1 2000-09-28 Allan Rae <rae@lyx.org>
3 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
4 that the #ifdef's had been applied to part of what should have been
5 a complete condition. It's possible there are other tests that
6 were specific to tables that are also wrong now that InsetTabular is
7 being used. Now we need to fix the output of '\n' after a table in a
8 float for the same reason as the original condition:
9 "don't insert this if we would be adding it before or after a table
10 in a float. This little trick is needed in order to allow use of
11 tables in \subfigures or \subtables."
12 Juergen can you check this?
14 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
16 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
17 outputed to the ostream.
19 * several files: fixed types based on warnings from cxx
21 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
23 * src/frontends/kde/Makefile.am: fix rule for
24 formindexdialogdata_moc.C
26 * src/.cvsignore: add ext_l10n.h to ignore
28 * acconfig.h: stop messing with __STRICT_ANSI__
29 * config/gnome.m4: remove option to set -ansi
30 * config/kde.m4: remove option to set -ansi
31 * config/lyxinclude.m4: don't set -ansi
33 2000-09-27 Juergen Vigna <jug@sad.it>
35 * various files: remove "default" language check.
37 * src/insets/insetquotes.C: removed use of current_view.
39 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
40 the one should have red ears by now!
42 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
43 in more then one paragraph. Fixed cursor-movement/selection.
45 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
46 paragraphs inside a text inset.
48 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
49 text-inset if this owner is an inset.
51 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
53 * src/Bullet.h: changed type of font, character and size to int
55 * src/buffer.C (asciiParagraph): remove actcell and fname1.
57 * src/insets/inseturl.[Ch]:
58 * src/insets/insetref.[Ch]:
59 * src/insets/insetlabel.[Ch]: add linelen to Ascii
61 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
63 * src/buffer.C (readFile): block-if statement rearranged to minimise
64 bloat. Patch does not reverse Jean-Marc's change ;-)
66 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
67 Class rewritten to store pointers to hide/update signals directly,
68 rather than Dialogs *. Also defined an enum to ease use. All xforms
69 forms can now be derived from this class.
71 * src/frontends/xforms/FormCommand.[Ch]
72 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
74 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
77 * src/frontends/xforms/forms/form_citation.fd
78 * src/frontends/xforms/forms/form_copyright.fd
79 * src/frontends/xforms/forms/form_error.fd
80 * src/frontends/xforms/forms/form_index.fd
81 * src/frontends/xforms/forms/form_ref.fd
82 * src/frontends/xforms/forms/form_toc.fd
83 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
85 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
87 * src/insets/insetfoot.C: removed redundent using directive.
89 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
91 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
92 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
94 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
95 created in the constructors in different groups. Then set() just
96 have to show the groups as needed. This fixes the redraw problems
97 (and is how the old menu code worked).
99 * src/support/lyxlib.h: declare the methods as static when we do
102 2000-09-26 Juergen Vigna <jug@sad.it>
104 * src/buffer.C (asciiParagraph): new function.
105 (writeFileAscii): new function with parameter ostream.
106 (writeFileAscii): use now asciiParagraph.
108 * various inset files: added the linelen parameter to the Ascii-func.
110 * src/tabular.C (Write): fixed error in writing file introduced by
111 the last changes from Lars.
113 * lib/bind/menus.bind: removed not supported functions.
115 * src/insets/insettext.C (Ascii): implemented this function.
117 * src/insets/lyxinset.h (Ascii): added linelen parameter.
119 * src/tabular.C (write_attribute[int,string,bool]): new functions.
120 (Write): use of the write_attribute functions.
122 * src/bufferlist.C (close): fixed reasking question!
124 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
126 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
127 new files use the everwhere possible.
130 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
131 src/log_form.C src/lyx.C:
134 * src/buffer.C (runLaTeX): remove func
136 * src/PaperLayout.C: removed file
137 * src/ParagraphExtra.C: likewise
138 * src/bullet_forms.C: likewise
139 * src/bullet_forms.h: likewise
140 * src/bullet_forms_cb.C: likewise
142 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
143 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
146 * several files: remove all traces of the old fd_form_paragraph,
147 and functions belonging to that.
149 * several files: remove all traces of the old fd_form_document,
150 and functions belonging to that.
152 * several files: constify local variables were possible.
154 * several files: remove all code that was dead when NEW_EXPORT was
157 * several files: removed string::c_str in as many places as
160 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
161 (e): be a bit more outspoken when patching
162 (updatesrc): only move files if changed.
164 * forms/layout_forms.h.patch: regenerated
166 * forms/layout_forms.fd: remove form_document and form_paragraph
167 and form_quotes and form_paper and form_table_options and
170 * forms/form1.fd: remove form_table
172 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
173 the fdui->... rewrite. Update some comments to xforms 0.88
175 * forms/bullet_forms.C.patch: removed file
176 * forms/bullet_forms.fd: likewise
177 * forms/bullet_forms.h.patch: likewise
179 * development/Code_rules/Rules: added a section on switch
180 statements. Updated some comment to xforms 0.88.
182 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
184 * src/buffer.C (readFile): make sure that the whole version number
185 is read after \lyxformat (even when it contains a comma)
187 * lib/ui/default.ui: change shortcut of math menu to M-a.
189 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
191 * src/vspace.C (nextToken): use isStrDbl() to check for proper
194 * src/LyXView.C (updateWindowTitle): show the full files name in
195 window title, limited to 30 characters.
197 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
198 When a number of characters has been given, we should not assume
199 that the string is 0-terminated.
201 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
202 calls (fixes some memory leaks)
204 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
205 trans member on exit.
207 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
209 * src/converter.C (GetReachable): fix typo.
211 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
212 understand ',' instead of '.'.
213 (GetInteger): rewrite to use strToInt().
215 2000-09-26 Juergen Vigna <jug@sad.it>
217 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
218 better visibility and error-message on wrong VSpace input.
220 * src/language.C (initL): added english again.
222 2000-09-25 Juergen Vigna <jug@sad.it>
224 * src/frontends/kde/Dialogs.C (Dialogs):
225 * src/frontends/gnome/Dialogs.C (Dialogs):
226 * src/frontends/kde/Makefile.am:
227 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
229 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
231 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
233 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
235 * src/frontends/xforms/FormParagraph.C:
236 * src/frontends/xforms/FormParagraph.h:
237 * src/frontends/xforms/form_paragraph.C:
238 * src/frontends/xforms/form_paragraph.h:
239 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
242 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
244 * src/tabular.C (OldFormatRead): forgot to delete the temporary
245 Paragraph-Data after use.
247 * src/insets/insettext.C (LocalDispatch): don't set the layout on
248 non breakable paragraphs.
250 2000-09-25 Garst R. Reese <reese@isn.net>
252 * src/language.C (initL): added missing language_country codes.
254 2000-09-25 Juergen Vigna <jug@sad.it>
256 * src/insets/insettext.C (InsetText):
257 (deleteLyXText): remove the not released LyXText structure!
259 2000-09-24 Marko Vendelin <markov@ioc.ee>
261 * src/frontends/gnome/mainapp.C
262 * src/frontends/gnome/mainapp.h: added support for keyboard
265 * src/frontends/gnome/FormCitation.C
266 * src/frontends/gnome/FormCitation.h
267 * src/frontends/gnome/Makefile.am
268 * src/frontends/gnome/pixbutton.h: completed the rewrite of
269 FormCitation to use "action area" in mainapp window
271 * src/frontends/gnome/Menubar_pimpl.C
272 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
275 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
277 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
278 width/descent/ascent values if name is empty.
279 (mathed_string_height): Use std::max.
281 2000-09-25 Allan Rae <rae@lyx.org>
283 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
284 segfault. This will be completely redesigned soon.
286 * sigc++: updated libsigc++. Fixes struct timespec bug.
288 * development/tools/makeLyXsigc.sh: .cvsignore addition
290 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
292 * several files: removed almost all traces of the old table
295 * src/TableLayout.C: removed file
297 2000-09-22 Juergen Vigna <jug@sad.it>
299 * src/frontends/kde/Dialogs.C: added credits forms.
301 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
303 * src/frontends/gnome/Dialogs.C: added some forms.
305 * src/spellchecker.C (init_spell_checker): set language in pspell code
306 (RunSpellChecker): some modifications for setting language string.
308 * src/language.[Ch]: added language_country code.
310 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
312 * src/frontends/Dialogs.h: added new signal showError.
313 Rearranged existing signals in some sort of alphabetical order.
315 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
316 FormError.[Ch], form_error.[Ch]
317 * src/frontends/xforms/forms/makefile: added new file form_error.fd
318 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
320 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
321 dialogs. I think that this can be used as the base to all these
324 * src/frontends/xforms/FormError.[Ch]
325 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
326 implementation of InsetError dialog.
328 * src/insets/inseterror.[Ch]: rendered GUI-independent.
330 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
331 * src/frontends/kde/Makefile.am: ditto
333 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
335 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
336 macrobf. This fixes a bug of invisible text.
338 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
340 * lib/doc/LaTeXConfig.lyx.in: updated.
342 * src/language.C (initL): remove language "francais" and change a
343 bit the names of the two other french variations.
345 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
346 string that may not be 0-terminated.
348 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
350 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
352 2000-09-20 Marko Vendelin <markov@ioc.ee>
354 * src/frontends/gnome/FormCitation.C
355 * src/frontends/gnome/FormIndex.C
356 * src/frontends/gnome/FormToc.C
357 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
358 the variable initialization to shut up the warnings
360 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
362 * src/table.[Ch]: deleted files
364 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
367 2000-09-18 Juergen Vigna <jug@sad.it>
369 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
370 problems with selection. Inserted new LFUN_PASTESELECTION.
371 (InsetButtonPress): inserted handling of middle mouse-button paste.
373 * src/spellchecker.C: changed word to word.c_str().
375 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
377 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
378 included in the ``make dist'' tarball.
380 2000-09-15 Juergen Vigna <jug@sad.it>
382 * src/CutAndPaste.C (cutSelection): small fix return the right
383 end position after cut inside one paragraph only.
385 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
386 we are locked as otherwise we don't have a valid cursor position!
388 * src/insets/figinset.C (draw): small bugfix but why is this needed???
390 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
392 * src/frontends/kde/FormRef.C: added using directive.
393 * src/frontends/kde/FormToc.C: ditto
395 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
397 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
399 2000-09-19 Marko Vendelin <markov@ioc.ee>
401 * src/frontends/gnome/Menubar_pimpl.C
402 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
403 Toc, ViewFormats, UpdateFormats, and ExportFormats.
405 * src/frontends/gnome/mainapp.C
406 * src/frontends/gnome/mainapp.h: support for menu update used
409 * src/frontends/gnome/mainapp.C
410 * src/frontends/gnome/mainapp.h: support for "action" area in the
411 main window. This area is used by small simple dialogs, such as
414 * src/frontends/gnome/FormIndex.C
415 * src/frontends/gnome/FormIndex.h
416 * src/frontends/gnome/FormUrl.C
417 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
420 * src/frontends/gnome/FormCitation.C
421 * src/frontends/gnome/FormCitation.h: rewrite to use main window
422 action area. Only "Insert new citation" is implemented.
424 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
426 * src/buffer.C (Dispatch): fix call to Dispatch
427 * src/insets/insetref.C (Edit): likewise
428 * src/insets/insetparent.C (Edit): likewise
429 * src/insets/insetinclude.C (include_cb): likewise
430 * src/frontends/xforms/FormUrl.C (apply): likewise
431 * src/frontends/xforms/FormToc.C (apply): likewise
432 * src/frontends/xforms/FormRef.C (apply): likewise
433 * src/frontends/xforms/FormIndex.C (apply): likewise
434 * src/frontends/xforms/FormCitation.C (apply): likewise
435 * src/lyxserver.C (callback): likewise
436 * src/lyxfunc.C (processKeySym): likewise
439 * src/lyx_cb.C (LayoutsCB): likewise
441 * Makefile.am (sourcedoc): small change
443 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
445 * src/main.C (main): Don't make an empty GUIRunTime object. all
446 methods are static. constify a bit remove unneded using + headers.
448 * src/tabular.C: some more const to local vars move some loop vars
450 * src/spellchecker.C: added some c_str after some word for pspell
452 * src/frontends/GUIRunTime.h: add new static method setDefaults
453 * src/frontends/xforms/GUIRunTime.C (setDefaults):
454 * src/frontends/kde/GUIRunTime.C (setDefaults):
455 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
457 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
458 with strnew in arg, use correct emptystring when calling SetName.
460 * several files: remove all commented code with relation to
461 HAVE_SSTREAM beeing false. We now only support stringstream and
464 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
466 * src/lyxfunc.C: construct correctly the automatic new file
469 * src/text2.C (IsStringInText): change type of variable i to shut
472 * src/support/sstream.h: do not use namespaces if the compiler
473 does not support them.
475 2000-09-15 Marko Vendelin <markov@ioc.ee>
476 * src/frontends/gnome/FormCitation.C
477 * src/frontends/gnome/FormCitation.h
478 * src/frontends/gnome/diainsertcitation_interface.c
479 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
480 regexp support to FormCitation [Gnome].
482 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
485 * configure.in: remove unused KDE/GTKGUI define
487 * src/frontends/kde/FormRef.C
488 * src/frontends/kde/FormRef.h
489 * src/frontends/kde/formrefdialog.C
490 * src/frontends/kde/formrefdialog.h: double click will
491 go to reference, now it is possible to change a cross-ref
494 * src/frontends/kde/FormToc.C
495 * src/frontends/kde/FormToc.h
496 * src/frontends/kde/formtocdialog.C
497 * src/frontends/kde/formtocdialog.h: add a depth
500 * src/frontends/kde/Makefile.am: add QtLyXView.h
503 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
505 * src/frontends/kde/FormCitation.h: added some using directives.
507 * src/frontends/kde/FormToc.h: corrected definition of doTree.
509 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
512 * src/mathed/math_defs.h: redefine SetAlign to use string rather
515 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
517 * src/buffer.C (pop_tag): revert for the second time a change by
518 Lars, who seems to really hate having non-local loop variables :)
520 * src/Lsstream.h: add "using" statements.
522 * src/support/copy.C (copy): add a bunch of std:: qualifiers
523 * src/buffer.C (writeFile): ditto
525 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
527 * src/buffer.C (writeFile): try to fix the locale modified format
528 number to always be as we want it.
530 * src/WorkArea.C (work_area_handler): try to workaround the bugs
531 in XForms 0.89. C-space is now working again.
533 * src/Lsstream.h src/support/sstream.h: new files.
535 * also commented out all cases where strstream were used.
537 * src/Bullet.h (c_str): remove method.
539 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
541 * a lot of files: get rid of "char const *" and "char *" is as
542 many places as possible. We only want to use them in interaction
543 with system of other libraries, not inside lyx.
545 * a lot of files: return const object is not of pod type. This
546 helps ensure that temporary objects is not modified. And fits well
547 with "programming by contract".
549 * configure.in: check for the locale header too
551 * Makefile.am (sourcedoc): new tag for generation of doc++
554 2000-09-14 Juergen Vigna <jug@sad.it>
556 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
557 callback to check which combo called it and do the right action.
559 * src/combox.C (combo_cb): added combo * to the callbacks.
560 (Hide): moved call of callback after Ungrab of the pointer.
562 * src/intl.h: removed LCombo2 function.
564 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
565 function as this can now be handled in one function.
567 * src/combox.h: added Combox * to callback prototype.
569 * src/frontends/xforms/Toolbar_pimpl.C:
570 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
572 2000-09-14 Garst Reese <reese@isn.net>
574 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
575 moved usepackage{xxx}'s to beginning of file. Changed left margin
576 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
577 underlining from title. Thanks to John Culleton for useful suggestions.
579 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
581 * src/lyxlex_pimpl.C (setFile): change error message to debug
584 2000-09-13 Juergen Vigna <jug@sad.it>
586 * src/frontends/xforms/FormDocument.C: implemented choice_class
587 as combox and give callback to combo_language so OK/Apply is activated
590 * src/bufferlist.C (newFile): small fix so already named files
591 (via an open call) are not requested to be named again on the
594 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
596 * src/frontends/kde/Makefile.am
597 * src/frontends/kde/FormRef.C
598 * src/frontends/kde/FormRef.h
599 * src/frontends/kde/formrefdialog.C
600 * src/frontends/kde/formrefdialog.h: implement
603 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
605 * src/frontends/kde/formtocdialog.C
606 * src/frontends/kde/formtocdialog.h
607 * src/frontends/kde/FormToc.C
608 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
610 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
612 * src/frontends/kde/FormCitation.C: fix thinko
613 where we didn't always display the reference text
616 * src/frontends/kde/formurldialog.C
617 * src/frontends/kde/formurldialog.h
618 * src/frontends/kde/FormUrl.C
619 * src/frontends/kde/FormUrl.h: minor cleanups
621 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
623 * src/frontends/kde/Makefile.am
624 * src/frontends/kde/FormToc.C
625 * src/frontends/kde/FormToc.h
626 * src/frontends/kde/FormCitation.C
627 * src/frontends/kde/FormCitation.h
628 * src/frontends/kde/FormIndex.C
629 * src/frontends/kde/FormIndex.h
630 * src/frontends/kde/formtocdialog.C
631 * src/frontends/kde/formtocdialog.h
632 * src/frontends/kde/formcitationdialog.C
633 * src/frontends/kde/formcitationdialog.h
634 * src/frontends/kde/formindexdialog.C
635 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
637 2000-09-12 Juergen Vigna <jug@sad.it>
639 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
642 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
644 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
647 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
649 * src/converter.C (Add, Convert): Added support for converter flags:
650 needaux, resultdir, resultfile.
651 (Convert): Added new parameter view_file.
652 (dvips_options): Fixed letter paper option.
654 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
655 (Export, GetExportableFormats, GetViewableFormats): Added support
658 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
660 (easyParse): Fixed to work with new export code.
662 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
665 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
667 * lib/bind/*.bind: Replaced
668 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
669 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
671 2000-09-11 Juergen Vigna <jug@sad.it>
673 * src/lyx_gui.C (runTime): uses global guiruntime variable.
675 * src/main.C (main): now GUII defines global guiruntime!
677 * src/frontends/gnome/GUIRunTime.C (initApplication):
678 * src/frontends/kde/GUIRunTime.C (initApplication):
679 * src/frontends/xforms/GUIRunTime.C (initApplication):
680 * src/frontends/GUIRunTime.h: added new function initApplication.
682 * src/spellchecker.C (sc_accept_word): change to add_to_session.
684 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
686 2000-09-08 Juergen Vigna <jug@sad.it>
688 * src/lyx_gui.C (create_forms): don't display the "default" entry as
689 we have already "Reset".
691 * src/language.C (initL): inserted "default" language and made this
692 THE default language (and not american!)
694 * src/paragraph.C: inserted handling of "default" language!
696 * src/lyxfont.C: ditto
700 * src/paragraph.C: output the \\par only if we have a following
701 paragraph otherwise it's not needed.
703 2000-09-05 Juergen Vigna <jug@sad.it>
705 * config/pspell.m4: added entry to lyx-flags
707 * src/spellchecker.C: modified version from Kevin for using pspell
709 2000-09-01 Marko Vendelin <markov@ioc.ee>
710 * src/frontends/gnome/Makefile.am
711 * src/frontends/gnome/FormCitation.C
712 * src/frontends/gnome/FormCitation.h
713 * src/frontends/gnome/diainsertcitation_callbacks.c
714 * src/frontends/gnome/diainsertcitation_callbacks.h
715 * src/frontends/gnome/diainsertcitation_interface.c
716 * src/frontends/gnome/diainsertcitation_interface.h
717 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
718 dialog for Gnome frontend
720 * src/main.C: Gnome libraries require keeping application name
721 and its version as strings
723 * src/frontends/gnome/mainapp.C: Change the name of the main window
724 from GnomeLyX to PACKAGE
726 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
728 * src/frontends/Liason.C: add "using: declaration.
730 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
732 * src/mathed/math_macro.C (Metrics): Set the size of the template
734 * src/mathed/formulamacro.C (Latex): Fixed the returned value
736 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
738 * src/converter.C (add_options): New function.
739 (SetViewer): Change $$FName into '$$FName'.
740 (View): Add options when running xdvi
741 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
742 (Convert): The 3rd parameter is now the desired filename. Converts
743 calls to lyx::rename if necessary.
744 Add options when running dvips.
745 (dvi_papersize,dvips_options): New methods.
747 * src/exporter.C (Export): Use getLatexName() instead of fileName().
749 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
750 using a call to Converter::dvips_options.
751 Fixed to work with nex export code.
754 * src/support/rename.C: New files
756 * src/support/syscall.h
757 * src/support/syscall.C: Added Starttype SystemDontWait.
759 * lib/ui/default.ui: Changed to work with new export code
761 * lib/configure.m4: Changed to work with new export code
763 * src/encoding.C: Changed latex name for iso8859_7 encoding.
765 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
767 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
768 so that code compiles with DEC cxx.
770 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
771 to work correctly! Also now supports the additional elements
774 2000-09-01 Allan Rae <rae@lyx.org>
776 * src/frontends/ButtonPolicies.C: renamed all the references to
777 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
779 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
780 since it's a const not a type.
782 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
784 2000-08-31 Juergen Vigna <jug@sad.it>
786 * src/insets/figinset.C: Various changes to look if the filename has
787 an extension and if not add it for inline previewing.
789 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
791 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
792 make buttonStatus and isReadOnly be const methods. (also reflect
793 this in derived classes.)
795 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
796 (nextState): change to be static inline, pass the StateMachine as
798 (PreferencesPolicy): remove casts
799 (OkCancelPolicy): remvoe casts
800 (OkCancelReadOnlyPolicy): remove casts
801 (NoRepeatedApplyReadOnlyPolicy): remove casts
802 (OkApplyCancelReadOnlyPolicy): remove casts
803 (OkApplyCancelPolicy): remove casts
804 (NoRepeatedApplyPolicy): remove casts
806 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
808 * src/converter.C: added some using directives
810 * src/frontends/ButtonPolicies.C: changes to overcome
811 "need lvalue" error with DEC c++
813 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
814 to WMHideCB for DEC c++
816 * src/frontends/xforms/Menubar_pimpl.C: added using directive
818 * src/frontends/xforms/forms/form_document.C.patch: use C callback
819 to BulletBMTableCB for DEC c++
821 2000-08-31 Allan Rae <rae@lyx.org>
823 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
824 character dialog separately from old document dialogs combo_language.
827 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
829 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
830 Removed LFUN_REF_CREATE.
832 * src/MenuBackend.C: Added new tags: toc and references
834 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
835 (add_lastfiles, add_documents, add_formats): Removed the unused smn
837 (add_toc, add_references): New methods.
838 (create_submenu): Handle correctly the case when there is a
839 seperator after optional menu items.
841 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
842 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
843 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
845 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
847 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
849 * src/converter.[Ch]: New file for converting between different
852 * src/export.[Ch]: New file for exporting a LyX file to different
855 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
856 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
857 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
858 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
859 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
860 RunDocBook, MenuExport.
862 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
863 Exporter::Preview methods if NEW_EXPORT is defined.
865 * src/buffer.C (Dispatch): Use Exporter::Export.
867 * src/lyxrc.C: Added new tags: \converter and \viewer.
870 * src/LyXAction.C: Define new lyx-function: buffer-update.
871 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
872 when NEW_EXPORT is defined.
874 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
876 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
878 * lib/ui/default.ui: Added submenus "view" and "update" to the
881 * src/filetools.C (GetExtension): New function.
883 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
885 2000-08-29 Allan Rae <rae@lyx.org>
887 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
889 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
890 (EnableDocumentLayout): removed
891 (DisableDocumentLayout): removed
892 (build): make use of ButtonController's read-only handling to
893 de/activate various objects. Replaces both of the above functions.
895 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
896 (readOnly): was read_only
897 (refresh): fixed dumb mistakes with read_only_ handling
899 * src/frontends/xforms/forms/form_document.fd:
900 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
901 tabbed dialogs so the tabs look more like tabs and so its easier to
902 work out which is the current tab.
904 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
905 segfault with form_table
907 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
909 2000-08-28 Juergen Vigna <jug@sad.it>
911 * acconfig.h: added USE_PSPELL.
913 * src/config.h.in: added USE_PSPELL.
915 * autogen.sh: added pspell.m4
917 * config/pspell.m4: new file.
919 * src/spellchecker.C: implemented support for pspell libary.
921 2000-08-25 Juergen Vigna <jug@sad.it>
923 * src/LyXAction.C (init): renamed LFUN_TABLE to
924 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
926 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
928 * src/lyxscreen.h: add force_clear variable and fuction to force
929 a clear area when redrawing in LyXText.
931 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
933 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
935 * some whitespace and comment changes.
937 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
939 * src/buffer.C: up te LYX_FORMAT to 2.17
941 2000-08-23 Juergen Vigna <jug@sad.it>
943 * src/BufferView_pimpl.C (tripleClick): disable this when in a
946 * src/insets/insettabular.C (pasteSelection): delete the insets
947 LyXText as it is not valid anymore.
948 (copySelection): new function.
949 (pasteSelection): new function.
950 (cutSelection): new function.
951 (LocalDispatch): implemented cut/copy/paste of cell selections.
953 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
954 don't have a LyXText.
956 * src/LyXAction.C (init): a NEW_TABULAR define too much.
958 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
961 2000-08-22 Juergen Vigna <jug@sad.it>
963 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
964 ifdef form_table out if NEW_TABULAR.
966 2000-08-21 Juergen Vigna <jug@sad.it>
968 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
969 (draw): fixed draw position so that the cursor is positioned in the
971 (InsetMotionNotify): hide/show cursor so the position is updated.
972 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
973 using cellstart() function where it should be used.
975 * src/insets/insettext.C (draw): ditto.
977 * src/tabular.C: fixed initialization of some missing variables and
978 made BoxType into an enum.
980 2000-08-22 Marko Vendelin <markov@ioc.ee>
981 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
982 stock menu item using action numerical value, not its string
986 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
988 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
989 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
991 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
993 * src/frontends/xforms/GUIRunTime.C: new file
995 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
996 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
998 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1000 * src/frontends/kde/GUIRunTime.C: new file
1002 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1003 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1005 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1007 * src/frontends/gnome/GUIRunTime.C: new file
1009 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1012 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1013 small change to documetentation.
1015 * src/frontends/GUIRunTime.C: removed file
1017 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1019 * src/lyxparagraph.h: enable NEW_TABULAR as default
1021 * src/lyxfunc.C (processKeySym): remove some commented code
1023 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1024 NEW_TABULAR around the fd_form_table_options.
1026 * src/lyx_gui.C (runTime): call the static member function as
1027 GUIRunTime::runTime().
1029 2000-08-21 Allan Rae <rae@lyx.org>
1031 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1034 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1036 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1038 2000-08-21 Allan Rae <rae@lyx.org>
1040 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1041 keep Garst happy ;-)
1042 * src/frontends/xforms/FormPreferences.C (build): use setOK
1043 * src/frontends/xforms/FormDocument.C (build): use setOK
1044 (FormDocument): use the appropriate policy.
1046 2000-08-21 Allan Rae <rae@lyx.org>
1048 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1049 automatic [de]activation of arbitrary objects when in a read-only state.
1051 * src/frontends/ButtonPolicies.h: More documentation
1052 (isReadOnly): added to support the above.
1054 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1056 2000-08-18 Juergen Vigna <jug@sad.it>
1058 * src/insets/insettabular.C (getStatus): changed to return func_status.
1060 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1061 display toggle menu entries if they are.
1063 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1064 new document layout now.
1066 * src/lyxfunc.C: ditto
1068 * src/lyx_gui_misc.C: ditto
1070 * src/lyx_gui.C: ditto
1072 * lib/ui/default.ui: removed paper and quotes layout as they are now
1073 all in the document layout tabbed folder.
1075 * src/frontends/xforms/forms/form_document.fd: added Restore
1076 button and callbacks for all inputs for Allan's ButtonPolicy.
1078 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1079 (CheckChoiceClass): added missing params setting on class change.
1080 (UpdateLayoutDocument): added for updating the layout on params.
1081 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1082 (FormDocument): Implemented Allan's ButtonPolicy with the
1085 2000-08-17 Allan Rae <rae@lyx.org>
1087 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1088 so we can at least see the credits again.
1090 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1091 controller calls for the appropriate callbacks. Note that since Ok
1092 calls apply followed by cancel, and apply isn't a valid input for the
1093 APPLIED state, the bc_ calls have to be made in the static callback not
1094 within each of the real callbacks.
1096 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1097 (setOk): renamed from setOkay()
1099 2000-08-17 Juergen Vigna <jug@sad.it>
1101 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1102 in the implementation part.
1103 (composeUIInfo): don't show optional menu-items.
1105 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1107 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1109 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1110 text-state when in a text-inset.
1112 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1114 2000-08-17 Marko Vendelin <markov@ioc.ee>
1115 * src/frontends/gnome/FormIndex.C
1116 * src/frontends/gnome/FormIndex.h
1117 * src/frontends/gnome/FormToc.C
1118 * src/frontends/gnome/FormToc.h
1119 * src/frontends/gnome/dialogs
1120 * src/frontends/gnome/diatoc_callbacks.c
1121 * src/frontends/gnome/diatoc_callbacks.h
1122 * src/frontends/gnome/diainsertindex_callbacks.h
1123 * src/frontends/gnome/diainsertindex_callbacks.c
1124 * src/frontends/gnome/diainsertindex_interface.c
1125 * src/frontends/gnome/diainsertindex_interface.h
1126 * src/frontends/gnome/diatoc_interface.h
1127 * src/frontends/gnome/diatoc_interface.c
1128 * src/frontends/gnome/Makefile.am: Table of Contents and
1129 Insert Index dialogs implementation for Gnome frontend
1131 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1133 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1135 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1138 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1140 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1141 destructor. Don't definde if you don't need it
1142 (processEvents): made static, non-blocking events processing for
1144 (runTime): static method. event loop for xforms
1145 * similar as above for kde and gnome.
1147 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1148 new Pimpl is correct
1149 (runTime): new method calss the real frontends runtime func.
1151 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1153 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1155 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1157 2000-08-16 Juergen Vigna <jug@sad.it>
1159 * src/lyx_gui.C (runTime): added GUII RunTime support.
1161 * src/frontends/Makefile.am:
1162 * src/frontends/GUIRunTime.[Ch]:
1163 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1164 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1165 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1167 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1169 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1170 as this is already set in ${FRONTEND_INCLUDE} if needed.
1172 * configure.in (CPPFLAGS): setting the include dir for the frontend
1173 directory and don't set FRONTEND=xforms for now as this is executed
1176 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1178 * src/frontends/kde/Makefile.am:
1179 * src/frontends/kde/FormUrl.C:
1180 * src/frontends/kde/FormUrl.h:
1181 * src/frontends/kde/formurldialog.h:
1182 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1184 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1186 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1188 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1190 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1193 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1195 * src/WorkArea.C (work_area_handler): more work to get te
1196 FL_KEYBOARD to work with xforms 0.88 too, please test.
1198 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1200 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1202 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1205 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1207 * src/Timeout.h: remove Qt::emit hack.
1209 * several files: changes to allo doc++ compilation
1211 * src/lyxfunc.C (processKeySym): new method
1212 (processKeyEvent): comment out if FL_REVISION < 89
1214 * src/WorkArea.C: change some debugging levels.
1215 (WorkArea): set wantkey to FL_KEY_ALL
1216 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1217 clearer code and the use of compose with XForms 0.89. Change to
1218 use signals instead of calling methods in bufferview directly.
1220 * src/Painter.C: change some debugging levels.
1222 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1225 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1226 (workAreaKeyPress): new method
1228 2000-08-14 Juergen Vigna <jug@sad.it>
1230 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1232 * config/kde.m4: addes some features
1234 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1235 include missing xforms dialogs.
1237 * src/Timeout.h: a hack to be able to compile with qt/kde.
1239 * sigc++/.cvsignore: added acinclude.m4
1241 * lib/.cvsignore: added listerros
1243 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1244 xforms tree as objects are needed for other frontends.
1246 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1247 linking with not yet implemented xforms objects.
1249 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1251 2000-08-14 Baruch Even <baruch.even@writeme.com>
1253 * src/frontends/xforms/FormGraphics.h:
1254 * src/frontends/xforms/FormGraphics.C:
1255 * src/frontends/xforms/RadioButtonGroup.h:
1256 * src/frontends/xforms/RadioButtonGroup.C:
1257 * src/insets/insetgraphics.h:
1258 * src/insets/insetgraphics.C:
1259 * src/insets/insetgraphicsParams.h:
1260 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1261 instead of spaces, and various other indentation issues to make the
1262 sources more consistent.
1264 2000-08-14 Marko Vendelin <markov@ioc.ee>
1266 * src/frontends/gnome/dialogs/diaprint.glade
1267 * src/frontends/gnome/FormPrint.C
1268 * src/frontends/gnome/FormPrint.h
1269 * src/frontends/gnome/diaprint_callbacks.c
1270 * src/frontends/gnome/diaprint_callbacks.h
1271 * src/frontends/gnome/diaprint_interface.c
1272 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1275 * src/frontends/gnome/dialogs/diainserturl.glade
1276 * src/frontends/gnome/FormUrl.C
1277 * src/frontends/gnome/FormUrl.h
1278 * src/frontends/gnome/diainserturl_callbacks.c
1279 * src/frontends/gnome/diainserturl_callbacks.h
1280 * src/frontends/gnome/diainserturl_interface.c
1281 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1282 Gnome implementation
1284 * src/frontends/gnome/Dialogs.C
1285 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1286 all other dialogs. Copy all unimplemented dialogs from Xforms
1289 * src/frontends/gnome/support.c
1290 * src/frontends/gnome/support.h: support files generated by Glade
1294 * config/gnome.m4: Gnome configuration scripts
1296 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1297 configure --help message
1299 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1300 only if there are no events pendling in Gnome/Gtk. This enhances
1301 the performance of menus.
1304 2000-08-14 Allan Rae <rae@lyx.org>
1306 * lib/Makefile.am: listerrors cleaning
1308 * lib/listerrors: removed -- generated file
1309 * acinclude.m4: ditto
1310 * sigc++/acinclude.m4: ditto
1312 * src/frontends/xforms/forms/form_citation.fd:
1313 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1316 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1317 `updatesrc` and now we have a `test` target that does what `updatesrc`
1318 used to do. I didn't like having an install target that wasn't related
1321 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1322 on all except FormGraphics. This may yet happen. Followed by a major
1323 cleanup including using FL_TRANSIENT for most of the dialogs. More
1324 changes to come when the ButtonController below is introduced.
1326 * src/frontends/xforms/ButtonController.h: New file for managing up to
1327 four buttons on a dialog according to an externally defined policy.
1328 * src/frontends/xforms/Makefile.am: added above
1330 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1331 Apply and Cancel/Close buttons and everything in between and beyond.
1332 * src/frontends/Makefile.am: added above.
1334 * src/frontends/xforms/forms/form_preferences.fd:
1335 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1336 and removed variable 'status' as a result. Fixed the set_minsize thing.
1337 Use the new screen-font-update after checking screen fonts were changed
1338 Added a "Restore" button to restore the original lyxrc values while
1339 editing. This restores everything not just the last input changed.
1340 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1342 * src/LyXAction.C: screen-font-update added for updating buffers after
1343 screen font settings have been changed.
1344 * src/commandtags.h: ditto
1345 * src/lyxfunc.C: ditto
1347 * forms/lyx.fd: removed screen fonts dialog.
1348 * src/lyx_gui.C: ditto
1349 * src/menus.[Ch]: ditto
1350 * src/lyx.[Ch]: ditto
1351 * src/lyx_cb.C: ditto + code from here moved to make
1352 screen-font-update. And people wonder why progress on GUII is
1353 slow. Look at how scattered this stuff was! It takes forever
1356 * forms/fdfix.sh: Fixup the spacing after commas.
1357 * forms/makefile: Remove date from generated files. Fewer clashes now.
1358 * forms/bullet_forms.C.patch: included someones handwritten changes
1360 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1361 once I've discovered why LyXRC was made noncopyable.
1362 * src/lyx_main.C: ditto
1364 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1366 * src/frontends/xforms/forms/fdfix.sh:
1367 * src/frontends/xforms/forms/fdfixh.sed:
1368 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1369 * src/frontends/xforms/Form*.[hC]:
1370 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1371 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1372 provide a destructor for the struct FD_form_xxxx. Another version of
1373 the set_[max|min]size workaround and a few other cleanups. Actually,
1374 Angus' patch from 20000809.
1376 2000-08-13 Baruch Even <baruch.even@writeme.com>
1378 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1381 2000-08-11 Juergen Vigna <jug@sad.it>
1383 * src/insets/insetgraphics.C (InsetGraphics): changing init
1384 order because of warnings.
1386 * src/frontends/xforms/forms/makefile: adding patching .C with
1389 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1390 from .C.patch to .c.patch
1392 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1393 order because of warning.
1395 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1397 * src/frontends/Liason.C (setMinibuffer): new helper function
1399 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1401 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1403 * lib/ui/default.ui: commented out PaperLayout entry
1405 * src/frontends/xforms/form_document.[Ch]: new added files
1407 * src/frontends/xforms/FormDocument.[Ch]: ditto
1409 * src/frontends/xforms/forms/form_document.fd: ditto
1411 * src/frontends/xforms/forms/form_document.C.patch: ditto
1413 2000-08-10 Juergen Vigna <jug@sad.it>
1415 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1416 (InsetGraphics): initialized cacheHandle to 0.
1417 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1419 2000-08-10 Baruch Even <baruch.even@writeme.com>
1421 * src/graphics/GraphicsCache.h:
1422 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1423 correctly as a cache.
1425 * src/graphics/GraphicsCacheItem.h:
1426 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1429 * src/graphics/GraphicsCacheItem_pimpl.h:
1430 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1433 * src/insets/insetgraphics.h:
1434 * src/insets/insetgraphics.C: Changed from using a signal notification
1435 to polling when image is not loaded.
1437 2000-08-10 Allan Rae <rae@lyx.org>
1439 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1440 that there are two functions that have to been taken out of line by
1441 hand and aren't taken care of in the script. (Just a reminder note)
1443 * sigc++/macros/*.h.m4: Updated as above.
1445 2000-08-09 Juergen Vigna <jug@sad.it>
1447 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1449 * src/insets/insettabular.C: make drawing of single cell smarter.
1451 2000-08-09 Marko Vendelin <markov@ioc.ee>
1452 * src/frontends/gnome/Menubar_pimpl.C
1453 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1454 implementation: new files
1456 * src/frontends/gnome/mainapp.C
1457 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1460 * src/main.C: create Gnome main window
1462 * src/frontends/xforms/Menubar_pimpl.h
1463 * src/frontends/Menubar.C
1464 * src/frontends/Menubar.h: added method Menubar::update that calls
1465 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1467 * src/LyXView.C: calls Menubar::update to update the state
1470 * src/frontends/gnome/Makefile.am: added new files
1472 * src/frontends/Makefile.am: added frontend compiler options
1474 2000-08-08 Juergen Vigna <jug@sad.it>
1476 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1478 * src/bufferlist.C (close):
1479 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1480 documents if exiting without saving.
1482 * src/buffer.C (save): use removeAutosaveFile()
1484 * src/support/filetools.C (removeAutosaveFile): new function.
1486 * src/lyx_cb.C (MenuWrite): returns a bool now.
1487 (MenuWriteAs): check if file could really be saved and revert to the
1489 (MenuWriteAs): removing old autosavefile if existant.
1491 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1492 before Goto toggle declaration, because of compiler warning.
1494 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1496 * src/lyxfunc.C (MenuNew): small fix.
1498 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1500 * src/bufferlist.C (newFile):
1501 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1503 * src/lyxrc.C: added new_ask_filename tag
1505 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1507 * src/lyx.fd: removed code pertaining to form_ref
1508 * src/lyx.[Ch]: ditto
1509 * src/lyx_cb.C: ditto
1510 * src/lyx_gui.C: ditto
1511 * src/lyx_gui_misc.C: ditto
1513 * src/BufferView_pimpl.C (restorePosition): update buffer only
1516 * src/commandtags.h (LFUN_REFTOGGLE): removed
1517 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1518 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1519 (LFUN_REFBACK): renamed LFUN_REF_BACK
1521 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1522 * src/menus.C: ditto
1523 * src/lyxfunc.C (Dispatch): ditto.
1524 InsertRef dialog is now GUI-independent.
1526 * src/texrow.C: added using std::endl;
1528 * src/insets/insetref.[Ch]: strip out large amounts of code.
1529 The inset is now a container and this functionality is now
1530 managed by a new FormRef dialog
1532 * src/frontends/Dialogs.h (showRef, createRef): new signals
1534 * src/frontends/xforms/FormIndex.[Ch],
1535 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1536 when setting dialog's min/max size
1537 * src/frontends/xforms/FormIndex.[Ch]: ditto
1539 * src/frontends/xforms/FormRef.[Ch],
1540 src/frontends/xforms/forms/form_ref.fd: new xforms
1541 implementation of an InsetRef dialog
1543 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1546 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1547 ios::nocreate is not part of the standard. Removed.
1549 2000-08-07 Baruch Even <baruch.even@writeme.com>
1551 * src/graphics/Renderer.h:
1552 * src/graphics/Renderer.C: Added base class for rendering of different
1553 image formats into Pixmaps.
1555 * src/graphics/XPM_Renderer.h:
1556 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1557 in a different class.
1559 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1560 easily add support for other formats.
1562 * src/insets/figinset.C: plugged a leak of an X resource.
1564 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1566 * src/CutAndPaste.[Ch]: make all metods static.
1568 * development/Code_rules/Rules: more work, added section on
1569 Exceptions, and a References section.
1571 * a lot of header files: work to make doc++ able to generate the
1572 source documentation, some workarounds of doc++ problems. Doc++ is
1573 now able to generate the documentation.
1575 2000-08-07 Juergen Vigna <jug@sad.it>
1577 * src/insets/insettabular.C (recomputeTextInsets): removed function
1579 * src/tabular.C (SetWidthOfMulticolCell):
1581 (calculate_width_of_column_NMC): fixed return value so that it really
1582 only returns true if the column-width has changed (there where
1583 problems with muliticolumn-cells in this column).
1585 2000-08-04 Juergen Vigna <jug@sad.it>
1587 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1588 also on the scrollstatus of the inset.
1589 (workAreaMotionNotify): ditto.
1591 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1593 2000-08-01 Juergen Vigna <jug@sad.it>
1595 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1597 * src/commandtags.h:
1598 * src/LyXAction.C (init):
1599 * src/insets/inset.C (LocalDispatch): added support for
1602 * src/insets/inset.C (scroll): new functions.
1604 * src/insets/insettext.C (removeNewlines): new function.
1605 (SetAutoBreakRows): removes forced newlines in the text of the
1606 paragraph if autoBreakRows is set to false.
1608 * src/tabular.C (Latex): generates a parbox around the cell contents
1611 * src/frontends/xforms/FormTabular.C (local_update): removed
1612 the radio_useparbox button.
1614 * src/tabular.C (UseParbox): new function
1616 2000-08-06 Baruch Even <baruch.even@writeme.com>
1618 * src/graphics/GraphicsCache.h:
1619 * src/graphics/GraphicsCache.C:
1620 * src/graphics/GraphicsCacheItem.h:
1621 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1624 * src/insets/insetgraphics.h:
1625 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1626 drawing of the inline image.
1628 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1629 into the wrong position.
1631 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1634 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1636 * src/support/translator.h: move all typedefs to public section
1638 * src/support/filetools.C (MakeLatexName): return string const
1640 (TmpFileName): ditto
1641 (FileOpenSearch): ditto
1643 (LibFileSearch): ditto
1644 (i18nLibFileSearch): ditto
1647 (CreateTmpDir): ditto
1648 (CreateBufferTmpDir): ditto
1649 (CreateLyXTmpDir): ditto
1652 (MakeAbsPath): ditto
1654 (OnlyFilename): ditto
1656 (NormalizePath): ditto
1657 (CleanupPath): ditto
1658 (GetFileContents): ditto
1659 (ReplaceEnvironmentPath): ditto
1660 (MakeRelPath): ditto
1662 (ChangeExtension): ditto
1663 (MakeDisplayPath): ditto
1664 (do_popen): return cmdret const
1665 (findtexfile): return string const
1667 * src/support/DebugStream.h: add some /// to please doc++
1669 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1671 * src/texrow.C (same_rownumber): functor to use with find_if
1672 (getIdFromRow): rewritten to use find_if and to not update the
1673 positions. return true if row is found
1674 (increasePos): new method, use to update positions
1676 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1678 * src/lyxlex_pimpl.C (verifyTable): new method
1681 (GetString): return string const
1682 (pushTable): rewrite to use std::stack
1684 (setFile): better check
1687 * src/lyxlex.h: make LyXLex noncopyable
1689 * src/lyxlex.C (text): return char const * const
1690 (GetString): return string const
1691 (getLongString): return string const
1693 * src/lyx_gui_misc.C (askForText): return pair<...> const
1695 * src/lastfiles.[Ch] (operator): return string const
1697 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1698 istringstream not char const *.
1699 move token.end() out of loop.
1700 (readFile): move initializaton of token
1702 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1703 getIdFromRow is successful.
1705 * lib/bind/emacs.bind: don't include menus bind
1707 * development/Code_rules/Rules: the beginnings of making this
1708 better and covering more of the unwritten rules that we have.
1710 * development/Code_rules/Recommendations: a couple of wording
1713 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1715 * src/support/strerror.c: remove C++ comment.
1717 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1719 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1720 LFUN_INDEX_INSERT_LAST
1722 * src/texrow.C (getIdFromRow): changed from const_iterator to
1723 iterator, allowing code to compile with DEC cxx
1725 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1726 stores part of the class, as suggested by Allan. Will allow
1728 (apply): test to apply uses InsetCommandParams operator!=
1730 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1731 (apply): test to apply uses InsetCommandParams operator!=
1733 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1734 stores part of the class.
1735 (update): removed limits on min/max size.
1737 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1738 (apply): test to apply uses InsetCommandParams operator!=
1740 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1741 (Read, Write, scanCommand, getCommand): moved functionality
1742 into InsetCommandParams.
1744 (getScreenLabel): made pure virtual
1745 new InsetCommandParams operators== and !=
1747 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1748 c-tors based on InsetCommandParams. Removed others.
1749 * src/insets/insetinclude.[Ch]: ditto
1750 * src/insets/insetlabel.[Ch]: ditto
1751 * src/insets/insetparent.[Ch]: ditto
1752 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1754 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1755 insets derived from InsetCommand created using similar c-tors
1756 based on InsetCommandParams
1757 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1758 * src/menus.C (ShowRefsMenu): ditto
1759 * src/paragraph.C (Clone): ditto
1760 * src/text2.C (SetCounter): ditto
1761 * src/lyxfunc.C (Dispatch) ditto
1762 Also recreated old InsetIndex behaviour exactly. Can now
1763 index-insert at the start of a paragraph and index-insert-last
1764 without launching the pop-up.
1766 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1768 * lib/lyxrc.example: mark te pdf options as non functional.
1770 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1771 (isStrDbl): move tmpstr.end() out of loop.
1772 (strToDbl): move intialization of tmpstr
1773 (lowercase): return string const and move tmp.end() out of loop.
1774 (uppercase): return string const and move tmp.edn() out of loop.
1775 (prefixIs): add assertion
1780 (containsOnly): ditto
1781 (containsOnly): ditto
1782 (containsOnly): ditto
1783 (countChar): make last arg char not char const
1784 (token): return string const
1785 (subst): return string const, move tmp.end() out of loop.
1786 (subst): return string const, add assertion
1787 (strip): return string const
1788 (frontStrip): return string const, add assertion
1789 (frontStrip): return string const
1794 * src/support/lstrings.C: add inclde "LAssert.h"
1795 (isStrInt): move tmpstr.end() out of loop.
1797 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1798 toollist.end() out of loop.
1799 (deactivate): move toollist.end() out of loop.
1800 (update): move toollist.end() out of loop.
1801 (updateLayoutList): move tc.end() out of loop.
1802 (add): move toollist.end() out of loop.
1804 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1805 md.end() out of loop.
1807 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1809 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1812 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1813 (Erase): move insetlist.end() out of loop.
1815 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1816 ref to const string as first arg. Move initialization of some
1817 variables, whitespace changes.
1819 * src/kbmap.C (defkey): move table.end() out of loop.
1820 (kb_keymap): move table.end() out of loop.
1821 (findbinding): move table.end() out of loop.
1823 * src/MenuBackend.C (hasMenu): move end() out of loop.
1824 (getMenu): move end() out of loop.
1825 (getMenu): move menulist_.end() out of loop.
1827 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1829 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1832 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1833 (getFromLyXName): move infotab.end() out of loop.
1835 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1836 -fvtable-thunks -ffunction-sections -fdata-sections
1838 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1840 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1843 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1845 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1847 * src/frontends/xforms/FormCitation.[Ch],
1848 src/frontends/xforms/FormIndex.[Ch],
1849 src/frontends/xforms/FormToc.[Ch],
1850 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1852 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1854 * src/commandtags.h: renamed, created some flags for citation
1857 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1859 * src/lyxfunc.C (dispatch): use signals to insert index entry
1861 * src/frontends/Dialogs.h: new signal createIndex
1863 * src/frontends/xforms/FormCommand.[Ch],
1864 src/frontends/xforms/FormCitation.[Ch],
1865 src/frontends/xforms/FormToc.[Ch],
1866 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1868 * src/insets/insetindex.[Ch]: GUI-independent
1870 * src/frontends/xforms/FormIndex.[Ch],
1871 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1874 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1876 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1877 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1879 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1881 * src/insets/insetref.C (Latex): rewrite so that there is now
1882 question that a initialization is requested.
1884 * src/insets/insetcommand.h: reenable the hide signal
1886 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1888 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1889 fix handling of shortcuts (many bugs :)
1890 (add_lastfiles): ditto.
1892 * lib/ui/default.ui: fix a few shortcuts.
1894 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1896 * Makefile.am: Fix ``rpmdist'' target to return the exit
1897 status of the ``rpm'' command, instead of the last command in
1898 the chain (the ``rm lyx.xpm'' command, which always returns
1901 2000-08-02 Allan Rae <rae@lyx.org>
1903 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1904 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1905 * src/frontends/xforms/FormToc.C (FormToc): ditto
1907 * src/frontends/xforms/Makefile.am: A few forgotten files
1909 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1910 Signals-not-copyable-problem Lars' started commenting out.
1912 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1914 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1916 * src/insets/insetcommand.h: Signals is not copyable so anoter
1917 scheme for automatic hiding of forms must be used.
1919 * src/frontends/xforms/FormCitation.h: don't inerit from
1920 noncopyable, FormCommand already does that.
1921 * src/frontends/xforms/FormToc.h: ditto
1922 * src/frontends/xforms/FormUrl.h: ditto
1924 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1926 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1928 * src/insets/insetcommand.h (hide): new SigC::Signal0
1929 (d-tor) new virtual destructor emits hide signal
1931 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1932 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1934 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1935 LOF and LOT. Inset is now GUI-independent
1937 * src/insets/insetloa.[Ch]: redundant
1938 * src/insets/insetlof.[Ch]: ditto
1939 * src/insets/insetlot.[Ch]: ditto
1941 * src/frontends/xforms/forms/form_url.fd: tweaked!
1942 * src/frontends/xforms/forms/form_citation.fd: ditto
1944 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1945 dialogs dealing with InsetCommand insets
1947 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1948 FormCommand base class
1949 * src/frontends/xforms/FormUrl.[Ch]: ditto
1951 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1953 * src/frontends/xforms/FormToc.[Ch]: ditto
1955 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1956 passed a generic InsetCommand pointer
1957 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1959 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1960 and modified InsetTOC class
1961 * src/buffer.C: ditto
1963 * forms/lyx.fd: strip out old FD_form_toc code
1964 * src/lyx_gui_misc.C: ditto
1965 * src/lyx_gui.C: ditto
1966 * src/lyx_cb.C: ditto
1967 * src/lyx.[Ch]: ditto
1969 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1971 * src/support/utility.hpp: tr -d '\r'
1973 2000-08-01 Juergen Vigna <jug@sad.it>
1975 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1977 * src/commandtags.h:
1978 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1979 LFUN_TABULAR_FEATURES.
1981 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1982 LFUN_LAYOUT_TABULAR.
1984 * src/insets/insettabular.C (getStatus): implemented helper function.
1986 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1988 2000-07-31 Juergen Vigna <jug@sad.it>
1990 * src/text.C (draw): fixed screen update problem for text-insets.
1992 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1993 something changed probably this has to be added in various other
1996 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1998 2000-07-31 Baruch Even <baruch.even@writeme.com>
2000 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2001 templates to satisfy compaq cxx.
2004 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2006 * src/support/translator.h (equal_1st_in_pair::operator()): take
2007 const ref pair_type as arg.
2008 (equal_2nd_in_pair::operator()): ditto
2009 (Translator::~Translator): remove empty d-tor.
2011 * src/graphics/GraphicsCache.C: move include config.h to top, also
2012 put initialization of GraphicsCache::singleton here.
2013 (~GraphicsCache): move here
2014 (addFile): take const ref as arg
2017 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2019 * src/BufferView2.C (insertLyXFile): change te with/without header
2022 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2024 * src/frontends/xforms/FormGraphics.C (apply): add some
2025 static_cast. Not very nice, but required by compaq cxx.
2027 * src/frontends/xforms/RadioButtonGroup.h: include header
2028 <utility> instead of <pair.h>
2030 * src/insets/insetgraphicsParams.C: add using directive.
2031 (readResize): change return type to void.
2032 (readOrigin): ditto.
2034 * src/lyxfunc.C (getStatus): add missing break for build-program
2035 function; add test for Literate for export functions.
2037 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2038 entries in Options menu.
2040 2000-07-31 Baruch Even <baruch.even@writeme.com>
2042 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2043 protect against auto-allocation; release icon when needed.
2045 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2047 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2048 on usual typewriter.
2050 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2051 earlier czech.kmap), useful only for programming.
2053 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2055 * src/frontends/xforms/FormCitation.h: fix conditioning around
2058 2000-07-31 Juergen Vigna <jug@sad.it>
2060 * src/frontends/xforms/FormTabular.C (local_update): changed
2061 radio_linebreaks to radio_useparbox and added radio_useminipage.
2063 * src/tabular.C: made support for using minipages/parboxes.
2065 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2067 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2069 (descent): so the cursor is in the middle.
2070 (width): bit smaller box.
2072 * src/insets/insetgraphics.h: added display() function.
2074 2000-07-31 Baruch Even <baruch.even@writeme.com>
2076 * src/frontends/Dialogs.h: Added showGraphics signals.
2078 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2079 xforms form definition of the graphics dialog.
2081 * src/frontends/xforms/FormGraphics.h:
2082 * src/frontends/xforms/FormGraphics.C: Added files, the
2083 GUIndependent code of InsetGraphics
2085 * src/insets/insetgraphics.h:
2086 * src/insets/insetgraphics.C: Major writing to make it work.
2088 * src/insets/insetgraphicsParams.h:
2089 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2090 struct between InsetGraphics and GUI.
2092 * src/LaTeXFeatures.h:
2093 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2094 support for graphicx package.
2096 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2097 for the graphics inset.
2099 * src/support/translator.h: Added file, used in
2100 InsetGraphicsParams. this is a template to translate between two
2103 * src/frontends/xforms/RadioButtonGroup.h:
2104 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2105 way to easily control a radio button group.
2107 2000-07-28 Juergen Vigna <jug@sad.it>
2109 * src/insets/insettabular.C (LocalDispatch):
2110 (TabularFeatures): added support for lyx-functions of tabular features.
2111 (cellstart): refixed this function after someone wrongly changed it.
2113 * src/commandtags.h:
2114 * src/LyXAction.C (init): added support for tabular-features
2116 2000-07-28 Allan Rae <rae@lyx.org>
2118 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2119 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2120 triggers the callback for input checking. As a result we sometimes get
2121 "LyX: This shouldn't happen..." printed to cerr.
2122 (input): Started using status variable since I only free() on
2123 destruction. Some input checking for paths and font sizes.
2125 * src/frontends/xforms/FormPreferences.h: Use status to control
2126 activation of Ok and Apply
2128 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2129 callback. Also resized to stop segfaults with 0.88. The problem is
2130 that xforms-0.88 requires the folder to be wide enough to fit all the
2131 tabs. If it isn't it causes all sorts of problems.
2133 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2135 * src/frontends/xforms/forms/README: Reflect reality.
2137 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2138 * src/frontends/xforms/forms/makefile: ditto.
2140 * src/commandtags.h: Get access to new Preferences dialog
2141 * src/LyXAction.C: ditto
2142 * src/lyxfunc.C: ditto
2143 * lib/ui/default.ui: ditto
2145 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2147 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2149 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2152 * src/frontends/xforms/form_url.[Ch]: added.
2154 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2156 * src/insets/insetbib.h: fixed bug in previous commit
2158 * src/frontends/xforms/FormUrl.h: ditto
2160 * src/frontends/xforms/FormPrint.h: ditto
2162 * src/frontends/xforms/FormPreferences.h: ditto
2164 * src/frontends/xforms/FormCopyright.h: ditto
2166 * src/frontends/xforms/FormCitation.C: ditto
2168 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2169 private copyconstructor and private default contructor
2171 * src/support/Makefile.am: add utility.hpp
2173 * src/support/utility.hpp: new file from boost
2175 * src/insets/insetbib.h: set owner in clone
2177 * src/frontends/xforms/FormCitation.C: added missing include
2180 * src/insets/form_url.[Ch]: removed
2182 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2184 * development/lyx.spec.in
2185 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2186 file/directory re-organization.
2188 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2190 * src/insets/insetcommand.[Ch]: moved the string data and
2191 associated manipulation methods into a new stand-alone class
2192 InsetCommandParams. This class has two additional methods
2193 getAsString() and setFromString() allowing the contents to be
2194 moved around as a single string.
2195 (addContents) method removed.
2196 (setContents) method no longer virtual.
2198 * src/buffer.C (readInset): made use of new InsetCitation,
2199 InsetUrl constructors based on InsetCommandParams.
2201 * src/commandtags.h: add LFUN_INSERT_URL
2203 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2204 independent InsetUrl and use InsetCommandParams to extract
2205 string info and create new Insets.
2207 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2209 * src/frontends/xforms/FormCitation.C (apply): uses
2212 * src/frontends/xforms/form_url.C
2213 * src/frontends/xforms/form_url.h
2214 * src/frontends/xforms/FormUrl.h
2215 * src/frontends/xforms/FormUrl.C
2216 * src/frontends/xforms/forms/form_url.fd: new files
2218 * src/insets/insetcite.[Ch]: removed unused constructors.
2220 * src/insets/insetinclude.[Ch]: no longer store filename
2222 * src/insets/inseturl.[Ch]: GUI-independent.
2224 2000-07-26 Juergen Vigna <jug@sad.it>
2225 * renamed frontend from gtk to gnome as it is that what is realized
2226 and did the necessary changes in the files.
2228 2000-07-26 Marko Vendelin <markov@ioc.ee>
2230 * configure.in: cleaning up gnome configuration scripts
2232 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2234 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2235 shortcuts syndrom by redrawing them explicitely (a better solution
2236 would be appreciated).
2238 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2240 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2243 * src/lyx_cb.C (MenuExport): change html export to do the right
2244 thing depending of the document type (instead of having
2245 html-linuxdoc and html-docbook).
2246 * src/lyxfunc.C (getStatus): update for html
2247 * lib/ui/default.ui: simplify due to the above change.
2248 * src/menus.C (ShowFileMenu): update too (in case we need it).
2250 * src/MenuBackend.C (read): if a menu is defined twice, add the
2251 new entries to the exiting one.
2253 2000-07-26 Juergen Vigna <jug@sad.it>
2255 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2257 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2258 and return a bool if it did actual save the file.
2259 (AutoSave): don't autosave a unnamed doc.
2261 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2262 check if this is an UNNAMED new file and react to it.
2263 (newFile): set buffer to unnamed and change to not mark a new
2264 buffer dirty if I didn't do anything with it.
2266 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2268 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2270 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2271 friend as per Angus's patch posted to lyx-devel.
2273 * src/ext_l10n.h: updated
2275 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2276 gettext on the style string right before inserting them into the
2279 * autogen.sh: add code to extract style strings form layout files,
2280 not good enough yet.
2282 * src/frontends/gtk/.cvsignore: add MAKEFILE
2284 * src/MenuBackend.C (read): run the label strings through gettext
2285 before storing them in the containers.
2287 * src/ext_l10n.h: new file
2289 * autogen.sh : generate the ext_l10n.h file here
2291 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2293 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2296 * lib/ui/default.ui: fix a couple of typos.
2298 * config/gnome/gtk.m4: added (and added to the list of files in
2301 * src/insets/insetinclude.C (unique_id): fix when we are using
2302 lyxstring instead of basic_string<>.
2303 * src/insets/insettext.C (LocalDispatch): ditto.
2304 * src/support/filetools.C: ditto.
2306 * lib/configure.m4: create the ui/ directory if necessary.
2308 * src/LyXView.[Ch] (updateToolbar): new method.
2310 * src/BufferView_pimpl.C (buffer): update the toolbar when
2311 opening/closing buffer.
2313 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2315 * src/LyXAction.C (getActionName): enhance to return also the name
2316 and options of pseudo-actions.
2317 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2319 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2320 as an example of what is possible). Used in File->Build too (more
2321 useful) and in the import/export menus (to mimick the complicated
2322 handling of linuxdoc and friends). Try to update all the entries.
2324 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2327 * src/MenuBackend.C (read): Parse the new OptItem tag.
2329 * src/MenuBackend.h: Add a new optional_ data member (used if the
2330 entry should be omitted when the lyxfunc is disabled).
2332 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2333 function, used as a shortcut.
2334 (create_submenu): align correctly the shortcuts on the widest
2337 * src/MenuBackend.h: MenuItem.label() only returns the label of
2338 the menu without shortcut; new method shortcut().
2340 2000-07-14 Marko Vendelin <markov@ioc.ee>
2342 * src/frontends/gtk/Dialogs.C:
2343 * src/frontends/gtk/FormCopyright.C:
2344 * src/frontends/gtk/FormCopyright.h:
2345 * src/frontends/gtk/Makefile.am: added these source-files for the
2346 Gtk/Gnome support of the Copyright-Dialog.
2348 * src/main.C: added Gnome::Main initialization if using
2349 Gtk/Gnome frontend-GUI.
2351 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2353 * config/gnome/aclocal-include.m4
2354 * config/gnome/compiler-flags.m4
2355 * config/gnome/curses.m4
2356 * config/gnome/gnome--.m4
2357 * config/gnome/gnome-bonobo-check.m4
2358 * config/gnome/gnome-common.m4
2359 * config/gnome/gnome-fileutils.m4
2360 * config/gnome/gnome-ghttp-check.m4
2361 * config/gnome/gnome-gnorba-check.m4
2362 * config/gnome/gnome-guile-checks.m4
2363 * config/gnome/gnome-libgtop-check.m4
2364 * config/gnome/gnome-objc-checks.m4
2365 * config/gnome/gnome-orbit-check.m4
2366 * config/gnome/gnome-print-check.m4
2367 * config/gnome/gnome-pthread-check.m4
2368 * config/gnome/gnome-support.m4
2369 * config/gnome/gnome-undelfs.m4
2370 * config/gnome/gnome-vfs.m4
2371 * config/gnome/gnome-x-checks.m4
2372 * config/gnome/gnome-xml-check.m4
2373 * config/gnome/gnome.m4
2374 * config/gnome/gperf-check.m4
2375 * config/gnome/gtk--.m4
2376 * config/gnome/linger.m4
2377 * config/gnome/need-declaration.m4: added configuration scripts
2378 for Gtk/Gnome frontend-GUI
2380 * configure.in: added support for the --with-frontend=gtk option
2382 * autogen.sh: added config/gnome/* to list of config-files
2384 * acconfig.h: added define for GTKGUI-support
2386 * config/lyxinclude.m4: added --with-frontend[=value] option value
2387 for Gtk/Gnome frontend-GUI support.
2389 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2391 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2395 * src/paragraph.C (GetChar): remove non-const version
2397 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2398 (search_kw): use it.
2400 * src/lyx_main.C (init): if "preferences" exist, read that instead
2402 (ReadRcFile): return bool if the file could be read ok.
2403 (ReadUIFile): add a check to see if lex file is set ok.
2405 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2406 bastring can be used instead of lyxstring (still uses the old code
2407 if std::string is good enough or if lyxstring is used.)
2409 * src/encoding.C: make the arrays static, move ininle functions
2411 * src/encoding.h: from here.
2413 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2414 (parseSingleLyXformat2Token): move inset parsing to separate method
2415 (readInset): new private method
2417 * src/Variables.h: remove virtual from get().
2419 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2420 access to NEW_INSETS and NEW_TABULAR
2422 * src/MenuBackend.h: remove superfluous forward declaration of
2423 MenuItem. Add documentations tags "///", remove empty MenuItem
2424 destructor, remove private default contructor.
2426 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2428 (read): more string mlabel and mname to where they are used
2429 (read): remove unused variables mlabel and mname
2430 (defaults): unconditional clear, make menusetup take advantage of
2431 add returning Menu &.
2433 * src/LyXView.h: define NEW_MENUBAR as default
2435 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2436 to NEW_INSETS and NEW_TABULAR.
2437 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2438 defined. Change some of the "xxxx-inset-insert" functions names to
2441 * several files: more enahncements to NEW_INSETS and the resulting
2444 * lib/lyxrc.example (\date_insert_format): move to misc section
2446 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2447 bastring and use AC_CACHE_CHECK.
2448 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2449 the system have the newest methods. uses AC_CACHE_CHECK
2450 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2451 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2452 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2454 * configure.in: add LYX_CXX_GOOD_STD_STRING
2456 * acinclude.m4: recreated
2458 2000-07-24 Amir Karger
2460 * README: add Hebrew, Arabic kmaps
2463 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2465 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2468 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2470 * Lot of files: add pragma interface/implementation.
2472 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2474 * lib/ui/default.ui: new file (ans new directory). Contains the
2475 default menu and toolbar.
2477 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2478 global space. Toolbars are now read (as menus) in ui files.
2480 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2482 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2483 is disabled because the document is read-only. We want to have the
2484 toggle state of the function anyway.
2485 (getStatus): add code for LFUN_VC* functions (mimicking what is
2486 done in old-style menus)
2488 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2489 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2491 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2492 * src/BufferView_pimpl.C: ditto.
2493 * src/lyxfunc.C: ditto.
2495 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2496 default). This replaces old-style menus by new ones.
2498 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2499 MenuItem. Contain the data structure of a menu.
2501 * src/insets/insettext.C: use LyXView::setLayout instead of
2502 accessing directly the toolbar combox.
2503 * src/lyxfunc.C (Dispatch): ditto.
2505 * src/LyXView.C (setLayout): new method, which just calls
2506 Toolbar::setLayout().
2507 (updateLayoutChoice): move part of this method in Toolbar.
2509 * src/toolbar.[Ch]: removed.
2511 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2512 implementation the toolbar.
2514 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2515 the toolbar. It might make sense to merge it with ToolbarDefaults
2517 (setLayout): new function.
2518 (updateLayoutList): ditto.
2519 (openLayoutList): ditto.
2521 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2522 xforms implementation of the toolbar.
2523 (get_toolbar_func): comment out, since I do not
2524 know what it is good for.
2526 * src/ToolbarDefaults.h: Add the ItemType enum.
2528 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2529 for a list of allocated C strings. Used in Menubar xforms
2530 implementation to avoid memory leaks.
2532 * src/support/lstrings.[Ch] (uppercase): new version taking and
2536 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2537 * lib/bind/emacs.bind: ditto.
2539 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2541 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2542 forward decl of LyXView.
2544 * src/toolbar.C (toolbarItem): moved from toolbar.h
2545 (toolbarItem::clean): ditto
2546 (toolbarItem::~toolbarItem): ditto
2547 (toolbarItem::operator): ditto
2549 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2551 * src/paragraph.h: control the NEW_TABULAR define from here
2553 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2554 USE_TABULAR_INSETS to NEW_TABULAR
2556 * src/ToolbarDefaults.C: add include "lyxlex.h"
2558 * files using the old table/tabular: use NEW_TABULAR to control
2559 compilation of old tabular stuff.
2561 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2564 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2565 planemet in reading of old style floats, fix the \end_deeper
2566 problem when reading old style floats.
2568 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2570 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2572 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2574 * lib/bind/sciword.bind: updated.
2576 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2578 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2579 layout write problem
2581 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2583 * src/Makefile.am (INCLUDES): remove image directory from include
2586 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2587 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2589 * src/LyXView.C (create_form_form_main): read the application icon
2592 * lib/images/*.xpm: change the icons to use transparent color for
2595 * src/toolbar.C (update): change the color of the button when it
2598 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2600 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2601 setting explicitely the minibuffer.
2602 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2604 * src/LyXView.C (showState): new function. Shows font information
2605 in minibuffer and update toolbar state.
2606 (LyXView): call Toolbar::update after creating the
2609 * src/toolbar.C: change toollist to be a vector instead of a
2611 (BubbleTimerCB): get help string directly from the callback
2612 argument of the corresponding icon (which is the action)
2613 (set): remove unnecessary ugliness.
2614 (update): new function. update the icons (depressed, disabled)
2615 depending of the status of the corresponding action.
2617 * src/toolbar.h: remove help in toolbarItem
2619 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2621 * src/Painter.C (text): Added code for using symbol glyphs from
2622 iso10646 fonts. Currently diabled.
2624 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2627 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2628 magyar,turkish and usorbian.
2630 * src/paragraph.C (isMultiLingual): Made more efficient.
2632 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2635 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2636 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2637 Also changed the prototype to "bool math_insert_greek(char)".
2639 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2641 * lots of files: apply the NEW_INSETS on all code that will not be
2642 needed when we move to use the new insets. Enable the define in
2643 lyxparagrah.h to try it.
2645 * src/insets/insettabular.C (cellstart): change to be a static
2647 (InsetTabular): initialize buffer in the initializer list.
2649 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2651 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2652 form_print.h out of the header file. Replaced with forward
2653 declarations of the relevant struct.
2655 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2658 * src/commandtags.h: do not include "debug.h" which does not
2659 belong there. #include it in some other places because of this
2662 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2664 * src/insets/insetcaption.C: add a couple "using" directives.
2666 * src/toolbar.C (add): get the help text directly from lyxaction.
2668 (setPixmap): new function. Loads from disk and sets a pixmap on a
2669 botton; the name of the pixmap file is derived from the command
2672 * src/toolbar.h: remove members isBitmap and pixmap from
2675 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2676 * lib/images/: move many files from images/banner.xpm.
2678 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2680 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2681 * src/toolbar.C: ditto.
2682 * configure.in: ditto.
2683 * INSTALL: document.
2685 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2686 the spellchecker popup is closed from the WM.
2688 2000-07-19 Juergen Vigna <jug@sad.it>
2690 * src/insets/insetfloat.C (Write): small fix because we use the
2691 insetname for the type now!
2693 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2695 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2698 * src/frontends/Dialogs.h: removed hideCitation signal
2700 * src/insets/insetcite.h: added hide signal
2702 * src/insets/insetcite.C (~InsetCitation): emits new signal
2703 (getScreenLabel): "intelligent" label should now fit on the screen!
2705 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2707 * src/frontends/xforms/FormCitation.C (showInset): connects
2708 hide() to the inset's hide signal
2709 (show): modified to use fl_set_object_position rather than
2710 fl_set_object_geometry wherever possible
2712 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2714 * src/insets/lyxinset.h: add caption code
2716 * src/insets/insetfloat.C (type): new method
2718 * src/insets/insetcaption.C (Write): new method
2720 (LyxCode): new method
2722 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2723 to get it right together with using the FloatList.
2725 * src/commandtags.h: add LFUN_INSET_CAPTION
2726 * src/lyxfunc.C (Dispatch): handle it
2728 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2731 * src/Variables.[Ch]: make expand take a const reference, remove
2732 the destructor, some whitespace changes.
2734 * src/LyXAction.C (init): add caption-inset-insert
2736 * src/FloatList.C (FloatList): update the default floats a bit.
2738 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2740 * src/Variables.[Ch]: new files. Intended to be used for language
2741 specific strings (like \chaptername) and filename substitution in
2744 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2746 * lib/kbd/american.kmap: update
2748 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2750 * src/bufferparams.[Ch]: remove member allowAccents.
2752 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2754 * src/LaTeXLog.C: use the log_form.h header.
2755 * src/lyx_gui.C: ditto.
2756 * src/lyx_gui_misc.C: ditto.
2757 * src/lyxvc.h: ditto.
2759 * forms/log_form.fd: new file, created from latexoptions.fd. I
2760 kept the log popup and nuked the options form.
2762 * src/{la,}texoptions.[Ch]: removed.
2763 * src/lyx_cb.C (LaTeXOptions): ditto
2765 * src/lyx_gui.C (create_forms): do not handle the
2766 fd_latex_options form.
2768 2000-07-18 Juergen Vigna <jug@sad.it>
2770 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2771 name of the inset so that it can be requested outside (text2.C).
2773 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2776 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2778 * src/mathed/formula.h (ConvertFont): constify
2780 * src/mathed/formula.C (Read): add warning if \end_inset is not
2781 found on expected place.
2783 * src/insets/lyxinset.h (ConvertFont): consify
2785 * src/insets/insetquotes.C (ConvertFont): constify
2786 * src/insets/insetquotes.h: ditto
2788 * src/insets/insetinfo.h: add labelfont
2790 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2791 (ascent): use labelfont
2795 (Write): make .lyx file a bit nicer
2797 * src/insets/insetfloat.C (Write): simplify somewhat...
2798 (Read): add warning if arg is not found
2800 * src/insets/insetcollapsable.C: add using std::max
2801 (Read): move string token and add warning in arg is not found
2802 (draw): use std::max to get the right ty
2803 (getMaxWidth): simplify by using std::max
2805 * src/insets/insetsection.h: new file
2806 * src/insets/insetsection.C: new file
2807 * src/insets/insetcaption.h: new file
2808 * src/insets/insetcaption.C: new file
2810 * src/insets/inset.C (ConvertFont): constify signature
2812 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2813 insetcaption.[Ch] and insetsection.[Ch]
2815 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2816 uses to use LABEL_COUNTER_CHAPTER instead.
2817 * src/text2.C (SetCounter): here
2819 * src/counters.h: new file
2820 * src/counters.C: new file
2821 * src/Sectioning.h: new file
2822 * src/Sectioning.C: new file
2824 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2826 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2828 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2831 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2834 2000-07-17 Juergen Vigna <jug@sad.it>
2836 * src/tabular.C (Validate): check if array-package is needed.
2837 (SetVAlignment): added support for vertical alignment.
2838 (SetLTFoot): better support for longtable header/footers
2839 (Latex): modified to support added features.
2841 * src/LaTeXFeatures.[Ch]: added array-package.
2843 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2845 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2848 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2850 * configure.in: do not forget to put a space after -isystem.
2852 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2854 * lib/kbd/arabic.kmap: a few fixes.
2856 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2858 * some whitespace chagnes to a number of files.
2860 * src/support/DebugStream.h: change to make it easier for
2861 doc++ to parse correctly.
2862 * src/support/lyxstring.h: ditto
2864 * src/mathed/math_utils.C (compara): change to have only one
2866 (MathedLookupBOP): change because of the above.
2868 * src/mathed/math_delim.C (math_deco_compare): change to have only
2870 (search_deco): change becasue of the above.
2872 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2873 instead of manually coded one.
2875 * src/insets/insetquotes.C (Read): read the \end_inset too
2877 * src/insets/insetlatex.h: remove file
2878 * src/insets/insetlatex.C: remove file
2880 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2882 (InsetPrintIndex): remove destructor
2884 * src/insets/insetinclude.h: remove default constructor
2886 * src/insets/insetfloat.C: work to make it work better
2888 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2890 * src/insets/insetcite.h (InsetCitation): remove default constructor
2892 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2894 * src/text.C (GetColumnNearX): comment out some currently unused code.
2896 * src/paragraph.C (writeFile): move some initializations closer to
2898 (CutIntoMinibuffer): small change to use new matchIT operator
2902 (InsertInset): ditto
2905 (InsetIterator): ditto
2906 (Erase): small change to use new matchFT operator
2908 (GetFontSettings): ditto
2909 (HighestFontInRange): ditto
2912 * src/lyxparagraph.h: some chars changed to value_type
2913 (matchIT): because of some stronger checking (perhaps too strong)
2914 in SGI STL, the two operator() unified to one.
2917 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2919 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2920 the last inset read added
2921 (parseSingleLyXformat2Token): some more (future) compability code added
2922 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2923 (parseSingleLyXformat2Token): set last_inset_read
2924 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2925 (parseSingleLyXformat2Token): don't double intializw string next_token
2927 * src/TextCache.C (text_fits::operator()): add const's to the signature
2928 (has_buffer::operator()): ditto
2930 * src/Floating.h: add some comments on the class
2932 * src/FloatList.[Ch] (typeExist): new method
2935 * src/BackStack.h: added default constructor, wanted by Gcc.
2937 2000-07-14 Juergen Vigna <jug@sad.it>
2939 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2941 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2943 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2944 do a redraw when the window is resized!
2945 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2947 * src/insets/insettext.C (resizeLyXText): added function to correctly
2948 being able to resize the LyXWindow.
2950 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2952 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2954 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2955 crashes when closing dialog to a deleted inset.
2957 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2958 method! Now similar to other insets.
2960 2000-07-13 Juergen Vigna <jug@sad.it>
2962 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2964 * lib/examples/Literate.lyx: small patch!
2966 * src/insets/insetbib.C (Read): added this function because of wrong
2967 Write (without [begin|end]_inset).
2969 2000-07-11 Juergen Vigna <jug@sad.it>
2971 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2972 as the insertInset could not be good!
2974 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2975 the bool param should not be last.
2977 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2979 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2980 did submit that to Karl).
2982 * configure.in: use -isystem instead of -I for X headers. This
2983 fixes a problem on solaris with a recent gcc;
2984 put the front-end code after the X detection code;
2985 configure in sigc++ before lib/
2987 * src/lyx_main.C (commandLineHelp): remove -display from command
2990 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2992 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2993 Also put in Makefile rules for building the ``listerrors''
2994 program for parsing errors from literate programs written in LyX.
2996 * lib/build-listerrors: Added small shell script as part of compile
2997 process. This builds a working ``listerrors'' binary if noweb is
2998 installed and either 1) the VNC X server is installed on the machine,
2999 or 2) the user is compiling from within a GUI. The existence of a GUI
3000 is necessary to use the ``lyx --export'' feature for now. This
3001 hack can be removed once ``lyx --export'' no longer requires a GUI to
3004 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3006 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3007 now passed back correctly from gcc and placed "under" error
3008 buttons in a Literate LyX source.
3010 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3012 * src/text.C (GetColumnNearX): Better behavior when a RTL
3013 paragraph is ended by LTR text.
3015 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3018 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3020 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3021 true when clipboard is empty.
3023 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3025 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3026 row of the paragraph.
3027 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3028 to prevent calculation of bidi tables
3030 2000-07-07 Juergen Vigna <jug@sad.it>
3032 * src/screen.C (ToggleSelection): added y_offset and x_offset
3035 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3038 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3040 * src/insets/insettext.C: fixed Layout-Display!
3042 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3044 * configure.in: add check for strings.h header.
3046 * src/spellchecker.C: include <strings.h> in order to have a
3047 definition for bzero().
3049 2000-07-07 Juergen Vigna <jug@sad.it>
3051 * src/insets/insettext.C (draw): set the status of the bv->text to
3052 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3054 * src/screen.C (DrawOneRow):
3055 (DrawFromTo): redraw the actual row if something has changed in it
3058 * src/text.C (draw): call an update of the toplevel-inset if something
3059 has changed inside while drawing.
3061 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3063 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3065 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3066 processing inside class.
3068 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3069 processing inside class.
3071 * src/insets/insetindex.h new struct Holder, consistent with other
3074 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3075 citation dialog from main code and placed it in src/frontends/xforms.
3076 Dialog launched through signals instead of callbacks
3078 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3080 * lyx.man: update the options description.
3082 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3084 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3085 handle neg values, set min width to 590, add doc about -display
3087 2000-07-05 Juergen Vigna <jug@sad.it>
3089 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3090 calls to BufferView *.
3092 * src/insets/insettext.C (checkAndActivateInset): small fix non
3093 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3095 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3096 their \end_inset token!
3098 2000-07-04 edscott <edscott@imp.mx>
3100 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3101 lib/lyxrc.example: added option \wheel_jump
3103 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3105 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3106 remove support for -width,-height,-xpos and -ypos.
3108 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3110 * src/encoding.[Ch]: New files.
3112 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3113 (text): Call to the underline() method only when needed.
3115 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3117 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3118 encoding(s) for the document.
3120 * src/bufferparams.C (BufferParams): Changed default value of
3123 * src/language.C (newLang): Removed.
3124 (items[]): Added encoding information for all defined languages.
3126 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3127 encoding choice button.
3129 * src/lyxrc.h (font_norm_type): New member variable.
3130 (set_font_norm_type): New method.
3132 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3133 paragraphs with different encodings.
3135 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3136 (TransformChar): Changed to work correctly with Arabic points.
3137 (draw): Added support for drawing Arabic points.
3138 (draw): Removed code for drawing underbars (this is done by
3141 * src/support/textutils.h (IsPrintableNonspace): New function.
3143 * src/BufferView_pimpl.h: Added "using SigC::Object".
3144 * src/LyXView.h: ditto.
3146 * src/insets/insetinclude.h (include_label): Changed to mutable.
3148 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3150 * src/mathed/math_iter.h: remove empty destructor
3152 * src/mathed/math_cursor.h: remove empty destructor
3154 * src/insets/lyxinset.h: add THEOREM_CODE
3156 * src/insets/insettheorem.[Ch]: new files
3158 * src/insets/insetminipage.C: (InsertInset): remove
3160 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3162 (InsertInset): remove
3164 * src/insets/insetlist.C: (InsertList): remove
3166 * src/insets/insetfootlike.[Ch]: new files
3168 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3171 (InsertInset): ditto
3173 * src/insets/insetert.C: remove include Painter.h, reindent
3174 (InsertInset): move to header
3176 * src/insets/insetcollapsable.h: remove explicit from default
3177 contructor, remove empty destructor, add InsertInset
3179 * src/insets/insetcollapsable.C (InsertInset): new func
3181 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3183 * src/vspace.h: add explicit to constructor
3185 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3186 \textcompwordmark, please test this.
3188 * src/lyxrc.C: set ascii_linelen to 65 by default
3190 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3192 * src/commandtags.h: add LFUN_INSET_THEOREM
3194 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3195 (makeLinuxDocFile): remove _some_ of the nice logic
3196 (makeDocBookFile): ditto
3198 * src/Painter.[Ch]: (~Painter): removed
3200 * src/LyXAction.C (init): entry for insettheorem added
3202 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3204 (deplog): code to detect files generated by LaTeX, needs testing
3207 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3209 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3211 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3213 * src/LaTeX.C (deplog): Add a check for files that are going to be
3214 created by the first latex run, part of the project to remove the
3217 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3218 contents to the extension list.
3220 2000-07-04 Juergen Vigna <jug@sad.it>
3222 * src/text.C (NextBreakPoint): added support for needFullRow()
3224 * src/insets/lyxinset.h: added needFullRow()
3226 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3229 * src/insets/insettext.C: lots of changes for update!
3231 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3233 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3235 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3237 * src/insets/insetinclude.C (InsetInclude): fixed
3238 initialization of include_label.
3239 (unique_id): now returns a string.
3241 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3243 * src/LaTeXFeatures.h: new member IncludedFiles, for
3244 a map of key, included file name.
3246 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3247 with the included files for inclusion in SGML preamble,
3248 i. e., linuxdoc and docbook.
3251 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3252 nice (is the generated linuxdoc code to be exported?), that
3253 allows to remove column, and only_body that will be true for
3254 slave documents. Insets are allowed inside SGML font type.
3255 New handling of the SGML preamble for included files.
3256 (makeDocBookFile): the same for docbook.
3258 * src/insets/insetinclude.h:
3259 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3261 (DocBook): new export methods.
3263 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3264 and makeDocBookFile.
3266 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3267 formats to export with command line argument -x.
3269 2000-06-29 Juergen Vigna <jug@sad.it>
3271 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3272 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3274 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3275 region could already been cleared by an inset!
3277 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3279 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3282 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3284 (cursorToggle): remove special handling of lyx focus.
3286 2000-06-28 Juergen Vigna <jug@sad.it>
3288 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3291 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3293 * src/insets/insetindex.C (Edit): add a callback when popup is
3296 * src/insets/insettext.C (LocalDispatch):
3297 * src/insets/insetmarginal.h:
3298 * src/insets/insetlist.h:
3299 * src/insets/insetfoot.h:
3300 * src/insets/insetfloat.h:
3301 * src/insets/insetert.h: add a missing std:: qualifier.
3303 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3305 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3308 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3310 * src/insets/insettext.C (Read): remove tmptok unused variable
3311 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3312 (InsertInset): change for new InsetInset code
3314 * src/insets/insettext.h: add TEXT inline method
3316 * src/insets/insettext.C: remove TEXT macro
3318 * src/insets/insetmarginal.C (Write): new method
3319 (Latex): change output slightly
3321 * src/insets/insetfoot.C (Write): new method
3322 (Latex): change output slightly (don't use endl when no need)
3324 * src/insets/insetert.C (Write): new method
3326 * src/insets/insetcollapsable.h: make button_length, button_top_y
3327 and button_bottm_y protected.
3329 * src/insets/insetcollapsable.C (Write): simplify code by using
3330 tostr. Also do not output the float name, the children class
3331 should to that to get control over own arguments
3333 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3334 src/insets/insetminipage.[Ch]:
3337 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3339 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3341 * src/Makefile.am (lyx_SOURCES): add the new files
3343 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3344 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3345 * src/commandtags.h: ditto
3347 * src/LaTeXFeatures.h: add a std::set of used floattypes
3349 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3351 * src/FloatList.[Ch] src/Floating.h: new files
3353 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3355 * src/lyx_cb.C (TableApplyCB): ditto
3357 * src/text2.C: ditto
3358 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3359 (parseSingleLyXformat2Token): ditto + add code for
3360 backwards compability for old float styles + add code for new insets
3362 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3364 (InsertInset(size_type, Inset *, LyXFont)): new method
3365 (InsetChar(size_type, char)): changed to use the other InsetChar
3366 with a LyXFont(ALL_INHERIT).
3367 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3368 insert the META_INSET.
3370 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3372 * sigc++/thread.h (Threads): from here
3374 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3375 definition out of line
3376 * sigc++/scope.h: from here
3378 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3380 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3381 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3383 * Makefile.am (bindist): new target.
3385 * INSTALL: add instructions for doing a binary distribution.
3387 * development/tools/README.bin.example: update a bit.
3389 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3392 * lib/lyxrc.example: new lyxrc tag \set_color.
3394 * src/lyxfunc.C (Dispatch):
3395 * src/commandtags.h:
3396 * src/LyXAction.C: new lyxfunc "set-color".
3398 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3399 and an x11name given as strings.
3401 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3402 cache when a color is changed.
3404 2000-06-26 Juergen Vigna <jug@sad.it>
3406 * src/lyxrow.C (width): added this functions and variable.
3408 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3411 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3413 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3415 * images/undo_bw.xpm: new icon.
3416 * images/redo_bw.xpm: ditto.
3418 * configure.in (INSTALL_SCRIPT): change value to
3419 ${INSTALL} to avoid failures of install-script target.
3420 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3422 * src/BufferView.h: add a magic "friend" declaration to please
3425 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3427 * forms/cite.fd: modified to allow resizing without messing
3430 * src/insetcite.C: Uses code from cite.fd almost without
3432 User can now resize dialog in the x-direction.
3433 Resizing the dialog in the y-direction is prevented, as the
3434 code does this intelligently already.
3436 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3438 * INSTALL: remove obsolete entry in "problems" section.
3440 * lib/examples/sl_*.lyx: update of the slovenian examples.
3442 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3444 2000-06-23 Juergen Vigna <jug@sad.it>
3446 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3448 * src/buffer.C (resize): delete the LyXText of textinsets.
3450 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3452 * src/insets/lyxinset.h: added another parameter 'cleared' to
3453 the draw() function.
3455 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3456 unlocking inset in inset.
3458 2000-06-22 Juergen Vigna <jug@sad.it>
3460 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3461 of insets and moved first to LyXText.
3463 * src/mathed/formulamacro.[Ch]:
3464 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3466 2000-06-21 Juergen Vigna <jug@sad.it>
3468 * src/text.C (GetVisibleRow): look if I should clear the area or not
3469 using Inset::doClearArea() function.
3471 * src/insets/lyxinset.h: added doClearArea() function and
3472 modified draw(Painter &, ...) to draw(BufferView *, ...)
3474 * src/text2.C (UpdateInset): return bool insted of int
3476 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3478 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3479 combox in the character popup
3481 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3482 BufferParams const & params
3484 2000-06-20 Juergen Vigna <jug@sad.it>
3486 * src/insets/insettext.C (SetParagraphData): set insetowner on
3489 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3491 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3492 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3494 (form_main_): remove
3496 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3497 (create_form_form_main): remove FD_form_main stuff, connect to
3498 autosave_timeout signal
3500 * src/LyXView.[Ch] (getMainForm): remove
3501 (UpdateTimerCB): remove
3502 * src/BufferView_pimpl.h: inherit from SigC::Object
3504 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3505 signal instead of callback
3507 * src/BufferView.[Ch] (cursorToggleCB): remove
3509 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3511 * src/BufferView_pimpl.C: changes because of the one below
3513 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3514 instead of storing a pointer to a LyXText.
3516 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3518 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3520 * src/lyxparagraph.h
3522 * src/paragraph.C: Changed fontlist to a sorted vector.
3524 2000-06-19 Juergen Vigna <jug@sad.it>
3526 * src/BufferView.h: added screen() function.
3528 * src/insets/insettext.C (LocalDispatch): some selection code
3531 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3533 * src/insets/insettext.C (SetParagraphData):
3535 (InsetText): fixes for multiple paragraphs.
3537 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3539 * development/lyx.spec.in: Call configure with ``--without-warnings''
3540 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3541 This should be fine, however, since we generally don't want to be
3542 verbose when making an RPM.
3544 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3546 * lib/scripts/fig2pstex.py: New file
3548 2000-06-16 Juergen Vigna <jug@sad.it>
3550 * src/insets/insettabular.C (UpdateLocal):
3551 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3552 (LocalDispatch): Changed all functions to use LyXText.
3554 2000-06-15 Juergen Vigna <jug@sad.it>
3556 * src/text.C (SetHeightOfRow): call inset::update before requesting
3559 * src/insets/insettext.C (update):
3560 * src/insets/insettabular.C (update): added implementation
3562 * src/insets/lyxinset.h: added update function
3564 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3566 * src/text.C (SelectNextWord): protect against null pointers with
3567 old-style string streams. (fix from Paul Theo Gonciari
3570 * src/cite.[Ch]: remove erroneous files.
3572 * lib/configure.m4: update the list of created directories.
3574 * src/lyxrow.C: include <config.h>
3575 * src/lyxcursor.C: ditto.
3577 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3579 * lib/examples/decimal.lyx: new example file from Mike.
3581 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3582 to find template definitions (from Dekel)
3584 * src/frontends/.cvsignore: add a few things.
3586 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3588 * src/Timeout.C (TimeOut): remove default argument.
3590 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3593 * src/insets/ExternalTemplate.C: add a "using" directive.
3595 * src/lyx_main.h: remove the act_ struct, which seems unused
3598 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3600 * LyX Developers Meeting: All files changed, due to random C++ (by
3601 coincidence) code generator script.
3603 - external inset (cool!)
3604 - initial online editing of preferences
3605 - insettabular breaks insettext(s contents)
3607 - some DocBook fixes
3608 - example files update
3609 - other cool stuff, create a diff and look for yourself.
3611 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3613 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3614 -1 this is a non-line-breaking textinset.
3616 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3617 if there is no width set.
3619 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3621 * Lots of files: Merged the dialogbase branch.
3623 2000-06-09 Allan Rae <rae@lyx.org>
3625 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3626 and the Dispatch methods that used it.
3628 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3629 access to functions formerly kept in Dispatch.
3631 2000-05-19 Allan Rae <rae@lyx.org>
3633 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3634 made to_page and count_copies integers again. from_page remains a
3635 string however because I want to allow entry of a print range like
3636 "1,4,22-25" using this field.
3638 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3639 and printer-params-get. These aren't useful from the minibuffer but
3640 could be used by a script/LyXServer app provided it passes a suitable
3641 auto_mem_buffer. I guess I should take a look at how the LyXServer
3642 works and make it support xtl buffers.
3644 * sigc++/: updated to libsigc++-1.0.1
3646 * src/xtl/: updated to xtl-1.3.pl.11
3648 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3649 those changes done to the files in src/ are actually recreated when
3650 they get regenerated. Please don't ever accept a patch that changes a
3651 dialog unless that patch includes the changes to the corresponding *.fd
3654 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3655 stringOnlyContains, renamed it and generalised it.
3657 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3658 branch. Removed the remaining old form_print code.
3660 2000-04-26 Allan Rae <rae@lyx.org>
3662 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3663 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3665 2000-04-25 Allan Rae <rae@lyx.org>
3667 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3668 against a base of xtl-1.3.pl.4
3670 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3671 filter the Id: entries so they still show the xtl version number
3674 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3675 into the src/xtl code. Patch still pending with José (XTL)
3677 2000-04-24 Allan Rae <rae@lyx.org>
3679 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3680 both more generic and much safer. Use the new template functions.
3681 * src/buffer.[Ch] (Dispatch): ditto.
3683 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3684 and mem buffer more intelligently. Also a little general cleanup.
3687 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3688 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3689 * src/xtl/Makefile.am: ditto.
3690 * src/xtl/.cvsignore: ditto.
3691 * src/Makefile.am: ditto.
3693 * src/PrinterParams.h: Removed the macros member functions. Added a
3694 testInvariant member function. A bit of tidying up and commenting.
3695 Included Angus's idea for fixing operation with egcs-1.1.2.
3697 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3698 cool expansion of XTL's mem_buffer to support automatic memory
3699 management within the buffer itself. Removed the various macros and
3700 replaced them with template functions that use either auto_mem_buffer
3701 or mem_buffer depending on a #define. The mem_buffer support will
3702 disappear as soon as the auto_mem_buffer is confirmed to be good on
3703 other platforms/compilers. That is, it's there so you've got something
3706 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3707 effectively forked XTL. However I expect José will include my code
3708 into the next major release. Also fixed a memory leak.
3709 * src/xtl/text.h: ditto.
3710 * src/xtl/xdr.h: ditto.
3711 * src/xtl/giop.h: ditto.
3713 2000-04-16 Allan Rae <rae@lyx.org>
3715 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3716 by autogen.sh and removed by maintainer-clean anyway.
3717 * .cvsignore, sigc++/.cvsignore: Support the above.
3719 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3721 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3723 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3724 macros, renamed static callback-target member functions to suit new
3725 scheme and made them public.
3726 * src/frontends/xforms/forms/form_print.fd: ditto.
3727 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3729 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3732 * src/xtl/: New directory containing a minimal distribution of XTL.
3733 This is XTL-1.3.pl.4.
3735 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3737 2000-04-15 Allan Rae <rae@lyx.org>
3739 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3741 * sigc++/: Updated to libsigc++-1.0.0
3743 2000-04-14 Allan Rae <rae@lyx.org>
3745 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3746 use the generic ones in future. I'll modify my conversion script.
3748 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3750 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3751 (CloseAllBufferRelatedDialogs): Renamed.
3752 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3754 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3755 of the generic ones. These are the same ones my conversion script
3758 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3759 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3760 * src/buffer.C (Dispatch): ditto
3762 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3763 functions for updating and hiding buffer dependent dialogs.
3764 * src/BufferView.C (buffer): ditto
3765 * src/buffer.C (setReadonly): ditto
3766 * src/lyxfunc.C (CloseBuffer): ditto
3768 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3769 Dialogs.h, and hence all the SigC stuff, into every file that includes
3770 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3772 * src/BufferView2.C: reduce the number of headers included by buffer.h
3774 2000-04-11 Allan Rae <rae@lyx.org>
3776 * src/frontends/xforms/xform_macros.h: A small collection of macros
3777 for building C callbacks.
3779 * src/frontends/xforms/Makefile.am: Added above file.
3781 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3782 scheme again. This time it should work for JMarc. If this is
3783 successful I'll revise my conversion script to automate some of this.
3784 The static member functions in the class also have to be public for
3785 this scheme will work. If the scheme works (it's almost identical to
3786 the way BufferView::cursorToggleCB is handled so it should work) then
3787 FormCopyright and FormPrint will be ready for inclusion into the main
3788 trunk immediately after 1.1.5 is released -- provided we're prepared
3789 for complaints about lame compilers not handling XTL.
3791 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3793 2000-04-07 Allan Rae <rae@lyx.org>
3795 * config/lyxinclude.m4: A bit more tidying up (Angus)
3797 * src/LString.h: JMarc's <string> header fix
3799 * src/PrinterParams.h: Used string for most data to remove some
3800 ugly code in the Print dialog and avoid even uglier code when
3801 appending the ints to a string for output.
3803 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3804 and moved "default:" back to the end of switch statement. Cleaned
3805 up the printing so it uses the right function calls and so the
3806 "print to file" option actually puts the file in the right directory.
3808 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3810 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3811 and Ok+Apply button control into a separate method: input (Angus).
3812 (input) Cleaned it up and improved it to be very thorough now.
3813 (All CB) static_cast used instead of C style cast (Angus). This will
3814 probably change again once we've worked out how to keep gcc-2.8.1 happy
3815 with real C callbacks.
3816 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3817 ignore some of the bool settings and has random numbers instead. Needs
3818 some more investigation. Added other input length checks and checking
3819 of file and printer names.
3821 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3822 would link (Angus). Seems the old code doesn't compile with the pragma
3823 statement either. Separated callback entries from internal methods.
3825 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3827 2000-03-17 Allan Rae <rae@lyx.org>
3829 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3830 need it? Maybe it could go in Dialogs instead? I could make it a
3831 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3832 values to get the bool return value.
3833 (Dispatch): New overloaded method for xtl support.
3835 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3836 extern "C" callback instead of static member functions. Hopefully,
3837 JMarc will be able to compile this. I haven't changed
3838 forms/form_copyright.fd yet. Breaking one of my own rules already.
3840 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3841 because they aren't useful from the minibuffer. Maybe a LyXServer
3842 might want a help message though?
3844 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3846 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3847 xtl which needs both rtti and exceptions.
3849 * src/support/Makefile.am:
3850 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3852 * src/frontends/xforms/input_validators.[ch]: input filters and
3853 validators. These conrol what keys are valid in input boxes.
3854 Use them and write some more. Much better idea than waiting till
3855 after the user has pressed Ok to say that the input fields don't make
3858 * src/frontends/xforms/Makefile.am:
3859 * src/frontends/xforms/forms/form_print.fd:
3860 * src/frontends/xforms/forms/makefile:
3861 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3862 new scheme. Still have to make sure I haven't missed anything from
3863 the current implementation.
3865 * src/Makefile.am, src/PrinterParams.h: New data store.
3867 * other files: Added a couple of copyright notices.
3869 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3871 * src/insets/insetbib.h: move Holder struct in public space.
3873 * src/frontends/include/DialogBase.h: use SigC:: only when
3874 SIGC_CXX_NAMESPACES is defined.
3875 * src/frontends/include/Dialogs.h: ditto.
3877 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3879 * src/frontends/xforms/FormCopyright.[Ch]: do not
3880 mention SigC:: explicitely.
3882 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3884 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3885 deals with testing KDE in main configure.in
3886 * configure.in: ditto.
3888 2000-02-22 Allan Rae <rae@lyx.org>
3890 * Lots of files: Merged from HEAD
3892 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3893 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3895 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3897 * sigc++/: new minidist.
3899 2000-02-14 Allan Rae <rae@lyx.org>
3901 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3903 2000-02-08 Juergen Vigna <jug@sad.it>
3905 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3906 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3908 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3909 for this port and so it is much easier for other people to port
3910 dialogs in a common development environment.
3912 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3913 the QT/KDE implementation.
3915 * src/frontends/kde/Dialogs.C:
3916 * src/frontends/kde/FormCopyright.C:
3917 * src/frontends/kde/FormCopyright.h:
3918 * src/frontends/kde/Makefile.am:
3919 * src/frontends/kde/formcopyrightdialog.C:
3920 * src/frontends/kde/formcopyrightdialog.h:
3921 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3922 for the kde support of the Copyright-Dialog.
3924 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3925 subdir-substitution instead of hardcoded 'xforms' as we now have also
3928 * src/frontends/include/DialogBase.h (Object): just commented the
3929 label after #endif (nasty warning and I don't like warnings ;)
3931 * src/main.C (main): added KApplication initialization if using
3934 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3935 For now only the KDE event-loop is added if frontend==kde.
3937 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3939 * configure.in: added support for the --with-frontend[=value] option
3941 * autogen.sh: added kde.m4 file to list of config-files
3943 * acconfig.h: added define for KDEGUI-support
3945 * config/kde.m4: added configuration functions for KDE-port
3947 * config/lyxinclude.m4: added --with-frontend[=value] option with
3948 support for xforms and KDE.
3950 2000-02-08 Allan Rae <rae@lyx.org>
3952 * all Makefile.am: Fixed up so the make targets dist, distclean,
3953 install and uninstall all work even if builddir != srcdir. Still
3954 have a new sigc++ minidist update to come.
3956 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3958 2000-02-01 Allan Rae <rae@lyx.org>
3960 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3961 Many mods to get builddir != srcdir working.
3963 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3964 for building on NT and so we can do the builddir != srcdir stuff.
3966 2000-01-30 Allan Rae <rae@lyx.org>
3968 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3969 This will stay in "rae" branch. We probably don't really need it in
3970 the main trunk as anyone who wants to help programming it should get
3971 a full library installed also. So they can check both included and
3972 system supplied library compilation.
3974 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3975 Added a 'mini' distribution of libsigc++. If you feel the urge to
3976 change something in these directories - Resist it. If you can't
3977 resist the urge then you should modify the following script and rebuild
3978 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3979 all happen. Still uses a hacked version of libsigc++'s configure.in.
3980 I'm quite happy with the results. I'm not sure the extra work to turn
3981 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3982 worth the trouble and would probably lead to extra maintenance
3984 I haven't tested the following important make targets: install, dist.
3985 Not ready for prime time but very close. Maybe 1.1.5.
3987 * development/tools/makeLyXsigc.sh: A shell script to automatically
3988 generate our mini-dist of libsigc++. It can only be used with a CVS
3989 checkout of libsigc++ not a tarball distribution. It's well commented.
3990 This will end up as part of the libsigc++ distribution so other apps
3991 can easily have an included mini-dist. If someone makes mods to the
3992 sigc++ subpackage without modifying this script to generate those
3993 changes I'll be very upset!
3995 * src/frontends/: Started the gui/system indep structure.
3997 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3998 to access the gui-indep dialogs are in this class. Much improved
3999 design compared to previous revision. Lars, please refrain from
4000 moving this header into src/ like you did with Popups.h last time.
4002 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4004 * src/frontends/xforms/: Started the gui-indep system with a single
4005 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4008 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4009 Here you'll find a very useful makefile and automated fdfix.sh that
4010 makes updating dailogs a no-brainer -- provided you follow the rules
4011 set out in the README. I'm thinking about adding another script to
4012 automatically generate skeleton code for a new dialog given just the
4015 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4016 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4017 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4019 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4021 * src/support/LSubstring.C (operator): simplify
4023 * src/lyxtext.h: removed bparams, use buffer_->params instead
4025 * src/lyxrow.h: make Row a real class, move all variables to
4026 private and use accessors.
4028 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4030 (isRightToLeftPar): ditto
4031 (ChangeLanguage): ditto
4032 (isMultiLingual): ditto
4035 (SimpleTeXOnePar): ditto
4036 (TeXEnvironment): ditto
4037 (GetEndLabel): ditto
4039 (SetOnlyLayout): ditto
4040 (BreakParagraph): ditto
4041 (BreakParagraphConservative): ditto
4042 (GetFontSettings): ditto
4044 (CopyIntoMinibuffer): ditto
4045 (CutIntoMinibuffer): ditto
4046 (PasteParagraph): ditto
4047 (SetPExtraType): ditto
4048 (UnsetPExtraType): ditto
4049 (DocBookContTableRows): ditto
4050 (SimpleDocBookOneTablePar): ditto
4052 (TeXFootnote): ditto
4053 (SimpleTeXOneTablePar): ditto
4054 (TeXContTableRows): ditto
4055 (SimpleTeXSpecialChars): ditto
4058 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4059 to private and use accessors.
4061 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4062 this, we did not use it anymore and has not been for ages. Just a
4063 waste of cpu cycles.
4065 * src/language.h: make Language a real class, move all variables
4066 to private and use accessors.
4068 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4069 (create_view): remove
4070 (update): some changes for new timer
4071 (cursorToggle): use new timer
4072 (beforeChange): change for new timer
4074 * src/BufferView.h (cursorToggleCB): removed last paramter because
4077 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4078 (cursorToggleCB): change because of new timer code
4080 * lib/CREDITS: updated own mailaddress
4082 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4084 * src/support/filetools.C (PutEnv): fix the code in case neither
4085 putenv() nor setenv() have been found.
4087 * INSTALL: mention the install-strip Makefile target.
4089 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4090 read-only documents.
4092 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4094 * lib/reLyX/configure.in (VERSION): avoid using a previously
4095 generated reLyX wrapper to find out $prefix.
4097 * lib/examples/eu_adibide_lyx-atua.lyx:
4098 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4099 translation of the Tutorial (Dooteo)
4101 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4103 * forms/cite.fd: new citation dialog
4105 * src/insetcite.[Ch]: the new citation dialog is moved into
4108 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4111 * src/insets/insetcommand.h: data members made private.
4113 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4115 * LyX 1.1.5 released
4117 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4119 * src/version.h (LYX_RELEASE): to 1.1.5
4121 * src/spellchecker.C (RunSpellChecker): return false if the
4122 spellchecker dies upon creation.
4124 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4126 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4127 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4131 * lib/CREDITS: update entry for Martin Vermeer.
4133 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4135 * src/text.C (draw): Draw foreign language bars at the bottom of
4136 the row instead of at the baseline.
4138 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4140 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4142 * lib/bind/de_menus.bind: updated
4144 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4146 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4148 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4150 * src/menus.C (Limit_string_length): New function
4151 (ShowTocMenu): Limit the number of items/length of items in the
4154 * src/paragraph.C (String): Correct result for a paragraph inside
4157 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4159 * src/bufferlist.C (close): test of buf->getuser() == NULL
4161 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4163 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4164 Do not call to SetCursor when the paragraph is a closed footnote!
4166 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4168 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4171 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4173 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4176 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4177 reference popup, that activates the reference-back action
4179 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4181 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4182 the menus. Also fixed a bug.
4184 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4185 the math panels when switching buffers (unless new buffer is readonly).
4187 * src/BufferView.C (NoSavedPositions)
4188 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4190 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4192 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4193 less of dvi dirty or not.
4195 * src/trans_mgr.[Ch] (insert): change first parameter to string
4198 * src/chset.[Ch] (encodeString): add const to first parameter
4200 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4202 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4206 * src/LaTeX.C (deplog): better searching for dependency files in
4207 the latex log. Uses now regexps.
4209 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4210 instead of the box hack or \hfill.
4212 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4214 * src/lyxfunc.C (doImportHelper): do not create the file before
4215 doing the actual import.
4216 (doImportASCIIasLines): create a new file before doing the insert.
4217 (doImportASCIIasParagraphs): ditto.
4219 * lib/lyxrc.example: remove mention of non-existing commands
4221 * lyx.man: remove mention of color-related switches.
4223 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4225 * src/lyx_gui.C: remove all the color-related ressources, which
4226 are not used anymore.
4228 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4231 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4233 * src/lyxrc.C (read): Add a missing break in the switch
4235 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4237 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4239 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4242 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4244 * src/text.C (draw): draw bars under foreign language words.
4246 * src/LColor.[Ch]: add LColor::language
4248 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4250 * src/lyxcursor.h (boundary): New member variable
4252 * src/text.C (IsBoundary): New methods
4254 * src/text.C: Use the above for currect cursor movement when there
4255 is both RTL & LTR text.
4257 * src/text2.C: ditto
4259 * src/bufferview_funcs.C (ToggleAndShow): ditto
4261 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4263 * src/text.C (DeleteLineForward): set selection to true to avoid
4264 that DeleteEmptyParagraphMechanism does some magic. This is how it
4265 is done in all other functions, and seems reasonable.
4266 (DeleteWordForward): do not jump over non-word stuff, since
4267 CursorRightOneWord() already does it.
4269 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4270 DeleteWordBackward, since they seem safe to me (since selection is
4271 set to "true") DeleteEmptyParagraphMechanism does nothing.
4273 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4275 * src/lyx_main.C (easyParse): simplify the code by factoring the
4276 part that removes parameters from the command line.
4277 (LyX): check wether wrong command line options have been given.
4279 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4281 * src/lyx_main.C : add support for specifying user LyX
4282 directory via command line option -userdir.
4284 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4286 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4287 the number of items per popup.
4288 (Add_to_refs_menu): Ditto.
4290 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4292 * src/lyxparagraph.h: renamed ClearParagraph() to
4293 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4294 textclass as parameter, and do nothing if free_spacing is
4295 true. This fixes part of the line-delete-forward problems.
4297 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4298 (pasteSelection): ditto.
4299 (SwitchLayoutsBetweenClasses): more translatable strings.
4301 * src/text2.C (CutSelection): use StripLeadingSpaces.
4302 (PasteSelection): ditto.
4303 (DeleteEmptyParagraphMechanism): ditto.
4305 2000-05-26 Juergen Vigna <jug@sad.it>
4307 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4308 is not needed in tabular insets.
4310 * src/insets/insettabular.C (TabularFeatures): added missing features.
4312 * src/tabular.C (DeleteColumn):
4314 (AppendRow): implemented this functions
4315 (cellsturct::operator=): clone the inset too;
4317 2000-05-23 Juergen Vigna <jug@sad.it>
4319 * src/insets/insettabular.C (LocalDispatch): better selection support
4320 when having multicolumn-cells.
4322 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4324 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4326 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4328 * src/ColorHandler.C (getGCForeground): put more test into _()
4330 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4333 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4336 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4338 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4339 there are no labels, or when buffer is readonly.
4341 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4342 there are no labels, buffer is SGML, or when buffer is readonly.
4344 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4346 * src/LColor.C (LColor): change a couple of grey40 to grey60
4347 (LColor): rewore initalization to make compiles go some magnitude
4349 (getGUIName): don't use gettext until we need the string.
4351 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4353 * src/Bullet.[Ch]: Fixed a small bug.
4355 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4357 * src/paragraph.C (String): Several fixes/improvements
4359 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4361 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4363 * src/paragraph.C (String): give more correct output.
4365 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4367 * src/lyxfont.C (stateText) Do not output the language if it is
4368 eqaul to the language of the document.
4370 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4371 between two paragraphs with the same language.
4373 * src/paragraph.C (getParLanguage) Return a correct answer for an
4374 empty dummy paragraph.
4376 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4379 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4382 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4383 the menus/popup, if requested fonts are unavailable.
4385 2000-05-22 Juergen Vigna <jug@sad.it>
4387 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4388 movement support (Up/Down/Tab/Shift-Tab).
4389 (LocalDispatch): added also preliminari cursor-selection.
4391 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4393 * src/paragraph.C (PasteParagraph): Hopefully now right!
4395 2000-05-22 Garst R. Reese <reese@isn.net>
4397 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4398 of list, change all references to Environment to Command
4399 * tex/hollywood.cls : rewrite environments as commands, add
4400 \uppercase to interiorshot and exteriorshot to force uppecase.
4401 * tex/broadway.cls : rewrite environments as commands. Tweak
4404 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4406 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4407 size of items: use a constant intead of the hardcoded 40, and more
4408 importantly do not remove the %m and %x tags added at the end.
4409 (Add_to_refs_menu): use vector::size_type instead of
4410 unsigned int as basic types for the variables. _Please_ do not
4411 assume that size_t is equal to unsigned int. On an alpha, this is
4412 unsigned long, which is _not_ the same.
4414 * src/language.C (initL): remove language "hungarian", since it
4415 seems that "magyar" is better.
4417 2000-05-22 Juergen Vigna <jug@sad.it>
4419 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4421 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4424 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4425 next was deleted but not set to 0.
4427 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4429 * src/language.C (initL): change the initialization of languages
4430 so that compiles goes _fast_.
4432 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4435 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4437 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4441 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4443 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4445 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4449 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4452 * src/insets/insetlo*.[Ch]: Made editable
4454 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4456 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4457 the current selection.
4459 * src/BufferView_pimpl.C (stuffClipboard): new method
4461 * src/BufferView.C (stuffClipboard): new method
4463 * src/paragraph.C (String): new method
4465 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4466 LColor::ignore when lyxname is not found.
4468 * src/BufferView.C (pasteSelection): new method
4470 * src/BufferView_pimpl.C (pasteSelection): new method
4472 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4474 * src/WorkArea.C (request_clipboard_cb): new static function
4475 (getClipboard): new method
4476 (putClipboard): new method
4478 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4480 * LyX 1.1.5pre2 released
4482 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4484 * src/vspace.C (operator=): removed
4485 (operator=): removed
4487 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4489 * src/layout.C (NumberOfClass): manually set the type in make_pair
4490 (NumberOfLayout): ditto
4492 * src/language.C: use the Language constructor for ignore_lang
4494 * src/language.h: add constructors to struct Language
4496 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4498 * src/text2.C (SetCursorIntern): comment out #warning
4500 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4502 * src/mathed/math_iter.h: initialize sx and sw to 0
4504 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4506 * forms/lyx.fd: Redesign of form_ref
4508 * src/LaTeXFeatures.[Ch]
4512 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4515 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4516 and Buffer::inset_iterator.
4518 * src/menus.C: Added new menus: TOC and Refs.
4520 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4522 * src/buffer.C (getTocList): New method.
4524 * src/BufferView2.C (ChangeRefs): New method.
4526 * src/buffer.C (getLabelList): New method. It replaces the old
4527 getReferenceList. The return type is vector<string> instead of
4530 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4531 the old getLabel() and GetNumberOfLabels() methods.
4532 * src/insets/insetlabel.C (getLabelList): ditto
4533 * src/mathed/formula.C (getLabelList): ditto
4535 * src/paragraph.C (String): New method.
4537 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4538 Uses the new getTocList() method.
4539 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4540 which automatically updates the contents of the browser.
4541 (RefUpdateCB): Use the new getLabelList method.
4543 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4545 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4547 * src/spellchecker.C: Added using std::reverse;
4549 2000-05-19 Juergen Vigna <jug@sad.it>
4551 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4553 * src/insets/insettext.C (computeTextRows): small fix for display of
4554 1 character after a newline.
4556 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4559 2000-05-18 Juergen Vigna <jug@sad.it>
4561 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4562 when changing width of column.
4564 * src/tabular.C (set_row_column_number_info): setting of
4565 autobreak rows if necessary.
4567 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4569 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4571 * src/vc-backend.*: renamed stat() to status() and vcstat to
4572 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4573 compilation broke. The new name seems more relevant, anyway.
4575 2000-05-17 Juergen Vigna <jug@sad.it>
4577 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4578 which was wrong if the removing caused removing of rows!
4580 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4581 (pushToken): new function.
4583 * src/text2.C (CutSelection): fix problem discovered with purify
4585 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4587 * src/debug.C (showTags): enlarge the first column, now that we
4588 have 6-digits debug codes.
4590 * lib/layouts/hollywood.layout:
4591 * lib/tex/hollywood.cls:
4592 * lib/tex/brodway.cls:
4593 * lib/layouts/brodway.layout: more commands and fewer
4594 environments. Preambles moved in the .cls files. Broadway now has
4595 more options on scene numbering and less whitespace (from Garst)
4597 * src/insets/insetbib.C (getKeys): make sure that we are in the
4598 document directory, in case the bib file is there.
4600 * src/insets/insetbib.C (Latex): revert bogus change.
4602 2000-05-16 Juergen Vigna <jug@sad.it>
4604 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4605 the TabularLayout on cursor move.
4607 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4609 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4612 (draw): fixed cursor position and drawing so that the cursor is
4613 visible when before the tabular-inset.
4615 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4616 when creating from old insettext.
4618 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4620 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4622 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4623 * lib/tex/brodway.cls: ditto
4625 * lib/layouts/brodway.layout: change alignment of parenthical
4628 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4630 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4631 versions 0.88 and 0.89 are supported.
4633 2000-05-15 Juergen Vigna <jug@sad.it>
4635 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4638 * src/insets/insettext.C (computeTextRows): redone completely this
4639 function in a much cleaner way, because of problems when having a
4641 (draw): added a frame border when the inset is locked.
4642 (SetDrawLockedFrame): this sets if we draw the border or not.
4643 (SetFrameColor): this sets the frame color (default=insetframe).
4645 * src/insets/lyxinset.h: added x() and y() functions which return
4646 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4647 function which is needed to see if we have a locking inset of some
4648 type in this inset (needed for now in insettabular).
4650 * src/vspace.C (inPixels): the same function also without a BufferView
4651 parameter as so it is easier to use it in some ocasions.
4653 * src/lyxfunc.C: changed all places where insertInset was used so
4654 that now if it couldn't be inserted it is deleted!
4656 * src/TabularLayout.C:
4657 * src/TableLayout.C: added support for new tabular-inset!
4659 * src/BufferView2.C (insertInset): this now returns a bool if the
4660 inset was really inserted!!!
4662 * src/tabular.C (GetLastCellInRow):
4663 (GetFirstCellInRow): new helper functions.
4664 (Latex): implemented for new tabular class.
4668 (TeXTopHLine): new Latex() helper functions.
4670 2000-05-12 Juergen Vigna <jug@sad.it>
4672 * src/mathed/formulamacro.C (Read):
4673 * src/mathed/formula.C (Read): read also the \end_inset here!
4675 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4677 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4678 crush when saving formulae with unbalanced parenthesis.
4680 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4682 * src/layout.C: Add new keyword "endlabelstring" to layout file
4684 * src/text.C (GetVisibleRow): Draw endlabel string.
4686 * lib/layouts/broadway.layout
4687 * lib/layouts/hollywood.layout: Added endlabel for the
4688 Parenthetical layout.
4690 * lib/layouts/heb-article.layout: Do not use slanted font shape
4691 for Theorem like environments.
4693 * src/buffer.C (makeLaTeXFile): Always add "american" to
4694 the UsedLanguages list if document language is RTL.
4696 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4698 * add addendum to README.OS2 and small patch (from SMiyata)
4700 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4702 * many files: correct the calls to ChangeExtension().
4704 * src/support/filetools.C (ChangeExtension): remove the no_path
4705 argument, which does not belong there. Use OnlyFileName() instead.
4707 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4708 files when LaTeXing a non-nice latex file.
4710 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4711 a chain of "if". Return false when deadkeys are not handled.
4713 * src/lyx_main.C (LyX): adapted the code for default bindings.
4715 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4716 bindings for basic functionality (except deadkeys).
4717 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4719 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4720 several methods: handle override_x_deadkeys.
4722 * src/lyxrc.h: remove the "bindings" map, which did not make much
4723 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4725 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4727 * src/lyxfont.C (stateText): use a saner method to determine
4728 whether the font is "default". Seems to fix the crash with DEC
4731 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4733 2000-05-08 Juergen Vigna <jug@sad.it>
4735 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4736 TabularLayoutMenu with mouse-button-3
4737 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4739 * src/TabularLayout.C: added this file for having a Layout for
4742 2000-05-05 Juergen Vigna <jug@sad.it>
4744 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4745 recalculating inset-widths.
4746 (TabularFeatures): activated this function so that I can change
4747 tabular-features via menu.
4749 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4750 that I can test some functions with the Table menu.
4752 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4754 * src/lyxfont.C (stateText): guard against stupid c++libs.
4756 * src/tabular.C: add using std::vector
4757 some whitespace changes, + removed som autogenerated code.
4759 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4761 2000-05-05 Juergen Vigna <jug@sad.it>
4763 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4764 row, columns and cellstructures.
4766 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4768 * lib/lyxrc.example: remove obsolete entries.
4770 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4771 reading of protected_separator for free_spacing.
4773 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4775 * src/text.C (draw): do not display an exclamation mark in the
4776 margin for margin notes. This is confusing, ugly and
4779 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4780 AMS math' is checked.
4782 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4783 name to see whether including the amsmath package is needed.
4785 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4787 * src/paragraph.C (validate): Compute UsedLanguages correctly
4788 (don't insert the american language if it doesn't appear in the
4791 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4792 The argument of \thanks{} command is considered moving argument
4794 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4797 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4799 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4800 for appendix/minipage/depth. The lines can be now both in the footnote
4801 frame, and outside the frame.
4803 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4806 2000-05-05 Juergen Vigna <jug@sad.it>
4808 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4809 neede only in tabular.[Ch].
4811 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4813 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4815 (Write): write '~' for PROTECTED_SEPARATOR
4817 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4819 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4822 * src/mathed/formula.C (drawStr): rename size to siz.
4824 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4825 possibly fix a bug by not changing the pflags = flags to piflags =
4828 2000-05-05 Juergen Vigna <jug@sad.it>
4830 * src/insets/insetbib.C: moved using directive
4832 * src/ImportNoweb.C: small fix for being able to compile (missing
4835 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4837 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4838 to use clear, since we don't depend on this in the code. Add test
4841 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4843 * (various *.C files): add using std::foo directives to please dec
4846 * replace calls to string::clear() to string::erase() (Angus)
4848 * src/cheaders/cmath: modified to provide std::abs.
4850 2000-05-04 Juergen Vigna <jug@sad.it>
4852 * src/insets/insettext.C: Prepared all for inserting of multiple
4853 paragraphs. Still display stuff to do (alignment and other things),
4854 but I would like to use LyXText to do this when we cleaned out the
4855 table-support stuff.
4857 * src/insets/insettabular.C: Changed lot of stuff and added lots
4858 of functionality still a lot to do.
4860 * src/tabular.C: Various functions changed name and moved to be
4861 const functions. Added new Read and Write functions and changed
4862 lots of things so it works good with tabular-insets (also removed
4863 some stuff which is not needed anymore * hacks *).
4865 * src/lyxcursor.h: added operators == and != which just look if
4866 par and pos are (not) equal.
4868 * src/buffer.C (latexParagraphs): inserted this function to latex
4869 all paragraphs form par to endpar as then I can use this too for
4872 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4873 so that I can call this to from text insets with their own cursor.
4875 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4876 output off all paragraphs (because of the fix below)!
4878 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4879 the very last paragraph (this could be also the last paragraph of an
4882 * src/texrow.h: added rows() call which returns the count-variable.
4884 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4886 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4888 * lib/configure.m4: better autodetection of DocBook tools.
4890 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4892 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4894 * src/lyx_cb.C: add using std::reverse;
4896 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4899 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4900 selected files. Should fix repeated errors from generated files.
4902 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4904 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4906 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4907 the spellchecker popup.
4909 * lib/lyxrc.example: Removed the \number_inset section
4911 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4913 * src/insets/figinset.C (various): Use IsFileReadable() to make
4914 sure that the file actually exist. Relying on ghostscripts errors
4915 is a bad idea since they can lead to X server crashes.
4917 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4919 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4922 * lib/lyxrc.example: smallish typo in description of
4923 \view_dvi_paper_option
4925 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4928 * src/lyxfunc.C: doImportHelper to factor out common code of the
4929 various import methods. New functions doImportASCIIasLines,
4930 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4931 doImportLinuxDoc for the format specific parts.
4934 * buffer.C: Dispatch returns now a bool to indicate success
4937 * lyx_gui.C: Add getLyXView() for member access
4939 * lyx_main.C: Change logic for batch commands: First try
4940 Buffer::Dispatch (possibly without GUI), if that fails, use
4943 * lyx_main.C: Add support for --import command line switch.
4944 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4945 Available Formats: Everything accepted by 'buffer-import <format>'
4947 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4949 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4952 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4953 documents will be reformatted upon reentry.
4955 2000-04-27 Juergen Vigna <jug@sad.it>
4957 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4958 correctly only last pos this was a bug.
4960 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4962 * release of lyx-1.1.5pre1
4964 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4966 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4968 * src/menus.C: revert the change of naming (Figure->Graphic...)
4969 from 2000-04-11. It was incomplete and bad.
4971 * src/LColor.[Ch]: add LColor::depthbar.
4972 * src/text.C (GetVisibleRow): use it.
4974 * README: update the languages list.
4976 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4978 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4981 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4983 * README: remove sections that were just wrong.
4985 * src/text2.C (GetRowNearY): remove currentrow code
4987 * src/text.C (GetRow): remove currentrow code
4989 * src/screen.C (Update): rewritten a bit.
4990 (SmallUpdate): removed func
4992 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4994 (FullRebreak): return bool
4995 (currentrow): remove var
4996 (currentrow_y): ditto
4998 * src/lyxscreen.h (Draw): change arg to unsigned long
4999 (FitCursor): return bool
5000 (FitManualCursor): ditto
5001 (Smallpdate): remove func
5002 (first): change to unsigned long
5003 (DrawOneRow): change second arg to long (from long &)
5004 (screen_refresh_y): remove var
5005 (scree_refresh_row): ditto
5007 * src/lyxrow.h: change baseline to usigned int from unsigned
5008 short, this brings some implicit/unsigned issues out in the open.
5010 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5012 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5013 instead of smallUpdate.
5015 * src/lyxcursor.h: change y to unsigned long
5017 * src/buffer.h: don't call updateScrollbar after fitcursor
5019 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5020 where they are used. Removed "\\direction", this was not present
5021 in 1.1.4 and is already obsolete. Commented out some code that I
5022 believe to never be called.
5023 (runLiterate): don't call updateScrollbar after fitCursor
5025 (buildProgram): ditto
5028 * src/WorkArea.h (workWidth): change return val to unsigned
5031 (redraw): remove the button redraws
5032 (setScrollbarValue): change for scrollbar
5033 (getScrollbarValue): change for scrollbar
5034 (getScrollbarBounds): change for scrollbar
5036 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5037 (C_WorkArea_down_cb): removed func
5038 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5039 (resize): change for scrollbar
5040 (setScrollbar): ditto
5041 (setScrollbarBounds): ditto
5042 (setScrollbarIncrements): ditto
5043 (up_cb): removed func
5044 (down_cb): removed func
5045 (scroll_cb): change for scrollbar
5046 (work_area_handler): ditto
5048 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5049 when FitCursor did something.
5050 (updateScrollbar): some unsigned changes
5051 (downCB): removed func
5052 (scrollUpOnePage): removed func
5053 (scrollDownOnePage): remvoed func
5054 (workAreaMotionNotify): don't call screen->FitCursor but use
5055 fitCursor instead. and bool return val
5056 (workAreaButtonPress): ditto
5057 (workAreaButtonRelease): some unsigned changes
5058 (checkInsetHit): ditto
5059 (workAreaExpose): ditto
5060 (update): parts rewritten, comments about the signed char arg added
5061 (smallUpdate): removed func
5062 (cursorPrevious): call needed updateScrollbar
5065 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5068 * src/BufferView.[Ch] (upCB): removed func
5069 (downCB): removed func
5070 (smallUpdate): removed func
5072 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5074 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5075 currentrow, currentrow_y optimization. This did not help a lot and
5076 if we want to do this kind of optimization we should rather use
5077 cursor.row instead of the currentrow.
5079 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5080 buffer spacing and klyx spacing support.
5082 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5084 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5087 2000-04-26 Juergen Vigna <jug@sad.it>
5089 * src/insets/figinset.C: fixes to Lars sstream changes!
5091 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5093 * A lot of files: Added Ascii(ostream &) methods to all inset
5094 classes. Used when exporting to ASCII.
5096 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5097 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5100 * src/text2.C (ToggleFree): Disabled implicit word selection when
5101 there is a change in the language
5103 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5104 no output was generated for end-of-sentence inset.
5106 * src/insets/lyxinset.h
5109 * src/paragraph.C: Removed the insetnumber code
5111 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5113 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5115 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5116 no_babel and no_epsfig completely from the file.
5117 (parseSingleLyXformat2Token): add handling for per-paragraph
5118 spacing as written by klyx.
5120 * src/insets/figinset.C: applied patch by Andre. Made it work with
5123 2000-04-20 Juergen Vigna <jug@sad.it>
5125 * src/insets/insettext.C (cutSelection):
5126 (copySelection): Fixed with selection from right to left.
5127 (draw): now the rows are not recalculated at every draw.
5128 (computeTextRows): for now reset the inset-owner here (this is
5129 important for an undo or copy where the inset-owner is not set
5132 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5133 motion to the_locking_inset screen->first was forgotten, this was
5134 not important till we got multiline insets.
5136 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5138 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5139 code seems to be alright (it is code changed by Dekel, and the
5140 intent is indeed that all macros should be defined \protect'ed)
5142 * NEWS: a bit of reorganisation of the new user-visible features.
5144 2000-04-19 Juergen Vigna <jug@sad.it>
5146 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5147 position. Set the inset_owner of the used paragraph so that it knows
5148 that it is inside an inset. Fixed cursor handling with mouse and
5149 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5150 and cleanups to make TextInsets work better.
5152 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5153 Changed parameters of various functions and added LockInsetInInset().
5155 * src/insets/insettext.C:
5157 * src/insets/insetcollapsable.h:
5158 * src/insets/insetcollapsable.C:
5159 * src/insets/insetfoot.h:
5160 * src/insets/insetfoot.C:
5161 * src/insets/insetert.h:
5162 * src/insets/insetert.C: cleaned up the code so that it works now
5163 correctly with insettext.
5165 * src/insets/inset.C:
5166 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5167 that insets in insets are supported right.
5170 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5172 * src/paragraph.C: some small fixes
5174 * src/debug.h: inserted INSETS debug info
5176 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5177 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5179 * src/commandtags.h:
5180 * src/LyXAction.C: insert code for InsetTabular.
5182 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5183 not Button1MotionMask.
5184 (workAreaButtonRelease): send always a InsetButtonRelease event to
5186 (checkInsetHit): some setCursor fixes (always with insets).
5188 * src/BufferView2.C (lockInset): returns a bool now and extended for
5189 locking insets inside insets.
5190 (showLockedInsetCursor): it is important to have the cursor always
5191 before the locked inset.
5192 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5194 * src/BufferView.h: made lockInset return a bool.
5196 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5198 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5199 that is used also internally but can be called as public to have back
5200 a cursor pos which is not set internally.
5201 (SetCursorIntern): Changed to use above function.
5203 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5205 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5210 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5211 patches for things that should be in or should be changed.
5213 * src/* [insetfiles]: change "usigned char fragile" to bool
5214 fragile. There was only one point that could that be questioned
5215 and that is commented in formulamacro.C. Grep for "CHECK".
5217 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5218 (DeleteBuffer): take it out of CutAndPaste and make it static.
5220 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5222 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5223 output the spacing envir commands. Also the new commands used in
5224 the LaTeX output makes the result better.
5226 * src/Spacing.C (writeEnvirBegin): new method
5227 (writeEnvirEnd): new method
5229 2000-04-18 Juergen Vigna <jug@sad.it>
5231 * src/CutAndPaste.C: made textclass a static member of the class
5232 as otherwise it is not accesed right!!!
5234 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5236 * forms/layout_forms.fd
5237 * src/layout_forms.h
5238 * src/layout_forms.C (create_form_form_character)
5239 * src/lyx_cb.C (UserFreeFont)
5240 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5241 documents (in the layout->character popup).
5243 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5245 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5246 \spell_command was in fact not honored (from Kevin Atkinson).
5248 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5251 * src/lyx_gui.h: make lyxViews private (Angus)
5253 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5255 * src/mathed/math_write.C
5256 (MathMatrixInset::Write) Put \protect before \begin{array} and
5257 \end{array} if fragile
5258 (MathParInset::Write): Put \protect before \\ if fragile
5260 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5262 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5263 initialization if the LyXColorHandler must be done after the
5264 connections to the XServer has been established.
5266 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5267 get the background pixel from the lyxColorhandler so that the
5268 figures are rendered with the correct background color.
5269 (NextToken): removed functions.
5270 (GetPSSizes): use ifs >> string instead of NextToken.
5272 * src/Painter.[Ch]: the color cache moved out of this file.
5274 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5277 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5279 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5280 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5282 * src/BufferView.C (enterView): new func
5283 (leaveView): new func
5285 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5287 (leaveView): new func, undefines xterm cursor when approp.
5289 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5290 (AllowInput): delete the Workarea cursor handling from this func.
5292 * src/Painter.C (underline): draw a slimer underline in most cases.
5294 * src/lyx_main.C (error_handler): use extern "C"
5296 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5298 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5299 sent directly to me.
5301 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5302 to the list by Dekel.
5304 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5307 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5308 methods from lyx_cb.here.
5310 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5313 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5315 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5316 instead of using current_view directly.
5318 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5320 * src/LyXAction.C (init): add the paragraph-spacing command.
5322 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5324 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5326 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5327 different from the documents.
5329 * src/text.C (SetHeightOfRow): take paragraph spacing into
5330 account, paragraph spacing takes precedence over buffer spacing
5331 (GetVisibleRow): ditto
5333 * src/paragraph.C (writeFile): output the spacing parameter too.
5334 (validate): set the correct features if spacing is used in the
5336 (Clear): set spacing to default
5337 (MakeSameLayout): spacing too
5338 (HasSameLayout): spacing too
5339 (SetLayout): spacing too
5340 (TeXOnePar): output the spacing commands
5342 * src/lyxparagraph.h: added a spacing variable for use with
5343 per-paragraph spacing.
5345 * src/Spacing.h: add a Default spacing and a method to check if
5346 the current spacing is default. also added an operator==
5348 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5351 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5353 * src/lyxserver.C (callback): fix dispatch of functions
5355 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5356 printf() into lyxerr call.
5358 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5361 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5362 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5363 the "Float" from each of the subitems.
5364 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5366 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5367 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5368 documented the change so that the workaround can be nuked later.
5370 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5373 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5375 * src/buffer.C (getLatexName): ditto
5376 (setReadonly): ditto
5378 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5380 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5381 avoid some uses of current_view. Added also a bufferParams()
5382 method to get at this.
5384 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5386 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5388 * src/lyxparagraph.[Ch]: removed
5389 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5390 with operators used by lower_bound and
5391 upper_bound in InsetTable's
5392 Make struct InsetTable private again. Used matchpos.
5394 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5396 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5397 document, the language of existing text is changed (unless the
5398 document is multi-lingual)
5400 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5402 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5404 * A lot of files: A rewrite of the Right-to-Left support.
5406 2000-04-10 Juergen Vigna <jug@sad.it>
5408 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5409 misplaced cursor when inset in inset is locked.
5411 * src/insets/insettext.C (LocalDispatch): small fix so that a
5412 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5414 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5415 footnote font should be decreased in size twice when displaying.
5417 * src/insets/insettext.C (GetDrawFont): inserted this function as
5418 the drawing-font may differ from the real paragraph font.
5420 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5421 insets (inset in inset!).
5423 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5424 function here because we don't want footnotes inside footnotes.
5426 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5428 (init): now set the inset_owner in paragraph.C
5429 (LocalDispatch): added some resetPos() in the right position
5432 (pasteSelection): changed to use the new CutAndPaste-Class.
5434 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5435 which tells if it is allowed to insert another inset inside this one.
5437 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5438 SwitchLayoutsBetweenClasses.
5440 * src/text2.C (InsertInset): checking of the new paragraph-function
5442 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5443 is not needed anymore here!
5446 (PasteSelection): redone (also with #ifdef) so that now this uses
5447 the CutAndPaste-Class.
5448 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5451 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5452 from/to text/insets.
5454 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5455 so that the paragraph knows if it is inside an (text)-inset.
5456 (InsertFromMinibuffer): changed return-value to bool as now it
5457 may happen that an inset is not inserted in the paragraph.
5458 (InsertInsetAllowed): this checks if it is allowed to insert an
5459 inset in this paragraph.
5461 (BreakParagraphConservative):
5462 (BreakParagraph) : small change for the above change of the return
5463 value of InsertFromMinibuffer.
5465 * src/lyxparagraph.h: added inset_owner and the functions to handle
5466 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5468 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5470 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5471 functions from BufferView to BufferView::Pimpl to ease maintence.
5473 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5474 correctly. Also use SetCursorIntern instead of SetCursor.
5476 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5479 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5481 * src/WorkArea.C (belowMouse): manually implement below mouse.
5483 * src/*: Add "explicit" on several constructors, I added probably
5484 some unneeded ones. A couple of changes to code because of this.
5486 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5487 implementation and private parts from the users of BufferView. Not
5490 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5491 implementation and private parts from the users of LyXLex. Not
5494 * src/BufferView_pimpl.[Ch]: new files
5496 * src/lyxlex_pimpl.[Ch]: new files
5498 * src/LyXView.[Ch]: some inline functions move out-of-line
5500 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5502 * src/lyxparagraph.h: make struct InsetTable public.
5504 * src/support/lyxstring.h: change lyxstring::difference_type to be
5505 ptrdiff_t. Add std:: modifiers to streams.
5507 * src/font.C: include the <cctype> header, for islower() and
5510 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5512 * src/font.[Ch]: new files. Contains the metric functions for
5513 fonts, takes a LyXFont as parameter. Better separation of concepts.
5515 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5516 changes because of this.
5518 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5520 * src/*: compile with -Winline and move functions that don't
5523 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5526 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5528 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5529 (various files changed because of this)
5531 * src/Painter.C (text): fixed the drawing of smallcaps.
5533 * src/lyxfont.[Ch] (drawText): removed unused member func.
5536 * src/*.C: added needed "using" statements and "std::" qualifiers.
5538 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5540 * src/*.h: removed all use of "using" from header files use
5541 qualifier std:: instead.
5543 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5545 * src/text.C (Backspace): some additional cleanups (we already
5546 know whether cursor.pos is 0 or not).
5548 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5549 automake does not provide one).
5551 * src/bmtable.h: replace C++ comments with C comments.
5553 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5555 * src/screen.C (ShowCursor): Change the shape of the cursor if
5556 the current language is not equal to the language of the document.
5557 (If the cursor change its shape unexpectedly, then you've found a bug)
5559 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5562 * src/insets/insetnumber.[Ch]: New files.
5564 * src/LyXAction.C (init)
5565 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5568 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5570 * src/lyxparagraph.h
5571 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5572 (the vector is kept sorted).
5574 * src/text.C (GetVisibleRow): Draw selection correctly when there
5575 is both LTR and RTL text.
5577 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5578 which is much faster.
5580 * src/text.C (GetVisibleRow and other): Do not draw the last space
5581 in a row if the direction of the last letter is not equal to the
5582 direction of the paragraph.
5584 * src/lyxfont.C (latexWriteStartChanges):
5585 Check that font language is not equal to basefont language.
5586 (latexWriteEndChanges): ditto
5588 * src/lyx_cb.C (StyleReset): Don't change the language while using
5589 the font-default command.
5591 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5592 empty paragraph before a footnote.
5594 * src/insets/insetcommand.C (draw): Increase x correctly.
5596 * src/screen.C (ShowCursor): Change cursor shape if
5597 current language != document language.
5599 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5601 2000-03-31 Juergen Vigna <jug@sad.it>
5603 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5604 (Clone): changed mode how the paragraph-data is copied to the
5605 new clone-paragraph.
5607 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5608 GetInset(pos) with no inset anymore there (in inset UNDO)
5610 * src/insets/insetcommand.C (draw): small fix as here x is
5611 incremented not as much as width() returns (2 before, 2 behind = 4)
5613 2000-03-30 Juergen Vigna <jug@sad.it>
5615 * src/insets/insettext.C (InsetText): small fix in initialize
5616 widthOffset (should not be done in the init() function)
5618 2000-03-29 Amir Karger <karger@lyx.org>
5620 * lib/examples/it_ItemizeBullets.lyx: translation by
5623 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5625 2000-03-29 Juergen Vigna <jug@sad.it>
5627 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5629 * src/insets/insetfoot.C (Clone): small change as for the below
5630 new init function in the text-inset
5632 * src/insets/insettext.C (init): new function as I've seen that
5633 clone did not copy the Paragraph-Data!
5634 (LocalDispatch): Added code so that now we have some sort of Undo
5635 functionality (well actually we HAVE Undo ;)
5637 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5639 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5641 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5644 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5646 * src/main.C: added a runtime check that verifies that the xforms
5647 header used when building LyX and the library used when running
5648 LyX match. Exit with a message if they don't match. This is a
5649 version number check only.
5651 * src/buffer.C (save): Don't allocate memory on the heap for
5652 struct utimbuf times.
5654 * *: some using changes, use iosfwd instead of the real headers.
5656 * src/lyxfont.C use char const * instead of string for the static
5657 strings. Rewrite some functions to use sstream.
5659 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5661 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5664 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5666 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5667 of Geodesy (from Martin Vermeer)
5669 * lib/layouts/svjour.inc: include file for the Springer svjour
5670 class. It can be used to support journals other than JoG.
5672 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5673 Miskiewicz <misiek@pld.org.pl>)
5674 * lib/reLyX/Makefile.am: ditto.
5676 2000-03-27 Juergen Vigna <jug@sad.it>
5678 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5679 also some modifications with operations on selected text.
5681 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5682 problems with clicking on insets (last famous words ;)
5684 * src/insets/insetcommand.C (draw):
5685 (width): Changed to have a bit of space before and after the inset so
5686 that the blinking cursor can be seen (otherwise it was hidden)
5688 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5690 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5691 would not be added to the link list when an installed gettext (not
5692 part of libc) is found.
5694 2000-03-24 Juergen Vigna <jug@sad.it>
5696 * src/insets/insetcollapsable.C (Edit):
5697 * src/mathed/formula.C (InsetButtonRelease):
5698 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5701 * src/BufferView.C (workAreaButtonPress):
5702 (workAreaButtonRelease):
5703 (checkInsetHit): Finally fixed the clicking on insets be handled
5706 * src/insets/insetert.C (Edit): inserted this call so that ERT
5707 insets work always with LaTeX-font
5709 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5711 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5712 caused lyx to startup with no GUI in place, causing in a crash
5713 upon startup when called with arguments.
5715 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5717 * src/FontLoader.C: better initialization of dummyXFontStruct.
5719 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5721 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5722 for linuxdoc and docbook import and export format options.
5724 * lib/lyxrc.example Example of default values for the previous flags.
5726 * src/lyx_cb.C Use those flags instead of the hardwired values for
5727 linuxdoc and docbook export.
5729 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5732 * src/menus.C Added menus entries for the new import/exports formats.
5734 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5736 * src/lyxrc.*: Added support for running without Gui
5739 * src/FontLoader.C: sensible defaults if no fonts are needed
5741 * src/lyx_cb.C: New function ShowMessage (writes either to the
5742 minibuffer or cout in case of no gui
5743 New function AskOverwrite for common stuff
5744 Consequently various changes to call these functions
5746 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5747 wild guess at sensible screen resolution when having no gui
5749 * src/lyxfont.C: no gui, no fonts... set some defaults
5751 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5753 * src/LColor.C: made the command inset background a bit lighter.
5755 2000-03-20 Hartmut Goebel <goebel@noris.net>
5757 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5758 stdstruct.inc. Koma-Script added some title elements which
5759 otherwise have been listed below "bibliography". This split allows
5760 adding title elements to where they belong.
5762 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5763 define the additional tilte elements and then include
5766 * many other layout files: changed to include stdtitle.inc just
5767 before stdstruct.inc.
5769 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5771 * src/buffer.C: (save) Added the option to store all backup files
5772 in a single directory
5774 * src/lyxrc.[Ch]: Added variable \backupdir_path
5776 * lib/lyxrc.example: Added descriptions of recently added variables
5778 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5779 bibtex inset, not closing the bibtex popup when deleting the inset)
5781 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5783 * src/lyx_cb.C: add a couple using directives.
5785 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5786 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5787 import based on the filename.
5789 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5790 file would be imported at start, if the filename where of a sgml file.
5792 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5794 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5796 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5797 * src/lyxfont.h Replaced the member variable bits.direction by the
5798 member variable lang. Made many changes in other files.
5799 This allows having a multi-lingual document
5801 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5802 that change the current language to <l>.
5803 Removed the command "font-rtl"
5805 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5806 format for Hebrew documents)
5808 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5809 When auto_mathmode is "true", pressing a digit key in normal mode
5810 will cause entering into mathmode.
5811 If auto_mathmode is "rtl" then this behavior will be active only
5812 when writing right-to-left text.
5814 * src/text2.C (InsertStringA) The string is inserted using the
5817 * src/paragraph.C (GetEndLabel) Gives a correct result for
5818 footnote paragraphs.
5820 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5822 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5824 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5825 front of PasteParagraph. Never insert a ' '. This should at least
5826 fix some cause for the segfaults that we have been experiencing,
5827 it also fixes backspace behaviour slightly. (Phu!)
5829 * src/support/lstrings.C (compare_no_case): some change to make it
5830 compile with gcc 2.95.2 and stdlibc++-v3
5832 * src/text2.C (MeltFootnoteEnvironment): change type o
5833 first_footnote_par_is_not_empty to bool.
5835 * src/lyxparagraph.h: make text private. Changes in other files
5837 (fitToSize): new function
5838 (setContentsFromPar): new function
5839 (clearContents): new function
5840 (SetChar): new function
5842 * src/paragraph.C (readSimpleWholeFile): deleted.
5844 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5845 the file, just use a simple string instead. Also read the file in
5846 a more maintainable manner.
5848 * src/text2.C (InsertStringA): deleted.
5849 (InsertStringB): deleted.
5851 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5853 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5854 RedoParagraphs from the doublespace handling part, just set status
5855 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5856 done, but perhaps not like this.)
5858 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5860 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5861 character when inserting an inset.
5863 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5865 * src/bufferparams.C (readLanguage): now takes "default" into
5868 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5869 also initialize the toplevel_keymap with the default bindings from
5872 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5874 * all files using lyxrc: have lyxrc as a real variable and not a
5875 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5878 * src/lyxrc.C: remove double call to defaultKeyBindings
5880 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5881 toolbar defauls using lyxlex. Remove enums, structs, functions
5884 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5885 toolbar defaults. Also store default keybindings in a map.
5887 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5888 storing the toolbar defaults without any xforms dependencies.
5890 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5891 applied. Changed to use iterators.
5893 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5895 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5896 systems that don't have LINGUAS set to begin with.
5898 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5900 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5901 the list by Dekel Tsur.
5903 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5905 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5906 * src/insets/form_graphics.C: ditto.
5908 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5910 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5912 * src/bufferparams.C (readLanguage): use the new language map
5914 * src/intl.C (InitKeyMapper): use the new language map
5916 * src/lyx_gui.C (create_forms): use the new language map
5918 * src/language.[Ch]: New files. Used for holding the information
5919 about each language. Now! Use this new language map enhance it and
5920 make it really usable for our needs.
5922 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5924 * screen.C (ShowCursor): Removed duplicate code.
5925 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5926 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5928 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5931 * src/text.C Added TransformChar method. Used for rendering Arabic
5932 text correctly (change the glyphs of the letter according to the
5933 position in the word)
5938 * src/lyxrc.C Added lyxrc command {language_command_begin,
5939 language_command_end,language_command_ltr,language_command_rtl,
5940 language_package} which allows the use of either arabtex or Omega
5943 * src/lyx_gui.C (init)
5945 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5946 to use encoding for menu fonts which is different than the encoding
5949 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5950 do not load the babel package.
5951 To write an English document with Hebrew/Arabic, change the document
5952 language to "english".
5954 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5955 (alphaCounter): changed to return char
5956 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5958 * lib/lyxrc.example Added examples for Hebrew/Arabic
5961 * src/layout.C Added layout command endlabeltype
5963 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5965 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5967 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5969 * src/mathed/math_delim.C (search_deco): return a
5970 math_deco_struct* instead of index.
5972 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5974 * All files with a USE_OSTREAM_ONLY within: removed all code that
5975 was unused when USE_OSTREAM_ONLY is defined.
5977 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5978 of any less. Removed header and using.
5980 * src/text.C (GetVisibleRow): draw the string "Page Break
5981 (top/bottom)" on screen when drawing a pagebreak line.
5983 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5985 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5987 * src/mathed/math_macro.C (draw): do some cast magic.
5990 * src/mathed/math_defs.h: change byte* argument to byte const*.
5992 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5994 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5995 know it is right to return InsetFoot* too, but cxx does not like
5998 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6000 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6002 * src/mathed/math_delim.C: change == to proper assignment.
6004 2000-03-09 Juergen Vigna <jug@sad.it>
6006 * src/insets/insettext.C (setPos): fixed various cursor positioning
6007 problems (via mouse and cursor-keys)
6008 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6009 inset (still a small display problem but it works ;)
6011 * src/insets/insetcollapsable.C (draw): added button_top_y and
6012 button_bottom_y to have correct values for clicking on the inset.
6014 * src/support/lyxalgo.h: commented out 'using std::less'
6016 2000-03-08 Juergen Vigna <jug@sad.it>
6018 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6019 Button-Release event closes as it is alos the Release-Event
6022 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6024 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6026 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6027 can add multiple spaces in Scrap (literate programming) styles...
6028 which, by the way, is how I got hooked on LyX to begin with.
6030 * src/mathed/formula.C (Write): Added dummy variable to an
6031 inset::Latex() call.
6032 (Latex): Add free_spacing boolean to inset::Latex()
6034 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6036 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6037 virtual function to include the free_spacing boolean from
6038 the containing paragraph's style.
6040 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6041 Added free_spacing boolean arg to match inset.h
6043 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6044 Added free_spacing boolean arg to match inset.h
6046 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6047 Added free_spacing boolean and made sure that if in a free_spacing
6048 paragraph, that we output normal space if there is a protected space.
6050 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6051 Added free_spacing boolean arg to match inset.h
6053 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6054 Added free_spacing boolean arg to match inset.h
6056 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6057 Added free_spacing boolean arg to match inset.h
6059 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6060 Added free_spacing boolean arg to match inset.h
6062 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6063 Added free_spacing boolean arg to match inset.h
6065 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6066 free_spacing boolean arg to match inset.h
6068 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6069 Added free_spacing boolean arg to match inset.h
6071 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6072 Added free_spacing boolean arg to match inset.h
6074 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6075 Added free_spacing boolean arg to match inset.h
6077 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6078 Added free_spacing boolean arg to match inset.h
6080 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6081 Added free_spacing boolean arg to match inset.h
6083 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6084 free_spacing boolean arg to match inset.h
6086 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6087 free_spacing boolean arg to match inset.h
6089 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6090 ignore free_spacing paragraphs. The user's spaces are left
6093 * src/text.C (InsertChar): Fixed the free_spacing layout
6094 attribute behavior. Now, if free_spacing is set, you can
6095 add multiple spaces in a paragraph with impunity (and they
6096 get output verbatim).
6097 (SelectSelectedWord): Added dummy argument to inset::Latex()
6100 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6103 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6104 paragraph layouts now only input a simple space instead.
6105 Special character insets don't make any sense in free-spacing
6108 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6109 hard-spaces in the *input* file to simple spaces if the layout
6110 is free-spacing. This converts old files which had to have
6111 hard-spaces in free-spacing layouts where a simple space was
6113 (writeFileAscii): Added free_spacing check to pass to the newly
6114 reworked inset::Latex(...) methods. The inset::Latex() code
6115 ensures that hard-spaces in free-spacing paragraphs get output
6116 as spaces (rather than "~").
6118 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6120 * src/mathed/math_delim.C (draw): draw the empty placeholder
6121 delims with a onoffdash line.
6122 (struct math_deco_compare): struct that holds the "functors" used
6123 for the sort and the binary search in math_deco_table.
6124 (class init_deco_table): class used for initial sort of the
6126 (search_deco): use lower_bound to do a binary search in the
6129 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6131 * src/lyxrc.C: a small secret thingie...
6133 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6134 and to not flush the stream as often as it used to.
6136 * src/support/lyxalgo.h: new file
6137 (sorted): template function used for checking if a sequence is
6138 sorted or not. Two versions with and without user supplied
6139 compare. Uses same compare as std::sort.
6141 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6142 it and give warning on lyxerr.
6144 (struct compare_tags): struct with function operators used for
6145 checking if sorted, sorting and lower_bound.
6146 (search_kw): use lower_bound instead of manually implemented
6149 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6151 * src/insets/insetcollapsable.h: fix Clone() declaration.
6152 * src/insets/insetfoot.h: ditto.
6154 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6156 2000-03-08 Juergen Vigna <jug@sad.it>
6158 * src/insets/lyxinset.h: added owner call which tells us if
6159 this inset is inside another inset. Changed also the return-type
6160 of Editable to an enum so it tells clearer what the return-value is.
6162 * src/insets/insettext.C (computeTextRows): fixed computing of
6163 textinsets which split automatically on more rows.
6165 * src/insets/insetert.[Ch]: changed this to be of BaseType
6168 * src/insets/insetfoot.[Ch]: added footnote inset
6170 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6171 collapsable insets (like footnote, ert, ...)
6173 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6175 * src/lyxdraw.h: remvoe file
6177 * src/lyxdraw.C: remove file
6179 * src/insets/insettext.C: added <algorithm>.
6181 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6183 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6184 (matrix_cb): case MM_OK use string stream
6186 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6189 * src/mathed/math_macro.C (draw): use string stream
6190 (Metrics): use string stream
6192 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6193 directly to the ostream.
6195 * src/vspace.C (asString): use string stream.
6196 (asString): use string stream
6197 (asLatexString): use string stream
6199 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6200 setting Spacing::Other.
6202 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6203 sprintf when creating the stretch vale.
6205 * src/text2.C (alphaCounter): changed to return a string and to
6206 not use a static variable internally. Also fixed a one-off bug.
6207 (SetCounter): changed the drawing of the labels to use string
6208 streams instead of sprintf.
6210 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6211 manipulator to use a scheme that does not require library support.
6212 This is also the way it is done in the new GNU libstdc++. Should
6213 work with DEC cxx now.
6215 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6217 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6218 end. This fixes a bug.
6220 * src/mathed (all files concerned with file writing): apply the
6221 USE_OSTREAM_ONLY changes to mathed too.
6223 * src/support/DebugStream.h: make the constructor explicit.
6225 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6226 count and ostream squashed.
6228 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6230 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6232 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6233 ostringstream uses STL strings, and we might not.
6235 * src/insets/insetspecialchar.C: add using directive.
6236 * src/insets/insettext.C: ditto.
6238 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6240 * lib/layouts/seminar.layout: feeble attempt at a layout for
6241 seminar.cls, far from completet and could really use some looking
6242 at from people used to write layout files.
6244 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6245 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6246 a lot nicer and works nicely with ostreams.
6248 * src/mathed/formula.C (draw): a slightly different solution that
6249 the one posted to the list, but I think this one works too. (font
6250 size wrong in headers.)
6252 * src/insets/insettext.C (computeTextRows): some fiddling on
6253 Jürgens turf, added some comments that he should read.
6255 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6256 used and it gave compiler warnings.
6257 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6260 * src/lyx_gui.C (create_forms): do the right thing when
6261 show_banner is true/false.
6263 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6264 show_banner is false.
6266 * most file writing files: Now use iostreams to do almost all of
6267 the writing. Also instead of passing string &, we now use
6268 stringstreams. mathed output is still not adapted to iostreams.
6269 This change can be turned off by commenting out all the occurences
6270 of the "#define USE_OSTREAM_ONLY 1" lines.
6272 * src/WorkArea.C (createPixmap): don't output debug messages.
6273 (WorkArea): don't output debug messages.
6275 * lib/lyxrc.example: added a comment about the new variable
6278 * development/Code_rules/Rules: Added some more commente about how
6279 to build class interfaces and on how better encapsulation can be
6282 2000-03-03 Juergen Vigna <jug@sad.it>
6284 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6285 automatically with the width of the LyX-Window
6287 * src/insets/insettext.C (computeTextRows): fixed update bug in
6288 displaying text-insets (scrollvalues where not initialized!)
6290 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6292 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6293 id in the check of the result from lower_bound is not enough since
6294 lower_bound can return last too, and then res->id will not be a
6297 * all insets and some code that use them: I have conditionalized
6298 removed the Latex(string & out, ...) this means that only the
6299 Latex(ostream &, ...) will be used. This is a work in progress to
6300 move towards using streams for all output of files.
6302 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6305 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6307 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6308 routine (this fixes bug where greek letters were surrounded by too
6311 * src/support/filetools.C (findtexfile): change a bit the search
6312 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6313 no longer passed to kpsewhich, we may have to change that later.
6315 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6316 warning options to avoid problems with X header files (from Angus
6318 * acinclude.m4: regenerated.
6320 2000-03-02 Juergen Vigna <jug@sad.it>
6322 * src/insets/insettext.C (WriteParagraphData): Using the
6323 par->writeFile() function for writing paragraph-data.
6324 (Read): Using buffer->parseSingleLyXformat2Token()-function
6325 for parsing paragraph data!
6327 * src/buffer.C (readLyXformat2): removed all parse data and using
6328 the new parseSingleLyXformat2Token()-function.
6329 (parseSingleLyXformat2Token): added this function to parse (read)
6330 lyx-file-format (this is called also from text-insets now!)
6332 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6334 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6337 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6338 directly instead of going through a func. One very bad thing: a
6339 static LyXFindReplace, but I don't know where to place it.
6341 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6342 string instead of char[]. Also changed to static.
6343 (GetSelectionOrWordAtCursor): changed to static inline
6344 (SetSelectionOverLenChars): ditto.
6346 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6347 current_view and global variables. both classes has changed names
6348 and LyXFindReplace is not inherited from SearchForm.
6350 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6351 fl_form_search form.
6353 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6355 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6357 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6358 bound (from Kayvan).
6360 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6362 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6364 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6366 * some things that I should comment but the local pub says head to
6369 * comment out all code that belongs to the Roff code for Ascii
6370 export of tables. (this is unused)
6372 * src/LyXView.C: use correct type for global variable
6373 current_layout. (LyXTextClass::size_type)
6375 * some code to get the new insetgraphics closer to working I'd be
6376 grateful for any help.
6378 * src/BufferView2.C (insertInset): use the return type of
6379 NumberOfLayout properly. (also changes in other files)
6381 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6382 this as a test. I want to know what breaks because of this.
6384 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6386 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6388 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6389 to use a \makebox in the label, this allows proper justification
6390 with out using protected spaces or multiple hfills. Now it is
6391 "label" for left justified, "\hfill label\hfill" for center, and
6392 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6393 should be changed accordingly.
6395 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6397 * src/lyxtext.h: change SetLayout() to take a
6398 LyXTextClass::size_type instead of a char (when there is more than
6399 127 layouts in a class); also change type of copylayouttype.
6400 * src/text2.C (SetLayout): ditto.
6401 * src/LyXView.C (updateLayoutChoice): ditto.
6403 * src/LaTeX.C (scanLogFile): errors where the line number was not
6404 given just after the '!'-line were ignored (from Dekel Tsur).
6406 * lib/lyxrc.example: fix description of \date_insert_format
6408 * lib/layouts/llncs.layout: new layout, contributed by Martin
6411 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6413 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6414 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6415 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6416 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6417 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6418 paragraph.C, text.C, text2.C)
6420 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6422 * src/insets/insettext.C (LocalDispatch): remove extra break
6425 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6426 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6428 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6429 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6431 * src/insets/insetbib.h: move InsetBibkey::Holder and
6432 InsetCitation::Holder in public space.
6434 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6436 * src/insets/insettext.h: small change to get the new files from
6437 Juergen to compile (use "string", not "class string").
6439 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6440 const & as parameter to LocalDispatch, use LyXFont const & as
6441 paramter to some other func. This also had impacto on lyxinsets.h
6442 and the two mathed insets.
6444 2000-02-24 Juergen Vigna <jug@sad.it>
6447 * src/commandtags.h:
6449 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6453 * src/BufferView2.C: added/updated code for various inset-functions
6455 * src/insets/insetert.[Ch]: added implementation of InsetERT
6457 * src/insets/insettext.[Ch]: added implementation of InsetText
6459 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6460 (draw): added preliminary code for inset scrolling not finshed yet
6462 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6463 as it is in lyxfunc.C now
6465 * src/insets/lyxinset.h: Added functions for text-insets
6467 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6469 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6470 BufferView and reimplement the list as a queue put inside its own
6473 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6475 * several files: use the new interface to the "updateinsetlist"
6477 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6479 (work_area_handler): call BufferView::trippleClick on trippleclick.
6481 * src/BufferView.C (doubleClick): new function, selects word on
6483 (trippleClick): new function, selects line on trippleclick.
6485 2000-02-22 Allan Rae <rae@lyx.org>
6487 * lib/bind/xemacs.bind: buffer-previous not supported
6489 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6491 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6494 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6496 * src/bufferlist.C: get rid of current_view from this file
6498 * src/spellchecker.C: get rid of current_view from this file
6500 * src/vspace.C: get rid of current_view from this file
6501 (inPixels): added BufferView parameter for this func
6502 (asLatexCommand): added a BufferParams for this func
6504 * src/text.C src/text2.C: get rid of current_view from these
6507 * src/lyxfont.C (getFontDirection): move this function here from
6510 * src/bufferparams.C (getDocumentDirection): move this function
6513 * src/paragraph.C (getParDirection): move this function here from
6515 (getLetterDirection): ditto
6517 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6519 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6520 resize due to wrong pixmap beeing used. Also took the opurtunity
6521 to make the LyXScreen stateless on regard to WorkArea and some
6522 general cleanup in the same files.
6524 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6526 * src/Makefile.am: add missing direction.h
6528 * src/PainterBase.h: made the width functions const.
6530 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6533 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6535 * src/insets/insetlatexaccent.C (draw): make the accents draw
6536 better, at present this will only work well with iso8859-1.
6538 * several files: remove the old drawing code, now we use the new
6541 * several files: remove support for mono_video, reverse_video and
6544 2000-02-17 Juergen Vigna <jug@sad.it>
6546 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6547 int ** as we have to return the pointer, otherwise we have only
6548 NULL pointers in the returning function.
6550 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6552 * src/LaTeX.C (operator()): quote file name when running latex.
6554 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6556 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6557 (bubble tip), this removes our special handling of this.
6559 * Remove all code that is unused now that we have the new
6560 workarea. (Code that are not active when NEW_WA is defined.)
6562 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6564 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6566 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6567 nonexisting layout; correctly redirect obsoleted layouts.
6569 * lib/lyxrc.example: document \view_dvi_paper_option
6571 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6574 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6575 (PreviewDVI): handle the view_dvi_paper_option variable.
6576 [Both from Roland Krause]
6578 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6580 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6581 char const *, int, LyXFont)
6582 (text(int, int, string, LyXFont)): ditto
6584 * src/text.C (InsertCharInTable): attempt to fix the double-space
6585 feature in tables too.
6586 (BackspaceInTable): ditto.
6587 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6589 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6591 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6593 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6594 newly found text in textcache to this.
6595 (buffer): set the owner of the text put into the textcache to 0
6597 * src/insets/figinset.C (draw): fixed the drawing of figures with
6600 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6601 drawing of mathframe, hfills, protected space, table lines. I have
6602 now no outstanding drawing problems with the new Painter code.
6604 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6606 * src/PainterBase.C (ellipse, circle): do not specify the default
6609 * src/LColor.h: add using directive.
6611 * src/Painter.[Ch]: change return type of methods from Painter& to
6612 PainterBase&. Add a using directive.
6614 * src/WorkArea.C: wrap xforms callbacks in C functions
6617 * lib/layouts/foils.layout: font fix and simplifications from Carl
6620 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6622 * a lot of files: The Painter, LColor and WorkArea from the old
6623 devel branch has been ported to lyx-devel. Some new files and a
6624 lot of #ifdeffed code. The new workarea is enabled by default, but
6625 if you want to test the new Painter and LColor you have to compile
6626 with USE_PAINTER defined (do this in config.h f.ex.) There are
6627 still some rought edges, and I'd like some help to clear those
6628 out. It looks stable (loads and displays the Userguide very well).
6631 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6633 * src/buffer.C (pop_tag): revert to the previous implementation
6634 (use a global variable for both loops).
6636 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6638 * src/lyxrc.C (LyXRC): change slightly default date format.
6640 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6641 there is an English text with a footnote that starts with a Hebrew
6642 paragraph, or vice versa.
6643 (TeXFootnote): ditto.
6645 * src/text.C (LeftMargin): allow for negative values for
6646 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6649 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6650 for input encoding (cyrillic)
6652 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6654 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6657 * src/toolbar.C (set): ditto
6658 * src/insets/insetbib.C (create_form_citation_form): ditto
6660 * lib/CREDITS: added Dekel Tsur.
6662 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6663 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6664 hebrew supports files from Dekel Tsur.
6666 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6667 <tzafrir@technion.ac.il>
6669 * src/lyxrc.C: put \date_insert_format at the right place.
6671 * src/buffer.C (makeLaTeXFile): fix the handling of
6672 BufferParams::sides when writing out latex files.
6674 * src/BufferView2.C: add a "using" directive.
6676 * src/support/lyxsum.C (sum): when we use lyxstring,
6677 ostringstream::str needs an additional .c_str().
6679 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6681 * src/support/filetools.C (ChangeExtension): patch from Etienne
6684 * src/TextCache.C (show): remove const_cast and make second
6685 parameter non-const LyXText *.
6687 * src/TextCache.h: use non const LyXText in show.
6689 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6692 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6694 * src/support/lyxsum.C: rework to be more flexible.
6696 * several places: don't check if a pointer is 0 if you are going
6699 * src/text.C: remove some dead code.
6701 * src/insets/figinset.C: remove some dead code
6703 * src/buffer.C: move the BufferView funcs to BufferView2.C
6704 remove all support for insetlatexdel
6705 remove support for oldpapersize stuff
6706 made some member funcs const
6708 * src/kbmap.C: use a std::list to store the bindings in.
6710 * src/BufferView2.C: new file
6712 * src/kbsequence.[Ch]: new files
6714 * src/LyXAction.C + others: remove all trace of buffer-previous
6716 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6717 only have one copy in the binary of this table.
6719 * hebrew patch: moved some functions from LyXText to more
6720 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6722 * several files: remove support for XForms older than 0.88
6724 remove some #if 0 #endif code
6726 * src/TextCache.[Ch]: new file. Holds the textcache.
6728 * src/BufferView.C: changes to use the new TextCache interface.
6729 (waitForX): remove the now unused code.
6731 * src/BackStack.h: remove some commented code
6733 * lib/bind/emacs.bind: remove binding for buffer-previous
6735 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6737 * applied the hebrew patch.
6739 * src/lyxrow.h: make sure that all Row variables are initialized.
6741 * src/text2.C (TextHandleUndo): comment out a delete, this might
6742 introduce a memory leak, but should also help us to not try to
6743 read freed memory. We need to look at this one.
6745 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6746 (LyXParagraph): initalize footnotekind.
6748 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6749 forgot this when applying the patch. Please heed the warnings.
6751 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6752 (aka. reformat problem)
6754 * src/bufferlist.C (exists): made const, and use const_iterator
6755 (isLoaded): new func.
6756 (release): use std::find to find the correct buffer.
6758 * src/bufferlist.h: made getState a const func.
6759 made empty a const func.
6760 made exists a const func.
6763 2000-02-01 Juergen Vigna <jug@sad.it>
6765 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6767 * po/it.po: updated a bit the italian po file and also changed the
6768 'file nuovo' for newfile to 'filenuovo' without a space, this did
6771 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6772 for the new insert_date command.
6774 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6775 from jdblair, to insert a date into the current text conforming to
6776 a strftime format (for now only considering the locale-set and not
6777 the document-language).
6779 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6781 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6782 Bounds Read error seen by purify. The problem was that islower is
6783 a macros which takes an unsigned char and uses it as an index for
6784 in array of characters properties (and is thus subject to the
6788 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6789 correctly the paper sides radio buttons.
6790 (UpdateDocumentButtons): ditto.
6792 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6794 * src/kbmap.C (getsym + others): change to return unsigned int,
6795 returning a long can give problems on 64 bit systems. (I assume
6796 that int is 32bit on 64bit systems)
6798 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6800 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6801 LyXLookupString to be zero-terminated. Really fixes problems seen
6804 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6806 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6807 write a (char*)0 to the lyxerr stream.
6809 * src/lastfiles.C: move algorithm before the using statemets.
6811 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6813 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6814 complains otherwise).
6815 * src/table.C: ditto
6817 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6820 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6821 that I removed earlier... It is really needed.
6823 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6825 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6827 * INSTALL: update xforms home page URL.
6829 * lib/configure.m4: fix a bug with unreadable layout files.
6831 * src/table.C (calculate_width_of_column): add "using std::max"
6834 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6836 * several files: marked several lines with "DEL LINE", this is
6837 lines that can be deleted without changing anything.
6838 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6839 checks this anyway */
6842 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6844 * src/DepTable.C (update): add a "+" at the end when the checksum
6845 is different. (debugging string only)
6847 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6848 the next inset to not be displayed. This should also fix the list
6849 of labels in the "Insert Crossreference" dialog.
6851 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6853 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6854 when regex was not found.
6856 * src/support/lstrings.C (lowercase): use handcoded transform always.
6859 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6860 old_cursor.par->prev could be 0.
6862 * several files: changed post inc/dec to pre inc/dec
6864 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6865 write the lastfiles to file.
6867 * src/BufferView.C (buffer): only show TextCache info when debugging
6869 (resizeCurrentBuffer): ditto
6870 (workAreaExpose): ditto
6872 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6874 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6876 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6877 a bit better by removing the special case for \i and \j.
6879 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6881 * src/lyx_main.C (easyParse): remove test for bad comand line
6882 options, since this broke all xforms-related parsing.
6884 * src/kbmap.C (getsym): set return type to unsigned long, as
6885 declared in header. On an alpha, long is _not_ the same as int.
6887 * src/support/LOstream.h: add a "using std::flush;"
6889 * src/insets/figinset.C: ditto.
6891 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6893 * src/bufferlist.C (write): use blinding fast file copy instead of
6894 "a char at a time", now we are doing it the C++ way.
6896 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6897 std::list<int> instead.
6898 (addpidwait): reflect move to std::list<int>
6899 (sigchldchecker): ditto
6901 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6904 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6905 that obviously was wrong...
6907 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6908 c, this avoids warnings with purify and islower.
6910 * src/insets/figinset.C: rename struct queue to struct
6911 queue_element and rewrite to use a std::queue. gsqueue is now a
6912 std::queue<queue_element>
6913 (runqueue): reflect move to std::queue
6916 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6917 we would get "1" "0" instead of "true" "false. Also make the tostr
6920 2000-01-21 Juergen Vigna <jug@sad.it>
6922 * src/buffer.C (writeFileAscii): Disabled code for special groff
6923 handling of tabulars till I fix this in table.C
6925 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6927 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6929 * src/support/lyxlib.h: ditto.
6931 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6933 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6934 and 'j' look better. This might fix the "macron" bug that has been
6937 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6938 functions as one template function. Delete the old versions.
6940 * src/support/lyxsum.C: move using std::ifstream inside
6943 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6946 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6948 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6950 * src/insets/figinset.C (InitFigures): use new instead of malloc
6951 to allocate memory for figures and bitmaps.
6952 (DoneFigures): use delete[] instead of free to deallocate memory
6953 for figures and bitmaps.
6954 (runqueue): use new to allocate
6955 (getfigdata): use new/delete[] instead of malloc/free
6956 (RegisterFigure): ditto
6958 * some files: moved some declarations closer to first use, small
6959 whitespace changes use preincrement instead of postincrement where
6960 it does not make a difference.
6962 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6963 step on the way to use stl::containers for key maps.
6965 * src/bufferlist.h: add a typedef for const_iterator and const
6966 versions of begin and end.
6968 * src/bufferlist.[Ch]: change name of member variable _state to
6969 state_. (avoid reserved names)
6971 (getFileNames): returns the filenames of the buffers in a vector.
6973 * configure.in (ALL_LINGUAS): added ro
6975 * src/support/putenv.C: new file
6977 * src/support/mkdir.C: new file
6979 2000-01-20 Allan Rae <rae@lyx.org>
6981 * lib/layouts/IEEEtran.layout: Added several theorem environments
6983 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6984 couple of minor additions.
6986 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6987 (except for those in footnotes of course)
6989 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6991 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6993 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6994 std::sort and std::lower_bound instead of qsort and handwritten
6996 (struct compara): struct that holds the functors used by std::sort
6997 and std::lower_bound in MathedLookupBOP.
6999 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7001 * src/support/LAssert.h: do not do partial specialization. We do
7004 * src/support/lyxlib.h: note that lyx::getUserName() and
7005 lyx::date() are not in use right now. Should these be suppressed?
7007 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7008 (makeLinuxDocFile): do not put date and user name in linuxdoc
7011 * src/support/lyxlib.h (kill): change first argument to long int,
7012 since that's what solaris uses.
7014 * src/support/kill.C (kill): fix declaration to match prototype.
7016 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7017 actually check whether namespaces are supported. This is not what
7020 * src/support/lyxsum.C: add a using directive.
7022 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7024 * src/support/kill.C: if we have namespace support we don't have
7025 to include lyxlib.h.
7027 * src/support/lyxlib.h: use namespace lyx if supported.
7029 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7031 * src/support/date.C: new file
7033 * src/support/chdir.C: new file
7035 * src/support/getUserName.C: new file
7037 * src/support/getcwd.C: new file
7039 * src/support/abort.C: new file
7041 * src/support/kill.C: new file
7043 * src/support/lyxlib.h: moved all the functions in this file
7044 insede struct lyx. Added also kill and abort to this struct. This
7045 is a way to avoid the "kill is not defined in <csignal>", we make
7046 C++ wrappers for functions that are not ANSI C or ANSI C++.
7048 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7049 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7050 lyx it has been renamed to sum.
7052 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7054 * src/text.C: add using directives for std::min and std::max.
7056 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7058 * src/texrow.C (getIdFromRow): actually return something useful in
7059 id and pos. Hopefully fixes the bug with positionning of errorbox
7062 * src/lyx_main.C (easyParse): output an error and exit if an
7063 incorrect command line option has been given.
7065 * src/spellchecker.C (ispell_check_word): document a memory leak.
7067 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7068 where a "struct utimbuf" is allocated with "new" and deleted with
7071 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7073 * src/text2.C (CutSelection): don't delete double spaces.
7074 (PasteSelection): ditto
7075 (CopySelection): ditto
7077 * src/text.C (Backspace): don't delete double spaces.
7079 * src/lyxlex.C (next): fix a bug that were only present with
7080 conformant std::istream::get to read comment lines, use
7081 std::istream::getline instead. This seems to fix the problem.
7083 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7085 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7086 allowed to insert space before space" editing problem. Please read
7087 commends at the beginning of the function. Comments about usage
7090 * src/text.C (InsertChar): fix for the "not allowed to insert
7091 space before space" editing problem.
7093 * src/text2.C (DeleteEmptyParagraphMechanism): when
7094 IsEmptyTableRow can only return false this last "else if" will
7095 always be a no-op. Commented out.
7097 * src/text.C (RedoParagraph): As far as I can understand tmp
7098 cursor is not really needed.
7100 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7101 present it could only return false anyway.
7102 (several functions): Did something not so smart...added a const
7103 specifier on a lot of methods.
7105 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7106 and add a tmp->text.resize. The LyXParagraph constructor does the
7108 (BreakParagraphConservative): ditto
7110 * src/support/path.h (Path): add a define so that the wrong usage
7111 "Path("/tmp") will be flagged as a compilation error:
7112 "`unnamed_Path' undeclared (first use this function)"
7114 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7116 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7117 which was bogus for several reasons.
7119 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7123 * autogen.sh: do not use "type -path" (what's that anyway?).
7125 * src/support/filetools.C (findtexfile): remove extraneous space
7126 which caused a kpsewhich warning (at least with kpathsea version
7129 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7131 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7133 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7135 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7137 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7139 * src/paragraph.C (BreakParagraph): do not reserve space on text
7140 if we don't need to (otherwise, if pos_end < pos, we end up
7141 reserving huge amounts of memory due to bad unsigned karma).
7142 (BreakParagraphConservative): ditto, although I have not seen
7143 evidence the bug can happen here.
7145 * src/lyxparagraph.h: add a using std::list.
7147 2000-01-11 Juergen Vigna <jug@sad.it>
7149 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7152 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7154 * src/vc-backend.C (doVCCommand): change to be static and take one
7155 more parameter: the path to chdir too be fore executing the command.
7156 (retrive): new function equiv to "co -r"
7158 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7159 file_not_found_hook is true.
7161 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7163 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7164 if a file is readwrite,readonly...anything else.
7166 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7168 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7169 (CreatePostscript): name change from MenuRunDVIPS (or something)
7170 (PreviewPostscript): name change from MenuPreviewPS
7171 (PreviewDVI): name change from MenuPreviewDVI
7173 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7174 \view_pdf_command., \pdf_to_ps_command
7176 * lib/configure.m4: added search for PDF viewer, and search for
7177 PDF to PS converter.
7178 (lyxrc.defaults output): add \pdflatex_command,
7179 \view_pdf_command and \pdf_to_ps_command.
7181 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7183 * src/bufferlist.C (write): we don't use blocksize for anything so
7186 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7188 * src/support/block.h: disable operator T* (), since it causes
7189 problems with both compilers I tried. See comments in the file.
7191 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7194 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7195 variable LYX_DIR_10x to LYX_DIR_11x.
7197 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7199 * INSTALL: document --with-lyxname.
7202 * configure.in: new configure flag --with-lyxname which allows to
7203 choose the name under which lyx is installed. Default is "lyx", of
7204 course. It used to be possible to do this with --program-suffix,
7205 but the later has in fact a different meaning for autoconf.
7207 * src/support/lstrings.h (lstrchr): reformat a bit.
7209 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7210 * src/mathed/math_defs.h: ditto.
7212 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7214 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7215 true, decides if we create a backup file or not when saving. New
7216 tag and variable \pdf_mode, defaults to false. New tag and
7217 variable \pdflatex_command, defaults to pdflatex. New tag and
7218 variable \view_pdf_command, defaults to xpdf. New tag and variable
7219 \pdf_to_ps_command, defaults to pdf2ps.
7221 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7223 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7224 does not have a BufferView.
7225 (unlockInset): ditto + don't access the_locking_inset if the
7226 buffer does not have a BufferView.
7228 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7229 certain circumstances so that we don't continue a keyboard
7230 operation long after the key was released. Try f.ex. to load a
7231 large document, press PageDown for some seconds and then release
7232 it. Before this change the document would contine to scroll for
7233 some time, with this change it stops imidiatly.
7235 * src/support/block.h: don't allocate more space than needed. As
7236 long as we don't try to write to the arr[x] in a array_type arr[x]
7237 it is perfectly ok. (if you write to it you might segfault).
7238 added operator value_type*() so that is possible to pass the array
7239 to functions expecting a C-pointer.
7241 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7244 * intl/*: updated to gettext 0.10.35, tried to add our own
7245 required modifications. Please verify.
7247 * po/*: updated to gettext 0.10.35, tried to add our own required
7248 modifications. Please verify.
7250 * src/support/lstrings.C (tostr): go at fixing the problem with
7251 cxx and stringstream. When stringstream is used return
7252 oss.str().c_str() so that problems with lyxstring and basic_string
7253 are avoided. Note that the best solution would be for cxx to use
7254 basic_string all the way, but it is not conformant yet. (it seems)
7256 * src/lyx_cb.C + other files: moved several global functions to
7257 class BufferView, some have been moved to BufferView.[Ch] others
7258 are still located in lyx_cb.C. Code changes because of this. (part
7259 of "get rid of current_view project".)
7261 * src/buffer.C + other files: moved several Buffer functions to
7262 class BufferView, the functions are still present in buffer.C.
7263 Code changes because of this.
7265 * config/lcmessage.m4: updated to most recent. used when creating
7268 * config/progtest.m4: updated to most recent. used when creating
7271 * config/gettext.m4: updated to most recent. applied patch for
7274 * config/gettext.m4.patch: new file that shows what changes we
7275 have done to the local copy of gettext.m4.
7277 * config/libtool.m4: new file, used in creation of acinclude.m4
7279 * config/lyxinclude.m4: new file, this is the lyx created m4
7280 macros, used in making acinclude.m4.
7282 * autogen.sh: GNU m4 discovered as a separate task not as part of
7283 the lib/configure creation.
7284 Generate acinlucde from files in config. Actually cat
7285 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7286 easier to upgrade .m4 files that really are external.
7288 * src/Spacing.h: moved using std::istringstream to right after
7289 <sstream>. This should fix the problem seen with some compilers.
7291 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7293 * src/lyx_cb.C: began some work to remove the dependency a lot of
7294 functions have on BufferView::text, even if not really needed.
7295 (GetCurrentTextClass): removed this func, it only hid the
7298 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7299 forgot this in last commit.
7301 * src/Bullet.C (bulletEntry): use static char const *[] for the
7302 tables, becuase of this the return arg had to change to string.
7304 (~Bullet): removed unneeded destructor
7306 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7307 (insetSleep): moved from Buffer
7308 (insetWakeup): moved from Buffer
7309 (insetUnlock): moved from Buffer
7311 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7312 from Buffer to BufferView.
7314 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7316 * config/ltmain.sh: updated to version 1.3.4 of libtool
7318 * config/ltconfig: updated to version 1.3.4 of libtool
7320 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7323 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7324 Did I get that right?
7326 * src/lyxlex.h: add a "using" directive or two.
7327 * src/Spacing.h: ditto.
7328 * src/insets/figinset.C: ditto.
7329 * src/support/filetools.C: ditto.
7330 * src/support/lstrings.C: ditto.
7331 * src/BufferView.C: ditto.
7332 * src/bufferlist.C: ditto.
7333 * src/lyx_cb.C: ditto.
7334 * src/lyxlex.C: ditto.
7336 * NEWS: add some changes for 1.1.4.
7338 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7340 * src/BufferView.C: first go at a TextCache to speed up switching
7343 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7345 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7346 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7347 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7348 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7351 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7352 members of the struct are correctly initialized to 0 (detected by
7354 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7355 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7357 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7358 pidwait, since it was allocated with "new". This was potentially
7359 very bad. Thanks to Michael Schmitt for running purify for us.
7362 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7364 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7366 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7368 1999-12-30 Allan Rae <rae@lyx.org>
7370 * lib/templates/IEEEtran.lyx: minor change
7372 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7373 src/mathed/formula.C (LocalDispatch): askForText changes
7375 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7376 know when a user has cancelled input. Fixes annoying problems with
7377 inserting labels and version control.
7379 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7381 * src/support/lstrings.C (tostr): rewritten to use strstream and
7384 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7386 * src/support/filetools.C (IsFileWriteable): use fstream to check
7387 (IsDirWriteable): use fileinfo to check
7389 * src/support/filetools.h (FilePtr): whole class deleted
7391 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7393 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7395 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7397 * src/bufferlist.C (write): use ifstream and ofstream instead of
7400 * src/Spacing.h: use istrstream instead of sscanf
7402 * src/mathed/math_defs.h: change first arg to istream from FILE*
7404 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7406 * src/mathed/math_parser.C: have yyis to be an istream
7407 (LexGetArg): use istream (yyis)
7409 (mathed_parse): ditto
7410 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7412 * src/mathed/formula.C (Read): rewritten to use istream
7414 * src/mathed/formulamacro.C (Read): rewritten to use istream
7416 * src/lyxlex.h (~LyXLex): deleted desturctor
7417 (getStream): new function, returns an istream
7418 (getFile): deleted funtion
7419 (IsOK): return is.good();
7421 * src/lyxlex.C (LyXLex): delete file and owns_file
7422 (setFile): open an filebuf and assign that to a istream instead of
7424 (setStream): new function, takes an istream as arg.
7425 (setFile): deleted function
7426 (EatLine): rewritten us use istream instead of FILE*
7430 * src/table.C (LyXTable): use istream instead of FILE*
7431 (Read): rewritten to take an istream instead of FILE*
7433 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7435 * src/buffer.C (Dispatch): remove an extraneous break statement.
7437 * src/support/filetools.C (QuoteName): change to do simple
7438 'quoting'. More work is necessary. Also changed to do nothing
7439 under emx (needs fix too).
7440 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7442 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7443 config.h.in to the AC_DEFINE_UNQUOTED() call.
7444 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7445 needs char * as argument (because Solaris 7 declares it like
7448 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7449 remove definition of BZERO.
7451 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7453 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7454 defined, "lyxregex.h" if not.
7456 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7458 (REGEX): new variable that is set to regex.c lyxregex.h when
7459 AM_CONDITIONAL USE_REGEX is set.
7460 (libsupport_la_SOURCES): add $(REGEX)
7462 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7465 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7468 * configure.in: add call to LYX_REGEX
7470 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7471 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7473 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7475 * lib/bind/fi_menus.bind: new file, from
7476 pauli.virtanen@saunalahti.fi.
7478 * src/buffer.C (getBibkeyList): pass the parameter delim to
7479 InsetInclude::getKeys and InsetBibtex::getKeys.
7481 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7482 is passed to Buffer::getBibkeyList
7484 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7485 instead of the hardcoded comma.
7487 * src/insets/insetbib.C (getKeys): make sure that there are not
7488 leading blanks in bibtex keys. Normal latex does not care, but
7489 harvard.sty seems to dislike blanks at the beginning of citation
7490 keys. In particular, the retturn value of the function is
7492 * INSTALL: make it clear that libstdc++ is needed and that gcc
7493 2.7.x probably does not work.
7495 * src/support/filetools.C (findtexfile): make debug message go to
7497 * src/insets/insetbib.C (getKeys): ditto
7499 * src/debug.C (showTags): make sure that the output is correctly
7502 * configure.in: add a comment for TWO_COLOR_ICON define.
7504 * acconfig.h: remove all the entries that already defined in
7505 configure.in or acinclude.m4.
7507 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7508 to avoid user name, date and copyright.
7510 1999-12-21 Juergen Vigna <jug@sad.it>
7512 * src/table.C (Read): Now read bogus row format informations
7513 if the format is < 5 so that afterwards the table can
7514 be read by lyx but without any format-info. Fixed the
7515 crash we experienced when not doing this.
7517 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7519 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7520 (RedoDrawingOfParagraph): ditto
7521 (RedoParagraphs): ditto
7522 (RemoveTableRow): ditto
7524 * src/text.C (Fill): rename arg paperwidth -> paper_width
7526 * src/buffer.C (insertLyXFile): rename var filename -> fname
7527 (writeFile): rename arg filename -> fname
7528 (writeFileAscii): ditto
7529 (makeLaTeXFile): ditto
7530 (makeLinuxDocFile): ditto
7531 (makeDocBookFile): ditto
7533 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7536 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7538 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7541 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7542 compiled by a C compiler not C++.
7544 * src/layout.h (LyXTextClass): added typedef for const_iterator
7545 (LyXTextClassList): added typedef for const_iterator + member
7546 functions begin and end.
7548 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7549 iterators to fill the choice_class.
7550 (updateLayoutChoice): rewritten to use iterators to fill the
7551 layoutlist in the toolbar.
7553 * src/BufferView.h (BufferView::work_area_width): removed unused
7556 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7558 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7559 (sgmlCloseTag): ditto
7561 * src/support/lstrings.h: return type of countChar changed to
7564 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7565 what version of this func to use. Also made to return unsigned int.
7567 * configure.in: call LYX_STD_COUNT
7569 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7570 conforming std::count.
7572 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7574 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7575 and a subscript would give bad display (patch from Dekel Tsur
7576 <dekel@math.tau.ac.il>).
7578 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7580 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7583 * src/chset.h: add a few 'using' directives
7585 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7586 triggered when no buffer is active
7588 * src/layout.C: removed `break' after `return' in switch(), since
7591 * src/lyx_main.C (init): make sure LyX can be ran in place even
7592 when libtool has done its magic with shared libraries. Fix the
7593 test for the case when the system directory has not been found.
7595 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7596 name for the latex file.
7597 (MenuMakeHTML): ditto
7599 * src/buffer.h: add an optional boolean argument, which is passed
7602 1999-12-20 Allan Rae <rae@lyx.org>
7604 * lib/templates/IEEEtran.lyx: small correction and update.
7606 * configure.in: Attempted to use LYX_PATH_HEADER
7608 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7610 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7611 input from JMarc. Now use preprocessor to find the header.
7612 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7613 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7614 LYX_STL_STRING_FWD. See comments in file.
7616 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7618 * The global MiniBuffer * minibuffer variable is dead.
7620 * The global FD_form_main * fd_form_main variable is dead.
7622 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7624 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7626 * src/table.h: add the LOstream.h header
7627 * src/debug.h: ditto
7629 * src/LyXAction.h: change the explaination of the ReadOnly
7630 attribute: is indicates that the function _can_ be used.
7632 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7635 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7637 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7643 * src/paragraph.C (GetWord): assert on pos>=0
7646 * src/support/lyxstring.C: condition the use of an invariant on
7648 * src/support/lyxstring.h: ditto
7650 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7651 Use LAssert.h instead of plain assert().
7653 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7655 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7656 * src/support/filetools.C: ditto
7658 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7661 * INSTALL: document the new configure flags
7663 * configure.in: suppress --with-debug; add --enable-assertions
7665 * acinclude.m4: various changes in alignment of help strings.
7667 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7669 * src/kbmap.C: commented out the use of the hash map in kb_map,
7670 beginning of movement to a stl::container.
7672 * several files: removed code that was not in effect when
7673 MOVE_TEXT was defined.
7675 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7676 for escaping should not be used. We can discuss if the string
7677 should be enclosed in f.ex. [] instead of "".
7679 * src/trans_mgr.C (insert): use the new returned value from
7680 encodeString to get deadkeys and keymaps done correctly.
7682 * src/chset.C (encodeString): changed to return a pair, to tell
7683 what to use if we know the string.
7685 * src/lyxscreen.h (fillArc): new function.
7687 * src/FontInfo.C (resize): rewritten to use more std::string like
7688 structore, especially string::replace.
7690 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7693 * configure.in (chmod +x some scripts): remove config/gcc-hack
7695 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7697 * src/buffer.C (writeFile): change once again the top comment in a
7698 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7699 instead of an hardcoded version number.
7700 (makeDocBookFile): ditto
7702 * src/version.h: add new define LYX_DOCVERSION
7704 * po/de.po: update from Pit Sütterlin
7705 * lib/bind/de_menus.bind: ditto.
7707 * src/lyxfunc.C (Dispatch): call MenuExport()
7708 * src/buffer.C (Dispatch): ditto
7710 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7711 LyXFunc::Dispatch().
7712 (MenuExport): new function, moved from
7713 LyXFunc::Dispatch().
7715 * src/trans_mgr.C (insert): small cleanup
7716 * src/chset.C (loadFile): ditto
7718 * lib/kbd/iso8859-1.cdef: add missing backslashes
7720 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7722 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7723 help with placing the manually drawn accents better.
7725 (Draw): x2 and hg changed to float to minimize rounding errors and
7726 help place the accents better.
7728 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7729 unsigned short to char is just wrong...cast the char to unsigned
7730 char instead so that the two values can compare sanely. This
7731 should also make the display of insetlatexaccents better and
7732 perhaps also some other insets.
7734 (lbearing): new function
7737 1999-12-15 Allan Rae <rae@lyx.org>
7739 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7740 header that provides a wrapper around the very annoying SGI STL header
7743 * src/support/lyxstring.C, src/LString.h:
7744 removed old SGI-STL-compatability attempts.
7746 * configure.in: Use LYX_STL_STRING_FWD.
7748 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7749 stl_string_fwd.h is around and try to determine it's location.
7750 Major improvement over previous SGI STL 3.2 compatability.
7751 Three small problems remain with this function due to my zero
7752 knowledge of autoconf. JMarc and lgb see the comments in the code.
7754 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7756 * src/broken_const.h, config/hack-gcc, config/README: removed
7758 * configure.in: remove --with-gcc-hack option; do not call
7761 * INSTALL: remove documentation of --with-broken-const and
7764 * acconfig.h: remove all trace of BROKEN_CONST define
7766 * src/buffer.C (makeDocBookFile): update version number in output
7768 (SimpleDocBookOnePar): fix an assert when trying to a character
7769 access beyond string length
7772 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7774 * po/de.po: fix the Export menu
7776 * lyx.man: update the description of -dbg
7778 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7779 (commandLineHelp): updated
7780 (easyParse): show list of available debug levels if -dbg is passed
7783 * src/Makefile.am: add debug.C
7785 * src/debug.h: moved some code to debug.C
7787 * src/debug.C: new file. Contains code to set and show debug
7790 * src/layout.C: remove 'break' after 'continue' in switch
7791 statements, since these cannot be reached.
7793 1999-12-13 Allan Rae <rae@lyx.org>
7795 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7796 (in_word_set): hash() -> math_hash()
7798 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7800 * acconfig.h: Added a test for whether we are using exceptions in the
7801 current compilation run. If so USING_EXCEPTIONS is defined.
7803 * config.in: Check for existance of stl_string_fwd.h
7804 * src/LString.h: If compiling --with-included-string and SGI's
7805 STL version 3.2 is present (see above test) we need to block their
7806 forward declaration of string and supply a __get_c_string().
7807 However, it turns out this is only necessary if compiling with
7808 exceptions enabled so I've a bit more to add yet.
7810 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7811 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7812 src/support/LRegex.h, src/undo.h:
7813 Shuffle the order of the included files a little to ensure that
7814 LString.h gets included before anything that includes stl_string_fwd.h
7816 * src/support/lyxstring.C: We need to #include LString.h instead of
7817 lyxstring.h to get the necessary definition of __get_c_string.
7818 (__get_c_string): New function. This is defined static just like SGI's
7819 although why they need to do this I'm not sure. Perhaps it should be
7820 in lstrings.C instead.
7822 * lib/templates/IEEEtran.lyx: New template file.
7824 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7826 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7827 * intl/Makefile.in (MKINSTALLDIRS): ditto
7829 * src/LyXAction.C (init): changed to hold the LFUN data in a
7830 automatic array in stead of in callso to newFunc, this speeds up
7831 compilation a lot. Also all the memory used by the array is
7832 returned when the init is completed.
7834 * a lot of files: compiled with -Wold-style-cast, changed most of
7835 the reported offenders to C++ style casts. Did not change the
7836 offenders in C files.
7838 * src/trans.h (Match): change argument type to unsigned int.
7840 * src/support/DebugStream.C: fix some types on the streambufs so
7841 that it works on a conforming implementation.
7843 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7845 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7847 * src/support/lyxstring.C: remove the inline added earlier since
7848 they cause a bunch of unsatisfied symbols when linking with dec
7849 cxx. Cxx likes to have the body of inlines at the place where they
7852 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7853 accessing negative bounds in array. This fixes the crash when
7854 inserting accented characters.
7855 * src/trans.h (Match): ditto
7857 * src/buffer.C (Dispatch): since this is a void, it should not try
7858 to return anything...
7860 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7862 * src/buffer.h: removed the two friends from Buffer. Some changes
7863 because of this. Buffer::getFileName and Buffer::setFileName
7864 renamed to Buffer::fileName() and Buffer::fileName(...).
7866 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7868 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7869 and Buffer::update(short) to BufferView. This move is currently
7870 controlled by a define MOVE_TEXT, this will be removed when all
7871 shows to be ok. This move paves the way for better separation
7872 between buffer contents and buffer view. One side effect is that
7873 the BufferView needs a rebreak when swiching buffers, if we want
7874 to avoid this we can add a cache that holds pointers to LyXText's
7875 that is not currently in use.
7877 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7880 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7882 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7884 * lyx_main.C: new command line option -x (or --execute) and
7885 -e (or --export). Now direct conversion from .lyx to .tex
7886 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7887 Unfortunately, X is still needed and the GUI pops up during the
7890 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7892 * src/Spacing.C: add a using directive to bring stream stuff into
7894 * src/paragraph.C: ditto
7895 * src/buffer.C: ditto
7897 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7898 from Lars' announcement).
7900 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7901 example files from Tino Meinen.
7903 1999-12-06 Allan Rae <rae@lyx.org>
7905 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7907 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7909 * src/support/lyxstring.C: added a lot of inline for no good
7912 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7913 latexWriteEndChanges, they were not used.
7915 * src/layout.h (operator<<): output operator for PageSides
7917 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7919 * some example files: loaded in LyX 1.0.4 and saved again to update
7920 certain constructs (table format)
7922 * a lot of files: did the change to use fstream/iostream for all
7923 writing of files. Done with a close look at Andre Poenitz's patch.
7925 * some files: whitespace changes.
7927 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7929 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7930 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7931 architecture, we provide our own. It is used unconditionnally, but
7932 I do not think this is a performance problem. Thanks to Angus
7933 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7934 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7936 (GetInset): use my_memcpy.
7940 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7941 it is easier to understand, but it uses less TeX-only constructs now.
7943 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7944 elements contain spaces
7946 * lib/configure: regenerated
7948 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7949 elements contain spaces; display the list of programs that are
7952 * autogen.sh: make sure lib/configure is executable
7954 * lib/examples/*: rename the tutorial examples to begin with the
7955 two-letters language code.
7957 * src/lyxfunc.C (getStatus): do not query current font if no
7960 * src/lyx_cb.C (RunScript): use QuoteName
7961 (MenuRunDvips): ditto
7962 (PrintApplyCB): ditto
7964 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7965 around argument, so that it works well with the current shell.
7966 Does not work properly with OS/2 shells currently.
7968 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7969 * src/LyXSendto.C (SendtoApplyCB): ditto
7970 * src/lyxfunc.C (Dispatch): ditto
7971 * src/buffer.C (runLaTeX): ditto
7972 (runLiterate): ditto
7973 (buildProgram): ditto
7975 * src/lyx_cb.C (RunScript): ditto
7976 (MenuMakeLaTeX): ditto
7978 * src/buffer.h (getLatexName): new method
7980 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7982 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7984 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7985 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7986 (create_math_panel): ditto
7988 * src/lyxfunc.C (getStatus): re-activate the code which gets
7989 current font and cursor; add test for export to html.
7991 * src/lyxrc.C (read): remove unreachable break statements; add a
7994 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7996 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7998 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7999 introduced by faulty regex.
8000 * src/buffer.C: ditto
8001 * src/lastfiles.C: ditto
8002 * src/paragraph.C: ditto
8003 * src/table.C: ditto
8004 * src/vspace.C: ditto
8005 * src/insets/figinset.C: ditto
8006 Note: most of these is absolutely harmless, except the one in
8007 src/mathed formula.C.
8009 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8011 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8012 operation, yielding correct results for the reLyX command.
8014 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8016 * src/support/filetools.C (ExpandPath): removed an over eager
8018 (ReplaceEnvironmentPath): ditto
8020 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8021 shows that we are doing something fishy in our code...
8025 * src/lyxrc.C (read): use a double switch trick to get more help
8026 from the compiler. (the same trick is used in layout.C)
8027 (write): new function. opens a ofstream and pass that to output
8028 (output): new function, takes a ostream and writes the lyxrc
8029 elemts to it. uses a dummy switch to make sure no elements are
8032 * src/lyxlex.h: added a struct pushpophelper for use in functions
8033 with more than one exit point.
8035 * src/lyxlex.[Ch] (GetInteger): made it const
8039 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8041 * src/layout.[hC] : LayoutTags splitted into several enums, new
8042 methods created, better error handling cleaner use of lyxlex. Read
8045 * src/bmtable.[Ch]: change some member prototypes because of the
8046 image const changes.
8048 * commandtags.h, src/LyXAction.C (init): new function:
8049 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8050 This file is not read automatically but you can add \input
8051 preferences to your lyxrc if you want to. We need to discuss how
8054 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8055 in .aux, also remove .bib and .bst files from dependencies when
8058 * src/BufferView.C, src/LyXView.C: add const_cast several places
8059 because of changes to images.
8061 * lib/images/*: same change as for images/*
8063 * lib/lyxrc.example: Default for accept_compound is false not no.
8065 * images/*: changed to be const, however I have som misgivings
8066 about this change so it might be changed back.
8068 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8070 * lib/configure, po/POTFILES.in: regenerated
8072 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8074 * config/lib_configure.m4: removed
8076 * lib/configure.m4: new file (was config/lib_configure.m4)
8078 * configure.in: do not test for rtti, since we do not use it.
8080 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8082 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8083 doubling of allocated space scheme. This makes it faster for large
8084 strings end to use less memory for small strings. xtra rememoved.
8086 * src/insets/figinset.C (waitalarm): commented out.
8087 (GhostscriptMsg): use static_cast
8088 (GhostscriptMsg): use new instead of malloc to allocate memory for
8089 cmap. also delete the memory after use.
8091 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8093 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8094 for changes in bibtex database or style.
8095 (runBibTeX): remove all .bib and .bst files from dep before we
8097 (run): use scanAuc in when dep file already exist.
8099 * src/DepTable.C (remove_files_with_extension): new method
8102 * src/DepTable.[Ch]: made many of the methods const.
8104 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8106 * src/bufferparams.C: make sure that the default textclass is
8107 "article". It used to be the first one by description order, but
8108 now the first one is "docbook".
8110 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8111 string; call Debug::value.
8112 (easyParse): pass complete argument to setDebuggingLevel().
8114 * src/debug.h (value): fix the code that parses debug levels.
8116 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8119 * src/LyXAction.C: use Debug::ACTION as debug channel.
8121 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8123 * NEWS: updated for the future 1.1.3 release.
8125 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8126 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8127 it should. This is of course a controversial change (since many
8128 people will find that their lyx workscreen is suddenly full of
8129 red), but done for the sake of correctness.
8131 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8132 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8134 * src/insets/inseterror.h, src/insets/inseturl.h,
8135 src/insets/insetinfo.h, src/insets/figinset.h,
8136 src/mathed/formulamacro.h, src/mathed/math_macro.h
8137 (EditMessage): add a missing const and add _() to make sure that
8140 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8141 src/insets/insetbib.C, src/support/filetools.C: add `using'
8144 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8145 doing 'Insert index of last word' at the beginning of a paragraph.
8147 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8149 * several files: white-space changes.
8151 * src/mathed/formula.C: removed IsAlpha and IsDigit
8153 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8154 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8157 * src/insets/figinset.C (GetPSSizes): don't break when
8158 "EndComments" is seen. But break when a boundingbox is read.
8160 * all classes inherited from Inset: return value of Clone
8161 changed back to Inset *.
8163 * all classes inherited form MathInset: return value of Clone
8164 changed back to MathedInset *.
8166 * src/insets/figinset.C (runqueue): use a ofstream to output the
8167 gs/ps file. Might need some setpresicion or setw. However I can
8168 see no problem with the current code.
8169 (runqueue): use sleep instead of the alarm/signal code. I just
8170 can't see the difference.
8172 * src/paragraph.C (LyXParagraph): reserve space in the new
8173 paragraph and resize the inserted paragraph to just fit.
8175 * src/lyxfunc.h (operator|=): added operator for func_status.
8177 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8178 check for readable file.
8180 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8181 check for readable file.
8182 (MenuMakeLinuxDoc): ditto
8183 (MenuMakeDocBook): ditto
8184 (MenuMakeAscii): ditto
8185 (InsertAsciiFile): split the test for openable and readable
8187 * src/bmtable.C (draw_bitmaptable): use
8188 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8190 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8191 findtexfile from LaTeX to filetools.
8193 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8194 instead of FilePtr. Needs to be verified by a literate user.
8196 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8198 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8199 (EditMessage): likewise.
8201 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8202 respectively as \textasciitilde and \textasciicircum.
8204 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8206 * src/support/lyxstring.h: made the methods that take iterators
8209 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8210 (regexMatch): made is use the real regex class.
8212 * src/support/Makefile.am: changed to use libtool
8214 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8216 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8218 (MathIsInset ++): changed several macros to be inline functions
8221 * src/mathed/Makefile.am: changed to use libtool
8223 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8225 * src/insets/inset* : Clone changed to const and return type is
8226 the true insettype not just Inset*.
8228 * src/insets/Makefile.am: changed to use libtool
8230 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8232 * src/undo.[Ch] : added empty() and changed some of the method
8235 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8237 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8238 setID use block<> for the bullets array, added const several places.
8240 * src/lyxfunc.C (getStatus): new function
8242 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8243 LyXAction, added const to several funtions.
8245 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8246 a std::map, and to store the dir items in a vector.
8248 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8251 * src/LyXView.[Ch] + other files : changed currentView to view.
8253 * src/LyXAction.[Ch] : ported from the old devel branch.
8255 * src/.cvsignore: added .libs and a.out
8257 * configure.in : changes to use libtool.
8259 * acinclude.m4 : inserted libtool.m4
8261 * .cvsignore: added libtool
8263 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8265 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8266 file name in insets and mathed directories (otherwise the
8267 dependency is not taken in account under cygwin).
8269 * src/text2.C (InsertString[AB]): make sure that we do not try to
8270 read characters past the string length.
8272 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8274 * lib/doc/LaTeXConfig.lyx.in,
8275 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8277 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8278 file saying who created them and when this heppened; this is
8279 useless and annoys tools like cvs.
8281 * lib/layouts/g-brief-{en,de}.layout,
8282 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8283 from Thomas Hartkens <thomas@hartkens.de>.
8285 * src/{insets,mathed}/Makefile.am: do not declare an empty
8286 LDFLAGS, so that it can be set at configure time (useful on Irix
8289 * lib/reLyX/configure.in: make sure that the prefix is set
8290 correctly in LYX_DIR.
8292 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8294 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8295 be used by 'command-sequence' this allows to bind a key to a
8296 sequence of LyX-commands
8297 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8299 * src/LyXAction.C: add "command-sequence"
8301 * src/LyXFunction.C: handling of "command-sequence"
8303 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8304 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8306 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8308 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8310 * src/buffer.C (writeFile): Do not output a comment giving user
8311 and date at the beginning of a .lyx file. This is useless and
8312 annoys cvs anyway; update version number to 1.1.
8314 * src/Makefile.am (LYX_DIR): add this definition, so that a
8315 default path is hardcoded in LyX.
8317 * configure.in: Use LYX_GNU_GETTEXT.
8319 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8320 AM_GNU_GETTEXT with a bug fixed.
8322 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8324 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8326 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8327 which is used to point to LyX data is now LYX_DIR_11x.
8329 * lyx.man: convert to a unix text file; small updates.
8331 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8333 * src/support/LSubstring.[Ch]: made the second arg of most of the
8334 constructors be a const reference.
8336 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8339 * src/support/lyxstring.[Ch] (swap): added missing member function
8340 and specialization of swap(str, str);
8342 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8344 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8345 trace of the old one.
8347 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8348 put the member definitions in undo.C.
8350 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8351 NEW_TEXT and have now only code that was included when this was
8354 * src/intl.C (LCombo): use static_cast
8356 (DispatchCallback): ditto
8358 * src/definitions.h: removed whole file
8360 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8362 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8363 parsing and stores in a std:map. a regex defines the file format.
8364 removed unneeded members.
8366 * src/bufferparams.h: added several enums from definitions.h here.
8367 Removed unsused destructor. Changed some types to use proper enum
8368 types. use block to have the temp_bullets and user_defined_bullets
8369 and to make the whole class assignable.
8371 * src/bufferparams.C (Copy): removed this functions, use a default
8374 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8377 * src/buffer.C (readLyXformat2): commend out all that have with
8378 oldpapersize to do. also comment out all that hve to do with
8379 insetlatex and insetlatexdel.
8380 (setOldPaperStuff): commented out
8382 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8384 * src/LyXAction.C: remove use of inset-latex-insert
8386 * src/mathed/math_panel.C (button_cb): use static_cast
8388 * src/insets/Makefile.am (insets_o_SOURCES): removed
8391 * src/support/lyxstring.C (helper): use the unsigned long
8392 specifier, UL, instead of a static_cast.
8394 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8396 * src/support/block.h: new file. to be used as a c-style array in
8397 classes, so that the class can be assignable.
8399 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8401 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8402 NULL, make sure to return an empty string (it is not possible to
8403 set a string to NULL).
8405 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8407 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8409 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8411 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8412 link line, so that Irix users (for example) can set it explicitely to
8415 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8416 it can be overidden at make time (static or dynamic link, for
8419 * src/vc-backend.C, src/LaTeXFeatures.h,
8420 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8421 statements to bring templates to global namespace.
8423 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8425 * src/support/lyxstring.C (operator[] const): make it standard
8428 * src/minibuffer.C (Init): changed to reflect that more
8429 information is given from the lyxvc and need not be provided here.
8431 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8433 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8435 * src/LyXView.C (UpdateTimerCB): use static_cast
8436 (KeyPressMask_raw_callback): ditto
8438 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8439 buffer_, a lot of changes because of this. currentBuffer() ->
8440 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8441 also changes to other files because of this.
8443 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8445 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8446 have no support for RCS and partial support for CVS, will be
8449 * src/insets/ several files: changes because of function name
8450 changes in Bufferview and LyXView.
8452 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8454 * src/support/LSubstring.[Ch]: new files. These implement a
8455 Substring that can be very convenient to use. i.e. is this
8457 string a = "Mary had a little sheep";
8458 Substring(a, "sheep") = "lamb";
8459 a is now "Mary has a little lamb".
8461 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8462 out patterns and subpatterns of strings. It is used by LSubstring
8463 and also by vc-backend.C
8465 * src/support/lyxstring.C: went over all the assertions used and
8466 tried to correct the wrong ones and flag which of them is required
8467 by the standard. some bugs found because of this. Also removed a
8468 couple of assertions.
8470 * src/support/Makefile.am (libsupport_a_SOURCES): added
8471 LSubstring.[Ch] and LRegex.[Ch]
8473 * src/support/FileInfo.h: have struct stat buf as an object and
8474 not a pointer to one, some changes because of this.
8476 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8477 information in layout when adding the layouts preamble to the
8480 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8483 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8484 because of bug in OS/2.
8486 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8488 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8489 \verbatim@font instead of \ttfamily, so that it can be redefined.
8491 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8492 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8493 src/layout.h, src/text2.C: add 'using' directive to bring the
8494 STL templates we need from the std:: namespace to the global one.
8495 Needed by DEC cxx in strict ansi mode.
8497 * src/support/LIstream.h,src/support/LOstream.h,
8498 src/support/lyxstring.h,src/table.h,
8499 src/lyxlookup.h: do not include <config.h> in header
8500 files. This should be done in the .C files only.
8502 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8506 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8508 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8509 from Kayvan to fix the tth invokation.
8511 * development/lyx.spec.in: updates from Kayvan to reflect the
8512 changes of file names.
8514 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8516 * src/text2.C (InsertStringB): use std::copy
8517 (InsertStringA): use std::copy
8519 * src/bufferlist.C: use a vector to store the buffers in. This is
8520 an internal change and should not affect any other thing.
8522 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8525 * src/text.C (Fill): fix potential bug, one off bug.
8527 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8529 * src/Makefile.am (lyx_main.o): add more files it depends on.
8531 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8533 * src/support/lyxstring.C: use size_t for the reference count,
8534 size, reserved memory and xtra.
8535 (internal_compare): new private member function. Now the compare
8536 functions should work for std::strings that have embedded '\0'
8538 (compare): all compare functions rewritten to use
8541 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8543 * src/support/lyxstring.C (compare): pass c_str()
8544 (compare): pass c_str
8545 (compare): pass c_str
8547 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8549 * src/support/DebugStream.C: <config.h> was not included correctly.
8551 * lib/configure: forgot to re-generate it :( I'll make this file
8552 auto generated soon.
8554 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8556 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8559 * src/support/lyxstring.C: some changes from length() to rep->sz.
8560 avoids a function call.
8562 * src/support/filetools.C (SpaceLess): yet another version of the
8563 algorithm...now per Jean-Marc's suggestions.
8565 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8567 * src/layout.C (less_textclass_desc): functor for use in sorting
8569 (LyXTextClass::Read): sort the textclasses after reading.
8571 * src/support/filetools.C (SpaceLess): new version of the
8572 SpaceLess functions. What problems does this one give? Please
8575 * images/banner_bw.xbm: made the arrays unsigned char *
8577 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8579 * src/support/lyxstring.C (find): remove bogus assertion in the
8580 two versions of find where this has not been done yet.
8582 * src/support/lyxlib.h: add missing int return type to
8585 * src/menus.C (ShowFileMenu): disable exporting to html if no
8586 html export command is present.
8588 * config/lib_configure.m4: add a test for an HTML converter. The
8589 programs checked for are, in this order: tth, latex2html and
8592 * lib/configure: generated from config/lib_configure.m4.
8594 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8595 html converter. The parameters are now passed through $$FName and
8596 $$OutName, instead of standard input/output.
8598 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8600 * lib/lyxrc.example: update description of \html_command.
8601 add "quotes" around \screen_font_xxx font setting examples to help
8602 people who use fonts with spaces in their names.
8604 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8606 * Distribution files: updates for v1.1.2
8608 * src/support/lyxstring.C (find): remove bogus assert and return
8609 npos for the same condition.
8611 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8613 * added patch for OS/2 from SMiyata.
8615 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8617 * src/text2.C (CutSelection): make space_wrapped a bool
8618 (CutSelection): dont declare int i until we have to.
8619 (alphaCounter): return a char const *.
8621 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8623 * src/support/syscall.C (Systemcalls::kill):
8624 src/support/filetools.C (PutEnv, PutEnvPath):
8625 src/lyx_cb.C (addNewlineAndDepth):
8626 src/FontInfo.C (FontInfo::resize): condition some #warning
8627 directives with WITH_WARNINGS.
8630 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8632 * src/layout.[Ch] + several files: access to class variables
8633 limited and made accessor functions instead a lot of code changed
8634 becuase of this. Also instead of returning pointers often a const
8635 reference is returned instead.
8637 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8639 * src/Makefile.am (dist-hook): added used to remove the CVS from
8640 cheaders upon creating a dist
8641 (EXTRA_DIST): added cheaders
8643 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8644 a character not as a small integer.
8646 * src/support/lyxstring.C (find): removed Assert and added i >=
8647 rep->sz to the first if.
8649 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8651 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8652 src/LyXView.C src/buffer.C src/bufferparams.C
8653 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8654 src/text2.C src/insets/insetinclude.C:
8655 lyxlayout renamed to textclasslist.
8657 * src/layout.C: some lyxerr changes.
8659 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8660 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8661 (LyXLayoutList): removed all traces of this class.
8662 (LyXTextClass::Read): rewrote LT_STYLE
8663 (LyXTextClass::hasLayout): new function
8664 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8665 both const and nonconst version.
8666 (LyXTextClass::delete_layout): new function.
8667 (LyXTextClassList::Style): bug fix. do the right thing if layout
8669 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8670 (LyXTextClassList::NameOfLayout): ditto
8671 (LyXTextClassList::Load): ditto
8673 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8675 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8677 * src/LyXAction.C (LookupFunc): added a workaround for sun
8678 compiler, on the other hand...we don't know if the current code
8679 compiles on sun at all...
8681 * src/support/filetools.C (CleanupPath): subst fix
8683 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8686 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8687 complained about this one?
8689 * src/insets/insetinclude.C (Latex): subst fix
8691 * src/insets/insetbib.C (getKeys): subst fix
8693 * src/LyXSendto.C (SendtoApplyCB): subst fix
8695 * src/lyx_main.C (init): subst fix
8697 * src/layout.C (Read): subst fix
8699 * src/lyx_sendfax_main.C (button_send): subst fix
8701 * src/buffer.C (RoffAsciiTable): subst fix
8703 * src/lyx_cb.C (MenuFax): subst fix
8704 (PrintApplyCB): subst fix
8706 1999-10-26 Juergen Vigna <jug@sad.it>
8708 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8710 (Read): Cleaned up this code so now we read only format vestion >= 5
8712 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8714 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8715 come nobody has complained about this one?
8717 * src/insets/insetinclude.C (Latex): subst fix
8719 * src/insets/insetbib.C (getKeys): subst fix
8721 * src/lyx_main.C (init): subst fix
8723 * src/layout.C (Read): subst fix
8725 * src/buffer.C (RoffAsciiTable): subst fix
8727 * src/lyx_cb.C (MenuFax): subst fix.
8729 * src/layout.[hC] + some other files: rewrote to use
8730 std::container to store textclasses and layouts in.
8731 Simplified, removed a lot of code. Make all classes
8732 assignable. Further simplifications and review of type
8733 use still to be one.
8735 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8736 lastfiles to create the lastfiles partr of the menu.
8738 * src/lastfiles.[Ch]: rewritten to use deque to store the
8739 lastfiles in. Uses fstream for reading and writing. Simplifies
8742 * src/support/syscall.C: remove explicit cast.
8744 * src/BufferView.C (CursorToggleCB): removed code snippets that
8746 use explicat C++ style casts instead of C style casts. also use
8747 u_vdata instea of passing pointers in longs.
8749 * src/PaperLayout.C: removed code snippets that were commented out.
8751 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8753 * src/lyx_main.C: removed code snippets that wer commented out.
8755 * src/paragraph.C: removed code snippets that were commented out.
8757 * src/lyxvc.C (logClose): use static_cast
8759 (viewLog): remove explicit cast to void*
8760 (showLog): removed old commented code
8762 * src/menus.C: use static_cast instead of C style casts. use
8763 u_vdata instead of u_ldata. remove explicit cast to (long) for
8764 pointers. Removed old code that was commented out.
8766 * src/insets/inset.C: removed old commented func
8768 * src/insets/insetref.C (InsetRef): removed old code that had been
8769 commented out for a long time.
8771 (escape): removed C style cast
8773 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8775 * src/insets/insetlatex.C (Draw): removed old commented code
8776 (Read): rewritten to use string
8778 * src/insets/insetlabel.C (escape): removed C style cast
8780 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8782 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8785 * src/insets/insetinclude.h: removed a couple of stupid bools
8787 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8788 (Clone): remove C style cast
8789 (getKeys): changed list to lst because of std::list
8791 * src/insets/inseterror.C (Draw): removed som old commented code.
8793 * src/insets/insetcommand.C (Draw): removed some old commented code.
8795 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8796 commented out forever.
8797 (bibitem_cb): use static_cast instead of C style cast
8798 use of vdata changed to u_vdata.
8800 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8802 (CloseUrlCB): use static_cast instead of C style cast.
8803 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8805 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8806 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8807 (CloseInfoCB): static_cast from ob->u_vdata instead.
8808 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8811 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8812 (C_InsetError_CloseErrorCB): forward the ob parameter
8813 (CloseErrorCB): static_cast from ob->u_vdata instead.
8815 * src/vspace.h: include LString.h since we use string in this class.
8817 * src/vspace.C (lyx_advance): changed name from advance because of
8818 nameclash with stl. And since we cannot use namespaces yet...I
8819 used a lyx_ prefix instead. Expect this to change when we begin
8822 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8824 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8825 and removed now defunct constructor and deconstructor.
8827 * src/BufferView.h: have backstack as a object not as a pointer.
8828 removed initialization from constructor. added include for BackStack
8830 * development/lyx.spec.in (%build): add CFLAGS also.
8832 * src/screen.C (drawFrame): removed another warning.
8834 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8836 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8837 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8838 README and ANNOUNCE a bit for the next release. More work is
8841 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8842 unbreakable if we are in freespacing mode (LyX-Code), but not in
8845 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8847 * src/BackStack.h: fixed initialization order in constructor
8849 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8851 * acinclude.m4 (VERSION): new rules for when a version is
8852 development, added also a variable for prerelease.
8853 (warnings): we set with_warnings=yes for prereleases
8854 (lyx_opt): prereleases compile with same optimization as development
8855 (CXXFLAGS): only use pedantic if we are a development version
8857 * src/BufferView.C (restorePosition): don't do anything if the
8860 * src/BackStack.h: added member empty, use this to test if there
8861 is anything to pop...
8863 1999-10-25 Juergen Vigna <jug@sad.it>
8866 * forms/layout_forms.fd +
8867 * forms/latexoptions.fd +
8868 * lyx.fd: changed for various form resize issues
8870 * src/mathed/math_panel.C +
8871 * src/insets/inseterror.C +
8872 * src/insets/insetinfo.C +
8873 * src/insets/inseturl.C +
8874 * src/insets/inseturl.h +
8877 * src/PaperLayout.C +
8878 * src/ParagraphExtra.C +
8879 * src/TableLayout.C +
8881 * src/layout_forms.C +
8888 * src/menus.C: fixed various resize issues. So now forms can be
8889 resized savely or not be resized at all.
8891 * forms/form_url.fd +
8892 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8895 * src/insets/Makefile.am: added files form_url.[Ch]
8897 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8899 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8900 (and presumably 6.2).
8902 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8903 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8904 remaining static member callbacks.
8906 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8909 * src/support/lyxstring.h: declare struct Srep as friend of
8910 lyxstring, since DEC cxx complains otherwise.
8912 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8914 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8916 * src/LaTeX.C (run): made run_bibtex also depend on files with
8918 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8919 are put into the dependency file.
8921 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8922 the code has shown itself to work
8923 (create_ispell_pipe): removed another warning, added a comment
8926 * src/minibuffer.C (ExecutingCB): removed code that has been
8927 commented out a long time
8929 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8930 out code + a warning.
8932 * src/support/lyxstring.h: comment out the three private
8933 operators, when compiling with string ansi conforming compilers
8936 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8938 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8939 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8942 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8945 * src/mathed/math_panel.C (create_math_panel): remove explicit
8948 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8951 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8952 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8953 to XCreatePixmapFromBitmapData
8954 (fl_set_bmtable_data): change the last argument to be unsigned
8956 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8957 and bh to be unsigned int, remove explicit casts in call to
8958 XReadBitmapFileData.
8960 * images/arrows.xbm: made the arrays unsigned char *
8961 * images/varsz.xbm: ditto
8962 * images/misc.xbm: ditto
8963 * images/greek.xbm: ditto
8964 * images/dots.xbm: ditto
8965 * images/brel.xbm: ditto
8966 * images/bop.xbm: ditto
8968 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8970 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8971 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8972 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8974 (LYX_CXX_CHEADERS): added <clocale> to the test.
8976 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8978 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8980 * src/support/lyxstring.C (append): fixed something that must be a
8981 bug, rep->assign was used instead of rep->append.
8983 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8986 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8987 lyx insert double chars. Fix spotted by Kayvan.
8989 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8991 * Fixed the tth support. I messed up with the Emacs patch apply feature
8992 and omitted the changes in lyxrc.C.
8994 1999-10-22 Juergen Vigna <jug@sad.it>
8996 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8998 * src/lyx_cb.C (MenuInsertRef) +
8999 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9000 the form cannot be resized under it limits (fixes a segfault)
9002 * src/lyx.C (create_form_form_ref) +
9003 * forms/lyx.fd: Changed Gravity on name input field so that it is
9006 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9008 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9009 <ostream> and <istream>.
9011 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9012 whether <fstream> provides the latest standard features, or if we
9013 have an oldstyle library (like in egcs).
9014 (LYX_CXX_STL_STRING): fix the test.
9016 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9017 code on MODERN_STL_STREAM.
9019 * src/support/lyxstring.h: use L{I,O}stream.h.
9021 * src/support/L{I,O}stream.h: new files, designed to setup
9022 correctly streams for our use
9023 - includes the right header depending on STL capabilities
9024 - puts std::ostream and std::endl (for LOStream.h) or
9025 std::istream (LIStream.h) in toplevel namespace.
9027 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9029 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9030 was a bib file that had been changed we ensure that bibtex is run.
9031 (runBibTeX): enhanced to extract the names of the bib files and
9032 getting their absolute path and enter them into the dep file.
9033 (findtexfile): static func that is used to look for tex-files,
9034 checks for absolute patchs and tries also with kpsewhich.
9035 Alternative ways of finding the correct files are wanted. Will
9037 (do_popen): function that runs a command using popen and returns
9038 the whole output of that command in a string. Should be moved to
9041 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9042 file with extension ext has changed.
9044 * src/insets/figinset.C: added ifdef guards around the fl_free
9045 code that jug commented out. Now it is commented out when
9046 compiling with XForms == 0.89.
9048 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9049 to lyxstring.C, and only keep a forward declaration in
9050 lyxstring.h. Simplifies the header file a bit and should help a
9051 bit on compile time too. Also changes to Srep will not mandate a
9052 recompile of code just using string.
9053 (~lyxstring): definition moved here since it uses srep.
9054 (size): definition moved here since it uses srep.
9056 * src/support/lyxstring.h: removed a couple of "inline" that should
9059 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9061 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9064 1999-10-21 Juergen Vigna <jug@sad.it>
9066 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9067 set to left if I just remove the width entry (or it is empty).
9069 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9070 paragraph when having dummy paragraphs.
9072 1999-10-20 Juergen Vigna <jug@sad.it>
9074 * src/insets/figinset.C: just commented some fl_free_form calls
9075 and added warnings so that this calls should be activated later
9076 again. This avoids for now a segfault, but we have a memory leak!
9078 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9079 'const char * argument' to 'string argument', this should
9080 fix some Asserts() in lyxstring.C.
9082 * src/lyxfunc.h: Removed the function argAsString(const char *)
9083 as it is not used anymore.
9085 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9087 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9090 * src/Literate.h: some funcs moved from public to private to make
9091 interface clearer. Unneeded args removed.
9093 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9095 (scanBuildLogFile): ditto
9097 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9098 normal TeX Error. Still room for improvement.
9100 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9102 * src/buffer.C (insertErrors): changes to make the error
9103 desctription show properly.
9105 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9108 * src/support/lyxstring.C (helper): changed to use
9109 sizeof(object->rep->ref).
9110 (operator>>): changed to use a pointer instead.
9112 * src/support/lyxstring.h: changed const reference & to value_type
9113 const & lets see if that helps.
9115 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9117 * Makefile.am (rpmdist): fixed to have non static package and
9120 * src/support/lyxstring.C: removed the compilation guards
9122 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9125 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9126 conditional compile of lyxstring.Ch
9128 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9129 stupid check, but it is a lot better than the bastring hack.
9130 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9132 * several files: changed string::erase into string::clear. Not
9135 * src/chset.C (encodeString): use a char temporary instead
9137 * src/table.C (TexEndOfCell): added tostr around
9138 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9139 (TexEndOfCell): ditto
9140 (TexEndOfCell): ditto
9141 (TexEndOfCell): ditto
9142 (DocBookEndOfCell): ditto
9143 (DocBookEndOfCell): ditto
9144 (DocBookEndOfCell): ditto
9145 (DocBookEndOfCell): ditto
9147 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9149 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9151 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9152 (MenuBuildProg): added tostr around ret
9153 (MenuRunChktex): added tostr around ret
9154 (DocumentApplyCB): added tostr around ret
9156 * src/chset.C (encodeString): added tostr around t->ic
9158 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9159 (makeLaTeXFile): added tostr around tocdepth
9160 (makeLaTeXFile): added tostr around ftcound - 1
9162 * src/insets/insetbib.C (setCounter): added tostr around counter.
9164 * src/support/lyxstring.h: added an operator+=(int) to catch more
9167 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9168 (lyxstring): We DON'T allow NULL pointers.
9170 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9172 * src/mathed/math_macro.C (MathMacroArgument::Write,
9173 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9174 when writing them out.
9176 * src/LString.C: remove, since it is not used anymore.
9178 * src/support/lyxstring.C: condition the content to
9179 USE_INCLUDED_STRING macro.
9181 * src/mathed/math_symbols.C, src/support/lstrings.C,
9182 src/support/lyxstring.C: add `using' directive to specify what
9183 we need in <algorithm>. I do not think that we need to
9184 conditionalize this, but any thought is appreciated.
9186 * many files: change all callback functions to "C" linkage
9187 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9188 strict_ansi. Those who were static are now global.
9189 The case of callbacks which are static class members is
9190 trickier, since we have to make C wrappers around them (see
9191 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9192 did not finish this yet, since it defeats the purpose of
9193 encapsulation, and I am not sure what the best route is.
9195 1999-10-19 Juergen Vigna <jug@sad.it>
9197 * src/support/lyxstring.C (lyxstring): we permit to have a null
9198 pointer as assignment value and just don't assign it.
9200 * src/vspace.C (nextToken): corrected this function substituting
9201 find_first(_not)_of with find_last_of.
9203 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9204 (TableOptCloseCB) (TableSpeCloseCB):
9205 inserted fl_set_focus call for problem with fl_hide_form() in
9208 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9210 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9213 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9215 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9216 LyXLex::next() and not eatline() to get its argument.
9218 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9220 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9221 instead, use fstreams for io of the depfile, removed unneeded
9222 functions and variables.
9224 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9225 vector instead, removed all functions and variables that is not in
9228 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9230 * src/buffer.C (insertErrors): use new interface to TeXError
9232 * Makefile.am (rpmdist): added a rpmdist target
9234 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9235 per Kayvan's instructions.
9237 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9239 * src/Makefile.am: add a definition for localedir, so that locales
9240 are found after installation (Kayvan)
9242 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9244 * development/.cvsignore: new file.
9246 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9248 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9249 C++ compiler provides wrappers for C headers and use our alternate
9252 * configure.in: use LYX_CXX_CHEADERS.
9254 * src/cheader/: new directory, populated with cname headers from
9255 libstdc++-2.8.1. They are a bit old, but probably good enough for
9256 what we want (support compilers who lack them).
9258 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9259 from includes. It turns out is was stupid.
9261 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9263 * lib/Makefile.am (install-data-local): forgot a ';'
9264 (install-data-local): forgot a '\'
9265 (libinstalldirs): needed after all. reintroduced.
9267 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9269 * configure.in (AC_OUTPUT): added lyx.spec
9271 * development/lyx.spec: removed file
9273 * development/lyx.spec.in: new file
9275 * po/*.po: merged with lyx.pot becuase of make distcheck
9277 * lib/Makefile.am (dist-hook): added dist-hook so that
9278 documentation files will be included when doing a make
9279 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9280 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9282 more: tried to make install do the right thing, exclude CVS dirs
9285 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9286 Path would fit in more nicely.
9288 * all files that used to use pathstack: uses now Path instead.
9289 This change was a lot easier than expected.
9291 * src/support/path.h: new file
9293 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9295 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9297 * src/support/lyxstring.C (getline): Default arg was given for
9300 * Configure.cmd: removed file
9302 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9304 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9305 streams classes and types, add the proper 'using' statements when
9306 MODERN_STL is defined.
9308 * src/debug.h: move the << operator definition after the inclusion
9311 * src/support/filetools.C: include "LAssert.h", which is needed
9314 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9317 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9318 include "debug.h" to define a proper ostream.
9320 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9322 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9323 method to the SystemCall class which can kill a process, but it's
9324 not fully implemented yet.
9326 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9328 * src/support/FileInfo.h: Better documentation
9330 * src/lyxfunc.C: Added support for buffer-export html
9332 * src/menus.C: Added Export->As HTML...
9334 * lib/bind/*.bind: Added short-cut for buffer-export html
9336 * src/lyxrc.*: Added support for new \tth_command
9338 * lib/lyxrc.example: Added stuff for new \tth_command
9340 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9342 * lib/Makefile.am (IMAGES): removed images/README
9343 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9344 installes in correct place. Check permisions is installed
9347 * src/LaTeX.C: some no-op changes moved declaration of some
9350 * src/LaTeX.h (LATEX_H): changed include guard name
9352 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9354 * lib/reLyX/Makefile.am: install noweb2lyx.
9356 * lib/Makefile.am: install configure.
9358 * lib/reLyX/configure.in: declare a config aux dir; set package
9359 name to lyx (not sure what the best solution is); generate noweb2lyx.
9361 * lib/layouts/egs.layout: fix the bibliography layout.
9363 1999-10-08 Jürgen Vigna <jug@sad.it>
9365 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9366 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9367 it returned without continuing to search the path.
9369 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9371 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9372 also fixes a bug. It is not allowed to do tricks with std::strings
9373 like: string a("hei"); &a[e]; this will not give what you
9374 think... Any reason for the complexity in this func?
9376 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9378 * Updated README and INSTALL a bit, mostly to check that my
9379 CVS rights are correctly set up.
9381 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9383 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9384 does not allow '\0' chars but lyxstring and std::string does.
9386 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9388 * autogen.sh (AUTOCONF): let the autogen script create the
9389 POTFILES.in file too. POTFILES.in should perhaps now not be
9390 included in the cvs module.
9392 * some more files changed to use C++ includes instead of C ones.
9394 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9396 (Reread): added tostr to nlink. buggy output otherwise.
9397 (Reread): added a string() around szMode when assigning to Buffer,
9398 without this I got a log of garbled info strings.
9400 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9403 * I have added several ostream & operator<<(ostream &, some_type)
9404 functions. This has been done to avoid casting and warnings when
9405 outputting enums to lyxerr. This as thus eliminated a lot of
9406 explicit casts and has made the code clearer. Among the enums
9407 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9408 mathed enums, some font enum the Debug::type enum.
9410 * src/support/lyxstring.h (clear): missing method. equivalent of
9413 * all files that contained "stderr": rewrote constructs that used
9414 stderr to use lyxerr instead. (except bmtable)
9416 * src/support/DebugStream.h (level): and the passed t with
9417 Debug::ANY to avoid spurious bits set.
9419 * src/debug.h (Debug::type value): made it accept strings of the
9422 * configure.in (Check for programs): Added a check for kpsewhich,
9423 the latex generation will use this later to better the dicovery of
9426 * src/BufferView.C (create_view): we don't need to cast this to
9427 (void*) that is done automatically.
9428 (WorkAreaButtonPress): removed some dead code.
9430 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9432 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9433 is not overwritten when translated (David Sua'rez de Lis).
9435 * lib/CREDITS: Added David Sua'rez de Lis
9437 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9439 * src/bufferparams.C (BufferParams): default input encoding is now
9442 * acinclude.m4 (cross_compiling): comment out macro
9443 LYX_GXX_STRENGTH_REDUCE.
9445 * acconfig.h: make sure that const is not defined (to empty) when
9446 we are compiling C++. Remove commented out code using SIZEOF_xx
9449 * configure.in : move the test for const and inline as late as
9450 possible so that these C tests do not interefere with C++ ones.
9451 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9452 has not been proven.
9454 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9456 * src/table.C (getDocBookAlign): remove bad default value for
9459 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9461 (ShowFileMenu2): ditto.
9463 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9466 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9468 * Most files: finished the change from the old error code to use
9469 DebugStream for all lyxerr debugging. Only minor changes remain
9470 (e.g. the setting of debug levels using strings instead of number)
9472 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9474 * src/layout.C (Add): Changed to use compare_no_case instead of
9477 * src/FontInfo.C: changed loop variable type too string::size_type.
9479 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9481 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9482 set ETAGS_ARGS to --c++
9484 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9486 * src/table.C (DocBookEndOfCell): commented out two unused variables
9488 * src/paragraph.C: commented out four unused variables.
9490 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9491 insed a if clause with type string::size_type.
9493 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9496 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9498 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9499 variable, also changed loop to go from 0 to lenght + 1, instead of
9500 -1 to length. This should be correct.
9502 * src/LaTeX.C (scanError): use string::size_type as loop variable
9505 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9506 (l.896) since y_tmp and row was not used anyway.
9508 * src/insets/insetref.C (escape): use string::size_type as loop
9511 * src/insets/insetquotes.C (Width): use string::size_type as loop
9513 (Draw): use string::size_type as loop variable type.
9515 * src/insets/insetlatexaccent.C (checkContents): use
9516 string::size_type as loop variable type.
9518 * src/insets/insetlabel.C (escape): use string::size_type as loop
9521 * src/insets/insetinfo.C: added an extern for current_view.
9523 * src/insets/insetcommand.C (scanCommand): use string::size_type
9524 as loop variable type.
9526 * most files: removed the RCS tags. With them we had to recompile
9527 a lot of files after a simple cvs commit. Also we have never used
9528 them for anything meaningful.
9530 * most files: tags-query-replace NULL 0. As adviced several plases
9531 we now use "0" instead of "NULL" in our code.
9533 * src/support/filetools.C (SpaceLess): use string::size_type as
9536 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9538 * src/paragraph.C: fixed up some more string stuff.
9540 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9542 * src/support/filetools.h: make modestr a std::string.
9544 * src/filetools.C (GetEnv): made ch really const.
9546 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9547 made code that used these use max/min from <algorithm> instead.
9549 * changed several c library include files to their equivalent c++
9550 library include files. All is not changed yet.
9552 * created a support subdir in src, put lyxstring and lstrings
9553 there + the extra files atexit, fileblock, strerror. Created
9554 Makefile.am. edited configure.in and src/Makefile.am to use this
9555 new subdir. More files moved to support.
9557 * imported som of the functions from repository lyx, filetools
9559 * ran tags-query-replace on LString -> string, corrected the bogus
9560 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9561 is still some errors in there. This is errors where too much or
9562 too litle get deleted from strings (string::erase, string::substr,
9563 string::replace), there can also be some off by one errors, or
9564 just plain wrong use of functions from lstrings. Viewing of quotes
9567 * LyX is now running fairly well with string, but there are
9568 certainly some bugs yet (see above) also string is quite different
9569 from LString among others in that it does not allow null pointers
9570 passed in and will abort if it gets any.
9572 * Added the revtex4 files I forgot when setting up the repository.
9574 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9576 * All over: Tried to clean everything up so that only the files
9577 that we really need are included in the cvs repository.
9578 * Switched to use automake.
9579 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9580 * Install has not been checked.
9582 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9584 * po/pt.po: Three errors:
9585 l.533 and l.538 format specification error
9586 l. 402 duplicate entry, I just deleted it.