1 2000-12-22 Juergen Vigna <jug@sad.it>
3 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
4 have a selection and button == 3.
5 (UpdateLocal): if what == INIT clear selection if existent!
6 (InsetButtonPress): don't activate the cell inset on button==3
8 (LocalDispatch): move curor up/down if exiting an inset which this
11 2000-12-20 Juergen Vigna <jug@sad.it>
13 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
14 calling for the math-panel (do not unlock the math-inset if locked)!
16 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
17 text-insets (with x-offset).
19 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
20 alignment of multicolumn-cells.
22 2000-12-19 Juergen Vigna <jug@sad.it>
24 * src/lyxfunc.C (Dispatch):
25 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
28 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
30 * src/WorkArea.C (work_area_handler): simplify the key/keysym
31 handling for XForms 0.89, this might have rendered some cases
32 unusable. I have at least deadkeys, accent-xxx and KP_x working.
33 Please report proplems.
35 * src/lyxfunc.C (processKeySym): make the self-insert handling
38 2000-12-18 Baruch Even <baruch.even@writeme.com>
40 * src/LaTeX.C (deplog): fix spelling errors
41 * src/text2.C (CutSelection): ditto
42 * src/lyxfunc.C (Dispatch): ditto
44 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
46 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
48 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
49 and h_align in default init.
50 adjust calls to MathedRowSt
52 * src/mathed/math_iter.C: adjust calls to MathedRowSt
53 * src/mathed/math_iter.h (getAD): ditto
55 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
56 methods setBaseline, ascent, descent
57 (class MathMatrixInset): remove method GetAlign, change h_align
60 * src/lyxfunc.C (processKeySym): discover the correct argument if
61 the action is LFUN_SELFINSERT
63 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
65 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
68 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
70 * src/support/copy.C: don't include filetools.h
72 * lib/images: revert to old banner, drop the cucumber.
74 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
76 * src/converter.C (Formats::View): Change the current directory to
77 the directory of the file.
79 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
81 * src/kbsequence.C (addkey): also clear sequence and modifiers if
84 * src/BufferView2.C (theLockingInset): return 0 if text is 0
86 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
88 * Many files: Fix RTL support for insettext.
90 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
92 * README: add mention of broken ghostscript versions, remove
93 reference to non-existent BUGS file
95 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
97 * src/support/lstrings.C (compare_no_case): small fix. When passed
98 length, should use it in the size comparison.
100 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
102 * src/insets/insetexternal.C (getScreenLabel): Return a default
103 value if the template label is empty.
105 * src/lyxlookup.C: do not condition on FL_REVISION.
108 * src/sp_form.C: fix the font size of some text entries
110 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
111 after TOC when there is no TOC.
113 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
114 bind file if it has not been done yet.
115 (read): remove local bindFile variable. Try to fix the handling of
116 RC_BIND and RC_BINDFILE.
118 * src/lyx_main.C (init): use readBindFileIfNeeded().
120 * lib/languages: Change description of german to "German (new
123 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
125 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
126 "Apply" buttons if arg is non-zero.
128 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
129 launching the popup if sufficient info is passed to
130 LFUN_CITATION_CREATE.
132 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
134 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
135 labels (disabled in 1.1.6).
137 * src/lyxrc.[Ch]: New variable label_init_length
139 * mathed/formula.C (LocalDispatch): Preserve the label when
140 changing from display math to eqnarray (however, the label
141 do not appear at the first line, as one might expects, but at the
143 (LocalDispatch): When inserting a label to a formula which already
144 have a label, the old label is used as default value.
145 Also, if the label is changed, then all references to the label
148 * src/mathed/math_iter.C (setLabel): Allow to set the label
149 even if it is empty. This is needed to allow deletion of a label
152 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
153 refernces only if the old label appears once in the document.
155 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
157 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
158 <gehlert@Rcs1.urz.tu-dresden.de>
160 * src/frontends/xforms/FormBase.C: comment out debug.h
162 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
163 code in xform_helpers instead.
164 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
166 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
167 Use N_(), rather than _() when creating strings to pass to browseFile()
168 because browseFile calls gettext() itself now.
170 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
171 display the filename correctly.
173 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
175 * src/converter.C (Move): New method. Used to move file or files
176 from temp dir to the output dir. (this fixes the bug that
177 exporting linuxdoc/docbook document to html would not move all
178 html file from temp directory).
180 * src/support/filetools.C (DirList): Fixed.
182 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
184 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
186 * src/converter.C (Add): Remove $$i when setting latex_command.
188 * src/text.C (IsBoundary): Return false when pos = 0.
190 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
192 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
194 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
196 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
197 need to empty the fields to turn off use of the geometry package!
199 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
201 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
202 (Buffer const &), not a (BufferParams const &) and so fix a crash
203 caused by using current_view before it had been initialised. Not
204 the best way to do this, but much easier than changing
205 Inset::Clone(Buffer const &) to Inset::Clone().
208 * src/tabular.C: changed call to CopyIntoMinibuffer().
210 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
212 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
214 * src/lyxfunc.C (getStatus): disable insertion of floats in a
217 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
219 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
220 changed filter for screen fonts input filter from int to float
222 * src/frontends/xforms/input_validators.c: removed.
223 * src/frontends/xforms/input_validators.C: new file. Can now call C++
224 functions from within the filter functions.
226 * src/frontends/xforms/input_validators.[Ch]
227 (fl_unsigned_float_filter): new filter function.
229 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
230 confused now! And if you think I'm going to do this in
231 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
233 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
235 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
237 * src/WorkArea.C (work_area_handler): don't handle button requests
238 if xbutton.button == 0
240 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
242 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
243 It creates a lot of interesting problems.
245 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
247 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
248 the menu exists in the current menubar before opening it.
250 * src/MenuBackend.C (hasSubmenu): new method.
252 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
253 action value by offsetting actions by a large constant (so that
254 bogs choice result will be less than this constant).
256 * lib/bind/fi_menus.bind: more cleanup to menus.
257 * lib/bind/sciword.bind: ditto.
258 * lib/bind/xemacs.bind: ditto.
259 * lib/bind/emacs.bind: ditto.
260 * lib/bind/pt_menus.bind: ditto.
261 * lib/bind/hu_menus.bind: ditto.
263 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
265 * INSTALL: update PROBLEMS section.
267 * src/lyxlookup.h: remove condition on xforms version, since we
268 should not include it if not appropriate.
270 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
272 * src/LColor.C: "latex text" -> "latex inset" (from
275 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
277 * src/frontends/kde/FormTabularCreate.C:
278 * src/frontends/kde/citationdlg.C:
279 * src/frontends/kde/copyrightdlg.C:
280 * src/frontends/kde/paradlg.C:
281 * src/frontends/kde/paraextradlg.C:
282 * src/frontends/kde/parageneraldlg.C:
283 * src/frontends/kde/printdlg.C:
284 * src/frontends/kde/refdlg.C:
285 * src/frontends/kde/tabcreatedlg.C:
286 * src/frontends/kde/tocdlg.C:
287 * src/frontends/kde/urldlg.C: add necessary headers
290 * src/frontends/kde/dlg/emptytable.C:
291 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
292 default parameters (from Angus Leeming)
294 * src/frontends/kde/dlg/moc/.cvsignore:
295 * src/frontends/kde/dlg/.cvsignore:
296 * src/frontends/kde/moc/.cvsignore: fix the library name
299 * src/frontends/kde/paradlg.C:
300 * src/frontends/kde/parageneraldlg.C:
301 * src/frontends/kde/dlg/para.dlg:
302 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
304 * src/frontends/kde/dlg/README: clarified qtarch version
306 * src/frontends/kde/dlg/Makefile.am: removed the
307 dlg rules as they created spontaneous rebuilds
308 (not a good idea as it requires qtarch)
310 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
312 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
313 fixlevel along with xforms version.
315 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
316 xforms version is strictly less than 0.89.5.
317 * src/lyx_gui.C (LyXGUI): ditto.
318 * src/LyXView.C (show): ditto.
320 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
322 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
323 movement in inset in RTL text.
324 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
325 (workAreaButtonRelease): Do not open a float when there is a selection.
327 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
329 * src/spellchecker.C (RunSpellChecker): Open all floats before
332 * src/text.C (InsertChar): Consider "," as a part of a number
333 (for LTR numbers in RTL text code).
334 (IsBoundary): Fixed (and simplified).
335 (InsertChar): Recalculate cursor boundary.
338 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
340 * src/spellchecker.C: fix figures with pspell enabled
342 * src/insets/figinset.C: workaround for gs hang xforms bug
344 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
346 * lib/bind/??_menus.bind: comment out the entries corresponding to
347 real menus. They should be eventually removed, but I'll let the
348 language maintainers do that.
350 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
352 * src/frontends/kde/parageneraldlg.C:
353 * src/frontends/kde/parageneraldlg.h: don't use
354 a derived class for SpaceAbove/Below
356 * src/frontends/kde/dlg/README: add some info
358 * src/frontends/kde/dlg/*: update data files, update
361 * src/frontends/kde/dlg/moc/Makefile.am: add
364 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
366 * configure.in: add new KDE Makefiles
367 * src/vspace.h: return GlueLength not a normal one
368 * src/support/lstrings.h:
369 * src/support/lstrings.C: add isStrUnsignedInt(),
372 * src/frontends/kde/*: big reorganisation, update
373 FormParagraph, add FormTabCreate
375 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
377 * lib/ui/default.ui: small grammatical change.
379 * src/frontends/xforms/xform_macros.h: removed.
381 * src/frontends/xforms/FormBase.C:
382 * src/frontends/xforms/FormPreferences.C:
383 * src/frontends/xforms/Makefile.am: changes associated with removing
384 xform_macros.h. Should make Lars' debugging a little easier.
386 * src/frontends/xforms/FormPreferences.C:
387 * src/frontends/xforms/FormPreferences.h:
388 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
389 longer use X11 color name database. HSV and RGB dials/sliders.
390 Please let this be the end of this!
392 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
394 * Several files: Allow compilation when the compiler doesn't
397 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
400 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
401 command line options.
403 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
405 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
406 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
409 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
411 * src/frontends/xforms/FormRef.C (updateBrowser):
412 * src/frontends/xforms/forms/form_ref.fd: try clicking on
413 different insets with the sort key active. Now apply this patch!
415 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
417 * src/frontends/xforms/FormPrint.C: set to valid()
418 when we update from the passed parameters.
420 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
422 * src/LColor.C (getFromGUIName): internationalise the comparison.
424 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
425 FormPreferences choice.
427 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
430 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
432 * src/lyxrc.C: more detail for the printer program config
435 * src/LColor.C: ert->latex text. LColor needs a big revamp
436 but will have to wait till after 1.1.6
438 * src/buffer.C: bring up a dialog if we load a document
439 with an un-installed text class, rather than just complain
442 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
444 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
445 the browser form for a combox in a tabbed folder. Bug fix courtesy of
446 Steve Lamont <spl@ncmir.ucsd.edu>.
448 * src/frontends/xforms/FormDocument.C (build):
449 * src/frontends/xforms/FormPreferences.C (Language::build):
450 pass tabfolders to Combox::add() in order to use this work around.
452 * src/frontends/xforms/FormCitation.C (connect): remove max size
454 (update): sort list of bibliography keys.
456 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
458 No max size limitation. Same popup for new and existing insets. Fixes
459 bugs reported by Rob Lahaye.
461 * src/frontends/xforms/FormCitation.C (c-tor):
462 * src/frontends/xforms/FormCopyright.C (c-tor):
463 * src/frontends/xforms/FormError.C (c-tor):
464 * src/frontends/xforms/FormGraphics.C (c-tor):
465 * src/frontends/xforms/FormIndex.C (c-tor):
466 * src/frontends/xforms/FormRef.C (c-tor):
467 * src/frontends/xforms/FormToc.C (c-tor):
468 * src/frontends/xforms/FormUrl.C (c-tor):
469 use correct policy for ButtonController.
471 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
473 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
476 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
478 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
479 Some resizing changes.
481 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
483 * configure.in: fix typo
485 * lib/languages: add ukraninian and change no to no_NO
487 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
489 * src/bufferview_funcs.C (FontSize): use setLyXSize
491 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
493 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
494 to check for systems where mkstemp() is available but not declared
495 in headers. The new autoconf macro lyx_CHECK_DECL can be used
496 to check for declarations in headers.
498 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
500 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
502 * forms/makefile: added bibforms.fd, include_form.fd.
503 Removed lyx_sendfax.fd.
505 * src/LaTeXLog.C (ShowLatexLog):
506 * src/LyXAction.C (init):
507 * src/bufferparams.C (readLanguage): altered messages as suggested by
510 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
513 * src/credits.C: made fd_form_credits non-static, so that it can be
514 redrawn should the xforms colors be re-mapped.
515 * src/spellchecker.C ditto fd_form_spell_options.
517 * src/filedlg.[Ch] (redraw):
518 * src/intl.[Ch] (redraw):
519 * src/lyxfr0.[Ch] (redraw):
520 * src/insets/figinset.[Ch] (redraw):
521 * src/insets/insetexternal.[Ch] (redraw):
522 new methods, connected to Dialogs::redrawGUI.
524 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
525 to be connected to Dialogs::redrawGUI.
527 * src/frontends/xforms/FormCitation.C (build):
528 * src/frontends/xforms/FormCopyright.C (build):
529 * src/frontends/xforms/FormError.C (build):
530 * src/frontends/xforms/FormGraphics.C (build):
531 * src/frontends/xforms/FormIndex.C (build):
532 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
533 * src/frontends/xforms/FormToc.C (build):
534 * src/frontends/xforms/FormUrl.C (build):
535 use the ButtonController correctly.
537 * src/frontends/xforms/FormCopyright.C (build):
538 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
539 the .fd file and into build().
541 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
543 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
545 * src/frontends/xforms/forms/form_citation.fd:
546 * src/frontends/xforms/forms/form_copyright.fd:
547 * src/frontends/xforms/forms/form_error.fd:
548 * src/frontends/xforms/forms/form_graphics.fd:
549 * src/frontends/xforms/forms/form_index.fd:
550 * src/frontends/xforms/forms/form_toc.fd:
551 * src/frontends/xforms/forms/form_url.fd:
552 renamed some of the objects. Named others explicitly for the first time.
553 Added Restore and Apply buttons where appropriate.
555 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
558 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
560 * src/version.h: try the pre2 again
562 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
564 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
566 * src/frontends/kde/FormParagraph.C: added using directive.
568 * src/frontends/kde/paradlg.C: added config.h and using directive.
570 * src/frontends/kde/paradlg.h: added std::qualifier.
572 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
574 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
576 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
578 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
580 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
582 * src/version.h: set back to 1.1.6cvs
584 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
586 * src/version.h: set to 1.1.6pre2
588 2000-11-20 Marko Vendelin <markov@ioc.ee>
590 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
592 * src/frontends/gnome/Makefile.am: updated list of XForms object files
594 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
596 * src/LColor.C (init):
597 * src/lyxrc.C (getDescription): changed some comments as suggested by
600 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
601 disconnect the redrawGUI signal in best-practice fashion.
603 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
604 long_opts_tab to reflect the change in name of this tabfolder, as
605 suggested by John Levon.
606 (connect, disconnect): new methods. Don't do much at present other than
607 ensuring that we can't resize the dialog. This just makes xforms go
609 (lots of methods in Colors): made void rather than bool. The idea is
610 to have an isOk() function that keeps track of whether any input is
611 genuinely invalid and should therefore block Save, Apply.
612 Easier to manipulate the counters rapidly.
613 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
614 compiler will like this code. Much cleaner way of doing things.
616 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
618 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
619 rather than simple counters, following suggestion by John Levon.
621 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
622 than engraved frame + text.
624 * src/frontends/xforms/forms/makefile: removed spurious command.
626 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
628 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
630 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
633 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
635 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
636 see what Lars has changed and what is just white space!
637 Now used X directly to ascertain the RGB color associated with the
639 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
641 Added some sort capability.
642 The X11 color name database input is only displayed if the database
643 isn't found in the standard place.
644 Got rid of struct compare_converter; it wasn't used.
645 Probably some other stuff that I've forgotten.
647 * src/frontends/xforms/FormPreferences.h: changed the names of some
648 methods in the Colors struct. Added a couple of structs to help sort
649 colors by name and by RGBColor.
651 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
652 functions into a new class RWInfo.
654 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
655 The dialog is now almost navigable using the keyboard. Unfortunately,
656 the cursor has to be inside a browser for it to be activated. There is
657 no visual feedback for the key shortcuts to the arrow keys (use
658 Alt-appropriate arrow key, Alt-x).
660 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
663 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
664 xform_helpers.[Ch]. See above.
666 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
668 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
670 * src/screen.C (setCursorColor): new method. Sets the color of the
672 (ShowManualCursor): call it.
673 Constify some local variables.
675 * src/LColor.[Ch] (LColor): add entry for cursor
676 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
679 2000-11-19 Juergen Vigna <jug@sad.it>
681 * src/insets/insettabular.C (draw): fixed text border redraw problem.
682 (calculate_dimensions_of_cells): try to boost up when inserting chars.
684 2000-11-15 Rob Lahaye <lahaye@postech.edu>
686 * lib/ui/default.ui: OptItem used for Fax entry
688 2000-11-17 Matej Cepl <cepl@bigfoot.com>
690 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
692 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
694 * src/vspace.C (nextToken): fix so it can handle length phrases like
695 "10mm+-20mm", "40inplus16mmminus10cm" etc.
697 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
699 * src/frontends/xforms/FormPreferences.C: constify several variables
700 (BrowserLyX): rewrite to not need the choice variable
701 (Modify): rewrite to not need the choide variable
702 (compare_converter): make operator const
704 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
705 correct the writing of \set_color
706 (getDescription): return a const string
708 * src/kbsequence.[Ch] (addkey): remove dead code
710 * src/Painter.C (text): remove some commented code
712 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
714 * src/ColorHandler.[Ch]: removed some header files from .h file.
715 Included LColor.h in .C file.
717 * src/LColor.[Ch]: made class copyable so that I could create a
718 system_lcolor instance.
720 * src/Painter.h: removed LColor.h.
722 * src/lyx_gui.C (create_forms): used AddName.
724 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
725 of user preferences/lyxrc file.
727 * src/lyxrc.C (output): output changes to lcolor.
729 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
731 Moved class xformColor to files xform_helpers.[Ch]. These files,
732 Color.[Ch], could now be moved into src if they would be useful to
735 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
736 Also moved FormPreferences::browseFile here as it can be used by any
737 xform dialog with a "Browse" button. FormGraphics is a perfect example.
739 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
740 ReadableFile): changed the FormPreferences methods a little and moved
741 them here as they'll be useful elsewhere also.
743 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
744 Removed some header files and used forward declarations instead.
746 Removed some methods as they'll be useful elsewhere (see above).
748 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
749 Can also now modify the LyX LColors. However, for reasons that I don't
750 yet understand, it appears that we can use
751 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
752 present. The problem appears to lie in ColorHandler, because I can
753 change the color using LColor.SetColor(). Similarly, when reading in a
754 preferences file with some set_color instances, I'll get a warning
755 like: Color sea green is undefined or may not be redefined
756 Bad lyxrc set_color for sea green
758 Once the buffer is loaded, however, I can happily change to this color.
760 Finally, it appears that I have to set the color of "inset frame"
761 explicitly, or it oscillates from "black" to "indian red" with each
764 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
766 * ANNOUNCE: corrected a spelling mistake.
768 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
771 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
773 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
775 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
778 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
779 match the requirements from the standard better. This is required
780 to work with gnu libstdc++-v3
782 * src/frontends/xforms/FormPreferences.C: add explict pair
783 arguments to browse calls. include support/lyxmanip.h remvoe
784 extern fmt. whitespace changes. reorder variables in
785 FormPreferences.h, to match initalizaton order.
787 * several files: constify more local variables.
789 * src/buffer.C: remove some commented functions.
791 * src/DepTable.C (remove_files_with_extension): temporary
792 work around for gcc 2.97
793 * src/filedlg.C (find): ditto
794 * src/Variables.C (set): ditto
795 * src/LyXAction.C (searchActionArg): ditto
796 (retrieveActionArg): ditto
798 * configure.in: check for mktemp too
800 * UPGRADING: prepare for 1.1.6
802 * Makefile.am (lgbtags): add backup tags for when etags are
803 different than usual.
805 * ANNOUNCE: prepare for 1.1.6
807 * src/support/tempname.C (make_tempfile): new function, wrapper
808 around mkstemp and mktemp. Only mkstemp has been tested.
811 2000-11-14 Rob Lahaye <lahaye@postech.edu>
813 * default.ui: capitalized some menu items to improve shortcuts.
815 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
817 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
819 * src/frontends/xforms/Dialogs.C: add "using" directive.
821 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
823 * src/filedlg.C (Select): highlight suggested file in browser, if
826 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
827 each tab folder is encapsulated in its own class.
828 The Language keymaps are now chosen using a text input and a
829 browser button, rather than a Combox.
830 All the browser buttons are now functional, although LyXFileDlg
831 still needs to be modified to make it straighhtforward to return a
832 directory if that is what is desired.
834 * src/frontends/xforms/forms/form_preferences.fd: use text input
835 and browse button to input the Language keymaps. Add a few
836 callbacks for the browse buttons.
838 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
840 * src/support/tempname.C (tempName): small changes to make it
841 safer. remove the '.' before XXXXXX
843 * src/support/filetools.C (TmpFileName): remove func
846 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
847 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
848 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
849 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
851 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
854 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
857 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
858 for bp (this fixes a reproducible hard crash)
860 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
863 * src/frontends/xforms/FormBase.h: make bp_ private
864 (FormBaseBI): remove default for bp
867 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
870 * src/frontends/xforms/Color.C (RGBColor): made several vars
871 const, changed initialization of j to allow it to be const
874 * several files: added const to local variables.
876 * src/lyx_cb.C: removed several function prototypes and moved them
880 (UpdateLayoutPreamble):
882 (MenuInsertLabel): add BufferView as arguemnt
883 (LayoutsCB): make tmp const
885 * src/layout_forms.h: regenerated
887 * src/debug.C: add Debug::FILES
888 (showLevel) (showTags): translate the desc
890 * src/debug.h: add FILES as debug target
892 * src/bufferlist.C: use current_view as an interim measure becuase
893 of added arguments to MenuWrite and MenuWriteAs
895 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
897 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
899 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
900 libstdc++ is compiled with.
902 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
904 * lib/layouts/docbook-book.layout
905 * lib/layouts/docbook.layout
906 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
907 those paragraphs are expresse as SGML comments <!-- -->.
909 * src/LaTeXFeatures.h
910 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
911 parameter, this allows to express all the include files as relative
912 paths to the master buffer. The verbatim insert works as the other
915 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
917 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
919 (MakeDocBookFile): top_element is always written. Some clean up, as
920 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
922 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
923 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
924 a reference is written instead of the name.
925 (Validate): use the relative path for the filename.
927 * src/insets/insetlabel.C (DocBook): write end tag, for XML
930 * src/support/filetools.h
931 * src/support/filetools.C (IsSGMLFilename): added.
934 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
936 * development/OS2/quick_fix.patch:
938 * README.OS2: quick update to the OS/2 port.
940 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
942 * src/converter.C: add "using" directive.
944 * src/frontends/xforms/FormPreferences.C: add "using" directive.
945 (compare_converter): add "int" as return type.
947 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
950 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
952 * src/lyx_gui.C (create_forms): map the xform colours, should a
953 mapping exist. Ie, call XformColor::read().
955 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
956 and struct HSV as HSVColor.
957 (XformColor::read, XformColor::write) : new methods that
958 input/output any changes to the cform GUI colors.
960 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
963 * src/frontends/xforms/FormPreferences.C Lots of little changes
964 associated with the changed name of the RGB and HSV structs. Can
965 now save changes to xforms GUI to file. Commented out
966 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
967 used currently anyway.
969 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
971 * src/converter.C: A lot of changes:
972 - It is no longer possible to choose between two or more ways to
973 export to some format (the new code uses only the shortest path).
974 However, it is still possible to choose between pdflatex/ps2pdf
975 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
976 - Added several methods that makes the FormPreferences code simpler.
977 - Changed the tokens $$FName and $$OutName to $$i and $$o.
979 * src/exporter.C (Export): lyxrc.use_pdf is set before
980 makeLaTeXFile is called. This works but not very nice.
982 * src/frontends/xforms/FormPreferences.C: The formats/converters
983 tabs are now fully functional.
985 * src/buffer.C (getTocList): Add numbers to the captions.
987 * lib/lyxrc.example: Removed fax section
989 * src/support/rename.C (rename): Delete the old file if lyx::copy
992 2000-11-13 Rob Lahaye <lahaye@postech.edu>
994 * lib/ui/default.ui: minor polishing.
996 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
998 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1001 * lib/Makefile.am (DOCINST): do not install everything in the
1002 documentation directory.
1004 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1006 * src/bufferlist.C (newFile): set the filename to the constructed
1009 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1010 constructed "newfileXX.lyx" name to the dialog
1012 * src/frontends/DialogBase.h: make update() non-abstract so
1013 KDE doesn't need to implement two update methods for every form
1015 * src/frontends/kde/Makefile.am: add missing xforms objects
1018 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1020 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1022 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1023 structs RGB and HSV. May not be the best place for these files.
1024 Perhaps move them into src ?
1026 * src/frontends/xforms/Makefile.am: added new files.
1028 * src/frontends/xforms/forms/form_preferences.fd:
1029 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1030 replaced all instances of "colour" with "color"!
1032 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1035 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1036 tab. Can now alter the colors of the xform's GUI on the fly. With
1037 the aid of a single static Signal (see below), can "Apply" these
1038 changes to all currently open dialogs. (Well, to all of the NEW
1039 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1040 subsequently opened dialogs will, of course, also have the new
1041 color scheme. Cannot yet save (or load) the choices to file, so
1042 they are lost when exiting LyX.
1044 * src/frontends/Dialogs.h:
1045 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1046 Used to trigger a redraw of any dialogs connected to it because,
1047 for example, the GUI colours have been re-mapped.
1049 * src/frontends/xforms/FormBase.[Ch]:
1050 * src/frontends/xforms/FormDocument.[Ch]:
1051 * src/frontends/xforms/FormParagraph.[Ch]:
1052 * src/frontends/xforms/FormPreferences.[Ch]:
1053 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1054 method, to be connected to Dialogs::redrawGUI. Method must be
1055 virtual, because dialogs with tabbed folders need to redraw the
1056 forms of each tab folder.
1058 * src/LyXView.C (d-tor):
1059 * src/frontends/xforms/FormBase.C (d-tor): connected
1060 Dialogs::redrawGUI signal to redraw().
1062 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1063 removed Assert, because it is identical to that in FormBase.
1065 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1067 * lib/ui/default.ui: minor polishing.
1069 2000-11-10 Juergen Vigna <jug@sad.it>
1071 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1072 (deleteLyXText): ditto
1074 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1075 selection on mouse-button-3.
1077 * src/insets/insettabular.h: new function clearSelection(), use this
1078 functions inside insettabular.C.
1080 * src/insets/insettabular.C (TabularFeatures): clear the selection
1081 on remove_row/column.
1083 * src/insets/inset.C (scroll): fixed some scroll stuff.
1085 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1087 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1089 * lib/CREDITS: add Yves Bastide
1091 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1093 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1094 check whether C library functions are in the global namespace.
1096 * configure.in: calls it.
1098 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1099 #ifndef __GLIBCPP__.
1101 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1103 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1104 iterators to prevent crash.
1106 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1108 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1110 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1111 shortcut for xforms CB to the preemptive or post-handler function.
1113 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1114 removed the HIDDEN_TIMER as it's no longer used.
1115 Various other small changes.
1117 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1118 preemptive handler to obtain feedback, rather than the post-handler.
1119 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1121 Formats tab is now complete. Converters tab is nearly so.
1123 2000-11-09 Juergen Vigna <jug@sad.it>
1125 * src/insets/insettext.C (~InsetText):
1128 (SetParagraphData): set cache.second to 0 after deleting it!
1129 (getLyXText): check if cache.second is not 0 if finding it.
1131 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1133 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1134 lyxlex to parse the rgb.txt file.
1137 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1138 replace the default '#' comment character.
1140 * src/support/tempname.C: add "using" directive
1141 * src/frontends/ButtonPolicies.C: ditto.
1143 * src/support/filetools.C (DirList): add an explicit cast to avoid
1144 a compile error (probably not the right fix)
1146 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1148 * src/support/filetools.C (DirList): implement using system functions
1150 * src/support/tempname.C: new file
1152 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1154 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1156 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1159 * src/frontends/xforms/ButtonController.C: new file
1161 * src/os2_defines.h: remove getcwd define
1163 * src/lyxvc.C: include support/lyxlib.h
1164 (showLog): use lyx::tempName
1166 * src/lyx_cb.C: comment out includes that we don't need
1167 (AutoSave): use lyx::tempName
1169 * src/filedlg.C: include support/lyxlib.h
1170 (Reread): use lyx::getcwd
1172 * src/converter.C: include support/filetools.h
1173 (add_options): change to static inline, make tail const
1174 (Add): make old_viewer const
1175 (GetAllFormats): make it a const method, use const_iterator
1176 (enable): make static inline
1177 (SplitFormat): make using_format const
1179 * src/LaTeX.C (run): use lyx::getcwd
1181 * configure.in: check for mkstemp as well
1183 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1185 * src/converter.[Ch] (GetAllCommands): new method.
1187 * src/support/filetools.[Ch] (DirList): new method.
1189 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1190 functionality to the converters tab.
1191 The formats tab is now nearly complete.
1192 The kbmap choices in Languages tab now display the contents of
1193 system_lyxdir/kbd/*.kmap in readable form.
1195 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1196 Moved some variables into the class.
1198 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1199 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1200 colour of active folder to lighter grey instead. Any takers?
1201 (form_colours): added an "Apply" button.
1202 (form_converters): added a "Flags" input field.
1203 (form_formats): added a "Shortcut" input field. Note that we can't use
1204 names such as "input_shortcut" as this buggers up the sed script stuff.
1206 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1214 * src/lyx_sendfax_main.C:
1217 * src/spellchecker.C:
1218 * src/insets/figinset.C:
1219 * src/insets/insetbib.C:
1220 * src/insets/insetexternal.C:
1221 * src/insets/insetinclude.C:
1222 * src/insets/insetinfo.C:
1223 * src/mathed/math_panel.C:
1224 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1225 all "daughter" dialogs now have identical "feel".
1227 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1229 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1230 used (and was only used in one place prior to this patch. Incorrectly!)
1232 * src/frontends/xforms/FormDocument.C: changed some instances of
1233 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1234 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1235 for options_->input_float_placement. This fixes a bug reported by
1238 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1239 functionality into d-tor.
1241 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1242 input of numerals also.
1244 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1245 fl_set_form_atclose(). Can now close dialog from window manager,
1246 fixing a bug reported by Rob Lahaye.
1248 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1250 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1251 are no longer dark. Haven't yet worked out how to lighten the colour of
1252 the active tabfolder. Any ideas anybody?
1253 Adjusted Colours tab a little.
1254 Added Shortcut field to converters tab. Note that we can't create an
1255 fdesign label like "input_shortcut" as this buggers up the sed-script
1258 * src/frontends/xforms/FormPreferences.[Ch]:
1259 (feedback): fixed crash due to to ob=0.
1260 (LanguagesXXX): the kbmap choices now contain the files
1261 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1262 be replaced by an input with a file browse button, but since the browse
1263 buttons don'y yet work, this'll do for the moment.
1264 (FormatsXXX): think that this is now nearly fully functional.
1265 Some points/questions though:
1266 1. Does "Apply" remove formats if no longer present?
1267 2. I think that the browser should list the GUI names rather than the
1269 3. Must ensure that we can't delete Formats used by an existing
1272 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1273 if this is the best way to do this.
1275 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1277 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1279 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1280 for variable assignment.
1282 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1284 * src/lib/ui/default.ui: added sub/superscripts to menu as
1285 Insert->Special characters and cleaned-up the file a bit
1287 2000-11-07 Allan Rae <rae@lyx.org>
1289 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1290 ob isn't 0 before using it. See comments in function.
1292 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1294 * src/frontends/xforms/form_*.C: regenerated
1296 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1298 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1300 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1301 compiling with gcc-2.96
1303 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1305 * src/support/lyxstring.C: add a couple "using" directives.
1307 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1308 a .c_str() here too for good measure.
1309 * src/Spacing.C (set): ditto.
1310 * src/lyxfunc.C (Dispatch): ditto.
1312 * src/insets/insettabular.C (copySelection): change .str() to
1313 .str().c_str() to fix problems with lyxstring.
1314 * src/support/filetools.C (GetFileContents): ditto.
1315 * src/buffer.C (asciiParagraph): ditto.
1316 * src/paragraph.C (String): ditto.
1318 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1319 * lib/bind/sciword.bind: ditto.
1321 * src/LyXAction.C (init): remove "symbol-insert" function, which
1322 shared LFUN_INSERT_MATH with "math-insert".
1324 * lib/configure.m4: == is not a valid operator for command test.
1326 * src/lyxrc.C: add using directive.
1328 * src/converter.h: add std:: qualifier.
1330 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1332 * src/converter.[Ch] and other files: Change the Format class to a
1333 real class, and create two instances: formats and system_format.
1335 * src/lyxrc.C (output): Output the difference between formats and
1338 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1339 (buildFormats): Insert formats into browser.
1340 (inputFormats): Made the browser and add button functional.
1341 (applyFormats): Update formats from format_vec.
1343 * src/converter.C: Changed all (*it). to it->
1344 (Format::dummy): New method.
1345 (Format::importer): New format flag.
1346 (Formats::GetAllFormats): New method.
1347 (Formats::Add): Delete format from the map if prettyname is empty.
1348 (Converter::Convert): Print an error message if moving the file fails.
1349 (Converter::GetReachableTo): New method
1351 * src/MenuBackend.[Ch]: Add support for importformats tag.
1353 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1355 * lib/configure.m4: Add word->tex and ps->fax converters.
1357 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1358 Return fax to file menu.
1362 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1364 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1367 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1370 * src/lyxfunc.C (processKeyEvent): removed
1372 * src/bufferlist.C (emergencyWrite): removed the out commented
1373 emergency write code.
1375 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1377 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1379 * many files: change formatting to be a bit more uniform for
1380 if,while,for,switch statements, remove some parantesis not needed.
1383 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1385 * config/kde.m4: make config more robust when KDEDIR is set
1387 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1389 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1390 not returned a pixmap for "math-insert".
1392 * src/LyXAction.C (init): sort the entries a bit.
1394 2000-11-03 Juergen Vigna <jug@sad.it>
1396 * src/insets/insettabular.h: added fixed number to update codes so
1397 that update is only in one direction.
1399 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1402 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1403 before call to edit because of redraw.
1405 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1407 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1409 * lib/ui/default.ui: Populate "edit_float" menu
1411 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1413 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1414 "floats-operate". The name is ugly (and the func also), but this
1415 is just a band-aid until we switch to new insets.
1417 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1419 * lib/ui/default.ui: update again the menu layout (fix some
1422 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1424 * src/MenuBackend.h (fulllabel): new method.
1426 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1427 the menu shortcuts of a menu are unique and whether they
1428 correspond to a letter of the label.
1429 (expand): call checkShortcuts when debugging.
1431 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1433 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1435 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1437 * lib/examples/*.lyx : '\language default' => '\language english'
1439 * lib/examples/it_splash.lyx : except where it should be italian
1441 * lib/templates/*.lyx : the same
1443 * doc/*.lyx* : the same
1445 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1447 * lib/bind/menus.bind: remove the Layout menu entries, which I
1448 somehow forgot earlier.
1450 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1452 * lib/ui/old-default.ui: keep the old one here for reference (to
1455 * lib/ui/default.ui: update the menu layout
1457 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1459 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1460 Can now Apply to different insets without closing the dialog.
1462 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1463 Can't actually DO anything with them yet, but I'd like a little
1466 * src/frontends/xforms/input_validators.[ch]
1467 (fl_lowercase_filter): new.
1469 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1471 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1472 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1474 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1476 2000-11-02 Juergen Vigna <jug@sad.it>
1478 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1479 on char insertion as it has already be updated by bv->updateInset().
1481 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1482 if an inset inside was updated.
1484 * lib/configure.cmd: commented out fax-search code
1486 2000-11-01 Yves Bastide <stid@acm.org>
1488 * src/tabular.C (OldFormatRead): set tabular language to the
1491 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1493 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1494 class names with non-letter characters (from Yves Bastide).
1496 * lib/ui/default.ui: change Item to OptItem in import menu.
1497 Comment out fax stuff.
1499 * lib/configure.m4: comment out fax-related stuff.
1501 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1503 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1504 useful xforms helper functions. At present contains only formatted().
1505 Input a string and it returns it with line breaks so that in fits
1508 * src/frontends/xforms/Makefile.am: add new files.
1510 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1511 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1514 * src/frontends/xforms/FormPreferences.[Ch]:
1515 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1516 but lots of little clean ups. Removed enum State. Make use of
1517 formatted(). Constify lots of methods. Perhaps best of all: removed
1518 requirement for that horrible reinterpret_cast from pointer to long in
1521 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1523 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1524 conditionalize build on xforms < 0.89
1526 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1528 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1530 * src/LyXAction.C (init): comment out fax
1532 * src/lyxrc.h: comment out the fax enums
1533 comment out the fax variables
1535 * src/commandtags.h: comment out LFUN_FAX
1537 * src/lyxrc.C: disable fax variables.
1538 (read): disable parsing of fax variables
1539 (output): disable writing of fax variables
1540 (getFeedback): now description for fax variables
1542 * src/lyxfunc.C: comment out MenuFax
1543 (Dispatch): disable LFUN_FAX
1545 * src/lyx_cb.C (MenuFax): comment out
1547 * src/WorkArea.C: add <cctype>
1548 (work_area_handler): better key handling, should be ok now.
1549 for accented chars + etc
1551 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1552 lyx_sendfax.h and lyx_sendfax_man.C
1554 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1555 (show): don't call InitLyXLookup when using xforms 0.89
1557 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1559 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1561 * src/support/filetools.C (GetFileContents): close to dummy change
1563 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1565 * src/trans.C (AddDeadkey): workaround stupid compilers.
1567 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1569 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1570 of two-sided document.
1572 2000-10-31 Juergen Vigna <jug@sad.it>
1574 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1576 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1577 xposition to the Edit call.
1579 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1581 * src/trans.C (AddDeadkey): cast explicitly to char.
1583 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1585 * src/tabular.C (AsciiBottomHLine): simplify?
1586 (AsciiTopHLine): simplify?
1587 (print_n_chars): simplify
1588 (DocBook): remove most of the << endl; we should flush the stream
1589 as seldom as possible.
1591 (TeXBottomHLine): ditto
1592 (TeXTopHLine): ditto
1594 (write_attribute): try a templified version.
1595 (set_row_column_number_info): lesson scope of variables
1597 * src/support/lstrings.h (tostr): new specialization of tostr
1599 * src/trans.C (AddDeadkey): slightly cleaner fix.
1601 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1603 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1604 '%%' in Toc menu labels.
1607 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1608 font_norm is iso10646-1.
1610 * src/font.C (ascent): Fixed for 16bit fonts
1611 (descent,lbearing,rbearing): ditto
1613 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1615 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1616 (getFeedback): new static method.
1618 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1619 Now use combox rather than choice to display languages.
1620 Feedback is now output using a new timer callback mechanism, identical
1621 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1623 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1625 * src/minibuffer.C: fix for older compilers
1627 2000-10-30 Juergen Vigna <jug@sad.it>
1629 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1630 has to be Left of the inset otherwise LyXText won't find it!
1632 * src/BufferView2.C (open_new_inset): delete the inset if it can
1635 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1637 * lyx.man: fix typo.
1639 2000-10-29 Marko Vendelin <markov@ioc.ee>
1640 * src/frontends/gnome/FormCitation.C
1641 * src/frontends/gnome/FormCitation.h
1642 * src/frontends/gnome/FormCopyright.C
1643 * src/frontends/gnome/FormCopyright.h
1644 * src/frontends/gnome/FormError.C
1645 * src/frontends/gnome/FormError.h
1646 * src/frontends/gnome/FormIndex.C
1647 * src/frontends/gnome/FormIndex.h
1648 * src/frontends/gnome/FormPrint.C
1649 * src/frontends/gnome/FormPrint.h
1650 * src/frontends/gnome/FormRef.C
1651 * src/frontends/gnome/FormRef.h
1652 * src/frontends/gnome/FormToc.C
1653 * src/frontends/gnome/FormToc.h
1654 * src/frontends/gnome/FormUrl.C
1655 * src/frontends/gnome/FormUrl.h
1656 * src/frontends/gnome/Menubar_pimpl.C
1657 * src/frontends/gnome/mainapp.C
1658 * src/frontends/gnome/mainapp.h
1659 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1660 changing update() to updateSlot() where appropriate
1662 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1664 * src/frontends/xforms/FormPreferences.[Ch]:
1665 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1668 2000-10-28 Juergen Vigna <jug@sad.it>
1670 * src/insets/insettabular.C (draw): fixed drawing bug.
1672 * src/insets/insettext.C (clear):
1674 (SetParagraphData): clearing the TEXT buffers when deleting the
1675 paragraphs used by it.
1677 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1679 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1681 2000-10-27 Juergen Vigna <jug@sad.it>
1683 * src/tabular.C (~LyXTabular): removed not needed anymore.
1685 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1688 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1690 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1693 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1696 * src/frontends/xforms/FormPreferences.[Ch]:
1697 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1698 Reorganised as modules based on tabs. Much easier to follow the
1699 flow and to add new tabs. Added warning and feedback messages.
1702 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1704 * src/tabular.h (DocBook): add std:: qualifier.
1706 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1708 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1709 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1712 * insettabular.C (DocBook): uses the tabular methods to export
1715 * src/insets/insettext.h
1716 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1718 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1720 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1723 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1724 moved misplaced AllowInput two lines up.
1726 * src/buffer.C (readFile): compare float with float, not with int
1728 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1730 * src/minibuffer.C: add "using SigC::slot" statement.
1732 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1734 * src/frontends/xforms/forms/README: updated section about make.
1736 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1737 Tidied some forms up, made two of form_tabular's tabs more
1738 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1739 fixed translation problem with "Column".
1741 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1743 * src/minibuffer.h: use Timeout instead of the xforms timer
1745 (setTimer) rewrite for the Timeout, change to unsigned arg
1746 (set): change to unsigned timer arg
1749 * src/minibuffer.C (TimerCB): removed func
1750 (C_MiniBuffer_TimerCB): removed func
1751 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1752 (peek_event): use a switch statement
1753 (add): don't use fl_add_timer.
1754 (Set): rewrite to use the Timeout
1757 * src/Timeout.[Ch] (setType): return a Timeout &
1758 (setTimeout): ditto, change to unsigned arg for timeout
1760 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1762 * src/mathed/formula.C (mathed_string_width): Use string instead
1763 of a constant size char array.
1765 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1767 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1768 the two recently added operator<< for SMInput and State.
1770 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1772 (OkCancelPolicy): ditto
1773 (OkCancelReadOnlyPolicy): ditto
1774 (NoRepeatedApplyReadOnlyPolicy): ditto
1775 (OkApplyCancelReadOnlyPolicy): ditto
1776 (OkApplyCancelPolicy): ditto
1777 (NoRepeatedApplyPolicy): ditto
1779 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1781 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1782 add the usual std:: qualifiers.
1784 2000-10-25 Juergen Vigna <jug@sad.it>
1786 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1788 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1790 * src/support/filetools.C (MakeRelPath): change some types to
1793 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1794 ButtonPolicy::SMInput and ButtonPolicy::State.
1796 * src/FontLoader.C (reset): small cleanup
1797 (unload): small cleanup
1799 * src/FontInfo.C (getFontname): initialize error to 10000.0
1801 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1803 * src/frontends/xforms/FormPreferences.[Ch]:
1804 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1805 TeX encoding and default paper size sections.
1807 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1809 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1812 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1813 make the message_ empty.
1814 (FormError): don't initialize message_ in initializer list.
1816 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1818 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1820 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1822 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1824 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1826 * src/frontends/kde/*data.[Ch]: _("") is not
1829 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1831 * src/buffer.C: removed redundant using directive.
1833 * src/frontends/DialogBase.h: revert to original definition of
1836 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1837 stuff into two classes, one for each dialog, requires a new
1838 element in the dialogs vector, FormTabularCreate.
1840 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1843 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1844 method. Continues Allan's idea, but means that derived classes
1845 don't need to worry about "update or hide?".
1847 * src/frontends/xforms/FormError.C (showInset): add connection
1850 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1851 one for each dialog. FormTabular now contains main tabular dialog
1854 * src/frontends/xforms/FormTabularCreate.[Ch]:
1855 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1858 * src/frontends/xforms/FormGraphics.[Ch]:
1859 * src/frontends/xforms/forms/form_graphics.fd
1860 * src/frontends/xforms/FormTabular.[Ch]:
1861 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1862 classes of FormInset.
1864 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1865 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1867 * src/frontends/xforms/Makefile.am:
1868 * src/frontends/xforms/forms/makefile: added new files.
1870 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1871 variable. added Signal0 hide signal, in keeping with other GUI-I
1874 * src/support/lstrings.h: removed redundant std:: qualifier as
1875 it's already declared in Lsstream.h.
1877 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1879 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1883 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1885 * src/tabular.C (Ascii): minimize scope of cell.
1887 * src/BufferView2.C (nextWord): return string() instead of 0;
1889 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1891 * src/converter.h: add a std:: qualifier
1893 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1895 * src/importer.[Ch]: New files. Used for importing files into LyX.
1897 * src/lyxfunc.C (doImport): Use the new Importer class.
1899 * src/converter.h: Add shortcut member to the Format class.
1900 Used for holding the menu shortcut.
1902 * src/converter.C and other files: Made a distinction between
1903 format name and format extension. New formats can be defined using
1904 the \format lyxrc tag.
1905 Added two new converter flags: latex and disable.
1907 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1909 * src/support/lyxlib.h: unify namespace/struct implementation.
1910 Remove extra declarations.
1912 * src/support/chdir.C (chdir): remove version taking char const *
1914 * src/support/rename.C: ditto.
1915 * src/support/lyxsum.C: ditto.
1917 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1919 * src/frontends/xforms/FormBase.[Ch]:
1920 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1921 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1922 work only for the next call to fl_show_form(). The correct place to set
1923 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1924 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1925 from FormBase have the minimum size set; no more stupid crashes with
1928 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1930 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1932 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1934 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1936 * src/support/lyxlib.h: changed second argument of mkdir to
1937 unsigned long int (unsigned int would probably have been enough,
1938 but...). Removed <sys/types.h> header.
1939 * src/support/mkdir.C (mkdir): ditto.
1943 2000-10-19 Juergen Vigna <jug@sad.it>
1945 * src/lyxfunc.C (MenuNew): small fix (form John)
1947 * src/screen.C (Update): removed unneeded code.
1949 * src/tabular.C (Ascii): refixed int != uint bug!
1951 * src/support/lyxlib.h: added sys/types.h include for now permits
1952 compiling, but I don't like this!
1954 2000-10-18 Juergen Vigna <jug@sad.it>
1956 * src/text2.C (ClearSelection): if we clear the selection we need
1957 more refresh so set the status apropriately
1959 * src/insets/insettext.C (draw): hopefully finally fixed draw
1962 2000-10-12 Juergen Vigna <jug@sad.it>
1964 * src/insets/insettext.C (draw): another small fix and make a block
1965 so that variables are localized.
1967 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1969 * src/support/lstrings.C (lowercase, uppercase):
1970 use explicit casts to remove compiler warnings.
1972 * src/support/LRegex.C (Impl):
1973 * src/support/StrPool.C (add):
1974 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1975 (AddPath, MakeDisplayPath):
1976 * src/support/lstrings.C (prefixIs, subst):
1977 use correct type to remove compiler warnings.
1979 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1981 * src/support/lyxlib.h:
1982 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1983 portability and to remove compiler warning with DEC cxx.
1985 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1987 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1989 * src/minibuffer.C (peek_event): retun 1 when there has been a
1990 mouseclick in the minibuffer.
1994 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1996 * src/frontends/xforms/FormParagraph.C: more space above/below
1999 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2001 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2002 a char only if real_current_font was changed.
2004 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2006 * NEWS: update somewhat for 1.1.6
2008 * lib/ui/default.ui: clean up.
2010 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2012 * lib/CREDITS: clean up
2014 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2016 * src/combox.[Ch] (select): changed argument back to int
2017 * src/combox.C (peek_event): removed num_bytes as it is declared but
2020 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2021 modified calls to Combox::select() to remove warnings about type
2024 * src/insets/insetbutton.C (width): explicit cast to remove warning
2025 about type conversion.
2027 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2030 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2031 sel_pos_end, refering to cursor position are changed to
2032 LyXParagraph::size_type.
2034 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2035 consistent with LyXCursor::pos().
2036 (inset_pos): changed to LyXParagraph::size_type for same reason.
2038 * src/insets/insettext.C (resizeLyXText): changed some temporary
2039 variables refing to cursor position to LyXParagraph::size_type.
2041 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2043 * src/frontends/kde/<various>: The Great Renaming,
2046 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2048 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2050 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2052 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2053 0 when there are no arguments.
2055 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2057 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2058 to segfaults when pressing Ok in InsetBibtex dialog.
2060 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2062 * forms/layout_forms.fd:
2063 * src/layout_forms.C (create_form_form_character): small change to use
2064 labelframe rather than engraved frame + text
2066 * src/lyx_gui.C (create_forms): initialise choice_language with some
2067 arbitrary value to prevent segfault when dialog is shown.
2069 2000-10-16 Baruch Even <baruch.even@writeme.com>
2071 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2072 is no resulting file. This pertains only to LaTeX output.
2074 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2076 * src/text.C (Backspace): Make sure that the row of the cursor is
2079 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2082 * src/lyx_gui.C (init): Prevent a crash when only one font from
2083 menu/popup fonts is not found.
2085 * lib/lyxrc.example: Add an example for binding a key for language
2088 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2090 * src/converter.C (GetReachable): Changed the returned type to
2092 (IsReachable): New method
2094 * src/MenuBackend.C (expand): Handle formats that appear more
2097 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2099 * src/frontends/support/Makefile.am
2100 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2103 * lib/CREDITS: add Garst Reese.
2105 * src/support/snprintf.h: add extern "C" {} around the definitions.
2107 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2109 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2112 * src/frontends/xforms/FormDocument.C:
2113 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2114 compile without "conversion to integral type of smaller size"
2117 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2119 * src/text.C (GetColumnNearX): Fixed disabled code.
2121 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2123 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2126 * src/support/snprintf.[ch]: new files
2128 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2130 * src/frontends/kde/formprintdialog.C: add
2131 file browser for selecting postscript output
2133 * src/frontends/kde/formprintdialogdata.C:
2134 * src/frontends/kde/formprintdialogdata.h: re-generate
2137 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2139 * src/frontends/gnome/Makefile.am:
2140 * src/frontends/kde/Makefile.am: FormCommand.C
2141 disappeared from xforms
2143 * src/frontends/kde/FormCitation.C:
2144 * src/frontends/kde/FormIndex.C: read-only
2147 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2149 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2152 * src/bufferlist.C: add using directive.
2154 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2156 * src/support/lyxfunctional.h: version of class_fun for void
2157 returns added, const versions of back_inseter_fun and compare_fun
2160 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2162 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2164 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2166 * ChangeLog: cleanup.
2168 * lib/CREDITS: update to add all the contributors we've forgotten.
2169 I have obviously missed some, so tell me whether there were
2172 2000-10-13 Marko Vendelin <markov@ioc.ee>
2174 * src/frontends/gnome/FormCitation.C
2175 * src/frontends/gnome/FormCitation.h
2176 * src/frontends/gnome/FormError.C
2177 * src/frontends/gnome/FormIndex.C
2178 * src/frontends/gnome/FormRef.C
2179 * src/frontends/gnome/FormRef.h
2180 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2182 * src/frontends/gnome/FormCitation.C
2183 * src/frontends/gnome/FormCopyright.C
2184 * src/frontends/gnome/FormError.C
2185 * src/frontends/gnome/FormIndex.C
2186 * src/frontends/gnome/FormRef.C
2187 * src/frontends/gnome/FormToc.C
2188 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2191 * src/frontends/gnome/Menubar_pimpl.C
2192 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2195 2000-10-11 Baruch Even <baruch.even@writeme.com>
2198 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2199 to convey its real action.
2201 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2202 clear the minibuffer and prepare to enter a command.
2204 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2205 the rename from ExecCommand to PrepareForCommand.
2206 * src/lyxfunc.C (Dispatch): ditto.
2208 2000-10-11 Baruch Even <baruch.even@writeme.com>
2210 * src/buffer.C (writeFile): Added test for errors on writing, this
2211 catches all errors and not only file system full errors as intended.
2213 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2215 * src/lyx_gui.C (create_forms): better fix for crash with
2216 translated interface.
2218 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2220 * src/frontends/kde/Makefile.am:
2221 * src/frontends/kde/FormCopyright.C:
2222 * src/frontends/kde/formcopyrightdialog.C:
2223 * src/frontends/kde/formcopyrightdialog.h:
2224 * src/frontends/kde/formcopyrightdialogdata.C:
2225 * src/frontends/kde/formcopyrightdialogdata.h:
2226 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2227 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2228 copyright to use qtarch
2230 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2232 * src/encoding.C (read): Fixed bug that caused an error message at
2233 the end of the file.
2235 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2237 * lib/lyxrc.example: Fixed hebrew example.
2239 2000-10-13 Allan Rae <rae@lyx.org>
2241 * src/frontends/xforms/FormPreferences.C (input): reworking the
2243 (build, update, apply): New inputs in various tabfolders
2245 * src/frontends/xforms/FormToc.C: use new button policy.
2246 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2247 dialogs that either can't use any existing policy or where it just
2250 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2253 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2254 added a bool parameter which is ignored.
2256 * src/buffer.C (setReadonly):
2257 * src/BufferView_pimpl.C (buffer):
2258 * src/frontends/kde/FormCopyright.h (update):
2259 * src/frontends/kde/FormCitation.[Ch] (update):
2260 * src/frontends/kde/FormIndex.[Ch] (update):
2261 * src/frontends/kde/FormPrint.[Ch] (update):
2262 * src/frontends/kde/FormRef.[Ch] (update):
2263 * src/frontends/kde/FormToc.[Ch] (update):
2264 * src/frontends/kde/FormUrl.[Ch] (update):
2265 * src/frontends/gnome/FormCopyright.h (update):
2266 * src/frontends/gnome/FormCitation.[Ch] (update):
2267 * src/frontends/gnome/FormError.[Ch] (update):
2268 * src/frontends/gnome/FormIndex.[Ch] (update):
2269 * src/frontends/gnome/FormPrint.[Ch] (update):
2270 * src/frontends/gnome/FormRef.h (update):
2271 * src/frontends/gnome/FormToc.[Ch] (update):
2272 * src/frontends/gnome/FormUrl.[Ch] (update):
2273 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2274 to updateBufferDependent and DialogBase
2276 * src/frontends/xforms/FormCitation.[hC]:
2277 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2278 * src/frontends/xforms/FormError.[Ch]:
2279 * src/frontends/xforms/FormGraphics.[Ch]:
2280 * src/frontends/xforms/FormIndex.[Ch]:
2281 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2282 and fixed readOnly handling.
2283 * src/frontends/xforms/FormPrint.[Ch]:
2284 * src/frontends/xforms/FormRef.[Ch]:
2285 * src/frontends/xforms/FormTabular.[Ch]:
2286 * src/frontends/xforms/FormToc.[Ch]:
2287 * src/frontends/xforms/FormUrl.[Ch]:
2288 * src/frontends/xforms/FormInset.[Ch]:
2289 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2290 form of updateBufferDependent.
2292 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2293 if form()->visible just in case someone does stuff to the form in a
2296 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2297 the buttoncontroller for everything the enum used to be used for.
2298 (update) It would seem we need to force all dialogs to use a bool
2299 parameter or have two update functions. I chose to go with one.
2300 I did try removing update() from here and FormBase and defining the
2301 appropriate update signatures in FormBaseB[DI] but then ran into the
2302 problem of the update() call in FormBase::show(). Whatever I did
2303 to get around that would require another function and that just
2304 got more confusing. Hence the decision to make everyone have an
2305 update(bool). An alternative might have been to override show() in
2306 FormBaseB[DI] and that would allow the different and appropriate
2309 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2310 true == buffer change occurred. I decided against using a default
2311 template parameter since not all compilers support that at present.
2313 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2315 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2316 army knife" by removing functionality.
2317 (clearStore): removed. All such housekeeping on hide()ing the dialog
2318 is to be carried out by overloaded disconnect() methods.
2319 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2320 superceded by Baruch's neat test (FormGraphics) to update an existing
2321 dialog if a new signal is recieved rather than block all new signals
2323 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2324 only to Inset dialogs.
2325 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2326 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2328 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2330 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2331 as a base class to all inset dialogs. Used solely to connect/disconnect
2332 the Inset::hide signal and to define what action to take on receipt of
2333 a UpdateBufferDependent signal.
2334 (FormCommand): now derived from FormInset.
2336 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2339 * src/frontends/xforms/FormCopyright.[Ch]:
2340 * src/frontends/xforms/FormPreferences.[Ch]:
2341 now derived from FormBaseBI.
2343 * src/frontends/xforms/FormDocument.[Ch]:
2344 * src/frontends/xforms/FormParagraph.[Ch]:
2345 * src/frontends/xforms/FormPrint.[Ch]:
2346 now derived from FormBaseBD.
2348 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2350 * src/frontends/xforms/FormCitation.[Ch]:
2351 * src/frontends/xforms/FormError.[Ch]:
2352 * src/frontends/xforms/FormRef.[Ch]:
2353 * src/frontends/xforms/FormToc.[Ch]:
2354 (clearStore): reworked as disconnect().
2356 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2359 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2361 * src/converter.C (runLaTeX): constify buffer argument
2364 * src/frontends/support/Makefile.am (INCLUDES): fix.
2366 * src/buffer.h: add std:: qualifier
2367 * src/insets/figinset.C (addpidwait): ditto
2368 * src/MenuBackend.C: ditto
2369 * src/buffer.C: ditto
2370 * src/bufferlist.C: ditto
2371 * src/layout.C: ditto
2372 * src/lyxfunc.C: ditto
2374 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2376 * src/lyxtext.h (bidi_level): change return type to
2377 LyXParagraph::size_type.
2379 * src/lyxparagraph.h: change size_type to
2380 TextContainer::difference_type. This should really be
2381 TextContainer::size_type, but we need currently to support signed
2384 2000-10-11 Marko Vendelin <markov@ioc.ee>
2385 * src/frontends/gnome/FormError.h
2386 * src/frontends/gnome/FormRef.C
2387 * src/frontends/gnome/FormRef.h
2388 * src/frontends/gnome/FormError.C
2389 * src/frontends/gnome/Makefile.am
2390 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2391 to Gnome frontend. Both dialogs use "action" area.
2393 2000-10-12 Baruch Even <baruch.even@writeme.com>
2395 * src/graphics/GraphicsCacheItem_pimpl.C:
2396 * src/graphics/Renderer.C:
2397 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2400 2000-10-12 Juergen Vigna <jug@sad.it>
2402 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2403 visible when selecting).
2405 * development/Code_rules/Rules: fixed some typos.
2407 2000-10-09 Baruch Even <baruch.even@writeme.com>
2409 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2410 compiling on egcs 1.1.2 possible.
2412 * src/filedlg.C (comp_direntry::operator() ): ditto.
2414 2000-08-31 Baruch Even <baruch.even@writeme.com>
2416 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2419 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2420 transient it now only gets freed when the object is destructed.
2422 2000-08-24 Baruch Even <baruch.even@writeme.com>
2424 * src/frontends/FormGraphics.h:
2425 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2428 2000-08-20 Baruch Even <baruch.even@writeme.com>
2430 * src/insets/insetgraphics.C:
2431 (draw): Added messages to the drawn rectangle to report status.
2432 (updateInset): Disabled the use of the inline graphics,
2435 2000-08-17 Baruch Even <baruch.even@writeme.com>
2437 * src/frontends/support: Directory added for the support of GUII LyX.
2439 * src/frontends/support/LyXImage.h:
2440 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2443 * src/frontends/support/LyXImage_X.h:
2444 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2445 version of LyXImage, this uses the Xlib Pixmap.
2447 * src/PainterBase.h:
2448 * src/PainterBase.C:
2450 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2451 replacement to Pixmap.
2453 * src/insets/insetgraphics.h:
2454 * src/insets/insetgraphics.C:
2455 * src/graphics/GraphicsCacheItem.h:
2456 * src/graphics/GraphicsCacheItem.C:
2457 * src/graphics/GraphicsCacheItem_pimpl.h:
2458 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2461 * src/graphics/GraphicsCacheItem.h:
2462 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2463 another copy of the object.
2465 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2466 of cacheHandle, this fixed a bug that sent LyX crashing.
2468 * src/graphics/XPM_Renderer.h:
2469 * src/graphics/XPM_Renderer.C:
2470 * src/graphics/EPS_Renderer.h:
2471 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2473 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2475 * src/lyxfunc.C (processKeySym): only handle the
2476 lockinginset/inset stuff if we have a buffer and text loaded...
2478 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2480 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2482 * src/support/lyxfunctional.h: add operator= that takes a reference
2484 * src/lyxserver.C (mkfifo): make first arg const
2486 * src/layout.h: renamed name(...) to setName(...) to work around
2489 * src/buffer.C (setFileName): had to change name of function to
2490 work around bugs in egcs. (renamed from fileName)
2492 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2494 * src/support/translator.h: move helper template classes to
2495 lyxfunctional.h, include "support/lyxfunctional.h"
2497 * src/support/lyxmanip.h: add delaration of fmt
2499 * src/support/lyxfunctional.h: new file
2500 (class_fun_t): new template class
2501 (class_fun): helper template function
2502 (back_insert_fun_iterator): new template class
2503 (back_inserter_fun): helper template function
2504 (compare_memfun_t): new template class
2505 (compare_memfun): helper template function
2506 (equal_1st_in_pair): moved here from translator
2507 (equal_2nd_in_pair): moved here from translator
2509 * src/support/fmt.C: new file
2510 (fmt): new func, can be used for a printf substitute when still
2511 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2513 * src/support/StrPool.C: add some comments
2515 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2518 * src/insets/figinset.C (addpidwait): use std::copy with
2519 ostream_iterator to fill the pidwaitlist
2521 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2523 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2526 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2529 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2531 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2532 (class_update): ditto
2533 (BulletPanel): ditto
2534 (CheckChoiceClass): move initialization of tc and tct
2536 * src/tabular.C: remove current_view
2537 (OldFormatRead): similar to right below [istream::ignore]
2539 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2540 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2541 unused [istream::ignore]
2543 * src/lyxfunc.C: include "support/lyxfunctional.h"
2544 (getInsetByCode): use std::find_if and compare_memfun
2546 * src/lyxfont.C (stateText): remove c_str()
2548 * src/lyx_main.C (setDebuggingLevel): make static
2549 (commandLineHelp): make static
2551 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2552 Screen* together with fl_get_display() and fl_screen
2554 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2555 togheter with fl_get_display() and fl_screen
2556 (create_forms): remove c_str()
2558 * src/layout.C: include "support/lyxfunctional.h"
2559 (hasLayout): use std::find_if and compare_memfun
2560 (GetLayout): use std::find_if and comapre_memfun
2561 (delete_layout): use std::remove_if and compare_memfun
2562 (NumberOfClass): use std:.find_if and compare_memfun
2564 * src/gettext.h: change for the new functions
2566 * src/gettext.C: new file, make _(char const * str) and _(string
2567 const & str) real functions.
2569 * src/font.C (width): rewrite slightly to avoid one extra variable
2571 * src/debug.C: initialize Debug::ANY here
2573 * src/commandtags.h: update number comments
2575 * src/combox.h (get): make const func
2577 (getline): make const
2579 * src/combox.C (input_cb): handle case where fl_get_input can
2582 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2583 "support/lyxfunctional.h", remove current_view variable.
2584 (resize): use std::for_each with std::mem_fun
2585 (getFileNames): use std::copy with back_inserter_fun
2586 (getBuffer): change arg type to unsigned int
2587 (emergencyWriteAll): call emergencyWrite with std::for_each and
2589 (emergencyWrite): new method, the for loop in emergencyWriteAll
2591 (exists): use std::find_if with compare_memfun
2592 (getBuffer): use std::find_if and compare_memfun
2594 * src/buffer.h: add typedefs for iterator_category, value_type
2595 difference_type, pointer and reference for inset_iterator
2596 add postfix ++ for inset_iterator
2597 make inset_iterator::getPos() const
2599 * src/buffer.C: added support/lyxmanip.h
2600 (readFile): use lyxerr << fmt instead of printf
2601 (makeLaTeXFile): use std::copy to write out encodings
2603 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2605 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2606 free and the char * temp.
2607 (hasMenu): use std::find_if and compare_memfun
2610 * src/Makefile.am (lyx_SOURCES): added gettext.C
2612 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2613 string::insert small change to avoid temporary
2615 * src/LColor.C (getGUIName): remove c_str()
2617 * several files: change all occurrences of fl_display to
2620 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2621 that -pedantic is not used for gcc 2.97 (cvs gcc)
2623 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2625 2000-10-11 Allan Rae <rae@lyx.org>
2627 * src/frontends/xforms/FormPreferences.C (input): template path must be
2628 a readable directory. It doesn't need to be writeable.
2629 (build, delete, update, apply): New inputs in the various tabfolders
2631 * src/frontends/xforms/forms/form_preferences.fd:
2632 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2633 several new entries to existing folders. Shuffled some existing stuff
2636 * src/frontends/xforms/forms/form_print.fd:
2637 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2638 Should probably rework PrinterParams as well. Note that the switch to
2639 collated is effectively the same as !unsorted so changing PrinterParams
2640 will require a lot of fiddly changes to reverse the existing logic.
2642 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2644 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2646 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2648 2000-10-10 Allan Rae <rae@lyx.org>
2651 * src/lyxfunc.C (Dispatch):
2653 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2656 * src/lyxrc.C (output): Only write the differences between system lyxrc
2657 and the users settings.
2660 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2662 I'll rewrite this later, after 1.1.6 probably, to keep a single
2663 LyXRC but two instances of a LyXRCStruct.
2665 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2667 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2669 * src/tabular.h: add a few std:: qualifiers.
2671 * src/encoding.C: add using directive.
2672 * src/language.C: ditto.
2674 * src/insets/insetquotes.C (Validate): use languages->lang()
2675 instead of only language.
2677 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2679 * lib/languages: New file.
2681 * lib/encodings: New file.
2683 * src/language.C (Languages): New class.
2684 (read): New method. Reads the languages from the 'languages' file.
2686 * src/encoding.C (Encodings): New class.
2687 (read): New method. Reads the encodings from the 'encodings' file.
2689 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2692 * src/bufferparams.h and a lot of files: Deleted the member language,
2693 and renamed language_info to language
2695 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2696 * src/lyxfont.C (latexWriteStartChanges): ditto.
2697 * src/paragraph.C (validate,TeXOnePar): ditto.
2699 * src/lyxfont.C (update): Restored deleted code.
2701 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2703 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2705 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2707 * src/insets/figinset.[Ch]:
2708 * src/insets/insetinclude.[Ch]:
2709 * src/insets/insetinclude.[Ch]:
2710 * src/insets/insetparent.[Ch]:
2711 * src/insets/insetref.[Ch]:
2712 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2714 * src/insets/*.[Ch]:
2715 * src/mathed/formula.[Ch]:
2716 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2718 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2719 * src/lyx_cb.C (FigureApplyCB):
2720 * src/lyxfunc.C (getStatus, Dispatch):
2721 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2724 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2726 * src/converter.[Ch] (Formats::View):
2727 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2729 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2730 *current_view->buffer(). This will change later, but this patch is way
2733 2000-10-09 Juergen Vigna <jug@sad.it>
2735 * src/text.C (GetRow): small fix.
2737 * src/BufferView_pimpl.C (cursorPrevious):
2738 (cursorNext): added LyXText parameter to function.
2740 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2741 keypress depending on cursor position.
2743 2000-10-06 Juergen Vigna <jug@sad.it>
2745 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2746 (copySelection): redone this function and also copy ascii representa-
2749 * src/tabular.C (Ascii):
2753 (print_n_chars): new functions to realize the ascii export of tabulars.
2755 2000-10-05 Juergen Vigna <jug@sad.it>
2757 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2758 if we don't have a buffer.
2760 2000-10-10 Allan Rae <rae@lyx.org>
2762 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2763 with closing dialog. It seems that nested tabfolders require hiding
2764 of inner tabfolders before hiding the dialog itself. Actually all I
2765 did was hide the active outer folder.
2767 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2768 unless there really is a buffer. hideBufferDependent is called
2771 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2772 POTFILES.in stays in $(srcdir).
2774 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2776 * lib/lyxrc.example: Few changes.
2778 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2780 * src/BufferView_pimpl.C (buffer): only need one the
2781 updateBufferDependent signal to be emitted once! Moved to the end of
2782 the method to allow bv_->text to be updated first.
2784 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2785 and hSignal_ with Dialogs * and BufferDependency variables.
2786 New Buffer * parent_, initialised when the dialog is launched. Used to
2787 check whether to update() or hide() dialog in the new, private
2788 updateOrHide() method that is connected to the updateBufferDependent
2789 signal. Daughter classes dictate what to do using the
2790 ChangedBufferAction enum, passed to the c-tor.
2792 * src/frontends/xforms/FormCitation.C:
2793 * src/frontends/xforms/FormCommand.C:
2794 * src/frontends/xforms/FormCopyright.C:
2795 * src/frontends/xforms/FormDocument.C:
2796 * src/frontends/xforms/FormError.C:
2797 * src/frontends/xforms/FormIndex.C:
2798 * src/frontends/xforms/FormPreferences.C:
2799 * src/frontends/xforms/FormPrint.C:
2800 * src/frontends/xforms/FormRef.C:
2801 * src/frontends/xforms/FormToc.C:
2802 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2805 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2806 ChangedBufferAction enum.
2808 * src/frontends/xforms/FormParagraph.[Ch]
2809 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2812 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2814 * lib/bind/cua.bind: fix a bit.
2815 * lib/bind/emacs.bind: ditto.
2817 * lib/bind/menus.bind: remove real menu entries from there.
2819 * src/spellchecker.C: make sure we only include strings.h when
2822 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2824 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2825 function. It enlarges the maximum number of pup when needed.
2826 (add_toc2): Open a new menu if maximum number of items per menu has
2829 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2831 * src/frontends/kde/FormPrint.C: fix error reporting
2833 * src/frontends/xforms/FormDocument.C: fix compiler
2836 * lib/.cvsignore: add Literate.nw
2838 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2841 * bufferview_funcs.[Ch]
2844 * text2.C: Add support for numbers in RTL text.
2846 2000-10-06 Allan Rae <rae@lyx.org>
2848 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2849 to be gettext.m4 friendly again. ext_l10n.h is now
2850 generated into $top_srcdir instead of $top_builddir
2851 so that lyx.pot will be built correctly -- without
2852 duplicate parsing of ext_l10n.h.
2854 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2856 * src/frontends/kde/FormCitation.C: make the dialog
2857 behave more sensibly
2859 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2861 * config/kde.m4: fix consecutive ./configure runs,
2862 look for qtarch, fix library order
2864 * src/frontends/kde/Makefile.am: tidy up,
2865 add Print dialog, add .dlg dependencies
2867 * src/frontends/kde/FormPrint.C:
2868 * src/frontends/kde/FormPrint.h:
2869 * src/frontends/kde/formprintdialog.C:
2870 * src/frontends/kde/formprintdialog.h:
2871 * src/frontends/kde/formprintdialogdata.C:
2872 * src/frontends/kde/formprintdialogdata.h:
2873 * src/frontends/kde/dlg/formprintdialog.dlg: add
2876 * src/frontends/kde/dlg/README: Added explanatory readme
2878 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2879 script to double-check qtarch's output
2881 * src/frontends/kde/formindexdialog.C:
2882 * src/frontends/kde/formindexdialogdata.C:
2883 * src/frontends/kde/formindexdialogdata.h:
2884 * src/frontends/kde/dlg/formindexdialog.dlg: update
2885 for qtarch, minor fixes
2887 2000-10-05 Allan Rae <rae@lyx.org>
2889 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2890 dialogs when switching buffers update them instead. It's up to each
2891 dialog to decide if it should still be visible or not.
2892 update() should return a bool to control visiblity within show().
2893 Or perhaps better to set a member variable and use that to control
2896 * lib/build-listerrors: create an empty "listerrors" file just to stop
2897 make trying to regenerate it all the time if you don't have noweb
2900 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2902 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2903 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2904 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2905 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2906 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2908 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2910 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2912 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2913 deleting buffer. Closes all buffer-dependent dialogs.
2915 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2917 * src/frontends/xforms/FormCitation.[Ch]:
2918 * src/frontends/xforms/FormPreferences.[Ch]:
2919 * src/frontends/xforms/FormPrint.[Ch]:
2920 * src/frontends/xforms/FormRef.[Ch]:
2921 * src/frontends/xforms/FormUrl.[Ch]: ditto
2923 * src/frontends/xforms/FormDocument.[Ch]:
2924 * src/frontends/xforms/forms/form_document.C.patch:
2925 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2926 pass through a single input() function.
2928 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2930 * lib/build-listerrors: return status as OK
2932 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2934 * lib/lyxrc.example: Updated to new export code
2936 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2938 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2941 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2944 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2945 LyX-Code is defined.
2946 * lib/layouts/amsbook.layout: ditto.
2948 * boost/Makefile.am: fix typo.
2950 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2952 (add_lastfiles): removed.
2953 (add_documents): removed.
2954 (add_formats): removed.
2956 * src/frontends/Menubar.C: remove useless "using" directive.
2958 * src/MenuBackend.h: add a new MenuItem constructor.
2960 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2963 2000-10-04 Allan Rae <rae@lyx.org>
2965 * lib/Makefile.am (listerrors):
2966 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2967 I haven't got notangle installed so Kayvan please test. The output
2968 should end up in $builddir. This also allows people who don't have
2969 noweb installed to complete the make process without error.
2971 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2972 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2973 by JMarc's picky compiler.
2975 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2978 * src/insets/insettabular.C (setPos): change for loop to not use
2979 sequencing operator. Please check this Jürgen.
2981 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2983 * src/insets/insetcite.C (getScreenLabel): ditto
2984 * src/support/filetools.C (QuoteName): ditto
2985 (ChangeExtension): ditto
2987 * src/BufferView_pimpl.C (scrollCB): make heigt int
2989 * src/BufferView2.C (insertInset): comment out unused arg
2991 * boost/Makefile.am (EXTRADIST): new variable
2993 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2995 * src/exporter.C (IsExportable): Fixed
2997 * lib/configure.m4: Small fix
2999 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3001 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3002 * src/insets/insetbib.C (bibitemWidest): ditto.
3003 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3005 2000-10-03 Juergen Vigna <jug@sad.it>
3007 * src/BufferView2.C (theLockingInset): removed const because of
3008 Agnus's compile problems.
3010 * src/insets/insettext.C (LocalDispatch): set the language of the
3011 surronding paragraph on inserting the first character.
3013 * various files: changed use of BufferView::the_locking_inset.
3015 * src/BufferView2.C (theLockingInset):
3016 (theLockingInset): new functions.
3018 * src/BufferView.h: removed the_locking_inset.
3020 * src/lyxtext.h: added the_locking_inset
3022 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3024 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3026 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3028 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3029 * src/mathed/math_cursor.C (IsAlpha): ditto.
3030 * src/mathed/math_inset.C (strnew): ditto.
3031 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3032 (IMetrics): cxp set but never used; removed.
3033 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3034 that the variable in question has been removed also!
3037 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3038 using the Buffer * passed to Latex(), using the BufferView * passed to
3039 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3041 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3042 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3044 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3045 * src/buffer.C (readInset): used new InsetBibtex c-tor
3046 * (getBibkeyList): used new InsetBibtex::getKeys
3048 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3051 * lib/build-listerrors
3053 * src/exporter.C: Add literate programming support to the export code
3056 * src/lyx_cb.C: Remove old literate code.
3058 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3061 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3062 * src/converter.C (View, Convert): Use QuoteName.
3064 * src/insets/figinset.C (Preview): Use Formats::View.
3066 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3068 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3070 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3071 the top of the function, because compaq cxx complains that the
3072 "goto exit_with_message" when the function is disabled bypasses
3074 (MenuNew): try a better fix for the generation of new file names.
3075 This time, I used AddName() instead of AddPath(), hoping Juergen
3078 2000-10-03 Allan Rae <rae@lyx.org>
3080 * src/frontends/xforms/forms/form_preferences.fd:
3081 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3082 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3083 "Look and Feel"->"General" but will need to be split up further into
3084 general output and general input tabs. Current plan is for four outer
3085 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3086 stuff; "Inputs" for input and import configuration; "Outputs" for
3087 output and export configuration; and one more whatever is left over
3088 called "General". The leftovers at present look like being which
3089 viewers to use, spellchecker, language support and might be better
3090 named "Support". I've put "Paths" in "Inputs" for the moment as this
3091 seems reasonable for now at least.
3092 One problem remains: X error kills LyX when you close Preferences.
3094 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3096 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3097 qualifier from form()
3098 * src/frontends/xforms/FormCitation.[Ch]:
3099 * src/frontends/xforms/FormCopyright.[Ch]:
3100 * src/frontends/xforms/FormDocument.[Ch]:
3101 * src/frontends/xforms/FormError.[Ch]:
3102 * src/frontends/xforms/FormIndex.[Ch]:
3103 * src/frontends/xforms/FormPreferences.[Ch]:
3104 * src/frontends/xforms/FormPrint.[Ch]:
3105 * src/frontends/xforms/FormRef.[Ch]:
3106 * src/frontends/xforms/FormToc.[Ch]:
3107 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3109 * src/frontends/xforms/FormCitation.[Ch]:
3110 * src/frontends/xforms/FormIndex.[Ch]:
3111 * src/frontends/xforms/FormRef.[Ch]:
3112 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3113 with Allan's naming policy
3115 * src/frontends/xforms/FormCitation.C: some static casts to remove
3118 2000-10-02 Juergen Vigna <jug@sad.it>
3120 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3121 now you can type or do stuff inside the table-cell also when in dummy
3122 position, fixed visible cursor.
3124 * src/insets/insettext.C (Edit): fixing cursor-view position.
3126 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3127 be used for equal functions in lyxfunc and insettext.
3129 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3131 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3133 * src/frontends/gnome/FormCitation.h:
3134 * src/frontends/gnome/FormCopyright.h:
3135 * src/frontends/gnome/FormIndex.h:
3136 * src/frontends/gnome/FormPrint.h:
3137 * src/frontends/gnome/FormToc.h:
3138 * src/frontends/gnome/FormUrl.h:
3139 * src/frontends/kde/FormCitation.h:
3140 * src/frontends/kde/FormCopyright.h:
3141 * src/frontends/kde/FormIndex.h:
3142 * src/frontends/kde/FormRef.h:
3143 * src/frontends/kde/FormToc.h:
3144 * src/frontends/kde/FormUrl.h: fix remaining users of
3147 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3149 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3150 from depth argument.
3151 (DocBookHandleCaption): ditto.
3152 (DocBookHandleFootnote): ditto.
3153 (SimpleDocBookOnePar): ditto.
3155 * src/frontends/xforms/FormDocument.h (form): remove extra
3156 FormDocument:: qualifier.
3158 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3160 * sigc++/handle.h: ditto.
3162 * src/lyx_gui_misc.C: add "using" directive.
3164 * src/cheaders/cstddef: new file, needed by the boost library (for
3167 2000-10-02 Juergen Vigna <jug@sad.it>
3169 * src/insets/insettext.C (SetFont): better support.
3171 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3173 * src/screen.C (DrawOneRow): some uint refixes!
3175 2000-10-02 Allan Rae <rae@lyx.org>
3177 * boost/.cvsignore: ignore Makefile as well
3179 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3180 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3182 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3183 Left this one out by accident.
3185 * src/frontends/xforms/FormBase.h (restore): default to calling
3186 update() since that will restore the original/currently-applied values.
3187 Any input() triggered error messages will require the derived classes
3188 to redefine restore().
3190 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3191 avoid a segfault. combo_doc_class is the main concern.
3193 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3195 * Simplify build-listerrors in view of GUI-less export ability!
3197 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3199 * src/lyx_main.C (easyParse): Disable gui when exporting
3201 * src/insets/figinset.C:
3204 * src/lyx_gui_misc.C
3205 * src/tabular.C: Changes to allow no-gui.
3207 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3209 * src/support/utility.hpp: removed file
3210 * src/support/block.h: removed file
3212 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3215 * src/mathed/formula.C: add support/lyxlib.h
3216 * src/mathed/formulamacro.C: ditto
3218 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3219 * src/lyxparagraph.h: ditto
3221 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3222 * src/frontends/Makefile.am (INCLUDES): ditto
3223 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3224 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3225 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3226 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3227 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3228 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3230 * src/BufferView.h: use boost/utility.hpp
3231 * src/LColor.h: ditto
3232 * src/LaTeX.h: ditto
3233 * src/LyXAction.h: ditto
3234 * src/LyXView.h: ditto
3235 * src/bufferlist.h: ditto
3236 * src/lastfiles.h: ditto
3237 * src/layout.h: ditto
3238 * src/lyx_gui.h: ditto
3239 * src/lyx_main.h: ditto
3240 * src/lyxlex.h: ditto
3241 * src/lyxrc.h: ditto
3242 * src/frontends/ButtonPolicies.h: ditto
3243 * src/frontends/Dialogs.h: ditto
3244 * src/frontends/xforms/FormBase.h: ditto
3245 * src/frontends/xforms/FormGraphics.h: ditto
3246 * src/frontends/xforms/FormParagraph.h: ditto
3247 * src/frontends/xforms/FormTabular.h: ditto
3248 * src/graphics/GraphicsCache.h: ditto
3249 * src/graphics/Renderer.h: ditto
3250 * src/insets/ExternalTemplate.h: ditto
3251 * src/insets/insetcommand.h: ditto
3252 * src/support/path.h: ditto
3254 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3255 and introduce clause for 2.97.
3257 * boost/libs/README: new file
3259 * boost/boost/utility.hpp: new file
3261 * boost/boost/config.hpp: new file
3263 * boost/boost/array.hpp: new file
3265 * boost/Makefile.am: new file
3267 * boost/.cvsignore: new file
3269 * configure.in (AC_OUTPUT): add boost/Makefile
3271 * Makefile.am (SUBDIRS): add boost
3273 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3275 * src/support/lstrings.C (suffixIs): Fixed.
3277 2000-10-01 Allan Rae <rae@lyx.org>
3279 * src/PrinterParams.h: moved things around to avoid the "can't
3280 inline call" warning.
3282 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3283 into doc++ documentation.
3285 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3287 * src/frontends/xforms/FormRef.C: make use of button controller
3288 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3289 cleaned up button controller usage.
3290 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3291 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3292 use the button controller
3294 * src/frontends/xforms/forms/*.fd: and associated generated files
3295 updated to reflect changes to FormBase. Some other FormXxxx files
3296 also got minor updates to reflect changes to FormBase.
3298 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3299 (hide): made virtual.
3300 (input): return a bool. true == valid input
3301 (RestoreCB, restore): new
3302 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3303 Changes to allow derived dialogs to use a ButtonController and
3304 make sense when doing so: OK button calls ok() and so on.
3306 * src/frontends/xforms/ButtonController.h (class ButtonController):
3307 Switch from template implementation to taking Policy parameter.
3308 Allows FormBase to provide a ButtonController for any dialog.
3310 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3311 Probably should rename connect and disconnect.
3312 (apply): use the radio button groups
3313 (form): needed by FormBase
3314 (build): setup the radio button groups
3316 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3318 * several files: type changes to reduce the number of warnings and
3319 to unify type hangling a bit. Still much to do.
3321 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3323 * lib/images/*: rename a bunch of icons to match Dekel converter
3326 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3329 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3331 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3333 * sigc++/handle.h: ditto for class Handle.
3335 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3337 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3339 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3341 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3342 removal of the "default" language.
3344 * src/combox.h (getline): Check that sel > 0
3346 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3348 * lib/examples/docbook_example.lyx
3349 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3351 * lib/layouts/docbook-book.layout: new docbook book layout.
3353 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3355 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3357 * src/insets/figinset.C (DocBook):fixed small typo.
3359 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3361 * src/insets/insetinclude.h: string include_label doesn't need to be
3364 2000-09-29 Allan Rae <rae@lyx.org>
3366 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3367 Allow derived type to control connection and disconnection from signals
3368 of its choice if desired.
3370 2000-09-28 Juergen Vigna <jug@sad.it>
3372 * src/insets/insettabular.C (update): fixed cursor setting when
3373 the_locking_inset changed.
3374 (draw): made this a bit cleaner.
3375 (InsetButtonPress): fixed!
3377 * various files: added LyXText Parameter to fitCursor call.
3379 * src/BufferView.C (fitCursor): added LyXText parameter.
3381 * src/insets/insettabular.C (draw): small draw fix.
3383 * src/tabular.C: right setting of left/right celllines.
3385 * src/tabular.[Ch]: fixed various types in funcions and structures.
3386 * src/insets/insettabular.C: ditto
3387 * src/frontends/xforms/FormTabular.C: ditto
3389 2000-09-28 Allan Rae <rae@lyx.org>
3391 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3392 that the #ifdef's had been applied to part of what should have been
3393 a complete condition. It's possible there are other tests that
3394 were specific to tables that are also wrong now that InsetTabular is
3395 being used. Now we need to fix the output of '\n' after a table in a
3396 float for the same reason as the original condition:
3397 "don't insert this if we would be adding it before or after a table
3398 in a float. This little trick is needed in order to allow use of
3399 tables in \subfigures or \subtables."
3400 Juergen can you check this?
3402 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3404 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3405 output to the ostream.
3407 * several files: fixed types based on warnings from cxx
3409 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3411 * src/frontends/kde/Makefile.am: fix rule for
3412 formindexdialogdata_moc.C
3414 * src/.cvsignore: add ext_l10n.h to ignore
3416 * acconfig.h: stop messing with __STRICT_ANSI__
3417 * config/gnome.m4: remove option to set -ansi
3418 * config/kde.m4: remove option to set -ansi
3419 * config/lyxinclude.m4: don't set -ansi
3421 2000-09-27 Juergen Vigna <jug@sad.it>
3423 * various files: remove "default" language check.
3425 * src/insets/insetquotes.C: removed use of current_view.
3427 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3428 the one should have red ears by now!
3430 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3431 in more then one paragraph. Fixed cursor-movement/selection.
3433 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3434 paragraphs inside a text inset.
3436 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3437 text-inset if this owner is an inset.
3439 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3441 * src/Bullet.h: changed type of font, character and size to int
3443 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3445 * src/insets/inseturl.[Ch]:
3446 * src/insets/insetref.[Ch]:
3447 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3449 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3451 * src/buffer.C (readFile): block-if statement rearranged to minimise
3452 bloat. Patch does not reverse Jean-Marc's change ;-)
3454 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3455 Class rewritten to store pointers to hide/update signals directly,
3456 rather than Dialogs *. Also defined an enum to ease use. All xforms
3457 forms can now be derived from this class.
3459 * src/frontends/xforms/FormCommand.[Ch]
3460 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3462 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3465 * src/frontends/xforms/forms/form_citation.fd
3466 * src/frontends/xforms/forms/form_copyright.fd
3467 * src/frontends/xforms/forms/form_error.fd
3468 * src/frontends/xforms/forms/form_index.fd
3469 * src/frontends/xforms/forms/form_ref.fd
3470 * src/frontends/xforms/forms/form_toc.fd
3471 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3473 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3475 * src/insets/insetfoot.C: removed redundent using directive.
3477 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3479 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3480 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3482 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3483 created in the constructors in different groups. Then set() just
3484 have to show the groups as needed. This fixes the redraw problems
3485 (and is how the old menu code worked).
3487 * src/support/lyxlib.h: declare the methods as static when we do
3488 not have namespaces.
3490 2000-09-26 Juergen Vigna <jug@sad.it>
3492 * src/buffer.C (asciiParagraph): new function.
3493 (writeFileAscii): new function with parameter ostream.
3494 (writeFileAscii): use now asciiParagraph.
3496 * various inset files: added the linelen parameter to the Ascii-func.
3498 * src/tabular.C (Write): fixed error in writing file introduced by
3499 the last changes from Lars.
3501 * lib/bind/menus.bind: removed not supported functions.
3503 * src/insets/insettext.C (Ascii): implemented this function.
3505 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3507 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3508 (Write): use of the write_attribute functions.
3510 * src/bufferlist.C (close): fixed reasking question!
3512 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3514 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3515 new files use the everwhere possible.
3518 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3519 src/log_form.C src/lyx.C:
3522 * src/buffer.C (runLaTeX): remove func
3524 * src/PaperLayout.C: removed file
3525 * src/ParagraphExtra.C: likewise
3526 * src/bullet_forms.C: likewise
3527 * src/bullet_forms.h: likewise
3528 * src/bullet_forms_cb.C: likewise
3530 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3531 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3534 * several files: remove all traces of the old fd_form_paragraph,
3535 and functions belonging to that.
3537 * several files: remove all traces of the old fd_form_document,
3538 and functions belonging to that.
3540 * several files: constify local variables were possible.
3542 * several files: remove all code that was dead when NEW_EXPORT was
3545 * several files: removed string::c_str in as many places as
3548 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3549 (e): be a bit more outspoken when patching
3550 (updatesrc): only move files if changed.
3552 * forms/layout_forms.h.patch: regenerated
3554 * forms/layout_forms.fd: remove form_document and form_paragraph
3555 and form_quotes and form_paper and form_table_options and
3556 form_paragraph_extra
3558 * forms/form1.fd: remove form_table
3560 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3561 the fdui->... rewrite. Update some comments to xforms 0.88
3563 * forms/bullet_forms.C.patch: removed file
3564 * forms/bullet_forms.fd: likewise
3565 * forms/bullet_forms.h.patch: likewise
3567 * development/Code_rules/Rules: added a section on switch
3568 statements. Updated some comment to xforms 0.88.
3570 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3572 * src/buffer.C (readFile): make sure that the whole version number
3573 is read after \lyxformat (even when it contains a comma)
3575 * lib/ui/default.ui: change shortcut of math menu to M-a.
3577 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3579 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3582 * src/LyXView.C (updateWindowTitle): show the full files name in
3583 window title, limited to 30 characters.
3585 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3586 When a number of characters has been given, we should not assume
3587 that the string is 0-terminated.
3589 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3590 calls (fixes some memory leaks)
3592 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3593 trans member on exit.
3595 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3597 * src/converter.C (GetReachable): fix typo.
3599 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3600 understand ',' instead of '.'.
3601 (GetInteger): rewrite to use strToInt().
3603 2000-09-26 Juergen Vigna <jug@sad.it>
3605 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3606 better visibility and error-message on wrong VSpace input.
3608 * src/language.C (initL): added english again.
3610 2000-09-25 Juergen Vigna <jug@sad.it>
3612 * src/frontends/kde/Dialogs.C (Dialogs):
3613 * src/frontends/gnome/Dialogs.C (Dialogs):
3614 * src/frontends/kde/Makefile.am:
3615 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3617 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3619 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3621 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3623 * src/frontends/xforms/FormParagraph.C:
3624 * src/frontends/xforms/FormParagraph.h:
3625 * src/frontends/xforms/form_paragraph.C:
3626 * src/frontends/xforms/form_paragraph.h:
3627 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3630 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3632 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3633 Paragraph-Data after use.
3635 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3636 non breakable paragraphs.
3638 2000-09-25 Garst R. Reese <reese@isn.net>
3640 * src/language.C (initL): added missing language_country codes.
3642 2000-09-25 Juergen Vigna <jug@sad.it>
3644 * src/insets/insettext.C (InsetText):
3645 (deleteLyXText): remove the not released LyXText structure!
3647 2000-09-24 Marko Vendelin <markov@ioc.ee>
3649 * src/frontends/gnome/mainapp.C
3650 * src/frontends/gnome/mainapp.h: added support for keyboard
3653 * src/frontends/gnome/FormCitation.C
3654 * src/frontends/gnome/FormCitation.h
3655 * src/frontends/gnome/Makefile.am
3656 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3657 FormCitation to use "action area" in mainapp window
3659 * src/frontends/gnome/Menubar_pimpl.C
3660 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3663 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3665 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3666 width/descent/ascent values if name is empty.
3667 (mathed_string_height): Use std::max.
3669 2000-09-25 Allan Rae <rae@lyx.org>
3671 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3672 segfault. This will be completely redesigned soon.
3674 * sigc++: updated libsigc++. Fixes struct timespec bug.
3676 * development/tools/makeLyXsigc.sh: .cvsignore addition
3678 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3680 * several files: removed almost all traces of the old table
3683 * src/TableLayout.C: removed file
3685 2000-09-22 Juergen Vigna <jug@sad.it>
3687 * src/frontends/kde/Dialogs.C: added credits forms.
3689 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3691 * src/frontends/gnome/Dialogs.C: added some forms.
3693 * src/spellchecker.C (init_spell_checker): set language in pspell code
3694 (RunSpellChecker): some modifications for setting language string.
3696 * src/language.[Ch]: added language_country code.
3698 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3700 * src/frontends/Dialogs.h: added new signal showError.
3701 Rearranged existing signals in some sort of alphabetical order.
3703 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3704 FormError.[Ch], form_error.[Ch]
3705 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3706 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3708 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3709 dialogs. I think that this can be used as the base to all these
3712 * src/frontends/xforms/FormError.[Ch]
3713 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3714 implementation of InsetError dialog.
3716 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3718 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3719 * src/frontends/kde/Makefile.am: ditto
3721 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3723 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3724 macrobf. This fixes a bug of invisible text.
3726 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3728 * lib/doc/LaTeXConfig.lyx.in: updated.
3730 * src/language.C (initL): remove language "francais" and change a
3731 bit the names of the two other french variations.
3733 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3734 string that may not be 0-terminated.
3736 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3738 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3740 2000-09-20 Marko Vendelin <markov@ioc.ee>
3742 * src/frontends/gnome/FormCitation.C
3743 * src/frontends/gnome/FormIndex.C
3744 * src/frontends/gnome/FormToc.C
3745 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3746 the variable initialization to shut up the warnings
3748 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3750 * src/table.[Ch]: deleted files
3752 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3755 2000-09-18 Juergen Vigna <jug@sad.it>
3757 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3758 problems with selection. Inserted new LFUN_PASTESELECTION.
3759 (InsetButtonPress): inserted handling of middle mouse-button paste.
3761 * src/spellchecker.C: changed word to word.c_str().
3763 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3765 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3766 included in the ``make dist'' tarball.
3768 2000-09-15 Juergen Vigna <jug@sad.it>
3770 * src/CutAndPaste.C (cutSelection): small fix return the right
3771 end position after cut inside one paragraph only.
3773 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3774 we are locked as otherwise we don't have a valid cursor position!
3776 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3778 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3780 * src/frontends/kde/FormRef.C: added using directive.
3781 * src/frontends/kde/FormToc.C: ditto
3783 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3785 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3787 2000-09-19 Marko Vendelin <markov@ioc.ee>
3789 * src/frontends/gnome/Menubar_pimpl.C
3790 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3791 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3793 * src/frontends/gnome/mainapp.C
3794 * src/frontends/gnome/mainapp.h: support for menu update used
3797 * src/frontends/gnome/mainapp.C
3798 * src/frontends/gnome/mainapp.h: support for "action" area in the
3799 main window. This area is used by small simple dialogs, such as
3802 * src/frontends/gnome/FormIndex.C
3803 * src/frontends/gnome/FormIndex.h
3804 * src/frontends/gnome/FormUrl.C
3805 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3808 * src/frontends/gnome/FormCitation.C
3809 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3810 action area. Only "Insert new citation" is implemented.
3812 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3814 * src/buffer.C (Dispatch): fix call to Dispatch
3815 * src/insets/insetref.C (Edit): likewise
3816 * src/insets/insetparent.C (Edit): likewise
3817 * src/insets/insetinclude.C (include_cb): likewise
3818 * src/frontends/xforms/FormUrl.C (apply): likewise
3819 * src/frontends/xforms/FormToc.C (apply): likewise
3820 * src/frontends/xforms/FormRef.C (apply): likewise
3821 * src/frontends/xforms/FormIndex.C (apply): likewise
3822 * src/frontends/xforms/FormCitation.C (apply): likewise
3823 * src/lyxserver.C (callback): likewise
3824 * src/lyxfunc.C (processKeySym): likewise
3825 (Dispatch): likewise
3826 (Dispatch): likewise
3827 * src/lyx_cb.C (LayoutsCB): likewise
3829 * Makefile.am (sourcedoc): small change
3831 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3833 * src/main.C (main): Don't make an empty GUIRunTime object. all
3834 methods are static. constify a bit remove unneded using + headers.
3836 * src/tabular.C: some more const to local vars move some loop vars
3838 * src/spellchecker.C: added some c_str after some word for pspell
3840 * src/frontends/GUIRunTime.h: add new static method setDefaults
3841 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3842 * src/frontends/kde/GUIRunTime.C (setDefaults):
3843 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3845 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3846 with strnew in arg, use correct emptystring when calling SetName.
3848 * several files: remove all commented code with relation to
3849 HAVE_SSTREAM beeing false. We now only support stringstream and
3852 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3854 * src/lyxfunc.C: construct correctly the automatic new file
3857 * src/text2.C (IsStringInText): change type of variable i to shut
3860 * src/support/sstream.h: do not use namespaces if the compiler
3861 does not support them.
3863 2000-09-15 Marko Vendelin <markov@ioc.ee>
3864 * src/frontends/gnome/FormCitation.C
3865 * src/frontends/gnome/FormCitation.h
3866 * src/frontends/gnome/diainsertcitation_interface.c
3867 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3868 regexp support to FormCitation [Gnome].
3870 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3873 * configure.in: remove unused KDE/GTKGUI define
3875 * src/frontends/kde/FormRef.C
3876 * src/frontends/kde/FormRef.h
3877 * src/frontends/kde/formrefdialog.C
3878 * src/frontends/kde/formrefdialog.h: double click will
3879 go to reference, now it is possible to change a cross-ref
3882 * src/frontends/kde/FormToc.C
3883 * src/frontends/kde/FormToc.h
3884 * src/frontends/kde/formtocdialog.C
3885 * src/frontends/kde/formtocdialog.h: add a depth
3888 * src/frontends/kde/Makefile.am: add QtLyXView.h
3891 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3893 * src/frontends/kde/FormCitation.h: added some using directives.
3895 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3897 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3900 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3903 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3905 * src/buffer.C (pop_tag): revert for the second time a change by
3906 Lars, who seems to really hate having non-local loop variables :)
3908 * src/Lsstream.h: add "using" statements.
3910 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3911 * src/buffer.C (writeFile): ditto
3913 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3915 * src/buffer.C (writeFile): try to fix the locale modified format
3916 number to always be as we want it.
3918 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3919 in XForms 0.89. C-space is now working again.
3921 * src/Lsstream.h src/support/sstream.h: new files.
3923 * also commented out all cases where strstream were used.
3925 * src/Bullet.h (c_str): remove method.
3927 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3929 * a lot of files: get rid of "char const *" and "char *" is as
3930 many places as possible. We only want to use them in interaction
3931 with system of other libraries, not inside lyx.
3933 * a lot of files: return const object is not of pod type. This
3934 helps ensure that temporary objects is not modified. And fits well
3935 with "programming by contract".
3937 * configure.in: check for the locale header too
3939 * Makefile.am (sourcedoc): new tag for generation of doc++
3942 2000-09-14 Juergen Vigna <jug@sad.it>
3944 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3945 callback to check which combo called it and do the right action.
3947 * src/combox.C (combo_cb): added combo * to the callbacks.
3948 (Hide): moved call of callback after Ungrab of the pointer.
3950 * src/intl.h: removed LCombo2 function.
3952 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3953 function as this can now be handled in one function.
3955 * src/combox.h: added Combox * to callback prototype.
3957 * src/frontends/xforms/Toolbar_pimpl.C:
3958 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3960 2000-09-14 Garst Reese <reese@isn.net>
3962 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3963 moved usepackage{xxx}'s to beginning of file. Changed left margin
3964 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3965 underlining from title. Thanks to John Culleton for useful suggestions.
3967 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3969 * src/lyxlex_pimpl.C (setFile): change error message to debug
3972 2000-09-13 Juergen Vigna <jug@sad.it>
3974 * src/frontends/xforms/FormDocument.C: implemented choice_class
3975 as combox and give callback to combo_language so OK/Apply is activated
3978 * src/bufferlist.C (newFile): small fix so already named files
3979 (via an open call) are not requested to be named again on the
3982 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3984 * src/frontends/kde/Makefile.am
3985 * src/frontends/kde/FormRef.C
3986 * src/frontends/kde/FormRef.h
3987 * src/frontends/kde/formrefdialog.C
3988 * src/frontends/kde/formrefdialog.h: implement
3991 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3993 * src/frontends/kde/formtocdialog.C
3994 * src/frontends/kde/formtocdialog.h
3995 * src/frontends/kde/FormToc.C
3996 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3998 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4000 * src/frontends/kde/FormCitation.C: fix thinko
4001 where we didn't always display the reference text
4004 * src/frontends/kde/formurldialog.C
4005 * src/frontends/kde/formurldialog.h
4006 * src/frontends/kde/FormUrl.C
4007 * src/frontends/kde/FormUrl.h: minor cleanups
4009 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4011 * src/frontends/kde/Makefile.am
4012 * src/frontends/kde/FormToc.C
4013 * src/frontends/kde/FormToc.h
4014 * src/frontends/kde/FormCitation.C
4015 * src/frontends/kde/FormCitation.h
4016 * src/frontends/kde/FormIndex.C
4017 * src/frontends/kde/FormIndex.h
4018 * src/frontends/kde/formtocdialog.C
4019 * src/frontends/kde/formtocdialog.h
4020 * src/frontends/kde/formcitationdialog.C
4021 * src/frontends/kde/formcitationdialog.h
4022 * src/frontends/kde/formindexdialog.C
4023 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4025 2000-09-12 Juergen Vigna <jug@sad.it>
4027 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4030 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4032 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4035 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4037 * src/converter.C (Add, Convert): Added support for converter flags:
4038 needaux, resultdir, resultfile.
4039 (Convert): Added new parameter view_file.
4040 (dvips_options): Fixed letter paper option.
4042 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4043 (Export, GetExportableFormats, GetViewableFormats): Added support
4046 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4048 (easyParse): Fixed to work with new export code.
4050 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4053 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4055 * lib/bind/*.bind: Replaced
4056 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4057 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4059 2000-09-11 Juergen Vigna <jug@sad.it>
4061 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4063 * src/main.C (main): now GUII defines global guiruntime!
4065 * src/frontends/gnome/GUIRunTime.C (initApplication):
4066 * src/frontends/kde/GUIRunTime.C (initApplication):
4067 * src/frontends/xforms/GUIRunTime.C (initApplication):
4068 * src/frontends/GUIRunTime.h: added new function initApplication.
4070 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4072 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4074 2000-09-08 Juergen Vigna <jug@sad.it>
4076 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4077 we have already "Reset".
4079 * src/language.C (initL): inserted "default" language and made this
4080 THE default language (and not american!)
4082 * src/paragraph.C: inserted handling of "default" language!
4084 * src/lyxfont.C: ditto
4088 * src/paragraph.C: output the \\par only if we have a following
4089 paragraph otherwise it's not needed.
4091 2000-09-05 Juergen Vigna <jug@sad.it>
4093 * config/pspell.m4: added entry to lyx-flags
4095 * src/spellchecker.C: modified version from Kevin for using pspell
4097 2000-09-01 Marko Vendelin <markov@ioc.ee>
4098 * src/frontends/gnome/Makefile.am
4099 * src/frontends/gnome/FormCitation.C
4100 * src/frontends/gnome/FormCitation.h
4101 * src/frontends/gnome/diainsertcitation_callbacks.c
4102 * src/frontends/gnome/diainsertcitation_callbacks.h
4103 * src/frontends/gnome/diainsertcitation_interface.c
4104 * src/frontends/gnome/diainsertcitation_interface.h
4105 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4106 dialog for Gnome frontend
4108 * src/main.C: Gnome libraries require keeping application name
4109 and its version as strings
4111 * src/frontends/gnome/mainapp.C: Change the name of the main window
4112 from GnomeLyX to PACKAGE
4114 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4116 * src/frontends/Liason.C: add "using: declaration.
4118 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4120 * src/mathed/math_macro.C (Metrics): Set the size of the template
4122 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4124 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4126 * src/converter.C (add_options): New function.
4127 (SetViewer): Change $$FName into '$$FName'.
4128 (View): Add options when running xdvi
4129 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4130 (Convert): The 3rd parameter is now the desired filename. Converts
4131 calls to lyx::rename if necessary.
4132 Add options when running dvips.
4133 (dvi_papersize,dvips_options): New methods.
4135 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4137 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4138 using a call to Converter::dvips_options.
4139 Fixed to work with nex export code.
4141 * src/support/copy.C
4142 * src/support/rename.C: New files
4144 * src/support/syscall.h
4145 * src/support/syscall.C: Added Starttype SystemDontWait.
4147 * lib/ui/default.ui: Changed to work with new export code
4149 * lib/configure.m4: Changed to work with new export code
4151 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4153 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4155 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4156 so that code compiles with DEC cxx.
4158 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4159 to work correctly! Also now supports the additional elements
4162 2000-09-01 Allan Rae <rae@lyx.org>
4164 * src/frontends/ButtonPolicies.C: renamed all the references to
4165 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4167 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4168 since it's a const not a type.
4170 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4172 2000-08-31 Juergen Vigna <jug@sad.it>
4174 * src/insets/figinset.C: Various changes to look if the filename has
4175 an extension and if not add it for inline previewing.
4177 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4179 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4180 make buttonStatus and isReadOnly be const methods. (also reflect
4181 this in derived classes.)
4183 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4184 (nextState): change to be static inline, pass the StateMachine as
4186 (PreferencesPolicy): remove casts
4187 (OkCancelPolicy): remvoe casts
4188 (OkCancelReadOnlyPolicy): remove casts
4189 (NoRepeatedApplyReadOnlyPolicy): remove casts
4190 (OkApplyCancelReadOnlyPolicy): remove casts
4191 (OkApplyCancelPolicy): remove casts
4192 (NoRepeatedApplyPolicy): remove casts
4194 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4196 * src/converter.C: added some using directives
4198 * src/frontends/ButtonPolicies.C: changes to overcome
4199 "need lvalue" error with DEC c++
4201 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4202 to WMHideCB for DEC c++
4204 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4206 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4207 to BulletBMTableCB for DEC c++
4209 2000-08-31 Allan Rae <rae@lyx.org>
4211 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4212 character dialog separately from old document dialogs combo_language.
4215 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4217 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4218 Removed LFUN_REF_CREATE.
4220 * src/MenuBackend.C: Added new tags: toc and references
4222 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4223 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4225 (add_toc, add_references): New methods.
4226 (create_submenu): Handle correctly the case when there is a
4227 seperator after optional menu items.
4229 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4230 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4231 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4233 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4235 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4237 * src/converter.[Ch]: New file for converting between different
4240 * src/export.[Ch]: New file for exporting a LyX file to different
4243 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4244 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4245 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4246 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4247 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4248 RunDocBook, MenuExport.
4250 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4251 Exporter::Preview methods if NEW_EXPORT is defined.
4253 * src/buffer.C (Dispatch): Use Exporter::Export.
4255 * src/lyxrc.C: Added new tags: \converter and \viewer.
4258 * src/LyXAction.C: Define new lyx-function: buffer-update.
4259 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4260 when NEW_EXPORT is defined.
4262 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4264 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4266 * lib/ui/default.ui: Added submenus "view" and "update" to the
4269 * src/filetools.C (GetExtension): New function.
4271 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4273 2000-08-29 Allan Rae <rae@lyx.org>
4275 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4277 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4278 (EnableDocumentLayout): removed
4279 (DisableDocumentLayout): removed
4280 (build): make use of ButtonController's read-only handling to
4281 de/activate various objects. Replaces both of the above functions.
4283 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4284 (readOnly): was read_only
4285 (refresh): fixed dumb mistakes with read_only_ handling
4287 * src/frontends/xforms/forms/form_document.fd:
4288 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4289 tabbed dialogs so the tabs look more like tabs and so its easier to
4290 work out which is the current tab.
4292 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4293 segfault with form_table
4295 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4297 2000-08-28 Juergen Vigna <jug@sad.it>
4299 * acconfig.h: added USE_PSPELL.
4301 * src/config.h.in: added USE_PSPELL.
4303 * autogen.sh: added pspell.m4
4305 * config/pspell.m4: new file.
4307 * src/spellchecker.C: implemented support for pspell libary.
4309 2000-08-25 Juergen Vigna <jug@sad.it>
4311 * src/LyXAction.C (init): renamed LFUN_TABLE to
4312 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4314 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4316 * src/lyxscreen.h: add force_clear variable and fuction to force
4317 a clear area when redrawing in LyXText.
4319 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4321 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4323 * some whitespace and comment changes.
4325 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4327 * src/buffer.C: up te LYX_FORMAT to 2.17
4329 2000-08-23 Juergen Vigna <jug@sad.it>
4331 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4334 * src/insets/insettabular.C (pasteSelection): delete the insets
4335 LyXText as it is not valid anymore.
4336 (copySelection): new function.
4337 (pasteSelection): new function.
4338 (cutSelection): new function.
4339 (LocalDispatch): implemented cut/copy/paste of cell selections.
4341 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4342 don't have a LyXText.
4344 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4346 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4349 2000-08-22 Juergen Vigna <jug@sad.it>
4351 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4352 ifdef form_table out if NEW_TABULAR.
4354 2000-08-21 Juergen Vigna <jug@sad.it>
4356 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4357 (draw): fixed draw position so that the cursor is positioned in the
4359 (InsetMotionNotify): hide/show cursor so the position is updated.
4360 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4361 using cellstart() function where it should be used.
4363 * src/insets/insettext.C (draw): ditto.
4365 * src/tabular.C: fixed initialization of some missing variables and
4366 made BoxType into an enum.
4368 2000-08-22 Marko Vendelin <markov@ioc.ee>
4369 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4370 stock menu item using action numerical value, not its string
4374 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4376 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4377 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4379 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4381 * src/frontends/xforms/GUIRunTime.C: new file
4383 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4384 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4386 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4388 * src/frontends/kde/GUIRunTime.C: new file
4390 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4391 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4393 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4395 * src/frontends/gnome/GUIRunTime.C: new file
4397 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4400 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4401 small change to documetentation.
4403 * src/frontends/GUIRunTime.C: removed file
4405 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4407 * src/lyxparagraph.h: enable NEW_TABULAR as default
4409 * src/lyxfunc.C (processKeySym): remove some commented code
4411 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4412 NEW_TABULAR around the fd_form_table_options.
4414 * src/lyx_gui.C (runTime): call the static member function as
4415 GUIRunTime::runTime().
4417 2000-08-21 Allan Rae <rae@lyx.org>
4419 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4422 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4424 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4426 2000-08-21 Allan Rae <rae@lyx.org>
4428 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4429 keep Garst happy ;-)
4430 * src/frontends/xforms/FormPreferences.C (build): use setOK
4431 * src/frontends/xforms/FormDocument.C (build): use setOK
4432 (FormDocument): use the appropriate policy.
4434 2000-08-21 Allan Rae <rae@lyx.org>
4436 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4437 automatic [de]activation of arbitrary objects when in a read-only state.
4439 * src/frontends/ButtonPolicies.h: More documentation
4440 (isReadOnly): added to support the above.
4442 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4444 2000-08-18 Juergen Vigna <jug@sad.it>
4446 * src/insets/insettabular.C (getStatus): changed to return func_status.
4448 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4449 display toggle menu entries if they are.
4451 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4452 new document layout now.
4454 * src/lyxfunc.C: ditto
4456 * src/lyx_gui_misc.C: ditto
4458 * src/lyx_gui.C: ditto
4460 * lib/ui/default.ui: removed paper and quotes layout as they are now
4461 all in the document layout tabbed folder.
4463 * src/frontends/xforms/forms/form_document.fd: added Restore
4464 button and callbacks for all inputs for Allan's ButtonPolicy.
4466 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4467 (CheckChoiceClass): added missing params setting on class change.
4468 (UpdateLayoutDocument): added for updating the layout on params.
4469 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4470 (FormDocument): Implemented Allan's ButtonPolicy with the
4473 2000-08-17 Allan Rae <rae@lyx.org>
4475 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4476 so we can at least see the credits again.
4478 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4479 controller calls for the appropriate callbacks. Note that since Ok
4480 calls apply followed by cancel, and apply isn't a valid input for the
4481 APPLIED state, the bc_ calls have to be made in the static callback not
4482 within each of the real callbacks.
4484 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4485 (setOk): renamed from setOkay()
4487 2000-08-17 Juergen Vigna <jug@sad.it>
4489 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4490 in the implementation part.
4491 (composeUIInfo): don't show optional menu-items.
4493 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4495 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4497 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4498 text-state when in a text-inset.
4500 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4502 2000-08-17 Marko Vendelin <markov@ioc.ee>
4503 * src/frontends/gnome/FormIndex.C
4504 * src/frontends/gnome/FormIndex.h
4505 * src/frontends/gnome/FormToc.C
4506 * src/frontends/gnome/FormToc.h
4507 * src/frontends/gnome/dialogs
4508 * src/frontends/gnome/diatoc_callbacks.c
4509 * src/frontends/gnome/diatoc_callbacks.h
4510 * src/frontends/gnome/diainsertindex_callbacks.h
4511 * src/frontends/gnome/diainsertindex_callbacks.c
4512 * src/frontends/gnome/diainsertindex_interface.c
4513 * src/frontends/gnome/diainsertindex_interface.h
4514 * src/frontends/gnome/diatoc_interface.h
4515 * src/frontends/gnome/diatoc_interface.c
4516 * src/frontends/gnome/Makefile.am: Table of Contents and
4517 Insert Index dialogs implementation for Gnome frontend
4519 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4521 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4523 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4526 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4528 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4529 destructor. Don't definde if you don't need it
4530 (processEvents): made static, non-blocking events processing for
4532 (runTime): static method. event loop for xforms
4533 * similar as above for kde and gnome.
4535 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4536 new Pimpl is correct
4537 (runTime): new method calss the real frontends runtime func.
4539 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4541 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4543 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4545 2000-08-16 Juergen Vigna <jug@sad.it>
4547 * src/lyx_gui.C (runTime): added GUII RunTime support.
4549 * src/frontends/Makefile.am:
4550 * src/frontends/GUIRunTime.[Ch]:
4551 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4552 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4553 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4555 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4557 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4558 as this is already set in ${FRONTEND_INCLUDE} if needed.
4560 * configure.in (CPPFLAGS): setting the include dir for the frontend
4561 directory and don't set FRONTEND=xforms for now as this is executed
4564 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4566 * src/frontends/kde/Makefile.am:
4567 * src/frontends/kde/FormUrl.C:
4568 * src/frontends/kde/FormUrl.h:
4569 * src/frontends/kde/formurldialog.h:
4570 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4572 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4574 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4576 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4578 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4581 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4583 * src/WorkArea.C (work_area_handler): more work to get te
4584 FL_KEYBOARD to work with xforms 0.88 too, please test.
4586 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4588 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4590 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4593 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4595 * src/Timeout.h: remove Qt::emit hack.
4597 * several files: changes to allo doc++ compilation
4599 * src/lyxfunc.C (processKeySym): new method
4600 (processKeyEvent): comment out if FL_REVISION < 89
4602 * src/WorkArea.C: change some debugging levels.
4603 (WorkArea): set wantkey to FL_KEY_ALL
4604 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4605 clearer code and the use of compose with XForms 0.89. Change to
4606 use signals instead of calling methods in bufferview directly.
4608 * src/Painter.C: change some debugging levels.
4610 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4613 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4614 (workAreaKeyPress): new method
4616 2000-08-14 Juergen Vigna <jug@sad.it>
4618 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4620 * config/kde.m4: addes some features
4622 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4623 include missing xforms dialogs.
4625 * src/Timeout.h: a hack to be able to compile with qt/kde.
4627 * sigc++/.cvsignore: added acinclude.m4
4629 * lib/.cvsignore: added listerros
4631 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4632 xforms tree as objects are needed for other frontends.
4634 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4635 linking with not yet implemented xforms objects.
4637 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4639 2000-08-14 Baruch Even <baruch.even@writeme.com>
4641 * src/frontends/xforms/FormGraphics.h:
4642 * src/frontends/xforms/FormGraphics.C:
4643 * src/frontends/xforms/RadioButtonGroup.h:
4644 * src/frontends/xforms/RadioButtonGroup.C:
4645 * src/insets/insetgraphics.h:
4646 * src/insets/insetgraphics.C:
4647 * src/insets/insetgraphicsParams.h:
4648 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4649 instead of spaces, and various other indentation issues to make the
4650 sources more consistent.
4652 2000-08-14 Marko Vendelin <markov@ioc.ee>
4654 * src/frontends/gnome/dialogs/diaprint.glade
4655 * src/frontends/gnome/FormPrint.C
4656 * src/frontends/gnome/FormPrint.h
4657 * src/frontends/gnome/diaprint_callbacks.c
4658 * src/frontends/gnome/diaprint_callbacks.h
4659 * src/frontends/gnome/diaprint_interface.c
4660 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4663 * src/frontends/gnome/dialogs/diainserturl.glade
4664 * src/frontends/gnome/FormUrl.C
4665 * src/frontends/gnome/FormUrl.h
4666 * src/frontends/gnome/diainserturl_callbacks.c
4667 * src/frontends/gnome/diainserturl_callbacks.h
4668 * src/frontends/gnome/diainserturl_interface.c
4669 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4670 Gnome implementation
4672 * src/frontends/gnome/Dialogs.C
4673 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4674 all other dialogs. Copy all unimplemented dialogs from Xforms
4677 * src/frontends/gnome/support.c
4678 * src/frontends/gnome/support.h: support files generated by Glade
4682 * config/gnome.m4: Gnome configuration scripts
4684 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4685 configure --help message
4687 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4688 only if there are no events pendling in Gnome/Gtk. This enhances
4689 the performance of menus.
4692 2000-08-14 Allan Rae <rae@lyx.org>
4694 * lib/Makefile.am: listerrors cleaning
4696 * lib/listerrors: removed -- generated file
4697 * acinclude.m4: ditto
4698 * sigc++/acinclude.m4: ditto
4700 * src/frontends/xforms/forms/form_citation.fd:
4701 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4704 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4705 `updatesrc` and now we have a `test` target that does what `updatesrc`
4706 used to do. I didn't like having an install target that wasn't related
4709 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4710 on all except FormGraphics. This may yet happen. Followed by a major
4711 cleanup including using FL_TRANSIENT for most of the dialogs. More
4712 changes to come when the ButtonController below is introduced.
4714 * src/frontends/xforms/ButtonController.h: New file for managing up to
4715 four buttons on a dialog according to an externally defined policy.
4716 * src/frontends/xforms/Makefile.am: added above
4718 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4719 Apply and Cancel/Close buttons and everything in between and beyond.
4720 * src/frontends/Makefile.am: added above.
4722 * src/frontends/xforms/forms/form_preferences.fd:
4723 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4724 and removed variable 'status' as a result. Fixed the set_minsize thing.
4725 Use the new screen-font-update after checking screen fonts were changed
4726 Added a "Restore" button to restore the original lyxrc values while
4727 editing. This restores everything not just the last input changed.
4728 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4730 * src/LyXAction.C: screen-font-update added for updating buffers after
4731 screen font settings have been changed.
4732 * src/commandtags.h: ditto
4733 * src/lyxfunc.C: ditto
4735 * forms/lyx.fd: removed screen fonts dialog.
4736 * src/lyx_gui.C: ditto
4737 * src/menus.[Ch]: ditto
4738 * src/lyx.[Ch]: ditto
4739 * src/lyx_cb.C: ditto + code from here moved to make
4740 screen-font-update. And people wonder why progress on GUII is
4741 slow. Look at how scattered this stuff was! It takes forever
4744 * forms/fdfix.sh: Fixup the spacing after commas.
4745 * forms/makefile: Remove date from generated files. Fewer clashes now.
4746 * forms/bullet_forms.C.patch: included someones handwritten changes
4748 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4749 once I've discovered why LyXRC was made noncopyable.
4750 * src/lyx_main.C: ditto
4752 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4754 * src/frontends/xforms/forms/fdfix.sh:
4755 * src/frontends/xforms/forms/fdfixh.sed:
4756 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4757 * src/frontends/xforms/Form*.[hC]:
4758 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4759 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4760 provide a destructor for the struct FD_form_xxxx. Another version of
4761 the set_[max|min]size workaround and a few other cleanups. Actually,
4762 Angus' patch from 20000809.
4764 2000-08-13 Baruch Even <baruch.even@writeme.com>
4766 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4769 2000-08-11 Juergen Vigna <jug@sad.it>
4771 * src/insets/insetgraphics.C (InsetGraphics): changing init
4772 order because of warnings.
4774 * src/frontends/xforms/forms/makefile: adding patching .C with
4777 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4778 from .C.patch to .c.patch
4780 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4781 order because of warning.
4783 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4785 * src/frontends/Liason.C (setMinibuffer): new helper function
4787 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4789 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4791 * lib/ui/default.ui: commented out PaperLayout entry
4793 * src/frontends/xforms/form_document.[Ch]: new added files
4795 * src/frontends/xforms/FormDocument.[Ch]: ditto
4797 * src/frontends/xforms/forms/form_document.fd: ditto
4799 * src/frontends/xforms/forms/form_document.C.patch: ditto
4801 2000-08-10 Juergen Vigna <jug@sad.it>
4803 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4804 (InsetGraphics): initialized cacheHandle to 0.
4805 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4807 2000-08-10 Baruch Even <baruch.even@writeme.com>
4809 * src/graphics/GraphicsCache.h:
4810 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4811 correctly as a cache.
4813 * src/graphics/GraphicsCacheItem.h:
4814 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4817 * src/graphics/GraphicsCacheItem_pimpl.h:
4818 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4821 * src/insets/insetgraphics.h:
4822 * src/insets/insetgraphics.C: Changed from using a signal notification
4823 to polling when image is not loaded.
4825 2000-08-10 Allan Rae <rae@lyx.org>
4827 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4828 that there are two functions that have to been taken out of line by
4829 hand and aren't taken care of in the script. (Just a reminder note)
4831 * sigc++/macros/*.h.m4: Updated as above.
4833 2000-08-09 Juergen Vigna <jug@sad.it>
4835 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4837 * src/insets/insettabular.C: make drawing of single cell smarter.
4839 2000-08-09 Marko Vendelin <markov@ioc.ee>
4840 * src/frontends/gnome/Menubar_pimpl.C
4841 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4842 implementation: new files
4844 * src/frontends/gnome/mainapp.C
4845 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4848 * src/main.C: create Gnome main window
4850 * src/frontends/xforms/Menubar_pimpl.h
4851 * src/frontends/Menubar.C
4852 * src/frontends/Menubar.h: added method Menubar::update that calls
4853 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4855 * src/LyXView.C: calls Menubar::update to update the state
4858 * src/frontends/gnome/Makefile.am: added new files
4860 * src/frontends/Makefile.am: added frontend compiler options
4862 2000-08-08 Juergen Vigna <jug@sad.it>
4864 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4866 * src/bufferlist.C (close):
4867 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4868 documents if exiting without saving.
4870 * src/buffer.C (save): use removeAutosaveFile()
4872 * src/support/filetools.C (removeAutosaveFile): new function.
4874 * src/lyx_cb.C (MenuWrite): returns a bool now.
4875 (MenuWriteAs): check if file could really be saved and revert to the
4877 (MenuWriteAs): removing old autosavefile if existant.
4879 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4880 before Goto toggle declaration, because of compiler warning.
4882 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4884 * src/lyxfunc.C (MenuNew): small fix.
4886 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4888 * src/bufferlist.C (newFile):
4889 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4891 * src/lyxrc.C: added new_ask_filename tag
4893 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4895 * src/lyx.fd: removed code pertaining to form_ref
4896 * src/lyx.[Ch]: ditto
4897 * src/lyx_cb.C: ditto
4898 * src/lyx_gui.C: ditto
4899 * src/lyx_gui_misc.C: ditto
4901 * src/BufferView_pimpl.C (restorePosition): update buffer only
4904 * src/commandtags.h (LFUN_REFTOGGLE): removed
4905 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4906 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4907 (LFUN_REFBACK): renamed LFUN_REF_BACK
4909 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4910 * src/menus.C: ditto
4911 * src/lyxfunc.C (Dispatch): ditto.
4912 InsertRef dialog is now GUI-independent.
4914 * src/texrow.C: added using std::endl;
4916 * src/insets/insetref.[Ch]: strip out large amounts of code.
4917 The inset is now a container and this functionality is now
4918 managed by a new FormRef dialog
4920 * src/frontends/Dialogs.h (showRef, createRef): new signals
4922 * src/frontends/xforms/FormIndex.[Ch],
4923 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4924 when setting dialog's min/max size
4925 * src/frontends/xforms/FormIndex.[Ch]: ditto
4927 * src/frontends/xforms/FormRef.[Ch],
4928 src/frontends/xforms/forms/form_ref.fd: new xforms
4929 implementation of an InsetRef dialog
4931 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4934 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4935 ios::nocreate is not part of the standard. Removed.
4937 2000-08-07 Baruch Even <baruch.even@writeme.com>
4939 * src/graphics/Renderer.h:
4940 * src/graphics/Renderer.C: Added base class for rendering of different
4941 image formats into Pixmaps.
4943 * src/graphics/XPM_Renderer.h:
4944 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4945 in a different class.
4947 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4948 easily add support for other formats.
4950 * src/insets/figinset.C: plugged a leak of an X resource.
4952 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4954 * src/CutAndPaste.[Ch]: make all metods static.
4956 * development/Code_rules/Rules: more work, added section on
4957 Exceptions, and a References section.
4959 * a lot of header files: work to make doc++ able to generate the
4960 source documentation, some workarounds of doc++ problems. Doc++ is
4961 now able to generate the documentation.
4963 2000-08-07 Juergen Vigna <jug@sad.it>
4965 * src/insets/insettabular.C (recomputeTextInsets): removed function
4967 * src/tabular.C (SetWidthOfMulticolCell):
4969 (calculate_width_of_column_NMC): fixed return value so that it really
4970 only returns true if the column-width has changed (there where
4971 problems with muliticolumn-cells in this column).
4973 2000-08-04 Juergen Vigna <jug@sad.it>
4975 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4976 also on the scrollstatus of the inset.
4977 (workAreaMotionNotify): ditto.
4979 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4981 2000-08-01 Juergen Vigna <jug@sad.it>
4983 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4985 * src/commandtags.h:
4986 * src/LyXAction.C (init):
4987 * src/insets/inset.C (LocalDispatch): added support for
4990 * src/insets/inset.C (scroll): new functions.
4992 * src/insets/insettext.C (removeNewlines): new function.
4993 (SetAutoBreakRows): removes forced newlines in the text of the
4994 paragraph if autoBreakRows is set to false.
4996 * src/tabular.C (Latex): generates a parbox around the cell contents
4999 * src/frontends/xforms/FormTabular.C (local_update): removed
5000 the radio_useparbox button.
5002 * src/tabular.C (UseParbox): new function
5004 2000-08-06 Baruch Even <baruch.even@writeme.com>
5006 * src/graphics/GraphicsCache.h:
5007 * src/graphics/GraphicsCache.C:
5008 * src/graphics/GraphicsCacheItem.h:
5009 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5012 * src/insets/insetgraphics.h:
5013 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5014 and the drawing of the inline image.
5016 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5017 loaded into the wrong position.
5019 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5022 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5024 * src/support/translator.h: move all typedefs to public section
5026 * src/support/filetools.C (MakeLatexName): return string const
5028 (TmpFileName): ditto
5029 (FileOpenSearch): ditto
5031 (LibFileSearch): ditto
5032 (i18nLibFileSearch): ditto
5035 (CreateTmpDir): ditto
5036 (CreateBufferTmpDir): ditto
5037 (CreateLyXTmpDir): ditto
5040 (MakeAbsPath): ditto
5042 (OnlyFilename): ditto
5044 (NormalizePath): ditto
5045 (CleanupPath): ditto
5046 (GetFileContents): ditto
5047 (ReplaceEnvironmentPath): ditto
5048 (MakeRelPath): ditto
5050 (ChangeExtension): ditto
5051 (MakeDisplayPath): ditto
5052 (do_popen): return cmdret const
5053 (findtexfile): return string const
5055 * src/support/DebugStream.h: add some /// to please doc++
5057 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5059 * src/texrow.C (same_rownumber): functor to use with find_if
5060 (getIdFromRow): rewritten to use find_if and to not update the
5061 positions. return true if row is found
5062 (increasePos): new method, use to update positions
5064 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5066 * src/lyxlex_pimpl.C (verifyTable): new method
5069 (GetString): return string const
5070 (pushTable): rewrite to use std::stack
5072 (setFile): better check
5075 * src/lyxlex.h: make LyXLex noncopyable
5077 * src/lyxlex.C (text): return char const * const
5078 (GetString): return string const
5079 (getLongString): return string const
5081 * src/lyx_gui_misc.C (askForText): return pair<...> const
5083 * src/lastfiles.[Ch] (operator): return string const
5085 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5086 istringstream not char const *.
5087 move token.end() out of loop.
5088 (readFile): move initializaton of token
5090 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5091 getIdFromRow is successful.
5093 * lib/bind/emacs.bind: don't include menus bind
5095 * development/Code_rules/Rules: the beginnings of making this
5096 better and covering more of the unwritten rules that we have.
5098 * development/Code_rules/Recommendations: a couple of wording
5101 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5103 * src/support/strerror.c: remove C++ comment.
5105 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5107 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5108 LFUN_INDEX_INSERT_LAST
5110 * src/texrow.C (getIdFromRow): changed from const_iterator to
5111 iterator, allowing code to compile with DEC cxx
5113 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5114 stores part of the class, as suggested by Allan. Will allow
5116 (apply): test to apply uses InsetCommandParams operator!=
5118 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5119 (apply): test to apply uses InsetCommandParams operator!=
5121 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5122 stores part of the class.
5123 (update): removed limits on min/max size.
5125 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5126 (apply): test to apply uses InsetCommandParams operator!=
5128 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5129 (Read, Write, scanCommand, getCommand): moved functionality
5130 into InsetCommandParams.
5132 (getScreenLabel): made pure virtual
5133 new InsetCommandParams operators== and !=
5135 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5136 c-tors based on InsetCommandParams. Removed others.
5137 * src/insets/insetinclude.[Ch]: ditto
5138 * src/insets/insetlabel.[Ch]: ditto
5139 * src/insets/insetparent.[Ch]: ditto
5140 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5142 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5143 insets derived from InsetCommand created using similar c-tors
5144 based on InsetCommandParams
5145 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5146 * src/menus.C (ShowRefsMenu): ditto
5147 * src/paragraph.C (Clone): ditto
5148 * src/text2.C (SetCounter): ditto
5149 * src/lyxfunc.C (Dispatch) ditto
5150 Also recreated old InsetIndex behaviour exactly. Can now
5151 index-insert at the start of a paragraph and index-insert-last
5152 without launching the pop-up.
5154 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5156 * lib/lyxrc.example: mark te pdf options as non functional.
5158 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5159 (isStrDbl): move tmpstr.end() out of loop.
5160 (strToDbl): move intialization of tmpstr
5161 (lowercase): return string const and move tmp.end() out of loop.
5162 (uppercase): return string const and move tmp.edn() out of loop.
5163 (prefixIs): add assertion
5168 (containsOnly): ditto
5169 (containsOnly): ditto
5170 (containsOnly): ditto
5171 (countChar): make last arg char not char const
5172 (token): return string const
5173 (subst): return string const, move tmp.end() out of loop.
5174 (subst): return string const, add assertion
5175 (strip): return string const
5176 (frontStrip): return string const, add assertion
5177 (frontStrip): return string const
5182 * src/support/lstrings.C: add inclde "LAssert.h"
5183 (isStrInt): move tmpstr.end() out of loop.
5185 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5186 toollist.end() out of loop.
5187 (deactivate): move toollist.end() out of loop.
5188 (update): move toollist.end() out of loop.
5189 (updateLayoutList): move tc.end() out of loop.
5190 (add): move toollist.end() out of loop.
5192 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5193 md.end() out of loop.
5195 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5197 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5200 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5201 (Erase): move insetlist.end() out of loop.
5203 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5204 ref to const string as first arg. Move initialization of some
5205 variables, whitespace changes.
5207 * src/kbmap.C (defkey): move table.end() out of loop.
5208 (kb_keymap): move table.end() out of loop.
5209 (findbinding): move table.end() out of loop.
5211 * src/MenuBackend.C (hasMenu): move end() out of loop.
5212 (getMenu): move end() out of loop.
5213 (getMenu): move menulist_.end() out of loop.
5215 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5217 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5220 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5221 (getFromLyXName): move infotab.end() out of loop.
5223 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5224 -fvtable-thunks -ffunction-sections -fdata-sections
5226 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5228 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5231 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5233 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5235 * src/frontends/xforms/FormCitation.[Ch],
5236 src/frontends/xforms/FormIndex.[Ch],
5237 src/frontends/xforms/FormToc.[Ch],
5238 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5240 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5242 * src/commandtags.h: renamed, created some flags for citation
5245 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5247 * src/lyxfunc.C (dispatch): use signals to insert index entry
5249 * src/frontends/Dialogs.h: new signal createIndex
5251 * src/frontends/xforms/FormCommand.[Ch],
5252 src/frontends/xforms/FormCitation.[Ch],
5253 src/frontends/xforms/FormToc.[Ch],
5254 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5256 * src/insets/insetindex.[Ch]: GUI-independent
5258 * src/frontends/xforms/FormIndex.[Ch],
5259 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5262 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5264 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5265 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5267 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5269 * src/insets/insetref.C (Latex): rewrite so that there is now
5270 question that a initialization is requested.
5272 * src/insets/insetcommand.h: reenable the hide signal
5274 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5276 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5277 fix handling of shortcuts (many bugs :)
5278 (add_lastfiles): ditto.
5280 * lib/ui/default.ui: fix a few shortcuts.
5282 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5284 * Makefile.am: Fix ``rpmdist'' target to return the exit
5285 status of the ``rpm'' command, instead of the last command in
5286 the chain (the ``rm lyx.xpm'' command, which always returns
5289 2000-08-02 Allan Rae <rae@lyx.org>
5291 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5292 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5293 * src/frontends/xforms/FormToc.C (FormToc): ditto
5295 * src/frontends/xforms/Makefile.am: A few forgotten files
5297 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5298 Signals-not-copyable-problem Lars' started commenting out.
5300 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5302 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5304 * src/insets/insetcommand.h: Signals is not copyable so anoter
5305 scheme for automatic hiding of forms must be used.
5307 * src/frontends/xforms/FormCitation.h: don't inerit from
5308 noncopyable, FormCommand already does that.
5309 * src/frontends/xforms/FormToc.h: ditto
5310 * src/frontends/xforms/FormUrl.h: ditto
5312 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5314 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5316 * src/insets/insetcommand.h (hide): new SigC::Signal0
5317 (d-tor) new virtual destructor emits hide signal
5319 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5320 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5322 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5323 LOF and LOT. Inset is now GUI-independent
5325 * src/insets/insetloa.[Ch]: redundant
5326 * src/insets/insetlof.[Ch]: ditto
5327 * src/insets/insetlot.[Ch]: ditto
5329 * src/frontends/xforms/forms/form_url.fd: tweaked!
5330 * src/frontends/xforms/forms/form_citation.fd: ditto
5332 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5333 dialogs dealing with InsetCommand insets
5335 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5336 FormCommand base class
5337 * src/frontends/xforms/FormUrl.[Ch]: ditto
5339 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5341 * src/frontends/xforms/FormToc.[Ch]: ditto
5343 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5344 passed a generic InsetCommand pointer
5345 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5347 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5348 and modified InsetTOC class
5349 * src/buffer.C: ditto
5351 * forms/lyx.fd: strip out old FD_form_toc code
5352 * src/lyx_gui_misc.C: ditto
5353 * src/lyx_gui.C: ditto
5354 * src/lyx_cb.C: ditto
5355 * src/lyx.[Ch]: ditto
5357 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5359 * src/support/utility.hpp: tr -d '\r'
5361 2000-08-01 Juergen Vigna <jug@sad.it>
5363 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5365 * src/commandtags.h:
5366 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5367 LFUN_TABULAR_FEATURES.
5369 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5370 LFUN_LAYOUT_TABULAR.
5372 * src/insets/insettabular.C (getStatus): implemented helper function.
5374 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5376 2000-07-31 Juergen Vigna <jug@sad.it>
5378 * src/text.C (draw): fixed screen update problem for text-insets.
5380 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5381 something changed probably this has to be added in various other
5384 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5386 2000-07-31 Baruch Even <baruch.even@writeme.com>
5388 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5389 templates to satisfy compaq cxx.
5392 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5394 * src/support/translator.h (equal_1st_in_pair::operator()): take
5395 const ref pair_type as arg.
5396 (equal_2nd_in_pair::operator()): ditto
5397 (Translator::~Translator): remove empty d-tor.
5399 * src/graphics/GraphicsCache.C: move include config.h to top, also
5400 put initialization of GraphicsCache::singleton here.
5401 (~GraphicsCache): move here
5402 (addFile): take const ref as arg
5405 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5407 * src/BufferView2.C (insertLyXFile): change te with/without header
5410 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5412 * src/frontends/xforms/FormGraphics.C (apply): add some
5413 static_cast. Not very nice, but required by compaq cxx.
5415 * src/frontends/xforms/RadioButtonGroup.h: include header
5416 <utility> instead of <pair.h>
5418 * src/insets/insetgraphicsParams.C: add using directive.
5419 (readResize): change return type to void.
5420 (readOrigin): ditto.
5422 * src/lyxfunc.C (getStatus): add missing break for build-program
5423 function; add test for Literate for export functions.
5425 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5426 entries in Options menu.
5428 2000-07-31 Baruch Even <baruch.even@writeme.com>
5430 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5431 protect against auto-allocation; release icon when needed.
5433 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5435 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5436 on usual typewriter.
5438 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5439 earlier czech.kmap), useful only for programming.
5441 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5443 * src/frontends/xforms/FormCitation.h: fix conditioning around
5446 2000-07-31 Juergen Vigna <jug@sad.it>
5448 * src/frontends/xforms/FormTabular.C (local_update): changed
5449 radio_linebreaks to radio_useparbox and added radio_useminipage.
5451 * src/tabular.C: made support for using minipages/parboxes.
5453 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5455 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5457 (descent): so the cursor is in the middle.
5458 (width): bit smaller box.
5460 * src/insets/insetgraphics.h: added display() function.
5462 2000-07-31 Baruch Even <baruch.even@writeme.com>
5464 * src/frontends/Dialogs.h: Added showGraphics signals.
5466 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5467 xforms form definition of the graphics dialog.
5469 * src/frontends/xforms/FormGraphics.h:
5470 * src/frontends/xforms/FormGraphics.C: Added files, the
5471 GUIndependent code of InsetGraphics
5473 * src/insets/insetgraphics.h:
5474 * src/insets/insetgraphics.C: Major writing to make it work.
5476 * src/insets/insetgraphicsParams.h:
5477 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5478 struct between InsetGraphics and GUI.
5480 * src/LaTeXFeatures.h:
5481 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5482 support for graphicx package.
5484 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5485 for the graphics inset.
5487 * src/support/translator.h: Added file, used in
5488 InsetGraphicsParams. this is a template to translate between two
5491 * src/frontends/xforms/RadioButtonGroup.h:
5492 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5493 way to easily control a radio button group.
5495 2000-07-28 Juergen Vigna <jug@sad.it>
5497 * src/insets/insettabular.C (LocalDispatch):
5498 (TabularFeatures): added support for lyx-functions of tabular features.
5499 (cellstart): refixed this function after someone wrongly changed it.
5501 * src/commandtags.h:
5502 * src/LyXAction.C (init): added support for tabular-features
5504 2000-07-28 Allan Rae <rae@lyx.org>
5506 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5507 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5508 triggers the callback for input checking. As a result we sometimes get
5509 "LyX: This shouldn't happen..." printed to cerr.
5510 (input): Started using status variable since I only free() on
5511 destruction. Some input checking for paths and font sizes.
5513 * src/frontends/xforms/FormPreferences.h: Use status to control
5514 activation of Ok and Apply
5516 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5517 callback. Also resized to stop segfaults with 0.88. The problem is
5518 that xforms-0.88 requires the folder to be wide enough to fit all the
5519 tabs. If it isn't it causes all sorts of problems.
5521 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5523 * src/frontends/xforms/forms/README: Reflect reality.
5525 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5526 * src/frontends/xforms/forms/makefile: ditto.
5528 * src/commandtags.h: Get access to new Preferences dialog
5529 * src/LyXAction.C: ditto
5530 * src/lyxfunc.C: ditto
5531 * lib/ui/default.ui: ditto
5533 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5535 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5537 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5540 * src/frontends/xforms/form_url.[Ch]: added.
5542 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5544 * src/insets/insetbib.h: fixed bug in previous commit
5546 * src/frontends/xforms/FormUrl.h: ditto
5548 * src/frontends/xforms/FormPrint.h: ditto
5550 * src/frontends/xforms/FormPreferences.h: ditto
5552 * src/frontends/xforms/FormCopyright.h: ditto
5554 * src/frontends/xforms/FormCitation.C: ditto
5556 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5557 private copyconstructor and private default contructor
5559 * src/support/Makefile.am: add utility.hpp
5561 * src/support/utility.hpp: new file from boost
5563 * src/insets/insetbib.h: set owner in clone
5565 * src/frontends/xforms/FormCitation.C: added missing include
5568 * src/insets/form_url.[Ch]: removed
5570 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5572 * development/lyx.spec.in
5573 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5574 file/directory re-organization.
5576 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5578 * src/insets/insetcommand.[Ch]: moved the string data and
5579 associated manipulation methods into a new stand-alone class
5580 InsetCommandParams. This class has two additional methods
5581 getAsString() and setFromString() allowing the contents to be
5582 moved around as a single string.
5583 (addContents) method removed.
5584 (setContents) method no longer virtual.
5586 * src/buffer.C (readInset): made use of new InsetCitation,
5587 InsetUrl constructors based on InsetCommandParams.
5589 * src/commandtags.h: add LFUN_INSERT_URL
5591 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5592 independent InsetUrl and use InsetCommandParams to extract
5593 string info and create new Insets.
5595 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5597 * src/frontends/xforms/FormCitation.C (apply): uses
5600 * src/frontends/xforms/form_url.C
5601 * src/frontends/xforms/form_url.h
5602 * src/frontends/xforms/FormUrl.h
5603 * src/frontends/xforms/FormUrl.C
5604 * src/frontends/xforms/forms/form_url.fd: new files
5606 * src/insets/insetcite.[Ch]: removed unused constructors.
5608 * src/insets/insetinclude.[Ch]: no longer store filename
5610 * src/insets/inseturl.[Ch]: GUI-independent.
5612 2000-07-26 Juergen Vigna <jug@sad.it>
5613 * renamed frontend from gtk to gnome as it is that what is realized
5614 and did the necessary changes in the files.
5616 2000-07-26 Marko Vendelin <markov@ioc.ee>
5618 * configure.in: cleaning up gnome configuration scripts
5620 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5622 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5623 shortcuts syndrom by redrawing them explicitely (a better solution
5624 would be appreciated).
5626 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5628 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5631 * src/lyx_cb.C (MenuExport): change html export to do the right
5632 thing depending of the document type (instead of having
5633 html-linuxdoc and html-docbook).
5634 * src/lyxfunc.C (getStatus): update for html
5635 * lib/ui/default.ui: simplify due to the above change.
5636 * src/menus.C (ShowFileMenu): update too (in case we need it).
5638 * src/MenuBackend.C (read): if a menu is defined twice, add the
5639 new entries to the exiting one.
5641 2000-07-26 Juergen Vigna <jug@sad.it>
5643 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5645 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5646 and return a bool if it did actual save the file.
5647 (AutoSave): don't autosave a unnamed doc.
5649 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5650 check if this is an UNNAMED new file and react to it.
5651 (newFile): set buffer to unnamed and change to not mark a new
5652 buffer dirty if I didn't do anything with it.
5654 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5656 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5658 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5659 friend as per Angus's patch posted to lyx-devel.
5661 * src/ext_l10n.h: updated
5663 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5664 gettext on the style string right before inserting them into the
5667 * autogen.sh: add code to extract style strings form layout files,
5668 not good enough yet.
5670 * src/frontends/gtk/.cvsignore: add MAKEFILE
5672 * src/MenuBackend.C (read): run the label strings through gettext
5673 before storing them in the containers.
5675 * src/ext_l10n.h: new file
5677 * autogen.sh : generate the ext_l10n.h file here
5679 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5681 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5684 * lib/ui/default.ui: fix a couple of typos.
5686 * config/gnome/gtk.m4: added (and added to the list of files in
5689 * src/insets/insetinclude.C (unique_id): fix when we are using
5690 lyxstring instead of basic_string<>.
5691 * src/insets/insettext.C (LocalDispatch): ditto.
5692 * src/support/filetools.C: ditto.
5694 * lib/configure.m4: create the ui/ directory if necessary.
5696 * src/LyXView.[Ch] (updateToolbar): new method.
5698 * src/BufferView_pimpl.C (buffer): update the toolbar when
5699 opening/closing buffer.
5701 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5703 * src/LyXAction.C (getActionName): enhance to return also the name
5704 and options of pseudo-actions.
5705 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5707 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5708 as an example of what is possible). Used in File->Build too (more
5709 useful) and in the import/export menus (to mimick the complicated
5710 handling of linuxdoc and friends). Try to update all the entries.
5712 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5715 * src/MenuBackend.C (read): Parse the new OptItem tag.
5717 * src/MenuBackend.h: Add a new optional_ data member (used if the
5718 entry should be omitted when the lyxfunc is disabled).
5720 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5721 function, used as a shortcut.
5722 (create_submenu): align correctly the shortcuts on the widest
5725 * src/MenuBackend.h: MenuItem.label() only returns the label of
5726 the menu without shortcut; new method shortcut().
5728 2000-07-14 Marko Vendelin <markov@ioc.ee>
5730 * src/frontends/gtk/Dialogs.C:
5731 * src/frontends/gtk/FormCopyright.C:
5732 * src/frontends/gtk/FormCopyright.h:
5733 * src/frontends/gtk/Makefile.am: added these source-files for the
5734 Gtk/Gnome support of the Copyright-Dialog.
5736 * src/main.C: added Gnome::Main initialization if using
5737 Gtk/Gnome frontend-GUI.
5739 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5741 * config/gnome/aclocal-include.m4
5742 * config/gnome/compiler-flags.m4
5743 * config/gnome/curses.m4
5744 * config/gnome/gnome--.m4
5745 * config/gnome/gnome-bonobo-check.m4
5746 * config/gnome/gnome-common.m4
5747 * config/gnome/gnome-fileutils.m4
5748 * config/gnome/gnome-ghttp-check.m4
5749 * config/gnome/gnome-gnorba-check.m4
5750 * config/gnome/gnome-guile-checks.m4
5751 * config/gnome/gnome-libgtop-check.m4
5752 * config/gnome/gnome-objc-checks.m4
5753 * config/gnome/gnome-orbit-check.m4
5754 * config/gnome/gnome-print-check.m4
5755 * config/gnome/gnome-pthread-check.m4
5756 * config/gnome/gnome-support.m4
5757 * config/gnome/gnome-undelfs.m4
5758 * config/gnome/gnome-vfs.m4
5759 * config/gnome/gnome-x-checks.m4
5760 * config/gnome/gnome-xml-check.m4
5761 * config/gnome/gnome.m4
5762 * config/gnome/gperf-check.m4
5763 * config/gnome/gtk--.m4
5764 * config/gnome/linger.m4
5765 * config/gnome/need-declaration.m4: added configuration scripts
5766 for Gtk/Gnome frontend-GUI
5768 * configure.in: added support for the --with-frontend=gtk option
5770 * autogen.sh: added config/gnome/* to list of config-files
5772 * acconfig.h: added define for GTKGUI-support
5774 * config/lyxinclude.m4: added --with-frontend[=value] option value
5775 for Gtk/Gnome frontend-GUI support.
5777 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5779 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5783 * src/paragraph.C (GetChar): remove non-const version
5785 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5786 (search_kw): use it.
5788 * src/lyx_main.C (init): if "preferences" exist, read that instead
5790 (ReadRcFile): return bool if the file could be read ok.
5791 (ReadUIFile): add a check to see if lex file is set ok.
5793 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5794 bastring can be used instead of lyxstring (still uses the old code
5795 if std::string is good enough or if lyxstring is used.)
5797 * src/encoding.C: make the arrays static, move ininle functions
5799 * src/encoding.h: from here.
5801 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5802 (parseSingleLyXformat2Token): move inset parsing to separate method
5803 (readInset): new private method
5805 * src/Variables.h: remove virtual from get().
5807 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5808 access to NEW_INSETS and NEW_TABULAR
5810 * src/MenuBackend.h: remove superfluous forward declaration of
5811 MenuItem. Add documentations tags "///", remove empty MenuItem
5812 destructor, remove private default contructor.
5814 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5816 (read): more string mlabel and mname to where they are used
5817 (read): remove unused variables mlabel and mname
5818 (defaults): unconditional clear, make menusetup take advantage of
5819 add returning Menu &.
5821 * src/LyXView.h: define NEW_MENUBAR as default
5823 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5824 to NEW_INSETS and NEW_TABULAR.
5825 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5826 defined. Change some of the "xxxx-inset-insert" functions names to
5829 * several files: more enahncements to NEW_INSETS and the resulting
5832 * lib/lyxrc.example (\date_insert_format): move to misc section
5834 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5835 bastring and use AC_CACHE_CHECK.
5836 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5837 the system have the newest methods. uses AC_CACHE_CHECK
5838 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5839 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5840 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5842 * configure.in: add LYX_CXX_GOOD_STD_STRING
5844 * acinclude.m4: recreated
5846 2000-07-24 Amir Karger <karger@lyx.org>
5848 * README: add Hebrew, Arabic kmaps
5851 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5853 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5856 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5858 * Lot of files: add pragma interface/implementation.
5860 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5862 * lib/ui/default.ui: new file (ans new directory). Contains the
5863 default menu and toolbar.
5865 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5866 global space. Toolbars are now read (as menus) in ui files.
5868 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5870 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5871 is disabled because the document is read-only. We want to have the
5872 toggle state of the function anyway.
5873 (getStatus): add code for LFUN_VC* functions (mimicking what is
5874 done in old-style menus)
5876 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5877 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5879 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5880 * src/BufferView_pimpl.C: ditto.
5881 * src/lyxfunc.C: ditto.
5883 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5884 default). This replaces old-style menus by new ones.
5886 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5887 MenuItem. Contain the data structure of a menu.
5889 * src/insets/insettext.C: use LyXView::setLayout instead of
5890 accessing directly the toolbar combox.
5891 * src/lyxfunc.C (Dispatch): ditto.
5893 * src/LyXView.C (setLayout): new method, which just calls
5894 Toolbar::setLayout().
5895 (updateLayoutChoice): move part of this method in Toolbar.
5897 * src/toolbar.[Ch]: removed.
5899 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5900 implementation the toolbar.
5902 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5903 the toolbar. It might make sense to merge it with ToolbarDefaults
5905 (setLayout): new function.
5906 (updateLayoutList): ditto.
5907 (openLayoutList): ditto.
5909 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5910 xforms implementation of the toolbar.
5911 (get_toolbar_func): comment out, since I do not
5912 know what it is good for.
5914 * src/ToolbarDefaults.h: Add the ItemType enum.
5916 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5917 for a list of allocated C strings. Used in Menubar xforms
5918 implementation to avoid memory leaks.
5920 * src/support/lstrings.[Ch] (uppercase): new version taking and
5924 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5925 * lib/bind/emacs.bind: ditto.
5927 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5929 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5930 forward decl of LyXView.
5932 * src/toolbar.C (toolbarItem): moved from toolbar.h
5933 (toolbarItem::clean): ditto
5934 (toolbarItem::~toolbarItem): ditto
5935 (toolbarItem::operator): ditto
5937 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5939 * src/paragraph.h: control the NEW_TABULAR define from here
5941 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5942 USE_TABULAR_INSETS to NEW_TABULAR
5944 * src/ToolbarDefaults.C: add include "lyxlex.h"
5946 * files using the old table/tabular: use NEW_TABULAR to control
5947 compilation of old tabular stuff.
5949 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5952 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5953 planemet in reading of old style floats, fix the \end_deeper
5954 problem when reading old style floats.
5956 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5958 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5960 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5962 * lib/bind/sciword.bind: updated.
5964 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5966 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5967 layout write problem
5969 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5971 * src/Makefile.am (INCLUDES): remove image directory from include
5974 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5975 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5977 * src/LyXView.C (create_form_form_main): read the application icon
5980 * lib/images/*.xpm: change the icons to use transparent color for
5983 * src/toolbar.C (update): change the color of the button when it
5986 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5988 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5989 setting explicitely the minibuffer.
5990 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5992 * src/LyXView.C (showState): new function. Shows font information
5993 in minibuffer and update toolbar state.
5994 (LyXView): call Toolbar::update after creating the
5997 * src/toolbar.C: change toollist to be a vector instead of a
5999 (BubbleTimerCB): get help string directly from the callback
6000 argument of the corresponding icon (which is the action)
6001 (set): remove unnecessary ugliness.
6002 (update): new function. update the icons (depressed, disabled)
6003 depending of the status of the corresponding action.
6005 * src/toolbar.h: remove help in toolbarItem
6007 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6009 * src/Painter.C (text): Added code for using symbol glyphs from
6010 iso10646 fonts. Currently diabled.
6012 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6015 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6016 magyar,turkish and usorbian.
6018 * src/paragraph.C (isMultiLingual): Made more efficient.
6020 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6023 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6024 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6025 Also changed the prototype to "bool math_insert_greek(char)".
6027 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6029 * lots of files: apply the NEW_INSETS on all code that will not be
6030 needed when we move to use the new insets. Enable the define in
6031 lyxparagrah.h to try it.
6033 * src/insets/insettabular.C (cellstart): change to be a static
6035 (InsetTabular): initialize buffer in the initializer list.
6037 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6039 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6040 form_print.h out of the header file. Replaced with forward
6041 declarations of the relevant struct.
6043 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6046 * src/commandtags.h: do not include "debug.h" which does not
6047 belong there. #include it in some other places because of this
6050 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6052 * src/insets/insetcaption.C: add a couple "using" directives.
6054 * src/toolbar.C (add): get the help text directly from lyxaction.
6056 (setPixmap): new function. Loads from disk and sets a pixmap on a
6057 botton; the name of the pixmap file is derived from the command
6060 * src/toolbar.h: remove members isBitmap and pixmap from
6063 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6064 * lib/images/: move many files from images/banner.xpm.
6066 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6068 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6069 * src/toolbar.C: ditto.
6070 * configure.in: ditto.
6071 * INSTALL: document.
6073 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6074 the spellchecker popup is closed from the WM.
6076 2000-07-19 Juergen Vigna <jug@sad.it>
6078 * src/insets/insetfloat.C (Write): small fix because we use the
6079 insetname for the type now!
6081 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6083 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6086 * src/frontends/Dialogs.h: removed hideCitation signal
6088 * src/insets/insetcite.h: added hide signal
6090 * src/insets/insetcite.C (~InsetCitation): emits new signal
6091 (getScreenLabel): "intelligent" label should now fit on the screen!
6093 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6095 * src/frontends/xforms/FormCitation.C (showInset): connects
6096 hide() to the inset's hide signal
6097 (show): modified to use fl_set_object_position rather than
6098 fl_set_object_geometry wherever possible
6100 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6102 * src/insets/lyxinset.h: add caption code
6104 * src/insets/insetfloat.C (type): new method
6106 * src/insets/insetcaption.C (Write): new method
6108 (LyxCode): new method
6110 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6111 to get it right together with using the FloatList.
6113 * src/commandtags.h: add LFUN_INSET_CAPTION
6114 * src/lyxfunc.C (Dispatch): handle it
6116 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6119 * src/Variables.[Ch]: make expand take a const reference, remove
6120 the destructor, some whitespace changes.
6122 * src/LyXAction.C (init): add caption-inset-insert
6124 * src/FloatList.C (FloatList): update the default floats a bit.
6126 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6128 * src/Variables.[Ch]: new files. Intended to be used for language
6129 specific strings (like \chaptername) and filename substitution in
6132 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6134 * lib/kbd/american.kmap: update
6136 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6138 * src/bufferparams.[Ch]: remove member allowAccents.
6140 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6142 * src/LaTeXLog.C: use the log_form.h header.
6143 * src/lyx_gui.C: ditto.
6144 * src/lyx_gui_misc.C: ditto.
6145 * src/lyxvc.h: ditto.
6147 * forms/log_form.fd: new file, created from latexoptions.fd. I
6148 kept the log popup and nuked the options form.
6150 * src/{la,}texoptions.[Ch]: removed.
6151 * src/lyx_cb.C (LaTeXOptions): ditto
6153 * src/lyx_gui.C (create_forms): do not handle the
6154 fd_latex_options form.
6156 2000-07-18 Juergen Vigna <jug@sad.it>
6158 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6159 name of the inset so that it can be requested outside (text2.C).
6161 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6164 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6166 * src/mathed/formula.h (ConvertFont): constify
6168 * src/mathed/formula.C (Read): add warning if \end_inset is not
6169 found on expected place.
6171 * src/insets/lyxinset.h (ConvertFont): consify
6173 * src/insets/insetquotes.C (ConvertFont): constify
6174 * src/insets/insetquotes.h: ditto
6176 * src/insets/insetinfo.h: add labelfont
6178 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6179 (ascent): use labelfont
6183 (Write): make .lyx file a bit nicer
6185 * src/insets/insetfloat.C (Write): simplify somewhat...
6186 (Read): add warning if arg is not found
6188 * src/insets/insetcollapsable.C: add using std::max
6189 (Read): move string token and add warning in arg is not found
6190 (draw): use std::max to get the right ty
6191 (getMaxWidth): simplify by using std::max
6193 * src/insets/insetsection.h: new file
6194 * src/insets/insetsection.C: new file
6195 * src/insets/insetcaption.h: new file
6196 * src/insets/insetcaption.C: new file
6198 * src/insets/inset.C (ConvertFont): constify signature
6200 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6201 insetcaption.[Ch] and insetsection.[Ch]
6203 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6204 uses to use LABEL_COUNTER_CHAPTER instead.
6205 * src/text2.C (SetCounter): here
6207 * src/counters.h: new file
6208 * src/counters.C: new file
6209 * src/Sectioning.h: new file
6210 * src/Sectioning.C: new file
6212 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6214 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6216 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6219 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6222 2000-07-17 Juergen Vigna <jug@sad.it>
6224 * src/tabular.C (Validate): check if array-package is needed.
6225 (SetVAlignment): added support for vertical alignment.
6226 (SetLTFoot): better support for longtable header/footers
6227 (Latex): modified to support added features.
6229 * src/LaTeXFeatures.[Ch]: added array-package.
6231 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6233 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6236 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6238 * configure.in: do not forget to put a space after -isystem.
6240 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6242 * lib/kbd/arabic.kmap: a few fixes.
6244 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6246 * some whitespace chagnes to a number of files.
6248 * src/support/DebugStream.h: change to make it easier for
6249 doc++ to parse correctly.
6250 * src/support/lyxstring.h: ditto
6252 * src/mathed/math_utils.C (compara): change to have only one
6254 (MathedLookupBOP): change because of the above.
6256 * src/mathed/math_delim.C (math_deco_compare): change to have only
6258 (search_deco): change becasue of the above.
6260 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6261 instead of manually coded one.
6263 * src/insets/insetquotes.C (Read): read the \end_inset too
6265 * src/insets/insetlatex.h: remove file
6266 * src/insets/insetlatex.C: remove file
6268 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6270 (InsetPrintIndex): remove destructor
6272 * src/insets/insetinclude.h: remove default constructor
6274 * src/insets/insetfloat.C: work to make it work better
6276 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6278 * src/insets/insetcite.h (InsetCitation): remove default constructor
6280 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6282 * src/text.C (GetColumnNearX): comment out some currently unused code.
6284 * src/paragraph.C (writeFile): move some initializations closer to
6286 (CutIntoMinibuffer): small change to use new matchIT operator
6290 (InsertInset): ditto
6293 (InsetIterator): ditto
6294 (Erase): small change to use new matchFT operator
6296 (GetFontSettings): ditto
6297 (HighestFontInRange): ditto
6300 * src/lyxparagraph.h: some chars changed to value_type
6301 (matchIT): because of some stronger checking (perhaps too strong)
6302 in SGI STL, the two operator() unified to one.
6305 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6307 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6308 the last inset read added
6309 (parseSingleLyXformat2Token): some more (future) compability code added
6310 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6311 (parseSingleLyXformat2Token): set last_inset_read
6312 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6313 (parseSingleLyXformat2Token): don't double intializw string next_token
6315 * src/TextCache.C (text_fits::operator()): add const's to the signature
6316 (has_buffer::operator()): ditto
6318 * src/Floating.h: add some comments on the class
6320 * src/FloatList.[Ch] (typeExist): new method
6323 * src/BackStack.h: added default constructor, wanted by Gcc.
6325 2000-07-14 Juergen Vigna <jug@sad.it>
6327 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6329 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6331 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6332 do a redraw when the window is resized!
6333 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6335 * src/insets/insettext.C (resizeLyXText): added function to correctly
6336 being able to resize the LyXWindow.
6338 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6340 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6342 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6343 crashes when closing dialog to a deleted inset.
6345 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6346 method! Now similar to other insets.
6348 2000-07-13 Juergen Vigna <jug@sad.it>
6350 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6352 * lib/examples/Literate.lyx: small patch!
6354 * src/insets/insetbib.C (Read): added this function because of wrong
6355 Write (without [begin|end]_inset).
6357 2000-07-11 Juergen Vigna <jug@sad.it>
6359 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6360 as the insertInset could not be good!
6362 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6363 the bool param should not be last.
6365 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6367 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6368 did submit that to Karl).
6370 * configure.in: use -isystem instead of -I for X headers. This
6371 fixes a problem on solaris with a recent gcc;
6372 put the front-end code after the X detection code;
6373 configure in sigc++ before lib/
6375 * src/lyx_main.C (commandLineHelp): remove -display from command
6378 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6380 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6381 Also put in Makefile rules for building the ``listerrors''
6382 program for parsing errors from literate programs written in LyX.
6384 * lib/build-listerrors: Added small shell script as part of compile
6385 process. This builds a working ``listerrors'' binary if noweb is
6386 installed and either 1) the VNC X server is installed on the machine,
6387 or 2) the user is compiling from within a GUI. The existence of a GUI
6388 is necessary to use the ``lyx --export'' feature for now. This
6389 hack can be removed once ``lyx --export'' no longer requires a GUI to
6392 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6394 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6395 now passed back correctly from gcc and placed "under" error
6396 buttons in a Literate LyX source.
6398 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6400 * src/text.C (GetColumnNearX): Better behavior when a RTL
6401 paragraph is ended by LTR text.
6403 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6406 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6408 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6409 true when clipboard is empty.
6411 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6413 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6414 row of the paragraph.
6415 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6416 to prevent calculation of bidi tables
6418 2000-07-07 Juergen Vigna <jug@sad.it>
6420 * src/screen.C (ToggleSelection): added y_offset and x_offset
6423 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6426 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6428 * src/insets/insettext.C: fixed Layout-Display!
6430 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6432 * configure.in: add check for strings.h header.
6434 * src/spellchecker.C: include <strings.h> in order to have a
6435 definition for bzero().
6437 2000-07-07 Juergen Vigna <jug@sad.it>
6439 * src/insets/insettext.C (draw): set the status of the bv->text to
6440 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6442 * src/screen.C (DrawOneRow):
6443 (DrawFromTo): redraw the actual row if something has changed in it
6446 * src/text.C (draw): call an update of the toplevel-inset if something
6447 has changed inside while drawing.
6449 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6451 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6453 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6454 processing inside class.
6456 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6457 processing inside class.
6459 * src/insets/insetindex.h new struct Holder, consistent with other
6462 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6463 citation dialog from main code and placed it in src/frontends/xforms.
6464 Dialog launched through signals instead of callbacks
6466 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6468 * lyx.man: update the options description.
6470 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6472 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6473 handle neg values, set min width to 590, add doc about -display
6475 2000-07-05 Juergen Vigna <jug@sad.it>
6477 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6478 calls to BufferView *.
6480 * src/insets/insettext.C (checkAndActivateInset): small fix non
6481 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6483 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6484 their \end_inset token!
6486 2000-07-04 edscott <edscott@imp.mx>
6488 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6489 lib/lyxrc.example: added option \wheel_jump
6491 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6493 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6494 remove support for -width,-height,-xpos and -ypos.
6496 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6498 * src/encoding.[Ch]: New files.
6500 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6501 (text): Call to the underline() method only when needed.
6503 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6505 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6506 encoding(s) for the document.
6508 * src/bufferparams.C (BufferParams): Changed default value of
6511 * src/language.C (newLang): Removed.
6512 (items[]): Added encoding information for all defined languages.
6514 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6515 encoding choice button.
6517 * src/lyxrc.h (font_norm_type): New member variable.
6518 (set_font_norm_type): New method.
6520 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6521 paragraphs with different encodings.
6523 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6524 (TransformChar): Changed to work correctly with Arabic points.
6525 (draw): Added support for drawing Arabic points.
6526 (draw): Removed code for drawing underbars (this is done by
6529 * src/support/textutils.h (IsPrintableNonspace): New function.
6531 * src/BufferView_pimpl.h: Added "using SigC::Object".
6532 * src/LyXView.h: ditto.
6534 * src/insets/insetinclude.h (include_label): Changed to mutable.
6536 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6538 * src/mathed/math_iter.h: remove empty destructor
6540 * src/mathed/math_cursor.h: remove empty destructor
6542 * src/insets/lyxinset.h: add THEOREM_CODE
6544 * src/insets/insettheorem.[Ch]: new files
6546 * src/insets/insetminipage.C: (InsertInset): remove
6548 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6550 (InsertInset): remove
6552 * src/insets/insetlist.C: (InsertList): remove
6554 * src/insets/insetfootlike.[Ch]: new files
6556 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6559 (InsertInset): ditto
6561 * src/insets/insetert.C: remove include Painter.h, reindent
6562 (InsertInset): move to header
6564 * src/insets/insetcollapsable.h: remove explicit from default
6565 contructor, remove empty destructor, add InsertInset
6567 * src/insets/insetcollapsable.C (InsertInset): new func
6569 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6571 * src/vspace.h: add explicit to constructor
6573 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6574 \textcompwordmark, please test this.
6576 * src/lyxrc.C: set ascii_linelen to 65 by default
6578 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6580 * src/commandtags.h: add LFUN_INSET_THEOREM
6582 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6583 (makeLinuxDocFile): remove _some_ of the nice logic
6584 (makeDocBookFile): ditto
6586 * src/Painter.[Ch]: (~Painter): removed
6588 * src/LyXAction.C (init): entry for insettheorem added
6590 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6592 (deplog): code to detect files generated by LaTeX, needs testing
6595 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6597 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6599 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6601 * src/LaTeX.C (deplog): Add a check for files that are going to be
6602 created by the first latex run, part of the project to remove the
6605 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6606 contents to the extension list.
6608 2000-07-04 Juergen Vigna <jug@sad.it>
6610 * src/text.C (NextBreakPoint): added support for needFullRow()
6612 * src/insets/lyxinset.h: added needFullRow()
6614 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6617 * src/insets/insettext.C: lots of changes for update!
6619 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6621 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6623 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6625 * src/insets/insetinclude.C (InsetInclude): fixed
6626 initialization of include_label.
6627 (unique_id): now returns a string.
6629 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6631 * src/LaTeXFeatures.h: new member IncludedFiles, for
6632 a map of key, included file name.
6634 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6635 with the included files for inclusion in SGML preamble,
6636 i. e., linuxdoc and docbook.
6639 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6640 nice (is the generated linuxdoc code to be exported?), that
6641 allows to remove column, and only_body that will be true for
6642 slave documents. Insets are allowed inside SGML font type.
6643 New handling of the SGML preamble for included files.
6644 (makeDocBookFile): the same for docbook.
6646 * src/insets/insetinclude.h:
6647 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6649 (DocBook): new export methods.
6651 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6652 and makeDocBookFile.
6654 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6655 formats to export with command line argument -x.
6657 2000-06-29 Juergen Vigna <jug@sad.it>
6659 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6660 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6662 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6663 region could already been cleared by an inset!
6665 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6667 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6670 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6672 (cursorToggle): remove special handling of lyx focus.
6674 2000-06-28 Juergen Vigna <jug@sad.it>
6676 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6679 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6681 * src/insets/insetindex.C (Edit): add a callback when popup is
6684 * src/insets/insettext.C (LocalDispatch):
6685 * src/insets/insetmarginal.h:
6686 * src/insets/insetlist.h:
6687 * src/insets/insetfoot.h:
6688 * src/insets/insetfloat.h:
6689 * src/insets/insetert.h: add a missing std:: qualifier.
6691 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6693 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6696 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6698 * src/insets/insettext.C (Read): remove tmptok unused variable
6699 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6700 (InsertInset): change for new InsetInset code
6702 * src/insets/insettext.h: add TEXT inline method
6704 * src/insets/insettext.C: remove TEXT macro
6706 * src/insets/insetmarginal.C (Write): new method
6707 (Latex): change output slightly
6709 * src/insets/insetfoot.C (Write): new method
6710 (Latex): change output slightly (don't use endl when no need)
6712 * src/insets/insetert.C (Write): new method
6714 * src/insets/insetcollapsable.h: make button_length, button_top_y
6715 and button_bottm_y protected.
6717 * src/insets/insetcollapsable.C (Write): simplify code by using
6718 tostr. Also do not output the float name, the children class
6719 should to that to get control over own arguments
6721 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6722 src/insets/insetminipage.[Ch]:
6725 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6727 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6729 * src/Makefile.am (lyx_SOURCES): add the new files
6731 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6732 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6733 * src/commandtags.h: ditto
6735 * src/LaTeXFeatures.h: add a std::set of used floattypes
6737 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6739 * src/FloatList.[Ch] src/Floating.h: new files
6741 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6743 * src/lyx_cb.C (TableApplyCB): ditto
6745 * src/text2.C: ditto
6746 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6747 (parseSingleLyXformat2Token): ditto + add code for
6748 backwards compability for old float styles + add code for new insets
6750 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6752 (InsertInset(size_type, Inset *, LyXFont)): new method
6753 (InsetChar(size_type, char)): changed to use the other InsetChar
6754 with a LyXFont(ALL_INHERIT).
6755 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6756 insert the META_INSET.
6758 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6760 * sigc++/thread.h (Threads): from here
6762 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6763 definition out of line
6764 * sigc++/scope.h: from here
6766 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6768 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6769 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6771 * Makefile.am (bindist): new target.
6773 * INSTALL: add instructions for doing a binary distribution.
6775 * development/tools/README.bin.example: update a bit.
6777 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6780 * lib/lyxrc.example: new lyxrc tag \set_color.
6782 * src/lyxfunc.C (Dispatch):
6783 * src/commandtags.h:
6784 * src/LyXAction.C: new lyxfunc "set-color".
6786 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6787 and an x11name given as strings.
6789 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6790 cache when a color is changed.
6792 2000-06-26 Juergen Vigna <jug@sad.it>
6794 * src/lyxrow.C (width): added this functions and variable.
6796 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6799 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6801 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6803 * images/undo_bw.xpm: new icon.
6804 * images/redo_bw.xpm: ditto.
6806 * configure.in (INSTALL_SCRIPT): change value to
6807 ${INSTALL} to avoid failures of install-script target.
6808 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6810 * src/BufferView.h: add a magic "friend" declaration to please
6813 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6815 * forms/cite.fd: modified to allow resizing without messing
6818 * src/insetcite.C: Uses code from cite.fd almost without
6820 User can now resize dialog in the x-direction.
6821 Resizing the dialog in the y-direction is prevented, as the
6822 code does this intelligently already.
6824 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6826 * INSTALL: remove obsolete entry in "problems" section.
6828 * lib/examples/sl_*.lyx: update of the slovenian examples.
6830 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6832 2000-06-23 Juergen Vigna <jug@sad.it>
6834 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6836 * src/buffer.C (resize): delete the LyXText of textinsets.
6838 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6840 * src/insets/lyxinset.h: added another parameter 'cleared' to
6841 the draw() function.
6843 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6844 unlocking inset in inset.
6846 2000-06-22 Juergen Vigna <jug@sad.it>
6848 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6849 of insets and moved first to LyXText.
6851 * src/mathed/formulamacro.[Ch]:
6852 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6854 2000-06-21 Juergen Vigna <jug@sad.it>
6856 * src/text.C (GetVisibleRow): look if I should clear the area or not
6857 using Inset::doClearArea() function.
6859 * src/insets/lyxinset.h: added doClearArea() function and
6860 modified draw(Painter &, ...) to draw(BufferView *, ...)
6862 * src/text2.C (UpdateInset): return bool insted of int
6864 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6866 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6867 combox in the character popup
6869 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6870 BufferParams const & params
6872 2000-06-20 Juergen Vigna <jug@sad.it>
6874 * src/insets/insettext.C (SetParagraphData): set insetowner on
6877 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6879 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6880 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6882 (form_main_): remove
6884 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6885 (create_form_form_main): remove FD_form_main stuff, connect to
6886 autosave_timeout signal
6888 * src/LyXView.[Ch] (getMainForm): remove
6889 (UpdateTimerCB): remove
6890 * src/BufferView_pimpl.h: inherit from SigC::Object
6892 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6893 signal instead of callback
6895 * src/BufferView.[Ch] (cursorToggleCB): remove
6897 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6899 * src/BufferView_pimpl.C: changes because of the one below
6901 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6902 instead of storing a pointer to a LyXText.
6904 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6906 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6908 * src/lyxparagraph.h
6910 * src/paragraph.C: Changed fontlist to a sorted vector.
6912 2000-06-19 Juergen Vigna <jug@sad.it>
6914 * src/BufferView.h: added screen() function.
6916 * src/insets/insettext.C (LocalDispatch): some selection code
6919 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6921 * src/insets/insettext.C (SetParagraphData):
6923 (InsetText): fixes for multiple paragraphs.
6925 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6927 * development/lyx.spec.in: Call configure with ``--without-warnings''
6928 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6929 This should be fine, however, since we generally don't want to be
6930 verbose when making an RPM.
6932 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6934 * lib/scripts/fig2pstex.py: New file
6936 2000-06-16 Juergen Vigna <jug@sad.it>
6938 * src/insets/insettabular.C (UpdateLocal):
6939 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6940 (LocalDispatch): Changed all functions to use LyXText.
6942 2000-06-15 Juergen Vigna <jug@sad.it>
6944 * src/text.C (SetHeightOfRow): call inset::update before requesting
6947 * src/insets/insettext.C (update):
6948 * src/insets/insettabular.C (update): added implementation
6950 * src/insets/lyxinset.h: added update function
6952 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6954 * src/text.C (SelectNextWord): protect against null pointers with
6955 old-style string streams. (fix from Paul Theo Gonciari
6958 * src/cite.[Ch]: remove erroneous files.
6960 * lib/configure.m4: update the list of created directories.
6962 * src/lyxrow.C: include <config.h>
6963 * src/lyxcursor.C: ditto.
6965 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6967 * lib/examples/decimal.lyx: new example file from Mike.
6969 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6970 to find template definitions (from Dekel)
6972 * src/frontends/.cvsignore: add a few things.
6974 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6976 * src/Timeout.C (TimeOut): remove default argument.
6978 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6981 * src/insets/ExternalTemplate.C: add a "using" directive.
6983 * src/lyx_main.h: remove the act_ struct, which seems unused
6986 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6988 * LyX Developers Meeting: All files changed, due to random C++ (by
6989 coincidence) code generator script.
6991 - external inset (cool!)
6992 - initial online editing of preferences
6993 - insettabular breaks insettext(s contents)
6995 - some DocBook fixes
6996 - example files update
6997 - other cool stuff, create a diff and look for yourself.
6999 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7001 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7002 -1 this is a non-line-breaking textinset.
7004 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7005 if there is no width set.
7007 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7009 * Lots of files: Merged the dialogbase branch.
7011 2000-06-09 Allan Rae <rae@lyx.org>
7013 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7014 and the Dispatch methods that used it.
7016 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7017 access to functions formerly kept in Dispatch.
7019 2000-05-19 Allan Rae <rae@lyx.org>
7021 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7022 made to_page and count_copies integers again. from_page remains a
7023 string however because I want to allow entry of a print range like
7024 "1,4,22-25" using this field.
7026 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7027 and printer-params-get. These aren't useful from the minibuffer but
7028 could be used by a script/LyXServer app provided it passes a suitable
7029 auto_mem_buffer. I guess I should take a look at how the LyXServer
7030 works and make it support xtl buffers.
7032 * sigc++/: updated to libsigc++-1.0.1
7034 * src/xtl/: updated to xtl-1.3.pl.11
7036 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7037 those changes done to the files in src/ are actually recreated when
7038 they get regenerated. Please don't ever accept a patch that changes a
7039 dialog unless that patch includes the changes to the corresponding *.fd
7042 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7043 stringOnlyContains, renamed it and generalised it.
7045 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7046 branch. Removed the remaining old form_print code.
7048 2000-04-26 Allan Rae <rae@lyx.org>
7050 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7051 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7053 2000-04-25 Allan Rae <rae@lyx.org>
7055 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7056 against a base of xtl-1.3.pl.4
7058 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7059 filter the Id: entries so they still show the xtl version number
7062 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7063 into the src/xtl code. Patch still pending with José (XTL)
7065 2000-04-24 Allan Rae <rae@lyx.org>
7067 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7068 both more generic and much safer. Use the new template functions.
7069 * src/buffer.[Ch] (Dispatch): ditto.
7071 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7072 and mem buffer more intelligently. Also a little general cleanup.
7075 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7076 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7077 * src/xtl/Makefile.am: ditto.
7078 * src/xtl/.cvsignore: ditto.
7079 * src/Makefile.am: ditto.
7081 * src/PrinterParams.h: Removed the macros member functions. Added a
7082 testInvariant member function. A bit of tidying up and commenting.
7083 Included Angus's idea for fixing operation with egcs-1.1.2.
7085 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7086 cool expansion of XTL's mem_buffer to support automatic memory
7087 management within the buffer itself. Removed the various macros and
7088 replaced them with template functions that use either auto_mem_buffer
7089 or mem_buffer depending on a #define. The mem_buffer support will
7090 disappear as soon as the auto_mem_buffer is confirmed to be good on
7091 other platforms/compilers. That is, it's there so you've got something
7094 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7095 effectively forked XTL. However I expect José will include my code
7096 into the next major release. Also fixed a memory leak.
7097 * src/xtl/text.h: ditto.
7098 * src/xtl/xdr.h: ditto.
7099 * src/xtl/giop.h: ditto.
7101 2000-04-16 Allan Rae <rae@lyx.org>
7103 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7104 by autogen.sh and removed by maintainer-clean anyway.
7105 * .cvsignore, sigc++/.cvsignore: Support the above.
7107 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7109 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7111 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7112 macros, renamed static callback-target member functions to suit new
7113 scheme and made them public.
7114 * src/frontends/xforms/forms/form_print.fd: ditto.
7115 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7117 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7120 * src/xtl/: New directory containing a minimal distribution of XTL.
7121 This is XTL-1.3.pl.4.
7123 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7125 2000-04-15 Allan Rae <rae@lyx.org>
7127 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7129 * sigc++/: Updated to libsigc++-1.0.0
7131 2000-04-14 Allan Rae <rae@lyx.org>
7133 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7134 use the generic ones in future. I'll modify my conversion script.
7136 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7138 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7139 (CloseAllBufferRelatedDialogs): Renamed.
7140 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7142 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7143 of the generic ones. These are the same ones my conversion script
7146 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7147 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7148 * src/buffer.C (Dispatch): ditto
7150 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7151 functions for updating and hiding buffer dependent dialogs.
7152 * src/BufferView.C (buffer): ditto
7153 * src/buffer.C (setReadonly): ditto
7154 * src/lyxfunc.C (CloseBuffer): ditto
7156 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7157 Dialogs.h, and hence all the SigC stuff, into every file that includes
7158 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7160 * src/BufferView2.C: reduce the number of headers included by buffer.h
7162 2000-04-11 Allan Rae <rae@lyx.org>
7164 * src/frontends/xforms/xform_macros.h: A small collection of macros
7165 for building C callbacks.
7167 * src/frontends/xforms/Makefile.am: Added above file.
7169 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7170 scheme again. This time it should work for JMarc. If this is
7171 successful I'll revise my conversion script to automate some of this.
7172 The static member functions in the class also have to be public for
7173 this scheme will work. If the scheme works (it's almost identical to
7174 the way BufferView::cursorToggleCB is handled so it should work) then
7175 FormCopyright and FormPrint will be ready for inclusion into the main
7176 trunk immediately after 1.1.5 is released -- provided we're prepared
7177 for complaints about lame compilers not handling XTL.
7179 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7181 2000-04-07 Allan Rae <rae@lyx.org>
7183 * config/lyxinclude.m4: A bit more tidying up (Angus)
7185 * src/LString.h: JMarc's <string> header fix
7187 * src/PrinterParams.h: Used string for most data to remove some
7188 ugly code in the Print dialog and avoid even uglier code when
7189 appending the ints to a string for output.
7191 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7192 and moved "default:" back to the end of switch statement. Cleaned
7193 up the printing so it uses the right function calls and so the
7194 "print to file" option actually puts the file in the right directory.
7196 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7198 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7199 and Ok+Apply button control into a separate method: input (Angus).
7200 (input) Cleaned it up and improved it to be very thorough now.
7201 (All CB) static_cast used instead of C style cast (Angus). This will
7202 probably change again once we've worked out how to keep gcc-2.8.1 happy
7203 with real C callbacks.
7204 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7205 ignore some of the bool settings and has random numbers instead. Needs
7206 some more investigation. Added other input length checks and checking
7207 of file and printer names.
7209 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7210 would link (Angus). Seems the old code doesn't compile with the pragma
7211 statement either. Separated callback entries from internal methods.
7213 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7215 2000-03-17 Allan Rae <rae@lyx.org>
7217 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7218 need it? Maybe it could go in Dialogs instead? I could make it a
7219 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7220 values to get the bool return value.
7221 (Dispatch): New overloaded method for xtl support.
7223 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7224 extern "C" callback instead of static member functions. Hopefully,
7225 JMarc will be able to compile this. I haven't changed
7226 forms/form_copyright.fd yet. Breaking one of my own rules already.
7228 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7229 because they aren't useful from the minibuffer. Maybe a LyXServer
7230 might want a help message though?
7232 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7234 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7235 xtl which needs both rtti and exceptions.
7237 * src/support/Makefile.am:
7238 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7240 * src/frontends/xforms/input_validators.[ch]: input filters and
7241 validators. These conrol what keys are valid in input boxes.
7242 Use them and write some more. Much better idea than waiting till
7243 after the user has pressed Ok to say that the input fields don't make
7246 * src/frontends/xforms/Makefile.am:
7247 * src/frontends/xforms/forms/form_print.fd:
7248 * src/frontends/xforms/forms/makefile:
7249 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7250 new scheme. Still have to make sure I haven't missed anything from
7251 the current implementation.
7253 * src/Makefile.am, src/PrinterParams.h: New data store.
7255 * other files: Added a couple of copyright notices.
7257 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7259 * src/insets/insetbib.h: move Holder struct in public space.
7261 * src/frontends/include/DialogBase.h: use SigC:: only when
7262 SIGC_CXX_NAMESPACES is defined.
7263 * src/frontends/include/Dialogs.h: ditto.
7265 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7267 * src/frontends/xforms/FormCopyright.[Ch]: do not
7268 mention SigC:: explicitely.
7270 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7272 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7273 deals with testing KDE in main configure.in
7274 * configure.in: ditto.
7276 2000-02-22 Allan Rae <rae@lyx.org>
7278 * Lots of files: Merged from HEAD
7280 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7281 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7283 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7285 * sigc++/: new minidist.
7287 2000-02-14 Allan Rae <rae@lyx.org>
7289 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7291 2000-02-08 Juergen Vigna <jug@sad.it>
7293 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7294 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7296 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7297 for this port and so it is much easier for other people to port
7298 dialogs in a common development environment.
7300 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7301 the QT/KDE implementation.
7303 * src/frontends/kde/Dialogs.C:
7304 * src/frontends/kde/FormCopyright.C:
7305 * src/frontends/kde/FormCopyright.h:
7306 * src/frontends/kde/Makefile.am:
7307 * src/frontends/kde/formcopyrightdialog.C:
7308 * src/frontends/kde/formcopyrightdialog.h:
7309 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7310 for the kde support of the Copyright-Dialog.
7312 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7313 subdir-substitution instead of hardcoded 'xforms' as we now have also
7316 * src/frontends/include/DialogBase.h (Object): just commented the
7317 label after #endif (nasty warning and I don't like warnings ;)
7319 * src/main.C (main): added KApplication initialization if using
7322 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7323 For now only the KDE event-loop is added if frontend==kde.
7325 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7327 * configure.in: added support for the --with-frontend[=value] option
7329 * autogen.sh: added kde.m4 file to list of config-files
7331 * acconfig.h: added define for KDEGUI-support
7333 * config/kde.m4: added configuration functions for KDE-port
7335 * config/lyxinclude.m4: added --with-frontend[=value] option with
7336 support for xforms and KDE.
7338 2000-02-08 Allan Rae <rae@lyx.org>
7340 * all Makefile.am: Fixed up so the make targets dist, distclean,
7341 install and uninstall all work even if builddir != srcdir. Still
7342 have a new sigc++ minidist update to come.
7344 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7346 2000-02-01 Allan Rae <rae@lyx.org>
7348 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7349 Many mods to get builddir != srcdir working.
7351 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7352 for building on NT and so we can do the builddir != srcdir stuff.
7354 2000-01-30 Allan Rae <rae@lyx.org>
7356 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7357 This will stay in "rae" branch. We probably don't really need it in
7358 the main trunk as anyone who wants to help programming it should get
7359 a full library installed also. So they can check both included and
7360 system supplied library compilation.
7362 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7363 Added a 'mini' distribution of libsigc++. If you feel the urge to
7364 change something in these directories - Resist it. If you can't
7365 resist the urge then you should modify the following script and rebuild
7366 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7367 all happen. Still uses a hacked version of libsigc++'s configure.in.
7368 I'm quite happy with the results. I'm not sure the extra work to turn
7369 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7370 worth the trouble and would probably lead to extra maintenance
7372 I haven't tested the following important make targets: install, dist.
7373 Not ready for prime time but very close. Maybe 1.1.5.
7375 * development/tools/makeLyXsigc.sh: A shell script to automatically
7376 generate our mini-dist of libsigc++. It can only be used with a CVS
7377 checkout of libsigc++ not a tarball distribution. It's well commented.
7378 This will end up as part of the libsigc++ distribution so other apps
7379 can easily have an included mini-dist. If someone makes mods to the
7380 sigc++ subpackage without modifying this script to generate those
7381 changes I'll be very upset!
7383 * src/frontends/: Started the gui/system indep structure.
7385 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7386 to access the gui-indep dialogs are in this class. Much improved
7387 design compared to previous revision. Lars, please refrain from
7388 moving this header into src/ like you did with Popups.h last time.
7390 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7392 * src/frontends/xforms/: Started the gui-indep system with a single
7393 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7396 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7397 Here you'll find a very useful makefile and automated fdfix.sh that
7398 makes updating dailogs a no-brainer -- provided you follow the rules
7399 set out in the README. I'm thinking about adding another script to
7400 automatically generate skeleton code for a new dialog given just the
7403 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7404 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7405 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7407 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7409 * src/support/LSubstring.C (operator): simplify
7411 * src/lyxtext.h: removed bparams, use buffer_->params instead
7413 * src/lyxrow.h: make Row a real class, move all variables to
7414 private and use accessors.
7416 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7418 (isRightToLeftPar): ditto
7419 (ChangeLanguage): ditto
7420 (isMultiLingual): ditto
7423 (SimpleTeXOnePar): ditto
7424 (TeXEnvironment): ditto
7425 (GetEndLabel): ditto
7427 (SetOnlyLayout): ditto
7428 (BreakParagraph): ditto
7429 (BreakParagraphConservative): ditto
7430 (GetFontSettings): ditto
7432 (CopyIntoMinibuffer): ditto
7433 (CutIntoMinibuffer): ditto
7434 (PasteParagraph): ditto
7435 (SetPExtraType): ditto
7436 (UnsetPExtraType): ditto
7437 (DocBookContTableRows): ditto
7438 (SimpleDocBookOneTablePar): ditto
7440 (TeXFootnote): ditto
7441 (SimpleTeXOneTablePar): ditto
7442 (TeXContTableRows): ditto
7443 (SimpleTeXSpecialChars): ditto
7446 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7447 to private and use accessors.
7449 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7450 this, we did not use it anymore and has not been for ages. Just a
7451 waste of cpu cycles.
7453 * src/language.h: make Language a real class, move all variables
7454 to private and use accessors.
7456 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7457 (create_view): remove
7458 (update): some changes for new timer
7459 (cursorToggle): use new timer
7460 (beforeChange): change for new timer
7462 * src/BufferView.h (cursorToggleCB): removed last paramter because
7465 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7466 (cursorToggleCB): change because of new timer code
7468 * lib/CREDITS: updated own mailaddress
7470 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7472 * src/support/filetools.C (PutEnv): fix the code in case neither
7473 putenv() nor setenv() have been found.
7475 * INSTALL: mention the install-strip Makefile target.
7477 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7478 read-only documents.
7480 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7482 * lib/reLyX/configure.in (VERSION): avoid using a previously
7483 generated reLyX wrapper to find out $prefix.
7485 * lib/examples/eu_adibide_lyx-atua.lyx:
7486 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7487 translation of the Tutorial (Dooteo)
7489 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7491 * forms/cite.fd: new citation dialog
7493 * src/insetcite.[Ch]: the new citation dialog is moved into
7496 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7499 * src/insets/insetcommand.h: data members made private.
7501 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7503 * LyX 1.1.5 released
7505 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7507 * src/version.h (LYX_RELEASE): to 1.1.5
7509 * src/spellchecker.C (RunSpellChecker): return false if the
7510 spellchecker dies upon creation.
7512 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7514 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7515 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7519 * lib/CREDITS: update entry for Martin Vermeer.
7521 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7523 * src/text.C (draw): Draw foreign language bars at the bottom of
7524 the row instead of at the baseline.
7526 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7528 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7530 * lib/bind/de_menus.bind: updated
7532 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7534 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7536 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7538 * src/menus.C (Limit_string_length): New function
7539 (ShowTocMenu): Limit the number of items/length of items in the
7542 * src/paragraph.C (String): Correct result for a paragraph inside
7545 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7547 * src/bufferlist.C (close): test of buf->getuser() == NULL
7549 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7551 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7552 Do not call to SetCursor when the paragraph is a closed footnote!
7554 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7556 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7559 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7561 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7564 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7565 reference popup, that activates the reference-back action
7567 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7569 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7570 the menus. Also fixed a bug.
7572 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7573 the math panels when switching buffers (unless new buffer is readonly).
7575 * src/BufferView.C (NoSavedPositions)
7576 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7578 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7580 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7581 less of dvi dirty or not.
7583 * src/trans_mgr.[Ch] (insert): change first parameter to string
7586 * src/chset.[Ch] (encodeString): add const to first parameter
7588 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7590 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7594 * src/LaTeX.C (deplog): better searching for dependency files in
7595 the latex log. Uses now regexps.
7597 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7598 instead of the box hack or \hfill.
7600 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7602 * src/lyxfunc.C (doImportHelper): do not create the file before
7603 doing the actual import.
7604 (doImportASCIIasLines): create a new file before doing the insert.
7605 (doImportASCIIasParagraphs): ditto.
7607 * lib/lyxrc.example: remove mention of non-existing commands
7609 * lyx.man: remove mention of color-related switches.
7611 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7613 * src/lyx_gui.C: remove all the color-related ressources, which
7614 are not used anymore.
7616 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7619 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7621 * src/lyxrc.C (read): Add a missing break in the switch
7623 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7625 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7627 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7630 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7632 * src/text.C (draw): draw bars under foreign language words.
7634 * src/LColor.[Ch]: add LColor::language
7636 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7638 * src/lyxcursor.h (boundary): New member variable
7640 * src/text.C (IsBoundary): New methods
7642 * src/text.C: Use the above for currect cursor movement when there
7643 is both RTL & LTR text.
7645 * src/text2.C: ditto
7647 * src/bufferview_funcs.C (ToggleAndShow): ditto
7649 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7651 * src/text.C (DeleteLineForward): set selection to true to avoid
7652 that DeleteEmptyParagraphMechanism does some magic. This is how it
7653 is done in all other functions, and seems reasonable.
7654 (DeleteWordForward): do not jump over non-word stuff, since
7655 CursorRightOneWord() already does it.
7657 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7658 DeleteWordBackward, since they seem safe to me (since selection is
7659 set to "true") DeleteEmptyParagraphMechanism does nothing.
7661 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7663 * src/lyx_main.C (easyParse): simplify the code by factoring the
7664 part that removes parameters from the command line.
7665 (LyX): check wether wrong command line options have been given.
7667 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7669 * src/lyx_main.C : add support for specifying user LyX
7670 directory via command line option -userdir.
7672 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7674 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7675 the number of items per popup.
7676 (Add_to_refs_menu): Ditto.
7678 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7680 * src/lyxparagraph.h: renamed ClearParagraph() to
7681 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7682 textclass as parameter, and do nothing if free_spacing is
7683 true. This fixes part of the line-delete-forward problems.
7685 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7686 (pasteSelection): ditto.
7687 (SwitchLayoutsBetweenClasses): more translatable strings.
7689 * src/text2.C (CutSelection): use StripLeadingSpaces.
7690 (PasteSelection): ditto.
7691 (DeleteEmptyParagraphMechanism): ditto.
7693 2000-05-26 Juergen Vigna <jug@sad.it>
7695 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7696 is not needed in tabular insets.
7698 * src/insets/insettabular.C (TabularFeatures): added missing features.
7700 * src/tabular.C (DeleteColumn):
7702 (AppendRow): implemented this functions
7703 (cellsturct::operator=): clone the inset too;
7705 2000-05-23 Juergen Vigna <jug@sad.it>
7707 * src/insets/insettabular.C (LocalDispatch): better selection support
7708 when having multicolumn-cells.
7710 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7712 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7714 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7716 * src/ColorHandler.C (getGCForeground): put more test into _()
7718 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7721 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7724 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7726 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7727 there are no labels, or when buffer is readonly.
7729 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7730 there are no labels, buffer is SGML, or when buffer is readonly.
7732 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7734 * src/LColor.C (LColor): change a couple of grey40 to grey60
7735 (LColor): rewore initalization to make compiles go some magnitude
7737 (getGUIName): don't use gettext until we need the string.
7739 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7741 * src/Bullet.[Ch]: Fixed a small bug.
7743 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7745 * src/paragraph.C (String): Several fixes/improvements
7747 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7749 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7751 * src/paragraph.C (String): give more correct output.
7753 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7755 * src/lyxfont.C (stateText) Do not output the language if it is
7756 eqaul to the language of the document.
7758 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7759 between two paragraphs with the same language.
7761 * src/paragraph.C (getParLanguage) Return a correct answer for an
7762 empty dummy paragraph.
7764 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7767 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7770 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7771 the menus/popup, if requested fonts are unavailable.
7773 2000-05-22 Juergen Vigna <jug@sad.it>
7775 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7776 movement support (Up/Down/Tab/Shift-Tab).
7777 (LocalDispatch): added also preliminari cursor-selection.
7779 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7781 * src/paragraph.C (PasteParagraph): Hopefully now right!
7783 2000-05-22 Garst R. Reese <reese@isn.net>
7785 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7786 of list, change all references to Environment to Command
7787 * tex/hollywood.cls : rewrite environments as commands, add
7788 \uppercase to interiorshot and exteriorshot to force uppecase.
7789 * tex/broadway.cls : rewrite environments as commands. Tweak
7792 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7794 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7795 size of items: use a constant intead of the hardcoded 40, and more
7796 importantly do not remove the %m and %x tags added at the end.
7797 (Add_to_refs_menu): use vector::size_type instead of
7798 unsigned int as basic types for the variables. _Please_ do not
7799 assume that size_t is equal to unsigned int. On an alpha, this is
7800 unsigned long, which is _not_ the same.
7802 * src/language.C (initL): remove language "hungarian", since it
7803 seems that "magyar" is better.
7805 2000-05-22 Juergen Vigna <jug@sad.it>
7807 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7809 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7812 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7813 next was deleted but not set to 0.
7815 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7817 * src/language.C (initL): change the initialization of languages
7818 so that compiles goes _fast_.
7820 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7823 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7825 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7829 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7831 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7833 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7837 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7840 * src/insets/insetlo*.[Ch]: Made editable
7842 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7844 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7845 the current selection.
7847 * src/BufferView_pimpl.C (stuffClipboard): new method
7849 * src/BufferView.C (stuffClipboard): new method
7851 * src/paragraph.C (String): new method
7853 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7854 LColor::ignore when lyxname is not found.
7856 * src/BufferView.C (pasteSelection): new method
7858 * src/BufferView_pimpl.C (pasteSelection): new method
7860 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7862 * src/WorkArea.C (request_clipboard_cb): new static function
7863 (getClipboard): new method
7864 (putClipboard): new method
7866 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7868 * LyX 1.1.5pre2 released
7870 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7872 * src/vspace.C (operator=): removed
7873 (operator=): removed
7875 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7877 * src/layout.C (NumberOfClass): manually set the type in make_pair
7878 (NumberOfLayout): ditto
7880 * src/language.C: use the Language constructor for ignore_lang
7882 * src/language.h: add constructors to struct Language
7884 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7886 * src/text2.C (SetCursorIntern): comment out #warning
7888 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7890 * src/mathed/math_iter.h: initialize sx and sw to 0
7892 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7894 * forms/lyx.fd: Redesign of form_ref
7896 * src/LaTeXFeatures.[Ch]
7900 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7903 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7904 and Buffer::inset_iterator.
7906 * src/menus.C: Added new menus: TOC and Refs.
7908 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7910 * src/buffer.C (getTocList): New method.
7912 * src/BufferView2.C (ChangeRefs): New method.
7914 * src/buffer.C (getLabelList): New method. It replaces the old
7915 getReferenceList. The return type is vector<string> instead of
7918 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7919 the old getLabel() and GetNumberOfLabels() methods.
7920 * src/insets/insetlabel.C (getLabelList): ditto
7921 * src/mathed/formula.C (getLabelList): ditto
7923 * src/paragraph.C (String): New method.
7925 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7926 Uses the new getTocList() method.
7927 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7928 which automatically updates the contents of the browser.
7929 (RefUpdateCB): Use the new getLabelList method.
7931 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7933 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7935 * src/spellchecker.C: Added using std::reverse;
7937 2000-05-19 Juergen Vigna <jug@sad.it>
7939 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7941 * src/insets/insettext.C (computeTextRows): small fix for display of
7942 1 character after a newline.
7944 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7947 2000-05-18 Juergen Vigna <jug@sad.it>
7949 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7950 when changing width of column.
7952 * src/tabular.C (set_row_column_number_info): setting of
7953 autobreak rows if necessary.
7955 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7957 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7959 * src/vc-backend.*: renamed stat() to status() and vcstat to
7960 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7961 compilation broke. The new name seems more relevant, anyway.
7963 2000-05-17 Juergen Vigna <jug@sad.it>
7965 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7966 which was wrong if the removing caused removing of rows!
7968 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7969 (pushToken): new function.
7971 * src/text2.C (CutSelection): fix problem discovered with purify
7973 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7975 * src/debug.C (showTags): enlarge the first column, now that we
7976 have 6-digits debug codes.
7978 * lib/layouts/hollywood.layout:
7979 * lib/tex/hollywood.cls:
7980 * lib/tex/brodway.cls:
7981 * lib/layouts/brodway.layout: more commands and fewer
7982 environments. Preambles moved in the .cls files. Broadway now has
7983 more options on scene numbering and less whitespace (from Garst)
7985 * src/insets/insetbib.C (getKeys): make sure that we are in the
7986 document directory, in case the bib file is there.
7988 * src/insets/insetbib.C (Latex): revert bogus change.
7990 2000-05-16 Juergen Vigna <jug@sad.it>
7992 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7993 the TabularLayout on cursor move.
7995 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7997 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8000 (draw): fixed cursor position and drawing so that the cursor is
8001 visible when before the tabular-inset.
8003 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8004 when creating from old insettext.
8006 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8008 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8010 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8011 * lib/tex/brodway.cls: ditto
8013 * lib/layouts/brodway.layout: change alignment of parenthical
8016 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8018 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8019 versions 0.88 and 0.89 are supported.
8021 2000-05-15 Juergen Vigna <jug@sad.it>
8023 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8026 * src/insets/insettext.C (computeTextRows): redone completely this
8027 function in a much cleaner way, because of problems when having a
8029 (draw): added a frame border when the inset is locked.
8030 (SetDrawLockedFrame): this sets if we draw the border or not.
8031 (SetFrameColor): this sets the frame color (default=insetframe).
8033 * src/insets/lyxinset.h: added x() and y() functions which return
8034 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8035 function which is needed to see if we have a locking inset of some
8036 type in this inset (needed for now in insettabular).
8038 * src/vspace.C (inPixels): the same function also without a BufferView
8039 parameter as so it is easier to use it in some ocasions.
8041 * src/lyxfunc.C: changed all places where insertInset was used so
8042 that now if it couldn't be inserted it is deleted!
8044 * src/TabularLayout.C:
8045 * src/TableLayout.C: added support for new tabular-inset!
8047 * src/BufferView2.C (insertInset): this now returns a bool if the
8048 inset was really inserted!!!
8050 * src/tabular.C (GetLastCellInRow):
8051 (GetFirstCellInRow): new helper functions.
8052 (Latex): implemented for new tabular class.
8056 (TeXTopHLine): new Latex() helper functions.
8058 2000-05-12 Juergen Vigna <jug@sad.it>
8060 * src/mathed/formulamacro.C (Read):
8061 * src/mathed/formula.C (Read): read also the \end_inset here!
8063 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8065 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8066 crush when saving formulae with unbalanced parenthesis.
8068 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8070 * src/layout.C: Add new keyword "endlabelstring" to layout file
8072 * src/text.C (GetVisibleRow): Draw endlabel string.
8074 * lib/layouts/broadway.layout
8075 * lib/layouts/hollywood.layout: Added endlabel for the
8076 Parenthetical layout.
8078 * lib/layouts/heb-article.layout: Do not use slanted font shape
8079 for Theorem like environments.
8081 * src/buffer.C (makeLaTeXFile): Always add "american" to
8082 the UsedLanguages list if document language is RTL.
8084 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8086 * add addendum to README.OS2 and small patch (from SMiyata)
8088 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8090 * many files: correct the calls to ChangeExtension().
8092 * src/support/filetools.C (ChangeExtension): remove the no_path
8093 argument, which does not belong there. Use OnlyFileName() instead.
8095 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8096 files when LaTeXing a non-nice latex file.
8098 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8099 a chain of "if". Return false when deadkeys are not handled.
8101 * src/lyx_main.C (LyX): adapted the code for default bindings.
8103 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8104 bindings for basic functionality (except deadkeys).
8105 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8107 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8108 several methods: handle override_x_deadkeys.
8110 * src/lyxrc.h: remove the "bindings" map, which did not make much
8111 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8113 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8115 * src/lyxfont.C (stateText): use a saner method to determine
8116 whether the font is "default". Seems to fix the crash with DEC
8119 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8121 2000-05-08 Juergen Vigna <jug@sad.it>
8123 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8124 TabularLayoutMenu with mouse-button-3
8125 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8127 * src/TabularLayout.C: added this file for having a Layout for
8130 2000-05-05 Juergen Vigna <jug@sad.it>
8132 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8133 recalculating inset-widths.
8134 (TabularFeatures): activated this function so that I can change
8135 tabular-features via menu.
8137 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8138 that I can test some functions with the Table menu.
8140 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8142 * src/lyxfont.C (stateText): guard against stupid c++libs.
8144 * src/tabular.C: add using std::vector
8145 some whitespace changes, + removed som autogenerated code.
8147 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8149 2000-05-05 Juergen Vigna <jug@sad.it>
8151 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8152 row, columns and cellstructures.
8154 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8156 * lib/lyxrc.example: remove obsolete entries.
8158 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8159 reading of protected_separator for free_spacing.
8161 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8163 * src/text.C (draw): do not display an exclamation mark in the
8164 margin for margin notes. This is confusing, ugly and
8167 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8168 AMS math' is checked.
8170 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8171 name to see whether including the amsmath package is needed.
8173 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8175 * src/paragraph.C (validate): Compute UsedLanguages correctly
8176 (don't insert the american language if it doesn't appear in the
8179 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8180 The argument of \thanks{} command is considered moving argument
8182 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8185 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8187 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8188 for appendix/minipage/depth. The lines can be now both in the footnote
8189 frame, and outside the frame.
8191 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8194 2000-05-05 Juergen Vigna <jug@sad.it>
8196 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8197 neede only in tabular.[Ch].
8199 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8201 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8203 (Write): write '~' for PROTECTED_SEPARATOR
8205 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8207 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8210 * src/mathed/formula.C (drawStr): rename size to siz.
8212 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8213 possibly fix a bug by not changing the pflags = flags to piflags =
8216 2000-05-05 Juergen Vigna <jug@sad.it>
8218 * src/insets/insetbib.C: moved using directive
8220 * src/ImportNoweb.C: small fix for being able to compile (missing
8223 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8225 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8226 to use clear, since we don't depend on this in the code. Add test
8229 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8231 * (various *.C files): add using std::foo directives to please dec
8234 * replace calls to string::clear() to string::erase() (Angus)
8236 * src/cheaders/cmath: modified to provide std::abs.
8238 2000-05-04 Juergen Vigna <jug@sad.it>
8240 * src/insets/insettext.C: Prepared all for inserting of multiple
8241 paragraphs. Still display stuff to do (alignment and other things),
8242 but I would like to use LyXText to do this when we cleaned out the
8243 table-support stuff.
8245 * src/insets/insettabular.C: Changed lot of stuff and added lots
8246 of functionality still a lot to do.
8248 * src/tabular.C: Various functions changed name and moved to be
8249 const functions. Added new Read and Write functions and changed
8250 lots of things so it works good with tabular-insets (also removed
8251 some stuff which is not needed anymore * hacks *).
8253 * src/lyxcursor.h: added operators == and != which just look if
8254 par and pos are (not) equal.
8256 * src/buffer.C (latexParagraphs): inserted this function to latex
8257 all paragraphs form par to endpar as then I can use this too for
8260 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8261 so that I can call this to from text insets with their own cursor.
8263 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8264 output off all paragraphs (because of the fix below)!
8266 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8267 the very last paragraph (this could be also the last paragraph of an
8270 * src/texrow.h: added rows() call which returns the count-variable.
8272 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8274 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8276 * lib/configure.m4: better autodetection of DocBook tools.
8278 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8280 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8282 * src/lyx_cb.C: add using std::reverse;
8284 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8287 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8288 selected files. Should fix repeated errors from generated files.
8290 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8292 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8294 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8295 the spellchecker popup.
8297 * lib/lyxrc.example: Removed the \number_inset section
8299 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8301 * src/insets/figinset.C (various): Use IsFileReadable() to make
8302 sure that the file actually exist. Relying on ghostscripts errors
8303 is a bad idea since they can lead to X server crashes.
8305 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8307 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8310 * lib/lyxrc.example: smallish typo in description of
8311 \view_dvi_paper_option
8313 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8316 * src/lyxfunc.C: doImportHelper to factor out common code of the
8317 various import methods. New functions doImportASCIIasLines,
8318 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8319 doImportLinuxDoc for the format specific parts.
8322 * buffer.C: Dispatch returns now a bool to indicate success
8325 * lyx_gui.C: Add getLyXView() for member access
8327 * lyx_main.C: Change logic for batch commands: First try
8328 Buffer::Dispatch (possibly without GUI), if that fails, use
8331 * lyx_main.C: Add support for --import command line switch.
8332 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8333 Available Formats: Everything accepted by 'buffer-import <format>'
8335 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8337 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8340 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8341 documents will be reformatted upon reentry.
8343 2000-04-27 Juergen Vigna <jug@sad.it>
8345 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8346 correctly only last pos this was a bug.
8348 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8350 * release of lyx-1.1.5pre1
8352 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8354 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8356 * src/menus.C: revert the change of naming (Figure->Graphic...)
8357 from 2000-04-11. It was incomplete and bad.
8359 * src/LColor.[Ch]: add LColor::depthbar.
8360 * src/text.C (GetVisibleRow): use it.
8362 * README: update the languages list.
8364 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8366 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8369 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8371 * README: remove sections that were just wrong.
8373 * src/text2.C (GetRowNearY): remove currentrow code
8375 * src/text.C (GetRow): remove currentrow code
8377 * src/screen.C (Update): rewritten a bit.
8378 (SmallUpdate): removed func
8380 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8382 (FullRebreak): return bool
8383 (currentrow): remove var
8384 (currentrow_y): ditto
8386 * src/lyxscreen.h (Draw): change arg to unsigned long
8387 (FitCursor): return bool
8388 (FitManualCursor): ditto
8389 (Smallpdate): remove func
8390 (first): change to unsigned long
8391 (DrawOneRow): change second arg to long (from long &)
8392 (screen_refresh_y): remove var
8393 (scree_refresh_row): ditto
8395 * src/lyxrow.h: change baseline to usigned int from unsigned
8396 short, this brings some implicit/unsigned issues out in the open.
8398 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8400 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8401 instead of smallUpdate.
8403 * src/lyxcursor.h: change y to unsigned long
8405 * src/buffer.h: don't call updateScrollbar after fitcursor
8407 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8408 where they are used. Removed "\\direction", this was not present
8409 in 1.1.4 and is already obsolete. Commented out some code that I
8410 believe to never be called.
8411 (runLiterate): don't call updateScrollbar after fitCursor
8413 (buildProgram): ditto
8416 * src/WorkArea.h (workWidth): change return val to unsigned
8419 (redraw): remove the button redraws
8420 (setScrollbarValue): change for scrollbar
8421 (getScrollbarValue): change for scrollbar
8422 (getScrollbarBounds): change for scrollbar
8424 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8425 (C_WorkArea_down_cb): removed func
8426 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8427 (resize): change for scrollbar
8428 (setScrollbar): ditto
8429 (setScrollbarBounds): ditto
8430 (setScrollbarIncrements): ditto
8431 (up_cb): removed func
8432 (down_cb): removed func
8433 (scroll_cb): change for scrollbar
8434 (work_area_handler): ditto
8436 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8437 when FitCursor did something.
8438 (updateScrollbar): some unsigned changes
8439 (downCB): removed func
8440 (scrollUpOnePage): removed func
8441 (scrollDownOnePage): remvoed func
8442 (workAreaMotionNotify): don't call screen->FitCursor but use
8443 fitCursor instead. and bool return val
8444 (workAreaButtonPress): ditto
8445 (workAreaButtonRelease): some unsigned changes
8446 (checkInsetHit): ditto
8447 (workAreaExpose): ditto
8448 (update): parts rewritten, comments about the signed char arg added
8449 (smallUpdate): removed func
8450 (cursorPrevious): call needed updateScrollbar
8453 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8456 * src/BufferView.[Ch] (upCB): removed func
8457 (downCB): removed func
8458 (smallUpdate): removed func
8460 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8462 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8463 currentrow, currentrow_y optimization. This did not help a lot and
8464 if we want to do this kind of optimization we should rather use
8465 cursor.row instead of the currentrow.
8467 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8468 buffer spacing and klyx spacing support.
8470 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8472 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8475 2000-04-26 Juergen Vigna <jug@sad.it>
8477 * src/insets/figinset.C: fixes to Lars sstream changes!
8479 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8481 * A lot of files: Added Ascii(ostream &) methods to all inset
8482 classes. Used when exporting to ASCII.
8484 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8485 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8488 * src/text2.C (ToggleFree): Disabled implicit word selection when
8489 there is a change in the language
8491 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8492 no output was generated for end-of-sentence inset.
8494 * src/insets/lyxinset.h
8497 * src/paragraph.C: Removed the insetnumber code
8499 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8501 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8503 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8504 no_babel and no_epsfig completely from the file.
8505 (parseSingleLyXformat2Token): add handling for per-paragraph
8506 spacing as written by klyx.
8508 * src/insets/figinset.C: applied patch by Andre. Made it work with
8511 2000-04-20 Juergen Vigna <jug@sad.it>
8513 * src/insets/insettext.C (cutSelection):
8514 (copySelection): Fixed with selection from right to left.
8515 (draw): now the rows are not recalculated at every draw.
8516 (computeTextRows): for now reset the inset-owner here (this is
8517 important for an undo or copy where the inset-owner is not set
8520 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8521 motion to the_locking_inset screen->first was forgotten, this was
8522 not important till we got multiline insets.
8524 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8526 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8527 code seems to be alright (it is code changed by Dekel, and the
8528 intent is indeed that all macros should be defined \protect'ed)
8530 * NEWS: a bit of reorganisation of the new user-visible features.
8532 2000-04-19 Juergen Vigna <jug@sad.it>
8534 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8535 position. Set the inset_owner of the used paragraph so that it knows
8536 that it is inside an inset. Fixed cursor handling with mouse and
8537 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8538 and cleanups to make TextInsets work better.
8540 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8541 Changed parameters of various functions and added LockInsetInInset().
8543 * src/insets/insettext.C:
8545 * src/insets/insetcollapsable.h:
8546 * src/insets/insetcollapsable.C:
8547 * src/insets/insetfoot.h:
8548 * src/insets/insetfoot.C:
8549 * src/insets/insetert.h:
8550 * src/insets/insetert.C: cleaned up the code so that it works now
8551 correctly with insettext.
8553 * src/insets/inset.C:
8554 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8555 that insets in insets are supported right.
8558 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8560 * src/paragraph.C: some small fixes
8562 * src/debug.h: inserted INSETS debug info
8564 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8565 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8567 * src/commandtags.h:
8568 * src/LyXAction.C: insert code for InsetTabular.
8570 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8571 not Button1MotionMask.
8572 (workAreaButtonRelease): send always a InsetButtonRelease event to
8574 (checkInsetHit): some setCursor fixes (always with insets).
8576 * src/BufferView2.C (lockInset): returns a bool now and extended for
8577 locking insets inside insets.
8578 (showLockedInsetCursor): it is important to have the cursor always
8579 before the locked inset.
8580 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8582 * src/BufferView.h: made lockInset return a bool.
8584 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8586 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8587 that is used also internally but can be called as public to have back
8588 a cursor pos which is not set internally.
8589 (SetCursorIntern): Changed to use above function.
8591 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8593 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8598 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8599 patches for things that should be in or should be changed.
8601 * src/* [insetfiles]: change "usigned char fragile" to bool
8602 fragile. There was only one point that could that be questioned
8603 and that is commented in formulamacro.C. Grep for "CHECK".
8605 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8606 (DeleteBuffer): take it out of CutAndPaste and make it static.
8608 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8610 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8611 output the spacing envir commands. Also the new commands used in
8612 the LaTeX output makes the result better.
8614 * src/Spacing.C (writeEnvirBegin): new method
8615 (writeEnvirEnd): new method
8617 2000-04-18 Juergen Vigna <jug@sad.it>
8619 * src/CutAndPaste.C: made textclass a static member of the class
8620 as otherwise it is not accesed right!!!
8622 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8624 * forms/layout_forms.fd
8625 * src/layout_forms.h
8626 * src/layout_forms.C (create_form_form_character)
8627 * src/lyx_cb.C (UserFreeFont)
8628 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8629 documents (in the layout->character popup).
8631 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8633 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8634 \spell_command was in fact not honored (from Kevin Atkinson).
8636 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8639 * src/lyx_gui.h: make lyxViews private (Angus)
8641 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8643 * src/mathed/math_write.C
8644 (MathMatrixInset::Write) Put \protect before \begin{array} and
8645 \end{array} if fragile
8646 (MathParInset::Write): Put \protect before \\ if fragile
8648 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8650 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8651 initialization if the LyXColorHandler must be done after the
8652 connections to the XServer has been established.
8654 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8655 get the background pixel from the lyxColorhandler so that the
8656 figures are rendered with the correct background color.
8657 (NextToken): removed functions.
8658 (GetPSSizes): use ifs >> string instead of NextToken.
8660 * src/Painter.[Ch]: the color cache moved out of this file.
8662 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8665 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8667 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8668 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8670 * src/BufferView.C (enterView): new func
8671 (leaveView): new func
8673 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8675 (leaveView): new func, undefines xterm cursor when approp.
8677 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8678 (AllowInput): delete the Workarea cursor handling from this func.
8680 * src/Painter.C (underline): draw a slimer underline in most cases.
8682 * src/lyx_main.C (error_handler): use extern "C"
8684 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8686 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8687 sent directly to me.
8689 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8690 to the list by Dekel.
8692 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8695 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8696 methods from lyx_cb.here.
8698 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8701 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8703 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8704 instead of using current_view directly.
8706 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8708 * src/LyXAction.C (init): add the paragraph-spacing command.
8710 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8712 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8714 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8715 different from the documents.
8717 * src/text.C (SetHeightOfRow): take paragraph spacing into
8718 account, paragraph spacing takes precedence over buffer spacing
8719 (GetVisibleRow): ditto
8721 * src/paragraph.C (writeFile): output the spacing parameter too.
8722 (validate): set the correct features if spacing is used in the
8724 (Clear): set spacing to default
8725 (MakeSameLayout): spacing too
8726 (HasSameLayout): spacing too
8727 (SetLayout): spacing too
8728 (TeXOnePar): output the spacing commands
8730 * src/lyxparagraph.h: added a spacing variable for use with
8731 per-paragraph spacing.
8733 * src/Spacing.h: add a Default spacing and a method to check if
8734 the current spacing is default. also added an operator==
8736 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8739 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8741 * src/lyxserver.C (callback): fix dispatch of functions
8743 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8744 printf() into lyxerr call.
8746 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8749 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8750 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8751 the "Float" from each of the subitems.
8752 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8754 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8755 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8756 documented the change so that the workaround can be nuked later.
8758 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8761 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8763 * src/buffer.C (getLatexName): ditto
8764 (setReadonly): ditto
8766 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8768 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8769 avoid some uses of current_view. Added also a bufferParams()
8770 method to get at this.
8772 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8774 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8776 * src/lyxparagraph.[Ch]: removed
8777 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8778 with operators used by lower_bound and
8779 upper_bound in InsetTable's
8780 Make struct InsetTable private again. Used matchpos.
8782 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8784 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8785 document, the language of existing text is changed (unless the
8786 document is multi-lingual)
8788 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8790 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8792 * A lot of files: A rewrite of the Right-to-Left support.
8794 2000-04-10 Juergen Vigna <jug@sad.it>
8796 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8797 misplaced cursor when inset in inset is locked.
8799 * src/insets/insettext.C (LocalDispatch): small fix so that a
8800 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8802 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8803 footnote font should be decreased in size twice when displaying.
8805 * src/insets/insettext.C (GetDrawFont): inserted this function as
8806 the drawing-font may differ from the real paragraph font.
8808 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8809 insets (inset in inset!).
8811 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8812 function here because we don't want footnotes inside footnotes.
8814 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8816 (init): now set the inset_owner in paragraph.C
8817 (LocalDispatch): added some resetPos() in the right position
8820 (pasteSelection): changed to use the new CutAndPaste-Class.
8822 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8823 which tells if it is allowed to insert another inset inside this one.
8825 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8826 SwitchLayoutsBetweenClasses.
8828 * src/text2.C (InsertInset): checking of the new paragraph-function
8830 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8831 is not needed anymore here!
8834 (PasteSelection): redone (also with #ifdef) so that now this uses
8835 the CutAndPaste-Class.
8836 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8839 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8840 from/to text/insets.
8842 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8843 so that the paragraph knows if it is inside an (text)-inset.
8844 (InsertFromMinibuffer): changed return-value to bool as now it
8845 may happen that an inset is not inserted in the paragraph.
8846 (InsertInsetAllowed): this checks if it is allowed to insert an
8847 inset in this paragraph.
8849 (BreakParagraphConservative):
8850 (BreakParagraph) : small change for the above change of the return
8851 value of InsertFromMinibuffer.
8853 * src/lyxparagraph.h: added inset_owner and the functions to handle
8854 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8856 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8858 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8859 functions from BufferView to BufferView::Pimpl to ease maintence.
8861 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8862 correctly. Also use SetCursorIntern instead of SetCursor.
8864 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8867 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8869 * src/WorkArea.C (belowMouse): manually implement below mouse.
8871 * src/*: Add "explicit" on several constructors, I added probably
8872 some unneeded ones. A couple of changes to code because of this.
8874 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8875 implementation and private parts from the users of BufferView. Not
8878 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8879 implementation and private parts from the users of LyXLex. Not
8882 * src/BufferView_pimpl.[Ch]: new files
8884 * src/lyxlex_pimpl.[Ch]: new files
8886 * src/LyXView.[Ch]: some inline functions move out-of-line
8888 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8890 * src/lyxparagraph.h: make struct InsetTable public.
8892 * src/support/lyxstring.h: change lyxstring::difference_type to be
8893 ptrdiff_t. Add std:: modifiers to streams.
8895 * src/font.C: include the <cctype> header, for islower() and
8898 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8900 * src/font.[Ch]: new files. Contains the metric functions for
8901 fonts, takes a LyXFont as parameter. Better separation of concepts.
8903 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8904 changes because of this.
8906 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8908 * src/*: compile with -Winline and move functions that don't
8911 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8914 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8916 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8917 (various files changed because of this)
8919 * src/Painter.C (text): fixed the drawing of smallcaps.
8921 * src/lyxfont.[Ch] (drawText): removed unused member func.
8924 * src/*.C: added needed "using" statements and "std::" qualifiers.
8926 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8928 * src/*.h: removed all use of "using" from header files use
8929 qualifier std:: instead.
8931 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8933 * src/text.C (Backspace): some additional cleanups (we already
8934 know whether cursor.pos is 0 or not).
8936 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8937 automake does not provide one).
8939 * src/bmtable.h: replace C++ comments with C comments.
8941 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8943 * src/screen.C (ShowCursor): Change the shape of the cursor if
8944 the current language is not equal to the language of the document.
8945 (If the cursor change its shape unexpectedly, then you've found a bug)
8947 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8950 * src/insets/insetnumber.[Ch]: New files.
8952 * src/LyXAction.C (init)
8953 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8956 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8958 * src/lyxparagraph.h
8959 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8960 (the vector is kept sorted).
8962 * src/text.C (GetVisibleRow): Draw selection correctly when there
8963 is both LTR and RTL text.
8965 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8966 which is much faster.
8968 * src/text.C (GetVisibleRow and other): Do not draw the last space
8969 in a row if the direction of the last letter is not equal to the
8970 direction of the paragraph.
8972 * src/lyxfont.C (latexWriteStartChanges):
8973 Check that font language is not equal to basefont language.
8974 (latexWriteEndChanges): ditto
8976 * src/lyx_cb.C (StyleReset): Don't change the language while using
8977 the font-default command.
8979 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8980 empty paragraph before a footnote.
8982 * src/insets/insetcommand.C (draw): Increase x correctly.
8984 * src/screen.C (ShowCursor): Change cursor shape if
8985 current language != document language.
8987 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8989 2000-03-31 Juergen Vigna <jug@sad.it>
8991 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8992 (Clone): changed mode how the paragraph-data is copied to the
8993 new clone-paragraph.
8995 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8996 GetInset(pos) with no inset anymore there (in inset UNDO)
8998 * src/insets/insetcommand.C (draw): small fix as here x is
8999 incremented not as much as width() returns (2 before, 2 behind = 4)
9001 2000-03-30 Juergen Vigna <jug@sad.it>
9003 * src/insets/insettext.C (InsetText): small fix in initialize
9004 widthOffset (should not be done in the init() function)
9006 2000-03-29 Amir Karger <karger@lyx.org>
9008 * lib/examples/it_ItemizeBullets.lyx: translation by
9011 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9013 2000-03-29 Juergen Vigna <jug@sad.it>
9015 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9017 * src/insets/insetfoot.C (Clone): small change as for the below
9018 new init function in the text-inset
9020 * src/insets/insettext.C (init): new function as I've seen that
9021 clone did not copy the Paragraph-Data!
9022 (LocalDispatch): Added code so that now we have some sort of Undo
9023 functionality (well actually we HAVE Undo ;)
9025 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9027 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9029 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9032 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9034 * src/main.C: added a runtime check that verifies that the xforms
9035 header used when building LyX and the library used when running
9036 LyX match. Exit with a message if they don't match. This is a
9037 version number check only.
9039 * src/buffer.C (save): Don't allocate memory on the heap for
9040 struct utimbuf times.
9042 * *: some using changes, use iosfwd instead of the real headers.
9044 * src/lyxfont.C use char const * instead of string for the static
9045 strings. Rewrite some functions to use sstream.
9047 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9049 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9052 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9054 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9055 of Geodesy (from Martin Vermeer)
9057 * lib/layouts/svjour.inc: include file for the Springer svjour
9058 class. It can be used to support journals other than JoG.
9060 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9061 Miskiewicz <misiek@pld.org.pl>)
9062 * lib/reLyX/Makefile.am: ditto.
9064 2000-03-27 Juergen Vigna <jug@sad.it>
9066 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9067 also some modifications with operations on selected text.
9069 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9070 problems with clicking on insets (last famous words ;)
9072 * src/insets/insetcommand.C (draw):
9073 (width): Changed to have a bit of space before and after the inset so
9074 that the blinking cursor can be seen (otherwise it was hidden)
9076 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9078 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9079 would not be added to the link list when an installed gettext (not
9080 part of libc) is found.
9082 2000-03-24 Juergen Vigna <jug@sad.it>
9084 * src/insets/insetcollapsable.C (Edit):
9085 * src/mathed/formula.C (InsetButtonRelease):
9086 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9089 * src/BufferView.C (workAreaButtonPress):
9090 (workAreaButtonRelease):
9091 (checkInsetHit): Finally fixed the clicking on insets be handled
9094 * src/insets/insetert.C (Edit): inserted this call so that ERT
9095 insets work always with LaTeX-font
9097 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9099 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9100 caused lyx to startup with no GUI in place, causing in a crash
9101 upon startup when called with arguments.
9103 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9105 * src/FontLoader.C: better initialization of dummyXFontStruct.
9107 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9109 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9110 for linuxdoc and docbook import and export format options.
9112 * lib/lyxrc.example Example of default values for the previous flags.
9114 * src/lyx_cb.C Use those flags instead of the hardwired values for
9115 linuxdoc and docbook export.
9117 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9120 * src/menus.C Added menus entries for the new import/exports formats.
9122 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9124 * src/lyxrc.*: Added support for running without Gui
9127 * src/FontLoader.C: sensible defaults if no fonts are needed
9129 * src/lyx_cb.C: New function ShowMessage (writes either to the
9130 minibuffer or cout in case of no gui
9131 New function AskOverwrite for common stuff
9132 Consequently various changes to call these functions
9134 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9135 wild guess at sensible screen resolution when having no gui
9137 * src/lyxfont.C: no gui, no fonts... set some defaults
9139 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9141 * src/LColor.C: made the command inset background a bit lighter.
9143 2000-03-20 Hartmut Goebel <goebel@noris.net>
9145 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9146 stdstruct.inc. Koma-Script added some title elements which
9147 otherwise have been listed below "bibliography". This split allows
9148 adding title elements to where they belong.
9150 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9151 define the additional title elements and then include
9154 * many other layout files: changed to include stdtitle.inc just
9155 before stdstruct.inc.
9157 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9159 * src/buffer.C: (save) Added the option to store all backup files
9160 in a single directory
9162 * src/lyxrc.[Ch]: Added variable \backupdir_path
9164 * lib/lyxrc.example: Added descriptions of recently added variables
9166 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9167 bibtex inset, not closing the bibtex popup when deleting the inset)
9169 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9171 * src/lyx_cb.C: add a couple using directives.
9173 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9174 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9175 import based on the filename.
9177 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9178 file would be imported at start, if the filename where of a sgml file.
9180 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9182 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9184 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9185 * src/lyxfont.h Replaced the member variable bits.direction by the
9186 member variable lang. Made many changes in other files.
9187 This allows having a multi-lingual document
9189 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9190 that change the current language to <l>.
9191 Removed the command "font-rtl"
9193 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9194 format for Hebrew documents)
9196 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9197 When auto_mathmode is "true", pressing a digit key in normal mode
9198 will cause entering into mathmode.
9199 If auto_mathmode is "rtl" then this behavior will be active only
9200 when writing right-to-left text.
9202 * src/text2.C (InsertStringA) The string is inserted using the
9205 * src/paragraph.C (GetEndLabel) Gives a correct result for
9206 footnote paragraphs.
9208 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9210 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9212 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9213 front of PasteParagraph. Never insert a ' '. This should at least
9214 fix some cause for the segfaults that we have been experiencing,
9215 it also fixes backspace behaviour slightly. (Phu!)
9217 * src/support/lstrings.C (compare_no_case): some change to make it
9218 compile with gcc 2.95.2 and stdlibc++-v3
9220 * src/text2.C (MeltFootnoteEnvironment): change type o
9221 first_footnote_par_is_not_empty to bool.
9223 * src/lyxparagraph.h: make text private. Changes in other files
9225 (fitToSize): new function
9226 (setContentsFromPar): new function
9227 (clearContents): new function
9228 (SetChar): new function
9230 * src/paragraph.C (readSimpleWholeFile): deleted.
9232 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9233 the file, just use a simple string instead. Also read the file in
9234 a more maintainable manner.
9236 * src/text2.C (InsertStringA): deleted.
9237 (InsertStringB): deleted.
9239 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9241 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9242 RedoParagraphs from the doublespace handling part, just set status
9243 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9244 done, but perhaps not like this.)
9246 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9248 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9249 character when inserting an inset.
9251 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9253 * src/bufferparams.C (readLanguage): now takes "default" into
9256 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9257 also initialize the toplevel_keymap with the default bindings from
9260 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9262 * all files using lyxrc: have lyxrc as a real variable and not a
9263 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9266 * src/lyxrc.C: remove double call to defaultKeyBindings
9268 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9269 toolbar defauls using lyxlex. Remove enums, structs, functions
9272 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9273 toolbar defaults. Also store default keybindings in a map.
9275 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9276 storing the toolbar defaults without any xforms dependencies.
9278 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9279 applied. Changed to use iterators.
9281 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9283 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9284 systems that don't have LINGUAS set to begin with.
9286 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9288 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9289 the list by Dekel Tsur.
9291 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9293 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9294 * src/insets/form_graphics.C: ditto.
9296 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9298 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9300 * src/bufferparams.C (readLanguage): use the new language map
9302 * src/intl.C (InitKeyMapper): use the new language map
9304 * src/lyx_gui.C (create_forms): use the new language map
9306 * src/language.[Ch]: New files. Used for holding the information
9307 about each language. Now! Use this new language map enhance it and
9308 make it really usable for our needs.
9310 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9312 * screen.C (ShowCursor): Removed duplicate code.
9313 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9314 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9316 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9319 * src/text.C Added TransformChar method. Used for rendering Arabic
9320 text correctly (change the glyphs of the letter according to the
9321 position in the word)
9326 * src/lyxrc.C Added lyxrc command {language_command_begin,
9327 language_command_end,language_command_ltr,language_command_rtl,
9328 language_package} which allows the use of either arabtex or Omega
9331 * src/lyx_gui.C (init)
9333 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9334 to use encoding for menu fonts which is different than the encoding
9337 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9338 do not load the babel package.
9339 To write an English document with Hebrew/Arabic, change the document
9340 language to "english".
9342 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9343 (alphaCounter): changed to return char
9344 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9346 * lib/lyxrc.example Added examples for Hebrew/Arabic
9349 * src/layout.C Added layout command endlabeltype
9351 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9353 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9355 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9357 * src/mathed/math_delim.C (search_deco): return a
9358 math_deco_struct* instead of index.
9360 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9362 * All files with a USE_OSTREAM_ONLY within: removed all code that
9363 was unused when USE_OSTREAM_ONLY is defined.
9365 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9366 of any less. Removed header and using.
9368 * src/text.C (GetVisibleRow): draw the string "Page Break
9369 (top/bottom)" on screen when drawing a pagebreak line.
9371 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9373 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9375 * src/mathed/math_macro.C (draw): do some cast magic.
9378 * src/mathed/math_defs.h: change byte* argument to byte const*.
9380 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9382 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9383 know it is right to return InsetFoot* too, but cxx does not like
9386 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9388 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9390 * src/mathed/math_delim.C: change == to proper assignment.
9392 2000-03-09 Juergen Vigna <jug@sad.it>
9394 * src/insets/insettext.C (setPos): fixed various cursor positioning
9395 problems (via mouse and cursor-keys)
9396 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9397 inset (still a small display problem but it works ;)
9399 * src/insets/insetcollapsable.C (draw): added button_top_y and
9400 button_bottom_y to have correct values for clicking on the inset.
9402 * src/support/lyxalgo.h: commented out 'using std::less'
9404 2000-03-08 Juergen Vigna <jug@sad.it>
9406 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9407 Button-Release event closes as it is alos the Release-Event
9410 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9412 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9414 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9415 can add multiple spaces in Scrap (literate programming) styles...
9416 which, by the way, is how I got hooked on LyX to begin with.
9418 * src/mathed/formula.C (Write): Added dummy variable to an
9419 inset::Latex() call.
9420 (Latex): Add free_spacing boolean to inset::Latex()
9422 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9424 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9425 virtual function to include the free_spacing boolean from
9426 the containing paragraph's style.
9428 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9429 Added free_spacing boolean arg to match inset.h
9431 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9432 Added free_spacing boolean arg to match inset.h
9434 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9435 Added free_spacing boolean and made sure that if in a free_spacing
9436 paragraph, that we output normal space if there is a protected space.
9438 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9439 Added free_spacing boolean arg to match inset.h
9441 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9442 Added free_spacing boolean arg to match inset.h
9444 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9445 Added free_spacing boolean arg to match inset.h
9447 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9448 Added free_spacing boolean arg to match inset.h
9450 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9451 Added free_spacing boolean arg to match inset.h
9453 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9454 free_spacing boolean arg to match inset.h
9456 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9457 Added free_spacing boolean arg to match inset.h
9459 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9460 Added free_spacing boolean arg to match inset.h
9462 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9463 Added free_spacing boolean arg to match inset.h
9465 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9466 Added free_spacing boolean arg to match inset.h
9468 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9469 Added free_spacing boolean arg to match inset.h
9471 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9472 free_spacing boolean arg to match inset.h
9474 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9475 free_spacing boolean arg to match inset.h
9477 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9478 ignore free_spacing paragraphs. The user's spaces are left
9481 * src/text.C (InsertChar): Fixed the free_spacing layout
9482 attribute behavior. Now, if free_spacing is set, you can
9483 add multiple spaces in a paragraph with impunity (and they
9484 get output verbatim).
9485 (SelectSelectedWord): Added dummy argument to inset::Latex()
9488 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9491 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9492 paragraph layouts now only input a simple space instead.
9493 Special character insets don't make any sense in free-spacing
9496 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9497 hard-spaces in the *input* file to simple spaces if the layout
9498 is free-spacing. This converts old files which had to have
9499 hard-spaces in free-spacing layouts where a simple space was
9501 (writeFileAscii): Added free_spacing check to pass to the newly
9502 reworked inset::Latex(...) methods. The inset::Latex() code
9503 ensures that hard-spaces in free-spacing paragraphs get output
9504 as spaces (rather than "~").
9506 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9508 * src/mathed/math_delim.C (draw): draw the empty placeholder
9509 delims with a onoffdash line.
9510 (struct math_deco_compare): struct that holds the "functors" used
9511 for the sort and the binary search in math_deco_table.
9512 (class init_deco_table): class used for initial sort of the
9514 (search_deco): use lower_bound to do a binary search in the
9517 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9519 * src/lyxrc.C: a small secret thingie...
9521 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9522 and to not flush the stream as often as it used to.
9524 * src/support/lyxalgo.h: new file
9525 (sorted): template function used for checking if a sequence is
9526 sorted or not. Two versions with and without user supplied
9527 compare. Uses same compare as std::sort.
9529 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9530 it and give warning on lyxerr.
9532 (struct compare_tags): struct with function operators used for
9533 checking if sorted, sorting and lower_bound.
9534 (search_kw): use lower_bound instead of manually implemented
9537 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9539 * src/insets/insetcollapsable.h: fix Clone() declaration.
9540 * src/insets/insetfoot.h: ditto.
9542 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9544 2000-03-08 Juergen Vigna <jug@sad.it>
9546 * src/insets/lyxinset.h: added owner call which tells us if
9547 this inset is inside another inset. Changed also the return-type
9548 of Editable to an enum so it tells clearer what the return-value is.
9550 * src/insets/insettext.C (computeTextRows): fixed computing of
9551 textinsets which split automatically on more rows.
9553 * src/insets/insetert.[Ch]: changed this to be of BaseType
9556 * src/insets/insetfoot.[Ch]: added footnote inset
9558 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9559 collapsable insets (like footnote, ert, ...)
9561 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9563 * src/lyxdraw.h: remvoe file
9565 * src/lyxdraw.C: remove file
9567 * src/insets/insettext.C: added <algorithm>.
9569 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9571 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9572 (matrix_cb): case MM_OK use string stream
9574 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9577 * src/mathed/math_macro.C (draw): use string stream
9578 (Metrics): use string stream
9580 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9581 directly to the ostream.
9583 * src/vspace.C (asString): use string stream.
9584 (asString): use string stream
9585 (asLatexString): use string stream
9587 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9588 setting Spacing::Other.
9590 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9591 sprintf when creating the stretch vale.
9593 * src/text2.C (alphaCounter): changed to return a string and to
9594 not use a static variable internally. Also fixed a one-off bug.
9595 (SetCounter): changed the drawing of the labels to use string
9596 streams instead of sprintf.
9598 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9599 manipulator to use a scheme that does not require library support.
9600 This is also the way it is done in the new GNU libstdc++. Should
9601 work with DEC cxx now.
9603 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9605 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9606 end. This fixes a bug.
9608 * src/mathed (all files concerned with file writing): apply the
9609 USE_OSTREAM_ONLY changes to mathed too.
9611 * src/support/DebugStream.h: make the constructor explicit.
9613 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9614 count and ostream squashed.
9616 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9618 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9620 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9621 ostringstream uses STL strings, and we might not.
9623 * src/insets/insetspecialchar.C: add using directive.
9624 * src/insets/insettext.C: ditto.
9626 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9628 * lib/layouts/seminar.layout: feeble attempt at a layout for
9629 seminar.cls, far from completet and could really use some looking
9630 at from people used to write layout files.
9632 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9633 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9634 a lot nicer and works nicely with ostreams.
9636 * src/mathed/formula.C (draw): a slightly different solution that
9637 the one posted to the list, but I think this one works too. (font
9638 size wrong in headers.)
9640 * src/insets/insettext.C (computeTextRows): some fiddling on
9641 Jürgens turf, added some comments that he should read.
9643 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9644 used and it gave compiler warnings.
9645 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9648 * src/lyx_gui.C (create_forms): do the right thing when
9649 show_banner is true/false.
9651 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9652 show_banner is false.
9654 * most file writing files: Now use iostreams to do almost all of
9655 the writing. Also instead of passing string &, we now use
9656 stringstreams. mathed output is still not adapted to iostreams.
9657 This change can be turned off by commenting out all the occurences
9658 of the "#define USE_OSTREAM_ONLY 1" lines.
9660 * src/WorkArea.C (createPixmap): don't output debug messages.
9661 (WorkArea): don't output debug messages.
9663 * lib/lyxrc.example: added a comment about the new variable
9666 * development/Code_rules/Rules: Added some more commente about how
9667 to build class interfaces and on how better encapsulation can be
9670 2000-03-03 Juergen Vigna <jug@sad.it>
9672 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9673 automatically with the width of the LyX-Window
9675 * src/insets/insettext.C (computeTextRows): fixed update bug in
9676 displaying text-insets (scrollvalues where not initialized!)
9678 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9680 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9681 id in the check of the result from lower_bound is not enough since
9682 lower_bound can return last too, and then res->id will not be a
9685 * all insets and some code that use them: I have conditionalized
9686 removed the Latex(string & out, ...) this means that only the
9687 Latex(ostream &, ...) will be used. This is a work in progress to
9688 move towards using streams for all output of files.
9690 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9693 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9695 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9696 routine (this fixes bug where greek letters were surrounded by too
9699 * src/support/filetools.C (findtexfile): change a bit the search
9700 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9701 no longer passed to kpsewhich, we may have to change that later.
9703 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9704 warning options to avoid problems with X header files (from Angus
9706 * acinclude.m4: regenerated.
9708 2000-03-02 Juergen Vigna <jug@sad.it>
9710 * src/insets/insettext.C (WriteParagraphData): Using the
9711 par->writeFile() function for writing paragraph-data.
9712 (Read): Using buffer->parseSingleLyXformat2Token()-function
9713 for parsing paragraph data!
9715 * src/buffer.C (readLyXformat2): removed all parse data and using
9716 the new parseSingleLyXformat2Token()-function.
9717 (parseSingleLyXformat2Token): added this function to parse (read)
9718 lyx-file-format (this is called also from text-insets now!)
9720 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9722 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9725 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9726 directly instead of going through a func. One very bad thing: a
9727 static LyXFindReplace, but I don't know where to place it.
9729 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9730 string instead of char[]. Also changed to static.
9731 (GetSelectionOrWordAtCursor): changed to static inline
9732 (SetSelectionOverLenChars): ditto.
9734 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9735 current_view and global variables. both classes has changed names
9736 and LyXFindReplace is not inherited from SearchForm.
9738 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9739 fl_form_search form.
9741 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9743 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9745 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9746 bound (from Kayvan).
9748 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9750 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9752 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9754 * some things that I should comment but the local pub says head to
9757 * comment out all code that belongs to the Roff code for Ascii
9758 export of tables. (this is unused)
9760 * src/LyXView.C: use correct type for global variable
9761 current_layout. (LyXTextClass::size_type)
9763 * some code to get the new insetgraphics closer to working I'd be
9764 grateful for any help.
9766 * src/BufferView2.C (insertInset): use the return type of
9767 NumberOfLayout properly. (also changes in other files)
9769 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9770 this as a test. I want to know what breaks because of this.
9772 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9774 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9776 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9777 to use a \makebox in the label, this allows proper justification
9778 with out using protected spaces or multiple hfills. Now it is
9779 "label" for left justified, "\hfill label\hfill" for center, and
9780 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9781 should be changed accordingly.
9783 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9785 * src/lyxtext.h: change SetLayout() to take a
9786 LyXTextClass::size_type instead of a char (when there is more than
9787 127 layouts in a class); also change type of copylayouttype.
9788 * src/text2.C (SetLayout): ditto.
9789 * src/LyXView.C (updateLayoutChoice): ditto.
9791 * src/LaTeX.C (scanLogFile): errors where the line number was not
9792 given just after the '!'-line were ignored (from Dekel Tsur).
9794 * lib/lyxrc.example: fix description of \date_insert_format
9796 * lib/layouts/llncs.layout: new layout, contributed by Martin
9799 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9801 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9802 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9803 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9804 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9805 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9806 paragraph.C, text.C, text2.C)
9808 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9810 * src/insets/insettext.C (LocalDispatch): remove extra break
9813 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9814 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9816 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9817 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9819 * src/insets/insetbib.h: move InsetBibkey::Holder and
9820 InsetCitation::Holder in public space.
9822 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9824 * src/insets/insettext.h: small change to get the new files from
9825 Juergen to compile (use "string", not "class string").
9827 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9828 const & as parameter to LocalDispatch, use LyXFont const & as
9829 paramter to some other func. This also had impacto on lyxinsets.h
9830 and the two mathed insets.
9832 2000-02-24 Juergen Vigna <jug@sad.it>
9835 * src/commandtags.h:
9837 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9841 * src/BufferView2.C: added/updated code for various inset-functions
9843 * src/insets/insetert.[Ch]: added implementation of InsetERT
9845 * src/insets/insettext.[Ch]: added implementation of InsetText
9847 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9848 (draw): added preliminary code for inset scrolling not finshed yet
9850 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9851 as it is in lyxfunc.C now
9853 * src/insets/lyxinset.h: Added functions for text-insets
9855 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9857 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9858 BufferView and reimplement the list as a queue put inside its own
9861 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9863 * several files: use the new interface to the "updateinsetlist"
9865 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9867 (work_area_handler): call BufferView::trippleClick on trippleclick.
9869 * src/BufferView.C (doubleClick): new function, selects word on
9871 (trippleClick): new function, selects line on trippleclick.
9873 2000-02-22 Allan Rae <rae@lyx.org>
9875 * lib/bind/xemacs.bind: buffer-previous not supported
9877 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9879 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9882 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9884 * src/bufferlist.C: get rid of current_view from this file
9886 * src/spellchecker.C: get rid of current_view from this file
9888 * src/vspace.C: get rid of current_view from this file
9889 (inPixels): added BufferView parameter for this func
9890 (asLatexCommand): added a BufferParams for this func
9892 * src/text.C src/text2.C: get rid of current_view from these
9895 * src/lyxfont.C (getFontDirection): move this function here from
9898 * src/bufferparams.C (getDocumentDirection): move this function
9901 * src/paragraph.C (getParDirection): move this function here from
9903 (getLetterDirection): ditto
9905 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9907 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9908 resize due to wrong pixmap beeing used. Also took the opurtunity
9909 to make the LyXScreen stateless on regard to WorkArea and some
9910 general cleanup in the same files.
9912 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9914 * src/Makefile.am: add missing direction.h
9916 * src/PainterBase.h: made the width functions const.
9918 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9921 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9923 * src/insets/insetlatexaccent.C (draw): make the accents draw
9924 better, at present this will only work well with iso8859-1.
9926 * several files: remove the old drawing code, now we use the new
9929 * several files: remove support for mono_video, reverse_video and
9932 2000-02-17 Juergen Vigna <jug@sad.it>
9934 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9935 int ** as we have to return the pointer, otherwise we have only
9936 NULL pointers in the returning function.
9938 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9940 * src/LaTeX.C (operator()): quote file name when running latex.
9942 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9944 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9945 (bubble tip), this removes our special handling of this.
9947 * Remove all code that is unused now that we have the new
9948 workarea. (Code that are not active when NEW_WA is defined.)
9950 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9952 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9954 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9955 nonexisting layout; correctly redirect obsoleted layouts.
9957 * lib/lyxrc.example: document \view_dvi_paper_option
9959 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9962 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9963 (PreviewDVI): handle the view_dvi_paper_option variable.
9964 [Both from Roland Krause]
9966 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9968 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9969 char const *, int, LyXFont)
9970 (text(int, int, string, LyXFont)): ditto
9972 * src/text.C (InsertCharInTable): attempt to fix the double-space
9973 feature in tables too.
9974 (BackspaceInTable): ditto.
9975 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9977 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9979 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9981 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9982 newly found text in textcache to this.
9983 (buffer): set the owner of the text put into the textcache to 0
9985 * src/insets/figinset.C (draw): fixed the drawing of figures with
9988 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9989 drawing of mathframe, hfills, protected space, table lines. I have
9990 now no outstanding drawing problems with the new Painter code.
9992 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9994 * src/PainterBase.C (ellipse, circle): do not specify the default
9997 * src/LColor.h: add using directive.
9999 * src/Painter.[Ch]: change return type of methods from Painter& to
10000 PainterBase&. Add a using directive.
10002 * src/WorkArea.C: wrap xforms callbacks in C functions
10005 * lib/layouts/foils.layout: font fix and simplifications from Carl
10008 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10010 * a lot of files: The Painter, LColor and WorkArea from the old
10011 devel branch has been ported to lyx-devel. Some new files and a
10012 lot of #ifdeffed code. The new workarea is enabled by default, but
10013 if you want to test the new Painter and LColor you have to compile
10014 with USE_PAINTER defined (do this in config.h f.ex.) There are
10015 still some rought edges, and I'd like some help to clear those
10016 out. It looks stable (loads and displays the Userguide very well).
10019 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10021 * src/buffer.C (pop_tag): revert to the previous implementation
10022 (use a global variable for both loops).
10024 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10026 * src/lyxrc.C (LyXRC): change slightly default date format.
10028 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10029 there is an English text with a footnote that starts with a Hebrew
10030 paragraph, or vice versa.
10031 (TeXFootnote): ditto.
10033 * src/text.C (LeftMargin): allow for negative values for
10034 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10037 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10038 for input encoding (cyrillic)
10040 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10042 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10045 * src/toolbar.C (set): ditto
10046 * src/insets/insetbib.C (create_form_citation_form): ditto
10048 * lib/CREDITS: added Dekel Tsur.
10050 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10051 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10052 hebrew supports files from Dekel Tsur.
10054 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10055 <tzafrir@technion.ac.il>
10057 * src/lyxrc.C: put \date_insert_format at the right place.
10059 * src/buffer.C (makeLaTeXFile): fix the handling of
10060 BufferParams::sides when writing out latex files.
10062 * src/BufferView2.C: add a "using" directive.
10064 * src/support/lyxsum.C (sum): when we use lyxstring,
10065 ostringstream::str needs an additional .c_str().
10067 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10069 * src/support/filetools.C (ChangeExtension): patch from Etienne
10072 * src/TextCache.C (show): remove const_cast and make second
10073 parameter non-const LyXText *.
10075 * src/TextCache.h: use non const LyXText in show.
10077 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10080 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10082 * src/support/lyxsum.C: rework to be more flexible.
10084 * several places: don't check if a pointer is 0 if you are going
10087 * src/text.C: remove some dead code.
10089 * src/insets/figinset.C: remove some dead code
10091 * src/buffer.C: move the BufferView funcs to BufferView2.C
10092 remove all support for insetlatexdel
10093 remove support for oldpapersize stuff
10094 made some member funcs const
10096 * src/kbmap.C: use a std::list to store the bindings in.
10098 * src/BufferView2.C: new file
10100 * src/kbsequence.[Ch]: new files
10102 * src/LyXAction.C + others: remove all trace of buffer-previous
10104 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10105 only have one copy in the binary of this table.
10107 * hebrew patch: moved some functions from LyXText to more
10108 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10110 * several files: remove support for XForms older than 0.88
10111 whitespace changes.
10112 remove some #if 0 #endif code
10114 * src/TextCache.[Ch]: new file. Holds the textcache.
10116 * src/BufferView.C: changes to use the new TextCache interface.
10117 (waitForX): remove the now unused code.
10119 * src/BackStack.h: remove some commented code
10121 * lib/bind/emacs.bind: remove binding for buffer-previous
10123 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10125 * applied the hebrew patch.
10127 * src/lyxrow.h: make sure that all Row variables are initialized.
10129 * src/text2.C (TextHandleUndo): comment out a delete, this might
10130 introduce a memory leak, but should also help us to not try to
10131 read freed memory. We need to look at this one.
10133 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10134 (LyXParagraph): initalize footnotekind.
10136 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10137 forgot this when applying the patch. Please heed the warnings.
10139 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10140 (aka. reformat problem)
10142 * src/bufferlist.C (exists): made const, and use const_iterator
10143 (isLoaded): new func.
10144 (release): use std::find to find the correct buffer.
10146 * src/bufferlist.h: made getState a const func.
10147 made empty a const func.
10148 made exists a const func.
10151 2000-02-01 Juergen Vigna <jug@sad.it>
10153 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10155 * po/it.po: updated a bit the italian po file and also changed the
10156 'file nuovo' for newfile to 'filenuovo' without a space, this did
10159 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10160 for the new insert_date command.
10162 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10163 from jdblair, to insert a date into the current text conforming to
10164 a strftime format (for now only considering the locale-set and not
10165 the document-language).
10167 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10169 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10170 Bounds Read error seen by purify. The problem was that islower is
10171 a macros which takes an unsigned char and uses it as an index for
10172 in array of characters properties (and is thus subject to the
10176 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10177 correctly the paper sides radio buttons.
10178 (UpdateDocumentButtons): ditto.
10180 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10182 * src/kbmap.C (getsym + others): change to return unsigned int,
10183 returning a long can give problems on 64 bit systems. (I assume
10184 that int is 32bit on 64bit systems)
10186 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10188 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10189 LyXLookupString to be zero-terminated. Really fixes problems seen
10190 by purify, I think.
10192 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10194 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10195 write a (char*)0 to the lyxerr stream.
10197 * src/lastfiles.C: move algorithm before the using statemets.
10199 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10201 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10202 complains otherwise).
10203 * src/table.C: ditto
10205 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10208 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10209 that I removed earlier... It is really needed.
10211 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10213 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10215 * INSTALL: update xforms home page URL.
10217 * lib/configure.m4: fix a bug with unreadable layout files.
10219 * src/table.C (calculate_width_of_column): add "using std::max"
10222 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10224 * several files: marked several lines with "DEL LINE", this is
10225 lines that can be deleted without changing anything.
10226 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10227 checks this anyway */
10230 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10232 * src/DepTable.C (update): add a "+" at the end when the checksum
10233 is different. (debugging string only)
10235 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10236 the next inset to not be displayed. This should also fix the list
10237 of labels in the "Insert Crossreference" dialog.
10239 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10241 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10242 when regex was not found.
10244 * src/support/lstrings.C (lowercase): use handcoded transform always.
10247 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10248 old_cursor.par->prev could be 0.
10250 * several files: changed post inc/dec to pre inc/dec
10252 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10253 write the lastfiles to file.
10255 * src/BufferView.C (buffer): only show TextCache info when debugging
10257 (resizeCurrentBuffer): ditto
10258 (workAreaExpose): ditto
10260 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10262 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10264 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10265 a bit better by removing the special case for \i and \j.
10267 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10269 * src/lyx_main.C (easyParse): remove test for bad comand line
10270 options, since this broke all xforms-related parsing.
10272 * src/kbmap.C (getsym): set return type to unsigned long, as
10273 declared in header. On an alpha, long is _not_ the same as int.
10275 * src/support/LOstream.h: add a "using std::flush;"
10277 * src/insets/figinset.C: ditto.
10279 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10281 * src/bufferlist.C (write): use blinding fast file copy instead of
10282 "a char at a time", now we are doing it the C++ way.
10284 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10285 std::list<int> instead.
10286 (addpidwait): reflect move to std::list<int>
10287 (sigchldchecker): ditto
10289 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10292 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10293 that obviously was wrong...
10295 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10296 c, this avoids warnings with purify and islower.
10298 * src/insets/figinset.C: rename struct queue to struct
10299 queue_element and rewrite to use a std::queue. gsqueue is now a
10300 std::queue<queue_element>
10301 (runqueue): reflect move to std::queue
10304 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10305 we would get "1" "0" instead of "true" "false. Also make the tostr
10308 2000-01-21 Juergen Vigna <jug@sad.it>
10310 * src/buffer.C (writeFileAscii): Disabled code for special groff
10311 handling of tabulars till I fix this in table.C
10313 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10315 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10317 * src/support/lyxlib.h: ditto.
10319 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10321 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10322 and 'j' look better. This might fix the "macron" bug that has been
10325 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10326 functions as one template function. Delete the old versions.
10328 * src/support/lyxsum.C: move using std::ifstream inside
10331 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10334 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10336 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10338 * src/insets/figinset.C (InitFigures): use new instead of malloc
10339 to allocate memory for figures and bitmaps.
10340 (DoneFigures): use delete[] instead of free to deallocate memory
10341 for figures and bitmaps.
10342 (runqueue): use new to allocate
10343 (getfigdata): use new/delete[] instead of malloc/free
10344 (RegisterFigure): ditto
10346 * some files: moved some declarations closer to first use, small
10347 whitespace changes use preincrement instead of postincrement where
10348 it does not make a difference.
10350 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10351 step on the way to use stl::containers for key maps.
10353 * src/bufferlist.h: add a typedef for const_iterator and const
10354 versions of begin and end.
10356 * src/bufferlist.[Ch]: change name of member variable _state to
10357 state_. (avoid reserved names)
10359 (getFileNames): returns the filenames of the buffers in a vector.
10361 * configure.in (ALL_LINGUAS): added ro
10363 * src/support/putenv.C: new file
10365 * src/support/mkdir.C: new file
10367 2000-01-20 Allan Rae <rae@lyx.org>
10369 * lib/layouts/IEEEtran.layout: Added several theorem environments
10371 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10372 couple of minor additions.
10374 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10375 (except for those in footnotes of course)
10377 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10379 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10381 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10382 std::sort and std::lower_bound instead of qsort and handwritten
10384 (struct compara): struct that holds the functors used by std::sort
10385 and std::lower_bound in MathedLookupBOP.
10387 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10389 * src/support/LAssert.h: do not do partial specialization. We do
10390 not really need it.
10392 * src/support/lyxlib.h: note that lyx::getUserName() and
10393 lyx::date() are not in use right now. Should these be suppressed?
10395 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10396 (makeLinuxDocFile): do not put date and user name in linuxdoc
10399 * src/support/lyxlib.h (kill): change first argument to long int,
10400 since that's what solaris uses.
10402 * src/support/kill.C (kill): fix declaration to match prototype.
10404 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10405 actually check whether namespaces are supported. This is not what
10408 * src/support/lyxsum.C: add a using directive.
10410 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10412 * src/support/kill.C: if we have namespace support we don't have
10413 to include lyxlib.h.
10415 * src/support/lyxlib.h: use namespace lyx if supported.
10417 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10419 * src/support/date.C: new file
10421 * src/support/chdir.C: new file
10423 * src/support/getUserName.C: new file
10425 * src/support/getcwd.C: new file
10427 * src/support/abort.C: new file
10429 * src/support/kill.C: new file
10431 * src/support/lyxlib.h: moved all the functions in this file
10432 insede struct lyx. Added also kill and abort to this struct. This
10433 is a way to avoid the "kill is not defined in <csignal>", we make
10434 C++ wrappers for functions that are not ANSI C or ANSI C++.
10436 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10437 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10438 lyx it has been renamed to sum.
10440 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10442 * src/text.C: add using directives for std::min and std::max.
10444 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10446 * src/texrow.C (getIdFromRow): actually return something useful in
10447 id and pos. Hopefully fixes the bug with positionning of errorbox
10450 * src/lyx_main.C (easyParse): output an error and exit if an
10451 incorrect command line option has been given.
10453 * src/spellchecker.C (ispell_check_word): document a memory leak.
10455 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10456 where a "struct utimbuf" is allocated with "new" and deleted with
10459 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10461 * src/text2.C (CutSelection): don't delete double spaces.
10462 (PasteSelection): ditto
10463 (CopySelection): ditto
10465 * src/text.C (Backspace): don't delete double spaces.
10467 * src/lyxlex.C (next): fix a bug that were only present with
10468 conformant std::istream::get to read comment lines, use
10469 std::istream::getline instead. This seems to fix the problem.
10471 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10473 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10474 allowed to insert space before space" editing problem. Please read
10475 commends at the beginning of the function. Comments about usage
10478 * src/text.C (InsertChar): fix for the "not allowed to insert
10479 space before space" editing problem.
10481 * src/text2.C (DeleteEmptyParagraphMechanism): when
10482 IsEmptyTableRow can only return false this last "else if" will
10483 always be a no-op. Commented out.
10485 * src/text.C (RedoParagraph): As far as I can understand tmp
10486 cursor is not really needed.
10488 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10489 present it could only return false anyway.
10490 (several functions): Did something not so smart...added a const
10491 specifier on a lot of methods.
10493 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10494 and add a tmp->text.resize. The LyXParagraph constructor does the
10496 (BreakParagraphConservative): ditto
10498 * src/support/path.h (Path): add a define so that the wrong usage
10499 "Path("/tmp") will be flagged as a compilation error:
10500 "`unnamed_Path' undeclared (first use this function)"
10502 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10504 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10505 which was bogus for several reasons.
10507 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10509 (runBibTeX): ditto.
10511 * autogen.sh: do not use "type -path" (what's that anyway?).
10513 * src/support/filetools.C (findtexfile): remove extraneous space
10514 which caused a kpsewhich warning (at least with kpathsea version
10517 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10519 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10521 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10523 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10525 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10527 * src/paragraph.C (BreakParagraph): do not reserve space on text
10528 if we don't need to (otherwise, if pos_end < pos, we end up
10529 reserving huge amounts of memory due to bad unsigned karma).
10530 (BreakParagraphConservative): ditto, although I have not seen
10531 evidence the bug can happen here.
10533 * src/lyxparagraph.h: add a using std::list.
10535 2000-01-11 Juergen Vigna <jug@sad.it>
10537 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10538 could not be found.
10540 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10542 * src/vc-backend.C (doVCCommand): change to be static and take one
10543 more parameter: the path to chdir too be fore executing the command.
10544 (retrive): new function equiv to "co -r"
10546 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10547 file_not_found_hook is true.
10549 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10551 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10552 if a file is readwrite,readonly...anything else.
10554 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10556 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10557 (CreatePostscript): name change from MenuRunDVIPS (or something)
10558 (PreviewPostscript): name change from MenuPreviewPS
10559 (PreviewDVI): name change from MenuPreviewDVI
10561 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10562 \view_pdf_command., \pdf_to_ps_command
10564 * lib/configure.m4: added search for PDF viewer, and search for
10565 PDF to PS converter.
10566 (lyxrc.defaults output): add \pdflatex_command,
10567 \view_pdf_command and \pdf_to_ps_command.
10569 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10571 * src/bufferlist.C (write): we don't use blocksize for anything so
10574 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10576 * src/support/block.h: disable operator T* (), since it causes
10577 problems with both compilers I tried. See comments in the file.
10579 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10582 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10583 variable LYX_DIR_10x to LYX_DIR_11x.
10585 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10587 * INSTALL: document --with-lyxname.
10590 * configure.in: new configure flag --with-lyxname which allows to
10591 choose the name under which lyx is installed. Default is "lyx", of
10592 course. It used to be possible to do this with --program-suffix,
10593 but the later has in fact a different meaning for autoconf.
10595 * src/support/lstrings.h (lstrchr): reformat a bit.
10597 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10598 * src/mathed/math_defs.h: ditto.
10600 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10602 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10603 true, decides if we create a backup file or not when saving. New
10604 tag and variable \pdf_mode, defaults to false. New tag and
10605 variable \pdflatex_command, defaults to pdflatex. New tag and
10606 variable \view_pdf_command, defaults to xpdf. New tag and variable
10607 \pdf_to_ps_command, defaults to pdf2ps.
10609 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10611 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10612 does not have a BufferView.
10613 (unlockInset): ditto + don't access the_locking_inset if the
10614 buffer does not have a BufferView.
10616 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10617 certain circumstances so that we don't continue a keyboard
10618 operation long after the key was released. Try f.ex. to load a
10619 large document, press PageDown for some seconds and then release
10620 it. Before this change the document would contine to scroll for
10621 some time, with this change it stops imidiatly.
10623 * src/support/block.h: don't allocate more space than needed. As
10624 long as we don't try to write to the arr[x] in a array_type arr[x]
10625 it is perfectly ok. (if you write to it you might segfault).
10626 added operator value_type*() so that is possible to pass the array
10627 to functions expecting a C-pointer.
10629 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10632 * intl/*: updated to gettext 0.10.35, tried to add our own
10633 required modifications. Please verify.
10635 * po/*: updated to gettext 0.10.35, tried to add our own required
10636 modifications. Please verify.
10638 * src/support/lstrings.C (tostr): go at fixing the problem with
10639 cxx and stringstream. When stringstream is used return
10640 oss.str().c_str() so that problems with lyxstring and basic_string
10641 are avoided. Note that the best solution would be for cxx to use
10642 basic_string all the way, but it is not conformant yet. (it seems)
10644 * src/lyx_cb.C + other files: moved several global functions to
10645 class BufferView, some have been moved to BufferView.[Ch] others
10646 are still located in lyx_cb.C. Code changes because of this. (part
10647 of "get rid of current_view project".)
10649 * src/buffer.C + other files: moved several Buffer functions to
10650 class BufferView, the functions are still present in buffer.C.
10651 Code changes because of this.
10653 * config/lcmessage.m4: updated to most recent. used when creating
10656 * config/progtest.m4: updated to most recent. used when creating
10659 * config/gettext.m4: updated to most recent. applied patch for
10662 * config/gettext.m4.patch: new file that shows what changes we
10663 have done to the local copy of gettext.m4.
10665 * config/libtool.m4: new file, used in creation of acinclude.m4
10667 * config/lyxinclude.m4: new file, this is the lyx created m4
10668 macros, used in making acinclude.m4.
10670 * autogen.sh: GNU m4 discovered as a separate task not as part of
10671 the lib/configure creation.
10672 Generate acinlucde from files in config. Actually cat
10673 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10674 easier to upgrade .m4 files that really are external.
10676 * src/Spacing.h: moved using std::istringstream to right after
10677 <sstream>. This should fix the problem seen with some compilers.
10679 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10681 * src/lyx_cb.C: began some work to remove the dependency a lot of
10682 functions have on BufferView::text, even if not really needed.
10683 (GetCurrentTextClass): removed this func, it only hid the
10686 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10687 forgot this in last commit.
10689 * src/Bullet.C (bulletEntry): use static char const *[] for the
10690 tables, becuase of this the return arg had to change to string.
10691 (bulletSize): ditto
10692 (~Bullet): removed unneeded destructor
10694 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10695 (insetSleep): moved from Buffer
10696 (insetWakeup): moved from Buffer
10697 (insetUnlock): moved from Buffer
10699 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10700 from Buffer to BufferView.
10702 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10704 * config/ltmain.sh: updated to version 1.3.4 of libtool
10706 * config/ltconfig: updated to version 1.3.4 of libtool
10708 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10711 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10712 Did I get that right?
10714 * src/lyxlex.h: add a "using" directive or two.
10715 * src/Spacing.h: ditto.
10716 * src/insets/figinset.C: ditto.
10717 * src/support/filetools.C: ditto.
10718 * src/support/lstrings.C: ditto.
10719 * src/BufferView.C: ditto.
10720 * src/bufferlist.C: ditto.
10721 * src/lyx_cb.C: ditto.
10722 * src/lyxlex.C: ditto.
10724 * NEWS: add some changes for 1.1.4.
10726 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10728 * src/BufferView.C: first go at a TextCache to speed up switching
10731 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10733 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10734 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10735 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10736 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10739 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10740 members of the struct are correctly initialized to 0 (detected by
10742 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10743 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10745 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10746 pidwait, since it was allocated with "new". This was potentially
10747 very bad. Thanks to Michael Schmitt for running purify for us.
10750 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10752 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10754 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10756 1999-12-30 Allan Rae <rae@lyx.org>
10758 * lib/templates/IEEEtran.lyx: minor change
10760 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10761 src/mathed/formula.C (LocalDispatch): askForText changes
10763 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10764 know when a user has cancelled input. Fixes annoying problems with
10765 inserting labels and version control.
10767 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10769 * src/support/lstrings.C (tostr): rewritten to use strstream and
10772 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10774 * src/support/filetools.C (IsFileWriteable): use fstream to check
10775 (IsDirWriteable): use fileinfo to check
10777 * src/support/filetools.h (FilePtr): whole class deleted
10779 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10781 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10783 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10785 * src/bufferlist.C (write): use ifstream and ofstream instead of
10788 * src/Spacing.h: use istrstream instead of sscanf
10790 * src/mathed/math_defs.h: change first arg to istream from FILE*
10792 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10794 * src/mathed/math_parser.C: have yyis to be an istream
10795 (LexGetArg): use istream (yyis)
10797 (mathed_parse): ditto
10798 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10800 * src/mathed/formula.C (Read): rewritten to use istream
10802 * src/mathed/formulamacro.C (Read): rewritten to use istream
10804 * src/lyxlex.h (~LyXLex): deleted desturctor
10805 (getStream): new function, returns an istream
10806 (getFile): deleted funtion
10807 (IsOK): return is.good();
10809 * src/lyxlex.C (LyXLex): delete file and owns_file
10810 (setFile): open an filebuf and assign that to a istream instead of
10812 (setStream): new function, takes an istream as arg.
10813 (setFile): deleted function
10814 (EatLine): rewritten us use istream instead of FILE*
10818 * src/table.C (LyXTable): use istream instead of FILE*
10819 (Read): rewritten to take an istream instead of FILE*
10821 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10823 * src/buffer.C (Dispatch): remove an extraneous break statement.
10825 * src/support/filetools.C (QuoteName): change to do simple
10826 'quoting'. More work is necessary. Also changed to do nothing
10827 under emx (needs fix too).
10828 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10830 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10831 config.h.in to the AC_DEFINE_UNQUOTED() call.
10832 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10833 needs char * as argument (because Solaris 7 declares it like
10836 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10837 remove definition of BZERO.
10839 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10841 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10842 defined, "lyxregex.h" if not.
10844 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10846 (REGEX): new variable that is set to regex.c lyxregex.h when
10847 AM_CONDITIONAL USE_REGEX is set.
10848 (libsupport_la_SOURCES): add $(REGEX)
10850 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10853 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10856 * configure.in: add call to LYX_REGEX
10858 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10859 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10861 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10863 * lib/bind/fi_menus.bind: new file, from
10864 pauli.virtanen@saunalahti.fi.
10866 * src/buffer.C (getBibkeyList): pass the parameter delim to
10867 InsetInclude::getKeys and InsetBibtex::getKeys.
10869 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10870 is passed to Buffer::getBibkeyList
10872 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10873 instead of the hardcoded comma.
10875 * src/insets/insetbib.C (getKeys): make sure that there are not
10876 leading blanks in bibtex keys. Normal latex does not care, but
10877 harvard.sty seems to dislike blanks at the beginning of citation
10878 keys. In particular, the retturn value of the function is
10880 * INSTALL: make it clear that libstdc++ is needed and that gcc
10881 2.7.x probably does not work.
10883 * src/support/filetools.C (findtexfile): make debug message go to
10885 * src/insets/insetbib.C (getKeys): ditto
10887 * src/debug.C (showTags): make sure that the output is correctly
10890 * configure.in: add a comment for TWO_COLOR_ICON define.
10892 * acconfig.h: remove all the entries that already defined in
10893 configure.in or acinclude.m4.
10895 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10896 to avoid user name, date and copyright.
10898 1999-12-21 Juergen Vigna <jug@sad.it>
10900 * src/table.C (Read): Now read bogus row format informations
10901 if the format is < 5 so that afterwards the table can
10902 be read by lyx but without any format-info. Fixed the
10903 crash we experienced when not doing this.
10905 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10907 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10908 (RedoDrawingOfParagraph): ditto
10909 (RedoParagraphs): ditto
10910 (RemoveTableRow): ditto
10912 * src/text.C (Fill): rename arg paperwidth -> paper_width
10914 * src/buffer.C (insertLyXFile): rename var filename -> fname
10915 (writeFile): rename arg filename -> fname
10916 (writeFileAscii): ditto
10917 (makeLaTeXFile): ditto
10918 (makeLinuxDocFile): ditto
10919 (makeDocBookFile): ditto
10921 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10924 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10926 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10929 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10930 compiled by a C compiler not C++.
10932 * src/layout.h (LyXTextClass): added typedef for const_iterator
10933 (LyXTextClassList): added typedef for const_iterator + member
10934 functions begin and end.
10936 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10937 iterators to fill the choice_class.
10938 (updateLayoutChoice): rewritten to use iterators to fill the
10939 layoutlist in the toolbar.
10941 * src/BufferView.h (BufferView::work_area_width): removed unused
10944 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10946 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10947 (sgmlCloseTag): ditto
10949 * src/support/lstrings.h: return type of countChar changed to
10952 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10953 what version of this func to use. Also made to return unsigned int.
10955 * configure.in: call LYX_STD_COUNT
10957 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10958 conforming std::count.
10960 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10962 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10963 and a subscript would give bad display (patch from Dekel Tsur
10964 <dekel@math.tau.ac.il>).
10966 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10968 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10971 * src/chset.h: add a few 'using' directives
10973 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10974 triggered when no buffer is active
10976 * src/layout.C: removed `break' after `return' in switch(), since
10979 * src/lyx_main.C (init): make sure LyX can be ran in place even
10980 when libtool has done its magic with shared libraries. Fix the
10981 test for the case when the system directory has not been found.
10983 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10984 name for the latex file.
10985 (MenuMakeHTML): ditto
10987 * src/buffer.h: add an optional boolean argument, which is passed
10988 to ChangeExtension.
10990 1999-12-20 Allan Rae <rae@lyx.org>
10992 * lib/templates/IEEEtran.lyx: small correction and update.
10994 * configure.in: Attempted to use LYX_PATH_HEADER
10996 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10998 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10999 input from JMarc. Now use preprocessor to find the header.
11000 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11001 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11002 LYX_STL_STRING_FWD. See comments in file.
11004 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11006 * The global MiniBuffer * minibuffer variable is dead.
11008 * The global FD_form_main * fd_form_main variable is dead.
11010 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11012 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11014 * src/table.h: add the LOstream.h header
11015 * src/debug.h: ditto
11017 * src/LyXAction.h: change the explaination of the ReadOnly
11018 attribute: is indicates that the function _can_ be used.
11020 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11023 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11025 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11031 * src/paragraph.C (GetWord): assert on pos>=0
11034 * src/support/lyxstring.C: condition the use of an invariant on
11036 * src/support/lyxstring.h: ditto
11038 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11039 Use LAssert.h instead of plain assert().
11041 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11043 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11044 * src/support/filetools.C: ditto
11046 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11049 * INSTALL: document the new configure flags
11051 * configure.in: suppress --with-debug; add --enable-assertions
11053 * acinclude.m4: various changes in alignment of help strings.
11055 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11057 * src/kbmap.C: commented out the use of the hash map in kb_map,
11058 beginning of movement to a stl::container.
11060 * several files: removed code that was not in effect when
11061 MOVE_TEXT was defined.
11063 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11064 for escaping should not be used. We can discuss if the string
11065 should be enclosed in f.ex. [] instead of "".
11067 * src/trans_mgr.C (insert): use the new returned value from
11068 encodeString to get deadkeys and keymaps done correctly.
11070 * src/chset.C (encodeString): changed to return a pair, to tell
11071 what to use if we know the string.
11073 * src/lyxscreen.h (fillArc): new function.
11075 * src/FontInfo.C (resize): rewritten to use more std::string like
11076 structore, especially string::replace.
11078 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11081 * configure.in (chmod +x some scripts): remove config/gcc-hack
11083 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11085 * src/buffer.C (writeFile): change once again the top comment in a
11086 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11087 instead of an hardcoded version number.
11088 (makeDocBookFile): ditto
11090 * src/version.h: add new define LYX_DOCVERSION
11092 * po/de.po: update from Pit Sütterlin
11093 * lib/bind/de_menus.bind: ditto.
11095 * src/lyxfunc.C (Dispatch): call MenuExport()
11096 * src/buffer.C (Dispatch): ditto
11098 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11099 LyXFunc::Dispatch().
11100 (MenuExport): new function, moved from
11101 LyXFunc::Dispatch().
11103 * src/trans_mgr.C (insert): small cleanup
11104 * src/chset.C (loadFile): ditto
11106 * lib/kbd/iso8859-1.cdef: add missing backslashes
11108 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11110 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11111 help with placing the manually drawn accents better.
11113 (Draw): x2 and hg changed to float to minimize rounding errors and
11114 help place the accents better.
11116 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11117 unsigned short to char is just wrong...cast the char to unsigned
11118 char instead so that the two values can compare sanely. This
11119 should also make the display of insetlatexaccents better and
11120 perhaps also some other insets.
11122 (lbearing): new function
11125 1999-12-15 Allan Rae <rae@lyx.org>
11127 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11128 header that provides a wrapper around the very annoying SGI STL header
11131 * src/support/lyxstring.C, src/LString.h:
11132 removed old SGI-STL-compatability attempts.
11134 * configure.in: Use LYX_STL_STRING_FWD.
11136 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11137 stl_string_fwd.h is around and try to determine it's location.
11138 Major improvement over previous SGI STL 3.2 compatability.
11139 Three small problems remain with this function due to my zero
11140 knowledge of autoconf. JMarc and lgb see the comments in the code.
11142 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11144 * src/broken_const.h, config/hack-gcc, config/README: removed
11146 * configure.in: remove --with-gcc-hack option; do not call
11149 * INSTALL: remove documentation of --with-broken-const and
11152 * acconfig.h: remove all trace of BROKEN_CONST define
11154 * src/buffer.C (makeDocBookFile): update version number in output
11156 (SimpleDocBookOnePar): fix an assert when trying to a character
11157 access beyond string length
11160 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11162 * po/de.po: fix the Export menu
11164 * lyx.man: update the description of -dbg
11166 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11167 (commandLineHelp): updated
11168 (easyParse): show list of available debug levels if -dbg is passed
11171 * src/Makefile.am: add debug.C
11173 * src/debug.h: moved some code to debug.C
11175 * src/debug.C: new file. Contains code to set and show debug
11178 * src/layout.C: remove 'break' after 'continue' in switch
11179 statements, since these cannot be reached.
11181 1999-12-13 Allan Rae <rae@lyx.org>
11183 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11184 (in_word_set): hash() -> math_hash()
11186 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11188 * acconfig.h: Added a test for whether we are using exceptions in the
11189 current compilation run. If so USING_EXCEPTIONS is defined.
11191 * config.in: Check for existance of stl_string_fwd.h
11192 * src/LString.h: If compiling --with-included-string and SGI's
11193 STL version 3.2 is present (see above test) we need to block their
11194 forward declaration of string and supply a __get_c_string().
11195 However, it turns out this is only necessary if compiling with
11196 exceptions enabled so I've a bit more to add yet.
11198 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11199 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11200 src/support/LRegex.h, src/undo.h:
11201 Shuffle the order of the included files a little to ensure that
11202 LString.h gets included before anything that includes stl_string_fwd.h
11204 * src/support/lyxstring.C: We need to #include LString.h instead of
11205 lyxstring.h to get the necessary definition of __get_c_string.
11206 (__get_c_string): New function. This is defined static just like SGI's
11207 although why they need to do this I'm not sure. Perhaps it should be
11208 in lstrings.C instead.
11210 * lib/templates/IEEEtran.lyx: New template file.
11212 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11214 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11215 * intl/Makefile.in (MKINSTALLDIRS): ditto
11217 * src/LyXAction.C (init): changed to hold the LFUN data in a
11218 automatic array in stead of in callso to newFunc, this speeds up
11219 compilation a lot. Also all the memory used by the array is
11220 returned when the init is completed.
11222 * a lot of files: compiled with -Wold-style-cast, changed most of
11223 the reported offenders to C++ style casts. Did not change the
11224 offenders in C files.
11226 * src/trans.h (Match): change argument type to unsigned int.
11228 * src/support/DebugStream.C: fix some types on the streambufs so
11229 that it works on a conforming implementation.
11231 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11233 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11235 * src/support/lyxstring.C: remove the inline added earlier since
11236 they cause a bunch of unsatisfied symbols when linking with dec
11237 cxx. Cxx likes to have the body of inlines at the place where they
11240 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11241 accessing negative bounds in array. This fixes the crash when
11242 inserting accented characters.
11243 * src/trans.h (Match): ditto
11245 * src/buffer.C (Dispatch): since this is a void, it should not try
11246 to return anything...
11248 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11250 * src/buffer.h: removed the two friends from Buffer. Some changes
11251 because of this. Buffer::getFileName and Buffer::setFileName
11252 renamed to Buffer::fileName() and Buffer::fileName(...).
11254 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11256 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11257 and Buffer::update(short) to BufferView. This move is currently
11258 controlled by a define MOVE_TEXT, this will be removed when all
11259 shows to be ok. This move paves the way for better separation
11260 between buffer contents and buffer view. One side effect is that
11261 the BufferView needs a rebreak when swiching buffers, if we want
11262 to avoid this we can add a cache that holds pointers to LyXText's
11263 that is not currently in use.
11265 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11268 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11270 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11272 * lyx_main.C: new command line option -x (or --execute) and
11273 -e (or --export). Now direct conversion from .lyx to .tex
11274 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11275 Unfortunately, X is still needed and the GUI pops up during the
11278 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11280 * src/Spacing.C: add a using directive to bring stream stuff into
11282 * src/paragraph.C: ditto
11283 * src/buffer.C: ditto
11285 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11286 from Lars' announcement).
11288 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11289 example files from Tino Meinen.
11291 1999-12-06 Allan Rae <rae@lyx.org>
11293 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11295 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11297 * src/support/lyxstring.C: added a lot of inline for no good
11300 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11301 latexWriteEndChanges, they were not used.
11303 * src/layout.h (operator<<): output operator for PageSides
11305 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11307 * some example files: loaded in LyX 1.0.4 and saved again to update
11308 certain constructs (table format)
11310 * a lot of files: did the change to use fstream/iostream for all
11311 writing of files. Done with a close look at Andre Poenitz's patch.
11313 * some files: whitespace changes.
11315 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11317 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11318 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11319 architecture, we provide our own. It is used unconditionnally, but
11320 I do not think this is a performance problem. Thanks to Angus
11321 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11322 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11324 (GetInset): use my_memcpy.
11328 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11329 it is easier to understand, but it uses less TeX-only constructs now.
11331 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11332 elements contain spaces
11334 * lib/configure: regenerated
11336 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11337 elements contain spaces; display the list of programs that are
11340 * autogen.sh: make sure lib/configure is executable
11342 * lib/examples/*: rename the tutorial examples to begin with the
11343 two-letters language code.
11345 * src/lyxfunc.C (getStatus): do not query current font if no
11348 * src/lyx_cb.C (RunScript): use QuoteName
11349 (MenuRunDvips): ditto
11350 (PrintApplyCB): ditto
11352 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11353 around argument, so that it works well with the current shell.
11354 Does not work properly with OS/2 shells currently.
11356 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11357 * src/LyXSendto.C (SendtoApplyCB): ditto
11358 * src/lyxfunc.C (Dispatch): ditto
11359 * src/buffer.C (runLaTeX): ditto
11360 (runLiterate): ditto
11361 (buildProgram): ditto
11363 * src/lyx_cb.C (RunScript): ditto
11364 (MenuMakeLaTeX): ditto
11366 * src/buffer.h (getLatexName): new method
11368 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11370 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11372 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11373 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11374 (create_math_panel): ditto
11376 * src/lyxfunc.C (getStatus): re-activate the code which gets
11377 current font and cursor; add test for export to html.
11379 * src/lyxrc.C (read): remove unreachable break statements; add a
11382 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11384 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11386 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11387 introduced by faulty regex.
11388 * src/buffer.C: ditto
11389 * src/lastfiles.C: ditto
11390 * src/paragraph.C: ditto
11391 * src/table.C: ditto
11392 * src/vspace.C: ditto
11393 * src/insets/figinset.C: ditto
11394 Note: most of these is absolutely harmless, except the one in
11395 src/mathed formula.C.
11397 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11399 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11400 operation, yielding correct results for the reLyX command.
11402 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11404 * src/support/filetools.C (ExpandPath): removed an over eager
11406 (ReplaceEnvironmentPath): ditto
11408 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11409 shows that we are doing something fishy in our code...
11410 (BubblePost): ditto
11413 * src/lyxrc.C (read): use a double switch trick to get more help
11414 from the compiler. (the same trick is used in layout.C)
11415 (write): new function. opens a ofstream and pass that to output
11416 (output): new function, takes a ostream and writes the lyxrc
11417 elemts to it. uses a dummy switch to make sure no elements are
11420 * src/lyxlex.h: added a struct pushpophelper for use in functions
11421 with more than one exit point.
11423 * src/lyxlex.[Ch] (GetInteger): made it const
11427 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11429 * src/layout.[hC] : LayoutTags splitted into several enums, new
11430 methods created, better error handling cleaner use of lyxlex. Read
11433 * src/bmtable.[Ch]: change some member prototypes because of the
11434 image const changes.
11436 * commandtags.h, src/LyXAction.C (init): new function:
11437 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11438 This file is not read automatically but you can add \input
11439 preferences to your lyxrc if you want to. We need to discuss how
11442 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11443 in .aux, also remove .bib and .bst files from dependencies when
11446 * src/BufferView.C, src/LyXView.C: add const_cast several places
11447 because of changes to images.
11449 * lib/images/*: same change as for images/*
11451 * lib/lyxrc.example: Default for accept_compound is false not no.
11453 * images/*: changed to be const, however I have som misgivings
11454 about this change so it might be changed back.
11456 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11458 * lib/configure, po/POTFILES.in: regenerated
11460 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11462 * config/lib_configure.m4: removed
11464 * lib/configure.m4: new file (was config/lib_configure.m4)
11466 * configure.in: do not test for rtti, since we do not use it.
11468 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11470 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11471 doubling of allocated space scheme. This makes it faster for large
11472 strings end to use less memory for small strings. xtra rememoved.
11474 * src/insets/figinset.C (waitalarm): commented out.
11475 (GhostscriptMsg): use static_cast
11476 (GhostscriptMsg): use new instead of malloc to allocate memory for
11477 cmap. also delete the memory after use.
11479 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11481 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11482 for changes in bibtex database or style.
11483 (runBibTeX): remove all .bib and .bst files from dep before we
11485 (run): use scanAuc in when dep file already exist.
11487 * src/DepTable.C (remove_files_with_extension): new method
11488 (exist): new method
11490 * src/DepTable.[Ch]: made many of the methods const.
11492 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11494 * src/bufferparams.C: make sure that the default textclass is
11495 "article". It used to be the first one by description order, but
11496 now the first one is "docbook".
11498 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11499 string; call Debug::value.
11500 (easyParse): pass complete argument to setDebuggingLevel().
11502 * src/debug.h (value): fix the code that parses debug levels.
11504 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11507 * src/LyXAction.C: use Debug::ACTION as debug channel.
11509 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11511 * NEWS: updated for the future 1.1.3 release.
11513 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11514 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11515 it should. This is of course a controversial change (since many
11516 people will find that their lyx workscreen is suddenly full of
11517 red), but done for the sake of correctness.
11519 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11520 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11522 * src/insets/inseterror.h, src/insets/inseturl.h,
11523 src/insets/insetinfo.h, src/insets/figinset.h,
11524 src/mathed/formulamacro.h, src/mathed/math_macro.h
11525 (EditMessage): add a missing const and add _() to make sure that
11526 translation happens
11528 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11529 src/insets/insetbib.C, src/support/filetools.C: add `using'
11530 directives for cxx.
11532 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11533 doing 'Insert index of last word' at the beginning of a paragraph.
11535 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11537 * several files: white-space changes.
11539 * src/mathed/formula.C: removed IsAlpha and IsDigit
11541 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11542 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11545 * src/insets/figinset.C (GetPSSizes): don't break when
11546 "EndComments" is seen. But break when a boundingbox is read.
11548 * all classes inherited from Inset: return value of Clone
11549 changed back to Inset *.
11551 * all classes inherited form MathInset: return value of Clone
11552 changed back to MathedInset *.
11554 * src/insets/figinset.C (runqueue): use a ofstream to output the
11555 gs/ps file. Might need some setpresicion or setw. However I can
11556 see no problem with the current code.
11557 (runqueue): use sleep instead of the alarm/signal code. I just
11558 can't see the difference.
11560 * src/paragraph.C (LyXParagraph): reserve space in the new
11561 paragraph and resize the inserted paragraph to just fit.
11563 * src/lyxfunc.h (operator|=): added operator for func_status.
11565 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11566 check for readable file.
11568 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11569 check for readable file.
11570 (MenuMakeLinuxDoc): ditto
11571 (MenuMakeDocBook): ditto
11572 (MenuMakeAscii): ditto
11573 (InsertAsciiFile): split the test for openable and readable
11575 * src/bmtable.C (draw_bitmaptable): use
11576 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11578 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11579 findtexfile from LaTeX to filetools.
11581 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11582 instead of FilePtr. Needs to be verified by a literate user.
11584 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11586 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11587 (EditMessage): likewise.
11589 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11590 respectively as \textasciitilde and \textasciicircum.
11592 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11594 * src/support/lyxstring.h: made the methods that take iterators
11595 use const_iterator.
11597 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11598 (regexMatch): made is use the real regex class.
11600 * src/support/Makefile.am: changed to use libtool
11602 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11604 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11606 (MathIsInset ++): changed several macros to be inline functions
11609 * src/mathed/Makefile.am: changed to use libtool
11611 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11613 * src/insets/inset* : Clone changed to const and return type is
11614 the true insettype not just Inset*.
11616 * src/insets/Makefile.am: changed to use libtool
11618 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11620 * src/undo.[Ch] : added empty() and changed some of the method
11623 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11625 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11626 setID use block<> for the bullets array, added const several places.
11628 * src/lyxfunc.C (getStatus): new function
11630 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11631 LyXAction, added const to several funtions.
11633 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11634 a std::map, and to store the dir items in a vector.
11636 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11639 * src/LyXView.[Ch] + other files : changed currentView to view.
11641 * src/LyXAction.[Ch] : ported from the old devel branch.
11643 * src/.cvsignore: added .libs and a.out
11645 * configure.in : changes to use libtool.
11647 * acinclude.m4 : inserted libtool.m4
11649 * .cvsignore: added libtool
11651 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11653 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11654 file name in insets and mathed directories (otherwise the
11655 dependency is not taken in account under cygwin).
11657 * src/text2.C (InsertString[AB]): make sure that we do not try to
11658 read characters past the string length.
11660 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11662 * lib/doc/LaTeXConfig.lyx.in,
11663 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11665 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11666 file saying who created them and when this heppened; this is
11667 useless and annoys tools like cvs.
11669 * lib/layouts/g-brief-{en,de}.layout,
11670 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11671 from Thomas Hartkens <thomas@hartkens.de>.
11673 * src/{insets,mathed}/Makefile.am: do not declare an empty
11674 LDFLAGS, so that it can be set at configure time (useful on Irix
11677 * lib/reLyX/configure.in: make sure that the prefix is set
11678 correctly in LYX_DIR.
11680 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11682 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11683 be used by 'command-sequence' this allows to bind a key to a
11684 sequence of LyX-commands
11685 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11687 * src/LyXAction.C: add "command-sequence"
11689 * src/LyXFunction.C: handling of "command-sequence"
11691 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11692 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11694 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11696 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11698 * src/buffer.C (writeFile): Do not output a comment giving user
11699 and date at the beginning of a .lyx file. This is useless and
11700 annoys cvs anyway; update version number to 1.1.
11702 * src/Makefile.am (LYX_DIR): add this definition, so that a
11703 default path is hardcoded in LyX.
11705 * configure.in: Use LYX_GNU_GETTEXT.
11707 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11708 AM_GNU_GETTEXT with a bug fixed.
11710 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11712 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11714 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11715 which is used to point to LyX data is now LYX_DIR_11x.
11717 * lyx.man: convert to a unix text file; small updates.
11719 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11721 * src/support/LSubstring.[Ch]: made the second arg of most of the
11722 constructors be a const reference.
11724 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11727 * src/support/lyxstring.[Ch] (swap): added missing member function
11728 and specialization of swap(str, str);
11730 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11732 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11733 trace of the old one.
11735 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11736 put the member definitions in undo.C.
11738 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11739 NEW_TEXT and have now only code that was included when this was
11742 * src/intl.C (LCombo): use static_cast
11744 (DispatchCallback): ditto
11746 * src/definitions.h: removed whole file
11748 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11750 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11751 parsing and stores in a std:map. a regex defines the file format.
11752 removed unneeded members.
11754 * src/bufferparams.h: added several enums from definitions.h here.
11755 Removed unsused destructor. Changed some types to use proper enum
11756 types. use block to have the temp_bullets and user_defined_bullets
11757 and to make the whole class assignable.
11759 * src/bufferparams.C (Copy): removed this functions, use a default
11760 assignment instead.
11762 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11765 * src/buffer.C (readLyXformat2): commend out all that have with
11766 oldpapersize to do. also comment out all that hve to do with
11767 insetlatex and insetlatexdel.
11768 (setOldPaperStuff): commented out
11770 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11772 * src/LyXAction.C: remove use of inset-latex-insert
11774 * src/mathed/math_panel.C (button_cb): use static_cast
11776 * src/insets/Makefile.am (insets_o_SOURCES): removed
11779 * src/support/lyxstring.C (helper): use the unsigned long
11780 specifier, UL, instead of a static_cast.
11782 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11784 * src/support/block.h: new file. to be used as a c-style array in
11785 classes, so that the class can be assignable.
11787 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11789 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11790 NULL, make sure to return an empty string (it is not possible to
11791 set a string to NULL).
11793 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11795 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11797 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11799 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11800 link line, so that Irix users (for example) can set it explicitely to
11803 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11804 it can be overidden at make time (static or dynamic link, for
11807 * src/vc-backend.C, src/LaTeXFeatures.h,
11808 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11809 statements to bring templates to global namespace.
11811 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11813 * src/support/lyxstring.C (operator[] const): make it standard
11816 * src/minibuffer.C (Init): changed to reflect that more
11817 information is given from the lyxvc and need not be provided here.
11819 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11821 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11823 * src/LyXView.C (UpdateTimerCB): use static_cast
11824 (KeyPressMask_raw_callback): ditto
11826 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11827 buffer_, a lot of changes because of this. currentBuffer() ->
11828 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11829 also changes to other files because of this.
11831 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11833 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11834 have no support for RCS and partial support for CVS, will be
11837 * src/insets/ several files: changes because of function name
11838 changes in Bufferview and LyXView.
11840 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11842 * src/support/LSubstring.[Ch]: new files. These implement a
11843 Substring that can be very convenient to use. i.e. is this
11845 string a = "Mary had a little sheep";
11846 Substring(a, "sheep") = "lamb";
11847 a is now "Mary has a little lamb".
11849 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11850 out patterns and subpatterns of strings. It is used by LSubstring
11851 and also by vc-backend.C
11853 * src/support/lyxstring.C: went over all the assertions used and
11854 tried to correct the wrong ones and flag which of them is required
11855 by the standard. some bugs found because of this. Also removed a
11856 couple of assertions.
11858 * src/support/Makefile.am (libsupport_a_SOURCES): added
11859 LSubstring.[Ch] and LRegex.[Ch]
11861 * src/support/FileInfo.h: have struct stat buf as an object and
11862 not a pointer to one, some changes because of this.
11864 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11865 information in layout when adding the layouts preamble to the
11866 textclass preamble.
11868 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11871 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11872 because of bug in OS/2.
11874 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11876 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11877 \verbatim@font instead of \ttfamily, so that it can be redefined.
11879 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11880 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11881 src/layout.h, src/text2.C: add 'using' directive to bring the
11882 STL templates we need from the std:: namespace to the global one.
11883 Needed by DEC cxx in strict ansi mode.
11885 * src/support/LIstream.h,src/support/LOstream.h,
11886 src/support/lyxstring.h,src/table.h,
11887 src/lyxlookup.h: do not include <config.h> in header
11888 files. This should be done in the .C files only.
11890 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11894 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11896 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11897 from Kayvan to fix the tth invokation.
11899 * development/lyx.spec.in: updates from Kayvan to reflect the
11900 changes of file names.
11902 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11904 * src/text2.C (InsertStringB): use std::copy
11905 (InsertStringA): use std::copy
11907 * src/bufferlist.C: use a vector to store the buffers in. This is
11908 an internal change and should not affect any other thing.
11910 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11913 * src/text.C (Fill): fix potential bug, one off bug.
11915 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11917 * src/Makefile.am (lyx_main.o): add more files it depends on.
11919 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11921 * src/support/lyxstring.C: use size_t for the reference count,
11922 size, reserved memory and xtra.
11923 (internal_compare): new private member function. Now the compare
11924 functions should work for std::strings that have embedded '\0'
11926 (compare): all compare functions rewritten to use
11929 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11931 * src/support/lyxstring.C (compare): pass c_str()
11932 (compare): pass c_str
11933 (compare): pass c_str
11935 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11937 * src/support/DebugStream.C: <config.h> was not included correctly.
11939 * lib/configure: forgot to re-generate it :( I'll make this file
11940 auto generated soon.
11942 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11944 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11947 * src/support/lyxstring.C: some changes from length() to rep->sz.
11948 avoids a function call.
11950 * src/support/filetools.C (SpaceLess): yet another version of the
11951 algorithm...now per Jean-Marc's suggestions.
11953 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11955 * src/layout.C (less_textclass_desc): functor for use in sorting
11957 (LyXTextClass::Read): sort the textclasses after reading.
11959 * src/support/filetools.C (SpaceLess): new version of the
11960 SpaceLess functions. What problems does this one give? Please
11963 * images/banner_bw.xbm: made the arrays unsigned char *
11965 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11967 * src/support/lyxstring.C (find): remove bogus assertion in the
11968 two versions of find where this has not been done yet.
11970 * src/support/lyxlib.h: add missing int return type to
11973 * src/menus.C (ShowFileMenu): disable exporting to html if no
11974 html export command is present.
11976 * config/lib_configure.m4: add a test for an HTML converter. The
11977 programs checked for are, in this order: tth, latex2html and
11980 * lib/configure: generated from config/lib_configure.m4.
11982 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11983 html converter. The parameters are now passed through $$FName and
11984 $$OutName, instead of standard input/output.
11986 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11988 * lib/lyxrc.example: update description of \html_command.
11989 add "quotes" around \screen_font_xxx font setting examples to help
11990 people who use fonts with spaces in their names.
11992 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11994 * Distribution files: updates for v1.1.2
11996 * src/support/lyxstring.C (find): remove bogus assert and return
11997 npos for the same condition.
11999 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12001 * added patch for OS/2 from SMiyata.
12003 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12005 * src/text2.C (CutSelection): make space_wrapped a bool
12006 (CutSelection): dont declare int i until we have to.
12007 (alphaCounter): return a char const *.
12009 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12011 * src/support/syscall.C (Systemcalls::kill):
12012 src/support/filetools.C (PutEnv, PutEnvPath):
12013 src/lyx_cb.C (addNewlineAndDepth):
12014 src/FontInfo.C (FontInfo::resize): condition some #warning
12015 directives with WITH_WARNINGS.
12018 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12020 * src/layout.[Ch] + several files: access to class variables
12021 limited and made accessor functions instead a lot of code changed
12022 becuase of this. Also instead of returning pointers often a const
12023 reference is returned instead.
12025 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12027 * src/Makefile.am (dist-hook): added used to remove the CVS from
12028 cheaders upon creating a dist
12029 (EXTRA_DIST): added cheaders
12031 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12032 a character not as a small integer.
12034 * src/support/lyxstring.C (find): removed Assert and added i >=
12035 rep->sz to the first if.
12037 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12039 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12040 src/LyXView.C src/buffer.C src/bufferparams.C
12041 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12042 src/text2.C src/insets/insetinclude.C:
12043 lyxlayout renamed to textclasslist.
12045 * src/layout.C: some lyxerr changes.
12047 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12048 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12049 (LyXLayoutList): removed all traces of this class.
12050 (LyXTextClass::Read): rewrote LT_STYLE
12051 (LyXTextClass::hasLayout): new function
12052 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12053 both const and nonconst version.
12054 (LyXTextClass::delete_layout): new function.
12055 (LyXTextClassList::Style): bug fix. do the right thing if layout
12057 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12058 (LyXTextClassList::NameOfLayout): ditto
12059 (LyXTextClassList::Load): ditto
12061 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12063 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12065 * src/LyXAction.C (LookupFunc): added a workaround for sun
12066 compiler, on the other hand...we don't know if the current code
12067 compiles on sun at all...
12069 * src/support/filetools.C (CleanupPath): subst fix
12071 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12074 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12075 complained about this one?
12077 * src/insets/insetinclude.C (Latex): subst fix
12079 * src/insets/insetbib.C (getKeys): subst fix
12081 * src/LyXSendto.C (SendtoApplyCB): subst fix
12083 * src/lyx_main.C (init): subst fix
12085 * src/layout.C (Read): subst fix
12087 * src/lyx_sendfax_main.C (button_send): subst fix
12089 * src/buffer.C (RoffAsciiTable): subst fix
12091 * src/lyx_cb.C (MenuFax): subst fix
12092 (PrintApplyCB): subst fix
12094 1999-10-26 Juergen Vigna <jug@sad.it>
12096 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12098 (Read): Cleaned up this code so now we read only format vestion >= 5
12100 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12102 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12103 come nobody has complained about this one?
12105 * src/insets/insetinclude.C (Latex): subst fix
12107 * src/insets/insetbib.C (getKeys): subst fix
12109 * src/lyx_main.C (init): subst fix
12111 * src/layout.C (Read): subst fix
12113 * src/buffer.C (RoffAsciiTable): subst fix
12115 * src/lyx_cb.C (MenuFax): subst fix.
12117 * src/layout.[hC] + some other files: rewrote to use
12118 std::container to store textclasses and layouts in.
12119 Simplified, removed a lot of code. Make all classes
12120 assignable. Further simplifications and review of type
12121 use still to be one.
12123 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12124 lastfiles to create the lastfiles partr of the menu.
12126 * src/lastfiles.[Ch]: rewritten to use deque to store the
12127 lastfiles in. Uses fstream for reading and writing. Simplifies
12130 * src/support/syscall.C: remove explicit cast.
12132 * src/BufferView.C (CursorToggleCB): removed code snippets that
12133 were commented out.
12134 use explicat C++ style casts instead of C style casts. also use
12135 u_vdata instea of passing pointers in longs.
12137 * src/PaperLayout.C: removed code snippets that were commented out.
12139 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12141 * src/lyx_main.C: removed code snippets that wer commented out.
12143 * src/paragraph.C: removed code snippets that were commented out.
12145 * src/lyxvc.C (logClose): use static_cast
12147 (viewLog): remove explicit cast to void*
12148 (showLog): removed old commented code
12150 * src/menus.C: use static_cast instead of C style casts. use
12151 u_vdata instead of u_ldata. remove explicit cast to (long) for
12152 pointers. Removed old code that was commented out.
12154 * src/insets/inset.C: removed old commented func
12156 * src/insets/insetref.C (InsetRef): removed old code that had been
12157 commented out for a long time.
12159 (escape): removed C style cast
12161 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12163 * src/insets/insetlatex.C (Draw): removed old commented code
12164 (Read): rewritten to use string
12166 * src/insets/insetlabel.C (escape): removed C style cast
12168 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12170 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12171 old commented code.
12173 * src/insets/insetinclude.h: removed a couple of stupid bools
12175 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12176 (Clone): remove C style cast
12177 (getKeys): changed list to lst because of std::list
12179 * src/insets/inseterror.C (Draw): removed som old commented code.
12181 * src/insets/insetcommand.C (Draw): removed some old commented code.
12183 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12184 commented out forever.
12185 (bibitem_cb): use static_cast instead of C style cast
12186 use of vdata changed to u_vdata.
12188 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12190 (CloseUrlCB): use static_cast instead of C style cast.
12191 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12193 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12194 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12195 (CloseInfoCB): static_cast from ob->u_vdata instead.
12196 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12199 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12200 (C_InsetError_CloseErrorCB): forward the ob parameter
12201 (CloseErrorCB): static_cast from ob->u_vdata instead.
12203 * src/vspace.h: include LString.h since we use string in this class.
12205 * src/vspace.C (lyx_advance): changed name from advance because of
12206 nameclash with stl. And since we cannot use namespaces yet...I
12207 used a lyx_ prefix instead. Expect this to change when we begin
12210 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12212 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12213 and removed now defunct constructor and deconstructor.
12215 * src/BufferView.h: have backstack as a object not as a pointer.
12216 removed initialization from constructor. added include for BackStack
12218 * development/lyx.spec.in (%build): add CFLAGS also.
12220 * src/screen.C (drawFrame): removed another warning.
12222 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12224 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12225 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12226 README and ANNOUNCE a bit for the next release. More work is
12229 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12230 unbreakable if we are in freespacing mode (LyX-Code), but not in
12233 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12235 * src/BackStack.h: fixed initialization order in constructor
12237 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12239 * acinclude.m4 (VERSION): new rules for when a version is
12240 development, added also a variable for prerelease.
12241 (warnings): we set with_warnings=yes for prereleases
12242 (lyx_opt): prereleases compile with same optimization as development
12243 (CXXFLAGS): only use pedantic if we are a development version
12245 * src/BufferView.C (restorePosition): don't do anything if the
12246 backstack is empty.
12248 * src/BackStack.h: added member empty, use this to test if there
12249 is anything to pop...
12251 1999-10-25 Juergen Vigna <jug@sad.it>
12254 * forms/layout_forms.fd +
12255 * forms/latexoptions.fd +
12256 * lyx.fd: changed for various form resize issues
12258 * src/mathed/math_panel.C +
12259 * src/insets/inseterror.C +
12260 * src/insets/insetinfo.C +
12261 * src/insets/inseturl.C +
12262 * src/insets/inseturl.h +
12264 * src/LyXSendto.C +
12265 * src/PaperLayout.C +
12266 * src/ParagraphExtra.C +
12267 * src/TableLayout.C +
12269 * src/layout_forms.C +
12276 * src/menus.C: fixed various resize issues. So now forms can be
12277 resized savely or not be resized at all.
12279 * forms/form_url.fd +
12280 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12283 * src/insets/Makefile.am: added files form_url.[Ch]
12285 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12287 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12288 (and presumably 6.2).
12290 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12291 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12292 remaining static member callbacks.
12294 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12297 * src/support/lyxstring.h: declare struct Srep as friend of
12298 lyxstring, since DEC cxx complains otherwise.
12300 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12302 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12304 * src/LaTeX.C (run): made run_bibtex also depend on files with
12306 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12307 are put into the dependency file.
12309 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12310 the code has shown itself to work
12311 (create_ispell_pipe): removed another warning, added a comment
12314 * src/minibuffer.C (ExecutingCB): removed code that has been
12315 commented out a long time
12317 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12318 out code + a warning.
12320 * src/support/lyxstring.h: comment out the three private
12321 operators, when compiling with string ansi conforming compilers
12322 they make problems.
12324 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12326 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12327 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12330 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12333 * src/mathed/math_panel.C (create_math_panel): remove explicit
12336 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12339 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12340 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12341 to XCreatePixmapFromBitmapData
12342 (fl_set_bmtable_data): change the last argument to be unsigned
12344 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12345 and bh to be unsigned int, remove explicit casts in call to
12346 XReadBitmapFileData.
12348 * images/arrows.xbm: made the arrays unsigned char *
12349 * images/varsz.xbm: ditto
12350 * images/misc.xbm: ditto
12351 * images/greek.xbm: ditto
12352 * images/dots.xbm: ditto
12353 * images/brel.xbm: ditto
12354 * images/bop.xbm: ditto
12356 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12358 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12359 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12360 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12362 (LYX_CXX_CHEADERS): added <clocale> to the test.
12364 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12366 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12368 * src/support/lyxstring.C (append): fixed something that must be a
12369 bug, rep->assign was used instead of rep->append.
12371 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12374 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12375 lyx insert double chars. Fix spotted by Kayvan.
12377 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12379 * Fixed the tth support. I messed up with the Emacs patch apply feature
12380 and omitted the changes in lyxrc.C.
12382 1999-10-22 Juergen Vigna <jug@sad.it>
12384 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12386 * src/lyx_cb.C (MenuInsertRef) +
12387 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12388 the form cannot be resized under it limits (fixes a segfault)
12390 * src/lyx.C (create_form_form_ref) +
12391 * forms/lyx.fd: Changed Gravity on name input field so that it is
12394 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12396 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12397 <ostream> and <istream>.
12399 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12400 whether <fstream> provides the latest standard features, or if we
12401 have an oldstyle library (like in egcs).
12402 (LYX_CXX_STL_STRING): fix the test.
12404 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12405 code on MODERN_STL_STREAM.
12407 * src/support/lyxstring.h: use L{I,O}stream.h.
12409 * src/support/L{I,O}stream.h: new files, designed to setup
12410 correctly streams for our use
12411 - includes the right header depending on STL capabilities
12412 - puts std::ostream and std::endl (for LOStream.h) or
12413 std::istream (LIStream.h) in toplevel namespace.
12415 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12417 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12418 was a bib file that had been changed we ensure that bibtex is run.
12419 (runBibTeX): enhanced to extract the names of the bib files and
12420 getting their absolute path and enter them into the dep file.
12421 (findtexfile): static func that is used to look for tex-files,
12422 checks for absolute patchs and tries also with kpsewhich.
12423 Alternative ways of finding the correct files are wanted. Will
12425 (do_popen): function that runs a command using popen and returns
12426 the whole output of that command in a string. Should be moved to
12429 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12430 file with extension ext has changed.
12432 * src/insets/figinset.C: added ifdef guards around the fl_free
12433 code that jug commented out. Now it is commented out when
12434 compiling with XForms == 0.89.
12436 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12437 to lyxstring.C, and only keep a forward declaration in
12438 lyxstring.h. Simplifies the header file a bit and should help a
12439 bit on compile time too. Also changes to Srep will not mandate a
12440 recompile of code just using string.
12441 (~lyxstring): definition moved here since it uses srep.
12442 (size): definition moved here since it uses srep.
12444 * src/support/lyxstring.h: removed a couple of "inline" that should
12447 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12449 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12452 1999-10-21 Juergen Vigna <jug@sad.it>
12454 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12455 set to left if I just remove the width entry (or it is empty).
12457 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12458 paragraph when having dummy paragraphs.
12460 1999-10-20 Juergen Vigna <jug@sad.it>
12462 * src/insets/figinset.C: just commented some fl_free_form calls
12463 and added warnings so that this calls should be activated later
12464 again. This avoids for now a segfault, but we have a memory leak!
12466 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12467 'const char * argument' to 'string argument', this should
12468 fix some Asserts() in lyxstring.C.
12470 * src/lyxfunc.h: Removed the function argAsString(const char *)
12471 as it is not used anymore.
12473 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12475 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12478 * src/Literate.h: some funcs moved from public to private to make
12479 interface clearer. Unneeded args removed.
12481 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12483 (scanBuildLogFile): ditto
12485 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12486 normal TeX Error. Still room for improvement.
12488 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12490 * src/buffer.C (insertErrors): changes to make the error
12491 desctription show properly.
12493 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12496 * src/support/lyxstring.C (helper): changed to use
12497 sizeof(object->rep->ref).
12498 (operator>>): changed to use a pointer instead.
12500 * src/support/lyxstring.h: changed const reference & to value_type
12501 const & lets see if that helps.
12503 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12505 * Makefile.am (rpmdist): fixed to have non static package and
12508 * src/support/lyxstring.C: removed the compilation guards
12510 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12513 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12514 conditional compile of lyxstring.Ch
12516 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12517 stupid check, but it is a lot better than the bastring hack.
12518 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12520 * several files: changed string::erase into string::clear. Not
12523 * src/chset.C (encodeString): use a char temporary instead
12525 * src/table.C (TexEndOfCell): added tostr around
12526 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12527 (TexEndOfCell): ditto
12528 (TexEndOfCell): ditto
12529 (TexEndOfCell): ditto
12530 (DocBookEndOfCell): ditto
12531 (DocBookEndOfCell): ditto
12532 (DocBookEndOfCell): ditto
12533 (DocBookEndOfCell): ditto
12535 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12537 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12539 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12540 (MenuBuildProg): added tostr around ret
12541 (MenuRunChktex): added tostr around ret
12542 (DocumentApplyCB): added tostr around ret
12544 * src/chset.C (encodeString): added tostr around t->ic
12546 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12547 (makeLaTeXFile): added tostr around tocdepth
12548 (makeLaTeXFile): added tostr around ftcound - 1
12550 * src/insets/insetbib.C (setCounter): added tostr around counter.
12552 * src/support/lyxstring.h: added an operator+=(int) to catch more
12555 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12556 (lyxstring): We DON'T allow NULL pointers.
12558 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12560 * src/mathed/math_macro.C (MathMacroArgument::Write,
12561 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12562 when writing them out.
12564 * src/LString.C: remove, since it is not used anymore.
12566 * src/support/lyxstring.C: condition the content to
12567 USE_INCLUDED_STRING macro.
12569 * src/mathed/math_symbols.C, src/support/lstrings.C,
12570 src/support/lyxstring.C: add `using' directive to specify what
12571 we need in <algorithm>. I do not think that we need to
12572 conditionalize this, but any thought is appreciated.
12574 * many files: change all callback functions to "C" linkage
12575 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12576 strict_ansi. Those who were static are now global.
12577 The case of callbacks which are static class members is
12578 trickier, since we have to make C wrappers around them (see
12579 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12580 did not finish this yet, since it defeats the purpose of
12581 encapsulation, and I am not sure what the best route is.
12583 1999-10-19 Juergen Vigna <jug@sad.it>
12585 * src/support/lyxstring.C (lyxstring): we permit to have a null
12586 pointer as assignment value and just don't assign it.
12588 * src/vspace.C (nextToken): corrected this function substituting
12589 find_first(_not)_of with find_last_of.
12591 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12592 (TableOptCloseCB) (TableSpeCloseCB):
12593 inserted fl_set_focus call for problem with fl_hide_form() in
12596 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12598 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12601 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12603 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12604 LyXLex::next() and not eatline() to get its argument.
12606 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12608 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12609 instead, use fstreams for io of the depfile, removed unneeded
12610 functions and variables.
12612 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12613 vector instead, removed all functions and variables that is not in
12616 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12618 * src/buffer.C (insertErrors): use new interface to TeXError
12620 * Makefile.am (rpmdist): added a rpmdist target
12622 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12623 per Kayvan's instructions.
12625 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12627 * src/Makefile.am: add a definition for localedir, so that locales
12628 are found after installation (Kayvan)
12630 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12632 * development/.cvsignore: new file.
12634 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12636 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12637 C++ compiler provides wrappers for C headers and use our alternate
12640 * configure.in: use LYX_CXX_CHEADERS.
12642 * src/cheader/: new directory, populated with cname headers from
12643 libstdc++-2.8.1. They are a bit old, but probably good enough for
12644 what we want (support compilers who lack them).
12646 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12647 from includes. It turns out is was stupid.
12649 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12651 * lib/Makefile.am (install-data-local): forgot a ';'
12652 (install-data-local): forgot a '\'
12653 (libinstalldirs): needed after all. reintroduced.
12655 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12657 * configure.in (AC_OUTPUT): added lyx.spec
12659 * development/lyx.spec: removed file
12661 * development/lyx.spec.in: new file
12663 * po/*.po: merged with lyx.pot becuase of make distcheck
12665 * lib/Makefile.am (dist-hook): added dist-hook so that
12666 documentation files will be included when doing a make
12667 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12668 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12670 more: tried to make install do the right thing, exclude CVS dirs
12673 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12674 Path would fit in more nicely.
12676 * all files that used to use pathstack: uses now Path instead.
12677 This change was a lot easier than expected.
12679 * src/support/path.h: new file
12681 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12683 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12685 * src/support/lyxstring.C (getline): Default arg was given for
12688 * Configure.cmd: removed file
12690 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12692 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12693 streams classes and types, add the proper 'using' statements when
12694 MODERN_STL is defined.
12696 * src/debug.h: move the << operator definition after the inclusion
12699 * src/support/filetools.C: include "LAssert.h", which is needed
12702 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12705 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12706 include "debug.h" to define a proper ostream.
12708 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12710 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12711 method to the SystemCall class which can kill a process, but it's
12712 not fully implemented yet.
12714 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12716 * src/support/FileInfo.h: Better documentation
12718 * src/lyxfunc.C: Added support for buffer-export html
12720 * src/menus.C: Added Export->As HTML...
12722 * lib/bind/*.bind: Added short-cut for buffer-export html
12724 * src/lyxrc.*: Added support for new \tth_command
12726 * lib/lyxrc.example: Added stuff for new \tth_command
12728 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12730 * lib/Makefile.am (IMAGES): removed images/README
12731 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12732 installes in correct place. Check permisions is installed
12735 * src/LaTeX.C: some no-op changes moved declaration of some
12738 * src/LaTeX.h (LATEX_H): changed include guard name
12740 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12742 * lib/reLyX/Makefile.am: install noweb2lyx.
12744 * lib/Makefile.am: install configure.
12746 * lib/reLyX/configure.in: declare a config aux dir; set package
12747 name to lyx (not sure what the best solution is); generate noweb2lyx.
12749 * lib/layouts/egs.layout: fix the bibliography layout.
12751 1999-10-08 Jürgen Vigna <jug@sad.it>
12753 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12754 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12755 it returned without continuing to search the path.
12757 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12759 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12760 also fixes a bug. It is not allowed to do tricks with std::strings
12761 like: string a("hei"); &a[e]; this will not give what you
12762 think... Any reason for the complexity in this func?
12764 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12766 * Updated README and INSTALL a bit, mostly to check that my
12767 CVS rights are correctly set up.
12769 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12771 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12772 does not allow '\0' chars but lyxstring and std::string does.
12774 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12776 * autogen.sh (AUTOCONF): let the autogen script create the
12777 POTFILES.in file too. POTFILES.in should perhaps now not be
12778 included in the cvs module.
12780 * some more files changed to use C++ includes instead of C ones.
12782 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12784 (Reread): added tostr to nlink. buggy output otherwise.
12785 (Reread): added a string() around szMode when assigning to Buffer,
12786 without this I got a log of garbled info strings.
12788 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12791 * I have added several ostream & operator<<(ostream &, some_type)
12792 functions. This has been done to avoid casting and warnings when
12793 outputting enums to lyxerr. This as thus eliminated a lot of
12794 explicit casts and has made the code clearer. Among the enums
12795 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12796 mathed enums, some font enum the Debug::type enum.
12798 * src/support/lyxstring.h (clear): missing method. equivalent of
12801 * all files that contained "stderr": rewrote constructs that used
12802 stderr to use lyxerr instead. (except bmtable)
12804 * src/support/DebugStream.h (level): and the passed t with
12805 Debug::ANY to avoid spurious bits set.
12807 * src/debug.h (Debug::type value): made it accept strings of the
12808 type INFO,INIT,KEY.
12810 * configure.in (Check for programs): Added a check for kpsewhich,
12811 the latex generation will use this later to better the dicovery of
12814 * src/BufferView.C (create_view): we don't need to cast this to
12815 (void*) that is done automatically.
12816 (WorkAreaButtonPress): removed some dead code.
12818 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12820 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12821 is not overwritten when translated (David Sua'rez de Lis).
12823 * lib/CREDITS: Added David Sua'rez de Lis
12825 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12827 * src/bufferparams.C (BufferParams): default input encoding is now
12830 * acinclude.m4 (cross_compiling): comment out macro
12831 LYX_GXX_STRENGTH_REDUCE.
12833 * acconfig.h: make sure that const is not defined (to empty) when
12834 we are compiling C++. Remove commented out code using SIZEOF_xx
12837 * configure.in : move the test for const and inline as late as
12838 possible so that these C tests do not interefere with C++ ones.
12839 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12840 has not been proven.
12842 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12844 * src/table.C (getDocBookAlign): remove bad default value for
12845 isColumn parameter.
12847 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12849 (ShowFileMenu2): ditto.
12851 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12852 of files to ignore.
12854 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12856 * Most files: finished the change from the old error code to use
12857 DebugStream for all lyxerr debugging. Only minor changes remain
12858 (e.g. the setting of debug levels using strings instead of number)
12860 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12862 * src/layout.C (Add): Changed to use compare_no_case instead of
12865 * src/FontInfo.C: changed loop variable type too string::size_type.
12867 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12869 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12870 set ETAGS_ARGS to --c++
12872 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12874 * src/table.C (DocBookEndOfCell): commented out two unused variables
12876 * src/paragraph.C: commented out four unused variables.
12878 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12879 insed a if clause with type string::size_type.
12881 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12884 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12886 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12887 variable, also changed loop to go from 0 to lenght + 1, instead of
12888 -1 to length. This should be correct.
12890 * src/LaTeX.C (scanError): use string::size_type as loop variable
12893 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12894 (l.896) since y_tmp and row was not used anyway.
12896 * src/insets/insetref.C (escape): use string::size_type as loop
12899 * src/insets/insetquotes.C (Width): use string::size_type as loop
12901 (Draw): use string::size_type as loop variable type.
12903 * src/insets/insetlatexaccent.C (checkContents): use
12904 string::size_type as loop variable type.
12906 * src/insets/insetlabel.C (escape): use string::size_type as loop
12909 * src/insets/insetinfo.C: added an extern for current_view.
12911 * src/insets/insetcommand.C (scanCommand): use string::size_type
12912 as loop variable type.
12914 * most files: removed the RCS tags. With them we had to recompile
12915 a lot of files after a simple cvs commit. Also we have never used
12916 them for anything meaningful.
12918 * most files: tags-query-replace NULL 0. As adviced several plases
12919 we now use "0" instead of "NULL" in our code.
12921 * src/support/filetools.C (SpaceLess): use string::size_type as
12922 loop variable type.
12924 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12926 * src/paragraph.C: fixed up some more string stuff.
12928 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12930 * src/support/filetools.h: make modestr a std::string.
12932 * src/filetools.C (GetEnv): made ch really const.
12934 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12935 made code that used these use max/min from <algorithm> instead.
12937 * changed several c library include files to their equivalent c++
12938 library include files. All is not changed yet.
12940 * created a support subdir in src, put lyxstring and lstrings
12941 there + the extra files atexit, fileblock, strerror. Created
12942 Makefile.am. edited configure.in and src/Makefile.am to use this
12943 new subdir. More files moved to support.
12945 * imported som of the functions from repository lyx, filetools
12947 * ran tags-query-replace on LString -> string, corrected the bogus
12948 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12949 is still some errors in there. This is errors where too much or
12950 too litle get deleted from strings (string::erase, string::substr,
12951 string::replace), there can also be some off by one errors, or
12952 just plain wrong use of functions from lstrings. Viewing of quotes
12955 * LyX is now running fairly well with string, but there are
12956 certainly some bugs yet (see above) also string is quite different
12957 from LString among others in that it does not allow null pointers
12958 passed in and will abort if it gets any.
12960 * Added the revtex4 files I forgot when setting up the repository.
12962 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12964 * All over: Tried to clean everything up so that only the files
12965 that we really need are included in the cvs repository.
12966 * Switched to use automake.
12967 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12968 * Install has not been checked.
12970 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12972 * po/pt.po: Three errors:
12973 l.533 and l.538 format specification error
12974 l. 402 duplicate entry, I just deleted it.