1 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/lyxlookup.C: do not condition on FL_REVISION.
6 * src/sp_form.C: fix the font size of some text entries
8 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
9 after TOC when there is no TOC.
11 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
12 bind file if it has not been done yet.
13 (read): remove local bindFile variable. Try to fix the handling of
14 RC_BIND and RC_BINDFILE.
16 * src/lyx_main.C (init): use readBindFileIfNeeded().
18 * lib/languages: Change description of german to "German (new
21 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
23 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
24 "Apply" buttons if arg is non-zero.
26 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
27 launching the popup if sufficient info is passed to
30 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
32 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
33 labels (disabled in 1.1.6).
35 * src/lyxrc.[Ch]: New variable label_init_length
37 * mathed/formula.C (LocalDispatch): Preserve the label when
38 changing from display math to eqnarray (however, the label
39 do not appear at the first line, as one might expects, but at the
41 (LocalDispatch): When inserting a label to a formula which already
42 have a label, the old label is used as default value.
43 Also, if the label is changed, then all references to the label
46 * src/mathed/math_iter.C (setLabel): Allow to set the label
47 even if it is empty. This is needed to allow deletion of a label
50 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
51 refernces only if the old label appears once in the document.
53 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
55 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
56 <gehlert@Rcs1.urz.tu-dresden.de>
58 * src/frontends/xforms/FormBase.C: comment out debug.h
60 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
61 code in xform_helpers instead.
62 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
64 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
65 Use N_(), rather than _() when creating strings to pass to browseFile()
66 because browseFile calls gettext() itself now.
68 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
69 display the filename correctly.
71 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
73 * src/converter.C (Move): New method. Used to move file or files
74 from temp dir to the output dir. (this fixes the bug that
75 exporting linuxdoc/docbook document to html would not move all
76 html file from temp directory).
78 * src/support/filetools.C (DirList): Fixed.
80 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
82 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
84 * src/converter.C (Add): Remove $$i when setting latex_command.
86 * src/text.C (IsBoundary): Return false when pos = 0.
88 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
90 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
92 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
94 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
95 need to empty the fields to turn off use of the geometry package!
97 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
99 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
100 (Buffer const &), not a (BufferParams const &) and so fix a crash
101 caused by using current_view before it had been initialised. Not
102 the best way to do this, but much easier than changing
103 Inset::Clone(Buffer const &) to Inset::Clone().
106 * src/tabular.C: changed call to CopyIntoMinibuffer().
108 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
110 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
112 * src/lyxfunc.C (getStatus): disable insertion of floats in a
115 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
117 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
118 changed filter for screen fonts input filter from int to float
120 * src/frontends/xforms/input_validators.c: removed.
121 * src/frontends/xforms/input_validators.C: new file. Can now call C++
122 functions from within the filter functions.
124 * src/frontends/xforms/input_validators.[Ch]
125 (fl_unsigned_float_filter): new filter function.
127 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
128 confused now! And if you think I'm going to do this in
129 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
131 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
133 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
135 * src/WorkArea.C (work_area_handler): don't handle button requests
136 if xbutton.button == 0
138 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
140 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
141 It creates a lot of interesting problems.
143 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
145 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
146 the menu exists in the current menubar before opening it.
148 * src/MenuBackend.C (hasSubmenu): new method.
150 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
151 action value by offsetting actions by a large constant (so that
152 bogs choice result will be less than this constant).
154 * lib/bind/fi_menus.bind: more cleanup to menus.
155 * lib/bind/sciword.bind: ditto.
156 * lib/bind/xemacs.bind: ditto.
157 * lib/bind/emacs.bind: ditto.
158 * lib/bind/pt_menus.bind: ditto.
159 * lib/bind/hu_menus.bind: ditto.
161 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
163 * INSTALL: update PROBLEMS section.
165 * src/lyxlookup.h: remove condition on xforms version, since we
166 should not include it if not appropriate.
168 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
170 * src/LColor.C: "latex text" -> "latex inset" (from
173 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
175 * src/frontends/kde/FormTabularCreate.C:
176 * src/frontends/kde/citationdlg.C:
177 * src/frontends/kde/copyrightdlg.C:
178 * src/frontends/kde/paradlg.C:
179 * src/frontends/kde/paraextradlg.C:
180 * src/frontends/kde/parageneraldlg.C:
181 * src/frontends/kde/printdlg.C:
182 * src/frontends/kde/refdlg.C:
183 * src/frontends/kde/tabcreatedlg.C:
184 * src/frontends/kde/tocdlg.C:
185 * src/frontends/kde/urldlg.C: add necessary headers
188 * src/frontends/kde/dlg/emptytable.C:
189 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
190 default parameters (from Angus Leeming)
192 * src/frontends/kde/dlg/moc/.cvsignore:
193 * src/frontends/kde/dlg/.cvsignore:
194 * src/frontends/kde/moc/.cvsignore: fix the library name
197 * src/frontends/kde/paradlg.C:
198 * src/frontends/kde/parageneraldlg.C:
199 * src/frontends/kde/dlg/para.dlg:
200 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
202 * src/frontends/kde/dlg/README: clarified qtarch version
204 * src/frontends/kde/dlg/Makefile.am: removed the
205 dlg rules as they created spontaneous rebuilds
206 (not a good idea as it requires qtarch)
208 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
210 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
211 fixlevel along with xforms version.
213 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
214 xforms version is strictly less than 0.89.5.
215 * src/lyx_gui.C (LyXGUI): ditto.
216 * src/LyXView.C (show): ditto.
218 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
220 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
221 movement in inset in RTL text.
222 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
223 (workAreaButtonRelease): Do not open a float when there is a selection.
225 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
227 * src/spellchecker.C (RunSpellChecker): Open all floats before
230 * src/text.C (InsertChar): Consider "," as a part of a number
231 (for LTR numbers in RTL text code).
232 (IsBoundary): Fixed (and simplified).
233 (InsertChar): Recalculate cursor boundary.
236 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
238 * src/spellchecker.C: fix figures with pspell enabled
240 * src/insets/figinset.C: workaround for gs hang xforms bug
242 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
244 * lib/bind/??_menus.bind: comment out the entries corresponding to
245 real menus. They should be eventually removed, but I'll let the
246 language maintainers do that.
248 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
250 * src/frontends/kde/parageneraldlg.C:
251 * src/frontends/kde/parageneraldlg.h: don't use
252 a derived class for SpaceAbove/Below
254 * src/frontends/kde/dlg/README: add some info
256 * src/frontends/kde/dlg/*: update data files, update
259 * src/frontends/kde/dlg/moc/Makefile.am: add
262 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
264 * configure.in: add new KDE Makefiles
265 * src/vspace.h: return GlueLength not a normal one
266 * src/support/lstrings.h:
267 * src/support/lstrings.C: add isStrUnsignedInt(),
270 * src/frontends/kde/*: big reorganisation, update
271 FormParagraph, add FormTabCreate
273 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
275 * lib/ui/default.ui: small grammatical change.
277 * src/frontends/xforms/xform_macros.h: removed.
279 * src/frontends/xforms/FormBase.C:
280 * src/frontends/xforms/FormPreferences.C:
281 * src/frontends/xforms/Makefile.am: changes associated with removing
282 xform_macros.h. Should make Lars' debugging a little easier.
284 * src/frontends/xforms/FormPreferences.C:
285 * src/frontends/xforms/FormPreferences.h:
286 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
287 longer use X11 color name database. HSV and RGB dials/sliders.
288 Please let this be the end of this!
290 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
292 * Several files: Allow compilation when the compiler doesn't
295 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
298 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
299 command line options.
301 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
303 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
304 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
307 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
309 * src/frontends/xforms/FormRef.C (updateBrowser):
310 * src/frontends/xforms/forms/form_ref.fd: try clicking on
311 different insets with the sort key active. Now apply this patch!
313 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
315 * src/frontends/xforms/FormPrint.C: set to valid()
316 when we update from the passed parameters.
318 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
320 * src/LColor.C (getFromGUIName): internationalise the comparison.
322 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
323 FormPreferences choice.
325 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
328 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
330 * src/lyxrc.C: more detail for the printer program config
333 * src/LColor.C: ert->latex text. LColor needs a big revamp
334 but will have to wait till after 1.1.6
336 * src/buffer.C: bring up a dialog if we load a document
337 with an un-installed text class, rather than just complain
340 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
342 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
343 the browser form for a combox in a tabbed folder. Bug fix courtesy of
344 Steve Lamont <spl@ncmir.ucsd.edu>.
346 * src/frontends/xforms/FormDocument.C (build):
347 * src/frontends/xforms/FormPreferences.C (Language::build):
348 pass tabfolders to Combox::add() in order to use this work around.
350 * src/frontends/xforms/FormCitation.C (connect): remove max size
352 (update): sort list of bibliography keys.
354 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
356 No max size limitation. Same popup for new and existing insets. Fixes
357 bugs reported by Rob Lahaye.
359 * src/frontends/xforms/FormCitation.C (c-tor):
360 * src/frontends/xforms/FormCopyright.C (c-tor):
361 * src/frontends/xforms/FormError.C (c-tor):
362 * src/frontends/xforms/FormGraphics.C (c-tor):
363 * src/frontends/xforms/FormIndex.C (c-tor):
364 * src/frontends/xforms/FormRef.C (c-tor):
365 * src/frontends/xforms/FormToc.C (c-tor):
366 * src/frontends/xforms/FormUrl.C (c-tor):
367 use correct policy for ButtonController.
369 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
371 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
374 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
376 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
377 Some resizing changes.
379 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
381 * configure.in: fix typo
383 * lib/languages: add ukraninian and change no to no_NO
385 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
387 * src/bufferview_funcs.C (FontSize): use setLyXSize
389 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
391 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
392 to check for systems where mkstemp() is available but not declared
393 in headers. The new autoconf macro lyx_CHECK_DECL can be used
394 to check for declarations in headers.
396 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
398 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
400 * forms/makefile: added bibforms.fd, include_form.fd.
401 Removed lyx_sendfax.fd.
403 * src/LaTeXLog.C (ShowLatexLog):
404 * src/LyXAction.C (init):
405 * src/bufferparams.C (readLanguage): altered messages as suggested by
408 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
411 * src/credits.C: made fd_form_credits non-static, so that it can be
412 redrawn should the xforms colors be re-mapped.
413 * src/spellchecker.C ditto fd_form_spell_options.
415 * src/filedlg.[Ch] (redraw):
416 * src/intl.[Ch] (redraw):
417 * src/lyxfr0.[Ch] (redraw):
418 * src/insets/figinset.[Ch] (redraw):
419 * src/insets/insetexternal.[Ch] (redraw):
420 new methods, connected to Dialogs::redrawGUI.
422 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
423 to be connected to Dialogs::redrawGUI.
425 * src/frontends/xforms/FormCitation.C (build):
426 * src/frontends/xforms/FormCopyright.C (build):
427 * src/frontends/xforms/FormError.C (build):
428 * src/frontends/xforms/FormGraphics.C (build):
429 * src/frontends/xforms/FormIndex.C (build):
430 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
431 * src/frontends/xforms/FormToc.C (build):
432 * src/frontends/xforms/FormUrl.C (build):
433 use the ButtonController correctly.
435 * src/frontends/xforms/FormCopyright.C (build):
436 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
437 the .fd file and into build().
439 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
441 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
443 * src/frontends/xforms/forms/form_citation.fd:
444 * src/frontends/xforms/forms/form_copyright.fd:
445 * src/frontends/xforms/forms/form_error.fd:
446 * src/frontends/xforms/forms/form_graphics.fd:
447 * src/frontends/xforms/forms/form_index.fd:
448 * src/frontends/xforms/forms/form_toc.fd:
449 * src/frontends/xforms/forms/form_url.fd:
450 renamed some of the objects. Named others explicitly for the first time.
451 Added Restore and Apply buttons where appropriate.
453 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
456 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
458 * src/version.h: try the pre2 again
460 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
462 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
464 * src/frontends/kde/FormParagraph.C: added using directive.
466 * src/frontends/kde/paradlg.C: added config.h and using directive.
468 * src/frontends/kde/paradlg.h: added std::qualifier.
470 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
472 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
474 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
476 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
478 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
480 * src/version.h: set back to 1.1.6cvs
482 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
484 * src/version.h: set to 1.1.6pre2
486 2000-11-20 Marko Vendelin <markov@ioc.ee>
488 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
490 * src/frontends/gnome/Makefile.am: updated list of XForms object files
492 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
494 * src/LColor.C (init):
495 * src/lyxrc.C (getDescription): changed some comments as suggested by
498 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
499 disconnect the redrawGUI signal in best-practice fashion.
501 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
502 long_opts_tab to reflect the change in name of this tabfolder, as
503 suggested by John Levon.
504 (connect, disconnect): new methods. Don't do much at present other than
505 ensuring that we can't resize the dialog. This just makes xforms go
507 (lots of methods in Colors): made void rather than bool. The idea is
508 to have an isOk() function that keeps track of whether any input is
509 genuinely invalid and should therefore block Save, Apply.
510 Easier to manipulate the counters rapidly.
511 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
512 compiler will like this code. Much cleaner way of doing things.
514 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
516 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
517 rather than simple counters, following suggestion by John Levon.
519 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
520 than engraved frame + text.
522 * src/frontends/xforms/forms/makefile: removed spurious command.
524 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
526 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
528 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
531 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
533 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
534 see what Lars has changed and what is just white space!
535 Now used X directly to ascertain the RGB color associated with the
537 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
539 Added some sort capability.
540 The X11 color name database input is only displayed if the database
541 isn't found in the standard place.
542 Got rid of struct compare_converter; it wasn't used.
543 Probably some other stuff that I've forgotten.
545 * src/frontends/xforms/FormPreferences.h: changed the names of some
546 methods in the Colors struct. Added a couple of structs to help sort
547 colors by name and by RGBColor.
549 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
550 functions into a new class RWInfo.
552 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
553 The dialog is now almost navigable using the keyboard. Unfortunately,
554 the cursor has to be inside a browser for it to be activated. There is
555 no visual feedback for the key shortcuts to the arrow keys (use
556 Alt-appropriate arrow key, Alt-x).
558 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
561 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
562 xform_helpers.[Ch]. See above.
564 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
566 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
568 * src/screen.C (setCursorColor): new method. Sets the color of the
570 (ShowManualCursor): call it.
571 Constify some local variables.
573 * src/LColor.[Ch] (LColor): add entry for cursor
574 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
577 2000-11-19 Juergen Vigna <jug@sad.it>
579 * src/insets/insettabular.C (draw): fixed text border redraw problem.
580 (calculate_dimensions_of_cells): try to boost up when inserting chars.
582 2000-11-15 Rob Lahaye <lahaye@postech.edu>
584 * lib/ui/default.ui: OptItem used for Fax entry
586 2000-11-17 Matej Cepl <cepl@bigfoot.com>
588 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
590 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
592 * src/vspace.C (nextToken): fix so it can handle length phrases like
593 "10mm+-20mm", "40inplus16mmminus10cm" etc.
595 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
597 * src/frontends/xforms/FormPreferences.C: constify several variables
598 (BrowserLyX): rewrite to not need the choice variable
599 (Modify): rewrite to not need the choide variable
600 (compare_converter): make operator const
602 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
603 correct the writing of \set_color
604 (getDescription): return a const string
606 * src/kbsequence.[Ch] (addkey): remove dead code
608 * src/Painter.C (text): remove some commented code
610 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
612 * src/ColorHandler.[Ch]: removed some header files from .h file.
613 Included LColor.h in .C file.
615 * src/LColor.[Ch]: made class copyable so that I could create a
616 system_lcolor instance.
618 * src/Painter.h: removed LColor.h.
620 * src/lyx_gui.C (create_forms): used AddName.
622 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
623 of user preferences/lyxrc file.
625 * src/lyxrc.C (output): output changes to lcolor.
627 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
629 Moved class xformColor to files xform_helpers.[Ch]. These files,
630 Color.[Ch], could now be moved into src if they would be useful to
633 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
634 Also moved FormPreferences::browseFile here as it can be used by any
635 xform dialog with a "Browse" button. FormGraphics is a perfect example.
637 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
638 ReadableFile): changed the FormPreferences methods a little and moved
639 them here as they'll be useful elsewhere also.
641 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
642 Removed some header files and used forward declarations instead.
644 Removed some methods as they'll be useful elsewhere (see above).
646 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
647 Can also now modify the LyX LColors. However, for reasons that I don't
648 yet understand, it appears that we can use
649 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
650 present. The problem appears to lie in ColorHandler, because I can
651 change the color using LColor.SetColor(). Similarly, when reading in a
652 preferences file with some set_color instances, I'll get a warning
653 like: Color sea green is undefined or may not be redefined
654 Bad lyxrc set_color for sea green
656 Once the buffer is loaded, however, I can happily change to this color.
658 Finally, it appears that I have to set the color of "inset frame"
659 explicitly, or it oscillates from "black" to "indian red" with each
662 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
664 * ANNOUNCE: corrected a spelling mistake.
666 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
669 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
671 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
673 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
676 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
677 match the requirements from the standard better. This is required
678 to work with gnu libstdc++-v3
680 * src/frontends/xforms/FormPreferences.C: add explict pair
681 arguments to browse calls. include support/lyxmanip.h remvoe
682 extern fmt. whitespace changes. reorder variables in
683 FormPreferences.h, to match initalizaton order.
685 * several files: constify more local variables.
687 * src/buffer.C: remove some commented functions.
689 * src/DepTable.C (remove_files_with_extension): temporary
690 work around for gcc 2.97
691 * src/filedlg.C (find): ditto
692 * src/Variables.C (set): ditto
693 * src/LyXAction.C (searchActionArg): ditto
694 (retrieveActionArg): ditto
696 * configure.in: check for mktemp too
698 * UPGRADING: prepare for 1.1.6
700 * Makefile.am (lgbtags): add backup tags for when etags are
701 different than usual.
703 * ANNOUNCE: prepare for 1.1.6
705 * src/support/tempname.C (make_tempfile): new function, wrapper
706 around mkstemp and mktemp. Only mkstemp has been tested.
709 2000-11-14 Rob Lahaye <lahaye@postech.edu>
711 * default.ui: capitalized some menu items to improve shortcuts.
713 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
715 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
717 * src/frontends/xforms/Dialogs.C: add "using" directive.
719 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
721 * src/filedlg.C (Select): highlight suggested file in browser, if
724 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
725 each tab folder is encapsulated in its own class.
726 The Language keymaps are now chosen using a text input and a
727 browser button, rather than a Combox.
728 All the browser buttons are now functional, although LyXFileDlg
729 still needs to be modified to make it straighhtforward to return a
730 directory if that is what is desired.
732 * src/frontends/xforms/forms/form_preferences.fd: use text input
733 and browse button to input the Language keymaps. Add a few
734 callbacks for the browse buttons.
736 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
738 * src/support/tempname.C (tempName): small changes to make it
739 safer. remove the '.' before XXXXXX
741 * src/support/filetools.C (TmpFileName): remove func
744 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
745 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
746 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
747 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
749 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
752 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
755 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
756 for bp (this fixes a reproducible hard crash)
758 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
761 * src/frontends/xforms/FormBase.h: make bp_ private
762 (FormBaseBI): remove default for bp
765 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
768 * src/frontends/xforms/Color.C (RGBColor): made several vars
769 const, changed initialization of j to allow it to be const
772 * several files: added const to local variables.
774 * src/lyx_cb.C: removed several function prototypes and moved them
778 (UpdateLayoutPreamble):
780 (MenuInsertLabel): add BufferView as arguemnt
781 (LayoutsCB): make tmp const
783 * src/layout_forms.h: regenerated
785 * src/debug.C: add Debug::FILES
786 (showLevel) (showTags): translate the desc
788 * src/debug.h: add FILES as debug target
790 * src/bufferlist.C: use current_view as an interim measure becuase
791 of added arguments to MenuWrite and MenuWriteAs
793 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
795 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
797 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
798 libstdc++ is compiled with.
800 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
802 * lib/layouts/docbook-book.layout
803 * lib/layouts/docbook.layout
804 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
805 those paragraphs are expresse as SGML comments <!-- -->.
807 * src/LaTeXFeatures.h
808 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
809 parameter, this allows to express all the include files as relative
810 paths to the master buffer. The verbatim insert works as the other
813 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
815 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
817 (MakeDocBookFile): top_element is always written. Some clean up, as
818 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
820 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
821 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
822 a reference is written instead of the name.
823 (Validate): use the relative path for the filename.
825 * src/insets/insetlabel.C (DocBook): write end tag, for XML
828 * src/support/filetools.h
829 * src/support/filetools.C (IsSGMLFilename): added.
832 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
834 * development/OS2/quick_fix.patch:
836 * README.OS2: quick update to the OS/2 port.
838 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
840 * src/converter.C: add "using" directive.
842 * src/frontends/xforms/FormPreferences.C: add "using" directive.
843 (compare_converter): add "int" as return type.
845 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
848 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
850 * src/lyx_gui.C (create_forms): map the xform colours, should a
851 mapping exist. Ie, call XformColor::read().
853 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
854 and struct HSV as HSVColor.
855 (XformColor::read, XformColor::write) : new methods that
856 input/output any changes to the cform GUI colors.
858 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
861 * src/frontends/xforms/FormPreferences.C Lots of little changes
862 associated with the changed name of the RGB and HSV structs. Can
863 now save changes to xforms GUI to file. Commented out
864 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
865 used currently anyway.
867 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
869 * src/converter.C: A lot of changes:
870 - It is no longer possible to choose between two or more ways to
871 export to some format (the new code uses only the shortest path).
872 However, it is still possible to choose between pdflatex/ps2pdf
873 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
874 - Added several methods that makes the FormPreferences code simpler.
875 - Changed the tokens $$FName and $$OutName to $$i and $$o.
877 * src/exporter.C (Export): lyxrc.use_pdf is set before
878 makeLaTeXFile is called. This works but not very nice.
880 * src/frontends/xforms/FormPreferences.C: The formats/converters
881 tabs are now fully functional.
883 * src/buffer.C (getTocList): Add numbers to the captions.
885 * lib/lyxrc.example: Removed fax section
887 * src/support/rename.C (rename): Delete the old file if lyx::copy
890 2000-11-13 Rob Lahaye <lahaye@postech.edu>
892 * lib/ui/default.ui: minor polishing.
894 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
896 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
899 * lib/Makefile.am (DOCINST): do not install everything in the
900 documentation directory.
902 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
904 * src/bufferlist.C (newFile): set the filename to the constructed
907 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
908 constructed "newfileXX.lyx" name to the dialog
910 * src/frontends/DialogBase.h: make update() non-abstract so
911 KDE doesn't need to implement two update methods for every form
913 * src/frontends/kde/Makefile.am: add missing xforms objects
916 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
918 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
920 * src/frontends/xforms/Color.[Ch]: new files, defining the color
921 structs RGB and HSV. May not be the best place for these files.
922 Perhaps move them into src ?
924 * src/frontends/xforms/Makefile.am: added new files.
926 * src/frontends/xforms/forms/form_preferences.fd:
927 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
928 replaced all instances of "colour" with "color"!
930 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
933 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
934 tab. Can now alter the colors of the xform's GUI on the fly. With
935 the aid of a single static Signal (see below), can "Apply" these
936 changes to all currently open dialogs. (Well, to all of the NEW
937 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
938 subsequently opened dialogs will, of course, also have the new
939 color scheme. Cannot yet save (or load) the choices to file, so
940 they are lost when exiting LyX.
942 * src/frontends/Dialogs.h:
943 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
944 Used to trigger a redraw of any dialogs connected to it because,
945 for example, the GUI colours have been re-mapped.
947 * src/frontends/xforms/FormBase.[Ch]:
948 * src/frontends/xforms/FormDocument.[Ch]:
949 * src/frontends/xforms/FormParagraph.[Ch]:
950 * src/frontends/xforms/FormPreferences.[Ch]:
951 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
952 method, to be connected to Dialogs::redrawGUI. Method must be
953 virtual, because dialogs with tabbed folders need to redraw the
954 forms of each tab folder.
956 * src/LyXView.C (d-tor):
957 * src/frontends/xforms/FormBase.C (d-tor): connected
958 Dialogs::redrawGUI signal to redraw().
960 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
961 removed Assert, because it is identical to that in FormBase.
963 2000-11-10 Rob Lahaye <lahaye@postech.edu>
965 * lib/ui/default.ui: minor polishing.
967 2000-11-10 Juergen Vigna <jug@sad.it>
969 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
970 (deleteLyXText): ditto
972 * src/insets/insettabular.C (InsetButtonPress): don't clear the
973 selection on mouse-button-3.
975 * src/insets/insettabular.h: new function clearSelection(), use this
976 functions inside insettabular.C.
978 * src/insets/insettabular.C (TabularFeatures): clear the selection
979 on remove_row/column.
981 * src/insets/inset.C (scroll): fixed some scroll stuff.
983 * src/insets/insettabular.C (draw): fixed another minor draw problem.
985 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
987 * lib/CREDITS: add Yves Bastide
989 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
991 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
992 check whether C library functions are in the global namespace.
994 * configure.in: calls it.
996 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
999 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1001 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1002 iterators to prevent crash.
1004 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1006 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1008 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1009 shortcut for xforms CB to the preemptive or post-handler function.
1011 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1012 removed the HIDDEN_TIMER as it's no longer used.
1013 Various other small changes.
1015 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1016 preemptive handler to obtain feedback, rather than the post-handler.
1017 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1019 Formats tab is now complete. Converters tab is nearly so.
1021 2000-11-09 Juergen Vigna <jug@sad.it>
1023 * src/insets/insettext.C (~InsetText):
1026 (SetParagraphData): set cache.second to 0 after deleting it!
1027 (getLyXText): check if cache.second is not 0 if finding it.
1029 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1031 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1032 lyxlex to parse the rgb.txt file.
1035 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1036 replace the default '#' comment character.
1038 * src/support/tempname.C: add "using" directive
1039 * src/frontends/ButtonPolicies.C: ditto.
1041 * src/support/filetools.C (DirList): add an explicit cast to avoid
1042 a compile error (probably not the right fix)
1044 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1046 * src/support/filetools.C (DirList): implement using system functions
1048 * src/support/tempname.C: new file
1050 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1052 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1054 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1057 * src/frontends/xforms/ButtonController.C: new file
1059 * src/os2_defines.h: remove getcwd define
1061 * src/lyxvc.C: include support/lyxlib.h
1062 (showLog): use lyx::tempName
1064 * src/lyx_cb.C: comment out includes that we don't need
1065 (AutoSave): use lyx::tempName
1067 * src/filedlg.C: include support/lyxlib.h
1068 (Reread): use lyx::getcwd
1070 * src/converter.C: include support/filetools.h
1071 (add_options): change to static inline, make tail const
1072 (Add): make old_viewer const
1073 (GetAllFormats): make it a const method, use const_iterator
1074 (enable): make static inline
1075 (SplitFormat): make using_format const
1077 * src/LaTeX.C (run): use lyx::getcwd
1079 * configure.in: check for mkstemp as well
1081 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1083 * src/converter.[Ch] (GetAllCommands): new method.
1085 * src/support/filetools.[Ch] (DirList): new method.
1087 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1088 functionality to the converters tab.
1089 The formats tab is now nearly complete.
1090 The kbmap choices in Languages tab now display the contents of
1091 system_lyxdir/kbd/*.kmap in readable form.
1093 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1094 Moved some variables into the class.
1096 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1097 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1098 colour of active folder to lighter grey instead. Any takers?
1099 (form_colours): added an "Apply" button.
1100 (form_converters): added a "Flags" input field.
1101 (form_formats): added a "Shortcut" input field. Note that we can't use
1102 names such as "input_shortcut" as this buggers up the sed script stuff.
1104 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1112 * src/lyx_sendfax_main.C:
1115 * src/spellchecker.C:
1116 * src/insets/figinset.C:
1117 * src/insets/insetbib.C:
1118 * src/insets/insetexternal.C:
1119 * src/insets/insetinclude.C:
1120 * src/insets/insetinfo.C:
1121 * src/mathed/math_panel.C:
1122 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1123 all "daughter" dialogs now have identical "feel".
1125 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1127 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1128 used (and was only used in one place prior to this patch. Incorrectly!)
1130 * src/frontends/xforms/FormDocument.C: changed some instances of
1131 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1132 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1133 for options_->input_float_placement. This fixes a bug reported by
1136 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1137 functionality into d-tor.
1139 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1140 input of numerals also.
1142 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1143 fl_set_form_atclose(). Can now close dialog from window manager,
1144 fixing a bug reported by Rob Lahaye.
1146 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1148 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1149 are no longer dark. Haven't yet worked out how to lighten the colour of
1150 the active tabfolder. Any ideas anybody?
1151 Adjusted Colours tab a little.
1152 Added Shortcut field to converters tab. Note that we can't create an
1153 fdesign label like "input_shortcut" as this buggers up the sed-script
1156 * src/frontends/xforms/FormPreferences.[Ch]:
1157 (feedback): fixed crash due to to ob=0.
1158 (LanguagesXXX): the kbmap choices now contain the files
1159 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1160 be replaced by an input with a file browse button, but since the browse
1161 buttons don'y yet work, this'll do for the moment.
1162 (FormatsXXX): think that this is now nearly fully functional.
1163 Some points/questions though:
1164 1. Does "Apply" remove formats if no longer present?
1165 2. I think that the browser should list the GUI names rather than the
1167 3. Must ensure that we can't delete Formats used by an existing
1170 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1171 if this is the best way to do this.
1173 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1175 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1177 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1178 for variable assignment.
1180 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1182 * src/lib/ui/default.ui: added sub/superscripts to menu as
1183 Insert->Special characters and cleaned-up the file a bit
1185 2000-11-07 Allan Rae <rae@lyx.org>
1187 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1188 ob isn't 0 before using it. See comments in function.
1190 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1192 * src/frontends/xforms/form_*.C: regenerated
1194 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1196 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1198 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1199 compiling with gcc-2.96
1201 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1203 * src/support/lyxstring.C: add a couple "using" directives.
1205 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1206 a .c_str() here too for good measure.
1207 * src/Spacing.C (set): ditto.
1208 * src/lyxfunc.C (Dispatch): ditto.
1210 * src/insets/insettabular.C (copySelection): change .str() to
1211 .str().c_str() to fix problems with lyxstring.
1212 * src/support/filetools.C (GetFileContents): ditto.
1213 * src/buffer.C (asciiParagraph): ditto.
1214 * src/paragraph.C (String): ditto.
1216 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1217 * lib/bind/sciword.bind: ditto.
1219 * src/LyXAction.C (init): remove "symbol-insert" function, which
1220 shared LFUN_INSERT_MATH with "math-insert".
1222 * lib/configure.m4: == is not a valid operator for command test.
1224 * src/lyxrc.C: add using directive.
1226 * src/converter.h: add std:: qualifier.
1228 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1230 * src/converter.[Ch] and other files: Change the Format class to a
1231 real class, and create two instances: formats and system_format.
1233 * src/lyxrc.C (output): Output the difference between formats and
1236 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1237 (buildFormats): Insert formats into browser.
1238 (inputFormats): Made the browser and add button functional.
1239 (applyFormats): Update formats from format_vec.
1241 * src/converter.C: Changed all (*it). to it->
1242 (Format::dummy): New method.
1243 (Format::importer): New format flag.
1244 (Formats::GetAllFormats): New method.
1245 (Formats::Add): Delete format from the map if prettyname is empty.
1246 (Converter::Convert): Print an error message if moving the file fails.
1247 (Converter::GetReachableTo): New method
1249 * src/MenuBackend.[Ch]: Add support for importformats tag.
1251 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1253 * lib/configure.m4: Add word->tex and ps->fax converters.
1255 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1256 Return fax to file menu.
1260 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1262 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1265 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1268 * src/lyxfunc.C (processKeyEvent): removed
1270 * src/bufferlist.C (emergencyWrite): removed the out commented
1271 emergency write code.
1273 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1275 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1277 * many files: change formatting to be a bit more uniform for
1278 if,while,for,switch statements, remove some parantesis not needed.
1281 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1283 * config/kde.m4: make config more robust when KDEDIR is set
1285 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1287 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1288 not returned a pixmap for "math-insert".
1290 * src/LyXAction.C (init): sort the entries a bit.
1292 2000-11-03 Juergen Vigna <jug@sad.it>
1294 * src/insets/insettabular.h: added fixed number to update codes so
1295 that update is only in one direction.
1297 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1300 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1301 before call to edit because of redraw.
1303 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1305 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1307 * lib/ui/default.ui: Populate "edit_float" menu
1309 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1311 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1312 "floats-operate". The name is ugly (and the func also), but this
1313 is just a band-aid until we switch to new insets.
1315 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1317 * lib/ui/default.ui: update again the menu layout (fix some
1320 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1322 * src/MenuBackend.h (fulllabel): new method.
1324 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1325 the menu shortcuts of a menu are unique and whether they
1326 correspond to a letter of the label.
1327 (expand): call checkShortcuts when debugging.
1329 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1331 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1333 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1335 * lib/examples/*.lyx : '\language default' => '\language english'
1337 * lib/examples/it_splash.lyx : except where it should be italian
1339 * lib/templates/*.lyx : the same
1341 * doc/*.lyx* : the same
1343 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1345 * lib/bind/menus.bind: remove the Layout menu entries, which I
1346 somehow forgot earlier.
1348 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1350 * lib/ui/old-default.ui: keep the old one here for reference (to
1353 * lib/ui/default.ui: update the menu layout
1355 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1357 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1358 Can now Apply to different insets without closing the dialog.
1360 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1361 Can't actually DO anything with them yet, but I'd like a little
1364 * src/frontends/xforms/input_validators.[ch]
1365 (fl_lowercase_filter): new.
1367 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1369 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1370 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1372 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1374 2000-11-02 Juergen Vigna <jug@sad.it>
1376 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1377 on char insertion as it has already be updated by bv->updateInset().
1379 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1380 if an inset inside was updated.
1382 * lib/configure.cmd: commented out fax-search code
1384 2000-11-01 Yves Bastide <stid@acm.org>
1386 * src/tabular.C (OldFormatRead): set tabular language to the
1389 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1391 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1392 class names with non-letter characters (from Yves Bastide).
1394 * lib/ui/default.ui: change Item to OptItem in import menu.
1395 Comment out fax stuff.
1397 * lib/configure.m4: comment out fax-related stuff.
1399 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1401 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1402 useful xforms helper functions. At present contains only formatted().
1403 Input a string and it returns it with line breaks so that in fits
1406 * src/frontends/xforms/Makefile.am: add new files.
1408 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1409 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1412 * src/frontends/xforms/FormPreferences.[Ch]:
1413 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1414 but lots of little clean ups. Removed enum State. Make use of
1415 formatted(). Constify lots of methods. Perhaps best of all: removed
1416 requirement for that horrible reinterpret_cast from pointer to long in
1419 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1421 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1422 conditionalize build on xforms < 0.89
1424 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1426 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1428 * src/LyXAction.C (init): comment out fax
1430 * src/lyxrc.h: comment out the fax enums
1431 comment out the fax variables
1433 * src/commandtags.h: comment out LFUN_FAX
1435 * src/lyxrc.C: disable fax variables.
1436 (read): disable parsing of fax variables
1437 (output): disable writing of fax variables
1438 (getFeedback): now description for fax variables
1440 * src/lyxfunc.C: comment out MenuFax
1441 (Dispatch): disable LFUN_FAX
1443 * src/lyx_cb.C (MenuFax): comment out
1445 * src/WorkArea.C: add <cctype>
1446 (work_area_handler): better key handling, should be ok now.
1447 for accented chars + etc
1449 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1450 lyx_sendfax.h and lyx_sendfax_man.C
1452 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1453 (show): don't call InitLyXLookup when using xforms 0.89
1455 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1457 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1459 * src/support/filetools.C (GetFileContents): close to dummy change
1461 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1463 * src/trans.C (AddDeadkey): workaround stupid compilers.
1465 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1467 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1468 of two-sided document.
1470 2000-10-31 Juergen Vigna <jug@sad.it>
1472 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1474 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1475 xposition to the Edit call.
1477 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1479 * src/trans.C (AddDeadkey): cast explicitly to char.
1481 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1483 * src/tabular.C (AsciiBottomHLine): simplify?
1484 (AsciiTopHLine): simplify?
1485 (print_n_chars): simplify
1486 (DocBook): remove most of the << endl; we should flush the stream
1487 as seldom as possible.
1489 (TeXBottomHLine): ditto
1490 (TeXTopHLine): ditto
1492 (write_attribute): try a templified version.
1493 (set_row_column_number_info): lesson scope of variables
1495 * src/support/lstrings.h (tostr): new specialization of tostr
1497 * src/trans.C (AddDeadkey): slightly cleaner fix.
1499 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1501 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1502 '%%' in Toc menu labels.
1505 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1506 font_norm is iso10646-1.
1508 * src/font.C (ascent): Fixed for 16bit fonts
1509 (descent,lbearing,rbearing): ditto
1511 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1513 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1514 (getFeedback): new static method.
1516 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1517 Now use combox rather than choice to display languages.
1518 Feedback is now output using a new timer callback mechanism, identical
1519 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1521 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1523 * src/minibuffer.C: fix for older compilers
1525 2000-10-30 Juergen Vigna <jug@sad.it>
1527 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1528 has to be Left of the inset otherwise LyXText won't find it!
1530 * src/BufferView2.C (open_new_inset): delete the inset if it can
1533 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1535 * lyx.man: fix typo.
1537 2000-10-29 Marko Vendelin <markov@ioc.ee>
1538 * src/frontends/gnome/FormCitation.C
1539 * src/frontends/gnome/FormCitation.h
1540 * src/frontends/gnome/FormCopyright.C
1541 * src/frontends/gnome/FormCopyright.h
1542 * src/frontends/gnome/FormError.C
1543 * src/frontends/gnome/FormError.h
1544 * src/frontends/gnome/FormIndex.C
1545 * src/frontends/gnome/FormIndex.h
1546 * src/frontends/gnome/FormPrint.C
1547 * src/frontends/gnome/FormPrint.h
1548 * src/frontends/gnome/FormRef.C
1549 * src/frontends/gnome/FormRef.h
1550 * src/frontends/gnome/FormToc.C
1551 * src/frontends/gnome/FormToc.h
1552 * src/frontends/gnome/FormUrl.C
1553 * src/frontends/gnome/FormUrl.h
1554 * src/frontends/gnome/Menubar_pimpl.C
1555 * src/frontends/gnome/mainapp.C
1556 * src/frontends/gnome/mainapp.h
1557 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1558 changing update() to updateSlot() where appropriate
1560 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1562 * src/frontends/xforms/FormPreferences.[Ch]:
1563 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1566 2000-10-28 Juergen Vigna <jug@sad.it>
1568 * src/insets/insettabular.C (draw): fixed drawing bug.
1570 * src/insets/insettext.C (clear):
1572 (SetParagraphData): clearing the TEXT buffers when deleting the
1573 paragraphs used by it.
1575 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1577 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1579 2000-10-27 Juergen Vigna <jug@sad.it>
1581 * src/tabular.C (~LyXTabular): removed not needed anymore.
1583 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1586 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1588 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1591 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1594 * src/frontends/xforms/FormPreferences.[Ch]:
1595 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1596 Reorganised as modules based on tabs. Much easier to follow the
1597 flow and to add new tabs. Added warning and feedback messages.
1600 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1602 * src/tabular.h (DocBook): add std:: qualifier.
1604 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1606 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1607 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1610 * insettabular.C (DocBook): uses the tabular methods to export
1613 * src/insets/insettext.h
1614 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1616 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1618 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1621 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1622 moved misplaced AllowInput two lines up.
1624 * src/buffer.C (readFile): compare float with float, not with int
1626 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1628 * src/minibuffer.C: add "using SigC::slot" statement.
1630 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1632 * src/frontends/xforms/forms/README: updated section about make.
1634 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1635 Tidied some forms up, made two of form_tabular's tabs more
1636 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1637 fixed translation problem with "Column".
1639 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1641 * src/minibuffer.h: use Timeout instead of the xforms timer
1643 (setTimer) rewrite for the Timeout, change to unsigned arg
1644 (set): change to unsigned timer arg
1647 * src/minibuffer.C (TimerCB): removed func
1648 (C_MiniBuffer_TimerCB): removed func
1649 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1650 (peek_event): use a switch statement
1651 (add): don't use fl_add_timer.
1652 (Set): rewrite to use the Timeout
1655 * src/Timeout.[Ch] (setType): return a Timeout &
1656 (setTimeout): ditto, change to unsigned arg for timeout
1658 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1660 * src/mathed/formula.C (mathed_string_width): Use string instead
1661 of a constant size char array.
1663 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1665 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1666 the two recently added operator<< for SMInput and State.
1668 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1670 (OkCancelPolicy): ditto
1671 (OkCancelReadOnlyPolicy): ditto
1672 (NoRepeatedApplyReadOnlyPolicy): ditto
1673 (OkApplyCancelReadOnlyPolicy): ditto
1674 (OkApplyCancelPolicy): ditto
1675 (NoRepeatedApplyPolicy): ditto
1677 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1679 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1680 add the usual std:: qualifiers.
1682 2000-10-25 Juergen Vigna <jug@sad.it>
1684 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1686 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1688 * src/support/filetools.C (MakeRelPath): change some types to
1691 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1692 ButtonPolicy::SMInput and ButtonPolicy::State.
1694 * src/FontLoader.C (reset): small cleanup
1695 (unload): small cleanup
1697 * src/FontInfo.C (getFontname): initialize error to 10000.0
1699 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1701 * src/frontends/xforms/FormPreferences.[Ch]:
1702 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1703 TeX encoding and default paper size sections.
1705 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1707 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1710 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1711 make the message_ empty.
1712 (FormError): don't initialize message_ in initializer list.
1714 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1716 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1718 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1720 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1722 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1724 * src/frontends/kde/*data.[Ch]: _("") is not
1727 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1729 * src/buffer.C: removed redundant using directive.
1731 * src/frontends/DialogBase.h: revert to original definition of
1734 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1735 stuff into two classes, one for each dialog, requires a new
1736 element in the dialogs vector, FormTabularCreate.
1738 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1741 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1742 method. Continues Allan's idea, but means that derived classes
1743 don't need to worry about "update or hide?".
1745 * src/frontends/xforms/FormError.C (showInset): add connection
1748 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1749 one for each dialog. FormTabular now contains main tabular dialog
1752 * src/frontends/xforms/FormTabularCreate.[Ch]:
1753 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1756 * src/frontends/xforms/FormGraphics.[Ch]:
1757 * src/frontends/xforms/forms/form_graphics.fd
1758 * src/frontends/xforms/FormTabular.[Ch]:
1759 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1760 classes of FormInset.
1762 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1763 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1765 * src/frontends/xforms/Makefile.am:
1766 * src/frontends/xforms/forms/makefile: added new files.
1768 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1769 variable. added Signal0 hide signal, in keeping with other GUI-I
1772 * src/support/lstrings.h: removed redundant std:: qualifier as
1773 it's already declared in Lsstream.h.
1775 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1777 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1781 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1783 * src/tabular.C (Ascii): minimize scope of cell.
1785 * src/BufferView2.C (nextWord): return string() instead of 0;
1787 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1789 * src/converter.h: add a std:: qualifier
1791 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1793 * src/importer.[Ch]: New files. Used for importing files into LyX.
1795 * src/lyxfunc.C (doImport): Use the new Importer class.
1797 * src/converter.h: Add shortcut member to the Format class.
1798 Used for holding the menu shortcut.
1800 * src/converter.C and other files: Made a distinction between
1801 format name and format extension. New formats can be defined using
1802 the \format lyxrc tag.
1803 Added two new converter flags: latex and disable.
1805 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1807 * src/support/lyxlib.h: unify namespace/struct implementation.
1808 Remove extra declarations.
1810 * src/support/chdir.C (chdir): remove version taking char const *
1812 * src/support/rename.C: ditto.
1813 * src/support/lyxsum.C: ditto.
1815 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1817 * src/frontends/xforms/FormBase.[Ch]:
1818 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1819 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1820 work only for the next call to fl_show_form(). The correct place to set
1821 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1822 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1823 from FormBase have the minimum size set; no more stupid crashes with
1826 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1828 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1830 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1832 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1834 * src/support/lyxlib.h: changed second argument of mkdir to
1835 unsigned long int (unsigned int would probably have been enough,
1836 but...). Removed <sys/types.h> header.
1837 * src/support/mkdir.C (mkdir): ditto.
1841 2000-10-19 Juergen Vigna <jug@sad.it>
1843 * src/lyxfunc.C (MenuNew): small fix (form John)
1845 * src/screen.C (Update): removed unneeded code.
1847 * src/tabular.C (Ascii): refixed int != uint bug!
1849 * src/support/lyxlib.h: added sys/types.h include for now permits
1850 compiling, but I don't like this!
1852 2000-10-18 Juergen Vigna <jug@sad.it>
1854 * src/text2.C (ClearSelection): if we clear the selection we need
1855 more refresh so set the status apropriately
1857 * src/insets/insettext.C (draw): hopefully finally fixed draw
1860 2000-10-12 Juergen Vigna <jug@sad.it>
1862 * src/insets/insettext.C (draw): another small fix and make a block
1863 so that variables are localized.
1865 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1867 * src/support/lstrings.C (lowercase, uppercase):
1868 use explicit casts to remove compiler warnings.
1870 * src/support/LRegex.C (Impl):
1871 * src/support/StrPool.C (add):
1872 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1873 (AddPath, MakeDisplayPath):
1874 * src/support/lstrings.C (prefixIs, subst):
1875 use correct type to remove compiler warnings.
1877 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1879 * src/support/lyxlib.h:
1880 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1881 portability and to remove compiler warning with DEC cxx.
1883 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1885 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1887 * src/minibuffer.C (peek_event): retun 1 when there has been a
1888 mouseclick in the minibuffer.
1892 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1894 * src/frontends/xforms/FormParagraph.C: more space above/below
1897 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1899 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1900 a char only if real_current_font was changed.
1902 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1904 * NEWS: update somewhat for 1.1.6
1906 * lib/ui/default.ui: clean up.
1908 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1910 * lib/CREDITS: clean up
1912 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1914 * src/combox.[Ch] (select): changed argument back to int
1915 * src/combox.C (peek_event): removed num_bytes as it is declared but
1918 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1919 modified calls to Combox::select() to remove warnings about type
1922 * src/insets/insetbutton.C (width): explicit cast to remove warning
1923 about type conversion.
1925 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1928 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1929 sel_pos_end, refering to cursor position are changed to
1930 LyXParagraph::size_type.
1932 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1933 consistent with LyXCursor::pos().
1934 (inset_pos): changed to LyXParagraph::size_type for same reason.
1936 * src/insets/insettext.C (resizeLyXText): changed some temporary
1937 variables refing to cursor position to LyXParagraph::size_type.
1939 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1941 * src/frontends/kde/<various>: The Great Renaming,
1944 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1946 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1948 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1950 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1951 0 when there are no arguments.
1953 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1955 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1956 to segfaults when pressing Ok in InsetBibtex dialog.
1958 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1960 * forms/layout_forms.fd:
1961 * src/layout_forms.C (create_form_form_character): small change to use
1962 labelframe rather than engraved frame + text
1964 * src/lyx_gui.C (create_forms): initialise choice_language with some
1965 arbitrary value to prevent segfault when dialog is shown.
1967 2000-10-16 Baruch Even <baruch.even@writeme.com>
1969 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1970 is no resulting file. This pertains only to LaTeX output.
1972 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1974 * src/text.C (Backspace): Make sure that the row of the cursor is
1977 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1980 * src/lyx_gui.C (init): Prevent a crash when only one font from
1981 menu/popup fonts is not found.
1983 * lib/lyxrc.example: Add an example for binding a key for language
1986 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1988 * src/converter.C (GetReachable): Changed the returned type to
1990 (IsReachable): New method
1992 * src/MenuBackend.C (expand): Handle formats that appear more
1995 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1997 * src/frontends/support/Makefile.am
1998 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2001 * lib/CREDITS: add Garst Reese.
2003 * src/support/snprintf.h: add extern "C" {} around the definitions.
2005 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2007 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2010 * src/frontends/xforms/FormDocument.C:
2011 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2012 compile without "conversion to integral type of smaller size"
2015 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2017 * src/text.C (GetColumnNearX): Fixed disabled code.
2019 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2021 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2024 * src/support/snprintf.[ch]: new files
2026 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2028 * src/frontends/kde/formprintdialog.C: add
2029 file browser for selecting postscript output
2031 * src/frontends/kde/formprintdialogdata.C:
2032 * src/frontends/kde/formprintdialogdata.h: re-generate
2035 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2037 * src/frontends/gnome/Makefile.am:
2038 * src/frontends/kde/Makefile.am: FormCommand.C
2039 disappeared from xforms
2041 * src/frontends/kde/FormCitation.C:
2042 * src/frontends/kde/FormIndex.C: read-only
2045 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2047 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2050 * src/bufferlist.C: add using directive.
2052 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2054 * src/support/lyxfunctional.h: version of class_fun for void
2055 returns added, const versions of back_inseter_fun and compare_fun
2058 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2060 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2062 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2064 * ChangeLog: cleanup.
2066 * lib/CREDITS: update to add all the contributors we've forgotten.
2067 I have obviously missed some, so tell me whether there were
2070 2000-10-13 Marko Vendelin <markov@ioc.ee>
2072 * src/frontends/gnome/FormCitation.C
2073 * src/frontends/gnome/FormCitation.h
2074 * src/frontends/gnome/FormError.C
2075 * src/frontends/gnome/FormIndex.C
2076 * src/frontends/gnome/FormRef.C
2077 * src/frontends/gnome/FormRef.h
2078 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2080 * src/frontends/gnome/FormCitation.C
2081 * src/frontends/gnome/FormCopyright.C
2082 * src/frontends/gnome/FormError.C
2083 * src/frontends/gnome/FormIndex.C
2084 * src/frontends/gnome/FormRef.C
2085 * src/frontends/gnome/FormToc.C
2086 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2089 * src/frontends/gnome/Menubar_pimpl.C
2090 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2093 2000-10-11 Baruch Even <baruch.even@writeme.com>
2096 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2097 to convey its real action.
2099 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2100 clear the minibuffer and prepare to enter a command.
2102 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2103 the rename from ExecCommand to PrepareForCommand.
2104 * src/lyxfunc.C (Dispatch): ditto.
2106 2000-10-11 Baruch Even <baruch.even@writeme.com>
2108 * src/buffer.C (writeFile): Added test for errors on writing, this
2109 catches all errors and not only file system full errors as intended.
2111 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2113 * src/lyx_gui.C (create_forms): better fix for crash with
2114 translated interface.
2116 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2118 * src/frontends/kde/Makefile.am:
2119 * src/frontends/kde/FormCopyright.C:
2120 * src/frontends/kde/formcopyrightdialog.C:
2121 * src/frontends/kde/formcopyrightdialog.h:
2122 * src/frontends/kde/formcopyrightdialogdata.C:
2123 * src/frontends/kde/formcopyrightdialogdata.h:
2124 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2125 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2126 copyright to use qtarch
2128 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2130 * src/encoding.C (read): Fixed bug that caused an error message at
2131 the end of the file.
2133 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2135 * lib/lyxrc.example: Fixed hebrew example.
2137 2000-10-13 Allan Rae <rae@lyx.org>
2139 * src/frontends/xforms/FormPreferences.C (input): reworking the
2141 (build, update, apply): New inputs in various tabfolders
2143 * src/frontends/xforms/FormToc.C: use new button policy.
2144 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2145 dialogs that either can't use any existing policy or where it just
2148 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2151 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2152 added a bool parameter which is ignored.
2154 * src/buffer.C (setReadonly):
2155 * src/BufferView_pimpl.C (buffer):
2156 * src/frontends/kde/FormCopyright.h (update):
2157 * src/frontends/kde/FormCitation.[Ch] (update):
2158 * src/frontends/kde/FormIndex.[Ch] (update):
2159 * src/frontends/kde/FormPrint.[Ch] (update):
2160 * src/frontends/kde/FormRef.[Ch] (update):
2161 * src/frontends/kde/FormToc.[Ch] (update):
2162 * src/frontends/kde/FormUrl.[Ch] (update):
2163 * src/frontends/gnome/FormCopyright.h (update):
2164 * src/frontends/gnome/FormCitation.[Ch] (update):
2165 * src/frontends/gnome/FormError.[Ch] (update):
2166 * src/frontends/gnome/FormIndex.[Ch] (update):
2167 * src/frontends/gnome/FormPrint.[Ch] (update):
2168 * src/frontends/gnome/FormRef.h (update):
2169 * src/frontends/gnome/FormToc.[Ch] (update):
2170 * src/frontends/gnome/FormUrl.[Ch] (update):
2171 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2172 to updateBufferDependent and DialogBase
2174 * src/frontends/xforms/FormCitation.[hC]:
2175 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2176 * src/frontends/xforms/FormError.[Ch]:
2177 * src/frontends/xforms/FormGraphics.[Ch]:
2178 * src/frontends/xforms/FormIndex.[Ch]:
2179 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2180 and fixed readOnly handling.
2181 * src/frontends/xforms/FormPrint.[Ch]:
2182 * src/frontends/xforms/FormRef.[Ch]:
2183 * src/frontends/xforms/FormTabular.[Ch]:
2184 * src/frontends/xforms/FormToc.[Ch]:
2185 * src/frontends/xforms/FormUrl.[Ch]:
2186 * src/frontends/xforms/FormInset.[Ch]:
2187 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2188 form of updateBufferDependent.
2190 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2191 if form()->visible just in case someone does stuff to the form in a
2194 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2195 the buttoncontroller for everything the enum used to be used for.
2196 (update) It would seem we need to force all dialogs to use a bool
2197 parameter or have two update functions. I chose to go with one.
2198 I did try removing update() from here and FormBase and defining the
2199 appropriate update signatures in FormBaseB[DI] but then ran into the
2200 problem of the update() call in FormBase::show(). Whatever I did
2201 to get around that would require another function and that just
2202 got more confusing. Hence the decision to make everyone have an
2203 update(bool). An alternative might have been to override show() in
2204 FormBaseB[DI] and that would allow the different and appropriate
2207 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2208 true == buffer change occurred. I decided against using a default
2209 template parameter since not all compilers support that at present.
2211 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2213 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2214 army knife" by removing functionality.
2215 (clearStore): removed. All such housekeeping on hide()ing the dialog
2216 is to be carried out by overloaded disconnect() methods.
2217 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2218 superceded by Baruch's neat test (FormGraphics) to update an existing
2219 dialog if a new signal is recieved rather than block all new signals
2221 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2222 only to Inset dialogs.
2223 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2224 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2226 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2228 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2229 as a base class to all inset dialogs. Used solely to connect/disconnect
2230 the Inset::hide signal and to define what action to take on receipt of
2231 a UpdateBufferDependent signal.
2232 (FormCommand): now derived from FormInset.
2234 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2237 * src/frontends/xforms/FormCopyright.[Ch]:
2238 * src/frontends/xforms/FormPreferences.[Ch]:
2239 now derived from FormBaseBI.
2241 * src/frontends/xforms/FormDocument.[Ch]:
2242 * src/frontends/xforms/FormParagraph.[Ch]:
2243 * src/frontends/xforms/FormPrint.[Ch]:
2244 now derived from FormBaseBD.
2246 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2248 * src/frontends/xforms/FormCitation.[Ch]:
2249 * src/frontends/xforms/FormError.[Ch]:
2250 * src/frontends/xforms/FormRef.[Ch]:
2251 * src/frontends/xforms/FormToc.[Ch]:
2252 (clearStore): reworked as disconnect().
2254 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2257 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2259 * src/converter.C (runLaTeX): constify buffer argument
2262 * src/frontends/support/Makefile.am (INCLUDES): fix.
2264 * src/buffer.h: add std:: qualifier
2265 * src/insets/figinset.C (addpidwait): ditto
2266 * src/MenuBackend.C: ditto
2267 * src/buffer.C: ditto
2268 * src/bufferlist.C: ditto
2269 * src/layout.C: ditto
2270 * src/lyxfunc.C: ditto
2272 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2274 * src/lyxtext.h (bidi_level): change return type to
2275 LyXParagraph::size_type.
2277 * src/lyxparagraph.h: change size_type to
2278 TextContainer::difference_type. This should really be
2279 TextContainer::size_type, but we need currently to support signed
2282 2000-10-11 Marko Vendelin <markov@ioc.ee>
2283 * src/frontends/gnome/FormError.h
2284 * src/frontends/gnome/FormRef.C
2285 * src/frontends/gnome/FormRef.h
2286 * src/frontends/gnome/FormError.C
2287 * src/frontends/gnome/Makefile.am
2288 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2289 to Gnome frontend. Both dialogs use "action" area.
2291 2000-10-12 Baruch Even <baruch.even@writeme.com>
2293 * src/graphics/GraphicsCacheItem_pimpl.C:
2294 * src/graphics/Renderer.C:
2295 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2298 2000-10-12 Juergen Vigna <jug@sad.it>
2300 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2301 visible when selecting).
2303 * development/Code_rules/Rules: fixed some typos.
2305 2000-10-09 Baruch Even <baruch.even@writeme.com>
2307 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2308 compiling on egcs 1.1.2 possible.
2310 * src/filedlg.C (comp_direntry::operator() ): ditto.
2312 2000-08-31 Baruch Even <baruch.even@writeme.com>
2314 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2317 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2318 transient it now only gets freed when the object is destructed.
2320 2000-08-24 Baruch Even <baruch.even@writeme.com>
2322 * src/frontends/FormGraphics.h:
2323 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2326 2000-08-20 Baruch Even <baruch.even@writeme.com>
2328 * src/insets/insetgraphics.C:
2329 (draw): Added messages to the drawn rectangle to report status.
2330 (updateInset): Disabled the use of the inline graphics,
2333 2000-08-17 Baruch Even <baruch.even@writeme.com>
2335 * src/frontends/support: Directory added for the support of GUII LyX.
2337 * src/frontends/support/LyXImage.h:
2338 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2341 * src/frontends/support/LyXImage_X.h:
2342 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2343 version of LyXImage, this uses the Xlib Pixmap.
2345 * src/PainterBase.h:
2346 * src/PainterBase.C:
2348 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2349 replacement to Pixmap.
2351 * src/insets/insetgraphics.h:
2352 * src/insets/insetgraphics.C:
2353 * src/graphics/GraphicsCacheItem.h:
2354 * src/graphics/GraphicsCacheItem.C:
2355 * src/graphics/GraphicsCacheItem_pimpl.h:
2356 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2359 * src/graphics/GraphicsCacheItem.h:
2360 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2361 another copy of the object.
2363 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2364 of cacheHandle, this fixed a bug that sent LyX crashing.
2366 * src/graphics/XPM_Renderer.h:
2367 * src/graphics/XPM_Renderer.C:
2368 * src/graphics/EPS_Renderer.h:
2369 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2371 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2373 * src/lyxfunc.C (processKeySym): only handle the
2374 lockinginset/inset stuff if we have a buffer and text loaded...
2376 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2378 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2380 * src/support/lyxfunctional.h: add operator= that takes a reference
2382 * src/lyxserver.C (mkfifo): make first arg const
2384 * src/layout.h: renamed name(...) to setName(...) to work around
2387 * src/buffer.C (setFileName): had to change name of function to
2388 work around bugs in egcs. (renamed from fileName)
2390 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2392 * src/support/translator.h: move helper template classes to
2393 lyxfunctional.h, include "support/lyxfunctional.h"
2395 * src/support/lyxmanip.h: add delaration of fmt
2397 * src/support/lyxfunctional.h: new file
2398 (class_fun_t): new template class
2399 (class_fun): helper template function
2400 (back_insert_fun_iterator): new template class
2401 (back_inserter_fun): helper template function
2402 (compare_memfun_t): new template class
2403 (compare_memfun): helper template function
2404 (equal_1st_in_pair): moved here from translator
2405 (equal_2nd_in_pair): moved here from translator
2407 * src/support/fmt.C: new file
2408 (fmt): new func, can be used for a printf substitute when still
2409 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2411 * src/support/StrPool.C: add some comments
2413 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2416 * src/insets/figinset.C (addpidwait): use std::copy with
2417 ostream_iterator to fill the pidwaitlist
2419 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2421 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2424 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2427 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2429 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2430 (class_update): ditto
2431 (BulletPanel): ditto
2432 (CheckChoiceClass): move initialization of tc and tct
2434 * src/tabular.C: remove current_view
2435 (OldFormatRead): similar to right below [istream::ignore]
2437 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2438 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2439 unused [istream::ignore]
2441 * src/lyxfunc.C: include "support/lyxfunctional.h"
2442 (getInsetByCode): use std::find_if and compare_memfun
2444 * src/lyxfont.C (stateText): remove c_str()
2446 * src/lyx_main.C (setDebuggingLevel): make static
2447 (commandLineHelp): make static
2449 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2450 Screen* together with fl_get_display() and fl_screen
2452 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2453 togheter with fl_get_display() and fl_screen
2454 (create_forms): remove c_str()
2456 * src/layout.C: include "support/lyxfunctional.h"
2457 (hasLayout): use std::find_if and compare_memfun
2458 (GetLayout): use std::find_if and comapre_memfun
2459 (delete_layout): use std::remove_if and compare_memfun
2460 (NumberOfClass): use std:.find_if and compare_memfun
2462 * src/gettext.h: change for the new functions
2464 * src/gettext.C: new file, make _(char const * str) and _(string
2465 const & str) real functions.
2467 * src/font.C (width): rewrite slightly to avoid one extra variable
2469 * src/debug.C: initialize Debug::ANY here
2471 * src/commandtags.h: update number comments
2473 * src/combox.h (get): make const func
2475 (getline): make const
2477 * src/combox.C (input_cb): handle case where fl_get_input can
2480 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2481 "support/lyxfunctional.h", remove current_view variable.
2482 (resize): use std::for_each with std::mem_fun
2483 (getFileNames): use std::copy with back_inserter_fun
2484 (getBuffer): change arg type to unsigned int
2485 (emergencyWriteAll): call emergencyWrite with std::for_each and
2487 (emergencyWrite): new method, the for loop in emergencyWriteAll
2489 (exists): use std::find_if with compare_memfun
2490 (getBuffer): use std::find_if and compare_memfun
2492 * src/buffer.h: add typedefs for iterator_category, value_type
2493 difference_type, pointer and reference for inset_iterator
2494 add postfix ++ for inset_iterator
2495 make inset_iterator::getPos() const
2497 * src/buffer.C: added support/lyxmanip.h
2498 (readFile): use lyxerr << fmt instead of printf
2499 (makeLaTeXFile): use std::copy to write out encodings
2501 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2503 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2504 free and the char * temp.
2505 (hasMenu): use std::find_if and compare_memfun
2508 * src/Makefile.am (lyx_SOURCES): added gettext.C
2510 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2511 string::insert small change to avoid temporary
2513 * src/LColor.C (getGUIName): remove c_str()
2515 * several files: change all occurrences of fl_display to
2518 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2519 that -pedantic is not used for gcc 2.97 (cvs gcc)
2521 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2523 2000-10-11 Allan Rae <rae@lyx.org>
2525 * src/frontends/xforms/FormPreferences.C (input): template path must be
2526 a readable directory. It doesn't need to be writeable.
2527 (build, delete, update, apply): New inputs in the various tabfolders
2529 * src/frontends/xforms/forms/form_preferences.fd:
2530 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2531 several new entries to existing folders. Shuffled some existing stuff
2534 * src/frontends/xforms/forms/form_print.fd:
2535 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2536 Should probably rework PrinterParams as well. Note that the switch to
2537 collated is effectively the same as !unsorted so changing PrinterParams
2538 will require a lot of fiddly changes to reverse the existing logic.
2540 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2542 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2544 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2546 2000-10-10 Allan Rae <rae@lyx.org>
2549 * src/lyxfunc.C (Dispatch):
2551 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2554 * src/lyxrc.C (output): Only write the differences between system lyxrc
2555 and the users settings.
2558 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2560 I'll rewrite this later, after 1.1.6 probably, to keep a single
2561 LyXRC but two instances of a LyXRCStruct.
2563 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2565 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2567 * src/tabular.h: add a few std:: qualifiers.
2569 * src/encoding.C: add using directive.
2570 * src/language.C: ditto.
2572 * src/insets/insetquotes.C (Validate): use languages->lang()
2573 instead of only language.
2575 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2577 * lib/languages: New file.
2579 * lib/encodings: New file.
2581 * src/language.C (Languages): New class.
2582 (read): New method. Reads the languages from the 'languages' file.
2584 * src/encoding.C (Encodings): New class.
2585 (read): New method. Reads the encodings from the 'encodings' file.
2587 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2590 * src/bufferparams.h and a lot of files: Deleted the member language,
2591 and renamed language_info to language
2593 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2594 * src/lyxfont.C (latexWriteStartChanges): ditto.
2595 * src/paragraph.C (validate,TeXOnePar): ditto.
2597 * src/lyxfont.C (update): Restored deleted code.
2599 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2601 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2603 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2605 * src/insets/figinset.[Ch]:
2606 * src/insets/insetinclude.[Ch]:
2607 * src/insets/insetinclude.[Ch]:
2608 * src/insets/insetparent.[Ch]:
2609 * src/insets/insetref.[Ch]:
2610 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2612 * src/insets/*.[Ch]:
2613 * src/mathed/formula.[Ch]:
2614 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2616 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2617 * src/lyx_cb.C (FigureApplyCB):
2618 * src/lyxfunc.C (getStatus, Dispatch):
2619 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2622 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2624 * src/converter.[Ch] (Formats::View):
2625 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2627 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2628 *current_view->buffer(). This will change later, but this patch is way
2631 2000-10-09 Juergen Vigna <jug@sad.it>
2633 * src/text.C (GetRow): small fix.
2635 * src/BufferView_pimpl.C (cursorPrevious):
2636 (cursorNext): added LyXText parameter to function.
2638 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2639 keypress depending on cursor position.
2641 2000-10-06 Juergen Vigna <jug@sad.it>
2643 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2644 (copySelection): redone this function and also copy ascii representa-
2647 * src/tabular.C (Ascii):
2651 (print_n_chars): new functions to realize the ascii export of tabulars.
2653 2000-10-05 Juergen Vigna <jug@sad.it>
2655 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2656 if we don't have a buffer.
2658 2000-10-10 Allan Rae <rae@lyx.org>
2660 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2661 with closing dialog. It seems that nested tabfolders require hiding
2662 of inner tabfolders before hiding the dialog itself. Actually all I
2663 did was hide the active outer folder.
2665 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2666 unless there really is a buffer. hideBufferDependent is called
2669 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2670 POTFILES.in stays in $(srcdir).
2672 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2674 * lib/lyxrc.example: Few changes.
2676 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2678 * src/BufferView_pimpl.C (buffer): only need one the
2679 updateBufferDependent signal to be emitted once! Moved to the end of
2680 the method to allow bv_->text to be updated first.
2682 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2683 and hSignal_ with Dialogs * and BufferDependency variables.
2684 New Buffer * parent_, initialised when the dialog is launched. Used to
2685 check whether to update() or hide() dialog in the new, private
2686 updateOrHide() method that is connected to the updateBufferDependent
2687 signal. Daughter classes dictate what to do using the
2688 ChangedBufferAction enum, passed to the c-tor.
2690 * src/frontends/xforms/FormCitation.C:
2691 * src/frontends/xforms/FormCommand.C:
2692 * src/frontends/xforms/FormCopyright.C:
2693 * src/frontends/xforms/FormDocument.C:
2694 * src/frontends/xforms/FormError.C:
2695 * src/frontends/xforms/FormIndex.C:
2696 * src/frontends/xforms/FormPreferences.C:
2697 * src/frontends/xforms/FormPrint.C:
2698 * src/frontends/xforms/FormRef.C:
2699 * src/frontends/xforms/FormToc.C:
2700 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2703 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2704 ChangedBufferAction enum.
2706 * src/frontends/xforms/FormParagraph.[Ch]
2707 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2710 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2712 * lib/bind/cua.bind: fix a bit.
2713 * lib/bind/emacs.bind: ditto.
2715 * lib/bind/menus.bind: remove real menu entries from there.
2717 * src/spellchecker.C: make sure we only include strings.h when
2720 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2722 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2723 function. It enlarges the maximum number of pup when needed.
2724 (add_toc2): Open a new menu if maximum number of items per menu has
2727 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2729 * src/frontends/kde/FormPrint.C: fix error reporting
2731 * src/frontends/xforms/FormDocument.C: fix compiler
2734 * lib/.cvsignore: add Literate.nw
2736 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2739 * bufferview_funcs.[Ch]
2742 * text2.C: Add support for numbers in RTL text.
2744 2000-10-06 Allan Rae <rae@lyx.org>
2746 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2747 to be gettext.m4 friendly again. ext_l10n.h is now
2748 generated into $top_srcdir instead of $top_builddir
2749 so that lyx.pot will be built correctly -- without
2750 duplicate parsing of ext_l10n.h.
2752 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2754 * src/frontends/kde/FormCitation.C: make the dialog
2755 behave more sensibly
2757 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2759 * config/kde.m4: fix consecutive ./configure runs,
2760 look for qtarch, fix library order
2762 * src/frontends/kde/Makefile.am: tidy up,
2763 add Print dialog, add .dlg dependencies
2765 * src/frontends/kde/FormPrint.C:
2766 * src/frontends/kde/FormPrint.h:
2767 * src/frontends/kde/formprintdialog.C:
2768 * src/frontends/kde/formprintdialog.h:
2769 * src/frontends/kde/formprintdialogdata.C:
2770 * src/frontends/kde/formprintdialogdata.h:
2771 * src/frontends/kde/dlg/formprintdialog.dlg: add
2774 * src/frontends/kde/dlg/README: Added explanatory readme
2776 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2777 script to double-check qtarch's output
2779 * src/frontends/kde/formindexdialog.C:
2780 * src/frontends/kde/formindexdialogdata.C:
2781 * src/frontends/kde/formindexdialogdata.h:
2782 * src/frontends/kde/dlg/formindexdialog.dlg: update
2783 for qtarch, minor fixes
2785 2000-10-05 Allan Rae <rae@lyx.org>
2787 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2788 dialogs when switching buffers update them instead. It's up to each
2789 dialog to decide if it should still be visible or not.
2790 update() should return a bool to control visiblity within show().
2791 Or perhaps better to set a member variable and use that to control
2794 * lib/build-listerrors: create an empty "listerrors" file just to stop
2795 make trying to regenerate it all the time if you don't have noweb
2798 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2800 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2801 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2802 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2803 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2804 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2806 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2808 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2810 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2811 deleting buffer. Closes all buffer-dependent dialogs.
2813 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2815 * src/frontends/xforms/FormCitation.[Ch]:
2816 * src/frontends/xforms/FormPreferences.[Ch]:
2817 * src/frontends/xforms/FormPrint.[Ch]:
2818 * src/frontends/xforms/FormRef.[Ch]:
2819 * src/frontends/xforms/FormUrl.[Ch]: ditto
2821 * src/frontends/xforms/FormDocument.[Ch]:
2822 * src/frontends/xforms/forms/form_document.C.patch:
2823 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2824 pass through a single input() function.
2826 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2828 * lib/build-listerrors: return status as OK
2830 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2832 * lib/lyxrc.example: Updated to new export code
2834 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2836 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2839 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2842 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2843 LyX-Code is defined.
2844 * lib/layouts/amsbook.layout: ditto.
2846 * boost/Makefile.am: fix typo.
2848 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2850 (add_lastfiles): removed.
2851 (add_documents): removed.
2852 (add_formats): removed.
2854 * src/frontends/Menubar.C: remove useless "using" directive.
2856 * src/MenuBackend.h: add a new MenuItem constructor.
2858 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2861 2000-10-04 Allan Rae <rae@lyx.org>
2863 * lib/Makefile.am (listerrors):
2864 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2865 I haven't got notangle installed so Kayvan please test. The output
2866 should end up in $builddir. This also allows people who don't have
2867 noweb installed to complete the make process without error.
2869 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2870 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2871 by JMarc's picky compiler.
2873 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2876 * src/insets/insettabular.C (setPos): change for loop to not use
2877 sequencing operator. Please check this Jürgen.
2879 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2881 * src/insets/insetcite.C (getScreenLabel): ditto
2882 * src/support/filetools.C (QuoteName): ditto
2883 (ChangeExtension): ditto
2885 * src/BufferView_pimpl.C (scrollCB): make heigt int
2887 * src/BufferView2.C (insertInset): comment out unused arg
2889 * boost/Makefile.am (EXTRADIST): new variable
2891 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2893 * src/exporter.C (IsExportable): Fixed
2895 * lib/configure.m4: Small fix
2897 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2899 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2900 * src/insets/insetbib.C (bibitemWidest): ditto.
2901 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2903 2000-10-03 Juergen Vigna <jug@sad.it>
2905 * src/BufferView2.C (theLockingInset): removed const because of
2906 Agnus's compile problems.
2908 * src/insets/insettext.C (LocalDispatch): set the language of the
2909 surronding paragraph on inserting the first character.
2911 * various files: changed use of BufferView::the_locking_inset.
2913 * src/BufferView2.C (theLockingInset):
2914 (theLockingInset): new functions.
2916 * src/BufferView.h: removed the_locking_inset.
2918 * src/lyxtext.h: added the_locking_inset
2920 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2922 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2924 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2926 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2927 * src/mathed/math_cursor.C (IsAlpha): ditto.
2928 * src/mathed/math_inset.C (strnew): ditto.
2929 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2930 (IMetrics): cxp set but never used; removed.
2931 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2932 that the variable in question has been removed also!
2935 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2936 using the Buffer * passed to Latex(), using the BufferView * passed to
2937 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2939 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2940 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2942 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2943 * src/buffer.C (readInset): used new InsetBibtex c-tor
2944 * (getBibkeyList): used new InsetBibtex::getKeys
2946 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2949 * lib/build-listerrors
2951 * src/exporter.C: Add literate programming support to the export code
2954 * src/lyx_cb.C: Remove old literate code.
2956 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2959 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2960 * src/converter.C (View, Convert): Use QuoteName.
2962 * src/insets/figinset.C (Preview): Use Formats::View.
2964 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2966 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2968 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2969 the top of the function, because compaq cxx complains that the
2970 "goto exit_with_message" when the function is disabled bypasses
2972 (MenuNew): try a better fix for the generation of new file names.
2973 This time, I used AddName() instead of AddPath(), hoping Juergen
2976 2000-10-03 Allan Rae <rae@lyx.org>
2978 * src/frontends/xforms/forms/form_preferences.fd:
2979 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2980 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2981 "Look and Feel"->"General" but will need to be split up further into
2982 general output and general input tabs. Current plan is for four outer
2983 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2984 stuff; "Inputs" for input and import configuration; "Outputs" for
2985 output and export configuration; and one more whatever is left over
2986 called "General". The leftovers at present look like being which
2987 viewers to use, spellchecker, language support and might be better
2988 named "Support". I've put "Paths" in "Inputs" for the moment as this
2989 seems reasonable for now at least.
2990 One problem remains: X error kills LyX when you close Preferences.
2992 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2994 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2995 qualifier from form()
2996 * src/frontends/xforms/FormCitation.[Ch]:
2997 * src/frontends/xforms/FormCopyright.[Ch]:
2998 * src/frontends/xforms/FormDocument.[Ch]:
2999 * src/frontends/xforms/FormError.[Ch]:
3000 * src/frontends/xforms/FormIndex.[Ch]:
3001 * src/frontends/xforms/FormPreferences.[Ch]:
3002 * src/frontends/xforms/FormPrint.[Ch]:
3003 * src/frontends/xforms/FormRef.[Ch]:
3004 * src/frontends/xforms/FormToc.[Ch]:
3005 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3007 * src/frontends/xforms/FormCitation.[Ch]:
3008 * src/frontends/xforms/FormIndex.[Ch]:
3009 * src/frontends/xforms/FormRef.[Ch]:
3010 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3011 with Allan's naming policy
3013 * src/frontends/xforms/FormCitation.C: some static casts to remove
3016 2000-10-02 Juergen Vigna <jug@sad.it>
3018 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3019 now you can type or do stuff inside the table-cell also when in dummy
3020 position, fixed visible cursor.
3022 * src/insets/insettext.C (Edit): fixing cursor-view position.
3024 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3025 be used for equal functions in lyxfunc and insettext.
3027 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3029 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3031 * src/frontends/gnome/FormCitation.h:
3032 * src/frontends/gnome/FormCopyright.h:
3033 * src/frontends/gnome/FormIndex.h:
3034 * src/frontends/gnome/FormPrint.h:
3035 * src/frontends/gnome/FormToc.h:
3036 * src/frontends/gnome/FormUrl.h:
3037 * src/frontends/kde/FormCitation.h:
3038 * src/frontends/kde/FormCopyright.h:
3039 * src/frontends/kde/FormIndex.h:
3040 * src/frontends/kde/FormRef.h:
3041 * src/frontends/kde/FormToc.h:
3042 * src/frontends/kde/FormUrl.h: fix remaining users of
3045 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3047 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3048 from depth argument.
3049 (DocBookHandleCaption): ditto.
3050 (DocBookHandleFootnote): ditto.
3051 (SimpleDocBookOnePar): ditto.
3053 * src/frontends/xforms/FormDocument.h (form): remove extra
3054 FormDocument:: qualifier.
3056 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3058 * sigc++/handle.h: ditto.
3060 * src/lyx_gui_misc.C: add "using" directive.
3062 * src/cheaders/cstddef: new file, needed by the boost library (for
3065 2000-10-02 Juergen Vigna <jug@sad.it>
3067 * src/insets/insettext.C (SetFont): better support.
3069 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3071 * src/screen.C (DrawOneRow): some uint refixes!
3073 2000-10-02 Allan Rae <rae@lyx.org>
3075 * boost/.cvsignore: ignore Makefile as well
3077 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3078 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3080 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3081 Left this one out by accident.
3083 * src/frontends/xforms/FormBase.h (restore): default to calling
3084 update() since that will restore the original/currently-applied values.
3085 Any input() triggered error messages will require the derived classes
3086 to redefine restore().
3088 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3089 avoid a segfault. combo_doc_class is the main concern.
3091 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3093 * Simplify build-listerrors in view of GUI-less export ability!
3095 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3097 * src/lyx_main.C (easyParse): Disable gui when exporting
3099 * src/insets/figinset.C:
3102 * src/lyx_gui_misc.C
3103 * src/tabular.C: Changes to allow no-gui.
3105 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3107 * src/support/utility.hpp: removed file
3108 * src/support/block.h: removed file
3110 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3113 * src/mathed/formula.C: add support/lyxlib.h
3114 * src/mathed/formulamacro.C: ditto
3116 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3117 * src/lyxparagraph.h: ditto
3119 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3120 * src/frontends/Makefile.am (INCLUDES): ditto
3121 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3122 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3123 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3124 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3125 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3126 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3128 * src/BufferView.h: use boost/utility.hpp
3129 * src/LColor.h: ditto
3130 * src/LaTeX.h: ditto
3131 * src/LyXAction.h: ditto
3132 * src/LyXView.h: ditto
3133 * src/bufferlist.h: ditto
3134 * src/lastfiles.h: ditto
3135 * src/layout.h: ditto
3136 * src/lyx_gui.h: ditto
3137 * src/lyx_main.h: ditto
3138 * src/lyxlex.h: ditto
3139 * src/lyxrc.h: ditto
3140 * src/frontends/ButtonPolicies.h: ditto
3141 * src/frontends/Dialogs.h: ditto
3142 * src/frontends/xforms/FormBase.h: ditto
3143 * src/frontends/xforms/FormGraphics.h: ditto
3144 * src/frontends/xforms/FormParagraph.h: ditto
3145 * src/frontends/xforms/FormTabular.h: ditto
3146 * src/graphics/GraphicsCache.h: ditto
3147 * src/graphics/Renderer.h: ditto
3148 * src/insets/ExternalTemplate.h: ditto
3149 * src/insets/insetcommand.h: ditto
3150 * src/support/path.h: ditto
3152 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3153 and introduce clause for 2.97.
3155 * boost/libs/README: new file
3157 * boost/boost/utility.hpp: new file
3159 * boost/boost/config.hpp: new file
3161 * boost/boost/array.hpp: new file
3163 * boost/Makefile.am: new file
3165 * boost/.cvsignore: new file
3167 * configure.in (AC_OUTPUT): add boost/Makefile
3169 * Makefile.am (SUBDIRS): add boost
3171 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3173 * src/support/lstrings.C (suffixIs): Fixed.
3175 2000-10-01 Allan Rae <rae@lyx.org>
3177 * src/PrinterParams.h: moved things around to avoid the "can't
3178 inline call" warning.
3180 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3181 into doc++ documentation.
3183 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3185 * src/frontends/xforms/FormRef.C: make use of button controller
3186 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3187 cleaned up button controller usage.
3188 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3189 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3190 use the button controller
3192 * src/frontends/xforms/forms/*.fd: and associated generated files
3193 updated to reflect changes to FormBase. Some other FormXxxx files
3194 also got minor updates to reflect changes to FormBase.
3196 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3197 (hide): made virtual.
3198 (input): return a bool. true == valid input
3199 (RestoreCB, restore): new
3200 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3201 Changes to allow derived dialogs to use a ButtonController and
3202 make sense when doing so: OK button calls ok() and so on.
3204 * src/frontends/xforms/ButtonController.h (class ButtonController):
3205 Switch from template implementation to taking Policy parameter.
3206 Allows FormBase to provide a ButtonController for any dialog.
3208 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3209 Probably should rename connect and disconnect.
3210 (apply): use the radio button groups
3211 (form): needed by FormBase
3212 (build): setup the radio button groups
3214 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3216 * several files: type changes to reduce the number of warnings and
3217 to unify type hangling a bit. Still much to do.
3219 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3221 * lib/images/*: rename a bunch of icons to match Dekel converter
3224 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3227 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3229 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3231 * sigc++/handle.h: ditto for class Handle.
3233 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3235 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3237 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3239 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3240 removal of the "default" language.
3242 * src/combox.h (getline): Check that sel > 0
3244 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3246 * lib/examples/docbook_example.lyx
3247 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3249 * lib/layouts/docbook-book.layout: new docbook book layout.
3251 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3253 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3255 * src/insets/figinset.C (DocBook):fixed small typo.
3257 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3259 * src/insets/insetinclude.h: string include_label doesn't need to be
3262 2000-09-29 Allan Rae <rae@lyx.org>
3264 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3265 Allow derived type to control connection and disconnection from signals
3266 of its choice if desired.
3268 2000-09-28 Juergen Vigna <jug@sad.it>
3270 * src/insets/insettabular.C (update): fixed cursor setting when
3271 the_locking_inset changed.
3272 (draw): made this a bit cleaner.
3273 (InsetButtonPress): fixed!
3275 * various files: added LyXText Parameter to fitCursor call.
3277 * src/BufferView.C (fitCursor): added LyXText parameter.
3279 * src/insets/insettabular.C (draw): small draw fix.
3281 * src/tabular.C: right setting of left/right celllines.
3283 * src/tabular.[Ch]: fixed various types in funcions and structures.
3284 * src/insets/insettabular.C: ditto
3285 * src/frontends/xforms/FormTabular.C: ditto
3287 2000-09-28 Allan Rae <rae@lyx.org>
3289 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3290 that the #ifdef's had been applied to part of what should have been
3291 a complete condition. It's possible there are other tests that
3292 were specific to tables that are also wrong now that InsetTabular is
3293 being used. Now we need to fix the output of '\n' after a table in a
3294 float for the same reason as the original condition:
3295 "don't insert this if we would be adding it before or after a table
3296 in a float. This little trick is needed in order to allow use of
3297 tables in \subfigures or \subtables."
3298 Juergen can you check this?
3300 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3302 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3303 output to the ostream.
3305 * several files: fixed types based on warnings from cxx
3307 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3309 * src/frontends/kde/Makefile.am: fix rule for
3310 formindexdialogdata_moc.C
3312 * src/.cvsignore: add ext_l10n.h to ignore
3314 * acconfig.h: stop messing with __STRICT_ANSI__
3315 * config/gnome.m4: remove option to set -ansi
3316 * config/kde.m4: remove option to set -ansi
3317 * config/lyxinclude.m4: don't set -ansi
3319 2000-09-27 Juergen Vigna <jug@sad.it>
3321 * various files: remove "default" language check.
3323 * src/insets/insetquotes.C: removed use of current_view.
3325 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3326 the one should have red ears by now!
3328 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3329 in more then one paragraph. Fixed cursor-movement/selection.
3331 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3332 paragraphs inside a text inset.
3334 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3335 text-inset if this owner is an inset.
3337 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3339 * src/Bullet.h: changed type of font, character and size to int
3341 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3343 * src/insets/inseturl.[Ch]:
3344 * src/insets/insetref.[Ch]:
3345 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3347 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3349 * src/buffer.C (readFile): block-if statement rearranged to minimise
3350 bloat. Patch does not reverse Jean-Marc's change ;-)
3352 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3353 Class rewritten to store pointers to hide/update signals directly,
3354 rather than Dialogs *. Also defined an enum to ease use. All xforms
3355 forms can now be derived from this class.
3357 * src/frontends/xforms/FormCommand.[Ch]
3358 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3360 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3363 * src/frontends/xforms/forms/form_citation.fd
3364 * src/frontends/xforms/forms/form_copyright.fd
3365 * src/frontends/xforms/forms/form_error.fd
3366 * src/frontends/xforms/forms/form_index.fd
3367 * src/frontends/xforms/forms/form_ref.fd
3368 * src/frontends/xforms/forms/form_toc.fd
3369 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3371 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3373 * src/insets/insetfoot.C: removed redundent using directive.
3375 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3377 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3378 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3380 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3381 created in the constructors in different groups. Then set() just
3382 have to show the groups as needed. This fixes the redraw problems
3383 (and is how the old menu code worked).
3385 * src/support/lyxlib.h: declare the methods as static when we do
3386 not have namespaces.
3388 2000-09-26 Juergen Vigna <jug@sad.it>
3390 * src/buffer.C (asciiParagraph): new function.
3391 (writeFileAscii): new function with parameter ostream.
3392 (writeFileAscii): use now asciiParagraph.
3394 * various inset files: added the linelen parameter to the Ascii-func.
3396 * src/tabular.C (Write): fixed error in writing file introduced by
3397 the last changes from Lars.
3399 * lib/bind/menus.bind: removed not supported functions.
3401 * src/insets/insettext.C (Ascii): implemented this function.
3403 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3405 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3406 (Write): use of the write_attribute functions.
3408 * src/bufferlist.C (close): fixed reasking question!
3410 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3412 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3413 new files use the everwhere possible.
3416 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3417 src/log_form.C src/lyx.C:
3420 * src/buffer.C (runLaTeX): remove func
3422 * src/PaperLayout.C: removed file
3423 * src/ParagraphExtra.C: likewise
3424 * src/bullet_forms.C: likewise
3425 * src/bullet_forms.h: likewise
3426 * src/bullet_forms_cb.C: likewise
3428 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3429 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3432 * several files: remove all traces of the old fd_form_paragraph,
3433 and functions belonging to that.
3435 * several files: remove all traces of the old fd_form_document,
3436 and functions belonging to that.
3438 * several files: constify local variables were possible.
3440 * several files: remove all code that was dead when NEW_EXPORT was
3443 * several files: removed string::c_str in as many places as
3446 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3447 (e): be a bit more outspoken when patching
3448 (updatesrc): only move files if changed.
3450 * forms/layout_forms.h.patch: regenerated
3452 * forms/layout_forms.fd: remove form_document and form_paragraph
3453 and form_quotes and form_paper and form_table_options and
3454 form_paragraph_extra
3456 * forms/form1.fd: remove form_table
3458 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3459 the fdui->... rewrite. Update some comments to xforms 0.88
3461 * forms/bullet_forms.C.patch: removed file
3462 * forms/bullet_forms.fd: likewise
3463 * forms/bullet_forms.h.patch: likewise
3465 * development/Code_rules/Rules: added a section on switch
3466 statements. Updated some comment to xforms 0.88.
3468 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3470 * src/buffer.C (readFile): make sure that the whole version number
3471 is read after \lyxformat (even when it contains a comma)
3473 * lib/ui/default.ui: change shortcut of math menu to M-a.
3475 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3477 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3480 * src/LyXView.C (updateWindowTitle): show the full files name in
3481 window title, limited to 30 characters.
3483 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3484 When a number of characters has been given, we should not assume
3485 that the string is 0-terminated.
3487 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3488 calls (fixes some memory leaks)
3490 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3491 trans member on exit.
3493 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3495 * src/converter.C (GetReachable): fix typo.
3497 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3498 understand ',' instead of '.'.
3499 (GetInteger): rewrite to use strToInt().
3501 2000-09-26 Juergen Vigna <jug@sad.it>
3503 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3504 better visibility and error-message on wrong VSpace input.
3506 * src/language.C (initL): added english again.
3508 2000-09-25 Juergen Vigna <jug@sad.it>
3510 * src/frontends/kde/Dialogs.C (Dialogs):
3511 * src/frontends/gnome/Dialogs.C (Dialogs):
3512 * src/frontends/kde/Makefile.am:
3513 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3515 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3517 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3519 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3521 * src/frontends/xforms/FormParagraph.C:
3522 * src/frontends/xforms/FormParagraph.h:
3523 * src/frontends/xforms/form_paragraph.C:
3524 * src/frontends/xforms/form_paragraph.h:
3525 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3528 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3530 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3531 Paragraph-Data after use.
3533 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3534 non breakable paragraphs.
3536 2000-09-25 Garst R. Reese <reese@isn.net>
3538 * src/language.C (initL): added missing language_country codes.
3540 2000-09-25 Juergen Vigna <jug@sad.it>
3542 * src/insets/insettext.C (InsetText):
3543 (deleteLyXText): remove the not released LyXText structure!
3545 2000-09-24 Marko Vendelin <markov@ioc.ee>
3547 * src/frontends/gnome/mainapp.C
3548 * src/frontends/gnome/mainapp.h: added support for keyboard
3551 * src/frontends/gnome/FormCitation.C
3552 * src/frontends/gnome/FormCitation.h
3553 * src/frontends/gnome/Makefile.am
3554 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3555 FormCitation to use "action area" in mainapp window
3557 * src/frontends/gnome/Menubar_pimpl.C
3558 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3561 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3563 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3564 width/descent/ascent values if name is empty.
3565 (mathed_string_height): Use std::max.
3567 2000-09-25 Allan Rae <rae@lyx.org>
3569 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3570 segfault. This will be completely redesigned soon.
3572 * sigc++: updated libsigc++. Fixes struct timespec bug.
3574 * development/tools/makeLyXsigc.sh: .cvsignore addition
3576 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3578 * several files: removed almost all traces of the old table
3581 * src/TableLayout.C: removed file
3583 2000-09-22 Juergen Vigna <jug@sad.it>
3585 * src/frontends/kde/Dialogs.C: added credits forms.
3587 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3589 * src/frontends/gnome/Dialogs.C: added some forms.
3591 * src/spellchecker.C (init_spell_checker): set language in pspell code
3592 (RunSpellChecker): some modifications for setting language string.
3594 * src/language.[Ch]: added language_country code.
3596 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3598 * src/frontends/Dialogs.h: added new signal showError.
3599 Rearranged existing signals in some sort of alphabetical order.
3601 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3602 FormError.[Ch], form_error.[Ch]
3603 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3604 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3606 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3607 dialogs. I think that this can be used as the base to all these
3610 * src/frontends/xforms/FormError.[Ch]
3611 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3612 implementation of InsetError dialog.
3614 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3616 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3617 * src/frontends/kde/Makefile.am: ditto
3619 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3621 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3622 macrobf. This fixes a bug of invisible text.
3624 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3626 * lib/doc/LaTeXConfig.lyx.in: updated.
3628 * src/language.C (initL): remove language "francais" and change a
3629 bit the names of the two other french variations.
3631 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3632 string that may not be 0-terminated.
3634 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3636 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3638 2000-09-20 Marko Vendelin <markov@ioc.ee>
3640 * src/frontends/gnome/FormCitation.C
3641 * src/frontends/gnome/FormIndex.C
3642 * src/frontends/gnome/FormToc.C
3643 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3644 the variable initialization to shut up the warnings
3646 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3648 * src/table.[Ch]: deleted files
3650 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3653 2000-09-18 Juergen Vigna <jug@sad.it>
3655 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3656 problems with selection. Inserted new LFUN_PASTESELECTION.
3657 (InsetButtonPress): inserted handling of middle mouse-button paste.
3659 * src/spellchecker.C: changed word to word.c_str().
3661 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3663 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3664 included in the ``make dist'' tarball.
3666 2000-09-15 Juergen Vigna <jug@sad.it>
3668 * src/CutAndPaste.C (cutSelection): small fix return the right
3669 end position after cut inside one paragraph only.
3671 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3672 we are locked as otherwise we don't have a valid cursor position!
3674 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3676 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3678 * src/frontends/kde/FormRef.C: added using directive.
3679 * src/frontends/kde/FormToc.C: ditto
3681 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3683 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3685 2000-09-19 Marko Vendelin <markov@ioc.ee>
3687 * src/frontends/gnome/Menubar_pimpl.C
3688 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3689 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3691 * src/frontends/gnome/mainapp.C
3692 * src/frontends/gnome/mainapp.h: support for menu update used
3695 * src/frontends/gnome/mainapp.C
3696 * src/frontends/gnome/mainapp.h: support for "action" area in the
3697 main window. This area is used by small simple dialogs, such as
3700 * src/frontends/gnome/FormIndex.C
3701 * src/frontends/gnome/FormIndex.h
3702 * src/frontends/gnome/FormUrl.C
3703 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3706 * src/frontends/gnome/FormCitation.C
3707 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3708 action area. Only "Insert new citation" is implemented.
3710 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3712 * src/buffer.C (Dispatch): fix call to Dispatch
3713 * src/insets/insetref.C (Edit): likewise
3714 * src/insets/insetparent.C (Edit): likewise
3715 * src/insets/insetinclude.C (include_cb): likewise
3716 * src/frontends/xforms/FormUrl.C (apply): likewise
3717 * src/frontends/xforms/FormToc.C (apply): likewise
3718 * src/frontends/xforms/FormRef.C (apply): likewise
3719 * src/frontends/xforms/FormIndex.C (apply): likewise
3720 * src/frontends/xforms/FormCitation.C (apply): likewise
3721 * src/lyxserver.C (callback): likewise
3722 * src/lyxfunc.C (processKeySym): likewise
3723 (Dispatch): likewise
3724 (Dispatch): likewise
3725 * src/lyx_cb.C (LayoutsCB): likewise
3727 * Makefile.am (sourcedoc): small change
3729 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3731 * src/main.C (main): Don't make an empty GUIRunTime object. all
3732 methods are static. constify a bit remove unneded using + headers.
3734 * src/tabular.C: some more const to local vars move some loop vars
3736 * src/spellchecker.C: added some c_str after some word for pspell
3738 * src/frontends/GUIRunTime.h: add new static method setDefaults
3739 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3740 * src/frontends/kde/GUIRunTime.C (setDefaults):
3741 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3743 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3744 with strnew in arg, use correct emptystring when calling SetName.
3746 * several files: remove all commented code with relation to
3747 HAVE_SSTREAM beeing false. We now only support stringstream and
3750 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3752 * src/lyxfunc.C: construct correctly the automatic new file
3755 * src/text2.C (IsStringInText): change type of variable i to shut
3758 * src/support/sstream.h: do not use namespaces if the compiler
3759 does not support them.
3761 2000-09-15 Marko Vendelin <markov@ioc.ee>
3762 * src/frontends/gnome/FormCitation.C
3763 * src/frontends/gnome/FormCitation.h
3764 * src/frontends/gnome/diainsertcitation_interface.c
3765 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3766 regexp support to FormCitation [Gnome].
3768 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3771 * configure.in: remove unused KDE/GTKGUI define
3773 * src/frontends/kde/FormRef.C
3774 * src/frontends/kde/FormRef.h
3775 * src/frontends/kde/formrefdialog.C
3776 * src/frontends/kde/formrefdialog.h: double click will
3777 go to reference, now it is possible to change a cross-ref
3780 * src/frontends/kde/FormToc.C
3781 * src/frontends/kde/FormToc.h
3782 * src/frontends/kde/formtocdialog.C
3783 * src/frontends/kde/formtocdialog.h: add a depth
3786 * src/frontends/kde/Makefile.am: add QtLyXView.h
3789 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3791 * src/frontends/kde/FormCitation.h: added some using directives.
3793 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3795 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3798 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3801 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3803 * src/buffer.C (pop_tag): revert for the second time a change by
3804 Lars, who seems to really hate having non-local loop variables :)
3806 * src/Lsstream.h: add "using" statements.
3808 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3809 * src/buffer.C (writeFile): ditto
3811 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3813 * src/buffer.C (writeFile): try to fix the locale modified format
3814 number to always be as we want it.
3816 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3817 in XForms 0.89. C-space is now working again.
3819 * src/Lsstream.h src/support/sstream.h: new files.
3821 * also commented out all cases where strstream were used.
3823 * src/Bullet.h (c_str): remove method.
3825 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3827 * a lot of files: get rid of "char const *" and "char *" is as
3828 many places as possible. We only want to use them in interaction
3829 with system of other libraries, not inside lyx.
3831 * a lot of files: return const object is not of pod type. This
3832 helps ensure that temporary objects is not modified. And fits well
3833 with "programming by contract".
3835 * configure.in: check for the locale header too
3837 * Makefile.am (sourcedoc): new tag for generation of doc++
3840 2000-09-14 Juergen Vigna <jug@sad.it>
3842 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3843 callback to check which combo called it and do the right action.
3845 * src/combox.C (combo_cb): added combo * to the callbacks.
3846 (Hide): moved call of callback after Ungrab of the pointer.
3848 * src/intl.h: removed LCombo2 function.
3850 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3851 function as this can now be handled in one function.
3853 * src/combox.h: added Combox * to callback prototype.
3855 * src/frontends/xforms/Toolbar_pimpl.C:
3856 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3858 2000-09-14 Garst Reese <reese@isn.net>
3860 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3861 moved usepackage{xxx}'s to beginning of file. Changed left margin
3862 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3863 underlining from title. Thanks to John Culleton for useful suggestions.
3865 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3867 * src/lyxlex_pimpl.C (setFile): change error message to debug
3870 2000-09-13 Juergen Vigna <jug@sad.it>
3872 * src/frontends/xforms/FormDocument.C: implemented choice_class
3873 as combox and give callback to combo_language so OK/Apply is activated
3876 * src/bufferlist.C (newFile): small fix so already named files
3877 (via an open call) are not requested to be named again on the
3880 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3882 * src/frontends/kde/Makefile.am
3883 * src/frontends/kde/FormRef.C
3884 * src/frontends/kde/FormRef.h
3885 * src/frontends/kde/formrefdialog.C
3886 * src/frontends/kde/formrefdialog.h: implement
3889 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3891 * src/frontends/kde/formtocdialog.C
3892 * src/frontends/kde/formtocdialog.h
3893 * src/frontends/kde/FormToc.C
3894 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3896 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3898 * src/frontends/kde/FormCitation.C: fix thinko
3899 where we didn't always display the reference text
3902 * src/frontends/kde/formurldialog.C
3903 * src/frontends/kde/formurldialog.h
3904 * src/frontends/kde/FormUrl.C
3905 * src/frontends/kde/FormUrl.h: minor cleanups
3907 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3909 * src/frontends/kde/Makefile.am
3910 * src/frontends/kde/FormToc.C
3911 * src/frontends/kde/FormToc.h
3912 * src/frontends/kde/FormCitation.C
3913 * src/frontends/kde/FormCitation.h
3914 * src/frontends/kde/FormIndex.C
3915 * src/frontends/kde/FormIndex.h
3916 * src/frontends/kde/formtocdialog.C
3917 * src/frontends/kde/formtocdialog.h
3918 * src/frontends/kde/formcitationdialog.C
3919 * src/frontends/kde/formcitationdialog.h
3920 * src/frontends/kde/formindexdialog.C
3921 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3923 2000-09-12 Juergen Vigna <jug@sad.it>
3925 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3928 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3930 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3933 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3935 * src/converter.C (Add, Convert): Added support for converter flags:
3936 needaux, resultdir, resultfile.
3937 (Convert): Added new parameter view_file.
3938 (dvips_options): Fixed letter paper option.
3940 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3941 (Export, GetExportableFormats, GetViewableFormats): Added support
3944 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3946 (easyParse): Fixed to work with new export code.
3948 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3951 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3953 * lib/bind/*.bind: Replaced
3954 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3955 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3957 2000-09-11 Juergen Vigna <jug@sad.it>
3959 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3961 * src/main.C (main): now GUII defines global guiruntime!
3963 * src/frontends/gnome/GUIRunTime.C (initApplication):
3964 * src/frontends/kde/GUIRunTime.C (initApplication):
3965 * src/frontends/xforms/GUIRunTime.C (initApplication):
3966 * src/frontends/GUIRunTime.h: added new function initApplication.
3968 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3970 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3972 2000-09-08 Juergen Vigna <jug@sad.it>
3974 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3975 we have already "Reset".
3977 * src/language.C (initL): inserted "default" language and made this
3978 THE default language (and not american!)
3980 * src/paragraph.C: inserted handling of "default" language!
3982 * src/lyxfont.C: ditto
3986 * src/paragraph.C: output the \\par only if we have a following
3987 paragraph otherwise it's not needed.
3989 2000-09-05 Juergen Vigna <jug@sad.it>
3991 * config/pspell.m4: added entry to lyx-flags
3993 * src/spellchecker.C: modified version from Kevin for using pspell
3995 2000-09-01 Marko Vendelin <markov@ioc.ee>
3996 * src/frontends/gnome/Makefile.am
3997 * src/frontends/gnome/FormCitation.C
3998 * src/frontends/gnome/FormCitation.h
3999 * src/frontends/gnome/diainsertcitation_callbacks.c
4000 * src/frontends/gnome/diainsertcitation_callbacks.h
4001 * src/frontends/gnome/diainsertcitation_interface.c
4002 * src/frontends/gnome/diainsertcitation_interface.h
4003 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4004 dialog for Gnome frontend
4006 * src/main.C: Gnome libraries require keeping application name
4007 and its version as strings
4009 * src/frontends/gnome/mainapp.C: Change the name of the main window
4010 from GnomeLyX to PACKAGE
4012 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4014 * src/frontends/Liason.C: add "using: declaration.
4016 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4018 * src/mathed/math_macro.C (Metrics): Set the size of the template
4020 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4022 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4024 * src/converter.C (add_options): New function.
4025 (SetViewer): Change $$FName into '$$FName'.
4026 (View): Add options when running xdvi
4027 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4028 (Convert): The 3rd parameter is now the desired filename. Converts
4029 calls to lyx::rename if necessary.
4030 Add options when running dvips.
4031 (dvi_papersize,dvips_options): New methods.
4033 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4035 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4036 using a call to Converter::dvips_options.
4037 Fixed to work with nex export code.
4039 * src/support/copy.C
4040 * src/support/rename.C: New files
4042 * src/support/syscall.h
4043 * src/support/syscall.C: Added Starttype SystemDontWait.
4045 * lib/ui/default.ui: Changed to work with new export code
4047 * lib/configure.m4: Changed to work with new export code
4049 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4051 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4053 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4054 so that code compiles with DEC cxx.
4056 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4057 to work correctly! Also now supports the additional elements
4060 2000-09-01 Allan Rae <rae@lyx.org>
4062 * src/frontends/ButtonPolicies.C: renamed all the references to
4063 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4065 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4066 since it's a const not a type.
4068 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4070 2000-08-31 Juergen Vigna <jug@sad.it>
4072 * src/insets/figinset.C: Various changes to look if the filename has
4073 an extension and if not add it for inline previewing.
4075 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4077 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4078 make buttonStatus and isReadOnly be const methods. (also reflect
4079 this in derived classes.)
4081 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4082 (nextState): change to be static inline, pass the StateMachine as
4084 (PreferencesPolicy): remove casts
4085 (OkCancelPolicy): remvoe casts
4086 (OkCancelReadOnlyPolicy): remove casts
4087 (NoRepeatedApplyReadOnlyPolicy): remove casts
4088 (OkApplyCancelReadOnlyPolicy): remove casts
4089 (OkApplyCancelPolicy): remove casts
4090 (NoRepeatedApplyPolicy): remove casts
4092 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4094 * src/converter.C: added some using directives
4096 * src/frontends/ButtonPolicies.C: changes to overcome
4097 "need lvalue" error with DEC c++
4099 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4100 to WMHideCB for DEC c++
4102 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4104 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4105 to BulletBMTableCB for DEC c++
4107 2000-08-31 Allan Rae <rae@lyx.org>
4109 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4110 character dialog separately from old document dialogs combo_language.
4113 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4115 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4116 Removed LFUN_REF_CREATE.
4118 * src/MenuBackend.C: Added new tags: toc and references
4120 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4121 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4123 (add_toc, add_references): New methods.
4124 (create_submenu): Handle correctly the case when there is a
4125 seperator after optional menu items.
4127 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4128 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4129 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4131 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4133 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4135 * src/converter.[Ch]: New file for converting between different
4138 * src/export.[Ch]: New file for exporting a LyX file to different
4141 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4142 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4143 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4144 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4145 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4146 RunDocBook, MenuExport.
4148 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4149 Exporter::Preview methods if NEW_EXPORT is defined.
4151 * src/buffer.C (Dispatch): Use Exporter::Export.
4153 * src/lyxrc.C: Added new tags: \converter and \viewer.
4156 * src/LyXAction.C: Define new lyx-function: buffer-update.
4157 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4158 when NEW_EXPORT is defined.
4160 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4162 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4164 * lib/ui/default.ui: Added submenus "view" and "update" to the
4167 * src/filetools.C (GetExtension): New function.
4169 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4171 2000-08-29 Allan Rae <rae@lyx.org>
4173 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4175 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4176 (EnableDocumentLayout): removed
4177 (DisableDocumentLayout): removed
4178 (build): make use of ButtonController's read-only handling to
4179 de/activate various objects. Replaces both of the above functions.
4181 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4182 (readOnly): was read_only
4183 (refresh): fixed dumb mistakes with read_only_ handling
4185 * src/frontends/xforms/forms/form_document.fd:
4186 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4187 tabbed dialogs so the tabs look more like tabs and so its easier to
4188 work out which is the current tab.
4190 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4191 segfault with form_table
4193 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4195 2000-08-28 Juergen Vigna <jug@sad.it>
4197 * acconfig.h: added USE_PSPELL.
4199 * src/config.h.in: added USE_PSPELL.
4201 * autogen.sh: added pspell.m4
4203 * config/pspell.m4: new file.
4205 * src/spellchecker.C: implemented support for pspell libary.
4207 2000-08-25 Juergen Vigna <jug@sad.it>
4209 * src/LyXAction.C (init): renamed LFUN_TABLE to
4210 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4212 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4214 * src/lyxscreen.h: add force_clear variable and fuction to force
4215 a clear area when redrawing in LyXText.
4217 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4219 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4221 * some whitespace and comment changes.
4223 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4225 * src/buffer.C: up te LYX_FORMAT to 2.17
4227 2000-08-23 Juergen Vigna <jug@sad.it>
4229 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4232 * src/insets/insettabular.C (pasteSelection): delete the insets
4233 LyXText as it is not valid anymore.
4234 (copySelection): new function.
4235 (pasteSelection): new function.
4236 (cutSelection): new function.
4237 (LocalDispatch): implemented cut/copy/paste of cell selections.
4239 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4240 don't have a LyXText.
4242 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4244 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4247 2000-08-22 Juergen Vigna <jug@sad.it>
4249 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4250 ifdef form_table out if NEW_TABULAR.
4252 2000-08-21 Juergen Vigna <jug@sad.it>
4254 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4255 (draw): fixed draw position so that the cursor is positioned in the
4257 (InsetMotionNotify): hide/show cursor so the position is updated.
4258 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4259 using cellstart() function where it should be used.
4261 * src/insets/insettext.C (draw): ditto.
4263 * src/tabular.C: fixed initialization of some missing variables and
4264 made BoxType into an enum.
4266 2000-08-22 Marko Vendelin <markov@ioc.ee>
4267 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4268 stock menu item using action numerical value, not its string
4272 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4274 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4275 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4277 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4279 * src/frontends/xforms/GUIRunTime.C: new file
4281 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4282 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4284 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4286 * src/frontends/kde/GUIRunTime.C: new file
4288 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4289 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4291 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4293 * src/frontends/gnome/GUIRunTime.C: new file
4295 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4298 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4299 small change to documetentation.
4301 * src/frontends/GUIRunTime.C: removed file
4303 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4305 * src/lyxparagraph.h: enable NEW_TABULAR as default
4307 * src/lyxfunc.C (processKeySym): remove some commented code
4309 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4310 NEW_TABULAR around the fd_form_table_options.
4312 * src/lyx_gui.C (runTime): call the static member function as
4313 GUIRunTime::runTime().
4315 2000-08-21 Allan Rae <rae@lyx.org>
4317 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4320 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4322 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4324 2000-08-21 Allan Rae <rae@lyx.org>
4326 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4327 keep Garst happy ;-)
4328 * src/frontends/xforms/FormPreferences.C (build): use setOK
4329 * src/frontends/xforms/FormDocument.C (build): use setOK
4330 (FormDocument): use the appropriate policy.
4332 2000-08-21 Allan Rae <rae@lyx.org>
4334 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4335 automatic [de]activation of arbitrary objects when in a read-only state.
4337 * src/frontends/ButtonPolicies.h: More documentation
4338 (isReadOnly): added to support the above.
4340 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4342 2000-08-18 Juergen Vigna <jug@sad.it>
4344 * src/insets/insettabular.C (getStatus): changed to return func_status.
4346 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4347 display toggle menu entries if they are.
4349 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4350 new document layout now.
4352 * src/lyxfunc.C: ditto
4354 * src/lyx_gui_misc.C: ditto
4356 * src/lyx_gui.C: ditto
4358 * lib/ui/default.ui: removed paper and quotes layout as they are now
4359 all in the document layout tabbed folder.
4361 * src/frontends/xforms/forms/form_document.fd: added Restore
4362 button and callbacks for all inputs for Allan's ButtonPolicy.
4364 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4365 (CheckChoiceClass): added missing params setting on class change.
4366 (UpdateLayoutDocument): added for updating the layout on params.
4367 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4368 (FormDocument): Implemented Allan's ButtonPolicy with the
4371 2000-08-17 Allan Rae <rae@lyx.org>
4373 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4374 so we can at least see the credits again.
4376 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4377 controller calls for the appropriate callbacks. Note that since Ok
4378 calls apply followed by cancel, and apply isn't a valid input for the
4379 APPLIED state, the bc_ calls have to be made in the static callback not
4380 within each of the real callbacks.
4382 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4383 (setOk): renamed from setOkay()
4385 2000-08-17 Juergen Vigna <jug@sad.it>
4387 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4388 in the implementation part.
4389 (composeUIInfo): don't show optional menu-items.
4391 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4393 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4395 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4396 text-state when in a text-inset.
4398 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4400 2000-08-17 Marko Vendelin <markov@ioc.ee>
4401 * src/frontends/gnome/FormIndex.C
4402 * src/frontends/gnome/FormIndex.h
4403 * src/frontends/gnome/FormToc.C
4404 * src/frontends/gnome/FormToc.h
4405 * src/frontends/gnome/dialogs
4406 * src/frontends/gnome/diatoc_callbacks.c
4407 * src/frontends/gnome/diatoc_callbacks.h
4408 * src/frontends/gnome/diainsertindex_callbacks.h
4409 * src/frontends/gnome/diainsertindex_callbacks.c
4410 * src/frontends/gnome/diainsertindex_interface.c
4411 * src/frontends/gnome/diainsertindex_interface.h
4412 * src/frontends/gnome/diatoc_interface.h
4413 * src/frontends/gnome/diatoc_interface.c
4414 * src/frontends/gnome/Makefile.am: Table of Contents and
4415 Insert Index dialogs implementation for Gnome frontend
4417 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4419 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4421 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4424 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4426 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4427 destructor. Don't definde if you don't need it
4428 (processEvents): made static, non-blocking events processing for
4430 (runTime): static method. event loop for xforms
4431 * similar as above for kde and gnome.
4433 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4434 new Pimpl is correct
4435 (runTime): new method calss the real frontends runtime func.
4437 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4439 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4441 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4443 2000-08-16 Juergen Vigna <jug@sad.it>
4445 * src/lyx_gui.C (runTime): added GUII RunTime support.
4447 * src/frontends/Makefile.am:
4448 * src/frontends/GUIRunTime.[Ch]:
4449 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4450 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4451 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4453 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4455 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4456 as this is already set in ${FRONTEND_INCLUDE} if needed.
4458 * configure.in (CPPFLAGS): setting the include dir for the frontend
4459 directory and don't set FRONTEND=xforms for now as this is executed
4462 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4464 * src/frontends/kde/Makefile.am:
4465 * src/frontends/kde/FormUrl.C:
4466 * src/frontends/kde/FormUrl.h:
4467 * src/frontends/kde/formurldialog.h:
4468 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4470 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4472 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4474 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4476 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4479 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4481 * src/WorkArea.C (work_area_handler): more work to get te
4482 FL_KEYBOARD to work with xforms 0.88 too, please test.
4484 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4486 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4488 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4491 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4493 * src/Timeout.h: remove Qt::emit hack.
4495 * several files: changes to allo doc++ compilation
4497 * src/lyxfunc.C (processKeySym): new method
4498 (processKeyEvent): comment out if FL_REVISION < 89
4500 * src/WorkArea.C: change some debugging levels.
4501 (WorkArea): set wantkey to FL_KEY_ALL
4502 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4503 clearer code and the use of compose with XForms 0.89. Change to
4504 use signals instead of calling methods in bufferview directly.
4506 * src/Painter.C: change some debugging levels.
4508 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4511 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4512 (workAreaKeyPress): new method
4514 2000-08-14 Juergen Vigna <jug@sad.it>
4516 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4518 * config/kde.m4: addes some features
4520 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4521 include missing xforms dialogs.
4523 * src/Timeout.h: a hack to be able to compile with qt/kde.
4525 * sigc++/.cvsignore: added acinclude.m4
4527 * lib/.cvsignore: added listerros
4529 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4530 xforms tree as objects are needed for other frontends.
4532 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4533 linking with not yet implemented xforms objects.
4535 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4537 2000-08-14 Baruch Even <baruch.even@writeme.com>
4539 * src/frontends/xforms/FormGraphics.h:
4540 * src/frontends/xforms/FormGraphics.C:
4541 * src/frontends/xforms/RadioButtonGroup.h:
4542 * src/frontends/xforms/RadioButtonGroup.C:
4543 * src/insets/insetgraphics.h:
4544 * src/insets/insetgraphics.C:
4545 * src/insets/insetgraphicsParams.h:
4546 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4547 instead of spaces, and various other indentation issues to make the
4548 sources more consistent.
4550 2000-08-14 Marko Vendelin <markov@ioc.ee>
4552 * src/frontends/gnome/dialogs/diaprint.glade
4553 * src/frontends/gnome/FormPrint.C
4554 * src/frontends/gnome/FormPrint.h
4555 * src/frontends/gnome/diaprint_callbacks.c
4556 * src/frontends/gnome/diaprint_callbacks.h
4557 * src/frontends/gnome/diaprint_interface.c
4558 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4561 * src/frontends/gnome/dialogs/diainserturl.glade
4562 * src/frontends/gnome/FormUrl.C
4563 * src/frontends/gnome/FormUrl.h
4564 * src/frontends/gnome/diainserturl_callbacks.c
4565 * src/frontends/gnome/diainserturl_callbacks.h
4566 * src/frontends/gnome/diainserturl_interface.c
4567 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4568 Gnome implementation
4570 * src/frontends/gnome/Dialogs.C
4571 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4572 all other dialogs. Copy all unimplemented dialogs from Xforms
4575 * src/frontends/gnome/support.c
4576 * src/frontends/gnome/support.h: support files generated by Glade
4580 * config/gnome.m4: Gnome configuration scripts
4582 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4583 configure --help message
4585 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4586 only if there are no events pendling in Gnome/Gtk. This enhances
4587 the performance of menus.
4590 2000-08-14 Allan Rae <rae@lyx.org>
4592 * lib/Makefile.am: listerrors cleaning
4594 * lib/listerrors: removed -- generated file
4595 * acinclude.m4: ditto
4596 * sigc++/acinclude.m4: ditto
4598 * src/frontends/xforms/forms/form_citation.fd:
4599 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4602 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4603 `updatesrc` and now we have a `test` target that does what `updatesrc`
4604 used to do. I didn't like having an install target that wasn't related
4607 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4608 on all except FormGraphics. This may yet happen. Followed by a major
4609 cleanup including using FL_TRANSIENT for most of the dialogs. More
4610 changes to come when the ButtonController below is introduced.
4612 * src/frontends/xforms/ButtonController.h: New file for managing up to
4613 four buttons on a dialog according to an externally defined policy.
4614 * src/frontends/xforms/Makefile.am: added above
4616 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4617 Apply and Cancel/Close buttons and everything in between and beyond.
4618 * src/frontends/Makefile.am: added above.
4620 * src/frontends/xforms/forms/form_preferences.fd:
4621 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4622 and removed variable 'status' as a result. Fixed the set_minsize thing.
4623 Use the new screen-font-update after checking screen fonts were changed
4624 Added a "Restore" button to restore the original lyxrc values while
4625 editing. This restores everything not just the last input changed.
4626 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4628 * src/LyXAction.C: screen-font-update added for updating buffers after
4629 screen font settings have been changed.
4630 * src/commandtags.h: ditto
4631 * src/lyxfunc.C: ditto
4633 * forms/lyx.fd: removed screen fonts dialog.
4634 * src/lyx_gui.C: ditto
4635 * src/menus.[Ch]: ditto
4636 * src/lyx.[Ch]: ditto
4637 * src/lyx_cb.C: ditto + code from here moved to make
4638 screen-font-update. And people wonder why progress on GUII is
4639 slow. Look at how scattered this stuff was! It takes forever
4642 * forms/fdfix.sh: Fixup the spacing after commas.
4643 * forms/makefile: Remove date from generated files. Fewer clashes now.
4644 * forms/bullet_forms.C.patch: included someones handwritten changes
4646 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4647 once I've discovered why LyXRC was made noncopyable.
4648 * src/lyx_main.C: ditto
4650 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4652 * src/frontends/xforms/forms/fdfix.sh:
4653 * src/frontends/xforms/forms/fdfixh.sed:
4654 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4655 * src/frontends/xforms/Form*.[hC]:
4656 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4657 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4658 provide a destructor for the struct FD_form_xxxx. Another version of
4659 the set_[max|min]size workaround and a few other cleanups. Actually,
4660 Angus' patch from 20000809.
4662 2000-08-13 Baruch Even <baruch.even@writeme.com>
4664 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4667 2000-08-11 Juergen Vigna <jug@sad.it>
4669 * src/insets/insetgraphics.C (InsetGraphics): changing init
4670 order because of warnings.
4672 * src/frontends/xforms/forms/makefile: adding patching .C with
4675 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4676 from .C.patch to .c.patch
4678 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4679 order because of warning.
4681 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4683 * src/frontends/Liason.C (setMinibuffer): new helper function
4685 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4687 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4689 * lib/ui/default.ui: commented out PaperLayout entry
4691 * src/frontends/xforms/form_document.[Ch]: new added files
4693 * src/frontends/xforms/FormDocument.[Ch]: ditto
4695 * src/frontends/xforms/forms/form_document.fd: ditto
4697 * src/frontends/xforms/forms/form_document.C.patch: ditto
4699 2000-08-10 Juergen Vigna <jug@sad.it>
4701 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4702 (InsetGraphics): initialized cacheHandle to 0.
4703 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4705 2000-08-10 Baruch Even <baruch.even@writeme.com>
4707 * src/graphics/GraphicsCache.h:
4708 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4709 correctly as a cache.
4711 * src/graphics/GraphicsCacheItem.h:
4712 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4715 * src/graphics/GraphicsCacheItem_pimpl.h:
4716 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4719 * src/insets/insetgraphics.h:
4720 * src/insets/insetgraphics.C: Changed from using a signal notification
4721 to polling when image is not loaded.
4723 2000-08-10 Allan Rae <rae@lyx.org>
4725 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4726 that there are two functions that have to been taken out of line by
4727 hand and aren't taken care of in the script. (Just a reminder note)
4729 * sigc++/macros/*.h.m4: Updated as above.
4731 2000-08-09 Juergen Vigna <jug@sad.it>
4733 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4735 * src/insets/insettabular.C: make drawing of single cell smarter.
4737 2000-08-09 Marko Vendelin <markov@ioc.ee>
4738 * src/frontends/gnome/Menubar_pimpl.C
4739 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4740 implementation: new files
4742 * src/frontends/gnome/mainapp.C
4743 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4746 * src/main.C: create Gnome main window
4748 * src/frontends/xforms/Menubar_pimpl.h
4749 * src/frontends/Menubar.C
4750 * src/frontends/Menubar.h: added method Menubar::update that calls
4751 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4753 * src/LyXView.C: calls Menubar::update to update the state
4756 * src/frontends/gnome/Makefile.am: added new files
4758 * src/frontends/Makefile.am: added frontend compiler options
4760 2000-08-08 Juergen Vigna <jug@sad.it>
4762 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4764 * src/bufferlist.C (close):
4765 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4766 documents if exiting without saving.
4768 * src/buffer.C (save): use removeAutosaveFile()
4770 * src/support/filetools.C (removeAutosaveFile): new function.
4772 * src/lyx_cb.C (MenuWrite): returns a bool now.
4773 (MenuWriteAs): check if file could really be saved and revert to the
4775 (MenuWriteAs): removing old autosavefile if existant.
4777 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4778 before Goto toggle declaration, because of compiler warning.
4780 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4782 * src/lyxfunc.C (MenuNew): small fix.
4784 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4786 * src/bufferlist.C (newFile):
4787 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4789 * src/lyxrc.C: added new_ask_filename tag
4791 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4793 * src/lyx.fd: removed code pertaining to form_ref
4794 * src/lyx.[Ch]: ditto
4795 * src/lyx_cb.C: ditto
4796 * src/lyx_gui.C: ditto
4797 * src/lyx_gui_misc.C: ditto
4799 * src/BufferView_pimpl.C (restorePosition): update buffer only
4802 * src/commandtags.h (LFUN_REFTOGGLE): removed
4803 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4804 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4805 (LFUN_REFBACK): renamed LFUN_REF_BACK
4807 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4808 * src/menus.C: ditto
4809 * src/lyxfunc.C (Dispatch): ditto.
4810 InsertRef dialog is now GUI-independent.
4812 * src/texrow.C: added using std::endl;
4814 * src/insets/insetref.[Ch]: strip out large amounts of code.
4815 The inset is now a container and this functionality is now
4816 managed by a new FormRef dialog
4818 * src/frontends/Dialogs.h (showRef, createRef): new signals
4820 * src/frontends/xforms/FormIndex.[Ch],
4821 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4822 when setting dialog's min/max size
4823 * src/frontends/xforms/FormIndex.[Ch]: ditto
4825 * src/frontends/xforms/FormRef.[Ch],
4826 src/frontends/xforms/forms/form_ref.fd: new xforms
4827 implementation of an InsetRef dialog
4829 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4832 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4833 ios::nocreate is not part of the standard. Removed.
4835 2000-08-07 Baruch Even <baruch.even@writeme.com>
4837 * src/graphics/Renderer.h:
4838 * src/graphics/Renderer.C: Added base class for rendering of different
4839 image formats into Pixmaps.
4841 * src/graphics/XPM_Renderer.h:
4842 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4843 in a different class.
4845 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4846 easily add support for other formats.
4848 * src/insets/figinset.C: plugged a leak of an X resource.
4850 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4852 * src/CutAndPaste.[Ch]: make all metods static.
4854 * development/Code_rules/Rules: more work, added section on
4855 Exceptions, and a References section.
4857 * a lot of header files: work to make doc++ able to generate the
4858 source documentation, some workarounds of doc++ problems. Doc++ is
4859 now able to generate the documentation.
4861 2000-08-07 Juergen Vigna <jug@sad.it>
4863 * src/insets/insettabular.C (recomputeTextInsets): removed function
4865 * src/tabular.C (SetWidthOfMulticolCell):
4867 (calculate_width_of_column_NMC): fixed return value so that it really
4868 only returns true if the column-width has changed (there where
4869 problems with muliticolumn-cells in this column).
4871 2000-08-04 Juergen Vigna <jug@sad.it>
4873 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4874 also on the scrollstatus of the inset.
4875 (workAreaMotionNotify): ditto.
4877 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4879 2000-08-01 Juergen Vigna <jug@sad.it>
4881 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4883 * src/commandtags.h:
4884 * src/LyXAction.C (init):
4885 * src/insets/inset.C (LocalDispatch): added support for
4888 * src/insets/inset.C (scroll): new functions.
4890 * src/insets/insettext.C (removeNewlines): new function.
4891 (SetAutoBreakRows): removes forced newlines in the text of the
4892 paragraph if autoBreakRows is set to false.
4894 * src/tabular.C (Latex): generates a parbox around the cell contents
4897 * src/frontends/xforms/FormTabular.C (local_update): removed
4898 the radio_useparbox button.
4900 * src/tabular.C (UseParbox): new function
4902 2000-08-06 Baruch Even <baruch.even@writeme.com>
4904 * src/graphics/GraphicsCache.h:
4905 * src/graphics/GraphicsCache.C:
4906 * src/graphics/GraphicsCacheItem.h:
4907 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4910 * src/insets/insetgraphics.h:
4911 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4912 and the drawing of the inline image.
4914 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4915 loaded into the wrong position.
4917 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4920 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4922 * src/support/translator.h: move all typedefs to public section
4924 * src/support/filetools.C (MakeLatexName): return string const
4926 (TmpFileName): ditto
4927 (FileOpenSearch): ditto
4929 (LibFileSearch): ditto
4930 (i18nLibFileSearch): ditto
4933 (CreateTmpDir): ditto
4934 (CreateBufferTmpDir): ditto
4935 (CreateLyXTmpDir): ditto
4938 (MakeAbsPath): ditto
4940 (OnlyFilename): ditto
4942 (NormalizePath): ditto
4943 (CleanupPath): ditto
4944 (GetFileContents): ditto
4945 (ReplaceEnvironmentPath): ditto
4946 (MakeRelPath): ditto
4948 (ChangeExtension): ditto
4949 (MakeDisplayPath): ditto
4950 (do_popen): return cmdret const
4951 (findtexfile): return string const
4953 * src/support/DebugStream.h: add some /// to please doc++
4955 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4957 * src/texrow.C (same_rownumber): functor to use with find_if
4958 (getIdFromRow): rewritten to use find_if and to not update the
4959 positions. return true if row is found
4960 (increasePos): new method, use to update positions
4962 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4964 * src/lyxlex_pimpl.C (verifyTable): new method
4967 (GetString): return string const
4968 (pushTable): rewrite to use std::stack
4970 (setFile): better check
4973 * src/lyxlex.h: make LyXLex noncopyable
4975 * src/lyxlex.C (text): return char const * const
4976 (GetString): return string const
4977 (getLongString): return string const
4979 * src/lyx_gui_misc.C (askForText): return pair<...> const
4981 * src/lastfiles.[Ch] (operator): return string const
4983 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4984 istringstream not char const *.
4985 move token.end() out of loop.
4986 (readFile): move initializaton of token
4988 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4989 getIdFromRow is successful.
4991 * lib/bind/emacs.bind: don't include menus bind
4993 * development/Code_rules/Rules: the beginnings of making this
4994 better and covering more of the unwritten rules that we have.
4996 * development/Code_rules/Recommendations: a couple of wording
4999 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5001 * src/support/strerror.c: remove C++ comment.
5003 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5005 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5006 LFUN_INDEX_INSERT_LAST
5008 * src/texrow.C (getIdFromRow): changed from const_iterator to
5009 iterator, allowing code to compile with DEC cxx
5011 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5012 stores part of the class, as suggested by Allan. Will allow
5014 (apply): test to apply uses InsetCommandParams operator!=
5016 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5017 (apply): test to apply uses InsetCommandParams operator!=
5019 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5020 stores part of the class.
5021 (update): removed limits on min/max size.
5023 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5024 (apply): test to apply uses InsetCommandParams operator!=
5026 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5027 (Read, Write, scanCommand, getCommand): moved functionality
5028 into InsetCommandParams.
5030 (getScreenLabel): made pure virtual
5031 new InsetCommandParams operators== and !=
5033 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5034 c-tors based on InsetCommandParams. Removed others.
5035 * src/insets/insetinclude.[Ch]: ditto
5036 * src/insets/insetlabel.[Ch]: ditto
5037 * src/insets/insetparent.[Ch]: ditto
5038 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5040 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5041 insets derived from InsetCommand created using similar c-tors
5042 based on InsetCommandParams
5043 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5044 * src/menus.C (ShowRefsMenu): ditto
5045 * src/paragraph.C (Clone): ditto
5046 * src/text2.C (SetCounter): ditto
5047 * src/lyxfunc.C (Dispatch) ditto
5048 Also recreated old InsetIndex behaviour exactly. Can now
5049 index-insert at the start of a paragraph and index-insert-last
5050 without launching the pop-up.
5052 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5054 * lib/lyxrc.example: mark te pdf options as non functional.
5056 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5057 (isStrDbl): move tmpstr.end() out of loop.
5058 (strToDbl): move intialization of tmpstr
5059 (lowercase): return string const and move tmp.end() out of loop.
5060 (uppercase): return string const and move tmp.edn() out of loop.
5061 (prefixIs): add assertion
5066 (containsOnly): ditto
5067 (containsOnly): ditto
5068 (containsOnly): ditto
5069 (countChar): make last arg char not char const
5070 (token): return string const
5071 (subst): return string const, move tmp.end() out of loop.
5072 (subst): return string const, add assertion
5073 (strip): return string const
5074 (frontStrip): return string const, add assertion
5075 (frontStrip): return string const
5080 * src/support/lstrings.C: add inclde "LAssert.h"
5081 (isStrInt): move tmpstr.end() out of loop.
5083 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5084 toollist.end() out of loop.
5085 (deactivate): move toollist.end() out of loop.
5086 (update): move toollist.end() out of loop.
5087 (updateLayoutList): move tc.end() out of loop.
5088 (add): move toollist.end() out of loop.
5090 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5091 md.end() out of loop.
5093 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5095 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5098 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5099 (Erase): move insetlist.end() out of loop.
5101 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5102 ref to const string as first arg. Move initialization of some
5103 variables, whitespace changes.
5105 * src/kbmap.C (defkey): move table.end() out of loop.
5106 (kb_keymap): move table.end() out of loop.
5107 (findbinding): move table.end() out of loop.
5109 * src/MenuBackend.C (hasMenu): move end() out of loop.
5110 (getMenu): move end() out of loop.
5111 (getMenu): move menulist_.end() out of loop.
5113 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5115 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5118 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5119 (getFromLyXName): move infotab.end() out of loop.
5121 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5122 -fvtable-thunks -ffunction-sections -fdata-sections
5124 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5126 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5129 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5131 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5133 * src/frontends/xforms/FormCitation.[Ch],
5134 src/frontends/xforms/FormIndex.[Ch],
5135 src/frontends/xforms/FormToc.[Ch],
5136 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5138 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5140 * src/commandtags.h: renamed, created some flags for citation
5143 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5145 * src/lyxfunc.C (dispatch): use signals to insert index entry
5147 * src/frontends/Dialogs.h: new signal createIndex
5149 * src/frontends/xforms/FormCommand.[Ch],
5150 src/frontends/xforms/FormCitation.[Ch],
5151 src/frontends/xforms/FormToc.[Ch],
5152 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5154 * src/insets/insetindex.[Ch]: GUI-independent
5156 * src/frontends/xforms/FormIndex.[Ch],
5157 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5160 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5162 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5163 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5165 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5167 * src/insets/insetref.C (Latex): rewrite so that there is now
5168 question that a initialization is requested.
5170 * src/insets/insetcommand.h: reenable the hide signal
5172 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5174 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5175 fix handling of shortcuts (many bugs :)
5176 (add_lastfiles): ditto.
5178 * lib/ui/default.ui: fix a few shortcuts.
5180 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5182 * Makefile.am: Fix ``rpmdist'' target to return the exit
5183 status of the ``rpm'' command, instead of the last command in
5184 the chain (the ``rm lyx.xpm'' command, which always returns
5187 2000-08-02 Allan Rae <rae@lyx.org>
5189 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5190 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5191 * src/frontends/xforms/FormToc.C (FormToc): ditto
5193 * src/frontends/xforms/Makefile.am: A few forgotten files
5195 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5196 Signals-not-copyable-problem Lars' started commenting out.
5198 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5200 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5202 * src/insets/insetcommand.h: Signals is not copyable so anoter
5203 scheme for automatic hiding of forms must be used.
5205 * src/frontends/xforms/FormCitation.h: don't inerit from
5206 noncopyable, FormCommand already does that.
5207 * src/frontends/xforms/FormToc.h: ditto
5208 * src/frontends/xforms/FormUrl.h: ditto
5210 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5212 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5214 * src/insets/insetcommand.h (hide): new SigC::Signal0
5215 (d-tor) new virtual destructor emits hide signal
5217 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5218 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5220 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5221 LOF and LOT. Inset is now GUI-independent
5223 * src/insets/insetloa.[Ch]: redundant
5224 * src/insets/insetlof.[Ch]: ditto
5225 * src/insets/insetlot.[Ch]: ditto
5227 * src/frontends/xforms/forms/form_url.fd: tweaked!
5228 * src/frontends/xforms/forms/form_citation.fd: ditto
5230 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5231 dialogs dealing with InsetCommand insets
5233 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5234 FormCommand base class
5235 * src/frontends/xforms/FormUrl.[Ch]: ditto
5237 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5239 * src/frontends/xforms/FormToc.[Ch]: ditto
5241 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5242 passed a generic InsetCommand pointer
5243 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5245 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5246 and modified InsetTOC class
5247 * src/buffer.C: ditto
5249 * forms/lyx.fd: strip out old FD_form_toc code
5250 * src/lyx_gui_misc.C: ditto
5251 * src/lyx_gui.C: ditto
5252 * src/lyx_cb.C: ditto
5253 * src/lyx.[Ch]: ditto
5255 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5257 * src/support/utility.hpp: tr -d '\r'
5259 2000-08-01 Juergen Vigna <jug@sad.it>
5261 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5263 * src/commandtags.h:
5264 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5265 LFUN_TABULAR_FEATURES.
5267 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5268 LFUN_LAYOUT_TABULAR.
5270 * src/insets/insettabular.C (getStatus): implemented helper function.
5272 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5274 2000-07-31 Juergen Vigna <jug@sad.it>
5276 * src/text.C (draw): fixed screen update problem for text-insets.
5278 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5279 something changed probably this has to be added in various other
5282 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5284 2000-07-31 Baruch Even <baruch.even@writeme.com>
5286 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5287 templates to satisfy compaq cxx.
5290 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5292 * src/support/translator.h (equal_1st_in_pair::operator()): take
5293 const ref pair_type as arg.
5294 (equal_2nd_in_pair::operator()): ditto
5295 (Translator::~Translator): remove empty d-tor.
5297 * src/graphics/GraphicsCache.C: move include config.h to top, also
5298 put initialization of GraphicsCache::singleton here.
5299 (~GraphicsCache): move here
5300 (addFile): take const ref as arg
5303 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5305 * src/BufferView2.C (insertLyXFile): change te with/without header
5308 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5310 * src/frontends/xforms/FormGraphics.C (apply): add some
5311 static_cast. Not very nice, but required by compaq cxx.
5313 * src/frontends/xforms/RadioButtonGroup.h: include header
5314 <utility> instead of <pair.h>
5316 * src/insets/insetgraphicsParams.C: add using directive.
5317 (readResize): change return type to void.
5318 (readOrigin): ditto.
5320 * src/lyxfunc.C (getStatus): add missing break for build-program
5321 function; add test for Literate for export functions.
5323 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5324 entries in Options menu.
5326 2000-07-31 Baruch Even <baruch.even@writeme.com>
5328 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5329 protect against auto-allocation; release icon when needed.
5331 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5333 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5334 on usual typewriter.
5336 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5337 earlier czech.kmap), useful only for programming.
5339 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5341 * src/frontends/xforms/FormCitation.h: fix conditioning around
5344 2000-07-31 Juergen Vigna <jug@sad.it>
5346 * src/frontends/xforms/FormTabular.C (local_update): changed
5347 radio_linebreaks to radio_useparbox and added radio_useminipage.
5349 * src/tabular.C: made support for using minipages/parboxes.
5351 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5353 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5355 (descent): so the cursor is in the middle.
5356 (width): bit smaller box.
5358 * src/insets/insetgraphics.h: added display() function.
5360 2000-07-31 Baruch Even <baruch.even@writeme.com>
5362 * src/frontends/Dialogs.h: Added showGraphics signals.
5364 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5365 xforms form definition of the graphics dialog.
5367 * src/frontends/xforms/FormGraphics.h:
5368 * src/frontends/xforms/FormGraphics.C: Added files, the
5369 GUIndependent code of InsetGraphics
5371 * src/insets/insetgraphics.h:
5372 * src/insets/insetgraphics.C: Major writing to make it work.
5374 * src/insets/insetgraphicsParams.h:
5375 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5376 struct between InsetGraphics and GUI.
5378 * src/LaTeXFeatures.h:
5379 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5380 support for graphicx package.
5382 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5383 for the graphics inset.
5385 * src/support/translator.h: Added file, used in
5386 InsetGraphicsParams. this is a template to translate between two
5389 * src/frontends/xforms/RadioButtonGroup.h:
5390 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5391 way to easily control a radio button group.
5393 2000-07-28 Juergen Vigna <jug@sad.it>
5395 * src/insets/insettabular.C (LocalDispatch):
5396 (TabularFeatures): added support for lyx-functions of tabular features.
5397 (cellstart): refixed this function after someone wrongly changed it.
5399 * src/commandtags.h:
5400 * src/LyXAction.C (init): added support for tabular-features
5402 2000-07-28 Allan Rae <rae@lyx.org>
5404 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5405 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5406 triggers the callback for input checking. As a result we sometimes get
5407 "LyX: This shouldn't happen..." printed to cerr.
5408 (input): Started using status variable since I only free() on
5409 destruction. Some input checking for paths and font sizes.
5411 * src/frontends/xforms/FormPreferences.h: Use status to control
5412 activation of Ok and Apply
5414 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5415 callback. Also resized to stop segfaults with 0.88. The problem is
5416 that xforms-0.88 requires the folder to be wide enough to fit all the
5417 tabs. If it isn't it causes all sorts of problems.
5419 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5421 * src/frontends/xforms/forms/README: Reflect reality.
5423 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5424 * src/frontends/xforms/forms/makefile: ditto.
5426 * src/commandtags.h: Get access to new Preferences dialog
5427 * src/LyXAction.C: ditto
5428 * src/lyxfunc.C: ditto
5429 * lib/ui/default.ui: ditto
5431 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5433 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5435 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5438 * src/frontends/xforms/form_url.[Ch]: added.
5440 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5442 * src/insets/insetbib.h: fixed bug in previous commit
5444 * src/frontends/xforms/FormUrl.h: ditto
5446 * src/frontends/xforms/FormPrint.h: ditto
5448 * src/frontends/xforms/FormPreferences.h: ditto
5450 * src/frontends/xforms/FormCopyright.h: ditto
5452 * src/frontends/xforms/FormCitation.C: ditto
5454 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5455 private copyconstructor and private default contructor
5457 * src/support/Makefile.am: add utility.hpp
5459 * src/support/utility.hpp: new file from boost
5461 * src/insets/insetbib.h: set owner in clone
5463 * src/frontends/xforms/FormCitation.C: added missing include
5466 * src/insets/form_url.[Ch]: removed
5468 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5470 * development/lyx.spec.in
5471 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5472 file/directory re-organization.
5474 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5476 * src/insets/insetcommand.[Ch]: moved the string data and
5477 associated manipulation methods into a new stand-alone class
5478 InsetCommandParams. This class has two additional methods
5479 getAsString() and setFromString() allowing the contents to be
5480 moved around as a single string.
5481 (addContents) method removed.
5482 (setContents) method no longer virtual.
5484 * src/buffer.C (readInset): made use of new InsetCitation,
5485 InsetUrl constructors based on InsetCommandParams.
5487 * src/commandtags.h: add LFUN_INSERT_URL
5489 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5490 independent InsetUrl and use InsetCommandParams to extract
5491 string info and create new Insets.
5493 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5495 * src/frontends/xforms/FormCitation.C (apply): uses
5498 * src/frontends/xforms/form_url.C
5499 * src/frontends/xforms/form_url.h
5500 * src/frontends/xforms/FormUrl.h
5501 * src/frontends/xforms/FormUrl.C
5502 * src/frontends/xforms/forms/form_url.fd: new files
5504 * src/insets/insetcite.[Ch]: removed unused constructors.
5506 * src/insets/insetinclude.[Ch]: no longer store filename
5508 * src/insets/inseturl.[Ch]: GUI-independent.
5510 2000-07-26 Juergen Vigna <jug@sad.it>
5511 * renamed frontend from gtk to gnome as it is that what is realized
5512 and did the necessary changes in the files.
5514 2000-07-26 Marko Vendelin <markov@ioc.ee>
5516 * configure.in: cleaning up gnome configuration scripts
5518 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5520 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5521 shortcuts syndrom by redrawing them explicitely (a better solution
5522 would be appreciated).
5524 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5526 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5529 * src/lyx_cb.C (MenuExport): change html export to do the right
5530 thing depending of the document type (instead of having
5531 html-linuxdoc and html-docbook).
5532 * src/lyxfunc.C (getStatus): update for html
5533 * lib/ui/default.ui: simplify due to the above change.
5534 * src/menus.C (ShowFileMenu): update too (in case we need it).
5536 * src/MenuBackend.C (read): if a menu is defined twice, add the
5537 new entries to the exiting one.
5539 2000-07-26 Juergen Vigna <jug@sad.it>
5541 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5543 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5544 and return a bool if it did actual save the file.
5545 (AutoSave): don't autosave a unnamed doc.
5547 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5548 check if this is an UNNAMED new file and react to it.
5549 (newFile): set buffer to unnamed and change to not mark a new
5550 buffer dirty if I didn't do anything with it.
5552 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5554 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5556 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5557 friend as per Angus's patch posted to lyx-devel.
5559 * src/ext_l10n.h: updated
5561 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5562 gettext on the style string right before inserting them into the
5565 * autogen.sh: add code to extract style strings form layout files,
5566 not good enough yet.
5568 * src/frontends/gtk/.cvsignore: add MAKEFILE
5570 * src/MenuBackend.C (read): run the label strings through gettext
5571 before storing them in the containers.
5573 * src/ext_l10n.h: new file
5575 * autogen.sh : generate the ext_l10n.h file here
5577 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5579 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5582 * lib/ui/default.ui: fix a couple of typos.
5584 * config/gnome/gtk.m4: added (and added to the list of files in
5587 * src/insets/insetinclude.C (unique_id): fix when we are using
5588 lyxstring instead of basic_string<>.
5589 * src/insets/insettext.C (LocalDispatch): ditto.
5590 * src/support/filetools.C: ditto.
5592 * lib/configure.m4: create the ui/ directory if necessary.
5594 * src/LyXView.[Ch] (updateToolbar): new method.
5596 * src/BufferView_pimpl.C (buffer): update the toolbar when
5597 opening/closing buffer.
5599 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5601 * src/LyXAction.C (getActionName): enhance to return also the name
5602 and options of pseudo-actions.
5603 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5605 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5606 as an example of what is possible). Used in File->Build too (more
5607 useful) and in the import/export menus (to mimick the complicated
5608 handling of linuxdoc and friends). Try to update all the entries.
5610 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5613 * src/MenuBackend.C (read): Parse the new OptItem tag.
5615 * src/MenuBackend.h: Add a new optional_ data member (used if the
5616 entry should be omitted when the lyxfunc is disabled).
5618 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5619 function, used as a shortcut.
5620 (create_submenu): align correctly the shortcuts on the widest
5623 * src/MenuBackend.h: MenuItem.label() only returns the label of
5624 the menu without shortcut; new method shortcut().
5626 2000-07-14 Marko Vendelin <markov@ioc.ee>
5628 * src/frontends/gtk/Dialogs.C:
5629 * src/frontends/gtk/FormCopyright.C:
5630 * src/frontends/gtk/FormCopyright.h:
5631 * src/frontends/gtk/Makefile.am: added these source-files for the
5632 Gtk/Gnome support of the Copyright-Dialog.
5634 * src/main.C: added Gnome::Main initialization if using
5635 Gtk/Gnome frontend-GUI.
5637 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5639 * config/gnome/aclocal-include.m4
5640 * config/gnome/compiler-flags.m4
5641 * config/gnome/curses.m4
5642 * config/gnome/gnome--.m4
5643 * config/gnome/gnome-bonobo-check.m4
5644 * config/gnome/gnome-common.m4
5645 * config/gnome/gnome-fileutils.m4
5646 * config/gnome/gnome-ghttp-check.m4
5647 * config/gnome/gnome-gnorba-check.m4
5648 * config/gnome/gnome-guile-checks.m4
5649 * config/gnome/gnome-libgtop-check.m4
5650 * config/gnome/gnome-objc-checks.m4
5651 * config/gnome/gnome-orbit-check.m4
5652 * config/gnome/gnome-print-check.m4
5653 * config/gnome/gnome-pthread-check.m4
5654 * config/gnome/gnome-support.m4
5655 * config/gnome/gnome-undelfs.m4
5656 * config/gnome/gnome-vfs.m4
5657 * config/gnome/gnome-x-checks.m4
5658 * config/gnome/gnome-xml-check.m4
5659 * config/gnome/gnome.m4
5660 * config/gnome/gperf-check.m4
5661 * config/gnome/gtk--.m4
5662 * config/gnome/linger.m4
5663 * config/gnome/need-declaration.m4: added configuration scripts
5664 for Gtk/Gnome frontend-GUI
5666 * configure.in: added support for the --with-frontend=gtk option
5668 * autogen.sh: added config/gnome/* to list of config-files
5670 * acconfig.h: added define for GTKGUI-support
5672 * config/lyxinclude.m4: added --with-frontend[=value] option value
5673 for Gtk/Gnome frontend-GUI support.
5675 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5677 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5681 * src/paragraph.C (GetChar): remove non-const version
5683 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5684 (search_kw): use it.
5686 * src/lyx_main.C (init): if "preferences" exist, read that instead
5688 (ReadRcFile): return bool if the file could be read ok.
5689 (ReadUIFile): add a check to see if lex file is set ok.
5691 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5692 bastring can be used instead of lyxstring (still uses the old code
5693 if std::string is good enough or if lyxstring is used.)
5695 * src/encoding.C: make the arrays static, move ininle functions
5697 * src/encoding.h: from here.
5699 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5700 (parseSingleLyXformat2Token): move inset parsing to separate method
5701 (readInset): new private method
5703 * src/Variables.h: remove virtual from get().
5705 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5706 access to NEW_INSETS and NEW_TABULAR
5708 * src/MenuBackend.h: remove superfluous forward declaration of
5709 MenuItem. Add documentations tags "///", remove empty MenuItem
5710 destructor, remove private default contructor.
5712 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5714 (read): more string mlabel and mname to where they are used
5715 (read): remove unused variables mlabel and mname
5716 (defaults): unconditional clear, make menusetup take advantage of
5717 add returning Menu &.
5719 * src/LyXView.h: define NEW_MENUBAR as default
5721 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5722 to NEW_INSETS and NEW_TABULAR.
5723 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5724 defined. Change some of the "xxxx-inset-insert" functions names to
5727 * several files: more enahncements to NEW_INSETS and the resulting
5730 * lib/lyxrc.example (\date_insert_format): move to misc section
5732 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5733 bastring and use AC_CACHE_CHECK.
5734 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5735 the system have the newest methods. uses AC_CACHE_CHECK
5736 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5737 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5738 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5740 * configure.in: add LYX_CXX_GOOD_STD_STRING
5742 * acinclude.m4: recreated
5744 2000-07-24 Amir Karger <karger@lyx.org>
5746 * README: add Hebrew, Arabic kmaps
5749 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5751 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5754 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5756 * Lot of files: add pragma interface/implementation.
5758 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5760 * lib/ui/default.ui: new file (ans new directory). Contains the
5761 default menu and toolbar.
5763 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5764 global space. Toolbars are now read (as menus) in ui files.
5766 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5768 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5769 is disabled because the document is read-only. We want to have the
5770 toggle state of the function anyway.
5771 (getStatus): add code for LFUN_VC* functions (mimicking what is
5772 done in old-style menus)
5774 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5775 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5777 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5778 * src/BufferView_pimpl.C: ditto.
5779 * src/lyxfunc.C: ditto.
5781 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5782 default). This replaces old-style menus by new ones.
5784 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5785 MenuItem. Contain the data structure of a menu.
5787 * src/insets/insettext.C: use LyXView::setLayout instead of
5788 accessing directly the toolbar combox.
5789 * src/lyxfunc.C (Dispatch): ditto.
5791 * src/LyXView.C (setLayout): new method, which just calls
5792 Toolbar::setLayout().
5793 (updateLayoutChoice): move part of this method in Toolbar.
5795 * src/toolbar.[Ch]: removed.
5797 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5798 implementation the toolbar.
5800 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5801 the toolbar. It might make sense to merge it with ToolbarDefaults
5803 (setLayout): new function.
5804 (updateLayoutList): ditto.
5805 (openLayoutList): ditto.
5807 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5808 xforms implementation of the toolbar.
5809 (get_toolbar_func): comment out, since I do not
5810 know what it is good for.
5812 * src/ToolbarDefaults.h: Add the ItemType enum.
5814 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5815 for a list of allocated C strings. Used in Menubar xforms
5816 implementation to avoid memory leaks.
5818 * src/support/lstrings.[Ch] (uppercase): new version taking and
5822 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5823 * lib/bind/emacs.bind: ditto.
5825 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5827 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5828 forward decl of LyXView.
5830 * src/toolbar.C (toolbarItem): moved from toolbar.h
5831 (toolbarItem::clean): ditto
5832 (toolbarItem::~toolbarItem): ditto
5833 (toolbarItem::operator): ditto
5835 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5837 * src/paragraph.h: control the NEW_TABULAR define from here
5839 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5840 USE_TABULAR_INSETS to NEW_TABULAR
5842 * src/ToolbarDefaults.C: add include "lyxlex.h"
5844 * files using the old table/tabular: use NEW_TABULAR to control
5845 compilation of old tabular stuff.
5847 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5850 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5851 planemet in reading of old style floats, fix the \end_deeper
5852 problem when reading old style floats.
5854 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5856 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5858 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5860 * lib/bind/sciword.bind: updated.
5862 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5864 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5865 layout write problem
5867 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5869 * src/Makefile.am (INCLUDES): remove image directory from include
5872 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5873 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5875 * src/LyXView.C (create_form_form_main): read the application icon
5878 * lib/images/*.xpm: change the icons to use transparent color for
5881 * src/toolbar.C (update): change the color of the button when it
5884 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5886 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5887 setting explicitely the minibuffer.
5888 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5890 * src/LyXView.C (showState): new function. Shows font information
5891 in minibuffer and update toolbar state.
5892 (LyXView): call Toolbar::update after creating the
5895 * src/toolbar.C: change toollist to be a vector instead of a
5897 (BubbleTimerCB): get help string directly from the callback
5898 argument of the corresponding icon (which is the action)
5899 (set): remove unnecessary ugliness.
5900 (update): new function. update the icons (depressed, disabled)
5901 depending of the status of the corresponding action.
5903 * src/toolbar.h: remove help in toolbarItem
5905 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5907 * src/Painter.C (text): Added code for using symbol glyphs from
5908 iso10646 fonts. Currently diabled.
5910 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5913 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5914 magyar,turkish and usorbian.
5916 * src/paragraph.C (isMultiLingual): Made more efficient.
5918 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5921 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5922 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5923 Also changed the prototype to "bool math_insert_greek(char)".
5925 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5927 * lots of files: apply the NEW_INSETS on all code that will not be
5928 needed when we move to use the new insets. Enable the define in
5929 lyxparagrah.h to try it.
5931 * src/insets/insettabular.C (cellstart): change to be a static
5933 (InsetTabular): initialize buffer in the initializer list.
5935 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5937 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5938 form_print.h out of the header file. Replaced with forward
5939 declarations of the relevant struct.
5941 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5944 * src/commandtags.h: do not include "debug.h" which does not
5945 belong there. #include it in some other places because of this
5948 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5950 * src/insets/insetcaption.C: add a couple "using" directives.
5952 * src/toolbar.C (add): get the help text directly from lyxaction.
5954 (setPixmap): new function. Loads from disk and sets a pixmap on a
5955 botton; the name of the pixmap file is derived from the command
5958 * src/toolbar.h: remove members isBitmap and pixmap from
5961 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5962 * lib/images/: move many files from images/banner.xpm.
5964 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5966 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5967 * src/toolbar.C: ditto.
5968 * configure.in: ditto.
5969 * INSTALL: document.
5971 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5972 the spellchecker popup is closed from the WM.
5974 2000-07-19 Juergen Vigna <jug@sad.it>
5976 * src/insets/insetfloat.C (Write): small fix because we use the
5977 insetname for the type now!
5979 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5981 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5984 * src/frontends/Dialogs.h: removed hideCitation signal
5986 * src/insets/insetcite.h: added hide signal
5988 * src/insets/insetcite.C (~InsetCitation): emits new signal
5989 (getScreenLabel): "intelligent" label should now fit on the screen!
5991 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5993 * src/frontends/xforms/FormCitation.C (showInset): connects
5994 hide() to the inset's hide signal
5995 (show): modified to use fl_set_object_position rather than
5996 fl_set_object_geometry wherever possible
5998 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6000 * src/insets/lyxinset.h: add caption code
6002 * src/insets/insetfloat.C (type): new method
6004 * src/insets/insetcaption.C (Write): new method
6006 (LyxCode): new method
6008 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6009 to get it right together with using the FloatList.
6011 * src/commandtags.h: add LFUN_INSET_CAPTION
6012 * src/lyxfunc.C (Dispatch): handle it
6014 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6017 * src/Variables.[Ch]: make expand take a const reference, remove
6018 the destructor, some whitespace changes.
6020 * src/LyXAction.C (init): add caption-inset-insert
6022 * src/FloatList.C (FloatList): update the default floats a bit.
6024 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6026 * src/Variables.[Ch]: new files. Intended to be used for language
6027 specific strings (like \chaptername) and filename substitution in
6030 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6032 * lib/kbd/american.kmap: update
6034 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6036 * src/bufferparams.[Ch]: remove member allowAccents.
6038 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6040 * src/LaTeXLog.C: use the log_form.h header.
6041 * src/lyx_gui.C: ditto.
6042 * src/lyx_gui_misc.C: ditto.
6043 * src/lyxvc.h: ditto.
6045 * forms/log_form.fd: new file, created from latexoptions.fd. I
6046 kept the log popup and nuked the options form.
6048 * src/{la,}texoptions.[Ch]: removed.
6049 * src/lyx_cb.C (LaTeXOptions): ditto
6051 * src/lyx_gui.C (create_forms): do not handle the
6052 fd_latex_options form.
6054 2000-07-18 Juergen Vigna <jug@sad.it>
6056 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6057 name of the inset so that it can be requested outside (text2.C).
6059 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6062 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6064 * src/mathed/formula.h (ConvertFont): constify
6066 * src/mathed/formula.C (Read): add warning if \end_inset is not
6067 found on expected place.
6069 * src/insets/lyxinset.h (ConvertFont): consify
6071 * src/insets/insetquotes.C (ConvertFont): constify
6072 * src/insets/insetquotes.h: ditto
6074 * src/insets/insetinfo.h: add labelfont
6076 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6077 (ascent): use labelfont
6081 (Write): make .lyx file a bit nicer
6083 * src/insets/insetfloat.C (Write): simplify somewhat...
6084 (Read): add warning if arg is not found
6086 * src/insets/insetcollapsable.C: add using std::max
6087 (Read): move string token and add warning in arg is not found
6088 (draw): use std::max to get the right ty
6089 (getMaxWidth): simplify by using std::max
6091 * src/insets/insetsection.h: new file
6092 * src/insets/insetsection.C: new file
6093 * src/insets/insetcaption.h: new file
6094 * src/insets/insetcaption.C: new file
6096 * src/insets/inset.C (ConvertFont): constify signature
6098 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6099 insetcaption.[Ch] and insetsection.[Ch]
6101 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6102 uses to use LABEL_COUNTER_CHAPTER instead.
6103 * src/text2.C (SetCounter): here
6105 * src/counters.h: new file
6106 * src/counters.C: new file
6107 * src/Sectioning.h: new file
6108 * src/Sectioning.C: new file
6110 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6112 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6114 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6117 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6120 2000-07-17 Juergen Vigna <jug@sad.it>
6122 * src/tabular.C (Validate): check if array-package is needed.
6123 (SetVAlignment): added support for vertical alignment.
6124 (SetLTFoot): better support for longtable header/footers
6125 (Latex): modified to support added features.
6127 * src/LaTeXFeatures.[Ch]: added array-package.
6129 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6131 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6134 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6136 * configure.in: do not forget to put a space after -isystem.
6138 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6140 * lib/kbd/arabic.kmap: a few fixes.
6142 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6144 * some whitespace chagnes to a number of files.
6146 * src/support/DebugStream.h: change to make it easier for
6147 doc++ to parse correctly.
6148 * src/support/lyxstring.h: ditto
6150 * src/mathed/math_utils.C (compara): change to have only one
6152 (MathedLookupBOP): change because of the above.
6154 * src/mathed/math_delim.C (math_deco_compare): change to have only
6156 (search_deco): change becasue of the above.
6158 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6159 instead of manually coded one.
6161 * src/insets/insetquotes.C (Read): read the \end_inset too
6163 * src/insets/insetlatex.h: remove file
6164 * src/insets/insetlatex.C: remove file
6166 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6168 (InsetPrintIndex): remove destructor
6170 * src/insets/insetinclude.h: remove default constructor
6172 * src/insets/insetfloat.C: work to make it work better
6174 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6176 * src/insets/insetcite.h (InsetCitation): remove default constructor
6178 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6180 * src/text.C (GetColumnNearX): comment out some currently unused code.
6182 * src/paragraph.C (writeFile): move some initializations closer to
6184 (CutIntoMinibuffer): small change to use new matchIT operator
6188 (InsertInset): ditto
6191 (InsetIterator): ditto
6192 (Erase): small change to use new matchFT operator
6194 (GetFontSettings): ditto
6195 (HighestFontInRange): ditto
6198 * src/lyxparagraph.h: some chars changed to value_type
6199 (matchIT): because of some stronger checking (perhaps too strong)
6200 in SGI STL, the two operator() unified to one.
6203 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6205 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6206 the last inset read added
6207 (parseSingleLyXformat2Token): some more (future) compability code added
6208 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6209 (parseSingleLyXformat2Token): set last_inset_read
6210 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6211 (parseSingleLyXformat2Token): don't double intializw string next_token
6213 * src/TextCache.C (text_fits::operator()): add const's to the signature
6214 (has_buffer::operator()): ditto
6216 * src/Floating.h: add some comments on the class
6218 * src/FloatList.[Ch] (typeExist): new method
6221 * src/BackStack.h: added default constructor, wanted by Gcc.
6223 2000-07-14 Juergen Vigna <jug@sad.it>
6225 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6227 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6229 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6230 do a redraw when the window is resized!
6231 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6233 * src/insets/insettext.C (resizeLyXText): added function to correctly
6234 being able to resize the LyXWindow.
6236 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6238 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6240 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6241 crashes when closing dialog to a deleted inset.
6243 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6244 method! Now similar to other insets.
6246 2000-07-13 Juergen Vigna <jug@sad.it>
6248 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6250 * lib/examples/Literate.lyx: small patch!
6252 * src/insets/insetbib.C (Read): added this function because of wrong
6253 Write (without [begin|end]_inset).
6255 2000-07-11 Juergen Vigna <jug@sad.it>
6257 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6258 as the insertInset could not be good!
6260 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6261 the bool param should not be last.
6263 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6265 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6266 did submit that to Karl).
6268 * configure.in: use -isystem instead of -I for X headers. This
6269 fixes a problem on solaris with a recent gcc;
6270 put the front-end code after the X detection code;
6271 configure in sigc++ before lib/
6273 * src/lyx_main.C (commandLineHelp): remove -display from command
6276 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6278 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6279 Also put in Makefile rules for building the ``listerrors''
6280 program for parsing errors from literate programs written in LyX.
6282 * lib/build-listerrors: Added small shell script as part of compile
6283 process. This builds a working ``listerrors'' binary if noweb is
6284 installed and either 1) the VNC X server is installed on the machine,
6285 or 2) the user is compiling from within a GUI. The existence of a GUI
6286 is necessary to use the ``lyx --export'' feature for now. This
6287 hack can be removed once ``lyx --export'' no longer requires a GUI to
6290 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6292 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6293 now passed back correctly from gcc and placed "under" error
6294 buttons in a Literate LyX source.
6296 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6298 * src/text.C (GetColumnNearX): Better behavior when a RTL
6299 paragraph is ended by LTR text.
6301 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6304 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6306 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6307 true when clipboard is empty.
6309 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6311 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6312 row of the paragraph.
6313 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6314 to prevent calculation of bidi tables
6316 2000-07-07 Juergen Vigna <jug@sad.it>
6318 * src/screen.C (ToggleSelection): added y_offset and x_offset
6321 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6324 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6326 * src/insets/insettext.C: fixed Layout-Display!
6328 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6330 * configure.in: add check for strings.h header.
6332 * src/spellchecker.C: include <strings.h> in order to have a
6333 definition for bzero().
6335 2000-07-07 Juergen Vigna <jug@sad.it>
6337 * src/insets/insettext.C (draw): set the status of the bv->text to
6338 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6340 * src/screen.C (DrawOneRow):
6341 (DrawFromTo): redraw the actual row if something has changed in it
6344 * src/text.C (draw): call an update of the toplevel-inset if something
6345 has changed inside while drawing.
6347 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6349 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6351 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6352 processing inside class.
6354 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6355 processing inside class.
6357 * src/insets/insetindex.h new struct Holder, consistent with other
6360 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6361 citation dialog from main code and placed it in src/frontends/xforms.
6362 Dialog launched through signals instead of callbacks
6364 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6366 * lyx.man: update the options description.
6368 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6370 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6371 handle neg values, set min width to 590, add doc about -display
6373 2000-07-05 Juergen Vigna <jug@sad.it>
6375 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6376 calls to BufferView *.
6378 * src/insets/insettext.C (checkAndActivateInset): small fix non
6379 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6381 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6382 their \end_inset token!
6384 2000-07-04 edscott <edscott@imp.mx>
6386 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6387 lib/lyxrc.example: added option \wheel_jump
6389 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6391 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6392 remove support for -width,-height,-xpos and -ypos.
6394 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6396 * src/encoding.[Ch]: New files.
6398 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6399 (text): Call to the underline() method only when needed.
6401 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6403 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6404 encoding(s) for the document.
6406 * src/bufferparams.C (BufferParams): Changed default value of
6409 * src/language.C (newLang): Removed.
6410 (items[]): Added encoding information for all defined languages.
6412 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6413 encoding choice button.
6415 * src/lyxrc.h (font_norm_type): New member variable.
6416 (set_font_norm_type): New method.
6418 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6419 paragraphs with different encodings.
6421 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6422 (TransformChar): Changed to work correctly with Arabic points.
6423 (draw): Added support for drawing Arabic points.
6424 (draw): Removed code for drawing underbars (this is done by
6427 * src/support/textutils.h (IsPrintableNonspace): New function.
6429 * src/BufferView_pimpl.h: Added "using SigC::Object".
6430 * src/LyXView.h: ditto.
6432 * src/insets/insetinclude.h (include_label): Changed to mutable.
6434 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6436 * src/mathed/math_iter.h: remove empty destructor
6438 * src/mathed/math_cursor.h: remove empty destructor
6440 * src/insets/lyxinset.h: add THEOREM_CODE
6442 * src/insets/insettheorem.[Ch]: new files
6444 * src/insets/insetminipage.C: (InsertInset): remove
6446 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6448 (InsertInset): remove
6450 * src/insets/insetlist.C: (InsertList): remove
6452 * src/insets/insetfootlike.[Ch]: new files
6454 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6457 (InsertInset): ditto
6459 * src/insets/insetert.C: remove include Painter.h, reindent
6460 (InsertInset): move to header
6462 * src/insets/insetcollapsable.h: remove explicit from default
6463 contructor, remove empty destructor, add InsertInset
6465 * src/insets/insetcollapsable.C (InsertInset): new func
6467 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6469 * src/vspace.h: add explicit to constructor
6471 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6472 \textcompwordmark, please test this.
6474 * src/lyxrc.C: set ascii_linelen to 65 by default
6476 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6478 * src/commandtags.h: add LFUN_INSET_THEOREM
6480 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6481 (makeLinuxDocFile): remove _some_ of the nice logic
6482 (makeDocBookFile): ditto
6484 * src/Painter.[Ch]: (~Painter): removed
6486 * src/LyXAction.C (init): entry for insettheorem added
6488 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6490 (deplog): code to detect files generated by LaTeX, needs testing
6493 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6495 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6497 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6499 * src/LaTeX.C (deplog): Add a check for files that are going to be
6500 created by the first latex run, part of the project to remove the
6503 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6504 contents to the extension list.
6506 2000-07-04 Juergen Vigna <jug@sad.it>
6508 * src/text.C (NextBreakPoint): added support for needFullRow()
6510 * src/insets/lyxinset.h: added needFullRow()
6512 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6515 * src/insets/insettext.C: lots of changes for update!
6517 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6519 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6521 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6523 * src/insets/insetinclude.C (InsetInclude): fixed
6524 initialization of include_label.
6525 (unique_id): now returns a string.
6527 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6529 * src/LaTeXFeatures.h: new member IncludedFiles, for
6530 a map of key, included file name.
6532 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6533 with the included files for inclusion in SGML preamble,
6534 i. e., linuxdoc and docbook.
6537 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6538 nice (is the generated linuxdoc code to be exported?), that
6539 allows to remove column, and only_body that will be true for
6540 slave documents. Insets are allowed inside SGML font type.
6541 New handling of the SGML preamble for included files.
6542 (makeDocBookFile): the same for docbook.
6544 * src/insets/insetinclude.h:
6545 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6547 (DocBook): new export methods.
6549 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6550 and makeDocBookFile.
6552 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6553 formats to export with command line argument -x.
6555 2000-06-29 Juergen Vigna <jug@sad.it>
6557 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6558 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6560 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6561 region could already been cleared by an inset!
6563 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6565 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6568 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6570 (cursorToggle): remove special handling of lyx focus.
6572 2000-06-28 Juergen Vigna <jug@sad.it>
6574 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6577 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6579 * src/insets/insetindex.C (Edit): add a callback when popup is
6582 * src/insets/insettext.C (LocalDispatch):
6583 * src/insets/insetmarginal.h:
6584 * src/insets/insetlist.h:
6585 * src/insets/insetfoot.h:
6586 * src/insets/insetfloat.h:
6587 * src/insets/insetert.h: add a missing std:: qualifier.
6589 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6591 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6594 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6596 * src/insets/insettext.C (Read): remove tmptok unused variable
6597 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6598 (InsertInset): change for new InsetInset code
6600 * src/insets/insettext.h: add TEXT inline method
6602 * src/insets/insettext.C: remove TEXT macro
6604 * src/insets/insetmarginal.C (Write): new method
6605 (Latex): change output slightly
6607 * src/insets/insetfoot.C (Write): new method
6608 (Latex): change output slightly (don't use endl when no need)
6610 * src/insets/insetert.C (Write): new method
6612 * src/insets/insetcollapsable.h: make button_length, button_top_y
6613 and button_bottm_y protected.
6615 * src/insets/insetcollapsable.C (Write): simplify code by using
6616 tostr. Also do not output the float name, the children class
6617 should to that to get control over own arguments
6619 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6620 src/insets/insetminipage.[Ch]:
6623 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6625 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6627 * src/Makefile.am (lyx_SOURCES): add the new files
6629 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6630 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6631 * src/commandtags.h: ditto
6633 * src/LaTeXFeatures.h: add a std::set of used floattypes
6635 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6637 * src/FloatList.[Ch] src/Floating.h: new files
6639 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6641 * src/lyx_cb.C (TableApplyCB): ditto
6643 * src/text2.C: ditto
6644 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6645 (parseSingleLyXformat2Token): ditto + add code for
6646 backwards compability for old float styles + add code for new insets
6648 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6650 (InsertInset(size_type, Inset *, LyXFont)): new method
6651 (InsetChar(size_type, char)): changed to use the other InsetChar
6652 with a LyXFont(ALL_INHERIT).
6653 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6654 insert the META_INSET.
6656 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6658 * sigc++/thread.h (Threads): from here
6660 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6661 definition out of line
6662 * sigc++/scope.h: from here
6664 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6666 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6667 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6669 * Makefile.am (bindist): new target.
6671 * INSTALL: add instructions for doing a binary distribution.
6673 * development/tools/README.bin.example: update a bit.
6675 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6678 * lib/lyxrc.example: new lyxrc tag \set_color.
6680 * src/lyxfunc.C (Dispatch):
6681 * src/commandtags.h:
6682 * src/LyXAction.C: new lyxfunc "set-color".
6684 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6685 and an x11name given as strings.
6687 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6688 cache when a color is changed.
6690 2000-06-26 Juergen Vigna <jug@sad.it>
6692 * src/lyxrow.C (width): added this functions and variable.
6694 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6697 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6699 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6701 * images/undo_bw.xpm: new icon.
6702 * images/redo_bw.xpm: ditto.
6704 * configure.in (INSTALL_SCRIPT): change value to
6705 ${INSTALL} to avoid failures of install-script target.
6706 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6708 * src/BufferView.h: add a magic "friend" declaration to please
6711 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6713 * forms/cite.fd: modified to allow resizing without messing
6716 * src/insetcite.C: Uses code from cite.fd almost without
6718 User can now resize dialog in the x-direction.
6719 Resizing the dialog in the y-direction is prevented, as the
6720 code does this intelligently already.
6722 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6724 * INSTALL: remove obsolete entry in "problems" section.
6726 * lib/examples/sl_*.lyx: update of the slovenian examples.
6728 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6730 2000-06-23 Juergen Vigna <jug@sad.it>
6732 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6734 * src/buffer.C (resize): delete the LyXText of textinsets.
6736 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6738 * src/insets/lyxinset.h: added another parameter 'cleared' to
6739 the draw() function.
6741 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6742 unlocking inset in inset.
6744 2000-06-22 Juergen Vigna <jug@sad.it>
6746 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6747 of insets and moved first to LyXText.
6749 * src/mathed/formulamacro.[Ch]:
6750 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6752 2000-06-21 Juergen Vigna <jug@sad.it>
6754 * src/text.C (GetVisibleRow): look if I should clear the area or not
6755 using Inset::doClearArea() function.
6757 * src/insets/lyxinset.h: added doClearArea() function and
6758 modified draw(Painter &, ...) to draw(BufferView *, ...)
6760 * src/text2.C (UpdateInset): return bool insted of int
6762 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6764 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6765 combox in the character popup
6767 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6768 BufferParams const & params
6770 2000-06-20 Juergen Vigna <jug@sad.it>
6772 * src/insets/insettext.C (SetParagraphData): set insetowner on
6775 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6777 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6778 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6780 (form_main_): remove
6782 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6783 (create_form_form_main): remove FD_form_main stuff, connect to
6784 autosave_timeout signal
6786 * src/LyXView.[Ch] (getMainForm): remove
6787 (UpdateTimerCB): remove
6788 * src/BufferView_pimpl.h: inherit from SigC::Object
6790 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6791 signal instead of callback
6793 * src/BufferView.[Ch] (cursorToggleCB): remove
6795 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6797 * src/BufferView_pimpl.C: changes because of the one below
6799 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6800 instead of storing a pointer to a LyXText.
6802 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6804 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6806 * src/lyxparagraph.h
6808 * src/paragraph.C: Changed fontlist to a sorted vector.
6810 2000-06-19 Juergen Vigna <jug@sad.it>
6812 * src/BufferView.h: added screen() function.
6814 * src/insets/insettext.C (LocalDispatch): some selection code
6817 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6819 * src/insets/insettext.C (SetParagraphData):
6821 (InsetText): fixes for multiple paragraphs.
6823 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6825 * development/lyx.spec.in: Call configure with ``--without-warnings''
6826 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6827 This should be fine, however, since we generally don't want to be
6828 verbose when making an RPM.
6830 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6832 * lib/scripts/fig2pstex.py: New file
6834 2000-06-16 Juergen Vigna <jug@sad.it>
6836 * src/insets/insettabular.C (UpdateLocal):
6837 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6838 (LocalDispatch): Changed all functions to use LyXText.
6840 2000-06-15 Juergen Vigna <jug@sad.it>
6842 * src/text.C (SetHeightOfRow): call inset::update before requesting
6845 * src/insets/insettext.C (update):
6846 * src/insets/insettabular.C (update): added implementation
6848 * src/insets/lyxinset.h: added update function
6850 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6852 * src/text.C (SelectNextWord): protect against null pointers with
6853 old-style string streams. (fix from Paul Theo Gonciari
6856 * src/cite.[Ch]: remove erroneous files.
6858 * lib/configure.m4: update the list of created directories.
6860 * src/lyxrow.C: include <config.h>
6861 * src/lyxcursor.C: ditto.
6863 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6865 * lib/examples/decimal.lyx: new example file from Mike.
6867 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6868 to find template definitions (from Dekel)
6870 * src/frontends/.cvsignore: add a few things.
6872 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6874 * src/Timeout.C (TimeOut): remove default argument.
6876 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6879 * src/insets/ExternalTemplate.C: add a "using" directive.
6881 * src/lyx_main.h: remove the act_ struct, which seems unused
6884 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6886 * LyX Developers Meeting: All files changed, due to random C++ (by
6887 coincidence) code generator script.
6889 - external inset (cool!)
6890 - initial online editing of preferences
6891 - insettabular breaks insettext(s contents)
6893 - some DocBook fixes
6894 - example files update
6895 - other cool stuff, create a diff and look for yourself.
6897 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6899 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6900 -1 this is a non-line-breaking textinset.
6902 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6903 if there is no width set.
6905 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6907 * Lots of files: Merged the dialogbase branch.
6909 2000-06-09 Allan Rae <rae@lyx.org>
6911 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6912 and the Dispatch methods that used it.
6914 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6915 access to functions formerly kept in Dispatch.
6917 2000-05-19 Allan Rae <rae@lyx.org>
6919 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6920 made to_page and count_copies integers again. from_page remains a
6921 string however because I want to allow entry of a print range like
6922 "1,4,22-25" using this field.
6924 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6925 and printer-params-get. These aren't useful from the minibuffer but
6926 could be used by a script/LyXServer app provided it passes a suitable
6927 auto_mem_buffer. I guess I should take a look at how the LyXServer
6928 works and make it support xtl buffers.
6930 * sigc++/: updated to libsigc++-1.0.1
6932 * src/xtl/: updated to xtl-1.3.pl.11
6934 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6935 those changes done to the files in src/ are actually recreated when
6936 they get regenerated. Please don't ever accept a patch that changes a
6937 dialog unless that patch includes the changes to the corresponding *.fd
6940 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6941 stringOnlyContains, renamed it and generalised it.
6943 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6944 branch. Removed the remaining old form_print code.
6946 2000-04-26 Allan Rae <rae@lyx.org>
6948 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6949 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6951 2000-04-25 Allan Rae <rae@lyx.org>
6953 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6954 against a base of xtl-1.3.pl.4
6956 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6957 filter the Id: entries so they still show the xtl version number
6960 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6961 into the src/xtl code. Patch still pending with José (XTL)
6963 2000-04-24 Allan Rae <rae@lyx.org>
6965 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6966 both more generic and much safer. Use the new template functions.
6967 * src/buffer.[Ch] (Dispatch): ditto.
6969 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6970 and mem buffer more intelligently. Also a little general cleanup.
6973 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6974 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6975 * src/xtl/Makefile.am: ditto.
6976 * src/xtl/.cvsignore: ditto.
6977 * src/Makefile.am: ditto.
6979 * src/PrinterParams.h: Removed the macros member functions. Added a
6980 testInvariant member function. A bit of tidying up and commenting.
6981 Included Angus's idea for fixing operation with egcs-1.1.2.
6983 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6984 cool expansion of XTL's mem_buffer to support automatic memory
6985 management within the buffer itself. Removed the various macros and
6986 replaced them with template functions that use either auto_mem_buffer
6987 or mem_buffer depending on a #define. The mem_buffer support will
6988 disappear as soon as the auto_mem_buffer is confirmed to be good on
6989 other platforms/compilers. That is, it's there so you've got something
6992 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6993 effectively forked XTL. However I expect José will include my code
6994 into the next major release. Also fixed a memory leak.
6995 * src/xtl/text.h: ditto.
6996 * src/xtl/xdr.h: ditto.
6997 * src/xtl/giop.h: ditto.
6999 2000-04-16 Allan Rae <rae@lyx.org>
7001 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7002 by autogen.sh and removed by maintainer-clean anyway.
7003 * .cvsignore, sigc++/.cvsignore: Support the above.
7005 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7007 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7009 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7010 macros, renamed static callback-target member functions to suit new
7011 scheme and made them public.
7012 * src/frontends/xforms/forms/form_print.fd: ditto.
7013 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7015 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7018 * src/xtl/: New directory containing a minimal distribution of XTL.
7019 This is XTL-1.3.pl.4.
7021 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7023 2000-04-15 Allan Rae <rae@lyx.org>
7025 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7027 * sigc++/: Updated to libsigc++-1.0.0
7029 2000-04-14 Allan Rae <rae@lyx.org>
7031 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7032 use the generic ones in future. I'll modify my conversion script.
7034 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7036 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7037 (CloseAllBufferRelatedDialogs): Renamed.
7038 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7040 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7041 of the generic ones. These are the same ones my conversion script
7044 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7045 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7046 * src/buffer.C (Dispatch): ditto
7048 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7049 functions for updating and hiding buffer dependent dialogs.
7050 * src/BufferView.C (buffer): ditto
7051 * src/buffer.C (setReadonly): ditto
7052 * src/lyxfunc.C (CloseBuffer): ditto
7054 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7055 Dialogs.h, and hence all the SigC stuff, into every file that includes
7056 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7058 * src/BufferView2.C: reduce the number of headers included by buffer.h
7060 2000-04-11 Allan Rae <rae@lyx.org>
7062 * src/frontends/xforms/xform_macros.h: A small collection of macros
7063 for building C callbacks.
7065 * src/frontends/xforms/Makefile.am: Added above file.
7067 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7068 scheme again. This time it should work for JMarc. If this is
7069 successful I'll revise my conversion script to automate some of this.
7070 The static member functions in the class also have to be public for
7071 this scheme will work. If the scheme works (it's almost identical to
7072 the way BufferView::cursorToggleCB is handled so it should work) then
7073 FormCopyright and FormPrint will be ready for inclusion into the main
7074 trunk immediately after 1.1.5 is released -- provided we're prepared
7075 for complaints about lame compilers not handling XTL.
7077 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7079 2000-04-07 Allan Rae <rae@lyx.org>
7081 * config/lyxinclude.m4: A bit more tidying up (Angus)
7083 * src/LString.h: JMarc's <string> header fix
7085 * src/PrinterParams.h: Used string for most data to remove some
7086 ugly code in the Print dialog and avoid even uglier code when
7087 appending the ints to a string for output.
7089 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7090 and moved "default:" back to the end of switch statement. Cleaned
7091 up the printing so it uses the right function calls and so the
7092 "print to file" option actually puts the file in the right directory.
7094 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7096 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7097 and Ok+Apply button control into a separate method: input (Angus).
7098 (input) Cleaned it up and improved it to be very thorough now.
7099 (All CB) static_cast used instead of C style cast (Angus). This will
7100 probably change again once we've worked out how to keep gcc-2.8.1 happy
7101 with real C callbacks.
7102 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7103 ignore some of the bool settings and has random numbers instead. Needs
7104 some more investigation. Added other input length checks and checking
7105 of file and printer names.
7107 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7108 would link (Angus). Seems the old code doesn't compile with the pragma
7109 statement either. Separated callback entries from internal methods.
7111 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7113 2000-03-17 Allan Rae <rae@lyx.org>
7115 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7116 need it? Maybe it could go in Dialogs instead? I could make it a
7117 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7118 values to get the bool return value.
7119 (Dispatch): New overloaded method for xtl support.
7121 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7122 extern "C" callback instead of static member functions. Hopefully,
7123 JMarc will be able to compile this. I haven't changed
7124 forms/form_copyright.fd yet. Breaking one of my own rules already.
7126 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7127 because they aren't useful from the minibuffer. Maybe a LyXServer
7128 might want a help message though?
7130 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7132 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7133 xtl which needs both rtti and exceptions.
7135 * src/support/Makefile.am:
7136 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7138 * src/frontends/xforms/input_validators.[ch]: input filters and
7139 validators. These conrol what keys are valid in input boxes.
7140 Use them and write some more. Much better idea than waiting till
7141 after the user has pressed Ok to say that the input fields don't make
7144 * src/frontends/xforms/Makefile.am:
7145 * src/frontends/xforms/forms/form_print.fd:
7146 * src/frontends/xforms/forms/makefile:
7147 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7148 new scheme. Still have to make sure I haven't missed anything from
7149 the current implementation.
7151 * src/Makefile.am, src/PrinterParams.h: New data store.
7153 * other files: Added a couple of copyright notices.
7155 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7157 * src/insets/insetbib.h: move Holder struct in public space.
7159 * src/frontends/include/DialogBase.h: use SigC:: only when
7160 SIGC_CXX_NAMESPACES is defined.
7161 * src/frontends/include/Dialogs.h: ditto.
7163 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7165 * src/frontends/xforms/FormCopyright.[Ch]: do not
7166 mention SigC:: explicitely.
7168 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7170 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7171 deals with testing KDE in main configure.in
7172 * configure.in: ditto.
7174 2000-02-22 Allan Rae <rae@lyx.org>
7176 * Lots of files: Merged from HEAD
7178 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7179 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7181 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7183 * sigc++/: new minidist.
7185 2000-02-14 Allan Rae <rae@lyx.org>
7187 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7189 2000-02-08 Juergen Vigna <jug@sad.it>
7191 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7192 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7194 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7195 for this port and so it is much easier for other people to port
7196 dialogs in a common development environment.
7198 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7199 the QT/KDE implementation.
7201 * src/frontends/kde/Dialogs.C:
7202 * src/frontends/kde/FormCopyright.C:
7203 * src/frontends/kde/FormCopyright.h:
7204 * src/frontends/kde/Makefile.am:
7205 * src/frontends/kde/formcopyrightdialog.C:
7206 * src/frontends/kde/formcopyrightdialog.h:
7207 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7208 for the kde support of the Copyright-Dialog.
7210 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7211 subdir-substitution instead of hardcoded 'xforms' as we now have also
7214 * src/frontends/include/DialogBase.h (Object): just commented the
7215 label after #endif (nasty warning and I don't like warnings ;)
7217 * src/main.C (main): added KApplication initialization if using
7220 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7221 For now only the KDE event-loop is added if frontend==kde.
7223 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7225 * configure.in: added support for the --with-frontend[=value] option
7227 * autogen.sh: added kde.m4 file to list of config-files
7229 * acconfig.h: added define for KDEGUI-support
7231 * config/kde.m4: added configuration functions for KDE-port
7233 * config/lyxinclude.m4: added --with-frontend[=value] option with
7234 support for xforms and KDE.
7236 2000-02-08 Allan Rae <rae@lyx.org>
7238 * all Makefile.am: Fixed up so the make targets dist, distclean,
7239 install and uninstall all work even if builddir != srcdir. Still
7240 have a new sigc++ minidist update to come.
7242 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7244 2000-02-01 Allan Rae <rae@lyx.org>
7246 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7247 Many mods to get builddir != srcdir working.
7249 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7250 for building on NT and so we can do the builddir != srcdir stuff.
7252 2000-01-30 Allan Rae <rae@lyx.org>
7254 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7255 This will stay in "rae" branch. We probably don't really need it in
7256 the main trunk as anyone who wants to help programming it should get
7257 a full library installed also. So they can check both included and
7258 system supplied library compilation.
7260 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7261 Added a 'mini' distribution of libsigc++. If you feel the urge to
7262 change something in these directories - Resist it. If you can't
7263 resist the urge then you should modify the following script and rebuild
7264 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7265 all happen. Still uses a hacked version of libsigc++'s configure.in.
7266 I'm quite happy with the results. I'm not sure the extra work to turn
7267 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7268 worth the trouble and would probably lead to extra maintenance
7270 I haven't tested the following important make targets: install, dist.
7271 Not ready for prime time but very close. Maybe 1.1.5.
7273 * development/tools/makeLyXsigc.sh: A shell script to automatically
7274 generate our mini-dist of libsigc++. It can only be used with a CVS
7275 checkout of libsigc++ not a tarball distribution. It's well commented.
7276 This will end up as part of the libsigc++ distribution so other apps
7277 can easily have an included mini-dist. If someone makes mods to the
7278 sigc++ subpackage without modifying this script to generate those
7279 changes I'll be very upset!
7281 * src/frontends/: Started the gui/system indep structure.
7283 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7284 to access the gui-indep dialogs are in this class. Much improved
7285 design compared to previous revision. Lars, please refrain from
7286 moving this header into src/ like you did with Popups.h last time.
7288 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7290 * src/frontends/xforms/: Started the gui-indep system with a single
7291 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7294 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7295 Here you'll find a very useful makefile and automated fdfix.sh that
7296 makes updating dailogs a no-brainer -- provided you follow the rules
7297 set out in the README. I'm thinking about adding another script to
7298 automatically generate skeleton code for a new dialog given just the
7301 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7302 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7303 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7305 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7307 * src/support/LSubstring.C (operator): simplify
7309 * src/lyxtext.h: removed bparams, use buffer_->params instead
7311 * src/lyxrow.h: make Row a real class, move all variables to
7312 private and use accessors.
7314 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7316 (isRightToLeftPar): ditto
7317 (ChangeLanguage): ditto
7318 (isMultiLingual): ditto
7321 (SimpleTeXOnePar): ditto
7322 (TeXEnvironment): ditto
7323 (GetEndLabel): ditto
7325 (SetOnlyLayout): ditto
7326 (BreakParagraph): ditto
7327 (BreakParagraphConservative): ditto
7328 (GetFontSettings): ditto
7330 (CopyIntoMinibuffer): ditto
7331 (CutIntoMinibuffer): ditto
7332 (PasteParagraph): ditto
7333 (SetPExtraType): ditto
7334 (UnsetPExtraType): ditto
7335 (DocBookContTableRows): ditto
7336 (SimpleDocBookOneTablePar): ditto
7338 (TeXFootnote): ditto
7339 (SimpleTeXOneTablePar): ditto
7340 (TeXContTableRows): ditto
7341 (SimpleTeXSpecialChars): ditto
7344 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7345 to private and use accessors.
7347 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7348 this, we did not use it anymore and has not been for ages. Just a
7349 waste of cpu cycles.
7351 * src/language.h: make Language a real class, move all variables
7352 to private and use accessors.
7354 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7355 (create_view): remove
7356 (update): some changes for new timer
7357 (cursorToggle): use new timer
7358 (beforeChange): change for new timer
7360 * src/BufferView.h (cursorToggleCB): removed last paramter because
7363 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7364 (cursorToggleCB): change because of new timer code
7366 * lib/CREDITS: updated own mailaddress
7368 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7370 * src/support/filetools.C (PutEnv): fix the code in case neither
7371 putenv() nor setenv() have been found.
7373 * INSTALL: mention the install-strip Makefile target.
7375 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7376 read-only documents.
7378 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7380 * lib/reLyX/configure.in (VERSION): avoid using a previously
7381 generated reLyX wrapper to find out $prefix.
7383 * lib/examples/eu_adibide_lyx-atua.lyx:
7384 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7385 translation of the Tutorial (Dooteo)
7387 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7389 * forms/cite.fd: new citation dialog
7391 * src/insetcite.[Ch]: the new citation dialog is moved into
7394 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7397 * src/insets/insetcommand.h: data members made private.
7399 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7401 * LyX 1.1.5 released
7403 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7405 * src/version.h (LYX_RELEASE): to 1.1.5
7407 * src/spellchecker.C (RunSpellChecker): return false if the
7408 spellchecker dies upon creation.
7410 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7412 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7413 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7417 * lib/CREDITS: update entry for Martin Vermeer.
7419 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7421 * src/text.C (draw): Draw foreign language bars at the bottom of
7422 the row instead of at the baseline.
7424 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7426 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7428 * lib/bind/de_menus.bind: updated
7430 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7432 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7434 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7436 * src/menus.C (Limit_string_length): New function
7437 (ShowTocMenu): Limit the number of items/length of items in the
7440 * src/paragraph.C (String): Correct result for a paragraph inside
7443 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7445 * src/bufferlist.C (close): test of buf->getuser() == NULL
7447 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7449 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7450 Do not call to SetCursor when the paragraph is a closed footnote!
7452 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7454 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7457 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7459 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7462 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7463 reference popup, that activates the reference-back action
7465 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7467 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7468 the menus. Also fixed a bug.
7470 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7471 the math panels when switching buffers (unless new buffer is readonly).
7473 * src/BufferView.C (NoSavedPositions)
7474 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7476 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7478 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7479 less of dvi dirty or not.
7481 * src/trans_mgr.[Ch] (insert): change first parameter to string
7484 * src/chset.[Ch] (encodeString): add const to first parameter
7486 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7488 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7492 * src/LaTeX.C (deplog): better searching for dependency files in
7493 the latex log. Uses now regexps.
7495 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7496 instead of the box hack or \hfill.
7498 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7500 * src/lyxfunc.C (doImportHelper): do not create the file before
7501 doing the actual import.
7502 (doImportASCIIasLines): create a new file before doing the insert.
7503 (doImportASCIIasParagraphs): ditto.
7505 * lib/lyxrc.example: remove mention of non-existing commands
7507 * lyx.man: remove mention of color-related switches.
7509 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7511 * src/lyx_gui.C: remove all the color-related ressources, which
7512 are not used anymore.
7514 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7517 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7519 * src/lyxrc.C (read): Add a missing break in the switch
7521 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7523 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7525 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7528 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7530 * src/text.C (draw): draw bars under foreign language words.
7532 * src/LColor.[Ch]: add LColor::language
7534 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7536 * src/lyxcursor.h (boundary): New member variable
7538 * src/text.C (IsBoundary): New methods
7540 * src/text.C: Use the above for currect cursor movement when there
7541 is both RTL & LTR text.
7543 * src/text2.C: ditto
7545 * src/bufferview_funcs.C (ToggleAndShow): ditto
7547 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7549 * src/text.C (DeleteLineForward): set selection to true to avoid
7550 that DeleteEmptyParagraphMechanism does some magic. This is how it
7551 is done in all other functions, and seems reasonable.
7552 (DeleteWordForward): do not jump over non-word stuff, since
7553 CursorRightOneWord() already does it.
7555 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7556 DeleteWordBackward, since they seem safe to me (since selection is
7557 set to "true") DeleteEmptyParagraphMechanism does nothing.
7559 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7561 * src/lyx_main.C (easyParse): simplify the code by factoring the
7562 part that removes parameters from the command line.
7563 (LyX): check wether wrong command line options have been given.
7565 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7567 * src/lyx_main.C : add support for specifying user LyX
7568 directory via command line option -userdir.
7570 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7572 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7573 the number of items per popup.
7574 (Add_to_refs_menu): Ditto.
7576 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7578 * src/lyxparagraph.h: renamed ClearParagraph() to
7579 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7580 textclass as parameter, and do nothing if free_spacing is
7581 true. This fixes part of the line-delete-forward problems.
7583 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7584 (pasteSelection): ditto.
7585 (SwitchLayoutsBetweenClasses): more translatable strings.
7587 * src/text2.C (CutSelection): use StripLeadingSpaces.
7588 (PasteSelection): ditto.
7589 (DeleteEmptyParagraphMechanism): ditto.
7591 2000-05-26 Juergen Vigna <jug@sad.it>
7593 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7594 is not needed in tabular insets.
7596 * src/insets/insettabular.C (TabularFeatures): added missing features.
7598 * src/tabular.C (DeleteColumn):
7600 (AppendRow): implemented this functions
7601 (cellsturct::operator=): clone the inset too;
7603 2000-05-23 Juergen Vigna <jug@sad.it>
7605 * src/insets/insettabular.C (LocalDispatch): better selection support
7606 when having multicolumn-cells.
7608 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7610 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7612 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7614 * src/ColorHandler.C (getGCForeground): put more test into _()
7616 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7619 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7622 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7624 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7625 there are no labels, or when buffer is readonly.
7627 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7628 there are no labels, buffer is SGML, or when buffer is readonly.
7630 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7632 * src/LColor.C (LColor): change a couple of grey40 to grey60
7633 (LColor): rewore initalization to make compiles go some magnitude
7635 (getGUIName): don't use gettext until we need the string.
7637 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7639 * src/Bullet.[Ch]: Fixed a small bug.
7641 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7643 * src/paragraph.C (String): Several fixes/improvements
7645 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7647 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7649 * src/paragraph.C (String): give more correct output.
7651 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7653 * src/lyxfont.C (stateText) Do not output the language if it is
7654 eqaul to the language of the document.
7656 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7657 between two paragraphs with the same language.
7659 * src/paragraph.C (getParLanguage) Return a correct answer for an
7660 empty dummy paragraph.
7662 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7665 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7668 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7669 the menus/popup, if requested fonts are unavailable.
7671 2000-05-22 Juergen Vigna <jug@sad.it>
7673 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7674 movement support (Up/Down/Tab/Shift-Tab).
7675 (LocalDispatch): added also preliminari cursor-selection.
7677 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7679 * src/paragraph.C (PasteParagraph): Hopefully now right!
7681 2000-05-22 Garst R. Reese <reese@isn.net>
7683 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7684 of list, change all references to Environment to Command
7685 * tex/hollywood.cls : rewrite environments as commands, add
7686 \uppercase to interiorshot and exteriorshot to force uppecase.
7687 * tex/broadway.cls : rewrite environments as commands. Tweak
7690 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7692 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7693 size of items: use a constant intead of the hardcoded 40, and more
7694 importantly do not remove the %m and %x tags added at the end.
7695 (Add_to_refs_menu): use vector::size_type instead of
7696 unsigned int as basic types for the variables. _Please_ do not
7697 assume that size_t is equal to unsigned int. On an alpha, this is
7698 unsigned long, which is _not_ the same.
7700 * src/language.C (initL): remove language "hungarian", since it
7701 seems that "magyar" is better.
7703 2000-05-22 Juergen Vigna <jug@sad.it>
7705 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7707 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7710 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7711 next was deleted but not set to 0.
7713 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7715 * src/language.C (initL): change the initialization of languages
7716 so that compiles goes _fast_.
7718 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7721 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7723 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7727 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7729 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7731 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7735 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7738 * src/insets/insetlo*.[Ch]: Made editable
7740 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7742 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7743 the current selection.
7745 * src/BufferView_pimpl.C (stuffClipboard): new method
7747 * src/BufferView.C (stuffClipboard): new method
7749 * src/paragraph.C (String): new method
7751 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7752 LColor::ignore when lyxname is not found.
7754 * src/BufferView.C (pasteSelection): new method
7756 * src/BufferView_pimpl.C (pasteSelection): new method
7758 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7760 * src/WorkArea.C (request_clipboard_cb): new static function
7761 (getClipboard): new method
7762 (putClipboard): new method
7764 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7766 * LyX 1.1.5pre2 released
7768 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7770 * src/vspace.C (operator=): removed
7771 (operator=): removed
7773 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7775 * src/layout.C (NumberOfClass): manually set the type in make_pair
7776 (NumberOfLayout): ditto
7778 * src/language.C: use the Language constructor for ignore_lang
7780 * src/language.h: add constructors to struct Language
7782 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7784 * src/text2.C (SetCursorIntern): comment out #warning
7786 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7788 * src/mathed/math_iter.h: initialize sx and sw to 0
7790 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7792 * forms/lyx.fd: Redesign of form_ref
7794 * src/LaTeXFeatures.[Ch]
7798 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7801 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7802 and Buffer::inset_iterator.
7804 * src/menus.C: Added new menus: TOC and Refs.
7806 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7808 * src/buffer.C (getTocList): New method.
7810 * src/BufferView2.C (ChangeRefs): New method.
7812 * src/buffer.C (getLabelList): New method. It replaces the old
7813 getReferenceList. The return type is vector<string> instead of
7816 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7817 the old getLabel() and GetNumberOfLabels() methods.
7818 * src/insets/insetlabel.C (getLabelList): ditto
7819 * src/mathed/formula.C (getLabelList): ditto
7821 * src/paragraph.C (String): New method.
7823 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7824 Uses the new getTocList() method.
7825 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7826 which automatically updates the contents of the browser.
7827 (RefUpdateCB): Use the new getLabelList method.
7829 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7831 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7833 * src/spellchecker.C: Added using std::reverse;
7835 2000-05-19 Juergen Vigna <jug@sad.it>
7837 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7839 * src/insets/insettext.C (computeTextRows): small fix for display of
7840 1 character after a newline.
7842 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7845 2000-05-18 Juergen Vigna <jug@sad.it>
7847 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7848 when changing width of column.
7850 * src/tabular.C (set_row_column_number_info): setting of
7851 autobreak rows if necessary.
7853 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7855 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7857 * src/vc-backend.*: renamed stat() to status() and vcstat to
7858 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7859 compilation broke. The new name seems more relevant, anyway.
7861 2000-05-17 Juergen Vigna <jug@sad.it>
7863 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7864 which was wrong if the removing caused removing of rows!
7866 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7867 (pushToken): new function.
7869 * src/text2.C (CutSelection): fix problem discovered with purify
7871 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7873 * src/debug.C (showTags): enlarge the first column, now that we
7874 have 6-digits debug codes.
7876 * lib/layouts/hollywood.layout:
7877 * lib/tex/hollywood.cls:
7878 * lib/tex/brodway.cls:
7879 * lib/layouts/brodway.layout: more commands and fewer
7880 environments. Preambles moved in the .cls files. Broadway now has
7881 more options on scene numbering and less whitespace (from Garst)
7883 * src/insets/insetbib.C (getKeys): make sure that we are in the
7884 document directory, in case the bib file is there.
7886 * src/insets/insetbib.C (Latex): revert bogus change.
7888 2000-05-16 Juergen Vigna <jug@sad.it>
7890 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7891 the TabularLayout on cursor move.
7893 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7895 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7898 (draw): fixed cursor position and drawing so that the cursor is
7899 visible when before the tabular-inset.
7901 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7902 when creating from old insettext.
7904 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7906 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7908 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7909 * lib/tex/brodway.cls: ditto
7911 * lib/layouts/brodway.layout: change alignment of parenthical
7914 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7916 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7917 versions 0.88 and 0.89 are supported.
7919 2000-05-15 Juergen Vigna <jug@sad.it>
7921 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7924 * src/insets/insettext.C (computeTextRows): redone completely this
7925 function in a much cleaner way, because of problems when having a
7927 (draw): added a frame border when the inset is locked.
7928 (SetDrawLockedFrame): this sets if we draw the border or not.
7929 (SetFrameColor): this sets the frame color (default=insetframe).
7931 * src/insets/lyxinset.h: added x() and y() functions which return
7932 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7933 function which is needed to see if we have a locking inset of some
7934 type in this inset (needed for now in insettabular).
7936 * src/vspace.C (inPixels): the same function also without a BufferView
7937 parameter as so it is easier to use it in some ocasions.
7939 * src/lyxfunc.C: changed all places where insertInset was used so
7940 that now if it couldn't be inserted it is deleted!
7942 * src/TabularLayout.C:
7943 * src/TableLayout.C: added support for new tabular-inset!
7945 * src/BufferView2.C (insertInset): this now returns a bool if the
7946 inset was really inserted!!!
7948 * src/tabular.C (GetLastCellInRow):
7949 (GetFirstCellInRow): new helper functions.
7950 (Latex): implemented for new tabular class.
7954 (TeXTopHLine): new Latex() helper functions.
7956 2000-05-12 Juergen Vigna <jug@sad.it>
7958 * src/mathed/formulamacro.C (Read):
7959 * src/mathed/formula.C (Read): read also the \end_inset here!
7961 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7963 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7964 crush when saving formulae with unbalanced parenthesis.
7966 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7968 * src/layout.C: Add new keyword "endlabelstring" to layout file
7970 * src/text.C (GetVisibleRow): Draw endlabel string.
7972 * lib/layouts/broadway.layout
7973 * lib/layouts/hollywood.layout: Added endlabel for the
7974 Parenthetical layout.
7976 * lib/layouts/heb-article.layout: Do not use slanted font shape
7977 for Theorem like environments.
7979 * src/buffer.C (makeLaTeXFile): Always add "american" to
7980 the UsedLanguages list if document language is RTL.
7982 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7984 * add addendum to README.OS2 and small patch (from SMiyata)
7986 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7988 * many files: correct the calls to ChangeExtension().
7990 * src/support/filetools.C (ChangeExtension): remove the no_path
7991 argument, which does not belong there. Use OnlyFileName() instead.
7993 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7994 files when LaTeXing a non-nice latex file.
7996 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7997 a chain of "if". Return false when deadkeys are not handled.
7999 * src/lyx_main.C (LyX): adapted the code for default bindings.
8001 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8002 bindings for basic functionality (except deadkeys).
8003 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8005 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8006 several methods: handle override_x_deadkeys.
8008 * src/lyxrc.h: remove the "bindings" map, which did not make much
8009 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8011 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8013 * src/lyxfont.C (stateText): use a saner method to determine
8014 whether the font is "default". Seems to fix the crash with DEC
8017 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8019 2000-05-08 Juergen Vigna <jug@sad.it>
8021 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8022 TabularLayoutMenu with mouse-button-3
8023 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8025 * src/TabularLayout.C: added this file for having a Layout for
8028 2000-05-05 Juergen Vigna <jug@sad.it>
8030 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8031 recalculating inset-widths.
8032 (TabularFeatures): activated this function so that I can change
8033 tabular-features via menu.
8035 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8036 that I can test some functions with the Table menu.
8038 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8040 * src/lyxfont.C (stateText): guard against stupid c++libs.
8042 * src/tabular.C: add using std::vector
8043 some whitespace changes, + removed som autogenerated code.
8045 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8047 2000-05-05 Juergen Vigna <jug@sad.it>
8049 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8050 row, columns and cellstructures.
8052 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8054 * lib/lyxrc.example: remove obsolete entries.
8056 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8057 reading of protected_separator for free_spacing.
8059 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8061 * src/text.C (draw): do not display an exclamation mark in the
8062 margin for margin notes. This is confusing, ugly and
8065 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8066 AMS math' is checked.
8068 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8069 name to see whether including the amsmath package is needed.
8071 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8073 * src/paragraph.C (validate): Compute UsedLanguages correctly
8074 (don't insert the american language if it doesn't appear in the
8077 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8078 The argument of \thanks{} command is considered moving argument
8080 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8083 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8085 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8086 for appendix/minipage/depth. The lines can be now both in the footnote
8087 frame, and outside the frame.
8089 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8092 2000-05-05 Juergen Vigna <jug@sad.it>
8094 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8095 neede only in tabular.[Ch].
8097 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8099 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8101 (Write): write '~' for PROTECTED_SEPARATOR
8103 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8105 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8108 * src/mathed/formula.C (drawStr): rename size to siz.
8110 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8111 possibly fix a bug by not changing the pflags = flags to piflags =
8114 2000-05-05 Juergen Vigna <jug@sad.it>
8116 * src/insets/insetbib.C: moved using directive
8118 * src/ImportNoweb.C: small fix for being able to compile (missing
8121 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8123 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8124 to use clear, since we don't depend on this in the code. Add test
8127 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8129 * (various *.C files): add using std::foo directives to please dec
8132 * replace calls to string::clear() to string::erase() (Angus)
8134 * src/cheaders/cmath: modified to provide std::abs.
8136 2000-05-04 Juergen Vigna <jug@sad.it>
8138 * src/insets/insettext.C: Prepared all for inserting of multiple
8139 paragraphs. Still display stuff to do (alignment and other things),
8140 but I would like to use LyXText to do this when we cleaned out the
8141 table-support stuff.
8143 * src/insets/insettabular.C: Changed lot of stuff and added lots
8144 of functionality still a lot to do.
8146 * src/tabular.C: Various functions changed name and moved to be
8147 const functions. Added new Read and Write functions and changed
8148 lots of things so it works good with tabular-insets (also removed
8149 some stuff which is not needed anymore * hacks *).
8151 * src/lyxcursor.h: added operators == and != which just look if
8152 par and pos are (not) equal.
8154 * src/buffer.C (latexParagraphs): inserted this function to latex
8155 all paragraphs form par to endpar as then I can use this too for
8158 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8159 so that I can call this to from text insets with their own cursor.
8161 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8162 output off all paragraphs (because of the fix below)!
8164 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8165 the very last paragraph (this could be also the last paragraph of an
8168 * src/texrow.h: added rows() call which returns the count-variable.
8170 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8172 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8174 * lib/configure.m4: better autodetection of DocBook tools.
8176 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8178 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8180 * src/lyx_cb.C: add using std::reverse;
8182 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8185 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8186 selected files. Should fix repeated errors from generated files.
8188 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8190 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8192 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8193 the spellchecker popup.
8195 * lib/lyxrc.example: Removed the \number_inset section
8197 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8199 * src/insets/figinset.C (various): Use IsFileReadable() to make
8200 sure that the file actually exist. Relying on ghostscripts errors
8201 is a bad idea since they can lead to X server crashes.
8203 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8205 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8208 * lib/lyxrc.example: smallish typo in description of
8209 \view_dvi_paper_option
8211 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8214 * src/lyxfunc.C: doImportHelper to factor out common code of the
8215 various import methods. New functions doImportASCIIasLines,
8216 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8217 doImportLinuxDoc for the format specific parts.
8220 * buffer.C: Dispatch returns now a bool to indicate success
8223 * lyx_gui.C: Add getLyXView() for member access
8225 * lyx_main.C: Change logic for batch commands: First try
8226 Buffer::Dispatch (possibly without GUI), if that fails, use
8229 * lyx_main.C: Add support for --import command line switch.
8230 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8231 Available Formats: Everything accepted by 'buffer-import <format>'
8233 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8235 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8238 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8239 documents will be reformatted upon reentry.
8241 2000-04-27 Juergen Vigna <jug@sad.it>
8243 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8244 correctly only last pos this was a bug.
8246 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8248 * release of lyx-1.1.5pre1
8250 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8252 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8254 * src/menus.C: revert the change of naming (Figure->Graphic...)
8255 from 2000-04-11. It was incomplete and bad.
8257 * src/LColor.[Ch]: add LColor::depthbar.
8258 * src/text.C (GetVisibleRow): use it.
8260 * README: update the languages list.
8262 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8264 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8267 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8269 * README: remove sections that were just wrong.
8271 * src/text2.C (GetRowNearY): remove currentrow code
8273 * src/text.C (GetRow): remove currentrow code
8275 * src/screen.C (Update): rewritten a bit.
8276 (SmallUpdate): removed func
8278 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8280 (FullRebreak): return bool
8281 (currentrow): remove var
8282 (currentrow_y): ditto
8284 * src/lyxscreen.h (Draw): change arg to unsigned long
8285 (FitCursor): return bool
8286 (FitManualCursor): ditto
8287 (Smallpdate): remove func
8288 (first): change to unsigned long
8289 (DrawOneRow): change second arg to long (from long &)
8290 (screen_refresh_y): remove var
8291 (scree_refresh_row): ditto
8293 * src/lyxrow.h: change baseline to usigned int from unsigned
8294 short, this brings some implicit/unsigned issues out in the open.
8296 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8298 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8299 instead of smallUpdate.
8301 * src/lyxcursor.h: change y to unsigned long
8303 * src/buffer.h: don't call updateScrollbar after fitcursor
8305 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8306 where they are used. Removed "\\direction", this was not present
8307 in 1.1.4 and is already obsolete. Commented out some code that I
8308 believe to never be called.
8309 (runLiterate): don't call updateScrollbar after fitCursor
8311 (buildProgram): ditto
8314 * src/WorkArea.h (workWidth): change return val to unsigned
8317 (redraw): remove the button redraws
8318 (setScrollbarValue): change for scrollbar
8319 (getScrollbarValue): change for scrollbar
8320 (getScrollbarBounds): change for scrollbar
8322 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8323 (C_WorkArea_down_cb): removed func
8324 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8325 (resize): change for scrollbar
8326 (setScrollbar): ditto
8327 (setScrollbarBounds): ditto
8328 (setScrollbarIncrements): ditto
8329 (up_cb): removed func
8330 (down_cb): removed func
8331 (scroll_cb): change for scrollbar
8332 (work_area_handler): ditto
8334 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8335 when FitCursor did something.
8336 (updateScrollbar): some unsigned changes
8337 (downCB): removed func
8338 (scrollUpOnePage): removed func
8339 (scrollDownOnePage): remvoed func
8340 (workAreaMotionNotify): don't call screen->FitCursor but use
8341 fitCursor instead. and bool return val
8342 (workAreaButtonPress): ditto
8343 (workAreaButtonRelease): some unsigned changes
8344 (checkInsetHit): ditto
8345 (workAreaExpose): ditto
8346 (update): parts rewritten, comments about the signed char arg added
8347 (smallUpdate): removed func
8348 (cursorPrevious): call needed updateScrollbar
8351 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8354 * src/BufferView.[Ch] (upCB): removed func
8355 (downCB): removed func
8356 (smallUpdate): removed func
8358 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8360 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8361 currentrow, currentrow_y optimization. This did not help a lot and
8362 if we want to do this kind of optimization we should rather use
8363 cursor.row instead of the currentrow.
8365 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8366 buffer spacing and klyx spacing support.
8368 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8370 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8373 2000-04-26 Juergen Vigna <jug@sad.it>
8375 * src/insets/figinset.C: fixes to Lars sstream changes!
8377 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8379 * A lot of files: Added Ascii(ostream &) methods to all inset
8380 classes. Used when exporting to ASCII.
8382 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8383 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8386 * src/text2.C (ToggleFree): Disabled implicit word selection when
8387 there is a change in the language
8389 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8390 no output was generated for end-of-sentence inset.
8392 * src/insets/lyxinset.h
8395 * src/paragraph.C: Removed the insetnumber code
8397 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8399 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8401 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8402 no_babel and no_epsfig completely from the file.
8403 (parseSingleLyXformat2Token): add handling for per-paragraph
8404 spacing as written by klyx.
8406 * src/insets/figinset.C: applied patch by Andre. Made it work with
8409 2000-04-20 Juergen Vigna <jug@sad.it>
8411 * src/insets/insettext.C (cutSelection):
8412 (copySelection): Fixed with selection from right to left.
8413 (draw): now the rows are not recalculated at every draw.
8414 (computeTextRows): for now reset the inset-owner here (this is
8415 important for an undo or copy where the inset-owner is not set
8418 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8419 motion to the_locking_inset screen->first was forgotten, this was
8420 not important till we got multiline insets.
8422 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8424 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8425 code seems to be alright (it is code changed by Dekel, and the
8426 intent is indeed that all macros should be defined \protect'ed)
8428 * NEWS: a bit of reorganisation of the new user-visible features.
8430 2000-04-19 Juergen Vigna <jug@sad.it>
8432 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8433 position. Set the inset_owner of the used paragraph so that it knows
8434 that it is inside an inset. Fixed cursor handling with mouse and
8435 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8436 and cleanups to make TextInsets work better.
8438 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8439 Changed parameters of various functions and added LockInsetInInset().
8441 * src/insets/insettext.C:
8443 * src/insets/insetcollapsable.h:
8444 * src/insets/insetcollapsable.C:
8445 * src/insets/insetfoot.h:
8446 * src/insets/insetfoot.C:
8447 * src/insets/insetert.h:
8448 * src/insets/insetert.C: cleaned up the code so that it works now
8449 correctly with insettext.
8451 * src/insets/inset.C:
8452 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8453 that insets in insets are supported right.
8456 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8458 * src/paragraph.C: some small fixes
8460 * src/debug.h: inserted INSETS debug info
8462 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8463 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8465 * src/commandtags.h:
8466 * src/LyXAction.C: insert code for InsetTabular.
8468 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8469 not Button1MotionMask.
8470 (workAreaButtonRelease): send always a InsetButtonRelease event to
8472 (checkInsetHit): some setCursor fixes (always with insets).
8474 * src/BufferView2.C (lockInset): returns a bool now and extended for
8475 locking insets inside insets.
8476 (showLockedInsetCursor): it is important to have the cursor always
8477 before the locked inset.
8478 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8480 * src/BufferView.h: made lockInset return a bool.
8482 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8484 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8485 that is used also internally but can be called as public to have back
8486 a cursor pos which is not set internally.
8487 (SetCursorIntern): Changed to use above function.
8489 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8491 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8496 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8497 patches for things that should be in or should be changed.
8499 * src/* [insetfiles]: change "usigned char fragile" to bool
8500 fragile. There was only one point that could that be questioned
8501 and that is commented in formulamacro.C. Grep for "CHECK".
8503 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8504 (DeleteBuffer): take it out of CutAndPaste and make it static.
8506 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8508 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8509 output the spacing envir commands. Also the new commands used in
8510 the LaTeX output makes the result better.
8512 * src/Spacing.C (writeEnvirBegin): new method
8513 (writeEnvirEnd): new method
8515 2000-04-18 Juergen Vigna <jug@sad.it>
8517 * src/CutAndPaste.C: made textclass a static member of the class
8518 as otherwise it is not accesed right!!!
8520 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8522 * forms/layout_forms.fd
8523 * src/layout_forms.h
8524 * src/layout_forms.C (create_form_form_character)
8525 * src/lyx_cb.C (UserFreeFont)
8526 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8527 documents (in the layout->character popup).
8529 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8531 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8532 \spell_command was in fact not honored (from Kevin Atkinson).
8534 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8537 * src/lyx_gui.h: make lyxViews private (Angus)
8539 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8541 * src/mathed/math_write.C
8542 (MathMatrixInset::Write) Put \protect before \begin{array} and
8543 \end{array} if fragile
8544 (MathParInset::Write): Put \protect before \\ if fragile
8546 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8548 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8549 initialization if the LyXColorHandler must be done after the
8550 connections to the XServer has been established.
8552 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8553 get the background pixel from the lyxColorhandler so that the
8554 figures are rendered with the correct background color.
8555 (NextToken): removed functions.
8556 (GetPSSizes): use ifs >> string instead of NextToken.
8558 * src/Painter.[Ch]: the color cache moved out of this file.
8560 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8563 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8565 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8566 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8568 * src/BufferView.C (enterView): new func
8569 (leaveView): new func
8571 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8573 (leaveView): new func, undefines xterm cursor when approp.
8575 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8576 (AllowInput): delete the Workarea cursor handling from this func.
8578 * src/Painter.C (underline): draw a slimer underline in most cases.
8580 * src/lyx_main.C (error_handler): use extern "C"
8582 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8584 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8585 sent directly to me.
8587 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8588 to the list by Dekel.
8590 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8593 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8594 methods from lyx_cb.here.
8596 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8599 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8601 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8602 instead of using current_view directly.
8604 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8606 * src/LyXAction.C (init): add the paragraph-spacing command.
8608 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8610 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8612 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8613 different from the documents.
8615 * src/text.C (SetHeightOfRow): take paragraph spacing into
8616 account, paragraph spacing takes precedence over buffer spacing
8617 (GetVisibleRow): ditto
8619 * src/paragraph.C (writeFile): output the spacing parameter too.
8620 (validate): set the correct features if spacing is used in the
8622 (Clear): set spacing to default
8623 (MakeSameLayout): spacing too
8624 (HasSameLayout): spacing too
8625 (SetLayout): spacing too
8626 (TeXOnePar): output the spacing commands
8628 * src/lyxparagraph.h: added a spacing variable for use with
8629 per-paragraph spacing.
8631 * src/Spacing.h: add a Default spacing and a method to check if
8632 the current spacing is default. also added an operator==
8634 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8637 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8639 * src/lyxserver.C (callback): fix dispatch of functions
8641 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8642 printf() into lyxerr call.
8644 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8647 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8648 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8649 the "Float" from each of the subitems.
8650 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8652 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8653 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8654 documented the change so that the workaround can be nuked later.
8656 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8659 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8661 * src/buffer.C (getLatexName): ditto
8662 (setReadonly): ditto
8664 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8666 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8667 avoid some uses of current_view. Added also a bufferParams()
8668 method to get at this.
8670 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8672 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8674 * src/lyxparagraph.[Ch]: removed
8675 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8676 with operators used by lower_bound and
8677 upper_bound in InsetTable's
8678 Make struct InsetTable private again. Used matchpos.
8680 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8682 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8683 document, the language of existing text is changed (unless the
8684 document is multi-lingual)
8686 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8688 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8690 * A lot of files: A rewrite of the Right-to-Left support.
8692 2000-04-10 Juergen Vigna <jug@sad.it>
8694 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8695 misplaced cursor when inset in inset is locked.
8697 * src/insets/insettext.C (LocalDispatch): small fix so that a
8698 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8700 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8701 footnote font should be decreased in size twice when displaying.
8703 * src/insets/insettext.C (GetDrawFont): inserted this function as
8704 the drawing-font may differ from the real paragraph font.
8706 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8707 insets (inset in inset!).
8709 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8710 function here because we don't want footnotes inside footnotes.
8712 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8714 (init): now set the inset_owner in paragraph.C
8715 (LocalDispatch): added some resetPos() in the right position
8718 (pasteSelection): changed to use the new CutAndPaste-Class.
8720 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8721 which tells if it is allowed to insert another inset inside this one.
8723 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8724 SwitchLayoutsBetweenClasses.
8726 * src/text2.C (InsertInset): checking of the new paragraph-function
8728 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8729 is not needed anymore here!
8732 (PasteSelection): redone (also with #ifdef) so that now this uses
8733 the CutAndPaste-Class.
8734 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8737 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8738 from/to text/insets.
8740 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8741 so that the paragraph knows if it is inside an (text)-inset.
8742 (InsertFromMinibuffer): changed return-value to bool as now it
8743 may happen that an inset is not inserted in the paragraph.
8744 (InsertInsetAllowed): this checks if it is allowed to insert an
8745 inset in this paragraph.
8747 (BreakParagraphConservative):
8748 (BreakParagraph) : small change for the above change of the return
8749 value of InsertFromMinibuffer.
8751 * src/lyxparagraph.h: added inset_owner and the functions to handle
8752 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8754 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8756 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8757 functions from BufferView to BufferView::Pimpl to ease maintence.
8759 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8760 correctly. Also use SetCursorIntern instead of SetCursor.
8762 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8765 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8767 * src/WorkArea.C (belowMouse): manually implement below mouse.
8769 * src/*: Add "explicit" on several constructors, I added probably
8770 some unneeded ones. A couple of changes to code because of this.
8772 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8773 implementation and private parts from the users of BufferView. Not
8776 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8777 implementation and private parts from the users of LyXLex. Not
8780 * src/BufferView_pimpl.[Ch]: new files
8782 * src/lyxlex_pimpl.[Ch]: new files
8784 * src/LyXView.[Ch]: some inline functions move out-of-line
8786 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8788 * src/lyxparagraph.h: make struct InsetTable public.
8790 * src/support/lyxstring.h: change lyxstring::difference_type to be
8791 ptrdiff_t. Add std:: modifiers to streams.
8793 * src/font.C: include the <cctype> header, for islower() and
8796 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8798 * src/font.[Ch]: new files. Contains the metric functions for
8799 fonts, takes a LyXFont as parameter. Better separation of concepts.
8801 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8802 changes because of this.
8804 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8806 * src/*: compile with -Winline and move functions that don't
8809 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8812 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8814 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8815 (various files changed because of this)
8817 * src/Painter.C (text): fixed the drawing of smallcaps.
8819 * src/lyxfont.[Ch] (drawText): removed unused member func.
8822 * src/*.C: added needed "using" statements and "std::" qualifiers.
8824 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8826 * src/*.h: removed all use of "using" from header files use
8827 qualifier std:: instead.
8829 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8831 * src/text.C (Backspace): some additional cleanups (we already
8832 know whether cursor.pos is 0 or not).
8834 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8835 automake does not provide one).
8837 * src/bmtable.h: replace C++ comments with C comments.
8839 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8841 * src/screen.C (ShowCursor): Change the shape of the cursor if
8842 the current language is not equal to the language of the document.
8843 (If the cursor change its shape unexpectedly, then you've found a bug)
8845 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8848 * src/insets/insetnumber.[Ch]: New files.
8850 * src/LyXAction.C (init)
8851 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8854 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8856 * src/lyxparagraph.h
8857 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8858 (the vector is kept sorted).
8860 * src/text.C (GetVisibleRow): Draw selection correctly when there
8861 is both LTR and RTL text.
8863 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8864 which is much faster.
8866 * src/text.C (GetVisibleRow and other): Do not draw the last space
8867 in a row if the direction of the last letter is not equal to the
8868 direction of the paragraph.
8870 * src/lyxfont.C (latexWriteStartChanges):
8871 Check that font language is not equal to basefont language.
8872 (latexWriteEndChanges): ditto
8874 * src/lyx_cb.C (StyleReset): Don't change the language while using
8875 the font-default command.
8877 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8878 empty paragraph before a footnote.
8880 * src/insets/insetcommand.C (draw): Increase x correctly.
8882 * src/screen.C (ShowCursor): Change cursor shape if
8883 current language != document language.
8885 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8887 2000-03-31 Juergen Vigna <jug@sad.it>
8889 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8890 (Clone): changed mode how the paragraph-data is copied to the
8891 new clone-paragraph.
8893 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8894 GetInset(pos) with no inset anymore there (in inset UNDO)
8896 * src/insets/insetcommand.C (draw): small fix as here x is
8897 incremented not as much as width() returns (2 before, 2 behind = 4)
8899 2000-03-30 Juergen Vigna <jug@sad.it>
8901 * src/insets/insettext.C (InsetText): small fix in initialize
8902 widthOffset (should not be done in the init() function)
8904 2000-03-29 Amir Karger <karger@lyx.org>
8906 * lib/examples/it_ItemizeBullets.lyx: translation by
8909 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8911 2000-03-29 Juergen Vigna <jug@sad.it>
8913 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8915 * src/insets/insetfoot.C (Clone): small change as for the below
8916 new init function in the text-inset
8918 * src/insets/insettext.C (init): new function as I've seen that
8919 clone did not copy the Paragraph-Data!
8920 (LocalDispatch): Added code so that now we have some sort of Undo
8921 functionality (well actually we HAVE Undo ;)
8923 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8925 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8927 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8930 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8932 * src/main.C: added a runtime check that verifies that the xforms
8933 header used when building LyX and the library used when running
8934 LyX match. Exit with a message if they don't match. This is a
8935 version number check only.
8937 * src/buffer.C (save): Don't allocate memory on the heap for
8938 struct utimbuf times.
8940 * *: some using changes, use iosfwd instead of the real headers.
8942 * src/lyxfont.C use char const * instead of string for the static
8943 strings. Rewrite some functions to use sstream.
8945 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8947 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8950 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8952 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8953 of Geodesy (from Martin Vermeer)
8955 * lib/layouts/svjour.inc: include file for the Springer svjour
8956 class. It can be used to support journals other than JoG.
8958 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8959 Miskiewicz <misiek@pld.org.pl>)
8960 * lib/reLyX/Makefile.am: ditto.
8962 2000-03-27 Juergen Vigna <jug@sad.it>
8964 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8965 also some modifications with operations on selected text.
8967 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8968 problems with clicking on insets (last famous words ;)
8970 * src/insets/insetcommand.C (draw):
8971 (width): Changed to have a bit of space before and after the inset so
8972 that the blinking cursor can be seen (otherwise it was hidden)
8974 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8976 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8977 would not be added to the link list when an installed gettext (not
8978 part of libc) is found.
8980 2000-03-24 Juergen Vigna <jug@sad.it>
8982 * src/insets/insetcollapsable.C (Edit):
8983 * src/mathed/formula.C (InsetButtonRelease):
8984 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8987 * src/BufferView.C (workAreaButtonPress):
8988 (workAreaButtonRelease):
8989 (checkInsetHit): Finally fixed the clicking on insets be handled
8992 * src/insets/insetert.C (Edit): inserted this call so that ERT
8993 insets work always with LaTeX-font
8995 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8997 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8998 caused lyx to startup with no GUI in place, causing in a crash
8999 upon startup when called with arguments.
9001 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9003 * src/FontLoader.C: better initialization of dummyXFontStruct.
9005 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9007 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9008 for linuxdoc and docbook import and export format options.
9010 * lib/lyxrc.example Example of default values for the previous flags.
9012 * src/lyx_cb.C Use those flags instead of the hardwired values for
9013 linuxdoc and docbook export.
9015 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9018 * src/menus.C Added menus entries for the new import/exports formats.
9020 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9022 * src/lyxrc.*: Added support for running without Gui
9025 * src/FontLoader.C: sensible defaults if no fonts are needed
9027 * src/lyx_cb.C: New function ShowMessage (writes either to the
9028 minibuffer or cout in case of no gui
9029 New function AskOverwrite for common stuff
9030 Consequently various changes to call these functions
9032 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9033 wild guess at sensible screen resolution when having no gui
9035 * src/lyxfont.C: no gui, no fonts... set some defaults
9037 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9039 * src/LColor.C: made the command inset background a bit lighter.
9041 2000-03-20 Hartmut Goebel <goebel@noris.net>
9043 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9044 stdstruct.inc. Koma-Script added some title elements which
9045 otherwise have been listed below "bibliography". This split allows
9046 adding title elements to where they belong.
9048 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9049 define the additional title elements and then include
9052 * many other layout files: changed to include stdtitle.inc just
9053 before stdstruct.inc.
9055 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9057 * src/buffer.C: (save) Added the option to store all backup files
9058 in a single directory
9060 * src/lyxrc.[Ch]: Added variable \backupdir_path
9062 * lib/lyxrc.example: Added descriptions of recently added variables
9064 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9065 bibtex inset, not closing the bibtex popup when deleting the inset)
9067 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9069 * src/lyx_cb.C: add a couple using directives.
9071 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9072 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9073 import based on the filename.
9075 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9076 file would be imported at start, if the filename where of a sgml file.
9078 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9080 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9082 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9083 * src/lyxfont.h Replaced the member variable bits.direction by the
9084 member variable lang. Made many changes in other files.
9085 This allows having a multi-lingual document
9087 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9088 that change the current language to <l>.
9089 Removed the command "font-rtl"
9091 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9092 format for Hebrew documents)
9094 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9095 When auto_mathmode is "true", pressing a digit key in normal mode
9096 will cause entering into mathmode.
9097 If auto_mathmode is "rtl" then this behavior will be active only
9098 when writing right-to-left text.
9100 * src/text2.C (InsertStringA) The string is inserted using the
9103 * src/paragraph.C (GetEndLabel) Gives a correct result for
9104 footnote paragraphs.
9106 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9108 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9110 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9111 front of PasteParagraph. Never insert a ' '. This should at least
9112 fix some cause for the segfaults that we have been experiencing,
9113 it also fixes backspace behaviour slightly. (Phu!)
9115 * src/support/lstrings.C (compare_no_case): some change to make it
9116 compile with gcc 2.95.2 and stdlibc++-v3
9118 * src/text2.C (MeltFootnoteEnvironment): change type o
9119 first_footnote_par_is_not_empty to bool.
9121 * src/lyxparagraph.h: make text private. Changes in other files
9123 (fitToSize): new function
9124 (setContentsFromPar): new function
9125 (clearContents): new function
9126 (SetChar): new function
9128 * src/paragraph.C (readSimpleWholeFile): deleted.
9130 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9131 the file, just use a simple string instead. Also read the file in
9132 a more maintainable manner.
9134 * src/text2.C (InsertStringA): deleted.
9135 (InsertStringB): deleted.
9137 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9139 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9140 RedoParagraphs from the doublespace handling part, just set status
9141 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9142 done, but perhaps not like this.)
9144 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9146 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9147 character when inserting an inset.
9149 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9151 * src/bufferparams.C (readLanguage): now takes "default" into
9154 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9155 also initialize the toplevel_keymap with the default bindings from
9158 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9160 * all files using lyxrc: have lyxrc as a real variable and not a
9161 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9164 * src/lyxrc.C: remove double call to defaultKeyBindings
9166 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9167 toolbar defauls using lyxlex. Remove enums, structs, functions
9170 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9171 toolbar defaults. Also store default keybindings in a map.
9173 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9174 storing the toolbar defaults without any xforms dependencies.
9176 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9177 applied. Changed to use iterators.
9179 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9181 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9182 systems that don't have LINGUAS set to begin with.
9184 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9186 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9187 the list by Dekel Tsur.
9189 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9191 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9192 * src/insets/form_graphics.C: ditto.
9194 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9196 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9198 * src/bufferparams.C (readLanguage): use the new language map
9200 * src/intl.C (InitKeyMapper): use the new language map
9202 * src/lyx_gui.C (create_forms): use the new language map
9204 * src/language.[Ch]: New files. Used for holding the information
9205 about each language. Now! Use this new language map enhance it and
9206 make it really usable for our needs.
9208 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9210 * screen.C (ShowCursor): Removed duplicate code.
9211 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9212 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9214 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9217 * src/text.C Added TransformChar method. Used for rendering Arabic
9218 text correctly (change the glyphs of the letter according to the
9219 position in the word)
9224 * src/lyxrc.C Added lyxrc command {language_command_begin,
9225 language_command_end,language_command_ltr,language_command_rtl,
9226 language_package} which allows the use of either arabtex or Omega
9229 * src/lyx_gui.C (init)
9231 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9232 to use encoding for menu fonts which is different than the encoding
9235 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9236 do not load the babel package.
9237 To write an English document with Hebrew/Arabic, change the document
9238 language to "english".
9240 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9241 (alphaCounter): changed to return char
9242 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9244 * lib/lyxrc.example Added examples for Hebrew/Arabic
9247 * src/layout.C Added layout command endlabeltype
9249 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9251 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9253 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9255 * src/mathed/math_delim.C (search_deco): return a
9256 math_deco_struct* instead of index.
9258 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9260 * All files with a USE_OSTREAM_ONLY within: removed all code that
9261 was unused when USE_OSTREAM_ONLY is defined.
9263 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9264 of any less. Removed header and using.
9266 * src/text.C (GetVisibleRow): draw the string "Page Break
9267 (top/bottom)" on screen when drawing a pagebreak line.
9269 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9271 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9273 * src/mathed/math_macro.C (draw): do some cast magic.
9276 * src/mathed/math_defs.h: change byte* argument to byte const*.
9278 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9280 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9281 know it is right to return InsetFoot* too, but cxx does not like
9284 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9286 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9288 * src/mathed/math_delim.C: change == to proper assignment.
9290 2000-03-09 Juergen Vigna <jug@sad.it>
9292 * src/insets/insettext.C (setPos): fixed various cursor positioning
9293 problems (via mouse and cursor-keys)
9294 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9295 inset (still a small display problem but it works ;)
9297 * src/insets/insetcollapsable.C (draw): added button_top_y and
9298 button_bottom_y to have correct values for clicking on the inset.
9300 * src/support/lyxalgo.h: commented out 'using std::less'
9302 2000-03-08 Juergen Vigna <jug@sad.it>
9304 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9305 Button-Release event closes as it is alos the Release-Event
9308 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9310 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9312 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9313 can add multiple spaces in Scrap (literate programming) styles...
9314 which, by the way, is how I got hooked on LyX to begin with.
9316 * src/mathed/formula.C (Write): Added dummy variable to an
9317 inset::Latex() call.
9318 (Latex): Add free_spacing boolean to inset::Latex()
9320 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9322 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9323 virtual function to include the free_spacing boolean from
9324 the containing paragraph's style.
9326 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9327 Added free_spacing boolean arg to match inset.h
9329 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9330 Added free_spacing boolean arg to match inset.h
9332 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9333 Added free_spacing boolean and made sure that if in a free_spacing
9334 paragraph, that we output normal space if there is a protected space.
9336 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9337 Added free_spacing boolean arg to match inset.h
9339 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9340 Added free_spacing boolean arg to match inset.h
9342 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9343 Added free_spacing boolean arg to match inset.h
9345 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9346 Added free_spacing boolean arg to match inset.h
9348 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9349 Added free_spacing boolean arg to match inset.h
9351 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9352 free_spacing boolean arg to match inset.h
9354 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9355 Added free_spacing boolean arg to match inset.h
9357 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9358 Added free_spacing boolean arg to match inset.h
9360 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9361 Added free_spacing boolean arg to match inset.h
9363 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9364 Added free_spacing boolean arg to match inset.h
9366 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9367 Added free_spacing boolean arg to match inset.h
9369 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9370 free_spacing boolean arg to match inset.h
9372 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9373 free_spacing boolean arg to match inset.h
9375 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9376 ignore free_spacing paragraphs. The user's spaces are left
9379 * src/text.C (InsertChar): Fixed the free_spacing layout
9380 attribute behavior. Now, if free_spacing is set, you can
9381 add multiple spaces in a paragraph with impunity (and they
9382 get output verbatim).
9383 (SelectSelectedWord): Added dummy argument to inset::Latex()
9386 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9389 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9390 paragraph layouts now only input a simple space instead.
9391 Special character insets don't make any sense in free-spacing
9394 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9395 hard-spaces in the *input* file to simple spaces if the layout
9396 is free-spacing. This converts old files which had to have
9397 hard-spaces in free-spacing layouts where a simple space was
9399 (writeFileAscii): Added free_spacing check to pass to the newly
9400 reworked inset::Latex(...) methods. The inset::Latex() code
9401 ensures that hard-spaces in free-spacing paragraphs get output
9402 as spaces (rather than "~").
9404 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9406 * src/mathed/math_delim.C (draw): draw the empty placeholder
9407 delims with a onoffdash line.
9408 (struct math_deco_compare): struct that holds the "functors" used
9409 for the sort and the binary search in math_deco_table.
9410 (class init_deco_table): class used for initial sort of the
9412 (search_deco): use lower_bound to do a binary search in the
9415 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9417 * src/lyxrc.C: a small secret thingie...
9419 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9420 and to not flush the stream as often as it used to.
9422 * src/support/lyxalgo.h: new file
9423 (sorted): template function used for checking if a sequence is
9424 sorted or not. Two versions with and without user supplied
9425 compare. Uses same compare as std::sort.
9427 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9428 it and give warning on lyxerr.
9430 (struct compare_tags): struct with function operators used for
9431 checking if sorted, sorting and lower_bound.
9432 (search_kw): use lower_bound instead of manually implemented
9435 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9437 * src/insets/insetcollapsable.h: fix Clone() declaration.
9438 * src/insets/insetfoot.h: ditto.
9440 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9442 2000-03-08 Juergen Vigna <jug@sad.it>
9444 * src/insets/lyxinset.h: added owner call which tells us if
9445 this inset is inside another inset. Changed also the return-type
9446 of Editable to an enum so it tells clearer what the return-value is.
9448 * src/insets/insettext.C (computeTextRows): fixed computing of
9449 textinsets which split automatically on more rows.
9451 * src/insets/insetert.[Ch]: changed this to be of BaseType
9454 * src/insets/insetfoot.[Ch]: added footnote inset
9456 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9457 collapsable insets (like footnote, ert, ...)
9459 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9461 * src/lyxdraw.h: remvoe file
9463 * src/lyxdraw.C: remove file
9465 * src/insets/insettext.C: added <algorithm>.
9467 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9469 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9470 (matrix_cb): case MM_OK use string stream
9472 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9475 * src/mathed/math_macro.C (draw): use string stream
9476 (Metrics): use string stream
9478 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9479 directly to the ostream.
9481 * src/vspace.C (asString): use string stream.
9482 (asString): use string stream
9483 (asLatexString): use string stream
9485 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9486 setting Spacing::Other.
9488 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9489 sprintf when creating the stretch vale.
9491 * src/text2.C (alphaCounter): changed to return a string and to
9492 not use a static variable internally. Also fixed a one-off bug.
9493 (SetCounter): changed the drawing of the labels to use string
9494 streams instead of sprintf.
9496 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9497 manipulator to use a scheme that does not require library support.
9498 This is also the way it is done in the new GNU libstdc++. Should
9499 work with DEC cxx now.
9501 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9503 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9504 end. This fixes a bug.
9506 * src/mathed (all files concerned with file writing): apply the
9507 USE_OSTREAM_ONLY changes to mathed too.
9509 * src/support/DebugStream.h: make the constructor explicit.
9511 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9512 count and ostream squashed.
9514 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9516 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9518 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9519 ostringstream uses STL strings, and we might not.
9521 * src/insets/insetspecialchar.C: add using directive.
9522 * src/insets/insettext.C: ditto.
9524 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9526 * lib/layouts/seminar.layout: feeble attempt at a layout for
9527 seminar.cls, far from completet and could really use some looking
9528 at from people used to write layout files.
9530 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9531 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9532 a lot nicer and works nicely with ostreams.
9534 * src/mathed/formula.C (draw): a slightly different solution that
9535 the one posted to the list, but I think this one works too. (font
9536 size wrong in headers.)
9538 * src/insets/insettext.C (computeTextRows): some fiddling on
9539 Jürgens turf, added some comments that he should read.
9541 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9542 used and it gave compiler warnings.
9543 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9546 * src/lyx_gui.C (create_forms): do the right thing when
9547 show_banner is true/false.
9549 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9550 show_banner is false.
9552 * most file writing files: Now use iostreams to do almost all of
9553 the writing. Also instead of passing string &, we now use
9554 stringstreams. mathed output is still not adapted to iostreams.
9555 This change can be turned off by commenting out all the occurences
9556 of the "#define USE_OSTREAM_ONLY 1" lines.
9558 * src/WorkArea.C (createPixmap): don't output debug messages.
9559 (WorkArea): don't output debug messages.
9561 * lib/lyxrc.example: added a comment about the new variable
9564 * development/Code_rules/Rules: Added some more commente about how
9565 to build class interfaces and on how better encapsulation can be
9568 2000-03-03 Juergen Vigna <jug@sad.it>
9570 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9571 automatically with the width of the LyX-Window
9573 * src/insets/insettext.C (computeTextRows): fixed update bug in
9574 displaying text-insets (scrollvalues where not initialized!)
9576 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9578 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9579 id in the check of the result from lower_bound is not enough since
9580 lower_bound can return last too, and then res->id will not be a
9583 * all insets and some code that use them: I have conditionalized
9584 removed the Latex(string & out, ...) this means that only the
9585 Latex(ostream &, ...) will be used. This is a work in progress to
9586 move towards using streams for all output of files.
9588 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9591 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9593 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9594 routine (this fixes bug where greek letters were surrounded by too
9597 * src/support/filetools.C (findtexfile): change a bit the search
9598 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9599 no longer passed to kpsewhich, we may have to change that later.
9601 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9602 warning options to avoid problems with X header files (from Angus
9604 * acinclude.m4: regenerated.
9606 2000-03-02 Juergen Vigna <jug@sad.it>
9608 * src/insets/insettext.C (WriteParagraphData): Using the
9609 par->writeFile() function for writing paragraph-data.
9610 (Read): Using buffer->parseSingleLyXformat2Token()-function
9611 for parsing paragraph data!
9613 * src/buffer.C (readLyXformat2): removed all parse data and using
9614 the new parseSingleLyXformat2Token()-function.
9615 (parseSingleLyXformat2Token): added this function to parse (read)
9616 lyx-file-format (this is called also from text-insets now!)
9618 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9620 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9623 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9624 directly instead of going through a func. One very bad thing: a
9625 static LyXFindReplace, but I don't know where to place it.
9627 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9628 string instead of char[]. Also changed to static.
9629 (GetSelectionOrWordAtCursor): changed to static inline
9630 (SetSelectionOverLenChars): ditto.
9632 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9633 current_view and global variables. both classes has changed names
9634 and LyXFindReplace is not inherited from SearchForm.
9636 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9637 fl_form_search form.
9639 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9641 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9643 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9644 bound (from Kayvan).
9646 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9648 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9650 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9652 * some things that I should comment but the local pub says head to
9655 * comment out all code that belongs to the Roff code for Ascii
9656 export of tables. (this is unused)
9658 * src/LyXView.C: use correct type for global variable
9659 current_layout. (LyXTextClass::size_type)
9661 * some code to get the new insetgraphics closer to working I'd be
9662 grateful for any help.
9664 * src/BufferView2.C (insertInset): use the return type of
9665 NumberOfLayout properly. (also changes in other files)
9667 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9668 this as a test. I want to know what breaks because of this.
9670 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9672 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9674 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9675 to use a \makebox in the label, this allows proper justification
9676 with out using protected spaces or multiple hfills. Now it is
9677 "label" for left justified, "\hfill label\hfill" for center, and
9678 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9679 should be changed accordingly.
9681 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9683 * src/lyxtext.h: change SetLayout() to take a
9684 LyXTextClass::size_type instead of a char (when there is more than
9685 127 layouts in a class); also change type of copylayouttype.
9686 * src/text2.C (SetLayout): ditto.
9687 * src/LyXView.C (updateLayoutChoice): ditto.
9689 * src/LaTeX.C (scanLogFile): errors where the line number was not
9690 given just after the '!'-line were ignored (from Dekel Tsur).
9692 * lib/lyxrc.example: fix description of \date_insert_format
9694 * lib/layouts/llncs.layout: new layout, contributed by Martin
9697 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9699 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9700 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9701 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9702 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9703 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9704 paragraph.C, text.C, text2.C)
9706 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9708 * src/insets/insettext.C (LocalDispatch): remove extra break
9711 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9712 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9714 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9715 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9717 * src/insets/insetbib.h: move InsetBibkey::Holder and
9718 InsetCitation::Holder in public space.
9720 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9722 * src/insets/insettext.h: small change to get the new files from
9723 Juergen to compile (use "string", not "class string").
9725 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9726 const & as parameter to LocalDispatch, use LyXFont const & as
9727 paramter to some other func. This also had impacto on lyxinsets.h
9728 and the two mathed insets.
9730 2000-02-24 Juergen Vigna <jug@sad.it>
9733 * src/commandtags.h:
9735 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9739 * src/BufferView2.C: added/updated code for various inset-functions
9741 * src/insets/insetert.[Ch]: added implementation of InsetERT
9743 * src/insets/insettext.[Ch]: added implementation of InsetText
9745 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9746 (draw): added preliminary code for inset scrolling not finshed yet
9748 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9749 as it is in lyxfunc.C now
9751 * src/insets/lyxinset.h: Added functions for text-insets
9753 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9755 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9756 BufferView and reimplement the list as a queue put inside its own
9759 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9761 * several files: use the new interface to the "updateinsetlist"
9763 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9765 (work_area_handler): call BufferView::trippleClick on trippleclick.
9767 * src/BufferView.C (doubleClick): new function, selects word on
9769 (trippleClick): new function, selects line on trippleclick.
9771 2000-02-22 Allan Rae <rae@lyx.org>
9773 * lib/bind/xemacs.bind: buffer-previous not supported
9775 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9777 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9780 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9782 * src/bufferlist.C: get rid of current_view from this file
9784 * src/spellchecker.C: get rid of current_view from this file
9786 * src/vspace.C: get rid of current_view from this file
9787 (inPixels): added BufferView parameter for this func
9788 (asLatexCommand): added a BufferParams for this func
9790 * src/text.C src/text2.C: get rid of current_view from these
9793 * src/lyxfont.C (getFontDirection): move this function here from
9796 * src/bufferparams.C (getDocumentDirection): move this function
9799 * src/paragraph.C (getParDirection): move this function here from
9801 (getLetterDirection): ditto
9803 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9805 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9806 resize due to wrong pixmap beeing used. Also took the opurtunity
9807 to make the LyXScreen stateless on regard to WorkArea and some
9808 general cleanup in the same files.
9810 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9812 * src/Makefile.am: add missing direction.h
9814 * src/PainterBase.h: made the width functions const.
9816 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9819 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9821 * src/insets/insetlatexaccent.C (draw): make the accents draw
9822 better, at present this will only work well with iso8859-1.
9824 * several files: remove the old drawing code, now we use the new
9827 * several files: remove support for mono_video, reverse_video and
9830 2000-02-17 Juergen Vigna <jug@sad.it>
9832 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9833 int ** as we have to return the pointer, otherwise we have only
9834 NULL pointers in the returning function.
9836 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9838 * src/LaTeX.C (operator()): quote file name when running latex.
9840 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9842 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9843 (bubble tip), this removes our special handling of this.
9845 * Remove all code that is unused now that we have the new
9846 workarea. (Code that are not active when NEW_WA is defined.)
9848 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9850 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9852 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9853 nonexisting layout; correctly redirect obsoleted layouts.
9855 * lib/lyxrc.example: document \view_dvi_paper_option
9857 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9860 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9861 (PreviewDVI): handle the view_dvi_paper_option variable.
9862 [Both from Roland Krause]
9864 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9866 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9867 char const *, int, LyXFont)
9868 (text(int, int, string, LyXFont)): ditto
9870 * src/text.C (InsertCharInTable): attempt to fix the double-space
9871 feature in tables too.
9872 (BackspaceInTable): ditto.
9873 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9875 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9877 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9879 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9880 newly found text in textcache to this.
9881 (buffer): set the owner of the text put into the textcache to 0
9883 * src/insets/figinset.C (draw): fixed the drawing of figures with
9886 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9887 drawing of mathframe, hfills, protected space, table lines. I have
9888 now no outstanding drawing problems with the new Painter code.
9890 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9892 * src/PainterBase.C (ellipse, circle): do not specify the default
9895 * src/LColor.h: add using directive.
9897 * src/Painter.[Ch]: change return type of methods from Painter& to
9898 PainterBase&. Add a using directive.
9900 * src/WorkArea.C: wrap xforms callbacks in C functions
9903 * lib/layouts/foils.layout: font fix and simplifications from Carl
9906 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9908 * a lot of files: The Painter, LColor and WorkArea from the old
9909 devel branch has been ported to lyx-devel. Some new files and a
9910 lot of #ifdeffed code. The new workarea is enabled by default, but
9911 if you want to test the new Painter and LColor you have to compile
9912 with USE_PAINTER defined (do this in config.h f.ex.) There are
9913 still some rought edges, and I'd like some help to clear those
9914 out. It looks stable (loads and displays the Userguide very well).
9917 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9919 * src/buffer.C (pop_tag): revert to the previous implementation
9920 (use a global variable for both loops).
9922 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9924 * src/lyxrc.C (LyXRC): change slightly default date format.
9926 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9927 there is an English text with a footnote that starts with a Hebrew
9928 paragraph, or vice versa.
9929 (TeXFootnote): ditto.
9931 * src/text.C (LeftMargin): allow for negative values for
9932 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9935 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9936 for input encoding (cyrillic)
9938 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9940 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9943 * src/toolbar.C (set): ditto
9944 * src/insets/insetbib.C (create_form_citation_form): ditto
9946 * lib/CREDITS: added Dekel Tsur.
9948 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9949 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9950 hebrew supports files from Dekel Tsur.
9952 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9953 <tzafrir@technion.ac.il>
9955 * src/lyxrc.C: put \date_insert_format at the right place.
9957 * src/buffer.C (makeLaTeXFile): fix the handling of
9958 BufferParams::sides when writing out latex files.
9960 * src/BufferView2.C: add a "using" directive.
9962 * src/support/lyxsum.C (sum): when we use lyxstring,
9963 ostringstream::str needs an additional .c_str().
9965 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9967 * src/support/filetools.C (ChangeExtension): patch from Etienne
9970 * src/TextCache.C (show): remove const_cast and make second
9971 parameter non-const LyXText *.
9973 * src/TextCache.h: use non const LyXText in show.
9975 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9978 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9980 * src/support/lyxsum.C: rework to be more flexible.
9982 * several places: don't check if a pointer is 0 if you are going
9985 * src/text.C: remove some dead code.
9987 * src/insets/figinset.C: remove some dead code
9989 * src/buffer.C: move the BufferView funcs to BufferView2.C
9990 remove all support for insetlatexdel
9991 remove support for oldpapersize stuff
9992 made some member funcs const
9994 * src/kbmap.C: use a std::list to store the bindings in.
9996 * src/BufferView2.C: new file
9998 * src/kbsequence.[Ch]: new files
10000 * src/LyXAction.C + others: remove all trace of buffer-previous
10002 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10003 only have one copy in the binary of this table.
10005 * hebrew patch: moved some functions from LyXText to more
10006 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10008 * several files: remove support for XForms older than 0.88
10009 whitespace changes.
10010 remove some #if 0 #endif code
10012 * src/TextCache.[Ch]: new file. Holds the textcache.
10014 * src/BufferView.C: changes to use the new TextCache interface.
10015 (waitForX): remove the now unused code.
10017 * src/BackStack.h: remove some commented code
10019 * lib/bind/emacs.bind: remove binding for buffer-previous
10021 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10023 * applied the hebrew patch.
10025 * src/lyxrow.h: make sure that all Row variables are initialized.
10027 * src/text2.C (TextHandleUndo): comment out a delete, this might
10028 introduce a memory leak, but should also help us to not try to
10029 read freed memory. We need to look at this one.
10031 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10032 (LyXParagraph): initalize footnotekind.
10034 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10035 forgot this when applying the patch. Please heed the warnings.
10037 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10038 (aka. reformat problem)
10040 * src/bufferlist.C (exists): made const, and use const_iterator
10041 (isLoaded): new func.
10042 (release): use std::find to find the correct buffer.
10044 * src/bufferlist.h: made getState a const func.
10045 made empty a const func.
10046 made exists a const func.
10049 2000-02-01 Juergen Vigna <jug@sad.it>
10051 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10053 * po/it.po: updated a bit the italian po file and also changed the
10054 'file nuovo' for newfile to 'filenuovo' without a space, this did
10057 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10058 for the new insert_date command.
10060 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10061 from jdblair, to insert a date into the current text conforming to
10062 a strftime format (for now only considering the locale-set and not
10063 the document-language).
10065 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10067 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10068 Bounds Read error seen by purify. The problem was that islower is
10069 a macros which takes an unsigned char and uses it as an index for
10070 in array of characters properties (and is thus subject to the
10074 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10075 correctly the paper sides radio buttons.
10076 (UpdateDocumentButtons): ditto.
10078 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10080 * src/kbmap.C (getsym + others): change to return unsigned int,
10081 returning a long can give problems on 64 bit systems. (I assume
10082 that int is 32bit on 64bit systems)
10084 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10086 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10087 LyXLookupString to be zero-terminated. Really fixes problems seen
10088 by purify, I think.
10090 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10092 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10093 write a (char*)0 to the lyxerr stream.
10095 * src/lastfiles.C: move algorithm before the using statemets.
10097 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10099 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10100 complains otherwise).
10101 * src/table.C: ditto
10103 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10106 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10107 that I removed earlier... It is really needed.
10109 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10111 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10113 * INSTALL: update xforms home page URL.
10115 * lib/configure.m4: fix a bug with unreadable layout files.
10117 * src/table.C (calculate_width_of_column): add "using std::max"
10120 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10122 * several files: marked several lines with "DEL LINE", this is
10123 lines that can be deleted without changing anything.
10124 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10125 checks this anyway */
10128 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10130 * src/DepTable.C (update): add a "+" at the end when the checksum
10131 is different. (debugging string only)
10133 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10134 the next inset to not be displayed. This should also fix the list
10135 of labels in the "Insert Crossreference" dialog.
10137 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10139 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10140 when regex was not found.
10142 * src/support/lstrings.C (lowercase): use handcoded transform always.
10145 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10146 old_cursor.par->prev could be 0.
10148 * several files: changed post inc/dec to pre inc/dec
10150 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10151 write the lastfiles to file.
10153 * src/BufferView.C (buffer): only show TextCache info when debugging
10155 (resizeCurrentBuffer): ditto
10156 (workAreaExpose): ditto
10158 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10160 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10162 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10163 a bit better by removing the special case for \i and \j.
10165 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10167 * src/lyx_main.C (easyParse): remove test for bad comand line
10168 options, since this broke all xforms-related parsing.
10170 * src/kbmap.C (getsym): set return type to unsigned long, as
10171 declared in header. On an alpha, long is _not_ the same as int.
10173 * src/support/LOstream.h: add a "using std::flush;"
10175 * src/insets/figinset.C: ditto.
10177 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10179 * src/bufferlist.C (write): use blinding fast file copy instead of
10180 "a char at a time", now we are doing it the C++ way.
10182 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10183 std::list<int> instead.
10184 (addpidwait): reflect move to std::list<int>
10185 (sigchldchecker): ditto
10187 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10190 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10191 that obviously was wrong...
10193 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10194 c, this avoids warnings with purify and islower.
10196 * src/insets/figinset.C: rename struct queue to struct
10197 queue_element and rewrite to use a std::queue. gsqueue is now a
10198 std::queue<queue_element>
10199 (runqueue): reflect move to std::queue
10202 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10203 we would get "1" "0" instead of "true" "false. Also make the tostr
10206 2000-01-21 Juergen Vigna <jug@sad.it>
10208 * src/buffer.C (writeFileAscii): Disabled code for special groff
10209 handling of tabulars till I fix this in table.C
10211 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10213 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10215 * src/support/lyxlib.h: ditto.
10217 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10219 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10220 and 'j' look better. This might fix the "macron" bug that has been
10223 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10224 functions as one template function. Delete the old versions.
10226 * src/support/lyxsum.C: move using std::ifstream inside
10229 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10232 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10234 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10236 * src/insets/figinset.C (InitFigures): use new instead of malloc
10237 to allocate memory for figures and bitmaps.
10238 (DoneFigures): use delete[] instead of free to deallocate memory
10239 for figures and bitmaps.
10240 (runqueue): use new to allocate
10241 (getfigdata): use new/delete[] instead of malloc/free
10242 (RegisterFigure): ditto
10244 * some files: moved some declarations closer to first use, small
10245 whitespace changes use preincrement instead of postincrement where
10246 it does not make a difference.
10248 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10249 step on the way to use stl::containers for key maps.
10251 * src/bufferlist.h: add a typedef for const_iterator and const
10252 versions of begin and end.
10254 * src/bufferlist.[Ch]: change name of member variable _state to
10255 state_. (avoid reserved names)
10257 (getFileNames): returns the filenames of the buffers in a vector.
10259 * configure.in (ALL_LINGUAS): added ro
10261 * src/support/putenv.C: new file
10263 * src/support/mkdir.C: new file
10265 2000-01-20 Allan Rae <rae@lyx.org>
10267 * lib/layouts/IEEEtran.layout: Added several theorem environments
10269 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10270 couple of minor additions.
10272 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10273 (except for those in footnotes of course)
10275 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10277 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10279 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10280 std::sort and std::lower_bound instead of qsort and handwritten
10282 (struct compara): struct that holds the functors used by std::sort
10283 and std::lower_bound in MathedLookupBOP.
10285 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10287 * src/support/LAssert.h: do not do partial specialization. We do
10288 not really need it.
10290 * src/support/lyxlib.h: note that lyx::getUserName() and
10291 lyx::date() are not in use right now. Should these be suppressed?
10293 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10294 (makeLinuxDocFile): do not put date and user name in linuxdoc
10297 * src/support/lyxlib.h (kill): change first argument to long int,
10298 since that's what solaris uses.
10300 * src/support/kill.C (kill): fix declaration to match prototype.
10302 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10303 actually check whether namespaces are supported. This is not what
10306 * src/support/lyxsum.C: add a using directive.
10308 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10310 * src/support/kill.C: if we have namespace support we don't have
10311 to include lyxlib.h.
10313 * src/support/lyxlib.h: use namespace lyx if supported.
10315 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10317 * src/support/date.C: new file
10319 * src/support/chdir.C: new file
10321 * src/support/getUserName.C: new file
10323 * src/support/getcwd.C: new file
10325 * src/support/abort.C: new file
10327 * src/support/kill.C: new file
10329 * src/support/lyxlib.h: moved all the functions in this file
10330 insede struct lyx. Added also kill and abort to this struct. This
10331 is a way to avoid the "kill is not defined in <csignal>", we make
10332 C++ wrappers for functions that are not ANSI C or ANSI C++.
10334 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10335 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10336 lyx it has been renamed to sum.
10338 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10340 * src/text.C: add using directives for std::min and std::max.
10342 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10344 * src/texrow.C (getIdFromRow): actually return something useful in
10345 id and pos. Hopefully fixes the bug with positionning of errorbox
10348 * src/lyx_main.C (easyParse): output an error and exit if an
10349 incorrect command line option has been given.
10351 * src/spellchecker.C (ispell_check_word): document a memory leak.
10353 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10354 where a "struct utimbuf" is allocated with "new" and deleted with
10357 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10359 * src/text2.C (CutSelection): don't delete double spaces.
10360 (PasteSelection): ditto
10361 (CopySelection): ditto
10363 * src/text.C (Backspace): don't delete double spaces.
10365 * src/lyxlex.C (next): fix a bug that were only present with
10366 conformant std::istream::get to read comment lines, use
10367 std::istream::getline instead. This seems to fix the problem.
10369 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10371 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10372 allowed to insert space before space" editing problem. Please read
10373 commends at the beginning of the function. Comments about usage
10376 * src/text.C (InsertChar): fix for the "not allowed to insert
10377 space before space" editing problem.
10379 * src/text2.C (DeleteEmptyParagraphMechanism): when
10380 IsEmptyTableRow can only return false this last "else if" will
10381 always be a no-op. Commented out.
10383 * src/text.C (RedoParagraph): As far as I can understand tmp
10384 cursor is not really needed.
10386 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10387 present it could only return false anyway.
10388 (several functions): Did something not so smart...added a const
10389 specifier on a lot of methods.
10391 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10392 and add a tmp->text.resize. The LyXParagraph constructor does the
10394 (BreakParagraphConservative): ditto
10396 * src/support/path.h (Path): add a define so that the wrong usage
10397 "Path("/tmp") will be flagged as a compilation error:
10398 "`unnamed_Path' undeclared (first use this function)"
10400 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10402 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10403 which was bogus for several reasons.
10405 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10407 (runBibTeX): ditto.
10409 * autogen.sh: do not use "type -path" (what's that anyway?).
10411 * src/support/filetools.C (findtexfile): remove extraneous space
10412 which caused a kpsewhich warning (at least with kpathsea version
10415 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10417 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10419 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10421 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10423 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10425 * src/paragraph.C (BreakParagraph): do not reserve space on text
10426 if we don't need to (otherwise, if pos_end < pos, we end up
10427 reserving huge amounts of memory due to bad unsigned karma).
10428 (BreakParagraphConservative): ditto, although I have not seen
10429 evidence the bug can happen here.
10431 * src/lyxparagraph.h: add a using std::list.
10433 2000-01-11 Juergen Vigna <jug@sad.it>
10435 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10436 could not be found.
10438 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10440 * src/vc-backend.C (doVCCommand): change to be static and take one
10441 more parameter: the path to chdir too be fore executing the command.
10442 (retrive): new function equiv to "co -r"
10444 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10445 file_not_found_hook is true.
10447 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10449 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10450 if a file is readwrite,readonly...anything else.
10452 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10454 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10455 (CreatePostscript): name change from MenuRunDVIPS (or something)
10456 (PreviewPostscript): name change from MenuPreviewPS
10457 (PreviewDVI): name change from MenuPreviewDVI
10459 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10460 \view_pdf_command., \pdf_to_ps_command
10462 * lib/configure.m4: added search for PDF viewer, and search for
10463 PDF to PS converter.
10464 (lyxrc.defaults output): add \pdflatex_command,
10465 \view_pdf_command and \pdf_to_ps_command.
10467 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10469 * src/bufferlist.C (write): we don't use blocksize for anything so
10472 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10474 * src/support/block.h: disable operator T* (), since it causes
10475 problems with both compilers I tried. See comments in the file.
10477 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10480 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10481 variable LYX_DIR_10x to LYX_DIR_11x.
10483 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10485 * INSTALL: document --with-lyxname.
10488 * configure.in: new configure flag --with-lyxname which allows to
10489 choose the name under which lyx is installed. Default is "lyx", of
10490 course. It used to be possible to do this with --program-suffix,
10491 but the later has in fact a different meaning for autoconf.
10493 * src/support/lstrings.h (lstrchr): reformat a bit.
10495 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10496 * src/mathed/math_defs.h: ditto.
10498 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10500 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10501 true, decides if we create a backup file or not when saving. New
10502 tag and variable \pdf_mode, defaults to false. New tag and
10503 variable \pdflatex_command, defaults to pdflatex. New tag and
10504 variable \view_pdf_command, defaults to xpdf. New tag and variable
10505 \pdf_to_ps_command, defaults to pdf2ps.
10507 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10509 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10510 does not have a BufferView.
10511 (unlockInset): ditto + don't access the_locking_inset if the
10512 buffer does not have a BufferView.
10514 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10515 certain circumstances so that we don't continue a keyboard
10516 operation long after the key was released. Try f.ex. to load a
10517 large document, press PageDown for some seconds and then release
10518 it. Before this change the document would contine to scroll for
10519 some time, with this change it stops imidiatly.
10521 * src/support/block.h: don't allocate more space than needed. As
10522 long as we don't try to write to the arr[x] in a array_type arr[x]
10523 it is perfectly ok. (if you write to it you might segfault).
10524 added operator value_type*() so that is possible to pass the array
10525 to functions expecting a C-pointer.
10527 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10530 * intl/*: updated to gettext 0.10.35, tried to add our own
10531 required modifications. Please verify.
10533 * po/*: updated to gettext 0.10.35, tried to add our own required
10534 modifications. Please verify.
10536 * src/support/lstrings.C (tostr): go at fixing the problem with
10537 cxx and stringstream. When stringstream is used return
10538 oss.str().c_str() so that problems with lyxstring and basic_string
10539 are avoided. Note that the best solution would be for cxx to use
10540 basic_string all the way, but it is not conformant yet. (it seems)
10542 * src/lyx_cb.C + other files: moved several global functions to
10543 class BufferView, some have been moved to BufferView.[Ch] others
10544 are still located in lyx_cb.C. Code changes because of this. (part
10545 of "get rid of current_view project".)
10547 * src/buffer.C + other files: moved several Buffer functions to
10548 class BufferView, the functions are still present in buffer.C.
10549 Code changes because of this.
10551 * config/lcmessage.m4: updated to most recent. used when creating
10554 * config/progtest.m4: updated to most recent. used when creating
10557 * config/gettext.m4: updated to most recent. applied patch for
10560 * config/gettext.m4.patch: new file that shows what changes we
10561 have done to the local copy of gettext.m4.
10563 * config/libtool.m4: new file, used in creation of acinclude.m4
10565 * config/lyxinclude.m4: new file, this is the lyx created m4
10566 macros, used in making acinclude.m4.
10568 * autogen.sh: GNU m4 discovered as a separate task not as part of
10569 the lib/configure creation.
10570 Generate acinlucde from files in config. Actually cat
10571 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10572 easier to upgrade .m4 files that really are external.
10574 * src/Spacing.h: moved using std::istringstream to right after
10575 <sstream>. This should fix the problem seen with some compilers.
10577 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10579 * src/lyx_cb.C: began some work to remove the dependency a lot of
10580 functions have on BufferView::text, even if not really needed.
10581 (GetCurrentTextClass): removed this func, it only hid the
10584 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10585 forgot this in last commit.
10587 * src/Bullet.C (bulletEntry): use static char const *[] for the
10588 tables, becuase of this the return arg had to change to string.
10589 (bulletSize): ditto
10590 (~Bullet): removed unneeded destructor
10592 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10593 (insetSleep): moved from Buffer
10594 (insetWakeup): moved from Buffer
10595 (insetUnlock): moved from Buffer
10597 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10598 from Buffer to BufferView.
10600 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10602 * config/ltmain.sh: updated to version 1.3.4 of libtool
10604 * config/ltconfig: updated to version 1.3.4 of libtool
10606 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10609 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10610 Did I get that right?
10612 * src/lyxlex.h: add a "using" directive or two.
10613 * src/Spacing.h: ditto.
10614 * src/insets/figinset.C: ditto.
10615 * src/support/filetools.C: ditto.
10616 * src/support/lstrings.C: ditto.
10617 * src/BufferView.C: ditto.
10618 * src/bufferlist.C: ditto.
10619 * src/lyx_cb.C: ditto.
10620 * src/lyxlex.C: ditto.
10622 * NEWS: add some changes for 1.1.4.
10624 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10626 * src/BufferView.C: first go at a TextCache to speed up switching
10629 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10631 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10632 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10633 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10634 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10637 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10638 members of the struct are correctly initialized to 0 (detected by
10640 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10641 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10643 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10644 pidwait, since it was allocated with "new". This was potentially
10645 very bad. Thanks to Michael Schmitt for running purify for us.
10648 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10650 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10652 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10654 1999-12-30 Allan Rae <rae@lyx.org>
10656 * lib/templates/IEEEtran.lyx: minor change
10658 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10659 src/mathed/formula.C (LocalDispatch): askForText changes
10661 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10662 know when a user has cancelled input. Fixes annoying problems with
10663 inserting labels and version control.
10665 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10667 * src/support/lstrings.C (tostr): rewritten to use strstream and
10670 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10672 * src/support/filetools.C (IsFileWriteable): use fstream to check
10673 (IsDirWriteable): use fileinfo to check
10675 * src/support/filetools.h (FilePtr): whole class deleted
10677 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10679 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10681 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10683 * src/bufferlist.C (write): use ifstream and ofstream instead of
10686 * src/Spacing.h: use istrstream instead of sscanf
10688 * src/mathed/math_defs.h: change first arg to istream from FILE*
10690 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10692 * src/mathed/math_parser.C: have yyis to be an istream
10693 (LexGetArg): use istream (yyis)
10695 (mathed_parse): ditto
10696 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10698 * src/mathed/formula.C (Read): rewritten to use istream
10700 * src/mathed/formulamacro.C (Read): rewritten to use istream
10702 * src/lyxlex.h (~LyXLex): deleted desturctor
10703 (getStream): new function, returns an istream
10704 (getFile): deleted funtion
10705 (IsOK): return is.good();
10707 * src/lyxlex.C (LyXLex): delete file and owns_file
10708 (setFile): open an filebuf and assign that to a istream instead of
10710 (setStream): new function, takes an istream as arg.
10711 (setFile): deleted function
10712 (EatLine): rewritten us use istream instead of FILE*
10716 * src/table.C (LyXTable): use istream instead of FILE*
10717 (Read): rewritten to take an istream instead of FILE*
10719 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10721 * src/buffer.C (Dispatch): remove an extraneous break statement.
10723 * src/support/filetools.C (QuoteName): change to do simple
10724 'quoting'. More work is necessary. Also changed to do nothing
10725 under emx (needs fix too).
10726 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10728 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10729 config.h.in to the AC_DEFINE_UNQUOTED() call.
10730 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10731 needs char * as argument (because Solaris 7 declares it like
10734 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10735 remove definition of BZERO.
10737 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10739 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10740 defined, "lyxregex.h" if not.
10742 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10744 (REGEX): new variable that is set to regex.c lyxregex.h when
10745 AM_CONDITIONAL USE_REGEX is set.
10746 (libsupport_la_SOURCES): add $(REGEX)
10748 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10751 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10754 * configure.in: add call to LYX_REGEX
10756 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10757 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10759 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10761 * lib/bind/fi_menus.bind: new file, from
10762 pauli.virtanen@saunalahti.fi.
10764 * src/buffer.C (getBibkeyList): pass the parameter delim to
10765 InsetInclude::getKeys and InsetBibtex::getKeys.
10767 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10768 is passed to Buffer::getBibkeyList
10770 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10771 instead of the hardcoded comma.
10773 * src/insets/insetbib.C (getKeys): make sure that there are not
10774 leading blanks in bibtex keys. Normal latex does not care, but
10775 harvard.sty seems to dislike blanks at the beginning of citation
10776 keys. In particular, the retturn value of the function is
10778 * INSTALL: make it clear that libstdc++ is needed and that gcc
10779 2.7.x probably does not work.
10781 * src/support/filetools.C (findtexfile): make debug message go to
10783 * src/insets/insetbib.C (getKeys): ditto
10785 * src/debug.C (showTags): make sure that the output is correctly
10788 * configure.in: add a comment for TWO_COLOR_ICON define.
10790 * acconfig.h: remove all the entries that already defined in
10791 configure.in or acinclude.m4.
10793 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10794 to avoid user name, date and copyright.
10796 1999-12-21 Juergen Vigna <jug@sad.it>
10798 * src/table.C (Read): Now read bogus row format informations
10799 if the format is < 5 so that afterwards the table can
10800 be read by lyx but without any format-info. Fixed the
10801 crash we experienced when not doing this.
10803 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10805 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10806 (RedoDrawingOfParagraph): ditto
10807 (RedoParagraphs): ditto
10808 (RemoveTableRow): ditto
10810 * src/text.C (Fill): rename arg paperwidth -> paper_width
10812 * src/buffer.C (insertLyXFile): rename var filename -> fname
10813 (writeFile): rename arg filename -> fname
10814 (writeFileAscii): ditto
10815 (makeLaTeXFile): ditto
10816 (makeLinuxDocFile): ditto
10817 (makeDocBookFile): ditto
10819 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10822 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10824 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10827 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10828 compiled by a C compiler not C++.
10830 * src/layout.h (LyXTextClass): added typedef for const_iterator
10831 (LyXTextClassList): added typedef for const_iterator + member
10832 functions begin and end.
10834 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10835 iterators to fill the choice_class.
10836 (updateLayoutChoice): rewritten to use iterators to fill the
10837 layoutlist in the toolbar.
10839 * src/BufferView.h (BufferView::work_area_width): removed unused
10842 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10844 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10845 (sgmlCloseTag): ditto
10847 * src/support/lstrings.h: return type of countChar changed to
10850 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10851 what version of this func to use. Also made to return unsigned int.
10853 * configure.in: call LYX_STD_COUNT
10855 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10856 conforming std::count.
10858 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10860 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10861 and a subscript would give bad display (patch from Dekel Tsur
10862 <dekel@math.tau.ac.il>).
10864 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10866 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10869 * src/chset.h: add a few 'using' directives
10871 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10872 triggered when no buffer is active
10874 * src/layout.C: removed `break' after `return' in switch(), since
10877 * src/lyx_main.C (init): make sure LyX can be ran in place even
10878 when libtool has done its magic with shared libraries. Fix the
10879 test for the case when the system directory has not been found.
10881 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10882 name for the latex file.
10883 (MenuMakeHTML): ditto
10885 * src/buffer.h: add an optional boolean argument, which is passed
10886 to ChangeExtension.
10888 1999-12-20 Allan Rae <rae@lyx.org>
10890 * lib/templates/IEEEtran.lyx: small correction and update.
10892 * configure.in: Attempted to use LYX_PATH_HEADER
10894 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10896 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10897 input from JMarc. Now use preprocessor to find the header.
10898 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10899 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10900 LYX_STL_STRING_FWD. See comments in file.
10902 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10904 * The global MiniBuffer * minibuffer variable is dead.
10906 * The global FD_form_main * fd_form_main variable is dead.
10908 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10910 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10912 * src/table.h: add the LOstream.h header
10913 * src/debug.h: ditto
10915 * src/LyXAction.h: change the explaination of the ReadOnly
10916 attribute: is indicates that the function _can_ be used.
10918 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10921 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10923 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10929 * src/paragraph.C (GetWord): assert on pos>=0
10932 * src/support/lyxstring.C: condition the use of an invariant on
10934 * src/support/lyxstring.h: ditto
10936 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10937 Use LAssert.h instead of plain assert().
10939 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10941 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10942 * src/support/filetools.C: ditto
10944 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10947 * INSTALL: document the new configure flags
10949 * configure.in: suppress --with-debug; add --enable-assertions
10951 * acinclude.m4: various changes in alignment of help strings.
10953 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10955 * src/kbmap.C: commented out the use of the hash map in kb_map,
10956 beginning of movement to a stl::container.
10958 * several files: removed code that was not in effect when
10959 MOVE_TEXT was defined.
10961 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10962 for escaping should not be used. We can discuss if the string
10963 should be enclosed in f.ex. [] instead of "".
10965 * src/trans_mgr.C (insert): use the new returned value from
10966 encodeString to get deadkeys and keymaps done correctly.
10968 * src/chset.C (encodeString): changed to return a pair, to tell
10969 what to use if we know the string.
10971 * src/lyxscreen.h (fillArc): new function.
10973 * src/FontInfo.C (resize): rewritten to use more std::string like
10974 structore, especially string::replace.
10976 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10979 * configure.in (chmod +x some scripts): remove config/gcc-hack
10981 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10983 * src/buffer.C (writeFile): change once again the top comment in a
10984 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10985 instead of an hardcoded version number.
10986 (makeDocBookFile): ditto
10988 * src/version.h: add new define LYX_DOCVERSION
10990 * po/de.po: update from Pit Sütterlin
10991 * lib/bind/de_menus.bind: ditto.
10993 * src/lyxfunc.C (Dispatch): call MenuExport()
10994 * src/buffer.C (Dispatch): ditto
10996 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10997 LyXFunc::Dispatch().
10998 (MenuExport): new function, moved from
10999 LyXFunc::Dispatch().
11001 * src/trans_mgr.C (insert): small cleanup
11002 * src/chset.C (loadFile): ditto
11004 * lib/kbd/iso8859-1.cdef: add missing backslashes
11006 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11008 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11009 help with placing the manually drawn accents better.
11011 (Draw): x2 and hg changed to float to minimize rounding errors and
11012 help place the accents better.
11014 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11015 unsigned short to char is just wrong...cast the char to unsigned
11016 char instead so that the two values can compare sanely. This
11017 should also make the display of insetlatexaccents better and
11018 perhaps also some other insets.
11020 (lbearing): new function
11023 1999-12-15 Allan Rae <rae@lyx.org>
11025 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11026 header that provides a wrapper around the very annoying SGI STL header
11029 * src/support/lyxstring.C, src/LString.h:
11030 removed old SGI-STL-compatability attempts.
11032 * configure.in: Use LYX_STL_STRING_FWD.
11034 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11035 stl_string_fwd.h is around and try to determine it's location.
11036 Major improvement over previous SGI STL 3.2 compatability.
11037 Three small problems remain with this function due to my zero
11038 knowledge of autoconf. JMarc and lgb see the comments in the code.
11040 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11042 * src/broken_const.h, config/hack-gcc, config/README: removed
11044 * configure.in: remove --with-gcc-hack option; do not call
11047 * INSTALL: remove documentation of --with-broken-const and
11050 * acconfig.h: remove all trace of BROKEN_CONST define
11052 * src/buffer.C (makeDocBookFile): update version number in output
11054 (SimpleDocBookOnePar): fix an assert when trying to a character
11055 access beyond string length
11058 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11060 * po/de.po: fix the Export menu
11062 * lyx.man: update the description of -dbg
11064 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11065 (commandLineHelp): updated
11066 (easyParse): show list of available debug levels if -dbg is passed
11069 * src/Makefile.am: add debug.C
11071 * src/debug.h: moved some code to debug.C
11073 * src/debug.C: new file. Contains code to set and show debug
11076 * src/layout.C: remove 'break' after 'continue' in switch
11077 statements, since these cannot be reached.
11079 1999-12-13 Allan Rae <rae@lyx.org>
11081 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11082 (in_word_set): hash() -> math_hash()
11084 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11086 * acconfig.h: Added a test for whether we are using exceptions in the
11087 current compilation run. If so USING_EXCEPTIONS is defined.
11089 * config.in: Check for existance of stl_string_fwd.h
11090 * src/LString.h: If compiling --with-included-string and SGI's
11091 STL version 3.2 is present (see above test) we need to block their
11092 forward declaration of string and supply a __get_c_string().
11093 However, it turns out this is only necessary if compiling with
11094 exceptions enabled so I've a bit more to add yet.
11096 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11097 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11098 src/support/LRegex.h, src/undo.h:
11099 Shuffle the order of the included files a little to ensure that
11100 LString.h gets included before anything that includes stl_string_fwd.h
11102 * src/support/lyxstring.C: We need to #include LString.h instead of
11103 lyxstring.h to get the necessary definition of __get_c_string.
11104 (__get_c_string): New function. This is defined static just like SGI's
11105 although why they need to do this I'm not sure. Perhaps it should be
11106 in lstrings.C instead.
11108 * lib/templates/IEEEtran.lyx: New template file.
11110 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11112 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11113 * intl/Makefile.in (MKINSTALLDIRS): ditto
11115 * src/LyXAction.C (init): changed to hold the LFUN data in a
11116 automatic array in stead of in callso to newFunc, this speeds up
11117 compilation a lot. Also all the memory used by the array is
11118 returned when the init is completed.
11120 * a lot of files: compiled with -Wold-style-cast, changed most of
11121 the reported offenders to C++ style casts. Did not change the
11122 offenders in C files.
11124 * src/trans.h (Match): change argument type to unsigned int.
11126 * src/support/DebugStream.C: fix some types on the streambufs so
11127 that it works on a conforming implementation.
11129 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11131 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11133 * src/support/lyxstring.C: remove the inline added earlier since
11134 they cause a bunch of unsatisfied symbols when linking with dec
11135 cxx. Cxx likes to have the body of inlines at the place where they
11138 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11139 accessing negative bounds in array. This fixes the crash when
11140 inserting accented characters.
11141 * src/trans.h (Match): ditto
11143 * src/buffer.C (Dispatch): since this is a void, it should not try
11144 to return anything...
11146 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11148 * src/buffer.h: removed the two friends from Buffer. Some changes
11149 because of this. Buffer::getFileName and Buffer::setFileName
11150 renamed to Buffer::fileName() and Buffer::fileName(...).
11152 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11154 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11155 and Buffer::update(short) to BufferView. This move is currently
11156 controlled by a define MOVE_TEXT, this will be removed when all
11157 shows to be ok. This move paves the way for better separation
11158 between buffer contents and buffer view. One side effect is that
11159 the BufferView needs a rebreak when swiching buffers, if we want
11160 to avoid this we can add a cache that holds pointers to LyXText's
11161 that is not currently in use.
11163 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11166 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11168 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11170 * lyx_main.C: new command line option -x (or --execute) and
11171 -e (or --export). Now direct conversion from .lyx to .tex
11172 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11173 Unfortunately, X is still needed and the GUI pops up during the
11176 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11178 * src/Spacing.C: add a using directive to bring stream stuff into
11180 * src/paragraph.C: ditto
11181 * src/buffer.C: ditto
11183 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11184 from Lars' announcement).
11186 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11187 example files from Tino Meinen.
11189 1999-12-06 Allan Rae <rae@lyx.org>
11191 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11193 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11195 * src/support/lyxstring.C: added a lot of inline for no good
11198 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11199 latexWriteEndChanges, they were not used.
11201 * src/layout.h (operator<<): output operator for PageSides
11203 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11205 * some example files: loaded in LyX 1.0.4 and saved again to update
11206 certain constructs (table format)
11208 * a lot of files: did the change to use fstream/iostream for all
11209 writing of files. Done with a close look at Andre Poenitz's patch.
11211 * some files: whitespace changes.
11213 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11215 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11216 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11217 architecture, we provide our own. It is used unconditionnally, but
11218 I do not think this is a performance problem. Thanks to Angus
11219 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11220 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11222 (GetInset): use my_memcpy.
11226 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11227 it is easier to understand, but it uses less TeX-only constructs now.
11229 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11230 elements contain spaces
11232 * lib/configure: regenerated
11234 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11235 elements contain spaces; display the list of programs that are
11238 * autogen.sh: make sure lib/configure is executable
11240 * lib/examples/*: rename the tutorial examples to begin with the
11241 two-letters language code.
11243 * src/lyxfunc.C (getStatus): do not query current font if no
11246 * src/lyx_cb.C (RunScript): use QuoteName
11247 (MenuRunDvips): ditto
11248 (PrintApplyCB): ditto
11250 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11251 around argument, so that it works well with the current shell.
11252 Does not work properly with OS/2 shells currently.
11254 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11255 * src/LyXSendto.C (SendtoApplyCB): ditto
11256 * src/lyxfunc.C (Dispatch): ditto
11257 * src/buffer.C (runLaTeX): ditto
11258 (runLiterate): ditto
11259 (buildProgram): ditto
11261 * src/lyx_cb.C (RunScript): ditto
11262 (MenuMakeLaTeX): ditto
11264 * src/buffer.h (getLatexName): new method
11266 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11268 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11270 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11271 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11272 (create_math_panel): ditto
11274 * src/lyxfunc.C (getStatus): re-activate the code which gets
11275 current font and cursor; add test for export to html.
11277 * src/lyxrc.C (read): remove unreachable break statements; add a
11280 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11282 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11284 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11285 introduced by faulty regex.
11286 * src/buffer.C: ditto
11287 * src/lastfiles.C: ditto
11288 * src/paragraph.C: ditto
11289 * src/table.C: ditto
11290 * src/vspace.C: ditto
11291 * src/insets/figinset.C: ditto
11292 Note: most of these is absolutely harmless, except the one in
11293 src/mathed formula.C.
11295 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11297 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11298 operation, yielding correct results for the reLyX command.
11300 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11302 * src/support/filetools.C (ExpandPath): removed an over eager
11304 (ReplaceEnvironmentPath): ditto
11306 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11307 shows that we are doing something fishy in our code...
11308 (BubblePost): ditto
11311 * src/lyxrc.C (read): use a double switch trick to get more help
11312 from the compiler. (the same trick is used in layout.C)
11313 (write): new function. opens a ofstream and pass that to output
11314 (output): new function, takes a ostream and writes the lyxrc
11315 elemts to it. uses a dummy switch to make sure no elements are
11318 * src/lyxlex.h: added a struct pushpophelper for use in functions
11319 with more than one exit point.
11321 * src/lyxlex.[Ch] (GetInteger): made it const
11325 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11327 * src/layout.[hC] : LayoutTags splitted into several enums, new
11328 methods created, better error handling cleaner use of lyxlex. Read
11331 * src/bmtable.[Ch]: change some member prototypes because of the
11332 image const changes.
11334 * commandtags.h, src/LyXAction.C (init): new function:
11335 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11336 This file is not read automatically but you can add \input
11337 preferences to your lyxrc if you want to. We need to discuss how
11340 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11341 in .aux, also remove .bib and .bst files from dependencies when
11344 * src/BufferView.C, src/LyXView.C: add const_cast several places
11345 because of changes to images.
11347 * lib/images/*: same change as for images/*
11349 * lib/lyxrc.example: Default for accept_compound is false not no.
11351 * images/*: changed to be const, however I have som misgivings
11352 about this change so it might be changed back.
11354 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11356 * lib/configure, po/POTFILES.in: regenerated
11358 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11360 * config/lib_configure.m4: removed
11362 * lib/configure.m4: new file (was config/lib_configure.m4)
11364 * configure.in: do not test for rtti, since we do not use it.
11366 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11368 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11369 doubling of allocated space scheme. This makes it faster for large
11370 strings end to use less memory for small strings. xtra rememoved.
11372 * src/insets/figinset.C (waitalarm): commented out.
11373 (GhostscriptMsg): use static_cast
11374 (GhostscriptMsg): use new instead of malloc to allocate memory for
11375 cmap. also delete the memory after use.
11377 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11379 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11380 for changes in bibtex database or style.
11381 (runBibTeX): remove all .bib and .bst files from dep before we
11383 (run): use scanAuc in when dep file already exist.
11385 * src/DepTable.C (remove_files_with_extension): new method
11386 (exist): new method
11388 * src/DepTable.[Ch]: made many of the methods const.
11390 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11392 * src/bufferparams.C: make sure that the default textclass is
11393 "article". It used to be the first one by description order, but
11394 now the first one is "docbook".
11396 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11397 string; call Debug::value.
11398 (easyParse): pass complete argument to setDebuggingLevel().
11400 * src/debug.h (value): fix the code that parses debug levels.
11402 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11405 * src/LyXAction.C: use Debug::ACTION as debug channel.
11407 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11409 * NEWS: updated for the future 1.1.3 release.
11411 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11412 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11413 it should. This is of course a controversial change (since many
11414 people will find that their lyx workscreen is suddenly full of
11415 red), but done for the sake of correctness.
11417 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11418 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11420 * src/insets/inseterror.h, src/insets/inseturl.h,
11421 src/insets/insetinfo.h, src/insets/figinset.h,
11422 src/mathed/formulamacro.h, src/mathed/math_macro.h
11423 (EditMessage): add a missing const and add _() to make sure that
11424 translation happens
11426 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11427 src/insets/insetbib.C, src/support/filetools.C: add `using'
11428 directives for cxx.
11430 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11431 doing 'Insert index of last word' at the beginning of a paragraph.
11433 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11435 * several files: white-space changes.
11437 * src/mathed/formula.C: removed IsAlpha and IsDigit
11439 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11440 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11443 * src/insets/figinset.C (GetPSSizes): don't break when
11444 "EndComments" is seen. But break when a boundingbox is read.
11446 * all classes inherited from Inset: return value of Clone
11447 changed back to Inset *.
11449 * all classes inherited form MathInset: return value of Clone
11450 changed back to MathedInset *.
11452 * src/insets/figinset.C (runqueue): use a ofstream to output the
11453 gs/ps file. Might need some setpresicion or setw. However I can
11454 see no problem with the current code.
11455 (runqueue): use sleep instead of the alarm/signal code. I just
11456 can't see the difference.
11458 * src/paragraph.C (LyXParagraph): reserve space in the new
11459 paragraph and resize the inserted paragraph to just fit.
11461 * src/lyxfunc.h (operator|=): added operator for func_status.
11463 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11464 check for readable file.
11466 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11467 check for readable file.
11468 (MenuMakeLinuxDoc): ditto
11469 (MenuMakeDocBook): ditto
11470 (MenuMakeAscii): ditto
11471 (InsertAsciiFile): split the test for openable and readable
11473 * src/bmtable.C (draw_bitmaptable): use
11474 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11476 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11477 findtexfile from LaTeX to filetools.
11479 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11480 instead of FilePtr. Needs to be verified by a literate user.
11482 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11484 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11485 (EditMessage): likewise.
11487 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11488 respectively as \textasciitilde and \textasciicircum.
11490 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11492 * src/support/lyxstring.h: made the methods that take iterators
11493 use const_iterator.
11495 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11496 (regexMatch): made is use the real regex class.
11498 * src/support/Makefile.am: changed to use libtool
11500 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11502 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11504 (MathIsInset ++): changed several macros to be inline functions
11507 * src/mathed/Makefile.am: changed to use libtool
11509 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11511 * src/insets/inset* : Clone changed to const and return type is
11512 the true insettype not just Inset*.
11514 * src/insets/Makefile.am: changed to use libtool
11516 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11518 * src/undo.[Ch] : added empty() and changed some of the method
11521 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11523 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11524 setID use block<> for the bullets array, added const several places.
11526 * src/lyxfunc.C (getStatus): new function
11528 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11529 LyXAction, added const to several funtions.
11531 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11532 a std::map, and to store the dir items in a vector.
11534 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11537 * src/LyXView.[Ch] + other files : changed currentView to view.
11539 * src/LyXAction.[Ch] : ported from the old devel branch.
11541 * src/.cvsignore: added .libs and a.out
11543 * configure.in : changes to use libtool.
11545 * acinclude.m4 : inserted libtool.m4
11547 * .cvsignore: added libtool
11549 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11551 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11552 file name in insets and mathed directories (otherwise the
11553 dependency is not taken in account under cygwin).
11555 * src/text2.C (InsertString[AB]): make sure that we do not try to
11556 read characters past the string length.
11558 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11560 * lib/doc/LaTeXConfig.lyx.in,
11561 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11563 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11564 file saying who created them and when this heppened; this is
11565 useless and annoys tools like cvs.
11567 * lib/layouts/g-brief-{en,de}.layout,
11568 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11569 from Thomas Hartkens <thomas@hartkens.de>.
11571 * src/{insets,mathed}/Makefile.am: do not declare an empty
11572 LDFLAGS, so that it can be set at configure time (useful on Irix
11575 * lib/reLyX/configure.in: make sure that the prefix is set
11576 correctly in LYX_DIR.
11578 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11580 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11581 be used by 'command-sequence' this allows to bind a key to a
11582 sequence of LyX-commands
11583 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11585 * src/LyXAction.C: add "command-sequence"
11587 * src/LyXFunction.C: handling of "command-sequence"
11589 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11590 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11592 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11594 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11596 * src/buffer.C (writeFile): Do not output a comment giving user
11597 and date at the beginning of a .lyx file. This is useless and
11598 annoys cvs anyway; update version number to 1.1.
11600 * src/Makefile.am (LYX_DIR): add this definition, so that a
11601 default path is hardcoded in LyX.
11603 * configure.in: Use LYX_GNU_GETTEXT.
11605 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11606 AM_GNU_GETTEXT with a bug fixed.
11608 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11610 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11612 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11613 which is used to point to LyX data is now LYX_DIR_11x.
11615 * lyx.man: convert to a unix text file; small updates.
11617 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11619 * src/support/LSubstring.[Ch]: made the second arg of most of the
11620 constructors be a const reference.
11622 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11625 * src/support/lyxstring.[Ch] (swap): added missing member function
11626 and specialization of swap(str, str);
11628 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11630 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11631 trace of the old one.
11633 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11634 put the member definitions in undo.C.
11636 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11637 NEW_TEXT and have now only code that was included when this was
11640 * src/intl.C (LCombo): use static_cast
11642 (DispatchCallback): ditto
11644 * src/definitions.h: removed whole file
11646 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11648 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11649 parsing and stores in a std:map. a regex defines the file format.
11650 removed unneeded members.
11652 * src/bufferparams.h: added several enums from definitions.h here.
11653 Removed unsused destructor. Changed some types to use proper enum
11654 types. use block to have the temp_bullets and user_defined_bullets
11655 and to make the whole class assignable.
11657 * src/bufferparams.C (Copy): removed this functions, use a default
11658 assignment instead.
11660 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11663 * src/buffer.C (readLyXformat2): commend out all that have with
11664 oldpapersize to do. also comment out all that hve to do with
11665 insetlatex and insetlatexdel.
11666 (setOldPaperStuff): commented out
11668 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11670 * src/LyXAction.C: remove use of inset-latex-insert
11672 * src/mathed/math_panel.C (button_cb): use static_cast
11674 * src/insets/Makefile.am (insets_o_SOURCES): removed
11677 * src/support/lyxstring.C (helper): use the unsigned long
11678 specifier, UL, instead of a static_cast.
11680 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11682 * src/support/block.h: new file. to be used as a c-style array in
11683 classes, so that the class can be assignable.
11685 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11687 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11688 NULL, make sure to return an empty string (it is not possible to
11689 set a string to NULL).
11691 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11693 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11695 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11697 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11698 link line, so that Irix users (for example) can set it explicitely to
11701 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11702 it can be overidden at make time (static or dynamic link, for
11705 * src/vc-backend.C, src/LaTeXFeatures.h,
11706 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11707 statements to bring templates to global namespace.
11709 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11711 * src/support/lyxstring.C (operator[] const): make it standard
11714 * src/minibuffer.C (Init): changed to reflect that more
11715 information is given from the lyxvc and need not be provided here.
11717 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11719 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11721 * src/LyXView.C (UpdateTimerCB): use static_cast
11722 (KeyPressMask_raw_callback): ditto
11724 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11725 buffer_, a lot of changes because of this. currentBuffer() ->
11726 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11727 also changes to other files because of this.
11729 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11731 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11732 have no support for RCS and partial support for CVS, will be
11735 * src/insets/ several files: changes because of function name
11736 changes in Bufferview and LyXView.
11738 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11740 * src/support/LSubstring.[Ch]: new files. These implement a
11741 Substring that can be very convenient to use. i.e. is this
11743 string a = "Mary had a little sheep";
11744 Substring(a, "sheep") = "lamb";
11745 a is now "Mary has a little lamb".
11747 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11748 out patterns and subpatterns of strings. It is used by LSubstring
11749 and also by vc-backend.C
11751 * src/support/lyxstring.C: went over all the assertions used and
11752 tried to correct the wrong ones and flag which of them is required
11753 by the standard. some bugs found because of this. Also removed a
11754 couple of assertions.
11756 * src/support/Makefile.am (libsupport_a_SOURCES): added
11757 LSubstring.[Ch] and LRegex.[Ch]
11759 * src/support/FileInfo.h: have struct stat buf as an object and
11760 not a pointer to one, some changes because of this.
11762 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11763 information in layout when adding the layouts preamble to the
11764 textclass preamble.
11766 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11769 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11770 because of bug in OS/2.
11772 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11774 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11775 \verbatim@font instead of \ttfamily, so that it can be redefined.
11777 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11778 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11779 src/layout.h, src/text2.C: add 'using' directive to bring the
11780 STL templates we need from the std:: namespace to the global one.
11781 Needed by DEC cxx in strict ansi mode.
11783 * src/support/LIstream.h,src/support/LOstream.h,
11784 src/support/lyxstring.h,src/table.h,
11785 src/lyxlookup.h: do not include <config.h> in header
11786 files. This should be done in the .C files only.
11788 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11792 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11794 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11795 from Kayvan to fix the tth invokation.
11797 * development/lyx.spec.in: updates from Kayvan to reflect the
11798 changes of file names.
11800 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11802 * src/text2.C (InsertStringB): use std::copy
11803 (InsertStringA): use std::copy
11805 * src/bufferlist.C: use a vector to store the buffers in. This is
11806 an internal change and should not affect any other thing.
11808 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11811 * src/text.C (Fill): fix potential bug, one off bug.
11813 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11815 * src/Makefile.am (lyx_main.o): add more files it depends on.
11817 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11819 * src/support/lyxstring.C: use size_t for the reference count,
11820 size, reserved memory and xtra.
11821 (internal_compare): new private member function. Now the compare
11822 functions should work for std::strings that have embedded '\0'
11824 (compare): all compare functions rewritten to use
11827 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11829 * src/support/lyxstring.C (compare): pass c_str()
11830 (compare): pass c_str
11831 (compare): pass c_str
11833 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11835 * src/support/DebugStream.C: <config.h> was not included correctly.
11837 * lib/configure: forgot to re-generate it :( I'll make this file
11838 auto generated soon.
11840 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11842 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11845 * src/support/lyxstring.C: some changes from length() to rep->sz.
11846 avoids a function call.
11848 * src/support/filetools.C (SpaceLess): yet another version of the
11849 algorithm...now per Jean-Marc's suggestions.
11851 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11853 * src/layout.C (less_textclass_desc): functor for use in sorting
11855 (LyXTextClass::Read): sort the textclasses after reading.
11857 * src/support/filetools.C (SpaceLess): new version of the
11858 SpaceLess functions. What problems does this one give? Please
11861 * images/banner_bw.xbm: made the arrays unsigned char *
11863 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11865 * src/support/lyxstring.C (find): remove bogus assertion in the
11866 two versions of find where this has not been done yet.
11868 * src/support/lyxlib.h: add missing int return type to
11871 * src/menus.C (ShowFileMenu): disable exporting to html if no
11872 html export command is present.
11874 * config/lib_configure.m4: add a test for an HTML converter. The
11875 programs checked for are, in this order: tth, latex2html and
11878 * lib/configure: generated from config/lib_configure.m4.
11880 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11881 html converter. The parameters are now passed through $$FName and
11882 $$OutName, instead of standard input/output.
11884 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11886 * lib/lyxrc.example: update description of \html_command.
11887 add "quotes" around \screen_font_xxx font setting examples to help
11888 people who use fonts with spaces in their names.
11890 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11892 * Distribution files: updates for v1.1.2
11894 * src/support/lyxstring.C (find): remove bogus assert and return
11895 npos for the same condition.
11897 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11899 * added patch for OS/2 from SMiyata.
11901 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11903 * src/text2.C (CutSelection): make space_wrapped a bool
11904 (CutSelection): dont declare int i until we have to.
11905 (alphaCounter): return a char const *.
11907 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11909 * src/support/syscall.C (Systemcalls::kill):
11910 src/support/filetools.C (PutEnv, PutEnvPath):
11911 src/lyx_cb.C (addNewlineAndDepth):
11912 src/FontInfo.C (FontInfo::resize): condition some #warning
11913 directives with WITH_WARNINGS.
11916 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11918 * src/layout.[Ch] + several files: access to class variables
11919 limited and made accessor functions instead a lot of code changed
11920 becuase of this. Also instead of returning pointers often a const
11921 reference is returned instead.
11923 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11925 * src/Makefile.am (dist-hook): added used to remove the CVS from
11926 cheaders upon creating a dist
11927 (EXTRA_DIST): added cheaders
11929 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11930 a character not as a small integer.
11932 * src/support/lyxstring.C (find): removed Assert and added i >=
11933 rep->sz to the first if.
11935 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11937 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11938 src/LyXView.C src/buffer.C src/bufferparams.C
11939 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11940 src/text2.C src/insets/insetinclude.C:
11941 lyxlayout renamed to textclasslist.
11943 * src/layout.C: some lyxerr changes.
11945 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11946 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11947 (LyXLayoutList): removed all traces of this class.
11948 (LyXTextClass::Read): rewrote LT_STYLE
11949 (LyXTextClass::hasLayout): new function
11950 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11951 both const and nonconst version.
11952 (LyXTextClass::delete_layout): new function.
11953 (LyXTextClassList::Style): bug fix. do the right thing if layout
11955 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11956 (LyXTextClassList::NameOfLayout): ditto
11957 (LyXTextClassList::Load): ditto
11959 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11961 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11963 * src/LyXAction.C (LookupFunc): added a workaround for sun
11964 compiler, on the other hand...we don't know if the current code
11965 compiles on sun at all...
11967 * src/support/filetools.C (CleanupPath): subst fix
11969 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11972 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11973 complained about this one?
11975 * src/insets/insetinclude.C (Latex): subst fix
11977 * src/insets/insetbib.C (getKeys): subst fix
11979 * src/LyXSendto.C (SendtoApplyCB): subst fix
11981 * src/lyx_main.C (init): subst fix
11983 * src/layout.C (Read): subst fix
11985 * src/lyx_sendfax_main.C (button_send): subst fix
11987 * src/buffer.C (RoffAsciiTable): subst fix
11989 * src/lyx_cb.C (MenuFax): subst fix
11990 (PrintApplyCB): subst fix
11992 1999-10-26 Juergen Vigna <jug@sad.it>
11994 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11996 (Read): Cleaned up this code so now we read only format vestion >= 5
11998 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12000 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12001 come nobody has complained about this one?
12003 * src/insets/insetinclude.C (Latex): subst fix
12005 * src/insets/insetbib.C (getKeys): subst fix
12007 * src/lyx_main.C (init): subst fix
12009 * src/layout.C (Read): subst fix
12011 * src/buffer.C (RoffAsciiTable): subst fix
12013 * src/lyx_cb.C (MenuFax): subst fix.
12015 * src/layout.[hC] + some other files: rewrote to use
12016 std::container to store textclasses and layouts in.
12017 Simplified, removed a lot of code. Make all classes
12018 assignable. Further simplifications and review of type
12019 use still to be one.
12021 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12022 lastfiles to create the lastfiles partr of the menu.
12024 * src/lastfiles.[Ch]: rewritten to use deque to store the
12025 lastfiles in. Uses fstream for reading and writing. Simplifies
12028 * src/support/syscall.C: remove explicit cast.
12030 * src/BufferView.C (CursorToggleCB): removed code snippets that
12031 were commented out.
12032 use explicat C++ style casts instead of C style casts. also use
12033 u_vdata instea of passing pointers in longs.
12035 * src/PaperLayout.C: removed code snippets that were commented out.
12037 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12039 * src/lyx_main.C: removed code snippets that wer commented out.
12041 * src/paragraph.C: removed code snippets that were commented out.
12043 * src/lyxvc.C (logClose): use static_cast
12045 (viewLog): remove explicit cast to void*
12046 (showLog): removed old commented code
12048 * src/menus.C: use static_cast instead of C style casts. use
12049 u_vdata instead of u_ldata. remove explicit cast to (long) for
12050 pointers. Removed old code that was commented out.
12052 * src/insets/inset.C: removed old commented func
12054 * src/insets/insetref.C (InsetRef): removed old code that had been
12055 commented out for a long time.
12057 (escape): removed C style cast
12059 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12061 * src/insets/insetlatex.C (Draw): removed old commented code
12062 (Read): rewritten to use string
12064 * src/insets/insetlabel.C (escape): removed C style cast
12066 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12068 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12069 old commented code.
12071 * src/insets/insetinclude.h: removed a couple of stupid bools
12073 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12074 (Clone): remove C style cast
12075 (getKeys): changed list to lst because of std::list
12077 * src/insets/inseterror.C (Draw): removed som old commented code.
12079 * src/insets/insetcommand.C (Draw): removed some old commented code.
12081 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12082 commented out forever.
12083 (bibitem_cb): use static_cast instead of C style cast
12084 use of vdata changed to u_vdata.
12086 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12088 (CloseUrlCB): use static_cast instead of C style cast.
12089 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12091 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12092 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12093 (CloseInfoCB): static_cast from ob->u_vdata instead.
12094 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12097 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12098 (C_InsetError_CloseErrorCB): forward the ob parameter
12099 (CloseErrorCB): static_cast from ob->u_vdata instead.
12101 * src/vspace.h: include LString.h since we use string in this class.
12103 * src/vspace.C (lyx_advance): changed name from advance because of
12104 nameclash with stl. And since we cannot use namespaces yet...I
12105 used a lyx_ prefix instead. Expect this to change when we begin
12108 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12110 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12111 and removed now defunct constructor and deconstructor.
12113 * src/BufferView.h: have backstack as a object not as a pointer.
12114 removed initialization from constructor. added include for BackStack
12116 * development/lyx.spec.in (%build): add CFLAGS also.
12118 * src/screen.C (drawFrame): removed another warning.
12120 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12122 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12123 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12124 README and ANNOUNCE a bit for the next release. More work is
12127 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12128 unbreakable if we are in freespacing mode (LyX-Code), but not in
12131 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12133 * src/BackStack.h: fixed initialization order in constructor
12135 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12137 * acinclude.m4 (VERSION): new rules for when a version is
12138 development, added also a variable for prerelease.
12139 (warnings): we set with_warnings=yes for prereleases
12140 (lyx_opt): prereleases compile with same optimization as development
12141 (CXXFLAGS): only use pedantic if we are a development version
12143 * src/BufferView.C (restorePosition): don't do anything if the
12144 backstack is empty.
12146 * src/BackStack.h: added member empty, use this to test if there
12147 is anything to pop...
12149 1999-10-25 Juergen Vigna <jug@sad.it>
12152 * forms/layout_forms.fd +
12153 * forms/latexoptions.fd +
12154 * lyx.fd: changed for various form resize issues
12156 * src/mathed/math_panel.C +
12157 * src/insets/inseterror.C +
12158 * src/insets/insetinfo.C +
12159 * src/insets/inseturl.C +
12160 * src/insets/inseturl.h +
12162 * src/LyXSendto.C +
12163 * src/PaperLayout.C +
12164 * src/ParagraphExtra.C +
12165 * src/TableLayout.C +
12167 * src/layout_forms.C +
12174 * src/menus.C: fixed various resize issues. So now forms can be
12175 resized savely or not be resized at all.
12177 * forms/form_url.fd +
12178 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12181 * src/insets/Makefile.am: added files form_url.[Ch]
12183 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12185 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12186 (and presumably 6.2).
12188 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12189 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12190 remaining static member callbacks.
12192 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12195 * src/support/lyxstring.h: declare struct Srep as friend of
12196 lyxstring, since DEC cxx complains otherwise.
12198 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12200 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12202 * src/LaTeX.C (run): made run_bibtex also depend on files with
12204 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12205 are put into the dependency file.
12207 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12208 the code has shown itself to work
12209 (create_ispell_pipe): removed another warning, added a comment
12212 * src/minibuffer.C (ExecutingCB): removed code that has been
12213 commented out a long time
12215 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12216 out code + a warning.
12218 * src/support/lyxstring.h: comment out the three private
12219 operators, when compiling with string ansi conforming compilers
12220 they make problems.
12222 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12224 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12225 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12228 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12231 * src/mathed/math_panel.C (create_math_panel): remove explicit
12234 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12237 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12238 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12239 to XCreatePixmapFromBitmapData
12240 (fl_set_bmtable_data): change the last argument to be unsigned
12242 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12243 and bh to be unsigned int, remove explicit casts in call to
12244 XReadBitmapFileData.
12246 * images/arrows.xbm: made the arrays unsigned char *
12247 * images/varsz.xbm: ditto
12248 * images/misc.xbm: ditto
12249 * images/greek.xbm: ditto
12250 * images/dots.xbm: ditto
12251 * images/brel.xbm: ditto
12252 * images/bop.xbm: ditto
12254 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12256 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12257 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12258 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12260 (LYX_CXX_CHEADERS): added <clocale> to the test.
12262 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12264 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12266 * src/support/lyxstring.C (append): fixed something that must be a
12267 bug, rep->assign was used instead of rep->append.
12269 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12272 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12273 lyx insert double chars. Fix spotted by Kayvan.
12275 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12277 * Fixed the tth support. I messed up with the Emacs patch apply feature
12278 and omitted the changes in lyxrc.C.
12280 1999-10-22 Juergen Vigna <jug@sad.it>
12282 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12284 * src/lyx_cb.C (MenuInsertRef) +
12285 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12286 the form cannot be resized under it limits (fixes a segfault)
12288 * src/lyx.C (create_form_form_ref) +
12289 * forms/lyx.fd: Changed Gravity on name input field so that it is
12292 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12294 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12295 <ostream> and <istream>.
12297 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12298 whether <fstream> provides the latest standard features, or if we
12299 have an oldstyle library (like in egcs).
12300 (LYX_CXX_STL_STRING): fix the test.
12302 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12303 code on MODERN_STL_STREAM.
12305 * src/support/lyxstring.h: use L{I,O}stream.h.
12307 * src/support/L{I,O}stream.h: new files, designed to setup
12308 correctly streams for our use
12309 - includes the right header depending on STL capabilities
12310 - puts std::ostream and std::endl (for LOStream.h) or
12311 std::istream (LIStream.h) in toplevel namespace.
12313 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12315 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12316 was a bib file that had been changed we ensure that bibtex is run.
12317 (runBibTeX): enhanced to extract the names of the bib files and
12318 getting their absolute path and enter them into the dep file.
12319 (findtexfile): static func that is used to look for tex-files,
12320 checks for absolute patchs and tries also with kpsewhich.
12321 Alternative ways of finding the correct files are wanted. Will
12323 (do_popen): function that runs a command using popen and returns
12324 the whole output of that command in a string. Should be moved to
12327 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12328 file with extension ext has changed.
12330 * src/insets/figinset.C: added ifdef guards around the fl_free
12331 code that jug commented out. Now it is commented out when
12332 compiling with XForms == 0.89.
12334 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12335 to lyxstring.C, and only keep a forward declaration in
12336 lyxstring.h. Simplifies the header file a bit and should help a
12337 bit on compile time too. Also changes to Srep will not mandate a
12338 recompile of code just using string.
12339 (~lyxstring): definition moved here since it uses srep.
12340 (size): definition moved here since it uses srep.
12342 * src/support/lyxstring.h: removed a couple of "inline" that should
12345 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12347 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12350 1999-10-21 Juergen Vigna <jug@sad.it>
12352 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12353 set to left if I just remove the width entry (or it is empty).
12355 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12356 paragraph when having dummy paragraphs.
12358 1999-10-20 Juergen Vigna <jug@sad.it>
12360 * src/insets/figinset.C: just commented some fl_free_form calls
12361 and added warnings so that this calls should be activated later
12362 again. This avoids for now a segfault, but we have a memory leak!
12364 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12365 'const char * argument' to 'string argument', this should
12366 fix some Asserts() in lyxstring.C.
12368 * src/lyxfunc.h: Removed the function argAsString(const char *)
12369 as it is not used anymore.
12371 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12373 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12376 * src/Literate.h: some funcs moved from public to private to make
12377 interface clearer. Unneeded args removed.
12379 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12381 (scanBuildLogFile): ditto
12383 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12384 normal TeX Error. Still room for improvement.
12386 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12388 * src/buffer.C (insertErrors): changes to make the error
12389 desctription show properly.
12391 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12394 * src/support/lyxstring.C (helper): changed to use
12395 sizeof(object->rep->ref).
12396 (operator>>): changed to use a pointer instead.
12398 * src/support/lyxstring.h: changed const reference & to value_type
12399 const & lets see if that helps.
12401 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12403 * Makefile.am (rpmdist): fixed to have non static package and
12406 * src/support/lyxstring.C: removed the compilation guards
12408 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12411 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12412 conditional compile of lyxstring.Ch
12414 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12415 stupid check, but it is a lot better than the bastring hack.
12416 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12418 * several files: changed string::erase into string::clear. Not
12421 * src/chset.C (encodeString): use a char temporary instead
12423 * src/table.C (TexEndOfCell): added tostr around
12424 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12425 (TexEndOfCell): ditto
12426 (TexEndOfCell): ditto
12427 (TexEndOfCell): ditto
12428 (DocBookEndOfCell): ditto
12429 (DocBookEndOfCell): ditto
12430 (DocBookEndOfCell): ditto
12431 (DocBookEndOfCell): ditto
12433 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12435 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12437 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12438 (MenuBuildProg): added tostr around ret
12439 (MenuRunChktex): added tostr around ret
12440 (DocumentApplyCB): added tostr around ret
12442 * src/chset.C (encodeString): added tostr around t->ic
12444 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12445 (makeLaTeXFile): added tostr around tocdepth
12446 (makeLaTeXFile): added tostr around ftcound - 1
12448 * src/insets/insetbib.C (setCounter): added tostr around counter.
12450 * src/support/lyxstring.h: added an operator+=(int) to catch more
12453 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12454 (lyxstring): We DON'T allow NULL pointers.
12456 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12458 * src/mathed/math_macro.C (MathMacroArgument::Write,
12459 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12460 when writing them out.
12462 * src/LString.C: remove, since it is not used anymore.
12464 * src/support/lyxstring.C: condition the content to
12465 USE_INCLUDED_STRING macro.
12467 * src/mathed/math_symbols.C, src/support/lstrings.C,
12468 src/support/lyxstring.C: add `using' directive to specify what
12469 we need in <algorithm>. I do not think that we need to
12470 conditionalize this, but any thought is appreciated.
12472 * many files: change all callback functions to "C" linkage
12473 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12474 strict_ansi. Those who were static are now global.
12475 The case of callbacks which are static class members is
12476 trickier, since we have to make C wrappers around them (see
12477 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12478 did not finish this yet, since it defeats the purpose of
12479 encapsulation, and I am not sure what the best route is.
12481 1999-10-19 Juergen Vigna <jug@sad.it>
12483 * src/support/lyxstring.C (lyxstring): we permit to have a null
12484 pointer as assignment value and just don't assign it.
12486 * src/vspace.C (nextToken): corrected this function substituting
12487 find_first(_not)_of with find_last_of.
12489 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12490 (TableOptCloseCB) (TableSpeCloseCB):
12491 inserted fl_set_focus call for problem with fl_hide_form() in
12494 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12496 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12499 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12501 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12502 LyXLex::next() and not eatline() to get its argument.
12504 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12506 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12507 instead, use fstreams for io of the depfile, removed unneeded
12508 functions and variables.
12510 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12511 vector instead, removed all functions and variables that is not in
12514 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12516 * src/buffer.C (insertErrors): use new interface to TeXError
12518 * Makefile.am (rpmdist): added a rpmdist target
12520 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12521 per Kayvan's instructions.
12523 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12525 * src/Makefile.am: add a definition for localedir, so that locales
12526 are found after installation (Kayvan)
12528 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12530 * development/.cvsignore: new file.
12532 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12534 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12535 C++ compiler provides wrappers for C headers and use our alternate
12538 * configure.in: use LYX_CXX_CHEADERS.
12540 * src/cheader/: new directory, populated with cname headers from
12541 libstdc++-2.8.1. They are a bit old, but probably good enough for
12542 what we want (support compilers who lack them).
12544 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12545 from includes. It turns out is was stupid.
12547 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12549 * lib/Makefile.am (install-data-local): forgot a ';'
12550 (install-data-local): forgot a '\'
12551 (libinstalldirs): needed after all. reintroduced.
12553 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12555 * configure.in (AC_OUTPUT): added lyx.spec
12557 * development/lyx.spec: removed file
12559 * development/lyx.spec.in: new file
12561 * po/*.po: merged with lyx.pot becuase of make distcheck
12563 * lib/Makefile.am (dist-hook): added dist-hook so that
12564 documentation files will be included when doing a make
12565 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12566 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12568 more: tried to make install do the right thing, exclude CVS dirs
12571 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12572 Path would fit in more nicely.
12574 * all files that used to use pathstack: uses now Path instead.
12575 This change was a lot easier than expected.
12577 * src/support/path.h: new file
12579 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12581 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12583 * src/support/lyxstring.C (getline): Default arg was given for
12586 * Configure.cmd: removed file
12588 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12590 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12591 streams classes and types, add the proper 'using' statements when
12592 MODERN_STL is defined.
12594 * src/debug.h: move the << operator definition after the inclusion
12597 * src/support/filetools.C: include "LAssert.h", which is needed
12600 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12603 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12604 include "debug.h" to define a proper ostream.
12606 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12608 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12609 method to the SystemCall class which can kill a process, but it's
12610 not fully implemented yet.
12612 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12614 * src/support/FileInfo.h: Better documentation
12616 * src/lyxfunc.C: Added support for buffer-export html
12618 * src/menus.C: Added Export->As HTML...
12620 * lib/bind/*.bind: Added short-cut for buffer-export html
12622 * src/lyxrc.*: Added support for new \tth_command
12624 * lib/lyxrc.example: Added stuff for new \tth_command
12626 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12628 * lib/Makefile.am (IMAGES): removed images/README
12629 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12630 installes in correct place. Check permisions is installed
12633 * src/LaTeX.C: some no-op changes moved declaration of some
12636 * src/LaTeX.h (LATEX_H): changed include guard name
12638 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12640 * lib/reLyX/Makefile.am: install noweb2lyx.
12642 * lib/Makefile.am: install configure.
12644 * lib/reLyX/configure.in: declare a config aux dir; set package
12645 name to lyx (not sure what the best solution is); generate noweb2lyx.
12647 * lib/layouts/egs.layout: fix the bibliography layout.
12649 1999-10-08 Jürgen Vigna <jug@sad.it>
12651 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12652 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12653 it returned without continuing to search the path.
12655 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12657 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12658 also fixes a bug. It is not allowed to do tricks with std::strings
12659 like: string a("hei"); &a[e]; this will not give what you
12660 think... Any reason for the complexity in this func?
12662 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12664 * Updated README and INSTALL a bit, mostly to check that my
12665 CVS rights are correctly set up.
12667 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12669 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12670 does not allow '\0' chars but lyxstring and std::string does.
12672 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12674 * autogen.sh (AUTOCONF): let the autogen script create the
12675 POTFILES.in file too. POTFILES.in should perhaps now not be
12676 included in the cvs module.
12678 * some more files changed to use C++ includes instead of C ones.
12680 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12682 (Reread): added tostr to nlink. buggy output otherwise.
12683 (Reread): added a string() around szMode when assigning to Buffer,
12684 without this I got a log of garbled info strings.
12686 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12689 * I have added several ostream & operator<<(ostream &, some_type)
12690 functions. This has been done to avoid casting and warnings when
12691 outputting enums to lyxerr. This as thus eliminated a lot of
12692 explicit casts and has made the code clearer. Among the enums
12693 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12694 mathed enums, some font enum the Debug::type enum.
12696 * src/support/lyxstring.h (clear): missing method. equivalent of
12699 * all files that contained "stderr": rewrote constructs that used
12700 stderr to use lyxerr instead. (except bmtable)
12702 * src/support/DebugStream.h (level): and the passed t with
12703 Debug::ANY to avoid spurious bits set.
12705 * src/debug.h (Debug::type value): made it accept strings of the
12706 type INFO,INIT,KEY.
12708 * configure.in (Check for programs): Added a check for kpsewhich,
12709 the latex generation will use this later to better the dicovery of
12712 * src/BufferView.C (create_view): we don't need to cast this to
12713 (void*) that is done automatically.
12714 (WorkAreaButtonPress): removed some dead code.
12716 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12718 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12719 is not overwritten when translated (David Sua'rez de Lis).
12721 * lib/CREDITS: Added David Sua'rez de Lis
12723 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12725 * src/bufferparams.C (BufferParams): default input encoding is now
12728 * acinclude.m4 (cross_compiling): comment out macro
12729 LYX_GXX_STRENGTH_REDUCE.
12731 * acconfig.h: make sure that const is not defined (to empty) when
12732 we are compiling C++. Remove commented out code using SIZEOF_xx
12735 * configure.in : move the test for const and inline as late as
12736 possible so that these C tests do not interefere with C++ ones.
12737 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12738 has not been proven.
12740 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12742 * src/table.C (getDocBookAlign): remove bad default value for
12743 isColumn parameter.
12745 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12747 (ShowFileMenu2): ditto.
12749 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12750 of files to ignore.
12752 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12754 * Most files: finished the change from the old error code to use
12755 DebugStream for all lyxerr debugging. Only minor changes remain
12756 (e.g. the setting of debug levels using strings instead of number)
12758 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12760 * src/layout.C (Add): Changed to use compare_no_case instead of
12763 * src/FontInfo.C: changed loop variable type too string::size_type.
12765 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12767 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12768 set ETAGS_ARGS to --c++
12770 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12772 * src/table.C (DocBookEndOfCell): commented out two unused variables
12774 * src/paragraph.C: commented out four unused variables.
12776 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12777 insed a if clause with type string::size_type.
12779 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12782 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12784 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12785 variable, also changed loop to go from 0 to lenght + 1, instead of
12786 -1 to length. This should be correct.
12788 * src/LaTeX.C (scanError): use string::size_type as loop variable
12791 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12792 (l.896) since y_tmp and row was not used anyway.
12794 * src/insets/insetref.C (escape): use string::size_type as loop
12797 * src/insets/insetquotes.C (Width): use string::size_type as loop
12799 (Draw): use string::size_type as loop variable type.
12801 * src/insets/insetlatexaccent.C (checkContents): use
12802 string::size_type as loop variable type.
12804 * src/insets/insetlabel.C (escape): use string::size_type as loop
12807 * src/insets/insetinfo.C: added an extern for current_view.
12809 * src/insets/insetcommand.C (scanCommand): use string::size_type
12810 as loop variable type.
12812 * most files: removed the RCS tags. With them we had to recompile
12813 a lot of files after a simple cvs commit. Also we have never used
12814 them for anything meaningful.
12816 * most files: tags-query-replace NULL 0. As adviced several plases
12817 we now use "0" instead of "NULL" in our code.
12819 * src/support/filetools.C (SpaceLess): use string::size_type as
12820 loop variable type.
12822 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12824 * src/paragraph.C: fixed up some more string stuff.
12826 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12828 * src/support/filetools.h: make modestr a std::string.
12830 * src/filetools.C (GetEnv): made ch really const.
12832 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12833 made code that used these use max/min from <algorithm> instead.
12835 * changed several c library include files to their equivalent c++
12836 library include files. All is not changed yet.
12838 * created a support subdir in src, put lyxstring and lstrings
12839 there + the extra files atexit, fileblock, strerror. Created
12840 Makefile.am. edited configure.in and src/Makefile.am to use this
12841 new subdir. More files moved to support.
12843 * imported som of the functions from repository lyx, filetools
12845 * ran tags-query-replace on LString -> string, corrected the bogus
12846 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12847 is still some errors in there. This is errors where too much or
12848 too litle get deleted from strings (string::erase, string::substr,
12849 string::replace), there can also be some off by one errors, or
12850 just plain wrong use of functions from lstrings. Viewing of quotes
12853 * LyX is now running fairly well with string, but there are
12854 certainly some bugs yet (see above) also string is quite different
12855 from LString among others in that it does not allow null pointers
12856 passed in and will abort if it gets any.
12858 * Added the revtex4 files I forgot when setting up the repository.
12860 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12862 * All over: Tried to clean everything up so that only the files
12863 that we really need are included in the cvs repository.
12864 * Switched to use automake.
12865 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12866 * Install has not been checked.
12868 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12870 * po/pt.po: Three errors:
12871 l.533 and l.538 format specification error
12872 l. 402 duplicate entry, I just deleted it.