1 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3 * src/converter.C (add_options): New function.
4 (SetViewer): Change $$FName into '$$FName'.
5 (View): Add options when running xdvi
6 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
7 (Convert): The 3rd parameter is now the desired filename. Converts
8 calls to lyx::rename if necessary.
9 Add options when running dvips.
10 (dvi_papersize,dvips_options): New methods.
12 * src/exporter.C (Export): Use getLatexName() instead of fileName().
14 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
15 using a call to Converter::dvips_options.
16 Fixed to work with nex export code.
19 * src/support/rename.C: New files
21 * src/support/syscall.h
22 * src/support/syscall.C: Added Starttype SystemDontWait.
24 * lib/ui/default.ui: Changed to work with new export code
26 * lib/configure.m4: Changed to work with new export code
28 * src/encoding.C: Changed latex name for iso8859_7 encoding.
30 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
32 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
33 so that code compiles with DEC cxx.
35 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
36 to work correctly! Also now supports the additional elements
39 2000-09-01 Allan Rae <rae@lyx.org>
41 * src/frontends/ButtonPolicies.C: renamed all the references to
42 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
44 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
45 since it's a const not a type.
47 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
49 2000-08-31 Juergen Vigna <jug@sad.it>
51 * src/insets/figinset.C: Various changes to look if the filename has
52 an extension and if not add it for inline previewing.
54 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
56 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
57 make buttonStatus and isReadOnly be const methods. (also reflect
58 this in derived classes.)
60 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
61 (nextState): change to be static inline, pass the StateMachine as
63 (PreferencesPolicy): remove casts
64 (OkCancelPolicy): remvoe casts
65 (OkCancelReadOnlyPolicy): remove casts
66 (NoRepeatedApplyReadOnlyPolicy): remove casts
67 (OkApplyCancelReadOnlyPolicy): remove casts
68 (OkApplyCancelPolicy): remove casts
69 (NoRepeatedApplyPolicy): remove casts
71 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
73 * src/converter.C: added some using directives
75 * src/frontends/ButtonPolicies.C: changes to overcome
76 "need lvalue" error with DEC c++
78 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
79 to WMHideCB for DEC c++
81 * src/frontends/xforms/Menubar_pimpl.C: added using directive
83 * src/frontends/xforms/forms/form_document.C.patch: use C callback
84 to BulletBMTableCB for DEC c++
86 2000-08-31 Allan Rae <rae@lyx.org>
88 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
89 character dialog separately from old document dialogs combo_language.
92 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
94 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
95 Removed LFUN_REF_CREATE.
97 * src/MenuBackend.C: Added new tags: toc and references
99 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
100 (add_lastfiles, add_documents, add_formats): Removed the unused smn
102 (add_toc, add_references): New methods.
103 (create_submenu): Handle correctly the case when there is a
104 seperator after optional menu items.
106 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
107 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
108 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
110 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
112 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
114 * src/converter.[Ch]: New file for converting between different
117 * src/export.[Ch]: New file for exporting a LyX file to different
120 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
121 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
122 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
123 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
124 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
125 RunDocBook, MenuExport.
127 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
128 Exporter::Preview methods if NEW_EXPORT is defined.
130 * src/buffer.C (Dispatch): Use Exporter::Export.
132 * src/lyxrc.C: Added new tags: \converter and \viewer.
135 * src/LyXAction.C: Define new lyx-function: buffer-update.
136 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
137 when NEW_EXPORT is defined.
139 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
141 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
143 * lib/ui/default.ui: Added submenus "view" and "update" to the
146 * src/filetools.C (GetExtension): New function.
148 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
150 2000-08-29 Allan Rae <rae@lyx.org>
152 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
154 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
155 (EnableDocumentLayout): removed
156 (DisableDocumentLayout): removed
157 (build): make use of ButtonController's read-only handling to
158 de/activate various objects. Replaces both of the above functions.
160 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
161 (readOnly): was read_only
162 (refresh): fixed dumb mistakes with read_only_ handling
164 * src/frontends/xforms/forms/form_document.fd:
165 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
166 tabbed dialogs so the tabs look more like tabs and so its easier to
167 work out which is the current tab.
169 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
170 segfault with form_table
172 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
174 2000-08-28 Juergen Vigna <jug@sad.it>
176 * acconfig.h: added USE_PSPELL.
178 * src/config.h.in: added USE_PSPELL.
180 * autogen.sh: added pspell.m4
182 * config/pspell.m4: new file.
184 * src/spellchecker.C: implemented support for pspell libary.
186 2000-08-25 Juergen Vigna <jug@sad.it>
188 * src/LyXAction.C (init): renamed LFUN_TABLE to
189 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
191 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
193 * src/lyxscreen.h: add force_clear variable and fuction to force
194 a clear area when redrawing in LyXText.
196 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
198 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
200 * some whitespace and comment changes.
202 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
204 * src/buffer.C: up te LYX_FORMAT to 2.17
206 2000-08-23 Juergen Vigna <jug@sad.it>
208 * src/BufferView_pimpl.C (tripleClick): disable this when in a
211 * src/insets/insettabular.C (pasteSelection): delete the insets
212 LyXText as it is not valid anymore.
213 (copySelection): new function.
214 (pasteSelection): new function.
215 (cutSelection): new function.
216 (LocalDispatch): implemented cut/copy/paste of cell selections.
218 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
219 don't have a LyXText.
221 * src/LyXAction.C (init): a NEW_TABULAR define too much.
223 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
226 2000-08-22 Juergen Vigna <jug@sad.it>
228 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
229 ifdef form_table out if NEW_TABULAR.
231 2000-08-21 Juergen Vigna <jug@sad.it>
233 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
234 (draw): fixed draw position so that the cursor is positioned in the
236 (InsetMotionNotify): hide/show cursor so the position is updated.
237 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
238 using cellstart() function where it should be used.
240 * src/insets/insettext.C (draw): ditto.
242 * src/tabular.C: fixed initialization of some missing variables and
243 made BoxType into an enum.
245 2000-08-22 Marko Vendelin <markov@ioc.ee>
246 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
247 stock menu item using action numerical value, not its string
251 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
253 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
254 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
256 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
258 * src/frontends/xforms/GUIRunTime.C: new file
260 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
261 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
263 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
265 * src/frontends/kde/GUIRunTime.C: new file
267 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
268 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
270 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
272 * src/frontends/gnome/GUIRunTime.C: new file
274 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
277 * src/frontends/GUIRunTime.h: removed constructor and destructor,
278 small change to documetentation.
280 * src/frontends/GUIRunTime.C: removed file
282 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
284 * src/lyxparagraph.h: enable NEW_TABULAR as default
286 * src/lyxfunc.C (processKeySym): remove some commented code
288 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
289 NEW_TABULAR around the fd_form_table_options.
291 * src/lyx_gui.C (runTime): call the static member function as
292 GUIRunTime::runTime().
294 2000-08-21 Allan Rae <rae@lyx.org>
296 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
299 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
301 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
303 2000-08-21 Allan Rae <rae@lyx.org>
305 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
307 * src/frontends/xforms/FormPreferences.C (build): use setOK
308 * src/frontends/xforms/FormDocument.C (build): use setOK
309 (FormDocument): use the appropriate policy.
311 2000-08-21 Allan Rae <rae@lyx.org>
313 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
314 automatic [de]activation of arbitrary objects when in a read-only state.
316 * src/frontends/ButtonPolicies.h: More documentation
317 (isReadOnly): added to support the above.
319 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
321 2000-08-18 Juergen Vigna <jug@sad.it>
323 * src/insets/insettabular.C (getStatus): changed to return func_status.
325 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
326 display toggle menu entries if they are.
328 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
329 new document layout now.
331 * src/lyxfunc.C: ditto
333 * src/lyx_gui_misc.C: ditto
335 * src/lyx_gui.C: ditto
337 * lib/ui/default.ui: removed paper and quotes layout as they are now
338 all in the document layout tabbed folder.
340 * src/frontends/xforms/forms/form_document.fd: added Restore
341 button and callbacks for all inputs for Allan's ButtonPolicy.
343 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
344 (CheckChoiceClass): added missing params setting on class change.
345 (UpdateLayoutDocument): added for updating the layout on params.
346 (build): forgot to RETURN_ALWAYS input_doc_spacing.
347 (FormDocument): Implemented Allan's ButtonPolicy with the
350 2000-08-17 Allan Rae <rae@lyx.org>
352 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
353 so we can at least see the credits again.
355 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
356 controller calls for the appropriate callbacks. Note that since Ok
357 calls apply followed by cancel, and apply isn't a valid input for the
358 APPLIED state, the bc_ calls have to be made in the static callback not
359 within each of the real callbacks.
361 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
362 (setOk): renamed from setOkay()
364 2000-08-17 Juergen Vigna <jug@sad.it>
366 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
367 in the implementation part.
368 (composeUIInfo): don't show optional menu-items.
370 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
372 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
374 * src/bufferview_funcs.C (CurrentState): fixed to show also the
375 text-state when in a text-inset.
377 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
379 2000-08-17 Marko Vendelin <markov@ioc.ee>
380 * src/frontends/gnome/FormIndex.C
381 * src/frontends/gnome/FormIndex.h
382 * src/frontends/gnome/FormToc.C
383 * src/frontends/gnome/FormToc.h
384 * src/frontends/gnome/dialogs
385 * src/frontends/gnome/diatoc_callbacks.c
386 * src/frontends/gnome/diatoc_callbacks.h
387 * src/frontends/gnome/diainsertindex_callbacks.h
388 * src/frontends/gnome/diainsertindex_callbacks.c
389 * src/frontends/gnome/diainsertindex_interface.c
390 * src/frontends/gnome/diainsertindex_interface.h
391 * src/frontends/gnome/diatoc_interface.h
392 * src/frontends/gnome/diatoc_interface.c
393 * src/frontends/gnome/Makefile.am: Table of Contents and
394 Insert Index dialogs implementation for Gnome frontend
396 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
398 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
400 * src/frontends/gnome/diainserturl_interface.c: make the dialog
403 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
405 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
406 destructor. Don't definde if you don't need it
407 (processEvents): made static, non-blocking events processing for
409 (runTime): static method. event loop for xforms
410 * similar as above for kde and gnome.
412 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
414 (runTime): new method calss the real frontends runtime func.
416 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
418 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
420 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
422 2000-08-16 Juergen Vigna <jug@sad.it>
424 * src/lyx_gui.C (runTime): added GUII RunTime support.
426 * src/frontends/Makefile.am:
427 * src/frontends/GUIRunTime.[Ch]:
428 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
429 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
430 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
432 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
434 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
435 as this is already set in ${FRONTEND_INCLUDE} if needed.
437 * configure.in (CPPFLAGS): setting the include dir for the frontend
438 directory and don't set FRONTEND=xforms for now as this is executed
441 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
443 * src/frontends/kde/Makefile.am:
444 * src/frontends/kde/FormUrl.C:
445 * src/frontends/kde/FormUrl.h:
446 * src/frontends/kde/formurldialog.h:
447 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
449 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
451 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
453 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
455 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
458 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
460 * src/WorkArea.C (work_area_handler): more work to get te
461 FL_KEYBOARD to work with xforms 0.88 too, please test.
463 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
465 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
467 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
470 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
472 * src/Timeout.h: remove Qt::emit hack.
474 * several files: changes to allo doc++ compilation
476 * src/lyxfunc.C (processKeySym): new method
477 (processKeyEvent): comment out if FL_REVISION < 89
479 * src/WorkArea.C: change some debugging levels.
480 (WorkArea): set wantkey to FL_KEY_ALL
481 (work_area_handler): enable the FL_KEYBOARD clause, this enables
482 clearer code and the use of compose with XForms 0.89. Change to
483 use signals instead of calling methods in bufferview directly.
485 * src/Painter.C: change some debugging levels.
487 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
490 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
491 (workAreaKeyPress): new method
493 2000-08-14 Juergen Vigna <jug@sad.it>
495 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
497 * config/kde.m4: addes some features
499 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
500 include missing xforms dialogs.
502 * src/Timeout.h: a hack to be able to compile with qt/kde.
504 * sigc++/.cvsignore: added acinclude.m4
506 * lib/.cvsignore: added listerros
508 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
509 xforms tree as objects are needed for other frontends.
511 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
512 linking with not yet implemented xforms objects.
514 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
516 2000-08-14 Baruch Even <baruch.even@writeme.com>
518 * src/frontends/xforms/FormGraphics.h:
519 * src/frontends/xforms/FormGraphics.C:
520 * src/frontends/xforms/RadioButtonGroup.h:
521 * src/frontends/xforms/RadioButtonGroup.C:
522 * src/insets/insetgraphics.h:
523 * src/insets/insetgraphics.C:
524 * src/insets/insetgraphicsParams.h:
525 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
526 instead of spaces, and various other indentation issues to make the
527 sources more consistent.
529 2000-08-14 Marko Vendelin <markov@ioc.ee>
531 * src/frontends/gnome/dialogs/diaprint.glade
532 * src/frontends/gnome/FormPrint.C
533 * src/frontends/gnome/FormPrint.h
534 * src/frontends/gnome/diaprint_callbacks.c
535 * src/frontends/gnome/diaprint_callbacks.h
536 * src/frontends/gnome/diaprint_interface.c
537 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
540 * src/frontends/gnome/dialogs/diainserturl.glade
541 * src/frontends/gnome/FormUrl.C
542 * src/frontends/gnome/FormUrl.h
543 * src/frontends/gnome/diainserturl_callbacks.c
544 * src/frontends/gnome/diainserturl_callbacks.h
545 * src/frontends/gnome/diainserturl_interface.c
546 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
549 * src/frontends/gnome/Dialogs.C
550 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
551 all other dialogs. Copy all unimplemented dialogs from Xforms
554 * src/frontends/gnome/support.c
555 * src/frontends/gnome/support.h: support files generated by Glade
559 * config/gnome.m4: Gnome configuration scripts
561 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
562 configure --help message
564 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
565 only if there are no events pendling in Gnome/Gtk. This enhances
566 the performance of menus.
569 2000-08-14 Allan Rae <rae@lyx.org>
571 * lib/Makefile.am: listerrors cleaning
573 * lib/listerrors: removed -- generated file
574 * acinclude.m4: ditto
575 * sigc++/acinclude.m4: ditto
577 * src/frontends/xforms/forms/form_citation.fd:
578 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
581 * src/frontends/xforms/forms/makefile: I renamed the `install` target
582 `updatesrc` and now we have a `test` target that does what `updatesrc`
583 used to do. I didn't like having an install target that wasn't related
586 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
587 on all except FormGraphics. This may yet happen. Followed by a major
588 cleanup including using FL_TRANSIENT for most of the dialogs. More
589 changes to come when the ButtonController below is introduced.
591 * src/frontends/xforms/ButtonController.h: New file for managing up to
592 four buttons on a dialog according to an externally defined policy.
593 * src/frontends/xforms/Makefile.am: added above
595 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
596 Apply and Cancel/Close buttons and everything in between and beyond.
597 * src/frontends/Makefile.am: added above.
599 * src/frontends/xforms/forms/form_preferences.fd:
600 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
601 and removed variable 'status' as a result. Fixed the set_minsize thing.
602 Use the new screen-font-update after checking screen fonts were changed
603 Added a "Restore" button to restore the original lyxrc values while
604 editing. This restores everything not just the last input changed.
605 That's still a tricky one. As is the "LyX: this shouldn't happen..."
607 * src/LyXAction.C: screen-font-update added for updating buffers after
608 screen font settings have been changed.
609 * src/commandtags.h: ditto
610 * src/lyxfunc.C: ditto
612 * forms/lyx.fd: removed screen fonts dialog.
613 * src/lyx_gui.C: ditto
614 * src/menus.[Ch]: ditto
615 * src/lyx.[Ch]: ditto
616 * src/lyx_cb.C: ditto + code from here moved to make
617 screen-font-update. And people wonder why progress on GUII is
618 slow. Look at how scattered this stuff was! It takes forever
621 * forms/fdfix.sh: Fixup the spacing after commas.
622 * forms/makefile: Remove date from generated files. Fewer clashes now.
623 * forms/bullet_forms.C.patch: included someones handwritten changes
625 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
626 once I've discovered why LyXRC was made noncopyable.
627 * src/lyx_main.C: ditto
629 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
631 * src/frontends/xforms/forms/fdfix.sh:
632 * src/frontends/xforms/forms/fdfixh.sed:
633 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
634 * src/frontends/xforms/Form*.[hC]:
635 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
636 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
637 provide a destructor for the struct FD_form_xxxx. Another version of
638 the set_[max|min]size workaround and a few other cleanups. Actually,
639 Angus' patch from 20000809.
641 2000-08-13 Baruch Even <baruch.even@writeme.com>
643 * src/insets/insetgraphics.C (Clone): Added several fields that needed
646 2000-08-11 Juergen Vigna <jug@sad.it>
648 * src/insets/insetgraphics.C (InsetGraphics): changing init
649 order because of warnings.
651 * src/frontends/xforms/forms/makefile: adding patching .C with
654 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
655 from .C.patch to .c.patch
657 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
658 order because of warning.
660 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
662 * src/frontends/Liason.C (setMinibuffer): new helper function
664 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
666 * src/lyxfunc.C (Dispatch): calling new Document-Layout
668 * lib/ui/default.ui: commented out PaperLayout entry
670 * src/frontends/xforms/form_document.[Ch]: new added files
672 * src/frontends/xforms/FormDocument.[Ch]: ditto
674 * src/frontends/xforms/forms/form_document.fd: ditto
676 * src/frontends/xforms/forms/form_document.C.patch: ditto
678 2000-08-10 Juergen Vigna <jug@sad.it>
680 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
681 (InsetGraphics): initialized cacheHandle to 0.
682 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
684 2000-08-10 Baruch Even <baruch.even@writeme.com>
686 * src/graphics/GraphicsCache.h:
687 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
688 correctly as a cache.
690 * src/graphics/GraphicsCacheItem.h:
691 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
694 * src/graphics/GraphicsCacheItem_pimpl.h:
695 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
698 * src/insets/insetgraphics.h:
699 * src/insets/insetgraphics.C: Changed from using a signal notification
700 to polling when image is not loaded.
702 2000-08-10 Allan Rae <rae@lyx.org>
704 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
705 that there are two functions that have to been taken out of line by
706 hand and aren't taken care of in the script. (Just a reminder note)
708 * sigc++/macros/*.h.m4: Updated as above.
710 2000-08-09 Juergen Vigna <jug@sad.it>
712 * src/insets/insettext.C (draw): small fix for clearing rectangle.
714 * src/insets/insettabular.C: make drawing of single cell smarter.
716 2000-08-09 Marko Vendelin <markov@ioc.ee>
717 * src/frontends/gnome/Menubar_pimpl.C
718 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
719 implementation: new files
721 * src/frontends/gnome/mainapp.C
722 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
725 * src/main.C: create Gnome main window
727 * src/frontends/xforms/Menubar_pimpl.h
728 * src/frontends/Menubar.C
729 * src/frontends/Menubar.h: added method Menubar::update that calls
730 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
732 * src/LyXView.C: calls Menubar::update to update the state
735 * src/frontends/gnome/Makefile.am: added new files
737 * src/frontends/Makefile.am: added frontend compiler options
739 2000-08-08 Juergen Vigna <jug@sad.it>
741 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
743 * src/bufferlist.C (close):
744 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
745 documents if exiting without saving.
747 * src/buffer.C (save): use removeAutosaveFile()
749 * src/support/filetools.C (removeAutosaveFile): new function.
751 * src/lyx_cb.C (MenuWrite): returns a bool now.
752 (MenuWriteAs): check if file could really be saved and revert to the
754 (MenuWriteAs): removing old autosavefile if existant.
756 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
757 before Goto toggle declaration, because of compiler warning.
759 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
761 * src/lyxfunc.C (MenuNew): small fix.
763 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
765 * src/bufferlist.C (newFile):
766 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
768 * src/lyxrc.C: added new_ask_filename tag
770 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
772 * src/lyx.fd: removed code pertaining to form_ref
773 * src/lyx.[Ch]: ditto
774 * src/lyx_cb.C: ditto
775 * src/lyx_gui.C: ditto
776 * src/lyx_gui_misc.C: ditto
778 * src/BufferView_pimpl.C (restorePosition): update buffer only
781 * src/commandtags.h (LFUN_REFTOGGLE): removed
782 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
783 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
784 (LFUN_REFBACK): renamed LFUN_REF_BACK
786 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
788 * src/lyxfunc.C (Dispatch): ditto.
789 InsertRef dialog is now GUI-independent.
791 * src/texrow.C: added using std::endl;
793 * src/insets/insetref.[Ch]: strip out large amounts of code.
794 The inset is now a container and this functionality is now
795 managed by a new FormRef dialog
797 * src/frontends/Dialogs.h (showRef, createRef): new signals
799 * src/frontends/xforms/FormIndex.[Ch],
800 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
801 when setting dialog's min/max size
802 * src/frontends/xforms/FormIndex.[Ch]: ditto
804 * src/frontends/xforms/FormRef.[Ch],
805 src/frontends/xforms/forms/form_ref.fd: new xforms
806 implementation of an InsetRef dialog
808 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
811 * src/graphics/XPM_Renderer.C (isImageFormatOK):
812 ios::nocreate is not part of the standard. Removed.
814 2000-08-07 Baruch Even <baruch.even@writeme.com>
816 * src/graphics/Renderer.h:
817 * src/graphics/Renderer.C: Added base class for rendering of different
818 image formats into Pixmaps.
820 * src/graphics/XPM_Renderer.h:
821 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
822 in a different class.
824 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
825 easily add support for other formats.
827 * src/insets/figinset.C: plugged a leak of an X resource.
829 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
831 * src/CutAndPaste.[Ch]: make all metods static.
833 * development/Code_rules/Rules: more work, added section on
834 Exceptions, and a References section.
836 * a lot of header files: work to make doc++ able to generate the
837 source documentation, some workarounds of doc++ problems. Doc++ is
838 now able to generate the documentation.
840 2000-08-07 Juergen Vigna <jug@sad.it>
842 * src/insets/insettabular.C (recomputeTextInsets): removed function
844 * src/tabular.C (SetWidthOfMulticolCell):
846 (calculate_width_of_column_NMC): fixed return value so that it really
847 only returns true if the column-width has changed (there where
848 problems with muliticolumn-cells in this column).
850 2000-08-04 Juergen Vigna <jug@sad.it>
852 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
853 also on the scrollstatus of the inset.
854 (workAreaMotionNotify): ditto.
856 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
858 2000-08-01 Juergen Vigna <jug@sad.it>
860 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
863 * src/LyXAction.C (init):
864 * src/insets/inset.C (LocalDispatch): added support for
867 * src/insets/inset.C (scroll): new functions.
869 * src/insets/insettext.C (removeNewlines): new function.
870 (SetAutoBreakRows): removes forced newlines in the text of the
871 paragraph if autoBreakRows is set to false.
873 * src/tabular.C (Latex): generates a parbox around the cell contents
876 * src/frontends/xforms/FormTabular.C (local_update): removed
877 the radio_useparbox button.
879 * src/tabular.C (UseParbox): new function
881 2000-08-06 Baruch Even <baruch.even@writeme.com>
883 * src/graphics/GraphicsCache.h:
884 * src/graphics/GraphicsCache.C:
885 * src/graphics/GraphicsCacheItem.h:
886 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
889 * src/insets/insetgraphics.h:
890 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
891 drawing of the inline image.
893 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
894 into the wrong position.
896 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
899 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
901 * src/support/translator.h: move all typedefs to public section
903 * src/support/filetools.C (MakeLatexName): return string const
906 (FileOpenSearch): ditto
908 (LibFileSearch): ditto
909 (i18nLibFileSearch): ditto
912 (CreateTmpDir): ditto
913 (CreateBufferTmpDir): ditto
914 (CreateLyXTmpDir): ditto
919 (OnlyFilename): ditto
921 (NormalizePath): ditto
923 (GetFileContents): ditto
924 (ReplaceEnvironmentPath): ditto
927 (ChangeExtension): ditto
928 (MakeDisplayPath): ditto
929 (do_popen): return cmdret const
930 (findtexfile): return string const
932 * src/support/DebugStream.h: add some /// to please doc++
934 * src/frontends/DialogBase.h (endif): add some /// to please doc++
936 * src/texrow.C (same_rownumber): functor to use with find_if
937 (getIdFromRow): rewritten to use find_if and to not update the
938 positions. return true if row is found
939 (increasePos): new method, use to update positions
941 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
943 * src/lyxlex_pimpl.C (verifyTable): new method
946 (GetString): return string const
947 (pushTable): rewrite to use std::stack
949 (setFile): better check
952 * src/lyxlex.h: make LyXLex noncopyable
954 * src/lyxlex.C (text): return char const * const
955 (GetString): return string const
956 (getLongString): return string const
958 * src/lyx_gui_misc.C (askForText): return pair<...> const
960 * src/lastfiles.[Ch] (operator): return string const
962 * src/buffer.C (parseSingleLyXformat2Token): pass string to
963 istringstream not char const *.
964 move token.end() out of loop.
965 (readFile): move initializaton of token
967 * src/BufferView2.C (insertErrors): run texrow.increasePos if
968 getIdFromRow is successful.
970 * lib/bind/emacs.bind: don't include menus bind
972 * development/Code_rules/Rules: the beginnings of making this
973 better and covering more of the unwritten rules that we have.
975 * development/Code_rules/Recommendations: a couple of wording
978 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
980 * src/support/strerror.c: remove C++ comment.
982 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
984 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
985 LFUN_INDEX_INSERT_LAST
987 * src/texrow.C (getIdFromRow): changed from const_iterator to
988 iterator, allowing code to compile with DEC cxx
990 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
991 stores part of the class, as suggested by Allan. Will allow
993 (apply): test to apply uses InsetCommandParams operator!=
995 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
996 (apply): test to apply uses InsetCommandParams operator!=
998 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
999 stores part of the class.
1000 (update): removed limits on min/max size.
1002 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1003 (apply): test to apply uses InsetCommandParams operator!=
1005 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1006 (Read, Write, scanCommand, getCommand): moved functionality
1007 into InsetCommandParams.
1009 (getScreenLabel): made pure virtual
1010 new InsetCommandParams operators== and !=
1012 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1013 c-tors based on InsetCommandParams. Removed others.
1014 * src/insets/insetinclude.[Ch]: ditto
1015 * src/insets/insetlabel.[Ch]: ditto
1016 * src/insets/insetparent.[Ch]: ditto
1017 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1019 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1020 insets derived from InsetCommand created using similar c-tors
1021 based on InsetCommandParams
1022 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1023 * src/menus.C (ShowRefsMenu): ditto
1024 * src/paragraph.C (Clone): ditto
1025 * src/text2.C (SetCounter): ditto
1026 * src/lyxfunc.C (Dispatch) ditto
1027 Also recreated old InsetIndex behaviour exactly. Can now
1028 index-insert at the start of a paragraph and index-insert-last
1029 without launching the pop-up.
1031 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1033 * lib/lyxrc.example: mark te pdf options as non functional.
1035 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1036 (isStrDbl): move tmpstr.end() out of loop.
1037 (strToDbl): move intialization of tmpstr
1038 (lowercase): return string const and move tmp.end() out of loop.
1039 (uppercase): return string const and move tmp.edn() out of loop.
1040 (prefixIs): add assertion
1045 (containsOnly): ditto
1046 (containsOnly): ditto
1047 (containsOnly): ditto
1048 (countChar): make last arg char not char const
1049 (token): return string const
1050 (subst): return string const, move tmp.end() out of loop.
1051 (subst): return string const, add assertion
1052 (strip): return string const
1053 (frontStrip): return string const, add assertion
1054 (frontStrip): return string const
1059 * src/support/lstrings.C: add inclde "LAssert.h"
1060 (isStrInt): move tmpstr.end() out of loop.
1062 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1063 toollist.end() out of loop.
1064 (deactivate): move toollist.end() out of loop.
1065 (update): move toollist.end() out of loop.
1066 (updateLayoutList): move tc.end() out of loop.
1067 (add): move toollist.end() out of loop.
1069 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1070 md.end() out of loop.
1072 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1074 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1077 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1078 (Erase): move insetlist.end() out of loop.
1080 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1081 ref to const string as first arg. Move initialization of some
1082 variables, whitespace changes.
1084 * src/kbmap.C (defkey): move table.end() out of loop.
1085 (kb_keymap): move table.end() out of loop.
1086 (findbinding): move table.end() out of loop.
1088 * src/MenuBackend.C (hasMenu): move end() out of loop.
1089 (getMenu): move end() out of loop.
1090 (getMenu): move menulist_.end() out of loop.
1092 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1094 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1097 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1098 (getFromLyXName): move infotab.end() out of loop.
1100 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1101 -fvtable-thunks -ffunction-sections -fdata-sections
1103 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1105 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1108 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1110 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1112 * src/frontends/xforms/FormCitation.[Ch],
1113 src/frontends/xforms/FormIndex.[Ch],
1114 src/frontends/xforms/FormToc.[Ch],
1115 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1117 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1119 * src/commandtags.h: renamed, created some flags for citation
1122 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1124 * src/lyxfunc.C (dispatch): use signals to insert index entry
1126 * src/frontends/Dialogs.h: new signal createIndex
1128 * src/frontends/xforms/FormCommand.[Ch],
1129 src/frontends/xforms/FormCitation.[Ch],
1130 src/frontends/xforms/FormToc.[Ch],
1131 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1133 * src/insets/insetindex.[Ch]: GUI-independent
1135 * src/frontends/xforms/FormIndex.[Ch],
1136 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1139 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1141 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1142 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1144 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1146 * src/insets/insetref.C (Latex): rewrite so that there is now
1147 question that a initialization is requested.
1149 * src/insets/insetcommand.h: reenable the hide signal
1151 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1153 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1154 fix handling of shortcuts (many bugs :)
1155 (add_lastfiles): ditto.
1157 * lib/ui/default.ui: fix a few shortcuts.
1159 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1161 * Makefile.am: Fix ``rpmdist'' target to return the exit
1162 status of the ``rpm'' command, instead of the last command in
1163 the chain (the ``rm lyx.xpm'' command, which always returns
1166 2000-08-02 Allan Rae <rae@lyx.org>
1168 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1169 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1170 * src/frontends/xforms/FormToc.C (FormToc): ditto
1172 * src/frontends/xforms/Makefile.am: A few forgotten files
1174 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1175 Signals-not-copyable-problem Lars' started commenting out.
1177 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1179 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1181 * src/insets/insetcommand.h: Signals is not copyable so anoter
1182 scheme for automatic hiding of forms must be used.
1184 * src/frontends/xforms/FormCitation.h: don't inerit from
1185 noncopyable, FormCommand already does that.
1186 * src/frontends/xforms/FormToc.h: ditto
1187 * src/frontends/xforms/FormUrl.h: ditto
1189 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1191 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1193 * src/insets/insetcommand.h (hide): new SigC::Signal0
1194 (d-tor) new virtual destructor emits hide signal
1196 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1197 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1199 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1200 LOF and LOT. Inset is now GUI-independent
1202 * src/insets/insetloa.[Ch]: redundant
1203 * src/insets/insetlof.[Ch]: ditto
1204 * src/insets/insetlot.[Ch]: ditto
1206 * src/frontends/xforms/forms/form_url.fd: tweaked!
1207 * src/frontends/xforms/forms/form_citation.fd: ditto
1209 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1210 dialogs dealing with InsetCommand insets
1212 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1213 FormCommand base class
1214 * src/frontends/xforms/FormUrl.[Ch]: ditto
1216 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1218 * src/frontends/xforms/FormToc.[Ch]: ditto
1220 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1221 passed a generic InsetCommand pointer
1222 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1224 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1225 and modified InsetTOC class
1226 * src/buffer.C: ditto
1228 * forms/lyx.fd: strip out old FD_form_toc code
1229 * src/lyx_gui_misc.C: ditto
1230 * src/lyx_gui.C: ditto
1231 * src/lyx_cb.C: ditto
1232 * src/lyx.[Ch]: ditto
1234 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1236 * src/support/utility.hpp: tr -d '\r'
1238 2000-08-01 Juergen Vigna <jug@sad.it>
1240 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1242 * src/commandtags.h:
1243 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1244 LFUN_TABULAR_FEATURES.
1246 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1247 LFUN_LAYOUT_TABULAR.
1249 * src/insets/insettabular.C (getStatus): implemented helper function.
1251 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1253 2000-07-31 Juergen Vigna <jug@sad.it>
1255 * src/text.C (draw): fixed screen update problem for text-insets.
1257 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1258 something changed probably this has to be added in various other
1261 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1263 2000-07-31 Baruch Even <baruch.even@writeme.com>
1265 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1266 templates to satisfy compaq cxx.
1269 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1271 * src/support/translator.h (equal_1st_in_pair::operator()): take
1272 const ref pair_type as arg.
1273 (equal_2nd_in_pair::operator()): ditto
1274 (Translator::~Translator): remove empty d-tor.
1276 * src/graphics/GraphicsCache.C: move include config.h to top, also
1277 put initialization of GraphicsCache::singleton here.
1278 (~GraphicsCache): move here
1279 (addFile): take const ref as arg
1282 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1284 * src/BufferView2.C (insertLyXFile): change te with/without header
1287 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1289 * src/frontends/xforms/FormGraphics.C (apply): add some
1290 static_cast. Not very nice, but required by compaq cxx.
1292 * src/frontends/xforms/RadioButtonGroup.h: include header
1293 <utility> instead of <pair.h>
1295 * src/insets/insetgraphicsParams.C: add using directive.
1296 (readResize): change return type to void.
1297 (readOrigin): ditto.
1299 * src/lyxfunc.C (getStatus): add missing break for build-program
1300 function; add test for Literate for export functions.
1302 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1303 entries in Options menu.
1305 2000-07-31 Baruch Even <baruch.even@writeme.com>
1307 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1308 protect against auto-allocation; release icon when needed.
1310 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1312 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1313 on usual typewriter.
1315 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1316 earlier czech.kmap), useful only for programming.
1318 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1320 * src/frontends/xforms/FormCitation.h: fix conditioning around
1323 2000-07-31 Juergen Vigna <jug@sad.it>
1325 * src/frontends/xforms/FormTabular.C (local_update): changed
1326 radio_linebreaks to radio_useparbox and added radio_useminipage.
1328 * src/tabular.C: made support for using minipages/parboxes.
1330 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1332 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1334 (descent): so the cursor is in the middle.
1335 (width): bit smaller box.
1337 * src/insets/insetgraphics.h: added display() function.
1339 2000-07-31 Baruch Even <baruch.even@writeme.com>
1341 * src/frontends/Dialogs.h: Added showGraphics signals.
1343 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1344 xforms form definition of the graphics dialog.
1346 * src/frontends/xforms/FormGraphics.h:
1347 * src/frontends/xforms/FormGraphics.C: Added files, the
1348 GUIndependent code of InsetGraphics
1350 * src/insets/insetgraphics.h:
1351 * src/insets/insetgraphics.C: Major writing to make it work.
1353 * src/insets/insetgraphicsParams.h:
1354 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1355 struct between InsetGraphics and GUI.
1357 * src/LaTeXFeatures.h:
1358 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1359 support for graphicx package.
1361 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1362 for the graphics inset.
1364 * src/support/translator.h: Added file, used in
1365 InsetGraphicsParams. this is a template to translate between two
1368 * src/frontends/xforms/RadioButtonGroup.h:
1369 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1370 way to easily control a radio button group.
1372 2000-07-28 Juergen Vigna <jug@sad.it>
1374 * src/insets/insettabular.C (LocalDispatch):
1375 (TabularFeatures): added support for lyx-functions of tabular features.
1376 (cellstart): refixed this function after someone wrongly changed it.
1378 * src/commandtags.h:
1379 * src/LyXAction.C (init): added support for tabular-features
1381 2000-07-28 Allan Rae <rae@lyx.org>
1383 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1384 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1385 triggers the callback for input checking. As a result we sometimes get
1386 "LyX: This shouldn't happen..." printed to cerr.
1387 (input): Started using status variable since I only free() on
1388 destruction. Some input checking for paths and font sizes.
1390 * src/frontends/xforms/FormPreferences.h: Use status to control
1391 activation of Ok and Apply
1393 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1394 callback. Also resized to stop segfaults with 0.88. The problem is
1395 that xforms-0.88 requires the folder to be wide enough to fit all the
1396 tabs. If it isn't it causes all sorts of problems.
1398 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1400 * src/frontends/xforms/forms/README: Reflect reality.
1402 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1403 * src/frontends/xforms/forms/makefile: ditto.
1405 * src/commandtags.h: Get access to new Preferences dialog
1406 * src/LyXAction.C: ditto
1407 * src/lyxfunc.C: ditto
1408 * lib/ui/default.ui: ditto
1410 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1412 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1414 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1417 * src/frontends/xforms/form_url.[Ch]: added.
1419 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1421 * src/insets/insetbib.h: fixed bug in previous commit
1423 * src/frontends/xforms/FormUrl.h: ditto
1425 * src/frontends/xforms/FormPrint.h: ditto
1427 * src/frontends/xforms/FormPreferences.h: ditto
1429 * src/frontends/xforms/FormCopyright.h: ditto
1431 * src/frontends/xforms/FormCitation.C: ditto
1433 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1434 private copyconstructor and private default contructor
1436 * src/support/Makefile.am: add utility.hpp
1438 * src/support/utility.hpp: new file from boost
1440 * src/insets/insetbib.h: set owner in clone
1442 * src/frontends/xforms/FormCitation.C: added missing include
1445 * src/insets/form_url.[Ch]: removed
1447 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1449 * development/lyx.spec.in
1450 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1451 file/directory re-organization.
1453 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1455 * src/insets/insetcommand.[Ch]: moved the string data and
1456 associated manipulation methods into a new stand-alone class
1457 InsetCommandParams. This class has two additional methods
1458 getAsString() and setFromString() allowing the contents to be
1459 moved around as a single string.
1460 (addContents) method removed.
1461 (setContents) method no longer virtual.
1463 * src/buffer.C (readInset): made use of new InsetCitation,
1464 InsetUrl constructors based on InsetCommandParams.
1466 * src/commandtags.h: add LFUN_INSERT_URL
1468 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1469 independent InsetUrl and use InsetCommandParams to extract
1470 string info and create new Insets.
1472 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1474 * src/frontends/xforms/FormCitation.C (apply): uses
1477 * src/frontends/xforms/form_url.C
1478 * src/frontends/xforms/form_url.h
1479 * src/frontends/xforms/FormUrl.h
1480 * src/frontends/xforms/FormUrl.C
1481 * src/frontends/xforms/forms/form_url.fd: new files
1483 * src/insets/insetcite.[Ch]: removed unused constructors.
1485 * src/insets/insetinclude.[Ch]: no longer store filename
1487 * src/insets/inseturl.[Ch]: GUI-independent.
1489 2000-07-26 Juergen Vigna <jug@sad.it>
1490 * renamed frontend from gtk to gnome as it is that what is realized
1491 and did the necessary changes in the files.
1493 2000-07-26 Marko Vendelin <markov@ioc.ee>
1495 * configure.in: cleaning up gnome configuration scripts
1497 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1499 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1500 shortcuts syndrom by redrawing them explicitely (a better solution
1501 would be appreciated).
1503 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1505 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1508 * src/lyx_cb.C (MenuExport): change html export to do the right
1509 thing depending of the document type (instead of having
1510 html-linuxdoc and html-docbook).
1511 * src/lyxfunc.C (getStatus): update for html
1512 * lib/ui/default.ui: simplify due to the above change.
1513 * src/menus.C (ShowFileMenu): update too (in case we need it).
1515 * src/MenuBackend.C (read): if a menu is defined twice, add the
1516 new entries to the exiting one.
1518 2000-07-26 Juergen Vigna <jug@sad.it>
1520 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1522 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1523 and return a bool if it did actual save the file.
1524 (AutoSave): don't autosave a unnamed doc.
1526 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1527 check if this is an UNNAMED new file and react to it.
1528 (newFile): set buffer to unnamed and change to not mark a new
1529 buffer dirty if I didn't do anything with it.
1531 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1533 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1535 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1536 friend as per Angus's patch posted to lyx-devel.
1538 * src/ext_l10n.h: updated
1540 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1541 gettext on the style string right before inserting them into the
1544 * autogen.sh: add code to extract style strings form layout files,
1545 not good enough yet.
1547 * src/frontends/gtk/.cvsignore: add MAKEFILE
1549 * src/MenuBackend.C (read): run the label strings through gettext
1550 before storing them in the containers.
1552 * src/ext_l10n.h: new file
1554 * autogen.sh : generate the ext_l10n.h file here
1556 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1558 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1561 * lib/ui/default.ui: fix a couple of typos.
1563 * config/gnome/gtk.m4: added (and added to the list of files in
1566 * src/insets/insetinclude.C (unique_id): fix when we are using
1567 lyxstring instead of basic_string<>.
1568 * src/insets/insettext.C (LocalDispatch): ditto.
1569 * src/support/filetools.C: ditto.
1571 * lib/configure.m4: create the ui/ directory if necessary.
1573 * src/LyXView.[Ch] (updateToolbar): new method.
1575 * src/BufferView_pimpl.C (buffer): update the toolbar when
1576 opening/closing buffer.
1578 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1580 * src/LyXAction.C (getActionName): enhance to return also the name
1581 and options of pseudo-actions.
1582 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1584 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1585 as an example of what is possible). Used in File->Build too (more
1586 useful) and in the import/export menus (to mimick the complicated
1587 handling of linuxdoc and friends). Try to update all the entries.
1589 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1592 * src/MenuBackend.C (read): Parse the new OptItem tag.
1594 * src/MenuBackend.h: Add a new optional_ data member (used if the
1595 entry should be omitted when the lyxfunc is disabled).
1597 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1598 function, used as a shortcut.
1599 (create_submenu): align correctly the shortcuts on the widest
1602 * src/MenuBackend.h: MenuItem.label() only returns the label of
1603 the menu without shortcut; new method shortcut().
1605 2000-07-14 Marko Vendelin <markov@ioc.ee>
1607 * src/frontends/gtk/Dialogs.C:
1608 * src/frontends/gtk/FormCopyright.C:
1609 * src/frontends/gtk/FormCopyright.h:
1610 * src/frontends/gtk/Makefile.am: added these source-files for the
1611 Gtk/Gnome support of the Copyright-Dialog.
1613 * src/main.C: added Gnome::Main initialization if using
1614 Gtk/Gnome frontend-GUI.
1616 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1618 * config/gnome/aclocal-include.m4
1619 * config/gnome/compiler-flags.m4
1620 * config/gnome/curses.m4
1621 * config/gnome/gnome--.m4
1622 * config/gnome/gnome-bonobo-check.m4
1623 * config/gnome/gnome-common.m4
1624 * config/gnome/gnome-fileutils.m4
1625 * config/gnome/gnome-ghttp-check.m4
1626 * config/gnome/gnome-gnorba-check.m4
1627 * config/gnome/gnome-guile-checks.m4
1628 * config/gnome/gnome-libgtop-check.m4
1629 * config/gnome/gnome-objc-checks.m4
1630 * config/gnome/gnome-orbit-check.m4
1631 * config/gnome/gnome-print-check.m4
1632 * config/gnome/gnome-pthread-check.m4
1633 * config/gnome/gnome-support.m4
1634 * config/gnome/gnome-undelfs.m4
1635 * config/gnome/gnome-vfs.m4
1636 * config/gnome/gnome-x-checks.m4
1637 * config/gnome/gnome-xml-check.m4
1638 * config/gnome/gnome.m4
1639 * config/gnome/gperf-check.m4
1640 * config/gnome/gtk--.m4
1641 * config/gnome/linger.m4
1642 * config/gnome/need-declaration.m4: added configuration scripts
1643 for Gtk/Gnome frontend-GUI
1645 * configure.in: added support for the --with-frontend=gtk option
1647 * autogen.sh: added config/gnome/* to list of config-files
1649 * acconfig.h: added define for GTKGUI-support
1651 * config/lyxinclude.m4: added --with-frontend[=value] option value
1652 for Gtk/Gnome frontend-GUI support.
1654 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1656 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1660 * src/paragraph.C (GetChar): remove non-const version
1662 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1663 (search_kw): use it.
1665 * src/lyx_main.C (init): if "preferences" exist, read that instead
1667 (ReadRcFile): return bool if the file could be read ok.
1668 (ReadUIFile): add a check to see if lex file is set ok.
1670 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1671 bastring can be used instead of lyxstring (still uses the old code
1672 if std::string is good enough or if lyxstring is used.)
1674 * src/encoding.C: make the arrays static, move ininle functions
1676 * src/encoding.h: from here.
1678 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1679 (parseSingleLyXformat2Token): move inset parsing to separate method
1680 (readInset): new private method
1682 * src/Variables.h: remove virtual from get().
1684 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1685 access to NEW_INSETS and NEW_TABULAR
1687 * src/MenuBackend.h: remove superfluous forward declaration of
1688 MenuItem. Add documentations tags "///", remove empty MenuItem
1689 destructor, remove private default contructor.
1691 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1693 (read): more string mlabel and mname to where they are used
1694 (read): remove unused variables mlabel and mname
1695 (defaults): unconditional clear, make menusetup take advantage of
1696 add returning Menu &.
1698 * src/LyXView.h: define NEW_MENUBAR as default
1700 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1701 to NEW_INSETS and NEW_TABULAR.
1702 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1703 defined. Change some of the "xxxx-inset-insert" functions names to
1706 * several files: more enahncements to NEW_INSETS and the resulting
1709 * lib/lyxrc.example (\date_insert_format): move to misc section
1711 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1712 bastring and use AC_CACHE_CHECK.
1713 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1714 the system have the newest methods. uses AC_CACHE_CHECK
1715 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1716 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1717 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1719 * configure.in: add LYX_CXX_GOOD_STD_STRING
1721 * acinclude.m4: recreated
1723 2000-07-24 Amir Karger
1725 * README: add Hebrew, Arabic kmaps
1728 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1730 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1733 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1735 * Lot of files: add pragma interface/implementation.
1737 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1739 * lib/ui/default.ui: new file (ans new directory). Contains the
1740 default menu and toolbar.
1742 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1743 global space. Toolbars are now read (as menus) in ui files.
1745 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1747 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1748 is disabled because the document is read-only. We want to have the
1749 toggle state of the function anyway.
1750 (getStatus): add code for LFUN_VC* functions (mimicking what is
1751 done in old-style menus)
1753 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1754 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1756 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1757 * src/BufferView_pimpl.C: ditto.
1758 * src/lyxfunc.C: ditto.
1760 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1761 default). This replaces old-style menus by new ones.
1763 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1764 MenuItem. Contain the data structure of a menu.
1766 * src/insets/insettext.C: use LyXView::setLayout instead of
1767 accessing directly the toolbar combox.
1768 * src/lyxfunc.C (Dispatch): ditto.
1770 * src/LyXView.C (setLayout): new method, which just calls
1771 Toolbar::setLayout().
1772 (updateLayoutChoice): move part of this method in Toolbar.
1774 * src/toolbar.[Ch]: removed.
1776 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1777 implementation the toolbar.
1779 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1780 the toolbar. It might make sense to merge it with ToolbarDefaults
1782 (setLayout): new function.
1783 (updateLayoutList): ditto.
1784 (openLayoutList): ditto.
1786 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1787 xforms implementation of the toolbar.
1788 (get_toolbar_func): comment out, since I do not
1789 know what it is good for.
1791 * src/ToolbarDefaults.h: Add the ItemType enum.
1793 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1794 for a list of allocated C strings. Used in Menubar xforms
1795 implementation to avoid memory leaks.
1797 * src/support/lstrings.[Ch] (uppercase): new version taking and
1801 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1802 * lib/bind/emacs.bind: ditto.
1804 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1806 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1807 forward decl of LyXView.
1809 * src/toolbar.C (toolbarItem): moved from toolbar.h
1810 (toolbarItem::clean): ditto
1811 (toolbarItem::~toolbarItem): ditto
1812 (toolbarItem::operator): ditto
1814 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1816 * src/paragraph.h: control the NEW_TABULAR define from here
1818 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1819 USE_TABULAR_INSETS to NEW_TABULAR
1821 * src/ToolbarDefaults.C: add include "lyxlex.h"
1823 * files using the old table/tabular: use NEW_TABULAR to control
1824 compilation of old tabular stuff.
1826 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1829 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1830 planemet in reading of old style floats, fix the \end_deeper
1831 problem when reading old style floats.
1833 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1835 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1837 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1839 * lib/bind/sciword.bind: updated.
1841 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1843 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1844 layout write problem
1846 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1848 * src/Makefile.am (INCLUDES): remove image directory from include
1851 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1852 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1854 * src/LyXView.C (create_form_form_main): read the application icon
1857 * lib/images/*.xpm: change the icons to use transparent color for
1860 * src/toolbar.C (update): change the color of the button when it
1863 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1865 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1866 setting explicitely the minibuffer.
1867 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1869 * src/LyXView.C (showState): new function. Shows font information
1870 in minibuffer and update toolbar state.
1871 (LyXView): call Toolbar::update after creating the
1874 * src/toolbar.C: change toollist to be a vector instead of a
1876 (BubbleTimerCB): get help string directly from the callback
1877 argument of the corresponding icon (which is the action)
1878 (set): remove unnecessary ugliness.
1879 (update): new function. update the icons (depressed, disabled)
1880 depending of the status of the corresponding action.
1882 * src/toolbar.h: remove help in toolbarItem
1884 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1886 * src/Painter.C (text): Added code for using symbol glyphs from
1887 iso10646 fonts. Currently diabled.
1889 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1892 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1893 magyar,turkish and usorbian.
1895 * src/paragraph.C (isMultiLingual): Made more efficient.
1897 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1900 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1901 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1902 Also changed the prototype to "bool math_insert_greek(char)".
1904 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1906 * lots of files: apply the NEW_INSETS on all code that will not be
1907 needed when we move to use the new insets. Enable the define in
1908 lyxparagrah.h to try it.
1910 * src/insets/insettabular.C (cellstart): change to be a static
1912 (InsetTabular): initialize buffer in the initializer list.
1914 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1916 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1917 form_print.h out of the header file. Replaced with forward
1918 declarations of the relevant struct.
1920 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1923 * src/commandtags.h: do not include "debug.h" which does not
1924 belong there. #include it in some other places because of this
1927 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1929 * src/insets/insetcaption.C: add a couple "using" directives.
1931 * src/toolbar.C (add): get the help text directly from lyxaction.
1933 (setPixmap): new function. Loads from disk and sets a pixmap on a
1934 botton; the name of the pixmap file is derived from the command
1937 * src/toolbar.h: remove members isBitmap and pixmap from
1940 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1941 * lib/images/: move many files from images/banner.xpm.
1943 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1945 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1946 * src/toolbar.C: ditto.
1947 * configure.in: ditto.
1948 * INSTALL: document.
1950 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1951 the spellchecker popup is closed from the WM.
1953 2000-07-19 Juergen Vigna <jug@sad.it>
1955 * src/insets/insetfloat.C (Write): small fix because we use the
1956 insetname for the type now!
1958 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1960 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1963 * src/frontends/Dialogs.h: removed hideCitation signal
1965 * src/insets/insetcite.h: added hide signal
1967 * src/insets/insetcite.C (~InsetCitation): emits new signal
1968 (getScreenLabel): "intelligent" label should now fit on the screen!
1970 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1972 * src/frontends/xforms/FormCitation.C (showInset): connects
1973 hide() to the inset's hide signal
1974 (show): modified to use fl_set_object_position rather than
1975 fl_set_object_geometry wherever possible
1977 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1979 * src/insets/lyxinset.h: add caption code
1981 * src/insets/insetfloat.C (type): new method
1983 * src/insets/insetcaption.C (Write): new method
1985 (LyxCode): new method
1987 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1988 to get it right together with using the FloatList.
1990 * src/commandtags.h: add LFUN_INSET_CAPTION
1991 * src/lyxfunc.C (Dispatch): handle it
1993 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1996 * src/Variables.[Ch]: make expand take a const reference, remove
1997 the destructor, some whitespace changes.
1999 * src/LyXAction.C (init): add caption-inset-insert
2001 * src/FloatList.C (FloatList): update the default floats a bit.
2003 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2005 * src/Variables.[Ch]: new files. Intended to be used for language
2006 specific strings (like \chaptername) and filename substitution in
2009 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2011 * lib/kbd/american.kmap: update
2013 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2015 * src/bufferparams.[Ch]: remove member allowAccents.
2017 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2019 * src/LaTeXLog.C: use the log_form.h header.
2020 * src/lyx_gui.C: ditto.
2021 * src/lyx_gui_misc.C: ditto.
2022 * src/lyxvc.h: ditto.
2024 * forms/log_form.fd: new file, created from latexoptions.fd. I
2025 kept the log popup and nuked the options form.
2027 * src/{la,}texoptions.[Ch]: removed.
2028 * src/lyx_cb.C (LaTeXOptions): ditto
2030 * src/lyx_gui.C (create_forms): do not handle the
2031 fd_latex_options form.
2033 2000-07-18 Juergen Vigna <jug@sad.it>
2035 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2036 name of the inset so that it can be requested outside (text2.C).
2038 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2041 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2043 * src/mathed/formula.h (ConvertFont): constify
2045 * src/mathed/formula.C (Read): add warning if \end_inset is not
2046 found on expected place.
2048 * src/insets/lyxinset.h (ConvertFont): consify
2050 * src/insets/insetquotes.C (ConvertFont): constify
2051 * src/insets/insetquotes.h: ditto
2053 * src/insets/insetinfo.h: add labelfont
2055 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2056 (ascent): use labelfont
2060 (Write): make .lyx file a bit nicer
2062 * src/insets/insetfloat.C (Write): simplify somewhat...
2063 (Read): add warning if arg is not found
2065 * src/insets/insetcollapsable.C: add using std::max
2066 (Read): move string token and add warning in arg is not found
2067 (draw): use std::max to get the right ty
2068 (getMaxWidth): simplify by using std::max
2070 * src/insets/insetsection.h: new file
2071 * src/insets/insetsection.C: new file
2072 * src/insets/insetcaption.h: new file
2073 * src/insets/insetcaption.C: new file
2075 * src/insets/inset.C (ConvertFont): constify signature
2077 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2078 insetcaption.[Ch] and insetsection.[Ch]
2080 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2081 uses to use LABEL_COUNTER_CHAPTER instead.
2082 * src/text2.C (SetCounter): here
2084 * src/counters.h: new file
2085 * src/counters.C: new file
2086 * src/Sectioning.h: new file
2087 * src/Sectioning.C: new file
2089 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2091 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2093 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2096 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2099 2000-07-17 Juergen Vigna <jug@sad.it>
2101 * src/tabular.C (Validate): check if array-package is needed.
2102 (SetVAlignment): added support for vertical alignment.
2103 (SetLTFoot): better support for longtable header/footers
2104 (Latex): modified to support added features.
2106 * src/LaTeXFeatures.[Ch]: added array-package.
2108 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2110 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2113 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2115 * configure.in: do not forget to put a space after -isystem.
2117 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2119 * lib/kbd/arabic.kmap: a few fixes.
2121 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2123 * some whitespace chagnes to a number of files.
2125 * src/support/DebugStream.h: change to make it easier for
2126 doc++ to parse correctly.
2127 * src/support/lyxstring.h: ditto
2129 * src/mathed/math_utils.C (compara): change to have only one
2131 (MathedLookupBOP): change because of the above.
2133 * src/mathed/math_delim.C (math_deco_compare): change to have only
2135 (search_deco): change becasue of the above.
2137 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2138 instead of manually coded one.
2140 * src/insets/insetquotes.C (Read): read the \end_inset too
2142 * src/insets/insetlatex.h: remove file
2143 * src/insets/insetlatex.C: remove file
2145 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2147 (InsetPrintIndex): remove destructor
2149 * src/insets/insetinclude.h: remove default constructor
2151 * src/insets/insetfloat.C: work to make it work better
2153 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2155 * src/insets/insetcite.h (InsetCitation): remove default constructor
2157 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2159 * src/text.C (GetColumnNearX): comment out some currently unused code.
2161 * src/paragraph.C (writeFile): move some initializations closer to
2163 (CutIntoMinibuffer): small change to use new matchIT operator
2167 (InsertInset): ditto
2170 (InsetIterator): ditto
2171 (Erase): small change to use new matchFT operator
2173 (GetFontSettings): ditto
2174 (HighestFontInRange): ditto
2177 * src/lyxparagraph.h: some chars changed to value_type
2178 (matchIT): because of some stronger checking (perhaps too strong)
2179 in SGI STL, the two operator() unified to one.
2182 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2184 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2185 the last inset read added
2186 (parseSingleLyXformat2Token): some more (future) compability code added
2187 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2188 (parseSingleLyXformat2Token): set last_inset_read
2189 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2190 (parseSingleLyXformat2Token): don't double intializw string next_token
2192 * src/TextCache.C (text_fits::operator()): add const's to the signature
2193 (has_buffer::operator()): ditto
2195 * src/Floating.h: add some comments on the class
2197 * src/FloatList.[Ch] (typeExist): new method
2200 * src/BackStack.h: added default constructor, wanted by Gcc.
2202 2000-07-14 Juergen Vigna <jug@sad.it>
2204 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2206 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2208 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2209 do a redraw when the window is resized!
2210 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2212 * src/insets/insettext.C (resizeLyXText): added function to correctly
2213 being able to resize the LyXWindow.
2215 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2217 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2219 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2220 crashes when closing dialog to a deleted inset.
2222 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2223 method! Now similar to other insets.
2225 2000-07-13 Juergen Vigna <jug@sad.it>
2227 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2229 * lib/examples/Literate.lyx: small patch!
2231 * src/insets/insetbib.C (Read): added this function because of wrong
2232 Write (without [begin|end]_inset).
2234 2000-07-11 Juergen Vigna <jug@sad.it>
2236 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2237 as the insertInset could not be good!
2239 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2240 the bool param should not be last.
2242 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2244 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2245 did submit that to Karl).
2247 * configure.in: use -isystem instead of -I for X headers. This
2248 fixes a problem on solaris with a recent gcc;
2249 put the front-end code after the X detection code;
2250 configure in sigc++ before lib/
2252 * src/lyx_main.C (commandLineHelp): remove -display from command
2255 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2257 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2258 Also put in Makefile rules for building the ``listerrors''
2259 program for parsing errors from literate programs written in LyX.
2261 * lib/build-listerrors: Added small shell script as part of compile
2262 process. This builds a working ``listerrors'' binary if noweb is
2263 installed and either 1) the VNC X server is installed on the machine,
2264 or 2) the user is compiling from within a GUI. The existence of a GUI
2265 is necessary to use the ``lyx --export'' feature for now. This
2266 hack can be removed once ``lyx --export'' no longer requires a GUI to
2269 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2271 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2272 now passed back correctly from gcc and placed "under" error
2273 buttons in a Literate LyX source.
2275 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2277 * src/text.C (GetColumnNearX): Better behavior when a RTL
2278 paragraph is ended by LTR text.
2280 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2283 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2285 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2286 true when clipboard is empty.
2288 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2290 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2291 row of the paragraph.
2292 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2293 to prevent calculation of bidi tables
2295 2000-07-07 Juergen Vigna <jug@sad.it>
2297 * src/screen.C (ToggleSelection): added y_offset and x_offset
2300 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2303 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2305 * src/insets/insettext.C: fixed Layout-Display!
2307 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2309 * configure.in: add check for strings.h header.
2311 * src/spellchecker.C: include <strings.h> in order to have a
2312 definition for bzero().
2314 2000-07-07 Juergen Vigna <jug@sad.it>
2316 * src/insets/insettext.C (draw): set the status of the bv->text to
2317 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2319 * src/screen.C (DrawOneRow):
2320 (DrawFromTo): redraw the actual row if something has changed in it
2323 * src/text.C (draw): call an update of the toplevel-inset if something
2324 has changed inside while drawing.
2326 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2328 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2330 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2331 processing inside class.
2333 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2334 processing inside class.
2336 * src/insets/insetindex.h new struct Holder, consistent with other
2339 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2340 citation dialog from main code and placed it in src/frontends/xforms.
2341 Dialog launched through signals instead of callbacks
2343 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2345 * lyx.man: update the options description.
2347 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2349 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2350 handle neg values, set min width to 590, add doc about -display
2352 2000-07-05 Juergen Vigna <jug@sad.it>
2354 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2355 calls to BufferView *.
2357 * src/insets/insettext.C (checkAndActivateInset): small fix non
2358 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2360 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2361 their \end_inset token!
2363 2000-07-04 edscott <edscott@imp.mx>
2365 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2366 lib/lyxrc.example: added option \wheel_jump
2368 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2370 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2371 remove support for -width,-height,-xpos and -ypos.
2373 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2375 * src/encoding.[Ch]: New files.
2377 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2378 (text): Call to the underline() method only when needed.
2380 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2382 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2383 encoding(s) for the document.
2385 * src/bufferparams.C (BufferParams): Changed default value of
2388 * src/language.C (newLang): Removed.
2389 (items[]): Added encoding information for all defined languages.
2391 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2392 encoding choice button.
2394 * src/lyxrc.h (font_norm_type): New member variable.
2395 (set_font_norm_type): New method.
2397 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2398 paragraphs with different encodings.
2400 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2401 (TransformChar): Changed to work correctly with Arabic points.
2402 (draw): Added support for drawing Arabic points.
2403 (draw): Removed code for drawing underbars (this is done by
2406 * src/support/textutils.h (IsPrintableNonspace): New function.
2408 * src/BufferView_pimpl.h: Added "using SigC::Object".
2409 * src/LyXView.h: ditto.
2411 * src/insets/insetinclude.h (include_label): Changed to mutable.
2413 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2415 * src/mathed/math_iter.h: remove empty destructor
2417 * src/mathed/math_cursor.h: remove empty destructor
2419 * src/insets/lyxinset.h: add THEOREM_CODE
2421 * src/insets/insettheorem.[Ch]: new files
2423 * src/insets/insetminipage.C: (InsertInset): remove
2425 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2427 (InsertInset): remove
2429 * src/insets/insetlist.C: (InsertList): remove
2431 * src/insets/insetfootlike.[Ch]: new files
2433 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2436 (InsertInset): ditto
2438 * src/insets/insetert.C: remove include Painter.h, reindent
2439 (InsertInset): move to header
2441 * src/insets/insetcollapsable.h: remove explicit from default
2442 contructor, remove empty destructor, add InsertInset
2444 * src/insets/insetcollapsable.C (InsertInset): new func
2446 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2448 * src/vspace.h: add explicit to constructor
2450 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2451 \textcompwordmark, please test this.
2453 * src/lyxrc.C: set ascii_linelen to 65 by default
2455 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2457 * src/commandtags.h: add LFUN_INSET_THEOREM
2459 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2460 (makeLinuxDocFile): remove _some_ of the nice logic
2461 (makeDocBookFile): ditto
2463 * src/Painter.[Ch]: (~Painter): removed
2465 * src/LyXAction.C (init): entry for insettheorem added
2467 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2469 (deplog): code to detect files generated by LaTeX, needs testing
2472 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2474 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2476 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2478 * src/LaTeX.C (deplog): Add a check for files that are going to be
2479 created by the first latex run, part of the project to remove the
2482 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2483 contents to the extension list.
2485 2000-07-04 Juergen Vigna <jug@sad.it>
2487 * src/text.C (NextBreakPoint): added support for needFullRow()
2489 * src/insets/lyxinset.h: added needFullRow()
2491 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2494 * src/insets/insettext.C: lots of changes for update!
2496 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2498 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2500 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2502 * src/insets/insetinclude.C (InsetInclude): fixed
2503 initialization of include_label.
2504 (unique_id): now returns a string.
2506 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2508 * src/LaTeXFeatures.h: new member IncludedFiles, for
2509 a map of key, included file name.
2511 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2512 with the included files for inclusion in SGML preamble,
2513 i. e., linuxdoc and docbook.
2516 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2517 nice (is the generated linuxdoc code to be exported?), that
2518 allows to remove column, and only_body that will be true for
2519 slave documents. Insets are allowed inside SGML font type.
2520 New handling of the SGML preamble for included files.
2521 (makeDocBookFile): the same for docbook.
2523 * src/insets/insetinclude.h:
2524 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2526 (DocBook): new export methods.
2528 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2529 and makeDocBookFile.
2531 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2532 formats to export with command line argument -x.
2534 2000-06-29 Juergen Vigna <jug@sad.it>
2536 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2537 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2539 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2540 region could already been cleared by an inset!
2542 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2544 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2547 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2549 (cursorToggle): remove special handling of lyx focus.
2551 2000-06-28 Juergen Vigna <jug@sad.it>
2553 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2556 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2558 * src/insets/insetindex.C (Edit): add a callback when popup is
2561 * src/insets/insettext.C (LocalDispatch):
2562 * src/insets/insetmarginal.h:
2563 * src/insets/insetlist.h:
2564 * src/insets/insetfoot.h:
2565 * src/insets/insetfloat.h:
2566 * src/insets/insetert.h: add a missing std:: qualifier.
2568 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2570 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2573 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2575 * src/insets/insettext.C (Read): remove tmptok unused variable
2576 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2577 (InsertInset): change for new InsetInset code
2579 * src/insets/insettext.h: add TEXT inline method
2581 * src/insets/insettext.C: remove TEXT macro
2583 * src/insets/insetmarginal.C (Write): new method
2584 (Latex): change output slightly
2586 * src/insets/insetfoot.C (Write): new method
2587 (Latex): change output slightly (don't use endl when no need)
2589 * src/insets/insetert.C (Write): new method
2591 * src/insets/insetcollapsable.h: make button_length, button_top_y
2592 and button_bottm_y protected.
2594 * src/insets/insetcollapsable.C (Write): simplify code by using
2595 tostr. Also do not output the float name, the children class
2596 should to that to get control over own arguments
2598 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2599 src/insets/insetminipage.[Ch]:
2602 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2604 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2606 * src/Makefile.am (lyx_SOURCES): add the new files
2608 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2609 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2610 * src/commandtags.h: ditto
2612 * src/LaTeXFeatures.h: add a std::set of used floattypes
2614 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2616 * src/FloatList.[Ch] src/Floating.h: new files
2618 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2620 * src/lyx_cb.C (TableApplyCB): ditto
2622 * src/text2.C: ditto
2623 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2624 (parseSingleLyXformat2Token): ditto + add code for
2625 backwards compability for old float styles + add code for new insets
2627 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2629 (InsertInset(size_type, Inset *, LyXFont)): new method
2630 (InsetChar(size_type, char)): changed to use the other InsetChar
2631 with a LyXFont(ALL_INHERIT).
2632 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2633 insert the META_INSET.
2635 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2637 * sigc++/thread.h (Threads): from here
2639 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2640 definition out of line
2641 * sigc++/scope.h: from here
2643 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2645 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2646 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2648 * Makefile.am (bindist): new target.
2650 * INSTALL: add instructions for doing a binary distribution.
2652 * development/tools/README.bin.example: update a bit.
2654 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2657 * lib/lyxrc.example: new lyxrc tag \set_color.
2659 * src/lyxfunc.C (Dispatch):
2660 * src/commandtags.h:
2661 * src/LyXAction.C: new lyxfunc "set-color".
2663 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2664 and an x11name given as strings.
2666 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2667 cache when a color is changed.
2669 2000-06-26 Juergen Vigna <jug@sad.it>
2671 * src/lyxrow.C (width): added this functions and variable.
2673 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2676 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2678 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2680 * images/undo_bw.xpm: new icon.
2681 * images/redo_bw.xpm: ditto.
2683 * configure.in (INSTALL_SCRIPT): change value to
2684 ${INSTALL} to avoid failures of install-script target.
2685 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2687 * src/BufferView.h: add a magic "friend" declaration to please
2690 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2692 * forms/cite.fd: modified to allow resizing without messing
2695 * src/insetcite.C: Uses code from cite.fd almost without
2697 User can now resize dialog in the x-direction.
2698 Resizing the dialog in the y-direction is prevented, as the
2699 code does this intelligently already.
2701 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2703 * INSTALL: remove obsolete entry in "problems" section.
2705 * lib/examples/sl_*.lyx: update of the slovenian examples.
2707 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2709 2000-06-23 Juergen Vigna <jug@sad.it>
2711 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2713 * src/buffer.C (resize): delete the LyXText of textinsets.
2715 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2717 * src/insets/lyxinset.h: added another parameter 'cleared' to
2718 the draw() function.
2720 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2721 unlocking inset in inset.
2723 2000-06-22 Juergen Vigna <jug@sad.it>
2725 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2726 of insets and moved first to LyXText.
2728 * src/mathed/formulamacro.[Ch]:
2729 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2731 2000-06-21 Juergen Vigna <jug@sad.it>
2733 * src/text.C (GetVisibleRow): look if I should clear the area or not
2734 using Inset::doClearArea() function.
2736 * src/insets/lyxinset.h: added doClearArea() function and
2737 modified draw(Painter &, ...) to draw(BufferView *, ...)
2739 * src/text2.C (UpdateInset): return bool insted of int
2741 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2743 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2744 combox in the character popup
2746 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2747 BufferParams const & params
2749 2000-06-20 Juergen Vigna <jug@sad.it>
2751 * src/insets/insettext.C (SetParagraphData): set insetowner on
2754 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2756 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2757 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2759 (form_main_): remove
2761 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2762 (create_form_form_main): remove FD_form_main stuff, connect to
2763 autosave_timeout signal
2765 * src/LyXView.[Ch] (getMainForm): remove
2766 (UpdateTimerCB): remove
2767 * src/BufferView_pimpl.h: inherit from SigC::Object
2769 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2770 signal instead of callback
2772 * src/BufferView.[Ch] (cursorToggleCB): remove
2774 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2776 * src/BufferView_pimpl.C: changes because of the one below
2778 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2779 instead of storing a pointer to a LyXText.
2781 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2783 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2785 * src/lyxparagraph.h
2787 * src/paragraph.C: Changed fontlist to a sorted vector.
2789 2000-06-19 Juergen Vigna <jug@sad.it>
2791 * src/BufferView.h: added screen() function.
2793 * src/insets/insettext.C (LocalDispatch): some selection code
2796 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2798 * src/insets/insettext.C (SetParagraphData):
2800 (InsetText): fixes for multiple paragraphs.
2802 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2804 * development/lyx.spec.in: Call configure with ``--without-warnings''
2805 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2806 This should be fine, however, since we generally don't want to be
2807 verbose when making an RPM.
2809 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2811 * lib/scripts/fig2pstex.py: New file
2813 2000-06-16 Juergen Vigna <jug@sad.it>
2815 * src/insets/insettabular.C (UpdateLocal):
2816 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2817 (LocalDispatch): Changed all functions to use LyXText.
2819 2000-06-15 Juergen Vigna <jug@sad.it>
2821 * src/text.C (SetHeightOfRow): call inset::update before requesting
2824 * src/insets/insettext.C (update):
2825 * src/insets/insettabular.C (update): added implementation
2827 * src/insets/lyxinset.h: added update function
2829 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2831 * src/text.C (SelectNextWord): protect against null pointers with
2832 old-style string streams. (fix from Paul Theo Gonciari
2835 * src/cite.[Ch]: remove erroneous files.
2837 * lib/configure.m4: update the list of created directories.
2839 * src/lyxrow.C: include <config.h>
2840 * src/lyxcursor.C: ditto.
2842 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2844 * lib/examples/decimal.lyx: new example file from Mike.
2846 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2847 to find template definitions (from Dekel)
2849 * src/frontends/.cvsignore: add a few things.
2851 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2853 * src/Timeout.C (TimeOut): remove default argument.
2855 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2858 * src/insets/ExternalTemplate.C: add a "using" directive.
2860 * src/lyx_main.h: remove the act_ struct, which seems unused
2863 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2865 * LyX Developers Meeting: All files changed, due to random C++ (by
2866 coincidence) code generator script.
2868 - external inset (cool!)
2869 - initial online editing of preferences
2870 - insettabular breaks insettext(s contents)
2872 - some DocBook fixes
2873 - example files update
2874 - other cool stuff, create a diff and look for yourself.
2876 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2878 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2879 -1 this is a non-line-breaking textinset.
2881 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2882 if there is no width set.
2884 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2886 * Lots of files: Merged the dialogbase branch.
2888 2000-06-09 Allan Rae <rae@lyx.org>
2890 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2891 and the Dispatch methods that used it.
2893 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2894 access to functions formerly kept in Dispatch.
2896 2000-05-19 Allan Rae <rae@lyx.org>
2898 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2899 made to_page and count_copies integers again. from_page remains a
2900 string however because I want to allow entry of a print range like
2901 "1,4,22-25" using this field.
2903 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2904 and printer-params-get. These aren't useful from the minibuffer but
2905 could be used by a script/LyXServer app provided it passes a suitable
2906 auto_mem_buffer. I guess I should take a look at how the LyXServer
2907 works and make it support xtl buffers.
2909 * sigc++/: updated to libsigc++-1.0.1
2911 * src/xtl/: updated to xtl-1.3.pl.11
2913 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2914 those changes done to the files in src/ are actually recreated when
2915 they get regenerated. Please don't ever accept a patch that changes a
2916 dialog unless that patch includes the changes to the corresponding *.fd
2919 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2920 stringOnlyContains, renamed it and generalised it.
2922 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2923 branch. Removed the remaining old form_print code.
2925 2000-04-26 Allan Rae <rae@lyx.org>
2927 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2928 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2930 2000-04-25 Allan Rae <rae@lyx.org>
2932 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2933 against a base of xtl-1.3.pl.4
2935 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2936 filter the Id: entries so they still show the xtl version number
2939 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2940 into the src/xtl code. Patch still pending with José (XTL)
2942 2000-04-24 Allan Rae <rae@lyx.org>
2944 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2945 both more generic and much safer. Use the new template functions.
2946 * src/buffer.[Ch] (Dispatch): ditto.
2948 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2949 and mem buffer more intelligently. Also a little general cleanup.
2952 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2953 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2954 * src/xtl/Makefile.am: ditto.
2955 * src/xtl/.cvsignore: ditto.
2956 * src/Makefile.am: ditto.
2958 * src/PrinterParams.h: Removed the macros member functions. Added a
2959 testInvariant member function. A bit of tidying up and commenting.
2960 Included Angus's idea for fixing operation with egcs-1.1.2.
2962 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2963 cool expansion of XTL's mem_buffer to support automatic memory
2964 management within the buffer itself. Removed the various macros and
2965 replaced them with template functions that use either auto_mem_buffer
2966 or mem_buffer depending on a #define. The mem_buffer support will
2967 disappear as soon as the auto_mem_buffer is confirmed to be good on
2968 other platforms/compilers. That is, it's there so you've got something
2971 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2972 effectively forked XTL. However I expect José will include my code
2973 into the next major release. Also fixed a memory leak.
2974 * src/xtl/text.h: ditto.
2975 * src/xtl/xdr.h: ditto.
2976 * src/xtl/giop.h: ditto.
2978 2000-04-16 Allan Rae <rae@lyx.org>
2980 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2981 by autogen.sh and removed by maintainer-clean anyway.
2982 * .cvsignore, sigc++/.cvsignore: Support the above.
2984 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2986 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2988 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2989 macros, renamed static callback-target member functions to suit new
2990 scheme and made them public.
2991 * src/frontends/xforms/forms/form_print.fd: ditto.
2992 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2994 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2997 * src/xtl/: New directory containing a minimal distribution of XTL.
2998 This is XTL-1.3.pl.4.
3000 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3002 2000-04-15 Allan Rae <rae@lyx.org>
3004 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3006 * sigc++/: Updated to libsigc++-1.0.0
3008 2000-04-14 Allan Rae <rae@lyx.org>
3010 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3011 use the generic ones in future. I'll modify my conversion script.
3013 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3015 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3016 (CloseAllBufferRelatedDialogs): Renamed.
3017 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3019 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3020 of the generic ones. These are the same ones my conversion script
3023 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3024 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3025 * src/buffer.C (Dispatch): ditto
3027 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3028 functions for updating and hiding buffer dependent dialogs.
3029 * src/BufferView.C (buffer): ditto
3030 * src/buffer.C (setReadonly): ditto
3031 * src/lyxfunc.C (CloseBuffer): ditto
3033 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3034 Dialogs.h, and hence all the SigC stuff, into every file that includes
3035 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3037 * src/BufferView2.C: reduce the number of headers included by buffer.h
3039 2000-04-11 Allan Rae <rae@lyx.org>
3041 * src/frontends/xforms/xform_macros.h: A small collection of macros
3042 for building C callbacks.
3044 * src/frontends/xforms/Makefile.am: Added above file.
3046 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3047 scheme again. This time it should work for JMarc. If this is
3048 successful I'll revise my conversion script to automate some of this.
3049 The static member functions in the class also have to be public for
3050 this scheme will work. If the scheme works (it's almost identical to
3051 the way BufferView::cursorToggleCB is handled so it should work) then
3052 FormCopyright and FormPrint will be ready for inclusion into the main
3053 trunk immediately after 1.1.5 is released -- provided we're prepared
3054 for complaints about lame compilers not handling XTL.
3056 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3058 2000-04-07 Allan Rae <rae@lyx.org>
3060 * config/lyxinclude.m4: A bit more tidying up (Angus)
3062 * src/LString.h: JMarc's <string> header fix
3064 * src/PrinterParams.h: Used string for most data to remove some
3065 ugly code in the Print dialog and avoid even uglier code when
3066 appending the ints to a string for output.
3068 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3069 and moved "default:" back to the end of switch statement. Cleaned
3070 up the printing so it uses the right function calls and so the
3071 "print to file" option actually puts the file in the right directory.
3073 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3075 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3076 and Ok+Apply button control into a separate method: input (Angus).
3077 (input) Cleaned it up and improved it to be very thorough now.
3078 (All CB) static_cast used instead of C style cast (Angus). This will
3079 probably change again once we've worked out how to keep gcc-2.8.1 happy
3080 with real C callbacks.
3081 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3082 ignore some of the bool settings and has random numbers instead. Needs
3083 some more investigation. Added other input length checks and checking
3084 of file and printer names.
3086 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3087 would link (Angus). Seems the old code doesn't compile with the pragma
3088 statement either. Separated callback entries from internal methods.
3090 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3092 2000-03-17 Allan Rae <rae@lyx.org>
3094 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3095 need it? Maybe it could go in Dialogs instead? I could make it a
3096 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3097 values to get the bool return value.
3098 (Dispatch): New overloaded method for xtl support.
3100 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3101 extern "C" callback instead of static member functions. Hopefully,
3102 JMarc will be able to compile this. I haven't changed
3103 forms/form_copyright.fd yet. Breaking one of my own rules already.
3105 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3106 because they aren't useful from the minibuffer. Maybe a LyXServer
3107 might want a help message though?
3109 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3111 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3112 xtl which needs both rtti and exceptions.
3114 * src/support/Makefile.am:
3115 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3117 * src/frontends/xforms/input_validators.[ch]: input filters and
3118 validators. These conrol what keys are valid in input boxes.
3119 Use them and write some more. Much better idea than waiting till
3120 after the user has pressed Ok to say that the input fields don't make
3123 * src/frontends/xforms/Makefile.am:
3124 * src/frontends/xforms/forms/form_print.fd:
3125 * src/frontends/xforms/forms/makefile:
3126 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3127 new scheme. Still have to make sure I haven't missed anything from
3128 the current implementation.
3130 * src/Makefile.am, src/PrinterParams.h: New data store.
3132 * other files: Added a couple of copyright notices.
3134 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3136 * src/insets/insetbib.h: move Holder struct in public space.
3138 * src/frontends/include/DialogBase.h: use SigC:: only when
3139 SIGC_CXX_NAMESPACES is defined.
3140 * src/frontends/include/Dialogs.h: ditto.
3142 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3144 * src/frontends/xforms/FormCopyright.[Ch]: do not
3145 mention SigC:: explicitely.
3147 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3149 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3150 deals with testing KDE in main configure.in
3151 * configure.in: ditto.
3153 2000-02-22 Allan Rae <rae@lyx.org>
3155 * Lots of files: Merged from HEAD
3157 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3158 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3160 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3162 * sigc++/: new minidist.
3164 2000-02-14 Allan Rae <rae@lyx.org>
3166 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3168 2000-02-08 Juergen Vigna <jug@sad.it>
3170 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3171 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3173 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3174 for this port and so it is much easier for other people to port
3175 dialogs in a common development environment.
3177 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3178 the QT/KDE implementation.
3180 * src/frontends/kde/Dialogs.C:
3181 * src/frontends/kde/FormCopyright.C:
3182 * src/frontends/kde/FormCopyright.h:
3183 * src/frontends/kde/Makefile.am:
3184 * src/frontends/kde/formcopyrightdialog.C:
3185 * src/frontends/kde/formcopyrightdialog.h:
3186 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3187 for the kde support of the Copyright-Dialog.
3189 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3190 subdir-substitution instead of hardcoded 'xforms' as we now have also
3193 * src/frontends/include/DialogBase.h (Object): just commented the
3194 label after #endif (nasty warning and I don't like warnings ;)
3196 * src/main.C (main): added KApplication initialization if using
3199 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3200 For now only the KDE event-loop is added if frontend==kde.
3202 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3204 * configure.in: added support for the --with-frontend[=value] option
3206 * autogen.sh: added kde.m4 file to list of config-files
3208 * acconfig.h: added define for KDEGUI-support
3210 * config/kde.m4: added configuration functions for KDE-port
3212 * config/lyxinclude.m4: added --with-frontend[=value] option with
3213 support for xforms and KDE.
3215 2000-02-08 Allan Rae <rae@lyx.org>
3217 * all Makefile.am: Fixed up so the make targets dist, distclean,
3218 install and uninstall all work even if builddir != srcdir. Still
3219 have a new sigc++ minidist update to come.
3221 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3223 2000-02-01 Allan Rae <rae@lyx.org>
3225 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3226 Many mods to get builddir != srcdir working.
3228 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3229 for building on NT and so we can do the builddir != srcdir stuff.
3231 2000-01-30 Allan Rae <rae@lyx.org>
3233 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3234 This will stay in "rae" branch. We probably don't really need it in
3235 the main trunk as anyone who wants to help programming it should get
3236 a full library installed also. So they can check both included and
3237 system supplied library compilation.
3239 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3240 Added a 'mini' distribution of libsigc++. If you feel the urge to
3241 change something in these directories - Resist it. If you can't
3242 resist the urge then you should modify the following script and rebuild
3243 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3244 all happen. Still uses a hacked version of libsigc++'s configure.in.
3245 I'm quite happy with the results. I'm not sure the extra work to turn
3246 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3247 worth the trouble and would probably lead to extra maintenance
3249 I haven't tested the following important make targets: install, dist.
3250 Not ready for prime time but very close. Maybe 1.1.5.
3252 * development/tools/makeLyXsigc.sh: A shell script to automatically
3253 generate our mini-dist of libsigc++. It can only be used with a CVS
3254 checkout of libsigc++ not a tarball distribution. It's well commented.
3255 This will end up as part of the libsigc++ distribution so other apps
3256 can easily have an included mini-dist. If someone makes mods to the
3257 sigc++ subpackage without modifying this script to generate those
3258 changes I'll be very upset!
3260 * src/frontends/: Started the gui/system indep structure.
3262 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3263 to access the gui-indep dialogs are in this class. Much improved
3264 design compared to previous revision. Lars, please refrain from
3265 moving this header into src/ like you did with Popups.h last time.
3267 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3269 * src/frontends/xforms/: Started the gui-indep system with a single
3270 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3273 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3274 Here you'll find a very useful makefile and automated fdfix.sh that
3275 makes updating dailogs a no-brainer -- provided you follow the rules
3276 set out in the README. I'm thinking about adding another script to
3277 automatically generate skeleton code for a new dialog given just the
3280 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3281 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3282 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3284 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3286 * src/support/LSubstring.C (operator): simplify
3288 * src/lyxtext.h: removed bparams, use buffer_->params instead
3290 * src/lyxrow.h: make Row a real class, move all variables to
3291 private and use accessors.
3293 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3295 (isRightToLeftPar): ditto
3296 (ChangeLanguage): ditto
3297 (isMultiLingual): ditto
3300 (SimpleTeXOnePar): ditto
3301 (TeXEnvironment): ditto
3302 (GetEndLabel): ditto
3304 (SetOnlyLayout): ditto
3305 (BreakParagraph): ditto
3306 (BreakParagraphConservative): ditto
3307 (GetFontSettings): ditto
3309 (CopyIntoMinibuffer): ditto
3310 (CutIntoMinibuffer): ditto
3311 (PasteParagraph): ditto
3312 (SetPExtraType): ditto
3313 (UnsetPExtraType): ditto
3314 (DocBookContTableRows): ditto
3315 (SimpleDocBookOneTablePar): ditto
3317 (TeXFootnote): ditto
3318 (SimpleTeXOneTablePar): ditto
3319 (TeXContTableRows): ditto
3320 (SimpleTeXSpecialChars): ditto
3323 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3324 to private and use accessors.
3326 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3327 this, we did not use it anymore and has not been for ages. Just a
3328 waste of cpu cycles.
3330 * src/language.h: make Language a real class, move all variables
3331 to private and use accessors.
3333 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3334 (create_view): remove
3335 (update): some changes for new timer
3336 (cursorToggle): use new timer
3337 (beforeChange): change for new timer
3339 * src/BufferView.h (cursorToggleCB): removed last paramter because
3342 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3343 (cursorToggleCB): change because of new timer code
3345 * lib/CREDITS: updated own mailaddress
3347 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3349 * src/support/filetools.C (PutEnv): fix the code in case neither
3350 putenv() nor setenv() have been found.
3352 * INSTALL: mention the install-strip Makefile target.
3354 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3355 read-only documents.
3357 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3359 * lib/reLyX/configure.in (VERSION): avoid using a previously
3360 generated reLyX wrapper to find out $prefix.
3362 * lib/examples/eu_adibide_lyx-atua.lyx:
3363 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3364 translation of the Tutorial (Dooteo)
3366 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3368 * forms/cite.fd: new citation dialog
3370 * src/insetcite.[Ch]: the new citation dialog is moved into
3373 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3376 * src/insets/insetcommand.h: data members made private.
3378 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3380 * LyX 1.1.5 released
3382 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3384 * src/version.h (LYX_RELEASE): to 1.1.5
3386 * src/spellchecker.C (RunSpellChecker): return false if the
3387 spellchecker dies upon creation.
3389 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3391 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3392 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3396 * lib/CREDITS: update entry for Martin Vermeer.
3398 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3400 * src/text.C (draw): Draw foreign language bars at the bottom of
3401 the row instead of at the baseline.
3403 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3405 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3407 * lib/bind/de_menus.bind: updated
3409 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3411 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3413 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3415 * src/menus.C (Limit_string_length): New function
3416 (ShowTocMenu): Limit the number of items/length of items in the
3419 * src/paragraph.C (String): Correct result for a paragraph inside
3422 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3424 * src/bufferlist.C (close): test of buf->getuser() == NULL
3426 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3428 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3429 Do not call to SetCursor when the paragraph is a closed footnote!
3431 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3433 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3436 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3438 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3441 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3442 reference popup, that activates the reference-back action
3444 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3446 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3447 the menus. Also fixed a bug.
3449 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3450 the math panels when switching buffers (unless new buffer is readonly).
3452 * src/BufferView.C (NoSavedPositions)
3453 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3455 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3457 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3458 less of dvi dirty or not.
3460 * src/trans_mgr.[Ch] (insert): change first parameter to string
3463 * src/chset.[Ch] (encodeString): add const to first parameter
3465 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3467 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3471 * src/LaTeX.C (deplog): better searching for dependency files in
3472 the latex log. Uses now regexps.
3474 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3475 instead of the box hack or \hfill.
3477 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3479 * src/lyxfunc.C (doImportHelper): do not create the file before
3480 doing the actual import.
3481 (doImportASCIIasLines): create a new file before doing the insert.
3482 (doImportASCIIasParagraphs): ditto.
3484 * lib/lyxrc.example: remove mention of non-existing commands
3486 * lyx.man: remove mention of color-related switches.
3488 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3490 * src/lyx_gui.C: remove all the color-related ressources, which
3491 are not used anymore.
3493 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3496 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3498 * src/lyxrc.C (read): Add a missing break in the switch
3500 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3502 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3504 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3507 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3509 * src/text.C (draw): draw bars under foreign language words.
3511 * src/LColor.[Ch]: add LColor::language
3513 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3515 * src/lyxcursor.h (boundary): New member variable
3517 * src/text.C (IsBoundary): New methods
3519 * src/text.C: Use the above for currect cursor movement when there
3520 is both RTL & LTR text.
3522 * src/text2.C: ditto
3524 * src/bufferview_funcs.C (ToggleAndShow): ditto
3526 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3528 * src/text.C (DeleteLineForward): set selection to true to avoid
3529 that DeleteEmptyParagraphMechanism does some magic. This is how it
3530 is done in all other functions, and seems reasonable.
3531 (DeleteWordForward): do not jump over non-word stuff, since
3532 CursorRightOneWord() already does it.
3534 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3535 DeleteWordBackward, since they seem safe to me (since selection is
3536 set to "true") DeleteEmptyParagraphMechanism does nothing.
3538 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3540 * src/lyx_main.C (easyParse): simplify the code by factoring the
3541 part that removes parameters from the command line.
3542 (LyX): check wether wrong command line options have been given.
3544 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3546 * src/lyx_main.C : add support for specifying user LyX
3547 directory via command line option -userdir.
3549 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3551 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3552 the number of items per popup.
3553 (Add_to_refs_menu): Ditto.
3555 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3557 * src/lyxparagraph.h: renamed ClearParagraph() to
3558 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3559 textclass as parameter, and do nothing if free_spacing is
3560 true. This fixes part of the line-delete-forward problems.
3562 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3563 (pasteSelection): ditto.
3564 (SwitchLayoutsBetweenClasses): more translatable strings.
3566 * src/text2.C (CutSelection): use StripLeadingSpaces.
3567 (PasteSelection): ditto.
3568 (DeleteEmptyParagraphMechanism): ditto.
3570 2000-05-26 Juergen Vigna <jug@sad.it>
3572 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3573 is not needed in tabular insets.
3575 * src/insets/insettabular.C (TabularFeatures): added missing features.
3577 * src/tabular.C (DeleteColumn):
3579 (AppendRow): implemented this functions
3580 (cellsturct::operator=): clone the inset too;
3582 2000-05-23 Juergen Vigna <jug@sad.it>
3584 * src/insets/insettabular.C (LocalDispatch): better selection support
3585 when having multicolumn-cells.
3587 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3589 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3591 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3593 * src/ColorHandler.C (getGCForeground): put more test into _()
3595 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3598 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3601 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3603 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3604 there are no labels, or when buffer is readonly.
3606 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3607 there are no labels, buffer is SGML, or when buffer is readonly.
3609 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3611 * src/LColor.C (LColor): change a couple of grey40 to grey60
3612 (LColor): rewore initalization to make compiles go some magnitude
3614 (getGUIName): don't use gettext until we need the string.
3616 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3618 * src/Bullet.[Ch]: Fixed a small bug.
3620 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3622 * src/paragraph.C (String): Several fixes/improvements
3624 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3626 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3628 * src/paragraph.C (String): give more correct output.
3630 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3632 * src/lyxfont.C (stateText) Do not output the language if it is
3633 eqaul to the language of the document.
3635 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3636 between two paragraphs with the same language.
3638 * src/paragraph.C (getParLanguage) Return a correct answer for an
3639 empty dummy paragraph.
3641 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3644 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3647 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3648 the menus/popup, if requested fonts are unavailable.
3650 2000-05-22 Juergen Vigna <jug@sad.it>
3652 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3653 movement support (Up/Down/Tab/Shift-Tab).
3654 (LocalDispatch): added also preliminari cursor-selection.
3656 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3658 * src/paragraph.C (PasteParagraph): Hopefully now right!
3660 2000-05-22 Garst R. Reese <reese@isn.net>
3662 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3663 of list, change all references to Environment to Command
3664 * tex/hollywood.cls : rewrite environments as commands, add
3665 \uppercase to interiorshot and exteriorshot to force uppecase.
3666 * tex/broadway.cls : rewrite environments as commands. Tweak
3669 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3671 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3672 size of items: use a constant intead of the hardcoded 40, and more
3673 importantly do not remove the %m and %x tags added at the end.
3674 (Add_to_refs_menu): use vector::size_type instead of
3675 unsigned int as basic types for the variables. _Please_ do not
3676 assume that size_t is equal to unsigned int. On an alpha, this is
3677 unsigned long, which is _not_ the same.
3679 * src/language.C (initL): remove language "hungarian", since it
3680 seems that "magyar" is better.
3682 2000-05-22 Juergen Vigna <jug@sad.it>
3684 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3686 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3689 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3690 next was deleted but not set to 0.
3692 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3694 * src/language.C (initL): change the initialization of languages
3695 so that compiles goes _fast_.
3697 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3700 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3702 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3706 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3708 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3710 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3714 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3717 * src/insets/insetlo*.[Ch]: Made editable
3719 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3721 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3722 the current selection.
3724 * src/BufferView_pimpl.C (stuffClipboard): new method
3726 * src/BufferView.C (stuffClipboard): new method
3728 * src/paragraph.C (String): new method
3730 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3731 LColor::ignore when lyxname is not found.
3733 * src/BufferView.C (pasteSelection): new method
3735 * src/BufferView_pimpl.C (pasteSelection): new method
3737 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3739 * src/WorkArea.C (request_clipboard_cb): new static function
3740 (getClipboard): new method
3741 (putClipboard): new method
3743 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3745 * LyX 1.1.5pre2 released
3747 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3749 * src/vspace.C (operator=): removed
3750 (operator=): removed
3752 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3754 * src/layout.C (NumberOfClass): manually set the type in make_pair
3755 (NumberOfLayout): ditto
3757 * src/language.C: use the Language constructor for ignore_lang
3759 * src/language.h: add constructors to struct Language
3761 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3763 * src/text2.C (SetCursorIntern): comment out #warning
3765 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3767 * src/mathed/math_iter.h: initialize sx and sw to 0
3769 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3771 * forms/lyx.fd: Redesign of form_ref
3773 * src/LaTeXFeatures.[Ch]
3777 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3780 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3781 and Buffer::inset_iterator.
3783 * src/menus.C: Added new menus: TOC and Refs.
3785 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3787 * src/buffer.C (getTocList): New method.
3789 * src/BufferView2.C (ChangeRefs): New method.
3791 * src/buffer.C (getLabelList): New method. It replaces the old
3792 getReferenceList. The return type is vector<string> instead of
3795 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3796 the old getLabel() and GetNumberOfLabels() methods.
3797 * src/insets/insetlabel.C (getLabelList): ditto
3798 * src/mathed/formula.C (getLabelList): ditto
3800 * src/paragraph.C (String): New method.
3802 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3803 Uses the new getTocList() method.
3804 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3805 which automatically updates the contents of the browser.
3806 (RefUpdateCB): Use the new getLabelList method.
3808 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3810 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3812 * src/spellchecker.C: Added using std::reverse;
3814 2000-05-19 Juergen Vigna <jug@sad.it>
3816 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3818 * src/insets/insettext.C (computeTextRows): small fix for display of
3819 1 character after a newline.
3821 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3824 2000-05-18 Juergen Vigna <jug@sad.it>
3826 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3827 when changing width of column.
3829 * src/tabular.C (set_row_column_number_info): setting of
3830 autobreak rows if necessary.
3832 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3834 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3836 * src/vc-backend.*: renamed stat() to status() and vcstat to
3837 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3838 compilation broke. The new name seems more relevant, anyway.
3840 2000-05-17 Juergen Vigna <jug@sad.it>
3842 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3843 which was wrong if the removing caused removing of rows!
3845 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3846 (pushToken): new function.
3848 * src/text2.C (CutSelection): fix problem discovered with purify
3850 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3852 * src/debug.C (showTags): enlarge the first column, now that we
3853 have 6-digits debug codes.
3855 * lib/layouts/hollywood.layout:
3856 * lib/tex/hollywood.cls:
3857 * lib/tex/brodway.cls:
3858 * lib/layouts/brodway.layout: more commands and fewer
3859 environments. Preambles moved in the .cls files. Broadway now has
3860 more options on scene numbering and less whitespace (from Garst)
3862 * src/insets/insetbib.C (getKeys): make sure that we are in the
3863 document directory, in case the bib file is there.
3865 * src/insets/insetbib.C (Latex): revert bogus change.
3867 2000-05-16 Juergen Vigna <jug@sad.it>
3869 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3870 the TabularLayout on cursor move.
3872 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3874 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3877 (draw): fixed cursor position and drawing so that the cursor is
3878 visible when before the tabular-inset.
3880 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3881 when creating from old insettext.
3883 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3885 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3887 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3888 * lib/tex/brodway.cls: ditto
3890 * lib/layouts/brodway.layout: change alignment of parenthical
3893 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3895 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3896 versions 0.88 and 0.89 are supported.
3898 2000-05-15 Juergen Vigna <jug@sad.it>
3900 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3903 * src/insets/insettext.C (computeTextRows): redone completely this
3904 function in a much cleaner way, because of problems when having a
3906 (draw): added a frame border when the inset is locked.
3907 (SetDrawLockedFrame): this sets if we draw the border or not.
3908 (SetFrameColor): this sets the frame color (default=insetframe).
3910 * src/insets/lyxinset.h: added x() and y() functions which return
3911 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3912 function which is needed to see if we have a locking inset of some
3913 type in this inset (needed for now in insettabular).
3915 * src/vspace.C (inPixels): the same function also without a BufferView
3916 parameter as so it is easier to use it in some ocasions.
3918 * src/lyxfunc.C: changed all places where insertInset was used so
3919 that now if it couldn't be inserted it is deleted!
3921 * src/TabularLayout.C:
3922 * src/TableLayout.C: added support for new tabular-inset!
3924 * src/BufferView2.C (insertInset): this now returns a bool if the
3925 inset was really inserted!!!
3927 * src/tabular.C (GetLastCellInRow):
3928 (GetFirstCellInRow): new helper functions.
3929 (Latex): implemented for new tabular class.
3933 (TeXTopHLine): new Latex() helper functions.
3935 2000-05-12 Juergen Vigna <jug@sad.it>
3937 * src/mathed/formulamacro.C (Read):
3938 * src/mathed/formula.C (Read): read also the \end_inset here!
3940 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3942 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3943 crush when saving formulae with unbalanced parenthesis.
3945 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3947 * src/layout.C: Add new keyword "endlabelstring" to layout file
3949 * src/text.C (GetVisibleRow): Draw endlabel string.
3951 * lib/layouts/broadway.layout
3952 * lib/layouts/hollywood.layout: Added endlabel for the
3953 Parenthetical layout.
3955 * lib/layouts/heb-article.layout: Do not use slanted font shape
3956 for Theorem like environments.
3958 * src/buffer.C (makeLaTeXFile): Always add "american" to
3959 the UsedLanguages list if document language is RTL.
3961 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3963 * add addendum to README.OS2 and small patch (from SMiyata)
3965 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3967 * many files: correct the calls to ChangeExtension().
3969 * src/support/filetools.C (ChangeExtension): remove the no_path
3970 argument, which does not belong there. Use OnlyFileName() instead.
3972 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3973 files when LaTeXing a non-nice latex file.
3975 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3976 a chain of "if". Return false when deadkeys are not handled.
3978 * src/lyx_main.C (LyX): adapted the code for default bindings.
3980 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3981 bindings for basic functionality (except deadkeys).
3982 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3984 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3985 several methods: handle override_x_deadkeys.
3987 * src/lyxrc.h: remove the "bindings" map, which did not make much
3988 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3990 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3992 * src/lyxfont.C (stateText): use a saner method to determine
3993 whether the font is "default". Seems to fix the crash with DEC
3996 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3998 2000-05-08 Juergen Vigna <jug@sad.it>
4000 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4001 TabularLayoutMenu with mouse-button-3
4002 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4004 * src/TabularLayout.C: added this file for having a Layout for
4007 2000-05-05 Juergen Vigna <jug@sad.it>
4009 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4010 recalculating inset-widths.
4011 (TabularFeatures): activated this function so that I can change
4012 tabular-features via menu.
4014 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4015 that I can test some functions with the Table menu.
4017 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4019 * src/lyxfont.C (stateText): guard against stupid c++libs.
4021 * src/tabular.C: add using std::vector
4022 some whitespace changes, + removed som autogenerated code.
4024 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4026 2000-05-05 Juergen Vigna <jug@sad.it>
4028 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4029 row, columns and cellstructures.
4031 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4033 * lib/lyxrc.example: remove obsolete entries.
4035 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4036 reading of protected_separator for free_spacing.
4038 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4040 * src/text.C (draw): do not display an exclamation mark in the
4041 margin for margin notes. This is confusing, ugly and
4044 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4045 AMS math' is checked.
4047 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4048 name to see whether including the amsmath package is needed.
4050 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4052 * src/paragraph.C (validate): Compute UsedLanguages correctly
4053 (don't insert the american language if it doesn't appear in the
4056 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4057 The argument of \thanks{} command is considered moving argument
4059 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4062 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4064 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4065 for appendix/minipage/depth. The lines can be now both in the footnote
4066 frame, and outside the frame.
4068 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4071 2000-05-05 Juergen Vigna <jug@sad.it>
4073 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4074 neede only in tabular.[Ch].
4076 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4078 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4080 (Write): write '~' for PROTECTED_SEPARATOR
4082 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4084 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4087 * src/mathed/formula.C (drawStr): rename size to siz.
4089 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4090 possibly fix a bug by not changing the pflags = flags to piflags =
4093 2000-05-05 Juergen Vigna <jug@sad.it>
4095 * src/insets/insetbib.C: moved using directive
4097 * src/ImportNoweb.C: small fix for being able to compile (missing
4100 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4102 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4103 to use clear, since we don't depend on this in the code. Add test
4106 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4108 * (various *.C files): add using std::foo directives to please dec
4111 * replace calls to string::clear() to string::erase() (Angus)
4113 * src/cheaders/cmath: modified to provide std::abs.
4115 2000-05-04 Juergen Vigna <jug@sad.it>
4117 * src/insets/insettext.C: Prepared all for inserting of multiple
4118 paragraphs. Still display stuff to do (alignment and other things),
4119 but I would like to use LyXText to do this when we cleaned out the
4120 table-support stuff.
4122 * src/insets/insettabular.C: Changed lot of stuff and added lots
4123 of functionality still a lot to do.
4125 * src/tabular.C: Various functions changed name and moved to be
4126 const functions. Added new Read and Write functions and changed
4127 lots of things so it works good with tabular-insets (also removed
4128 some stuff which is not needed anymore * hacks *).
4130 * src/lyxcursor.h: added operators == and != which just look if
4131 par and pos are (not) equal.
4133 * src/buffer.C (latexParagraphs): inserted this function to latex
4134 all paragraphs form par to endpar as then I can use this too for
4137 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4138 so that I can call this to from text insets with their own cursor.
4140 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4141 output off all paragraphs (because of the fix below)!
4143 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4144 the very last paragraph (this could be also the last paragraph of an
4147 * src/texrow.h: added rows() call which returns the count-variable.
4149 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4151 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4153 * lib/configure.m4: better autodetection of DocBook tools.
4155 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4157 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4159 * src/lyx_cb.C: add using std::reverse;
4161 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4164 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4165 selected files. Should fix repeated errors from generated files.
4167 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4169 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4171 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4172 the spellchecker popup.
4174 * lib/lyxrc.example: Removed the \number_inset section
4176 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4178 * src/insets/figinset.C (various): Use IsFileReadable() to make
4179 sure that the file actually exist. Relying on ghostscripts errors
4180 is a bad idea since they can lead to X server crashes.
4182 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4184 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4187 * lib/lyxrc.example: smallish typo in description of
4188 \view_dvi_paper_option
4190 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4193 * src/lyxfunc.C: doImportHelper to factor out common code of the
4194 various import methods. New functions doImportASCIIasLines,
4195 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4196 doImportLinuxDoc for the format specific parts.
4199 * buffer.C: Dispatch returns now a bool to indicate success
4202 * lyx_gui.C: Add getLyXView() for member access
4204 * lyx_main.C: Change logic for batch commands: First try
4205 Buffer::Dispatch (possibly without GUI), if that fails, use
4208 * lyx_main.C: Add support for --import command line switch.
4209 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4210 Available Formats: Everything accepted by 'buffer-import <format>'
4212 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4214 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4217 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4218 documents will be reformatted upon reentry.
4220 2000-04-27 Juergen Vigna <jug@sad.it>
4222 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4223 correctly only last pos this was a bug.
4225 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4227 * release of lyx-1.1.5pre1
4229 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4231 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4233 * src/menus.C: revert the change of naming (Figure->Graphic...)
4234 from 2000-04-11. It was incomplete and bad.
4236 * src/LColor.[Ch]: add LColor::depthbar.
4237 * src/text.C (GetVisibleRow): use it.
4239 * README: update the languages list.
4241 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4243 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4246 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4248 * README: remove sections that were just wrong.
4250 * src/text2.C (GetRowNearY): remove currentrow code
4252 * src/text.C (GetRow): remove currentrow code
4254 * src/screen.C (Update): rewritten a bit.
4255 (SmallUpdate): removed func
4257 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4259 (FullRebreak): return bool
4260 (currentrow): remove var
4261 (currentrow_y): ditto
4263 * src/lyxscreen.h (Draw): change arg to unsigned long
4264 (FitCursor): return bool
4265 (FitManualCursor): ditto
4266 (Smallpdate): remove func
4267 (first): change to unsigned long
4268 (DrawOneRow): change second arg to long (from long &)
4269 (screen_refresh_y): remove var
4270 (scree_refresh_row): ditto
4272 * src/lyxrow.h: change baseline to usigned int from unsigned
4273 short, this brings some implicit/unsigned issues out in the open.
4275 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4277 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4278 instead of smallUpdate.
4280 * src/lyxcursor.h: change y to unsigned long
4282 * src/buffer.h: don't call updateScrollbar after fitcursor
4284 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4285 where they are used. Removed "\\direction", this was not present
4286 in 1.1.4 and is already obsolete. Commented out some code that I
4287 believe to never be called.
4288 (runLiterate): don't call updateScrollbar after fitCursor
4290 (buildProgram): ditto
4293 * src/WorkArea.h (workWidth): change return val to unsigned
4296 (redraw): remove the button redraws
4297 (setScrollbarValue): change for scrollbar
4298 (getScrollbarValue): change for scrollbar
4299 (getScrollbarBounds): change for scrollbar
4301 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4302 (C_WorkArea_down_cb): removed func
4303 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4304 (resize): change for scrollbar
4305 (setScrollbar): ditto
4306 (setScrollbarBounds): ditto
4307 (setScrollbarIncrements): ditto
4308 (up_cb): removed func
4309 (down_cb): removed func
4310 (scroll_cb): change for scrollbar
4311 (work_area_handler): ditto
4313 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4314 when FitCursor did something.
4315 (updateScrollbar): some unsigned changes
4316 (downCB): removed func
4317 (scrollUpOnePage): removed func
4318 (scrollDownOnePage): remvoed func
4319 (workAreaMotionNotify): don't call screen->FitCursor but use
4320 fitCursor instead. and bool return val
4321 (workAreaButtonPress): ditto
4322 (workAreaButtonRelease): some unsigned changes
4323 (checkInsetHit): ditto
4324 (workAreaExpose): ditto
4325 (update): parts rewritten, comments about the signed char arg added
4326 (smallUpdate): removed func
4327 (cursorPrevious): call needed updateScrollbar
4330 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4333 * src/BufferView.[Ch] (upCB): removed func
4334 (downCB): removed func
4335 (smallUpdate): removed func
4337 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4339 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4340 currentrow, currentrow_y optimization. This did not help a lot and
4341 if we want to do this kind of optimization we should rather use
4342 cursor.row instead of the currentrow.
4344 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4345 buffer spacing and klyx spacing support.
4347 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4349 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4352 2000-04-26 Juergen Vigna <jug@sad.it>
4354 * src/insets/figinset.C: fixes to Lars sstream changes!
4356 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4358 * A lot of files: Added Ascii(ostream &) methods to all inset
4359 classes. Used when exporting to ASCII.
4361 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4362 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4365 * src/text2.C (ToggleFree): Disabled implicit word selection when
4366 there is a change in the language
4368 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4369 no output was generated for end-of-sentence inset.
4371 * src/insets/lyxinset.h
4374 * src/paragraph.C: Removed the insetnumber code
4376 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4378 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4380 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4381 no_babel and no_epsfig completely from the file.
4382 (parseSingleLyXformat2Token): add handling for per-paragraph
4383 spacing as written by klyx.
4385 * src/insets/figinset.C: applied patch by Andre. Made it work with
4388 2000-04-20 Juergen Vigna <jug@sad.it>
4390 * src/insets/insettext.C (cutSelection):
4391 (copySelection): Fixed with selection from right to left.
4392 (draw): now the rows are not recalculated at every draw.
4393 (computeTextRows): for now reset the inset-owner here (this is
4394 important for an undo or copy where the inset-owner is not set
4397 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4398 motion to the_locking_inset screen->first was forgotten, this was
4399 not important till we got multiline insets.
4401 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4403 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4404 code seems to be alright (it is code changed by Dekel, and the
4405 intent is indeed that all macros should be defined \protect'ed)
4407 * NEWS: a bit of reorganisation of the new user-visible features.
4409 2000-04-19 Juergen Vigna <jug@sad.it>
4411 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4412 position. Set the inset_owner of the used paragraph so that it knows
4413 that it is inside an inset. Fixed cursor handling with mouse and
4414 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4415 and cleanups to make TextInsets work better.
4417 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4418 Changed parameters of various functions and added LockInsetInInset().
4420 * src/insets/insettext.C:
4422 * src/insets/insetcollapsable.h:
4423 * src/insets/insetcollapsable.C:
4424 * src/insets/insetfoot.h:
4425 * src/insets/insetfoot.C:
4426 * src/insets/insetert.h:
4427 * src/insets/insetert.C: cleaned up the code so that it works now
4428 correctly with insettext.
4430 * src/insets/inset.C:
4431 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4432 that insets in insets are supported right.
4435 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4437 * src/paragraph.C: some small fixes
4439 * src/debug.h: inserted INSETS debug info
4441 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4442 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4444 * src/commandtags.h:
4445 * src/LyXAction.C: insert code for InsetTabular.
4447 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4448 not Button1MotionMask.
4449 (workAreaButtonRelease): send always a InsetButtonRelease event to
4451 (checkInsetHit): some setCursor fixes (always with insets).
4453 * src/BufferView2.C (lockInset): returns a bool now and extended for
4454 locking insets inside insets.
4455 (showLockedInsetCursor): it is important to have the cursor always
4456 before the locked inset.
4457 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4459 * src/BufferView.h: made lockInset return a bool.
4461 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4463 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4464 that is used also internally but can be called as public to have back
4465 a cursor pos which is not set internally.
4466 (SetCursorIntern): Changed to use above function.
4468 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4470 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4475 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4476 patches for things that should be in or should be changed.
4478 * src/* [insetfiles]: change "usigned char fragile" to bool
4479 fragile. There was only one point that could that be questioned
4480 and that is commented in formulamacro.C. Grep for "CHECK".
4482 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4483 (DeleteBuffer): take it out of CutAndPaste and make it static.
4485 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4487 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4488 output the spacing envir commands. Also the new commands used in
4489 the LaTeX output makes the result better.
4491 * src/Spacing.C (writeEnvirBegin): new method
4492 (writeEnvirEnd): new method
4494 2000-04-18 Juergen Vigna <jug@sad.it>
4496 * src/CutAndPaste.C: made textclass a static member of the class
4497 as otherwise it is not accesed right!!!
4499 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4501 * forms/layout_forms.fd
4502 * src/layout_forms.h
4503 * src/layout_forms.C (create_form_form_character)
4504 * src/lyx_cb.C (UserFreeFont)
4505 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4506 documents (in the layout->character popup).
4508 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4510 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4511 \spell_command was in fact not honored (from Kevin Atkinson).
4513 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4516 * src/lyx_gui.h: make lyxViews private (Angus)
4518 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4520 * src/mathed/math_write.C
4521 (MathMatrixInset::Write) Put \protect before \begin{array} and
4522 \end{array} if fragile
4523 (MathParInset::Write): Put \protect before \\ if fragile
4525 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4527 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4528 initialization if the LyXColorHandler must be done after the
4529 connections to the XServer has been established.
4531 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4532 get the background pixel from the lyxColorhandler so that the
4533 figures are rendered with the correct background color.
4534 (NextToken): removed functions.
4535 (GetPSSizes): use ifs >> string instead of NextToken.
4537 * src/Painter.[Ch]: the color cache moved out of this file.
4539 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4542 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4544 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4545 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4547 * src/BufferView.C (enterView): new func
4548 (leaveView): new func
4550 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4552 (leaveView): new func, undefines xterm cursor when approp.
4554 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4555 (AllowInput): delete the Workarea cursor handling from this func.
4557 * src/Painter.C (underline): draw a slimer underline in most cases.
4559 * src/lyx_main.C (error_handler): use extern "C"
4561 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4563 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4564 sent directly to me.
4566 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4567 to the list by Dekel.
4569 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4572 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4573 methods from lyx_cb.here.
4575 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4578 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4580 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4581 instead of using current_view directly.
4583 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4585 * src/LyXAction.C (init): add the paragraph-spacing command.
4587 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4589 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4591 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4592 different from the documents.
4594 * src/text.C (SetHeightOfRow): take paragraph spacing into
4595 account, paragraph spacing takes precedence over buffer spacing
4596 (GetVisibleRow): ditto
4598 * src/paragraph.C (writeFile): output the spacing parameter too.
4599 (validate): set the correct features if spacing is used in the
4601 (Clear): set spacing to default
4602 (MakeSameLayout): spacing too
4603 (HasSameLayout): spacing too
4604 (SetLayout): spacing too
4605 (TeXOnePar): output the spacing commands
4607 * src/lyxparagraph.h: added a spacing variable for use with
4608 per-paragraph spacing.
4610 * src/Spacing.h: add a Default spacing and a method to check if
4611 the current spacing is default. also added an operator==
4613 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4616 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4618 * src/lyxserver.C (callback): fix dispatch of functions
4620 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4621 printf() into lyxerr call.
4623 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4626 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4627 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4628 the "Float" from each of the subitems.
4629 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4631 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4632 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4633 documented the change so that the workaround can be nuked later.
4635 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4638 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4640 * src/buffer.C (getLatexName): ditto
4641 (setReadonly): ditto
4643 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4645 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4646 avoid some uses of current_view. Added also a bufferParams()
4647 method to get at this.
4649 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4651 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4653 * src/lyxparagraph.[Ch]: removed
4654 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4655 with operators used by lower_bound and
4656 upper_bound in InsetTable's
4657 Make struct InsetTable private again. Used matchpos.
4659 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4661 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4662 document, the language of existing text is changed (unless the
4663 document is multi-lingual)
4665 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4667 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4669 * A lot of files: A rewrite of the Right-to-Left support.
4671 2000-04-10 Juergen Vigna <jug@sad.it>
4673 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4674 misplaced cursor when inset in inset is locked.
4676 * src/insets/insettext.C (LocalDispatch): small fix so that a
4677 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4679 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4680 footnote font should be decreased in size twice when displaying.
4682 * src/insets/insettext.C (GetDrawFont): inserted this function as
4683 the drawing-font may differ from the real paragraph font.
4685 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4686 insets (inset in inset!).
4688 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4689 function here because we don't want footnotes inside footnotes.
4691 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4693 (init): now set the inset_owner in paragraph.C
4694 (LocalDispatch): added some resetPos() in the right position
4697 (pasteSelection): changed to use the new CutAndPaste-Class.
4699 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4700 which tells if it is allowed to insert another inset inside this one.
4702 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4703 SwitchLayoutsBetweenClasses.
4705 * src/text2.C (InsertInset): checking of the new paragraph-function
4707 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4708 is not needed anymore here!
4711 (PasteSelection): redone (also with #ifdef) so that now this uses
4712 the CutAndPaste-Class.
4713 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4716 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4717 from/to text/insets.
4719 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4720 so that the paragraph knows if it is inside an (text)-inset.
4721 (InsertFromMinibuffer): changed return-value to bool as now it
4722 may happen that an inset is not inserted in the paragraph.
4723 (InsertInsetAllowed): this checks if it is allowed to insert an
4724 inset in this paragraph.
4726 (BreakParagraphConservative):
4727 (BreakParagraph) : small change for the above change of the return
4728 value of InsertFromMinibuffer.
4730 * src/lyxparagraph.h: added inset_owner and the functions to handle
4731 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4733 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4735 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4736 functions from BufferView to BufferView::Pimpl to ease maintence.
4738 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4739 correctly. Also use SetCursorIntern instead of SetCursor.
4741 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4744 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4746 * src/WorkArea.C (belowMouse): manually implement below mouse.
4748 * src/*: Add "explicit" on several constructors, I added probably
4749 some unneeded ones. A couple of changes to code because of this.
4751 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4752 implementation and private parts from the users of BufferView. Not
4755 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4756 implementation and private parts from the users of LyXLex. Not
4759 * src/BufferView_pimpl.[Ch]: new files
4761 * src/lyxlex_pimpl.[Ch]: new files
4763 * src/LyXView.[Ch]: some inline functions move out-of-line
4765 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4767 * src/lyxparagraph.h: make struct InsetTable public.
4769 * src/support/lyxstring.h: change lyxstring::difference_type to be
4770 ptrdiff_t. Add std:: modifiers to streams.
4772 * src/font.C: include the <cctype> header, for islower() and
4775 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4777 * src/font.[Ch]: new files. Contains the metric functions for
4778 fonts, takes a LyXFont as parameter. Better separation of concepts.
4780 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4781 changes because of this.
4783 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4785 * src/*: compile with -Winline and move functions that don't
4788 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4791 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4793 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4794 (various files changed because of this)
4796 * src/Painter.C (text): fixed the drawing of smallcaps.
4798 * src/lyxfont.[Ch] (drawText): removed unused member func.
4801 * src/*.C: added needed "using" statements and "std::" qualifiers.
4803 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4805 * src/*.h: removed all use of "using" from header files use
4806 qualifier std:: instead.
4808 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4810 * src/text.C (Backspace): some additional cleanups (we already
4811 know whether cursor.pos is 0 or not).
4813 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4814 automake does not provide one).
4816 * src/bmtable.h: replace C++ comments with C comments.
4818 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4820 * src/screen.C (ShowCursor): Change the shape of the cursor if
4821 the current language is not equal to the language of the document.
4822 (If the cursor change its shape unexpectedly, then you've found a bug)
4824 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4827 * src/insets/insetnumber.[Ch]: New files.
4829 * src/LyXAction.C (init)
4830 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4833 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4835 * src/lyxparagraph.h
4836 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4837 (the vector is kept sorted).
4839 * src/text.C (GetVisibleRow): Draw selection correctly when there
4840 is both LTR and RTL text.
4842 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4843 which is much faster.
4845 * src/text.C (GetVisibleRow and other): Do not draw the last space
4846 in a row if the direction of the last letter is not equal to the
4847 direction of the paragraph.
4849 * src/lyxfont.C (latexWriteStartChanges):
4850 Check that font language is not equal to basefont language.
4851 (latexWriteEndChanges): ditto
4853 * src/lyx_cb.C (StyleReset): Don't change the language while using
4854 the font-default command.
4856 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4857 empty paragraph before a footnote.
4859 * src/insets/insetcommand.C (draw): Increase x correctly.
4861 * src/screen.C (ShowCursor): Change cursor shape if
4862 current language != document language.
4864 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4866 2000-03-31 Juergen Vigna <jug@sad.it>
4868 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4869 (Clone): changed mode how the paragraph-data is copied to the
4870 new clone-paragraph.
4872 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4873 GetInset(pos) with no inset anymore there (in inset UNDO)
4875 * src/insets/insetcommand.C (draw): small fix as here x is
4876 incremented not as much as width() returns (2 before, 2 behind = 4)
4878 2000-03-30 Juergen Vigna <jug@sad.it>
4880 * src/insets/insettext.C (InsetText): small fix in initialize
4881 widthOffset (should not be done in the init() function)
4883 2000-03-29 Amir Karger <karger@lyx.org>
4885 * lib/examples/it_ItemizeBullets.lyx: translation by
4888 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4890 2000-03-29 Juergen Vigna <jug@sad.it>
4892 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4894 * src/insets/insetfoot.C (Clone): small change as for the below
4895 new init function in the text-inset
4897 * src/insets/insettext.C (init): new function as I've seen that
4898 clone did not copy the Paragraph-Data!
4899 (LocalDispatch): Added code so that now we have some sort of Undo
4900 functionality (well actually we HAVE Undo ;)
4902 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4904 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4906 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4909 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4911 * src/main.C: added a runtime check that verifies that the xforms
4912 header used when building LyX and the library used when running
4913 LyX match. Exit with a message if they don't match. This is a
4914 version number check only.
4916 * src/buffer.C (save): Don't allocate memory on the heap for
4917 struct utimbuf times.
4919 * *: some using changes, use iosfwd instead of the real headers.
4921 * src/lyxfont.C use char const * instead of string for the static
4922 strings. Rewrite some functions to use sstream.
4924 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4926 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4929 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4931 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4932 of Geodesy (from Martin Vermeer)
4934 * lib/layouts/svjour.inc: include file for the Springer svjour
4935 class. It can be used to support journals other than JoG.
4937 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4938 Miskiewicz <misiek@pld.org.pl>)
4939 * lib/reLyX/Makefile.am: ditto.
4941 2000-03-27 Juergen Vigna <jug@sad.it>
4943 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4944 also some modifications with operations on selected text.
4946 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4947 problems with clicking on insets (last famous words ;)
4949 * src/insets/insetcommand.C (draw):
4950 (width): Changed to have a bit of space before and after the inset so
4951 that the blinking cursor can be seen (otherwise it was hidden)
4953 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4955 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4956 would not be added to the link list when an installed gettext (not
4957 part of libc) is found.
4959 2000-03-24 Juergen Vigna <jug@sad.it>
4961 * src/insets/insetcollapsable.C (Edit):
4962 * src/mathed/formula.C (InsetButtonRelease):
4963 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4966 * src/BufferView.C (workAreaButtonPress):
4967 (workAreaButtonRelease):
4968 (checkInsetHit): Finally fixed the clicking on insets be handled
4971 * src/insets/insetert.C (Edit): inserted this call so that ERT
4972 insets work always with LaTeX-font
4974 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4976 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4977 caused lyx to startup with no GUI in place, causing in a crash
4978 upon startup when called with arguments.
4980 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4982 * src/FontLoader.C: better initialization of dummyXFontStruct.
4984 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4986 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4987 for linuxdoc and docbook import and export format options.
4989 * lib/lyxrc.example Example of default values for the previous flags.
4991 * src/lyx_cb.C Use those flags instead of the hardwired values for
4992 linuxdoc and docbook export.
4994 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4997 * src/menus.C Added menus entries for the new import/exports formats.
4999 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5001 * src/lyxrc.*: Added support for running without Gui
5004 * src/FontLoader.C: sensible defaults if no fonts are needed
5006 * src/lyx_cb.C: New function ShowMessage (writes either to the
5007 minibuffer or cout in case of no gui
5008 New function AskOverwrite for common stuff
5009 Consequently various changes to call these functions
5011 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5012 wild guess at sensible screen resolution when having no gui
5014 * src/lyxfont.C: no gui, no fonts... set some defaults
5016 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5018 * src/LColor.C: made the command inset background a bit lighter.
5020 2000-03-20 Hartmut Goebel <goebel@noris.net>
5022 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5023 stdstruct.inc. Koma-Script added some title elements which
5024 otherwise have been listed below "bibliography". This split allows
5025 adding title elements to where they belong.
5027 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5028 define the additional tilte elements and then include
5031 * many other layout files: changed to include stdtitle.inc just
5032 before stdstruct.inc.
5034 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5036 * src/buffer.C: (save) Added the option to store all backup files
5037 in a single directory
5039 * src/lyxrc.[Ch]: Added variable \backupdir_path
5041 * lib/lyxrc.example: Added descriptions of recently added variables
5043 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5044 bibtex inset, not closing the bibtex popup when deleting the inset)
5046 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5048 * src/lyx_cb.C: add a couple using directives.
5050 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5051 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5052 import based on the filename.
5054 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5055 file would be imported at start, if the filename where of a sgml file.
5057 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5059 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5061 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5062 * src/lyxfont.h Replaced the member variable bits.direction by the
5063 member variable lang. Made many changes in other files.
5064 This allows having a multi-lingual document
5066 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5067 that change the current language to <l>.
5068 Removed the command "font-rtl"
5070 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5071 format for Hebrew documents)
5073 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5074 When auto_mathmode is "true", pressing a digit key in normal mode
5075 will cause entering into mathmode.
5076 If auto_mathmode is "rtl" then this behavior will be active only
5077 when writing right-to-left text.
5079 * src/text2.C (InsertStringA) The string is inserted using the
5082 * src/paragraph.C (GetEndLabel) Gives a correct result for
5083 footnote paragraphs.
5085 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5087 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5089 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5090 front of PasteParagraph. Never insert a ' '. This should at least
5091 fix some cause for the segfaults that we have been experiencing,
5092 it also fixes backspace behaviour slightly. (Phu!)
5094 * src/support/lstrings.C (compare_no_case): some change to make it
5095 compile with gcc 2.95.2 and stdlibc++-v3
5097 * src/text2.C (MeltFootnoteEnvironment): change type o
5098 first_footnote_par_is_not_empty to bool.
5100 * src/lyxparagraph.h: make text private. Changes in other files
5102 (fitToSize): new function
5103 (setContentsFromPar): new function
5104 (clearContents): new function
5105 (SetChar): new function
5107 * src/paragraph.C (readSimpleWholeFile): deleted.
5109 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5110 the file, just use a simple string instead. Also read the file in
5111 a more maintainable manner.
5113 * src/text2.C (InsertStringA): deleted.
5114 (InsertStringB): deleted.
5116 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5118 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5119 RedoParagraphs from the doublespace handling part, just set status
5120 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5121 done, but perhaps not like this.)
5123 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5125 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5126 character when inserting an inset.
5128 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5130 * src/bufferparams.C (readLanguage): now takes "default" into
5133 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5134 also initialize the toplevel_keymap with the default bindings from
5137 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5139 * all files using lyxrc: have lyxrc as a real variable and not a
5140 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5143 * src/lyxrc.C: remove double call to defaultKeyBindings
5145 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5146 toolbar defauls using lyxlex. Remove enums, structs, functions
5149 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5150 toolbar defaults. Also store default keybindings in a map.
5152 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5153 storing the toolbar defaults without any xforms dependencies.
5155 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5156 applied. Changed to use iterators.
5158 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5160 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5161 systems that don't have LINGUAS set to begin with.
5163 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5165 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5166 the list by Dekel Tsur.
5168 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5170 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5171 * src/insets/form_graphics.C: ditto.
5173 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5175 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5177 * src/bufferparams.C (readLanguage): use the new language map
5179 * src/intl.C (InitKeyMapper): use the new language map
5181 * src/lyx_gui.C (create_forms): use the new language map
5183 * src/language.[Ch]: New files. Used for holding the information
5184 about each language. Now! Use this new language map enhance it and
5185 make it really usable for our needs.
5187 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5189 * screen.C (ShowCursor): Removed duplicate code.
5190 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5191 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5193 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5196 * src/text.C Added TransformChar method. Used for rendering Arabic
5197 text correctly (change the glyphs of the letter according to the
5198 position in the word)
5203 * src/lyxrc.C Added lyxrc command {language_command_begin,
5204 language_command_end,language_command_ltr,language_command_rtl,
5205 language_package} which allows the use of either arabtex or Omega
5208 * src/lyx_gui.C (init)
5210 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5211 to use encoding for menu fonts which is different than the encoding
5214 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5215 do not load the babel package.
5216 To write an English document with Hebrew/Arabic, change the document
5217 language to "english".
5219 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5220 (alphaCounter): changed to return char
5221 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5223 * lib/lyxrc.example Added examples for Hebrew/Arabic
5226 * src/layout.C Added layout command endlabeltype
5228 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5230 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5232 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5234 * src/mathed/math_delim.C (search_deco): return a
5235 math_deco_struct* instead of index.
5237 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5239 * All files with a USE_OSTREAM_ONLY within: removed all code that
5240 was unused when USE_OSTREAM_ONLY is defined.
5242 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5243 of any less. Removed header and using.
5245 * src/text.C (GetVisibleRow): draw the string "Page Break
5246 (top/bottom)" on screen when drawing a pagebreak line.
5248 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5250 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5252 * src/mathed/math_macro.C (draw): do some cast magic.
5255 * src/mathed/math_defs.h: change byte* argument to byte const*.
5257 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5259 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5260 know it is right to return InsetFoot* too, but cxx does not like
5263 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5265 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5267 * src/mathed/math_delim.C: change == to proper assignment.
5269 2000-03-09 Juergen Vigna <jug@sad.it>
5271 * src/insets/insettext.C (setPos): fixed various cursor positioning
5272 problems (via mouse and cursor-keys)
5273 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5274 inset (still a small display problem but it works ;)
5276 * src/insets/insetcollapsable.C (draw): added button_top_y and
5277 button_bottom_y to have correct values for clicking on the inset.
5279 * src/support/lyxalgo.h: commented out 'using std::less'
5281 2000-03-08 Juergen Vigna <jug@sad.it>
5283 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5284 Button-Release event closes as it is alos the Release-Event
5287 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5289 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5291 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5292 can add multiple spaces in Scrap (literate programming) styles...
5293 which, by the way, is how I got hooked on LyX to begin with.
5295 * src/mathed/formula.C (Write): Added dummy variable to an
5296 inset::Latex() call.
5297 (Latex): Add free_spacing boolean to inset::Latex()
5299 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5301 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5302 virtual function to include the free_spacing boolean from
5303 the containing paragraph's style.
5305 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5306 Added free_spacing boolean arg to match inset.h
5308 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5309 Added free_spacing boolean arg to match inset.h
5311 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5312 Added free_spacing boolean and made sure that if in a free_spacing
5313 paragraph, that we output normal space if there is a protected space.
5315 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5316 Added free_spacing boolean arg to match inset.h
5318 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5319 Added free_spacing boolean arg to match inset.h
5321 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5322 Added free_spacing boolean arg to match inset.h
5324 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5325 Added free_spacing boolean arg to match inset.h
5327 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5328 Added free_spacing boolean arg to match inset.h
5330 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5331 free_spacing boolean arg to match inset.h
5333 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5334 Added free_spacing boolean arg to match inset.h
5336 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5337 Added free_spacing boolean arg to match inset.h
5339 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5340 Added free_spacing boolean arg to match inset.h
5342 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5343 Added free_spacing boolean arg to match inset.h
5345 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5346 Added free_spacing boolean arg to match inset.h
5348 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5349 free_spacing boolean arg to match inset.h
5351 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5352 free_spacing boolean arg to match inset.h
5354 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5355 ignore free_spacing paragraphs. The user's spaces are left
5358 * src/text.C (InsertChar): Fixed the free_spacing layout
5359 attribute behavior. Now, if free_spacing is set, you can
5360 add multiple spaces in a paragraph with impunity (and they
5361 get output verbatim).
5362 (SelectSelectedWord): Added dummy argument to inset::Latex()
5365 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5368 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5369 paragraph layouts now only input a simple space instead.
5370 Special character insets don't make any sense in free-spacing
5373 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5374 hard-spaces in the *input* file to simple spaces if the layout
5375 is free-spacing. This converts old files which had to have
5376 hard-spaces in free-spacing layouts where a simple space was
5378 (writeFileAscii): Added free_spacing check to pass to the newly
5379 reworked inset::Latex(...) methods. The inset::Latex() code
5380 ensures that hard-spaces in free-spacing paragraphs get output
5381 as spaces (rather than "~").
5383 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5385 * src/mathed/math_delim.C (draw): draw the empty placeholder
5386 delims with a onoffdash line.
5387 (struct math_deco_compare): struct that holds the "functors" used
5388 for the sort and the binary search in math_deco_table.
5389 (class init_deco_table): class used for initial sort of the
5391 (search_deco): use lower_bound to do a binary search in the
5394 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5396 * src/lyxrc.C: a small secret thingie...
5398 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5399 and to not flush the stream as often as it used to.
5401 * src/support/lyxalgo.h: new file
5402 (sorted): template function used for checking if a sequence is
5403 sorted or not. Two versions with and without user supplied
5404 compare. Uses same compare as std::sort.
5406 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5407 it and give warning on lyxerr.
5409 (struct compare_tags): struct with function operators used for
5410 checking if sorted, sorting and lower_bound.
5411 (search_kw): use lower_bound instead of manually implemented
5414 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5416 * src/insets/insetcollapsable.h: fix Clone() declaration.
5417 * src/insets/insetfoot.h: ditto.
5419 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5421 2000-03-08 Juergen Vigna <jug@sad.it>
5423 * src/insets/lyxinset.h: added owner call which tells us if
5424 this inset is inside another inset. Changed also the return-type
5425 of Editable to an enum so it tells clearer what the return-value is.
5427 * src/insets/insettext.C (computeTextRows): fixed computing of
5428 textinsets which split automatically on more rows.
5430 * src/insets/insetert.[Ch]: changed this to be of BaseType
5433 * src/insets/insetfoot.[Ch]: added footnote inset
5435 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5436 collapsable insets (like footnote, ert, ...)
5438 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5440 * src/lyxdraw.h: remvoe file
5442 * src/lyxdraw.C: remove file
5444 * src/insets/insettext.C: added <algorithm>.
5446 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5448 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5449 (matrix_cb): case MM_OK use string stream
5451 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5454 * src/mathed/math_macro.C (draw): use string stream
5455 (Metrics): use string stream
5457 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5458 directly to the ostream.
5460 * src/vspace.C (asString): use string stream.
5461 (asString): use string stream
5462 (asLatexString): use string stream
5464 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5465 setting Spacing::Other.
5467 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5468 sprintf when creating the stretch vale.
5470 * src/text2.C (alphaCounter): changed to return a string and to
5471 not use a static variable internally. Also fixed a one-off bug.
5472 (SetCounter): changed the drawing of the labels to use string
5473 streams instead of sprintf.
5475 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5476 manipulator to use a scheme that does not require library support.
5477 This is also the way it is done in the new GNU libstdc++. Should
5478 work with DEC cxx now.
5480 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5482 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5483 end. This fixes a bug.
5485 * src/mathed (all files concerned with file writing): apply the
5486 USE_OSTREAM_ONLY changes to mathed too.
5488 * src/support/DebugStream.h: make the constructor explicit.
5490 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5491 count and ostream squashed.
5493 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5495 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5497 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5498 ostringstream uses STL strings, and we might not.
5500 * src/insets/insetspecialchar.C: add using directive.
5501 * src/insets/insettext.C: ditto.
5503 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5505 * lib/layouts/seminar.layout: feeble attempt at a layout for
5506 seminar.cls, far from completet and could really use some looking
5507 at from people used to write layout files.
5509 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5510 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5511 a lot nicer and works nicely with ostreams.
5513 * src/mathed/formula.C (draw): a slightly different solution that
5514 the one posted to the list, but I think this one works too. (font
5515 size wrong in headers.)
5517 * src/insets/insettext.C (computeTextRows): some fiddling on
5518 Jürgens turf, added some comments that he should read.
5520 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5521 used and it gave compiler warnings.
5522 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5525 * src/lyx_gui.C (create_forms): do the right thing when
5526 show_banner is true/false.
5528 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5529 show_banner is false.
5531 * most file writing files: Now use iostreams to do almost all of
5532 the writing. Also instead of passing string &, we now use
5533 stringstreams. mathed output is still not adapted to iostreams.
5534 This change can be turned off by commenting out all the occurences
5535 of the "#define USE_OSTREAM_ONLY 1" lines.
5537 * src/WorkArea.C (createPixmap): don't output debug messages.
5538 (WorkArea): don't output debug messages.
5540 * lib/lyxrc.example: added a comment about the new variable
5543 * development/Code_rules/Rules: Added some more commente about how
5544 to build class interfaces and on how better encapsulation can be
5547 2000-03-03 Juergen Vigna <jug@sad.it>
5549 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5550 automatically with the width of the LyX-Window
5552 * src/insets/insettext.C (computeTextRows): fixed update bug in
5553 displaying text-insets (scrollvalues where not initialized!)
5555 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5557 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5558 id in the check of the result from lower_bound is not enough since
5559 lower_bound can return last too, and then res->id will not be a
5562 * all insets and some code that use them: I have conditionalized
5563 removed the Latex(string & out, ...) this means that only the
5564 Latex(ostream &, ...) will be used. This is a work in progress to
5565 move towards using streams for all output of files.
5567 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5570 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5572 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5573 routine (this fixes bug where greek letters were surrounded by too
5576 * src/support/filetools.C (findtexfile): change a bit the search
5577 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5578 no longer passed to kpsewhich, we may have to change that later.
5580 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5581 warning options to avoid problems with X header files (from Angus
5583 * acinclude.m4: regenerated.
5585 2000-03-02 Juergen Vigna <jug@sad.it>
5587 * src/insets/insettext.C (WriteParagraphData): Using the
5588 par->writeFile() function for writing paragraph-data.
5589 (Read): Using buffer->parseSingleLyXformat2Token()-function
5590 for parsing paragraph data!
5592 * src/buffer.C (readLyXformat2): removed all parse data and using
5593 the new parseSingleLyXformat2Token()-function.
5594 (parseSingleLyXformat2Token): added this function to parse (read)
5595 lyx-file-format (this is called also from text-insets now!)
5597 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5599 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5602 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5603 directly instead of going through a func. One very bad thing: a
5604 static LyXFindReplace, but I don't know where to place it.
5606 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5607 string instead of char[]. Also changed to static.
5608 (GetSelectionOrWordAtCursor): changed to static inline
5609 (SetSelectionOverLenChars): ditto.
5611 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5612 current_view and global variables. both classes has changed names
5613 and LyXFindReplace is not inherited from SearchForm.
5615 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5616 fl_form_search form.
5618 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5620 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5622 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5623 bound (from Kayvan).
5625 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5627 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5629 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5631 * some things that I should comment but the local pub says head to
5634 * comment out all code that belongs to the Roff code for Ascii
5635 export of tables. (this is unused)
5637 * src/LyXView.C: use correct type for global variable
5638 current_layout. (LyXTextClass::size_type)
5640 * some code to get the new insetgraphics closer to working I'd be
5641 grateful for any help.
5643 * src/BufferView2.C (insertInset): use the return type of
5644 NumberOfLayout properly. (also changes in other files)
5646 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5647 this as a test. I want to know what breaks because of this.
5649 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5651 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5653 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5654 to use a \makebox in the label, this allows proper justification
5655 with out using protected spaces or multiple hfills. Now it is
5656 "label" for left justified, "\hfill label\hfill" for center, and
5657 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5658 should be changed accordingly.
5660 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5662 * src/lyxtext.h: change SetLayout() to take a
5663 LyXTextClass::size_type instead of a char (when there is more than
5664 127 layouts in a class); also change type of copylayouttype.
5665 * src/text2.C (SetLayout): ditto.
5666 * src/LyXView.C (updateLayoutChoice): ditto.
5668 * src/LaTeX.C (scanLogFile): errors where the line number was not
5669 given just after the '!'-line were ignored (from Dekel Tsur).
5671 * lib/lyxrc.example: fix description of \date_insert_format
5673 * lib/layouts/llncs.layout: new layout, contributed by Martin
5676 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5678 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5679 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5680 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5681 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5682 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5683 paragraph.C, text.C, text2.C)
5685 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5687 * src/insets/insettext.C (LocalDispatch): remove extra break
5690 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5691 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5693 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5694 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5696 * src/insets/insetbib.h: move InsetBibkey::Holder and
5697 InsetCitation::Holder in public space.
5699 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5701 * src/insets/insettext.h: small change to get the new files from
5702 Juergen to compile (use "string", not "class string").
5704 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5705 const & as parameter to LocalDispatch, use LyXFont const & as
5706 paramter to some other func. This also had impacto on lyxinsets.h
5707 and the two mathed insets.
5709 2000-02-24 Juergen Vigna <jug@sad.it>
5712 * src/commandtags.h:
5714 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5718 * src/BufferView2.C: added/updated code for various inset-functions
5720 * src/insets/insetert.[Ch]: added implementation of InsetERT
5722 * src/insets/insettext.[Ch]: added implementation of InsetText
5724 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5725 (draw): added preliminary code for inset scrolling not finshed yet
5727 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5728 as it is in lyxfunc.C now
5730 * src/insets/lyxinset.h: Added functions for text-insets
5732 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5734 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5735 BufferView and reimplement the list as a queue put inside its own
5738 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5740 * several files: use the new interface to the "updateinsetlist"
5742 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5744 (work_area_handler): call BufferView::trippleClick on trippleclick.
5746 * src/BufferView.C (doubleClick): new function, selects word on
5748 (trippleClick): new function, selects line on trippleclick.
5750 2000-02-22 Allan Rae <rae@lyx.org>
5752 * lib/bind/xemacs.bind: buffer-previous not supported
5754 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5756 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5759 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5761 * src/bufferlist.C: get rid of current_view from this file
5763 * src/spellchecker.C: get rid of current_view from this file
5765 * src/vspace.C: get rid of current_view from this file
5766 (inPixels): added BufferView parameter for this func
5767 (asLatexCommand): added a BufferParams for this func
5769 * src/text.C src/text2.C: get rid of current_view from these
5772 * src/lyxfont.C (getFontDirection): move this function here from
5775 * src/bufferparams.C (getDocumentDirection): move this function
5778 * src/paragraph.C (getParDirection): move this function here from
5780 (getLetterDirection): ditto
5782 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5784 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5785 resize due to wrong pixmap beeing used. Also took the opurtunity
5786 to make the LyXScreen stateless on regard to WorkArea and some
5787 general cleanup in the same files.
5789 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5791 * src/Makefile.am: add missing direction.h
5793 * src/PainterBase.h: made the width functions const.
5795 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5798 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5800 * src/insets/insetlatexaccent.C (draw): make the accents draw
5801 better, at present this will only work well with iso8859-1.
5803 * several files: remove the old drawing code, now we use the new
5806 * several files: remove support for mono_video, reverse_video and
5809 2000-02-17 Juergen Vigna <jug@sad.it>
5811 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5812 int ** as we have to return the pointer, otherwise we have only
5813 NULL pointers in the returning function.
5815 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5817 * src/LaTeX.C (operator()): quote file name when running latex.
5819 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5821 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5822 (bubble tip), this removes our special handling of this.
5824 * Remove all code that is unused now that we have the new
5825 workarea. (Code that are not active when NEW_WA is defined.)
5827 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5829 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5831 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5832 nonexisting layout; correctly redirect obsoleted layouts.
5834 * lib/lyxrc.example: document \view_dvi_paper_option
5836 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5839 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5840 (PreviewDVI): handle the view_dvi_paper_option variable.
5841 [Both from Roland Krause]
5843 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5845 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5846 char const *, int, LyXFont)
5847 (text(int, int, string, LyXFont)): ditto
5849 * src/text.C (InsertCharInTable): attempt to fix the double-space
5850 feature in tables too.
5851 (BackspaceInTable): ditto.
5852 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5854 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5856 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5858 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5859 newly found text in textcache to this.
5860 (buffer): set the owner of the text put into the textcache to 0
5862 * src/insets/figinset.C (draw): fixed the drawing of figures with
5865 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5866 drawing of mathframe, hfills, protected space, table lines. I have
5867 now no outstanding drawing problems with the new Painter code.
5869 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5871 * src/PainterBase.C (ellipse, circle): do not specify the default
5874 * src/LColor.h: add using directive.
5876 * src/Painter.[Ch]: change return type of methods from Painter& to
5877 PainterBase&. Add a using directive.
5879 * src/WorkArea.C: wrap xforms callbacks in C functions
5882 * lib/layouts/foils.layout: font fix and simplifications from Carl
5885 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5887 * a lot of files: The Painter, LColor and WorkArea from the old
5888 devel branch has been ported to lyx-devel. Some new files and a
5889 lot of #ifdeffed code. The new workarea is enabled by default, but
5890 if you want to test the new Painter and LColor you have to compile
5891 with USE_PAINTER defined (do this in config.h f.ex.) There are
5892 still some rought edges, and I'd like some help to clear those
5893 out. It looks stable (loads and displays the Userguide very well).
5896 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5898 * src/buffer.C (pop_tag): revert to the previous implementation
5899 (use a global variable for both loops).
5901 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5903 * src/lyxrc.C (LyXRC): change slightly default date format.
5905 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5906 there is an English text with a footnote that starts with a Hebrew
5907 paragraph, or vice versa.
5908 (TeXFootnote): ditto.
5910 * src/text.C (LeftMargin): allow for negative values for
5911 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5914 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5915 for input encoding (cyrillic)
5917 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5919 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5922 * src/toolbar.C (set): ditto
5923 * src/insets/insetbib.C (create_form_citation_form): ditto
5925 * lib/CREDITS: added Dekel Tsur.
5927 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5928 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5929 hebrew supports files from Dekel Tsur.
5931 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5932 <tzafrir@technion.ac.il>
5934 * src/lyxrc.C: put \date_insert_format at the right place.
5936 * src/buffer.C (makeLaTeXFile): fix the handling of
5937 BufferParams::sides when writing out latex files.
5939 * src/BufferView2.C: add a "using" directive.
5941 * src/support/lyxsum.C (sum): when we use lyxstring,
5942 ostringstream::str needs an additional .c_str().
5944 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5946 * src/support/filetools.C (ChangeExtension): patch from Etienne
5949 * src/TextCache.C (show): remove const_cast and make second
5950 parameter non-const LyXText *.
5952 * src/TextCache.h: use non const LyXText in show.
5954 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5957 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5959 * src/support/lyxsum.C: rework to be more flexible.
5961 * several places: don't check if a pointer is 0 if you are going
5964 * src/text.C: remove some dead code.
5966 * src/insets/figinset.C: remove some dead code
5968 * src/buffer.C: move the BufferView funcs to BufferView2.C
5969 remove all support for insetlatexdel
5970 remove support for oldpapersize stuff
5971 made some member funcs const
5973 * src/kbmap.C: use a std::list to store the bindings in.
5975 * src/BufferView2.C: new file
5977 * src/kbsequence.[Ch]: new files
5979 * src/LyXAction.C + others: remove all trace of buffer-previous
5981 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5982 only have one copy in the binary of this table.
5984 * hebrew patch: moved some functions from LyXText to more
5985 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5987 * several files: remove support for XForms older than 0.88
5989 remove some #if 0 #endif code
5991 * src/TextCache.[Ch]: new file. Holds the textcache.
5993 * src/BufferView.C: changes to use the new TextCache interface.
5994 (waitForX): remove the now unused code.
5996 * src/BackStack.h: remove some commented code
5998 * lib/bind/emacs.bind: remove binding for buffer-previous
6000 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6002 * applied the hebrew patch.
6004 * src/lyxrow.h: make sure that all Row variables are initialized.
6006 * src/text2.C (TextHandleUndo): comment out a delete, this might
6007 introduce a memory leak, but should also help us to not try to
6008 read freed memory. We need to look at this one.
6010 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6011 (LyXParagraph): initalize footnotekind.
6013 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6014 forgot this when applying the patch. Please heed the warnings.
6016 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6017 (aka. reformat problem)
6019 * src/bufferlist.C (exists): made const, and use const_iterator
6020 (isLoaded): new func.
6021 (release): use std::find to find the correct buffer.
6023 * src/bufferlist.h: made getState a const func.
6024 made empty a const func.
6025 made exists a const func.
6028 2000-02-01 Juergen Vigna <jug@sad.it>
6030 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6032 * po/it.po: updated a bit the italian po file and also changed the
6033 'file nuovo' for newfile to 'filenuovo' without a space, this did
6036 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6037 for the new insert_date command.
6039 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6040 from jdblair, to insert a date into the current text conforming to
6041 a strftime format (for now only considering the locale-set and not
6042 the document-language).
6044 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6046 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6047 Bounds Read error seen by purify. The problem was that islower is
6048 a macros which takes an unsigned char and uses it as an index for
6049 in array of characters properties (and is thus subject to the
6053 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6054 correctly the paper sides radio buttons.
6055 (UpdateDocumentButtons): ditto.
6057 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6059 * src/kbmap.C (getsym + others): change to return unsigned int,
6060 returning a long can give problems on 64 bit systems. (I assume
6061 that int is 32bit on 64bit systems)
6063 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6065 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6066 LyXLookupString to be zero-terminated. Really fixes problems seen
6069 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6071 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6072 write a (char*)0 to the lyxerr stream.
6074 * src/lastfiles.C: move algorithm before the using statemets.
6076 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6078 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6079 complains otherwise).
6080 * src/table.C: ditto
6082 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6085 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6086 that I removed earlier... It is really needed.
6088 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6090 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6092 * INSTALL: update xforms home page URL.
6094 * lib/configure.m4: fix a bug with unreadable layout files.
6096 * src/table.C (calculate_width_of_column): add "using std::max"
6099 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6101 * several files: marked several lines with "DEL LINE", this is
6102 lines that can be deleted without changing anything.
6103 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6104 checks this anyway */
6107 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6109 * src/DepTable.C (update): add a "+" at the end when the checksum
6110 is different. (debugging string only)
6112 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6113 the next inset to not be displayed. This should also fix the list
6114 of labels in the "Insert Crossreference" dialog.
6116 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6118 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6119 when regex was not found.
6121 * src/support/lstrings.C (lowercase): use handcoded transform always.
6124 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6125 old_cursor.par->prev could be 0.
6127 * several files: changed post inc/dec to pre inc/dec
6129 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6130 write the lastfiles to file.
6132 * src/BufferView.C (buffer): only show TextCache info when debugging
6134 (resizeCurrentBuffer): ditto
6135 (workAreaExpose): ditto
6137 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6139 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6141 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6142 a bit better by removing the special case for \i and \j.
6144 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6146 * src/lyx_main.C (easyParse): remove test for bad comand line
6147 options, since this broke all xforms-related parsing.
6149 * src/kbmap.C (getsym): set return type to unsigned long, as
6150 declared in header. On an alpha, long is _not_ the same as int.
6152 * src/support/LOstream.h: add a "using std::flush;"
6154 * src/insets/figinset.C: ditto.
6156 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6158 * src/bufferlist.C (write): use blinding fast file copy instead of
6159 "a char at a time", now we are doing it the C++ way.
6161 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6162 std::list<int> instead.
6163 (addpidwait): reflect move to std::list<int>
6164 (sigchldchecker): ditto
6166 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6169 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6170 that obviously was wrong...
6172 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6173 c, this avoids warnings with purify and islower.
6175 * src/insets/figinset.C: rename struct queue to struct
6176 queue_element and rewrite to use a std::queue. gsqueue is now a
6177 std::queue<queue_element>
6178 (runqueue): reflect move to std::queue
6181 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6182 we would get "1" "0" instead of "true" "false. Also make the tostr
6185 2000-01-21 Juergen Vigna <jug@sad.it>
6187 * src/buffer.C (writeFileAscii): Disabled code for special groff
6188 handling of tabulars till I fix this in table.C
6190 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6192 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6194 * src/support/lyxlib.h: ditto.
6196 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6198 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6199 and 'j' look better. This might fix the "macron" bug that has been
6202 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6203 functions as one template function. Delete the old versions.
6205 * src/support/lyxsum.C: move using std::ifstream inside
6208 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6211 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6213 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6215 * src/insets/figinset.C (InitFigures): use new instead of malloc
6216 to allocate memory for figures and bitmaps.
6217 (DoneFigures): use delete[] instead of free to deallocate memory
6218 for figures and bitmaps.
6219 (runqueue): use new to allocate
6220 (getfigdata): use new/delete[] instead of malloc/free
6221 (RegisterFigure): ditto
6223 * some files: moved some declarations closer to first use, small
6224 whitespace changes use preincrement instead of postincrement where
6225 it does not make a difference.
6227 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6228 step on the way to use stl::containers for key maps.
6230 * src/bufferlist.h: add a typedef for const_iterator and const
6231 versions of begin and end.
6233 * src/bufferlist.[Ch]: change name of member variable _state to
6234 state_. (avoid reserved names)
6236 (getFileNames): returns the filenames of the buffers in a vector.
6238 * configure.in (ALL_LINGUAS): added ro
6240 * src/support/putenv.C: new file
6242 * src/support/mkdir.C: new file
6244 2000-01-20 Allan Rae <rae@lyx.org>
6246 * lib/layouts/IEEEtran.layout: Added several theorem environments
6248 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6249 couple of minor additions.
6251 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6252 (except for those in footnotes of course)
6254 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6256 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6258 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6259 std::sort and std::lower_bound instead of qsort and handwritten
6261 (struct compara): struct that holds the functors used by std::sort
6262 and std::lower_bound in MathedLookupBOP.
6264 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6266 * src/support/LAssert.h: do not do partial specialization. We do
6269 * src/support/lyxlib.h: note that lyx::getUserName() and
6270 lyx::date() are not in use right now. Should these be suppressed?
6272 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6273 (makeLinuxDocFile): do not put date and user name in linuxdoc
6276 * src/support/lyxlib.h (kill): change first argument to long int,
6277 since that's what solaris uses.
6279 * src/support/kill.C (kill): fix declaration to match prototype.
6281 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6282 actually check whether namespaces are supported. This is not what
6285 * src/support/lyxsum.C: add a using directive.
6287 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6289 * src/support/kill.C: if we have namespace support we don't have
6290 to include lyxlib.h.
6292 * src/support/lyxlib.h: use namespace lyx if supported.
6294 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6296 * src/support/date.C: new file
6298 * src/support/chdir.C: new file
6300 * src/support/getUserName.C: new file
6302 * src/support/getcwd.C: new file
6304 * src/support/abort.C: new file
6306 * src/support/kill.C: new file
6308 * src/support/lyxlib.h: moved all the functions in this file
6309 insede struct lyx. Added also kill and abort to this struct. This
6310 is a way to avoid the "kill is not defined in <csignal>", we make
6311 C++ wrappers for functions that are not ANSI C or ANSI C++.
6313 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6314 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6315 lyx it has been renamed to sum.
6317 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6319 * src/text.C: add using directives for std::min and std::max.
6321 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6323 * src/texrow.C (getIdFromRow): actually return something useful in
6324 id and pos. Hopefully fixes the bug with positionning of errorbox
6327 * src/lyx_main.C (easyParse): output an error and exit if an
6328 incorrect command line option has been given.
6330 * src/spellchecker.C (ispell_check_word): document a memory leak.
6332 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6333 where a "struct utimbuf" is allocated with "new" and deleted with
6336 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6338 * src/text2.C (CutSelection): don't delete double spaces.
6339 (PasteSelection): ditto
6340 (CopySelection): ditto
6342 * src/text.C (Backspace): don't delete double spaces.
6344 * src/lyxlex.C (next): fix a bug that were only present with
6345 conformant std::istream::get to read comment lines, use
6346 std::istream::getline instead. This seems to fix the problem.
6348 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6350 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6351 allowed to insert space before space" editing problem. Please read
6352 commends at the beginning of the function. Comments about usage
6355 * src/text.C (InsertChar): fix for the "not allowed to insert
6356 space before space" editing problem.
6358 * src/text2.C (DeleteEmptyParagraphMechanism): when
6359 IsEmptyTableRow can only return false this last "else if" will
6360 always be a no-op. Commented out.
6362 * src/text.C (RedoParagraph): As far as I can understand tmp
6363 cursor is not really needed.
6365 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6366 present it could only return false anyway.
6367 (several functions): Did something not so smart...added a const
6368 specifier on a lot of methods.
6370 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6371 and add a tmp->text.resize. The LyXParagraph constructor does the
6373 (BreakParagraphConservative): ditto
6375 * src/support/path.h (Path): add a define so that the wrong usage
6376 "Path("/tmp") will be flagged as a compilation error:
6377 "`unnamed_Path' undeclared (first use this function)"
6379 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6381 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6382 which was bogus for several reasons.
6384 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6388 * autogen.sh: do not use "type -path" (what's that anyway?).
6390 * src/support/filetools.C (findtexfile): remove extraneous space
6391 which caused a kpsewhich warning (at least with kpathsea version
6394 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6396 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6398 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6400 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6402 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6404 * src/paragraph.C (BreakParagraph): do not reserve space on text
6405 if we don't need to (otherwise, if pos_end < pos, we end up
6406 reserving huge amounts of memory due to bad unsigned karma).
6407 (BreakParagraphConservative): ditto, although I have not seen
6408 evidence the bug can happen here.
6410 * src/lyxparagraph.h: add a using std::list.
6412 2000-01-11 Juergen Vigna <jug@sad.it>
6414 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6417 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6419 * src/vc-backend.C (doVCCommand): change to be static and take one
6420 more parameter: the path to chdir too be fore executing the command.
6421 (retrive): new function equiv to "co -r"
6423 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6424 file_not_found_hook is true.
6426 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6428 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6429 if a file is readwrite,readonly...anything else.
6431 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6433 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6434 (CreatePostscript): name change from MenuRunDVIPS (or something)
6435 (PreviewPostscript): name change from MenuPreviewPS
6436 (PreviewDVI): name change from MenuPreviewDVI
6438 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6439 \view_pdf_command., \pdf_to_ps_command
6441 * lib/configure.m4: added search for PDF viewer, and search for
6442 PDF to PS converter.
6443 (lyxrc.defaults output): add \pdflatex_command,
6444 \view_pdf_command and \pdf_to_ps_command.
6446 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6448 * src/bufferlist.C (write): we don't use blocksize for anything so
6451 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6453 * src/support/block.h: disable operator T* (), since it causes
6454 problems with both compilers I tried. See comments in the file.
6456 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6459 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6460 variable LYX_DIR_10x to LYX_DIR_11x.
6462 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6464 * INSTALL: document --with-lyxname.
6467 * configure.in: new configure flag --with-lyxname which allows to
6468 choose the name under which lyx is installed. Default is "lyx", of
6469 course. It used to be possible to do this with --program-suffix,
6470 but the later has in fact a different meaning for autoconf.
6472 * src/support/lstrings.h (lstrchr): reformat a bit.
6474 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6475 * src/mathed/math_defs.h: ditto.
6477 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6479 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6480 true, decides if we create a backup file or not when saving. New
6481 tag and variable \pdf_mode, defaults to false. New tag and
6482 variable \pdflatex_command, defaults to pdflatex. New tag and
6483 variable \view_pdf_command, defaults to xpdf. New tag and variable
6484 \pdf_to_ps_command, defaults to pdf2ps.
6486 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6488 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6489 does not have a BufferView.
6490 (unlockInset): ditto + don't access the_locking_inset if the
6491 buffer does not have a BufferView.
6493 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6494 certain circumstances so that we don't continue a keyboard
6495 operation long after the key was released. Try f.ex. to load a
6496 large document, press PageDown for some seconds and then release
6497 it. Before this change the document would contine to scroll for
6498 some time, with this change it stops imidiatly.
6500 * src/support/block.h: don't allocate more space than needed. As
6501 long as we don't try to write to the arr[x] in a array_type arr[x]
6502 it is perfectly ok. (if you write to it you might segfault).
6503 added operator value_type*() so that is possible to pass the array
6504 to functions expecting a C-pointer.
6506 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6509 * intl/*: updated to gettext 0.10.35, tried to add our own
6510 required modifications. Please verify.
6512 * po/*: updated to gettext 0.10.35, tried to add our own required
6513 modifications. Please verify.
6515 * src/support/lstrings.C (tostr): go at fixing the problem with
6516 cxx and stringstream. When stringstream is used return
6517 oss.str().c_str() so that problems with lyxstring and basic_string
6518 are avoided. Note that the best solution would be for cxx to use
6519 basic_string all the way, but it is not conformant yet. (it seems)
6521 * src/lyx_cb.C + other files: moved several global functions to
6522 class BufferView, some have been moved to BufferView.[Ch] others
6523 are still located in lyx_cb.C. Code changes because of this. (part
6524 of "get rid of current_view project".)
6526 * src/buffer.C + other files: moved several Buffer functions to
6527 class BufferView, the functions are still present in buffer.C.
6528 Code changes because of this.
6530 * config/lcmessage.m4: updated to most recent. used when creating
6533 * config/progtest.m4: updated to most recent. used when creating
6536 * config/gettext.m4: updated to most recent. applied patch for
6539 * config/gettext.m4.patch: new file that shows what changes we
6540 have done to the local copy of gettext.m4.
6542 * config/libtool.m4: new file, used in creation of acinclude.m4
6544 * config/lyxinclude.m4: new file, this is the lyx created m4
6545 macros, used in making acinclude.m4.
6547 * autogen.sh: GNU m4 discovered as a separate task not as part of
6548 the lib/configure creation.
6549 Generate acinlucde from files in config. Actually cat
6550 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6551 easier to upgrade .m4 files that really are external.
6553 * src/Spacing.h: moved using std::istringstream to right after
6554 <sstream>. This should fix the problem seen with some compilers.
6556 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6558 * src/lyx_cb.C: began some work to remove the dependency a lot of
6559 functions have on BufferView::text, even if not really needed.
6560 (GetCurrentTextClass): removed this func, it only hid the
6563 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6564 forgot this in last commit.
6566 * src/Bullet.C (bulletEntry): use static char const *[] for the
6567 tables, becuase of this the return arg had to change to string.
6569 (~Bullet): removed unneeded destructor
6571 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6572 (insetSleep): moved from Buffer
6573 (insetWakeup): moved from Buffer
6574 (insetUnlock): moved from Buffer
6576 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6577 from Buffer to BufferView.
6579 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6581 * config/ltmain.sh: updated to version 1.3.4 of libtool
6583 * config/ltconfig: updated to version 1.3.4 of libtool
6585 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6588 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6589 Did I get that right?
6591 * src/lyxlex.h: add a "using" directive or two.
6592 * src/Spacing.h: ditto.
6593 * src/insets/figinset.C: ditto.
6594 * src/support/filetools.C: ditto.
6595 * src/support/lstrings.C: ditto.
6596 * src/BufferView.C: ditto.
6597 * src/bufferlist.C: ditto.
6598 * src/lyx_cb.C: ditto.
6599 * src/lyxlex.C: ditto.
6601 * NEWS: add some changes for 1.1.4.
6603 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6605 * src/BufferView.C: first go at a TextCache to speed up switching
6608 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6610 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6611 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6612 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6613 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6616 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6617 members of the struct are correctly initialized to 0 (detected by
6619 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6620 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6622 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6623 pidwait, since it was allocated with "new". This was potentially
6624 very bad. Thanks to Michael Schmitt for running purify for us.
6627 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6629 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6631 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6633 1999-12-30 Allan Rae <rae@lyx.org>
6635 * lib/templates/IEEEtran.lyx: minor change
6637 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6638 src/mathed/formula.C (LocalDispatch): askForText changes
6640 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6641 know when a user has cancelled input. Fixes annoying problems with
6642 inserting labels and version control.
6644 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6646 * src/support/lstrings.C (tostr): rewritten to use strstream and
6649 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6651 * src/support/filetools.C (IsFileWriteable): use fstream to check
6652 (IsDirWriteable): use fileinfo to check
6654 * src/support/filetools.h (FilePtr): whole class deleted
6656 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6658 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6660 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6662 * src/bufferlist.C (write): use ifstream and ofstream instead of
6665 * src/Spacing.h: use istrstream instead of sscanf
6667 * src/mathed/math_defs.h: change first arg to istream from FILE*
6669 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6671 * src/mathed/math_parser.C: have yyis to be an istream
6672 (LexGetArg): use istream (yyis)
6674 (mathed_parse): ditto
6675 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6677 * src/mathed/formula.C (Read): rewritten to use istream
6679 * src/mathed/formulamacro.C (Read): rewritten to use istream
6681 * src/lyxlex.h (~LyXLex): deleted desturctor
6682 (getStream): new function, returns an istream
6683 (getFile): deleted funtion
6684 (IsOK): return is.good();
6686 * src/lyxlex.C (LyXLex): delete file and owns_file
6687 (setFile): open an filebuf and assign that to a istream instead of
6689 (setStream): new function, takes an istream as arg.
6690 (setFile): deleted function
6691 (EatLine): rewritten us use istream instead of FILE*
6695 * src/table.C (LyXTable): use istream instead of FILE*
6696 (Read): rewritten to take an istream instead of FILE*
6698 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6700 * src/buffer.C (Dispatch): remove an extraneous break statement.
6702 * src/support/filetools.C (QuoteName): change to do simple
6703 'quoting'. More work is necessary. Also changed to do nothing
6704 under emx (needs fix too).
6705 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6707 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6708 config.h.in to the AC_DEFINE_UNQUOTED() call.
6709 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6710 needs char * as argument (because Solaris 7 declares it like
6713 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6714 remove definition of BZERO.
6716 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6718 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6719 defined, "lyxregex.h" if not.
6721 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6723 (REGEX): new variable that is set to regex.c lyxregex.h when
6724 AM_CONDITIONAL USE_REGEX is set.
6725 (libsupport_la_SOURCES): add $(REGEX)
6727 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6730 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6733 * configure.in: add call to LYX_REGEX
6735 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6736 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6738 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6740 * lib/bind/fi_menus.bind: new file, from
6741 pauli.virtanen@saunalahti.fi.
6743 * src/buffer.C (getBibkeyList): pass the parameter delim to
6744 InsetInclude::getKeys and InsetBibtex::getKeys.
6746 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6747 is passed to Buffer::getBibkeyList
6749 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6750 instead of the hardcoded comma.
6752 * src/insets/insetbib.C (getKeys): make sure that there are not
6753 leading blanks in bibtex keys. Normal latex does not care, but
6754 harvard.sty seems to dislike blanks at the beginning of citation
6755 keys. In particular, the retturn value of the function is
6757 * INSTALL: make it clear that libstdc++ is needed and that gcc
6758 2.7.x probably does not work.
6760 * src/support/filetools.C (findtexfile): make debug message go to
6762 * src/insets/insetbib.C (getKeys): ditto
6764 * src/debug.C (showTags): make sure that the output is correctly
6767 * configure.in: add a comment for TWO_COLOR_ICON define.
6769 * acconfig.h: remove all the entries that already defined in
6770 configure.in or acinclude.m4.
6772 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6773 to avoid user name, date and copyright.
6775 1999-12-21 Juergen Vigna <jug@sad.it>
6777 * src/table.C (Read): Now read bogus row format informations
6778 if the format is < 5 so that afterwards the table can
6779 be read by lyx but without any format-info. Fixed the
6780 crash we experienced when not doing this.
6782 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6784 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6785 (RedoDrawingOfParagraph): ditto
6786 (RedoParagraphs): ditto
6787 (RemoveTableRow): ditto
6789 * src/text.C (Fill): rename arg paperwidth -> paper_width
6791 * src/buffer.C (insertLyXFile): rename var filename -> fname
6792 (writeFile): rename arg filename -> fname
6793 (writeFileAscii): ditto
6794 (makeLaTeXFile): ditto
6795 (makeLinuxDocFile): ditto
6796 (makeDocBookFile): ditto
6798 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6801 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6803 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6806 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6807 compiled by a C compiler not C++.
6809 * src/layout.h (LyXTextClass): added typedef for const_iterator
6810 (LyXTextClassList): added typedef for const_iterator + member
6811 functions begin and end.
6813 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6814 iterators to fill the choice_class.
6815 (updateLayoutChoice): rewritten to use iterators to fill the
6816 layoutlist in the toolbar.
6818 * src/BufferView.h (BufferView::work_area_width): removed unused
6821 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6823 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6824 (sgmlCloseTag): ditto
6826 * src/support/lstrings.h: return type of countChar changed to
6829 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6830 what version of this func to use. Also made to return unsigned int.
6832 * configure.in: call LYX_STD_COUNT
6834 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6835 conforming std::count.
6837 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6839 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6840 and a subscript would give bad display (patch from Dekel Tsur
6841 <dekel@math.tau.ac.il>).
6843 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6845 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6848 * src/chset.h: add a few 'using' directives
6850 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6851 triggered when no buffer is active
6853 * src/layout.C: removed `break' after `return' in switch(), since
6856 * src/lyx_main.C (init): make sure LyX can be ran in place even
6857 when libtool has done its magic with shared libraries. Fix the
6858 test for the case when the system directory has not been found.
6860 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6861 name for the latex file.
6862 (MenuMakeHTML): ditto
6864 * src/buffer.h: add an optional boolean argument, which is passed
6867 1999-12-20 Allan Rae <rae@lyx.org>
6869 * lib/templates/IEEEtran.lyx: small correction and update.
6871 * configure.in: Attempted to use LYX_PATH_HEADER
6873 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6875 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6876 input from JMarc. Now use preprocessor to find the header.
6877 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6878 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6879 LYX_STL_STRING_FWD. See comments in file.
6881 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6883 * The global MiniBuffer * minibuffer variable is dead.
6885 * The global FD_form_main * fd_form_main variable is dead.
6887 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6889 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6891 * src/table.h: add the LOstream.h header
6892 * src/debug.h: ditto
6894 * src/LyXAction.h: change the explaination of the ReadOnly
6895 attribute: is indicates that the function _can_ be used.
6897 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6900 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6902 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6908 * src/paragraph.C (GetWord): assert on pos>=0
6911 * src/support/lyxstring.C: condition the use of an invariant on
6913 * src/support/lyxstring.h: ditto
6915 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6916 Use LAssert.h instead of plain assert().
6918 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6920 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6921 * src/support/filetools.C: ditto
6923 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6926 * INSTALL: document the new configure flags
6928 * configure.in: suppress --with-debug; add --enable-assertions
6930 * acinclude.m4: various changes in alignment of help strings.
6932 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6934 * src/kbmap.C: commented out the use of the hash map in kb_map,
6935 beginning of movement to a stl::container.
6937 * several files: removed code that was not in effect when
6938 MOVE_TEXT was defined.
6940 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6941 for escaping should not be used. We can discuss if the string
6942 should be enclosed in f.ex. [] instead of "".
6944 * src/trans_mgr.C (insert): use the new returned value from
6945 encodeString to get deadkeys and keymaps done correctly.
6947 * src/chset.C (encodeString): changed to return a pair, to tell
6948 what to use if we know the string.
6950 * src/lyxscreen.h (fillArc): new function.
6952 * src/FontInfo.C (resize): rewritten to use more std::string like
6953 structore, especially string::replace.
6955 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6958 * configure.in (chmod +x some scripts): remove config/gcc-hack
6960 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6962 * src/buffer.C (writeFile): change once again the top comment in a
6963 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6964 instead of an hardcoded version number.
6965 (makeDocBookFile): ditto
6967 * src/version.h: add new define LYX_DOCVERSION
6969 * po/de.po: update from Pit Sütterlin
6970 * lib/bind/de_menus.bind: ditto.
6972 * src/lyxfunc.C (Dispatch): call MenuExport()
6973 * src/buffer.C (Dispatch): ditto
6975 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6976 LyXFunc::Dispatch().
6977 (MenuExport): new function, moved from
6978 LyXFunc::Dispatch().
6980 * src/trans_mgr.C (insert): small cleanup
6981 * src/chset.C (loadFile): ditto
6983 * lib/kbd/iso8859-1.cdef: add missing backslashes
6985 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6987 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6988 help with placing the manually drawn accents better.
6990 (Draw): x2 and hg changed to float to minimize rounding errors and
6991 help place the accents better.
6993 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6994 unsigned short to char is just wrong...cast the char to unsigned
6995 char instead so that the two values can compare sanely. This
6996 should also make the display of insetlatexaccents better and
6997 perhaps also some other insets.
6999 (lbearing): new function
7002 1999-12-15 Allan Rae <rae@lyx.org>
7004 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7005 header that provides a wrapper around the very annoying SGI STL header
7008 * src/support/lyxstring.C, src/LString.h:
7009 removed old SGI-STL-compatability attempts.
7011 * configure.in: Use LYX_STL_STRING_FWD.
7013 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7014 stl_string_fwd.h is around and try to determine it's location.
7015 Major improvement over previous SGI STL 3.2 compatability.
7016 Three small problems remain with this function due to my zero
7017 knowledge of autoconf. JMarc and lgb see the comments in the code.
7019 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7021 * src/broken_const.h, config/hack-gcc, config/README: removed
7023 * configure.in: remove --with-gcc-hack option; do not call
7026 * INSTALL: remove documentation of --with-broken-const and
7029 * acconfig.h: remove all trace of BROKEN_CONST define
7031 * src/buffer.C (makeDocBookFile): update version number in output
7033 (SimpleDocBookOnePar): fix an assert when trying to a character
7034 access beyond string length
7037 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7039 * po/de.po: fix the Export menu
7041 * lyx.man: update the description of -dbg
7043 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7044 (commandLineHelp): updated
7045 (easyParse): show list of available debug levels if -dbg is passed
7048 * src/Makefile.am: add debug.C
7050 * src/debug.h: moved some code to debug.C
7052 * src/debug.C: new file. Contains code to set and show debug
7055 * src/layout.C: remove 'break' after 'continue' in switch
7056 statements, since these cannot be reached.
7058 1999-12-13 Allan Rae <rae@lyx.org>
7060 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7061 (in_word_set): hash() -> math_hash()
7063 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7065 * acconfig.h: Added a test for whether we are using exceptions in the
7066 current compilation run. If so USING_EXCEPTIONS is defined.
7068 * config.in: Check for existance of stl_string_fwd.h
7069 * src/LString.h: If compiling --with-included-string and SGI's
7070 STL version 3.2 is present (see above test) we need to block their
7071 forward declaration of string and supply a __get_c_string().
7072 However, it turns out this is only necessary if compiling with
7073 exceptions enabled so I've a bit more to add yet.
7075 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7076 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7077 src/support/LRegex.h, src/undo.h:
7078 Shuffle the order of the included files a little to ensure that
7079 LString.h gets included before anything that includes stl_string_fwd.h
7081 * src/support/lyxstring.C: We need to #include LString.h instead of
7082 lyxstring.h to get the necessary definition of __get_c_string.
7083 (__get_c_string): New function. This is defined static just like SGI's
7084 although why they need to do this I'm not sure. Perhaps it should be
7085 in lstrings.C instead.
7087 * lib/templates/IEEEtran.lyx: New template file.
7089 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7091 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7092 * intl/Makefile.in (MKINSTALLDIRS): ditto
7094 * src/LyXAction.C (init): changed to hold the LFUN data in a
7095 automatic array in stead of in callso to newFunc, this speeds up
7096 compilation a lot. Also all the memory used by the array is
7097 returned when the init is completed.
7099 * a lot of files: compiled with -Wold-style-cast, changed most of
7100 the reported offenders to C++ style casts. Did not change the
7101 offenders in C files.
7103 * src/trans.h (Match): change argument type to unsigned int.
7105 * src/support/DebugStream.C: fix some types on the streambufs so
7106 that it works on a conforming implementation.
7108 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7110 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7112 * src/support/lyxstring.C: remove the inline added earlier since
7113 they cause a bunch of unsatisfied symbols when linking with dec
7114 cxx. Cxx likes to have the body of inlines at the place where they
7117 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7118 accessing negative bounds in array. This fixes the crash when
7119 inserting accented characters.
7120 * src/trans.h (Match): ditto
7122 * src/buffer.C (Dispatch): since this is a void, it should not try
7123 to return anything...
7125 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7127 * src/buffer.h: removed the two friends from Buffer. Some changes
7128 because of this. Buffer::getFileName and Buffer::setFileName
7129 renamed to Buffer::fileName() and Buffer::fileName(...).
7131 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7133 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7134 and Buffer::update(short) to BufferView. This move is currently
7135 controlled by a define MOVE_TEXT, this will be removed when all
7136 shows to be ok. This move paves the way for better separation
7137 between buffer contents and buffer view. One side effect is that
7138 the BufferView needs a rebreak when swiching buffers, if we want
7139 to avoid this we can add a cache that holds pointers to LyXText's
7140 that is not currently in use.
7142 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7145 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7147 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7149 * lyx_main.C: new command line option -x (or --execute) and
7150 -e (or --export). Now direct conversion from .lyx to .tex
7151 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7152 Unfortunately, X is still needed and the GUI pops up during the
7155 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7157 * src/Spacing.C: add a using directive to bring stream stuff into
7159 * src/paragraph.C: ditto
7160 * src/buffer.C: ditto
7162 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7163 from Lars' announcement).
7165 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7166 example files from Tino Meinen.
7168 1999-12-06 Allan Rae <rae@lyx.org>
7170 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7172 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7174 * src/support/lyxstring.C: added a lot of inline for no good
7177 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7178 latexWriteEndChanges, they were not used.
7180 * src/layout.h (operator<<): output operator for PageSides
7182 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7184 * some example files: loaded in LyX 1.0.4 and saved again to update
7185 certain constructs (table format)
7187 * a lot of files: did the change to use fstream/iostream for all
7188 writing of files. Done with a close look at Andre Poenitz's patch.
7190 * some files: whitespace changes.
7192 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7194 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7195 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7196 architecture, we provide our own. It is used unconditionnally, but
7197 I do not think this is a performance problem. Thanks to Angus
7198 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7199 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7201 (GetInset): use my_memcpy.
7205 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7206 it is easier to understand, but it uses less TeX-only constructs now.
7208 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7209 elements contain spaces
7211 * lib/configure: regenerated
7213 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7214 elements contain spaces; display the list of programs that are
7217 * autogen.sh: make sure lib/configure is executable
7219 * lib/examples/*: rename the tutorial examples to begin with the
7220 two-letters language code.
7222 * src/lyxfunc.C (getStatus): do not query current font if no
7225 * src/lyx_cb.C (RunScript): use QuoteName
7226 (MenuRunDvips): ditto
7227 (PrintApplyCB): ditto
7229 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7230 around argument, so that it works well with the current shell.
7231 Does not work properly with OS/2 shells currently.
7233 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7234 * src/LyXSendto.C (SendtoApplyCB): ditto
7235 * src/lyxfunc.C (Dispatch): ditto
7236 * src/buffer.C (runLaTeX): ditto
7237 (runLiterate): ditto
7238 (buildProgram): ditto
7240 * src/lyx_cb.C (RunScript): ditto
7241 (MenuMakeLaTeX): ditto
7243 * src/buffer.h (getLatexName): new method
7245 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7247 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7249 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7250 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7251 (create_math_panel): ditto
7253 * src/lyxfunc.C (getStatus): re-activate the code which gets
7254 current font and cursor; add test for export to html.
7256 * src/lyxrc.C (read): remove unreachable break statements; add a
7259 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7261 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7263 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7264 introduced by faulty regex.
7265 * src/buffer.C: ditto
7266 * src/lastfiles.C: ditto
7267 * src/paragraph.C: ditto
7268 * src/table.C: ditto
7269 * src/vspace.C: ditto
7270 * src/insets/figinset.C: ditto
7271 Note: most of these is absolutely harmless, except the one in
7272 src/mathed formula.C.
7274 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7276 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7277 operation, yielding correct results for the reLyX command.
7279 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7281 * src/support/filetools.C (ExpandPath): removed an over eager
7283 (ReplaceEnvironmentPath): ditto
7285 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7286 shows that we are doing something fishy in our code...
7290 * src/lyxrc.C (read): use a double switch trick to get more help
7291 from the compiler. (the same trick is used in layout.C)
7292 (write): new function. opens a ofstream and pass that to output
7293 (output): new function, takes a ostream and writes the lyxrc
7294 elemts to it. uses a dummy switch to make sure no elements are
7297 * src/lyxlex.h: added a struct pushpophelper for use in functions
7298 with more than one exit point.
7300 * src/lyxlex.[Ch] (GetInteger): made it const
7304 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7306 * src/layout.[hC] : LayoutTags splitted into several enums, new
7307 methods created, better error handling cleaner use of lyxlex. Read
7310 * src/bmtable.[Ch]: change some member prototypes because of the
7311 image const changes.
7313 * commandtags.h, src/LyXAction.C (init): new function:
7314 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7315 This file is not read automatically but you can add \input
7316 preferences to your lyxrc if you want to. We need to discuss how
7319 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7320 in .aux, also remove .bib and .bst files from dependencies when
7323 * src/BufferView.C, src/LyXView.C: add const_cast several places
7324 because of changes to images.
7326 * lib/images/*: same change as for images/*
7328 * lib/lyxrc.example: Default for accept_compound is false not no.
7330 * images/*: changed to be const, however I have som misgivings
7331 about this change so it might be changed back.
7333 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7335 * lib/configure, po/POTFILES.in: regenerated
7337 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7339 * config/lib_configure.m4: removed
7341 * lib/configure.m4: new file (was config/lib_configure.m4)
7343 * configure.in: do not test for rtti, since we do not use it.
7345 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7347 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7348 doubling of allocated space scheme. This makes it faster for large
7349 strings end to use less memory for small strings. xtra rememoved.
7351 * src/insets/figinset.C (waitalarm): commented out.
7352 (GhostscriptMsg): use static_cast
7353 (GhostscriptMsg): use new instead of malloc to allocate memory for
7354 cmap. also delete the memory after use.
7356 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7358 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7359 for changes in bibtex database or style.
7360 (runBibTeX): remove all .bib and .bst files from dep before we
7362 (run): use scanAuc in when dep file already exist.
7364 * src/DepTable.C (remove_files_with_extension): new method
7367 * src/DepTable.[Ch]: made many of the methods const.
7369 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7371 * src/bufferparams.C: make sure that the default textclass is
7372 "article". It used to be the first one by description order, but
7373 now the first one is "docbook".
7375 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7376 string; call Debug::value.
7377 (easyParse): pass complete argument to setDebuggingLevel().
7379 * src/debug.h (value): fix the code that parses debug levels.
7381 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7384 * src/LyXAction.C: use Debug::ACTION as debug channel.
7386 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7388 * NEWS: updated for the future 1.1.3 release.
7390 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7391 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7392 it should. This is of course a controversial change (since many
7393 people will find that their lyx workscreen is suddenly full of
7394 red), but done for the sake of correctness.
7396 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7397 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7399 * src/insets/inseterror.h, src/insets/inseturl.h,
7400 src/insets/insetinfo.h, src/insets/figinset.h,
7401 src/mathed/formulamacro.h, src/mathed/math_macro.h
7402 (EditMessage): add a missing const and add _() to make sure that
7405 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7406 src/insets/insetbib.C, src/support/filetools.C: add `using'
7409 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7410 doing 'Insert index of last word' at the beginning of a paragraph.
7412 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7414 * several files: white-space changes.
7416 * src/mathed/formula.C: removed IsAlpha and IsDigit
7418 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7419 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7422 * src/insets/figinset.C (GetPSSizes): don't break when
7423 "EndComments" is seen. But break when a boundingbox is read.
7425 * all classes inherited from Inset: return value of Clone
7426 changed back to Inset *.
7428 * all classes inherited form MathInset: return value of Clone
7429 changed back to MathedInset *.
7431 * src/insets/figinset.C (runqueue): use a ofstream to output the
7432 gs/ps file. Might need some setpresicion or setw. However I can
7433 see no problem with the current code.
7434 (runqueue): use sleep instead of the alarm/signal code. I just
7435 can't see the difference.
7437 * src/paragraph.C (LyXParagraph): reserve space in the new
7438 paragraph and resize the inserted paragraph to just fit.
7440 * src/lyxfunc.h (operator|=): added operator for func_status.
7442 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7443 check for readable file.
7445 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7446 check for readable file.
7447 (MenuMakeLinuxDoc): ditto
7448 (MenuMakeDocBook): ditto
7449 (MenuMakeAscii): ditto
7450 (InsertAsciiFile): split the test for openable and readable
7452 * src/bmtable.C (draw_bitmaptable): use
7453 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7455 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7456 findtexfile from LaTeX to filetools.
7458 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7459 instead of FilePtr. Needs to be verified by a literate user.
7461 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7463 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7464 (EditMessage): likewise.
7466 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7467 respectively as \textasciitilde and \textasciicircum.
7469 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7471 * src/support/lyxstring.h: made the methods that take iterators
7474 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7475 (regexMatch): made is use the real regex class.
7477 * src/support/Makefile.am: changed to use libtool
7479 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7481 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7483 (MathIsInset ++): changed several macros to be inline functions
7486 * src/mathed/Makefile.am: changed to use libtool
7488 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7490 * src/insets/inset* : Clone changed to const and return type is
7491 the true insettype not just Inset*.
7493 * src/insets/Makefile.am: changed to use libtool
7495 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7497 * src/undo.[Ch] : added empty() and changed some of the method
7500 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7502 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7503 setID use block<> for the bullets array, added const several places.
7505 * src/lyxfunc.C (getStatus): new function
7507 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7508 LyXAction, added const to several funtions.
7510 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7511 a std::map, and to store the dir items in a vector.
7513 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7516 * src/LyXView.[Ch] + other files : changed currentView to view.
7518 * src/LyXAction.[Ch] : ported from the old devel branch.
7520 * src/.cvsignore: added .libs and a.out
7522 * configure.in : changes to use libtool.
7524 * acinclude.m4 : inserted libtool.m4
7526 * .cvsignore: added libtool
7528 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7530 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7531 file name in insets and mathed directories (otherwise the
7532 dependency is not taken in account under cygwin).
7534 * src/text2.C (InsertString[AB]): make sure that we do not try to
7535 read characters past the string length.
7537 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7539 * lib/doc/LaTeXConfig.lyx.in,
7540 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7542 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7543 file saying who created them and when this heppened; this is
7544 useless and annoys tools like cvs.
7546 * lib/layouts/g-brief-{en,de}.layout,
7547 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7548 from Thomas Hartkens <thomas@hartkens.de>.
7550 * src/{insets,mathed}/Makefile.am: do not declare an empty
7551 LDFLAGS, so that it can be set at configure time (useful on Irix
7554 * lib/reLyX/configure.in: make sure that the prefix is set
7555 correctly in LYX_DIR.
7557 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7559 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7560 be used by 'command-sequence' this allows to bind a key to a
7561 sequence of LyX-commands
7562 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7564 * src/LyXAction.C: add "command-sequence"
7566 * src/LyXFunction.C: handling of "command-sequence"
7568 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7569 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7571 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7573 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7575 * src/buffer.C (writeFile): Do not output a comment giving user
7576 and date at the beginning of a .lyx file. This is useless and
7577 annoys cvs anyway; update version number to 1.1.
7579 * src/Makefile.am (LYX_DIR): add this definition, so that a
7580 default path is hardcoded in LyX.
7582 * configure.in: Use LYX_GNU_GETTEXT.
7584 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7585 AM_GNU_GETTEXT with a bug fixed.
7587 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7589 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7591 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7592 which is used to point to LyX data is now LYX_DIR_11x.
7594 * lyx.man: convert to a unix text file; small updates.
7596 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7598 * src/support/LSubstring.[Ch]: made the second arg of most of the
7599 constructors be a const reference.
7601 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7604 * src/support/lyxstring.[Ch] (swap): added missing member function
7605 and specialization of swap(str, str);
7607 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7609 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7610 trace of the old one.
7612 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7613 put the member definitions in undo.C.
7615 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7616 NEW_TEXT and have now only code that was included when this was
7619 * src/intl.C (LCombo): use static_cast
7621 (DispatchCallback): ditto
7623 * src/definitions.h: removed whole file
7625 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7627 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7628 parsing and stores in a std:map. a regex defines the file format.
7629 removed unneeded members.
7631 * src/bufferparams.h: added several enums from definitions.h here.
7632 Removed unsused destructor. Changed some types to use proper enum
7633 types. use block to have the temp_bullets and user_defined_bullets
7634 and to make the whole class assignable.
7636 * src/bufferparams.C (Copy): removed this functions, use a default
7639 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7642 * src/buffer.C (readLyXformat2): commend out all that have with
7643 oldpapersize to do. also comment out all that hve to do with
7644 insetlatex and insetlatexdel.
7645 (setOldPaperStuff): commented out
7647 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7649 * src/LyXAction.C: remove use of inset-latex-insert
7651 * src/mathed/math_panel.C (button_cb): use static_cast
7653 * src/insets/Makefile.am (insets_o_SOURCES): removed
7656 * src/support/lyxstring.C (helper): use the unsigned long
7657 specifier, UL, instead of a static_cast.
7659 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7661 * src/support/block.h: new file. to be used as a c-style array in
7662 classes, so that the class can be assignable.
7664 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7666 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7667 NULL, make sure to return an empty string (it is not possible to
7668 set a string to NULL).
7670 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7672 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7674 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7676 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7677 link line, so that Irix users (for example) can set it explicitely to
7680 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7681 it can be overidden at make time (static or dynamic link, for
7684 * src/vc-backend.C, src/LaTeXFeatures.h,
7685 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7686 statements to bring templates to global namespace.
7688 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7690 * src/support/lyxstring.C (operator[] const): make it standard
7693 * src/minibuffer.C (Init): changed to reflect that more
7694 information is given from the lyxvc and need not be provided here.
7696 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7698 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7700 * src/LyXView.C (UpdateTimerCB): use static_cast
7701 (KeyPressMask_raw_callback): ditto
7703 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7704 buffer_, a lot of changes because of this. currentBuffer() ->
7705 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7706 also changes to other files because of this.
7708 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7710 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7711 have no support for RCS and partial support for CVS, will be
7714 * src/insets/ several files: changes because of function name
7715 changes in Bufferview and LyXView.
7717 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7719 * src/support/LSubstring.[Ch]: new files. These implement a
7720 Substring that can be very convenient to use. i.e. is this
7722 string a = "Mary had a little sheep";
7723 Substring(a, "sheep") = "lamb";
7724 a is now "Mary has a little lamb".
7726 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7727 out patterns and subpatterns of strings. It is used by LSubstring
7728 and also by vc-backend.C
7730 * src/support/lyxstring.C: went over all the assertions used and
7731 tried to correct the wrong ones and flag which of them is required
7732 by the standard. some bugs found because of this. Also removed a
7733 couple of assertions.
7735 * src/support/Makefile.am (libsupport_a_SOURCES): added
7736 LSubstring.[Ch] and LRegex.[Ch]
7738 * src/support/FileInfo.h: have struct stat buf as an object and
7739 not a pointer to one, some changes because of this.
7741 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7742 information in layout when adding the layouts preamble to the
7745 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7748 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7749 because of bug in OS/2.
7751 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7753 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7754 \verbatim@font instead of \ttfamily, so that it can be redefined.
7756 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7757 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7758 src/layout.h, src/text2.C: add 'using' directive to bring the
7759 STL templates we need from the std:: namespace to the global one.
7760 Needed by DEC cxx in strict ansi mode.
7762 * src/support/LIstream.h,src/support/LOstream.h,
7763 src/support/lyxstring.h,src/table.h,
7764 src/lyxlookup.h: do not include <config.h> in header
7765 files. This should be done in the .C files only.
7767 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7771 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7773 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7774 from Kayvan to fix the tth invokation.
7776 * development/lyx.spec.in: updates from Kayvan to reflect the
7777 changes of file names.
7779 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7781 * src/text2.C (InsertStringB): use std::copy
7782 (InsertStringA): use std::copy
7784 * src/bufferlist.C: use a vector to store the buffers in. This is
7785 an internal change and should not affect any other thing.
7787 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7790 * src/text.C (Fill): fix potential bug, one off bug.
7792 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7794 * src/Makefile.am (lyx_main.o): add more files it depends on.
7796 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7798 * src/support/lyxstring.C: use size_t for the reference count,
7799 size, reserved memory and xtra.
7800 (internal_compare): new private member function. Now the compare
7801 functions should work for std::strings that have embedded '\0'
7803 (compare): all compare functions rewritten to use
7806 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7808 * src/support/lyxstring.C (compare): pass c_str()
7809 (compare): pass c_str
7810 (compare): pass c_str
7812 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7814 * src/support/DebugStream.C: <config.h> was not included correctly.
7816 * lib/configure: forgot to re-generate it :( I'll make this file
7817 auto generated soon.
7819 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7821 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7824 * src/support/lyxstring.C: some changes from length() to rep->sz.
7825 avoids a function call.
7827 * src/support/filetools.C (SpaceLess): yet another version of the
7828 algorithm...now per Jean-Marc's suggestions.
7830 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7832 * src/layout.C (less_textclass_desc): functor for use in sorting
7834 (LyXTextClass::Read): sort the textclasses after reading.
7836 * src/support/filetools.C (SpaceLess): new version of the
7837 SpaceLess functions. What problems does this one give? Please
7840 * images/banner_bw.xbm: made the arrays unsigned char *
7842 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7844 * src/support/lyxstring.C (find): remove bogus assertion in the
7845 two versions of find where this has not been done yet.
7847 * src/support/lyxlib.h: add missing int return type to
7850 * src/menus.C (ShowFileMenu): disable exporting to html if no
7851 html export command is present.
7853 * config/lib_configure.m4: add a test for an HTML converter. The
7854 programs checked for are, in this order: tth, latex2html and
7857 * lib/configure: generated from config/lib_configure.m4.
7859 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7860 html converter. The parameters are now passed through $$FName and
7861 $$OutName, instead of standard input/output.
7863 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7865 * lib/lyxrc.example: update description of \html_command.
7866 add "quotes" around \screen_font_xxx font setting examples to help
7867 people who use fonts with spaces in their names.
7869 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7871 * Distribution files: updates for v1.1.2
7873 * src/support/lyxstring.C (find): remove bogus assert and return
7874 npos for the same condition.
7876 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7878 * added patch for OS/2 from SMiyata.
7880 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7882 * src/text2.C (CutSelection): make space_wrapped a bool
7883 (CutSelection): dont declare int i until we have to.
7884 (alphaCounter): return a char const *.
7886 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7888 * src/support/syscall.C (Systemcalls::kill):
7889 src/support/filetools.C (PutEnv, PutEnvPath):
7890 src/lyx_cb.C (addNewlineAndDepth):
7891 src/FontInfo.C (FontInfo::resize): condition some #warning
7892 directives with WITH_WARNINGS.
7895 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7897 * src/layout.[Ch] + several files: access to class variables
7898 limited and made accessor functions instead a lot of code changed
7899 becuase of this. Also instead of returning pointers often a const
7900 reference is returned instead.
7902 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7904 * src/Makefile.am (dist-hook): added used to remove the CVS from
7905 cheaders upon creating a dist
7906 (EXTRA_DIST): added cheaders
7908 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7909 a character not as a small integer.
7911 * src/support/lyxstring.C (find): removed Assert and added i >=
7912 rep->sz to the first if.
7914 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7916 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7917 src/LyXView.C src/buffer.C src/bufferparams.C
7918 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7919 src/text2.C src/insets/insetinclude.C:
7920 lyxlayout renamed to textclasslist.
7922 * src/layout.C: some lyxerr changes.
7924 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7925 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7926 (LyXLayoutList): removed all traces of this class.
7927 (LyXTextClass::Read): rewrote LT_STYLE
7928 (LyXTextClass::hasLayout): new function
7929 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7930 both const and nonconst version.
7931 (LyXTextClass::delete_layout): new function.
7932 (LyXTextClassList::Style): bug fix. do the right thing if layout
7934 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7935 (LyXTextClassList::NameOfLayout): ditto
7936 (LyXTextClassList::Load): ditto
7938 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7940 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7942 * src/LyXAction.C (LookupFunc): added a workaround for sun
7943 compiler, on the other hand...we don't know if the current code
7944 compiles on sun at all...
7946 * src/support/filetools.C (CleanupPath): subst fix
7948 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7951 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7952 complained about this one?
7954 * src/insets/insetinclude.C (Latex): subst fix
7956 * src/insets/insetbib.C (getKeys): subst fix
7958 * src/LyXSendto.C (SendtoApplyCB): subst fix
7960 * src/lyx_main.C (init): subst fix
7962 * src/layout.C (Read): subst fix
7964 * src/lyx_sendfax_main.C (button_send): subst fix
7966 * src/buffer.C (RoffAsciiTable): subst fix
7968 * src/lyx_cb.C (MenuFax): subst fix
7969 (PrintApplyCB): subst fix
7971 1999-10-26 Juergen Vigna <jug@sad.it>
7973 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7975 (Read): Cleaned up this code so now we read only format vestion >= 5
7977 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7979 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7980 come nobody has complained about this one?
7982 * src/insets/insetinclude.C (Latex): subst fix
7984 * src/insets/insetbib.C (getKeys): subst fix
7986 * src/lyx_main.C (init): subst fix
7988 * src/layout.C (Read): subst fix
7990 * src/buffer.C (RoffAsciiTable): subst fix
7992 * src/lyx_cb.C (MenuFax): subst fix.
7994 * src/layout.[hC] + some other files: rewrote to use
7995 std::container to store textclasses and layouts in.
7996 Simplified, removed a lot of code. Make all classes
7997 assignable. Further simplifications and review of type
7998 use still to be one.
8000 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8001 lastfiles to create the lastfiles partr of the menu.
8003 * src/lastfiles.[Ch]: rewritten to use deque to store the
8004 lastfiles in. Uses fstream for reading and writing. Simplifies
8007 * src/support/syscall.C: remove explicit cast.
8009 * src/BufferView.C (CursorToggleCB): removed code snippets that
8011 use explicat C++ style casts instead of C style casts. also use
8012 u_vdata instea of passing pointers in longs.
8014 * src/PaperLayout.C: removed code snippets that were commented out.
8016 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8018 * src/lyx_main.C: removed code snippets that wer commented out.
8020 * src/paragraph.C: removed code snippets that were commented out.
8022 * src/lyxvc.C (logClose): use static_cast
8024 (viewLog): remove explicit cast to void*
8025 (showLog): removed old commented code
8027 * src/menus.C: use static_cast instead of C style casts. use
8028 u_vdata instead of u_ldata. remove explicit cast to (long) for
8029 pointers. Removed old code that was commented out.
8031 * src/insets/inset.C: removed old commented func
8033 * src/insets/insetref.C (InsetRef): removed old code that had been
8034 commented out for a long time.
8036 (escape): removed C style cast
8038 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8040 * src/insets/insetlatex.C (Draw): removed old commented code
8041 (Read): rewritten to use string
8043 * src/insets/insetlabel.C (escape): removed C style cast
8045 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8047 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8050 * src/insets/insetinclude.h: removed a couple of stupid bools
8052 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8053 (Clone): remove C style cast
8054 (getKeys): changed list to lst because of std::list
8056 * src/insets/inseterror.C (Draw): removed som old commented code.
8058 * src/insets/insetcommand.C (Draw): removed some old commented code.
8060 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8061 commented out forever.
8062 (bibitem_cb): use static_cast instead of C style cast
8063 use of vdata changed to u_vdata.
8065 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8067 (CloseUrlCB): use static_cast instead of C style cast.
8068 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8070 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8071 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8072 (CloseInfoCB): static_cast from ob->u_vdata instead.
8073 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8076 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8077 (C_InsetError_CloseErrorCB): forward the ob parameter
8078 (CloseErrorCB): static_cast from ob->u_vdata instead.
8080 * src/vspace.h: include LString.h since we use string in this class.
8082 * src/vspace.C (lyx_advance): changed name from advance because of
8083 nameclash with stl. And since we cannot use namespaces yet...I
8084 used a lyx_ prefix instead. Expect this to change when we begin
8087 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8089 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8090 and removed now defunct constructor and deconstructor.
8092 * src/BufferView.h: have backstack as a object not as a pointer.
8093 removed initialization from constructor. added include for BackStack
8095 * development/lyx.spec.in (%build): add CFLAGS also.
8097 * src/screen.C (drawFrame): removed another warning.
8099 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8101 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8102 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8103 README and ANNOUNCE a bit for the next release. More work is
8106 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8107 unbreakable if we are in freespacing mode (LyX-Code), but not in
8110 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8112 * src/BackStack.h: fixed initialization order in constructor
8114 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8116 * acinclude.m4 (VERSION): new rules for when a version is
8117 development, added also a variable for prerelease.
8118 (warnings): we set with_warnings=yes for prereleases
8119 (lyx_opt): prereleases compile with same optimization as development
8120 (CXXFLAGS): only use pedantic if we are a development version
8122 * src/BufferView.C (restorePosition): don't do anything if the
8125 * src/BackStack.h: added member empty, use this to test if there
8126 is anything to pop...
8128 1999-10-25 Juergen Vigna <jug@sad.it>
8131 * forms/layout_forms.fd +
8132 * forms/latexoptions.fd +
8133 * lyx.fd: changed for various form resize issues
8135 * src/mathed/math_panel.C +
8136 * src/insets/inseterror.C +
8137 * src/insets/insetinfo.C +
8138 * src/insets/inseturl.C +
8139 * src/insets/inseturl.h +
8142 * src/PaperLayout.C +
8143 * src/ParagraphExtra.C +
8144 * src/TableLayout.C +
8146 * src/layout_forms.C +
8153 * src/menus.C: fixed various resize issues. So now forms can be
8154 resized savely or not be resized at all.
8156 * forms/form_url.fd +
8157 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8160 * src/insets/Makefile.am: added files form_url.[Ch]
8162 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8164 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8165 (and presumably 6.2).
8167 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8168 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8169 remaining static member callbacks.
8171 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8174 * src/support/lyxstring.h: declare struct Srep as friend of
8175 lyxstring, since DEC cxx complains otherwise.
8177 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8179 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8181 * src/LaTeX.C (run): made run_bibtex also depend on files with
8183 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8184 are put into the dependency file.
8186 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8187 the code has shown itself to work
8188 (create_ispell_pipe): removed another warning, added a comment
8191 * src/minibuffer.C (ExecutingCB): removed code that has been
8192 commented out a long time
8194 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8195 out code + a warning.
8197 * src/support/lyxstring.h: comment out the three private
8198 operators, when compiling with string ansi conforming compilers
8201 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8203 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8204 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8207 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8210 * src/mathed/math_panel.C (create_math_panel): remove explicit
8213 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8216 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8217 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8218 to XCreatePixmapFromBitmapData
8219 (fl_set_bmtable_data): change the last argument to be unsigned
8221 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8222 and bh to be unsigned int, remove explicit casts in call to
8223 XReadBitmapFileData.
8225 * images/arrows.xbm: made the arrays unsigned char *
8226 * images/varsz.xbm: ditto
8227 * images/misc.xbm: ditto
8228 * images/greek.xbm: ditto
8229 * images/dots.xbm: ditto
8230 * images/brel.xbm: ditto
8231 * images/bop.xbm: ditto
8233 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8235 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8236 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8237 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8239 (LYX_CXX_CHEADERS): added <clocale> to the test.
8241 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8243 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8245 * src/support/lyxstring.C (append): fixed something that must be a
8246 bug, rep->assign was used instead of rep->append.
8248 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8251 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8252 lyx insert double chars. Fix spotted by Kayvan.
8254 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8256 * Fixed the tth support. I messed up with the Emacs patch apply feature
8257 and omitted the changes in lyxrc.C.
8259 1999-10-22 Juergen Vigna <jug@sad.it>
8261 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8263 * src/lyx_cb.C (MenuInsertRef) +
8264 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8265 the form cannot be resized under it limits (fixes a segfault)
8267 * src/lyx.C (create_form_form_ref) +
8268 * forms/lyx.fd: Changed Gravity on name input field so that it is
8271 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8273 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8274 <ostream> and <istream>.
8276 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8277 whether <fstream> provides the latest standard features, or if we
8278 have an oldstyle library (like in egcs).
8279 (LYX_CXX_STL_STRING): fix the test.
8281 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8282 code on MODERN_STL_STREAM.
8284 * src/support/lyxstring.h: use L{I,O}stream.h.
8286 * src/support/L{I,O}stream.h: new files, designed to setup
8287 correctly streams for our use
8288 - includes the right header depending on STL capabilities
8289 - puts std::ostream and std::endl (for LOStream.h) or
8290 std::istream (LIStream.h) in toplevel namespace.
8292 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8294 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8295 was a bib file that had been changed we ensure that bibtex is run.
8296 (runBibTeX): enhanced to extract the names of the bib files and
8297 getting their absolute path and enter them into the dep file.
8298 (findtexfile): static func that is used to look for tex-files,
8299 checks for absolute patchs and tries also with kpsewhich.
8300 Alternative ways of finding the correct files are wanted. Will
8302 (do_popen): function that runs a command using popen and returns
8303 the whole output of that command in a string. Should be moved to
8306 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8307 file with extension ext has changed.
8309 * src/insets/figinset.C: added ifdef guards around the fl_free
8310 code that jug commented out. Now it is commented out when
8311 compiling with XForms == 0.89.
8313 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8314 to lyxstring.C, and only keep a forward declaration in
8315 lyxstring.h. Simplifies the header file a bit and should help a
8316 bit on compile time too. Also changes to Srep will not mandate a
8317 recompile of code just using string.
8318 (~lyxstring): definition moved here since it uses srep.
8319 (size): definition moved here since it uses srep.
8321 * src/support/lyxstring.h: removed a couple of "inline" that should
8324 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8326 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8329 1999-10-21 Juergen Vigna <jug@sad.it>
8331 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8332 set to left if I just remove the width entry (or it is empty).
8334 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8335 paragraph when having dummy paragraphs.
8337 1999-10-20 Juergen Vigna <jug@sad.it>
8339 * src/insets/figinset.C: just commented some fl_free_form calls
8340 and added warnings so that this calls should be activated later
8341 again. This avoids for now a segfault, but we have a memory leak!
8343 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8344 'const char * argument' to 'string argument', this should
8345 fix some Asserts() in lyxstring.C.
8347 * src/lyxfunc.h: Removed the function argAsString(const char *)
8348 as it is not used anymore.
8350 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8352 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8355 * src/Literate.h: some funcs moved from public to private to make
8356 interface clearer. Unneeded args removed.
8358 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8360 (scanBuildLogFile): ditto
8362 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8363 normal TeX Error. Still room for improvement.
8365 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8367 * src/buffer.C (insertErrors): changes to make the error
8368 desctription show properly.
8370 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8373 * src/support/lyxstring.C (helper): changed to use
8374 sizeof(object->rep->ref).
8375 (operator>>): changed to use a pointer instead.
8377 * src/support/lyxstring.h: changed const reference & to value_type
8378 const & lets see if that helps.
8380 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8382 * Makefile.am (rpmdist): fixed to have non static package and
8385 * src/support/lyxstring.C: removed the compilation guards
8387 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8390 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8391 conditional compile of lyxstring.Ch
8393 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8394 stupid check, but it is a lot better than the bastring hack.
8395 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8397 * several files: changed string::erase into string::clear. Not
8400 * src/chset.C (encodeString): use a char temporary instead
8402 * src/table.C (TexEndOfCell): added tostr around
8403 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8404 (TexEndOfCell): ditto
8405 (TexEndOfCell): ditto
8406 (TexEndOfCell): ditto
8407 (DocBookEndOfCell): ditto
8408 (DocBookEndOfCell): ditto
8409 (DocBookEndOfCell): ditto
8410 (DocBookEndOfCell): ditto
8412 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8414 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8416 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8417 (MenuBuildProg): added tostr around ret
8418 (MenuRunChktex): added tostr around ret
8419 (DocumentApplyCB): added tostr around ret
8421 * src/chset.C (encodeString): added tostr around t->ic
8423 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8424 (makeLaTeXFile): added tostr around tocdepth
8425 (makeLaTeXFile): added tostr around ftcound - 1
8427 * src/insets/insetbib.C (setCounter): added tostr around counter.
8429 * src/support/lyxstring.h: added an operator+=(int) to catch more
8432 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8433 (lyxstring): We DON'T allow NULL pointers.
8435 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8437 * src/mathed/math_macro.C (MathMacroArgument::Write,
8438 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8439 when writing them out.
8441 * src/LString.C: remove, since it is not used anymore.
8443 * src/support/lyxstring.C: condition the content to
8444 USE_INCLUDED_STRING macro.
8446 * src/mathed/math_symbols.C, src/support/lstrings.C,
8447 src/support/lyxstring.C: add `using' directive to specify what
8448 we need in <algorithm>. I do not think that we need to
8449 conditionalize this, but any thought is appreciated.
8451 * many files: change all callback functions to "C" linkage
8452 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8453 strict_ansi. Those who were static are now global.
8454 The case of callbacks which are static class members is
8455 trickier, since we have to make C wrappers around them (see
8456 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8457 did not finish this yet, since it defeats the purpose of
8458 encapsulation, and I am not sure what the best route is.
8460 1999-10-19 Juergen Vigna <jug@sad.it>
8462 * src/support/lyxstring.C (lyxstring): we permit to have a null
8463 pointer as assignment value and just don't assign it.
8465 * src/vspace.C (nextToken): corrected this function substituting
8466 find_first(_not)_of with find_last_of.
8468 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8469 (TableOptCloseCB) (TableSpeCloseCB):
8470 inserted fl_set_focus call for problem with fl_hide_form() in
8473 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8475 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8478 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8480 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8481 LyXLex::next() and not eatline() to get its argument.
8483 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8485 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8486 instead, use fstreams for io of the depfile, removed unneeded
8487 functions and variables.
8489 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8490 vector instead, removed all functions and variables that is not in
8493 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8495 * src/buffer.C (insertErrors): use new interface to TeXError
8497 * Makefile.am (rpmdist): added a rpmdist target
8499 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8500 per Kayvan's instructions.
8502 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8504 * src/Makefile.am: add a definition for localedir, so that locales
8505 are found after installation (Kayvan)
8507 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8509 * development/.cvsignore: new file.
8511 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8513 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8514 C++ compiler provides wrappers for C headers and use our alternate
8517 * configure.in: use LYX_CXX_CHEADERS.
8519 * src/cheader/: new directory, populated with cname headers from
8520 libstdc++-2.8.1. They are a bit old, but probably good enough for
8521 what we want (support compilers who lack them).
8523 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8524 from includes. It turns out is was stupid.
8526 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8528 * lib/Makefile.am (install-data-local): forgot a ';'
8529 (install-data-local): forgot a '\'
8530 (libinstalldirs): needed after all. reintroduced.
8532 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8534 * configure.in (AC_OUTPUT): added lyx.spec
8536 * development/lyx.spec: removed file
8538 * development/lyx.spec.in: new file
8540 * po/*.po: merged with lyx.pot becuase of make distcheck
8542 * lib/Makefile.am (dist-hook): added dist-hook so that
8543 documentation files will be included when doing a make
8544 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8545 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8547 more: tried to make install do the right thing, exclude CVS dirs
8550 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8551 Path would fit in more nicely.
8553 * all files that used to use pathstack: uses now Path instead.
8554 This change was a lot easier than expected.
8556 * src/support/path.h: new file
8558 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8560 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8562 * src/support/lyxstring.C (getline): Default arg was given for
8565 * Configure.cmd: removed file
8567 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8569 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8570 streams classes and types, add the proper 'using' statements when
8571 MODERN_STL is defined.
8573 * src/debug.h: move the << operator definition after the inclusion
8576 * src/support/filetools.C: include "LAssert.h", which is needed
8579 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8582 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8583 include "debug.h" to define a proper ostream.
8585 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8587 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8588 method to the SystemCall class which can kill a process, but it's
8589 not fully implemented yet.
8591 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8593 * src/support/FileInfo.h: Better documentation
8595 * src/lyxfunc.C: Added support for buffer-export html
8597 * src/menus.C: Added Export->As HTML...
8599 * lib/bind/*.bind: Added short-cut for buffer-export html
8601 * src/lyxrc.*: Added support for new \tth_command
8603 * lib/lyxrc.example: Added stuff for new \tth_command
8605 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8607 * lib/Makefile.am (IMAGES): removed images/README
8608 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8609 installes in correct place. Check permisions is installed
8612 * src/LaTeX.C: some no-op changes moved declaration of some
8615 * src/LaTeX.h (LATEX_H): changed include guard name
8617 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8619 * lib/reLyX/Makefile.am: install noweb2lyx.
8621 * lib/Makefile.am: install configure.
8623 * lib/reLyX/configure.in: declare a config aux dir; set package
8624 name to lyx (not sure what the best solution is); generate noweb2lyx.
8626 * lib/layouts/egs.layout: fix the bibliography layout.
8628 1999-10-08 Jürgen Vigna <jug@sad.it>
8630 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8631 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8632 it returned without continuing to search the path.
8634 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8636 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8637 also fixes a bug. It is not allowed to do tricks with std::strings
8638 like: string a("hei"); &a[e]; this will not give what you
8639 think... Any reason for the complexity in this func?
8641 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8643 * Updated README and INSTALL a bit, mostly to check that my
8644 CVS rights are correctly set up.
8646 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8648 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8649 does not allow '\0' chars but lyxstring and std::string does.
8651 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8653 * autogen.sh (AUTOCONF): let the autogen script create the
8654 POTFILES.in file too. POTFILES.in should perhaps now not be
8655 included in the cvs module.
8657 * some more files changed to use C++ includes instead of C ones.
8659 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8661 (Reread): added tostr to nlink. buggy output otherwise.
8662 (Reread): added a string() around szMode when assigning to Buffer,
8663 without this I got a log of garbled info strings.
8665 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8668 * I have added several ostream & operator<<(ostream &, some_type)
8669 functions. This has been done to avoid casting and warnings when
8670 outputting enums to lyxerr. This as thus eliminated a lot of
8671 explicit casts and has made the code clearer. Among the enums
8672 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8673 mathed enums, some font enum the Debug::type enum.
8675 * src/support/lyxstring.h (clear): missing method. equivalent of
8678 * all files that contained "stderr": rewrote constructs that used
8679 stderr to use lyxerr instead. (except bmtable)
8681 * src/support/DebugStream.h (level): and the passed t with
8682 Debug::ANY to avoid spurious bits set.
8684 * src/debug.h (Debug::type value): made it accept strings of the
8687 * configure.in (Check for programs): Added a check for kpsewhich,
8688 the latex generation will use this later to better the dicovery of
8691 * src/BufferView.C (create_view): we don't need to cast this to
8692 (void*) that is done automatically.
8693 (WorkAreaButtonPress): removed some dead code.
8695 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8697 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8698 is not overwritten when translated (David Sua'rez de Lis).
8700 * lib/CREDITS: Added David Sua'rez de Lis
8702 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8704 * src/bufferparams.C (BufferParams): default input encoding is now
8707 * acinclude.m4 (cross_compiling): comment out macro
8708 LYX_GXX_STRENGTH_REDUCE.
8710 * acconfig.h: make sure that const is not defined (to empty) when
8711 we are compiling C++. Remove commented out code using SIZEOF_xx
8714 * configure.in : move the test for const and inline as late as
8715 possible so that these C tests do not interefere with C++ ones.
8716 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8717 has not been proven.
8719 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8721 * src/table.C (getDocBookAlign): remove bad default value for
8724 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8726 (ShowFileMenu2): ditto.
8728 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8731 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8733 * Most files: finished the change from the old error code to use
8734 DebugStream for all lyxerr debugging. Only minor changes remain
8735 (e.g. the setting of debug levels using strings instead of number)
8737 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8739 * src/layout.C (Add): Changed to use compare_no_case instead of
8742 * src/FontInfo.C: changed loop variable type too string::size_type.
8744 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8746 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8747 set ETAGS_ARGS to --c++
8749 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8751 * src/table.C (DocBookEndOfCell): commented out two unused variables
8753 * src/paragraph.C: commented out four unused variables.
8755 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8756 insed a if clause with type string::size_type.
8758 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8761 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8763 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8764 variable, also changed loop to go from 0 to lenght + 1, instead of
8765 -1 to length. This should be correct.
8767 * src/LaTeX.C (scanError): use string::size_type as loop variable
8770 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8771 (l.896) since y_tmp and row was not used anyway.
8773 * src/insets/insetref.C (escape): use string::size_type as loop
8776 * src/insets/insetquotes.C (Width): use string::size_type as loop
8778 (Draw): use string::size_type as loop variable type.
8780 * src/insets/insetlatexaccent.C (checkContents): use
8781 string::size_type as loop variable type.
8783 * src/insets/insetlabel.C (escape): use string::size_type as loop
8786 * src/insets/insetinfo.C: added an extern for current_view.
8788 * src/insets/insetcommand.C (scanCommand): use string::size_type
8789 as loop variable type.
8791 * most files: removed the RCS tags. With them we had to recompile
8792 a lot of files after a simple cvs commit. Also we have never used
8793 them for anything meaningful.
8795 * most files: tags-query-replace NULL 0. As adviced several plases
8796 we now use "0" instead of "NULL" in our code.
8798 * src/support/filetools.C (SpaceLess): use string::size_type as
8801 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8803 * src/paragraph.C: fixed up some more string stuff.
8805 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8807 * src/support/filetools.h: make modestr a std::string.
8809 * src/filetools.C (GetEnv): made ch really const.
8811 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8812 made code that used these use max/min from <algorithm> instead.
8814 * changed several c library include files to their equivalent c++
8815 library include files. All is not changed yet.
8817 * created a support subdir in src, put lyxstring and lstrings
8818 there + the extra files atexit, fileblock, strerror. Created
8819 Makefile.am. edited configure.in and src/Makefile.am to use this
8820 new subdir. More files moved to support.
8822 * imported som of the functions from repository lyx, filetools
8824 * ran tags-query-replace on LString -> string, corrected the bogus
8825 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8826 is still some errors in there. This is errors where too much or
8827 too litle get deleted from strings (string::erase, string::substr,
8828 string::replace), there can also be some off by one errors, or
8829 just plain wrong use of functions from lstrings. Viewing of quotes
8832 * LyX is now running fairly well with string, but there are
8833 certainly some bugs yet (see above) also string is quite different
8834 from LString among others in that it does not allow null pointers
8835 passed in and will abort if it gets any.
8837 * Added the revtex4 files I forgot when setting up the repository.
8839 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8841 * All over: Tried to clean everything up so that only the files
8842 that we really need are included in the cvs repository.
8843 * Switched to use automake.
8844 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8845 * Install has not been checked.
8847 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8849 * po/pt.po: Three errors:
8850 l.533 and l.538 format specification error
8851 l. 402 duplicate entry, I just deleted it.