1 2000-10-03 Allan Rae <rae@lyx.org>
3 * src/frontends/xforms/forms/form_preferences.fd:
4 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
5 nested tabfolders has begun. The old "Miscellaneous" was renamed as
6 "Look and Feel"->"General" but will need to be split up further into
7 general output and general input tabs. Current plan is for four outer
8 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
9 stuff; "Inputs" for input and import configuration; "Outputs" for
10 output and export configuration; and one more whatever is left over
11 called "General". The leftovers at present look like being which
12 viewers to use, spellchecker, language support and might be better
13 named "Support". I've put "Paths" in "Inputs" for the moment as this
14 seems reasonable for now at least.
15 One problem remains: X error kills LyX when you close Preferences.
17 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
19 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
21 * src/frontends/xforms/FormCitation.[Ch]:
22 * src/frontends/xforms/FormCopyright.[Ch]:
23 * src/frontends/xforms/FormDocument.[Ch]:
24 * src/frontends/xforms/FormError.[Ch]:
25 * src/frontends/xforms/FormIndex.[Ch]:
26 * src/frontends/xforms/FormPreferences.[Ch]:
27 * src/frontends/xforms/FormPrint.[Ch]:
28 * src/frontends/xforms/FormRef.[Ch]:
29 * src/frontends/xforms/FormToc.[Ch]:
30 * src/frontends/xforms/FormUrl.[Ch]: ditto.
32 * src/frontends/xforms/FormCitation.[Ch]:
33 * src/frontends/xforms/FormIndex.[Ch]:
34 * src/frontends/xforms/FormRef.[Ch]:
35 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
36 with Allan's naming policy
38 * src/frontends/xforms/FormCitation.C: some static casts to remove
41 2000-10-02 Juergen Vigna <jug@sad.it>
43 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
44 now you can type or do stuff inside the table-cell also when in dummy
45 position, fixed visible cursor.
47 * src/insets/insettext.C (Edit): fixing cursor-view position.
49 * src/lyxfunc.C (Dispatch): use * text variable so that it can
50 be used for equal functions in lyxfunc and insettext.
52 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
54 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
56 * src/frontends/gnome/FormCitation.h:
57 * src/frontends/gnome/FormCopyright.h:
58 * src/frontends/gnome/FormIndex.h:
59 * src/frontends/gnome/FormPrint.h:
60 * src/frontends/gnome/FormToc.h:
61 * src/frontends/gnome/FormUrl.h:
62 * src/frontends/kde/FormCitation.h:
63 * src/frontends/kde/FormCopyright.h:
64 * src/frontends/kde/FormIndex.h:
65 * src/frontends/kde/FormRef.h:
66 * src/frontends/kde/FormToc.h:
67 * src/frontends/kde/FormUrl.h: fix remaining users of
70 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
72 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
74 (DocBookHandleCaption): ditto.
75 (DocBookHandleFootnote): ditto.
76 (SimpleDocBookOnePar): ditto.
78 * src/frontends/xforms/FormDocument.h (form): remove extra
79 FormDocument:: qualifier.
81 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
83 * sigc++/handle.h: ditto.
85 * src/lyx_gui_misc.C: add "using" directive.
87 * src/cheaders/cstddef: new file, needed by the boost library (for
90 2000-10-02 Juergen Vigna <jug@sad.it>
92 * src/insets/insettext.C (SetFont): better support.
94 * src/insets/insettabular.C (draw): fixed drawing of single cell.
96 * src/screen.C (DrawOneRow): some uint refixes!
98 2000-10-02 Allan Rae <rae@lyx.org>
100 * boost/.cvsignore: ignore Makefile as well
102 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
103 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
105 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
106 Left this one out by accident.
108 * src/frontends/xforms/FormBase.h (restore): default to calling
109 update() since that will restore the original/currently-applied values.
110 Any input() triggered error messages will require the derived classes
111 to redefine restore().
113 * src/frontends/xforms/FormDocument.C: initialize a few variables to
114 avoid a segfault. combo_doc_class is the main concern.
116 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
118 * Simplify build-listerrors in view of GUI-less export ability!
120 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
122 * src/lyx_main.C (easyParse): Disable gui when exporting
124 * src/insets/figinset.C:
128 * src/tabular.C: Changes to allow no-gui.
130 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
132 * src/support/utility.hpp: removed file
133 * src/support/block.h: removed file
135 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
138 * src/mathed/formula.C: add support/lyxlib.h
139 * src/mathed/formulamacro.C: ditto
141 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
142 * src/lyxparagraph.h: ditto
144 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
145 * src/frontends/Makefile.am (INCLUDES): ditto
146 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
147 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
148 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
149 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
150 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
151 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
153 * src/BufferView.h: use boost/utility.hpp
154 * src/LColor.h: ditto
156 * src/LyXAction.h: ditto
157 * src/LyXView.h: ditto
158 * src/bufferlist.h: ditto
159 * src/lastfiles.h: ditto
160 * src/layout.h: ditto
161 * src/lyx_gui.h: ditto
162 * src/lyx_main.h: ditto
163 * src/lyxlex.h: ditto
165 * src/frontends/ButtonPolicies.h: ditto
166 * src/frontends/Dialogs.h: ditto
167 * src/frontends/xforms/FormBase.h: ditto
168 * src/frontends/xforms/FormGraphics.h: ditto
169 * src/frontends/xforms/FormParagraph.h: ditto
170 * src/frontends/xforms/FormTabular.h: ditto
171 * src/graphics/GraphicsCache.h: ditto
172 * src/graphics/Renderer.h: ditto
173 * src/insets/ExternalTemplate.h: ditto
174 * src/insets/insetcommand.h: ditto
175 * src/support/path.h: ditto
177 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
178 and introduce clause for 2.97.
180 * boost/libs/README: new file
182 * boost/boost/utility.hpp: new file
184 * boost/boost/config.hpp: new file
186 * boost/boost/array.hpp: new file
188 * boost/Makefile.am: new file
190 * boost/.cvsignore: new file
192 * configure.in (AC_OUTPUT): add boost/Makefile
194 * Makefile.am (SUBDIRS): add boost
196 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
198 * src/support/lstrings.C (suffixIs): Fixed.
200 2000-10-01 Allan Rae <rae@lyx.org>
202 * src/PrinterParams.h: moved things around to avoid the "can't
203 inline call" warning.
205 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
206 into doc++ documentation.
208 * src/frontends/xforms/FormCommand.[Ch]: support button policy
210 * src/frontends/xforms/FormRef.C: make use of button controller
211 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
212 cleaned up button controller usage.
213 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
214 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
215 use the button controller
217 * src/frontends/xforms/forms/*.fd: and associated generated files
218 updated to reflect changes to FormBase. Some other FormXxxx files
219 also got minor updates to reflect changes to FormBase.
221 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
222 (hide): made virtual.
223 (input): return a bool. true == valid input
224 (RestoreCB, restore): new
225 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
226 Changes to allow derived dialogs to use a ButtonController and
227 make sense when doing so: OK button calls ok() and so on.
229 * src/frontends/xforms/ButtonController.h (class ButtonController):
230 Switch from template implementation to taking Policy parameter.
231 Allows FormBase to provide a ButtonController for any dialog.
233 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
234 Probably should rename connect and disconnect.
235 (apply): use the radio button groups
236 (form): needed by FormBase
237 (build): setup the radio button groups
239 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
241 * several files: type canges to reduce the number of warnings and
242 to unify type hangling a bit. Still much to do.
244 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
246 * lib/images/*: rename a bunch of icons to match Dekel converter
249 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
252 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
254 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
256 * sigc++/handle.h: ditto for class Handle.
258 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
260 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
262 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
264 * src/intl.C (InitKeyMapper): Correct the value of n due to the
265 removal of the "default" language.
267 * src/combox.h (getline): Check that sel > 0
269 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
271 * lib/examples/docbook_example.lyx
272 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
274 * lib/layouts/docbook-book.layout: new docbook book layout.
276 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
278 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
280 * src/insets/figinset.C (DocBook):fixed small typo.
282 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
284 * src/insets/insetinclude.h: string include_label doesn't need to be
287 2000-09-29 Allan Rae <rae@lyx.org>
289 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
290 Allow derived type to control connection and disconnection from signals
291 of its choice if desired.
293 2000-09-28 Juergen Vigna <jug@sad.it>
295 * src/insets/insettabular.C (update): fixed cursor setting when
296 the_locking_inset changed.
297 (draw): made this a bit cleaner.
298 (InsetButtonPress): fixed!
300 * various files: added LyXText Parameter to fitCursor call.
302 * src/BufferView.C (fitCursor): added LyXText parameter.
304 * src/insets/insettabular.C (draw): small draw fix.
306 * src/tabular.C: right setting of left/right celllines.
308 * src/tabular.[Ch]: fixed various types in funcions and structures.
309 * src/insets/insettabular.C: ditto
310 * src/frontends/xforms/FormTabular.C: ditto
312 2000-09-28 Allan Rae <rae@lyx.org>
314 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
315 that the #ifdef's had been applied to part of what should have been
316 a complete condition. It's possible there are other tests that
317 were specific to tables that are also wrong now that InsetTabular is
318 being used. Now we need to fix the output of '\n' after a table in a
319 float for the same reason as the original condition:
320 "don't insert this if we would be adding it before or after a table
321 in a float. This little trick is needed in order to allow use of
322 tables in \subfigures or \subtables."
323 Juergen can you check this?
325 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
327 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
328 outputed to the ostream.
330 * several files: fixed types based on warnings from cxx
332 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
334 * src/frontends/kde/Makefile.am: fix rule for
335 formindexdialogdata_moc.C
337 * src/.cvsignore: add ext_l10n.h to ignore
339 * acconfig.h: stop messing with __STRICT_ANSI__
340 * config/gnome.m4: remove option to set -ansi
341 * config/kde.m4: remove option to set -ansi
342 * config/lyxinclude.m4: don't set -ansi
344 2000-09-27 Juergen Vigna <jug@sad.it>
346 * various files: remove "default" language check.
348 * src/insets/insetquotes.C: removed use of current_view.
350 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
351 the one should have red ears by now!
353 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
354 in more then one paragraph. Fixed cursor-movement/selection.
356 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
357 paragraphs inside a text inset.
359 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
360 text-inset if this owner is an inset.
362 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
364 * src/Bullet.h: changed type of font, character and size to int
366 * src/buffer.C (asciiParagraph): remove actcell and fname1.
368 * src/insets/inseturl.[Ch]:
369 * src/insets/insetref.[Ch]:
370 * src/insets/insetlabel.[Ch]: add linelen to Ascii
372 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
374 * src/buffer.C (readFile): block-if statement rearranged to minimise
375 bloat. Patch does not reverse Jean-Marc's change ;-)
377 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
378 Class rewritten to store pointers to hide/update signals directly,
379 rather than Dialogs *. Also defined an enum to ease use. All xforms
380 forms can now be derived from this class.
382 * src/frontends/xforms/FormCommand.[Ch]
383 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
385 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
388 * src/frontends/xforms/forms/form_citation.fd
389 * src/frontends/xforms/forms/form_copyright.fd
390 * src/frontends/xforms/forms/form_error.fd
391 * src/frontends/xforms/forms/form_index.fd
392 * src/frontends/xforms/forms/form_ref.fd
393 * src/frontends/xforms/forms/form_toc.fd
394 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
396 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
398 * src/insets/insetfoot.C: removed redundent using directive.
400 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
402 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
403 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
405 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
406 created in the constructors in different groups. Then set() just
407 have to show the groups as needed. This fixes the redraw problems
408 (and is how the old menu code worked).
410 * src/support/lyxlib.h: declare the methods as static when we do
413 2000-09-26 Juergen Vigna <jug@sad.it>
415 * src/buffer.C (asciiParagraph): new function.
416 (writeFileAscii): new function with parameter ostream.
417 (writeFileAscii): use now asciiParagraph.
419 * various inset files: added the linelen parameter to the Ascii-func.
421 * src/tabular.C (Write): fixed error in writing file introduced by
422 the last changes from Lars.
424 * lib/bind/menus.bind: removed not supported functions.
426 * src/insets/insettext.C (Ascii): implemented this function.
428 * src/insets/lyxinset.h (Ascii): added linelen parameter.
430 * src/tabular.C (write_attribute[int,string,bool]): new functions.
431 (Write): use of the write_attribute functions.
433 * src/bufferlist.C (close): fixed reasking question!
435 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
437 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
438 new files use the everwhere possible.
441 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
442 src/log_form.C src/lyx.C:
445 * src/buffer.C (runLaTeX): remove func
447 * src/PaperLayout.C: removed file
448 * src/ParagraphExtra.C: likewise
449 * src/bullet_forms.C: likewise
450 * src/bullet_forms.h: likewise
451 * src/bullet_forms_cb.C: likewise
453 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
454 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
457 * several files: remove all traces of the old fd_form_paragraph,
458 and functions belonging to that.
460 * several files: remove all traces of the old fd_form_document,
461 and functions belonging to that.
463 * several files: constify local variables were possible.
465 * several files: remove all code that was dead when NEW_EXPORT was
468 * several files: removed string::c_str in as many places as
471 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
472 (e): be a bit more outspoken when patching
473 (updatesrc): only move files if changed.
475 * forms/layout_forms.h.patch: regenerated
477 * forms/layout_forms.fd: remove form_document and form_paragraph
478 and form_quotes and form_paper and form_table_options and
481 * forms/form1.fd: remove form_table
483 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
484 the fdui->... rewrite. Update some comments to xforms 0.88
486 * forms/bullet_forms.C.patch: removed file
487 * forms/bullet_forms.fd: likewise
488 * forms/bullet_forms.h.patch: likewise
490 * development/Code_rules/Rules: added a section on switch
491 statements. Updated some comment to xforms 0.88.
493 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
495 * src/buffer.C (readFile): make sure that the whole version number
496 is read after \lyxformat (even when it contains a comma)
498 * lib/ui/default.ui: change shortcut of math menu to M-a.
500 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
502 * src/vspace.C (nextToken): use isStrDbl() to check for proper
505 * src/LyXView.C (updateWindowTitle): show the full files name in
506 window title, limited to 30 characters.
508 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
509 When a number of characters has been given, we should not assume
510 that the string is 0-terminated.
512 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
513 calls (fixes some memory leaks)
515 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
516 trans member on exit.
518 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
520 * src/converter.C (GetReachable): fix typo.
522 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
523 understand ',' instead of '.'.
524 (GetInteger): rewrite to use strToInt().
526 2000-09-26 Juergen Vigna <jug@sad.it>
528 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
529 better visibility and error-message on wrong VSpace input.
531 * src/language.C (initL): added english again.
533 2000-09-25 Juergen Vigna <jug@sad.it>
535 * src/frontends/kde/Dialogs.C (Dialogs):
536 * src/frontends/gnome/Dialogs.C (Dialogs):
537 * src/frontends/kde/Makefile.am:
538 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
540 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
542 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
544 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
546 * src/frontends/xforms/FormParagraph.C:
547 * src/frontends/xforms/FormParagraph.h:
548 * src/frontends/xforms/form_paragraph.C:
549 * src/frontends/xforms/form_paragraph.h:
550 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
553 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
555 * src/tabular.C (OldFormatRead): forgot to delete the temporary
556 Paragraph-Data after use.
558 * src/insets/insettext.C (LocalDispatch): don't set the layout on
559 non breakable paragraphs.
561 2000-09-25 Garst R. Reese <reese@isn.net>
563 * src/language.C (initL): added missing language_country codes.
565 2000-09-25 Juergen Vigna <jug@sad.it>
567 * src/insets/insettext.C (InsetText):
568 (deleteLyXText): remove the not released LyXText structure!
570 2000-09-24 Marko Vendelin <markov@ioc.ee>
572 * src/frontends/gnome/mainapp.C
573 * src/frontends/gnome/mainapp.h: added support for keyboard
576 * src/frontends/gnome/FormCitation.C
577 * src/frontends/gnome/FormCitation.h
578 * src/frontends/gnome/Makefile.am
579 * src/frontends/gnome/pixbutton.h: completed the rewrite of
580 FormCitation to use "action area" in mainapp window
582 * src/frontends/gnome/Menubar_pimpl.C
583 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
586 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
588 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
589 width/descent/ascent values if name is empty.
590 (mathed_string_height): Use std::max.
592 2000-09-25 Allan Rae <rae@lyx.org>
594 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
595 segfault. This will be completely redesigned soon.
597 * sigc++: updated libsigc++. Fixes struct timespec bug.
599 * development/tools/makeLyXsigc.sh: .cvsignore addition
601 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
603 * several files: removed almost all traces of the old table
606 * src/TableLayout.C: removed file
608 2000-09-22 Juergen Vigna <jug@sad.it>
610 * src/frontends/kde/Dialogs.C: added credits forms.
612 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
614 * src/frontends/gnome/Dialogs.C: added some forms.
616 * src/spellchecker.C (init_spell_checker): set language in pspell code
617 (RunSpellChecker): some modifications for setting language string.
619 * src/language.[Ch]: added language_country code.
621 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
623 * src/frontends/Dialogs.h: added new signal showError.
624 Rearranged existing signals in some sort of alphabetical order.
626 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
627 FormError.[Ch], form_error.[Ch]
628 * src/frontends/xforms/forms/makefile: added new file form_error.fd
629 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
631 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
632 dialogs. I think that this can be used as the base to all these
635 * src/frontends/xforms/FormError.[Ch]
636 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
637 implementation of InsetError dialog.
639 * src/insets/inseterror.[Ch]: rendered GUI-independent.
641 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
642 * src/frontends/kde/Makefile.am: ditto
644 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
646 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
647 macrobf. This fixes a bug of invisible text.
649 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
651 * lib/doc/LaTeXConfig.lyx.in: updated.
653 * src/language.C (initL): remove language "francais" and change a
654 bit the names of the two other french variations.
656 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
657 string that may not be 0-terminated.
659 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
661 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
663 2000-09-20 Marko Vendelin <markov@ioc.ee>
665 * src/frontends/gnome/FormCitation.C
666 * src/frontends/gnome/FormIndex.C
667 * src/frontends/gnome/FormToc.C
668 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
669 the variable initialization to shut up the warnings
671 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
673 * src/table.[Ch]: deleted files
675 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
678 2000-09-18 Juergen Vigna <jug@sad.it>
680 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
681 problems with selection. Inserted new LFUN_PASTESELECTION.
682 (InsetButtonPress): inserted handling of middle mouse-button paste.
684 * src/spellchecker.C: changed word to word.c_str().
686 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
688 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
689 included in the ``make dist'' tarball.
691 2000-09-15 Juergen Vigna <jug@sad.it>
693 * src/CutAndPaste.C (cutSelection): small fix return the right
694 end position after cut inside one paragraph only.
696 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
697 we are locked as otherwise we don't have a valid cursor position!
699 * src/insets/figinset.C (draw): small bugfix but why is this needed???
701 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
703 * src/frontends/kde/FormRef.C: added using directive.
704 * src/frontends/kde/FormToc.C: ditto
706 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
708 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
710 2000-09-19 Marko Vendelin <markov@ioc.ee>
712 * src/frontends/gnome/Menubar_pimpl.C
713 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
714 Toc, ViewFormats, UpdateFormats, and ExportFormats.
716 * src/frontends/gnome/mainapp.C
717 * src/frontends/gnome/mainapp.h: support for menu update used
720 * src/frontends/gnome/mainapp.C
721 * src/frontends/gnome/mainapp.h: support for "action" area in the
722 main window. This area is used by small simple dialogs, such as
725 * src/frontends/gnome/FormIndex.C
726 * src/frontends/gnome/FormIndex.h
727 * src/frontends/gnome/FormUrl.C
728 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
731 * src/frontends/gnome/FormCitation.C
732 * src/frontends/gnome/FormCitation.h: rewrite to use main window
733 action area. Only "Insert new citation" is implemented.
735 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
737 * src/buffer.C (Dispatch): fix call to Dispatch
738 * src/insets/insetref.C (Edit): likewise
739 * src/insets/insetparent.C (Edit): likewise
740 * src/insets/insetinclude.C (include_cb): likewise
741 * src/frontends/xforms/FormUrl.C (apply): likewise
742 * src/frontends/xforms/FormToc.C (apply): likewise
743 * src/frontends/xforms/FormRef.C (apply): likewise
744 * src/frontends/xforms/FormIndex.C (apply): likewise
745 * src/frontends/xforms/FormCitation.C (apply): likewise
746 * src/lyxserver.C (callback): likewise
747 * src/lyxfunc.C (processKeySym): likewise
750 * src/lyx_cb.C (LayoutsCB): likewise
752 * Makefile.am (sourcedoc): small change
754 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
756 * src/main.C (main): Don't make an empty GUIRunTime object. all
757 methods are static. constify a bit remove unneded using + headers.
759 * src/tabular.C: some more const to local vars move some loop vars
761 * src/spellchecker.C: added some c_str after some word for pspell
763 * src/frontends/GUIRunTime.h: add new static method setDefaults
764 * src/frontends/xforms/GUIRunTime.C (setDefaults):
765 * src/frontends/kde/GUIRunTime.C (setDefaults):
766 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
768 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
769 with strnew in arg, use correct emptystring when calling SetName.
771 * several files: remove all commented code with relation to
772 HAVE_SSTREAM beeing false. We now only support stringstream and
775 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
777 * src/lyxfunc.C: construct correctly the automatic new file
780 * src/text2.C (IsStringInText): change type of variable i to shut
783 * src/support/sstream.h: do not use namespaces if the compiler
784 does not support them.
786 2000-09-15 Marko Vendelin <markov@ioc.ee>
787 * src/frontends/gnome/FormCitation.C
788 * src/frontends/gnome/FormCitation.h
789 * src/frontends/gnome/diainsertcitation_interface.c
790 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
791 regexp support to FormCitation [Gnome].
793 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
796 * configure.in: remove unused KDE/GTKGUI define
798 * src/frontends/kde/FormRef.C
799 * src/frontends/kde/FormRef.h
800 * src/frontends/kde/formrefdialog.C
801 * src/frontends/kde/formrefdialog.h: double click will
802 go to reference, now it is possible to change a cross-ref
805 * src/frontends/kde/FormToc.C
806 * src/frontends/kde/FormToc.h
807 * src/frontends/kde/formtocdialog.C
808 * src/frontends/kde/formtocdialog.h: add a depth
811 * src/frontends/kde/Makefile.am: add QtLyXView.h
814 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
816 * src/frontends/kde/FormCitation.h: added some using directives.
818 * src/frontends/kde/FormToc.h: corrected definition of doTree.
820 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
823 * src/mathed/math_defs.h: redefine SetAlign to use string rather
826 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
828 * src/buffer.C (pop_tag): revert for the second time a change by
829 Lars, who seems to really hate having non-local loop variables :)
831 * src/Lsstream.h: add "using" statements.
833 * src/support/copy.C (copy): add a bunch of std:: qualifiers
834 * src/buffer.C (writeFile): ditto
836 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
838 * src/buffer.C (writeFile): try to fix the locale modified format
839 number to always be as we want it.
841 * src/WorkArea.C (work_area_handler): try to workaround the bugs
842 in XForms 0.89. C-space is now working again.
844 * src/Lsstream.h src/support/sstream.h: new files.
846 * also commented out all cases where strstream were used.
848 * src/Bullet.h (c_str): remove method.
850 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
852 * a lot of files: get rid of "char const *" and "char *" is as
853 many places as possible. We only want to use them in interaction
854 with system of other libraries, not inside lyx.
856 * a lot of files: return const object is not of pod type. This
857 helps ensure that temporary objects is not modified. And fits well
858 with "programming by contract".
860 * configure.in: check for the locale header too
862 * Makefile.am (sourcedoc): new tag for generation of doc++
865 2000-09-14 Juergen Vigna <jug@sad.it>
867 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
868 callback to check which combo called it and do the right action.
870 * src/combox.C (combo_cb): added combo * to the callbacks.
871 (Hide): moved call of callback after Ungrab of the pointer.
873 * src/intl.h: removed LCombo2 function.
875 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
876 function as this can now be handled in one function.
878 * src/combox.h: added Combox * to callback prototype.
880 * src/frontends/xforms/Toolbar_pimpl.C:
881 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
883 2000-09-14 Garst Reese <reese@isn.net>
885 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
886 moved usepackage{xxx}'s to beginning of file. Changed left margin
887 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
888 underlining from title. Thanks to John Culleton for useful suggestions.
890 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
892 * src/lyxlex_pimpl.C (setFile): change error message to debug
895 2000-09-13 Juergen Vigna <jug@sad.it>
897 * src/frontends/xforms/FormDocument.C: implemented choice_class
898 as combox and give callback to combo_language so OK/Apply is activated
901 * src/bufferlist.C (newFile): small fix so already named files
902 (via an open call) are not requested to be named again on the
905 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
907 * src/frontends/kde/Makefile.am
908 * src/frontends/kde/FormRef.C
909 * src/frontends/kde/FormRef.h
910 * src/frontends/kde/formrefdialog.C
911 * src/frontends/kde/formrefdialog.h: implement
914 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
916 * src/frontends/kde/formtocdialog.C
917 * src/frontends/kde/formtocdialog.h
918 * src/frontends/kde/FormToc.C
919 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
921 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
923 * src/frontends/kde/FormCitation.C: fix thinko
924 where we didn't always display the reference text
927 * src/frontends/kde/formurldialog.C
928 * src/frontends/kde/formurldialog.h
929 * src/frontends/kde/FormUrl.C
930 * src/frontends/kde/FormUrl.h: minor cleanups
932 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
934 * src/frontends/kde/Makefile.am
935 * src/frontends/kde/FormToc.C
936 * src/frontends/kde/FormToc.h
937 * src/frontends/kde/FormCitation.C
938 * src/frontends/kde/FormCitation.h
939 * src/frontends/kde/FormIndex.C
940 * src/frontends/kde/FormIndex.h
941 * src/frontends/kde/formtocdialog.C
942 * src/frontends/kde/formtocdialog.h
943 * src/frontends/kde/formcitationdialog.C
944 * src/frontends/kde/formcitationdialog.h
945 * src/frontends/kde/formindexdialog.C
946 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
948 2000-09-12 Juergen Vigna <jug@sad.it>
950 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
953 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
955 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
958 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
960 * src/converter.C (Add, Convert): Added support for converter flags:
961 needaux, resultdir, resultfile.
962 (Convert): Added new parameter view_file.
963 (dvips_options): Fixed letter paper option.
965 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
966 (Export, GetExportableFormats, GetViewableFormats): Added support
969 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
971 (easyParse): Fixed to work with new export code.
973 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
976 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
978 * lib/bind/*.bind: Replaced
979 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
980 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
982 2000-09-11 Juergen Vigna <jug@sad.it>
984 * src/lyx_gui.C (runTime): uses global guiruntime variable.
986 * src/main.C (main): now GUII defines global guiruntime!
988 * src/frontends/gnome/GUIRunTime.C (initApplication):
989 * src/frontends/kde/GUIRunTime.C (initApplication):
990 * src/frontends/xforms/GUIRunTime.C (initApplication):
991 * src/frontends/GUIRunTime.h: added new function initApplication.
993 * src/spellchecker.C (sc_accept_word): change to add_to_session.
995 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
997 2000-09-08 Juergen Vigna <jug@sad.it>
999 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1000 we have already "Reset".
1002 * src/language.C (initL): inserted "default" language and made this
1003 THE default language (and not american!)
1005 * src/paragraph.C: inserted handling of "default" language!
1007 * src/lyxfont.C: ditto
1011 * src/paragraph.C: output the \\par only if we have a following
1012 paragraph otherwise it's not needed.
1014 2000-09-05 Juergen Vigna <jug@sad.it>
1016 * config/pspell.m4: added entry to lyx-flags
1018 * src/spellchecker.C: modified version from Kevin for using pspell
1020 2000-09-01 Marko Vendelin <markov@ioc.ee>
1021 * src/frontends/gnome/Makefile.am
1022 * src/frontends/gnome/FormCitation.C
1023 * src/frontends/gnome/FormCitation.h
1024 * src/frontends/gnome/diainsertcitation_callbacks.c
1025 * src/frontends/gnome/diainsertcitation_callbacks.h
1026 * src/frontends/gnome/diainsertcitation_interface.c
1027 * src/frontends/gnome/diainsertcitation_interface.h
1028 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1029 dialog for Gnome frontend
1031 * src/main.C: Gnome libraries require keeping application name
1032 and its version as strings
1034 * src/frontends/gnome/mainapp.C: Change the name of the main window
1035 from GnomeLyX to PACKAGE
1037 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1039 * src/frontends/Liason.C: add "using: declaration.
1041 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1043 * src/mathed/math_macro.C (Metrics): Set the size of the template
1045 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1047 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1049 * src/converter.C (add_options): New function.
1050 (SetViewer): Change $$FName into '$$FName'.
1051 (View): Add options when running xdvi
1052 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
1053 (Convert): The 3rd parameter is now the desired filename. Converts
1054 calls to lyx::rename if necessary.
1055 Add options when running dvips.
1056 (dvi_papersize,dvips_options): New methods.
1058 * src/exporter.C (Export): Use getLatexName() instead of fileName().
1060 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
1061 using a call to Converter::dvips_options.
1062 Fixed to work with nex export code.
1064 * src/support/copy.C
1065 * src/support/rename.C: New files
1067 * src/support/syscall.h
1068 * src/support/syscall.C: Added Starttype SystemDontWait.
1070 * lib/ui/default.ui: Changed to work with new export code
1072 * lib/configure.m4: Changed to work with new export code
1074 * src/encoding.C: Changed latex name for iso8859_7 encoding.
1076 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
1078 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
1079 so that code compiles with DEC cxx.
1081 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
1082 to work correctly! Also now supports the additional elements
1085 2000-09-01 Allan Rae <rae@lyx.org>
1087 * src/frontends/ButtonPolicies.C: renamed all the references to
1088 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
1090 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
1091 since it's a const not a type.
1093 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
1095 2000-08-31 Juergen Vigna <jug@sad.it>
1097 * src/insets/figinset.C: Various changes to look if the filename has
1098 an extension and if not add it for inline previewing.
1100 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1102 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1103 make buttonStatus and isReadOnly be const methods. (also reflect
1104 this in derived classes.)
1106 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1107 (nextState): change to be static inline, pass the StateMachine as
1109 (PreferencesPolicy): remove casts
1110 (OkCancelPolicy): remvoe casts
1111 (OkCancelReadOnlyPolicy): remove casts
1112 (NoRepeatedApplyReadOnlyPolicy): remove casts
1113 (OkApplyCancelReadOnlyPolicy): remove casts
1114 (OkApplyCancelPolicy): remove casts
1115 (NoRepeatedApplyPolicy): remove casts
1117 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1119 * src/converter.C: added some using directives
1121 * src/frontends/ButtonPolicies.C: changes to overcome
1122 "need lvalue" error with DEC c++
1124 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1125 to WMHideCB for DEC c++
1127 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1129 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1130 to BulletBMTableCB for DEC c++
1132 2000-08-31 Allan Rae <rae@lyx.org>
1134 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1135 character dialog separately from old document dialogs combo_language.
1138 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1140 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1141 Removed LFUN_REF_CREATE.
1143 * src/MenuBackend.C: Added new tags: toc and references
1145 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1146 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1148 (add_toc, add_references): New methods.
1149 (create_submenu): Handle correctly the case when there is a
1150 seperator after optional menu items.
1152 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1153 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1154 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1156 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1158 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1160 * src/converter.[Ch]: New file for converting between different
1163 * src/export.[Ch]: New file for exporting a LyX file to different
1166 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1167 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1168 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1169 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1170 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1171 RunDocBook, MenuExport.
1173 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1174 Exporter::Preview methods if NEW_EXPORT is defined.
1176 * src/buffer.C (Dispatch): Use Exporter::Export.
1178 * src/lyxrc.C: Added new tags: \converter and \viewer.
1181 * src/LyXAction.C: Define new lyx-function: buffer-update.
1182 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1183 when NEW_EXPORT is defined.
1185 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1187 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1189 * lib/ui/default.ui: Added submenus "view" and "update" to the
1192 * src/filetools.C (GetExtension): New function.
1194 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1196 2000-08-29 Allan Rae <rae@lyx.org>
1198 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1200 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1201 (EnableDocumentLayout): removed
1202 (DisableDocumentLayout): removed
1203 (build): make use of ButtonController's read-only handling to
1204 de/activate various objects. Replaces both of the above functions.
1206 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1207 (readOnly): was read_only
1208 (refresh): fixed dumb mistakes with read_only_ handling
1210 * src/frontends/xforms/forms/form_document.fd:
1211 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1212 tabbed dialogs so the tabs look more like tabs and so its easier to
1213 work out which is the current tab.
1215 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1216 segfault with form_table
1218 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1220 2000-08-28 Juergen Vigna <jug@sad.it>
1222 * acconfig.h: added USE_PSPELL.
1224 * src/config.h.in: added USE_PSPELL.
1226 * autogen.sh: added pspell.m4
1228 * config/pspell.m4: new file.
1230 * src/spellchecker.C: implemented support for pspell libary.
1232 2000-08-25 Juergen Vigna <jug@sad.it>
1234 * src/LyXAction.C (init): renamed LFUN_TABLE to
1235 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1237 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1239 * src/lyxscreen.h: add force_clear variable and fuction to force
1240 a clear area when redrawing in LyXText.
1242 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1244 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1246 * some whitespace and comment changes.
1248 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1250 * src/buffer.C: up te LYX_FORMAT to 2.17
1252 2000-08-23 Juergen Vigna <jug@sad.it>
1254 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1257 * src/insets/insettabular.C (pasteSelection): delete the insets
1258 LyXText as it is not valid anymore.
1259 (copySelection): new function.
1260 (pasteSelection): new function.
1261 (cutSelection): new function.
1262 (LocalDispatch): implemented cut/copy/paste of cell selections.
1264 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1265 don't have a LyXText.
1267 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1269 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1272 2000-08-22 Juergen Vigna <jug@sad.it>
1274 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1275 ifdef form_table out if NEW_TABULAR.
1277 2000-08-21 Juergen Vigna <jug@sad.it>
1279 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1280 (draw): fixed draw position so that the cursor is positioned in the
1282 (InsetMotionNotify): hide/show cursor so the position is updated.
1283 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1284 using cellstart() function where it should be used.
1286 * src/insets/insettext.C (draw): ditto.
1288 * src/tabular.C: fixed initialization of some missing variables and
1289 made BoxType into an enum.
1291 2000-08-22 Marko Vendelin <markov@ioc.ee>
1292 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1293 stock menu item using action numerical value, not its string
1297 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1299 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1300 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1302 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1304 * src/frontends/xforms/GUIRunTime.C: new file
1306 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1307 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1309 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1311 * src/frontends/kde/GUIRunTime.C: new file
1313 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1314 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1316 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1318 * src/frontends/gnome/GUIRunTime.C: new file
1320 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1323 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1324 small change to documetentation.
1326 * src/frontends/GUIRunTime.C: removed file
1328 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1330 * src/lyxparagraph.h: enable NEW_TABULAR as default
1332 * src/lyxfunc.C (processKeySym): remove some commented code
1334 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1335 NEW_TABULAR around the fd_form_table_options.
1337 * src/lyx_gui.C (runTime): call the static member function as
1338 GUIRunTime::runTime().
1340 2000-08-21 Allan Rae <rae@lyx.org>
1342 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1345 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1347 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1349 2000-08-21 Allan Rae <rae@lyx.org>
1351 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1352 keep Garst happy ;-)
1353 * src/frontends/xforms/FormPreferences.C (build): use setOK
1354 * src/frontends/xforms/FormDocument.C (build): use setOK
1355 (FormDocument): use the appropriate policy.
1357 2000-08-21 Allan Rae <rae@lyx.org>
1359 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1360 automatic [de]activation of arbitrary objects when in a read-only state.
1362 * src/frontends/ButtonPolicies.h: More documentation
1363 (isReadOnly): added to support the above.
1365 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1367 2000-08-18 Juergen Vigna <jug@sad.it>
1369 * src/insets/insettabular.C (getStatus): changed to return func_status.
1371 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1372 display toggle menu entries if they are.
1374 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1375 new document layout now.
1377 * src/lyxfunc.C: ditto
1379 * src/lyx_gui_misc.C: ditto
1381 * src/lyx_gui.C: ditto
1383 * lib/ui/default.ui: removed paper and quotes layout as they are now
1384 all in the document layout tabbed folder.
1386 * src/frontends/xforms/forms/form_document.fd: added Restore
1387 button and callbacks for all inputs for Allan's ButtonPolicy.
1389 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1390 (CheckChoiceClass): added missing params setting on class change.
1391 (UpdateLayoutDocument): added for updating the layout on params.
1392 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1393 (FormDocument): Implemented Allan's ButtonPolicy with the
1396 2000-08-17 Allan Rae <rae@lyx.org>
1398 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1399 so we can at least see the credits again.
1401 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1402 controller calls for the appropriate callbacks. Note that since Ok
1403 calls apply followed by cancel, and apply isn't a valid input for the
1404 APPLIED state, the bc_ calls have to be made in the static callback not
1405 within each of the real callbacks.
1407 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1408 (setOk): renamed from setOkay()
1410 2000-08-17 Juergen Vigna <jug@sad.it>
1412 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1413 in the implementation part.
1414 (composeUIInfo): don't show optional menu-items.
1416 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1418 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1420 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1421 text-state when in a text-inset.
1423 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1425 2000-08-17 Marko Vendelin <markov@ioc.ee>
1426 * src/frontends/gnome/FormIndex.C
1427 * src/frontends/gnome/FormIndex.h
1428 * src/frontends/gnome/FormToc.C
1429 * src/frontends/gnome/FormToc.h
1430 * src/frontends/gnome/dialogs
1431 * src/frontends/gnome/diatoc_callbacks.c
1432 * src/frontends/gnome/diatoc_callbacks.h
1433 * src/frontends/gnome/diainsertindex_callbacks.h
1434 * src/frontends/gnome/diainsertindex_callbacks.c
1435 * src/frontends/gnome/diainsertindex_interface.c
1436 * src/frontends/gnome/diainsertindex_interface.h
1437 * src/frontends/gnome/diatoc_interface.h
1438 * src/frontends/gnome/diatoc_interface.c
1439 * src/frontends/gnome/Makefile.am: Table of Contents and
1440 Insert Index dialogs implementation for Gnome frontend
1442 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1444 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1446 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1449 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1451 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1452 destructor. Don't definde if you don't need it
1453 (processEvents): made static, non-blocking events processing for
1455 (runTime): static method. event loop for xforms
1456 * similar as above for kde and gnome.
1458 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1459 new Pimpl is correct
1460 (runTime): new method calss the real frontends runtime func.
1462 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1464 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1466 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1468 2000-08-16 Juergen Vigna <jug@sad.it>
1470 * src/lyx_gui.C (runTime): added GUII RunTime support.
1472 * src/frontends/Makefile.am:
1473 * src/frontends/GUIRunTime.[Ch]:
1474 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1475 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1476 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1478 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1480 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1481 as this is already set in ${FRONTEND_INCLUDE} if needed.
1483 * configure.in (CPPFLAGS): setting the include dir for the frontend
1484 directory and don't set FRONTEND=xforms for now as this is executed
1487 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1489 * src/frontends/kde/Makefile.am:
1490 * src/frontends/kde/FormUrl.C:
1491 * src/frontends/kde/FormUrl.h:
1492 * src/frontends/kde/formurldialog.h:
1493 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1495 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1497 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1499 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1501 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1504 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1506 * src/WorkArea.C (work_area_handler): more work to get te
1507 FL_KEYBOARD to work with xforms 0.88 too, please test.
1509 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1511 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1513 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1516 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1518 * src/Timeout.h: remove Qt::emit hack.
1520 * several files: changes to allo doc++ compilation
1522 * src/lyxfunc.C (processKeySym): new method
1523 (processKeyEvent): comment out if FL_REVISION < 89
1525 * src/WorkArea.C: change some debugging levels.
1526 (WorkArea): set wantkey to FL_KEY_ALL
1527 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1528 clearer code and the use of compose with XForms 0.89. Change to
1529 use signals instead of calling methods in bufferview directly.
1531 * src/Painter.C: change some debugging levels.
1533 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1536 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1537 (workAreaKeyPress): new method
1539 2000-08-14 Juergen Vigna <jug@sad.it>
1541 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1543 * config/kde.m4: addes some features
1545 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1546 include missing xforms dialogs.
1548 * src/Timeout.h: a hack to be able to compile with qt/kde.
1550 * sigc++/.cvsignore: added acinclude.m4
1552 * lib/.cvsignore: added listerros
1554 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1555 xforms tree as objects are needed for other frontends.
1557 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1558 linking with not yet implemented xforms objects.
1560 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1562 2000-08-14 Baruch Even <baruch.even@writeme.com>
1564 * src/frontends/xforms/FormGraphics.h:
1565 * src/frontends/xforms/FormGraphics.C:
1566 * src/frontends/xforms/RadioButtonGroup.h:
1567 * src/frontends/xforms/RadioButtonGroup.C:
1568 * src/insets/insetgraphics.h:
1569 * src/insets/insetgraphics.C:
1570 * src/insets/insetgraphicsParams.h:
1571 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1572 instead of spaces, and various other indentation issues to make the
1573 sources more consistent.
1575 2000-08-14 Marko Vendelin <markov@ioc.ee>
1577 * src/frontends/gnome/dialogs/diaprint.glade
1578 * src/frontends/gnome/FormPrint.C
1579 * src/frontends/gnome/FormPrint.h
1580 * src/frontends/gnome/diaprint_callbacks.c
1581 * src/frontends/gnome/diaprint_callbacks.h
1582 * src/frontends/gnome/diaprint_interface.c
1583 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1586 * src/frontends/gnome/dialogs/diainserturl.glade
1587 * src/frontends/gnome/FormUrl.C
1588 * src/frontends/gnome/FormUrl.h
1589 * src/frontends/gnome/diainserturl_callbacks.c
1590 * src/frontends/gnome/diainserturl_callbacks.h
1591 * src/frontends/gnome/diainserturl_interface.c
1592 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1593 Gnome implementation
1595 * src/frontends/gnome/Dialogs.C
1596 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1597 all other dialogs. Copy all unimplemented dialogs from Xforms
1600 * src/frontends/gnome/support.c
1601 * src/frontends/gnome/support.h: support files generated by Glade
1605 * config/gnome.m4: Gnome configuration scripts
1607 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1608 configure --help message
1610 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1611 only if there are no events pendling in Gnome/Gtk. This enhances
1612 the performance of menus.
1615 2000-08-14 Allan Rae <rae@lyx.org>
1617 * lib/Makefile.am: listerrors cleaning
1619 * lib/listerrors: removed -- generated file
1620 * acinclude.m4: ditto
1621 * sigc++/acinclude.m4: ditto
1623 * src/frontends/xforms/forms/form_citation.fd:
1624 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1627 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1628 `updatesrc` and now we have a `test` target that does what `updatesrc`
1629 used to do. I didn't like having an install target that wasn't related
1632 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1633 on all except FormGraphics. This may yet happen. Followed by a major
1634 cleanup including using FL_TRANSIENT for most of the dialogs. More
1635 changes to come when the ButtonController below is introduced.
1637 * src/frontends/xforms/ButtonController.h: New file for managing up to
1638 four buttons on a dialog according to an externally defined policy.
1639 * src/frontends/xforms/Makefile.am: added above
1641 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1642 Apply and Cancel/Close buttons and everything in between and beyond.
1643 * src/frontends/Makefile.am: added above.
1645 * src/frontends/xforms/forms/form_preferences.fd:
1646 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1647 and removed variable 'status' as a result. Fixed the set_minsize thing.
1648 Use the new screen-font-update after checking screen fonts were changed
1649 Added a "Restore" button to restore the original lyxrc values while
1650 editing. This restores everything not just the last input changed.
1651 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1653 * src/LyXAction.C: screen-font-update added for updating buffers after
1654 screen font settings have been changed.
1655 * src/commandtags.h: ditto
1656 * src/lyxfunc.C: ditto
1658 * forms/lyx.fd: removed screen fonts dialog.
1659 * src/lyx_gui.C: ditto
1660 * src/menus.[Ch]: ditto
1661 * src/lyx.[Ch]: ditto
1662 * src/lyx_cb.C: ditto + code from here moved to make
1663 screen-font-update. And people wonder why progress on GUII is
1664 slow. Look at how scattered this stuff was! It takes forever
1667 * forms/fdfix.sh: Fixup the spacing after commas.
1668 * forms/makefile: Remove date from generated files. Fewer clashes now.
1669 * forms/bullet_forms.C.patch: included someones handwritten changes
1671 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1672 once I've discovered why LyXRC was made noncopyable.
1673 * src/lyx_main.C: ditto
1675 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1677 * src/frontends/xforms/forms/fdfix.sh:
1678 * src/frontends/xforms/forms/fdfixh.sed:
1679 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1680 * src/frontends/xforms/Form*.[hC]:
1681 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1682 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1683 provide a destructor for the struct FD_form_xxxx. Another version of
1684 the set_[max|min]size workaround and a few other cleanups. Actually,
1685 Angus' patch from 20000809.
1687 2000-08-13 Baruch Even <baruch.even@writeme.com>
1689 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1692 2000-08-11 Juergen Vigna <jug@sad.it>
1694 * src/insets/insetgraphics.C (InsetGraphics): changing init
1695 order because of warnings.
1697 * src/frontends/xforms/forms/makefile: adding patching .C with
1700 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1701 from .C.patch to .c.patch
1703 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1704 order because of warning.
1706 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1708 * src/frontends/Liason.C (setMinibuffer): new helper function
1710 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1712 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1714 * lib/ui/default.ui: commented out PaperLayout entry
1716 * src/frontends/xforms/form_document.[Ch]: new added files
1718 * src/frontends/xforms/FormDocument.[Ch]: ditto
1720 * src/frontends/xforms/forms/form_document.fd: ditto
1722 * src/frontends/xforms/forms/form_document.C.patch: ditto
1724 2000-08-10 Juergen Vigna <jug@sad.it>
1726 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1727 (InsetGraphics): initialized cacheHandle to 0.
1728 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1730 2000-08-10 Baruch Even <baruch.even@writeme.com>
1732 * src/graphics/GraphicsCache.h:
1733 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1734 correctly as a cache.
1736 * src/graphics/GraphicsCacheItem.h:
1737 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1740 * src/graphics/GraphicsCacheItem_pimpl.h:
1741 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1744 * src/insets/insetgraphics.h:
1745 * src/insets/insetgraphics.C: Changed from using a signal notification
1746 to polling when image is not loaded.
1748 2000-08-10 Allan Rae <rae@lyx.org>
1750 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1751 that there are two functions that have to been taken out of line by
1752 hand and aren't taken care of in the script. (Just a reminder note)
1754 * sigc++/macros/*.h.m4: Updated as above.
1756 2000-08-09 Juergen Vigna <jug@sad.it>
1758 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1760 * src/insets/insettabular.C: make drawing of single cell smarter.
1762 2000-08-09 Marko Vendelin <markov@ioc.ee>
1763 * src/frontends/gnome/Menubar_pimpl.C
1764 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1765 implementation: new files
1767 * src/frontends/gnome/mainapp.C
1768 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1771 * src/main.C: create Gnome main window
1773 * src/frontends/xforms/Menubar_pimpl.h
1774 * src/frontends/Menubar.C
1775 * src/frontends/Menubar.h: added method Menubar::update that calls
1776 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1778 * src/LyXView.C: calls Menubar::update to update the state
1781 * src/frontends/gnome/Makefile.am: added new files
1783 * src/frontends/Makefile.am: added frontend compiler options
1785 2000-08-08 Juergen Vigna <jug@sad.it>
1787 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1789 * src/bufferlist.C (close):
1790 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1791 documents if exiting without saving.
1793 * src/buffer.C (save): use removeAutosaveFile()
1795 * src/support/filetools.C (removeAutosaveFile): new function.
1797 * src/lyx_cb.C (MenuWrite): returns a bool now.
1798 (MenuWriteAs): check if file could really be saved and revert to the
1800 (MenuWriteAs): removing old autosavefile if existant.
1802 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1803 before Goto toggle declaration, because of compiler warning.
1805 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1807 * src/lyxfunc.C (MenuNew): small fix.
1809 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1811 * src/bufferlist.C (newFile):
1812 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1814 * src/lyxrc.C: added new_ask_filename tag
1816 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1818 * src/lyx.fd: removed code pertaining to form_ref
1819 * src/lyx.[Ch]: ditto
1820 * src/lyx_cb.C: ditto
1821 * src/lyx_gui.C: ditto
1822 * src/lyx_gui_misc.C: ditto
1824 * src/BufferView_pimpl.C (restorePosition): update buffer only
1827 * src/commandtags.h (LFUN_REFTOGGLE): removed
1828 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1829 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1830 (LFUN_REFBACK): renamed LFUN_REF_BACK
1832 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1833 * src/menus.C: ditto
1834 * src/lyxfunc.C (Dispatch): ditto.
1835 InsertRef dialog is now GUI-independent.
1837 * src/texrow.C: added using std::endl;
1839 * src/insets/insetref.[Ch]: strip out large amounts of code.
1840 The inset is now a container and this functionality is now
1841 managed by a new FormRef dialog
1843 * src/frontends/Dialogs.h (showRef, createRef): new signals
1845 * src/frontends/xforms/FormIndex.[Ch],
1846 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1847 when setting dialog's min/max size
1848 * src/frontends/xforms/FormIndex.[Ch]: ditto
1850 * src/frontends/xforms/FormRef.[Ch],
1851 src/frontends/xforms/forms/form_ref.fd: new xforms
1852 implementation of an InsetRef dialog
1854 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1857 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1858 ios::nocreate is not part of the standard. Removed.
1860 2000-08-07 Baruch Even <baruch.even@writeme.com>
1862 * src/graphics/Renderer.h:
1863 * src/graphics/Renderer.C: Added base class for rendering of different
1864 image formats into Pixmaps.
1866 * src/graphics/XPM_Renderer.h:
1867 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1868 in a different class.
1870 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1871 easily add support for other formats.
1873 * src/insets/figinset.C: plugged a leak of an X resource.
1875 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1877 * src/CutAndPaste.[Ch]: make all metods static.
1879 * development/Code_rules/Rules: more work, added section on
1880 Exceptions, and a References section.
1882 * a lot of header files: work to make doc++ able to generate the
1883 source documentation, some workarounds of doc++ problems. Doc++ is
1884 now able to generate the documentation.
1886 2000-08-07 Juergen Vigna <jug@sad.it>
1888 * src/insets/insettabular.C (recomputeTextInsets): removed function
1890 * src/tabular.C (SetWidthOfMulticolCell):
1892 (calculate_width_of_column_NMC): fixed return value so that it really
1893 only returns true if the column-width has changed (there where
1894 problems with muliticolumn-cells in this column).
1896 2000-08-04 Juergen Vigna <jug@sad.it>
1898 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1899 also on the scrollstatus of the inset.
1900 (workAreaMotionNotify): ditto.
1902 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1904 2000-08-01 Juergen Vigna <jug@sad.it>
1906 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1908 * src/commandtags.h:
1909 * src/LyXAction.C (init):
1910 * src/insets/inset.C (LocalDispatch): added support for
1913 * src/insets/inset.C (scroll): new functions.
1915 * src/insets/insettext.C (removeNewlines): new function.
1916 (SetAutoBreakRows): removes forced newlines in the text of the
1917 paragraph if autoBreakRows is set to false.
1919 * src/tabular.C (Latex): generates a parbox around the cell contents
1922 * src/frontends/xforms/FormTabular.C (local_update): removed
1923 the radio_useparbox button.
1925 * src/tabular.C (UseParbox): new function
1927 2000-08-06 Baruch Even <baruch.even@writeme.com>
1929 * src/graphics/GraphicsCache.h:
1930 * src/graphics/GraphicsCache.C:
1931 * src/graphics/GraphicsCacheItem.h:
1932 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1935 * src/insets/insetgraphics.h:
1936 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1937 drawing of the inline image.
1939 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1940 into the wrong position.
1942 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1945 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1947 * src/support/translator.h: move all typedefs to public section
1949 * src/support/filetools.C (MakeLatexName): return string const
1951 (TmpFileName): ditto
1952 (FileOpenSearch): ditto
1954 (LibFileSearch): ditto
1955 (i18nLibFileSearch): ditto
1958 (CreateTmpDir): ditto
1959 (CreateBufferTmpDir): ditto
1960 (CreateLyXTmpDir): ditto
1963 (MakeAbsPath): ditto
1965 (OnlyFilename): ditto
1967 (NormalizePath): ditto
1968 (CleanupPath): ditto
1969 (GetFileContents): ditto
1970 (ReplaceEnvironmentPath): ditto
1971 (MakeRelPath): ditto
1973 (ChangeExtension): ditto
1974 (MakeDisplayPath): ditto
1975 (do_popen): return cmdret const
1976 (findtexfile): return string const
1978 * src/support/DebugStream.h: add some /// to please doc++
1980 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1982 * src/texrow.C (same_rownumber): functor to use with find_if
1983 (getIdFromRow): rewritten to use find_if and to not update the
1984 positions. return true if row is found
1985 (increasePos): new method, use to update positions
1987 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1989 * src/lyxlex_pimpl.C (verifyTable): new method
1992 (GetString): return string const
1993 (pushTable): rewrite to use std::stack
1995 (setFile): better check
1998 * src/lyxlex.h: make LyXLex noncopyable
2000 * src/lyxlex.C (text): return char const * const
2001 (GetString): return string const
2002 (getLongString): return string const
2004 * src/lyx_gui_misc.C (askForText): return pair<...> const
2006 * src/lastfiles.[Ch] (operator): return string const
2008 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2009 istringstream not char const *.
2010 move token.end() out of loop.
2011 (readFile): move initializaton of token
2013 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2014 getIdFromRow is successful.
2016 * lib/bind/emacs.bind: don't include menus bind
2018 * development/Code_rules/Rules: the beginnings of making this
2019 better and covering more of the unwritten rules that we have.
2021 * development/Code_rules/Recommendations: a couple of wording
2024 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2026 * src/support/strerror.c: remove C++ comment.
2028 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2030 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2031 LFUN_INDEX_INSERT_LAST
2033 * src/texrow.C (getIdFromRow): changed from const_iterator to
2034 iterator, allowing code to compile with DEC cxx
2036 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2037 stores part of the class, as suggested by Allan. Will allow
2039 (apply): test to apply uses InsetCommandParams operator!=
2041 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2042 (apply): test to apply uses InsetCommandParams operator!=
2044 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2045 stores part of the class.
2046 (update): removed limits on min/max size.
2048 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2049 (apply): test to apply uses InsetCommandParams operator!=
2051 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
2052 (Read, Write, scanCommand, getCommand): moved functionality
2053 into InsetCommandParams.
2055 (getScreenLabel): made pure virtual
2056 new InsetCommandParams operators== and !=
2058 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
2059 c-tors based on InsetCommandParams. Removed others.
2060 * src/insets/insetinclude.[Ch]: ditto
2061 * src/insets/insetlabel.[Ch]: ditto
2062 * src/insets/insetparent.[Ch]: ditto
2063 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
2065 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
2066 insets derived from InsetCommand created using similar c-tors
2067 based on InsetCommandParams
2068 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
2069 * src/menus.C (ShowRefsMenu): ditto
2070 * src/paragraph.C (Clone): ditto
2071 * src/text2.C (SetCounter): ditto
2072 * src/lyxfunc.C (Dispatch) ditto
2073 Also recreated old InsetIndex behaviour exactly. Can now
2074 index-insert at the start of a paragraph and index-insert-last
2075 without launching the pop-up.
2077 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2079 * lib/lyxrc.example: mark te pdf options as non functional.
2081 * src/support/lstrings.C (strToInt): move initalization of tmpstr
2082 (isStrDbl): move tmpstr.end() out of loop.
2083 (strToDbl): move intialization of tmpstr
2084 (lowercase): return string const and move tmp.end() out of loop.
2085 (uppercase): return string const and move tmp.edn() out of loop.
2086 (prefixIs): add assertion
2091 (containsOnly): ditto
2092 (containsOnly): ditto
2093 (containsOnly): ditto
2094 (countChar): make last arg char not char const
2095 (token): return string const
2096 (subst): return string const, move tmp.end() out of loop.
2097 (subst): return string const, add assertion
2098 (strip): return string const
2099 (frontStrip): return string const, add assertion
2100 (frontStrip): return string const
2105 * src/support/lstrings.C: add inclde "LAssert.h"
2106 (isStrInt): move tmpstr.end() out of loop.
2108 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2109 toollist.end() out of loop.
2110 (deactivate): move toollist.end() out of loop.
2111 (update): move toollist.end() out of loop.
2112 (updateLayoutList): move tc.end() out of loop.
2113 (add): move toollist.end() out of loop.
2115 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2116 md.end() out of loop.
2118 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2120 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2123 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2124 (Erase): move insetlist.end() out of loop.
2126 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2127 ref to const string as first arg. Move initialization of some
2128 variables, whitespace changes.
2130 * src/kbmap.C (defkey): move table.end() out of loop.
2131 (kb_keymap): move table.end() out of loop.
2132 (findbinding): move table.end() out of loop.
2134 * src/MenuBackend.C (hasMenu): move end() out of loop.
2135 (getMenu): move end() out of loop.
2136 (getMenu): move menulist_.end() out of loop.
2138 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2140 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2143 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2144 (getFromLyXName): move infotab.end() out of loop.
2146 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2147 -fvtable-thunks -ffunction-sections -fdata-sections
2149 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2151 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2154 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2156 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2158 * src/frontends/xforms/FormCitation.[Ch],
2159 src/frontends/xforms/FormIndex.[Ch],
2160 src/frontends/xforms/FormToc.[Ch],
2161 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2163 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2165 * src/commandtags.h: renamed, created some flags for citation
2168 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2170 * src/lyxfunc.C (dispatch): use signals to insert index entry
2172 * src/frontends/Dialogs.h: new signal createIndex
2174 * src/frontends/xforms/FormCommand.[Ch],
2175 src/frontends/xforms/FormCitation.[Ch],
2176 src/frontends/xforms/FormToc.[Ch],
2177 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2179 * src/insets/insetindex.[Ch]: GUI-independent
2181 * src/frontends/xforms/FormIndex.[Ch],
2182 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2185 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2187 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2188 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2190 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2192 * src/insets/insetref.C (Latex): rewrite so that there is now
2193 question that a initialization is requested.
2195 * src/insets/insetcommand.h: reenable the hide signal
2197 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2199 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2200 fix handling of shortcuts (many bugs :)
2201 (add_lastfiles): ditto.
2203 * lib/ui/default.ui: fix a few shortcuts.
2205 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2207 * Makefile.am: Fix ``rpmdist'' target to return the exit
2208 status of the ``rpm'' command, instead of the last command in
2209 the chain (the ``rm lyx.xpm'' command, which always returns
2212 2000-08-02 Allan Rae <rae@lyx.org>
2214 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2215 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2216 * src/frontends/xforms/FormToc.C (FormToc): ditto
2218 * src/frontends/xforms/Makefile.am: A few forgotten files
2220 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2221 Signals-not-copyable-problem Lars' started commenting out.
2223 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2225 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2227 * src/insets/insetcommand.h: Signals is not copyable so anoter
2228 scheme for automatic hiding of forms must be used.
2230 * src/frontends/xforms/FormCitation.h: don't inerit from
2231 noncopyable, FormCommand already does that.
2232 * src/frontends/xforms/FormToc.h: ditto
2233 * src/frontends/xforms/FormUrl.h: ditto
2235 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2237 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2239 * src/insets/insetcommand.h (hide): new SigC::Signal0
2240 (d-tor) new virtual destructor emits hide signal
2242 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2243 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2245 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2246 LOF and LOT. Inset is now GUI-independent
2248 * src/insets/insetloa.[Ch]: redundant
2249 * src/insets/insetlof.[Ch]: ditto
2250 * src/insets/insetlot.[Ch]: ditto
2252 * src/frontends/xforms/forms/form_url.fd: tweaked!
2253 * src/frontends/xforms/forms/form_citation.fd: ditto
2255 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2256 dialogs dealing with InsetCommand insets
2258 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2259 FormCommand base class
2260 * src/frontends/xforms/FormUrl.[Ch]: ditto
2262 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2264 * src/frontends/xforms/FormToc.[Ch]: ditto
2266 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2267 passed a generic InsetCommand pointer
2268 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2270 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2271 and modified InsetTOC class
2272 * src/buffer.C: ditto
2274 * forms/lyx.fd: strip out old FD_form_toc code
2275 * src/lyx_gui_misc.C: ditto
2276 * src/lyx_gui.C: ditto
2277 * src/lyx_cb.C: ditto
2278 * src/lyx.[Ch]: ditto
2280 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2282 * src/support/utility.hpp: tr -d '\r'
2284 2000-08-01 Juergen Vigna <jug@sad.it>
2286 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2288 * src/commandtags.h:
2289 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2290 LFUN_TABULAR_FEATURES.
2292 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2293 LFUN_LAYOUT_TABULAR.
2295 * src/insets/insettabular.C (getStatus): implemented helper function.
2297 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2299 2000-07-31 Juergen Vigna <jug@sad.it>
2301 * src/text.C (draw): fixed screen update problem for text-insets.
2303 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2304 something changed probably this has to be added in various other
2307 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2309 2000-07-31 Baruch Even <baruch.even@writeme.com>
2311 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2312 templates to satisfy compaq cxx.
2315 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2317 * src/support/translator.h (equal_1st_in_pair::operator()): take
2318 const ref pair_type as arg.
2319 (equal_2nd_in_pair::operator()): ditto
2320 (Translator::~Translator): remove empty d-tor.
2322 * src/graphics/GraphicsCache.C: move include config.h to top, also
2323 put initialization of GraphicsCache::singleton here.
2324 (~GraphicsCache): move here
2325 (addFile): take const ref as arg
2328 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2330 * src/BufferView2.C (insertLyXFile): change te with/without header
2333 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2335 * src/frontends/xforms/FormGraphics.C (apply): add some
2336 static_cast. Not very nice, but required by compaq cxx.
2338 * src/frontends/xforms/RadioButtonGroup.h: include header
2339 <utility> instead of <pair.h>
2341 * src/insets/insetgraphicsParams.C: add using directive.
2342 (readResize): change return type to void.
2343 (readOrigin): ditto.
2345 * src/lyxfunc.C (getStatus): add missing break for build-program
2346 function; add test for Literate for export functions.
2348 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2349 entries in Options menu.
2351 2000-07-31 Baruch Even <baruch.even@writeme.com>
2353 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2354 protect against auto-allocation; release icon when needed.
2356 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2358 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2359 on usual typewriter.
2361 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2362 earlier czech.kmap), useful only for programming.
2364 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2366 * src/frontends/xforms/FormCitation.h: fix conditioning around
2369 2000-07-31 Juergen Vigna <jug@sad.it>
2371 * src/frontends/xforms/FormTabular.C (local_update): changed
2372 radio_linebreaks to radio_useparbox and added radio_useminipage.
2374 * src/tabular.C: made support for using minipages/parboxes.
2376 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2378 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2380 (descent): so the cursor is in the middle.
2381 (width): bit smaller box.
2383 * src/insets/insetgraphics.h: added display() function.
2385 2000-07-31 Baruch Even <baruch.even@writeme.com>
2387 * src/frontends/Dialogs.h: Added showGraphics signals.
2389 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2390 xforms form definition of the graphics dialog.
2392 * src/frontends/xforms/FormGraphics.h:
2393 * src/frontends/xforms/FormGraphics.C: Added files, the
2394 GUIndependent code of InsetGraphics
2396 * src/insets/insetgraphics.h:
2397 * src/insets/insetgraphics.C: Major writing to make it work.
2399 * src/insets/insetgraphicsParams.h:
2400 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2401 struct between InsetGraphics and GUI.
2403 * src/LaTeXFeatures.h:
2404 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2405 support for graphicx package.
2407 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2408 for the graphics inset.
2410 * src/support/translator.h: Added file, used in
2411 InsetGraphicsParams. this is a template to translate between two
2414 * src/frontends/xforms/RadioButtonGroup.h:
2415 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2416 way to easily control a radio button group.
2418 2000-07-28 Juergen Vigna <jug@sad.it>
2420 * src/insets/insettabular.C (LocalDispatch):
2421 (TabularFeatures): added support for lyx-functions of tabular features.
2422 (cellstart): refixed this function after someone wrongly changed it.
2424 * src/commandtags.h:
2425 * src/LyXAction.C (init): added support for tabular-features
2427 2000-07-28 Allan Rae <rae@lyx.org>
2429 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2430 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2431 triggers the callback for input checking. As a result we sometimes get
2432 "LyX: This shouldn't happen..." printed to cerr.
2433 (input): Started using status variable since I only free() on
2434 destruction. Some input checking for paths and font sizes.
2436 * src/frontends/xforms/FormPreferences.h: Use status to control
2437 activation of Ok and Apply
2439 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2440 callback. Also resized to stop segfaults with 0.88. The problem is
2441 that xforms-0.88 requires the folder to be wide enough to fit all the
2442 tabs. If it isn't it causes all sorts of problems.
2444 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2446 * src/frontends/xforms/forms/README: Reflect reality.
2448 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2449 * src/frontends/xforms/forms/makefile: ditto.
2451 * src/commandtags.h: Get access to new Preferences dialog
2452 * src/LyXAction.C: ditto
2453 * src/lyxfunc.C: ditto
2454 * lib/ui/default.ui: ditto
2456 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2458 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2460 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2463 * src/frontends/xforms/form_url.[Ch]: added.
2465 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2467 * src/insets/insetbib.h: fixed bug in previous commit
2469 * src/frontends/xforms/FormUrl.h: ditto
2471 * src/frontends/xforms/FormPrint.h: ditto
2473 * src/frontends/xforms/FormPreferences.h: ditto
2475 * src/frontends/xforms/FormCopyright.h: ditto
2477 * src/frontends/xforms/FormCitation.C: ditto
2479 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2480 private copyconstructor and private default contructor
2482 * src/support/Makefile.am: add utility.hpp
2484 * src/support/utility.hpp: new file from boost
2486 * src/insets/insetbib.h: set owner in clone
2488 * src/frontends/xforms/FormCitation.C: added missing include
2491 * src/insets/form_url.[Ch]: removed
2493 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2495 * development/lyx.spec.in
2496 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2497 file/directory re-organization.
2499 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2501 * src/insets/insetcommand.[Ch]: moved the string data and
2502 associated manipulation methods into a new stand-alone class
2503 InsetCommandParams. This class has two additional methods
2504 getAsString() and setFromString() allowing the contents to be
2505 moved around as a single string.
2506 (addContents) method removed.
2507 (setContents) method no longer virtual.
2509 * src/buffer.C (readInset): made use of new InsetCitation,
2510 InsetUrl constructors based on InsetCommandParams.
2512 * src/commandtags.h: add LFUN_INSERT_URL
2514 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2515 independent InsetUrl and use InsetCommandParams to extract
2516 string info and create new Insets.
2518 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2520 * src/frontends/xforms/FormCitation.C (apply): uses
2523 * src/frontends/xforms/form_url.C
2524 * src/frontends/xforms/form_url.h
2525 * src/frontends/xforms/FormUrl.h
2526 * src/frontends/xforms/FormUrl.C
2527 * src/frontends/xforms/forms/form_url.fd: new files
2529 * src/insets/insetcite.[Ch]: removed unused constructors.
2531 * src/insets/insetinclude.[Ch]: no longer store filename
2533 * src/insets/inseturl.[Ch]: GUI-independent.
2535 2000-07-26 Juergen Vigna <jug@sad.it>
2536 * renamed frontend from gtk to gnome as it is that what is realized
2537 and did the necessary changes in the files.
2539 2000-07-26 Marko Vendelin <markov@ioc.ee>
2541 * configure.in: cleaning up gnome configuration scripts
2543 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2545 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2546 shortcuts syndrom by redrawing them explicitely (a better solution
2547 would be appreciated).
2549 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2551 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2554 * src/lyx_cb.C (MenuExport): change html export to do the right
2555 thing depending of the document type (instead of having
2556 html-linuxdoc and html-docbook).
2557 * src/lyxfunc.C (getStatus): update for html
2558 * lib/ui/default.ui: simplify due to the above change.
2559 * src/menus.C (ShowFileMenu): update too (in case we need it).
2561 * src/MenuBackend.C (read): if a menu is defined twice, add the
2562 new entries to the exiting one.
2564 2000-07-26 Juergen Vigna <jug@sad.it>
2566 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2568 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2569 and return a bool if it did actual save the file.
2570 (AutoSave): don't autosave a unnamed doc.
2572 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2573 check if this is an UNNAMED new file and react to it.
2574 (newFile): set buffer to unnamed and change to not mark a new
2575 buffer dirty if I didn't do anything with it.
2577 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2579 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2581 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2582 friend as per Angus's patch posted to lyx-devel.
2584 * src/ext_l10n.h: updated
2586 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2587 gettext on the style string right before inserting them into the
2590 * autogen.sh: add code to extract style strings form layout files,
2591 not good enough yet.
2593 * src/frontends/gtk/.cvsignore: add MAKEFILE
2595 * src/MenuBackend.C (read): run the label strings through gettext
2596 before storing them in the containers.
2598 * src/ext_l10n.h: new file
2600 * autogen.sh : generate the ext_l10n.h file here
2602 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2604 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2607 * lib/ui/default.ui: fix a couple of typos.
2609 * config/gnome/gtk.m4: added (and added to the list of files in
2612 * src/insets/insetinclude.C (unique_id): fix when we are using
2613 lyxstring instead of basic_string<>.
2614 * src/insets/insettext.C (LocalDispatch): ditto.
2615 * src/support/filetools.C: ditto.
2617 * lib/configure.m4: create the ui/ directory if necessary.
2619 * src/LyXView.[Ch] (updateToolbar): new method.
2621 * src/BufferView_pimpl.C (buffer): update the toolbar when
2622 opening/closing buffer.
2624 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2626 * src/LyXAction.C (getActionName): enhance to return also the name
2627 and options of pseudo-actions.
2628 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2630 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2631 as an example of what is possible). Used in File->Build too (more
2632 useful) and in the import/export menus (to mimick the complicated
2633 handling of linuxdoc and friends). Try to update all the entries.
2635 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2638 * src/MenuBackend.C (read): Parse the new OptItem tag.
2640 * src/MenuBackend.h: Add a new optional_ data member (used if the
2641 entry should be omitted when the lyxfunc is disabled).
2643 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2644 function, used as a shortcut.
2645 (create_submenu): align correctly the shortcuts on the widest
2648 * src/MenuBackend.h: MenuItem.label() only returns the label of
2649 the menu without shortcut; new method shortcut().
2651 2000-07-14 Marko Vendelin <markov@ioc.ee>
2653 * src/frontends/gtk/Dialogs.C:
2654 * src/frontends/gtk/FormCopyright.C:
2655 * src/frontends/gtk/FormCopyright.h:
2656 * src/frontends/gtk/Makefile.am: added these source-files for the
2657 Gtk/Gnome support of the Copyright-Dialog.
2659 * src/main.C: added Gnome::Main initialization if using
2660 Gtk/Gnome frontend-GUI.
2662 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2664 * config/gnome/aclocal-include.m4
2665 * config/gnome/compiler-flags.m4
2666 * config/gnome/curses.m4
2667 * config/gnome/gnome--.m4
2668 * config/gnome/gnome-bonobo-check.m4
2669 * config/gnome/gnome-common.m4
2670 * config/gnome/gnome-fileutils.m4
2671 * config/gnome/gnome-ghttp-check.m4
2672 * config/gnome/gnome-gnorba-check.m4
2673 * config/gnome/gnome-guile-checks.m4
2674 * config/gnome/gnome-libgtop-check.m4
2675 * config/gnome/gnome-objc-checks.m4
2676 * config/gnome/gnome-orbit-check.m4
2677 * config/gnome/gnome-print-check.m4
2678 * config/gnome/gnome-pthread-check.m4
2679 * config/gnome/gnome-support.m4
2680 * config/gnome/gnome-undelfs.m4
2681 * config/gnome/gnome-vfs.m4
2682 * config/gnome/gnome-x-checks.m4
2683 * config/gnome/gnome-xml-check.m4
2684 * config/gnome/gnome.m4
2685 * config/gnome/gperf-check.m4
2686 * config/gnome/gtk--.m4
2687 * config/gnome/linger.m4
2688 * config/gnome/need-declaration.m4: added configuration scripts
2689 for Gtk/Gnome frontend-GUI
2691 * configure.in: added support for the --with-frontend=gtk option
2693 * autogen.sh: added config/gnome/* to list of config-files
2695 * acconfig.h: added define for GTKGUI-support
2697 * config/lyxinclude.m4: added --with-frontend[=value] option value
2698 for Gtk/Gnome frontend-GUI support.
2700 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2702 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2706 * src/paragraph.C (GetChar): remove non-const version
2708 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2709 (search_kw): use it.
2711 * src/lyx_main.C (init): if "preferences" exist, read that instead
2713 (ReadRcFile): return bool if the file could be read ok.
2714 (ReadUIFile): add a check to see if lex file is set ok.
2716 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2717 bastring can be used instead of lyxstring (still uses the old code
2718 if std::string is good enough or if lyxstring is used.)
2720 * src/encoding.C: make the arrays static, move ininle functions
2722 * src/encoding.h: from here.
2724 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2725 (parseSingleLyXformat2Token): move inset parsing to separate method
2726 (readInset): new private method
2728 * src/Variables.h: remove virtual from get().
2730 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2731 access to NEW_INSETS and NEW_TABULAR
2733 * src/MenuBackend.h: remove superfluous forward declaration of
2734 MenuItem. Add documentations tags "///", remove empty MenuItem
2735 destructor, remove private default contructor.
2737 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2739 (read): more string mlabel and mname to where they are used
2740 (read): remove unused variables mlabel and mname
2741 (defaults): unconditional clear, make menusetup take advantage of
2742 add returning Menu &.
2744 * src/LyXView.h: define NEW_MENUBAR as default
2746 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2747 to NEW_INSETS and NEW_TABULAR.
2748 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2749 defined. Change some of the "xxxx-inset-insert" functions names to
2752 * several files: more enahncements to NEW_INSETS and the resulting
2755 * lib/lyxrc.example (\date_insert_format): move to misc section
2757 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2758 bastring and use AC_CACHE_CHECK.
2759 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2760 the system have the newest methods. uses AC_CACHE_CHECK
2761 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2762 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2763 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2765 * configure.in: add LYX_CXX_GOOD_STD_STRING
2767 * acinclude.m4: recreated
2769 2000-07-24 Amir Karger
2771 * README: add Hebrew, Arabic kmaps
2774 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2776 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2779 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2781 * Lot of files: add pragma interface/implementation.
2783 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2785 * lib/ui/default.ui: new file (ans new directory). Contains the
2786 default menu and toolbar.
2788 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2789 global space. Toolbars are now read (as menus) in ui files.
2791 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2793 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2794 is disabled because the document is read-only. We want to have the
2795 toggle state of the function anyway.
2796 (getStatus): add code for LFUN_VC* functions (mimicking what is
2797 done in old-style menus)
2799 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2800 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2802 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2803 * src/BufferView_pimpl.C: ditto.
2804 * src/lyxfunc.C: ditto.
2806 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2807 default). This replaces old-style menus by new ones.
2809 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2810 MenuItem. Contain the data structure of a menu.
2812 * src/insets/insettext.C: use LyXView::setLayout instead of
2813 accessing directly the toolbar combox.
2814 * src/lyxfunc.C (Dispatch): ditto.
2816 * src/LyXView.C (setLayout): new method, which just calls
2817 Toolbar::setLayout().
2818 (updateLayoutChoice): move part of this method in Toolbar.
2820 * src/toolbar.[Ch]: removed.
2822 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2823 implementation the toolbar.
2825 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2826 the toolbar. It might make sense to merge it with ToolbarDefaults
2828 (setLayout): new function.
2829 (updateLayoutList): ditto.
2830 (openLayoutList): ditto.
2832 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2833 xforms implementation of the toolbar.
2834 (get_toolbar_func): comment out, since I do not
2835 know what it is good for.
2837 * src/ToolbarDefaults.h: Add the ItemType enum.
2839 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2840 for a list of allocated C strings. Used in Menubar xforms
2841 implementation to avoid memory leaks.
2843 * src/support/lstrings.[Ch] (uppercase): new version taking and
2847 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2848 * lib/bind/emacs.bind: ditto.
2850 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2852 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2853 forward decl of LyXView.
2855 * src/toolbar.C (toolbarItem): moved from toolbar.h
2856 (toolbarItem::clean): ditto
2857 (toolbarItem::~toolbarItem): ditto
2858 (toolbarItem::operator): ditto
2860 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2862 * src/paragraph.h: control the NEW_TABULAR define from here
2864 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2865 USE_TABULAR_INSETS to NEW_TABULAR
2867 * src/ToolbarDefaults.C: add include "lyxlex.h"
2869 * files using the old table/tabular: use NEW_TABULAR to control
2870 compilation of old tabular stuff.
2872 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2875 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2876 planemet in reading of old style floats, fix the \end_deeper
2877 problem when reading old style floats.
2879 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2881 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2883 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2885 * lib/bind/sciword.bind: updated.
2887 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2889 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2890 layout write problem
2892 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2894 * src/Makefile.am (INCLUDES): remove image directory from include
2897 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2898 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2900 * src/LyXView.C (create_form_form_main): read the application icon
2903 * lib/images/*.xpm: change the icons to use transparent color for
2906 * src/toolbar.C (update): change the color of the button when it
2909 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2911 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2912 setting explicitely the minibuffer.
2913 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2915 * src/LyXView.C (showState): new function. Shows font information
2916 in minibuffer and update toolbar state.
2917 (LyXView): call Toolbar::update after creating the
2920 * src/toolbar.C: change toollist to be a vector instead of a
2922 (BubbleTimerCB): get help string directly from the callback
2923 argument of the corresponding icon (which is the action)
2924 (set): remove unnecessary ugliness.
2925 (update): new function. update the icons (depressed, disabled)
2926 depending of the status of the corresponding action.
2928 * src/toolbar.h: remove help in toolbarItem
2930 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2932 * src/Painter.C (text): Added code for using symbol glyphs from
2933 iso10646 fonts. Currently diabled.
2935 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2938 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2939 magyar,turkish and usorbian.
2941 * src/paragraph.C (isMultiLingual): Made more efficient.
2943 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2946 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2947 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2948 Also changed the prototype to "bool math_insert_greek(char)".
2950 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2952 * lots of files: apply the NEW_INSETS on all code that will not be
2953 needed when we move to use the new insets. Enable the define in
2954 lyxparagrah.h to try it.
2956 * src/insets/insettabular.C (cellstart): change to be a static
2958 (InsetTabular): initialize buffer in the initializer list.
2960 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2962 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2963 form_print.h out of the header file. Replaced with forward
2964 declarations of the relevant struct.
2966 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2969 * src/commandtags.h: do not include "debug.h" which does not
2970 belong there. #include it in some other places because of this
2973 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2975 * src/insets/insetcaption.C: add a couple "using" directives.
2977 * src/toolbar.C (add): get the help text directly from lyxaction.
2979 (setPixmap): new function. Loads from disk and sets a pixmap on a
2980 botton; the name of the pixmap file is derived from the command
2983 * src/toolbar.h: remove members isBitmap and pixmap from
2986 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2987 * lib/images/: move many files from images/banner.xpm.
2989 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2991 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2992 * src/toolbar.C: ditto.
2993 * configure.in: ditto.
2994 * INSTALL: document.
2996 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2997 the spellchecker popup is closed from the WM.
2999 2000-07-19 Juergen Vigna <jug@sad.it>
3001 * src/insets/insetfloat.C (Write): small fix because we use the
3002 insetname for the type now!
3004 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3006 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3009 * src/frontends/Dialogs.h: removed hideCitation signal
3011 * src/insets/insetcite.h: added hide signal
3013 * src/insets/insetcite.C (~InsetCitation): emits new signal
3014 (getScreenLabel): "intelligent" label should now fit on the screen!
3016 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3018 * src/frontends/xforms/FormCitation.C (showInset): connects
3019 hide() to the inset's hide signal
3020 (show): modified to use fl_set_object_position rather than
3021 fl_set_object_geometry wherever possible
3023 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3025 * src/insets/lyxinset.h: add caption code
3027 * src/insets/insetfloat.C (type): new method
3029 * src/insets/insetcaption.C (Write): new method
3031 (LyxCode): new method
3033 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3034 to get it right together with using the FloatList.
3036 * src/commandtags.h: add LFUN_INSET_CAPTION
3037 * src/lyxfunc.C (Dispatch): handle it
3039 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3042 * src/Variables.[Ch]: make expand take a const reference, remove
3043 the destructor, some whitespace changes.
3045 * src/LyXAction.C (init): add caption-inset-insert
3047 * src/FloatList.C (FloatList): update the default floats a bit.
3049 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3051 * src/Variables.[Ch]: new files. Intended to be used for language
3052 specific strings (like \chaptername) and filename substitution in
3055 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
3057 * lib/kbd/american.kmap: update
3059 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
3061 * src/bufferparams.[Ch]: remove member allowAccents.
3063 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
3065 * src/LaTeXLog.C: use the log_form.h header.
3066 * src/lyx_gui.C: ditto.
3067 * src/lyx_gui_misc.C: ditto.
3068 * src/lyxvc.h: ditto.
3070 * forms/log_form.fd: new file, created from latexoptions.fd. I
3071 kept the log popup and nuked the options form.
3073 * src/{la,}texoptions.[Ch]: removed.
3074 * src/lyx_cb.C (LaTeXOptions): ditto
3076 * src/lyx_gui.C (create_forms): do not handle the
3077 fd_latex_options form.
3079 2000-07-18 Juergen Vigna <jug@sad.it>
3081 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
3082 name of the inset so that it can be requested outside (text2.C).
3084 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
3087 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3089 * src/mathed/formula.h (ConvertFont): constify
3091 * src/mathed/formula.C (Read): add warning if \end_inset is not
3092 found on expected place.
3094 * src/insets/lyxinset.h (ConvertFont): consify
3096 * src/insets/insetquotes.C (ConvertFont): constify
3097 * src/insets/insetquotes.h: ditto
3099 * src/insets/insetinfo.h: add labelfont
3101 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3102 (ascent): use labelfont
3106 (Write): make .lyx file a bit nicer
3108 * src/insets/insetfloat.C (Write): simplify somewhat...
3109 (Read): add warning if arg is not found
3111 * src/insets/insetcollapsable.C: add using std::max
3112 (Read): move string token and add warning in arg is not found
3113 (draw): use std::max to get the right ty
3114 (getMaxWidth): simplify by using std::max
3116 * src/insets/insetsection.h: new file
3117 * src/insets/insetsection.C: new file
3118 * src/insets/insetcaption.h: new file
3119 * src/insets/insetcaption.C: new file
3121 * src/insets/inset.C (ConvertFont): constify signature
3123 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3124 insetcaption.[Ch] and insetsection.[Ch]
3126 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3127 uses to use LABEL_COUNTER_CHAPTER instead.
3128 * src/text2.C (SetCounter): here
3130 * src/counters.h: new file
3131 * src/counters.C: new file
3132 * src/Sectioning.h: new file
3133 * src/Sectioning.C: new file
3135 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3137 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3139 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3142 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3145 2000-07-17 Juergen Vigna <jug@sad.it>
3147 * src/tabular.C (Validate): check if array-package is needed.
3148 (SetVAlignment): added support for vertical alignment.
3149 (SetLTFoot): better support for longtable header/footers
3150 (Latex): modified to support added features.
3152 * src/LaTeXFeatures.[Ch]: added array-package.
3154 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3156 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3159 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3161 * configure.in: do not forget to put a space after -isystem.
3163 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3165 * lib/kbd/arabic.kmap: a few fixes.
3167 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3169 * some whitespace chagnes to a number of files.
3171 * src/support/DebugStream.h: change to make it easier for
3172 doc++ to parse correctly.
3173 * src/support/lyxstring.h: ditto
3175 * src/mathed/math_utils.C (compara): change to have only one
3177 (MathedLookupBOP): change because of the above.
3179 * src/mathed/math_delim.C (math_deco_compare): change to have only
3181 (search_deco): change becasue of the above.
3183 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3184 instead of manually coded one.
3186 * src/insets/insetquotes.C (Read): read the \end_inset too
3188 * src/insets/insetlatex.h: remove file
3189 * src/insets/insetlatex.C: remove file
3191 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3193 (InsetPrintIndex): remove destructor
3195 * src/insets/insetinclude.h: remove default constructor
3197 * src/insets/insetfloat.C: work to make it work better
3199 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3201 * src/insets/insetcite.h (InsetCitation): remove default constructor
3203 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3205 * src/text.C (GetColumnNearX): comment out some currently unused code.
3207 * src/paragraph.C (writeFile): move some initializations closer to
3209 (CutIntoMinibuffer): small change to use new matchIT operator
3213 (InsertInset): ditto
3216 (InsetIterator): ditto
3217 (Erase): small change to use new matchFT operator
3219 (GetFontSettings): ditto
3220 (HighestFontInRange): ditto
3223 * src/lyxparagraph.h: some chars changed to value_type
3224 (matchIT): because of some stronger checking (perhaps too strong)
3225 in SGI STL, the two operator() unified to one.
3228 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3230 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3231 the last inset read added
3232 (parseSingleLyXformat2Token): some more (future) compability code added
3233 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3234 (parseSingleLyXformat2Token): set last_inset_read
3235 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3236 (parseSingleLyXformat2Token): don't double intializw string next_token
3238 * src/TextCache.C (text_fits::operator()): add const's to the signature
3239 (has_buffer::operator()): ditto
3241 * src/Floating.h: add some comments on the class
3243 * src/FloatList.[Ch] (typeExist): new method
3246 * src/BackStack.h: added default constructor, wanted by Gcc.
3248 2000-07-14 Juergen Vigna <jug@sad.it>
3250 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3252 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3254 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3255 do a redraw when the window is resized!
3256 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3258 * src/insets/insettext.C (resizeLyXText): added function to correctly
3259 being able to resize the LyXWindow.
3261 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3263 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3265 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3266 crashes when closing dialog to a deleted inset.
3268 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3269 method! Now similar to other insets.
3271 2000-07-13 Juergen Vigna <jug@sad.it>
3273 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3275 * lib/examples/Literate.lyx: small patch!
3277 * src/insets/insetbib.C (Read): added this function because of wrong
3278 Write (without [begin|end]_inset).
3280 2000-07-11 Juergen Vigna <jug@sad.it>
3282 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3283 as the insertInset could not be good!
3285 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3286 the bool param should not be last.
3288 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3290 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3291 did submit that to Karl).
3293 * configure.in: use -isystem instead of -I for X headers. This
3294 fixes a problem on solaris with a recent gcc;
3295 put the front-end code after the X detection code;
3296 configure in sigc++ before lib/
3298 * src/lyx_main.C (commandLineHelp): remove -display from command
3301 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3303 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3304 Also put in Makefile rules for building the ``listerrors''
3305 program for parsing errors from literate programs written in LyX.
3307 * lib/build-listerrors: Added small shell script as part of compile
3308 process. This builds a working ``listerrors'' binary if noweb is
3309 installed and either 1) the VNC X server is installed on the machine,
3310 or 2) the user is compiling from within a GUI. The existence of a GUI
3311 is necessary to use the ``lyx --export'' feature for now. This
3312 hack can be removed once ``lyx --export'' no longer requires a GUI to
3315 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3317 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3318 now passed back correctly from gcc and placed "under" error
3319 buttons in a Literate LyX source.
3321 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3323 * src/text.C (GetColumnNearX): Better behavior when a RTL
3324 paragraph is ended by LTR text.
3326 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3329 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3331 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3332 true when clipboard is empty.
3334 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3336 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3337 row of the paragraph.
3338 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3339 to prevent calculation of bidi tables
3341 2000-07-07 Juergen Vigna <jug@sad.it>
3343 * src/screen.C (ToggleSelection): added y_offset and x_offset
3346 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3349 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3351 * src/insets/insettext.C: fixed Layout-Display!
3353 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3355 * configure.in: add check for strings.h header.
3357 * src/spellchecker.C: include <strings.h> in order to have a
3358 definition for bzero().
3360 2000-07-07 Juergen Vigna <jug@sad.it>
3362 * src/insets/insettext.C (draw): set the status of the bv->text to
3363 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3365 * src/screen.C (DrawOneRow):
3366 (DrawFromTo): redraw the actual row if something has changed in it
3369 * src/text.C (draw): call an update of the toplevel-inset if something
3370 has changed inside while drawing.
3372 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3374 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3376 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3377 processing inside class.
3379 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3380 processing inside class.
3382 * src/insets/insetindex.h new struct Holder, consistent with other
3385 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3386 citation dialog from main code and placed it in src/frontends/xforms.
3387 Dialog launched through signals instead of callbacks
3389 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3391 * lyx.man: update the options description.
3393 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3395 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3396 handle neg values, set min width to 590, add doc about -display
3398 2000-07-05 Juergen Vigna <jug@sad.it>
3400 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3401 calls to BufferView *.
3403 * src/insets/insettext.C (checkAndActivateInset): small fix non
3404 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3406 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3407 their \end_inset token!
3409 2000-07-04 edscott <edscott@imp.mx>
3411 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3412 lib/lyxrc.example: added option \wheel_jump
3414 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3416 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3417 remove support for -width,-height,-xpos and -ypos.
3419 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3421 * src/encoding.[Ch]: New files.
3423 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3424 (text): Call to the underline() method only when needed.
3426 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3428 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3429 encoding(s) for the document.
3431 * src/bufferparams.C (BufferParams): Changed default value of
3434 * src/language.C (newLang): Removed.
3435 (items[]): Added encoding information for all defined languages.
3437 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3438 encoding choice button.
3440 * src/lyxrc.h (font_norm_type): New member variable.
3441 (set_font_norm_type): New method.
3443 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3444 paragraphs with different encodings.
3446 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3447 (TransformChar): Changed to work correctly with Arabic points.
3448 (draw): Added support for drawing Arabic points.
3449 (draw): Removed code for drawing underbars (this is done by
3452 * src/support/textutils.h (IsPrintableNonspace): New function.
3454 * src/BufferView_pimpl.h: Added "using SigC::Object".
3455 * src/LyXView.h: ditto.
3457 * src/insets/insetinclude.h (include_label): Changed to mutable.
3459 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3461 * src/mathed/math_iter.h: remove empty destructor
3463 * src/mathed/math_cursor.h: remove empty destructor
3465 * src/insets/lyxinset.h: add THEOREM_CODE
3467 * src/insets/insettheorem.[Ch]: new files
3469 * src/insets/insetminipage.C: (InsertInset): remove
3471 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3473 (InsertInset): remove
3475 * src/insets/insetlist.C: (InsertList): remove
3477 * src/insets/insetfootlike.[Ch]: new files
3479 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3482 (InsertInset): ditto
3484 * src/insets/insetert.C: remove include Painter.h, reindent
3485 (InsertInset): move to header
3487 * src/insets/insetcollapsable.h: remove explicit from default
3488 contructor, remove empty destructor, add InsertInset
3490 * src/insets/insetcollapsable.C (InsertInset): new func
3492 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3494 * src/vspace.h: add explicit to constructor
3496 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3497 \textcompwordmark, please test this.
3499 * src/lyxrc.C: set ascii_linelen to 65 by default
3501 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3503 * src/commandtags.h: add LFUN_INSET_THEOREM
3505 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3506 (makeLinuxDocFile): remove _some_ of the nice logic
3507 (makeDocBookFile): ditto
3509 * src/Painter.[Ch]: (~Painter): removed
3511 * src/LyXAction.C (init): entry for insettheorem added
3513 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3515 (deplog): code to detect files generated by LaTeX, needs testing
3518 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3520 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3522 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3524 * src/LaTeX.C (deplog): Add a check for files that are going to be
3525 created by the first latex run, part of the project to remove the
3528 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3529 contents to the extension list.
3531 2000-07-04 Juergen Vigna <jug@sad.it>
3533 * src/text.C (NextBreakPoint): added support for needFullRow()
3535 * src/insets/lyxinset.h: added needFullRow()
3537 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3540 * src/insets/insettext.C: lots of changes for update!
3542 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3544 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3546 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3548 * src/insets/insetinclude.C (InsetInclude): fixed
3549 initialization of include_label.
3550 (unique_id): now returns a string.
3552 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3554 * src/LaTeXFeatures.h: new member IncludedFiles, for
3555 a map of key, included file name.
3557 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3558 with the included files for inclusion in SGML preamble,
3559 i. e., linuxdoc and docbook.
3562 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3563 nice (is the generated linuxdoc code to be exported?), that
3564 allows to remove column, and only_body that will be true for
3565 slave documents. Insets are allowed inside SGML font type.
3566 New handling of the SGML preamble for included files.
3567 (makeDocBookFile): the same for docbook.
3569 * src/insets/insetinclude.h:
3570 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3572 (DocBook): new export methods.
3574 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3575 and makeDocBookFile.
3577 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3578 formats to export with command line argument -x.
3580 2000-06-29 Juergen Vigna <jug@sad.it>
3582 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3583 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3585 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3586 region could already been cleared by an inset!
3588 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3590 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3593 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3595 (cursorToggle): remove special handling of lyx focus.
3597 2000-06-28 Juergen Vigna <jug@sad.it>
3599 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3602 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3604 * src/insets/insetindex.C (Edit): add a callback when popup is
3607 * src/insets/insettext.C (LocalDispatch):
3608 * src/insets/insetmarginal.h:
3609 * src/insets/insetlist.h:
3610 * src/insets/insetfoot.h:
3611 * src/insets/insetfloat.h:
3612 * src/insets/insetert.h: add a missing std:: qualifier.
3614 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3616 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3619 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3621 * src/insets/insettext.C (Read): remove tmptok unused variable
3622 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3623 (InsertInset): change for new InsetInset code
3625 * src/insets/insettext.h: add TEXT inline method
3627 * src/insets/insettext.C: remove TEXT macro
3629 * src/insets/insetmarginal.C (Write): new method
3630 (Latex): change output slightly
3632 * src/insets/insetfoot.C (Write): new method
3633 (Latex): change output slightly (don't use endl when no need)
3635 * src/insets/insetert.C (Write): new method
3637 * src/insets/insetcollapsable.h: make button_length, button_top_y
3638 and button_bottm_y protected.
3640 * src/insets/insetcollapsable.C (Write): simplify code by using
3641 tostr. Also do not output the float name, the children class
3642 should to that to get control over own arguments
3644 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3645 src/insets/insetminipage.[Ch]:
3648 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3650 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3652 * src/Makefile.am (lyx_SOURCES): add the new files
3654 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3655 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3656 * src/commandtags.h: ditto
3658 * src/LaTeXFeatures.h: add a std::set of used floattypes
3660 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3662 * src/FloatList.[Ch] src/Floating.h: new files
3664 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3666 * src/lyx_cb.C (TableApplyCB): ditto
3668 * src/text2.C: ditto
3669 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3670 (parseSingleLyXformat2Token): ditto + add code for
3671 backwards compability for old float styles + add code for new insets
3673 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3675 (InsertInset(size_type, Inset *, LyXFont)): new method
3676 (InsetChar(size_type, char)): changed to use the other InsetChar
3677 with a LyXFont(ALL_INHERIT).
3678 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3679 insert the META_INSET.
3681 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3683 * sigc++/thread.h (Threads): from here
3685 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3686 definition out of line
3687 * sigc++/scope.h: from here
3689 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3691 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3692 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3694 * Makefile.am (bindist): new target.
3696 * INSTALL: add instructions for doing a binary distribution.
3698 * development/tools/README.bin.example: update a bit.
3700 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3703 * lib/lyxrc.example: new lyxrc tag \set_color.
3705 * src/lyxfunc.C (Dispatch):
3706 * src/commandtags.h:
3707 * src/LyXAction.C: new lyxfunc "set-color".
3709 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3710 and an x11name given as strings.
3712 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3713 cache when a color is changed.
3715 2000-06-26 Juergen Vigna <jug@sad.it>
3717 * src/lyxrow.C (width): added this functions and variable.
3719 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3722 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3724 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3726 * images/undo_bw.xpm: new icon.
3727 * images/redo_bw.xpm: ditto.
3729 * configure.in (INSTALL_SCRIPT): change value to
3730 ${INSTALL} to avoid failures of install-script target.
3731 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3733 * src/BufferView.h: add a magic "friend" declaration to please
3736 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3738 * forms/cite.fd: modified to allow resizing without messing
3741 * src/insetcite.C: Uses code from cite.fd almost without
3743 User can now resize dialog in the x-direction.
3744 Resizing the dialog in the y-direction is prevented, as the
3745 code does this intelligently already.
3747 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3749 * INSTALL: remove obsolete entry in "problems" section.
3751 * lib/examples/sl_*.lyx: update of the slovenian examples.
3753 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3755 2000-06-23 Juergen Vigna <jug@sad.it>
3757 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3759 * src/buffer.C (resize): delete the LyXText of textinsets.
3761 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3763 * src/insets/lyxinset.h: added another parameter 'cleared' to
3764 the draw() function.
3766 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3767 unlocking inset in inset.
3769 2000-06-22 Juergen Vigna <jug@sad.it>
3771 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3772 of insets and moved first to LyXText.
3774 * src/mathed/formulamacro.[Ch]:
3775 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3777 2000-06-21 Juergen Vigna <jug@sad.it>
3779 * src/text.C (GetVisibleRow): look if I should clear the area or not
3780 using Inset::doClearArea() function.
3782 * src/insets/lyxinset.h: added doClearArea() function and
3783 modified draw(Painter &, ...) to draw(BufferView *, ...)
3785 * src/text2.C (UpdateInset): return bool insted of int
3787 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3789 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3790 combox in the character popup
3792 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3793 BufferParams const & params
3795 2000-06-20 Juergen Vigna <jug@sad.it>
3797 * src/insets/insettext.C (SetParagraphData): set insetowner on
3800 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3802 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3803 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3805 (form_main_): remove
3807 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3808 (create_form_form_main): remove FD_form_main stuff, connect to
3809 autosave_timeout signal
3811 * src/LyXView.[Ch] (getMainForm): remove
3812 (UpdateTimerCB): remove
3813 * src/BufferView_pimpl.h: inherit from SigC::Object
3815 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3816 signal instead of callback
3818 * src/BufferView.[Ch] (cursorToggleCB): remove
3820 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3822 * src/BufferView_pimpl.C: changes because of the one below
3824 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3825 instead of storing a pointer to a LyXText.
3827 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3829 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3831 * src/lyxparagraph.h
3833 * src/paragraph.C: Changed fontlist to a sorted vector.
3835 2000-06-19 Juergen Vigna <jug@sad.it>
3837 * src/BufferView.h: added screen() function.
3839 * src/insets/insettext.C (LocalDispatch): some selection code
3842 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3844 * src/insets/insettext.C (SetParagraphData):
3846 (InsetText): fixes for multiple paragraphs.
3848 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3850 * development/lyx.spec.in: Call configure with ``--without-warnings''
3851 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3852 This should be fine, however, since we generally don't want to be
3853 verbose when making an RPM.
3855 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3857 * lib/scripts/fig2pstex.py: New file
3859 2000-06-16 Juergen Vigna <jug@sad.it>
3861 * src/insets/insettabular.C (UpdateLocal):
3862 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3863 (LocalDispatch): Changed all functions to use LyXText.
3865 2000-06-15 Juergen Vigna <jug@sad.it>
3867 * src/text.C (SetHeightOfRow): call inset::update before requesting
3870 * src/insets/insettext.C (update):
3871 * src/insets/insettabular.C (update): added implementation
3873 * src/insets/lyxinset.h: added update function
3875 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3877 * src/text.C (SelectNextWord): protect against null pointers with
3878 old-style string streams. (fix from Paul Theo Gonciari
3881 * src/cite.[Ch]: remove erroneous files.
3883 * lib/configure.m4: update the list of created directories.
3885 * src/lyxrow.C: include <config.h>
3886 * src/lyxcursor.C: ditto.
3888 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3890 * lib/examples/decimal.lyx: new example file from Mike.
3892 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3893 to find template definitions (from Dekel)
3895 * src/frontends/.cvsignore: add a few things.
3897 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3899 * src/Timeout.C (TimeOut): remove default argument.
3901 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3904 * src/insets/ExternalTemplate.C: add a "using" directive.
3906 * src/lyx_main.h: remove the act_ struct, which seems unused
3909 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3911 * LyX Developers Meeting: All files changed, due to random C++ (by
3912 coincidence) code generator script.
3914 - external inset (cool!)
3915 - initial online editing of preferences
3916 - insettabular breaks insettext(s contents)
3918 - some DocBook fixes
3919 - example files update
3920 - other cool stuff, create a diff and look for yourself.
3922 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3924 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3925 -1 this is a non-line-breaking textinset.
3927 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3928 if there is no width set.
3930 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3932 * Lots of files: Merged the dialogbase branch.
3934 2000-06-09 Allan Rae <rae@lyx.org>
3936 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3937 and the Dispatch methods that used it.
3939 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3940 access to functions formerly kept in Dispatch.
3942 2000-05-19 Allan Rae <rae@lyx.org>
3944 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3945 made to_page and count_copies integers again. from_page remains a
3946 string however because I want to allow entry of a print range like
3947 "1,4,22-25" using this field.
3949 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3950 and printer-params-get. These aren't useful from the minibuffer but
3951 could be used by a script/LyXServer app provided it passes a suitable
3952 auto_mem_buffer. I guess I should take a look at how the LyXServer
3953 works and make it support xtl buffers.
3955 * sigc++/: updated to libsigc++-1.0.1
3957 * src/xtl/: updated to xtl-1.3.pl.11
3959 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3960 those changes done to the files in src/ are actually recreated when
3961 they get regenerated. Please don't ever accept a patch that changes a
3962 dialog unless that patch includes the changes to the corresponding *.fd
3965 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3966 stringOnlyContains, renamed it and generalised it.
3968 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3969 branch. Removed the remaining old form_print code.
3971 2000-04-26 Allan Rae <rae@lyx.org>
3973 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3974 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3976 2000-04-25 Allan Rae <rae@lyx.org>
3978 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3979 against a base of xtl-1.3.pl.4
3981 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3982 filter the Id: entries so they still show the xtl version number
3985 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3986 into the src/xtl code. Patch still pending with José (XTL)
3988 2000-04-24 Allan Rae <rae@lyx.org>
3990 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3991 both more generic and much safer. Use the new template functions.
3992 * src/buffer.[Ch] (Dispatch): ditto.
3994 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3995 and mem buffer more intelligently. Also a little general cleanup.
3998 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3999 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4000 * src/xtl/Makefile.am: ditto.
4001 * src/xtl/.cvsignore: ditto.
4002 * src/Makefile.am: ditto.
4004 * src/PrinterParams.h: Removed the macros member functions. Added a
4005 testInvariant member function. A bit of tidying up and commenting.
4006 Included Angus's idea for fixing operation with egcs-1.1.2.
4008 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4009 cool expansion of XTL's mem_buffer to support automatic memory
4010 management within the buffer itself. Removed the various macros and
4011 replaced them with template functions that use either auto_mem_buffer
4012 or mem_buffer depending on a #define. The mem_buffer support will
4013 disappear as soon as the auto_mem_buffer is confirmed to be good on
4014 other platforms/compilers. That is, it's there so you've got something
4017 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4018 effectively forked XTL. However I expect José will include my code
4019 into the next major release. Also fixed a memory leak.
4020 * src/xtl/text.h: ditto.
4021 * src/xtl/xdr.h: ditto.
4022 * src/xtl/giop.h: ditto.
4024 2000-04-16 Allan Rae <rae@lyx.org>
4026 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4027 by autogen.sh and removed by maintainer-clean anyway.
4028 * .cvsignore, sigc++/.cvsignore: Support the above.
4030 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4032 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4034 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4035 macros, renamed static callback-target member functions to suit new
4036 scheme and made them public.
4037 * src/frontends/xforms/forms/form_print.fd: ditto.
4038 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4040 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4043 * src/xtl/: New directory containing a minimal distribution of XTL.
4044 This is XTL-1.3.pl.4.
4046 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4048 2000-04-15 Allan Rae <rae@lyx.org>
4050 * development/tools/makeLyXsigc.sh: Remove the library version numbers
4052 * sigc++/: Updated to libsigc++-1.0.0
4054 2000-04-14 Allan Rae <rae@lyx.org>
4056 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
4057 use the generic ones in future. I'll modify my conversion script.
4059 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
4061 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
4062 (CloseAllBufferRelatedDialogs): Renamed.
4063 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
4065 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
4066 of the generic ones. These are the same ones my conversion script
4069 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
4070 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
4071 * src/buffer.C (Dispatch): ditto
4073 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
4074 functions for updating and hiding buffer dependent dialogs.
4075 * src/BufferView.C (buffer): ditto
4076 * src/buffer.C (setReadonly): ditto
4077 * src/lyxfunc.C (CloseBuffer): ditto
4079 * src/buffer.h: Take setReadonly() out of line so I don't have to include
4080 Dialogs.h, and hence all the SigC stuff, into every file that includes
4081 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
4083 * src/BufferView2.C: reduce the number of headers included by buffer.h
4085 2000-04-11 Allan Rae <rae@lyx.org>
4087 * src/frontends/xforms/xform_macros.h: A small collection of macros
4088 for building C callbacks.
4090 * src/frontends/xforms/Makefile.am: Added above file.
4092 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
4093 scheme again. This time it should work for JMarc. If this is
4094 successful I'll revise my conversion script to automate some of this.
4095 The static member functions in the class also have to be public for
4096 this scheme will work. If the scheme works (it's almost identical to
4097 the way BufferView::cursorToggleCB is handled so it should work) then
4098 FormCopyright and FormPrint will be ready for inclusion into the main
4099 trunk immediately after 1.1.5 is released -- provided we're prepared
4100 for complaints about lame compilers not handling XTL.
4102 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4104 2000-04-07 Allan Rae <rae@lyx.org>
4106 * config/lyxinclude.m4: A bit more tidying up (Angus)
4108 * src/LString.h: JMarc's <string> header fix
4110 * src/PrinterParams.h: Used string for most data to remove some
4111 ugly code in the Print dialog and avoid even uglier code when
4112 appending the ints to a string for output.
4114 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4115 and moved "default:" back to the end of switch statement. Cleaned
4116 up the printing so it uses the right function calls and so the
4117 "print to file" option actually puts the file in the right directory.
4119 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4121 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4122 and Ok+Apply button control into a separate method: input (Angus).
4123 (input) Cleaned it up and improved it to be very thorough now.
4124 (All CB) static_cast used instead of C style cast (Angus). This will
4125 probably change again once we've worked out how to keep gcc-2.8.1 happy
4126 with real C callbacks.
4127 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4128 ignore some of the bool settings and has random numbers instead. Needs
4129 some more investigation. Added other input length checks and checking
4130 of file and printer names.
4132 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4133 would link (Angus). Seems the old code doesn't compile with the pragma
4134 statement either. Separated callback entries from internal methods.
4136 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4138 2000-03-17 Allan Rae <rae@lyx.org>
4140 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4141 need it? Maybe it could go in Dialogs instead? I could make it a
4142 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4143 values to get the bool return value.
4144 (Dispatch): New overloaded method for xtl support.
4146 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4147 extern "C" callback instead of static member functions. Hopefully,
4148 JMarc will be able to compile this. I haven't changed
4149 forms/form_copyright.fd yet. Breaking one of my own rules already.
4151 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4152 because they aren't useful from the minibuffer. Maybe a LyXServer
4153 might want a help message though?
4155 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4157 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4158 xtl which needs both rtti and exceptions.
4160 * src/support/Makefile.am:
4161 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4163 * src/frontends/xforms/input_validators.[ch]: input filters and
4164 validators. These conrol what keys are valid in input boxes.
4165 Use them and write some more. Much better idea than waiting till
4166 after the user has pressed Ok to say that the input fields don't make
4169 * src/frontends/xforms/Makefile.am:
4170 * src/frontends/xforms/forms/form_print.fd:
4171 * src/frontends/xforms/forms/makefile:
4172 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4173 new scheme. Still have to make sure I haven't missed anything from
4174 the current implementation.
4176 * src/Makefile.am, src/PrinterParams.h: New data store.
4178 * other files: Added a couple of copyright notices.
4180 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4182 * src/insets/insetbib.h: move Holder struct in public space.
4184 * src/frontends/include/DialogBase.h: use SigC:: only when
4185 SIGC_CXX_NAMESPACES is defined.
4186 * src/frontends/include/Dialogs.h: ditto.
4188 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4190 * src/frontends/xforms/FormCopyright.[Ch]: do not
4191 mention SigC:: explicitely.
4193 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4195 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4196 deals with testing KDE in main configure.in
4197 * configure.in: ditto.
4199 2000-02-22 Allan Rae <rae@lyx.org>
4201 * Lots of files: Merged from HEAD
4203 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4204 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4206 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4208 * sigc++/: new minidist.
4210 2000-02-14 Allan Rae <rae@lyx.org>
4212 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4214 2000-02-08 Juergen Vigna <jug@sad.it>
4216 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4217 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4219 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4220 for this port and so it is much easier for other people to port
4221 dialogs in a common development environment.
4223 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4224 the QT/KDE implementation.
4226 * src/frontends/kde/Dialogs.C:
4227 * src/frontends/kde/FormCopyright.C:
4228 * src/frontends/kde/FormCopyright.h:
4229 * src/frontends/kde/Makefile.am:
4230 * src/frontends/kde/formcopyrightdialog.C:
4231 * src/frontends/kde/formcopyrightdialog.h:
4232 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4233 for the kde support of the Copyright-Dialog.
4235 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4236 subdir-substitution instead of hardcoded 'xforms' as we now have also
4239 * src/frontends/include/DialogBase.h (Object): just commented the
4240 label after #endif (nasty warning and I don't like warnings ;)
4242 * src/main.C (main): added KApplication initialization if using
4245 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4246 For now only the KDE event-loop is added if frontend==kde.
4248 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4250 * configure.in: added support for the --with-frontend[=value] option
4252 * autogen.sh: added kde.m4 file to list of config-files
4254 * acconfig.h: added define for KDEGUI-support
4256 * config/kde.m4: added configuration functions for KDE-port
4258 * config/lyxinclude.m4: added --with-frontend[=value] option with
4259 support for xforms and KDE.
4261 2000-02-08 Allan Rae <rae@lyx.org>
4263 * all Makefile.am: Fixed up so the make targets dist, distclean,
4264 install and uninstall all work even if builddir != srcdir. Still
4265 have a new sigc++ minidist update to come.
4267 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4269 2000-02-01 Allan Rae <rae@lyx.org>
4271 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4272 Many mods to get builddir != srcdir working.
4274 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4275 for building on NT and so we can do the builddir != srcdir stuff.
4277 2000-01-30 Allan Rae <rae@lyx.org>
4279 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4280 This will stay in "rae" branch. We probably don't really need it in
4281 the main trunk as anyone who wants to help programming it should get
4282 a full library installed also. So they can check both included and
4283 system supplied library compilation.
4285 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4286 Added a 'mini' distribution of libsigc++. If you feel the urge to
4287 change something in these directories - Resist it. If you can't
4288 resist the urge then you should modify the following script and rebuild
4289 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4290 all happen. Still uses a hacked version of libsigc++'s configure.in.
4291 I'm quite happy with the results. I'm not sure the extra work to turn
4292 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4293 worth the trouble and would probably lead to extra maintenance
4295 I haven't tested the following important make targets: install, dist.
4296 Not ready for prime time but very close. Maybe 1.1.5.
4298 * development/tools/makeLyXsigc.sh: A shell script to automatically
4299 generate our mini-dist of libsigc++. It can only be used with a CVS
4300 checkout of libsigc++ not a tarball distribution. It's well commented.
4301 This will end up as part of the libsigc++ distribution so other apps
4302 can easily have an included mini-dist. If someone makes mods to the
4303 sigc++ subpackage without modifying this script to generate those
4304 changes I'll be very upset!
4306 * src/frontends/: Started the gui/system indep structure.
4308 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4309 to access the gui-indep dialogs are in this class. Much improved
4310 design compared to previous revision. Lars, please refrain from
4311 moving this header into src/ like you did with Popups.h last time.
4313 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4315 * src/frontends/xforms/: Started the gui-indep system with a single
4316 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4319 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4320 Here you'll find a very useful makefile and automated fdfix.sh that
4321 makes updating dailogs a no-brainer -- provided you follow the rules
4322 set out in the README. I'm thinking about adding another script to
4323 automatically generate skeleton code for a new dialog given just the
4326 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4327 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4328 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4330 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4332 * src/support/LSubstring.C (operator): simplify
4334 * src/lyxtext.h: removed bparams, use buffer_->params instead
4336 * src/lyxrow.h: make Row a real class, move all variables to
4337 private and use accessors.
4339 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4341 (isRightToLeftPar): ditto
4342 (ChangeLanguage): ditto
4343 (isMultiLingual): ditto
4346 (SimpleTeXOnePar): ditto
4347 (TeXEnvironment): ditto
4348 (GetEndLabel): ditto
4350 (SetOnlyLayout): ditto
4351 (BreakParagraph): ditto
4352 (BreakParagraphConservative): ditto
4353 (GetFontSettings): ditto
4355 (CopyIntoMinibuffer): ditto
4356 (CutIntoMinibuffer): ditto
4357 (PasteParagraph): ditto
4358 (SetPExtraType): ditto
4359 (UnsetPExtraType): ditto
4360 (DocBookContTableRows): ditto
4361 (SimpleDocBookOneTablePar): ditto
4363 (TeXFootnote): ditto
4364 (SimpleTeXOneTablePar): ditto
4365 (TeXContTableRows): ditto
4366 (SimpleTeXSpecialChars): ditto
4369 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4370 to private and use accessors.
4372 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4373 this, we did not use it anymore and has not been for ages. Just a
4374 waste of cpu cycles.
4376 * src/language.h: make Language a real class, move all variables
4377 to private and use accessors.
4379 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4380 (create_view): remove
4381 (update): some changes for new timer
4382 (cursorToggle): use new timer
4383 (beforeChange): change for new timer
4385 * src/BufferView.h (cursorToggleCB): removed last paramter because
4388 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4389 (cursorToggleCB): change because of new timer code
4391 * lib/CREDITS: updated own mailaddress
4393 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4395 * src/support/filetools.C (PutEnv): fix the code in case neither
4396 putenv() nor setenv() have been found.
4398 * INSTALL: mention the install-strip Makefile target.
4400 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4401 read-only documents.
4403 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4405 * lib/reLyX/configure.in (VERSION): avoid using a previously
4406 generated reLyX wrapper to find out $prefix.
4408 * lib/examples/eu_adibide_lyx-atua.lyx:
4409 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4410 translation of the Tutorial (Dooteo)
4412 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4414 * forms/cite.fd: new citation dialog
4416 * src/insetcite.[Ch]: the new citation dialog is moved into
4419 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4422 * src/insets/insetcommand.h: data members made private.
4424 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4426 * LyX 1.1.5 released
4428 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4430 * src/version.h (LYX_RELEASE): to 1.1.5
4432 * src/spellchecker.C (RunSpellChecker): return false if the
4433 spellchecker dies upon creation.
4435 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4437 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4438 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4442 * lib/CREDITS: update entry for Martin Vermeer.
4444 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4446 * src/text.C (draw): Draw foreign language bars at the bottom of
4447 the row instead of at the baseline.
4449 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4451 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4453 * lib/bind/de_menus.bind: updated
4455 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4457 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4459 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4461 * src/menus.C (Limit_string_length): New function
4462 (ShowTocMenu): Limit the number of items/length of items in the
4465 * src/paragraph.C (String): Correct result for a paragraph inside
4468 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4470 * src/bufferlist.C (close): test of buf->getuser() == NULL
4472 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4474 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4475 Do not call to SetCursor when the paragraph is a closed footnote!
4477 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4479 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4482 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4484 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4487 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4488 reference popup, that activates the reference-back action
4490 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4492 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4493 the menus. Also fixed a bug.
4495 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4496 the math panels when switching buffers (unless new buffer is readonly).
4498 * src/BufferView.C (NoSavedPositions)
4499 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4501 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4503 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4504 less of dvi dirty or not.
4506 * src/trans_mgr.[Ch] (insert): change first parameter to string
4509 * src/chset.[Ch] (encodeString): add const to first parameter
4511 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4513 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4517 * src/LaTeX.C (deplog): better searching for dependency files in
4518 the latex log. Uses now regexps.
4520 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4521 instead of the box hack or \hfill.
4523 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4525 * src/lyxfunc.C (doImportHelper): do not create the file before
4526 doing the actual import.
4527 (doImportASCIIasLines): create a new file before doing the insert.
4528 (doImportASCIIasParagraphs): ditto.
4530 * lib/lyxrc.example: remove mention of non-existing commands
4532 * lyx.man: remove mention of color-related switches.
4534 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4536 * src/lyx_gui.C: remove all the color-related ressources, which
4537 are not used anymore.
4539 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4542 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4544 * src/lyxrc.C (read): Add a missing break in the switch
4546 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4548 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4550 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4553 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4555 * src/text.C (draw): draw bars under foreign language words.
4557 * src/LColor.[Ch]: add LColor::language
4559 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4561 * src/lyxcursor.h (boundary): New member variable
4563 * src/text.C (IsBoundary): New methods
4565 * src/text.C: Use the above for currect cursor movement when there
4566 is both RTL & LTR text.
4568 * src/text2.C: ditto
4570 * src/bufferview_funcs.C (ToggleAndShow): ditto
4572 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4574 * src/text.C (DeleteLineForward): set selection to true to avoid
4575 that DeleteEmptyParagraphMechanism does some magic. This is how it
4576 is done in all other functions, and seems reasonable.
4577 (DeleteWordForward): do not jump over non-word stuff, since
4578 CursorRightOneWord() already does it.
4580 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4581 DeleteWordBackward, since they seem safe to me (since selection is
4582 set to "true") DeleteEmptyParagraphMechanism does nothing.
4584 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4586 * src/lyx_main.C (easyParse): simplify the code by factoring the
4587 part that removes parameters from the command line.
4588 (LyX): check wether wrong command line options have been given.
4590 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4592 * src/lyx_main.C : add support for specifying user LyX
4593 directory via command line option -userdir.
4595 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4597 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4598 the number of items per popup.
4599 (Add_to_refs_menu): Ditto.
4601 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4603 * src/lyxparagraph.h: renamed ClearParagraph() to
4604 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4605 textclass as parameter, and do nothing if free_spacing is
4606 true. This fixes part of the line-delete-forward problems.
4608 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4609 (pasteSelection): ditto.
4610 (SwitchLayoutsBetweenClasses): more translatable strings.
4612 * src/text2.C (CutSelection): use StripLeadingSpaces.
4613 (PasteSelection): ditto.
4614 (DeleteEmptyParagraphMechanism): ditto.
4616 2000-05-26 Juergen Vigna <jug@sad.it>
4618 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4619 is not needed in tabular insets.
4621 * src/insets/insettabular.C (TabularFeatures): added missing features.
4623 * src/tabular.C (DeleteColumn):
4625 (AppendRow): implemented this functions
4626 (cellsturct::operator=): clone the inset too;
4628 2000-05-23 Juergen Vigna <jug@sad.it>
4630 * src/insets/insettabular.C (LocalDispatch): better selection support
4631 when having multicolumn-cells.
4633 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4635 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4637 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4639 * src/ColorHandler.C (getGCForeground): put more test into _()
4641 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4644 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4647 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4649 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4650 there are no labels, or when buffer is readonly.
4652 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4653 there are no labels, buffer is SGML, or when buffer is readonly.
4655 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4657 * src/LColor.C (LColor): change a couple of grey40 to grey60
4658 (LColor): rewore initalization to make compiles go some magnitude
4660 (getGUIName): don't use gettext until we need the string.
4662 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4664 * src/Bullet.[Ch]: Fixed a small bug.
4666 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4668 * src/paragraph.C (String): Several fixes/improvements
4670 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4672 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4674 * src/paragraph.C (String): give more correct output.
4676 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4678 * src/lyxfont.C (stateText) Do not output the language if it is
4679 eqaul to the language of the document.
4681 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4682 between two paragraphs with the same language.
4684 * src/paragraph.C (getParLanguage) Return a correct answer for an
4685 empty dummy paragraph.
4687 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4690 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4693 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4694 the menus/popup, if requested fonts are unavailable.
4696 2000-05-22 Juergen Vigna <jug@sad.it>
4698 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4699 movement support (Up/Down/Tab/Shift-Tab).
4700 (LocalDispatch): added also preliminari cursor-selection.
4702 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4704 * src/paragraph.C (PasteParagraph): Hopefully now right!
4706 2000-05-22 Garst R. Reese <reese@isn.net>
4708 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4709 of list, change all references to Environment to Command
4710 * tex/hollywood.cls : rewrite environments as commands, add
4711 \uppercase to interiorshot and exteriorshot to force uppecase.
4712 * tex/broadway.cls : rewrite environments as commands. Tweak
4715 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4717 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4718 size of items: use a constant intead of the hardcoded 40, and more
4719 importantly do not remove the %m and %x tags added at the end.
4720 (Add_to_refs_menu): use vector::size_type instead of
4721 unsigned int as basic types for the variables. _Please_ do not
4722 assume that size_t is equal to unsigned int. On an alpha, this is
4723 unsigned long, which is _not_ the same.
4725 * src/language.C (initL): remove language "hungarian", since it
4726 seems that "magyar" is better.
4728 2000-05-22 Juergen Vigna <jug@sad.it>
4730 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4732 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4735 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4736 next was deleted but not set to 0.
4738 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4740 * src/language.C (initL): change the initialization of languages
4741 so that compiles goes _fast_.
4743 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4746 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4748 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4752 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4754 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4756 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4760 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4763 * src/insets/insetlo*.[Ch]: Made editable
4765 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4767 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4768 the current selection.
4770 * src/BufferView_pimpl.C (stuffClipboard): new method
4772 * src/BufferView.C (stuffClipboard): new method
4774 * src/paragraph.C (String): new method
4776 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4777 LColor::ignore when lyxname is not found.
4779 * src/BufferView.C (pasteSelection): new method
4781 * src/BufferView_pimpl.C (pasteSelection): new method
4783 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4785 * src/WorkArea.C (request_clipboard_cb): new static function
4786 (getClipboard): new method
4787 (putClipboard): new method
4789 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4791 * LyX 1.1.5pre2 released
4793 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4795 * src/vspace.C (operator=): removed
4796 (operator=): removed
4798 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4800 * src/layout.C (NumberOfClass): manually set the type in make_pair
4801 (NumberOfLayout): ditto
4803 * src/language.C: use the Language constructor for ignore_lang
4805 * src/language.h: add constructors to struct Language
4807 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4809 * src/text2.C (SetCursorIntern): comment out #warning
4811 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4813 * src/mathed/math_iter.h: initialize sx and sw to 0
4815 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4817 * forms/lyx.fd: Redesign of form_ref
4819 * src/LaTeXFeatures.[Ch]
4823 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4826 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4827 and Buffer::inset_iterator.
4829 * src/menus.C: Added new menus: TOC and Refs.
4831 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4833 * src/buffer.C (getTocList): New method.
4835 * src/BufferView2.C (ChangeRefs): New method.
4837 * src/buffer.C (getLabelList): New method. It replaces the old
4838 getReferenceList. The return type is vector<string> instead of
4841 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4842 the old getLabel() and GetNumberOfLabels() methods.
4843 * src/insets/insetlabel.C (getLabelList): ditto
4844 * src/mathed/formula.C (getLabelList): ditto
4846 * src/paragraph.C (String): New method.
4848 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4849 Uses the new getTocList() method.
4850 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4851 which automatically updates the contents of the browser.
4852 (RefUpdateCB): Use the new getLabelList method.
4854 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4856 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4858 * src/spellchecker.C: Added using std::reverse;
4860 2000-05-19 Juergen Vigna <jug@sad.it>
4862 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4864 * src/insets/insettext.C (computeTextRows): small fix for display of
4865 1 character after a newline.
4867 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4870 2000-05-18 Juergen Vigna <jug@sad.it>
4872 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4873 when changing width of column.
4875 * src/tabular.C (set_row_column_number_info): setting of
4876 autobreak rows if necessary.
4878 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4880 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4882 * src/vc-backend.*: renamed stat() to status() and vcstat to
4883 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4884 compilation broke. The new name seems more relevant, anyway.
4886 2000-05-17 Juergen Vigna <jug@sad.it>
4888 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4889 which was wrong if the removing caused removing of rows!
4891 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4892 (pushToken): new function.
4894 * src/text2.C (CutSelection): fix problem discovered with purify
4896 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4898 * src/debug.C (showTags): enlarge the first column, now that we
4899 have 6-digits debug codes.
4901 * lib/layouts/hollywood.layout:
4902 * lib/tex/hollywood.cls:
4903 * lib/tex/brodway.cls:
4904 * lib/layouts/brodway.layout: more commands and fewer
4905 environments. Preambles moved in the .cls files. Broadway now has
4906 more options on scene numbering and less whitespace (from Garst)
4908 * src/insets/insetbib.C (getKeys): make sure that we are in the
4909 document directory, in case the bib file is there.
4911 * src/insets/insetbib.C (Latex): revert bogus change.
4913 2000-05-16 Juergen Vigna <jug@sad.it>
4915 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4916 the TabularLayout on cursor move.
4918 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4920 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4923 (draw): fixed cursor position and drawing so that the cursor is
4924 visible when before the tabular-inset.
4926 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4927 when creating from old insettext.
4929 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4931 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4933 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4934 * lib/tex/brodway.cls: ditto
4936 * lib/layouts/brodway.layout: change alignment of parenthical
4939 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4941 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4942 versions 0.88 and 0.89 are supported.
4944 2000-05-15 Juergen Vigna <jug@sad.it>
4946 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4949 * src/insets/insettext.C (computeTextRows): redone completely this
4950 function in a much cleaner way, because of problems when having a
4952 (draw): added a frame border when the inset is locked.
4953 (SetDrawLockedFrame): this sets if we draw the border or not.
4954 (SetFrameColor): this sets the frame color (default=insetframe).
4956 * src/insets/lyxinset.h: added x() and y() functions which return
4957 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4958 function which is needed to see if we have a locking inset of some
4959 type in this inset (needed for now in insettabular).
4961 * src/vspace.C (inPixels): the same function also without a BufferView
4962 parameter as so it is easier to use it in some ocasions.
4964 * src/lyxfunc.C: changed all places where insertInset was used so
4965 that now if it couldn't be inserted it is deleted!
4967 * src/TabularLayout.C:
4968 * src/TableLayout.C: added support for new tabular-inset!
4970 * src/BufferView2.C (insertInset): this now returns a bool if the
4971 inset was really inserted!!!
4973 * src/tabular.C (GetLastCellInRow):
4974 (GetFirstCellInRow): new helper functions.
4975 (Latex): implemented for new tabular class.
4979 (TeXTopHLine): new Latex() helper functions.
4981 2000-05-12 Juergen Vigna <jug@sad.it>
4983 * src/mathed/formulamacro.C (Read):
4984 * src/mathed/formula.C (Read): read also the \end_inset here!
4986 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4988 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4989 crush when saving formulae with unbalanced parenthesis.
4991 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4993 * src/layout.C: Add new keyword "endlabelstring" to layout file
4995 * src/text.C (GetVisibleRow): Draw endlabel string.
4997 * lib/layouts/broadway.layout
4998 * lib/layouts/hollywood.layout: Added endlabel for the
4999 Parenthetical layout.
5001 * lib/layouts/heb-article.layout: Do not use slanted font shape
5002 for Theorem like environments.
5004 * src/buffer.C (makeLaTeXFile): Always add "american" to
5005 the UsedLanguages list if document language is RTL.
5007 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5009 * add addendum to README.OS2 and small patch (from SMiyata)
5011 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5013 * many files: correct the calls to ChangeExtension().
5015 * src/support/filetools.C (ChangeExtension): remove the no_path
5016 argument, which does not belong there. Use OnlyFileName() instead.
5018 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5019 files when LaTeXing a non-nice latex file.
5021 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5022 a chain of "if". Return false when deadkeys are not handled.
5024 * src/lyx_main.C (LyX): adapted the code for default bindings.
5026 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5027 bindings for basic functionality (except deadkeys).
5028 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5030 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5031 several methods: handle override_x_deadkeys.
5033 * src/lyxrc.h: remove the "bindings" map, which did not make much
5034 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5036 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5038 * src/lyxfont.C (stateText): use a saner method to determine
5039 whether the font is "default". Seems to fix the crash with DEC
5042 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5044 2000-05-08 Juergen Vigna <jug@sad.it>
5046 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5047 TabularLayoutMenu with mouse-button-3
5048 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
5050 * src/TabularLayout.C: added this file for having a Layout for
5053 2000-05-05 Juergen Vigna <jug@sad.it>
5055 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
5056 recalculating inset-widths.
5057 (TabularFeatures): activated this function so that I can change
5058 tabular-features via menu.
5060 * src/menus.C (ShowEditMenu): inserted support for insettabular so
5061 that I can test some functions with the Table menu.
5063 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5065 * src/lyxfont.C (stateText): guard against stupid c++libs.
5067 * src/tabular.C: add using std::vector
5068 some whitespace changes, + removed som autogenerated code.
5070 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
5072 2000-05-05 Juergen Vigna <jug@sad.it>
5074 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
5075 row, columns and cellstructures.
5077 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5079 * lib/lyxrc.example: remove obsolete entries.
5081 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
5082 reading of protected_separator for free_spacing.
5084 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5086 * src/text.C (draw): do not display an exclamation mark in the
5087 margin for margin notes. This is confusing, ugly and
5090 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
5091 AMS math' is checked.
5093 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
5094 name to see whether including the amsmath package is needed.
5096 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5098 * src/paragraph.C (validate): Compute UsedLanguages correctly
5099 (don't insert the american language if it doesn't appear in the
5102 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5103 The argument of \thanks{} command is considered moving argument
5105 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5108 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5110 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5111 for appendix/minipage/depth. The lines can be now both in the footnote
5112 frame, and outside the frame.
5114 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5117 2000-05-05 Juergen Vigna <jug@sad.it>
5119 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5120 neede only in tabular.[Ch].
5122 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5124 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5126 (Write): write '~' for PROTECTED_SEPARATOR
5128 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5130 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5133 * src/mathed/formula.C (drawStr): rename size to siz.
5135 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5136 possibly fix a bug by not changing the pflags = flags to piflags =
5139 2000-05-05 Juergen Vigna <jug@sad.it>
5141 * src/insets/insetbib.C: moved using directive
5143 * src/ImportNoweb.C: small fix for being able to compile (missing
5146 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5148 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5149 to use clear, since we don't depend on this in the code. Add test
5152 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5154 * (various *.C files): add using std::foo directives to please dec
5157 * replace calls to string::clear() to string::erase() (Angus)
5159 * src/cheaders/cmath: modified to provide std::abs.
5161 2000-05-04 Juergen Vigna <jug@sad.it>
5163 * src/insets/insettext.C: Prepared all for inserting of multiple
5164 paragraphs. Still display stuff to do (alignment and other things),
5165 but I would like to use LyXText to do this when we cleaned out the
5166 table-support stuff.
5168 * src/insets/insettabular.C: Changed lot of stuff and added lots
5169 of functionality still a lot to do.
5171 * src/tabular.C: Various functions changed name and moved to be
5172 const functions. Added new Read and Write functions and changed
5173 lots of things so it works good with tabular-insets (also removed
5174 some stuff which is not needed anymore * hacks *).
5176 * src/lyxcursor.h: added operators == and != which just look if
5177 par and pos are (not) equal.
5179 * src/buffer.C (latexParagraphs): inserted this function to latex
5180 all paragraphs form par to endpar as then I can use this too for
5183 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5184 so that I can call this to from text insets with their own cursor.
5186 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5187 output off all paragraphs (because of the fix below)!
5189 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5190 the very last paragraph (this could be also the last paragraph of an
5193 * src/texrow.h: added rows() call which returns the count-variable.
5195 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5197 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5199 * lib/configure.m4: better autodetection of DocBook tools.
5201 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5203 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5205 * src/lyx_cb.C: add using std::reverse;
5207 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5210 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5211 selected files. Should fix repeated errors from generated files.
5213 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5215 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5217 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5218 the spellchecker popup.
5220 * lib/lyxrc.example: Removed the \number_inset section
5222 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5224 * src/insets/figinset.C (various): Use IsFileReadable() to make
5225 sure that the file actually exist. Relying on ghostscripts errors
5226 is a bad idea since they can lead to X server crashes.
5228 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5230 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5233 * lib/lyxrc.example: smallish typo in description of
5234 \view_dvi_paper_option
5236 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5239 * src/lyxfunc.C: doImportHelper to factor out common code of the
5240 various import methods. New functions doImportASCIIasLines,
5241 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5242 doImportLinuxDoc for the format specific parts.
5245 * buffer.C: Dispatch returns now a bool to indicate success
5248 * lyx_gui.C: Add getLyXView() for member access
5250 * lyx_main.C: Change logic for batch commands: First try
5251 Buffer::Dispatch (possibly without GUI), if that fails, use
5254 * lyx_main.C: Add support for --import command line switch.
5255 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5256 Available Formats: Everything accepted by 'buffer-import <format>'
5258 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5260 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5263 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5264 documents will be reformatted upon reentry.
5266 2000-04-27 Juergen Vigna <jug@sad.it>
5268 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5269 correctly only last pos this was a bug.
5271 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5273 * release of lyx-1.1.5pre1
5275 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5277 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5279 * src/menus.C: revert the change of naming (Figure->Graphic...)
5280 from 2000-04-11. It was incomplete and bad.
5282 * src/LColor.[Ch]: add LColor::depthbar.
5283 * src/text.C (GetVisibleRow): use it.
5285 * README: update the languages list.
5287 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5289 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5292 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5294 * README: remove sections that were just wrong.
5296 * src/text2.C (GetRowNearY): remove currentrow code
5298 * src/text.C (GetRow): remove currentrow code
5300 * src/screen.C (Update): rewritten a bit.
5301 (SmallUpdate): removed func
5303 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5305 (FullRebreak): return bool
5306 (currentrow): remove var
5307 (currentrow_y): ditto
5309 * src/lyxscreen.h (Draw): change arg to unsigned long
5310 (FitCursor): return bool
5311 (FitManualCursor): ditto
5312 (Smallpdate): remove func
5313 (first): change to unsigned long
5314 (DrawOneRow): change second arg to long (from long &)
5315 (screen_refresh_y): remove var
5316 (scree_refresh_row): ditto
5318 * src/lyxrow.h: change baseline to usigned int from unsigned
5319 short, this brings some implicit/unsigned issues out in the open.
5321 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5323 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5324 instead of smallUpdate.
5326 * src/lyxcursor.h: change y to unsigned long
5328 * src/buffer.h: don't call updateScrollbar after fitcursor
5330 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5331 where they are used. Removed "\\direction", this was not present
5332 in 1.1.4 and is already obsolete. Commented out some code that I
5333 believe to never be called.
5334 (runLiterate): don't call updateScrollbar after fitCursor
5336 (buildProgram): ditto
5339 * src/WorkArea.h (workWidth): change return val to unsigned
5342 (redraw): remove the button redraws
5343 (setScrollbarValue): change for scrollbar
5344 (getScrollbarValue): change for scrollbar
5345 (getScrollbarBounds): change for scrollbar
5347 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5348 (C_WorkArea_down_cb): removed func
5349 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5350 (resize): change for scrollbar
5351 (setScrollbar): ditto
5352 (setScrollbarBounds): ditto
5353 (setScrollbarIncrements): ditto
5354 (up_cb): removed func
5355 (down_cb): removed func
5356 (scroll_cb): change for scrollbar
5357 (work_area_handler): ditto
5359 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5360 when FitCursor did something.
5361 (updateScrollbar): some unsigned changes
5362 (downCB): removed func
5363 (scrollUpOnePage): removed func
5364 (scrollDownOnePage): remvoed func
5365 (workAreaMotionNotify): don't call screen->FitCursor but use
5366 fitCursor instead. and bool return val
5367 (workAreaButtonPress): ditto
5368 (workAreaButtonRelease): some unsigned changes
5369 (checkInsetHit): ditto
5370 (workAreaExpose): ditto
5371 (update): parts rewritten, comments about the signed char arg added
5372 (smallUpdate): removed func
5373 (cursorPrevious): call needed updateScrollbar
5376 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5379 * src/BufferView.[Ch] (upCB): removed func
5380 (downCB): removed func
5381 (smallUpdate): removed func
5383 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5385 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5386 currentrow, currentrow_y optimization. This did not help a lot and
5387 if we want to do this kind of optimization we should rather use
5388 cursor.row instead of the currentrow.
5390 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5391 buffer spacing and klyx spacing support.
5393 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5395 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5398 2000-04-26 Juergen Vigna <jug@sad.it>
5400 * src/insets/figinset.C: fixes to Lars sstream changes!
5402 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5404 * A lot of files: Added Ascii(ostream &) methods to all inset
5405 classes. Used when exporting to ASCII.
5407 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5408 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5411 * src/text2.C (ToggleFree): Disabled implicit word selection when
5412 there is a change in the language
5414 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5415 no output was generated for end-of-sentence inset.
5417 * src/insets/lyxinset.h
5420 * src/paragraph.C: Removed the insetnumber code
5422 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5424 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5426 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5427 no_babel and no_epsfig completely from the file.
5428 (parseSingleLyXformat2Token): add handling for per-paragraph
5429 spacing as written by klyx.
5431 * src/insets/figinset.C: applied patch by Andre. Made it work with
5434 2000-04-20 Juergen Vigna <jug@sad.it>
5436 * src/insets/insettext.C (cutSelection):
5437 (copySelection): Fixed with selection from right to left.
5438 (draw): now the rows are not recalculated at every draw.
5439 (computeTextRows): for now reset the inset-owner here (this is
5440 important for an undo or copy where the inset-owner is not set
5443 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5444 motion to the_locking_inset screen->first was forgotten, this was
5445 not important till we got multiline insets.
5447 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5449 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5450 code seems to be alright (it is code changed by Dekel, and the
5451 intent is indeed that all macros should be defined \protect'ed)
5453 * NEWS: a bit of reorganisation of the new user-visible features.
5455 2000-04-19 Juergen Vigna <jug@sad.it>
5457 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5458 position. Set the inset_owner of the used paragraph so that it knows
5459 that it is inside an inset. Fixed cursor handling with mouse and
5460 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5461 and cleanups to make TextInsets work better.
5463 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5464 Changed parameters of various functions and added LockInsetInInset().
5466 * src/insets/insettext.C:
5468 * src/insets/insetcollapsable.h:
5469 * src/insets/insetcollapsable.C:
5470 * src/insets/insetfoot.h:
5471 * src/insets/insetfoot.C:
5472 * src/insets/insetert.h:
5473 * src/insets/insetert.C: cleaned up the code so that it works now
5474 correctly with insettext.
5476 * src/insets/inset.C:
5477 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5478 that insets in insets are supported right.
5481 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5483 * src/paragraph.C: some small fixes
5485 * src/debug.h: inserted INSETS debug info
5487 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5488 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5490 * src/commandtags.h:
5491 * src/LyXAction.C: insert code for InsetTabular.
5493 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5494 not Button1MotionMask.
5495 (workAreaButtonRelease): send always a InsetButtonRelease event to
5497 (checkInsetHit): some setCursor fixes (always with insets).
5499 * src/BufferView2.C (lockInset): returns a bool now and extended for
5500 locking insets inside insets.
5501 (showLockedInsetCursor): it is important to have the cursor always
5502 before the locked inset.
5503 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5505 * src/BufferView.h: made lockInset return a bool.
5507 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5509 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5510 that is used also internally but can be called as public to have back
5511 a cursor pos which is not set internally.
5512 (SetCursorIntern): Changed to use above function.
5514 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5516 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5521 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5522 patches for things that should be in or should be changed.
5524 * src/* [insetfiles]: change "usigned char fragile" to bool
5525 fragile. There was only one point that could that be questioned
5526 and that is commented in formulamacro.C. Grep for "CHECK".
5528 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5529 (DeleteBuffer): take it out of CutAndPaste and make it static.
5531 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5533 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5534 output the spacing envir commands. Also the new commands used in
5535 the LaTeX output makes the result better.
5537 * src/Spacing.C (writeEnvirBegin): new method
5538 (writeEnvirEnd): new method
5540 2000-04-18 Juergen Vigna <jug@sad.it>
5542 * src/CutAndPaste.C: made textclass a static member of the class
5543 as otherwise it is not accesed right!!!
5545 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5547 * forms/layout_forms.fd
5548 * src/layout_forms.h
5549 * src/layout_forms.C (create_form_form_character)
5550 * src/lyx_cb.C (UserFreeFont)
5551 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5552 documents (in the layout->character popup).
5554 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5556 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5557 \spell_command was in fact not honored (from Kevin Atkinson).
5559 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5562 * src/lyx_gui.h: make lyxViews private (Angus)
5564 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5566 * src/mathed/math_write.C
5567 (MathMatrixInset::Write) Put \protect before \begin{array} and
5568 \end{array} if fragile
5569 (MathParInset::Write): Put \protect before \\ if fragile
5571 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5573 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5574 initialization if the LyXColorHandler must be done after the
5575 connections to the XServer has been established.
5577 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5578 get the background pixel from the lyxColorhandler so that the
5579 figures are rendered with the correct background color.
5580 (NextToken): removed functions.
5581 (GetPSSizes): use ifs >> string instead of NextToken.
5583 * src/Painter.[Ch]: the color cache moved out of this file.
5585 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5588 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5590 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5591 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5593 * src/BufferView.C (enterView): new func
5594 (leaveView): new func
5596 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5598 (leaveView): new func, undefines xterm cursor when approp.
5600 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5601 (AllowInput): delete the Workarea cursor handling from this func.
5603 * src/Painter.C (underline): draw a slimer underline in most cases.
5605 * src/lyx_main.C (error_handler): use extern "C"
5607 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5609 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5610 sent directly to me.
5612 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5613 to the list by Dekel.
5615 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5618 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5619 methods from lyx_cb.here.
5621 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5624 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5626 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5627 instead of using current_view directly.
5629 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5631 * src/LyXAction.C (init): add the paragraph-spacing command.
5633 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5635 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5637 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5638 different from the documents.
5640 * src/text.C (SetHeightOfRow): take paragraph spacing into
5641 account, paragraph spacing takes precedence over buffer spacing
5642 (GetVisibleRow): ditto
5644 * src/paragraph.C (writeFile): output the spacing parameter too.
5645 (validate): set the correct features if spacing is used in the
5647 (Clear): set spacing to default
5648 (MakeSameLayout): spacing too
5649 (HasSameLayout): spacing too
5650 (SetLayout): spacing too
5651 (TeXOnePar): output the spacing commands
5653 * src/lyxparagraph.h: added a spacing variable for use with
5654 per-paragraph spacing.
5656 * src/Spacing.h: add a Default spacing and a method to check if
5657 the current spacing is default. also added an operator==
5659 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5662 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5664 * src/lyxserver.C (callback): fix dispatch of functions
5666 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5667 printf() into lyxerr call.
5669 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5672 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5673 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5674 the "Float" from each of the subitems.
5675 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5677 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5678 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5679 documented the change so that the workaround can be nuked later.
5681 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5684 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5686 * src/buffer.C (getLatexName): ditto
5687 (setReadonly): ditto
5689 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5691 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5692 avoid some uses of current_view. Added also a bufferParams()
5693 method to get at this.
5695 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5697 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5699 * src/lyxparagraph.[Ch]: removed
5700 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5701 with operators used by lower_bound and
5702 upper_bound in InsetTable's
5703 Make struct InsetTable private again. Used matchpos.
5705 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5707 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5708 document, the language of existing text is changed (unless the
5709 document is multi-lingual)
5711 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5713 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5715 * A lot of files: A rewrite of the Right-to-Left support.
5717 2000-04-10 Juergen Vigna <jug@sad.it>
5719 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5720 misplaced cursor when inset in inset is locked.
5722 * src/insets/insettext.C (LocalDispatch): small fix so that a
5723 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5725 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5726 footnote font should be decreased in size twice when displaying.
5728 * src/insets/insettext.C (GetDrawFont): inserted this function as
5729 the drawing-font may differ from the real paragraph font.
5731 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5732 insets (inset in inset!).
5734 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5735 function here because we don't want footnotes inside footnotes.
5737 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5739 (init): now set the inset_owner in paragraph.C
5740 (LocalDispatch): added some resetPos() in the right position
5743 (pasteSelection): changed to use the new CutAndPaste-Class.
5745 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5746 which tells if it is allowed to insert another inset inside this one.
5748 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5749 SwitchLayoutsBetweenClasses.
5751 * src/text2.C (InsertInset): checking of the new paragraph-function
5753 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5754 is not needed anymore here!
5757 (PasteSelection): redone (also with #ifdef) so that now this uses
5758 the CutAndPaste-Class.
5759 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5762 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5763 from/to text/insets.
5765 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5766 so that the paragraph knows if it is inside an (text)-inset.
5767 (InsertFromMinibuffer): changed return-value to bool as now it
5768 may happen that an inset is not inserted in the paragraph.
5769 (InsertInsetAllowed): this checks if it is allowed to insert an
5770 inset in this paragraph.
5772 (BreakParagraphConservative):
5773 (BreakParagraph) : small change for the above change of the return
5774 value of InsertFromMinibuffer.
5776 * src/lyxparagraph.h: added inset_owner and the functions to handle
5777 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5779 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5781 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5782 functions from BufferView to BufferView::Pimpl to ease maintence.
5784 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5785 correctly. Also use SetCursorIntern instead of SetCursor.
5787 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5790 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5792 * src/WorkArea.C (belowMouse): manually implement below mouse.
5794 * src/*: Add "explicit" on several constructors, I added probably
5795 some unneeded ones. A couple of changes to code because of this.
5797 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5798 implementation and private parts from the users of BufferView. Not
5801 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5802 implementation and private parts from the users of LyXLex. Not
5805 * src/BufferView_pimpl.[Ch]: new files
5807 * src/lyxlex_pimpl.[Ch]: new files
5809 * src/LyXView.[Ch]: some inline functions move out-of-line
5811 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5813 * src/lyxparagraph.h: make struct InsetTable public.
5815 * src/support/lyxstring.h: change lyxstring::difference_type to be
5816 ptrdiff_t. Add std:: modifiers to streams.
5818 * src/font.C: include the <cctype> header, for islower() and
5821 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5823 * src/font.[Ch]: new files. Contains the metric functions for
5824 fonts, takes a LyXFont as parameter. Better separation of concepts.
5826 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5827 changes because of this.
5829 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5831 * src/*: compile with -Winline and move functions that don't
5834 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5837 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5839 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5840 (various files changed because of this)
5842 * src/Painter.C (text): fixed the drawing of smallcaps.
5844 * src/lyxfont.[Ch] (drawText): removed unused member func.
5847 * src/*.C: added needed "using" statements and "std::" qualifiers.
5849 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5851 * src/*.h: removed all use of "using" from header files use
5852 qualifier std:: instead.
5854 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5856 * src/text.C (Backspace): some additional cleanups (we already
5857 know whether cursor.pos is 0 or not).
5859 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5860 automake does not provide one).
5862 * src/bmtable.h: replace C++ comments with C comments.
5864 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5866 * src/screen.C (ShowCursor): Change the shape of the cursor if
5867 the current language is not equal to the language of the document.
5868 (If the cursor change its shape unexpectedly, then you've found a bug)
5870 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5873 * src/insets/insetnumber.[Ch]: New files.
5875 * src/LyXAction.C (init)
5876 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5879 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5881 * src/lyxparagraph.h
5882 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5883 (the vector is kept sorted).
5885 * src/text.C (GetVisibleRow): Draw selection correctly when there
5886 is both LTR and RTL text.
5888 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5889 which is much faster.
5891 * src/text.C (GetVisibleRow and other): Do not draw the last space
5892 in a row if the direction of the last letter is not equal to the
5893 direction of the paragraph.
5895 * src/lyxfont.C (latexWriteStartChanges):
5896 Check that font language is not equal to basefont language.
5897 (latexWriteEndChanges): ditto
5899 * src/lyx_cb.C (StyleReset): Don't change the language while using
5900 the font-default command.
5902 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5903 empty paragraph before a footnote.
5905 * src/insets/insetcommand.C (draw): Increase x correctly.
5907 * src/screen.C (ShowCursor): Change cursor shape if
5908 current language != document language.
5910 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5912 2000-03-31 Juergen Vigna <jug@sad.it>
5914 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5915 (Clone): changed mode how the paragraph-data is copied to the
5916 new clone-paragraph.
5918 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5919 GetInset(pos) with no inset anymore there (in inset UNDO)
5921 * src/insets/insetcommand.C (draw): small fix as here x is
5922 incremented not as much as width() returns (2 before, 2 behind = 4)
5924 2000-03-30 Juergen Vigna <jug@sad.it>
5926 * src/insets/insettext.C (InsetText): small fix in initialize
5927 widthOffset (should not be done in the init() function)
5929 2000-03-29 Amir Karger <karger@lyx.org>
5931 * lib/examples/it_ItemizeBullets.lyx: translation by
5934 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5936 2000-03-29 Juergen Vigna <jug@sad.it>
5938 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5940 * src/insets/insetfoot.C (Clone): small change as for the below
5941 new init function in the text-inset
5943 * src/insets/insettext.C (init): new function as I've seen that
5944 clone did not copy the Paragraph-Data!
5945 (LocalDispatch): Added code so that now we have some sort of Undo
5946 functionality (well actually we HAVE Undo ;)
5948 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5950 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5952 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5955 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5957 * src/main.C: added a runtime check that verifies that the xforms
5958 header used when building LyX and the library used when running
5959 LyX match. Exit with a message if they don't match. This is a
5960 version number check only.
5962 * src/buffer.C (save): Don't allocate memory on the heap for
5963 struct utimbuf times.
5965 * *: some using changes, use iosfwd instead of the real headers.
5967 * src/lyxfont.C use char const * instead of string for the static
5968 strings. Rewrite some functions to use sstream.
5970 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5972 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5975 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5977 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5978 of Geodesy (from Martin Vermeer)
5980 * lib/layouts/svjour.inc: include file for the Springer svjour
5981 class. It can be used to support journals other than JoG.
5983 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5984 Miskiewicz <misiek@pld.org.pl>)
5985 * lib/reLyX/Makefile.am: ditto.
5987 2000-03-27 Juergen Vigna <jug@sad.it>
5989 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5990 also some modifications with operations on selected text.
5992 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5993 problems with clicking on insets (last famous words ;)
5995 * src/insets/insetcommand.C (draw):
5996 (width): Changed to have a bit of space before and after the inset so
5997 that the blinking cursor can be seen (otherwise it was hidden)
5999 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6001 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6002 would not be added to the link list when an installed gettext (not
6003 part of libc) is found.
6005 2000-03-24 Juergen Vigna <jug@sad.it>
6007 * src/insets/insetcollapsable.C (Edit):
6008 * src/mathed/formula.C (InsetButtonRelease):
6009 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6012 * src/BufferView.C (workAreaButtonPress):
6013 (workAreaButtonRelease):
6014 (checkInsetHit): Finally fixed the clicking on insets be handled
6017 * src/insets/insetert.C (Edit): inserted this call so that ERT
6018 insets work always with LaTeX-font
6020 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6022 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6023 caused lyx to startup with no GUI in place, causing in a crash
6024 upon startup when called with arguments.
6026 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6028 * src/FontLoader.C: better initialization of dummyXFontStruct.
6030 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6032 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6033 for linuxdoc and docbook import and export format options.
6035 * lib/lyxrc.example Example of default values for the previous flags.
6037 * src/lyx_cb.C Use those flags instead of the hardwired values for
6038 linuxdoc and docbook export.
6040 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6043 * src/menus.C Added menus entries for the new import/exports formats.
6045 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6047 * src/lyxrc.*: Added support for running without Gui
6050 * src/FontLoader.C: sensible defaults if no fonts are needed
6052 * src/lyx_cb.C: New function ShowMessage (writes either to the
6053 minibuffer or cout in case of no gui
6054 New function AskOverwrite for common stuff
6055 Consequently various changes to call these functions
6057 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
6058 wild guess at sensible screen resolution when having no gui
6060 * src/lyxfont.C: no gui, no fonts... set some defaults
6062 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6064 * src/LColor.C: made the command inset background a bit lighter.
6066 2000-03-20 Hartmut Goebel <goebel@noris.net>
6068 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
6069 stdstruct.inc. Koma-Script added some title elements which
6070 otherwise have been listed below "bibliography". This split allows
6071 adding title elements to where they belong.
6073 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
6074 define the additional tilte elements and then include
6077 * many other layout files: changed to include stdtitle.inc just
6078 before stdstruct.inc.
6080 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
6082 * src/buffer.C: (save) Added the option to store all backup files
6083 in a single directory
6085 * src/lyxrc.[Ch]: Added variable \backupdir_path
6087 * lib/lyxrc.example: Added descriptions of recently added variables
6089 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
6090 bibtex inset, not closing the bibtex popup when deleting the inset)
6092 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6094 * src/lyx_cb.C: add a couple using directives.
6096 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6097 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6098 import based on the filename.
6100 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6101 file would be imported at start, if the filename where of a sgml file.
6103 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6105 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6107 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6108 * src/lyxfont.h Replaced the member variable bits.direction by the
6109 member variable lang. Made many changes in other files.
6110 This allows having a multi-lingual document
6112 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6113 that change the current language to <l>.
6114 Removed the command "font-rtl"
6116 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6117 format for Hebrew documents)
6119 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6120 When auto_mathmode is "true", pressing a digit key in normal mode
6121 will cause entering into mathmode.
6122 If auto_mathmode is "rtl" then this behavior will be active only
6123 when writing right-to-left text.
6125 * src/text2.C (InsertStringA) The string is inserted using the
6128 * src/paragraph.C (GetEndLabel) Gives a correct result for
6129 footnote paragraphs.
6131 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6133 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6135 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6136 front of PasteParagraph. Never insert a ' '. This should at least
6137 fix some cause for the segfaults that we have been experiencing,
6138 it also fixes backspace behaviour slightly. (Phu!)
6140 * src/support/lstrings.C (compare_no_case): some change to make it
6141 compile with gcc 2.95.2 and stdlibc++-v3
6143 * src/text2.C (MeltFootnoteEnvironment): change type o
6144 first_footnote_par_is_not_empty to bool.
6146 * src/lyxparagraph.h: make text private. Changes in other files
6148 (fitToSize): new function
6149 (setContentsFromPar): new function
6150 (clearContents): new function
6151 (SetChar): new function
6153 * src/paragraph.C (readSimpleWholeFile): deleted.
6155 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6156 the file, just use a simple string instead. Also read the file in
6157 a more maintainable manner.
6159 * src/text2.C (InsertStringA): deleted.
6160 (InsertStringB): deleted.
6162 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6164 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6165 RedoParagraphs from the doublespace handling part, just set status
6166 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6167 done, but perhaps not like this.)
6169 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6171 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6172 character when inserting an inset.
6174 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6176 * src/bufferparams.C (readLanguage): now takes "default" into
6179 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6180 also initialize the toplevel_keymap with the default bindings from
6183 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6185 * all files using lyxrc: have lyxrc as a real variable and not a
6186 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6189 * src/lyxrc.C: remove double call to defaultKeyBindings
6191 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6192 toolbar defauls using lyxlex. Remove enums, structs, functions
6195 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6196 toolbar defaults. Also store default keybindings in a map.
6198 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6199 storing the toolbar defaults without any xforms dependencies.
6201 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6202 applied. Changed to use iterators.
6204 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6206 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6207 systems that don't have LINGUAS set to begin with.
6209 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6211 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6212 the list by Dekel Tsur.
6214 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6216 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6217 * src/insets/form_graphics.C: ditto.
6219 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6221 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6223 * src/bufferparams.C (readLanguage): use the new language map
6225 * src/intl.C (InitKeyMapper): use the new language map
6227 * src/lyx_gui.C (create_forms): use the new language map
6229 * src/language.[Ch]: New files. Used for holding the information
6230 about each language. Now! Use this new language map enhance it and
6231 make it really usable for our needs.
6233 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6235 * screen.C (ShowCursor): Removed duplicate code.
6236 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6237 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6239 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6242 * src/text.C Added TransformChar method. Used for rendering Arabic
6243 text correctly (change the glyphs of the letter according to the
6244 position in the word)
6249 * src/lyxrc.C Added lyxrc command {language_command_begin,
6250 language_command_end,language_command_ltr,language_command_rtl,
6251 language_package} which allows the use of either arabtex or Omega
6254 * src/lyx_gui.C (init)
6256 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6257 to use encoding for menu fonts which is different than the encoding
6260 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6261 do not load the babel package.
6262 To write an English document with Hebrew/Arabic, change the document
6263 language to "english".
6265 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6266 (alphaCounter): changed to return char
6267 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6269 * lib/lyxrc.example Added examples for Hebrew/Arabic
6272 * src/layout.C Added layout command endlabeltype
6274 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6276 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6278 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6280 * src/mathed/math_delim.C (search_deco): return a
6281 math_deco_struct* instead of index.
6283 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6285 * All files with a USE_OSTREAM_ONLY within: removed all code that
6286 was unused when USE_OSTREAM_ONLY is defined.
6288 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6289 of any less. Removed header and using.
6291 * src/text.C (GetVisibleRow): draw the string "Page Break
6292 (top/bottom)" on screen when drawing a pagebreak line.
6294 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6296 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6298 * src/mathed/math_macro.C (draw): do some cast magic.
6301 * src/mathed/math_defs.h: change byte* argument to byte const*.
6303 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6305 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6306 know it is right to return InsetFoot* too, but cxx does not like
6309 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6311 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6313 * src/mathed/math_delim.C: change == to proper assignment.
6315 2000-03-09 Juergen Vigna <jug@sad.it>
6317 * src/insets/insettext.C (setPos): fixed various cursor positioning
6318 problems (via mouse and cursor-keys)
6319 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6320 inset (still a small display problem but it works ;)
6322 * src/insets/insetcollapsable.C (draw): added button_top_y and
6323 button_bottom_y to have correct values for clicking on the inset.
6325 * src/support/lyxalgo.h: commented out 'using std::less'
6327 2000-03-08 Juergen Vigna <jug@sad.it>
6329 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6330 Button-Release event closes as it is alos the Release-Event
6333 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6335 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6337 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6338 can add multiple spaces in Scrap (literate programming) styles...
6339 which, by the way, is how I got hooked on LyX to begin with.
6341 * src/mathed/formula.C (Write): Added dummy variable to an
6342 inset::Latex() call.
6343 (Latex): Add free_spacing boolean to inset::Latex()
6345 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6347 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6348 virtual function to include the free_spacing boolean from
6349 the containing paragraph's style.
6351 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6352 Added free_spacing boolean arg to match inset.h
6354 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6355 Added free_spacing boolean arg to match inset.h
6357 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6358 Added free_spacing boolean and made sure that if in a free_spacing
6359 paragraph, that we output normal space if there is a protected space.
6361 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6362 Added free_spacing boolean arg to match inset.h
6364 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6365 Added free_spacing boolean arg to match inset.h
6367 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6368 Added free_spacing boolean arg to match inset.h
6370 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6371 Added free_spacing boolean arg to match inset.h
6373 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6374 Added free_spacing boolean arg to match inset.h
6376 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6377 free_spacing boolean arg to match inset.h
6379 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6380 Added free_spacing boolean arg to match inset.h
6382 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6383 Added free_spacing boolean arg to match inset.h
6385 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6386 Added free_spacing boolean arg to match inset.h
6388 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6389 Added free_spacing boolean arg to match inset.h
6391 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6392 Added free_spacing boolean arg to match inset.h
6394 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6395 free_spacing boolean arg to match inset.h
6397 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6398 free_spacing boolean arg to match inset.h
6400 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6401 ignore free_spacing paragraphs. The user's spaces are left
6404 * src/text.C (InsertChar): Fixed the free_spacing layout
6405 attribute behavior. Now, if free_spacing is set, you can
6406 add multiple spaces in a paragraph with impunity (and they
6407 get output verbatim).
6408 (SelectSelectedWord): Added dummy argument to inset::Latex()
6411 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6414 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6415 paragraph layouts now only input a simple space instead.
6416 Special character insets don't make any sense in free-spacing
6419 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6420 hard-spaces in the *input* file to simple spaces if the layout
6421 is free-spacing. This converts old files which had to have
6422 hard-spaces in free-spacing layouts where a simple space was
6424 (writeFileAscii): Added free_spacing check to pass to the newly
6425 reworked inset::Latex(...) methods. The inset::Latex() code
6426 ensures that hard-spaces in free-spacing paragraphs get output
6427 as spaces (rather than "~").
6429 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6431 * src/mathed/math_delim.C (draw): draw the empty placeholder
6432 delims with a onoffdash line.
6433 (struct math_deco_compare): struct that holds the "functors" used
6434 for the sort and the binary search in math_deco_table.
6435 (class init_deco_table): class used for initial sort of the
6437 (search_deco): use lower_bound to do a binary search in the
6440 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6442 * src/lyxrc.C: a small secret thingie...
6444 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6445 and to not flush the stream as often as it used to.
6447 * src/support/lyxalgo.h: new file
6448 (sorted): template function used for checking if a sequence is
6449 sorted or not. Two versions with and without user supplied
6450 compare. Uses same compare as std::sort.
6452 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6453 it and give warning on lyxerr.
6455 (struct compare_tags): struct with function operators used for
6456 checking if sorted, sorting and lower_bound.
6457 (search_kw): use lower_bound instead of manually implemented
6460 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6462 * src/insets/insetcollapsable.h: fix Clone() declaration.
6463 * src/insets/insetfoot.h: ditto.
6465 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6467 2000-03-08 Juergen Vigna <jug@sad.it>
6469 * src/insets/lyxinset.h: added owner call which tells us if
6470 this inset is inside another inset. Changed also the return-type
6471 of Editable to an enum so it tells clearer what the return-value is.
6473 * src/insets/insettext.C (computeTextRows): fixed computing of
6474 textinsets which split automatically on more rows.
6476 * src/insets/insetert.[Ch]: changed this to be of BaseType
6479 * src/insets/insetfoot.[Ch]: added footnote inset
6481 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6482 collapsable insets (like footnote, ert, ...)
6484 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6486 * src/lyxdraw.h: remvoe file
6488 * src/lyxdraw.C: remove file
6490 * src/insets/insettext.C: added <algorithm>.
6492 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6494 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6495 (matrix_cb): case MM_OK use string stream
6497 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6500 * src/mathed/math_macro.C (draw): use string stream
6501 (Metrics): use string stream
6503 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6504 directly to the ostream.
6506 * src/vspace.C (asString): use string stream.
6507 (asString): use string stream
6508 (asLatexString): use string stream
6510 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6511 setting Spacing::Other.
6513 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6514 sprintf when creating the stretch vale.
6516 * src/text2.C (alphaCounter): changed to return a string and to
6517 not use a static variable internally. Also fixed a one-off bug.
6518 (SetCounter): changed the drawing of the labels to use string
6519 streams instead of sprintf.
6521 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6522 manipulator to use a scheme that does not require library support.
6523 This is also the way it is done in the new GNU libstdc++. Should
6524 work with DEC cxx now.
6526 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6528 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6529 end. This fixes a bug.
6531 * src/mathed (all files concerned with file writing): apply the
6532 USE_OSTREAM_ONLY changes to mathed too.
6534 * src/support/DebugStream.h: make the constructor explicit.
6536 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6537 count and ostream squashed.
6539 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6541 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6543 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6544 ostringstream uses STL strings, and we might not.
6546 * src/insets/insetspecialchar.C: add using directive.
6547 * src/insets/insettext.C: ditto.
6549 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6551 * lib/layouts/seminar.layout: feeble attempt at a layout for
6552 seminar.cls, far from completet and could really use some looking
6553 at from people used to write layout files.
6555 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6556 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6557 a lot nicer and works nicely with ostreams.
6559 * src/mathed/formula.C (draw): a slightly different solution that
6560 the one posted to the list, but I think this one works too. (font
6561 size wrong in headers.)
6563 * src/insets/insettext.C (computeTextRows): some fiddling on
6564 Jürgens turf, added some comments that he should read.
6566 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6567 used and it gave compiler warnings.
6568 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6571 * src/lyx_gui.C (create_forms): do the right thing when
6572 show_banner is true/false.
6574 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6575 show_banner is false.
6577 * most file writing files: Now use iostreams to do almost all of
6578 the writing. Also instead of passing string &, we now use
6579 stringstreams. mathed output is still not adapted to iostreams.
6580 This change can be turned off by commenting out all the occurences
6581 of the "#define USE_OSTREAM_ONLY 1" lines.
6583 * src/WorkArea.C (createPixmap): don't output debug messages.
6584 (WorkArea): don't output debug messages.
6586 * lib/lyxrc.example: added a comment about the new variable
6589 * development/Code_rules/Rules: Added some more commente about how
6590 to build class interfaces and on how better encapsulation can be
6593 2000-03-03 Juergen Vigna <jug@sad.it>
6595 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6596 automatically with the width of the LyX-Window
6598 * src/insets/insettext.C (computeTextRows): fixed update bug in
6599 displaying text-insets (scrollvalues where not initialized!)
6601 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6603 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6604 id in the check of the result from lower_bound is not enough since
6605 lower_bound can return last too, and then res->id will not be a
6608 * all insets and some code that use them: I have conditionalized
6609 removed the Latex(string & out, ...) this means that only the
6610 Latex(ostream &, ...) will be used. This is a work in progress to
6611 move towards using streams for all output of files.
6613 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6616 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6618 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6619 routine (this fixes bug where greek letters were surrounded by too
6622 * src/support/filetools.C (findtexfile): change a bit the search
6623 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6624 no longer passed to kpsewhich, we may have to change that later.
6626 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6627 warning options to avoid problems with X header files (from Angus
6629 * acinclude.m4: regenerated.
6631 2000-03-02 Juergen Vigna <jug@sad.it>
6633 * src/insets/insettext.C (WriteParagraphData): Using the
6634 par->writeFile() function for writing paragraph-data.
6635 (Read): Using buffer->parseSingleLyXformat2Token()-function
6636 for parsing paragraph data!
6638 * src/buffer.C (readLyXformat2): removed all parse data and using
6639 the new parseSingleLyXformat2Token()-function.
6640 (parseSingleLyXformat2Token): added this function to parse (read)
6641 lyx-file-format (this is called also from text-insets now!)
6643 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6645 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6648 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6649 directly instead of going through a func. One very bad thing: a
6650 static LyXFindReplace, but I don't know where to place it.
6652 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6653 string instead of char[]. Also changed to static.
6654 (GetSelectionOrWordAtCursor): changed to static inline
6655 (SetSelectionOverLenChars): ditto.
6657 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6658 current_view and global variables. both classes has changed names
6659 and LyXFindReplace is not inherited from SearchForm.
6661 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6662 fl_form_search form.
6664 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6666 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6668 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6669 bound (from Kayvan).
6671 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6673 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6675 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6677 * some things that I should comment but the local pub says head to
6680 * comment out all code that belongs to the Roff code for Ascii
6681 export of tables. (this is unused)
6683 * src/LyXView.C: use correct type for global variable
6684 current_layout. (LyXTextClass::size_type)
6686 * some code to get the new insetgraphics closer to working I'd be
6687 grateful for any help.
6689 * src/BufferView2.C (insertInset): use the return type of
6690 NumberOfLayout properly. (also changes in other files)
6692 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6693 this as a test. I want to know what breaks because of this.
6695 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6697 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6699 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6700 to use a \makebox in the label, this allows proper justification
6701 with out using protected spaces or multiple hfills. Now it is
6702 "label" for left justified, "\hfill label\hfill" for center, and
6703 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6704 should be changed accordingly.
6706 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6708 * src/lyxtext.h: change SetLayout() to take a
6709 LyXTextClass::size_type instead of a char (when there is more than
6710 127 layouts in a class); also change type of copylayouttype.
6711 * src/text2.C (SetLayout): ditto.
6712 * src/LyXView.C (updateLayoutChoice): ditto.
6714 * src/LaTeX.C (scanLogFile): errors where the line number was not
6715 given just after the '!'-line were ignored (from Dekel Tsur).
6717 * lib/lyxrc.example: fix description of \date_insert_format
6719 * lib/layouts/llncs.layout: new layout, contributed by Martin
6722 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6724 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6725 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6726 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6727 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6728 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6729 paragraph.C, text.C, text2.C)
6731 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6733 * src/insets/insettext.C (LocalDispatch): remove extra break
6736 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6737 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6739 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6740 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6742 * src/insets/insetbib.h: move InsetBibkey::Holder and
6743 InsetCitation::Holder in public space.
6745 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6747 * src/insets/insettext.h: small change to get the new files from
6748 Juergen to compile (use "string", not "class string").
6750 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6751 const & as parameter to LocalDispatch, use LyXFont const & as
6752 paramter to some other func. This also had impacto on lyxinsets.h
6753 and the two mathed insets.
6755 2000-02-24 Juergen Vigna <jug@sad.it>
6758 * src/commandtags.h:
6760 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6764 * src/BufferView2.C: added/updated code for various inset-functions
6766 * src/insets/insetert.[Ch]: added implementation of InsetERT
6768 * src/insets/insettext.[Ch]: added implementation of InsetText
6770 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6771 (draw): added preliminary code for inset scrolling not finshed yet
6773 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6774 as it is in lyxfunc.C now
6776 * src/insets/lyxinset.h: Added functions for text-insets
6778 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6780 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6781 BufferView and reimplement the list as a queue put inside its own
6784 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6786 * several files: use the new interface to the "updateinsetlist"
6788 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6790 (work_area_handler): call BufferView::trippleClick on trippleclick.
6792 * src/BufferView.C (doubleClick): new function, selects word on
6794 (trippleClick): new function, selects line on trippleclick.
6796 2000-02-22 Allan Rae <rae@lyx.org>
6798 * lib/bind/xemacs.bind: buffer-previous not supported
6800 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6802 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6805 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6807 * src/bufferlist.C: get rid of current_view from this file
6809 * src/spellchecker.C: get rid of current_view from this file
6811 * src/vspace.C: get rid of current_view from this file
6812 (inPixels): added BufferView parameter for this func
6813 (asLatexCommand): added a BufferParams for this func
6815 * src/text.C src/text2.C: get rid of current_view from these
6818 * src/lyxfont.C (getFontDirection): move this function here from
6821 * src/bufferparams.C (getDocumentDirection): move this function
6824 * src/paragraph.C (getParDirection): move this function here from
6826 (getLetterDirection): ditto
6828 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6830 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6831 resize due to wrong pixmap beeing used. Also took the opurtunity
6832 to make the LyXScreen stateless on regard to WorkArea and some
6833 general cleanup in the same files.
6835 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6837 * src/Makefile.am: add missing direction.h
6839 * src/PainterBase.h: made the width functions const.
6841 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6844 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6846 * src/insets/insetlatexaccent.C (draw): make the accents draw
6847 better, at present this will only work well with iso8859-1.
6849 * several files: remove the old drawing code, now we use the new
6852 * several files: remove support for mono_video, reverse_video and
6855 2000-02-17 Juergen Vigna <jug@sad.it>
6857 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6858 int ** as we have to return the pointer, otherwise we have only
6859 NULL pointers in the returning function.
6861 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6863 * src/LaTeX.C (operator()): quote file name when running latex.
6865 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6867 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6868 (bubble tip), this removes our special handling of this.
6870 * Remove all code that is unused now that we have the new
6871 workarea. (Code that are not active when NEW_WA is defined.)
6873 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6875 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6877 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6878 nonexisting layout; correctly redirect obsoleted layouts.
6880 * lib/lyxrc.example: document \view_dvi_paper_option
6882 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6885 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6886 (PreviewDVI): handle the view_dvi_paper_option variable.
6887 [Both from Roland Krause]
6889 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6891 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6892 char const *, int, LyXFont)
6893 (text(int, int, string, LyXFont)): ditto
6895 * src/text.C (InsertCharInTable): attempt to fix the double-space
6896 feature in tables too.
6897 (BackspaceInTable): ditto.
6898 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6900 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6902 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6904 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6905 newly found text in textcache to this.
6906 (buffer): set the owner of the text put into the textcache to 0
6908 * src/insets/figinset.C (draw): fixed the drawing of figures with
6911 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6912 drawing of mathframe, hfills, protected space, table lines. I have
6913 now no outstanding drawing problems with the new Painter code.
6915 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6917 * src/PainterBase.C (ellipse, circle): do not specify the default
6920 * src/LColor.h: add using directive.
6922 * src/Painter.[Ch]: change return type of methods from Painter& to
6923 PainterBase&. Add a using directive.
6925 * src/WorkArea.C: wrap xforms callbacks in C functions
6928 * lib/layouts/foils.layout: font fix and simplifications from Carl
6931 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6933 * a lot of files: The Painter, LColor and WorkArea from the old
6934 devel branch has been ported to lyx-devel. Some new files and a
6935 lot of #ifdeffed code. The new workarea is enabled by default, but
6936 if you want to test the new Painter and LColor you have to compile
6937 with USE_PAINTER defined (do this in config.h f.ex.) There are
6938 still some rought edges, and I'd like some help to clear those
6939 out. It looks stable (loads and displays the Userguide very well).
6942 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6944 * src/buffer.C (pop_tag): revert to the previous implementation
6945 (use a global variable for both loops).
6947 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6949 * src/lyxrc.C (LyXRC): change slightly default date format.
6951 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6952 there is an English text with a footnote that starts with a Hebrew
6953 paragraph, or vice versa.
6954 (TeXFootnote): ditto.
6956 * src/text.C (LeftMargin): allow for negative values for
6957 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6960 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6961 for input encoding (cyrillic)
6963 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6965 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6968 * src/toolbar.C (set): ditto
6969 * src/insets/insetbib.C (create_form_citation_form): ditto
6971 * lib/CREDITS: added Dekel Tsur.
6973 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6974 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6975 hebrew supports files from Dekel Tsur.
6977 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6978 <tzafrir@technion.ac.il>
6980 * src/lyxrc.C: put \date_insert_format at the right place.
6982 * src/buffer.C (makeLaTeXFile): fix the handling of
6983 BufferParams::sides when writing out latex files.
6985 * src/BufferView2.C: add a "using" directive.
6987 * src/support/lyxsum.C (sum): when we use lyxstring,
6988 ostringstream::str needs an additional .c_str().
6990 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6992 * src/support/filetools.C (ChangeExtension): patch from Etienne
6995 * src/TextCache.C (show): remove const_cast and make second
6996 parameter non-const LyXText *.
6998 * src/TextCache.h: use non const LyXText in show.
7000 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7003 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7005 * src/support/lyxsum.C: rework to be more flexible.
7007 * several places: don't check if a pointer is 0 if you are going
7010 * src/text.C: remove some dead code.
7012 * src/insets/figinset.C: remove some dead code
7014 * src/buffer.C: move the BufferView funcs to BufferView2.C
7015 remove all support for insetlatexdel
7016 remove support for oldpapersize stuff
7017 made some member funcs const
7019 * src/kbmap.C: use a std::list to store the bindings in.
7021 * src/BufferView2.C: new file
7023 * src/kbsequence.[Ch]: new files
7025 * src/LyXAction.C + others: remove all trace of buffer-previous
7027 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7028 only have one copy in the binary of this table.
7030 * hebrew patch: moved some functions from LyXText to more
7031 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7033 * several files: remove support for XForms older than 0.88
7035 remove some #if 0 #endif code
7037 * src/TextCache.[Ch]: new file. Holds the textcache.
7039 * src/BufferView.C: changes to use the new TextCache interface.
7040 (waitForX): remove the now unused code.
7042 * src/BackStack.h: remove some commented code
7044 * lib/bind/emacs.bind: remove binding for buffer-previous
7046 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7048 * applied the hebrew patch.
7050 * src/lyxrow.h: make sure that all Row variables are initialized.
7052 * src/text2.C (TextHandleUndo): comment out a delete, this might
7053 introduce a memory leak, but should also help us to not try to
7054 read freed memory. We need to look at this one.
7056 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
7057 (LyXParagraph): initalize footnotekind.
7059 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
7060 forgot this when applying the patch. Please heed the warnings.
7062 * src/BufferView.C (buffer): a fix for the buffer-reload problem
7063 (aka. reformat problem)
7065 * src/bufferlist.C (exists): made const, and use const_iterator
7066 (isLoaded): new func.
7067 (release): use std::find to find the correct buffer.
7069 * src/bufferlist.h: made getState a const func.
7070 made empty a const func.
7071 made exists a const func.
7074 2000-02-01 Juergen Vigna <jug@sad.it>
7076 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
7078 * po/it.po: updated a bit the italian po file and also changed the
7079 'file nuovo' for newfile to 'filenuovo' without a space, this did
7082 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
7083 for the new insert_date command.
7085 * src/lyxfunc.C (Dispatch): added support for a insert_date function
7086 from jdblair, to insert a date into the current text conforming to
7087 a strftime format (for now only considering the locale-set and not
7088 the document-language).
7090 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7092 * src/lyxfont.C (textWidth): hopefully better fix for the Array
7093 Bounds Read error seen by purify. The problem was that islower is
7094 a macros which takes an unsigned char and uses it as an index for
7095 in array of characters properties (and is thus subject to the
7099 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7100 correctly the paper sides radio buttons.
7101 (UpdateDocumentButtons): ditto.
7103 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7105 * src/kbmap.C (getsym + others): change to return unsigned int,
7106 returning a long can give problems on 64 bit systems. (I assume
7107 that int is 32bit on 64bit systems)
7109 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7111 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7112 LyXLookupString to be zero-terminated. Really fixes problems seen
7115 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7117 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7118 write a (char*)0 to the lyxerr stream.
7120 * src/lastfiles.C: move algorithm before the using statemets.
7122 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7124 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7125 complains otherwise).
7126 * src/table.C: ditto
7128 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7131 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7132 that I removed earlier... It is really needed.
7134 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7136 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7138 * INSTALL: update xforms home page URL.
7140 * lib/configure.m4: fix a bug with unreadable layout files.
7142 * src/table.C (calculate_width_of_column): add "using std::max"
7145 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7147 * several files: marked several lines with "DEL LINE", this is
7148 lines that can be deleted without changing anything.
7149 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7150 checks this anyway */
7153 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7155 * src/DepTable.C (update): add a "+" at the end when the checksum
7156 is different. (debugging string only)
7158 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7159 the next inset to not be displayed. This should also fix the list
7160 of labels in the "Insert Crossreference" dialog.
7162 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7164 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7165 when regex was not found.
7167 * src/support/lstrings.C (lowercase): use handcoded transform always.
7170 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7171 old_cursor.par->prev could be 0.
7173 * several files: changed post inc/dec to pre inc/dec
7175 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7176 write the lastfiles to file.
7178 * src/BufferView.C (buffer): only show TextCache info when debugging
7180 (resizeCurrentBuffer): ditto
7181 (workAreaExpose): ditto
7183 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7185 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7187 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7188 a bit better by removing the special case for \i and \j.
7190 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7192 * src/lyx_main.C (easyParse): remove test for bad comand line
7193 options, since this broke all xforms-related parsing.
7195 * src/kbmap.C (getsym): set return type to unsigned long, as
7196 declared in header. On an alpha, long is _not_ the same as int.
7198 * src/support/LOstream.h: add a "using std::flush;"
7200 * src/insets/figinset.C: ditto.
7202 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7204 * src/bufferlist.C (write): use blinding fast file copy instead of
7205 "a char at a time", now we are doing it the C++ way.
7207 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7208 std::list<int> instead.
7209 (addpidwait): reflect move to std::list<int>
7210 (sigchldchecker): ditto
7212 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7215 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7216 that obviously was wrong...
7218 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7219 c, this avoids warnings with purify and islower.
7221 * src/insets/figinset.C: rename struct queue to struct
7222 queue_element and rewrite to use a std::queue. gsqueue is now a
7223 std::queue<queue_element>
7224 (runqueue): reflect move to std::queue
7227 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7228 we would get "1" "0" instead of "true" "false. Also make the tostr
7231 2000-01-21 Juergen Vigna <jug@sad.it>
7233 * src/buffer.C (writeFileAscii): Disabled code for special groff
7234 handling of tabulars till I fix this in table.C
7236 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7238 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7240 * src/support/lyxlib.h: ditto.
7242 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7244 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7245 and 'j' look better. This might fix the "macron" bug that has been
7248 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7249 functions as one template function. Delete the old versions.
7251 * src/support/lyxsum.C: move using std::ifstream inside
7254 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7257 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7259 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7261 * src/insets/figinset.C (InitFigures): use new instead of malloc
7262 to allocate memory for figures and bitmaps.
7263 (DoneFigures): use delete[] instead of free to deallocate memory
7264 for figures and bitmaps.
7265 (runqueue): use new to allocate
7266 (getfigdata): use new/delete[] instead of malloc/free
7267 (RegisterFigure): ditto
7269 * some files: moved some declarations closer to first use, small
7270 whitespace changes use preincrement instead of postincrement where
7271 it does not make a difference.
7273 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7274 step on the way to use stl::containers for key maps.
7276 * src/bufferlist.h: add a typedef for const_iterator and const
7277 versions of begin and end.
7279 * src/bufferlist.[Ch]: change name of member variable _state to
7280 state_. (avoid reserved names)
7282 (getFileNames): returns the filenames of the buffers in a vector.
7284 * configure.in (ALL_LINGUAS): added ro
7286 * src/support/putenv.C: new file
7288 * src/support/mkdir.C: new file
7290 2000-01-20 Allan Rae <rae@lyx.org>
7292 * lib/layouts/IEEEtran.layout: Added several theorem environments
7294 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7295 couple of minor additions.
7297 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7298 (except for those in footnotes of course)
7300 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7302 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7304 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7305 std::sort and std::lower_bound instead of qsort and handwritten
7307 (struct compara): struct that holds the functors used by std::sort
7308 and std::lower_bound in MathedLookupBOP.
7310 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7312 * src/support/LAssert.h: do not do partial specialization. We do
7315 * src/support/lyxlib.h: note that lyx::getUserName() and
7316 lyx::date() are not in use right now. Should these be suppressed?
7318 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7319 (makeLinuxDocFile): do not put date and user name in linuxdoc
7322 * src/support/lyxlib.h (kill): change first argument to long int,
7323 since that's what solaris uses.
7325 * src/support/kill.C (kill): fix declaration to match prototype.
7327 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7328 actually check whether namespaces are supported. This is not what
7331 * src/support/lyxsum.C: add a using directive.
7333 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7335 * src/support/kill.C: if we have namespace support we don't have
7336 to include lyxlib.h.
7338 * src/support/lyxlib.h: use namespace lyx if supported.
7340 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7342 * src/support/date.C: new file
7344 * src/support/chdir.C: new file
7346 * src/support/getUserName.C: new file
7348 * src/support/getcwd.C: new file
7350 * src/support/abort.C: new file
7352 * src/support/kill.C: new file
7354 * src/support/lyxlib.h: moved all the functions in this file
7355 insede struct lyx. Added also kill and abort to this struct. This
7356 is a way to avoid the "kill is not defined in <csignal>", we make
7357 C++ wrappers for functions that are not ANSI C or ANSI C++.
7359 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7360 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7361 lyx it has been renamed to sum.
7363 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7365 * src/text.C: add using directives for std::min and std::max.
7367 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7369 * src/texrow.C (getIdFromRow): actually return something useful in
7370 id and pos. Hopefully fixes the bug with positionning of errorbox
7373 * src/lyx_main.C (easyParse): output an error and exit if an
7374 incorrect command line option has been given.
7376 * src/spellchecker.C (ispell_check_word): document a memory leak.
7378 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7379 where a "struct utimbuf" is allocated with "new" and deleted with
7382 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7384 * src/text2.C (CutSelection): don't delete double spaces.
7385 (PasteSelection): ditto
7386 (CopySelection): ditto
7388 * src/text.C (Backspace): don't delete double spaces.
7390 * src/lyxlex.C (next): fix a bug that were only present with
7391 conformant std::istream::get to read comment lines, use
7392 std::istream::getline instead. This seems to fix the problem.
7394 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7396 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7397 allowed to insert space before space" editing problem. Please read
7398 commends at the beginning of the function. Comments about usage
7401 * src/text.C (InsertChar): fix for the "not allowed to insert
7402 space before space" editing problem.
7404 * src/text2.C (DeleteEmptyParagraphMechanism): when
7405 IsEmptyTableRow can only return false this last "else if" will
7406 always be a no-op. Commented out.
7408 * src/text.C (RedoParagraph): As far as I can understand tmp
7409 cursor is not really needed.
7411 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7412 present it could only return false anyway.
7413 (several functions): Did something not so smart...added a const
7414 specifier on a lot of methods.
7416 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7417 and add a tmp->text.resize. The LyXParagraph constructor does the
7419 (BreakParagraphConservative): ditto
7421 * src/support/path.h (Path): add a define so that the wrong usage
7422 "Path("/tmp") will be flagged as a compilation error:
7423 "`unnamed_Path' undeclared (first use this function)"
7425 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7427 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7428 which was bogus for several reasons.
7430 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7434 * autogen.sh: do not use "type -path" (what's that anyway?).
7436 * src/support/filetools.C (findtexfile): remove extraneous space
7437 which caused a kpsewhich warning (at least with kpathsea version
7440 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7442 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7444 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7446 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7448 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7450 * src/paragraph.C (BreakParagraph): do not reserve space on text
7451 if we don't need to (otherwise, if pos_end < pos, we end up
7452 reserving huge amounts of memory due to bad unsigned karma).
7453 (BreakParagraphConservative): ditto, although I have not seen
7454 evidence the bug can happen here.
7456 * src/lyxparagraph.h: add a using std::list.
7458 2000-01-11 Juergen Vigna <jug@sad.it>
7460 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7463 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7465 * src/vc-backend.C (doVCCommand): change to be static and take one
7466 more parameter: the path to chdir too be fore executing the command.
7467 (retrive): new function equiv to "co -r"
7469 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7470 file_not_found_hook is true.
7472 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7474 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7475 if a file is readwrite,readonly...anything else.
7477 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7479 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7480 (CreatePostscript): name change from MenuRunDVIPS (or something)
7481 (PreviewPostscript): name change from MenuPreviewPS
7482 (PreviewDVI): name change from MenuPreviewDVI
7484 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7485 \view_pdf_command., \pdf_to_ps_command
7487 * lib/configure.m4: added search for PDF viewer, and search for
7488 PDF to PS converter.
7489 (lyxrc.defaults output): add \pdflatex_command,
7490 \view_pdf_command and \pdf_to_ps_command.
7492 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7494 * src/bufferlist.C (write): we don't use blocksize for anything so
7497 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7499 * src/support/block.h: disable operator T* (), since it causes
7500 problems with both compilers I tried. See comments in the file.
7502 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7505 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7506 variable LYX_DIR_10x to LYX_DIR_11x.
7508 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7510 * INSTALL: document --with-lyxname.
7513 * configure.in: new configure flag --with-lyxname which allows to
7514 choose the name under which lyx is installed. Default is "lyx", of
7515 course. It used to be possible to do this with --program-suffix,
7516 but the later has in fact a different meaning for autoconf.
7518 * src/support/lstrings.h (lstrchr): reformat a bit.
7520 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7521 * src/mathed/math_defs.h: ditto.
7523 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7525 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7526 true, decides if we create a backup file or not when saving. New
7527 tag and variable \pdf_mode, defaults to false. New tag and
7528 variable \pdflatex_command, defaults to pdflatex. New tag and
7529 variable \view_pdf_command, defaults to xpdf. New tag and variable
7530 \pdf_to_ps_command, defaults to pdf2ps.
7532 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7534 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7535 does not have a BufferView.
7536 (unlockInset): ditto + don't access the_locking_inset if the
7537 buffer does not have a BufferView.
7539 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7540 certain circumstances so that we don't continue a keyboard
7541 operation long after the key was released. Try f.ex. to load a
7542 large document, press PageDown for some seconds and then release
7543 it. Before this change the document would contine to scroll for
7544 some time, with this change it stops imidiatly.
7546 * src/support/block.h: don't allocate more space than needed. As
7547 long as we don't try to write to the arr[x] in a array_type arr[x]
7548 it is perfectly ok. (if you write to it you might segfault).
7549 added operator value_type*() so that is possible to pass the array
7550 to functions expecting a C-pointer.
7552 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7555 * intl/*: updated to gettext 0.10.35, tried to add our own
7556 required modifications. Please verify.
7558 * po/*: updated to gettext 0.10.35, tried to add our own required
7559 modifications. Please verify.
7561 * src/support/lstrings.C (tostr): go at fixing the problem with
7562 cxx and stringstream. When stringstream is used return
7563 oss.str().c_str() so that problems with lyxstring and basic_string
7564 are avoided. Note that the best solution would be for cxx to use
7565 basic_string all the way, but it is not conformant yet. (it seems)
7567 * src/lyx_cb.C + other files: moved several global functions to
7568 class BufferView, some have been moved to BufferView.[Ch] others
7569 are still located in lyx_cb.C. Code changes because of this. (part
7570 of "get rid of current_view project".)
7572 * src/buffer.C + other files: moved several Buffer functions to
7573 class BufferView, the functions are still present in buffer.C.
7574 Code changes because of this.
7576 * config/lcmessage.m4: updated to most recent. used when creating
7579 * config/progtest.m4: updated to most recent. used when creating
7582 * config/gettext.m4: updated to most recent. applied patch for
7585 * config/gettext.m4.patch: new file that shows what changes we
7586 have done to the local copy of gettext.m4.
7588 * config/libtool.m4: new file, used in creation of acinclude.m4
7590 * config/lyxinclude.m4: new file, this is the lyx created m4
7591 macros, used in making acinclude.m4.
7593 * autogen.sh: GNU m4 discovered as a separate task not as part of
7594 the lib/configure creation.
7595 Generate acinlucde from files in config. Actually cat
7596 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7597 easier to upgrade .m4 files that really are external.
7599 * src/Spacing.h: moved using std::istringstream to right after
7600 <sstream>. This should fix the problem seen with some compilers.
7602 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7604 * src/lyx_cb.C: began some work to remove the dependency a lot of
7605 functions have on BufferView::text, even if not really needed.
7606 (GetCurrentTextClass): removed this func, it only hid the
7609 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7610 forgot this in last commit.
7612 * src/Bullet.C (bulletEntry): use static char const *[] for the
7613 tables, becuase of this the return arg had to change to string.
7615 (~Bullet): removed unneeded destructor
7617 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7618 (insetSleep): moved from Buffer
7619 (insetWakeup): moved from Buffer
7620 (insetUnlock): moved from Buffer
7622 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7623 from Buffer to BufferView.
7625 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7627 * config/ltmain.sh: updated to version 1.3.4 of libtool
7629 * config/ltconfig: updated to version 1.3.4 of libtool
7631 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7634 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7635 Did I get that right?
7637 * src/lyxlex.h: add a "using" directive or two.
7638 * src/Spacing.h: ditto.
7639 * src/insets/figinset.C: ditto.
7640 * src/support/filetools.C: ditto.
7641 * src/support/lstrings.C: ditto.
7642 * src/BufferView.C: ditto.
7643 * src/bufferlist.C: ditto.
7644 * src/lyx_cb.C: ditto.
7645 * src/lyxlex.C: ditto.
7647 * NEWS: add some changes for 1.1.4.
7649 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7651 * src/BufferView.C: first go at a TextCache to speed up switching
7654 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7656 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7657 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7658 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7659 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7662 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7663 members of the struct are correctly initialized to 0 (detected by
7665 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7666 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7668 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7669 pidwait, since it was allocated with "new". This was potentially
7670 very bad. Thanks to Michael Schmitt for running purify for us.
7673 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7675 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7677 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7679 1999-12-30 Allan Rae <rae@lyx.org>
7681 * lib/templates/IEEEtran.lyx: minor change
7683 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7684 src/mathed/formula.C (LocalDispatch): askForText changes
7686 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7687 know when a user has cancelled input. Fixes annoying problems with
7688 inserting labels and version control.
7690 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7692 * src/support/lstrings.C (tostr): rewritten to use strstream and
7695 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7697 * src/support/filetools.C (IsFileWriteable): use fstream to check
7698 (IsDirWriteable): use fileinfo to check
7700 * src/support/filetools.h (FilePtr): whole class deleted
7702 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7704 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7706 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7708 * src/bufferlist.C (write): use ifstream and ofstream instead of
7711 * src/Spacing.h: use istrstream instead of sscanf
7713 * src/mathed/math_defs.h: change first arg to istream from FILE*
7715 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7717 * src/mathed/math_parser.C: have yyis to be an istream
7718 (LexGetArg): use istream (yyis)
7720 (mathed_parse): ditto
7721 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7723 * src/mathed/formula.C (Read): rewritten to use istream
7725 * src/mathed/formulamacro.C (Read): rewritten to use istream
7727 * src/lyxlex.h (~LyXLex): deleted desturctor
7728 (getStream): new function, returns an istream
7729 (getFile): deleted funtion
7730 (IsOK): return is.good();
7732 * src/lyxlex.C (LyXLex): delete file and owns_file
7733 (setFile): open an filebuf and assign that to a istream instead of
7735 (setStream): new function, takes an istream as arg.
7736 (setFile): deleted function
7737 (EatLine): rewritten us use istream instead of FILE*
7741 * src/table.C (LyXTable): use istream instead of FILE*
7742 (Read): rewritten to take an istream instead of FILE*
7744 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7746 * src/buffer.C (Dispatch): remove an extraneous break statement.
7748 * src/support/filetools.C (QuoteName): change to do simple
7749 'quoting'. More work is necessary. Also changed to do nothing
7750 under emx (needs fix too).
7751 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7753 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7754 config.h.in to the AC_DEFINE_UNQUOTED() call.
7755 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7756 needs char * as argument (because Solaris 7 declares it like
7759 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7760 remove definition of BZERO.
7762 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7764 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7765 defined, "lyxregex.h" if not.
7767 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7769 (REGEX): new variable that is set to regex.c lyxregex.h when
7770 AM_CONDITIONAL USE_REGEX is set.
7771 (libsupport_la_SOURCES): add $(REGEX)
7773 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7776 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7779 * configure.in: add call to LYX_REGEX
7781 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7782 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7784 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7786 * lib/bind/fi_menus.bind: new file, from
7787 pauli.virtanen@saunalahti.fi.
7789 * src/buffer.C (getBibkeyList): pass the parameter delim to
7790 InsetInclude::getKeys and InsetBibtex::getKeys.
7792 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7793 is passed to Buffer::getBibkeyList
7795 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7796 instead of the hardcoded comma.
7798 * src/insets/insetbib.C (getKeys): make sure that there are not
7799 leading blanks in bibtex keys. Normal latex does not care, but
7800 harvard.sty seems to dislike blanks at the beginning of citation
7801 keys. In particular, the retturn value of the function is
7803 * INSTALL: make it clear that libstdc++ is needed and that gcc
7804 2.7.x probably does not work.
7806 * src/support/filetools.C (findtexfile): make debug message go to
7808 * src/insets/insetbib.C (getKeys): ditto
7810 * src/debug.C (showTags): make sure that the output is correctly
7813 * configure.in: add a comment for TWO_COLOR_ICON define.
7815 * acconfig.h: remove all the entries that already defined in
7816 configure.in or acinclude.m4.
7818 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7819 to avoid user name, date and copyright.
7821 1999-12-21 Juergen Vigna <jug@sad.it>
7823 * src/table.C (Read): Now read bogus row format informations
7824 if the format is < 5 so that afterwards the table can
7825 be read by lyx but without any format-info. Fixed the
7826 crash we experienced when not doing this.
7828 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7830 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7831 (RedoDrawingOfParagraph): ditto
7832 (RedoParagraphs): ditto
7833 (RemoveTableRow): ditto
7835 * src/text.C (Fill): rename arg paperwidth -> paper_width
7837 * src/buffer.C (insertLyXFile): rename var filename -> fname
7838 (writeFile): rename arg filename -> fname
7839 (writeFileAscii): ditto
7840 (makeLaTeXFile): ditto
7841 (makeLinuxDocFile): ditto
7842 (makeDocBookFile): ditto
7844 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7847 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7849 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7852 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7853 compiled by a C compiler not C++.
7855 * src/layout.h (LyXTextClass): added typedef for const_iterator
7856 (LyXTextClassList): added typedef for const_iterator + member
7857 functions begin and end.
7859 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7860 iterators to fill the choice_class.
7861 (updateLayoutChoice): rewritten to use iterators to fill the
7862 layoutlist in the toolbar.
7864 * src/BufferView.h (BufferView::work_area_width): removed unused
7867 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7869 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7870 (sgmlCloseTag): ditto
7872 * src/support/lstrings.h: return type of countChar changed to
7875 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7876 what version of this func to use. Also made to return unsigned int.
7878 * configure.in: call LYX_STD_COUNT
7880 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7881 conforming std::count.
7883 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7885 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7886 and a subscript would give bad display (patch from Dekel Tsur
7887 <dekel@math.tau.ac.il>).
7889 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7891 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7894 * src/chset.h: add a few 'using' directives
7896 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7897 triggered when no buffer is active
7899 * src/layout.C: removed `break' after `return' in switch(), since
7902 * src/lyx_main.C (init): make sure LyX can be ran in place even
7903 when libtool has done its magic with shared libraries. Fix the
7904 test for the case when the system directory has not been found.
7906 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7907 name for the latex file.
7908 (MenuMakeHTML): ditto
7910 * src/buffer.h: add an optional boolean argument, which is passed
7913 1999-12-20 Allan Rae <rae@lyx.org>
7915 * lib/templates/IEEEtran.lyx: small correction and update.
7917 * configure.in: Attempted to use LYX_PATH_HEADER
7919 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7921 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7922 input from JMarc. Now use preprocessor to find the header.
7923 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7924 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7925 LYX_STL_STRING_FWD. See comments in file.
7927 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7929 * The global MiniBuffer * minibuffer variable is dead.
7931 * The global FD_form_main * fd_form_main variable is dead.
7933 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7935 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7937 * src/table.h: add the LOstream.h header
7938 * src/debug.h: ditto
7940 * src/LyXAction.h: change the explaination of the ReadOnly
7941 attribute: is indicates that the function _can_ be used.
7943 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7946 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7948 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7954 * src/paragraph.C (GetWord): assert on pos>=0
7957 * src/support/lyxstring.C: condition the use of an invariant on
7959 * src/support/lyxstring.h: ditto
7961 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7962 Use LAssert.h instead of plain assert().
7964 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7966 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7967 * src/support/filetools.C: ditto
7969 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7972 * INSTALL: document the new configure flags
7974 * configure.in: suppress --with-debug; add --enable-assertions
7976 * acinclude.m4: various changes in alignment of help strings.
7978 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7980 * src/kbmap.C: commented out the use of the hash map in kb_map,
7981 beginning of movement to a stl::container.
7983 * several files: removed code that was not in effect when
7984 MOVE_TEXT was defined.
7986 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7987 for escaping should not be used. We can discuss if the string
7988 should be enclosed in f.ex. [] instead of "".
7990 * src/trans_mgr.C (insert): use the new returned value from
7991 encodeString to get deadkeys and keymaps done correctly.
7993 * src/chset.C (encodeString): changed to return a pair, to tell
7994 what to use if we know the string.
7996 * src/lyxscreen.h (fillArc): new function.
7998 * src/FontInfo.C (resize): rewritten to use more std::string like
7999 structore, especially string::replace.
8001 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8004 * configure.in (chmod +x some scripts): remove config/gcc-hack
8006 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8008 * src/buffer.C (writeFile): change once again the top comment in a
8009 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8010 instead of an hardcoded version number.
8011 (makeDocBookFile): ditto
8013 * src/version.h: add new define LYX_DOCVERSION
8015 * po/de.po: update from Pit Sütterlin
8016 * lib/bind/de_menus.bind: ditto.
8018 * src/lyxfunc.C (Dispatch): call MenuExport()
8019 * src/buffer.C (Dispatch): ditto
8021 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8022 LyXFunc::Dispatch().
8023 (MenuExport): new function, moved from
8024 LyXFunc::Dispatch().
8026 * src/trans_mgr.C (insert): small cleanup
8027 * src/chset.C (loadFile): ditto
8029 * lib/kbd/iso8859-1.cdef: add missing backslashes
8031 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8033 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8034 help with placing the manually drawn accents better.
8036 (Draw): x2 and hg changed to float to minimize rounding errors and
8037 help place the accents better.
8039 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8040 unsigned short to char is just wrong...cast the char to unsigned
8041 char instead so that the two values can compare sanely. This
8042 should also make the display of insetlatexaccents better and
8043 perhaps also some other insets.
8045 (lbearing): new function
8048 1999-12-15 Allan Rae <rae@lyx.org>
8050 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
8051 header that provides a wrapper around the very annoying SGI STL header
8054 * src/support/lyxstring.C, src/LString.h:
8055 removed old SGI-STL-compatability attempts.
8057 * configure.in: Use LYX_STL_STRING_FWD.
8059 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
8060 stl_string_fwd.h is around and try to determine it's location.
8061 Major improvement over previous SGI STL 3.2 compatability.
8062 Three small problems remain with this function due to my zero
8063 knowledge of autoconf. JMarc and lgb see the comments in the code.
8065 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8067 * src/broken_const.h, config/hack-gcc, config/README: removed
8069 * configure.in: remove --with-gcc-hack option; do not call
8072 * INSTALL: remove documentation of --with-broken-const and
8075 * acconfig.h: remove all trace of BROKEN_CONST define
8077 * src/buffer.C (makeDocBookFile): update version number in output
8079 (SimpleDocBookOnePar): fix an assert when trying to a character
8080 access beyond string length
8083 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8085 * po/de.po: fix the Export menu
8087 * lyx.man: update the description of -dbg
8089 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
8090 (commandLineHelp): updated
8091 (easyParse): show list of available debug levels if -dbg is passed
8094 * src/Makefile.am: add debug.C
8096 * src/debug.h: moved some code to debug.C
8098 * src/debug.C: new file. Contains code to set and show debug
8101 * src/layout.C: remove 'break' after 'continue' in switch
8102 statements, since these cannot be reached.
8104 1999-12-13 Allan Rae <rae@lyx.org>
8106 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8107 (in_word_set): hash() -> math_hash()
8109 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8111 * acconfig.h: Added a test for whether we are using exceptions in the
8112 current compilation run. If so USING_EXCEPTIONS is defined.
8114 * config.in: Check for existance of stl_string_fwd.h
8115 * src/LString.h: If compiling --with-included-string and SGI's
8116 STL version 3.2 is present (see above test) we need to block their
8117 forward declaration of string and supply a __get_c_string().
8118 However, it turns out this is only necessary if compiling with
8119 exceptions enabled so I've a bit more to add yet.
8121 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8122 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8123 src/support/LRegex.h, src/undo.h:
8124 Shuffle the order of the included files a little to ensure that
8125 LString.h gets included before anything that includes stl_string_fwd.h
8127 * src/support/lyxstring.C: We need to #include LString.h instead of
8128 lyxstring.h to get the necessary definition of __get_c_string.
8129 (__get_c_string): New function. This is defined static just like SGI's
8130 although why they need to do this I'm not sure. Perhaps it should be
8131 in lstrings.C instead.
8133 * lib/templates/IEEEtran.lyx: New template file.
8135 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8137 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8138 * intl/Makefile.in (MKINSTALLDIRS): ditto
8140 * src/LyXAction.C (init): changed to hold the LFUN data in a
8141 automatic array in stead of in callso to newFunc, this speeds up
8142 compilation a lot. Also all the memory used by the array is
8143 returned when the init is completed.
8145 * a lot of files: compiled with -Wold-style-cast, changed most of
8146 the reported offenders to C++ style casts. Did not change the
8147 offenders in C files.
8149 * src/trans.h (Match): change argument type to unsigned int.
8151 * src/support/DebugStream.C: fix some types on the streambufs so
8152 that it works on a conforming implementation.
8154 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8156 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8158 * src/support/lyxstring.C: remove the inline added earlier since
8159 they cause a bunch of unsatisfied symbols when linking with dec
8160 cxx. Cxx likes to have the body of inlines at the place where they
8163 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8164 accessing negative bounds in array. This fixes the crash when
8165 inserting accented characters.
8166 * src/trans.h (Match): ditto
8168 * src/buffer.C (Dispatch): since this is a void, it should not try
8169 to return anything...
8171 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8173 * src/buffer.h: removed the two friends from Buffer. Some changes
8174 because of this. Buffer::getFileName and Buffer::setFileName
8175 renamed to Buffer::fileName() and Buffer::fileName(...).
8177 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8179 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8180 and Buffer::update(short) to BufferView. This move is currently
8181 controlled by a define MOVE_TEXT, this will be removed when all
8182 shows to be ok. This move paves the way for better separation
8183 between buffer contents and buffer view. One side effect is that
8184 the BufferView needs a rebreak when swiching buffers, if we want
8185 to avoid this we can add a cache that holds pointers to LyXText's
8186 that is not currently in use.
8188 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8191 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8193 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8195 * lyx_main.C: new command line option -x (or --execute) and
8196 -e (or --export). Now direct conversion from .lyx to .tex
8197 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8198 Unfortunately, X is still needed and the GUI pops up during the
8201 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8203 * src/Spacing.C: add a using directive to bring stream stuff into
8205 * src/paragraph.C: ditto
8206 * src/buffer.C: ditto
8208 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8209 from Lars' announcement).
8211 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8212 example files from Tino Meinen.
8214 1999-12-06 Allan Rae <rae@lyx.org>
8216 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8218 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8220 * src/support/lyxstring.C: added a lot of inline for no good
8223 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8224 latexWriteEndChanges, they were not used.
8226 * src/layout.h (operator<<): output operator for PageSides
8228 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8230 * some example files: loaded in LyX 1.0.4 and saved again to update
8231 certain constructs (table format)
8233 * a lot of files: did the change to use fstream/iostream for all
8234 writing of files. Done with a close look at Andre Poenitz's patch.
8236 * some files: whitespace changes.
8238 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8240 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8241 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8242 architecture, we provide our own. It is used unconditionnally, but
8243 I do not think this is a performance problem. Thanks to Angus
8244 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8245 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8247 (GetInset): use my_memcpy.
8251 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8252 it is easier to understand, but it uses less TeX-only constructs now.
8254 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8255 elements contain spaces
8257 * lib/configure: regenerated
8259 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8260 elements contain spaces; display the list of programs that are
8263 * autogen.sh: make sure lib/configure is executable
8265 * lib/examples/*: rename the tutorial examples to begin with the
8266 two-letters language code.
8268 * src/lyxfunc.C (getStatus): do not query current font if no
8271 * src/lyx_cb.C (RunScript): use QuoteName
8272 (MenuRunDvips): ditto
8273 (PrintApplyCB): ditto
8275 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8276 around argument, so that it works well with the current shell.
8277 Does not work properly with OS/2 shells currently.
8279 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8280 * src/LyXSendto.C (SendtoApplyCB): ditto
8281 * src/lyxfunc.C (Dispatch): ditto
8282 * src/buffer.C (runLaTeX): ditto
8283 (runLiterate): ditto
8284 (buildProgram): ditto
8286 * src/lyx_cb.C (RunScript): ditto
8287 (MenuMakeLaTeX): ditto
8289 * src/buffer.h (getLatexName): new method
8291 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8293 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8295 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8296 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8297 (create_math_panel): ditto
8299 * src/lyxfunc.C (getStatus): re-activate the code which gets
8300 current font and cursor; add test for export to html.
8302 * src/lyxrc.C (read): remove unreachable break statements; add a
8305 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8307 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8309 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8310 introduced by faulty regex.
8311 * src/buffer.C: ditto
8312 * src/lastfiles.C: ditto
8313 * src/paragraph.C: ditto
8314 * src/table.C: ditto
8315 * src/vspace.C: ditto
8316 * src/insets/figinset.C: ditto
8317 Note: most of these is absolutely harmless, except the one in
8318 src/mathed formula.C.
8320 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8322 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8323 operation, yielding correct results for the reLyX command.
8325 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8327 * src/support/filetools.C (ExpandPath): removed an over eager
8329 (ReplaceEnvironmentPath): ditto
8331 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8332 shows that we are doing something fishy in our code...
8336 * src/lyxrc.C (read): use a double switch trick to get more help
8337 from the compiler. (the same trick is used in layout.C)
8338 (write): new function. opens a ofstream and pass that to output
8339 (output): new function, takes a ostream and writes the lyxrc
8340 elemts to it. uses a dummy switch to make sure no elements are
8343 * src/lyxlex.h: added a struct pushpophelper for use in functions
8344 with more than one exit point.
8346 * src/lyxlex.[Ch] (GetInteger): made it const
8350 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8352 * src/layout.[hC] : LayoutTags splitted into several enums, new
8353 methods created, better error handling cleaner use of lyxlex. Read
8356 * src/bmtable.[Ch]: change some member prototypes because of the
8357 image const changes.
8359 * commandtags.h, src/LyXAction.C (init): new function:
8360 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8361 This file is not read automatically but you can add \input
8362 preferences to your lyxrc if you want to. We need to discuss how
8365 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8366 in .aux, also remove .bib and .bst files from dependencies when
8369 * src/BufferView.C, src/LyXView.C: add const_cast several places
8370 because of changes to images.
8372 * lib/images/*: same change as for images/*
8374 * lib/lyxrc.example: Default for accept_compound is false not no.
8376 * images/*: changed to be const, however I have som misgivings
8377 about this change so it might be changed back.
8379 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8381 * lib/configure, po/POTFILES.in: regenerated
8383 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8385 * config/lib_configure.m4: removed
8387 * lib/configure.m4: new file (was config/lib_configure.m4)
8389 * configure.in: do not test for rtti, since we do not use it.
8391 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8393 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8394 doubling of allocated space scheme. This makes it faster for large
8395 strings end to use less memory for small strings. xtra rememoved.
8397 * src/insets/figinset.C (waitalarm): commented out.
8398 (GhostscriptMsg): use static_cast
8399 (GhostscriptMsg): use new instead of malloc to allocate memory for
8400 cmap. also delete the memory after use.
8402 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8404 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8405 for changes in bibtex database or style.
8406 (runBibTeX): remove all .bib and .bst files from dep before we
8408 (run): use scanAuc in when dep file already exist.
8410 * src/DepTable.C (remove_files_with_extension): new method
8413 * src/DepTable.[Ch]: made many of the methods const.
8415 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8417 * src/bufferparams.C: make sure that the default textclass is
8418 "article". It used to be the first one by description order, but
8419 now the first one is "docbook".
8421 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8422 string; call Debug::value.
8423 (easyParse): pass complete argument to setDebuggingLevel().
8425 * src/debug.h (value): fix the code that parses debug levels.
8427 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8430 * src/LyXAction.C: use Debug::ACTION as debug channel.
8432 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8434 * NEWS: updated for the future 1.1.3 release.
8436 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8437 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8438 it should. This is of course a controversial change (since many
8439 people will find that their lyx workscreen is suddenly full of
8440 red), but done for the sake of correctness.
8442 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8443 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8445 * src/insets/inseterror.h, src/insets/inseturl.h,
8446 src/insets/insetinfo.h, src/insets/figinset.h,
8447 src/mathed/formulamacro.h, src/mathed/math_macro.h
8448 (EditMessage): add a missing const and add _() to make sure that
8451 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8452 src/insets/insetbib.C, src/support/filetools.C: add `using'
8455 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8456 doing 'Insert index of last word' at the beginning of a paragraph.
8458 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8460 * several files: white-space changes.
8462 * src/mathed/formula.C: removed IsAlpha and IsDigit
8464 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8465 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8468 * src/insets/figinset.C (GetPSSizes): don't break when
8469 "EndComments" is seen. But break when a boundingbox is read.
8471 * all classes inherited from Inset: return value of Clone
8472 changed back to Inset *.
8474 * all classes inherited form MathInset: return value of Clone
8475 changed back to MathedInset *.
8477 * src/insets/figinset.C (runqueue): use a ofstream to output the
8478 gs/ps file. Might need some setpresicion or setw. However I can
8479 see no problem with the current code.
8480 (runqueue): use sleep instead of the alarm/signal code. I just
8481 can't see the difference.
8483 * src/paragraph.C (LyXParagraph): reserve space in the new
8484 paragraph and resize the inserted paragraph to just fit.
8486 * src/lyxfunc.h (operator|=): added operator for func_status.
8488 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8489 check for readable file.
8491 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8492 check for readable file.
8493 (MenuMakeLinuxDoc): ditto
8494 (MenuMakeDocBook): ditto
8495 (MenuMakeAscii): ditto
8496 (InsertAsciiFile): split the test for openable and readable
8498 * src/bmtable.C (draw_bitmaptable): use
8499 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8501 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8502 findtexfile from LaTeX to filetools.
8504 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8505 instead of FilePtr. Needs to be verified by a literate user.
8507 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8509 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8510 (EditMessage): likewise.
8512 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8513 respectively as \textasciitilde and \textasciicircum.
8515 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8517 * src/support/lyxstring.h: made the methods that take iterators
8520 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8521 (regexMatch): made is use the real regex class.
8523 * src/support/Makefile.am: changed to use libtool
8525 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8527 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8529 (MathIsInset ++): changed several macros to be inline functions
8532 * src/mathed/Makefile.am: changed to use libtool
8534 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8536 * src/insets/inset* : Clone changed to const and return type is
8537 the true insettype not just Inset*.
8539 * src/insets/Makefile.am: changed to use libtool
8541 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8543 * src/undo.[Ch] : added empty() and changed some of the method
8546 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8548 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8549 setID use block<> for the bullets array, added const several places.
8551 * src/lyxfunc.C (getStatus): new function
8553 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8554 LyXAction, added const to several funtions.
8556 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8557 a std::map, and to store the dir items in a vector.
8559 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8562 * src/LyXView.[Ch] + other files : changed currentView to view.
8564 * src/LyXAction.[Ch] : ported from the old devel branch.
8566 * src/.cvsignore: added .libs and a.out
8568 * configure.in : changes to use libtool.
8570 * acinclude.m4 : inserted libtool.m4
8572 * .cvsignore: added libtool
8574 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8576 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8577 file name in insets and mathed directories (otherwise the
8578 dependency is not taken in account under cygwin).
8580 * src/text2.C (InsertString[AB]): make sure that we do not try to
8581 read characters past the string length.
8583 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8585 * lib/doc/LaTeXConfig.lyx.in,
8586 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8588 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8589 file saying who created them and when this heppened; this is
8590 useless and annoys tools like cvs.
8592 * lib/layouts/g-brief-{en,de}.layout,
8593 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8594 from Thomas Hartkens <thomas@hartkens.de>.
8596 * src/{insets,mathed}/Makefile.am: do not declare an empty
8597 LDFLAGS, so that it can be set at configure time (useful on Irix
8600 * lib/reLyX/configure.in: make sure that the prefix is set
8601 correctly in LYX_DIR.
8603 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8605 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8606 be used by 'command-sequence' this allows to bind a key to a
8607 sequence of LyX-commands
8608 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8610 * src/LyXAction.C: add "command-sequence"
8612 * src/LyXFunction.C: handling of "command-sequence"
8614 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8615 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8617 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8619 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8621 * src/buffer.C (writeFile): Do not output a comment giving user
8622 and date at the beginning of a .lyx file. This is useless and
8623 annoys cvs anyway; update version number to 1.1.
8625 * src/Makefile.am (LYX_DIR): add this definition, so that a
8626 default path is hardcoded in LyX.
8628 * configure.in: Use LYX_GNU_GETTEXT.
8630 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8631 AM_GNU_GETTEXT with a bug fixed.
8633 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8635 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8637 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8638 which is used to point to LyX data is now LYX_DIR_11x.
8640 * lyx.man: convert to a unix text file; small updates.
8642 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8644 * src/support/LSubstring.[Ch]: made the second arg of most of the
8645 constructors be a const reference.
8647 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8650 * src/support/lyxstring.[Ch] (swap): added missing member function
8651 and specialization of swap(str, str);
8653 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8655 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8656 trace of the old one.
8658 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8659 put the member definitions in undo.C.
8661 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8662 NEW_TEXT and have now only code that was included when this was
8665 * src/intl.C (LCombo): use static_cast
8667 (DispatchCallback): ditto
8669 * src/definitions.h: removed whole file
8671 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8673 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8674 parsing and stores in a std:map. a regex defines the file format.
8675 removed unneeded members.
8677 * src/bufferparams.h: added several enums from definitions.h here.
8678 Removed unsused destructor. Changed some types to use proper enum
8679 types. use block to have the temp_bullets and user_defined_bullets
8680 and to make the whole class assignable.
8682 * src/bufferparams.C (Copy): removed this functions, use a default
8685 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8688 * src/buffer.C (readLyXformat2): commend out all that have with
8689 oldpapersize to do. also comment out all that hve to do with
8690 insetlatex and insetlatexdel.
8691 (setOldPaperStuff): commented out
8693 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8695 * src/LyXAction.C: remove use of inset-latex-insert
8697 * src/mathed/math_panel.C (button_cb): use static_cast
8699 * src/insets/Makefile.am (insets_o_SOURCES): removed
8702 * src/support/lyxstring.C (helper): use the unsigned long
8703 specifier, UL, instead of a static_cast.
8705 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8707 * src/support/block.h: new file. to be used as a c-style array in
8708 classes, so that the class can be assignable.
8710 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8712 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8713 NULL, make sure to return an empty string (it is not possible to
8714 set a string to NULL).
8716 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8718 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8720 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8722 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8723 link line, so that Irix users (for example) can set it explicitely to
8726 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8727 it can be overidden at make time (static or dynamic link, for
8730 * src/vc-backend.C, src/LaTeXFeatures.h,
8731 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8732 statements to bring templates to global namespace.
8734 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8736 * src/support/lyxstring.C (operator[] const): make it standard
8739 * src/minibuffer.C (Init): changed to reflect that more
8740 information is given from the lyxvc and need not be provided here.
8742 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8744 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8746 * src/LyXView.C (UpdateTimerCB): use static_cast
8747 (KeyPressMask_raw_callback): ditto
8749 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8750 buffer_, a lot of changes because of this. currentBuffer() ->
8751 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8752 also changes to other files because of this.
8754 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8756 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8757 have no support for RCS and partial support for CVS, will be
8760 * src/insets/ several files: changes because of function name
8761 changes in Bufferview and LyXView.
8763 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8765 * src/support/LSubstring.[Ch]: new files. These implement a
8766 Substring that can be very convenient to use. i.e. is this
8768 string a = "Mary had a little sheep";
8769 Substring(a, "sheep") = "lamb";
8770 a is now "Mary has a little lamb".
8772 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8773 out patterns and subpatterns of strings. It is used by LSubstring
8774 and also by vc-backend.C
8776 * src/support/lyxstring.C: went over all the assertions used and
8777 tried to correct the wrong ones and flag which of them is required
8778 by the standard. some bugs found because of this. Also removed a
8779 couple of assertions.
8781 * src/support/Makefile.am (libsupport_a_SOURCES): added
8782 LSubstring.[Ch] and LRegex.[Ch]
8784 * src/support/FileInfo.h: have struct stat buf as an object and
8785 not a pointer to one, some changes because of this.
8787 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8788 information in layout when adding the layouts preamble to the
8791 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8794 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8795 because of bug in OS/2.
8797 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8799 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8800 \verbatim@font instead of \ttfamily, so that it can be redefined.
8802 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8803 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8804 src/layout.h, src/text2.C: add 'using' directive to bring the
8805 STL templates we need from the std:: namespace to the global one.
8806 Needed by DEC cxx in strict ansi mode.
8808 * src/support/LIstream.h,src/support/LOstream.h,
8809 src/support/lyxstring.h,src/table.h,
8810 src/lyxlookup.h: do not include <config.h> in header
8811 files. This should be done in the .C files only.
8813 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8817 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8819 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8820 from Kayvan to fix the tth invokation.
8822 * development/lyx.spec.in: updates from Kayvan to reflect the
8823 changes of file names.
8825 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8827 * src/text2.C (InsertStringB): use std::copy
8828 (InsertStringA): use std::copy
8830 * src/bufferlist.C: use a vector to store the buffers in. This is
8831 an internal change and should not affect any other thing.
8833 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8836 * src/text.C (Fill): fix potential bug, one off bug.
8838 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8840 * src/Makefile.am (lyx_main.o): add more files it depends on.
8842 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8844 * src/support/lyxstring.C: use size_t for the reference count,
8845 size, reserved memory and xtra.
8846 (internal_compare): new private member function. Now the compare
8847 functions should work for std::strings that have embedded '\0'
8849 (compare): all compare functions rewritten to use
8852 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8854 * src/support/lyxstring.C (compare): pass c_str()
8855 (compare): pass c_str
8856 (compare): pass c_str
8858 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8860 * src/support/DebugStream.C: <config.h> was not included correctly.
8862 * lib/configure: forgot to re-generate it :( I'll make this file
8863 auto generated soon.
8865 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8867 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8870 * src/support/lyxstring.C: some changes from length() to rep->sz.
8871 avoids a function call.
8873 * src/support/filetools.C (SpaceLess): yet another version of the
8874 algorithm...now per Jean-Marc's suggestions.
8876 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8878 * src/layout.C (less_textclass_desc): functor for use in sorting
8880 (LyXTextClass::Read): sort the textclasses after reading.
8882 * src/support/filetools.C (SpaceLess): new version of the
8883 SpaceLess functions. What problems does this one give? Please
8886 * images/banner_bw.xbm: made the arrays unsigned char *
8888 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8890 * src/support/lyxstring.C (find): remove bogus assertion in the
8891 two versions of find where this has not been done yet.
8893 * src/support/lyxlib.h: add missing int return type to
8896 * src/menus.C (ShowFileMenu): disable exporting to html if no
8897 html export command is present.
8899 * config/lib_configure.m4: add a test for an HTML converter. The
8900 programs checked for are, in this order: tth, latex2html and
8903 * lib/configure: generated from config/lib_configure.m4.
8905 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8906 html converter. The parameters are now passed through $$FName and
8907 $$OutName, instead of standard input/output.
8909 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8911 * lib/lyxrc.example: update description of \html_command.
8912 add "quotes" around \screen_font_xxx font setting examples to help
8913 people who use fonts with spaces in their names.
8915 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8917 * Distribution files: updates for v1.1.2
8919 * src/support/lyxstring.C (find): remove bogus assert and return
8920 npos for the same condition.
8922 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8924 * added patch for OS/2 from SMiyata.
8926 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8928 * src/text2.C (CutSelection): make space_wrapped a bool
8929 (CutSelection): dont declare int i until we have to.
8930 (alphaCounter): return a char const *.
8932 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8934 * src/support/syscall.C (Systemcalls::kill):
8935 src/support/filetools.C (PutEnv, PutEnvPath):
8936 src/lyx_cb.C (addNewlineAndDepth):
8937 src/FontInfo.C (FontInfo::resize): condition some #warning
8938 directives with WITH_WARNINGS.
8941 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8943 * src/layout.[Ch] + several files: access to class variables
8944 limited and made accessor functions instead a lot of code changed
8945 becuase of this. Also instead of returning pointers often a const
8946 reference is returned instead.
8948 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8950 * src/Makefile.am (dist-hook): added used to remove the CVS from
8951 cheaders upon creating a dist
8952 (EXTRA_DIST): added cheaders
8954 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8955 a character not as a small integer.
8957 * src/support/lyxstring.C (find): removed Assert and added i >=
8958 rep->sz to the first if.
8960 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8962 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8963 src/LyXView.C src/buffer.C src/bufferparams.C
8964 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8965 src/text2.C src/insets/insetinclude.C:
8966 lyxlayout renamed to textclasslist.
8968 * src/layout.C: some lyxerr changes.
8970 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8971 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8972 (LyXLayoutList): removed all traces of this class.
8973 (LyXTextClass::Read): rewrote LT_STYLE
8974 (LyXTextClass::hasLayout): new function
8975 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8976 both const and nonconst version.
8977 (LyXTextClass::delete_layout): new function.
8978 (LyXTextClassList::Style): bug fix. do the right thing if layout
8980 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8981 (LyXTextClassList::NameOfLayout): ditto
8982 (LyXTextClassList::Load): ditto
8984 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8986 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8988 * src/LyXAction.C (LookupFunc): added a workaround for sun
8989 compiler, on the other hand...we don't know if the current code
8990 compiles on sun at all...
8992 * src/support/filetools.C (CleanupPath): subst fix
8994 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8997 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8998 complained about this one?
9000 * src/insets/insetinclude.C (Latex): subst fix
9002 * src/insets/insetbib.C (getKeys): subst fix
9004 * src/LyXSendto.C (SendtoApplyCB): subst fix
9006 * src/lyx_main.C (init): subst fix
9008 * src/layout.C (Read): subst fix
9010 * src/lyx_sendfax_main.C (button_send): subst fix
9012 * src/buffer.C (RoffAsciiTable): subst fix
9014 * src/lyx_cb.C (MenuFax): subst fix
9015 (PrintApplyCB): subst fix
9017 1999-10-26 Juergen Vigna <jug@sad.it>
9019 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9021 (Read): Cleaned up this code so now we read only format vestion >= 5
9023 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9025 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9026 come nobody has complained about this one?
9028 * src/insets/insetinclude.C (Latex): subst fix
9030 * src/insets/insetbib.C (getKeys): subst fix
9032 * src/lyx_main.C (init): subst fix
9034 * src/layout.C (Read): subst fix
9036 * src/buffer.C (RoffAsciiTable): subst fix
9038 * src/lyx_cb.C (MenuFax): subst fix.
9040 * src/layout.[hC] + some other files: rewrote to use
9041 std::container to store textclasses and layouts in.
9042 Simplified, removed a lot of code. Make all classes
9043 assignable. Further simplifications and review of type
9044 use still to be one.
9046 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9047 lastfiles to create the lastfiles partr of the menu.
9049 * src/lastfiles.[Ch]: rewritten to use deque to store the
9050 lastfiles in. Uses fstream for reading and writing. Simplifies
9053 * src/support/syscall.C: remove explicit cast.
9055 * src/BufferView.C (CursorToggleCB): removed code snippets that
9057 use explicat C++ style casts instead of C style casts. also use
9058 u_vdata instea of passing pointers in longs.
9060 * src/PaperLayout.C: removed code snippets that were commented out.
9062 * src/lyx_gui_misc.C: removed code snippets that were commented out.
9064 * src/lyx_main.C: removed code snippets that wer commented out.
9066 * src/paragraph.C: removed code snippets that were commented out.
9068 * src/lyxvc.C (logClose): use static_cast
9070 (viewLog): remove explicit cast to void*
9071 (showLog): removed old commented code
9073 * src/menus.C: use static_cast instead of C style casts. use
9074 u_vdata instead of u_ldata. remove explicit cast to (long) for
9075 pointers. Removed old code that was commented out.
9077 * src/insets/inset.C: removed old commented func
9079 * src/insets/insetref.C (InsetRef): removed old code that had been
9080 commented out for a long time.
9082 (escape): removed C style cast
9084 * src/insets/insetlatexaccent.C (Draw): removed old commented code
9086 * src/insets/insetlatex.C (Draw): removed old commented code
9087 (Read): rewritten to use string
9089 * src/insets/insetlabel.C (escape): removed C style cast
9091 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
9093 * src/insets/insetindex.C: use static_cast and u_vdata, removed
9096 * src/insets/insetinclude.h: removed a couple of stupid bools
9098 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9099 (Clone): remove C style cast
9100 (getKeys): changed list to lst because of std::list
9102 * src/insets/inseterror.C (Draw): removed som old commented code.
9104 * src/insets/insetcommand.C (Draw): removed some old commented code.
9106 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9107 commented out forever.
9108 (bibitem_cb): use static_cast instead of C style cast
9109 use of vdata changed to u_vdata.
9111 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9113 (CloseUrlCB): use static_cast instead of C style cast.
9114 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9116 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9117 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9118 (CloseInfoCB): static_cast from ob->u_vdata instead.
9119 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9122 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9123 (C_InsetError_CloseErrorCB): forward the ob parameter
9124 (CloseErrorCB): static_cast from ob->u_vdata instead.
9126 * src/vspace.h: include LString.h since we use string in this class.
9128 * src/vspace.C (lyx_advance): changed name from advance because of
9129 nameclash with stl. And since we cannot use namespaces yet...I
9130 used a lyx_ prefix instead. Expect this to change when we begin
9133 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9135 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9136 and removed now defunct constructor and deconstructor.
9138 * src/BufferView.h: have backstack as a object not as a pointer.
9139 removed initialization from constructor. added include for BackStack
9141 * development/lyx.spec.in (%build): add CFLAGS also.
9143 * src/screen.C (drawFrame): removed another warning.
9145 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9147 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9148 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9149 README and ANNOUNCE a bit for the next release. More work is
9152 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9153 unbreakable if we are in freespacing mode (LyX-Code), but not in
9156 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9158 * src/BackStack.h: fixed initialization order in constructor
9160 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9162 * acinclude.m4 (VERSION): new rules for when a version is
9163 development, added also a variable for prerelease.
9164 (warnings): we set with_warnings=yes for prereleases
9165 (lyx_opt): prereleases compile with same optimization as development
9166 (CXXFLAGS): only use pedantic if we are a development version
9168 * src/BufferView.C (restorePosition): don't do anything if the
9171 * src/BackStack.h: added member empty, use this to test if there
9172 is anything to pop...
9174 1999-10-25 Juergen Vigna <jug@sad.it>
9177 * forms/layout_forms.fd +
9178 * forms/latexoptions.fd +
9179 * lyx.fd: changed for various form resize issues
9181 * src/mathed/math_panel.C +
9182 * src/insets/inseterror.C +
9183 * src/insets/insetinfo.C +
9184 * src/insets/inseturl.C +
9185 * src/insets/inseturl.h +
9188 * src/PaperLayout.C +
9189 * src/ParagraphExtra.C +
9190 * src/TableLayout.C +
9192 * src/layout_forms.C +
9199 * src/menus.C: fixed various resize issues. So now forms can be
9200 resized savely or not be resized at all.
9202 * forms/form_url.fd +
9203 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9206 * src/insets/Makefile.am: added files form_url.[Ch]
9208 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9210 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9211 (and presumably 6.2).
9213 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9214 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9215 remaining static member callbacks.
9217 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9220 * src/support/lyxstring.h: declare struct Srep as friend of
9221 lyxstring, since DEC cxx complains otherwise.
9223 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9225 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9227 * src/LaTeX.C (run): made run_bibtex also depend on files with
9229 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9230 are put into the dependency file.
9232 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9233 the code has shown itself to work
9234 (create_ispell_pipe): removed another warning, added a comment
9237 * src/minibuffer.C (ExecutingCB): removed code that has been
9238 commented out a long time
9240 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9241 out code + a warning.
9243 * src/support/lyxstring.h: comment out the three private
9244 operators, when compiling with string ansi conforming compilers
9247 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9249 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9250 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9253 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9256 * src/mathed/math_panel.C (create_math_panel): remove explicit
9259 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9262 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9263 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9264 to XCreatePixmapFromBitmapData
9265 (fl_set_bmtable_data): change the last argument to be unsigned
9267 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9268 and bh to be unsigned int, remove explicit casts in call to
9269 XReadBitmapFileData.
9271 * images/arrows.xbm: made the arrays unsigned char *
9272 * images/varsz.xbm: ditto
9273 * images/misc.xbm: ditto
9274 * images/greek.xbm: ditto
9275 * images/dots.xbm: ditto
9276 * images/brel.xbm: ditto
9277 * images/bop.xbm: ditto
9279 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9281 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9282 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9283 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9285 (LYX_CXX_CHEADERS): added <clocale> to the test.
9287 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9289 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9291 * src/support/lyxstring.C (append): fixed something that must be a
9292 bug, rep->assign was used instead of rep->append.
9294 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9297 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9298 lyx insert double chars. Fix spotted by Kayvan.
9300 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9302 * Fixed the tth support. I messed up with the Emacs patch apply feature
9303 and omitted the changes in lyxrc.C.
9305 1999-10-22 Juergen Vigna <jug@sad.it>
9307 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9309 * src/lyx_cb.C (MenuInsertRef) +
9310 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9311 the form cannot be resized under it limits (fixes a segfault)
9313 * src/lyx.C (create_form_form_ref) +
9314 * forms/lyx.fd: Changed Gravity on name input field so that it is
9317 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9319 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9320 <ostream> and <istream>.
9322 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9323 whether <fstream> provides the latest standard features, or if we
9324 have an oldstyle library (like in egcs).
9325 (LYX_CXX_STL_STRING): fix the test.
9327 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9328 code on MODERN_STL_STREAM.
9330 * src/support/lyxstring.h: use L{I,O}stream.h.
9332 * src/support/L{I,O}stream.h: new files, designed to setup
9333 correctly streams for our use
9334 - includes the right header depending on STL capabilities
9335 - puts std::ostream and std::endl (for LOStream.h) or
9336 std::istream (LIStream.h) in toplevel namespace.
9338 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9340 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9341 was a bib file that had been changed we ensure that bibtex is run.
9342 (runBibTeX): enhanced to extract the names of the bib files and
9343 getting their absolute path and enter them into the dep file.
9344 (findtexfile): static func that is used to look for tex-files,
9345 checks for absolute patchs and tries also with kpsewhich.
9346 Alternative ways of finding the correct files are wanted. Will
9348 (do_popen): function that runs a command using popen and returns
9349 the whole output of that command in a string. Should be moved to
9352 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9353 file with extension ext has changed.
9355 * src/insets/figinset.C: added ifdef guards around the fl_free
9356 code that jug commented out. Now it is commented out when
9357 compiling with XForms == 0.89.
9359 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9360 to lyxstring.C, and only keep a forward declaration in
9361 lyxstring.h. Simplifies the header file a bit and should help a
9362 bit on compile time too. Also changes to Srep will not mandate a
9363 recompile of code just using string.
9364 (~lyxstring): definition moved here since it uses srep.
9365 (size): definition moved here since it uses srep.
9367 * src/support/lyxstring.h: removed a couple of "inline" that should
9370 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9372 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9375 1999-10-21 Juergen Vigna <jug@sad.it>
9377 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9378 set to left if I just remove the width entry (or it is empty).
9380 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9381 paragraph when having dummy paragraphs.
9383 1999-10-20 Juergen Vigna <jug@sad.it>
9385 * src/insets/figinset.C: just commented some fl_free_form calls
9386 and added warnings so that this calls should be activated later
9387 again. This avoids for now a segfault, but we have a memory leak!
9389 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9390 'const char * argument' to 'string argument', this should
9391 fix some Asserts() in lyxstring.C.
9393 * src/lyxfunc.h: Removed the function argAsString(const char *)
9394 as it is not used anymore.
9396 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9398 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9401 * src/Literate.h: some funcs moved from public to private to make
9402 interface clearer. Unneeded args removed.
9404 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9406 (scanBuildLogFile): ditto
9408 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9409 normal TeX Error. Still room for improvement.
9411 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9413 * src/buffer.C (insertErrors): changes to make the error
9414 desctription show properly.
9416 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9419 * src/support/lyxstring.C (helper): changed to use
9420 sizeof(object->rep->ref).
9421 (operator>>): changed to use a pointer instead.
9423 * src/support/lyxstring.h: changed const reference & to value_type
9424 const & lets see if that helps.
9426 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9428 * Makefile.am (rpmdist): fixed to have non static package and
9431 * src/support/lyxstring.C: removed the compilation guards
9433 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9436 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9437 conditional compile of lyxstring.Ch
9439 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9440 stupid check, but it is a lot better than the bastring hack.
9441 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9443 * several files: changed string::erase into string::clear. Not
9446 * src/chset.C (encodeString): use a char temporary instead
9448 * src/table.C (TexEndOfCell): added tostr around
9449 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9450 (TexEndOfCell): ditto
9451 (TexEndOfCell): ditto
9452 (TexEndOfCell): ditto
9453 (DocBookEndOfCell): ditto
9454 (DocBookEndOfCell): ditto
9455 (DocBookEndOfCell): ditto
9456 (DocBookEndOfCell): ditto
9458 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9460 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9462 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9463 (MenuBuildProg): added tostr around ret
9464 (MenuRunChktex): added tostr around ret
9465 (DocumentApplyCB): added tostr around ret
9467 * src/chset.C (encodeString): added tostr around t->ic
9469 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9470 (makeLaTeXFile): added tostr around tocdepth
9471 (makeLaTeXFile): added tostr around ftcound - 1
9473 * src/insets/insetbib.C (setCounter): added tostr around counter.
9475 * src/support/lyxstring.h: added an operator+=(int) to catch more
9478 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9479 (lyxstring): We DON'T allow NULL pointers.
9481 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9483 * src/mathed/math_macro.C (MathMacroArgument::Write,
9484 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9485 when writing them out.
9487 * src/LString.C: remove, since it is not used anymore.
9489 * src/support/lyxstring.C: condition the content to
9490 USE_INCLUDED_STRING macro.
9492 * src/mathed/math_symbols.C, src/support/lstrings.C,
9493 src/support/lyxstring.C: add `using' directive to specify what
9494 we need in <algorithm>. I do not think that we need to
9495 conditionalize this, but any thought is appreciated.
9497 * many files: change all callback functions to "C" linkage
9498 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9499 strict_ansi. Those who were static are now global.
9500 The case of callbacks which are static class members is
9501 trickier, since we have to make C wrappers around them (see
9502 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9503 did not finish this yet, since it defeats the purpose of
9504 encapsulation, and I am not sure what the best route is.
9506 1999-10-19 Juergen Vigna <jug@sad.it>
9508 * src/support/lyxstring.C (lyxstring): we permit to have a null
9509 pointer as assignment value and just don't assign it.
9511 * src/vspace.C (nextToken): corrected this function substituting
9512 find_first(_not)_of with find_last_of.
9514 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9515 (TableOptCloseCB) (TableSpeCloseCB):
9516 inserted fl_set_focus call for problem with fl_hide_form() in
9519 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9521 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9524 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9526 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9527 LyXLex::next() and not eatline() to get its argument.
9529 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9531 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9532 instead, use fstreams for io of the depfile, removed unneeded
9533 functions and variables.
9535 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9536 vector instead, removed all functions and variables that is not in
9539 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9541 * src/buffer.C (insertErrors): use new interface to TeXError
9543 * Makefile.am (rpmdist): added a rpmdist target
9545 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9546 per Kayvan's instructions.
9548 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9550 * src/Makefile.am: add a definition for localedir, so that locales
9551 are found after installation (Kayvan)
9553 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9555 * development/.cvsignore: new file.
9557 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9559 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9560 C++ compiler provides wrappers for C headers and use our alternate
9563 * configure.in: use LYX_CXX_CHEADERS.
9565 * src/cheader/: new directory, populated with cname headers from
9566 libstdc++-2.8.1. They are a bit old, but probably good enough for
9567 what we want (support compilers who lack them).
9569 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9570 from includes. It turns out is was stupid.
9572 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9574 * lib/Makefile.am (install-data-local): forgot a ';'
9575 (install-data-local): forgot a '\'
9576 (libinstalldirs): needed after all. reintroduced.
9578 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9580 * configure.in (AC_OUTPUT): added lyx.spec
9582 * development/lyx.spec: removed file
9584 * development/lyx.spec.in: new file
9586 * po/*.po: merged with lyx.pot becuase of make distcheck
9588 * lib/Makefile.am (dist-hook): added dist-hook so that
9589 documentation files will be included when doing a make
9590 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9591 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9593 more: tried to make install do the right thing, exclude CVS dirs
9596 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9597 Path would fit in more nicely.
9599 * all files that used to use pathstack: uses now Path instead.
9600 This change was a lot easier than expected.
9602 * src/support/path.h: new file
9604 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9606 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9608 * src/support/lyxstring.C (getline): Default arg was given for
9611 * Configure.cmd: removed file
9613 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9615 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9616 streams classes and types, add the proper 'using' statements when
9617 MODERN_STL is defined.
9619 * src/debug.h: move the << operator definition after the inclusion
9622 * src/support/filetools.C: include "LAssert.h", which is needed
9625 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9628 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9629 include "debug.h" to define a proper ostream.
9631 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9633 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9634 method to the SystemCall class which can kill a process, but it's
9635 not fully implemented yet.
9637 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9639 * src/support/FileInfo.h: Better documentation
9641 * src/lyxfunc.C: Added support for buffer-export html
9643 * src/menus.C: Added Export->As HTML...
9645 * lib/bind/*.bind: Added short-cut for buffer-export html
9647 * src/lyxrc.*: Added support for new \tth_command
9649 * lib/lyxrc.example: Added stuff for new \tth_command
9651 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9653 * lib/Makefile.am (IMAGES): removed images/README
9654 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9655 installes in correct place. Check permisions is installed
9658 * src/LaTeX.C: some no-op changes moved declaration of some
9661 * src/LaTeX.h (LATEX_H): changed include guard name
9663 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9665 * lib/reLyX/Makefile.am: install noweb2lyx.
9667 * lib/Makefile.am: install configure.
9669 * lib/reLyX/configure.in: declare a config aux dir; set package
9670 name to lyx (not sure what the best solution is); generate noweb2lyx.
9672 * lib/layouts/egs.layout: fix the bibliography layout.
9674 1999-10-08 Jürgen Vigna <jug@sad.it>
9676 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9677 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9678 it returned without continuing to search the path.
9680 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9682 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9683 also fixes a bug. It is not allowed to do tricks with std::strings
9684 like: string a("hei"); &a[e]; this will not give what you
9685 think... Any reason for the complexity in this func?
9687 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9689 * Updated README and INSTALL a bit, mostly to check that my
9690 CVS rights are correctly set up.
9692 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9694 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9695 does not allow '\0' chars but lyxstring and std::string does.
9697 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9699 * autogen.sh (AUTOCONF): let the autogen script create the
9700 POTFILES.in file too. POTFILES.in should perhaps now not be
9701 included in the cvs module.
9703 * some more files changed to use C++ includes instead of C ones.
9705 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9707 (Reread): added tostr to nlink. buggy output otherwise.
9708 (Reread): added a string() around szMode when assigning to Buffer,
9709 without this I got a log of garbled info strings.
9711 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9714 * I have added several ostream & operator<<(ostream &, some_type)
9715 functions. This has been done to avoid casting and warnings when
9716 outputting enums to lyxerr. This as thus eliminated a lot of
9717 explicit casts and has made the code clearer. Among the enums
9718 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9719 mathed enums, some font enum the Debug::type enum.
9721 * src/support/lyxstring.h (clear): missing method. equivalent of
9724 * all files that contained "stderr": rewrote constructs that used
9725 stderr to use lyxerr instead. (except bmtable)
9727 * src/support/DebugStream.h (level): and the passed t with
9728 Debug::ANY to avoid spurious bits set.
9730 * src/debug.h (Debug::type value): made it accept strings of the
9733 * configure.in (Check for programs): Added a check for kpsewhich,
9734 the latex generation will use this later to better the dicovery of
9737 * src/BufferView.C (create_view): we don't need to cast this to
9738 (void*) that is done automatically.
9739 (WorkAreaButtonPress): removed some dead code.
9741 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9743 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9744 is not overwritten when translated (David Sua'rez de Lis).
9746 * lib/CREDITS: Added David Sua'rez de Lis
9748 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9750 * src/bufferparams.C (BufferParams): default input encoding is now
9753 * acinclude.m4 (cross_compiling): comment out macro
9754 LYX_GXX_STRENGTH_REDUCE.
9756 * acconfig.h: make sure that const is not defined (to empty) when
9757 we are compiling C++. Remove commented out code using SIZEOF_xx
9760 * configure.in : move the test for const and inline as late as
9761 possible so that these C tests do not interefere with C++ ones.
9762 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9763 has not been proven.
9765 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9767 * src/table.C (getDocBookAlign): remove bad default value for
9770 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9772 (ShowFileMenu2): ditto.
9774 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9777 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9779 * Most files: finished the change from the old error code to use
9780 DebugStream for all lyxerr debugging. Only minor changes remain
9781 (e.g. the setting of debug levels using strings instead of number)
9783 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9785 * src/layout.C (Add): Changed to use compare_no_case instead of
9788 * src/FontInfo.C: changed loop variable type too string::size_type.
9790 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9792 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9793 set ETAGS_ARGS to --c++
9795 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9797 * src/table.C (DocBookEndOfCell): commented out two unused variables
9799 * src/paragraph.C: commented out four unused variables.
9801 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9802 insed a if clause with type string::size_type.
9804 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9807 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9809 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9810 variable, also changed loop to go from 0 to lenght + 1, instead of
9811 -1 to length. This should be correct.
9813 * src/LaTeX.C (scanError): use string::size_type as loop variable
9816 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9817 (l.896) since y_tmp and row was not used anyway.
9819 * src/insets/insetref.C (escape): use string::size_type as loop
9822 * src/insets/insetquotes.C (Width): use string::size_type as loop
9824 (Draw): use string::size_type as loop variable type.
9826 * src/insets/insetlatexaccent.C (checkContents): use
9827 string::size_type as loop variable type.
9829 * src/insets/insetlabel.C (escape): use string::size_type as loop
9832 * src/insets/insetinfo.C: added an extern for current_view.
9834 * src/insets/insetcommand.C (scanCommand): use string::size_type
9835 as loop variable type.
9837 * most files: removed the RCS tags. With them we had to recompile
9838 a lot of files after a simple cvs commit. Also we have never used
9839 them for anything meaningful.
9841 * most files: tags-query-replace NULL 0. As adviced several plases
9842 we now use "0" instead of "NULL" in our code.
9844 * src/support/filetools.C (SpaceLess): use string::size_type as
9847 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9849 * src/paragraph.C: fixed up some more string stuff.
9851 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9853 * src/support/filetools.h: make modestr a std::string.
9855 * src/filetools.C (GetEnv): made ch really const.
9857 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9858 made code that used these use max/min from <algorithm> instead.
9860 * changed several c library include files to their equivalent c++
9861 library include files. All is not changed yet.
9863 * created a support subdir in src, put lyxstring and lstrings
9864 there + the extra files atexit, fileblock, strerror. Created
9865 Makefile.am. edited configure.in and src/Makefile.am to use this
9866 new subdir. More files moved to support.
9868 * imported som of the functions from repository lyx, filetools
9870 * ran tags-query-replace on LString -> string, corrected the bogus
9871 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9872 is still some errors in there. This is errors where too much or
9873 too litle get deleted from strings (string::erase, string::substr,
9874 string::replace), there can also be some off by one errors, or
9875 just plain wrong use of functions from lstrings. Viewing of quotes
9878 * LyX is now running fairly well with string, but there are
9879 certainly some bugs yet (see above) also string is quite different
9880 from LString among others in that it does not allow null pointers
9881 passed in and will abort if it gets any.
9883 * Added the revtex4 files I forgot when setting up the repository.
9885 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9887 * All over: Tried to clean everything up so that only the files
9888 that we really need are included in the cvs repository.
9889 * Switched to use automake.
9890 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9891 * Install has not been checked.
9893 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9895 * po/pt.po: Three errors:
9896 l.533 and l.538 format specification error
9897 l. 402 duplicate entry, I just deleted it.