1 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3 * src/frontends/kde/formtocdialog.C
4 * src/frontends/kde/formtocdialog.h
5 * src/frontends/kde/FormToc.C
6 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
8 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
10 * src/frontends/kde/FormCitation.C: fix thinko
11 where we didn't always display the reference text
14 * src/frontends/kde/formurldialog.C
15 * src/frontends/kde/formurldialog.h
16 * src/frontends/kde/FormUrl.C
17 * src/frontends/kde/FormUrl.h: minor cleanups
19 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
21 * src/frontends/kde/Makefile.am
22 * src/frontends/kde/FormToc.C
23 * src/frontends/kde/FormToc.h
24 * src/frontends/kde/FormCitation.C
25 * src/frontends/kde/FormCitation.h
26 * src/frontends/kde/FormIndex.C
27 * src/frontends/kde/FormIndex.h
28 * src/frontends/kde/formtocdialog.C
29 * src/frontends/kde/formtocdialog.h
30 * src/frontends/kde/formcitationdialog.C
31 * src/frontends/kde/formcitationdialog.h
32 * src/frontends/kde/formindexdialog.C
33 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
35 2000-09-12 Juergen Vigna <jug@sad.it>
37 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
40 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
42 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
45 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
47 * src/converter.C (Add, Convert): Added support for converter flags:
48 needaux, resultdir, resultfile.
49 (Convert): Added new parameter view_file.
50 (dvips_options): Fixed letter paper option.
52 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
53 (Export, GetExportableFormats, GetViewableFormats): Added support
56 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
58 (easyParse): Fixed to work with new export code.
60 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
63 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
65 * lib/bind/*.bind: Replaced
66 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
67 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
69 2000-09-11 Juergen Vigna <jug@sad.it>
71 * src/lyx_gui.C (runTime): uses global guiruntime variable.
73 * src/main.C (main): now GUII defines global guiruntime!
75 * src/frontends/gnome/GUIRunTime.C (initApplication):
76 * src/frontends/kde/GUIRunTime.C (initApplication):
77 * src/frontends/xforms/GUIRunTime.C (initApplication):
78 * src/frontends/GUIRunTime.h: added new function initApplication.
80 * src/spellchecker.C (sc_accept_word): change to add_to_session.
82 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
84 2000-09-08 Juergen Vigna <jug@sad.it>
86 * src/lyx_gui.C (create_forms): don't display the "default" entry as
87 we have already "Reset".
89 * src/language.C (initL): inserted "default" language and made this
90 THE default language (and not american!)
92 * src/paragraph.C: inserted handling of "default" language!
94 * src/lyxfont.C: ditto
98 * src/paragraph.C: output the \\par only if we have a following
99 paragraph otherwise it's not needed.
101 2000-09-05 Juergen Vigna <jug@sad.it>
103 * config/pspell.m4: added entry to lyx-flags
105 * src/spellchecker.C: modified version from Kevin for using pspell
107 2000-09-01 Marko Vendelin <markov@ioc.ee>
108 * src/frontends/gnome/Makefile.am
109 * src/frontends/gnome/FormCitation.C
110 * src/frontends/gnome/FormCitation.h
111 * src/frontends/gnome/diainsertcitation_callbacks.c
112 * src/frontends/gnome/diainsertcitation_callbacks.h
113 * src/frontends/gnome/diainsertcitation_interface.c
114 * src/frontends/gnome/diainsertcitation_interface.h
115 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
116 dialog for Gnome frontend
118 * src/main.C: Gnome libraries require keeping application name
119 and its version as strings
121 * src/frontends/gnome/mainapp.C: Change the name of the main window
122 from GnomeLyX to PACKAGE
124 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
126 * src/frontends/Liason.C: add "using: declaration.
128 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
130 * src/mathed/math_macro.C (Metrics): Set the size of the template
132 * src/mathed/formulamacro.C (Latex): Fixed the returned value
134 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
136 * src/converter.C (add_options): New function.
137 (SetViewer): Change $$FName into '$$FName'.
138 (View): Add options when running xdvi
139 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
140 (Convert): The 3rd parameter is now the desired filename. Converts
141 calls to lyx::rename if necessary.
142 Add options when running dvips.
143 (dvi_papersize,dvips_options): New methods.
145 * src/exporter.C (Export): Use getLatexName() instead of fileName().
147 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
148 using a call to Converter::dvips_options.
149 Fixed to work with nex export code.
152 * src/support/rename.C: New files
154 * src/support/syscall.h
155 * src/support/syscall.C: Added Starttype SystemDontWait.
157 * lib/ui/default.ui: Changed to work with new export code
159 * lib/configure.m4: Changed to work with new export code
161 * src/encoding.C: Changed latex name for iso8859_7 encoding.
163 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
165 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
166 so that code compiles with DEC cxx.
168 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
169 to work correctly! Also now supports the additional elements
172 2000-09-01 Allan Rae <rae@lyx.org>
174 * src/frontends/ButtonPolicies.C: renamed all the references to
175 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
177 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
178 since it's a const not a type.
180 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
182 2000-08-31 Juergen Vigna <jug@sad.it>
184 * src/insets/figinset.C: Various changes to look if the filename has
185 an extension and if not add it for inline previewing.
187 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
189 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
190 make buttonStatus and isReadOnly be const methods. (also reflect
191 this in derived classes.)
193 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
194 (nextState): change to be static inline, pass the StateMachine as
196 (PreferencesPolicy): remove casts
197 (OkCancelPolicy): remvoe casts
198 (OkCancelReadOnlyPolicy): remove casts
199 (NoRepeatedApplyReadOnlyPolicy): remove casts
200 (OkApplyCancelReadOnlyPolicy): remove casts
201 (OkApplyCancelPolicy): remove casts
202 (NoRepeatedApplyPolicy): remove casts
204 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
206 * src/converter.C: added some using directives
208 * src/frontends/ButtonPolicies.C: changes to overcome
209 "need lvalue" error with DEC c++
211 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
212 to WMHideCB for DEC c++
214 * src/frontends/xforms/Menubar_pimpl.C: added using directive
216 * src/frontends/xforms/forms/form_document.C.patch: use C callback
217 to BulletBMTableCB for DEC c++
219 2000-08-31 Allan Rae <rae@lyx.org>
221 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
222 character dialog separately from old document dialogs combo_language.
225 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
227 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
228 Removed LFUN_REF_CREATE.
230 * src/MenuBackend.C: Added new tags: toc and references
232 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
233 (add_lastfiles, add_documents, add_formats): Removed the unused smn
235 (add_toc, add_references): New methods.
236 (create_submenu): Handle correctly the case when there is a
237 seperator after optional menu items.
239 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
240 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
241 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
243 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
245 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
247 * src/converter.[Ch]: New file for converting between different
250 * src/export.[Ch]: New file for exporting a LyX file to different
253 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
254 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
255 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
256 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
257 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
258 RunDocBook, MenuExport.
260 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
261 Exporter::Preview methods if NEW_EXPORT is defined.
263 * src/buffer.C (Dispatch): Use Exporter::Export.
265 * src/lyxrc.C: Added new tags: \converter and \viewer.
268 * src/LyXAction.C: Define new lyx-function: buffer-update.
269 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
270 when NEW_EXPORT is defined.
272 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
274 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
276 * lib/ui/default.ui: Added submenus "view" and "update" to the
279 * src/filetools.C (GetExtension): New function.
281 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
283 2000-08-29 Allan Rae <rae@lyx.org>
285 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
287 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
288 (EnableDocumentLayout): removed
289 (DisableDocumentLayout): removed
290 (build): make use of ButtonController's read-only handling to
291 de/activate various objects. Replaces both of the above functions.
293 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
294 (readOnly): was read_only
295 (refresh): fixed dumb mistakes with read_only_ handling
297 * src/frontends/xforms/forms/form_document.fd:
298 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
299 tabbed dialogs so the tabs look more like tabs and so its easier to
300 work out which is the current tab.
302 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
303 segfault with form_table
305 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
307 2000-08-28 Juergen Vigna <jug@sad.it>
309 * acconfig.h: added USE_PSPELL.
311 * src/config.h.in: added USE_PSPELL.
313 * autogen.sh: added pspell.m4
315 * config/pspell.m4: new file.
317 * src/spellchecker.C: implemented support for pspell libary.
319 2000-08-25 Juergen Vigna <jug@sad.it>
321 * src/LyXAction.C (init): renamed LFUN_TABLE to
322 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
324 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
326 * src/lyxscreen.h: add force_clear variable and fuction to force
327 a clear area when redrawing in LyXText.
329 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
331 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
333 * some whitespace and comment changes.
335 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
337 * src/buffer.C: up te LYX_FORMAT to 2.17
339 2000-08-23 Juergen Vigna <jug@sad.it>
341 * src/BufferView_pimpl.C (tripleClick): disable this when in a
344 * src/insets/insettabular.C (pasteSelection): delete the insets
345 LyXText as it is not valid anymore.
346 (copySelection): new function.
347 (pasteSelection): new function.
348 (cutSelection): new function.
349 (LocalDispatch): implemented cut/copy/paste of cell selections.
351 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
352 don't have a LyXText.
354 * src/LyXAction.C (init): a NEW_TABULAR define too much.
356 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
359 2000-08-22 Juergen Vigna <jug@sad.it>
361 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
362 ifdef form_table out if NEW_TABULAR.
364 2000-08-21 Juergen Vigna <jug@sad.it>
366 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
367 (draw): fixed draw position so that the cursor is positioned in the
369 (InsetMotionNotify): hide/show cursor so the position is updated.
370 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
371 using cellstart() function where it should be used.
373 * src/insets/insettext.C (draw): ditto.
375 * src/tabular.C: fixed initialization of some missing variables and
376 made BoxType into an enum.
378 2000-08-22 Marko Vendelin <markov@ioc.ee>
379 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
380 stock menu item using action numerical value, not its string
384 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
386 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
387 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
389 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
391 * src/frontends/xforms/GUIRunTime.C: new file
393 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
394 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
396 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
398 * src/frontends/kde/GUIRunTime.C: new file
400 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
401 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
403 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
405 * src/frontends/gnome/GUIRunTime.C: new file
407 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
410 * src/frontends/GUIRunTime.h: removed constructor and destructor,
411 small change to documetentation.
413 * src/frontends/GUIRunTime.C: removed file
415 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
417 * src/lyxparagraph.h: enable NEW_TABULAR as default
419 * src/lyxfunc.C (processKeySym): remove some commented code
421 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
422 NEW_TABULAR around the fd_form_table_options.
424 * src/lyx_gui.C (runTime): call the static member function as
425 GUIRunTime::runTime().
427 2000-08-21 Allan Rae <rae@lyx.org>
429 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
432 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
434 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
436 2000-08-21 Allan Rae <rae@lyx.org>
438 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
440 * src/frontends/xforms/FormPreferences.C (build): use setOK
441 * src/frontends/xforms/FormDocument.C (build): use setOK
442 (FormDocument): use the appropriate policy.
444 2000-08-21 Allan Rae <rae@lyx.org>
446 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
447 automatic [de]activation of arbitrary objects when in a read-only state.
449 * src/frontends/ButtonPolicies.h: More documentation
450 (isReadOnly): added to support the above.
452 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
454 2000-08-18 Juergen Vigna <jug@sad.it>
456 * src/insets/insettabular.C (getStatus): changed to return func_status.
458 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
459 display toggle menu entries if they are.
461 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
462 new document layout now.
464 * src/lyxfunc.C: ditto
466 * src/lyx_gui_misc.C: ditto
468 * src/lyx_gui.C: ditto
470 * lib/ui/default.ui: removed paper and quotes layout as they are now
471 all in the document layout tabbed folder.
473 * src/frontends/xforms/forms/form_document.fd: added Restore
474 button and callbacks for all inputs for Allan's ButtonPolicy.
476 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
477 (CheckChoiceClass): added missing params setting on class change.
478 (UpdateLayoutDocument): added for updating the layout on params.
479 (build): forgot to RETURN_ALWAYS input_doc_spacing.
480 (FormDocument): Implemented Allan's ButtonPolicy with the
483 2000-08-17 Allan Rae <rae@lyx.org>
485 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
486 so we can at least see the credits again.
488 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
489 controller calls for the appropriate callbacks. Note that since Ok
490 calls apply followed by cancel, and apply isn't a valid input for the
491 APPLIED state, the bc_ calls have to be made in the static callback not
492 within each of the real callbacks.
494 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
495 (setOk): renamed from setOkay()
497 2000-08-17 Juergen Vigna <jug@sad.it>
499 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
500 in the implementation part.
501 (composeUIInfo): don't show optional menu-items.
503 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
505 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
507 * src/bufferview_funcs.C (CurrentState): fixed to show also the
508 text-state when in a text-inset.
510 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
512 2000-08-17 Marko Vendelin <markov@ioc.ee>
513 * src/frontends/gnome/FormIndex.C
514 * src/frontends/gnome/FormIndex.h
515 * src/frontends/gnome/FormToc.C
516 * src/frontends/gnome/FormToc.h
517 * src/frontends/gnome/dialogs
518 * src/frontends/gnome/diatoc_callbacks.c
519 * src/frontends/gnome/diatoc_callbacks.h
520 * src/frontends/gnome/diainsertindex_callbacks.h
521 * src/frontends/gnome/diainsertindex_callbacks.c
522 * src/frontends/gnome/diainsertindex_interface.c
523 * src/frontends/gnome/diainsertindex_interface.h
524 * src/frontends/gnome/diatoc_interface.h
525 * src/frontends/gnome/diatoc_interface.c
526 * src/frontends/gnome/Makefile.am: Table of Contents and
527 Insert Index dialogs implementation for Gnome frontend
529 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
531 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
533 * src/frontends/gnome/diainserturl_interface.c: make the dialog
536 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
538 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
539 destructor. Don't definde if you don't need it
540 (processEvents): made static, non-blocking events processing for
542 (runTime): static method. event loop for xforms
543 * similar as above for kde and gnome.
545 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
547 (runTime): new method calss the real frontends runtime func.
549 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
551 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
553 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
555 2000-08-16 Juergen Vigna <jug@sad.it>
557 * src/lyx_gui.C (runTime): added GUII RunTime support.
559 * src/frontends/Makefile.am:
560 * src/frontends/GUIRunTime.[Ch]:
561 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
562 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
563 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
565 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
567 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
568 as this is already set in ${FRONTEND_INCLUDE} if needed.
570 * configure.in (CPPFLAGS): setting the include dir for the frontend
571 directory and don't set FRONTEND=xforms for now as this is executed
574 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
576 * src/frontends/kde/Makefile.am:
577 * src/frontends/kde/FormUrl.C:
578 * src/frontends/kde/FormUrl.h:
579 * src/frontends/kde/formurldialog.h:
580 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
582 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
584 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
586 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
588 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
591 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
593 * src/WorkArea.C (work_area_handler): more work to get te
594 FL_KEYBOARD to work with xforms 0.88 too, please test.
596 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
598 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
600 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
603 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
605 * src/Timeout.h: remove Qt::emit hack.
607 * several files: changes to allo doc++ compilation
609 * src/lyxfunc.C (processKeySym): new method
610 (processKeyEvent): comment out if FL_REVISION < 89
612 * src/WorkArea.C: change some debugging levels.
613 (WorkArea): set wantkey to FL_KEY_ALL
614 (work_area_handler): enable the FL_KEYBOARD clause, this enables
615 clearer code and the use of compose with XForms 0.89. Change to
616 use signals instead of calling methods in bufferview directly.
618 * src/Painter.C: change some debugging levels.
620 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
623 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
624 (workAreaKeyPress): new method
626 2000-08-14 Juergen Vigna <jug@sad.it>
628 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
630 * config/kde.m4: addes some features
632 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
633 include missing xforms dialogs.
635 * src/Timeout.h: a hack to be able to compile with qt/kde.
637 * sigc++/.cvsignore: added acinclude.m4
639 * lib/.cvsignore: added listerros
641 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
642 xforms tree as objects are needed for other frontends.
644 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
645 linking with not yet implemented xforms objects.
647 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
649 2000-08-14 Baruch Even <baruch.even@writeme.com>
651 * src/frontends/xforms/FormGraphics.h:
652 * src/frontends/xforms/FormGraphics.C:
653 * src/frontends/xforms/RadioButtonGroup.h:
654 * src/frontends/xforms/RadioButtonGroup.C:
655 * src/insets/insetgraphics.h:
656 * src/insets/insetgraphics.C:
657 * src/insets/insetgraphicsParams.h:
658 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
659 instead of spaces, and various other indentation issues to make the
660 sources more consistent.
662 2000-08-14 Marko Vendelin <markov@ioc.ee>
664 * src/frontends/gnome/dialogs/diaprint.glade
665 * src/frontends/gnome/FormPrint.C
666 * src/frontends/gnome/FormPrint.h
667 * src/frontends/gnome/diaprint_callbacks.c
668 * src/frontends/gnome/diaprint_callbacks.h
669 * src/frontends/gnome/diaprint_interface.c
670 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
673 * src/frontends/gnome/dialogs/diainserturl.glade
674 * src/frontends/gnome/FormUrl.C
675 * src/frontends/gnome/FormUrl.h
676 * src/frontends/gnome/diainserturl_callbacks.c
677 * src/frontends/gnome/diainserturl_callbacks.h
678 * src/frontends/gnome/diainserturl_interface.c
679 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
682 * src/frontends/gnome/Dialogs.C
683 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
684 all other dialogs. Copy all unimplemented dialogs from Xforms
687 * src/frontends/gnome/support.c
688 * src/frontends/gnome/support.h: support files generated by Glade
692 * config/gnome.m4: Gnome configuration scripts
694 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
695 configure --help message
697 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
698 only if there are no events pendling in Gnome/Gtk. This enhances
699 the performance of menus.
702 2000-08-14 Allan Rae <rae@lyx.org>
704 * lib/Makefile.am: listerrors cleaning
706 * lib/listerrors: removed -- generated file
707 * acinclude.m4: ditto
708 * sigc++/acinclude.m4: ditto
710 * src/frontends/xforms/forms/form_citation.fd:
711 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
714 * src/frontends/xforms/forms/makefile: I renamed the `install` target
715 `updatesrc` and now we have a `test` target that does what `updatesrc`
716 used to do. I didn't like having an install target that wasn't related
719 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
720 on all except FormGraphics. This may yet happen. Followed by a major
721 cleanup including using FL_TRANSIENT for most of the dialogs. More
722 changes to come when the ButtonController below is introduced.
724 * src/frontends/xforms/ButtonController.h: New file for managing up to
725 four buttons on a dialog according to an externally defined policy.
726 * src/frontends/xforms/Makefile.am: added above
728 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
729 Apply and Cancel/Close buttons and everything in between and beyond.
730 * src/frontends/Makefile.am: added above.
732 * src/frontends/xforms/forms/form_preferences.fd:
733 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
734 and removed variable 'status' as a result. Fixed the set_minsize thing.
735 Use the new screen-font-update after checking screen fonts were changed
736 Added a "Restore" button to restore the original lyxrc values while
737 editing. This restores everything not just the last input changed.
738 That's still a tricky one. As is the "LyX: this shouldn't happen..."
740 * src/LyXAction.C: screen-font-update added for updating buffers after
741 screen font settings have been changed.
742 * src/commandtags.h: ditto
743 * src/lyxfunc.C: ditto
745 * forms/lyx.fd: removed screen fonts dialog.
746 * src/lyx_gui.C: ditto
747 * src/menus.[Ch]: ditto
748 * src/lyx.[Ch]: ditto
749 * src/lyx_cb.C: ditto + code from here moved to make
750 screen-font-update. And people wonder why progress on GUII is
751 slow. Look at how scattered this stuff was! It takes forever
754 * forms/fdfix.sh: Fixup the spacing after commas.
755 * forms/makefile: Remove date from generated files. Fewer clashes now.
756 * forms/bullet_forms.C.patch: included someones handwritten changes
758 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
759 once I've discovered why LyXRC was made noncopyable.
760 * src/lyx_main.C: ditto
762 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
764 * src/frontends/xforms/forms/fdfix.sh:
765 * src/frontends/xforms/forms/fdfixh.sed:
766 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
767 * src/frontends/xforms/Form*.[hC]:
768 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
769 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
770 provide a destructor for the struct FD_form_xxxx. Another version of
771 the set_[max|min]size workaround and a few other cleanups. Actually,
772 Angus' patch from 20000809.
774 2000-08-13 Baruch Even <baruch.even@writeme.com>
776 * src/insets/insetgraphics.C (Clone): Added several fields that needed
779 2000-08-11 Juergen Vigna <jug@sad.it>
781 * src/insets/insetgraphics.C (InsetGraphics): changing init
782 order because of warnings.
784 * src/frontends/xforms/forms/makefile: adding patching .C with
787 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
788 from .C.patch to .c.patch
790 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
791 order because of warning.
793 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
795 * src/frontends/Liason.C (setMinibuffer): new helper function
797 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
799 * src/lyxfunc.C (Dispatch): calling new Document-Layout
801 * lib/ui/default.ui: commented out PaperLayout entry
803 * src/frontends/xforms/form_document.[Ch]: new added files
805 * src/frontends/xforms/FormDocument.[Ch]: ditto
807 * src/frontends/xforms/forms/form_document.fd: ditto
809 * src/frontends/xforms/forms/form_document.C.patch: ditto
811 2000-08-10 Juergen Vigna <jug@sad.it>
813 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
814 (InsetGraphics): initialized cacheHandle to 0.
815 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
817 2000-08-10 Baruch Even <baruch.even@writeme.com>
819 * src/graphics/GraphicsCache.h:
820 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
821 correctly as a cache.
823 * src/graphics/GraphicsCacheItem.h:
824 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
827 * src/graphics/GraphicsCacheItem_pimpl.h:
828 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
831 * src/insets/insetgraphics.h:
832 * src/insets/insetgraphics.C: Changed from using a signal notification
833 to polling when image is not loaded.
835 2000-08-10 Allan Rae <rae@lyx.org>
837 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
838 that there are two functions that have to been taken out of line by
839 hand and aren't taken care of in the script. (Just a reminder note)
841 * sigc++/macros/*.h.m4: Updated as above.
843 2000-08-09 Juergen Vigna <jug@sad.it>
845 * src/insets/insettext.C (draw): small fix for clearing rectangle.
847 * src/insets/insettabular.C: make drawing of single cell smarter.
849 2000-08-09 Marko Vendelin <markov@ioc.ee>
850 * src/frontends/gnome/Menubar_pimpl.C
851 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
852 implementation: new files
854 * src/frontends/gnome/mainapp.C
855 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
858 * src/main.C: create Gnome main window
860 * src/frontends/xforms/Menubar_pimpl.h
861 * src/frontends/Menubar.C
862 * src/frontends/Menubar.h: added method Menubar::update that calls
863 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
865 * src/LyXView.C: calls Menubar::update to update the state
868 * src/frontends/gnome/Makefile.am: added new files
870 * src/frontends/Makefile.am: added frontend compiler options
872 2000-08-08 Juergen Vigna <jug@sad.it>
874 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
876 * src/bufferlist.C (close):
877 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
878 documents if exiting without saving.
880 * src/buffer.C (save): use removeAutosaveFile()
882 * src/support/filetools.C (removeAutosaveFile): new function.
884 * src/lyx_cb.C (MenuWrite): returns a bool now.
885 (MenuWriteAs): check if file could really be saved and revert to the
887 (MenuWriteAs): removing old autosavefile if existant.
889 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
890 before Goto toggle declaration, because of compiler warning.
892 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
894 * src/lyxfunc.C (MenuNew): small fix.
896 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
898 * src/bufferlist.C (newFile):
899 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
901 * src/lyxrc.C: added new_ask_filename tag
903 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
905 * src/lyx.fd: removed code pertaining to form_ref
906 * src/lyx.[Ch]: ditto
907 * src/lyx_cb.C: ditto
908 * src/lyx_gui.C: ditto
909 * src/lyx_gui_misc.C: ditto
911 * src/BufferView_pimpl.C (restorePosition): update buffer only
914 * src/commandtags.h (LFUN_REFTOGGLE): removed
915 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
916 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
917 (LFUN_REFBACK): renamed LFUN_REF_BACK
919 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
921 * src/lyxfunc.C (Dispatch): ditto.
922 InsertRef dialog is now GUI-independent.
924 * src/texrow.C: added using std::endl;
926 * src/insets/insetref.[Ch]: strip out large amounts of code.
927 The inset is now a container and this functionality is now
928 managed by a new FormRef dialog
930 * src/frontends/Dialogs.h (showRef, createRef): new signals
932 * src/frontends/xforms/FormIndex.[Ch],
933 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
934 when setting dialog's min/max size
935 * src/frontends/xforms/FormIndex.[Ch]: ditto
937 * src/frontends/xforms/FormRef.[Ch],
938 src/frontends/xforms/forms/form_ref.fd: new xforms
939 implementation of an InsetRef dialog
941 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
944 * src/graphics/XPM_Renderer.C (isImageFormatOK):
945 ios::nocreate is not part of the standard. Removed.
947 2000-08-07 Baruch Even <baruch.even@writeme.com>
949 * src/graphics/Renderer.h:
950 * src/graphics/Renderer.C: Added base class for rendering of different
951 image formats into Pixmaps.
953 * src/graphics/XPM_Renderer.h:
954 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
955 in a different class.
957 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
958 easily add support for other formats.
960 * src/insets/figinset.C: plugged a leak of an X resource.
962 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
964 * src/CutAndPaste.[Ch]: make all metods static.
966 * development/Code_rules/Rules: more work, added section on
967 Exceptions, and a References section.
969 * a lot of header files: work to make doc++ able to generate the
970 source documentation, some workarounds of doc++ problems. Doc++ is
971 now able to generate the documentation.
973 2000-08-07 Juergen Vigna <jug@sad.it>
975 * src/insets/insettabular.C (recomputeTextInsets): removed function
977 * src/tabular.C (SetWidthOfMulticolCell):
979 (calculate_width_of_column_NMC): fixed return value so that it really
980 only returns true if the column-width has changed (there where
981 problems with muliticolumn-cells in this column).
983 2000-08-04 Juergen Vigna <jug@sad.it>
985 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
986 also on the scrollstatus of the inset.
987 (workAreaMotionNotify): ditto.
989 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
991 2000-08-01 Juergen Vigna <jug@sad.it>
993 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
996 * src/LyXAction.C (init):
997 * src/insets/inset.C (LocalDispatch): added support for
1000 * src/insets/inset.C (scroll): new functions.
1002 * src/insets/insettext.C (removeNewlines): new function.
1003 (SetAutoBreakRows): removes forced newlines in the text of the
1004 paragraph if autoBreakRows is set to false.
1006 * src/tabular.C (Latex): generates a parbox around the cell contents
1009 * src/frontends/xforms/FormTabular.C (local_update): removed
1010 the radio_useparbox button.
1012 * src/tabular.C (UseParbox): new function
1014 2000-08-06 Baruch Even <baruch.even@writeme.com>
1016 * src/graphics/GraphicsCache.h:
1017 * src/graphics/GraphicsCache.C:
1018 * src/graphics/GraphicsCacheItem.h:
1019 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1022 * src/insets/insetgraphics.h:
1023 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1024 drawing of the inline image.
1026 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1027 into the wrong position.
1029 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1032 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1034 * src/support/translator.h: move all typedefs to public section
1036 * src/support/filetools.C (MakeLatexName): return string const
1038 (TmpFileName): ditto
1039 (FileOpenSearch): ditto
1041 (LibFileSearch): ditto
1042 (i18nLibFileSearch): ditto
1045 (CreateTmpDir): ditto
1046 (CreateBufferTmpDir): ditto
1047 (CreateLyXTmpDir): ditto
1050 (MakeAbsPath): ditto
1052 (OnlyFilename): ditto
1054 (NormalizePath): ditto
1055 (CleanupPath): ditto
1056 (GetFileContents): ditto
1057 (ReplaceEnvironmentPath): ditto
1058 (MakeRelPath): ditto
1060 (ChangeExtension): ditto
1061 (MakeDisplayPath): ditto
1062 (do_popen): return cmdret const
1063 (findtexfile): return string const
1065 * src/support/DebugStream.h: add some /// to please doc++
1067 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1069 * src/texrow.C (same_rownumber): functor to use with find_if
1070 (getIdFromRow): rewritten to use find_if and to not update the
1071 positions. return true if row is found
1072 (increasePos): new method, use to update positions
1074 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1076 * src/lyxlex_pimpl.C (verifyTable): new method
1079 (GetString): return string const
1080 (pushTable): rewrite to use std::stack
1082 (setFile): better check
1085 * src/lyxlex.h: make LyXLex noncopyable
1087 * src/lyxlex.C (text): return char const * const
1088 (GetString): return string const
1089 (getLongString): return string const
1091 * src/lyx_gui_misc.C (askForText): return pair<...> const
1093 * src/lastfiles.[Ch] (operator): return string const
1095 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1096 istringstream not char const *.
1097 move token.end() out of loop.
1098 (readFile): move initializaton of token
1100 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1101 getIdFromRow is successful.
1103 * lib/bind/emacs.bind: don't include menus bind
1105 * development/Code_rules/Rules: the beginnings of making this
1106 better and covering more of the unwritten rules that we have.
1108 * development/Code_rules/Recommendations: a couple of wording
1111 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1113 * src/support/strerror.c: remove C++ comment.
1115 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1117 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1118 LFUN_INDEX_INSERT_LAST
1120 * src/texrow.C (getIdFromRow): changed from const_iterator to
1121 iterator, allowing code to compile with DEC cxx
1123 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1124 stores part of the class, as suggested by Allan. Will allow
1126 (apply): test to apply uses InsetCommandParams operator!=
1128 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1129 (apply): test to apply uses InsetCommandParams operator!=
1131 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1132 stores part of the class.
1133 (update): removed limits on min/max size.
1135 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1136 (apply): test to apply uses InsetCommandParams operator!=
1138 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1139 (Read, Write, scanCommand, getCommand): moved functionality
1140 into InsetCommandParams.
1142 (getScreenLabel): made pure virtual
1143 new InsetCommandParams operators== and !=
1145 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1146 c-tors based on InsetCommandParams. Removed others.
1147 * src/insets/insetinclude.[Ch]: ditto
1148 * src/insets/insetlabel.[Ch]: ditto
1149 * src/insets/insetparent.[Ch]: ditto
1150 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1152 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1153 insets derived from InsetCommand created using similar c-tors
1154 based on InsetCommandParams
1155 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1156 * src/menus.C (ShowRefsMenu): ditto
1157 * src/paragraph.C (Clone): ditto
1158 * src/text2.C (SetCounter): ditto
1159 * src/lyxfunc.C (Dispatch) ditto
1160 Also recreated old InsetIndex behaviour exactly. Can now
1161 index-insert at the start of a paragraph and index-insert-last
1162 without launching the pop-up.
1164 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1166 * lib/lyxrc.example: mark te pdf options as non functional.
1168 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1169 (isStrDbl): move tmpstr.end() out of loop.
1170 (strToDbl): move intialization of tmpstr
1171 (lowercase): return string const and move tmp.end() out of loop.
1172 (uppercase): return string const and move tmp.edn() out of loop.
1173 (prefixIs): add assertion
1178 (containsOnly): ditto
1179 (containsOnly): ditto
1180 (containsOnly): ditto
1181 (countChar): make last arg char not char const
1182 (token): return string const
1183 (subst): return string const, move tmp.end() out of loop.
1184 (subst): return string const, add assertion
1185 (strip): return string const
1186 (frontStrip): return string const, add assertion
1187 (frontStrip): return string const
1192 * src/support/lstrings.C: add inclde "LAssert.h"
1193 (isStrInt): move tmpstr.end() out of loop.
1195 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1196 toollist.end() out of loop.
1197 (deactivate): move toollist.end() out of loop.
1198 (update): move toollist.end() out of loop.
1199 (updateLayoutList): move tc.end() out of loop.
1200 (add): move toollist.end() out of loop.
1202 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1203 md.end() out of loop.
1205 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1207 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1210 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1211 (Erase): move insetlist.end() out of loop.
1213 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1214 ref to const string as first arg. Move initialization of some
1215 variables, whitespace changes.
1217 * src/kbmap.C (defkey): move table.end() out of loop.
1218 (kb_keymap): move table.end() out of loop.
1219 (findbinding): move table.end() out of loop.
1221 * src/MenuBackend.C (hasMenu): move end() out of loop.
1222 (getMenu): move end() out of loop.
1223 (getMenu): move menulist_.end() out of loop.
1225 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1227 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1230 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1231 (getFromLyXName): move infotab.end() out of loop.
1233 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1234 -fvtable-thunks -ffunction-sections -fdata-sections
1236 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1238 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1241 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1243 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1245 * src/frontends/xforms/FormCitation.[Ch],
1246 src/frontends/xforms/FormIndex.[Ch],
1247 src/frontends/xforms/FormToc.[Ch],
1248 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1250 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1252 * src/commandtags.h: renamed, created some flags for citation
1255 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1257 * src/lyxfunc.C (dispatch): use signals to insert index entry
1259 * src/frontends/Dialogs.h: new signal createIndex
1261 * src/frontends/xforms/FormCommand.[Ch],
1262 src/frontends/xforms/FormCitation.[Ch],
1263 src/frontends/xforms/FormToc.[Ch],
1264 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1266 * src/insets/insetindex.[Ch]: GUI-independent
1268 * src/frontends/xforms/FormIndex.[Ch],
1269 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1272 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1274 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1275 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1277 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1279 * src/insets/insetref.C (Latex): rewrite so that there is now
1280 question that a initialization is requested.
1282 * src/insets/insetcommand.h: reenable the hide signal
1284 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1286 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1287 fix handling of shortcuts (many bugs :)
1288 (add_lastfiles): ditto.
1290 * lib/ui/default.ui: fix a few shortcuts.
1292 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1294 * Makefile.am: Fix ``rpmdist'' target to return the exit
1295 status of the ``rpm'' command, instead of the last command in
1296 the chain (the ``rm lyx.xpm'' command, which always returns
1299 2000-08-02 Allan Rae <rae@lyx.org>
1301 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1302 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1303 * src/frontends/xforms/FormToc.C (FormToc): ditto
1305 * src/frontends/xforms/Makefile.am: A few forgotten files
1307 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1308 Signals-not-copyable-problem Lars' started commenting out.
1310 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1312 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1314 * src/insets/insetcommand.h: Signals is not copyable so anoter
1315 scheme for automatic hiding of forms must be used.
1317 * src/frontends/xforms/FormCitation.h: don't inerit from
1318 noncopyable, FormCommand already does that.
1319 * src/frontends/xforms/FormToc.h: ditto
1320 * src/frontends/xforms/FormUrl.h: ditto
1322 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1324 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1326 * src/insets/insetcommand.h (hide): new SigC::Signal0
1327 (d-tor) new virtual destructor emits hide signal
1329 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1330 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1332 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1333 LOF and LOT. Inset is now GUI-independent
1335 * src/insets/insetloa.[Ch]: redundant
1336 * src/insets/insetlof.[Ch]: ditto
1337 * src/insets/insetlot.[Ch]: ditto
1339 * src/frontends/xforms/forms/form_url.fd: tweaked!
1340 * src/frontends/xforms/forms/form_citation.fd: ditto
1342 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1343 dialogs dealing with InsetCommand insets
1345 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1346 FormCommand base class
1347 * src/frontends/xforms/FormUrl.[Ch]: ditto
1349 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1351 * src/frontends/xforms/FormToc.[Ch]: ditto
1353 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1354 passed a generic InsetCommand pointer
1355 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1357 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1358 and modified InsetTOC class
1359 * src/buffer.C: ditto
1361 * forms/lyx.fd: strip out old FD_form_toc code
1362 * src/lyx_gui_misc.C: ditto
1363 * src/lyx_gui.C: ditto
1364 * src/lyx_cb.C: ditto
1365 * src/lyx.[Ch]: ditto
1367 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1369 * src/support/utility.hpp: tr -d '\r'
1371 2000-08-01 Juergen Vigna <jug@sad.it>
1373 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1375 * src/commandtags.h:
1376 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1377 LFUN_TABULAR_FEATURES.
1379 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1380 LFUN_LAYOUT_TABULAR.
1382 * src/insets/insettabular.C (getStatus): implemented helper function.
1384 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1386 2000-07-31 Juergen Vigna <jug@sad.it>
1388 * src/text.C (draw): fixed screen update problem for text-insets.
1390 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1391 something changed probably this has to be added in various other
1394 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1396 2000-07-31 Baruch Even <baruch.even@writeme.com>
1398 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1399 templates to satisfy compaq cxx.
1402 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1404 * src/support/translator.h (equal_1st_in_pair::operator()): take
1405 const ref pair_type as arg.
1406 (equal_2nd_in_pair::operator()): ditto
1407 (Translator::~Translator): remove empty d-tor.
1409 * src/graphics/GraphicsCache.C: move include config.h to top, also
1410 put initialization of GraphicsCache::singleton here.
1411 (~GraphicsCache): move here
1412 (addFile): take const ref as arg
1415 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1417 * src/BufferView2.C (insertLyXFile): change te with/without header
1420 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1422 * src/frontends/xforms/FormGraphics.C (apply): add some
1423 static_cast. Not very nice, but required by compaq cxx.
1425 * src/frontends/xforms/RadioButtonGroup.h: include header
1426 <utility> instead of <pair.h>
1428 * src/insets/insetgraphicsParams.C: add using directive.
1429 (readResize): change return type to void.
1430 (readOrigin): ditto.
1432 * src/lyxfunc.C (getStatus): add missing break for build-program
1433 function; add test for Literate for export functions.
1435 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1436 entries in Options menu.
1438 2000-07-31 Baruch Even <baruch.even@writeme.com>
1440 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1441 protect against auto-allocation; release icon when needed.
1443 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1445 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1446 on usual typewriter.
1448 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1449 earlier czech.kmap), useful only for programming.
1451 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1453 * src/frontends/xforms/FormCitation.h: fix conditioning around
1456 2000-07-31 Juergen Vigna <jug@sad.it>
1458 * src/frontends/xforms/FormTabular.C (local_update): changed
1459 radio_linebreaks to radio_useparbox and added radio_useminipage.
1461 * src/tabular.C: made support for using minipages/parboxes.
1463 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1465 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1467 (descent): so the cursor is in the middle.
1468 (width): bit smaller box.
1470 * src/insets/insetgraphics.h: added display() function.
1472 2000-07-31 Baruch Even <baruch.even@writeme.com>
1474 * src/frontends/Dialogs.h: Added showGraphics signals.
1476 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1477 xforms form definition of the graphics dialog.
1479 * src/frontends/xforms/FormGraphics.h:
1480 * src/frontends/xforms/FormGraphics.C: Added files, the
1481 GUIndependent code of InsetGraphics
1483 * src/insets/insetgraphics.h:
1484 * src/insets/insetgraphics.C: Major writing to make it work.
1486 * src/insets/insetgraphicsParams.h:
1487 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1488 struct between InsetGraphics and GUI.
1490 * src/LaTeXFeatures.h:
1491 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1492 support for graphicx package.
1494 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1495 for the graphics inset.
1497 * src/support/translator.h: Added file, used in
1498 InsetGraphicsParams. this is a template to translate between two
1501 * src/frontends/xforms/RadioButtonGroup.h:
1502 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1503 way to easily control a radio button group.
1505 2000-07-28 Juergen Vigna <jug@sad.it>
1507 * src/insets/insettabular.C (LocalDispatch):
1508 (TabularFeatures): added support for lyx-functions of tabular features.
1509 (cellstart): refixed this function after someone wrongly changed it.
1511 * src/commandtags.h:
1512 * src/LyXAction.C (init): added support for tabular-features
1514 2000-07-28 Allan Rae <rae@lyx.org>
1516 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1517 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1518 triggers the callback for input checking. As a result we sometimes get
1519 "LyX: This shouldn't happen..." printed to cerr.
1520 (input): Started using status variable since I only free() on
1521 destruction. Some input checking for paths and font sizes.
1523 * src/frontends/xforms/FormPreferences.h: Use status to control
1524 activation of Ok and Apply
1526 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1527 callback. Also resized to stop segfaults with 0.88. The problem is
1528 that xforms-0.88 requires the folder to be wide enough to fit all the
1529 tabs. If it isn't it causes all sorts of problems.
1531 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1533 * src/frontends/xforms/forms/README: Reflect reality.
1535 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1536 * src/frontends/xforms/forms/makefile: ditto.
1538 * src/commandtags.h: Get access to new Preferences dialog
1539 * src/LyXAction.C: ditto
1540 * src/lyxfunc.C: ditto
1541 * lib/ui/default.ui: ditto
1543 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1545 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1547 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1550 * src/frontends/xforms/form_url.[Ch]: added.
1552 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1554 * src/insets/insetbib.h: fixed bug in previous commit
1556 * src/frontends/xforms/FormUrl.h: ditto
1558 * src/frontends/xforms/FormPrint.h: ditto
1560 * src/frontends/xforms/FormPreferences.h: ditto
1562 * src/frontends/xforms/FormCopyright.h: ditto
1564 * src/frontends/xforms/FormCitation.C: ditto
1566 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1567 private copyconstructor and private default contructor
1569 * src/support/Makefile.am: add utility.hpp
1571 * src/support/utility.hpp: new file from boost
1573 * src/insets/insetbib.h: set owner in clone
1575 * src/frontends/xforms/FormCitation.C: added missing include
1578 * src/insets/form_url.[Ch]: removed
1580 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1582 * development/lyx.spec.in
1583 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1584 file/directory re-organization.
1586 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1588 * src/insets/insetcommand.[Ch]: moved the string data and
1589 associated manipulation methods into a new stand-alone class
1590 InsetCommandParams. This class has two additional methods
1591 getAsString() and setFromString() allowing the contents to be
1592 moved around as a single string.
1593 (addContents) method removed.
1594 (setContents) method no longer virtual.
1596 * src/buffer.C (readInset): made use of new InsetCitation,
1597 InsetUrl constructors based on InsetCommandParams.
1599 * src/commandtags.h: add LFUN_INSERT_URL
1601 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1602 independent InsetUrl and use InsetCommandParams to extract
1603 string info and create new Insets.
1605 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1607 * src/frontends/xforms/FormCitation.C (apply): uses
1610 * src/frontends/xforms/form_url.C
1611 * src/frontends/xforms/form_url.h
1612 * src/frontends/xforms/FormUrl.h
1613 * src/frontends/xforms/FormUrl.C
1614 * src/frontends/xforms/forms/form_url.fd: new files
1616 * src/insets/insetcite.[Ch]: removed unused constructors.
1618 * src/insets/insetinclude.[Ch]: no longer store filename
1620 * src/insets/inseturl.[Ch]: GUI-independent.
1622 2000-07-26 Juergen Vigna <jug@sad.it>
1623 * renamed frontend from gtk to gnome as it is that what is realized
1624 and did the necessary changes in the files.
1626 2000-07-26 Marko Vendelin <markov@ioc.ee>
1628 * configure.in: cleaning up gnome configuration scripts
1630 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1632 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1633 shortcuts syndrom by redrawing them explicitely (a better solution
1634 would be appreciated).
1636 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1638 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1641 * src/lyx_cb.C (MenuExport): change html export to do the right
1642 thing depending of the document type (instead of having
1643 html-linuxdoc and html-docbook).
1644 * src/lyxfunc.C (getStatus): update for html
1645 * lib/ui/default.ui: simplify due to the above change.
1646 * src/menus.C (ShowFileMenu): update too (in case we need it).
1648 * src/MenuBackend.C (read): if a menu is defined twice, add the
1649 new entries to the exiting one.
1651 2000-07-26 Juergen Vigna <jug@sad.it>
1653 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1655 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1656 and return a bool if it did actual save the file.
1657 (AutoSave): don't autosave a unnamed doc.
1659 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1660 check if this is an UNNAMED new file and react to it.
1661 (newFile): set buffer to unnamed and change to not mark a new
1662 buffer dirty if I didn't do anything with it.
1664 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1666 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1668 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1669 friend as per Angus's patch posted to lyx-devel.
1671 * src/ext_l10n.h: updated
1673 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1674 gettext on the style string right before inserting them into the
1677 * autogen.sh: add code to extract style strings form layout files,
1678 not good enough yet.
1680 * src/frontends/gtk/.cvsignore: add MAKEFILE
1682 * src/MenuBackend.C (read): run the label strings through gettext
1683 before storing them in the containers.
1685 * src/ext_l10n.h: new file
1687 * autogen.sh : generate the ext_l10n.h file here
1689 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1691 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1694 * lib/ui/default.ui: fix a couple of typos.
1696 * config/gnome/gtk.m4: added (and added to the list of files in
1699 * src/insets/insetinclude.C (unique_id): fix when we are using
1700 lyxstring instead of basic_string<>.
1701 * src/insets/insettext.C (LocalDispatch): ditto.
1702 * src/support/filetools.C: ditto.
1704 * lib/configure.m4: create the ui/ directory if necessary.
1706 * src/LyXView.[Ch] (updateToolbar): new method.
1708 * src/BufferView_pimpl.C (buffer): update the toolbar when
1709 opening/closing buffer.
1711 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1713 * src/LyXAction.C (getActionName): enhance to return also the name
1714 and options of pseudo-actions.
1715 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1717 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1718 as an example of what is possible). Used in File->Build too (more
1719 useful) and in the import/export menus (to mimick the complicated
1720 handling of linuxdoc and friends). Try to update all the entries.
1722 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1725 * src/MenuBackend.C (read): Parse the new OptItem tag.
1727 * src/MenuBackend.h: Add a new optional_ data member (used if the
1728 entry should be omitted when the lyxfunc is disabled).
1730 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1731 function, used as a shortcut.
1732 (create_submenu): align correctly the shortcuts on the widest
1735 * src/MenuBackend.h: MenuItem.label() only returns the label of
1736 the menu without shortcut; new method shortcut().
1738 2000-07-14 Marko Vendelin <markov@ioc.ee>
1740 * src/frontends/gtk/Dialogs.C:
1741 * src/frontends/gtk/FormCopyright.C:
1742 * src/frontends/gtk/FormCopyright.h:
1743 * src/frontends/gtk/Makefile.am: added these source-files for the
1744 Gtk/Gnome support of the Copyright-Dialog.
1746 * src/main.C: added Gnome::Main initialization if using
1747 Gtk/Gnome frontend-GUI.
1749 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1751 * config/gnome/aclocal-include.m4
1752 * config/gnome/compiler-flags.m4
1753 * config/gnome/curses.m4
1754 * config/gnome/gnome--.m4
1755 * config/gnome/gnome-bonobo-check.m4
1756 * config/gnome/gnome-common.m4
1757 * config/gnome/gnome-fileutils.m4
1758 * config/gnome/gnome-ghttp-check.m4
1759 * config/gnome/gnome-gnorba-check.m4
1760 * config/gnome/gnome-guile-checks.m4
1761 * config/gnome/gnome-libgtop-check.m4
1762 * config/gnome/gnome-objc-checks.m4
1763 * config/gnome/gnome-orbit-check.m4
1764 * config/gnome/gnome-print-check.m4
1765 * config/gnome/gnome-pthread-check.m4
1766 * config/gnome/gnome-support.m4
1767 * config/gnome/gnome-undelfs.m4
1768 * config/gnome/gnome-vfs.m4
1769 * config/gnome/gnome-x-checks.m4
1770 * config/gnome/gnome-xml-check.m4
1771 * config/gnome/gnome.m4
1772 * config/gnome/gperf-check.m4
1773 * config/gnome/gtk--.m4
1774 * config/gnome/linger.m4
1775 * config/gnome/need-declaration.m4: added configuration scripts
1776 for Gtk/Gnome frontend-GUI
1778 * configure.in: added support for the --with-frontend=gtk option
1780 * autogen.sh: added config/gnome/* to list of config-files
1782 * acconfig.h: added define for GTKGUI-support
1784 * config/lyxinclude.m4: added --with-frontend[=value] option value
1785 for Gtk/Gnome frontend-GUI support.
1787 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1789 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1793 * src/paragraph.C (GetChar): remove non-const version
1795 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1796 (search_kw): use it.
1798 * src/lyx_main.C (init): if "preferences" exist, read that instead
1800 (ReadRcFile): return bool if the file could be read ok.
1801 (ReadUIFile): add a check to see if lex file is set ok.
1803 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1804 bastring can be used instead of lyxstring (still uses the old code
1805 if std::string is good enough or if lyxstring is used.)
1807 * src/encoding.C: make the arrays static, move ininle functions
1809 * src/encoding.h: from here.
1811 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1812 (parseSingleLyXformat2Token): move inset parsing to separate method
1813 (readInset): new private method
1815 * src/Variables.h: remove virtual from get().
1817 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1818 access to NEW_INSETS and NEW_TABULAR
1820 * src/MenuBackend.h: remove superfluous forward declaration of
1821 MenuItem. Add documentations tags "///", remove empty MenuItem
1822 destructor, remove private default contructor.
1824 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1826 (read): more string mlabel and mname to where they are used
1827 (read): remove unused variables mlabel and mname
1828 (defaults): unconditional clear, make menusetup take advantage of
1829 add returning Menu &.
1831 * src/LyXView.h: define NEW_MENUBAR as default
1833 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1834 to NEW_INSETS and NEW_TABULAR.
1835 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1836 defined. Change some of the "xxxx-inset-insert" functions names to
1839 * several files: more enahncements to NEW_INSETS and the resulting
1842 * lib/lyxrc.example (\date_insert_format): move to misc section
1844 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1845 bastring and use AC_CACHE_CHECK.
1846 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1847 the system have the newest methods. uses AC_CACHE_CHECK
1848 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1849 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1850 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1852 * configure.in: add LYX_CXX_GOOD_STD_STRING
1854 * acinclude.m4: recreated
1856 2000-07-24 Amir Karger
1858 * README: add Hebrew, Arabic kmaps
1861 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1863 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1866 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1868 * Lot of files: add pragma interface/implementation.
1870 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1872 * lib/ui/default.ui: new file (ans new directory). Contains the
1873 default menu and toolbar.
1875 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1876 global space. Toolbars are now read (as menus) in ui files.
1878 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1880 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1881 is disabled because the document is read-only. We want to have the
1882 toggle state of the function anyway.
1883 (getStatus): add code for LFUN_VC* functions (mimicking what is
1884 done in old-style menus)
1886 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1887 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1889 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1890 * src/BufferView_pimpl.C: ditto.
1891 * src/lyxfunc.C: ditto.
1893 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1894 default). This replaces old-style menus by new ones.
1896 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1897 MenuItem. Contain the data structure of a menu.
1899 * src/insets/insettext.C: use LyXView::setLayout instead of
1900 accessing directly the toolbar combox.
1901 * src/lyxfunc.C (Dispatch): ditto.
1903 * src/LyXView.C (setLayout): new method, which just calls
1904 Toolbar::setLayout().
1905 (updateLayoutChoice): move part of this method in Toolbar.
1907 * src/toolbar.[Ch]: removed.
1909 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1910 implementation the toolbar.
1912 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1913 the toolbar. It might make sense to merge it with ToolbarDefaults
1915 (setLayout): new function.
1916 (updateLayoutList): ditto.
1917 (openLayoutList): ditto.
1919 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1920 xforms implementation of the toolbar.
1921 (get_toolbar_func): comment out, since I do not
1922 know what it is good for.
1924 * src/ToolbarDefaults.h: Add the ItemType enum.
1926 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1927 for a list of allocated C strings. Used in Menubar xforms
1928 implementation to avoid memory leaks.
1930 * src/support/lstrings.[Ch] (uppercase): new version taking and
1934 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1935 * lib/bind/emacs.bind: ditto.
1937 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1939 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1940 forward decl of LyXView.
1942 * src/toolbar.C (toolbarItem): moved from toolbar.h
1943 (toolbarItem::clean): ditto
1944 (toolbarItem::~toolbarItem): ditto
1945 (toolbarItem::operator): ditto
1947 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1949 * src/paragraph.h: control the NEW_TABULAR define from here
1951 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1952 USE_TABULAR_INSETS to NEW_TABULAR
1954 * src/ToolbarDefaults.C: add include "lyxlex.h"
1956 * files using the old table/tabular: use NEW_TABULAR to control
1957 compilation of old tabular stuff.
1959 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1962 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1963 planemet in reading of old style floats, fix the \end_deeper
1964 problem when reading old style floats.
1966 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1968 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1970 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1972 * lib/bind/sciword.bind: updated.
1974 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1976 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1977 layout write problem
1979 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1981 * src/Makefile.am (INCLUDES): remove image directory from include
1984 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1985 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1987 * src/LyXView.C (create_form_form_main): read the application icon
1990 * lib/images/*.xpm: change the icons to use transparent color for
1993 * src/toolbar.C (update): change the color of the button when it
1996 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1998 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1999 setting explicitely the minibuffer.
2000 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2002 * src/LyXView.C (showState): new function. Shows font information
2003 in minibuffer and update toolbar state.
2004 (LyXView): call Toolbar::update after creating the
2007 * src/toolbar.C: change toollist to be a vector instead of a
2009 (BubbleTimerCB): get help string directly from the callback
2010 argument of the corresponding icon (which is the action)
2011 (set): remove unnecessary ugliness.
2012 (update): new function. update the icons (depressed, disabled)
2013 depending of the status of the corresponding action.
2015 * src/toolbar.h: remove help in toolbarItem
2017 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2019 * src/Painter.C (text): Added code for using symbol glyphs from
2020 iso10646 fonts. Currently diabled.
2022 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2025 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2026 magyar,turkish and usorbian.
2028 * src/paragraph.C (isMultiLingual): Made more efficient.
2030 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2033 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2034 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2035 Also changed the prototype to "bool math_insert_greek(char)".
2037 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2039 * lots of files: apply the NEW_INSETS on all code that will not be
2040 needed when we move to use the new insets. Enable the define in
2041 lyxparagrah.h to try it.
2043 * src/insets/insettabular.C (cellstart): change to be a static
2045 (InsetTabular): initialize buffer in the initializer list.
2047 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2049 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2050 form_print.h out of the header file. Replaced with forward
2051 declarations of the relevant struct.
2053 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2056 * src/commandtags.h: do not include "debug.h" which does not
2057 belong there. #include it in some other places because of this
2060 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2062 * src/insets/insetcaption.C: add a couple "using" directives.
2064 * src/toolbar.C (add): get the help text directly from lyxaction.
2066 (setPixmap): new function. Loads from disk and sets a pixmap on a
2067 botton; the name of the pixmap file is derived from the command
2070 * src/toolbar.h: remove members isBitmap and pixmap from
2073 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2074 * lib/images/: move many files from images/banner.xpm.
2076 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2078 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2079 * src/toolbar.C: ditto.
2080 * configure.in: ditto.
2081 * INSTALL: document.
2083 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2084 the spellchecker popup is closed from the WM.
2086 2000-07-19 Juergen Vigna <jug@sad.it>
2088 * src/insets/insetfloat.C (Write): small fix because we use the
2089 insetname for the type now!
2091 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2093 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2096 * src/frontends/Dialogs.h: removed hideCitation signal
2098 * src/insets/insetcite.h: added hide signal
2100 * src/insets/insetcite.C (~InsetCitation): emits new signal
2101 (getScreenLabel): "intelligent" label should now fit on the screen!
2103 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2105 * src/frontends/xforms/FormCitation.C (showInset): connects
2106 hide() to the inset's hide signal
2107 (show): modified to use fl_set_object_position rather than
2108 fl_set_object_geometry wherever possible
2110 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2112 * src/insets/lyxinset.h: add caption code
2114 * src/insets/insetfloat.C (type): new method
2116 * src/insets/insetcaption.C (Write): new method
2118 (LyxCode): new method
2120 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2121 to get it right together with using the FloatList.
2123 * src/commandtags.h: add LFUN_INSET_CAPTION
2124 * src/lyxfunc.C (Dispatch): handle it
2126 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2129 * src/Variables.[Ch]: make expand take a const reference, remove
2130 the destructor, some whitespace changes.
2132 * src/LyXAction.C (init): add caption-inset-insert
2134 * src/FloatList.C (FloatList): update the default floats a bit.
2136 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2138 * src/Variables.[Ch]: new files. Intended to be used for language
2139 specific strings (like \chaptername) and filename substitution in
2142 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2144 * lib/kbd/american.kmap: update
2146 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2148 * src/bufferparams.[Ch]: remove member allowAccents.
2150 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2152 * src/LaTeXLog.C: use the log_form.h header.
2153 * src/lyx_gui.C: ditto.
2154 * src/lyx_gui_misc.C: ditto.
2155 * src/lyxvc.h: ditto.
2157 * forms/log_form.fd: new file, created from latexoptions.fd. I
2158 kept the log popup and nuked the options form.
2160 * src/{la,}texoptions.[Ch]: removed.
2161 * src/lyx_cb.C (LaTeXOptions): ditto
2163 * src/lyx_gui.C (create_forms): do not handle the
2164 fd_latex_options form.
2166 2000-07-18 Juergen Vigna <jug@sad.it>
2168 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2169 name of the inset so that it can be requested outside (text2.C).
2171 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2174 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2176 * src/mathed/formula.h (ConvertFont): constify
2178 * src/mathed/formula.C (Read): add warning if \end_inset is not
2179 found on expected place.
2181 * src/insets/lyxinset.h (ConvertFont): consify
2183 * src/insets/insetquotes.C (ConvertFont): constify
2184 * src/insets/insetquotes.h: ditto
2186 * src/insets/insetinfo.h: add labelfont
2188 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2189 (ascent): use labelfont
2193 (Write): make .lyx file a bit nicer
2195 * src/insets/insetfloat.C (Write): simplify somewhat...
2196 (Read): add warning if arg is not found
2198 * src/insets/insetcollapsable.C: add using std::max
2199 (Read): move string token and add warning in arg is not found
2200 (draw): use std::max to get the right ty
2201 (getMaxWidth): simplify by using std::max
2203 * src/insets/insetsection.h: new file
2204 * src/insets/insetsection.C: new file
2205 * src/insets/insetcaption.h: new file
2206 * src/insets/insetcaption.C: new file
2208 * src/insets/inset.C (ConvertFont): constify signature
2210 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2211 insetcaption.[Ch] and insetsection.[Ch]
2213 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2214 uses to use LABEL_COUNTER_CHAPTER instead.
2215 * src/text2.C (SetCounter): here
2217 * src/counters.h: new file
2218 * src/counters.C: new file
2219 * src/Sectioning.h: new file
2220 * src/Sectioning.C: new file
2222 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2224 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2226 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2229 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2232 2000-07-17 Juergen Vigna <jug@sad.it>
2234 * src/tabular.C (Validate): check if array-package is needed.
2235 (SetVAlignment): added support for vertical alignment.
2236 (SetLTFoot): better support for longtable header/footers
2237 (Latex): modified to support added features.
2239 * src/LaTeXFeatures.[Ch]: added array-package.
2241 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2243 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2246 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2248 * configure.in: do not forget to put a space after -isystem.
2250 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2252 * lib/kbd/arabic.kmap: a few fixes.
2254 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2256 * some whitespace chagnes to a number of files.
2258 * src/support/DebugStream.h: change to make it easier for
2259 doc++ to parse correctly.
2260 * src/support/lyxstring.h: ditto
2262 * src/mathed/math_utils.C (compara): change to have only one
2264 (MathedLookupBOP): change because of the above.
2266 * src/mathed/math_delim.C (math_deco_compare): change to have only
2268 (search_deco): change becasue of the above.
2270 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2271 instead of manually coded one.
2273 * src/insets/insetquotes.C (Read): read the \end_inset too
2275 * src/insets/insetlatex.h: remove file
2276 * src/insets/insetlatex.C: remove file
2278 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2280 (InsetPrintIndex): remove destructor
2282 * src/insets/insetinclude.h: remove default constructor
2284 * src/insets/insetfloat.C: work to make it work better
2286 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2288 * src/insets/insetcite.h (InsetCitation): remove default constructor
2290 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2292 * src/text.C (GetColumnNearX): comment out some currently unused code.
2294 * src/paragraph.C (writeFile): move some initializations closer to
2296 (CutIntoMinibuffer): small change to use new matchIT operator
2300 (InsertInset): ditto
2303 (InsetIterator): ditto
2304 (Erase): small change to use new matchFT operator
2306 (GetFontSettings): ditto
2307 (HighestFontInRange): ditto
2310 * src/lyxparagraph.h: some chars changed to value_type
2311 (matchIT): because of some stronger checking (perhaps too strong)
2312 in SGI STL, the two operator() unified to one.
2315 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2317 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2318 the last inset read added
2319 (parseSingleLyXformat2Token): some more (future) compability code added
2320 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2321 (parseSingleLyXformat2Token): set last_inset_read
2322 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2323 (parseSingleLyXformat2Token): don't double intializw string next_token
2325 * src/TextCache.C (text_fits::operator()): add const's to the signature
2326 (has_buffer::operator()): ditto
2328 * src/Floating.h: add some comments on the class
2330 * src/FloatList.[Ch] (typeExist): new method
2333 * src/BackStack.h: added default constructor, wanted by Gcc.
2335 2000-07-14 Juergen Vigna <jug@sad.it>
2337 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2339 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2341 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2342 do a redraw when the window is resized!
2343 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2345 * src/insets/insettext.C (resizeLyXText): added function to correctly
2346 being able to resize the LyXWindow.
2348 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2350 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2352 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2353 crashes when closing dialog to a deleted inset.
2355 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2356 method! Now similar to other insets.
2358 2000-07-13 Juergen Vigna <jug@sad.it>
2360 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2362 * lib/examples/Literate.lyx: small patch!
2364 * src/insets/insetbib.C (Read): added this function because of wrong
2365 Write (without [begin|end]_inset).
2367 2000-07-11 Juergen Vigna <jug@sad.it>
2369 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2370 as the insertInset could not be good!
2372 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2373 the bool param should not be last.
2375 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2377 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2378 did submit that to Karl).
2380 * configure.in: use -isystem instead of -I for X headers. This
2381 fixes a problem on solaris with a recent gcc;
2382 put the front-end code after the X detection code;
2383 configure in sigc++ before lib/
2385 * src/lyx_main.C (commandLineHelp): remove -display from command
2388 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2390 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2391 Also put in Makefile rules for building the ``listerrors''
2392 program for parsing errors from literate programs written in LyX.
2394 * lib/build-listerrors: Added small shell script as part of compile
2395 process. This builds a working ``listerrors'' binary if noweb is
2396 installed and either 1) the VNC X server is installed on the machine,
2397 or 2) the user is compiling from within a GUI. The existence of a GUI
2398 is necessary to use the ``lyx --export'' feature for now. This
2399 hack can be removed once ``lyx --export'' no longer requires a GUI to
2402 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2404 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2405 now passed back correctly from gcc and placed "under" error
2406 buttons in a Literate LyX source.
2408 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2410 * src/text.C (GetColumnNearX): Better behavior when a RTL
2411 paragraph is ended by LTR text.
2413 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2416 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2418 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2419 true when clipboard is empty.
2421 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2423 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2424 row of the paragraph.
2425 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2426 to prevent calculation of bidi tables
2428 2000-07-07 Juergen Vigna <jug@sad.it>
2430 * src/screen.C (ToggleSelection): added y_offset and x_offset
2433 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2436 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2438 * src/insets/insettext.C: fixed Layout-Display!
2440 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2442 * configure.in: add check for strings.h header.
2444 * src/spellchecker.C: include <strings.h> in order to have a
2445 definition for bzero().
2447 2000-07-07 Juergen Vigna <jug@sad.it>
2449 * src/insets/insettext.C (draw): set the status of the bv->text to
2450 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2452 * src/screen.C (DrawOneRow):
2453 (DrawFromTo): redraw the actual row if something has changed in it
2456 * src/text.C (draw): call an update of the toplevel-inset if something
2457 has changed inside while drawing.
2459 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2461 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2463 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2464 processing inside class.
2466 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2467 processing inside class.
2469 * src/insets/insetindex.h new struct Holder, consistent with other
2472 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2473 citation dialog from main code and placed it in src/frontends/xforms.
2474 Dialog launched through signals instead of callbacks
2476 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2478 * lyx.man: update the options description.
2480 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2482 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2483 handle neg values, set min width to 590, add doc about -display
2485 2000-07-05 Juergen Vigna <jug@sad.it>
2487 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2488 calls to BufferView *.
2490 * src/insets/insettext.C (checkAndActivateInset): small fix non
2491 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2493 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2494 their \end_inset token!
2496 2000-07-04 edscott <edscott@imp.mx>
2498 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2499 lib/lyxrc.example: added option \wheel_jump
2501 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2503 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2504 remove support for -width,-height,-xpos and -ypos.
2506 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2508 * src/encoding.[Ch]: New files.
2510 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2511 (text): Call to the underline() method only when needed.
2513 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2515 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2516 encoding(s) for the document.
2518 * src/bufferparams.C (BufferParams): Changed default value of
2521 * src/language.C (newLang): Removed.
2522 (items[]): Added encoding information for all defined languages.
2524 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2525 encoding choice button.
2527 * src/lyxrc.h (font_norm_type): New member variable.
2528 (set_font_norm_type): New method.
2530 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2531 paragraphs with different encodings.
2533 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2534 (TransformChar): Changed to work correctly with Arabic points.
2535 (draw): Added support for drawing Arabic points.
2536 (draw): Removed code for drawing underbars (this is done by
2539 * src/support/textutils.h (IsPrintableNonspace): New function.
2541 * src/BufferView_pimpl.h: Added "using SigC::Object".
2542 * src/LyXView.h: ditto.
2544 * src/insets/insetinclude.h (include_label): Changed to mutable.
2546 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2548 * src/mathed/math_iter.h: remove empty destructor
2550 * src/mathed/math_cursor.h: remove empty destructor
2552 * src/insets/lyxinset.h: add THEOREM_CODE
2554 * src/insets/insettheorem.[Ch]: new files
2556 * src/insets/insetminipage.C: (InsertInset): remove
2558 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2560 (InsertInset): remove
2562 * src/insets/insetlist.C: (InsertList): remove
2564 * src/insets/insetfootlike.[Ch]: new files
2566 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2569 (InsertInset): ditto
2571 * src/insets/insetert.C: remove include Painter.h, reindent
2572 (InsertInset): move to header
2574 * src/insets/insetcollapsable.h: remove explicit from default
2575 contructor, remove empty destructor, add InsertInset
2577 * src/insets/insetcollapsable.C (InsertInset): new func
2579 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2581 * src/vspace.h: add explicit to constructor
2583 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2584 \textcompwordmark, please test this.
2586 * src/lyxrc.C: set ascii_linelen to 65 by default
2588 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2590 * src/commandtags.h: add LFUN_INSET_THEOREM
2592 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2593 (makeLinuxDocFile): remove _some_ of the nice logic
2594 (makeDocBookFile): ditto
2596 * src/Painter.[Ch]: (~Painter): removed
2598 * src/LyXAction.C (init): entry for insettheorem added
2600 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2602 (deplog): code to detect files generated by LaTeX, needs testing
2605 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2607 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2609 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2611 * src/LaTeX.C (deplog): Add a check for files that are going to be
2612 created by the first latex run, part of the project to remove the
2615 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2616 contents to the extension list.
2618 2000-07-04 Juergen Vigna <jug@sad.it>
2620 * src/text.C (NextBreakPoint): added support for needFullRow()
2622 * src/insets/lyxinset.h: added needFullRow()
2624 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2627 * src/insets/insettext.C: lots of changes for update!
2629 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2631 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2633 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2635 * src/insets/insetinclude.C (InsetInclude): fixed
2636 initialization of include_label.
2637 (unique_id): now returns a string.
2639 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2641 * src/LaTeXFeatures.h: new member IncludedFiles, for
2642 a map of key, included file name.
2644 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2645 with the included files for inclusion in SGML preamble,
2646 i. e., linuxdoc and docbook.
2649 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2650 nice (is the generated linuxdoc code to be exported?), that
2651 allows to remove column, and only_body that will be true for
2652 slave documents. Insets are allowed inside SGML font type.
2653 New handling of the SGML preamble for included files.
2654 (makeDocBookFile): the same for docbook.
2656 * src/insets/insetinclude.h:
2657 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2659 (DocBook): new export methods.
2661 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2662 and makeDocBookFile.
2664 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2665 formats to export with command line argument -x.
2667 2000-06-29 Juergen Vigna <jug@sad.it>
2669 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2670 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2672 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2673 region could already been cleared by an inset!
2675 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2677 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2680 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2682 (cursorToggle): remove special handling of lyx focus.
2684 2000-06-28 Juergen Vigna <jug@sad.it>
2686 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2689 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2691 * src/insets/insetindex.C (Edit): add a callback when popup is
2694 * src/insets/insettext.C (LocalDispatch):
2695 * src/insets/insetmarginal.h:
2696 * src/insets/insetlist.h:
2697 * src/insets/insetfoot.h:
2698 * src/insets/insetfloat.h:
2699 * src/insets/insetert.h: add a missing std:: qualifier.
2701 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2703 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2706 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2708 * src/insets/insettext.C (Read): remove tmptok unused variable
2709 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2710 (InsertInset): change for new InsetInset code
2712 * src/insets/insettext.h: add TEXT inline method
2714 * src/insets/insettext.C: remove TEXT macro
2716 * src/insets/insetmarginal.C (Write): new method
2717 (Latex): change output slightly
2719 * src/insets/insetfoot.C (Write): new method
2720 (Latex): change output slightly (don't use endl when no need)
2722 * src/insets/insetert.C (Write): new method
2724 * src/insets/insetcollapsable.h: make button_length, button_top_y
2725 and button_bottm_y protected.
2727 * src/insets/insetcollapsable.C (Write): simplify code by using
2728 tostr. Also do not output the float name, the children class
2729 should to that to get control over own arguments
2731 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2732 src/insets/insetminipage.[Ch]:
2735 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2737 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2739 * src/Makefile.am (lyx_SOURCES): add the new files
2741 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2742 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2743 * src/commandtags.h: ditto
2745 * src/LaTeXFeatures.h: add a std::set of used floattypes
2747 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2749 * src/FloatList.[Ch] src/Floating.h: new files
2751 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2753 * src/lyx_cb.C (TableApplyCB): ditto
2755 * src/text2.C: ditto
2756 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2757 (parseSingleLyXformat2Token): ditto + add code for
2758 backwards compability for old float styles + add code for new insets
2760 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2762 (InsertInset(size_type, Inset *, LyXFont)): new method
2763 (InsetChar(size_type, char)): changed to use the other InsetChar
2764 with a LyXFont(ALL_INHERIT).
2765 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2766 insert the META_INSET.
2768 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2770 * sigc++/thread.h (Threads): from here
2772 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2773 definition out of line
2774 * sigc++/scope.h: from here
2776 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2778 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2779 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2781 * Makefile.am (bindist): new target.
2783 * INSTALL: add instructions for doing a binary distribution.
2785 * development/tools/README.bin.example: update a bit.
2787 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2790 * lib/lyxrc.example: new lyxrc tag \set_color.
2792 * src/lyxfunc.C (Dispatch):
2793 * src/commandtags.h:
2794 * src/LyXAction.C: new lyxfunc "set-color".
2796 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2797 and an x11name given as strings.
2799 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2800 cache when a color is changed.
2802 2000-06-26 Juergen Vigna <jug@sad.it>
2804 * src/lyxrow.C (width): added this functions and variable.
2806 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2809 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2811 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2813 * images/undo_bw.xpm: new icon.
2814 * images/redo_bw.xpm: ditto.
2816 * configure.in (INSTALL_SCRIPT): change value to
2817 ${INSTALL} to avoid failures of install-script target.
2818 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2820 * src/BufferView.h: add a magic "friend" declaration to please
2823 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2825 * forms/cite.fd: modified to allow resizing without messing
2828 * src/insetcite.C: Uses code from cite.fd almost without
2830 User can now resize dialog in the x-direction.
2831 Resizing the dialog in the y-direction is prevented, as the
2832 code does this intelligently already.
2834 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2836 * INSTALL: remove obsolete entry in "problems" section.
2838 * lib/examples/sl_*.lyx: update of the slovenian examples.
2840 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2842 2000-06-23 Juergen Vigna <jug@sad.it>
2844 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2846 * src/buffer.C (resize): delete the LyXText of textinsets.
2848 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2850 * src/insets/lyxinset.h: added another parameter 'cleared' to
2851 the draw() function.
2853 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2854 unlocking inset in inset.
2856 2000-06-22 Juergen Vigna <jug@sad.it>
2858 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2859 of insets and moved first to LyXText.
2861 * src/mathed/formulamacro.[Ch]:
2862 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2864 2000-06-21 Juergen Vigna <jug@sad.it>
2866 * src/text.C (GetVisibleRow): look if I should clear the area or not
2867 using Inset::doClearArea() function.
2869 * src/insets/lyxinset.h: added doClearArea() function and
2870 modified draw(Painter &, ...) to draw(BufferView *, ...)
2872 * src/text2.C (UpdateInset): return bool insted of int
2874 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2876 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2877 combox in the character popup
2879 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2880 BufferParams const & params
2882 2000-06-20 Juergen Vigna <jug@sad.it>
2884 * src/insets/insettext.C (SetParagraphData): set insetowner on
2887 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2889 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2890 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2892 (form_main_): remove
2894 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2895 (create_form_form_main): remove FD_form_main stuff, connect to
2896 autosave_timeout signal
2898 * src/LyXView.[Ch] (getMainForm): remove
2899 (UpdateTimerCB): remove
2900 * src/BufferView_pimpl.h: inherit from SigC::Object
2902 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2903 signal instead of callback
2905 * src/BufferView.[Ch] (cursorToggleCB): remove
2907 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2909 * src/BufferView_pimpl.C: changes because of the one below
2911 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2912 instead of storing a pointer to a LyXText.
2914 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2916 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2918 * src/lyxparagraph.h
2920 * src/paragraph.C: Changed fontlist to a sorted vector.
2922 2000-06-19 Juergen Vigna <jug@sad.it>
2924 * src/BufferView.h: added screen() function.
2926 * src/insets/insettext.C (LocalDispatch): some selection code
2929 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2931 * src/insets/insettext.C (SetParagraphData):
2933 (InsetText): fixes for multiple paragraphs.
2935 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2937 * development/lyx.spec.in: Call configure with ``--without-warnings''
2938 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2939 This should be fine, however, since we generally don't want to be
2940 verbose when making an RPM.
2942 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2944 * lib/scripts/fig2pstex.py: New file
2946 2000-06-16 Juergen Vigna <jug@sad.it>
2948 * src/insets/insettabular.C (UpdateLocal):
2949 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2950 (LocalDispatch): Changed all functions to use LyXText.
2952 2000-06-15 Juergen Vigna <jug@sad.it>
2954 * src/text.C (SetHeightOfRow): call inset::update before requesting
2957 * src/insets/insettext.C (update):
2958 * src/insets/insettabular.C (update): added implementation
2960 * src/insets/lyxinset.h: added update function
2962 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2964 * src/text.C (SelectNextWord): protect against null pointers with
2965 old-style string streams. (fix from Paul Theo Gonciari
2968 * src/cite.[Ch]: remove erroneous files.
2970 * lib/configure.m4: update the list of created directories.
2972 * src/lyxrow.C: include <config.h>
2973 * src/lyxcursor.C: ditto.
2975 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2977 * lib/examples/decimal.lyx: new example file from Mike.
2979 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2980 to find template definitions (from Dekel)
2982 * src/frontends/.cvsignore: add a few things.
2984 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2986 * src/Timeout.C (TimeOut): remove default argument.
2988 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2991 * src/insets/ExternalTemplate.C: add a "using" directive.
2993 * src/lyx_main.h: remove the act_ struct, which seems unused
2996 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2998 * LyX Developers Meeting: All files changed, due to random C++ (by
2999 coincidence) code generator script.
3001 - external inset (cool!)
3002 - initial online editing of preferences
3003 - insettabular breaks insettext(s contents)
3005 - some DocBook fixes
3006 - example files update
3007 - other cool stuff, create a diff and look for yourself.
3009 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3011 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3012 -1 this is a non-line-breaking textinset.
3014 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3015 if there is no width set.
3017 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3019 * Lots of files: Merged the dialogbase branch.
3021 2000-06-09 Allan Rae <rae@lyx.org>
3023 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3024 and the Dispatch methods that used it.
3026 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3027 access to functions formerly kept in Dispatch.
3029 2000-05-19 Allan Rae <rae@lyx.org>
3031 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3032 made to_page and count_copies integers again. from_page remains a
3033 string however because I want to allow entry of a print range like
3034 "1,4,22-25" using this field.
3036 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3037 and printer-params-get. These aren't useful from the minibuffer but
3038 could be used by a script/LyXServer app provided it passes a suitable
3039 auto_mem_buffer. I guess I should take a look at how the LyXServer
3040 works and make it support xtl buffers.
3042 * sigc++/: updated to libsigc++-1.0.1
3044 * src/xtl/: updated to xtl-1.3.pl.11
3046 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3047 those changes done to the files in src/ are actually recreated when
3048 they get regenerated. Please don't ever accept a patch that changes a
3049 dialog unless that patch includes the changes to the corresponding *.fd
3052 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3053 stringOnlyContains, renamed it and generalised it.
3055 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3056 branch. Removed the remaining old form_print code.
3058 2000-04-26 Allan Rae <rae@lyx.org>
3060 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3061 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3063 2000-04-25 Allan Rae <rae@lyx.org>
3065 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3066 against a base of xtl-1.3.pl.4
3068 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3069 filter the Id: entries so they still show the xtl version number
3072 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3073 into the src/xtl code. Patch still pending with José (XTL)
3075 2000-04-24 Allan Rae <rae@lyx.org>
3077 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3078 both more generic and much safer. Use the new template functions.
3079 * src/buffer.[Ch] (Dispatch): ditto.
3081 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3082 and mem buffer more intelligently. Also a little general cleanup.
3085 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3086 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3087 * src/xtl/Makefile.am: ditto.
3088 * src/xtl/.cvsignore: ditto.
3089 * src/Makefile.am: ditto.
3091 * src/PrinterParams.h: Removed the macros member functions. Added a
3092 testInvariant member function. A bit of tidying up and commenting.
3093 Included Angus's idea for fixing operation with egcs-1.1.2.
3095 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3096 cool expansion of XTL's mem_buffer to support automatic memory
3097 management within the buffer itself. Removed the various macros and
3098 replaced them with template functions that use either auto_mem_buffer
3099 or mem_buffer depending on a #define. The mem_buffer support will
3100 disappear as soon as the auto_mem_buffer is confirmed to be good on
3101 other platforms/compilers. That is, it's there so you've got something
3104 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3105 effectively forked XTL. However I expect José will include my code
3106 into the next major release. Also fixed a memory leak.
3107 * src/xtl/text.h: ditto.
3108 * src/xtl/xdr.h: ditto.
3109 * src/xtl/giop.h: ditto.
3111 2000-04-16 Allan Rae <rae@lyx.org>
3113 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3114 by autogen.sh and removed by maintainer-clean anyway.
3115 * .cvsignore, sigc++/.cvsignore: Support the above.
3117 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3119 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3121 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3122 macros, renamed static callback-target member functions to suit new
3123 scheme and made them public.
3124 * src/frontends/xforms/forms/form_print.fd: ditto.
3125 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3127 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3130 * src/xtl/: New directory containing a minimal distribution of XTL.
3131 This is XTL-1.3.pl.4.
3133 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3135 2000-04-15 Allan Rae <rae@lyx.org>
3137 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3139 * sigc++/: Updated to libsigc++-1.0.0
3141 2000-04-14 Allan Rae <rae@lyx.org>
3143 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3144 use the generic ones in future. I'll modify my conversion script.
3146 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3148 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3149 (CloseAllBufferRelatedDialogs): Renamed.
3150 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3152 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3153 of the generic ones. These are the same ones my conversion script
3156 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3157 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3158 * src/buffer.C (Dispatch): ditto
3160 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3161 functions for updating and hiding buffer dependent dialogs.
3162 * src/BufferView.C (buffer): ditto
3163 * src/buffer.C (setReadonly): ditto
3164 * src/lyxfunc.C (CloseBuffer): ditto
3166 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3167 Dialogs.h, and hence all the SigC stuff, into every file that includes
3168 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3170 * src/BufferView2.C: reduce the number of headers included by buffer.h
3172 2000-04-11 Allan Rae <rae@lyx.org>
3174 * src/frontends/xforms/xform_macros.h: A small collection of macros
3175 for building C callbacks.
3177 * src/frontends/xforms/Makefile.am: Added above file.
3179 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3180 scheme again. This time it should work for JMarc. If this is
3181 successful I'll revise my conversion script to automate some of this.
3182 The static member functions in the class also have to be public for
3183 this scheme will work. If the scheme works (it's almost identical to
3184 the way BufferView::cursorToggleCB is handled so it should work) then
3185 FormCopyright and FormPrint will be ready for inclusion into the main
3186 trunk immediately after 1.1.5 is released -- provided we're prepared
3187 for complaints about lame compilers not handling XTL.
3189 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3191 2000-04-07 Allan Rae <rae@lyx.org>
3193 * config/lyxinclude.m4: A bit more tidying up (Angus)
3195 * src/LString.h: JMarc's <string> header fix
3197 * src/PrinterParams.h: Used string for most data to remove some
3198 ugly code in the Print dialog and avoid even uglier code when
3199 appending the ints to a string for output.
3201 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3202 and moved "default:" back to the end of switch statement. Cleaned
3203 up the printing so it uses the right function calls and so the
3204 "print to file" option actually puts the file in the right directory.
3206 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3208 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3209 and Ok+Apply button control into a separate method: input (Angus).
3210 (input) Cleaned it up and improved it to be very thorough now.
3211 (All CB) static_cast used instead of C style cast (Angus). This will
3212 probably change again once we've worked out how to keep gcc-2.8.1 happy
3213 with real C callbacks.
3214 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3215 ignore some of the bool settings and has random numbers instead. Needs
3216 some more investigation. Added other input length checks and checking
3217 of file and printer names.
3219 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3220 would link (Angus). Seems the old code doesn't compile with the pragma
3221 statement either. Separated callback entries from internal methods.
3223 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3225 2000-03-17 Allan Rae <rae@lyx.org>
3227 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3228 need it? Maybe it could go in Dialogs instead? I could make it a
3229 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3230 values to get the bool return value.
3231 (Dispatch): New overloaded method for xtl support.
3233 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3234 extern "C" callback instead of static member functions. Hopefully,
3235 JMarc will be able to compile this. I haven't changed
3236 forms/form_copyright.fd yet. Breaking one of my own rules already.
3238 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3239 because they aren't useful from the minibuffer. Maybe a LyXServer
3240 might want a help message though?
3242 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3244 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3245 xtl which needs both rtti and exceptions.
3247 * src/support/Makefile.am:
3248 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3250 * src/frontends/xforms/input_validators.[ch]: input filters and
3251 validators. These conrol what keys are valid in input boxes.
3252 Use them and write some more. Much better idea than waiting till
3253 after the user has pressed Ok to say that the input fields don't make
3256 * src/frontends/xforms/Makefile.am:
3257 * src/frontends/xforms/forms/form_print.fd:
3258 * src/frontends/xforms/forms/makefile:
3259 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3260 new scheme. Still have to make sure I haven't missed anything from
3261 the current implementation.
3263 * src/Makefile.am, src/PrinterParams.h: New data store.
3265 * other files: Added a couple of copyright notices.
3267 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3269 * src/insets/insetbib.h: move Holder struct in public space.
3271 * src/frontends/include/DialogBase.h: use SigC:: only when
3272 SIGC_CXX_NAMESPACES is defined.
3273 * src/frontends/include/Dialogs.h: ditto.
3275 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3277 * src/frontends/xforms/FormCopyright.[Ch]: do not
3278 mention SigC:: explicitely.
3280 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3282 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3283 deals with testing KDE in main configure.in
3284 * configure.in: ditto.
3286 2000-02-22 Allan Rae <rae@lyx.org>
3288 * Lots of files: Merged from HEAD
3290 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3291 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3293 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3295 * sigc++/: new minidist.
3297 2000-02-14 Allan Rae <rae@lyx.org>
3299 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3301 2000-02-08 Juergen Vigna <jug@sad.it>
3303 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3304 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3306 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3307 for this port and so it is much easier for other people to port
3308 dialogs in a common development environment.
3310 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3311 the QT/KDE implementation.
3313 * src/frontends/kde/Dialogs.C:
3314 * src/frontends/kde/FormCopyright.C:
3315 * src/frontends/kde/FormCopyright.h:
3316 * src/frontends/kde/Makefile.am:
3317 * src/frontends/kde/formcopyrightdialog.C:
3318 * src/frontends/kde/formcopyrightdialog.h:
3319 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3320 for the kde support of the Copyright-Dialog.
3322 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3323 subdir-substitution instead of hardcoded 'xforms' as we now have also
3326 * src/frontends/include/DialogBase.h (Object): just commented the
3327 label after #endif (nasty warning and I don't like warnings ;)
3329 * src/main.C (main): added KApplication initialization if using
3332 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3333 For now only the KDE event-loop is added if frontend==kde.
3335 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3337 * configure.in: added support for the --with-frontend[=value] option
3339 * autogen.sh: added kde.m4 file to list of config-files
3341 * acconfig.h: added define for KDEGUI-support
3343 * config/kde.m4: added configuration functions for KDE-port
3345 * config/lyxinclude.m4: added --with-frontend[=value] option with
3346 support for xforms and KDE.
3348 2000-02-08 Allan Rae <rae@lyx.org>
3350 * all Makefile.am: Fixed up so the make targets dist, distclean,
3351 install and uninstall all work even if builddir != srcdir. Still
3352 have a new sigc++ minidist update to come.
3354 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3356 2000-02-01 Allan Rae <rae@lyx.org>
3358 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3359 Many mods to get builddir != srcdir working.
3361 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3362 for building on NT and so we can do the builddir != srcdir stuff.
3364 2000-01-30 Allan Rae <rae@lyx.org>
3366 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3367 This will stay in "rae" branch. We probably don't really need it in
3368 the main trunk as anyone who wants to help programming it should get
3369 a full library installed also. So they can check both included and
3370 system supplied library compilation.
3372 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3373 Added a 'mini' distribution of libsigc++. If you feel the urge to
3374 change something in these directories - Resist it. If you can't
3375 resist the urge then you should modify the following script and rebuild
3376 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3377 all happen. Still uses a hacked version of libsigc++'s configure.in.
3378 I'm quite happy with the results. I'm not sure the extra work to turn
3379 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3380 worth the trouble and would probably lead to extra maintenance
3382 I haven't tested the following important make targets: install, dist.
3383 Not ready for prime time but very close. Maybe 1.1.5.
3385 * development/tools/makeLyXsigc.sh: A shell script to automatically
3386 generate our mini-dist of libsigc++. It can only be used with a CVS
3387 checkout of libsigc++ not a tarball distribution. It's well commented.
3388 This will end up as part of the libsigc++ distribution so other apps
3389 can easily have an included mini-dist. If someone makes mods to the
3390 sigc++ subpackage without modifying this script to generate those
3391 changes I'll be very upset!
3393 * src/frontends/: Started the gui/system indep structure.
3395 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3396 to access the gui-indep dialogs are in this class. Much improved
3397 design compared to previous revision. Lars, please refrain from
3398 moving this header into src/ like you did with Popups.h last time.
3400 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3402 * src/frontends/xforms/: Started the gui-indep system with a single
3403 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3406 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3407 Here you'll find a very useful makefile and automated fdfix.sh that
3408 makes updating dailogs a no-brainer -- provided you follow the rules
3409 set out in the README. I'm thinking about adding another script to
3410 automatically generate skeleton code for a new dialog given just the
3413 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3414 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3415 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3417 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3419 * src/support/LSubstring.C (operator): simplify
3421 * src/lyxtext.h: removed bparams, use buffer_->params instead
3423 * src/lyxrow.h: make Row a real class, move all variables to
3424 private and use accessors.
3426 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3428 (isRightToLeftPar): ditto
3429 (ChangeLanguage): ditto
3430 (isMultiLingual): ditto
3433 (SimpleTeXOnePar): ditto
3434 (TeXEnvironment): ditto
3435 (GetEndLabel): ditto
3437 (SetOnlyLayout): ditto
3438 (BreakParagraph): ditto
3439 (BreakParagraphConservative): ditto
3440 (GetFontSettings): ditto
3442 (CopyIntoMinibuffer): ditto
3443 (CutIntoMinibuffer): ditto
3444 (PasteParagraph): ditto
3445 (SetPExtraType): ditto
3446 (UnsetPExtraType): ditto
3447 (DocBookContTableRows): ditto
3448 (SimpleDocBookOneTablePar): ditto
3450 (TeXFootnote): ditto
3451 (SimpleTeXOneTablePar): ditto
3452 (TeXContTableRows): ditto
3453 (SimpleTeXSpecialChars): ditto
3456 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3457 to private and use accessors.
3459 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3460 this, we did not use it anymore and has not been for ages. Just a
3461 waste of cpu cycles.
3463 * src/language.h: make Language a real class, move all variables
3464 to private and use accessors.
3466 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3467 (create_view): remove
3468 (update): some changes for new timer
3469 (cursorToggle): use new timer
3470 (beforeChange): change for new timer
3472 * src/BufferView.h (cursorToggleCB): removed last paramter because
3475 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3476 (cursorToggleCB): change because of new timer code
3478 * lib/CREDITS: updated own mailaddress
3480 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3482 * src/support/filetools.C (PutEnv): fix the code in case neither
3483 putenv() nor setenv() have been found.
3485 * INSTALL: mention the install-strip Makefile target.
3487 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3488 read-only documents.
3490 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3492 * lib/reLyX/configure.in (VERSION): avoid using a previously
3493 generated reLyX wrapper to find out $prefix.
3495 * lib/examples/eu_adibide_lyx-atua.lyx:
3496 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3497 translation of the Tutorial (Dooteo)
3499 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3501 * forms/cite.fd: new citation dialog
3503 * src/insetcite.[Ch]: the new citation dialog is moved into
3506 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3509 * src/insets/insetcommand.h: data members made private.
3511 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3513 * LyX 1.1.5 released
3515 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3517 * src/version.h (LYX_RELEASE): to 1.1.5
3519 * src/spellchecker.C (RunSpellChecker): return false if the
3520 spellchecker dies upon creation.
3522 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3524 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3525 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3529 * lib/CREDITS: update entry for Martin Vermeer.
3531 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3533 * src/text.C (draw): Draw foreign language bars at the bottom of
3534 the row instead of at the baseline.
3536 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3538 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3540 * lib/bind/de_menus.bind: updated
3542 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3544 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3546 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3548 * src/menus.C (Limit_string_length): New function
3549 (ShowTocMenu): Limit the number of items/length of items in the
3552 * src/paragraph.C (String): Correct result for a paragraph inside
3555 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3557 * src/bufferlist.C (close): test of buf->getuser() == NULL
3559 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3561 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3562 Do not call to SetCursor when the paragraph is a closed footnote!
3564 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3566 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3569 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3571 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3574 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3575 reference popup, that activates the reference-back action
3577 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3579 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3580 the menus. Also fixed a bug.
3582 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3583 the math panels when switching buffers (unless new buffer is readonly).
3585 * src/BufferView.C (NoSavedPositions)
3586 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3588 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3590 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3591 less of dvi dirty or not.
3593 * src/trans_mgr.[Ch] (insert): change first parameter to string
3596 * src/chset.[Ch] (encodeString): add const to first parameter
3598 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3600 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3604 * src/LaTeX.C (deplog): better searching for dependency files in
3605 the latex log. Uses now regexps.
3607 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3608 instead of the box hack or \hfill.
3610 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3612 * src/lyxfunc.C (doImportHelper): do not create the file before
3613 doing the actual import.
3614 (doImportASCIIasLines): create a new file before doing the insert.
3615 (doImportASCIIasParagraphs): ditto.
3617 * lib/lyxrc.example: remove mention of non-existing commands
3619 * lyx.man: remove mention of color-related switches.
3621 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3623 * src/lyx_gui.C: remove all the color-related ressources, which
3624 are not used anymore.
3626 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3629 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3631 * src/lyxrc.C (read): Add a missing break in the switch
3633 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3635 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3637 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3640 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3642 * src/text.C (draw): draw bars under foreign language words.
3644 * src/LColor.[Ch]: add LColor::language
3646 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3648 * src/lyxcursor.h (boundary): New member variable
3650 * src/text.C (IsBoundary): New methods
3652 * src/text.C: Use the above for currect cursor movement when there
3653 is both RTL & LTR text.
3655 * src/text2.C: ditto
3657 * src/bufferview_funcs.C (ToggleAndShow): ditto
3659 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3661 * src/text.C (DeleteLineForward): set selection to true to avoid
3662 that DeleteEmptyParagraphMechanism does some magic. This is how it
3663 is done in all other functions, and seems reasonable.
3664 (DeleteWordForward): do not jump over non-word stuff, since
3665 CursorRightOneWord() already does it.
3667 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3668 DeleteWordBackward, since they seem safe to me (since selection is
3669 set to "true") DeleteEmptyParagraphMechanism does nothing.
3671 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3673 * src/lyx_main.C (easyParse): simplify the code by factoring the
3674 part that removes parameters from the command line.
3675 (LyX): check wether wrong command line options have been given.
3677 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3679 * src/lyx_main.C : add support for specifying user LyX
3680 directory via command line option -userdir.
3682 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3684 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3685 the number of items per popup.
3686 (Add_to_refs_menu): Ditto.
3688 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3690 * src/lyxparagraph.h: renamed ClearParagraph() to
3691 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3692 textclass as parameter, and do nothing if free_spacing is
3693 true. This fixes part of the line-delete-forward problems.
3695 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3696 (pasteSelection): ditto.
3697 (SwitchLayoutsBetweenClasses): more translatable strings.
3699 * src/text2.C (CutSelection): use StripLeadingSpaces.
3700 (PasteSelection): ditto.
3701 (DeleteEmptyParagraphMechanism): ditto.
3703 2000-05-26 Juergen Vigna <jug@sad.it>
3705 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3706 is not needed in tabular insets.
3708 * src/insets/insettabular.C (TabularFeatures): added missing features.
3710 * src/tabular.C (DeleteColumn):
3712 (AppendRow): implemented this functions
3713 (cellsturct::operator=): clone the inset too;
3715 2000-05-23 Juergen Vigna <jug@sad.it>
3717 * src/insets/insettabular.C (LocalDispatch): better selection support
3718 when having multicolumn-cells.
3720 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3722 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3724 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3726 * src/ColorHandler.C (getGCForeground): put more test into _()
3728 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3731 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3734 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3736 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3737 there are no labels, or when buffer is readonly.
3739 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3740 there are no labels, buffer is SGML, or when buffer is readonly.
3742 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3744 * src/LColor.C (LColor): change a couple of grey40 to grey60
3745 (LColor): rewore initalization to make compiles go some magnitude
3747 (getGUIName): don't use gettext until we need the string.
3749 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3751 * src/Bullet.[Ch]: Fixed a small bug.
3753 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3755 * src/paragraph.C (String): Several fixes/improvements
3757 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3759 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3761 * src/paragraph.C (String): give more correct output.
3763 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3765 * src/lyxfont.C (stateText) Do not output the language if it is
3766 eqaul to the language of the document.
3768 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3769 between two paragraphs with the same language.
3771 * src/paragraph.C (getParLanguage) Return a correct answer for an
3772 empty dummy paragraph.
3774 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3777 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3780 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3781 the menus/popup, if requested fonts are unavailable.
3783 2000-05-22 Juergen Vigna <jug@sad.it>
3785 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3786 movement support (Up/Down/Tab/Shift-Tab).
3787 (LocalDispatch): added also preliminari cursor-selection.
3789 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3791 * src/paragraph.C (PasteParagraph): Hopefully now right!
3793 2000-05-22 Garst R. Reese <reese@isn.net>
3795 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3796 of list, change all references to Environment to Command
3797 * tex/hollywood.cls : rewrite environments as commands, add
3798 \uppercase to interiorshot and exteriorshot to force uppecase.
3799 * tex/broadway.cls : rewrite environments as commands. Tweak
3802 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3804 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3805 size of items: use a constant intead of the hardcoded 40, and more
3806 importantly do not remove the %m and %x tags added at the end.
3807 (Add_to_refs_menu): use vector::size_type instead of
3808 unsigned int as basic types for the variables. _Please_ do not
3809 assume that size_t is equal to unsigned int. On an alpha, this is
3810 unsigned long, which is _not_ the same.
3812 * src/language.C (initL): remove language "hungarian", since it
3813 seems that "magyar" is better.
3815 2000-05-22 Juergen Vigna <jug@sad.it>
3817 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3819 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3822 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3823 next was deleted but not set to 0.
3825 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3827 * src/language.C (initL): change the initialization of languages
3828 so that compiles goes _fast_.
3830 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3833 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3835 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3839 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3841 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3843 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3847 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3850 * src/insets/insetlo*.[Ch]: Made editable
3852 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3854 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3855 the current selection.
3857 * src/BufferView_pimpl.C (stuffClipboard): new method
3859 * src/BufferView.C (stuffClipboard): new method
3861 * src/paragraph.C (String): new method
3863 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3864 LColor::ignore when lyxname is not found.
3866 * src/BufferView.C (pasteSelection): new method
3868 * src/BufferView_pimpl.C (pasteSelection): new method
3870 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3872 * src/WorkArea.C (request_clipboard_cb): new static function
3873 (getClipboard): new method
3874 (putClipboard): new method
3876 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3878 * LyX 1.1.5pre2 released
3880 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3882 * src/vspace.C (operator=): removed
3883 (operator=): removed
3885 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3887 * src/layout.C (NumberOfClass): manually set the type in make_pair
3888 (NumberOfLayout): ditto
3890 * src/language.C: use the Language constructor for ignore_lang
3892 * src/language.h: add constructors to struct Language
3894 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3896 * src/text2.C (SetCursorIntern): comment out #warning
3898 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3900 * src/mathed/math_iter.h: initialize sx and sw to 0
3902 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3904 * forms/lyx.fd: Redesign of form_ref
3906 * src/LaTeXFeatures.[Ch]
3910 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3913 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3914 and Buffer::inset_iterator.
3916 * src/menus.C: Added new menus: TOC and Refs.
3918 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3920 * src/buffer.C (getTocList): New method.
3922 * src/BufferView2.C (ChangeRefs): New method.
3924 * src/buffer.C (getLabelList): New method. It replaces the old
3925 getReferenceList. The return type is vector<string> instead of
3928 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3929 the old getLabel() and GetNumberOfLabels() methods.
3930 * src/insets/insetlabel.C (getLabelList): ditto
3931 * src/mathed/formula.C (getLabelList): ditto
3933 * src/paragraph.C (String): New method.
3935 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3936 Uses the new getTocList() method.
3937 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3938 which automatically updates the contents of the browser.
3939 (RefUpdateCB): Use the new getLabelList method.
3941 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3943 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3945 * src/spellchecker.C: Added using std::reverse;
3947 2000-05-19 Juergen Vigna <jug@sad.it>
3949 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3951 * src/insets/insettext.C (computeTextRows): small fix for display of
3952 1 character after a newline.
3954 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3957 2000-05-18 Juergen Vigna <jug@sad.it>
3959 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3960 when changing width of column.
3962 * src/tabular.C (set_row_column_number_info): setting of
3963 autobreak rows if necessary.
3965 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3967 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3969 * src/vc-backend.*: renamed stat() to status() and vcstat to
3970 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3971 compilation broke. The new name seems more relevant, anyway.
3973 2000-05-17 Juergen Vigna <jug@sad.it>
3975 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3976 which was wrong if the removing caused removing of rows!
3978 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3979 (pushToken): new function.
3981 * src/text2.C (CutSelection): fix problem discovered with purify
3983 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3985 * src/debug.C (showTags): enlarge the first column, now that we
3986 have 6-digits debug codes.
3988 * lib/layouts/hollywood.layout:
3989 * lib/tex/hollywood.cls:
3990 * lib/tex/brodway.cls:
3991 * lib/layouts/brodway.layout: more commands and fewer
3992 environments. Preambles moved in the .cls files. Broadway now has
3993 more options on scene numbering and less whitespace (from Garst)
3995 * src/insets/insetbib.C (getKeys): make sure that we are in the
3996 document directory, in case the bib file is there.
3998 * src/insets/insetbib.C (Latex): revert bogus change.
4000 2000-05-16 Juergen Vigna <jug@sad.it>
4002 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4003 the TabularLayout on cursor move.
4005 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4007 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4010 (draw): fixed cursor position and drawing so that the cursor is
4011 visible when before the tabular-inset.
4013 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4014 when creating from old insettext.
4016 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4018 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4020 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4021 * lib/tex/brodway.cls: ditto
4023 * lib/layouts/brodway.layout: change alignment of parenthical
4026 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4028 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4029 versions 0.88 and 0.89 are supported.
4031 2000-05-15 Juergen Vigna <jug@sad.it>
4033 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4036 * src/insets/insettext.C (computeTextRows): redone completely this
4037 function in a much cleaner way, because of problems when having a
4039 (draw): added a frame border when the inset is locked.
4040 (SetDrawLockedFrame): this sets if we draw the border or not.
4041 (SetFrameColor): this sets the frame color (default=insetframe).
4043 * src/insets/lyxinset.h: added x() and y() functions which return
4044 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4045 function which is needed to see if we have a locking inset of some
4046 type in this inset (needed for now in insettabular).
4048 * src/vspace.C (inPixels): the same function also without a BufferView
4049 parameter as so it is easier to use it in some ocasions.
4051 * src/lyxfunc.C: changed all places where insertInset was used so
4052 that now if it couldn't be inserted it is deleted!
4054 * src/TabularLayout.C:
4055 * src/TableLayout.C: added support for new tabular-inset!
4057 * src/BufferView2.C (insertInset): this now returns a bool if the
4058 inset was really inserted!!!
4060 * src/tabular.C (GetLastCellInRow):
4061 (GetFirstCellInRow): new helper functions.
4062 (Latex): implemented for new tabular class.
4066 (TeXTopHLine): new Latex() helper functions.
4068 2000-05-12 Juergen Vigna <jug@sad.it>
4070 * src/mathed/formulamacro.C (Read):
4071 * src/mathed/formula.C (Read): read also the \end_inset here!
4073 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4075 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4076 crush when saving formulae with unbalanced parenthesis.
4078 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4080 * src/layout.C: Add new keyword "endlabelstring" to layout file
4082 * src/text.C (GetVisibleRow): Draw endlabel string.
4084 * lib/layouts/broadway.layout
4085 * lib/layouts/hollywood.layout: Added endlabel for the
4086 Parenthetical layout.
4088 * lib/layouts/heb-article.layout: Do not use slanted font shape
4089 for Theorem like environments.
4091 * src/buffer.C (makeLaTeXFile): Always add "american" to
4092 the UsedLanguages list if document language is RTL.
4094 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4096 * add addendum to README.OS2 and small patch (from SMiyata)
4098 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4100 * many files: correct the calls to ChangeExtension().
4102 * src/support/filetools.C (ChangeExtension): remove the no_path
4103 argument, which does not belong there. Use OnlyFileName() instead.
4105 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4106 files when LaTeXing a non-nice latex file.
4108 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4109 a chain of "if". Return false when deadkeys are not handled.
4111 * src/lyx_main.C (LyX): adapted the code for default bindings.
4113 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4114 bindings for basic functionality (except deadkeys).
4115 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4117 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4118 several methods: handle override_x_deadkeys.
4120 * src/lyxrc.h: remove the "bindings" map, which did not make much
4121 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4123 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4125 * src/lyxfont.C (stateText): use a saner method to determine
4126 whether the font is "default". Seems to fix the crash with DEC
4129 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4131 2000-05-08 Juergen Vigna <jug@sad.it>
4133 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4134 TabularLayoutMenu with mouse-button-3
4135 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4137 * src/TabularLayout.C: added this file for having a Layout for
4140 2000-05-05 Juergen Vigna <jug@sad.it>
4142 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4143 recalculating inset-widths.
4144 (TabularFeatures): activated this function so that I can change
4145 tabular-features via menu.
4147 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4148 that I can test some functions with the Table menu.
4150 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4152 * src/lyxfont.C (stateText): guard against stupid c++libs.
4154 * src/tabular.C: add using std::vector
4155 some whitespace changes, + removed som autogenerated code.
4157 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4159 2000-05-05 Juergen Vigna <jug@sad.it>
4161 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4162 row, columns and cellstructures.
4164 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4166 * lib/lyxrc.example: remove obsolete entries.
4168 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4169 reading of protected_separator for free_spacing.
4171 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4173 * src/text.C (draw): do not display an exclamation mark in the
4174 margin for margin notes. This is confusing, ugly and
4177 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4178 AMS math' is checked.
4180 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4181 name to see whether including the amsmath package is needed.
4183 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4185 * src/paragraph.C (validate): Compute UsedLanguages correctly
4186 (don't insert the american language if it doesn't appear in the
4189 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4190 The argument of \thanks{} command is considered moving argument
4192 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4195 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4197 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4198 for appendix/minipage/depth. The lines can be now both in the footnote
4199 frame, and outside the frame.
4201 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4204 2000-05-05 Juergen Vigna <jug@sad.it>
4206 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4207 neede only in tabular.[Ch].
4209 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4211 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4213 (Write): write '~' for PROTECTED_SEPARATOR
4215 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4217 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4220 * src/mathed/formula.C (drawStr): rename size to siz.
4222 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4223 possibly fix a bug by not changing the pflags = flags to piflags =
4226 2000-05-05 Juergen Vigna <jug@sad.it>
4228 * src/insets/insetbib.C: moved using directive
4230 * src/ImportNoweb.C: small fix for being able to compile (missing
4233 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4235 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4236 to use clear, since we don't depend on this in the code. Add test
4239 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4241 * (various *.C files): add using std::foo directives to please dec
4244 * replace calls to string::clear() to string::erase() (Angus)
4246 * src/cheaders/cmath: modified to provide std::abs.
4248 2000-05-04 Juergen Vigna <jug@sad.it>
4250 * src/insets/insettext.C: Prepared all for inserting of multiple
4251 paragraphs. Still display stuff to do (alignment and other things),
4252 but I would like to use LyXText to do this when we cleaned out the
4253 table-support stuff.
4255 * src/insets/insettabular.C: Changed lot of stuff and added lots
4256 of functionality still a lot to do.
4258 * src/tabular.C: Various functions changed name and moved to be
4259 const functions. Added new Read and Write functions and changed
4260 lots of things so it works good with tabular-insets (also removed
4261 some stuff which is not needed anymore * hacks *).
4263 * src/lyxcursor.h: added operators == and != which just look if
4264 par and pos are (not) equal.
4266 * src/buffer.C (latexParagraphs): inserted this function to latex
4267 all paragraphs form par to endpar as then I can use this too for
4270 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4271 so that I can call this to from text insets with their own cursor.
4273 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4274 output off all paragraphs (because of the fix below)!
4276 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4277 the very last paragraph (this could be also the last paragraph of an
4280 * src/texrow.h: added rows() call which returns the count-variable.
4282 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4284 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4286 * lib/configure.m4: better autodetection of DocBook tools.
4288 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4290 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4292 * src/lyx_cb.C: add using std::reverse;
4294 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4297 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4298 selected files. Should fix repeated errors from generated files.
4300 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4302 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4304 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4305 the spellchecker popup.
4307 * lib/lyxrc.example: Removed the \number_inset section
4309 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4311 * src/insets/figinset.C (various): Use IsFileReadable() to make
4312 sure that the file actually exist. Relying on ghostscripts errors
4313 is a bad idea since they can lead to X server crashes.
4315 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4317 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4320 * lib/lyxrc.example: smallish typo in description of
4321 \view_dvi_paper_option
4323 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4326 * src/lyxfunc.C: doImportHelper to factor out common code of the
4327 various import methods. New functions doImportASCIIasLines,
4328 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4329 doImportLinuxDoc for the format specific parts.
4332 * buffer.C: Dispatch returns now a bool to indicate success
4335 * lyx_gui.C: Add getLyXView() for member access
4337 * lyx_main.C: Change logic for batch commands: First try
4338 Buffer::Dispatch (possibly without GUI), if that fails, use
4341 * lyx_main.C: Add support for --import command line switch.
4342 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4343 Available Formats: Everything accepted by 'buffer-import <format>'
4345 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4347 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4350 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4351 documents will be reformatted upon reentry.
4353 2000-04-27 Juergen Vigna <jug@sad.it>
4355 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4356 correctly only last pos this was a bug.
4358 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4360 * release of lyx-1.1.5pre1
4362 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4364 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4366 * src/menus.C: revert the change of naming (Figure->Graphic...)
4367 from 2000-04-11. It was incomplete and bad.
4369 * src/LColor.[Ch]: add LColor::depthbar.
4370 * src/text.C (GetVisibleRow): use it.
4372 * README: update the languages list.
4374 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4376 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4379 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4381 * README: remove sections that were just wrong.
4383 * src/text2.C (GetRowNearY): remove currentrow code
4385 * src/text.C (GetRow): remove currentrow code
4387 * src/screen.C (Update): rewritten a bit.
4388 (SmallUpdate): removed func
4390 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4392 (FullRebreak): return bool
4393 (currentrow): remove var
4394 (currentrow_y): ditto
4396 * src/lyxscreen.h (Draw): change arg to unsigned long
4397 (FitCursor): return bool
4398 (FitManualCursor): ditto
4399 (Smallpdate): remove func
4400 (first): change to unsigned long
4401 (DrawOneRow): change second arg to long (from long &)
4402 (screen_refresh_y): remove var
4403 (scree_refresh_row): ditto
4405 * src/lyxrow.h: change baseline to usigned int from unsigned
4406 short, this brings some implicit/unsigned issues out in the open.
4408 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4410 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4411 instead of smallUpdate.
4413 * src/lyxcursor.h: change y to unsigned long
4415 * src/buffer.h: don't call updateScrollbar after fitcursor
4417 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4418 where they are used. Removed "\\direction", this was not present
4419 in 1.1.4 and is already obsolete. Commented out some code that I
4420 believe to never be called.
4421 (runLiterate): don't call updateScrollbar after fitCursor
4423 (buildProgram): ditto
4426 * src/WorkArea.h (workWidth): change return val to unsigned
4429 (redraw): remove the button redraws
4430 (setScrollbarValue): change for scrollbar
4431 (getScrollbarValue): change for scrollbar
4432 (getScrollbarBounds): change for scrollbar
4434 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4435 (C_WorkArea_down_cb): removed func
4436 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4437 (resize): change for scrollbar
4438 (setScrollbar): ditto
4439 (setScrollbarBounds): ditto
4440 (setScrollbarIncrements): ditto
4441 (up_cb): removed func
4442 (down_cb): removed func
4443 (scroll_cb): change for scrollbar
4444 (work_area_handler): ditto
4446 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4447 when FitCursor did something.
4448 (updateScrollbar): some unsigned changes
4449 (downCB): removed func
4450 (scrollUpOnePage): removed func
4451 (scrollDownOnePage): remvoed func
4452 (workAreaMotionNotify): don't call screen->FitCursor but use
4453 fitCursor instead. and bool return val
4454 (workAreaButtonPress): ditto
4455 (workAreaButtonRelease): some unsigned changes
4456 (checkInsetHit): ditto
4457 (workAreaExpose): ditto
4458 (update): parts rewritten, comments about the signed char arg added
4459 (smallUpdate): removed func
4460 (cursorPrevious): call needed updateScrollbar
4463 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4466 * src/BufferView.[Ch] (upCB): removed func
4467 (downCB): removed func
4468 (smallUpdate): removed func
4470 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4472 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4473 currentrow, currentrow_y optimization. This did not help a lot and
4474 if we want to do this kind of optimization we should rather use
4475 cursor.row instead of the currentrow.
4477 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4478 buffer spacing and klyx spacing support.
4480 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4482 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4485 2000-04-26 Juergen Vigna <jug@sad.it>
4487 * src/insets/figinset.C: fixes to Lars sstream changes!
4489 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4491 * A lot of files: Added Ascii(ostream &) methods to all inset
4492 classes. Used when exporting to ASCII.
4494 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4495 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4498 * src/text2.C (ToggleFree): Disabled implicit word selection when
4499 there is a change in the language
4501 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4502 no output was generated for end-of-sentence inset.
4504 * src/insets/lyxinset.h
4507 * src/paragraph.C: Removed the insetnumber code
4509 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4511 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4513 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4514 no_babel and no_epsfig completely from the file.
4515 (parseSingleLyXformat2Token): add handling for per-paragraph
4516 spacing as written by klyx.
4518 * src/insets/figinset.C: applied patch by Andre. Made it work with
4521 2000-04-20 Juergen Vigna <jug@sad.it>
4523 * src/insets/insettext.C (cutSelection):
4524 (copySelection): Fixed with selection from right to left.
4525 (draw): now the rows are not recalculated at every draw.
4526 (computeTextRows): for now reset the inset-owner here (this is
4527 important for an undo or copy where the inset-owner is not set
4530 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4531 motion to the_locking_inset screen->first was forgotten, this was
4532 not important till we got multiline insets.
4534 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4536 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4537 code seems to be alright (it is code changed by Dekel, and the
4538 intent is indeed that all macros should be defined \protect'ed)
4540 * NEWS: a bit of reorganisation of the new user-visible features.
4542 2000-04-19 Juergen Vigna <jug@sad.it>
4544 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4545 position. Set the inset_owner of the used paragraph so that it knows
4546 that it is inside an inset. Fixed cursor handling with mouse and
4547 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4548 and cleanups to make TextInsets work better.
4550 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4551 Changed parameters of various functions and added LockInsetInInset().
4553 * src/insets/insettext.C:
4555 * src/insets/insetcollapsable.h:
4556 * src/insets/insetcollapsable.C:
4557 * src/insets/insetfoot.h:
4558 * src/insets/insetfoot.C:
4559 * src/insets/insetert.h:
4560 * src/insets/insetert.C: cleaned up the code so that it works now
4561 correctly with insettext.
4563 * src/insets/inset.C:
4564 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4565 that insets in insets are supported right.
4568 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4570 * src/paragraph.C: some small fixes
4572 * src/debug.h: inserted INSETS debug info
4574 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4575 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4577 * src/commandtags.h:
4578 * src/LyXAction.C: insert code for InsetTabular.
4580 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4581 not Button1MotionMask.
4582 (workAreaButtonRelease): send always a InsetButtonRelease event to
4584 (checkInsetHit): some setCursor fixes (always with insets).
4586 * src/BufferView2.C (lockInset): returns a bool now and extended for
4587 locking insets inside insets.
4588 (showLockedInsetCursor): it is important to have the cursor always
4589 before the locked inset.
4590 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4592 * src/BufferView.h: made lockInset return a bool.
4594 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4596 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4597 that is used also internally but can be called as public to have back
4598 a cursor pos which is not set internally.
4599 (SetCursorIntern): Changed to use above function.
4601 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4603 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4608 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4609 patches for things that should be in or should be changed.
4611 * src/* [insetfiles]: change "usigned char fragile" to bool
4612 fragile. There was only one point that could that be questioned
4613 and that is commented in formulamacro.C. Grep for "CHECK".
4615 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4616 (DeleteBuffer): take it out of CutAndPaste and make it static.
4618 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4620 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4621 output the spacing envir commands. Also the new commands used in
4622 the LaTeX output makes the result better.
4624 * src/Spacing.C (writeEnvirBegin): new method
4625 (writeEnvirEnd): new method
4627 2000-04-18 Juergen Vigna <jug@sad.it>
4629 * src/CutAndPaste.C: made textclass a static member of the class
4630 as otherwise it is not accesed right!!!
4632 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4634 * forms/layout_forms.fd
4635 * src/layout_forms.h
4636 * src/layout_forms.C (create_form_form_character)
4637 * src/lyx_cb.C (UserFreeFont)
4638 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4639 documents (in the layout->character popup).
4641 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4643 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4644 \spell_command was in fact not honored (from Kevin Atkinson).
4646 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4649 * src/lyx_gui.h: make lyxViews private (Angus)
4651 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4653 * src/mathed/math_write.C
4654 (MathMatrixInset::Write) Put \protect before \begin{array} and
4655 \end{array} if fragile
4656 (MathParInset::Write): Put \protect before \\ if fragile
4658 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4660 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4661 initialization if the LyXColorHandler must be done after the
4662 connections to the XServer has been established.
4664 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4665 get the background pixel from the lyxColorhandler so that the
4666 figures are rendered with the correct background color.
4667 (NextToken): removed functions.
4668 (GetPSSizes): use ifs >> string instead of NextToken.
4670 * src/Painter.[Ch]: the color cache moved out of this file.
4672 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4675 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4677 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4678 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4680 * src/BufferView.C (enterView): new func
4681 (leaveView): new func
4683 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4685 (leaveView): new func, undefines xterm cursor when approp.
4687 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4688 (AllowInput): delete the Workarea cursor handling from this func.
4690 * src/Painter.C (underline): draw a slimer underline in most cases.
4692 * src/lyx_main.C (error_handler): use extern "C"
4694 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4696 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4697 sent directly to me.
4699 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4700 to the list by Dekel.
4702 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4705 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4706 methods from lyx_cb.here.
4708 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4711 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4713 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4714 instead of using current_view directly.
4716 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4718 * src/LyXAction.C (init): add the paragraph-spacing command.
4720 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4722 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4724 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4725 different from the documents.
4727 * src/text.C (SetHeightOfRow): take paragraph spacing into
4728 account, paragraph spacing takes precedence over buffer spacing
4729 (GetVisibleRow): ditto
4731 * src/paragraph.C (writeFile): output the spacing parameter too.
4732 (validate): set the correct features if spacing is used in the
4734 (Clear): set spacing to default
4735 (MakeSameLayout): spacing too
4736 (HasSameLayout): spacing too
4737 (SetLayout): spacing too
4738 (TeXOnePar): output the spacing commands
4740 * src/lyxparagraph.h: added a spacing variable for use with
4741 per-paragraph spacing.
4743 * src/Spacing.h: add a Default spacing and a method to check if
4744 the current spacing is default. also added an operator==
4746 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4749 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4751 * src/lyxserver.C (callback): fix dispatch of functions
4753 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4754 printf() into lyxerr call.
4756 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4759 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4760 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4761 the "Float" from each of the subitems.
4762 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4764 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4765 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4766 documented the change so that the workaround can be nuked later.
4768 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4771 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4773 * src/buffer.C (getLatexName): ditto
4774 (setReadonly): ditto
4776 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4778 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4779 avoid some uses of current_view. Added also a bufferParams()
4780 method to get at this.
4782 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4784 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4786 * src/lyxparagraph.[Ch]: removed
4787 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4788 with operators used by lower_bound and
4789 upper_bound in InsetTable's
4790 Make struct InsetTable private again. Used matchpos.
4792 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4794 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4795 document, the language of existing text is changed (unless the
4796 document is multi-lingual)
4798 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4800 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4802 * A lot of files: A rewrite of the Right-to-Left support.
4804 2000-04-10 Juergen Vigna <jug@sad.it>
4806 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4807 misplaced cursor when inset in inset is locked.
4809 * src/insets/insettext.C (LocalDispatch): small fix so that a
4810 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4812 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4813 footnote font should be decreased in size twice when displaying.
4815 * src/insets/insettext.C (GetDrawFont): inserted this function as
4816 the drawing-font may differ from the real paragraph font.
4818 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4819 insets (inset in inset!).
4821 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4822 function here because we don't want footnotes inside footnotes.
4824 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4826 (init): now set the inset_owner in paragraph.C
4827 (LocalDispatch): added some resetPos() in the right position
4830 (pasteSelection): changed to use the new CutAndPaste-Class.
4832 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4833 which tells if it is allowed to insert another inset inside this one.
4835 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4836 SwitchLayoutsBetweenClasses.
4838 * src/text2.C (InsertInset): checking of the new paragraph-function
4840 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4841 is not needed anymore here!
4844 (PasteSelection): redone (also with #ifdef) so that now this uses
4845 the CutAndPaste-Class.
4846 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4849 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4850 from/to text/insets.
4852 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4853 so that the paragraph knows if it is inside an (text)-inset.
4854 (InsertFromMinibuffer): changed return-value to bool as now it
4855 may happen that an inset is not inserted in the paragraph.
4856 (InsertInsetAllowed): this checks if it is allowed to insert an
4857 inset in this paragraph.
4859 (BreakParagraphConservative):
4860 (BreakParagraph) : small change for the above change of the return
4861 value of InsertFromMinibuffer.
4863 * src/lyxparagraph.h: added inset_owner and the functions to handle
4864 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4866 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4868 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4869 functions from BufferView to BufferView::Pimpl to ease maintence.
4871 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4872 correctly. Also use SetCursorIntern instead of SetCursor.
4874 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4877 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4879 * src/WorkArea.C (belowMouse): manually implement below mouse.
4881 * src/*: Add "explicit" on several constructors, I added probably
4882 some unneeded ones. A couple of changes to code because of this.
4884 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4885 implementation and private parts from the users of BufferView. Not
4888 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4889 implementation and private parts from the users of LyXLex. Not
4892 * src/BufferView_pimpl.[Ch]: new files
4894 * src/lyxlex_pimpl.[Ch]: new files
4896 * src/LyXView.[Ch]: some inline functions move out-of-line
4898 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4900 * src/lyxparagraph.h: make struct InsetTable public.
4902 * src/support/lyxstring.h: change lyxstring::difference_type to be
4903 ptrdiff_t. Add std:: modifiers to streams.
4905 * src/font.C: include the <cctype> header, for islower() and
4908 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4910 * src/font.[Ch]: new files. Contains the metric functions for
4911 fonts, takes a LyXFont as parameter. Better separation of concepts.
4913 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4914 changes because of this.
4916 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4918 * src/*: compile with -Winline and move functions that don't
4921 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4924 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4926 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4927 (various files changed because of this)
4929 * src/Painter.C (text): fixed the drawing of smallcaps.
4931 * src/lyxfont.[Ch] (drawText): removed unused member func.
4934 * src/*.C: added needed "using" statements and "std::" qualifiers.
4936 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4938 * src/*.h: removed all use of "using" from header files use
4939 qualifier std:: instead.
4941 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4943 * src/text.C (Backspace): some additional cleanups (we already
4944 know whether cursor.pos is 0 or not).
4946 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4947 automake does not provide one).
4949 * src/bmtable.h: replace C++ comments with C comments.
4951 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4953 * src/screen.C (ShowCursor): Change the shape of the cursor if
4954 the current language is not equal to the language of the document.
4955 (If the cursor change its shape unexpectedly, then you've found a bug)
4957 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4960 * src/insets/insetnumber.[Ch]: New files.
4962 * src/LyXAction.C (init)
4963 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4966 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4968 * src/lyxparagraph.h
4969 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4970 (the vector is kept sorted).
4972 * src/text.C (GetVisibleRow): Draw selection correctly when there
4973 is both LTR and RTL text.
4975 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4976 which is much faster.
4978 * src/text.C (GetVisibleRow and other): Do not draw the last space
4979 in a row if the direction of the last letter is not equal to the
4980 direction of the paragraph.
4982 * src/lyxfont.C (latexWriteStartChanges):
4983 Check that font language is not equal to basefont language.
4984 (latexWriteEndChanges): ditto
4986 * src/lyx_cb.C (StyleReset): Don't change the language while using
4987 the font-default command.
4989 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4990 empty paragraph before a footnote.
4992 * src/insets/insetcommand.C (draw): Increase x correctly.
4994 * src/screen.C (ShowCursor): Change cursor shape if
4995 current language != document language.
4997 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4999 2000-03-31 Juergen Vigna <jug@sad.it>
5001 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5002 (Clone): changed mode how the paragraph-data is copied to the
5003 new clone-paragraph.
5005 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5006 GetInset(pos) with no inset anymore there (in inset UNDO)
5008 * src/insets/insetcommand.C (draw): small fix as here x is
5009 incremented not as much as width() returns (2 before, 2 behind = 4)
5011 2000-03-30 Juergen Vigna <jug@sad.it>
5013 * src/insets/insettext.C (InsetText): small fix in initialize
5014 widthOffset (should not be done in the init() function)
5016 2000-03-29 Amir Karger <karger@lyx.org>
5018 * lib/examples/it_ItemizeBullets.lyx: translation by
5021 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5023 2000-03-29 Juergen Vigna <jug@sad.it>
5025 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5027 * src/insets/insetfoot.C (Clone): small change as for the below
5028 new init function in the text-inset
5030 * src/insets/insettext.C (init): new function as I've seen that
5031 clone did not copy the Paragraph-Data!
5032 (LocalDispatch): Added code so that now we have some sort of Undo
5033 functionality (well actually we HAVE Undo ;)
5035 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5037 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5039 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5042 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5044 * src/main.C: added a runtime check that verifies that the xforms
5045 header used when building LyX and the library used when running
5046 LyX match. Exit with a message if they don't match. This is a
5047 version number check only.
5049 * src/buffer.C (save): Don't allocate memory on the heap for
5050 struct utimbuf times.
5052 * *: some using changes, use iosfwd instead of the real headers.
5054 * src/lyxfont.C use char const * instead of string for the static
5055 strings. Rewrite some functions to use sstream.
5057 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5059 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5062 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5064 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5065 of Geodesy (from Martin Vermeer)
5067 * lib/layouts/svjour.inc: include file for the Springer svjour
5068 class. It can be used to support journals other than JoG.
5070 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5071 Miskiewicz <misiek@pld.org.pl>)
5072 * lib/reLyX/Makefile.am: ditto.
5074 2000-03-27 Juergen Vigna <jug@sad.it>
5076 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5077 also some modifications with operations on selected text.
5079 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5080 problems with clicking on insets (last famous words ;)
5082 * src/insets/insetcommand.C (draw):
5083 (width): Changed to have a bit of space before and after the inset so
5084 that the blinking cursor can be seen (otherwise it was hidden)
5086 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5088 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5089 would not be added to the link list when an installed gettext (not
5090 part of libc) is found.
5092 2000-03-24 Juergen Vigna <jug@sad.it>
5094 * src/insets/insetcollapsable.C (Edit):
5095 * src/mathed/formula.C (InsetButtonRelease):
5096 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5099 * src/BufferView.C (workAreaButtonPress):
5100 (workAreaButtonRelease):
5101 (checkInsetHit): Finally fixed the clicking on insets be handled
5104 * src/insets/insetert.C (Edit): inserted this call so that ERT
5105 insets work always with LaTeX-font
5107 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5109 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5110 caused lyx to startup with no GUI in place, causing in a crash
5111 upon startup when called with arguments.
5113 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5115 * src/FontLoader.C: better initialization of dummyXFontStruct.
5117 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5119 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5120 for linuxdoc and docbook import and export format options.
5122 * lib/lyxrc.example Example of default values for the previous flags.
5124 * src/lyx_cb.C Use those flags instead of the hardwired values for
5125 linuxdoc and docbook export.
5127 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5130 * src/menus.C Added menus entries for the new import/exports formats.
5132 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5134 * src/lyxrc.*: Added support for running without Gui
5137 * src/FontLoader.C: sensible defaults if no fonts are needed
5139 * src/lyx_cb.C: New function ShowMessage (writes either to the
5140 minibuffer or cout in case of no gui
5141 New function AskOverwrite for common stuff
5142 Consequently various changes to call these functions
5144 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5145 wild guess at sensible screen resolution when having no gui
5147 * src/lyxfont.C: no gui, no fonts... set some defaults
5149 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5151 * src/LColor.C: made the command inset background a bit lighter.
5153 2000-03-20 Hartmut Goebel <goebel@noris.net>
5155 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5156 stdstruct.inc. Koma-Script added some title elements which
5157 otherwise have been listed below "bibliography". This split allows
5158 adding title elements to where they belong.
5160 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5161 define the additional tilte elements and then include
5164 * many other layout files: changed to include stdtitle.inc just
5165 before stdstruct.inc.
5167 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5169 * src/buffer.C: (save) Added the option to store all backup files
5170 in a single directory
5172 * src/lyxrc.[Ch]: Added variable \backupdir_path
5174 * lib/lyxrc.example: Added descriptions of recently added variables
5176 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5177 bibtex inset, not closing the bibtex popup when deleting the inset)
5179 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5181 * src/lyx_cb.C: add a couple using directives.
5183 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5184 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5185 import based on the filename.
5187 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5188 file would be imported at start, if the filename where of a sgml file.
5190 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5192 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5194 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5195 * src/lyxfont.h Replaced the member variable bits.direction by the
5196 member variable lang. Made many changes in other files.
5197 This allows having a multi-lingual document
5199 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5200 that change the current language to <l>.
5201 Removed the command "font-rtl"
5203 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5204 format for Hebrew documents)
5206 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5207 When auto_mathmode is "true", pressing a digit key in normal mode
5208 will cause entering into mathmode.
5209 If auto_mathmode is "rtl" then this behavior will be active only
5210 when writing right-to-left text.
5212 * src/text2.C (InsertStringA) The string is inserted using the
5215 * src/paragraph.C (GetEndLabel) Gives a correct result for
5216 footnote paragraphs.
5218 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5220 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5222 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5223 front of PasteParagraph. Never insert a ' '. This should at least
5224 fix some cause for the segfaults that we have been experiencing,
5225 it also fixes backspace behaviour slightly. (Phu!)
5227 * src/support/lstrings.C (compare_no_case): some change to make it
5228 compile with gcc 2.95.2 and stdlibc++-v3
5230 * src/text2.C (MeltFootnoteEnvironment): change type o
5231 first_footnote_par_is_not_empty to bool.
5233 * src/lyxparagraph.h: make text private. Changes in other files
5235 (fitToSize): new function
5236 (setContentsFromPar): new function
5237 (clearContents): new function
5238 (SetChar): new function
5240 * src/paragraph.C (readSimpleWholeFile): deleted.
5242 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5243 the file, just use a simple string instead. Also read the file in
5244 a more maintainable manner.
5246 * src/text2.C (InsertStringA): deleted.
5247 (InsertStringB): deleted.
5249 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5251 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5252 RedoParagraphs from the doublespace handling part, just set status
5253 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5254 done, but perhaps not like this.)
5256 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5258 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5259 character when inserting an inset.
5261 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5263 * src/bufferparams.C (readLanguage): now takes "default" into
5266 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5267 also initialize the toplevel_keymap with the default bindings from
5270 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5272 * all files using lyxrc: have lyxrc as a real variable and not a
5273 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5276 * src/lyxrc.C: remove double call to defaultKeyBindings
5278 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5279 toolbar defauls using lyxlex. Remove enums, structs, functions
5282 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5283 toolbar defaults. Also store default keybindings in a map.
5285 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5286 storing the toolbar defaults without any xforms dependencies.
5288 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5289 applied. Changed to use iterators.
5291 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5293 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5294 systems that don't have LINGUAS set to begin with.
5296 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5298 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5299 the list by Dekel Tsur.
5301 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5303 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5304 * src/insets/form_graphics.C: ditto.
5306 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5308 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5310 * src/bufferparams.C (readLanguage): use the new language map
5312 * src/intl.C (InitKeyMapper): use the new language map
5314 * src/lyx_gui.C (create_forms): use the new language map
5316 * src/language.[Ch]: New files. Used for holding the information
5317 about each language. Now! Use this new language map enhance it and
5318 make it really usable for our needs.
5320 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5322 * screen.C (ShowCursor): Removed duplicate code.
5323 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5324 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5326 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5329 * src/text.C Added TransformChar method. Used for rendering Arabic
5330 text correctly (change the glyphs of the letter according to the
5331 position in the word)
5336 * src/lyxrc.C Added lyxrc command {language_command_begin,
5337 language_command_end,language_command_ltr,language_command_rtl,
5338 language_package} which allows the use of either arabtex or Omega
5341 * src/lyx_gui.C (init)
5343 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5344 to use encoding for menu fonts which is different than the encoding
5347 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5348 do not load the babel package.
5349 To write an English document with Hebrew/Arabic, change the document
5350 language to "english".
5352 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5353 (alphaCounter): changed to return char
5354 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5356 * lib/lyxrc.example Added examples for Hebrew/Arabic
5359 * src/layout.C Added layout command endlabeltype
5361 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5363 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5365 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5367 * src/mathed/math_delim.C (search_deco): return a
5368 math_deco_struct* instead of index.
5370 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5372 * All files with a USE_OSTREAM_ONLY within: removed all code that
5373 was unused when USE_OSTREAM_ONLY is defined.
5375 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5376 of any less. Removed header and using.
5378 * src/text.C (GetVisibleRow): draw the string "Page Break
5379 (top/bottom)" on screen when drawing a pagebreak line.
5381 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5383 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5385 * src/mathed/math_macro.C (draw): do some cast magic.
5388 * src/mathed/math_defs.h: change byte* argument to byte const*.
5390 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5392 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5393 know it is right to return InsetFoot* too, but cxx does not like
5396 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5398 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5400 * src/mathed/math_delim.C: change == to proper assignment.
5402 2000-03-09 Juergen Vigna <jug@sad.it>
5404 * src/insets/insettext.C (setPos): fixed various cursor positioning
5405 problems (via mouse and cursor-keys)
5406 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5407 inset (still a small display problem but it works ;)
5409 * src/insets/insetcollapsable.C (draw): added button_top_y and
5410 button_bottom_y to have correct values for clicking on the inset.
5412 * src/support/lyxalgo.h: commented out 'using std::less'
5414 2000-03-08 Juergen Vigna <jug@sad.it>
5416 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5417 Button-Release event closes as it is alos the Release-Event
5420 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5422 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5424 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5425 can add multiple spaces in Scrap (literate programming) styles...
5426 which, by the way, is how I got hooked on LyX to begin with.
5428 * src/mathed/formula.C (Write): Added dummy variable to an
5429 inset::Latex() call.
5430 (Latex): Add free_spacing boolean to inset::Latex()
5432 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5434 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5435 virtual function to include the free_spacing boolean from
5436 the containing paragraph's style.
5438 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5439 Added free_spacing boolean arg to match inset.h
5441 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5442 Added free_spacing boolean arg to match inset.h
5444 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5445 Added free_spacing boolean and made sure that if in a free_spacing
5446 paragraph, that we output normal space if there is a protected space.
5448 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5449 Added free_spacing boolean arg to match inset.h
5451 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5452 Added free_spacing boolean arg to match inset.h
5454 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5455 Added free_spacing boolean arg to match inset.h
5457 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5458 Added free_spacing boolean arg to match inset.h
5460 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5461 Added free_spacing boolean arg to match inset.h
5463 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5464 free_spacing boolean arg to match inset.h
5466 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5467 Added free_spacing boolean arg to match inset.h
5469 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5470 Added free_spacing boolean arg to match inset.h
5472 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5473 Added free_spacing boolean arg to match inset.h
5475 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5476 Added free_spacing boolean arg to match inset.h
5478 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5479 Added free_spacing boolean arg to match inset.h
5481 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5482 free_spacing boolean arg to match inset.h
5484 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5485 free_spacing boolean arg to match inset.h
5487 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5488 ignore free_spacing paragraphs. The user's spaces are left
5491 * src/text.C (InsertChar): Fixed the free_spacing layout
5492 attribute behavior. Now, if free_spacing is set, you can
5493 add multiple spaces in a paragraph with impunity (and they
5494 get output verbatim).
5495 (SelectSelectedWord): Added dummy argument to inset::Latex()
5498 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5501 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5502 paragraph layouts now only input a simple space instead.
5503 Special character insets don't make any sense in free-spacing
5506 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5507 hard-spaces in the *input* file to simple spaces if the layout
5508 is free-spacing. This converts old files which had to have
5509 hard-spaces in free-spacing layouts where a simple space was
5511 (writeFileAscii): Added free_spacing check to pass to the newly
5512 reworked inset::Latex(...) methods. The inset::Latex() code
5513 ensures that hard-spaces in free-spacing paragraphs get output
5514 as spaces (rather than "~").
5516 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5518 * src/mathed/math_delim.C (draw): draw the empty placeholder
5519 delims with a onoffdash line.
5520 (struct math_deco_compare): struct that holds the "functors" used
5521 for the sort and the binary search in math_deco_table.
5522 (class init_deco_table): class used for initial sort of the
5524 (search_deco): use lower_bound to do a binary search in the
5527 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5529 * src/lyxrc.C: a small secret thingie...
5531 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5532 and to not flush the stream as often as it used to.
5534 * src/support/lyxalgo.h: new file
5535 (sorted): template function used for checking if a sequence is
5536 sorted or not. Two versions with and without user supplied
5537 compare. Uses same compare as std::sort.
5539 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5540 it and give warning on lyxerr.
5542 (struct compare_tags): struct with function operators used for
5543 checking if sorted, sorting and lower_bound.
5544 (search_kw): use lower_bound instead of manually implemented
5547 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5549 * src/insets/insetcollapsable.h: fix Clone() declaration.
5550 * src/insets/insetfoot.h: ditto.
5552 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5554 2000-03-08 Juergen Vigna <jug@sad.it>
5556 * src/insets/lyxinset.h: added owner call which tells us if
5557 this inset is inside another inset. Changed also the return-type
5558 of Editable to an enum so it tells clearer what the return-value is.
5560 * src/insets/insettext.C (computeTextRows): fixed computing of
5561 textinsets which split automatically on more rows.
5563 * src/insets/insetert.[Ch]: changed this to be of BaseType
5566 * src/insets/insetfoot.[Ch]: added footnote inset
5568 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5569 collapsable insets (like footnote, ert, ...)
5571 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5573 * src/lyxdraw.h: remvoe file
5575 * src/lyxdraw.C: remove file
5577 * src/insets/insettext.C: added <algorithm>.
5579 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5581 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5582 (matrix_cb): case MM_OK use string stream
5584 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5587 * src/mathed/math_macro.C (draw): use string stream
5588 (Metrics): use string stream
5590 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5591 directly to the ostream.
5593 * src/vspace.C (asString): use string stream.
5594 (asString): use string stream
5595 (asLatexString): use string stream
5597 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5598 setting Spacing::Other.
5600 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5601 sprintf when creating the stretch vale.
5603 * src/text2.C (alphaCounter): changed to return a string and to
5604 not use a static variable internally. Also fixed a one-off bug.
5605 (SetCounter): changed the drawing of the labels to use string
5606 streams instead of sprintf.
5608 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5609 manipulator to use a scheme that does not require library support.
5610 This is also the way it is done in the new GNU libstdc++. Should
5611 work with DEC cxx now.
5613 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5615 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5616 end. This fixes a bug.
5618 * src/mathed (all files concerned with file writing): apply the
5619 USE_OSTREAM_ONLY changes to mathed too.
5621 * src/support/DebugStream.h: make the constructor explicit.
5623 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5624 count and ostream squashed.
5626 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5628 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5630 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5631 ostringstream uses STL strings, and we might not.
5633 * src/insets/insetspecialchar.C: add using directive.
5634 * src/insets/insettext.C: ditto.
5636 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5638 * lib/layouts/seminar.layout: feeble attempt at a layout for
5639 seminar.cls, far from completet and could really use some looking
5640 at from people used to write layout files.
5642 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5643 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5644 a lot nicer and works nicely with ostreams.
5646 * src/mathed/formula.C (draw): a slightly different solution that
5647 the one posted to the list, but I think this one works too. (font
5648 size wrong in headers.)
5650 * src/insets/insettext.C (computeTextRows): some fiddling on
5651 Jürgens turf, added some comments that he should read.
5653 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5654 used and it gave compiler warnings.
5655 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5658 * src/lyx_gui.C (create_forms): do the right thing when
5659 show_banner is true/false.
5661 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5662 show_banner is false.
5664 * most file writing files: Now use iostreams to do almost all of
5665 the writing. Also instead of passing string &, we now use
5666 stringstreams. mathed output is still not adapted to iostreams.
5667 This change can be turned off by commenting out all the occurences
5668 of the "#define USE_OSTREAM_ONLY 1" lines.
5670 * src/WorkArea.C (createPixmap): don't output debug messages.
5671 (WorkArea): don't output debug messages.
5673 * lib/lyxrc.example: added a comment about the new variable
5676 * development/Code_rules/Rules: Added some more commente about how
5677 to build class interfaces and on how better encapsulation can be
5680 2000-03-03 Juergen Vigna <jug@sad.it>
5682 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5683 automatically with the width of the LyX-Window
5685 * src/insets/insettext.C (computeTextRows): fixed update bug in
5686 displaying text-insets (scrollvalues where not initialized!)
5688 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5690 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5691 id in the check of the result from lower_bound is not enough since
5692 lower_bound can return last too, and then res->id will not be a
5695 * all insets and some code that use them: I have conditionalized
5696 removed the Latex(string & out, ...) this means that only the
5697 Latex(ostream &, ...) will be used. This is a work in progress to
5698 move towards using streams for all output of files.
5700 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5703 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5705 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5706 routine (this fixes bug where greek letters were surrounded by too
5709 * src/support/filetools.C (findtexfile): change a bit the search
5710 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5711 no longer passed to kpsewhich, we may have to change that later.
5713 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5714 warning options to avoid problems with X header files (from Angus
5716 * acinclude.m4: regenerated.
5718 2000-03-02 Juergen Vigna <jug@sad.it>
5720 * src/insets/insettext.C (WriteParagraphData): Using the
5721 par->writeFile() function for writing paragraph-data.
5722 (Read): Using buffer->parseSingleLyXformat2Token()-function
5723 for parsing paragraph data!
5725 * src/buffer.C (readLyXformat2): removed all parse data and using
5726 the new parseSingleLyXformat2Token()-function.
5727 (parseSingleLyXformat2Token): added this function to parse (read)
5728 lyx-file-format (this is called also from text-insets now!)
5730 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5732 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5735 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5736 directly instead of going through a func. One very bad thing: a
5737 static LyXFindReplace, but I don't know where to place it.
5739 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5740 string instead of char[]. Also changed to static.
5741 (GetSelectionOrWordAtCursor): changed to static inline
5742 (SetSelectionOverLenChars): ditto.
5744 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5745 current_view and global variables. both classes has changed names
5746 and LyXFindReplace is not inherited from SearchForm.
5748 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5749 fl_form_search form.
5751 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5753 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5755 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5756 bound (from Kayvan).
5758 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5760 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5762 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5764 * some things that I should comment but the local pub says head to
5767 * comment out all code that belongs to the Roff code for Ascii
5768 export of tables. (this is unused)
5770 * src/LyXView.C: use correct type for global variable
5771 current_layout. (LyXTextClass::size_type)
5773 * some code to get the new insetgraphics closer to working I'd be
5774 grateful for any help.
5776 * src/BufferView2.C (insertInset): use the return type of
5777 NumberOfLayout properly. (also changes in other files)
5779 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5780 this as a test. I want to know what breaks because of this.
5782 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5784 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5786 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5787 to use a \makebox in the label, this allows proper justification
5788 with out using protected spaces or multiple hfills. Now it is
5789 "label" for left justified, "\hfill label\hfill" for center, and
5790 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5791 should be changed accordingly.
5793 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5795 * src/lyxtext.h: change SetLayout() to take a
5796 LyXTextClass::size_type instead of a char (when there is more than
5797 127 layouts in a class); also change type of copylayouttype.
5798 * src/text2.C (SetLayout): ditto.
5799 * src/LyXView.C (updateLayoutChoice): ditto.
5801 * src/LaTeX.C (scanLogFile): errors where the line number was not
5802 given just after the '!'-line were ignored (from Dekel Tsur).
5804 * lib/lyxrc.example: fix description of \date_insert_format
5806 * lib/layouts/llncs.layout: new layout, contributed by Martin
5809 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5811 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5812 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5813 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5814 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5815 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5816 paragraph.C, text.C, text2.C)
5818 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5820 * src/insets/insettext.C (LocalDispatch): remove extra break
5823 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5824 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5826 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5827 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5829 * src/insets/insetbib.h: move InsetBibkey::Holder and
5830 InsetCitation::Holder in public space.
5832 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5834 * src/insets/insettext.h: small change to get the new files from
5835 Juergen to compile (use "string", not "class string").
5837 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5838 const & as parameter to LocalDispatch, use LyXFont const & as
5839 paramter to some other func. This also had impacto on lyxinsets.h
5840 and the two mathed insets.
5842 2000-02-24 Juergen Vigna <jug@sad.it>
5845 * src/commandtags.h:
5847 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5851 * src/BufferView2.C: added/updated code for various inset-functions
5853 * src/insets/insetert.[Ch]: added implementation of InsetERT
5855 * src/insets/insettext.[Ch]: added implementation of InsetText
5857 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5858 (draw): added preliminary code for inset scrolling not finshed yet
5860 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5861 as it is in lyxfunc.C now
5863 * src/insets/lyxinset.h: Added functions for text-insets
5865 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5867 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5868 BufferView and reimplement the list as a queue put inside its own
5871 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5873 * several files: use the new interface to the "updateinsetlist"
5875 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5877 (work_area_handler): call BufferView::trippleClick on trippleclick.
5879 * src/BufferView.C (doubleClick): new function, selects word on
5881 (trippleClick): new function, selects line on trippleclick.
5883 2000-02-22 Allan Rae <rae@lyx.org>
5885 * lib/bind/xemacs.bind: buffer-previous not supported
5887 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5889 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5892 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5894 * src/bufferlist.C: get rid of current_view from this file
5896 * src/spellchecker.C: get rid of current_view from this file
5898 * src/vspace.C: get rid of current_view from this file
5899 (inPixels): added BufferView parameter for this func
5900 (asLatexCommand): added a BufferParams for this func
5902 * src/text.C src/text2.C: get rid of current_view from these
5905 * src/lyxfont.C (getFontDirection): move this function here from
5908 * src/bufferparams.C (getDocumentDirection): move this function
5911 * src/paragraph.C (getParDirection): move this function here from
5913 (getLetterDirection): ditto
5915 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5917 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5918 resize due to wrong pixmap beeing used. Also took the opurtunity
5919 to make the LyXScreen stateless on regard to WorkArea and some
5920 general cleanup in the same files.
5922 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5924 * src/Makefile.am: add missing direction.h
5926 * src/PainterBase.h: made the width functions const.
5928 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5931 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5933 * src/insets/insetlatexaccent.C (draw): make the accents draw
5934 better, at present this will only work well with iso8859-1.
5936 * several files: remove the old drawing code, now we use the new
5939 * several files: remove support for mono_video, reverse_video and
5942 2000-02-17 Juergen Vigna <jug@sad.it>
5944 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5945 int ** as we have to return the pointer, otherwise we have only
5946 NULL pointers in the returning function.
5948 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5950 * src/LaTeX.C (operator()): quote file name when running latex.
5952 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5954 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5955 (bubble tip), this removes our special handling of this.
5957 * Remove all code that is unused now that we have the new
5958 workarea. (Code that are not active when NEW_WA is defined.)
5960 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5962 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5964 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5965 nonexisting layout; correctly redirect obsoleted layouts.
5967 * lib/lyxrc.example: document \view_dvi_paper_option
5969 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5972 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5973 (PreviewDVI): handle the view_dvi_paper_option variable.
5974 [Both from Roland Krause]
5976 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5978 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5979 char const *, int, LyXFont)
5980 (text(int, int, string, LyXFont)): ditto
5982 * src/text.C (InsertCharInTable): attempt to fix the double-space
5983 feature in tables too.
5984 (BackspaceInTable): ditto.
5985 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5987 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5989 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5991 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5992 newly found text in textcache to this.
5993 (buffer): set the owner of the text put into the textcache to 0
5995 * src/insets/figinset.C (draw): fixed the drawing of figures with
5998 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5999 drawing of mathframe, hfills, protected space, table lines. I have
6000 now no outstanding drawing problems with the new Painter code.
6002 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6004 * src/PainterBase.C (ellipse, circle): do not specify the default
6007 * src/LColor.h: add using directive.
6009 * src/Painter.[Ch]: change return type of methods from Painter& to
6010 PainterBase&. Add a using directive.
6012 * src/WorkArea.C: wrap xforms callbacks in C functions
6015 * lib/layouts/foils.layout: font fix and simplifications from Carl
6018 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6020 * a lot of files: The Painter, LColor and WorkArea from the old
6021 devel branch has been ported to lyx-devel. Some new files and a
6022 lot of #ifdeffed code. The new workarea is enabled by default, but
6023 if you want to test the new Painter and LColor you have to compile
6024 with USE_PAINTER defined (do this in config.h f.ex.) There are
6025 still some rought edges, and I'd like some help to clear those
6026 out. It looks stable (loads and displays the Userguide very well).
6029 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6031 * src/buffer.C (pop_tag): revert to the previous implementation
6032 (use a global variable for both loops).
6034 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6036 * src/lyxrc.C (LyXRC): change slightly default date format.
6038 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6039 there is an English text with a footnote that starts with a Hebrew
6040 paragraph, or vice versa.
6041 (TeXFootnote): ditto.
6043 * src/text.C (LeftMargin): allow for negative values for
6044 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6047 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6048 for input encoding (cyrillic)
6050 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6052 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6055 * src/toolbar.C (set): ditto
6056 * src/insets/insetbib.C (create_form_citation_form): ditto
6058 * lib/CREDITS: added Dekel Tsur.
6060 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6061 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6062 hebrew supports files from Dekel Tsur.
6064 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6065 <tzafrir@technion.ac.il>
6067 * src/lyxrc.C: put \date_insert_format at the right place.
6069 * src/buffer.C (makeLaTeXFile): fix the handling of
6070 BufferParams::sides when writing out latex files.
6072 * src/BufferView2.C: add a "using" directive.
6074 * src/support/lyxsum.C (sum): when we use lyxstring,
6075 ostringstream::str needs an additional .c_str().
6077 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6079 * src/support/filetools.C (ChangeExtension): patch from Etienne
6082 * src/TextCache.C (show): remove const_cast and make second
6083 parameter non-const LyXText *.
6085 * src/TextCache.h: use non const LyXText in show.
6087 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6090 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6092 * src/support/lyxsum.C: rework to be more flexible.
6094 * several places: don't check if a pointer is 0 if you are going
6097 * src/text.C: remove some dead code.
6099 * src/insets/figinset.C: remove some dead code
6101 * src/buffer.C: move the BufferView funcs to BufferView2.C
6102 remove all support for insetlatexdel
6103 remove support for oldpapersize stuff
6104 made some member funcs const
6106 * src/kbmap.C: use a std::list to store the bindings in.
6108 * src/BufferView2.C: new file
6110 * src/kbsequence.[Ch]: new files
6112 * src/LyXAction.C + others: remove all trace of buffer-previous
6114 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6115 only have one copy in the binary of this table.
6117 * hebrew patch: moved some functions from LyXText to more
6118 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6120 * several files: remove support for XForms older than 0.88
6122 remove some #if 0 #endif code
6124 * src/TextCache.[Ch]: new file. Holds the textcache.
6126 * src/BufferView.C: changes to use the new TextCache interface.
6127 (waitForX): remove the now unused code.
6129 * src/BackStack.h: remove some commented code
6131 * lib/bind/emacs.bind: remove binding for buffer-previous
6133 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6135 * applied the hebrew patch.
6137 * src/lyxrow.h: make sure that all Row variables are initialized.
6139 * src/text2.C (TextHandleUndo): comment out a delete, this might
6140 introduce a memory leak, but should also help us to not try to
6141 read freed memory. We need to look at this one.
6143 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6144 (LyXParagraph): initalize footnotekind.
6146 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6147 forgot this when applying the patch. Please heed the warnings.
6149 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6150 (aka. reformat problem)
6152 * src/bufferlist.C (exists): made const, and use const_iterator
6153 (isLoaded): new func.
6154 (release): use std::find to find the correct buffer.
6156 * src/bufferlist.h: made getState a const func.
6157 made empty a const func.
6158 made exists a const func.
6161 2000-02-01 Juergen Vigna <jug@sad.it>
6163 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6165 * po/it.po: updated a bit the italian po file and also changed the
6166 'file nuovo' for newfile to 'filenuovo' without a space, this did
6169 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6170 for the new insert_date command.
6172 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6173 from jdblair, to insert a date into the current text conforming to
6174 a strftime format (for now only considering the locale-set and not
6175 the document-language).
6177 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6179 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6180 Bounds Read error seen by purify. The problem was that islower is
6181 a macros which takes an unsigned char and uses it as an index for
6182 in array of characters properties (and is thus subject to the
6186 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6187 correctly the paper sides radio buttons.
6188 (UpdateDocumentButtons): ditto.
6190 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6192 * src/kbmap.C (getsym + others): change to return unsigned int,
6193 returning a long can give problems on 64 bit systems. (I assume
6194 that int is 32bit on 64bit systems)
6196 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6198 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6199 LyXLookupString to be zero-terminated. Really fixes problems seen
6202 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6204 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6205 write a (char*)0 to the lyxerr stream.
6207 * src/lastfiles.C: move algorithm before the using statemets.
6209 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6211 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6212 complains otherwise).
6213 * src/table.C: ditto
6215 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6218 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6219 that I removed earlier... It is really needed.
6221 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6223 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6225 * INSTALL: update xforms home page URL.
6227 * lib/configure.m4: fix a bug with unreadable layout files.
6229 * src/table.C (calculate_width_of_column): add "using std::max"
6232 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6234 * several files: marked several lines with "DEL LINE", this is
6235 lines that can be deleted without changing anything.
6236 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6237 checks this anyway */
6240 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6242 * src/DepTable.C (update): add a "+" at the end when the checksum
6243 is different. (debugging string only)
6245 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6246 the next inset to not be displayed. This should also fix the list
6247 of labels in the "Insert Crossreference" dialog.
6249 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6251 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6252 when regex was not found.
6254 * src/support/lstrings.C (lowercase): use handcoded transform always.
6257 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6258 old_cursor.par->prev could be 0.
6260 * several files: changed post inc/dec to pre inc/dec
6262 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6263 write the lastfiles to file.
6265 * src/BufferView.C (buffer): only show TextCache info when debugging
6267 (resizeCurrentBuffer): ditto
6268 (workAreaExpose): ditto
6270 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6272 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6274 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6275 a bit better by removing the special case for \i and \j.
6277 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6279 * src/lyx_main.C (easyParse): remove test for bad comand line
6280 options, since this broke all xforms-related parsing.
6282 * src/kbmap.C (getsym): set return type to unsigned long, as
6283 declared in header. On an alpha, long is _not_ the same as int.
6285 * src/support/LOstream.h: add a "using std::flush;"
6287 * src/insets/figinset.C: ditto.
6289 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6291 * src/bufferlist.C (write): use blinding fast file copy instead of
6292 "a char at a time", now we are doing it the C++ way.
6294 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6295 std::list<int> instead.
6296 (addpidwait): reflect move to std::list<int>
6297 (sigchldchecker): ditto
6299 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6302 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6303 that obviously was wrong...
6305 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6306 c, this avoids warnings with purify and islower.
6308 * src/insets/figinset.C: rename struct queue to struct
6309 queue_element and rewrite to use a std::queue. gsqueue is now a
6310 std::queue<queue_element>
6311 (runqueue): reflect move to std::queue
6314 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6315 we would get "1" "0" instead of "true" "false. Also make the tostr
6318 2000-01-21 Juergen Vigna <jug@sad.it>
6320 * src/buffer.C (writeFileAscii): Disabled code for special groff
6321 handling of tabulars till I fix this in table.C
6323 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6325 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6327 * src/support/lyxlib.h: ditto.
6329 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6331 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6332 and 'j' look better. This might fix the "macron" bug that has been
6335 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6336 functions as one template function. Delete the old versions.
6338 * src/support/lyxsum.C: move using std::ifstream inside
6341 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6344 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6346 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6348 * src/insets/figinset.C (InitFigures): use new instead of malloc
6349 to allocate memory for figures and bitmaps.
6350 (DoneFigures): use delete[] instead of free to deallocate memory
6351 for figures and bitmaps.
6352 (runqueue): use new to allocate
6353 (getfigdata): use new/delete[] instead of malloc/free
6354 (RegisterFigure): ditto
6356 * some files: moved some declarations closer to first use, small
6357 whitespace changes use preincrement instead of postincrement where
6358 it does not make a difference.
6360 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6361 step on the way to use stl::containers for key maps.
6363 * src/bufferlist.h: add a typedef for const_iterator and const
6364 versions of begin and end.
6366 * src/bufferlist.[Ch]: change name of member variable _state to
6367 state_. (avoid reserved names)
6369 (getFileNames): returns the filenames of the buffers in a vector.
6371 * configure.in (ALL_LINGUAS): added ro
6373 * src/support/putenv.C: new file
6375 * src/support/mkdir.C: new file
6377 2000-01-20 Allan Rae <rae@lyx.org>
6379 * lib/layouts/IEEEtran.layout: Added several theorem environments
6381 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6382 couple of minor additions.
6384 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6385 (except for those in footnotes of course)
6387 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6389 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6391 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6392 std::sort and std::lower_bound instead of qsort and handwritten
6394 (struct compara): struct that holds the functors used by std::sort
6395 and std::lower_bound in MathedLookupBOP.
6397 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6399 * src/support/LAssert.h: do not do partial specialization. We do
6402 * src/support/lyxlib.h: note that lyx::getUserName() and
6403 lyx::date() are not in use right now. Should these be suppressed?
6405 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6406 (makeLinuxDocFile): do not put date and user name in linuxdoc
6409 * src/support/lyxlib.h (kill): change first argument to long int,
6410 since that's what solaris uses.
6412 * src/support/kill.C (kill): fix declaration to match prototype.
6414 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6415 actually check whether namespaces are supported. This is not what
6418 * src/support/lyxsum.C: add a using directive.
6420 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6422 * src/support/kill.C: if we have namespace support we don't have
6423 to include lyxlib.h.
6425 * src/support/lyxlib.h: use namespace lyx if supported.
6427 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6429 * src/support/date.C: new file
6431 * src/support/chdir.C: new file
6433 * src/support/getUserName.C: new file
6435 * src/support/getcwd.C: new file
6437 * src/support/abort.C: new file
6439 * src/support/kill.C: new file
6441 * src/support/lyxlib.h: moved all the functions in this file
6442 insede struct lyx. Added also kill and abort to this struct. This
6443 is a way to avoid the "kill is not defined in <csignal>", we make
6444 C++ wrappers for functions that are not ANSI C or ANSI C++.
6446 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6447 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6448 lyx it has been renamed to sum.
6450 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6452 * src/text.C: add using directives for std::min and std::max.
6454 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6456 * src/texrow.C (getIdFromRow): actually return something useful in
6457 id and pos. Hopefully fixes the bug with positionning of errorbox
6460 * src/lyx_main.C (easyParse): output an error and exit if an
6461 incorrect command line option has been given.
6463 * src/spellchecker.C (ispell_check_word): document a memory leak.
6465 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6466 where a "struct utimbuf" is allocated with "new" and deleted with
6469 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6471 * src/text2.C (CutSelection): don't delete double spaces.
6472 (PasteSelection): ditto
6473 (CopySelection): ditto
6475 * src/text.C (Backspace): don't delete double spaces.
6477 * src/lyxlex.C (next): fix a bug that were only present with
6478 conformant std::istream::get to read comment lines, use
6479 std::istream::getline instead. This seems to fix the problem.
6481 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6483 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6484 allowed to insert space before space" editing problem. Please read
6485 commends at the beginning of the function. Comments about usage
6488 * src/text.C (InsertChar): fix for the "not allowed to insert
6489 space before space" editing problem.
6491 * src/text2.C (DeleteEmptyParagraphMechanism): when
6492 IsEmptyTableRow can only return false this last "else if" will
6493 always be a no-op. Commented out.
6495 * src/text.C (RedoParagraph): As far as I can understand tmp
6496 cursor is not really needed.
6498 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6499 present it could only return false anyway.
6500 (several functions): Did something not so smart...added a const
6501 specifier on a lot of methods.
6503 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6504 and add a tmp->text.resize. The LyXParagraph constructor does the
6506 (BreakParagraphConservative): ditto
6508 * src/support/path.h (Path): add a define so that the wrong usage
6509 "Path("/tmp") will be flagged as a compilation error:
6510 "`unnamed_Path' undeclared (first use this function)"
6512 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6514 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6515 which was bogus for several reasons.
6517 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6521 * autogen.sh: do not use "type -path" (what's that anyway?).
6523 * src/support/filetools.C (findtexfile): remove extraneous space
6524 which caused a kpsewhich warning (at least with kpathsea version
6527 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6529 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6531 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6533 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6535 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6537 * src/paragraph.C (BreakParagraph): do not reserve space on text
6538 if we don't need to (otherwise, if pos_end < pos, we end up
6539 reserving huge amounts of memory due to bad unsigned karma).
6540 (BreakParagraphConservative): ditto, although I have not seen
6541 evidence the bug can happen here.
6543 * src/lyxparagraph.h: add a using std::list.
6545 2000-01-11 Juergen Vigna <jug@sad.it>
6547 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6550 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6552 * src/vc-backend.C (doVCCommand): change to be static and take one
6553 more parameter: the path to chdir too be fore executing the command.
6554 (retrive): new function equiv to "co -r"
6556 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6557 file_not_found_hook is true.
6559 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6561 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6562 if a file is readwrite,readonly...anything else.
6564 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6566 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6567 (CreatePostscript): name change from MenuRunDVIPS (or something)
6568 (PreviewPostscript): name change from MenuPreviewPS
6569 (PreviewDVI): name change from MenuPreviewDVI
6571 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6572 \view_pdf_command., \pdf_to_ps_command
6574 * lib/configure.m4: added search for PDF viewer, and search for
6575 PDF to PS converter.
6576 (lyxrc.defaults output): add \pdflatex_command,
6577 \view_pdf_command and \pdf_to_ps_command.
6579 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6581 * src/bufferlist.C (write): we don't use blocksize for anything so
6584 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6586 * src/support/block.h: disable operator T* (), since it causes
6587 problems with both compilers I tried. See comments in the file.
6589 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6592 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6593 variable LYX_DIR_10x to LYX_DIR_11x.
6595 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6597 * INSTALL: document --with-lyxname.
6600 * configure.in: new configure flag --with-lyxname which allows to
6601 choose the name under which lyx is installed. Default is "lyx", of
6602 course. It used to be possible to do this with --program-suffix,
6603 but the later has in fact a different meaning for autoconf.
6605 * src/support/lstrings.h (lstrchr): reformat a bit.
6607 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6608 * src/mathed/math_defs.h: ditto.
6610 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6612 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6613 true, decides if we create a backup file or not when saving. New
6614 tag and variable \pdf_mode, defaults to false. New tag and
6615 variable \pdflatex_command, defaults to pdflatex. New tag and
6616 variable \view_pdf_command, defaults to xpdf. New tag and variable
6617 \pdf_to_ps_command, defaults to pdf2ps.
6619 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6621 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6622 does not have a BufferView.
6623 (unlockInset): ditto + don't access the_locking_inset if the
6624 buffer does not have a BufferView.
6626 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6627 certain circumstances so that we don't continue a keyboard
6628 operation long after the key was released. Try f.ex. to load a
6629 large document, press PageDown for some seconds and then release
6630 it. Before this change the document would contine to scroll for
6631 some time, with this change it stops imidiatly.
6633 * src/support/block.h: don't allocate more space than needed. As
6634 long as we don't try to write to the arr[x] in a array_type arr[x]
6635 it is perfectly ok. (if you write to it you might segfault).
6636 added operator value_type*() so that is possible to pass the array
6637 to functions expecting a C-pointer.
6639 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6642 * intl/*: updated to gettext 0.10.35, tried to add our own
6643 required modifications. Please verify.
6645 * po/*: updated to gettext 0.10.35, tried to add our own required
6646 modifications. Please verify.
6648 * src/support/lstrings.C (tostr): go at fixing the problem with
6649 cxx and stringstream. When stringstream is used return
6650 oss.str().c_str() so that problems with lyxstring and basic_string
6651 are avoided. Note that the best solution would be for cxx to use
6652 basic_string all the way, but it is not conformant yet. (it seems)
6654 * src/lyx_cb.C + other files: moved several global functions to
6655 class BufferView, some have been moved to BufferView.[Ch] others
6656 are still located in lyx_cb.C. Code changes because of this. (part
6657 of "get rid of current_view project".)
6659 * src/buffer.C + other files: moved several Buffer functions to
6660 class BufferView, the functions are still present in buffer.C.
6661 Code changes because of this.
6663 * config/lcmessage.m4: updated to most recent. used when creating
6666 * config/progtest.m4: updated to most recent. used when creating
6669 * config/gettext.m4: updated to most recent. applied patch for
6672 * config/gettext.m4.patch: new file that shows what changes we
6673 have done to the local copy of gettext.m4.
6675 * config/libtool.m4: new file, used in creation of acinclude.m4
6677 * config/lyxinclude.m4: new file, this is the lyx created m4
6678 macros, used in making acinclude.m4.
6680 * autogen.sh: GNU m4 discovered as a separate task not as part of
6681 the lib/configure creation.
6682 Generate acinlucde from files in config. Actually cat
6683 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6684 easier to upgrade .m4 files that really are external.
6686 * src/Spacing.h: moved using std::istringstream to right after
6687 <sstream>. This should fix the problem seen with some compilers.
6689 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6691 * src/lyx_cb.C: began some work to remove the dependency a lot of
6692 functions have on BufferView::text, even if not really needed.
6693 (GetCurrentTextClass): removed this func, it only hid the
6696 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6697 forgot this in last commit.
6699 * src/Bullet.C (bulletEntry): use static char const *[] for the
6700 tables, becuase of this the return arg had to change to string.
6702 (~Bullet): removed unneeded destructor
6704 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6705 (insetSleep): moved from Buffer
6706 (insetWakeup): moved from Buffer
6707 (insetUnlock): moved from Buffer
6709 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6710 from Buffer to BufferView.
6712 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6714 * config/ltmain.sh: updated to version 1.3.4 of libtool
6716 * config/ltconfig: updated to version 1.3.4 of libtool
6718 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6721 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6722 Did I get that right?
6724 * src/lyxlex.h: add a "using" directive or two.
6725 * src/Spacing.h: ditto.
6726 * src/insets/figinset.C: ditto.
6727 * src/support/filetools.C: ditto.
6728 * src/support/lstrings.C: ditto.
6729 * src/BufferView.C: ditto.
6730 * src/bufferlist.C: ditto.
6731 * src/lyx_cb.C: ditto.
6732 * src/lyxlex.C: ditto.
6734 * NEWS: add some changes for 1.1.4.
6736 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6738 * src/BufferView.C: first go at a TextCache to speed up switching
6741 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6743 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6744 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6745 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6746 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6749 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6750 members of the struct are correctly initialized to 0 (detected by
6752 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6753 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6755 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6756 pidwait, since it was allocated with "new". This was potentially
6757 very bad. Thanks to Michael Schmitt for running purify for us.
6760 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6762 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6764 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6766 1999-12-30 Allan Rae <rae@lyx.org>
6768 * lib/templates/IEEEtran.lyx: minor change
6770 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6771 src/mathed/formula.C (LocalDispatch): askForText changes
6773 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6774 know when a user has cancelled input. Fixes annoying problems with
6775 inserting labels and version control.
6777 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6779 * src/support/lstrings.C (tostr): rewritten to use strstream and
6782 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6784 * src/support/filetools.C (IsFileWriteable): use fstream to check
6785 (IsDirWriteable): use fileinfo to check
6787 * src/support/filetools.h (FilePtr): whole class deleted
6789 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6791 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6793 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6795 * src/bufferlist.C (write): use ifstream and ofstream instead of
6798 * src/Spacing.h: use istrstream instead of sscanf
6800 * src/mathed/math_defs.h: change first arg to istream from FILE*
6802 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6804 * src/mathed/math_parser.C: have yyis to be an istream
6805 (LexGetArg): use istream (yyis)
6807 (mathed_parse): ditto
6808 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6810 * src/mathed/formula.C (Read): rewritten to use istream
6812 * src/mathed/formulamacro.C (Read): rewritten to use istream
6814 * src/lyxlex.h (~LyXLex): deleted desturctor
6815 (getStream): new function, returns an istream
6816 (getFile): deleted funtion
6817 (IsOK): return is.good();
6819 * src/lyxlex.C (LyXLex): delete file and owns_file
6820 (setFile): open an filebuf and assign that to a istream instead of
6822 (setStream): new function, takes an istream as arg.
6823 (setFile): deleted function
6824 (EatLine): rewritten us use istream instead of FILE*
6828 * src/table.C (LyXTable): use istream instead of FILE*
6829 (Read): rewritten to take an istream instead of FILE*
6831 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6833 * src/buffer.C (Dispatch): remove an extraneous break statement.
6835 * src/support/filetools.C (QuoteName): change to do simple
6836 'quoting'. More work is necessary. Also changed to do nothing
6837 under emx (needs fix too).
6838 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6840 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6841 config.h.in to the AC_DEFINE_UNQUOTED() call.
6842 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6843 needs char * as argument (because Solaris 7 declares it like
6846 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6847 remove definition of BZERO.
6849 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6851 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6852 defined, "lyxregex.h" if not.
6854 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6856 (REGEX): new variable that is set to regex.c lyxregex.h when
6857 AM_CONDITIONAL USE_REGEX is set.
6858 (libsupport_la_SOURCES): add $(REGEX)
6860 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6863 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6866 * configure.in: add call to LYX_REGEX
6868 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6869 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6871 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6873 * lib/bind/fi_menus.bind: new file, from
6874 pauli.virtanen@saunalahti.fi.
6876 * src/buffer.C (getBibkeyList): pass the parameter delim to
6877 InsetInclude::getKeys and InsetBibtex::getKeys.
6879 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6880 is passed to Buffer::getBibkeyList
6882 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6883 instead of the hardcoded comma.
6885 * src/insets/insetbib.C (getKeys): make sure that there are not
6886 leading blanks in bibtex keys. Normal latex does not care, but
6887 harvard.sty seems to dislike blanks at the beginning of citation
6888 keys. In particular, the retturn value of the function is
6890 * INSTALL: make it clear that libstdc++ is needed and that gcc
6891 2.7.x probably does not work.
6893 * src/support/filetools.C (findtexfile): make debug message go to
6895 * src/insets/insetbib.C (getKeys): ditto
6897 * src/debug.C (showTags): make sure that the output is correctly
6900 * configure.in: add a comment for TWO_COLOR_ICON define.
6902 * acconfig.h: remove all the entries that already defined in
6903 configure.in or acinclude.m4.
6905 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6906 to avoid user name, date and copyright.
6908 1999-12-21 Juergen Vigna <jug@sad.it>
6910 * src/table.C (Read): Now read bogus row format informations
6911 if the format is < 5 so that afterwards the table can
6912 be read by lyx but without any format-info. Fixed the
6913 crash we experienced when not doing this.
6915 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6917 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6918 (RedoDrawingOfParagraph): ditto
6919 (RedoParagraphs): ditto
6920 (RemoveTableRow): ditto
6922 * src/text.C (Fill): rename arg paperwidth -> paper_width
6924 * src/buffer.C (insertLyXFile): rename var filename -> fname
6925 (writeFile): rename arg filename -> fname
6926 (writeFileAscii): ditto
6927 (makeLaTeXFile): ditto
6928 (makeLinuxDocFile): ditto
6929 (makeDocBookFile): ditto
6931 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6934 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6936 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6939 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6940 compiled by a C compiler not C++.
6942 * src/layout.h (LyXTextClass): added typedef for const_iterator
6943 (LyXTextClassList): added typedef for const_iterator + member
6944 functions begin and end.
6946 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6947 iterators to fill the choice_class.
6948 (updateLayoutChoice): rewritten to use iterators to fill the
6949 layoutlist in the toolbar.
6951 * src/BufferView.h (BufferView::work_area_width): removed unused
6954 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6956 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6957 (sgmlCloseTag): ditto
6959 * src/support/lstrings.h: return type of countChar changed to
6962 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6963 what version of this func to use. Also made to return unsigned int.
6965 * configure.in: call LYX_STD_COUNT
6967 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6968 conforming std::count.
6970 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6972 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6973 and a subscript would give bad display (patch from Dekel Tsur
6974 <dekel@math.tau.ac.il>).
6976 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6978 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6981 * src/chset.h: add a few 'using' directives
6983 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6984 triggered when no buffer is active
6986 * src/layout.C: removed `break' after `return' in switch(), since
6989 * src/lyx_main.C (init): make sure LyX can be ran in place even
6990 when libtool has done its magic with shared libraries. Fix the
6991 test for the case when the system directory has not been found.
6993 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6994 name for the latex file.
6995 (MenuMakeHTML): ditto
6997 * src/buffer.h: add an optional boolean argument, which is passed
7000 1999-12-20 Allan Rae <rae@lyx.org>
7002 * lib/templates/IEEEtran.lyx: small correction and update.
7004 * configure.in: Attempted to use LYX_PATH_HEADER
7006 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7008 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7009 input from JMarc. Now use preprocessor to find the header.
7010 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7011 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7012 LYX_STL_STRING_FWD. See comments in file.
7014 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7016 * The global MiniBuffer * minibuffer variable is dead.
7018 * The global FD_form_main * fd_form_main variable is dead.
7020 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7022 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7024 * src/table.h: add the LOstream.h header
7025 * src/debug.h: ditto
7027 * src/LyXAction.h: change the explaination of the ReadOnly
7028 attribute: is indicates that the function _can_ be used.
7030 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7033 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7035 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7041 * src/paragraph.C (GetWord): assert on pos>=0
7044 * src/support/lyxstring.C: condition the use of an invariant on
7046 * src/support/lyxstring.h: ditto
7048 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7049 Use LAssert.h instead of plain assert().
7051 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7053 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7054 * src/support/filetools.C: ditto
7056 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7059 * INSTALL: document the new configure flags
7061 * configure.in: suppress --with-debug; add --enable-assertions
7063 * acinclude.m4: various changes in alignment of help strings.
7065 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7067 * src/kbmap.C: commented out the use of the hash map in kb_map,
7068 beginning of movement to a stl::container.
7070 * several files: removed code that was not in effect when
7071 MOVE_TEXT was defined.
7073 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7074 for escaping should not be used. We can discuss if the string
7075 should be enclosed in f.ex. [] instead of "".
7077 * src/trans_mgr.C (insert): use the new returned value from
7078 encodeString to get deadkeys and keymaps done correctly.
7080 * src/chset.C (encodeString): changed to return a pair, to tell
7081 what to use if we know the string.
7083 * src/lyxscreen.h (fillArc): new function.
7085 * src/FontInfo.C (resize): rewritten to use more std::string like
7086 structore, especially string::replace.
7088 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7091 * configure.in (chmod +x some scripts): remove config/gcc-hack
7093 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7095 * src/buffer.C (writeFile): change once again the top comment in a
7096 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7097 instead of an hardcoded version number.
7098 (makeDocBookFile): ditto
7100 * src/version.h: add new define LYX_DOCVERSION
7102 * po/de.po: update from Pit Sütterlin
7103 * lib/bind/de_menus.bind: ditto.
7105 * src/lyxfunc.C (Dispatch): call MenuExport()
7106 * src/buffer.C (Dispatch): ditto
7108 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7109 LyXFunc::Dispatch().
7110 (MenuExport): new function, moved from
7111 LyXFunc::Dispatch().
7113 * src/trans_mgr.C (insert): small cleanup
7114 * src/chset.C (loadFile): ditto
7116 * lib/kbd/iso8859-1.cdef: add missing backslashes
7118 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7120 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7121 help with placing the manually drawn accents better.
7123 (Draw): x2 and hg changed to float to minimize rounding errors and
7124 help place the accents better.
7126 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7127 unsigned short to char is just wrong...cast the char to unsigned
7128 char instead so that the two values can compare sanely. This
7129 should also make the display of insetlatexaccents better and
7130 perhaps also some other insets.
7132 (lbearing): new function
7135 1999-12-15 Allan Rae <rae@lyx.org>
7137 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7138 header that provides a wrapper around the very annoying SGI STL header
7141 * src/support/lyxstring.C, src/LString.h:
7142 removed old SGI-STL-compatability attempts.
7144 * configure.in: Use LYX_STL_STRING_FWD.
7146 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7147 stl_string_fwd.h is around and try to determine it's location.
7148 Major improvement over previous SGI STL 3.2 compatability.
7149 Three small problems remain with this function due to my zero
7150 knowledge of autoconf. JMarc and lgb see the comments in the code.
7152 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7154 * src/broken_const.h, config/hack-gcc, config/README: removed
7156 * configure.in: remove --with-gcc-hack option; do not call
7159 * INSTALL: remove documentation of --with-broken-const and
7162 * acconfig.h: remove all trace of BROKEN_CONST define
7164 * src/buffer.C (makeDocBookFile): update version number in output
7166 (SimpleDocBookOnePar): fix an assert when trying to a character
7167 access beyond string length
7170 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7172 * po/de.po: fix the Export menu
7174 * lyx.man: update the description of -dbg
7176 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7177 (commandLineHelp): updated
7178 (easyParse): show list of available debug levels if -dbg is passed
7181 * src/Makefile.am: add debug.C
7183 * src/debug.h: moved some code to debug.C
7185 * src/debug.C: new file. Contains code to set and show debug
7188 * src/layout.C: remove 'break' after 'continue' in switch
7189 statements, since these cannot be reached.
7191 1999-12-13 Allan Rae <rae@lyx.org>
7193 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7194 (in_word_set): hash() -> math_hash()
7196 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7198 * acconfig.h: Added a test for whether we are using exceptions in the
7199 current compilation run. If so USING_EXCEPTIONS is defined.
7201 * config.in: Check for existance of stl_string_fwd.h
7202 * src/LString.h: If compiling --with-included-string and SGI's
7203 STL version 3.2 is present (see above test) we need to block their
7204 forward declaration of string and supply a __get_c_string().
7205 However, it turns out this is only necessary if compiling with
7206 exceptions enabled so I've a bit more to add yet.
7208 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7209 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7210 src/support/LRegex.h, src/undo.h:
7211 Shuffle the order of the included files a little to ensure that
7212 LString.h gets included before anything that includes stl_string_fwd.h
7214 * src/support/lyxstring.C: We need to #include LString.h instead of
7215 lyxstring.h to get the necessary definition of __get_c_string.
7216 (__get_c_string): New function. This is defined static just like SGI's
7217 although why they need to do this I'm not sure. Perhaps it should be
7218 in lstrings.C instead.
7220 * lib/templates/IEEEtran.lyx: New template file.
7222 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7224 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7225 * intl/Makefile.in (MKINSTALLDIRS): ditto
7227 * src/LyXAction.C (init): changed to hold the LFUN data in a
7228 automatic array in stead of in callso to newFunc, this speeds up
7229 compilation a lot. Also all the memory used by the array is
7230 returned when the init is completed.
7232 * a lot of files: compiled with -Wold-style-cast, changed most of
7233 the reported offenders to C++ style casts. Did not change the
7234 offenders in C files.
7236 * src/trans.h (Match): change argument type to unsigned int.
7238 * src/support/DebugStream.C: fix some types on the streambufs so
7239 that it works on a conforming implementation.
7241 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7243 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7245 * src/support/lyxstring.C: remove the inline added earlier since
7246 they cause a bunch of unsatisfied symbols when linking with dec
7247 cxx. Cxx likes to have the body of inlines at the place where they
7250 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7251 accessing negative bounds in array. This fixes the crash when
7252 inserting accented characters.
7253 * src/trans.h (Match): ditto
7255 * src/buffer.C (Dispatch): since this is a void, it should not try
7256 to return anything...
7258 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7260 * src/buffer.h: removed the two friends from Buffer. Some changes
7261 because of this. Buffer::getFileName and Buffer::setFileName
7262 renamed to Buffer::fileName() and Buffer::fileName(...).
7264 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7266 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7267 and Buffer::update(short) to BufferView. This move is currently
7268 controlled by a define MOVE_TEXT, this will be removed when all
7269 shows to be ok. This move paves the way for better separation
7270 between buffer contents and buffer view. One side effect is that
7271 the BufferView needs a rebreak when swiching buffers, if we want
7272 to avoid this we can add a cache that holds pointers to LyXText's
7273 that is not currently in use.
7275 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7278 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7280 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7282 * lyx_main.C: new command line option -x (or --execute) and
7283 -e (or --export). Now direct conversion from .lyx to .tex
7284 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7285 Unfortunately, X is still needed and the GUI pops up during the
7288 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7290 * src/Spacing.C: add a using directive to bring stream stuff into
7292 * src/paragraph.C: ditto
7293 * src/buffer.C: ditto
7295 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7296 from Lars' announcement).
7298 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7299 example files from Tino Meinen.
7301 1999-12-06 Allan Rae <rae@lyx.org>
7303 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7305 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7307 * src/support/lyxstring.C: added a lot of inline for no good
7310 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7311 latexWriteEndChanges, they were not used.
7313 * src/layout.h (operator<<): output operator for PageSides
7315 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7317 * some example files: loaded in LyX 1.0.4 and saved again to update
7318 certain constructs (table format)
7320 * a lot of files: did the change to use fstream/iostream for all
7321 writing of files. Done with a close look at Andre Poenitz's patch.
7323 * some files: whitespace changes.
7325 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7327 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7328 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7329 architecture, we provide our own. It is used unconditionnally, but
7330 I do not think this is a performance problem. Thanks to Angus
7331 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7332 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7334 (GetInset): use my_memcpy.
7338 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7339 it is easier to understand, but it uses less TeX-only constructs now.
7341 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7342 elements contain spaces
7344 * lib/configure: regenerated
7346 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7347 elements contain spaces; display the list of programs that are
7350 * autogen.sh: make sure lib/configure is executable
7352 * lib/examples/*: rename the tutorial examples to begin with the
7353 two-letters language code.
7355 * src/lyxfunc.C (getStatus): do not query current font if no
7358 * src/lyx_cb.C (RunScript): use QuoteName
7359 (MenuRunDvips): ditto
7360 (PrintApplyCB): ditto
7362 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7363 around argument, so that it works well with the current shell.
7364 Does not work properly with OS/2 shells currently.
7366 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7367 * src/LyXSendto.C (SendtoApplyCB): ditto
7368 * src/lyxfunc.C (Dispatch): ditto
7369 * src/buffer.C (runLaTeX): ditto
7370 (runLiterate): ditto
7371 (buildProgram): ditto
7373 * src/lyx_cb.C (RunScript): ditto
7374 (MenuMakeLaTeX): ditto
7376 * src/buffer.h (getLatexName): new method
7378 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7380 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7382 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7383 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7384 (create_math_panel): ditto
7386 * src/lyxfunc.C (getStatus): re-activate the code which gets
7387 current font and cursor; add test for export to html.
7389 * src/lyxrc.C (read): remove unreachable break statements; add a
7392 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7394 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7396 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7397 introduced by faulty regex.
7398 * src/buffer.C: ditto
7399 * src/lastfiles.C: ditto
7400 * src/paragraph.C: ditto
7401 * src/table.C: ditto
7402 * src/vspace.C: ditto
7403 * src/insets/figinset.C: ditto
7404 Note: most of these is absolutely harmless, except the one in
7405 src/mathed formula.C.
7407 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7409 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7410 operation, yielding correct results for the reLyX command.
7412 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7414 * src/support/filetools.C (ExpandPath): removed an over eager
7416 (ReplaceEnvironmentPath): ditto
7418 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7419 shows that we are doing something fishy in our code...
7423 * src/lyxrc.C (read): use a double switch trick to get more help
7424 from the compiler. (the same trick is used in layout.C)
7425 (write): new function. opens a ofstream and pass that to output
7426 (output): new function, takes a ostream and writes the lyxrc
7427 elemts to it. uses a dummy switch to make sure no elements are
7430 * src/lyxlex.h: added a struct pushpophelper for use in functions
7431 with more than one exit point.
7433 * src/lyxlex.[Ch] (GetInteger): made it const
7437 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7439 * src/layout.[hC] : LayoutTags splitted into several enums, new
7440 methods created, better error handling cleaner use of lyxlex. Read
7443 * src/bmtable.[Ch]: change some member prototypes because of the
7444 image const changes.
7446 * commandtags.h, src/LyXAction.C (init): new function:
7447 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7448 This file is not read automatically but you can add \input
7449 preferences to your lyxrc if you want to. We need to discuss how
7452 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7453 in .aux, also remove .bib and .bst files from dependencies when
7456 * src/BufferView.C, src/LyXView.C: add const_cast several places
7457 because of changes to images.
7459 * lib/images/*: same change as for images/*
7461 * lib/lyxrc.example: Default for accept_compound is false not no.
7463 * images/*: changed to be const, however I have som misgivings
7464 about this change so it might be changed back.
7466 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7468 * lib/configure, po/POTFILES.in: regenerated
7470 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7472 * config/lib_configure.m4: removed
7474 * lib/configure.m4: new file (was config/lib_configure.m4)
7476 * configure.in: do not test for rtti, since we do not use it.
7478 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7480 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7481 doubling of allocated space scheme. This makes it faster for large
7482 strings end to use less memory for small strings. xtra rememoved.
7484 * src/insets/figinset.C (waitalarm): commented out.
7485 (GhostscriptMsg): use static_cast
7486 (GhostscriptMsg): use new instead of malloc to allocate memory for
7487 cmap. also delete the memory after use.
7489 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7491 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7492 for changes in bibtex database or style.
7493 (runBibTeX): remove all .bib and .bst files from dep before we
7495 (run): use scanAuc in when dep file already exist.
7497 * src/DepTable.C (remove_files_with_extension): new method
7500 * src/DepTable.[Ch]: made many of the methods const.
7502 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7504 * src/bufferparams.C: make sure that the default textclass is
7505 "article". It used to be the first one by description order, but
7506 now the first one is "docbook".
7508 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7509 string; call Debug::value.
7510 (easyParse): pass complete argument to setDebuggingLevel().
7512 * src/debug.h (value): fix the code that parses debug levels.
7514 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7517 * src/LyXAction.C: use Debug::ACTION as debug channel.
7519 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7521 * NEWS: updated for the future 1.1.3 release.
7523 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7524 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7525 it should. This is of course a controversial change (since many
7526 people will find that their lyx workscreen is suddenly full of
7527 red), but done for the sake of correctness.
7529 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7530 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7532 * src/insets/inseterror.h, src/insets/inseturl.h,
7533 src/insets/insetinfo.h, src/insets/figinset.h,
7534 src/mathed/formulamacro.h, src/mathed/math_macro.h
7535 (EditMessage): add a missing const and add _() to make sure that
7538 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7539 src/insets/insetbib.C, src/support/filetools.C: add `using'
7542 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7543 doing 'Insert index of last word' at the beginning of a paragraph.
7545 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7547 * several files: white-space changes.
7549 * src/mathed/formula.C: removed IsAlpha and IsDigit
7551 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7552 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7555 * src/insets/figinset.C (GetPSSizes): don't break when
7556 "EndComments" is seen. But break when a boundingbox is read.
7558 * all classes inherited from Inset: return value of Clone
7559 changed back to Inset *.
7561 * all classes inherited form MathInset: return value of Clone
7562 changed back to MathedInset *.
7564 * src/insets/figinset.C (runqueue): use a ofstream to output the
7565 gs/ps file. Might need some setpresicion or setw. However I can
7566 see no problem with the current code.
7567 (runqueue): use sleep instead of the alarm/signal code. I just
7568 can't see the difference.
7570 * src/paragraph.C (LyXParagraph): reserve space in the new
7571 paragraph and resize the inserted paragraph to just fit.
7573 * src/lyxfunc.h (operator|=): added operator for func_status.
7575 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7576 check for readable file.
7578 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7579 check for readable file.
7580 (MenuMakeLinuxDoc): ditto
7581 (MenuMakeDocBook): ditto
7582 (MenuMakeAscii): ditto
7583 (InsertAsciiFile): split the test for openable and readable
7585 * src/bmtable.C (draw_bitmaptable): use
7586 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7588 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7589 findtexfile from LaTeX to filetools.
7591 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7592 instead of FilePtr. Needs to be verified by a literate user.
7594 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7596 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7597 (EditMessage): likewise.
7599 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7600 respectively as \textasciitilde and \textasciicircum.
7602 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7604 * src/support/lyxstring.h: made the methods that take iterators
7607 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7608 (regexMatch): made is use the real regex class.
7610 * src/support/Makefile.am: changed to use libtool
7612 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7614 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7616 (MathIsInset ++): changed several macros to be inline functions
7619 * src/mathed/Makefile.am: changed to use libtool
7621 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7623 * src/insets/inset* : Clone changed to const and return type is
7624 the true insettype not just Inset*.
7626 * src/insets/Makefile.am: changed to use libtool
7628 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7630 * src/undo.[Ch] : added empty() and changed some of the method
7633 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7635 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7636 setID use block<> for the bullets array, added const several places.
7638 * src/lyxfunc.C (getStatus): new function
7640 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7641 LyXAction, added const to several funtions.
7643 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7644 a std::map, and to store the dir items in a vector.
7646 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7649 * src/LyXView.[Ch] + other files : changed currentView to view.
7651 * src/LyXAction.[Ch] : ported from the old devel branch.
7653 * src/.cvsignore: added .libs and a.out
7655 * configure.in : changes to use libtool.
7657 * acinclude.m4 : inserted libtool.m4
7659 * .cvsignore: added libtool
7661 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7663 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7664 file name in insets and mathed directories (otherwise the
7665 dependency is not taken in account under cygwin).
7667 * src/text2.C (InsertString[AB]): make sure that we do not try to
7668 read characters past the string length.
7670 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7672 * lib/doc/LaTeXConfig.lyx.in,
7673 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7675 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7676 file saying who created them and when this heppened; this is
7677 useless and annoys tools like cvs.
7679 * lib/layouts/g-brief-{en,de}.layout,
7680 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7681 from Thomas Hartkens <thomas@hartkens.de>.
7683 * src/{insets,mathed}/Makefile.am: do not declare an empty
7684 LDFLAGS, so that it can be set at configure time (useful on Irix
7687 * lib/reLyX/configure.in: make sure that the prefix is set
7688 correctly in LYX_DIR.
7690 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7692 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7693 be used by 'command-sequence' this allows to bind a key to a
7694 sequence of LyX-commands
7695 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7697 * src/LyXAction.C: add "command-sequence"
7699 * src/LyXFunction.C: handling of "command-sequence"
7701 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7702 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7704 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7706 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7708 * src/buffer.C (writeFile): Do not output a comment giving user
7709 and date at the beginning of a .lyx file. This is useless and
7710 annoys cvs anyway; update version number to 1.1.
7712 * src/Makefile.am (LYX_DIR): add this definition, so that a
7713 default path is hardcoded in LyX.
7715 * configure.in: Use LYX_GNU_GETTEXT.
7717 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7718 AM_GNU_GETTEXT with a bug fixed.
7720 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7722 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7724 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7725 which is used to point to LyX data is now LYX_DIR_11x.
7727 * lyx.man: convert to a unix text file; small updates.
7729 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7731 * src/support/LSubstring.[Ch]: made the second arg of most of the
7732 constructors be a const reference.
7734 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7737 * src/support/lyxstring.[Ch] (swap): added missing member function
7738 and specialization of swap(str, str);
7740 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7742 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7743 trace of the old one.
7745 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7746 put the member definitions in undo.C.
7748 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7749 NEW_TEXT and have now only code that was included when this was
7752 * src/intl.C (LCombo): use static_cast
7754 (DispatchCallback): ditto
7756 * src/definitions.h: removed whole file
7758 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7760 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7761 parsing and stores in a std:map. a regex defines the file format.
7762 removed unneeded members.
7764 * src/bufferparams.h: added several enums from definitions.h here.
7765 Removed unsused destructor. Changed some types to use proper enum
7766 types. use block to have the temp_bullets and user_defined_bullets
7767 and to make the whole class assignable.
7769 * src/bufferparams.C (Copy): removed this functions, use a default
7772 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7775 * src/buffer.C (readLyXformat2): commend out all that have with
7776 oldpapersize to do. also comment out all that hve to do with
7777 insetlatex and insetlatexdel.
7778 (setOldPaperStuff): commented out
7780 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7782 * src/LyXAction.C: remove use of inset-latex-insert
7784 * src/mathed/math_panel.C (button_cb): use static_cast
7786 * src/insets/Makefile.am (insets_o_SOURCES): removed
7789 * src/support/lyxstring.C (helper): use the unsigned long
7790 specifier, UL, instead of a static_cast.
7792 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7794 * src/support/block.h: new file. to be used as a c-style array in
7795 classes, so that the class can be assignable.
7797 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7799 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7800 NULL, make sure to return an empty string (it is not possible to
7801 set a string to NULL).
7803 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7805 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7807 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7809 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7810 link line, so that Irix users (for example) can set it explicitely to
7813 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7814 it can be overidden at make time (static or dynamic link, for
7817 * src/vc-backend.C, src/LaTeXFeatures.h,
7818 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7819 statements to bring templates to global namespace.
7821 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7823 * src/support/lyxstring.C (operator[] const): make it standard
7826 * src/minibuffer.C (Init): changed to reflect that more
7827 information is given from the lyxvc and need not be provided here.
7829 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7831 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7833 * src/LyXView.C (UpdateTimerCB): use static_cast
7834 (KeyPressMask_raw_callback): ditto
7836 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7837 buffer_, a lot of changes because of this. currentBuffer() ->
7838 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7839 also changes to other files because of this.
7841 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7843 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7844 have no support for RCS and partial support for CVS, will be
7847 * src/insets/ several files: changes because of function name
7848 changes in Bufferview and LyXView.
7850 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7852 * src/support/LSubstring.[Ch]: new files. These implement a
7853 Substring that can be very convenient to use. i.e. is this
7855 string a = "Mary had a little sheep";
7856 Substring(a, "sheep") = "lamb";
7857 a is now "Mary has a little lamb".
7859 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7860 out patterns and subpatterns of strings. It is used by LSubstring
7861 and also by vc-backend.C
7863 * src/support/lyxstring.C: went over all the assertions used and
7864 tried to correct the wrong ones and flag which of them is required
7865 by the standard. some bugs found because of this. Also removed a
7866 couple of assertions.
7868 * src/support/Makefile.am (libsupport_a_SOURCES): added
7869 LSubstring.[Ch] and LRegex.[Ch]
7871 * src/support/FileInfo.h: have struct stat buf as an object and
7872 not a pointer to one, some changes because of this.
7874 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7875 information in layout when adding the layouts preamble to the
7878 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7881 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7882 because of bug in OS/2.
7884 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7886 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7887 \verbatim@font instead of \ttfamily, so that it can be redefined.
7889 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7890 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7891 src/layout.h, src/text2.C: add 'using' directive to bring the
7892 STL templates we need from the std:: namespace to the global one.
7893 Needed by DEC cxx in strict ansi mode.
7895 * src/support/LIstream.h,src/support/LOstream.h,
7896 src/support/lyxstring.h,src/table.h,
7897 src/lyxlookup.h: do not include <config.h> in header
7898 files. This should be done in the .C files only.
7900 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7904 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7906 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7907 from Kayvan to fix the tth invokation.
7909 * development/lyx.spec.in: updates from Kayvan to reflect the
7910 changes of file names.
7912 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7914 * src/text2.C (InsertStringB): use std::copy
7915 (InsertStringA): use std::copy
7917 * src/bufferlist.C: use a vector to store the buffers in. This is
7918 an internal change and should not affect any other thing.
7920 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7923 * src/text.C (Fill): fix potential bug, one off bug.
7925 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7927 * src/Makefile.am (lyx_main.o): add more files it depends on.
7929 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7931 * src/support/lyxstring.C: use size_t for the reference count,
7932 size, reserved memory and xtra.
7933 (internal_compare): new private member function. Now the compare
7934 functions should work for std::strings that have embedded '\0'
7936 (compare): all compare functions rewritten to use
7939 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7941 * src/support/lyxstring.C (compare): pass c_str()
7942 (compare): pass c_str
7943 (compare): pass c_str
7945 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7947 * src/support/DebugStream.C: <config.h> was not included correctly.
7949 * lib/configure: forgot to re-generate it :( I'll make this file
7950 auto generated soon.
7952 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7954 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7957 * src/support/lyxstring.C: some changes from length() to rep->sz.
7958 avoids a function call.
7960 * src/support/filetools.C (SpaceLess): yet another version of the
7961 algorithm...now per Jean-Marc's suggestions.
7963 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7965 * src/layout.C (less_textclass_desc): functor for use in sorting
7967 (LyXTextClass::Read): sort the textclasses after reading.
7969 * src/support/filetools.C (SpaceLess): new version of the
7970 SpaceLess functions. What problems does this one give? Please
7973 * images/banner_bw.xbm: made the arrays unsigned char *
7975 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7977 * src/support/lyxstring.C (find): remove bogus assertion in the
7978 two versions of find where this has not been done yet.
7980 * src/support/lyxlib.h: add missing int return type to
7983 * src/menus.C (ShowFileMenu): disable exporting to html if no
7984 html export command is present.
7986 * config/lib_configure.m4: add a test for an HTML converter. The
7987 programs checked for are, in this order: tth, latex2html and
7990 * lib/configure: generated from config/lib_configure.m4.
7992 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7993 html converter. The parameters are now passed through $$FName and
7994 $$OutName, instead of standard input/output.
7996 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7998 * lib/lyxrc.example: update description of \html_command.
7999 add "quotes" around \screen_font_xxx font setting examples to help
8000 people who use fonts with spaces in their names.
8002 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8004 * Distribution files: updates for v1.1.2
8006 * src/support/lyxstring.C (find): remove bogus assert and return
8007 npos for the same condition.
8009 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8011 * added patch for OS/2 from SMiyata.
8013 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8015 * src/text2.C (CutSelection): make space_wrapped a bool
8016 (CutSelection): dont declare int i until we have to.
8017 (alphaCounter): return a char const *.
8019 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8021 * src/support/syscall.C (Systemcalls::kill):
8022 src/support/filetools.C (PutEnv, PutEnvPath):
8023 src/lyx_cb.C (addNewlineAndDepth):
8024 src/FontInfo.C (FontInfo::resize): condition some #warning
8025 directives with WITH_WARNINGS.
8028 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8030 * src/layout.[Ch] + several files: access to class variables
8031 limited and made accessor functions instead a lot of code changed
8032 becuase of this. Also instead of returning pointers often a const
8033 reference is returned instead.
8035 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8037 * src/Makefile.am (dist-hook): added used to remove the CVS from
8038 cheaders upon creating a dist
8039 (EXTRA_DIST): added cheaders
8041 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8042 a character not as a small integer.
8044 * src/support/lyxstring.C (find): removed Assert and added i >=
8045 rep->sz to the first if.
8047 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8049 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8050 src/LyXView.C src/buffer.C src/bufferparams.C
8051 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8052 src/text2.C src/insets/insetinclude.C:
8053 lyxlayout renamed to textclasslist.
8055 * src/layout.C: some lyxerr changes.
8057 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8058 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8059 (LyXLayoutList): removed all traces of this class.
8060 (LyXTextClass::Read): rewrote LT_STYLE
8061 (LyXTextClass::hasLayout): new function
8062 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8063 both const and nonconst version.
8064 (LyXTextClass::delete_layout): new function.
8065 (LyXTextClassList::Style): bug fix. do the right thing if layout
8067 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8068 (LyXTextClassList::NameOfLayout): ditto
8069 (LyXTextClassList::Load): ditto
8071 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8073 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8075 * src/LyXAction.C (LookupFunc): added a workaround for sun
8076 compiler, on the other hand...we don't know if the current code
8077 compiles on sun at all...
8079 * src/support/filetools.C (CleanupPath): subst fix
8081 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8084 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8085 complained about this one?
8087 * src/insets/insetinclude.C (Latex): subst fix
8089 * src/insets/insetbib.C (getKeys): subst fix
8091 * src/LyXSendto.C (SendtoApplyCB): subst fix
8093 * src/lyx_main.C (init): subst fix
8095 * src/layout.C (Read): subst fix
8097 * src/lyx_sendfax_main.C (button_send): subst fix
8099 * src/buffer.C (RoffAsciiTable): subst fix
8101 * src/lyx_cb.C (MenuFax): subst fix
8102 (PrintApplyCB): subst fix
8104 1999-10-26 Juergen Vigna <jug@sad.it>
8106 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8108 (Read): Cleaned up this code so now we read only format vestion >= 5
8110 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8112 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8113 come nobody has complained about this one?
8115 * src/insets/insetinclude.C (Latex): subst fix
8117 * src/insets/insetbib.C (getKeys): subst fix
8119 * src/lyx_main.C (init): subst fix
8121 * src/layout.C (Read): subst fix
8123 * src/buffer.C (RoffAsciiTable): subst fix
8125 * src/lyx_cb.C (MenuFax): subst fix.
8127 * src/layout.[hC] + some other files: rewrote to use
8128 std::container to store textclasses and layouts in.
8129 Simplified, removed a lot of code. Make all classes
8130 assignable. Further simplifications and review of type
8131 use still to be one.
8133 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8134 lastfiles to create the lastfiles partr of the menu.
8136 * src/lastfiles.[Ch]: rewritten to use deque to store the
8137 lastfiles in. Uses fstream for reading and writing. Simplifies
8140 * src/support/syscall.C: remove explicit cast.
8142 * src/BufferView.C (CursorToggleCB): removed code snippets that
8144 use explicat C++ style casts instead of C style casts. also use
8145 u_vdata instea of passing pointers in longs.
8147 * src/PaperLayout.C: removed code snippets that were commented out.
8149 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8151 * src/lyx_main.C: removed code snippets that wer commented out.
8153 * src/paragraph.C: removed code snippets that were commented out.
8155 * src/lyxvc.C (logClose): use static_cast
8157 (viewLog): remove explicit cast to void*
8158 (showLog): removed old commented code
8160 * src/menus.C: use static_cast instead of C style casts. use
8161 u_vdata instead of u_ldata. remove explicit cast to (long) for
8162 pointers. Removed old code that was commented out.
8164 * src/insets/inset.C: removed old commented func
8166 * src/insets/insetref.C (InsetRef): removed old code that had been
8167 commented out for a long time.
8169 (escape): removed C style cast
8171 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8173 * src/insets/insetlatex.C (Draw): removed old commented code
8174 (Read): rewritten to use string
8176 * src/insets/insetlabel.C (escape): removed C style cast
8178 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8180 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8183 * src/insets/insetinclude.h: removed a couple of stupid bools
8185 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8186 (Clone): remove C style cast
8187 (getKeys): changed list to lst because of std::list
8189 * src/insets/inseterror.C (Draw): removed som old commented code.
8191 * src/insets/insetcommand.C (Draw): removed some old commented code.
8193 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8194 commented out forever.
8195 (bibitem_cb): use static_cast instead of C style cast
8196 use of vdata changed to u_vdata.
8198 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8200 (CloseUrlCB): use static_cast instead of C style cast.
8201 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8203 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8204 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8205 (CloseInfoCB): static_cast from ob->u_vdata instead.
8206 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8209 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8210 (C_InsetError_CloseErrorCB): forward the ob parameter
8211 (CloseErrorCB): static_cast from ob->u_vdata instead.
8213 * src/vspace.h: include LString.h since we use string in this class.
8215 * src/vspace.C (lyx_advance): changed name from advance because of
8216 nameclash with stl. And since we cannot use namespaces yet...I
8217 used a lyx_ prefix instead. Expect this to change when we begin
8220 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8222 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8223 and removed now defunct constructor and deconstructor.
8225 * src/BufferView.h: have backstack as a object not as a pointer.
8226 removed initialization from constructor. added include for BackStack
8228 * development/lyx.spec.in (%build): add CFLAGS also.
8230 * src/screen.C (drawFrame): removed another warning.
8232 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8234 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8235 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8236 README and ANNOUNCE a bit for the next release. More work is
8239 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8240 unbreakable if we are in freespacing mode (LyX-Code), but not in
8243 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8245 * src/BackStack.h: fixed initialization order in constructor
8247 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8249 * acinclude.m4 (VERSION): new rules for when a version is
8250 development, added also a variable for prerelease.
8251 (warnings): we set with_warnings=yes for prereleases
8252 (lyx_opt): prereleases compile with same optimization as development
8253 (CXXFLAGS): only use pedantic if we are a development version
8255 * src/BufferView.C (restorePosition): don't do anything if the
8258 * src/BackStack.h: added member empty, use this to test if there
8259 is anything to pop...
8261 1999-10-25 Juergen Vigna <jug@sad.it>
8264 * forms/layout_forms.fd +
8265 * forms/latexoptions.fd +
8266 * lyx.fd: changed for various form resize issues
8268 * src/mathed/math_panel.C +
8269 * src/insets/inseterror.C +
8270 * src/insets/insetinfo.C +
8271 * src/insets/inseturl.C +
8272 * src/insets/inseturl.h +
8275 * src/PaperLayout.C +
8276 * src/ParagraphExtra.C +
8277 * src/TableLayout.C +
8279 * src/layout_forms.C +
8286 * src/menus.C: fixed various resize issues. So now forms can be
8287 resized savely or not be resized at all.
8289 * forms/form_url.fd +
8290 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8293 * src/insets/Makefile.am: added files form_url.[Ch]
8295 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8297 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8298 (and presumably 6.2).
8300 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8301 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8302 remaining static member callbacks.
8304 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8307 * src/support/lyxstring.h: declare struct Srep as friend of
8308 lyxstring, since DEC cxx complains otherwise.
8310 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8312 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8314 * src/LaTeX.C (run): made run_bibtex also depend on files with
8316 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8317 are put into the dependency file.
8319 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8320 the code has shown itself to work
8321 (create_ispell_pipe): removed another warning, added a comment
8324 * src/minibuffer.C (ExecutingCB): removed code that has been
8325 commented out a long time
8327 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8328 out code + a warning.
8330 * src/support/lyxstring.h: comment out the three private
8331 operators, when compiling with string ansi conforming compilers
8334 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8336 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8337 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8340 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8343 * src/mathed/math_panel.C (create_math_panel): remove explicit
8346 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8349 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8350 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8351 to XCreatePixmapFromBitmapData
8352 (fl_set_bmtable_data): change the last argument to be unsigned
8354 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8355 and bh to be unsigned int, remove explicit casts in call to
8356 XReadBitmapFileData.
8358 * images/arrows.xbm: made the arrays unsigned char *
8359 * images/varsz.xbm: ditto
8360 * images/misc.xbm: ditto
8361 * images/greek.xbm: ditto
8362 * images/dots.xbm: ditto
8363 * images/brel.xbm: ditto
8364 * images/bop.xbm: ditto
8366 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8368 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8369 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8370 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8372 (LYX_CXX_CHEADERS): added <clocale> to the test.
8374 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8376 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8378 * src/support/lyxstring.C (append): fixed something that must be a
8379 bug, rep->assign was used instead of rep->append.
8381 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8384 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8385 lyx insert double chars. Fix spotted by Kayvan.
8387 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8389 * Fixed the tth support. I messed up with the Emacs patch apply feature
8390 and omitted the changes in lyxrc.C.
8392 1999-10-22 Juergen Vigna <jug@sad.it>
8394 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8396 * src/lyx_cb.C (MenuInsertRef) +
8397 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8398 the form cannot be resized under it limits (fixes a segfault)
8400 * src/lyx.C (create_form_form_ref) +
8401 * forms/lyx.fd: Changed Gravity on name input field so that it is
8404 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8406 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8407 <ostream> and <istream>.
8409 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8410 whether <fstream> provides the latest standard features, or if we
8411 have an oldstyle library (like in egcs).
8412 (LYX_CXX_STL_STRING): fix the test.
8414 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8415 code on MODERN_STL_STREAM.
8417 * src/support/lyxstring.h: use L{I,O}stream.h.
8419 * src/support/L{I,O}stream.h: new files, designed to setup
8420 correctly streams for our use
8421 - includes the right header depending on STL capabilities
8422 - puts std::ostream and std::endl (for LOStream.h) or
8423 std::istream (LIStream.h) in toplevel namespace.
8425 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8427 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8428 was a bib file that had been changed we ensure that bibtex is run.
8429 (runBibTeX): enhanced to extract the names of the bib files and
8430 getting their absolute path and enter them into the dep file.
8431 (findtexfile): static func that is used to look for tex-files,
8432 checks for absolute patchs and tries also with kpsewhich.
8433 Alternative ways of finding the correct files are wanted. Will
8435 (do_popen): function that runs a command using popen and returns
8436 the whole output of that command in a string. Should be moved to
8439 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8440 file with extension ext has changed.
8442 * src/insets/figinset.C: added ifdef guards around the fl_free
8443 code that jug commented out. Now it is commented out when
8444 compiling with XForms == 0.89.
8446 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8447 to lyxstring.C, and only keep a forward declaration in
8448 lyxstring.h. Simplifies the header file a bit and should help a
8449 bit on compile time too. Also changes to Srep will not mandate a
8450 recompile of code just using string.
8451 (~lyxstring): definition moved here since it uses srep.
8452 (size): definition moved here since it uses srep.
8454 * src/support/lyxstring.h: removed a couple of "inline" that should
8457 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8459 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8462 1999-10-21 Juergen Vigna <jug@sad.it>
8464 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8465 set to left if I just remove the width entry (or it is empty).
8467 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8468 paragraph when having dummy paragraphs.
8470 1999-10-20 Juergen Vigna <jug@sad.it>
8472 * src/insets/figinset.C: just commented some fl_free_form calls
8473 and added warnings so that this calls should be activated later
8474 again. This avoids for now a segfault, but we have a memory leak!
8476 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8477 'const char * argument' to 'string argument', this should
8478 fix some Asserts() in lyxstring.C.
8480 * src/lyxfunc.h: Removed the function argAsString(const char *)
8481 as it is not used anymore.
8483 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8485 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8488 * src/Literate.h: some funcs moved from public to private to make
8489 interface clearer. Unneeded args removed.
8491 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8493 (scanBuildLogFile): ditto
8495 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8496 normal TeX Error. Still room for improvement.
8498 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8500 * src/buffer.C (insertErrors): changes to make the error
8501 desctription show properly.
8503 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8506 * src/support/lyxstring.C (helper): changed to use
8507 sizeof(object->rep->ref).
8508 (operator>>): changed to use a pointer instead.
8510 * src/support/lyxstring.h: changed const reference & to value_type
8511 const & lets see if that helps.
8513 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8515 * Makefile.am (rpmdist): fixed to have non static package and
8518 * src/support/lyxstring.C: removed the compilation guards
8520 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8523 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8524 conditional compile of lyxstring.Ch
8526 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8527 stupid check, but it is a lot better than the bastring hack.
8528 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8530 * several files: changed string::erase into string::clear. Not
8533 * src/chset.C (encodeString): use a char temporary instead
8535 * src/table.C (TexEndOfCell): added tostr around
8536 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8537 (TexEndOfCell): ditto
8538 (TexEndOfCell): ditto
8539 (TexEndOfCell): ditto
8540 (DocBookEndOfCell): ditto
8541 (DocBookEndOfCell): ditto
8542 (DocBookEndOfCell): ditto
8543 (DocBookEndOfCell): ditto
8545 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8547 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8549 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8550 (MenuBuildProg): added tostr around ret
8551 (MenuRunChktex): added tostr around ret
8552 (DocumentApplyCB): added tostr around ret
8554 * src/chset.C (encodeString): added tostr around t->ic
8556 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8557 (makeLaTeXFile): added tostr around tocdepth
8558 (makeLaTeXFile): added tostr around ftcound - 1
8560 * src/insets/insetbib.C (setCounter): added tostr around counter.
8562 * src/support/lyxstring.h: added an operator+=(int) to catch more
8565 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8566 (lyxstring): We DON'T allow NULL pointers.
8568 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8570 * src/mathed/math_macro.C (MathMacroArgument::Write,
8571 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8572 when writing them out.
8574 * src/LString.C: remove, since it is not used anymore.
8576 * src/support/lyxstring.C: condition the content to
8577 USE_INCLUDED_STRING macro.
8579 * src/mathed/math_symbols.C, src/support/lstrings.C,
8580 src/support/lyxstring.C: add `using' directive to specify what
8581 we need in <algorithm>. I do not think that we need to
8582 conditionalize this, but any thought is appreciated.
8584 * many files: change all callback functions to "C" linkage
8585 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8586 strict_ansi. Those who were static are now global.
8587 The case of callbacks which are static class members is
8588 trickier, since we have to make C wrappers around them (see
8589 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8590 did not finish this yet, since it defeats the purpose of
8591 encapsulation, and I am not sure what the best route is.
8593 1999-10-19 Juergen Vigna <jug@sad.it>
8595 * src/support/lyxstring.C (lyxstring): we permit to have a null
8596 pointer as assignment value and just don't assign it.
8598 * src/vspace.C (nextToken): corrected this function substituting
8599 find_first(_not)_of with find_last_of.
8601 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8602 (TableOptCloseCB) (TableSpeCloseCB):
8603 inserted fl_set_focus call for problem with fl_hide_form() in
8606 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8608 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8611 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8613 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8614 LyXLex::next() and not eatline() to get its argument.
8616 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8618 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8619 instead, use fstreams for io of the depfile, removed unneeded
8620 functions and variables.
8622 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8623 vector instead, removed all functions and variables that is not in
8626 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8628 * src/buffer.C (insertErrors): use new interface to TeXError
8630 * Makefile.am (rpmdist): added a rpmdist target
8632 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8633 per Kayvan's instructions.
8635 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8637 * src/Makefile.am: add a definition for localedir, so that locales
8638 are found after installation (Kayvan)
8640 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8642 * development/.cvsignore: new file.
8644 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8646 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8647 C++ compiler provides wrappers for C headers and use our alternate
8650 * configure.in: use LYX_CXX_CHEADERS.
8652 * src/cheader/: new directory, populated with cname headers from
8653 libstdc++-2.8.1. They are a bit old, but probably good enough for
8654 what we want (support compilers who lack them).
8656 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8657 from includes. It turns out is was stupid.
8659 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8661 * lib/Makefile.am (install-data-local): forgot a ';'
8662 (install-data-local): forgot a '\'
8663 (libinstalldirs): needed after all. reintroduced.
8665 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8667 * configure.in (AC_OUTPUT): added lyx.spec
8669 * development/lyx.spec: removed file
8671 * development/lyx.spec.in: new file
8673 * po/*.po: merged with lyx.pot becuase of make distcheck
8675 * lib/Makefile.am (dist-hook): added dist-hook so that
8676 documentation files will be included when doing a make
8677 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8678 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8680 more: tried to make install do the right thing, exclude CVS dirs
8683 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8684 Path would fit in more nicely.
8686 * all files that used to use pathstack: uses now Path instead.
8687 This change was a lot easier than expected.
8689 * src/support/path.h: new file
8691 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8693 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8695 * src/support/lyxstring.C (getline): Default arg was given for
8698 * Configure.cmd: removed file
8700 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8702 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8703 streams classes and types, add the proper 'using' statements when
8704 MODERN_STL is defined.
8706 * src/debug.h: move the << operator definition after the inclusion
8709 * src/support/filetools.C: include "LAssert.h", which is needed
8712 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8715 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8716 include "debug.h" to define a proper ostream.
8718 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8720 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8721 method to the SystemCall class which can kill a process, but it's
8722 not fully implemented yet.
8724 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8726 * src/support/FileInfo.h: Better documentation
8728 * src/lyxfunc.C: Added support for buffer-export html
8730 * src/menus.C: Added Export->As HTML...
8732 * lib/bind/*.bind: Added short-cut for buffer-export html
8734 * src/lyxrc.*: Added support for new \tth_command
8736 * lib/lyxrc.example: Added stuff for new \tth_command
8738 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8740 * lib/Makefile.am (IMAGES): removed images/README
8741 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8742 installes in correct place. Check permisions is installed
8745 * src/LaTeX.C: some no-op changes moved declaration of some
8748 * src/LaTeX.h (LATEX_H): changed include guard name
8750 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8752 * lib/reLyX/Makefile.am: install noweb2lyx.
8754 * lib/Makefile.am: install configure.
8756 * lib/reLyX/configure.in: declare a config aux dir; set package
8757 name to lyx (not sure what the best solution is); generate noweb2lyx.
8759 * lib/layouts/egs.layout: fix the bibliography layout.
8761 1999-10-08 Jürgen Vigna <jug@sad.it>
8763 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8764 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8765 it returned without continuing to search the path.
8767 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8769 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8770 also fixes a bug. It is not allowed to do tricks with std::strings
8771 like: string a("hei"); &a[e]; this will not give what you
8772 think... Any reason for the complexity in this func?
8774 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8776 * Updated README and INSTALL a bit, mostly to check that my
8777 CVS rights are correctly set up.
8779 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8781 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8782 does not allow '\0' chars but lyxstring and std::string does.
8784 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8786 * autogen.sh (AUTOCONF): let the autogen script create the
8787 POTFILES.in file too. POTFILES.in should perhaps now not be
8788 included in the cvs module.
8790 * some more files changed to use C++ includes instead of C ones.
8792 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8794 (Reread): added tostr to nlink. buggy output otherwise.
8795 (Reread): added a string() around szMode when assigning to Buffer,
8796 without this I got a log of garbled info strings.
8798 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8801 * I have added several ostream & operator<<(ostream &, some_type)
8802 functions. This has been done to avoid casting and warnings when
8803 outputting enums to lyxerr. This as thus eliminated a lot of
8804 explicit casts and has made the code clearer. Among the enums
8805 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8806 mathed enums, some font enum the Debug::type enum.
8808 * src/support/lyxstring.h (clear): missing method. equivalent of
8811 * all files that contained "stderr": rewrote constructs that used
8812 stderr to use lyxerr instead. (except bmtable)
8814 * src/support/DebugStream.h (level): and the passed t with
8815 Debug::ANY to avoid spurious bits set.
8817 * src/debug.h (Debug::type value): made it accept strings of the
8820 * configure.in (Check for programs): Added a check for kpsewhich,
8821 the latex generation will use this later to better the dicovery of
8824 * src/BufferView.C (create_view): we don't need to cast this to
8825 (void*) that is done automatically.
8826 (WorkAreaButtonPress): removed some dead code.
8828 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8830 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8831 is not overwritten when translated (David Sua'rez de Lis).
8833 * lib/CREDITS: Added David Sua'rez de Lis
8835 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8837 * src/bufferparams.C (BufferParams): default input encoding is now
8840 * acinclude.m4 (cross_compiling): comment out macro
8841 LYX_GXX_STRENGTH_REDUCE.
8843 * acconfig.h: make sure that const is not defined (to empty) when
8844 we are compiling C++. Remove commented out code using SIZEOF_xx
8847 * configure.in : move the test for const and inline as late as
8848 possible so that these C tests do not interefere with C++ ones.
8849 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8850 has not been proven.
8852 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8854 * src/table.C (getDocBookAlign): remove bad default value for
8857 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8859 (ShowFileMenu2): ditto.
8861 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8864 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8866 * Most files: finished the change from the old error code to use
8867 DebugStream for all lyxerr debugging. Only minor changes remain
8868 (e.g. the setting of debug levels using strings instead of number)
8870 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8872 * src/layout.C (Add): Changed to use compare_no_case instead of
8875 * src/FontInfo.C: changed loop variable type too string::size_type.
8877 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8879 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8880 set ETAGS_ARGS to --c++
8882 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8884 * src/table.C (DocBookEndOfCell): commented out two unused variables
8886 * src/paragraph.C: commented out four unused variables.
8888 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8889 insed a if clause with type string::size_type.
8891 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8894 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8896 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8897 variable, also changed loop to go from 0 to lenght + 1, instead of
8898 -1 to length. This should be correct.
8900 * src/LaTeX.C (scanError): use string::size_type as loop variable
8903 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8904 (l.896) since y_tmp and row was not used anyway.
8906 * src/insets/insetref.C (escape): use string::size_type as loop
8909 * src/insets/insetquotes.C (Width): use string::size_type as loop
8911 (Draw): use string::size_type as loop variable type.
8913 * src/insets/insetlatexaccent.C (checkContents): use
8914 string::size_type as loop variable type.
8916 * src/insets/insetlabel.C (escape): use string::size_type as loop
8919 * src/insets/insetinfo.C: added an extern for current_view.
8921 * src/insets/insetcommand.C (scanCommand): use string::size_type
8922 as loop variable type.
8924 * most files: removed the RCS tags. With them we had to recompile
8925 a lot of files after a simple cvs commit. Also we have never used
8926 them for anything meaningful.
8928 * most files: tags-query-replace NULL 0. As adviced several plases
8929 we now use "0" instead of "NULL" in our code.
8931 * src/support/filetools.C (SpaceLess): use string::size_type as
8934 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8936 * src/paragraph.C: fixed up some more string stuff.
8938 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8940 * src/support/filetools.h: make modestr a std::string.
8942 * src/filetools.C (GetEnv): made ch really const.
8944 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8945 made code that used these use max/min from <algorithm> instead.
8947 * changed several c library include files to their equivalent c++
8948 library include files. All is not changed yet.
8950 * created a support subdir in src, put lyxstring and lstrings
8951 there + the extra files atexit, fileblock, strerror. Created
8952 Makefile.am. edited configure.in and src/Makefile.am to use this
8953 new subdir. More files moved to support.
8955 * imported som of the functions from repository lyx, filetools
8957 * ran tags-query-replace on LString -> string, corrected the bogus
8958 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8959 is still some errors in there. This is errors where too much or
8960 too litle get deleted from strings (string::erase, string::substr,
8961 string::replace), there can also be some off by one errors, or
8962 just plain wrong use of functions from lstrings. Viewing of quotes
8965 * LyX is now running fairly well with string, but there are
8966 certainly some bugs yet (see above) also string is quite different
8967 from LString among others in that it does not allow null pointers
8968 passed in and will abort if it gets any.
8970 * Added the revtex4 files I forgot when setting up the repository.
8972 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8974 * All over: Tried to clean everything up so that only the files
8975 that we really need are included in the cvs repository.
8976 * Switched to use automake.
8977 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8978 * Install has not been checked.
8980 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8982 * po/pt.po: Three errors:
8983 l.533 and l.538 format specification error
8984 l. 402 duplicate entry, I just deleted it.