QuoteName): change to do simple
7891 'quoting'. More work is necessary. Also changed to do nothing
7892 under emx (needs fix too).
7893 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7895 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7896 config.h.in to the AC_DEFINE_UNQUOTED() call.
7897 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7898 needs char * as argument (because Solaris 7 declares it like
7901 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7902 remove definition of BZERO.
7904 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7906 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7907 defined, "lyxregex.h" if not.
7909 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7911 (REGEX): new variable that is set to regex.c lyxregex.h when
7912 AM_CONDITIONAL USE_REGEX is set.
7913 (libsupport_la_SOURCES): add $(REGEX)
7915 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7918 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7921 * configure.in: add call to LYX_REGEX
7923 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7924 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7926 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7928 * lib/bind/fi_menus.bind: new file, from
7929 pauli.virtanen@saunalahti.fi.
7931 * src/buffer.C (getBibkeyList): pass the parameter delim to
7932 InsetInclude::getKeys and InsetBibtex::getKeys.
7934 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7935 is passed to Buffer::getBibkeyList
7937 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7938 instead of the hardcoded comma.
7940 * src/insets/insetbib.C (getKeys): make sure that there are not
7941 leading blanks in bibtex keys. Normal latex does not care, but
7942 harvard.sty seems to dislike blanks at the beginning of citation
7943 keys. In particular, the retturn value of the function is
7945 * INSTALL: make it clear that libstdc++ is needed and that gcc
7946 2.7.x probably does not work.
7948 * src/support/filetools.C (findtexfile): make debug message go to
7950 * src/insets/insetbib.C (getKeys): ditto
7952 * src/debug.C (showTags): make sure that the output is correctly
7955 * configure.in: add a comment for TWO_COLOR_ICON define.
7957 * acconfig.h: remove all the entries that already defined in
7958 configure.in or acinclude.m4.
7960 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7961 to avoid user name, date and copyright.
7963 1999-12-21 Juergen Vigna <jug@sad.it>
7965 * src/table.C (Read): Now read bogus row format informations
7966 if the format is < 5 so that afterwards the table can
7967 be read by lyx but without any format-info. Fixed the
7968 crash we experienced when not doing this.
7970 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7972 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7973 (RedoDrawingOfParagraph): ditto
7974 (RedoParagraphs): ditto
7975 (RemoveTableRow): ditto
7977 * src/text.C (Fill): rename arg paperwidth -> paper_width
7979 * src/buffer.C (insertLyXFile): rename var filename -> fname
7980 (writeFile): rename arg filename -> fname
7981 (writeFileAscii): ditto
7982 (makeLaTeXFile): ditto
7983 (makeLinuxDocFile): ditto
7984 (makeDocBookFile): ditto
7986 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7989 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7991 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7994 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7995 compiled by a C compiler not C++.
7997 * src/layout.h (LyXTextClass): added typedef for const_iterator
7998 (LyXTextClassList): added typedef for const_iterator + member
7999 functions begin and end.
8001 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8002 iterators to fill the choice_class.
8003 (updateLayoutChoice): rewritten to use iterators to fill the
8004 layoutlist in the toolbar.
8006 * src/BufferView.h (BufferView::work_area_width): removed unused
8009 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8011 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8012 (sgmlCloseTag): ditto
8014 * src/support/lstrings.h: return type of countChar changed to
8017 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8018 what version of this func to use. Also made to return unsigned int.
8020 * configure.in: call LYX_STD_COUNT
8022 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8023 conforming std::count.
8025 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8027 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8028 and a subscript would give bad display (patch from Dekel Tsur
8029 <dekel@math.tau.ac.il>).
8031 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8033 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8036 * src/chset.h: add a few 'using' directives
8038 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8039 triggered when no buffer is active
8041 * src/layout.C: removed `break' after `return' in switch(), since
8044 * src/lyx_main.C (init): make sure LyX can be ran in place even
8045 when libtool has done its magic with shared libraries. Fix the
8046 test for the case when the system directory has not been found.
8048 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8049 name for the latex file.
8050 (MenuMakeHTML): ditto
8052 * src/buffer.h: add an optional boolean argument, which is passed
8055 1999-12-20 Allan Rae <rae@lyx.org>
8057 * lib/templates/IEEEtran.lyx: small correction and update.
8059 * configure.in: Attempted to use LYX_PATH_HEADER
8061 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8063 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8064 input from JMarc. Now use preprocessor to find the header.
8065 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8066 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8067 LYX_STL_STRING_FWD. See comments in file.
8069 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
8071 * The global MiniBuffer * minibuffer variable is dead.
8073 * The global FD_form_main * fd_form_main variable is dead.
8075 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8077 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
8079 * src/table.h: add the LOstream.h header
8080 * src/debug.h: ditto
8082 * src/LyXAction.h: change the explaination of the ReadOnly
8083 attribute: is indicates that the function _can_ be used.
8085 * src/LyXAction.C (init): find-replace _can_ be used in read-only
8088 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8090 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8096 * src/paragraph.C (GetWord): assert on pos>=0
8099 * src/support/lyxstring.C: condition the use of an invariant on
8101 * src/support/lyxstring.h: ditto
8103 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8104 Use LAssert.h instead of plain assert().
8106 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8108 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8109 * src/support/filetools.C: ditto
8111 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
8114 * INSTALL: document the new configure flags
8116 * configure.in: suppress --with-debug; add --enable-assertions
8118 * acinclude.m4: various changes in alignment of help strings.
8120 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8122 * src/kbmap.C: commented out the use of the hash map in kb_map,
8123 beginning of movement to a stl::container.
8125 * several files: removed code that was not in effect when
8126 MOVE_TEXT was defined.
8128 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
8129 for escaping should not be used. We can discuss if the string
8130 should be enclosed in f.ex. [] instead of "".
8132 * src/trans_mgr.C (insert): use the new returned value from
8133 encodeString to get deadkeys and keymaps done correctly.
8135 * src/chset.C (encodeString): changed to return a pair, to tell
8136 what to use if we know the string.
8138 * src/lyxscreen.h (fillArc): new function.
8140 * src/FontInfo.C (resize): rewritten to use more std::string like
8141 structore, especially string::replace.
8143 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8146 * configure.in (chmod +x some scripts): remove config/gcc-hack
8148 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8150 * src/buffer.C (writeFile): change once again the top comment in a
8151 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8152 instead of an hardcoded version number.
8153 (makeDocBookFile): ditto
8155 * src/version.h: add new define LYX_DOCVERSION
8157 * po/de.po: update from Pit Sütterlin
8158 * lib/bind/de_menus.bind: ditto.
8160 * src/lyxfunc.C (Dispatch): call MenuExport()
8161 * src/buffer.C (Dispatch): ditto
8163 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8164 LyXFunc::Dispatch().
8165 (MenuExport): new function, moved from
8166 LyXFunc::Dispatch().
8168 * src/trans_mgr.C (insert): small cleanup
8169 * src/chset.C (loadFile): ditto
8171 * lib/kbd/iso8859-1.cdef: add missing backslashes
8173 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8175 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8176 help with placing the manually drawn accents better.
8178 (Draw): x2 and hg changed to float to minimize rounding errors and
8179 help place the accents better.
8181 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8182 unsigned short to char is just wrong...cast the char to unsigned
8183 char instead so that the two values can compare sanely. This
8184 should also make the display of insetlatexaccents better and
8185 perhaps also some other insets.
8187 (lbearing): new function
8190 1999-12-15 Allan Rae <rae@lyx.org>
8192 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
8193 header that provides a wrapper around the very annoying SGI STL header
8196 * src/support/lyxstring.C, src/LString.h:
8197 removed old SGI-STL-compatability attempts.
8199 * configure.in: Use LYX_STL_STRING_FWD.
8201 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
8202 stl_string_fwd.h is around and try to determine it's location.
8203 Major improvement over previous SGI STL 3.2 compatability.
8204 Three small problems remain with this function due to my zero
8205 knowledge of autoconf. JMarc and lgb see the comments in the code.
8207 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8209 * src/broken_const.h, config/hack-gcc, config/README: removed
8211 * configure.in: remove --with-gcc-hack option; do not call
8214 * INSTALL: remove documentation of --with-broken-const and
8217 * acconfig.h: remove all trace of BROKEN_CONST define
8219 * src/buffer.C (makeDocBookFile): update version number in output
8221 (SimpleDocBookOnePar): fix an assert when trying to a character
8222 access beyond string length
8225 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8227 * po/de.po: fix the Export menu
8229 * lyx.man: update the description of -dbg
8231 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
8232 (commandLineHelp): updated
8233 (easyParse): show list of available debug levels if -dbg is passed
8236 * src/Makefile.am: add debug.C
8238 * src/debug.h: moved some code to debug.C
8240 * src/debug.C: new file. Contains code to set and show debug
8243 * src/layout.C: remove 'break' after 'continue' in switch
8244 statements, since these cannot be reached.
8246 1999-12-13 Allan Rae <rae@lyx.org>
8248 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8249 (in_word_set): hash() -> math_hash()
8251 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8253 * acconfig.h: Added a test for whether we are using exceptions in the
8254 current compilation run. If so USING_EXCEPTIONS is defined.
8256 * config.in: Check for existance of stl_string_fwd.h
8257 * src/LString.h: If compiling --with-included-string and SGI's
8258 STL version 3.2 is present (see above test) we need to block their
8259 forward declaration of string and supply a __get_c_string().
8260 However, it turns out this is only necessary if compiling with
8261 exceptions enabled so I've a bit more to add yet.
8263 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8264 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8265 src/support/LRegex.h, src/undo.h:
8266 Shuffle the order of the included files a little to ensure that
8267 LString.h gets included before anything that includes stl_string_fwd.h
8269 * src/support/lyxstring.C: We need to #include LString.h instead of
8270 lyxstring.h to get the necessary definition of __get_c_string.
8271 (__get_c_string): New function. This is defined static just like SGI's
8272 although why they need to do this I'm not sure. Perhaps it should be
8273 in lstrings.C instead.
8275 * lib/templates/IEEEtran.lyx: New template file.
8277 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8279 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8280 * intl/Makefile.in (MKINSTALLDIRS): ditto
8282 * src/LyXAction.C (init): changed to hold the LFUN data in a
8283 automatic array in stead of in callso to newFunc, this speeds up
8284 compilation a lot. Also all the memory used by the array is
8285 returned when the init is completed.
8287 * a lot of files: compiled with -Wold-style-cast, changed most of
8288 the reported offenders to C++ style casts. Did not change the
8289 offenders in C files.
8291 * src/trans.h (Match): change argument type to unsigned int.
8293 * src/support/DebugStream.C: fix some types on the streambufs so
8294 that it works on a conforming implementation.
8296 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8298 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8300 * src/support/lyxstring.C: remove the inline added earlier since
8301 they cause a bunch of unsatisfied symbols when linking with dec
8302 cxx. Cxx likes to have the body of inlines at the place where they
8305 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8306 accessing negative bounds in array. This fixes the crash when
8307 inserting accented characters.
8308 * src/trans.h (Match): ditto
8310 * src/buffer.C (Dispatch): since this is a void, it should not try
8311 to return anything...
8313 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8315 * src/buffer.h: removed the two friends from Buffer. Some changes
8316 because of this. Buffer::getFileName and Buffer::setFileName
8317 renamed to Buffer::fileName() and Buffer::fileName(...).
8319 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8321 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8322 and Buffer::update(short) to BufferView. This move is currently
8323 controlled by a define MOVE_TEXT, this will be removed when all
8324 shows to be ok. This move paves the way for better separation
8325 between buffer contents and buffer view. One side effect is that
8326 the BufferView needs a rebreak when swiching buffers, if we want
8327 to avoid this we can add a cache that holds pointers to LyXText's
8328 that is not currently in use.
8330 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8333 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8335 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8337 * lyx_main.C: new command line option -x (or --execute) and
8338 -e (or --export). Now direct conversion from .lyx to .tex
8339 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8340 Unfortunately, X is still needed and the GUI pops up during the
8343 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8345 * src/Spacing.C: add a using directive to bring stream stuff into
8347 * src/paragraph.C: ditto
8348 * src/buffer.C: ditto
8350 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8351 from Lars' announcement).
8353 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8354 example files from Tino Meinen.
8356 1999-12-06 Allan Rae <rae@lyx.org>
8358 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8360 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8362 * src/support/lyxstring.C: added a lot of inline for no good
8365 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8366 latexWriteEndChanges, they were not used.
8368 * src/layout.h (operator<<): output operator for PageSides
8370 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8372 * some example files: loaded in LyX 1.0.4 and saved again to update
8373 certain constructs (table format)
8375 * a lot of files: did the change to use fstream/iostream for all
8376 writing of files. Done with a close look at Andre Poenitz's patch.
8378 * some files: whitespace changes.
8380 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8382 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8383 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8384 architecture, we provide our own. It is used unconditionnally, but
8385 I do not think this is a performance problem. Thanks to Angus
8386 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8387 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8389 (GetInset): use my_memcpy.
8393 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8394 it is easier to understand, but it uses less TeX-only constructs now.
8396 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8397 elements contain spaces
8399 * lib/configure: regenerated
8401 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8402 elements contain spaces; display the list of programs that are
8405 * autogen.sh: make sure lib/configure is executable
8407 * lib/examples/*: rename the tutorial examples to begin with the
8408 two-letters language code.
8410 * src/lyxfunc.C (getStatus): do not query current font if no
8413 * src/lyx_cb.C (RunScript): use QuoteName
8414 (MenuRunDvips): ditto
8415 (PrintApplyCB): ditto
8417 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8418 around argument, so that it works well with the current shell.
8419 Does not work properly with OS/2 shells currently.
8421 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8422 * src/LyXSendto.C (SendtoApplyCB): ditto
8423 * src/lyxfunc.C (Dispatch): ditto
8424 * src/buffer.C (runLaTeX): ditto
8425 (runLiterate): ditto
8426 (buildProgram): ditto
8428 * src/lyx_cb.C (RunScript): ditto
8429 (MenuMakeLaTeX): ditto
8431 * src/buffer.h (getLatexName): new method
8433 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8435 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8437 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8438 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8439 (create_math_panel): ditto
8441 * src/lyxfunc.C (getStatus): re-activate the code which gets
8442 current font and cursor; add test for export to html.
8444 * src/lyxrc.C (read): remove unreachable break statements; add a
8447 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8449 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8451 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8452 introduced by faulty regex.
8453 * src/buffer.C: ditto
8454 * src/lastfiles.C: ditto
8455 * src/paragraph.C: ditto
8456 * src/table.C: ditto
8457 * src/vspace.C: ditto
8458 * src/insets/figinset.C: ditto
8459 Note: most of these is absolutely harmless, except the one in
8460 src/mathed formula.C.
8462 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8464 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8465 operation, yielding correct results for the reLyX command.
8467 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8469 * src/support/filetools.C (ExpandPath): removed an over eager
8471 (ReplaceEnvironmentPath): ditto
8473 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8474 shows that we are doing something fishy in our code...
8478 * src/lyxrc.C (read): use a double switch trick to get more help
8479 from the compiler. (the same trick is used in layout.C)
8480 (write): new function. opens a ofstream and pass that to output
8481 (output): new function, takes a ostream and writes the lyxrc
8482 elemts to it. uses a dummy switch to make sure no elements are
8485 * src/lyxlex.h: added a struct pushpophelper for use in functions
8486 with more than one exit point.
8488 * src/lyxlex.[Ch] (GetInteger): made it const
8492 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8494 * src/layout.[hC] : LayoutTags splitted into several enums, new
8495 methods created, better error handling cleaner use of lyxlex. Read
8498 * src/bmtable.[Ch]: change some member prototypes because of the
8499 image const changes.
8501 * commandtags.h, src/LyXAction.C (init): new function:
8502 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8503 This file is not read automatically but you can add \input
8504 preferences to your lyxrc if you want to. We need to discuss how
8507 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8508 in .aux, also remove .bib and .bst files from dependencies when
8511 * src/BufferView.C, src/LyXView.C: add const_cast several places
8512 because of changes to images.
8514 * lib/images/*: same change as for images/*
8516 * lib/lyxrc.example: Default for accept_compound is false not no.
8518 * images/*: changed to be const, however I have som misgivings
8519 about this change so it might be changed back.
8521 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8523 * lib/configure, po/POTFILES.in: regenerated
8525 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8527 * config/lib_configure.m4: removed
8529 * lib/configure.m4: new file (was config/lib_configure.m4)
8531 * configure.in: do not test for rtti, since we do not use it.
8533 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8535 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8536 doubling of allocated space scheme. This makes it faster for large
8537 strings end to use less memory for small strings. xtra rememoved.
8539 * src/insets/figinset.C (waitalarm): commented out.
8540 (GhostscriptMsg): use static_cast
8541 (GhostscriptMsg): use new instead of malloc to allocate memory for
8542 cmap. also delete the memory after use.
8544 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8546 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8547 for changes in bibtex database or style.
8548 (runBibTeX): remove all .bib and .bst files from dep before we
8550 (run): use scanAuc in when dep file already exist.
8552 * src/DepTable.C (remove_files_with_extension): new method
8555 * src/DepTable.[Ch]: made many of the methods const.
8557 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8559 * src/bufferparams.C: make sure that the default textclass is
8560 "article". It used to be the first one by description order, but
8561 now the first one is "docbook".
8563 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8564 string; call Debug::value.
8565 (easyParse): pass complete argument to setDebuggingLevel().
8567 * src/debug.h (value): fix the code that parses debug levels.
8569 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8572 * src/LyXAction.C: use Debug::ACTION as debug channel.
8574 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8576 * NEWS: updated for the future 1.1.3 release.
8578 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8579 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8580 it should. This is of course a controversial change (since many
8581 people will find that their lyx workscreen is suddenly full of
8582 red), but done for the sake of correctness.
8584 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8585 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8587 * src/insets/inseterror.h, src/insets/inseturl.h,
8588 src/insets/insetinfo.h, src/insets/figinset.h,
8589 src/mathed/formulamacro.h, src/mathed/math_macro.h
8590 (EditMessage): add a missing const and add _() to make sure that
8593 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8594 src/insets/insetbib.C, src/support/filetools.C: add `using'
8597 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8598 doing 'Insert index of last word' at the beginning of a paragraph.
8600 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8602 * several files: white-space changes.
8604 * src/mathed/formula.C: removed IsAlpha and IsDigit
8606 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8607 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8610 * src/insets/figinset.C (GetPSSizes): don't break when
8611 "EndComments" is seen. But break when a boundingbox is read.
8613 * all classes inherited from Inset: return value of Clone
8614 changed back to Inset *.
8616 * all classes inherited form MathInset: return value of Clone
8617 changed back to MathedInset *.
8619 * src/insets/figinset.C (runqueue): use a ofstream to output the
8620 gs/ps file. Might need some setpresicion or setw. However I can
8621 see no problem with the current code.
8622 (runqueue): use sleep instead of the alarm/signal code. I just
8623 can't see the difference.
8625 * src/paragraph.C (LyXParagraph): reserve space in the new
8626 paragraph and resize the inserted paragraph to just fit.
8628 * src/lyxfunc.h (operator|=): added operator for func_status.
8630 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8631 check for readable file.
8633 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8634 check for readable file.
8635 (MenuMakeLinuxDoc): ditto
8636 (MenuMakeDocBook): ditto
8637 (MenuMakeAscii): ditto
8638 (InsertAsciiFile): split the test for openable and readable
8640 * src/bmtable.C (draw_bitmaptable): use
8641 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8643 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8644 findtexfile from LaTeX to filetools.
8646 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8647 instead of FilePtr. Needs to be verified by a literate user.
8649 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8651 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8652 (EditMessage): likewise.
8654 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8655 respectively as \textasciitilde and \textasciicircum.
8657 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8659 * src/support/lyxstring.h: made the methods that take iterators
8662 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8663 (regexMatch): made is use the real regex class.
8665 * src/support/Makefile.am: changed to use libtool
8667 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8669 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8671 (MathIsInset ++): changed several macros to be inline functions
8674 * src/mathed/Makefile.am: changed to use libtool
8676 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8678 * src/insets/inset* : Clone changed to const and return type is
8679 the true insettype not just Inset*.
8681 * src/insets/Makefile.am: changed to use libtool
8683 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8685 * src/undo.[Ch] : added empty() and changed some of the method
8688 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8690 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8691 setID use block<> for the bullets array, added const several places.
8693 * src/lyxfunc.C (getStatus): new function
8695 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8696 LyXAction, added const to several funtions.
8698 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8699 a std::map, and to store the dir items in a vector.
8701 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8704 * src/LyXView.[Ch] + other files : changed currentView to view.
8706 * src/LyXAction.[Ch] : ported from the old devel branch.
8708 * src/.cvsignore: added .libs and a.out
8710 * configure.in : changes to use libtool.
8712 * acinclude.m4 : inserted libtool.m4
8714 * .cvsignore: added libtool
8716 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8718 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8719 file name in insets and mathed directories (otherwise the
8720 dependency is not taken in account under cygwin).
8722 * src/text2.C (InsertString[AB]): make sure that we do not try to
8723 read characters past the string length.
8725 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8727 * lib/doc/LaTeXConfig.lyx.in,
8728 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8730 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8731 file saying who created them and when this heppened; this is
8732 useless and annoys tools like cvs.
8734 * lib/layouts/g-brief-{en,de}.layout,
8735 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8736 from Thomas Hartkens <thomas@hartkens.de>.
8738 * src/{insets,mathed}/Makefile.am: do not declare an empty
8739 LDFLAGS, so that it can be set at configure time (useful on Irix
8742 * lib/reLyX/configure.in: make sure that the prefix is set
8743 correctly in LYX_DIR.
8745 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8747 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8748 be used by 'command-sequence' this allows to bind a key to a
8749 sequence of LyX-commands
8750 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8752 * src/LyXAction.C: add "command-sequence"
8754 * src/LyXFunction.C: handling of "command-sequence"
8756 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8757 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8759 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8761 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8763 * src/buffer.C (writeFile): Do not output a comment giving user
8764 and date at the beginning of a .lyx file. This is useless and
8765 annoys cvs anyway; update version number to 1.1.
8767 * src/Makefile.am (LYX_DIR): add this definition, so that a
8768 default path is hardcoded in LyX.
8770 * configure.in: Use LYX_GNU_GETTEXT.
8772 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8773 AM_GNU_GETTEXT with a bug fixed.
8775 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8777 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8779 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8780 which is used to point to LyX data is now LYX_DIR_11x.
8782 * lyx.man: convert to a unix text file; small updates.
8784 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8786 * src/support/LSubstring.[Ch]: made the second arg of most of the
8787 constructors be a const reference.
8789 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8792 * src/support/lyxstring.[Ch] (swap): added missing member function
8793 and specialization of swap(str, str);
8795 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8797 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8798 trace of the old one.
8800 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8801 put the member definitions in undo.C.
8803 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8804 NEW_TEXT and have now only code that was included when this was
8807 * src/intl.C (LCombo): use static_cast
8809 (DispatchCallback): ditto
8811 * src/definitions.h: removed whole file
8813 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8815 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8816 parsing and stores in a std:map. a regex defines the file format.
8817 removed unneeded members.
8819 * src/bufferparams.h: added several enums from definitions.h here.
8820 Removed unsused destructor. Changed some types to use proper enum
8821 types. use block to have the temp_bullets and user_defined_bullets
8822 and to make the whole class assignable.
8824 * src/bufferparams.C (Copy): removed this functions, use a default
8827 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8830 * src/buffer.C (readLyXformat2): commend out all that have with
8831 oldpapersize to do. also comment out all that hve to do with
8832 insetlatex and insetlatexdel.
8833 (setOldPaperStuff): commented out
8835 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8837 * src/LyXAction.C: remove use of inset-latex-insert
8839 * src/mathed/math_panel.C (button_cb): use static_cast
8841 * src/insets/Makefile.am (insets_o_SOURCES): removed
8844 * src/support/lyxstring.C (helper): use the unsigned long
8845 specifier, UL, instead of a static_cast.
8847 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8849 * src/support/block.h: new file. to be used as a c-style array in
8850 classes, so that the class can be assignable.
8852 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8854 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8855 NULL, make sure to return an empty string (it is not possible to
8856 set a string to NULL).
8858 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8860 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8862 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8864 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8865 link line, so that Irix users (for example) can set it explicitely to
8868 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8869 it can be overidden at make time (static or dynamic link, for
8872 * src/vc-backend.C, src/LaTeXFeatures.h,
8873 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8874 statements to bring templates to global namespace.
8876 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8878 * src/support/lyxstring.C (operator[] const): make it standard
8881 * src/minibuffer.C (Init): changed to reflect that more
8882 information is given from the lyxvc and need not be provided here.
8884 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8886 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8888 * src/LyXView.C (UpdateTimerCB): use static_cast
8889 (KeyPressMask_raw_callback): ditto
8891 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8892 buffer_, a lot of changes because of this. currentBuffer() ->
8893 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8894 also changes to other files because of this.
8896 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8898 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8899 have no support for RCS and partial support for CVS, will be
8902 * src/insets/ several files: changes because of function name
8903 changes in Bufferview and LyXView.
8905 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8907 * src/support/LSubstring.[Ch]: new files. These implement a
8908 Substring that can be very convenient to use. i.e. is this
8910 string a = "Mary had a little sheep";
8911 Substring(a, "sheep") = "lamb";
8912 a is now "Mary has a little lamb".
8914 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8915 out patterns and subpatterns of strings. It is used by LSubstring
8916 and also by vc-backend.C
8918 * src/support/lyxstring.C: went over all the assertions used and
8919 tried to correct the wrong ones and flag which of them is required
8920 by the standard. some bugs found because of this. Also removed a
8921 couple of assertions.
8923 * src/support/Makefile.am (libsupport_a_SOURCES): added
8924 LSubstring.[Ch] and LRegex.[Ch]
8926 * src/support/FileInfo.h: have struct stat buf as an object and
8927 not a pointer to one, some changes because of this.
8929 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8930 information in layout when adding the layouts preamble to the
8933 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8936 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8937 because of bug in OS/2.
8939 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8941 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8942 \verbatim@font instead of \ttfamily, so that it can be redefined.
8944 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8945 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8946 src/layout.h, src/text2.C: add 'using' directive to bring the
8947 STL templates we need from the std:: namespace to the global one.
8948 Needed by DEC cxx in strict ansi mode.
8950 * src/support/LIstream.h,src/support/LOstream.h,
8951 src/support/lyxstring.h,src/table.h,
8952 src/lyxlookup.h: do not include <config.h> in header
8953 files. This should be done in the .C files only.
8955 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8959 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8961 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8962 from Kayvan to fix the tth invokation.
8964 * development/lyx.spec.in: updates from Kayvan to reflect the
8965 changes of file names.
8967 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8969 * src/text2.C (InsertStringB): use std::copy
8970 (InsertStringA): use std::copy
8972 * src/bufferlist.C: use a vector to store the buffers in. This is
8973 an internal change and should not affect any other thing.
8975 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8978 * src/text.C (Fill): fix potential bug, one off bug.
8980 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8982 * src/Makefile.am (lyx_main.o): add more files it depends on.
8984 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8986 * src/support/lyxstring.C: use size_t for the reference count,
8987 size, reserved memory and xtra.
8988 (internal_compare): new private member function. Now the compare
8989 functions should work for std::strings that have embedded '\0'
8991 (compare): all compare functions rewritten to use
8994 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8996 * src/support/lyxstring.C (compare): pass c_str()
8997 (compare): pass c_str
8998 (compare): pass c_str
9000 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9002 * src/support/DebugStream.C: <config.h> was not included correctly.
9004 * lib/configure: forgot to re-generate it :( I'll make this file
9005 auto generated soon.
9007 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9009 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9012 * src/support/lyxstring.C: some changes from length() to rep->sz.
9013 avoids a function call.
9015 * src/support/filetools.C (SpaceLess): yet another version of the
9016 algorithm...now per Jean-Marc's suggestions.
9018 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9020 * src/layout.C (less_textclass_desc): functor for use in sorting
9022 (LyXTextClass::Read): sort the textclasses after reading.
9024 * src/support/filetools.C (SpaceLess): new version of the
9025 SpaceLess functions. What problems does this one give? Please
9028 * images/banner_bw.xbm: made the arrays unsigned char *
9030 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9032 * src/support/lyxstring.C (find): remove bogus assertion in the
9033 two versions of find where this has not been done yet.
9035 * src/support/lyxlib.h: add missing int return type to
9038 * src/menus.C (ShowFileMenu): disable exporting to html if no
9039 html export command is present.
9041 * config/lib_configure.m4: add a test for an HTML converter. The
9042 programs checked for are, in this order: tth, latex2html and
9045 * lib/configure: generated from config/lib_configure.m4.
9047 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9048 html converter. The parameters are now passed through $$FName and
9049 $$OutName, instead of standard input/output.
9051 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9053 * lib/lyxrc.example: update description of \html_command.
9054 add "quotes" around \screen_font_xxx font setting examples to help
9055 people who use fonts with spaces in their names.
9057 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9059 * Distribution files: updates for v1.1.2
9061 * src/support/lyxstring.C (find): remove bogus assert and return
9062 npos for the same condition.
9064 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9066 * added patch for OS/2 from SMiyata.
9068 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9070 * src/text2.C (CutSelection): make space_wrapped a bool
9071 (CutSelection): dont declare int i until we have to.
9072 (alphaCounter): return a char const *.
9074 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9076 * src/support/syscall.C (Systemcalls::kill):
9077 src/support/filetools.C (PutEnv, PutEnvPath):
9078 src/lyx_cb.C (addNewlineAndDepth):
9079 src/FontInfo.C (FontInfo::resize): condition some #warning
9080 directives with WITH_WARNINGS.
9083 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9085 * src/layout.[Ch] + several files: access to class variables
9086 limited and made accessor functions instead a lot of code changed
9087 becuase of this. Also instead of returning pointers often a const
9088 reference is returned instead.
9090 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9092 * src/Makefile.am (dist-hook): added used to remove the CVS from
9093 cheaders upon creating a dist
9094 (EXTRA_DIST): added cheaders
9096 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9097 a character not as a small integer.
9099 * src/support/lyxstring.C (find): removed Assert and added i >=
9100 rep->sz to the first if.
9102 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9104 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9105 src/LyXView.C src/buffer.C src/bufferparams.C
9106 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9107 src/text2.C src/insets/insetinclude.C:
9108 lyxlayout renamed to textclasslist.
9110 * src/layout.C: some lyxerr changes.
9112 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9113 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
9114 (LyXLayoutList): removed all traces of this class.
9115 (LyXTextClass::Read): rewrote LT_STYLE
9116 (LyXTextClass::hasLayout): new function
9117 (LyXTextClass::GetLayout): rewritten to return an iterator + has
9118 both const and nonconst version.
9119 (LyXTextClass::delete_layout): new function.
9120 (LyXTextClassList::Style): bug fix. do the right thing if layout
9122 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
9123 (LyXTextClassList::NameOfLayout): ditto
9124 (LyXTextClassList::Load): ditto
9126 * src/buffer.C (makeLaTeXFile): new access to layoutlist
9128 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
9130 * src/LyXAction.C (LookupFunc): added a workaround for sun
9131 compiler, on the other hand...we don't know if the current code
9132 compiles on sun at all...
9134 * src/support/filetools.C (CleanupPath): subst fix
9136 * src/insets/insetbib.C (delDatabase): subst fix, this looks
9139 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
9140 complained about this one?
9142 * src/insets/insetinclude.C (Latex): subst fix
9144 * src/insets/insetbib.C (getKeys): subst fix
9146 * src/LyXSendto.C (SendtoApplyCB): subst fix
9148 * src/lyx_main.C (init): subst fix
9150 * src/layout.C (Read): subst fix
9152 * src/lyx_sendfax_main.C (button_send): subst fix
9154 * src/buffer.C (RoffAsciiTable): subst fix
9156 * src/lyx_cb.C (MenuFax): subst fix
9157 (PrintApplyCB): subst fix
9159 1999-10-26 Juergen Vigna <jug@sad.it>
9161 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9163 (Read): Cleaned up this code so now we read only format vestion >= 5
9165 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9167 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9168 come nobody has complained about this one?
9170 * src/insets/insetinclude.C (Latex): subst fix
9172 * src/insets/insetbib.C (getKeys): subst fix
9174 * src/lyx_main.C (init): subst fix
9176 * src/layout.C (Read): subst fix
9178 * src/buffer.C (RoffAsciiTable): subst fix
9180 * src/lyx_cb.C (MenuFax): subst fix.
9182 * src/layout.[hC] + some other files: rewrote to use
9183 std::container to store textclasses and layouts in.
9184 Simplified, removed a lot of code. Make all classes
9185 assignable. Further simplifications and review of type
9186 use still to be one.
9188 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9189 lastfiles to create the lastfiles partr of the menu.
9191 * src/lastfiles.[Ch]: rewritten to use deque to store the
9192 lastfiles in. Uses fstream for reading and writing. Simplifies
9195 * src/support/syscall.C: remove explicit cast.
9197 * src/BufferView.C (CursorToggleCB): removed code snippets that
9199 use explicat C++ style casts instead of C style casts. also use
9200 u_vdata instea of passing pointers in longs.
9202 * src/PaperLayout.C: removed code snippets that were commented out.
9204 * src/lyx_gui_misc.C: removed code snippets that were commented out.
9206 * src/lyx_main.C: removed code snippets that wer commented out.
9208 * src/paragraph.C: removed code snippets that were commented out.
9210 * src/lyxvc.C (logClose): use static_cast
9212 (viewLog): remove explicit cast to void*
9213 (showLog): removed old commented code
9215 * src/menus.C: use static_cast instead of C style casts. use
9216 u_vdata instead of u_ldata. remove explicit cast to (long) for
9217 pointers. Removed old code that was commented out.
9219 * src/insets/inset.C: removed old commented func
9221 * src/insets/insetref.C (InsetRef): removed old code that had been
9222 commented out for a long time.
9224 (escape): removed C style cast
9226 * src/insets/insetlatexaccent.C (Draw): removed old commented code
9228 * src/insets/insetlatex.C (Draw): removed old commented code
9229 (Read): rewritten to use string
9231 * src/insets/insetlabel.C (escape): removed C style cast
9233 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
9235 * src/insets/insetindex.C: use static_cast and u_vdata, removed
9238 * src/insets/insetinclude.h: removed a couple of stupid bools
9240 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9241 (Clone): remove C style cast
9242 (getKeys): changed list to lst because of std::list
9244 * src/insets/inseterror.C (Draw): removed som old commented code.
9246 * src/insets/insetcommand.C (Draw): removed some old commented code.
9248 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9249 commented out forever.
9250 (bibitem_cb): use static_cast instead of C style cast
9251 use of vdata changed to u_vdata.
9253 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9255 (CloseUrlCB): use static_cast instead of C style cast.
9256 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9258 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9259 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9260 (CloseInfoCB): static_cast from ob->u_vdata instead.
9261 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9264 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9265 (C_InsetError_CloseErrorCB): forward the ob parameter
9266 (CloseErrorCB): static_cast from ob->u_vdata instead.
9268 * src/vspace.h: include LString.h since we use string in this class.
9270 * src/vspace.C (lyx_advance): changed name from advance because of
9271 nameclash with stl. And since we cannot use namespaces yet...I
9272 used a lyx_ prefix instead. Expect this to change when we begin
9275 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9277 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9278 and removed now defunct constructor and deconstructor.
9280 * src/BufferView.h: have backstack as a object not as a pointer.
9281 removed initialization from constructor. added include for BackStack
9283 * development/lyx.spec.in (%build): add CFLAGS also.
9285 * src/screen.C (drawFrame): removed another warning.
9287 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9289 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9290 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9291 README and ANNOUNCE a bit for the next release. More work is
9294 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9295 unbreakable if we are in freespacing mode (LyX-Code), but not in
9298 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9300 * src/BackStack.h: fixed initialization order in constructor
9302 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9304 * acinclude.m4 (VERSION): new rules for when a version is
9305 development, added also a variable for prerelease.
9306 (warnings): we set with_warnings=yes for prereleases
9307 (lyx_opt): prereleases compile with same optimization as development
9308 (CXXFLAGS): only use pedantic if we are a development version
9310 * src/BufferView.C (restorePosition): don't do anything if the
9313 * src/BackStack.h: added member empty, use this to test if there
9314 is anything to pop...
9316 1999-10-25 Juergen Vigna <jug@sad.it>
9319 * forms/layout_forms.fd +
9320 * forms/latexoptions.fd +
9321 * lyx.fd: changed for various form resize issues
9323 * src/mathed/math_panel.C +
9324 * src/insets/inseterror.C +
9325 * src/insets/insetinfo.C +
9326 * src/insets/inseturl.C +
9327 * src/insets/inseturl.h +
9330 * src/PaperLayout.C +
9331 * src/ParagraphExtra.C +
9332 * src/TableLayout.C +
9334 * src/layout_forms.C +
9341 * src/menus.C: fixed various resize issues. So now forms can be
9342 resized savely or not be resized at all.
9344 * forms/form_url.fd +
9345 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9348 * src/insets/Makefile.am: added files form_url.[Ch]
9350 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9352 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9353 (and presumably 6.2).
9355 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9356 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9357 remaining static member callbacks.
9359 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9362 * src/support/lyxstring.h: declare struct Srep as friend of
9363 lyxstring, since DEC cxx complains otherwise.
9365 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9367 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9369 * src/LaTeX.C (run): made run_bibtex also depend on files with
9371 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9372 are put into the dependency file.
9374 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9375 the code has shown itself to work
9376 (create_ispell_pipe): removed another warning, added a comment
9379 * src/minibuffer.C (ExecutingCB): removed code that has been
9380 commented out a long time
9382 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9383 out code + a warning.
9385 * src/support/lyxstring.h: comment out the three private
9386 operators, when compiling with string ansi conforming compilers
9389 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9391 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9392 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9395 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9398 * src/mathed/math_panel.C (create_math_panel): remove explicit
9401 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9404 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9405 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9406 to XCreatePixmapFromBitmapData
9407 (fl_set_bmtable_data): change the last argument to be unsigned
9409 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9410 and bh to be unsigned int, remove explicit casts in call to
9411 XReadBitmapFileData.
9413 * images/arrows.xbm: made the arrays unsigned char *
9414 * images/varsz.xbm: ditto
9415 * images/misc.xbm: ditto
9416 * images/greek.xbm: ditto
9417 * images/dots.xbm: ditto
9418 * images/brel.xbm: ditto
9419 * images/bop.xbm: ditto
9421 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9423 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9424 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9425 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9427 (LYX_CXX_CHEADERS): added <clocale> to the test.
9429 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9431 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9433 * src/support/lyxstring.C (append): fixed something that must be a
9434 bug, rep->assign was used instead of rep->append.
9436 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9439 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9440 lyx insert double chars. Fix spotted by Kayvan.
9442 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9444 * Fixed the tth support. I messed up with the Emacs patch apply feature
9445 and omitted the changes in lyxrc.C.
9447 1999-10-22 Juergen Vigna <jug@sad.it>
9449 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9451 * src/lyx_cb.C (MenuInsertRef) +
9452 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9453 the form cannot be resized under it limits (fixes a segfault)
9455 * src/lyx.C (create_form_form_ref) +
9456 * forms/lyx.fd: Changed Gravity on name input field so that it is
9459 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9461 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9462 <ostream> and <istream>.
9464 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9465 whether <fstream> provides the latest standard features, or if we
9466 have an oldstyle library (like in egcs).
9467 (LYX_CXX_STL_STRING): fix the test.
9469 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9470 code on MODERN_STL_STREAM.
9472 * src/support/lyxstring.h: use L{I,O}stream.h.
9474 * src/support/L{I,O}stream.h: new files, designed to setup
9475 correctly streams for our use
9476 - includes the right header depending on STL capabilities
9477 - puts std::ostream and std::endl (for LOStream.h) or
9478 std::istream (LIStream.h) in toplevel namespace.
9480 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9482 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9483 was a bib file that had been changed we ensure that bibtex is run.
9484 (runBibTeX): enhanced to extract the names of the bib files and
9485 getting their absolute path and enter them into the dep file.
9486 (findtexfile): static func that is used to look for tex-files,
9487 checks for absolute patchs and tries also with kpsewhich.
9488 Alternative ways of finding the correct files are wanted. Will
9490 (do_popen): function that runs a command using popen and returns
9491 the whole output of that command in a string. Should be moved to
9494 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9495 file with extension ext has changed.
9497 * src/insets/figinset.C: added ifdef guards around the fl_free
9498 code that jug commented out. Now it is commented out when
9499 compiling with XForms == 0.89.
9501 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9502 to lyxstring.C, and only keep a forward declaration in
9503 lyxstring.h. Simplifies the header file a bit and should help a
9504 bit on compile time too. Also changes to Srep will not mandate a
9505 recompile of code just using string.
9506 (~lyxstring): definition moved here since it uses srep.
9507 (size): definition moved here since it uses srep.
9509 * src/support/lyxstring.h: removed a couple of "inline" that should
9512 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9514 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9517 1999-10-21 Juergen Vigna <jug@sad.it>
9519 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9520 set to left if I just remove the width entry (or it is empty).
9522 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9523 paragraph when having dummy paragraphs.
9525 1999-10-20 Juergen Vigna <jug@sad.it>
9527 * src/insets/figinset.C: just commented some fl_free_form calls
9528 and added warnings so that this calls should be activated later
9529 again. This avoids for now a segfault, but we have a memory leak!
9531 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9532 'const char * argument' to 'string argument', this should
9533 fix some Asserts() in lyxstring.C.
9535 * src/lyxfunc.h: Removed the function argAsString(const char *)
9536 as it is not used anymore.
9538 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9540 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9543 * src/Literate.h: some funcs moved from public to private to make
9544 interface clearer. Unneeded args removed.
9546 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9548 (scanBuildLogFile): ditto
9550 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9551 normal TeX Error. Still room for improvement.
9553 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9555 * src/buffer.C (insertErrors): changes to make the error
9556 desctription show properly.
9558 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9561 * src/support/lyxstring.C (helper): changed to use
9562 sizeof(object->rep->ref).
9563 (operator>>): changed to use a pointer instead.
9565 * src/support/lyxstring.h: changed const reference & to value_type
9566 const & lets see if that helps.
9568 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9570 * Makefile.am (rpmdist): fixed to have non static package and
9573 * src/support/lyxstring.C: removed the compilation guards
9575 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9578 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9579 conditional compile of lyxstring.Ch
9581 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9582 stupid check, but it is a lot better than the bastring hack.
9583 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9585 * several files: changed string::erase into string::clear. Not
9588 * src/chset.C (encodeString): use a char temporary instead
9590 * src/table.C (TexEndOfCell): added tostr around
9591 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9592 (TexEndOfCell): ditto
9593 (TexEndOfCell): ditto
9594 (TexEndOfCell): ditto
9595 (DocBookEndOfCell): ditto
9596 (DocBookEndOfCell): ditto
9597 (DocBookEndOfCell): ditto
9598 (DocBookEndOfCell): ditto
9600 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9602 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9604 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9605 (MenuBuildProg): added tostr around ret
9606 (MenuRunChktex): added tostr around ret
9607 (DocumentApplyCB): added tostr around ret
9609 * src/chset.C (encodeString): added tostr around t->ic
9611 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9612 (makeLaTeXFile): added tostr around tocdepth
9613 (makeLaTeXFile): added tostr around ftcound - 1
9615 * src/insets/insetbib.C (setCounter): added tostr around counter.
9617 * src/support/lyxstring.h: added an operator+=(int) to catch more
9620 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9621 (lyxstring): We DON'T allow NULL pointers.
9623 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9625 * src/mathed/math_macro.C (MathMacroArgument::Write,
9626 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9627 when writing them out.
9629 * src/LString.C: remove, since it is not used anymore.
9631 * src/support/lyxstring.C: condition the content to
9632 USE_INCLUDED_STRING macro.
9634 * src/mathed/math_symbols.C, src/support/lstrings.C,
9635 src/support/lyxstring.C: add `using' directive to specify what
9636 we need in <algorithm>. I do not think that we need to
9637 conditionalize this, but any thought is appreciated.
9639 * many files: change all callback functions to "C" linkage
9640 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9641 strict_ansi. Those who were static are now global.
9642 The case of callbacks which are static class members is
9643 trickier, since we have to make C wrappers around them (see
9644 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9645 did not finish this yet, since it defeats the purpose of
9646 encapsulation, and I am not sure what the best route is.
9648 1999-10-19 Juergen Vigna <jug@sad.it>
9650 * src/support/lyxstring.C (lyxstring): we permit to have a null
9651 pointer as assignment value and just don't assign it.
9653 * src/vspace.C (nextToken): corrected this function substituting
9654 find_first(_not)_of with find_last_of.
9656 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9657 (TableOptCloseCB) (TableSpeCloseCB):
9658 inserted fl_set_focus call for problem with fl_hide_form() in
9661 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9663 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9666 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9668 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9669 LyXLex::next() and not eatline() to get its argument.
9671 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9673 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9674 instead, use fstreams for io of the depfile, removed unneeded
9675 functions and variables.
9677 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9678 vector instead, removed all functions and variables that is not in
9681 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9683 * src/buffer.C (insertErrors): use new interface to TeXError
9685 * Makefile.am (rpmdist): added a rpmdist target
9687 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9688 per Kayvan's instructions.
9690 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9692 * src/Makefile.am: add a definition for localedir, so that locales
9693 are found after installation (Kayvan)
9695 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9697 * development/.cvsignore: new file.
9699 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9701 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9702 C++ compiler provides wrappers for C headers and use our alternate
9705 * configure.in: use LYX_CXX_CHEADERS.
9707 * src/cheader/: new directory, populated with cname headers from
9708 libstdc++-2.8.1. They are a bit old, but probably good enough for
9709 what we want (support compilers who lack them).
9711 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9712 from includes. It turns out is was stupid.
9714 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9716 * lib/Makefile.am (install-data-local): forgot a ';'
9717 (install-data-local): forgot a '\'
9718 (libinstalldirs): needed after all. reintroduced.
9720 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9722 * configure.in (AC_OUTPUT): added lyx.spec
9724 * development/lyx.spec: removed file
9726 * development/lyx.spec.in: new file
9728 * po/*.po: merged with lyx.pot becuase of make distcheck
9730 * lib/Makefile.am (dist-hook): added dist-hook so that
9731 documentation files will be included when doing a make
9732 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9733 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9735 more: tried to make install do the right thing, exclude CVS dirs
9738 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9739 Path would fit in more nicely.
9741 * all files that used to use pathstack: uses now Path instead.
9742 This change was a lot easier than expected.
9744 * src/support/path.h: new file
9746 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9748 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9750 * src/support/lyxstring.C (getline): Default arg was given for
9753 * Configure.cmd: removed file
9755 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9757 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9758 streams classes and types, add the proper 'using' statements when
9759 MODERN_STL is defined.
9761 * src/debug.h: move the << operator definition after the inclusion
9764 * src/support/filetools.C: include "LAssert.h", which is needed
9767 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9770 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9771 include "debug.h" to define a proper ostream.
9773 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9775 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9776 method to the SystemCall class which can kill a process, but it's
9777 not fully implemented yet.
9779 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9781 * src/support/FileInfo.h: Better documentation
9783 * src/lyxfunc.C: Added support for buffer-export html
9785 * src/menus.C: Added Export->As HTML...
9787 * lib/bind/*.bind: Added short-cut for buffer-export html
9789 * src/lyxrc.*: Added support for new \tth_command
9791 * lib/lyxrc.example: Added stuff for new \tth_command
9793 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9795 * lib/Makefile.am (IMAGES): removed images/README
9796 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9797 installes in correct place. Check permisions is installed
9800 * src/LaTeX.C: some no-op changes moved declaration of some
9803 * src/LaTeX.h (LATEX_H): changed include guard name
9805 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9807 * lib/reLyX/Makefile.am: install noweb2lyx.
9809 * lib/Makefile.am: install configure.
9811 * lib/reLyX/configure.in: declare a config aux dir; set package
9812 name to lyx (not sure what the best solution is); generate noweb2lyx.
9814 * lib/layouts/egs.layout: fix the bibliography layout.
9816 1999-10-08 Jürgen Vigna <jug@sad.it>
9818 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9819 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9820 it returned without continuing to search the path.
9822 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9824 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9825 also fixes a bug. It is not allowed to do tricks with std::strings
9826 like: string a("hei"); &a[e]; this will not give what you
9827 think... Any reason for the complexity in this func?
9829 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9831 * Updated README and INSTALL a bit, mostly to check that my
9832 CVS rights are correctly set up.
9834 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9836 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9837 does not allow '\0' chars but lyxstring and std::string does.
9839 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9841 * autogen.sh (AUTOCONF): let the autogen script create the
9842 POTFILES.in file too. POTFILES.in should perhaps now not be
9843 included in the cvs module.
9845 * some more files changed to use C++ includes instead of C ones.
9847 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9849 (Reread): added tostr to nlink. buggy output otherwise.
9850 (Reread): added a string() around szMode when assigning to Buffer,
9851 without this I got a log of garbled info strings.
9853 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9856 * I have added several ostream & operator<<(ostream &, some_type)
9857 functions. This has been done to avoid casting and warnings when
9858 outputting enums to lyxerr. This as thus eliminated a lot of
9859 explicit casts and has made the code clearer. Among the enums
9860 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9861 mathed enums, some font enum the Debug::type enum.
9863 * src/support/lyxstring.h (clear): missing method. equivalent of
9866 * all files that contained "stderr": rewrote constructs that used
9867 stderr to use lyxerr instead. (except bmtable)
9869 * src/support/DebugStream.h (level): and the passed t with
9870 Debug::ANY to avoid spurious bits set.
9872 * src/debug.h (Debug::type value): made it accept strings of the
9875 * configure.in (Check for programs): Added a check for kpsewhich,
9876 the latex generation will use this later to better the dicovery of
9879 * src/BufferView.C (create_view): we don't need to cast this to
9880 (void*) that is done automatically.
9881 (WorkAreaButtonPress): removed some dead code.
9883 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9885 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9886 is not overwritten when translated (David Sua'rez de Lis).
9888 * lib/CREDITS: Added David Sua'rez de Lis
9890 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9892 * src/bufferparams.C (BufferParams): default input encoding is now
9895 * acinclude.m4 (cross_compiling): comment out macro
9896 LYX_GXX_STRENGTH_REDUCE.
9898 * acconfig.h: make sure that const is not defined (to empty) when
9899 we are compiling C++. Remove commented out code using SIZEOF_xx
9902 * configure.in : move the test for const and inline as late as
9903 possible so that these C tests do not interefere with C++ ones.
9904 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9905 has not been proven.
9907 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9909 * src/table.C (getDocBookAlign): remove bad default value for
9912 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9914 (ShowFileMenu2): ditto.
9916 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9919 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9921 * Most files: finished the change from the old error code to use
9922 DebugStream for all lyxerr debugging. Only minor changes remain
9923 (e.g. the setting of debug levels using strings instead of number)
9925 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9927 * src/layout.C (Add): Changed to use compare_no_case instead of
9930 * src/FontInfo.C: changed loop variable type too string::size_type.
9932 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9934 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9935 set ETAGS_ARGS to --c++
9937 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9939 * src/table.C (DocBookEndOfCell): commented out two unused variables
9941 * src/paragraph.C: commented out four unused variables.
9943 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9944 insed a if clause with type string::size_type.
9946 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9949 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9951 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9952 variable, also changed loop to go from 0 to lenght + 1, instead of
9953 -1 to length. This should be correct.
9955 * src/LaTeX.C (scanError): use string::size_type as loop variable
9958 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9959 (l.896) since y_tmp and row was not used anyway.
9961 * src/insets/insetref.C (escape): use string::size_type as loop
9964 * src/insets/insetquotes.C (Width): use string::size_type as loop
9966 (Draw): use string::size_type as loop variable type.
9968 * src/insets/insetlatexaccent.C (checkContents): use
9969 string::size_type as loop variable type.
9971 * src/insets/insetlabel.C (escape): use string::size_type as loop
9974 * src/insets/insetinfo.C: added an extern for current_view.
9976 * src/insets/insetcommand.C (scanCommand): use string::size_type
9977 as loop variable type.
9979 * most files: removed the RCS tags. With them we had to recompile
9980 a lot of files after a simple cvs commit. Also we have never used
9981 them for anything meaningful.
9983 * most files: tags-query-replace NULL 0. As adviced several plases
9984 we now use "0" instead of "NULL" in our code.
9986 * src/support/filetools.C (SpaceLess): use string::size_type as
9989 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9991 * src/paragraph.C: fixed up some more string stuff.
9993 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9995 * src/support/filetools.h: make modestr a std::string.
9997 * src/filetools.C (GetEnv): made ch really const.
9999 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10000 made code that used these use max/min from <algorithm> instead.
10002 * changed several c library include files to their equivalent c++
10003 library include files. All is not changed yet.
10005 * created a support subdir in src, put lyxstring and lstrings
10006 there + the extra files atexit, fileblock, strerror. Created
10007 Makefile.am. edited configure.in and src/Makefile.am to use this
10008 new subdir. More files moved to support.
10010 * imported som of the functions from repository lyx, filetools
10012 * ran tags-query-replace on LString -> string, corrected the bogus
10013 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10014 is still some errors in there. This is errors where too much or
10015 too litle get deleted from strings (string::erase, string::substr,
10016 string::replace), there can also be some off by one errors, or
10017 just plain wrong use of functions from lstrings. Viewing of quotes
10020 * LyX is now running fairly well with string, but there are
10021 certainly some bugs yet (see above) also string is quite different
10022 from LString among others in that it does not allow null pointers
10023 passed in and will abort if it gets any.
10025 * Added the revtex4 files I forgot when setting up the repository.
10027 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10029 * All over: Tried to clean everything up so that only the files
10030 that we really need are included in the cvs repository.
10031 * Switched to use automake.
10032 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10033 * Install has not been checked.
10035 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10037 * po/pt.po: Three errors:
10038 l.533 and l.538 format specification error
10039 l. 402 duplicate entry, I just deleted it.