1 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
5 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
7 * src/intl.C (InitKeyMapper): Correct the value of n due to the
8 removal of the "default" language.
10 * src/combox.h (getline): Check that sel > 0
12 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
14 * lib/examples/docbook_example.lyx
15 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
17 * lib/layouts/docbook-book.layout: new docbook book layout.
19 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
21 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
23 * src/insets/figinset.C (DocBook):fixed small typo.
25 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
27 * src/insets/insetinclude.h: string include_label doesn't need to be
30 2000-09-29 Allan Rae <rae@lyx.org>
32 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
33 Allow derived type to control connection and disconnection from signals
34 of its choice if desired.
36 2000-09-28 Juergen Vigna <jug@sad.it>
38 * src/insets/insettabular.C (update): fixed cursor setting when
39 the_locking_inset changed.
40 (draw): made this a bit cleaner.
41 (InsetButtonPress): fixed!
43 * various files: added LyXText Parameter to fitCursor call.
45 * src/BufferView.C (fitCursor): added LyXText parameter.
47 * src/insets/insettabular.C (draw): small draw fix.
49 * src/tabular.C: right setting of left/right celllines.
51 * src/tabular.[Ch]: fixed various types in funcions and structures.
52 * src/insets/insettabular.C: ditto
53 * src/frontends/xforms/FormTabular.C: ditto
55 2000-09-28 Allan Rae <rae@lyx.org>
57 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
58 that the #ifdef's had been applied to part of what should have been
59 a complete condition. It's possible there are other tests that
60 were specific to tables that are also wrong now that InsetTabular is
61 being used. Now we need to fix the output of '\n' after a table in a
62 float for the same reason as the original condition:
63 "don't insert this if we would be adding it before or after a table
64 in a float. This little trick is needed in order to allow use of
65 tables in \subfigures or \subtables."
66 Juergen can you check this?
68 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
70 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
71 outputed to the ostream.
73 * several files: fixed types based on warnings from cxx
75 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
77 * src/frontends/kde/Makefile.am: fix rule for
78 formindexdialogdata_moc.C
80 * src/.cvsignore: add ext_l10n.h to ignore
82 * acconfig.h: stop messing with __STRICT_ANSI__
83 * config/gnome.m4: remove option to set -ansi
84 * config/kde.m4: remove option to set -ansi
85 * config/lyxinclude.m4: don't set -ansi
87 2000-09-27 Juergen Vigna <jug@sad.it>
89 * various files: remove "default" language check.
91 * src/insets/insetquotes.C: removed use of current_view.
93 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
94 the one should have red ears by now!
96 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
97 in more then one paragraph. Fixed cursor-movement/selection.
99 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
100 paragraphs inside a text inset.
102 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
103 text-inset if this owner is an inset.
105 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
107 * src/Bullet.h: changed type of font, character and size to int
109 * src/buffer.C (asciiParagraph): remove actcell and fname1.
111 * src/insets/inseturl.[Ch]:
112 * src/insets/insetref.[Ch]:
113 * src/insets/insetlabel.[Ch]: add linelen to Ascii
115 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
117 * src/buffer.C (readFile): block-if statement rearranged to minimise
118 bloat. Patch does not reverse Jean-Marc's change ;-)
120 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
121 Class rewritten to store pointers to hide/update signals directly,
122 rather than Dialogs *. Also defined an enum to ease use. All xforms
123 forms can now be derived from this class.
125 * src/frontends/xforms/FormCommand.[Ch]
126 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
128 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
131 * src/frontends/xforms/forms/form_citation.fd
132 * src/frontends/xforms/forms/form_copyright.fd
133 * src/frontends/xforms/forms/form_error.fd
134 * src/frontends/xforms/forms/form_index.fd
135 * src/frontends/xforms/forms/form_ref.fd
136 * src/frontends/xforms/forms/form_toc.fd
137 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
139 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
141 * src/insets/insetfoot.C: removed redundent using directive.
143 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
145 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
146 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
148 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
149 created in the constructors in different groups. Then set() just
150 have to show the groups as needed. This fixes the redraw problems
151 (and is how the old menu code worked).
153 * src/support/lyxlib.h: declare the methods as static when we do
156 2000-09-26 Juergen Vigna <jug@sad.it>
158 * src/buffer.C (asciiParagraph): new function.
159 (writeFileAscii): new function with parameter ostream.
160 (writeFileAscii): use now asciiParagraph.
162 * various inset files: added the linelen parameter to the Ascii-func.
164 * src/tabular.C (Write): fixed error in writing file introduced by
165 the last changes from Lars.
167 * lib/bind/menus.bind: removed not supported functions.
169 * src/insets/insettext.C (Ascii): implemented this function.
171 * src/insets/lyxinset.h (Ascii): added linelen parameter.
173 * src/tabular.C (write_attribute[int,string,bool]): new functions.
174 (Write): use of the write_attribute functions.
176 * src/bufferlist.C (close): fixed reasking question!
178 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
180 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
181 new files use the everwhere possible.
184 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
185 src/log_form.C src/lyx.C:
188 * src/buffer.C (runLaTeX): remove func
190 * src/PaperLayout.C: removed file
191 * src/ParagraphExtra.C: likewise
192 * src/bullet_forms.C: likewise
193 * src/bullet_forms.h: likewise
194 * src/bullet_forms_cb.C: likewise
196 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
197 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
200 * several files: remove all traces of the old fd_form_paragraph,
201 and functions belonging to that.
203 * several files: remove all traces of the old fd_form_document,
204 and functions belonging to that.
206 * several files: constify local variables were possible.
208 * several files: remove all code that was dead when NEW_EXPORT was
211 * several files: removed string::c_str in as many places as
214 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
215 (e): be a bit more outspoken when patching
216 (updatesrc): only move files if changed.
218 * forms/layout_forms.h.patch: regenerated
220 * forms/layout_forms.fd: remove form_document and form_paragraph
221 and form_quotes and form_paper and form_table_options and
224 * forms/form1.fd: remove form_table
226 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
227 the fdui->... rewrite. Update some comments to xforms 0.88
229 * forms/bullet_forms.C.patch: removed file
230 * forms/bullet_forms.fd: likewise
231 * forms/bullet_forms.h.patch: likewise
233 * development/Code_rules/Rules: added a section on switch
234 statements. Updated some comment to xforms 0.88.
236 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
238 * src/buffer.C (readFile): make sure that the whole version number
239 is read after \lyxformat (even when it contains a comma)
241 * lib/ui/default.ui: change shortcut of math menu to M-a.
243 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
245 * src/vspace.C (nextToken): use isStrDbl() to check for proper
248 * src/LyXView.C (updateWindowTitle): show the full files name in
249 window title, limited to 30 characters.
251 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
252 When a number of characters has been given, we should not assume
253 that the string is 0-terminated.
255 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
256 calls (fixes some memory leaks)
258 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
259 trans member on exit.
261 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
263 * src/converter.C (GetReachable): fix typo.
265 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
266 understand ',' instead of '.'.
267 (GetInteger): rewrite to use strToInt().
269 2000-09-26 Juergen Vigna <jug@sad.it>
271 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
272 better visibility and error-message on wrong VSpace input.
274 * src/language.C (initL): added english again.
276 2000-09-25 Juergen Vigna <jug@sad.it>
278 * src/frontends/kde/Dialogs.C (Dialogs):
279 * src/frontends/gnome/Dialogs.C (Dialogs):
280 * src/frontends/kde/Makefile.am:
281 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
283 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
285 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
287 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
289 * src/frontends/xforms/FormParagraph.C:
290 * src/frontends/xforms/FormParagraph.h:
291 * src/frontends/xforms/form_paragraph.C:
292 * src/frontends/xforms/form_paragraph.h:
293 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
296 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
298 * src/tabular.C (OldFormatRead): forgot to delete the temporary
299 Paragraph-Data after use.
301 * src/insets/insettext.C (LocalDispatch): don't set the layout on
302 non breakable paragraphs.
304 2000-09-25 Garst R. Reese <reese@isn.net>
306 * src/language.C (initL): added missing language_country codes.
308 2000-09-25 Juergen Vigna <jug@sad.it>
310 * src/insets/insettext.C (InsetText):
311 (deleteLyXText): remove the not released LyXText structure!
313 2000-09-24 Marko Vendelin <markov@ioc.ee>
315 * src/frontends/gnome/mainapp.C
316 * src/frontends/gnome/mainapp.h: added support for keyboard
319 * src/frontends/gnome/FormCitation.C
320 * src/frontends/gnome/FormCitation.h
321 * src/frontends/gnome/Makefile.am
322 * src/frontends/gnome/pixbutton.h: completed the rewrite of
323 FormCitation to use "action area" in mainapp window
325 * src/frontends/gnome/Menubar_pimpl.C
326 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
329 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
331 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
332 width/descent/ascent values if name is empty.
333 (mathed_string_height): Use std::max.
335 2000-09-25 Allan Rae <rae@lyx.org>
337 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
338 segfault. This will be completely redesigned soon.
340 * sigc++: updated libsigc++. Fixes struct timespec bug.
342 * development/tools/makeLyXsigc.sh: .cvsignore addition
344 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
346 * several files: removed almost all traces of the old table
349 * src/TableLayout.C: removed file
351 2000-09-22 Juergen Vigna <jug@sad.it>
353 * src/frontends/kde/Dialogs.C: added credits forms.
355 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
357 * src/frontends/gnome/Dialogs.C: added some forms.
359 * src/spellchecker.C (init_spell_checker): set language in pspell code
360 (RunSpellChecker): some modifications for setting language string.
362 * src/language.[Ch]: added language_country code.
364 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
366 * src/frontends/Dialogs.h: added new signal showError.
367 Rearranged existing signals in some sort of alphabetical order.
369 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
370 FormError.[Ch], form_error.[Ch]
371 * src/frontends/xforms/forms/makefile: added new file form_error.fd
372 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
374 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
375 dialogs. I think that this can be used as the base to all these
378 * src/frontends/xforms/FormError.[Ch]
379 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
380 implementation of InsetError dialog.
382 * src/insets/inseterror.[Ch]: rendered GUI-independent.
384 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
385 * src/frontends/kde/Makefile.am: ditto
387 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
389 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
390 macrobf. This fixes a bug of invisible text.
392 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
394 * lib/doc/LaTeXConfig.lyx.in: updated.
396 * src/language.C (initL): remove language "francais" and change a
397 bit the names of the two other french variations.
399 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
400 string that may not be 0-terminated.
402 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
404 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
406 2000-09-20 Marko Vendelin <markov@ioc.ee>
408 * src/frontends/gnome/FormCitation.C
409 * src/frontends/gnome/FormIndex.C
410 * src/frontends/gnome/FormToc.C
411 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
412 the variable initialization to shut up the warnings
414 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
416 * src/table.[Ch]: deleted files
418 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
421 2000-09-18 Juergen Vigna <jug@sad.it>
423 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
424 problems with selection. Inserted new LFUN_PASTESELECTION.
425 (InsetButtonPress): inserted handling of middle mouse-button paste.
427 * src/spellchecker.C: changed word to word.c_str().
429 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
431 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
432 included in the ``make dist'' tarball.
434 2000-09-15 Juergen Vigna <jug@sad.it>
436 * src/CutAndPaste.C (cutSelection): small fix return the right
437 end position after cut inside one paragraph only.
439 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
440 we are locked as otherwise we don't have a valid cursor position!
442 * src/insets/figinset.C (draw): small bugfix but why is this needed???
444 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
446 * src/frontends/kde/FormRef.C: added using directive.
447 * src/frontends/kde/FormToc.C: ditto
449 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
451 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
453 2000-09-19 Marko Vendelin <markov@ioc.ee>
455 * src/frontends/gnome/Menubar_pimpl.C
456 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
457 Toc, ViewFormats, UpdateFormats, and ExportFormats.
459 * src/frontends/gnome/mainapp.C
460 * src/frontends/gnome/mainapp.h: support for menu update used
463 * src/frontends/gnome/mainapp.C
464 * src/frontends/gnome/mainapp.h: support for "action" area in the
465 main window. This area is used by small simple dialogs, such as
468 * src/frontends/gnome/FormIndex.C
469 * src/frontends/gnome/FormIndex.h
470 * src/frontends/gnome/FormUrl.C
471 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
474 * src/frontends/gnome/FormCitation.C
475 * src/frontends/gnome/FormCitation.h: rewrite to use main window
476 action area. Only "Insert new citation" is implemented.
478 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
480 * src/buffer.C (Dispatch): fix call to Dispatch
481 * src/insets/insetref.C (Edit): likewise
482 * src/insets/insetparent.C (Edit): likewise
483 * src/insets/insetinclude.C (include_cb): likewise
484 * src/frontends/xforms/FormUrl.C (apply): likewise
485 * src/frontends/xforms/FormToc.C (apply): likewise
486 * src/frontends/xforms/FormRef.C (apply): likewise
487 * src/frontends/xforms/FormIndex.C (apply): likewise
488 * src/frontends/xforms/FormCitation.C (apply): likewise
489 * src/lyxserver.C (callback): likewise
490 * src/lyxfunc.C (processKeySym): likewise
493 * src/lyx_cb.C (LayoutsCB): likewise
495 * Makefile.am (sourcedoc): small change
497 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
499 * src/main.C (main): Don't make an empty GUIRunTime object. all
500 methods are static. constify a bit remove unneded using + headers.
502 * src/tabular.C: some more const to local vars move some loop vars
504 * src/spellchecker.C: added some c_str after some word for pspell
506 * src/frontends/GUIRunTime.h: add new static method setDefaults
507 * src/frontends/xforms/GUIRunTime.C (setDefaults):
508 * src/frontends/kde/GUIRunTime.C (setDefaults):
509 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
511 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
512 with strnew in arg, use correct emptystring when calling SetName.
514 * several files: remove all commented code with relation to
515 HAVE_SSTREAM beeing false. We now only support stringstream and
518 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
520 * src/lyxfunc.C: construct correctly the automatic new file
523 * src/text2.C (IsStringInText): change type of variable i to shut
526 * src/support/sstream.h: do not use namespaces if the compiler
527 does not support them.
529 2000-09-15 Marko Vendelin <markov@ioc.ee>
530 * src/frontends/gnome/FormCitation.C
531 * src/frontends/gnome/FormCitation.h
532 * src/frontends/gnome/diainsertcitation_interface.c
533 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
534 regexp support to FormCitation [Gnome].
536 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
539 * configure.in: remove unused KDE/GTKGUI define
541 * src/frontends/kde/FormRef.C
542 * src/frontends/kde/FormRef.h
543 * src/frontends/kde/formrefdialog.C
544 * src/frontends/kde/formrefdialog.h: double click will
545 go to reference, now it is possible to change a cross-ref
548 * src/frontends/kde/FormToc.C
549 * src/frontends/kde/FormToc.h
550 * src/frontends/kde/formtocdialog.C
551 * src/frontends/kde/formtocdialog.h: add a depth
554 * src/frontends/kde/Makefile.am: add QtLyXView.h
557 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
559 * src/frontends/kde/FormCitation.h: added some using directives.
561 * src/frontends/kde/FormToc.h: corrected definition of doTree.
563 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
566 * src/mathed/math_defs.h: redefine SetAlign to use string rather
569 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
571 * src/buffer.C (pop_tag): revert for the second time a change by
572 Lars, who seems to really hate having non-local loop variables :)
574 * src/Lsstream.h: add "using" statements.
576 * src/support/copy.C (copy): add a bunch of std:: qualifiers
577 * src/buffer.C (writeFile): ditto
579 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
581 * src/buffer.C (writeFile): try to fix the locale modified format
582 number to always be as we want it.
584 * src/WorkArea.C (work_area_handler): try to workaround the bugs
585 in XForms 0.89. C-space is now working again.
587 * src/Lsstream.h src/support/sstream.h: new files.
589 * also commented out all cases where strstream were used.
591 * src/Bullet.h (c_str): remove method.
593 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
595 * a lot of files: get rid of "char const *" and "char *" is as
596 many places as possible. We only want to use them in interaction
597 with system of other libraries, not inside lyx.
599 * a lot of files: return const object is not of pod type. This
600 helps ensure that temporary objects is not modified. And fits well
601 with "programming by contract".
603 * configure.in: check for the locale header too
605 * Makefile.am (sourcedoc): new tag for generation of doc++
608 2000-09-14 Juergen Vigna <jug@sad.it>
610 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
611 callback to check which combo called it and do the right action.
613 * src/combox.C (combo_cb): added combo * to the callbacks.
614 (Hide): moved call of callback after Ungrab of the pointer.
616 * src/intl.h: removed LCombo2 function.
618 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
619 function as this can now be handled in one function.
621 * src/combox.h: added Combox * to callback prototype.
623 * src/frontends/xforms/Toolbar_pimpl.C:
624 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
626 2000-09-14 Garst Reese <reese@isn.net>
628 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
629 moved usepackage{xxx}'s to beginning of file. Changed left margin
630 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
631 underlining from title. Thanks to John Culleton for useful suggestions.
633 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
635 * src/lyxlex_pimpl.C (setFile): change error message to debug
638 2000-09-13 Juergen Vigna <jug@sad.it>
640 * src/frontends/xforms/FormDocument.C: implemented choice_class
641 as combox and give callback to combo_language so OK/Apply is activated
644 * src/bufferlist.C (newFile): small fix so already named files
645 (via an open call) are not requested to be named again on the
648 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
650 * src/frontends/kde/Makefile.am
651 * src/frontends/kde/FormRef.C
652 * src/frontends/kde/FormRef.h
653 * src/frontends/kde/formrefdialog.C
654 * src/frontends/kde/formrefdialog.h: implement
657 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
659 * src/frontends/kde/formtocdialog.C
660 * src/frontends/kde/formtocdialog.h
661 * src/frontends/kde/FormToc.C
662 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
664 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
666 * src/frontends/kde/FormCitation.C: fix thinko
667 where we didn't always display the reference text
670 * src/frontends/kde/formurldialog.C
671 * src/frontends/kde/formurldialog.h
672 * src/frontends/kde/FormUrl.C
673 * src/frontends/kde/FormUrl.h: minor cleanups
675 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
677 * src/frontends/kde/Makefile.am
678 * src/frontends/kde/FormToc.C
679 * src/frontends/kde/FormToc.h
680 * src/frontends/kde/FormCitation.C
681 * src/frontends/kde/FormCitation.h
682 * src/frontends/kde/FormIndex.C
683 * src/frontends/kde/FormIndex.h
684 * src/frontends/kde/formtocdialog.C
685 * src/frontends/kde/formtocdialog.h
686 * src/frontends/kde/formcitationdialog.C
687 * src/frontends/kde/formcitationdialog.h
688 * src/frontends/kde/formindexdialog.C
689 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
691 2000-09-12 Juergen Vigna <jug@sad.it>
693 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
696 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
698 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
701 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
703 * src/converter.C (Add, Convert): Added support for converter flags:
704 needaux, resultdir, resultfile.
705 (Convert): Added new parameter view_file.
706 (dvips_options): Fixed letter paper option.
708 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
709 (Export, GetExportableFormats, GetViewableFormats): Added support
712 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
714 (easyParse): Fixed to work with new export code.
716 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
719 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
721 * lib/bind/*.bind: Replaced
722 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
723 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
725 2000-09-11 Juergen Vigna <jug@sad.it>
727 * src/lyx_gui.C (runTime): uses global guiruntime variable.
729 * src/main.C (main): now GUII defines global guiruntime!
731 * src/frontends/gnome/GUIRunTime.C (initApplication):
732 * src/frontends/kde/GUIRunTime.C (initApplication):
733 * src/frontends/xforms/GUIRunTime.C (initApplication):
734 * src/frontends/GUIRunTime.h: added new function initApplication.
736 * src/spellchecker.C (sc_accept_word): change to add_to_session.
738 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
740 2000-09-08 Juergen Vigna <jug@sad.it>
742 * src/lyx_gui.C (create_forms): don't display the "default" entry as
743 we have already "Reset".
745 * src/language.C (initL): inserted "default" language and made this
746 THE default language (and not american!)
748 * src/paragraph.C: inserted handling of "default" language!
750 * src/lyxfont.C: ditto
754 * src/paragraph.C: output the \\par only if we have a following
755 paragraph otherwise it's not needed.
757 2000-09-05 Juergen Vigna <jug@sad.it>
759 * config/pspell.m4: added entry to lyx-flags
761 * src/spellchecker.C: modified version from Kevin for using pspell
763 2000-09-01 Marko Vendelin <markov@ioc.ee>
764 * src/frontends/gnome/Makefile.am
765 * src/frontends/gnome/FormCitation.C
766 * src/frontends/gnome/FormCitation.h
767 * src/frontends/gnome/diainsertcitation_callbacks.c
768 * src/frontends/gnome/diainsertcitation_callbacks.h
769 * src/frontends/gnome/diainsertcitation_interface.c
770 * src/frontends/gnome/diainsertcitation_interface.h
771 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
772 dialog for Gnome frontend
774 * src/main.C: Gnome libraries require keeping application name
775 and its version as strings
777 * src/frontends/gnome/mainapp.C: Change the name of the main window
778 from GnomeLyX to PACKAGE
780 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
782 * src/frontends/Liason.C: add "using: declaration.
784 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
786 * src/mathed/math_macro.C (Metrics): Set the size of the template
788 * src/mathed/formulamacro.C (Latex): Fixed the returned value
790 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
792 * src/converter.C (add_options): New function.
793 (SetViewer): Change $$FName into '$$FName'.
794 (View): Add options when running xdvi
795 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
796 (Convert): The 3rd parameter is now the desired filename. Converts
797 calls to lyx::rename if necessary.
798 Add options when running dvips.
799 (dvi_papersize,dvips_options): New methods.
801 * src/exporter.C (Export): Use getLatexName() instead of fileName().
803 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
804 using a call to Converter::dvips_options.
805 Fixed to work with nex export code.
808 * src/support/rename.C: New files
810 * src/support/syscall.h
811 * src/support/syscall.C: Added Starttype SystemDontWait.
813 * lib/ui/default.ui: Changed to work with new export code
815 * lib/configure.m4: Changed to work with new export code
817 * src/encoding.C: Changed latex name for iso8859_7 encoding.
819 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
821 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
822 so that code compiles with DEC cxx.
824 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
825 to work correctly! Also now supports the additional elements
828 2000-09-01 Allan Rae <rae@lyx.org>
830 * src/frontends/ButtonPolicies.C: renamed all the references to
831 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
833 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
834 since it's a const not a type.
836 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
838 2000-08-31 Juergen Vigna <jug@sad.it>
840 * src/insets/figinset.C: Various changes to look if the filename has
841 an extension and if not add it for inline previewing.
843 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
845 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
846 make buttonStatus and isReadOnly be const methods. (also reflect
847 this in derived classes.)
849 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
850 (nextState): change to be static inline, pass the StateMachine as
852 (PreferencesPolicy): remove casts
853 (OkCancelPolicy): remvoe casts
854 (OkCancelReadOnlyPolicy): remove casts
855 (NoRepeatedApplyReadOnlyPolicy): remove casts
856 (OkApplyCancelReadOnlyPolicy): remove casts
857 (OkApplyCancelPolicy): remove casts
858 (NoRepeatedApplyPolicy): remove casts
860 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
862 * src/converter.C: added some using directives
864 * src/frontends/ButtonPolicies.C: changes to overcome
865 "need lvalue" error with DEC c++
867 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
868 to WMHideCB for DEC c++
870 * src/frontends/xforms/Menubar_pimpl.C: added using directive
872 * src/frontends/xforms/forms/form_document.C.patch: use C callback
873 to BulletBMTableCB for DEC c++
875 2000-08-31 Allan Rae <rae@lyx.org>
877 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
878 character dialog separately from old document dialogs combo_language.
881 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
883 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
884 Removed LFUN_REF_CREATE.
886 * src/MenuBackend.C: Added new tags: toc and references
888 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
889 (add_lastfiles, add_documents, add_formats): Removed the unused smn
891 (add_toc, add_references): New methods.
892 (create_submenu): Handle correctly the case when there is a
893 seperator after optional menu items.
895 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
896 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
897 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
899 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
901 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
903 * src/converter.[Ch]: New file for converting between different
906 * src/export.[Ch]: New file for exporting a LyX file to different
909 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
910 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
911 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
912 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
913 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
914 RunDocBook, MenuExport.
916 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
917 Exporter::Preview methods if NEW_EXPORT is defined.
919 * src/buffer.C (Dispatch): Use Exporter::Export.
921 * src/lyxrc.C: Added new tags: \converter and \viewer.
924 * src/LyXAction.C: Define new lyx-function: buffer-update.
925 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
926 when NEW_EXPORT is defined.
928 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
930 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
932 * lib/ui/default.ui: Added submenus "view" and "update" to the
935 * src/filetools.C (GetExtension): New function.
937 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
939 2000-08-29 Allan Rae <rae@lyx.org>
941 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
943 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
944 (EnableDocumentLayout): removed
945 (DisableDocumentLayout): removed
946 (build): make use of ButtonController's read-only handling to
947 de/activate various objects. Replaces both of the above functions.
949 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
950 (readOnly): was read_only
951 (refresh): fixed dumb mistakes with read_only_ handling
953 * src/frontends/xforms/forms/form_document.fd:
954 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
955 tabbed dialogs so the tabs look more like tabs and so its easier to
956 work out which is the current tab.
958 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
959 segfault with form_table
961 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
963 2000-08-28 Juergen Vigna <jug@sad.it>
965 * acconfig.h: added USE_PSPELL.
967 * src/config.h.in: added USE_PSPELL.
969 * autogen.sh: added pspell.m4
971 * config/pspell.m4: new file.
973 * src/spellchecker.C: implemented support for pspell libary.
975 2000-08-25 Juergen Vigna <jug@sad.it>
977 * src/LyXAction.C (init): renamed LFUN_TABLE to
978 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
980 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
982 * src/lyxscreen.h: add force_clear variable and fuction to force
983 a clear area when redrawing in LyXText.
985 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
987 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
989 * some whitespace and comment changes.
991 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
993 * src/buffer.C: up te LYX_FORMAT to 2.17
995 2000-08-23 Juergen Vigna <jug@sad.it>
997 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1000 * src/insets/insettabular.C (pasteSelection): delete the insets
1001 LyXText as it is not valid anymore.
1002 (copySelection): new function.
1003 (pasteSelection): new function.
1004 (cutSelection): new function.
1005 (LocalDispatch): implemented cut/copy/paste of cell selections.
1007 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1008 don't have a LyXText.
1010 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1012 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1015 2000-08-22 Juergen Vigna <jug@sad.it>
1017 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1018 ifdef form_table out if NEW_TABULAR.
1020 2000-08-21 Juergen Vigna <jug@sad.it>
1022 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1023 (draw): fixed draw position so that the cursor is positioned in the
1025 (InsetMotionNotify): hide/show cursor so the position is updated.
1026 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1027 using cellstart() function where it should be used.
1029 * src/insets/insettext.C (draw): ditto.
1031 * src/tabular.C: fixed initialization of some missing variables and
1032 made BoxType into an enum.
1034 2000-08-22 Marko Vendelin <markov@ioc.ee>
1035 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1036 stock menu item using action numerical value, not its string
1040 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1042 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1043 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1045 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1047 * src/frontends/xforms/GUIRunTime.C: new file
1049 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1050 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1052 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1054 * src/frontends/kde/GUIRunTime.C: new file
1056 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1057 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1059 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1061 * src/frontends/gnome/GUIRunTime.C: new file
1063 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1066 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1067 small change to documetentation.
1069 * src/frontends/GUIRunTime.C: removed file
1071 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1073 * src/lyxparagraph.h: enable NEW_TABULAR as default
1075 * src/lyxfunc.C (processKeySym): remove some commented code
1077 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1078 NEW_TABULAR around the fd_form_table_options.
1080 * src/lyx_gui.C (runTime): call the static member function as
1081 GUIRunTime::runTime().
1083 2000-08-21 Allan Rae <rae@lyx.org>
1085 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1088 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1090 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1092 2000-08-21 Allan Rae <rae@lyx.org>
1094 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1095 keep Garst happy ;-)
1096 * src/frontends/xforms/FormPreferences.C (build): use setOK
1097 * src/frontends/xforms/FormDocument.C (build): use setOK
1098 (FormDocument): use the appropriate policy.
1100 2000-08-21 Allan Rae <rae@lyx.org>
1102 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1103 automatic [de]activation of arbitrary objects when in a read-only state.
1105 * src/frontends/ButtonPolicies.h: More documentation
1106 (isReadOnly): added to support the above.
1108 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1110 2000-08-18 Juergen Vigna <jug@sad.it>
1112 * src/insets/insettabular.C (getStatus): changed to return func_status.
1114 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1115 display toggle menu entries if they are.
1117 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1118 new document layout now.
1120 * src/lyxfunc.C: ditto
1122 * src/lyx_gui_misc.C: ditto
1124 * src/lyx_gui.C: ditto
1126 * lib/ui/default.ui: removed paper and quotes layout as they are now
1127 all in the document layout tabbed folder.
1129 * src/frontends/xforms/forms/form_document.fd: added Restore
1130 button and callbacks for all inputs for Allan's ButtonPolicy.
1132 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1133 (CheckChoiceClass): added missing params setting on class change.
1134 (UpdateLayoutDocument): added for updating the layout on params.
1135 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1136 (FormDocument): Implemented Allan's ButtonPolicy with the
1139 2000-08-17 Allan Rae <rae@lyx.org>
1141 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1142 so we can at least see the credits again.
1144 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1145 controller calls for the appropriate callbacks. Note that since Ok
1146 calls apply followed by cancel, and apply isn't a valid input for the
1147 APPLIED state, the bc_ calls have to be made in the static callback not
1148 within each of the real callbacks.
1150 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1151 (setOk): renamed from setOkay()
1153 2000-08-17 Juergen Vigna <jug@sad.it>
1155 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1156 in the implementation part.
1157 (composeUIInfo): don't show optional menu-items.
1159 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1161 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1163 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1164 text-state when in a text-inset.
1166 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1168 2000-08-17 Marko Vendelin <markov@ioc.ee>
1169 * src/frontends/gnome/FormIndex.C
1170 * src/frontends/gnome/FormIndex.h
1171 * src/frontends/gnome/FormToc.C
1172 * src/frontends/gnome/FormToc.h
1173 * src/frontends/gnome/dialogs
1174 * src/frontends/gnome/diatoc_callbacks.c
1175 * src/frontends/gnome/diatoc_callbacks.h
1176 * src/frontends/gnome/diainsertindex_callbacks.h
1177 * src/frontends/gnome/diainsertindex_callbacks.c
1178 * src/frontends/gnome/diainsertindex_interface.c
1179 * src/frontends/gnome/diainsertindex_interface.h
1180 * src/frontends/gnome/diatoc_interface.h
1181 * src/frontends/gnome/diatoc_interface.c
1182 * src/frontends/gnome/Makefile.am: Table of Contents and
1183 Insert Index dialogs implementation for Gnome frontend
1185 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1187 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1189 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1192 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1194 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1195 destructor. Don't definde if you don't need it
1196 (processEvents): made static, non-blocking events processing for
1198 (runTime): static method. event loop for xforms
1199 * similar as above for kde and gnome.
1201 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1202 new Pimpl is correct
1203 (runTime): new method calss the real frontends runtime func.
1205 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1207 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1209 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1211 2000-08-16 Juergen Vigna <jug@sad.it>
1213 * src/lyx_gui.C (runTime): added GUII RunTime support.
1215 * src/frontends/Makefile.am:
1216 * src/frontends/GUIRunTime.[Ch]:
1217 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1218 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1219 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1221 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1223 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1224 as this is already set in ${FRONTEND_INCLUDE} if needed.
1226 * configure.in (CPPFLAGS): setting the include dir for the frontend
1227 directory and don't set FRONTEND=xforms for now as this is executed
1230 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1232 * src/frontends/kde/Makefile.am:
1233 * src/frontends/kde/FormUrl.C:
1234 * src/frontends/kde/FormUrl.h:
1235 * src/frontends/kde/formurldialog.h:
1236 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1238 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1240 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1242 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1244 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1247 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1249 * src/WorkArea.C (work_area_handler): more work to get te
1250 FL_KEYBOARD to work with xforms 0.88 too, please test.
1252 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1254 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1256 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1259 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1261 * src/Timeout.h: remove Qt::emit hack.
1263 * several files: changes to allo doc++ compilation
1265 * src/lyxfunc.C (processKeySym): new method
1266 (processKeyEvent): comment out if FL_REVISION < 89
1268 * src/WorkArea.C: change some debugging levels.
1269 (WorkArea): set wantkey to FL_KEY_ALL
1270 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1271 clearer code and the use of compose with XForms 0.89. Change to
1272 use signals instead of calling methods in bufferview directly.
1274 * src/Painter.C: change some debugging levels.
1276 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1279 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1280 (workAreaKeyPress): new method
1282 2000-08-14 Juergen Vigna <jug@sad.it>
1284 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1286 * config/kde.m4: addes some features
1288 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1289 include missing xforms dialogs.
1291 * src/Timeout.h: a hack to be able to compile with qt/kde.
1293 * sigc++/.cvsignore: added acinclude.m4
1295 * lib/.cvsignore: added listerros
1297 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1298 xforms tree as objects are needed for other frontends.
1300 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1301 linking with not yet implemented xforms objects.
1303 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1305 2000-08-14 Baruch Even <baruch.even@writeme.com>
1307 * src/frontends/xforms/FormGraphics.h:
1308 * src/frontends/xforms/FormGraphics.C:
1309 * src/frontends/xforms/RadioButtonGroup.h:
1310 * src/frontends/xforms/RadioButtonGroup.C:
1311 * src/insets/insetgraphics.h:
1312 * src/insets/insetgraphics.C:
1313 * src/insets/insetgraphicsParams.h:
1314 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1315 instead of spaces, and various other indentation issues to make the
1316 sources more consistent.
1318 2000-08-14 Marko Vendelin <markov@ioc.ee>
1320 * src/frontends/gnome/dialogs/diaprint.glade
1321 * src/frontends/gnome/FormPrint.C
1322 * src/frontends/gnome/FormPrint.h
1323 * src/frontends/gnome/diaprint_callbacks.c
1324 * src/frontends/gnome/diaprint_callbacks.h
1325 * src/frontends/gnome/diaprint_interface.c
1326 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1329 * src/frontends/gnome/dialogs/diainserturl.glade
1330 * src/frontends/gnome/FormUrl.C
1331 * src/frontends/gnome/FormUrl.h
1332 * src/frontends/gnome/diainserturl_callbacks.c
1333 * src/frontends/gnome/diainserturl_callbacks.h
1334 * src/frontends/gnome/diainserturl_interface.c
1335 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1336 Gnome implementation
1338 * src/frontends/gnome/Dialogs.C
1339 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1340 all other dialogs. Copy all unimplemented dialogs from Xforms
1343 * src/frontends/gnome/support.c
1344 * src/frontends/gnome/support.h: support files generated by Glade
1348 * config/gnome.m4: Gnome configuration scripts
1350 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1351 configure --help message
1353 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1354 only if there are no events pendling in Gnome/Gtk. This enhances
1355 the performance of menus.
1358 2000-08-14 Allan Rae <rae@lyx.org>
1360 * lib/Makefile.am: listerrors cleaning
1362 * lib/listerrors: removed -- generated file
1363 * acinclude.m4: ditto
1364 * sigc++/acinclude.m4: ditto
1366 * src/frontends/xforms/forms/form_citation.fd:
1367 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1370 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1371 `updatesrc` and now we have a `test` target that does what `updatesrc`
1372 used to do. I didn't like having an install target that wasn't related
1375 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1376 on all except FormGraphics. This may yet happen. Followed by a major
1377 cleanup including using FL_TRANSIENT for most of the dialogs. More
1378 changes to come when the ButtonController below is introduced.
1380 * src/frontends/xforms/ButtonController.h: New file for managing up to
1381 four buttons on a dialog according to an externally defined policy.
1382 * src/frontends/xforms/Makefile.am: added above
1384 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1385 Apply and Cancel/Close buttons and everything in between and beyond.
1386 * src/frontends/Makefile.am: added above.
1388 * src/frontends/xforms/forms/form_preferences.fd:
1389 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1390 and removed variable 'status' as a result. Fixed the set_minsize thing.
1391 Use the new screen-font-update after checking screen fonts were changed
1392 Added a "Restore" button to restore the original lyxrc values while
1393 editing. This restores everything not just the last input changed.
1394 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1396 * src/LyXAction.C: screen-font-update added for updating buffers after
1397 screen font settings have been changed.
1398 * src/commandtags.h: ditto
1399 * src/lyxfunc.C: ditto
1401 * forms/lyx.fd: removed screen fonts dialog.
1402 * src/lyx_gui.C: ditto
1403 * src/menus.[Ch]: ditto
1404 * src/lyx.[Ch]: ditto
1405 * src/lyx_cb.C: ditto + code from here moved to make
1406 screen-font-update. And people wonder why progress on GUII is
1407 slow. Look at how scattered this stuff was! It takes forever
1410 * forms/fdfix.sh: Fixup the spacing after commas.
1411 * forms/makefile: Remove date from generated files. Fewer clashes now.
1412 * forms/bullet_forms.C.patch: included someones handwritten changes
1414 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1415 once I've discovered why LyXRC was made noncopyable.
1416 * src/lyx_main.C: ditto
1418 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1420 * src/frontends/xforms/forms/fdfix.sh:
1421 * src/frontends/xforms/forms/fdfixh.sed:
1422 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1423 * src/frontends/xforms/Form*.[hC]:
1424 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1425 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1426 provide a destructor for the struct FD_form_xxxx. Another version of
1427 the set_[max|min]size workaround and a few other cleanups. Actually,
1428 Angus' patch from 20000809.
1430 2000-08-13 Baruch Even <baruch.even@writeme.com>
1432 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1435 2000-08-11 Juergen Vigna <jug@sad.it>
1437 * src/insets/insetgraphics.C (InsetGraphics): changing init
1438 order because of warnings.
1440 * src/frontends/xforms/forms/makefile: adding patching .C with
1443 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1444 from .C.patch to .c.patch
1446 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1447 order because of warning.
1449 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1451 * src/frontends/Liason.C (setMinibuffer): new helper function
1453 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1455 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1457 * lib/ui/default.ui: commented out PaperLayout entry
1459 * src/frontends/xforms/form_document.[Ch]: new added files
1461 * src/frontends/xforms/FormDocument.[Ch]: ditto
1463 * src/frontends/xforms/forms/form_document.fd: ditto
1465 * src/frontends/xforms/forms/form_document.C.patch: ditto
1467 2000-08-10 Juergen Vigna <jug@sad.it>
1469 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1470 (InsetGraphics): initialized cacheHandle to 0.
1471 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1473 2000-08-10 Baruch Even <baruch.even@writeme.com>
1475 * src/graphics/GraphicsCache.h:
1476 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1477 correctly as a cache.
1479 * src/graphics/GraphicsCacheItem.h:
1480 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1483 * src/graphics/GraphicsCacheItem_pimpl.h:
1484 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1487 * src/insets/insetgraphics.h:
1488 * src/insets/insetgraphics.C: Changed from using a signal notification
1489 to polling when image is not loaded.
1491 2000-08-10 Allan Rae <rae@lyx.org>
1493 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1494 that there are two functions that have to been taken out of line by
1495 hand and aren't taken care of in the script. (Just a reminder note)
1497 * sigc++/macros/*.h.m4: Updated as above.
1499 2000-08-09 Juergen Vigna <jug@sad.it>
1501 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1503 * src/insets/insettabular.C: make drawing of single cell smarter.
1505 2000-08-09 Marko Vendelin <markov@ioc.ee>
1506 * src/frontends/gnome/Menubar_pimpl.C
1507 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1508 implementation: new files
1510 * src/frontends/gnome/mainapp.C
1511 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1514 * src/main.C: create Gnome main window
1516 * src/frontends/xforms/Menubar_pimpl.h
1517 * src/frontends/Menubar.C
1518 * src/frontends/Menubar.h: added method Menubar::update that calls
1519 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1521 * src/LyXView.C: calls Menubar::update to update the state
1524 * src/frontends/gnome/Makefile.am: added new files
1526 * src/frontends/Makefile.am: added frontend compiler options
1528 2000-08-08 Juergen Vigna <jug@sad.it>
1530 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1532 * src/bufferlist.C (close):
1533 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1534 documents if exiting without saving.
1536 * src/buffer.C (save): use removeAutosaveFile()
1538 * src/support/filetools.C (removeAutosaveFile): new function.
1540 * src/lyx_cb.C (MenuWrite): returns a bool now.
1541 (MenuWriteAs): check if file could really be saved and revert to the
1543 (MenuWriteAs): removing old autosavefile if existant.
1545 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1546 before Goto toggle declaration, because of compiler warning.
1548 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1550 * src/lyxfunc.C (MenuNew): small fix.
1552 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1554 * src/bufferlist.C (newFile):
1555 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1557 * src/lyxrc.C: added new_ask_filename tag
1559 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1561 * src/lyx.fd: removed code pertaining to form_ref
1562 * src/lyx.[Ch]: ditto
1563 * src/lyx_cb.C: ditto
1564 * src/lyx_gui.C: ditto
1565 * src/lyx_gui_misc.C: ditto
1567 * src/BufferView_pimpl.C (restorePosition): update buffer only
1570 * src/commandtags.h (LFUN_REFTOGGLE): removed
1571 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1572 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1573 (LFUN_REFBACK): renamed LFUN_REF_BACK
1575 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1576 * src/menus.C: ditto
1577 * src/lyxfunc.C (Dispatch): ditto.
1578 InsertRef dialog is now GUI-independent.
1580 * src/texrow.C: added using std::endl;
1582 * src/insets/insetref.[Ch]: strip out large amounts of code.
1583 The inset is now a container and this functionality is now
1584 managed by a new FormRef dialog
1586 * src/frontends/Dialogs.h (showRef, createRef): new signals
1588 * src/frontends/xforms/FormIndex.[Ch],
1589 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1590 when setting dialog's min/max size
1591 * src/frontends/xforms/FormIndex.[Ch]: ditto
1593 * src/frontends/xforms/FormRef.[Ch],
1594 src/frontends/xforms/forms/form_ref.fd: new xforms
1595 implementation of an InsetRef dialog
1597 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1600 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1601 ios::nocreate is not part of the standard. Removed.
1603 2000-08-07 Baruch Even <baruch.even@writeme.com>
1605 * src/graphics/Renderer.h:
1606 * src/graphics/Renderer.C: Added base class for rendering of different
1607 image formats into Pixmaps.
1609 * src/graphics/XPM_Renderer.h:
1610 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1611 in a different class.
1613 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1614 easily add support for other formats.
1616 * src/insets/figinset.C: plugged a leak of an X resource.
1618 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1620 * src/CutAndPaste.[Ch]: make all metods static.
1622 * development/Code_rules/Rules: more work, added section on
1623 Exceptions, and a References section.
1625 * a lot of header files: work to make doc++ able to generate the
1626 source documentation, some workarounds of doc++ problems. Doc++ is
1627 now able to generate the documentation.
1629 2000-08-07 Juergen Vigna <jug@sad.it>
1631 * src/insets/insettabular.C (recomputeTextInsets): removed function
1633 * src/tabular.C (SetWidthOfMulticolCell):
1635 (calculate_width_of_column_NMC): fixed return value so that it really
1636 only returns true if the column-width has changed (there where
1637 problems with muliticolumn-cells in this column).
1639 2000-08-04 Juergen Vigna <jug@sad.it>
1641 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1642 also on the scrollstatus of the inset.
1643 (workAreaMotionNotify): ditto.
1645 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1647 2000-08-01 Juergen Vigna <jug@sad.it>
1649 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1651 * src/commandtags.h:
1652 * src/LyXAction.C (init):
1653 * src/insets/inset.C (LocalDispatch): added support for
1656 * src/insets/inset.C (scroll): new functions.
1658 * src/insets/insettext.C (removeNewlines): new function.
1659 (SetAutoBreakRows): removes forced newlines in the text of the
1660 paragraph if autoBreakRows is set to false.
1662 * src/tabular.C (Latex): generates a parbox around the cell contents
1665 * src/frontends/xforms/FormTabular.C (local_update): removed
1666 the radio_useparbox button.
1668 * src/tabular.C (UseParbox): new function
1670 2000-08-06 Baruch Even <baruch.even@writeme.com>
1672 * src/graphics/GraphicsCache.h:
1673 * src/graphics/GraphicsCache.C:
1674 * src/graphics/GraphicsCacheItem.h:
1675 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1678 * src/insets/insetgraphics.h:
1679 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1680 drawing of the inline image.
1682 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1683 into the wrong position.
1685 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1688 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1690 * src/support/translator.h: move all typedefs to public section
1692 * src/support/filetools.C (MakeLatexName): return string const
1694 (TmpFileName): ditto
1695 (FileOpenSearch): ditto
1697 (LibFileSearch): ditto
1698 (i18nLibFileSearch): ditto
1701 (CreateTmpDir): ditto
1702 (CreateBufferTmpDir): ditto
1703 (CreateLyXTmpDir): ditto
1706 (MakeAbsPath): ditto
1708 (OnlyFilename): ditto
1710 (NormalizePath): ditto
1711 (CleanupPath): ditto
1712 (GetFileContents): ditto
1713 (ReplaceEnvironmentPath): ditto
1714 (MakeRelPath): ditto
1716 (ChangeExtension): ditto
1717 (MakeDisplayPath): ditto
1718 (do_popen): return cmdret const
1719 (findtexfile): return string const
1721 * src/support/DebugStream.h: add some /// to please doc++
1723 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1725 * src/texrow.C (same_rownumber): functor to use with find_if
1726 (getIdFromRow): rewritten to use find_if and to not update the
1727 positions. return true if row is found
1728 (increasePos): new method, use to update positions
1730 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1732 * src/lyxlex_pimpl.C (verifyTable): new method
1735 (GetString): return string const
1736 (pushTable): rewrite to use std::stack
1738 (setFile): better check
1741 * src/lyxlex.h: make LyXLex noncopyable
1743 * src/lyxlex.C (text): return char const * const
1744 (GetString): return string const
1745 (getLongString): return string const
1747 * src/lyx_gui_misc.C (askForText): return pair<...> const
1749 * src/lastfiles.[Ch] (operator): return string const
1751 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1752 istringstream not char const *.
1753 move token.end() out of loop.
1754 (readFile): move initializaton of token
1756 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1757 getIdFromRow is successful.
1759 * lib/bind/emacs.bind: don't include menus bind
1761 * development/Code_rules/Rules: the beginnings of making this
1762 better and covering more of the unwritten rules that we have.
1764 * development/Code_rules/Recommendations: a couple of wording
1767 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1769 * src/support/strerror.c: remove C++ comment.
1771 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1773 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1774 LFUN_INDEX_INSERT_LAST
1776 * src/texrow.C (getIdFromRow): changed from const_iterator to
1777 iterator, allowing code to compile with DEC cxx
1779 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1780 stores part of the class, as suggested by Allan. Will allow
1782 (apply): test to apply uses InsetCommandParams operator!=
1784 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1785 (apply): test to apply uses InsetCommandParams operator!=
1787 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1788 stores part of the class.
1789 (update): removed limits on min/max size.
1791 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1792 (apply): test to apply uses InsetCommandParams operator!=
1794 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1795 (Read, Write, scanCommand, getCommand): moved functionality
1796 into InsetCommandParams.
1798 (getScreenLabel): made pure virtual
1799 new InsetCommandParams operators== and !=
1801 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1802 c-tors based on InsetCommandParams. Removed others.
1803 * src/insets/insetinclude.[Ch]: ditto
1804 * src/insets/insetlabel.[Ch]: ditto
1805 * src/insets/insetparent.[Ch]: ditto
1806 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1808 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1809 insets derived from InsetCommand created using similar c-tors
1810 based on InsetCommandParams
1811 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1812 * src/menus.C (ShowRefsMenu): ditto
1813 * src/paragraph.C (Clone): ditto
1814 * src/text2.C (SetCounter): ditto
1815 * src/lyxfunc.C (Dispatch) ditto
1816 Also recreated old InsetIndex behaviour exactly. Can now
1817 index-insert at the start of a paragraph and index-insert-last
1818 without launching the pop-up.
1820 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1822 * lib/lyxrc.example: mark te pdf options as non functional.
1824 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1825 (isStrDbl): move tmpstr.end() out of loop.
1826 (strToDbl): move intialization of tmpstr
1827 (lowercase): return string const and move tmp.end() out of loop.
1828 (uppercase): return string const and move tmp.edn() out of loop.
1829 (prefixIs): add assertion
1834 (containsOnly): ditto
1835 (containsOnly): ditto
1836 (containsOnly): ditto
1837 (countChar): make last arg char not char const
1838 (token): return string const
1839 (subst): return string const, move tmp.end() out of loop.
1840 (subst): return string const, add assertion
1841 (strip): return string const
1842 (frontStrip): return string const, add assertion
1843 (frontStrip): return string const
1848 * src/support/lstrings.C: add inclde "LAssert.h"
1849 (isStrInt): move tmpstr.end() out of loop.
1851 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1852 toollist.end() out of loop.
1853 (deactivate): move toollist.end() out of loop.
1854 (update): move toollist.end() out of loop.
1855 (updateLayoutList): move tc.end() out of loop.
1856 (add): move toollist.end() out of loop.
1858 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1859 md.end() out of loop.
1861 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1863 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1866 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1867 (Erase): move insetlist.end() out of loop.
1869 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1870 ref to const string as first arg. Move initialization of some
1871 variables, whitespace changes.
1873 * src/kbmap.C (defkey): move table.end() out of loop.
1874 (kb_keymap): move table.end() out of loop.
1875 (findbinding): move table.end() out of loop.
1877 * src/MenuBackend.C (hasMenu): move end() out of loop.
1878 (getMenu): move end() out of loop.
1879 (getMenu): move menulist_.end() out of loop.
1881 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1883 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1886 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1887 (getFromLyXName): move infotab.end() out of loop.
1889 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1890 -fvtable-thunks -ffunction-sections -fdata-sections
1892 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1894 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1897 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1899 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1901 * src/frontends/xforms/FormCitation.[Ch],
1902 src/frontends/xforms/FormIndex.[Ch],
1903 src/frontends/xforms/FormToc.[Ch],
1904 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1906 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1908 * src/commandtags.h: renamed, created some flags for citation
1911 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1913 * src/lyxfunc.C (dispatch): use signals to insert index entry
1915 * src/frontends/Dialogs.h: new signal createIndex
1917 * src/frontends/xforms/FormCommand.[Ch],
1918 src/frontends/xforms/FormCitation.[Ch],
1919 src/frontends/xforms/FormToc.[Ch],
1920 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1922 * src/insets/insetindex.[Ch]: GUI-independent
1924 * src/frontends/xforms/FormIndex.[Ch],
1925 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1928 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1930 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1931 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1933 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1935 * src/insets/insetref.C (Latex): rewrite so that there is now
1936 question that a initialization is requested.
1938 * src/insets/insetcommand.h: reenable the hide signal
1940 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1942 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1943 fix handling of shortcuts (many bugs :)
1944 (add_lastfiles): ditto.
1946 * lib/ui/default.ui: fix a few shortcuts.
1948 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1950 * Makefile.am: Fix ``rpmdist'' target to return the exit
1951 status of the ``rpm'' command, instead of the last command in
1952 the chain (the ``rm lyx.xpm'' command, which always returns
1955 2000-08-02 Allan Rae <rae@lyx.org>
1957 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1958 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1959 * src/frontends/xforms/FormToc.C (FormToc): ditto
1961 * src/frontends/xforms/Makefile.am: A few forgotten files
1963 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1964 Signals-not-copyable-problem Lars' started commenting out.
1966 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1968 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1970 * src/insets/insetcommand.h: Signals is not copyable so anoter
1971 scheme for automatic hiding of forms must be used.
1973 * src/frontends/xforms/FormCitation.h: don't inerit from
1974 noncopyable, FormCommand already does that.
1975 * src/frontends/xforms/FormToc.h: ditto
1976 * src/frontends/xforms/FormUrl.h: ditto
1978 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1980 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1982 * src/insets/insetcommand.h (hide): new SigC::Signal0
1983 (d-tor) new virtual destructor emits hide signal
1985 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1986 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1988 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1989 LOF and LOT. Inset is now GUI-independent
1991 * src/insets/insetloa.[Ch]: redundant
1992 * src/insets/insetlof.[Ch]: ditto
1993 * src/insets/insetlot.[Ch]: ditto
1995 * src/frontends/xforms/forms/form_url.fd: tweaked!
1996 * src/frontends/xforms/forms/form_citation.fd: ditto
1998 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1999 dialogs dealing with InsetCommand insets
2001 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2002 FormCommand base class
2003 * src/frontends/xforms/FormUrl.[Ch]: ditto
2005 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2007 * src/frontends/xforms/FormToc.[Ch]: ditto
2009 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2010 passed a generic InsetCommand pointer
2011 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2013 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2014 and modified InsetTOC class
2015 * src/buffer.C: ditto
2017 * forms/lyx.fd: strip out old FD_form_toc code
2018 * src/lyx_gui_misc.C: ditto
2019 * src/lyx_gui.C: ditto
2020 * src/lyx_cb.C: ditto
2021 * src/lyx.[Ch]: ditto
2023 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2025 * src/support/utility.hpp: tr -d '\r'
2027 2000-08-01 Juergen Vigna <jug@sad.it>
2029 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2031 * src/commandtags.h:
2032 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2033 LFUN_TABULAR_FEATURES.
2035 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2036 LFUN_LAYOUT_TABULAR.
2038 * src/insets/insettabular.C (getStatus): implemented helper function.
2040 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2042 2000-07-31 Juergen Vigna <jug@sad.it>
2044 * src/text.C (draw): fixed screen update problem for text-insets.
2046 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2047 something changed probably this has to be added in various other
2050 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2052 2000-07-31 Baruch Even <baruch.even@writeme.com>
2054 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2055 templates to satisfy compaq cxx.
2058 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2060 * src/support/translator.h (equal_1st_in_pair::operator()): take
2061 const ref pair_type as arg.
2062 (equal_2nd_in_pair::operator()): ditto
2063 (Translator::~Translator): remove empty d-tor.
2065 * src/graphics/GraphicsCache.C: move include config.h to top, also
2066 put initialization of GraphicsCache::singleton here.
2067 (~GraphicsCache): move here
2068 (addFile): take const ref as arg
2071 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2073 * src/BufferView2.C (insertLyXFile): change te with/without header
2076 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2078 * src/frontends/xforms/FormGraphics.C (apply): add some
2079 static_cast. Not very nice, but required by compaq cxx.
2081 * src/frontends/xforms/RadioButtonGroup.h: include header
2082 <utility> instead of <pair.h>
2084 * src/insets/insetgraphicsParams.C: add using directive.
2085 (readResize): change return type to void.
2086 (readOrigin): ditto.
2088 * src/lyxfunc.C (getStatus): add missing break for build-program
2089 function; add test for Literate for export functions.
2091 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2092 entries in Options menu.
2094 2000-07-31 Baruch Even <baruch.even@writeme.com>
2096 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2097 protect against auto-allocation; release icon when needed.
2099 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2101 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2102 on usual typewriter.
2104 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2105 earlier czech.kmap), useful only for programming.
2107 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2109 * src/frontends/xforms/FormCitation.h: fix conditioning around
2112 2000-07-31 Juergen Vigna <jug@sad.it>
2114 * src/frontends/xforms/FormTabular.C (local_update): changed
2115 radio_linebreaks to radio_useparbox and added radio_useminipage.
2117 * src/tabular.C: made support for using minipages/parboxes.
2119 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2121 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2123 (descent): so the cursor is in the middle.
2124 (width): bit smaller box.
2126 * src/insets/insetgraphics.h: added display() function.
2128 2000-07-31 Baruch Even <baruch.even@writeme.com>
2130 * src/frontends/Dialogs.h: Added showGraphics signals.
2132 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2133 xforms form definition of the graphics dialog.
2135 * src/frontends/xforms/FormGraphics.h:
2136 * src/frontends/xforms/FormGraphics.C: Added files, the
2137 GUIndependent code of InsetGraphics
2139 * src/insets/insetgraphics.h:
2140 * src/insets/insetgraphics.C: Major writing to make it work.
2142 * src/insets/insetgraphicsParams.h:
2143 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2144 struct between InsetGraphics and GUI.
2146 * src/LaTeXFeatures.h:
2147 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2148 support for graphicx package.
2150 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2151 for the graphics inset.
2153 * src/support/translator.h: Added file, used in
2154 InsetGraphicsParams. this is a template to translate between two
2157 * src/frontends/xforms/RadioButtonGroup.h:
2158 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2159 way to easily control a radio button group.
2161 2000-07-28 Juergen Vigna <jug@sad.it>
2163 * src/insets/insettabular.C (LocalDispatch):
2164 (TabularFeatures): added support for lyx-functions of tabular features.
2165 (cellstart): refixed this function after someone wrongly changed it.
2167 * src/commandtags.h:
2168 * src/LyXAction.C (init): added support for tabular-features
2170 2000-07-28 Allan Rae <rae@lyx.org>
2172 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2173 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2174 triggers the callback for input checking. As a result we sometimes get
2175 "LyX: This shouldn't happen..." printed to cerr.
2176 (input): Started using status variable since I only free() on
2177 destruction. Some input checking for paths and font sizes.
2179 * src/frontends/xforms/FormPreferences.h: Use status to control
2180 activation of Ok and Apply
2182 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2183 callback. Also resized to stop segfaults with 0.88. The problem is
2184 that xforms-0.88 requires the folder to be wide enough to fit all the
2185 tabs. If it isn't it causes all sorts of problems.
2187 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2189 * src/frontends/xforms/forms/README: Reflect reality.
2191 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2192 * src/frontends/xforms/forms/makefile: ditto.
2194 * src/commandtags.h: Get access to new Preferences dialog
2195 * src/LyXAction.C: ditto
2196 * src/lyxfunc.C: ditto
2197 * lib/ui/default.ui: ditto
2199 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2201 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2203 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2206 * src/frontends/xforms/form_url.[Ch]: added.
2208 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2210 * src/insets/insetbib.h: fixed bug in previous commit
2212 * src/frontends/xforms/FormUrl.h: ditto
2214 * src/frontends/xforms/FormPrint.h: ditto
2216 * src/frontends/xforms/FormPreferences.h: ditto
2218 * src/frontends/xforms/FormCopyright.h: ditto
2220 * src/frontends/xforms/FormCitation.C: ditto
2222 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2223 private copyconstructor and private default contructor
2225 * src/support/Makefile.am: add utility.hpp
2227 * src/support/utility.hpp: new file from boost
2229 * src/insets/insetbib.h: set owner in clone
2231 * src/frontends/xforms/FormCitation.C: added missing include
2234 * src/insets/form_url.[Ch]: removed
2236 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2238 * development/lyx.spec.in
2239 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2240 file/directory re-organization.
2242 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2244 * src/insets/insetcommand.[Ch]: moved the string data and
2245 associated manipulation methods into a new stand-alone class
2246 InsetCommandParams. This class has two additional methods
2247 getAsString() and setFromString() allowing the contents to be
2248 moved around as a single string.
2249 (addContents) method removed.
2250 (setContents) method no longer virtual.
2252 * src/buffer.C (readInset): made use of new InsetCitation,
2253 InsetUrl constructors based on InsetCommandParams.
2255 * src/commandtags.h: add LFUN_INSERT_URL
2257 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2258 independent InsetUrl and use InsetCommandParams to extract
2259 string info and create new Insets.
2261 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2263 * src/frontends/xforms/FormCitation.C (apply): uses
2266 * src/frontends/xforms/form_url.C
2267 * src/frontends/xforms/form_url.h
2268 * src/frontends/xforms/FormUrl.h
2269 * src/frontends/xforms/FormUrl.C
2270 * src/frontends/xforms/forms/form_url.fd: new files
2272 * src/insets/insetcite.[Ch]: removed unused constructors.
2274 * src/insets/insetinclude.[Ch]: no longer store filename
2276 * src/insets/inseturl.[Ch]: GUI-independent.
2278 2000-07-26 Juergen Vigna <jug@sad.it>
2279 * renamed frontend from gtk to gnome as it is that what is realized
2280 and did the necessary changes in the files.
2282 2000-07-26 Marko Vendelin <markov@ioc.ee>
2284 * configure.in: cleaning up gnome configuration scripts
2286 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2288 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2289 shortcuts syndrom by redrawing them explicitely (a better solution
2290 would be appreciated).
2292 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2294 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2297 * src/lyx_cb.C (MenuExport): change html export to do the right
2298 thing depending of the document type (instead of having
2299 html-linuxdoc and html-docbook).
2300 * src/lyxfunc.C (getStatus): update for html
2301 * lib/ui/default.ui: simplify due to the above change.
2302 * src/menus.C (ShowFileMenu): update too (in case we need it).
2304 * src/MenuBackend.C (read): if a menu is defined twice, add the
2305 new entries to the exiting one.
2307 2000-07-26 Juergen Vigna <jug@sad.it>
2309 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2311 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2312 and return a bool if it did actual save the file.
2313 (AutoSave): don't autosave a unnamed doc.
2315 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2316 check if this is an UNNAMED new file and react to it.
2317 (newFile): set buffer to unnamed and change to not mark a new
2318 buffer dirty if I didn't do anything with it.
2320 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2322 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2324 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2325 friend as per Angus's patch posted to lyx-devel.
2327 * src/ext_l10n.h: updated
2329 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2330 gettext on the style string right before inserting them into the
2333 * autogen.sh: add code to extract style strings form layout files,
2334 not good enough yet.
2336 * src/frontends/gtk/.cvsignore: add MAKEFILE
2338 * src/MenuBackend.C (read): run the label strings through gettext
2339 before storing them in the containers.
2341 * src/ext_l10n.h: new file
2343 * autogen.sh : generate the ext_l10n.h file here
2345 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2347 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2350 * lib/ui/default.ui: fix a couple of typos.
2352 * config/gnome/gtk.m4: added (and added to the list of files in
2355 * src/insets/insetinclude.C (unique_id): fix when we are using
2356 lyxstring instead of basic_string<>.
2357 * src/insets/insettext.C (LocalDispatch): ditto.
2358 * src/support/filetools.C: ditto.
2360 * lib/configure.m4: create the ui/ directory if necessary.
2362 * src/LyXView.[Ch] (updateToolbar): new method.
2364 * src/BufferView_pimpl.C (buffer): update the toolbar when
2365 opening/closing buffer.
2367 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2369 * src/LyXAction.C (getActionName): enhance to return also the name
2370 and options of pseudo-actions.
2371 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2373 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2374 as an example of what is possible). Used in File->Build too (more
2375 useful) and in the import/export menus (to mimick the complicated
2376 handling of linuxdoc and friends). Try to update all the entries.
2378 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2381 * src/MenuBackend.C (read): Parse the new OptItem tag.
2383 * src/MenuBackend.h: Add a new optional_ data member (used if the
2384 entry should be omitted when the lyxfunc is disabled).
2386 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2387 function, used as a shortcut.
2388 (create_submenu): align correctly the shortcuts on the widest
2391 * src/MenuBackend.h: MenuItem.label() only returns the label of
2392 the menu without shortcut; new method shortcut().
2394 2000-07-14 Marko Vendelin <markov@ioc.ee>
2396 * src/frontends/gtk/Dialogs.C:
2397 * src/frontends/gtk/FormCopyright.C:
2398 * src/frontends/gtk/FormCopyright.h:
2399 * src/frontends/gtk/Makefile.am: added these source-files for the
2400 Gtk/Gnome support of the Copyright-Dialog.
2402 * src/main.C: added Gnome::Main initialization if using
2403 Gtk/Gnome frontend-GUI.
2405 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2407 * config/gnome/aclocal-include.m4
2408 * config/gnome/compiler-flags.m4
2409 * config/gnome/curses.m4
2410 * config/gnome/gnome--.m4
2411 * config/gnome/gnome-bonobo-check.m4
2412 * config/gnome/gnome-common.m4
2413 * config/gnome/gnome-fileutils.m4
2414 * config/gnome/gnome-ghttp-check.m4
2415 * config/gnome/gnome-gnorba-check.m4
2416 * config/gnome/gnome-guile-checks.m4
2417 * config/gnome/gnome-libgtop-check.m4
2418 * config/gnome/gnome-objc-checks.m4
2419 * config/gnome/gnome-orbit-check.m4
2420 * config/gnome/gnome-print-check.m4
2421 * config/gnome/gnome-pthread-check.m4
2422 * config/gnome/gnome-support.m4
2423 * config/gnome/gnome-undelfs.m4
2424 * config/gnome/gnome-vfs.m4
2425 * config/gnome/gnome-x-checks.m4
2426 * config/gnome/gnome-xml-check.m4
2427 * config/gnome/gnome.m4
2428 * config/gnome/gperf-check.m4
2429 * config/gnome/gtk--.m4
2430 * config/gnome/linger.m4
2431 * config/gnome/need-declaration.m4: added configuration scripts
2432 for Gtk/Gnome frontend-GUI
2434 * configure.in: added support for the --with-frontend=gtk option
2436 * autogen.sh: added config/gnome/* to list of config-files
2438 * acconfig.h: added define for GTKGUI-support
2440 * config/lyxinclude.m4: added --with-frontend[=value] option value
2441 for Gtk/Gnome frontend-GUI support.
2443 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2445 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2449 * src/paragraph.C (GetChar): remove non-const version
2451 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2452 (search_kw): use it.
2454 * src/lyx_main.C (init): if "preferences" exist, read that instead
2456 (ReadRcFile): return bool if the file could be read ok.
2457 (ReadUIFile): add a check to see if lex file is set ok.
2459 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2460 bastring can be used instead of lyxstring (still uses the old code
2461 if std::string is good enough or if lyxstring is used.)
2463 * src/encoding.C: make the arrays static, move ininle functions
2465 * src/encoding.h: from here.
2467 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2468 (parseSingleLyXformat2Token): move inset parsing to separate method
2469 (readInset): new private method
2471 * src/Variables.h: remove virtual from get().
2473 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2474 access to NEW_INSETS and NEW_TABULAR
2476 * src/MenuBackend.h: remove superfluous forward declaration of
2477 MenuItem. Add documentations tags "///", remove empty MenuItem
2478 destructor, remove private default contructor.
2480 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2482 (read): more string mlabel and mname to where they are used
2483 (read): remove unused variables mlabel and mname
2484 (defaults): unconditional clear, make menusetup take advantage of
2485 add returning Menu &.
2487 * src/LyXView.h: define NEW_MENUBAR as default
2489 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2490 to NEW_INSETS and NEW_TABULAR.
2491 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2492 defined. Change some of the "xxxx-inset-insert" functions names to
2495 * several files: more enahncements to NEW_INSETS and the resulting
2498 * lib/lyxrc.example (\date_insert_format): move to misc section
2500 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2501 bastring and use AC_CACHE_CHECK.
2502 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2503 the system have the newest methods. uses AC_CACHE_CHECK
2504 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2505 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2506 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2508 * configure.in: add LYX_CXX_GOOD_STD_STRING
2510 * acinclude.m4: recreated
2512 2000-07-24 Amir Karger
2514 * README: add Hebrew, Arabic kmaps
2517 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2519 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2522 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2524 * Lot of files: add pragma interface/implementation.
2526 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2528 * lib/ui/default.ui: new file (ans new directory). Contains the
2529 default menu and toolbar.
2531 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2532 global space. Toolbars are now read (as menus) in ui files.
2534 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2536 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2537 is disabled because the document is read-only. We want to have the
2538 toggle state of the function anyway.
2539 (getStatus): add code for LFUN_VC* functions (mimicking what is
2540 done in old-style menus)
2542 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2543 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2545 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2546 * src/BufferView_pimpl.C: ditto.
2547 * src/lyxfunc.C: ditto.
2549 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2550 default). This replaces old-style menus by new ones.
2552 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2553 MenuItem. Contain the data structure of a menu.
2555 * src/insets/insettext.C: use LyXView::setLayout instead of
2556 accessing directly the toolbar combox.
2557 * src/lyxfunc.C (Dispatch): ditto.
2559 * src/LyXView.C (setLayout): new method, which just calls
2560 Toolbar::setLayout().
2561 (updateLayoutChoice): move part of this method in Toolbar.
2563 * src/toolbar.[Ch]: removed.
2565 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2566 implementation the toolbar.
2568 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2569 the toolbar. It might make sense to merge it with ToolbarDefaults
2571 (setLayout): new function.
2572 (updateLayoutList): ditto.
2573 (openLayoutList): ditto.
2575 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2576 xforms implementation of the toolbar.
2577 (get_toolbar_func): comment out, since I do not
2578 know what it is good for.
2580 * src/ToolbarDefaults.h: Add the ItemType enum.
2582 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2583 for a list of allocated C strings. Used in Menubar xforms
2584 implementation to avoid memory leaks.
2586 * src/support/lstrings.[Ch] (uppercase): new version taking and
2590 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2591 * lib/bind/emacs.bind: ditto.
2593 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2595 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2596 forward decl of LyXView.
2598 * src/toolbar.C (toolbarItem): moved from toolbar.h
2599 (toolbarItem::clean): ditto
2600 (toolbarItem::~toolbarItem): ditto
2601 (toolbarItem::operator): ditto
2603 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2605 * src/paragraph.h: control the NEW_TABULAR define from here
2607 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2608 USE_TABULAR_INSETS to NEW_TABULAR
2610 * src/ToolbarDefaults.C: add include "lyxlex.h"
2612 * files using the old table/tabular: use NEW_TABULAR to control
2613 compilation of old tabular stuff.
2615 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2618 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2619 planemet in reading of old style floats, fix the \end_deeper
2620 problem when reading old style floats.
2622 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2624 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2626 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2628 * lib/bind/sciword.bind: updated.
2630 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2632 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2633 layout write problem
2635 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2637 * src/Makefile.am (INCLUDES): remove image directory from include
2640 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2641 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2643 * src/LyXView.C (create_form_form_main): read the application icon
2646 * lib/images/*.xpm: change the icons to use transparent color for
2649 * src/toolbar.C (update): change the color of the button when it
2652 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2654 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2655 setting explicitely the minibuffer.
2656 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2658 * src/LyXView.C (showState): new function. Shows font information
2659 in minibuffer and update toolbar state.
2660 (LyXView): call Toolbar::update after creating the
2663 * src/toolbar.C: change toollist to be a vector instead of a
2665 (BubbleTimerCB): get help string directly from the callback
2666 argument of the corresponding icon (which is the action)
2667 (set): remove unnecessary ugliness.
2668 (update): new function. update the icons (depressed, disabled)
2669 depending of the status of the corresponding action.
2671 * src/toolbar.h: remove help in toolbarItem
2673 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2675 * src/Painter.C (text): Added code for using symbol glyphs from
2676 iso10646 fonts. Currently diabled.
2678 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2681 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2682 magyar,turkish and usorbian.
2684 * src/paragraph.C (isMultiLingual): Made more efficient.
2686 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2689 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2690 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2691 Also changed the prototype to "bool math_insert_greek(char)".
2693 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2695 * lots of files: apply the NEW_INSETS on all code that will not be
2696 needed when we move to use the new insets. Enable the define in
2697 lyxparagrah.h to try it.
2699 * src/insets/insettabular.C (cellstart): change to be a static
2701 (InsetTabular): initialize buffer in the initializer list.
2703 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2705 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2706 form_print.h out of the header file. Replaced with forward
2707 declarations of the relevant struct.
2709 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2712 * src/commandtags.h: do not include "debug.h" which does not
2713 belong there. #include it in some other places because of this
2716 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2718 * src/insets/insetcaption.C: add a couple "using" directives.
2720 * src/toolbar.C (add): get the help text directly from lyxaction.
2722 (setPixmap): new function. Loads from disk and sets a pixmap on a
2723 botton; the name of the pixmap file is derived from the command
2726 * src/toolbar.h: remove members isBitmap and pixmap from
2729 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2730 * lib/images/: move many files from images/banner.xpm.
2732 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2734 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2735 * src/toolbar.C: ditto.
2736 * configure.in: ditto.
2737 * INSTALL: document.
2739 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2740 the spellchecker popup is closed from the WM.
2742 2000-07-19 Juergen Vigna <jug@sad.it>
2744 * src/insets/insetfloat.C (Write): small fix because we use the
2745 insetname for the type now!
2747 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2749 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2752 * src/frontends/Dialogs.h: removed hideCitation signal
2754 * src/insets/insetcite.h: added hide signal
2756 * src/insets/insetcite.C (~InsetCitation): emits new signal
2757 (getScreenLabel): "intelligent" label should now fit on the screen!
2759 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2761 * src/frontends/xforms/FormCitation.C (showInset): connects
2762 hide() to the inset's hide signal
2763 (show): modified to use fl_set_object_position rather than
2764 fl_set_object_geometry wherever possible
2766 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2768 * src/insets/lyxinset.h: add caption code
2770 * src/insets/insetfloat.C (type): new method
2772 * src/insets/insetcaption.C (Write): new method
2774 (LyxCode): new method
2776 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2777 to get it right together with using the FloatList.
2779 * src/commandtags.h: add LFUN_INSET_CAPTION
2780 * src/lyxfunc.C (Dispatch): handle it
2782 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2785 * src/Variables.[Ch]: make expand take a const reference, remove
2786 the destructor, some whitespace changes.
2788 * src/LyXAction.C (init): add caption-inset-insert
2790 * src/FloatList.C (FloatList): update the default floats a bit.
2792 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2794 * src/Variables.[Ch]: new files. Intended to be used for language
2795 specific strings (like \chaptername) and filename substitution in
2798 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2800 * lib/kbd/american.kmap: update
2802 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2804 * src/bufferparams.[Ch]: remove member allowAccents.
2806 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2808 * src/LaTeXLog.C: use the log_form.h header.
2809 * src/lyx_gui.C: ditto.
2810 * src/lyx_gui_misc.C: ditto.
2811 * src/lyxvc.h: ditto.
2813 * forms/log_form.fd: new file, created from latexoptions.fd. I
2814 kept the log popup and nuked the options form.
2816 * src/{la,}texoptions.[Ch]: removed.
2817 * src/lyx_cb.C (LaTeXOptions): ditto
2819 * src/lyx_gui.C (create_forms): do not handle the
2820 fd_latex_options form.
2822 2000-07-18 Juergen Vigna <jug@sad.it>
2824 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2825 name of the inset so that it can be requested outside (text2.C).
2827 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2830 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2832 * src/mathed/formula.h (ConvertFont): constify
2834 * src/mathed/formula.C (Read): add warning if \end_inset is not
2835 found on expected place.
2837 * src/insets/lyxinset.h (ConvertFont): consify
2839 * src/insets/insetquotes.C (ConvertFont): constify
2840 * src/insets/insetquotes.h: ditto
2842 * src/insets/insetinfo.h: add labelfont
2844 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2845 (ascent): use labelfont
2849 (Write): make .lyx file a bit nicer
2851 * src/insets/insetfloat.C (Write): simplify somewhat...
2852 (Read): add warning if arg is not found
2854 * src/insets/insetcollapsable.C: add using std::max
2855 (Read): move string token and add warning in arg is not found
2856 (draw): use std::max to get the right ty
2857 (getMaxWidth): simplify by using std::max
2859 * src/insets/insetsection.h: new file
2860 * src/insets/insetsection.C: new file
2861 * src/insets/insetcaption.h: new file
2862 * src/insets/insetcaption.C: new file
2864 * src/insets/inset.C (ConvertFont): constify signature
2866 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2867 insetcaption.[Ch] and insetsection.[Ch]
2869 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2870 uses to use LABEL_COUNTER_CHAPTER instead.
2871 * src/text2.C (SetCounter): here
2873 * src/counters.h: new file
2874 * src/counters.C: new file
2875 * src/Sectioning.h: new file
2876 * src/Sectioning.C: new file
2878 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2880 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2882 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2885 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2888 2000-07-17 Juergen Vigna <jug@sad.it>
2890 * src/tabular.C (Validate): check if array-package is needed.
2891 (SetVAlignment): added support for vertical alignment.
2892 (SetLTFoot): better support for longtable header/footers
2893 (Latex): modified to support added features.
2895 * src/LaTeXFeatures.[Ch]: added array-package.
2897 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2899 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2902 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2904 * configure.in: do not forget to put a space after -isystem.
2906 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2908 * lib/kbd/arabic.kmap: a few fixes.
2910 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2912 * some whitespace chagnes to a number of files.
2914 * src/support/DebugStream.h: change to make it easier for
2915 doc++ to parse correctly.
2916 * src/support/lyxstring.h: ditto
2918 * src/mathed/math_utils.C (compara): change to have only one
2920 (MathedLookupBOP): change because of the above.
2922 * src/mathed/math_delim.C (math_deco_compare): change to have only
2924 (search_deco): change becasue of the above.
2926 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2927 instead of manually coded one.
2929 * src/insets/insetquotes.C (Read): read the \end_inset too
2931 * src/insets/insetlatex.h: remove file
2932 * src/insets/insetlatex.C: remove file
2934 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2936 (InsetPrintIndex): remove destructor
2938 * src/insets/insetinclude.h: remove default constructor
2940 * src/insets/insetfloat.C: work to make it work better
2942 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2944 * src/insets/insetcite.h (InsetCitation): remove default constructor
2946 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2948 * src/text.C (GetColumnNearX): comment out some currently unused code.
2950 * src/paragraph.C (writeFile): move some initializations closer to
2952 (CutIntoMinibuffer): small change to use new matchIT operator
2956 (InsertInset): ditto
2959 (InsetIterator): ditto
2960 (Erase): small change to use new matchFT operator
2962 (GetFontSettings): ditto
2963 (HighestFontInRange): ditto
2966 * src/lyxparagraph.h: some chars changed to value_type
2967 (matchIT): because of some stronger checking (perhaps too strong)
2968 in SGI STL, the two operator() unified to one.
2971 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2973 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2974 the last inset read added
2975 (parseSingleLyXformat2Token): some more (future) compability code added
2976 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2977 (parseSingleLyXformat2Token): set last_inset_read
2978 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2979 (parseSingleLyXformat2Token): don't double intializw string next_token
2981 * src/TextCache.C (text_fits::operator()): add const's to the signature
2982 (has_buffer::operator()): ditto
2984 * src/Floating.h: add some comments on the class
2986 * src/FloatList.[Ch] (typeExist): new method
2989 * src/BackStack.h: added default constructor, wanted by Gcc.
2991 2000-07-14 Juergen Vigna <jug@sad.it>
2993 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2995 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2997 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2998 do a redraw when the window is resized!
2999 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3001 * src/insets/insettext.C (resizeLyXText): added function to correctly
3002 being able to resize the LyXWindow.
3004 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3006 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3008 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3009 crashes when closing dialog to a deleted inset.
3011 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3012 method! Now similar to other insets.
3014 2000-07-13 Juergen Vigna <jug@sad.it>
3016 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3018 * lib/examples/Literate.lyx: small patch!
3020 * src/insets/insetbib.C (Read): added this function because of wrong
3021 Write (without [begin|end]_inset).
3023 2000-07-11 Juergen Vigna <jug@sad.it>
3025 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3026 as the insertInset could not be good!
3028 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3029 the bool param should not be last.
3031 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3033 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3034 did submit that to Karl).
3036 * configure.in: use -isystem instead of -I for X headers. This
3037 fixes a problem on solaris with a recent gcc;
3038 put the front-end code after the X detection code;
3039 configure in sigc++ before lib/
3041 * src/lyx_main.C (commandLineHelp): remove -display from command
3044 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3046 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3047 Also put in Makefile rules for building the ``listerrors''
3048 program for parsing errors from literate programs written in LyX.
3050 * lib/build-listerrors: Added small shell script as part of compile
3051 process. This builds a working ``listerrors'' binary if noweb is
3052 installed and either 1) the VNC X server is installed on the machine,
3053 or 2) the user is compiling from within a GUI. The existence of a GUI
3054 is necessary to use the ``lyx --export'' feature for now. This
3055 hack can be removed once ``lyx --export'' no longer requires a GUI to
3058 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3060 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3061 now passed back correctly from gcc and placed "under" error
3062 buttons in a Literate LyX source.
3064 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3066 * src/text.C (GetColumnNearX): Better behavior when a RTL
3067 paragraph is ended by LTR text.
3069 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3072 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3074 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3075 true when clipboard is empty.
3077 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3079 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3080 row of the paragraph.
3081 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3082 to prevent calculation of bidi tables
3084 2000-07-07 Juergen Vigna <jug@sad.it>
3086 * src/screen.C (ToggleSelection): added y_offset and x_offset
3089 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3092 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3094 * src/insets/insettext.C: fixed Layout-Display!
3096 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3098 * configure.in: add check for strings.h header.
3100 * src/spellchecker.C: include <strings.h> in order to have a
3101 definition for bzero().
3103 2000-07-07 Juergen Vigna <jug@sad.it>
3105 * src/insets/insettext.C (draw): set the status of the bv->text to
3106 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3108 * src/screen.C (DrawOneRow):
3109 (DrawFromTo): redraw the actual row if something has changed in it
3112 * src/text.C (draw): call an update of the toplevel-inset if something
3113 has changed inside while drawing.
3115 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3117 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3119 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3120 processing inside class.
3122 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3123 processing inside class.
3125 * src/insets/insetindex.h new struct Holder, consistent with other
3128 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3129 citation dialog from main code and placed it in src/frontends/xforms.
3130 Dialog launched through signals instead of callbacks
3132 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3134 * lyx.man: update the options description.
3136 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3138 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3139 handle neg values, set min width to 590, add doc about -display
3141 2000-07-05 Juergen Vigna <jug@sad.it>
3143 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3144 calls to BufferView *.
3146 * src/insets/insettext.C (checkAndActivateInset): small fix non
3147 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3149 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3150 their \end_inset token!
3152 2000-07-04 edscott <edscott@imp.mx>
3154 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3155 lib/lyxrc.example: added option \wheel_jump
3157 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3159 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3160 remove support for -width,-height,-xpos and -ypos.
3162 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3164 * src/encoding.[Ch]: New files.
3166 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3167 (text): Call to the underline() method only when needed.
3169 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3171 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3172 encoding(s) for the document.
3174 * src/bufferparams.C (BufferParams): Changed default value of
3177 * src/language.C (newLang): Removed.
3178 (items[]): Added encoding information for all defined languages.
3180 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3181 encoding choice button.
3183 * src/lyxrc.h (font_norm_type): New member variable.
3184 (set_font_norm_type): New method.
3186 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3187 paragraphs with different encodings.
3189 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3190 (TransformChar): Changed to work correctly with Arabic points.
3191 (draw): Added support for drawing Arabic points.
3192 (draw): Removed code for drawing underbars (this is done by
3195 * src/support/textutils.h (IsPrintableNonspace): New function.
3197 * src/BufferView_pimpl.h: Added "using SigC::Object".
3198 * src/LyXView.h: ditto.
3200 * src/insets/insetinclude.h (include_label): Changed to mutable.
3202 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3204 * src/mathed/math_iter.h: remove empty destructor
3206 * src/mathed/math_cursor.h: remove empty destructor
3208 * src/insets/lyxinset.h: add THEOREM_CODE
3210 * src/insets/insettheorem.[Ch]: new files
3212 * src/insets/insetminipage.C: (InsertInset): remove
3214 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3216 (InsertInset): remove
3218 * src/insets/insetlist.C: (InsertList): remove
3220 * src/insets/insetfootlike.[Ch]: new files
3222 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3225 (InsertInset): ditto
3227 * src/insets/insetert.C: remove include Painter.h, reindent
3228 (InsertInset): move to header
3230 * src/insets/insetcollapsable.h: remove explicit from default
3231 contructor, remove empty destructor, add InsertInset
3233 * src/insets/insetcollapsable.C (InsertInset): new func
3235 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3237 * src/vspace.h: add explicit to constructor
3239 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3240 \textcompwordmark, please test this.
3242 * src/lyxrc.C: set ascii_linelen to 65 by default
3244 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3246 * src/commandtags.h: add LFUN_INSET_THEOREM
3248 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3249 (makeLinuxDocFile): remove _some_ of the nice logic
3250 (makeDocBookFile): ditto
3252 * src/Painter.[Ch]: (~Painter): removed
3254 * src/LyXAction.C (init): entry for insettheorem added
3256 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3258 (deplog): code to detect files generated by LaTeX, needs testing
3261 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3263 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3265 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3267 * src/LaTeX.C (deplog): Add a check for files that are going to be
3268 created by the first latex run, part of the project to remove the
3271 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3272 contents to the extension list.
3274 2000-07-04 Juergen Vigna <jug@sad.it>
3276 * src/text.C (NextBreakPoint): added support for needFullRow()
3278 * src/insets/lyxinset.h: added needFullRow()
3280 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3283 * src/insets/insettext.C: lots of changes for update!
3285 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3287 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3289 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3291 * src/insets/insetinclude.C (InsetInclude): fixed
3292 initialization of include_label.
3293 (unique_id): now returns a string.
3295 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3297 * src/LaTeXFeatures.h: new member IncludedFiles, for
3298 a map of key, included file name.
3300 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3301 with the included files for inclusion in SGML preamble,
3302 i. e., linuxdoc and docbook.
3305 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3306 nice (is the generated linuxdoc code to be exported?), that
3307 allows to remove column, and only_body that will be true for
3308 slave documents. Insets are allowed inside SGML font type.
3309 New handling of the SGML preamble for included files.
3310 (makeDocBookFile): the same for docbook.
3312 * src/insets/insetinclude.h:
3313 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3315 (DocBook): new export methods.
3317 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3318 and makeDocBookFile.
3320 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3321 formats to export with command line argument -x.
3323 2000-06-29 Juergen Vigna <jug@sad.it>
3325 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3326 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3328 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3329 region could already been cleared by an inset!
3331 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3333 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3336 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3338 (cursorToggle): remove special handling of lyx focus.
3340 2000-06-28 Juergen Vigna <jug@sad.it>
3342 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3345 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3347 * src/insets/insetindex.C (Edit): add a callback when popup is
3350 * src/insets/insettext.C (LocalDispatch):
3351 * src/insets/insetmarginal.h:
3352 * src/insets/insetlist.h:
3353 * src/insets/insetfoot.h:
3354 * src/insets/insetfloat.h:
3355 * src/insets/insetert.h: add a missing std:: qualifier.
3357 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3359 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3362 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3364 * src/insets/insettext.C (Read): remove tmptok unused variable
3365 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3366 (InsertInset): change for new InsetInset code
3368 * src/insets/insettext.h: add TEXT inline method
3370 * src/insets/insettext.C: remove TEXT macro
3372 * src/insets/insetmarginal.C (Write): new method
3373 (Latex): change output slightly
3375 * src/insets/insetfoot.C (Write): new method
3376 (Latex): change output slightly (don't use endl when no need)
3378 * src/insets/insetert.C (Write): new method
3380 * src/insets/insetcollapsable.h: make button_length, button_top_y
3381 and button_bottm_y protected.
3383 * src/insets/insetcollapsable.C (Write): simplify code by using
3384 tostr. Also do not output the float name, the children class
3385 should to that to get control over own arguments
3387 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3388 src/insets/insetminipage.[Ch]:
3391 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3393 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3395 * src/Makefile.am (lyx_SOURCES): add the new files
3397 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3398 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3399 * src/commandtags.h: ditto
3401 * src/LaTeXFeatures.h: add a std::set of used floattypes
3403 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3405 * src/FloatList.[Ch] src/Floating.h: new files
3407 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3409 * src/lyx_cb.C (TableApplyCB): ditto
3411 * src/text2.C: ditto
3412 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3413 (parseSingleLyXformat2Token): ditto + add code for
3414 backwards compability for old float styles + add code for new insets
3416 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3418 (InsertInset(size_type, Inset *, LyXFont)): new method
3419 (InsetChar(size_type, char)): changed to use the other InsetChar
3420 with a LyXFont(ALL_INHERIT).
3421 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3422 insert the META_INSET.
3424 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3426 * sigc++/thread.h (Threads): from here
3428 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3429 definition out of line
3430 * sigc++/scope.h: from here
3432 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3434 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3435 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3437 * Makefile.am (bindist): new target.
3439 * INSTALL: add instructions for doing a binary distribution.
3441 * development/tools/README.bin.example: update a bit.
3443 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3446 * lib/lyxrc.example: new lyxrc tag \set_color.
3448 * src/lyxfunc.C (Dispatch):
3449 * src/commandtags.h:
3450 * src/LyXAction.C: new lyxfunc "set-color".
3452 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3453 and an x11name given as strings.
3455 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3456 cache when a color is changed.
3458 2000-06-26 Juergen Vigna <jug@sad.it>
3460 * src/lyxrow.C (width): added this functions and variable.
3462 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3465 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3467 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3469 * images/undo_bw.xpm: new icon.
3470 * images/redo_bw.xpm: ditto.
3472 * configure.in (INSTALL_SCRIPT): change value to
3473 ${INSTALL} to avoid failures of install-script target.
3474 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3476 * src/BufferView.h: add a magic "friend" declaration to please
3479 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3481 * forms/cite.fd: modified to allow resizing without messing
3484 * src/insetcite.C: Uses code from cite.fd almost without
3486 User can now resize dialog in the x-direction.
3487 Resizing the dialog in the y-direction is prevented, as the
3488 code does this intelligently already.
3490 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3492 * INSTALL: remove obsolete entry in "problems" section.
3494 * lib/examples/sl_*.lyx: update of the slovenian examples.
3496 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3498 2000-06-23 Juergen Vigna <jug@sad.it>
3500 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3502 * src/buffer.C (resize): delete the LyXText of textinsets.
3504 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3506 * src/insets/lyxinset.h: added another parameter 'cleared' to
3507 the draw() function.
3509 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3510 unlocking inset in inset.
3512 2000-06-22 Juergen Vigna <jug@sad.it>
3514 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3515 of insets and moved first to LyXText.
3517 * src/mathed/formulamacro.[Ch]:
3518 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3520 2000-06-21 Juergen Vigna <jug@sad.it>
3522 * src/text.C (GetVisibleRow): look if I should clear the area or not
3523 using Inset::doClearArea() function.
3525 * src/insets/lyxinset.h: added doClearArea() function and
3526 modified draw(Painter &, ...) to draw(BufferView *, ...)
3528 * src/text2.C (UpdateInset): return bool insted of int
3530 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3532 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3533 combox in the character popup
3535 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3536 BufferParams const & params
3538 2000-06-20 Juergen Vigna <jug@sad.it>
3540 * src/insets/insettext.C (SetParagraphData): set insetowner on
3543 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3545 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3546 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3548 (form_main_): remove
3550 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3551 (create_form_form_main): remove FD_form_main stuff, connect to
3552 autosave_timeout signal
3554 * src/LyXView.[Ch] (getMainForm): remove
3555 (UpdateTimerCB): remove
3556 * src/BufferView_pimpl.h: inherit from SigC::Object
3558 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3559 signal instead of callback
3561 * src/BufferView.[Ch] (cursorToggleCB): remove
3563 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3565 * src/BufferView_pimpl.C: changes because of the one below
3567 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3568 instead of storing a pointer to a LyXText.
3570 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3572 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3574 * src/lyxparagraph.h
3576 * src/paragraph.C: Changed fontlist to a sorted vector.
3578 2000-06-19 Juergen Vigna <jug@sad.it>
3580 * src/BufferView.h: added screen() function.
3582 * src/insets/insettext.C (LocalDispatch): some selection code
3585 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3587 * src/insets/insettext.C (SetParagraphData):
3589 (InsetText): fixes for multiple paragraphs.
3591 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3593 * development/lyx.spec.in: Call configure with ``--without-warnings''
3594 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3595 This should be fine, however, since we generally don't want to be
3596 verbose when making an RPM.
3598 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3600 * lib/scripts/fig2pstex.py: New file
3602 2000-06-16 Juergen Vigna <jug@sad.it>
3604 * src/insets/insettabular.C (UpdateLocal):
3605 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3606 (LocalDispatch): Changed all functions to use LyXText.
3608 2000-06-15 Juergen Vigna <jug@sad.it>
3610 * src/text.C (SetHeightOfRow): call inset::update before requesting
3613 * src/insets/insettext.C (update):
3614 * src/insets/insettabular.C (update): added implementation
3616 * src/insets/lyxinset.h: added update function
3618 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3620 * src/text.C (SelectNextWord): protect against null pointers with
3621 old-style string streams. (fix from Paul Theo Gonciari
3624 * src/cite.[Ch]: remove erroneous files.
3626 * lib/configure.m4: update the list of created directories.
3628 * src/lyxrow.C: include <config.h>
3629 * src/lyxcursor.C: ditto.
3631 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3633 * lib/examples/decimal.lyx: new example file from Mike.
3635 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3636 to find template definitions (from Dekel)
3638 * src/frontends/.cvsignore: add a few things.
3640 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3642 * src/Timeout.C (TimeOut): remove default argument.
3644 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3647 * src/insets/ExternalTemplate.C: add a "using" directive.
3649 * src/lyx_main.h: remove the act_ struct, which seems unused
3652 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3654 * LyX Developers Meeting: All files changed, due to random C++ (by
3655 coincidence) code generator script.
3657 - external inset (cool!)
3658 - initial online editing of preferences
3659 - insettabular breaks insettext(s contents)
3661 - some DocBook fixes
3662 - example files update
3663 - other cool stuff, create a diff and look for yourself.
3665 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3667 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3668 -1 this is a non-line-breaking textinset.
3670 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3671 if there is no width set.
3673 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3675 * Lots of files: Merged the dialogbase branch.
3677 2000-06-09 Allan Rae <rae@lyx.org>
3679 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3680 and the Dispatch methods that used it.
3682 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3683 access to functions formerly kept in Dispatch.
3685 2000-05-19 Allan Rae <rae@lyx.org>
3687 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3688 made to_page and count_copies integers again. from_page remains a
3689 string however because I want to allow entry of a print range like
3690 "1,4,22-25" using this field.
3692 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3693 and printer-params-get. These aren't useful from the minibuffer but
3694 could be used by a script/LyXServer app provided it passes a suitable
3695 auto_mem_buffer. I guess I should take a look at how the LyXServer
3696 works and make it support xtl buffers.
3698 * sigc++/: updated to libsigc++-1.0.1
3700 * src/xtl/: updated to xtl-1.3.pl.11
3702 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3703 those changes done to the files in src/ are actually recreated when
3704 they get regenerated. Please don't ever accept a patch that changes a
3705 dialog unless that patch includes the changes to the corresponding *.fd
3708 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3709 stringOnlyContains, renamed it and generalised it.
3711 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3712 branch. Removed the remaining old form_print code.
3714 2000-04-26 Allan Rae <rae@lyx.org>
3716 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3717 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3719 2000-04-25 Allan Rae <rae@lyx.org>
3721 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3722 against a base of xtl-1.3.pl.4
3724 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3725 filter the Id: entries so they still show the xtl version number
3728 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3729 into the src/xtl code. Patch still pending with José (XTL)
3731 2000-04-24 Allan Rae <rae@lyx.org>
3733 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3734 both more generic and much safer. Use the new template functions.
3735 * src/buffer.[Ch] (Dispatch): ditto.
3737 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3738 and mem buffer more intelligently. Also a little general cleanup.
3741 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3742 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3743 * src/xtl/Makefile.am: ditto.
3744 * src/xtl/.cvsignore: ditto.
3745 * src/Makefile.am: ditto.
3747 * src/PrinterParams.h: Removed the macros member functions. Added a
3748 testInvariant member function. A bit of tidying up and commenting.
3749 Included Angus's idea for fixing operation with egcs-1.1.2.
3751 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3752 cool expansion of XTL's mem_buffer to support automatic memory
3753 management within the buffer itself. Removed the various macros and
3754 replaced them with template functions that use either auto_mem_buffer
3755 or mem_buffer depending on a #define. The mem_buffer support will
3756 disappear as soon as the auto_mem_buffer is confirmed to be good on
3757 other platforms/compilers. That is, it's there so you've got something
3760 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3761 effectively forked XTL. However I expect José will include my code
3762 into the next major release. Also fixed a memory leak.
3763 * src/xtl/text.h: ditto.
3764 * src/xtl/xdr.h: ditto.
3765 * src/xtl/giop.h: ditto.
3767 2000-04-16 Allan Rae <rae@lyx.org>
3769 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3770 by autogen.sh and removed by maintainer-clean anyway.
3771 * .cvsignore, sigc++/.cvsignore: Support the above.
3773 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3775 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3777 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3778 macros, renamed static callback-target member functions to suit new
3779 scheme and made them public.
3780 * src/frontends/xforms/forms/form_print.fd: ditto.
3781 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3783 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3786 * src/xtl/: New directory containing a minimal distribution of XTL.
3787 This is XTL-1.3.pl.4.
3789 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3791 2000-04-15 Allan Rae <rae@lyx.org>
3793 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3795 * sigc++/: Updated to libsigc++-1.0.0
3797 2000-04-14 Allan Rae <rae@lyx.org>
3799 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3800 use the generic ones in future. I'll modify my conversion script.
3802 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3804 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3805 (CloseAllBufferRelatedDialogs): Renamed.
3806 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3808 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3809 of the generic ones. These are the same ones my conversion script
3812 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3813 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3814 * src/buffer.C (Dispatch): ditto
3816 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3817 functions for updating and hiding buffer dependent dialogs.
3818 * src/BufferView.C (buffer): ditto
3819 * src/buffer.C (setReadonly): ditto
3820 * src/lyxfunc.C (CloseBuffer): ditto
3822 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3823 Dialogs.h, and hence all the SigC stuff, into every file that includes
3824 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3826 * src/BufferView2.C: reduce the number of headers included by buffer.h
3828 2000-04-11 Allan Rae <rae@lyx.org>
3830 * src/frontends/xforms/xform_macros.h: A small collection of macros
3831 for building C callbacks.
3833 * src/frontends/xforms/Makefile.am: Added above file.
3835 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3836 scheme again. This time it should work for JMarc. If this is
3837 successful I'll revise my conversion script to automate some of this.
3838 The static member functions in the class also have to be public for
3839 this scheme will work. If the scheme works (it's almost identical to
3840 the way BufferView::cursorToggleCB is handled so it should work) then
3841 FormCopyright and FormPrint will be ready for inclusion into the main
3842 trunk immediately after 1.1.5 is released -- provided we're prepared
3843 for complaints about lame compilers not handling XTL.
3845 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3847 2000-04-07 Allan Rae <rae@lyx.org>
3849 * config/lyxinclude.m4: A bit more tidying up (Angus)
3851 * src/LString.h: JMarc's <string> header fix
3853 * src/PrinterParams.h: Used string for most data to remove some
3854 ugly code in the Print dialog and avoid even uglier code when
3855 appending the ints to a string for output.
3857 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3858 and moved "default:" back to the end of switch statement. Cleaned
3859 up the printing so it uses the right function calls and so the
3860 "print to file" option actually puts the file in the right directory.
3862 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3864 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3865 and Ok+Apply button control into a separate method: input (Angus).
3866 (input) Cleaned it up and improved it to be very thorough now.
3867 (All CB) static_cast used instead of C style cast (Angus). This will
3868 probably change again once we've worked out how to keep gcc-2.8.1 happy
3869 with real C callbacks.
3870 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3871 ignore some of the bool settings and has random numbers instead. Needs
3872 some more investigation. Added other input length checks and checking
3873 of file and printer names.
3875 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3876 would link (Angus). Seems the old code doesn't compile with the pragma
3877 statement either. Separated callback entries from internal methods.
3879 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3881 2000-03-17 Allan Rae <rae@lyx.org>
3883 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3884 need it? Maybe it could go in Dialogs instead? I could make it a
3885 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3886 values to get the bool return value.
3887 (Dispatch): New overloaded method for xtl support.
3889 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3890 extern "C" callback instead of static member functions. Hopefully,
3891 JMarc will be able to compile this. I haven't changed
3892 forms/form_copyright.fd yet. Breaking one of my own rules already.
3894 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3895 because they aren't useful from the minibuffer. Maybe a LyXServer
3896 might want a help message though?
3898 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3900 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3901 xtl which needs both rtti and exceptions.
3903 * src/support/Makefile.am:
3904 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3906 * src/frontends/xforms/input_validators.[ch]: input filters and
3907 validators. These conrol what keys are valid in input boxes.
3908 Use them and write some more. Much better idea than waiting till
3909 after the user has pressed Ok to say that the input fields don't make
3912 * src/frontends/xforms/Makefile.am:
3913 * src/frontends/xforms/forms/form_print.fd:
3914 * src/frontends/xforms/forms/makefile:
3915 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3916 new scheme. Still have to make sure I haven't missed anything from
3917 the current implementation.
3919 * src/Makefile.am, src/PrinterParams.h: New data store.
3921 * other files: Added a couple of copyright notices.
3923 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3925 * src/insets/insetbib.h: move Holder struct in public space.
3927 * src/frontends/include/DialogBase.h: use SigC:: only when
3928 SIGC_CXX_NAMESPACES is defined.
3929 * src/frontends/include/Dialogs.h: ditto.
3931 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3933 * src/frontends/xforms/FormCopyright.[Ch]: do not
3934 mention SigC:: explicitely.
3936 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3938 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3939 deals with testing KDE in main configure.in
3940 * configure.in: ditto.
3942 2000-02-22 Allan Rae <rae@lyx.org>
3944 * Lots of files: Merged from HEAD
3946 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3947 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3949 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3951 * sigc++/: new minidist.
3953 2000-02-14 Allan Rae <rae@lyx.org>
3955 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3957 2000-02-08 Juergen Vigna <jug@sad.it>
3959 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3960 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3962 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3963 for this port and so it is much easier for other people to port
3964 dialogs in a common development environment.
3966 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3967 the QT/KDE implementation.
3969 * src/frontends/kde/Dialogs.C:
3970 * src/frontends/kde/FormCopyright.C:
3971 * src/frontends/kde/FormCopyright.h:
3972 * src/frontends/kde/Makefile.am:
3973 * src/frontends/kde/formcopyrightdialog.C:
3974 * src/frontends/kde/formcopyrightdialog.h:
3975 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3976 for the kde support of the Copyright-Dialog.
3978 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3979 subdir-substitution instead of hardcoded 'xforms' as we now have also
3982 * src/frontends/include/DialogBase.h (Object): just commented the
3983 label after #endif (nasty warning and I don't like warnings ;)
3985 * src/main.C (main): added KApplication initialization if using
3988 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3989 For now only the KDE event-loop is added if frontend==kde.
3991 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3993 * configure.in: added support for the --with-frontend[=value] option
3995 * autogen.sh: added kde.m4 file to list of config-files
3997 * acconfig.h: added define for KDEGUI-support
3999 * config/kde.m4: added configuration functions for KDE-port
4001 * config/lyxinclude.m4: added --with-frontend[=value] option with
4002 support for xforms and KDE.
4004 2000-02-08 Allan Rae <rae@lyx.org>
4006 * all Makefile.am: Fixed up so the make targets dist, distclean,
4007 install and uninstall all work even if builddir != srcdir. Still
4008 have a new sigc++ minidist update to come.
4010 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4012 2000-02-01 Allan Rae <rae@lyx.org>
4014 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4015 Many mods to get builddir != srcdir working.
4017 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4018 for building on NT and so we can do the builddir != srcdir stuff.
4020 2000-01-30 Allan Rae <rae@lyx.org>
4022 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4023 This will stay in "rae" branch. We probably don't really need it in
4024 the main trunk as anyone who wants to help programming it should get
4025 a full library installed also. So they can check both included and
4026 system supplied library compilation.
4028 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4029 Added a 'mini' distribution of libsigc++. If you feel the urge to
4030 change something in these directories - Resist it. If you can't
4031 resist the urge then you should modify the following script and rebuild
4032 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4033 all happen. Still uses a hacked version of libsigc++'s configure.in.
4034 I'm quite happy with the results. I'm not sure the extra work to turn
4035 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4036 worth the trouble and would probably lead to extra maintenance
4038 I haven't tested the following important make targets: install, dist.
4039 Not ready for prime time but very close. Maybe 1.1.5.
4041 * development/tools/makeLyXsigc.sh: A shell script to automatically
4042 generate our mini-dist of libsigc++. It can only be used with a CVS
4043 checkout of libsigc++ not a tarball distribution. It's well commented.
4044 This will end up as part of the libsigc++ distribution so other apps
4045 can easily have an included mini-dist. If someone makes mods to the
4046 sigc++ subpackage without modifying this script to generate those
4047 changes I'll be very upset!
4049 * src/frontends/: Started the gui/system indep structure.
4051 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4052 to access the gui-indep dialogs are in this class. Much improved
4053 design compared to previous revision. Lars, please refrain from
4054 moving this header into src/ like you did with Popups.h last time.
4056 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4058 * src/frontends/xforms/: Started the gui-indep system with a single
4059 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4062 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4063 Here you'll find a very useful makefile and automated fdfix.sh that
4064 makes updating dailogs a no-brainer -- provided you follow the rules
4065 set out in the README. I'm thinking about adding another script to
4066 automatically generate skeleton code for a new dialog given just the
4069 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4070 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4071 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4073 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4075 * src/support/LSubstring.C (operator): simplify
4077 * src/lyxtext.h: removed bparams, use buffer_->params instead
4079 * src/lyxrow.h: make Row a real class, move all variables to
4080 private and use accessors.
4082 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4084 (isRightToLeftPar): ditto
4085 (ChangeLanguage): ditto
4086 (isMultiLingual): ditto
4089 (SimpleTeXOnePar): ditto
4090 (TeXEnvironment): ditto
4091 (GetEndLabel): ditto
4093 (SetOnlyLayout): ditto
4094 (BreakParagraph): ditto
4095 (BreakParagraphConservative): ditto
4096 (GetFontSettings): ditto
4098 (CopyIntoMinibuffer): ditto
4099 (CutIntoMinibuffer): ditto
4100 (PasteParagraph): ditto
4101 (SetPExtraType): ditto
4102 (UnsetPExtraType): ditto
4103 (DocBookContTableRows): ditto
4104 (SimpleDocBookOneTablePar): ditto
4106 (TeXFootnote): ditto
4107 (SimpleTeXOneTablePar): ditto
4108 (TeXContTableRows): ditto
4109 (SimpleTeXSpecialChars): ditto
4112 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4113 to private and use accessors.
4115 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4116 this, we did not use it anymore and has not been for ages. Just a
4117 waste of cpu cycles.
4119 * src/language.h: make Language a real class, move all variables
4120 to private and use accessors.
4122 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4123 (create_view): remove
4124 (update): some changes for new timer
4125 (cursorToggle): use new timer
4126 (beforeChange): change for new timer
4128 * src/BufferView.h (cursorToggleCB): removed last paramter because
4131 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4132 (cursorToggleCB): change because of new timer code
4134 * lib/CREDITS: updated own mailaddress
4136 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4138 * src/support/filetools.C (PutEnv): fix the code in case neither
4139 putenv() nor setenv() have been found.
4141 * INSTALL: mention the install-strip Makefile target.
4143 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4144 read-only documents.
4146 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4148 * lib/reLyX/configure.in (VERSION): avoid using a previously
4149 generated reLyX wrapper to find out $prefix.
4151 * lib/examples/eu_adibide_lyx-atua.lyx:
4152 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4153 translation of the Tutorial (Dooteo)
4155 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4157 * forms/cite.fd: new citation dialog
4159 * src/insetcite.[Ch]: the new citation dialog is moved into
4162 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4165 * src/insets/insetcommand.h: data members made private.
4167 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4169 * LyX 1.1.5 released
4171 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4173 * src/version.h (LYX_RELEASE): to 1.1.5
4175 * src/spellchecker.C (RunSpellChecker): return false if the
4176 spellchecker dies upon creation.
4178 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4180 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4181 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4185 * lib/CREDITS: update entry for Martin Vermeer.
4187 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4189 * src/text.C (draw): Draw foreign language bars at the bottom of
4190 the row instead of at the baseline.
4192 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4194 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4196 * lib/bind/de_menus.bind: updated
4198 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4200 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4202 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4204 * src/menus.C (Limit_string_length): New function
4205 (ShowTocMenu): Limit the number of items/length of items in the
4208 * src/paragraph.C (String): Correct result for a paragraph inside
4211 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4213 * src/bufferlist.C (close): test of buf->getuser() == NULL
4215 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4217 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4218 Do not call to SetCursor when the paragraph is a closed footnote!
4220 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4222 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4225 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4227 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4230 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4231 reference popup, that activates the reference-back action
4233 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4235 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4236 the menus. Also fixed a bug.
4238 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4239 the math panels when switching buffers (unless new buffer is readonly).
4241 * src/BufferView.C (NoSavedPositions)
4242 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4244 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4246 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4247 less of dvi dirty or not.
4249 * src/trans_mgr.[Ch] (insert): change first parameter to string
4252 * src/chset.[Ch] (encodeString): add const to first parameter
4254 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4256 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4260 * src/LaTeX.C (deplog): better searching for dependency files in
4261 the latex log. Uses now regexps.
4263 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4264 instead of the box hack or \hfill.
4266 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4268 * src/lyxfunc.C (doImportHelper): do not create the file before
4269 doing the actual import.
4270 (doImportASCIIasLines): create a new file before doing the insert.
4271 (doImportASCIIasParagraphs): ditto.
4273 * lib/lyxrc.example: remove mention of non-existing commands
4275 * lyx.man: remove mention of color-related switches.
4277 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4279 * src/lyx_gui.C: remove all the color-related ressources, which
4280 are not used anymore.
4282 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4285 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4287 * src/lyxrc.C (read): Add a missing break in the switch
4289 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4291 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4293 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4296 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4298 * src/text.C (draw): draw bars under foreign language words.
4300 * src/LColor.[Ch]: add LColor::language
4302 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4304 * src/lyxcursor.h (boundary): New member variable
4306 * src/text.C (IsBoundary): New methods
4308 * src/text.C: Use the above for currect cursor movement when there
4309 is both RTL & LTR text.
4311 * src/text2.C: ditto
4313 * src/bufferview_funcs.C (ToggleAndShow): ditto
4315 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4317 * src/text.C (DeleteLineForward): set selection to true to avoid
4318 that DeleteEmptyParagraphMechanism does some magic. This is how it
4319 is done in all other functions, and seems reasonable.
4320 (DeleteWordForward): do not jump over non-word stuff, since
4321 CursorRightOneWord() already does it.
4323 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4324 DeleteWordBackward, since they seem safe to me (since selection is
4325 set to "true") DeleteEmptyParagraphMechanism does nothing.
4327 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4329 * src/lyx_main.C (easyParse): simplify the code by factoring the
4330 part that removes parameters from the command line.
4331 (LyX): check wether wrong command line options have been given.
4333 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4335 * src/lyx_main.C : add support for specifying user LyX
4336 directory via command line option -userdir.
4338 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4340 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4341 the number of items per popup.
4342 (Add_to_refs_menu): Ditto.
4344 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4346 * src/lyxparagraph.h: renamed ClearParagraph() to
4347 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4348 textclass as parameter, and do nothing if free_spacing is
4349 true. This fixes part of the line-delete-forward problems.
4351 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4352 (pasteSelection): ditto.
4353 (SwitchLayoutsBetweenClasses): more translatable strings.
4355 * src/text2.C (CutSelection): use StripLeadingSpaces.
4356 (PasteSelection): ditto.
4357 (DeleteEmptyParagraphMechanism): ditto.
4359 2000-05-26 Juergen Vigna <jug@sad.it>
4361 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4362 is not needed in tabular insets.
4364 * src/insets/insettabular.C (TabularFeatures): added missing features.
4366 * src/tabular.C (DeleteColumn):
4368 (AppendRow): implemented this functions
4369 (cellsturct::operator=): clone the inset too;
4371 2000-05-23 Juergen Vigna <jug@sad.it>
4373 * src/insets/insettabular.C (LocalDispatch): better selection support
4374 when having multicolumn-cells.
4376 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4378 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4380 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4382 * src/ColorHandler.C (getGCForeground): put more test into _()
4384 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4387 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4390 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4392 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4393 there are no labels, or when buffer is readonly.
4395 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4396 there are no labels, buffer is SGML, or when buffer is readonly.
4398 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4400 * src/LColor.C (LColor): change a couple of grey40 to grey60
4401 (LColor): rewore initalization to make compiles go some magnitude
4403 (getGUIName): don't use gettext until we need the string.
4405 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4407 * src/Bullet.[Ch]: Fixed a small bug.
4409 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4411 * src/paragraph.C (String): Several fixes/improvements
4413 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4415 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4417 * src/paragraph.C (String): give more correct output.
4419 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4421 * src/lyxfont.C (stateText) Do not output the language if it is
4422 eqaul to the language of the document.
4424 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4425 between two paragraphs with the same language.
4427 * src/paragraph.C (getParLanguage) Return a correct answer for an
4428 empty dummy paragraph.
4430 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4433 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4436 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4437 the menus/popup, if requested fonts are unavailable.
4439 2000-05-22 Juergen Vigna <jug@sad.it>
4441 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4442 movement support (Up/Down/Tab/Shift-Tab).
4443 (LocalDispatch): added also preliminari cursor-selection.
4445 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4447 * src/paragraph.C (PasteParagraph): Hopefully now right!
4449 2000-05-22 Garst R. Reese <reese@isn.net>
4451 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4452 of list, change all references to Environment to Command
4453 * tex/hollywood.cls : rewrite environments as commands, add
4454 \uppercase to interiorshot and exteriorshot to force uppecase.
4455 * tex/broadway.cls : rewrite environments as commands. Tweak
4458 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4460 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4461 size of items: use a constant intead of the hardcoded 40, and more
4462 importantly do not remove the %m and %x tags added at the end.
4463 (Add_to_refs_menu): use vector::size_type instead of
4464 unsigned int as basic types for the variables. _Please_ do not
4465 assume that size_t is equal to unsigned int. On an alpha, this is
4466 unsigned long, which is _not_ the same.
4468 * src/language.C (initL): remove language "hungarian", since it
4469 seems that "magyar" is better.
4471 2000-05-22 Juergen Vigna <jug@sad.it>
4473 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4475 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4478 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4479 next was deleted but not set to 0.
4481 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4483 * src/language.C (initL): change the initialization of languages
4484 so that compiles goes _fast_.
4486 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4489 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4491 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4495 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4497 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4499 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4503 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4506 * src/insets/insetlo*.[Ch]: Made editable
4508 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4510 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4511 the current selection.
4513 * src/BufferView_pimpl.C (stuffClipboard): new method
4515 * src/BufferView.C (stuffClipboard): new method
4517 * src/paragraph.C (String): new method
4519 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4520 LColor::ignore when lyxname is not found.
4522 * src/BufferView.C (pasteSelection): new method
4524 * src/BufferView_pimpl.C (pasteSelection): new method
4526 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4528 * src/WorkArea.C (request_clipboard_cb): new static function
4529 (getClipboard): new method
4530 (putClipboard): new method
4532 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4534 * LyX 1.1.5pre2 released
4536 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4538 * src/vspace.C (operator=): removed
4539 (operator=): removed
4541 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4543 * src/layout.C (NumberOfClass): manually set the type in make_pair
4544 (NumberOfLayout): ditto
4546 * src/language.C: use the Language constructor for ignore_lang
4548 * src/language.h: add constructors to struct Language
4550 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4552 * src/text2.C (SetCursorIntern): comment out #warning
4554 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4556 * src/mathed/math_iter.h: initialize sx and sw to 0
4558 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4560 * forms/lyx.fd: Redesign of form_ref
4562 * src/LaTeXFeatures.[Ch]
4566 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4569 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4570 and Buffer::inset_iterator.
4572 * src/menus.C: Added new menus: TOC and Refs.
4574 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4576 * src/buffer.C (getTocList): New method.
4578 * src/BufferView2.C (ChangeRefs): New method.
4580 * src/buffer.C (getLabelList): New method. It replaces the old
4581 getReferenceList. The return type is vector<string> instead of
4584 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4585 the old getLabel() and GetNumberOfLabels() methods.
4586 * src/insets/insetlabel.C (getLabelList): ditto
4587 * src/mathed/formula.C (getLabelList): ditto
4589 * src/paragraph.C (String): New method.
4591 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4592 Uses the new getTocList() method.
4593 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4594 which automatically updates the contents of the browser.
4595 (RefUpdateCB): Use the new getLabelList method.
4597 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4599 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4601 * src/spellchecker.C: Added using std::reverse;
4603 2000-05-19 Juergen Vigna <jug@sad.it>
4605 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4607 * src/insets/insettext.C (computeTextRows): small fix for display of
4608 1 character after a newline.
4610 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4613 2000-05-18 Juergen Vigna <jug@sad.it>
4615 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4616 when changing width of column.
4618 * src/tabular.C (set_row_column_number_info): setting of
4619 autobreak rows if necessary.
4621 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4623 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4625 * src/vc-backend.*: renamed stat() to status() and vcstat to
4626 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4627 compilation broke. The new name seems more relevant, anyway.
4629 2000-05-17 Juergen Vigna <jug@sad.it>
4631 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4632 which was wrong if the removing caused removing of rows!
4634 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4635 (pushToken): new function.
4637 * src/text2.C (CutSelection): fix problem discovered with purify
4639 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4641 * src/debug.C (showTags): enlarge the first column, now that we
4642 have 6-digits debug codes.
4644 * lib/layouts/hollywood.layout:
4645 * lib/tex/hollywood.cls:
4646 * lib/tex/brodway.cls:
4647 * lib/layouts/brodway.layout: more commands and fewer
4648 environments. Preambles moved in the .cls files. Broadway now has
4649 more options on scene numbering and less whitespace (from Garst)
4651 * src/insets/insetbib.C (getKeys): make sure that we are in the
4652 document directory, in case the bib file is there.
4654 * src/insets/insetbib.C (Latex): revert bogus change.
4656 2000-05-16 Juergen Vigna <jug@sad.it>
4658 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4659 the TabularLayout on cursor move.
4661 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4663 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4666 (draw): fixed cursor position and drawing so that the cursor is
4667 visible when before the tabular-inset.
4669 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4670 when creating from old insettext.
4672 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4674 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4676 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4677 * lib/tex/brodway.cls: ditto
4679 * lib/layouts/brodway.layout: change alignment of parenthical
4682 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4684 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4685 versions 0.88 and 0.89 are supported.
4687 2000-05-15 Juergen Vigna <jug@sad.it>
4689 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4692 * src/insets/insettext.C (computeTextRows): redone completely this
4693 function in a much cleaner way, because of problems when having a
4695 (draw): added a frame border when the inset is locked.
4696 (SetDrawLockedFrame): this sets if we draw the border or not.
4697 (SetFrameColor): this sets the frame color (default=insetframe).
4699 * src/insets/lyxinset.h: added x() and y() functions which return
4700 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4701 function which is needed to see if we have a locking inset of some
4702 type in this inset (needed for now in insettabular).
4704 * src/vspace.C (inPixels): the same function also without a BufferView
4705 parameter as so it is easier to use it in some ocasions.
4707 * src/lyxfunc.C: changed all places where insertInset was used so
4708 that now if it couldn't be inserted it is deleted!
4710 * src/TabularLayout.C:
4711 * src/TableLayout.C: added support for new tabular-inset!
4713 * src/BufferView2.C (insertInset): this now returns a bool if the
4714 inset was really inserted!!!
4716 * src/tabular.C (GetLastCellInRow):
4717 (GetFirstCellInRow): new helper functions.
4718 (Latex): implemented for new tabular class.
4722 (TeXTopHLine): new Latex() helper functions.
4724 2000-05-12 Juergen Vigna <jug@sad.it>
4726 * src/mathed/formulamacro.C (Read):
4727 * src/mathed/formula.C (Read): read also the \end_inset here!
4729 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4731 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4732 crush when saving formulae with unbalanced parenthesis.
4734 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4736 * src/layout.C: Add new keyword "endlabelstring" to layout file
4738 * src/text.C (GetVisibleRow): Draw endlabel string.
4740 * lib/layouts/broadway.layout
4741 * lib/layouts/hollywood.layout: Added endlabel for the
4742 Parenthetical layout.
4744 * lib/layouts/heb-article.layout: Do not use slanted font shape
4745 for Theorem like environments.
4747 * src/buffer.C (makeLaTeXFile): Always add "american" to
4748 the UsedLanguages list if document language is RTL.
4750 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4752 * add addendum to README.OS2 and small patch (from SMiyata)
4754 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4756 * many files: correct the calls to ChangeExtension().
4758 * src/support/filetools.C (ChangeExtension): remove the no_path
4759 argument, which does not belong there. Use OnlyFileName() instead.
4761 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4762 files when LaTeXing a non-nice latex file.
4764 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4765 a chain of "if". Return false when deadkeys are not handled.
4767 * src/lyx_main.C (LyX): adapted the code for default bindings.
4769 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4770 bindings for basic functionality (except deadkeys).
4771 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4773 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4774 several methods: handle override_x_deadkeys.
4776 * src/lyxrc.h: remove the "bindings" map, which did not make much
4777 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4779 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4781 * src/lyxfont.C (stateText): use a saner method to determine
4782 whether the font is "default". Seems to fix the crash with DEC
4785 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4787 2000-05-08 Juergen Vigna <jug@sad.it>
4789 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4790 TabularLayoutMenu with mouse-button-3
4791 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4793 * src/TabularLayout.C: added this file for having a Layout for
4796 2000-05-05 Juergen Vigna <jug@sad.it>
4798 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4799 recalculating inset-widths.
4800 (TabularFeatures): activated this function so that I can change
4801 tabular-features via menu.
4803 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4804 that I can test some functions with the Table menu.
4806 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4808 * src/lyxfont.C (stateText): guard against stupid c++libs.
4810 * src/tabular.C: add using std::vector
4811 some whitespace changes, + removed som autogenerated code.
4813 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4815 2000-05-05 Juergen Vigna <jug@sad.it>
4817 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4818 row, columns and cellstructures.
4820 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4822 * lib/lyxrc.example: remove obsolete entries.
4824 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4825 reading of protected_separator for free_spacing.
4827 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4829 * src/text.C (draw): do not display an exclamation mark in the
4830 margin for margin notes. This is confusing, ugly and
4833 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4834 AMS math' is checked.
4836 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4837 name to see whether including the amsmath package is needed.
4839 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4841 * src/paragraph.C (validate): Compute UsedLanguages correctly
4842 (don't insert the american language if it doesn't appear in the
4845 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4846 The argument of \thanks{} command is considered moving argument
4848 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4851 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4853 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4854 for appendix/minipage/depth. The lines can be now both in the footnote
4855 frame, and outside the frame.
4857 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4860 2000-05-05 Juergen Vigna <jug@sad.it>
4862 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4863 neede only in tabular.[Ch].
4865 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4867 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4869 (Write): write '~' for PROTECTED_SEPARATOR
4871 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4873 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4876 * src/mathed/formula.C (drawStr): rename size to siz.
4878 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4879 possibly fix a bug by not changing the pflags = flags to piflags =
4882 2000-05-05 Juergen Vigna <jug@sad.it>
4884 * src/insets/insetbib.C: moved using directive
4886 * src/ImportNoweb.C: small fix for being able to compile (missing
4889 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4891 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4892 to use clear, since we don't depend on this in the code. Add test
4895 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4897 * (various *.C files): add using std::foo directives to please dec
4900 * replace calls to string::clear() to string::erase() (Angus)
4902 * src/cheaders/cmath: modified to provide std::abs.
4904 2000-05-04 Juergen Vigna <jug@sad.it>
4906 * src/insets/insettext.C: Prepared all for inserting of multiple
4907 paragraphs. Still display stuff to do (alignment and other things),
4908 but I would like to use LyXText to do this when we cleaned out the
4909 table-support stuff.
4911 * src/insets/insettabular.C: Changed lot of stuff and added lots
4912 of functionality still a lot to do.
4914 * src/tabular.C: Various functions changed name and moved to be
4915 const functions. Added new Read and Write functions and changed
4916 lots of things so it works good with tabular-insets (also removed
4917 some stuff which is not needed anymore * hacks *).
4919 * src/lyxcursor.h: added operators == and != which just look if
4920 par and pos are (not) equal.
4922 * src/buffer.C (latexParagraphs): inserted this function to latex
4923 all paragraphs form par to endpar as then I can use this too for
4926 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4927 so that I can call this to from text insets with their own cursor.
4929 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4930 output off all paragraphs (because of the fix below)!
4932 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4933 the very last paragraph (this could be also the last paragraph of an
4936 * src/texrow.h: added rows() call which returns the count-variable.
4938 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4940 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4942 * lib/configure.m4: better autodetection of DocBook tools.
4944 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4946 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4948 * src/lyx_cb.C: add using std::reverse;
4950 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4953 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4954 selected files. Should fix repeated errors from generated files.
4956 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4958 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4960 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4961 the spellchecker popup.
4963 * lib/lyxrc.example: Removed the \number_inset section
4965 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4967 * src/insets/figinset.C (various): Use IsFileReadable() to make
4968 sure that the file actually exist. Relying on ghostscripts errors
4969 is a bad idea since they can lead to X server crashes.
4971 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4973 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4976 * lib/lyxrc.example: smallish typo in description of
4977 \view_dvi_paper_option
4979 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4982 * src/lyxfunc.C: doImportHelper to factor out common code of the
4983 various import methods. New functions doImportASCIIasLines,
4984 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4985 doImportLinuxDoc for the format specific parts.
4988 * buffer.C: Dispatch returns now a bool to indicate success
4991 * lyx_gui.C: Add getLyXView() for member access
4993 * lyx_main.C: Change logic for batch commands: First try
4994 Buffer::Dispatch (possibly without GUI), if that fails, use
4997 * lyx_main.C: Add support for --import command line switch.
4998 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4999 Available Formats: Everything accepted by 'buffer-import <format>'
5001 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5003 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5006 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5007 documents will be reformatted upon reentry.
5009 2000-04-27 Juergen Vigna <jug@sad.it>
5011 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5012 correctly only last pos this was a bug.
5014 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5016 * release of lyx-1.1.5pre1
5018 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5020 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5022 * src/menus.C: revert the change of naming (Figure->Graphic...)
5023 from 2000-04-11. It was incomplete and bad.
5025 * src/LColor.[Ch]: add LColor::depthbar.
5026 * src/text.C (GetVisibleRow): use it.
5028 * README: update the languages list.
5030 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5032 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5035 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5037 * README: remove sections that were just wrong.
5039 * src/text2.C (GetRowNearY): remove currentrow code
5041 * src/text.C (GetRow): remove currentrow code
5043 * src/screen.C (Update): rewritten a bit.
5044 (SmallUpdate): removed func
5046 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5048 (FullRebreak): return bool
5049 (currentrow): remove var
5050 (currentrow_y): ditto
5052 * src/lyxscreen.h (Draw): change arg to unsigned long
5053 (FitCursor): return bool
5054 (FitManualCursor): ditto
5055 (Smallpdate): remove func
5056 (first): change to unsigned long
5057 (DrawOneRow): change second arg to long (from long &)
5058 (screen_refresh_y): remove var
5059 (scree_refresh_row): ditto
5061 * src/lyxrow.h: change baseline to usigned int from unsigned
5062 short, this brings some implicit/unsigned issues out in the open.
5064 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5066 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5067 instead of smallUpdate.
5069 * src/lyxcursor.h: change y to unsigned long
5071 * src/buffer.h: don't call updateScrollbar after fitcursor
5073 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5074 where they are used. Removed "\\direction", this was not present
5075 in 1.1.4 and is already obsolete. Commented out some code that I
5076 believe to never be called.
5077 (runLiterate): don't call updateScrollbar after fitCursor
5079 (buildProgram): ditto
5082 * src/WorkArea.h (workWidth): change return val to unsigned
5085 (redraw): remove the button redraws
5086 (setScrollbarValue): change for scrollbar
5087 (getScrollbarValue): change for scrollbar
5088 (getScrollbarBounds): change for scrollbar
5090 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5091 (C_WorkArea_down_cb): removed func
5092 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5093 (resize): change for scrollbar
5094 (setScrollbar): ditto
5095 (setScrollbarBounds): ditto
5096 (setScrollbarIncrements): ditto
5097 (up_cb): removed func
5098 (down_cb): removed func
5099 (scroll_cb): change for scrollbar
5100 (work_area_handler): ditto
5102 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5103 when FitCursor did something.
5104 (updateScrollbar): some unsigned changes
5105 (downCB): removed func
5106 (scrollUpOnePage): removed func
5107 (scrollDownOnePage): remvoed func
5108 (workAreaMotionNotify): don't call screen->FitCursor but use
5109 fitCursor instead. and bool return val
5110 (workAreaButtonPress): ditto
5111 (workAreaButtonRelease): some unsigned changes
5112 (checkInsetHit): ditto
5113 (workAreaExpose): ditto
5114 (update): parts rewritten, comments about the signed char arg added
5115 (smallUpdate): removed func
5116 (cursorPrevious): call needed updateScrollbar
5119 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5122 * src/BufferView.[Ch] (upCB): removed func
5123 (downCB): removed func
5124 (smallUpdate): removed func
5126 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5128 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5129 currentrow, currentrow_y optimization. This did not help a lot and
5130 if we want to do this kind of optimization we should rather use
5131 cursor.row instead of the currentrow.
5133 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5134 buffer spacing and klyx spacing support.
5136 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5138 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5141 2000-04-26 Juergen Vigna <jug@sad.it>
5143 * src/insets/figinset.C: fixes to Lars sstream changes!
5145 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5147 * A lot of files: Added Ascii(ostream &) methods to all inset
5148 classes. Used when exporting to ASCII.
5150 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5151 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5154 * src/text2.C (ToggleFree): Disabled implicit word selection when
5155 there is a change in the language
5157 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5158 no output was generated for end-of-sentence inset.
5160 * src/insets/lyxinset.h
5163 * src/paragraph.C: Removed the insetnumber code
5165 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5167 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5169 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5170 no_babel and no_epsfig completely from the file.
5171 (parseSingleLyXformat2Token): add handling for per-paragraph
5172 spacing as written by klyx.
5174 * src/insets/figinset.C: applied patch by Andre. Made it work with
5177 2000-04-20 Juergen Vigna <jug@sad.it>
5179 * src/insets/insettext.C (cutSelection):
5180 (copySelection): Fixed with selection from right to left.
5181 (draw): now the rows are not recalculated at every draw.
5182 (computeTextRows): for now reset the inset-owner here (this is
5183 important for an undo or copy where the inset-owner is not set
5186 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5187 motion to the_locking_inset screen->first was forgotten, this was
5188 not important till we got multiline insets.
5190 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5192 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5193 code seems to be alright (it is code changed by Dekel, and the
5194 intent is indeed that all macros should be defined \protect'ed)
5196 * NEWS: a bit of reorganisation of the new user-visible features.
5198 2000-04-19 Juergen Vigna <jug@sad.it>
5200 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5201 position. Set the inset_owner of the used paragraph so that it knows
5202 that it is inside an inset. Fixed cursor handling with mouse and
5203 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5204 and cleanups to make TextInsets work better.
5206 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5207 Changed parameters of various functions and added LockInsetInInset().
5209 * src/insets/insettext.C:
5211 * src/insets/insetcollapsable.h:
5212 * src/insets/insetcollapsable.C:
5213 * src/insets/insetfoot.h:
5214 * src/insets/insetfoot.C:
5215 * src/insets/insetert.h:
5216 * src/insets/insetert.C: cleaned up the code so that it works now
5217 correctly with insettext.
5219 * src/insets/inset.C:
5220 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5221 that insets in insets are supported right.
5224 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5226 * src/paragraph.C: some small fixes
5228 * src/debug.h: inserted INSETS debug info
5230 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5231 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5233 * src/commandtags.h:
5234 * src/LyXAction.C: insert code for InsetTabular.
5236 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5237 not Button1MotionMask.
5238 (workAreaButtonRelease): send always a InsetButtonRelease event to
5240 (checkInsetHit): some setCursor fixes (always with insets).
5242 * src/BufferView2.C (lockInset): returns a bool now and extended for
5243 locking insets inside insets.
5244 (showLockedInsetCursor): it is important to have the cursor always
5245 before the locked inset.
5246 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5248 * src/BufferView.h: made lockInset return a bool.
5250 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5252 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5253 that is used also internally but can be called as public to have back
5254 a cursor pos which is not set internally.
5255 (SetCursorIntern): Changed to use above function.
5257 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5259 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5264 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5265 patches for things that should be in or should be changed.
5267 * src/* [insetfiles]: change "usigned char fragile" to bool
5268 fragile. There was only one point that could that be questioned
5269 and that is commented in formulamacro.C. Grep for "CHECK".
5271 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5272 (DeleteBuffer): take it out of CutAndPaste and make it static.
5274 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5276 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5277 output the spacing envir commands. Also the new commands used in
5278 the LaTeX output makes the result better.
5280 * src/Spacing.C (writeEnvirBegin): new method
5281 (writeEnvirEnd): new method
5283 2000-04-18 Juergen Vigna <jug@sad.it>
5285 * src/CutAndPaste.C: made textclass a static member of the class
5286 as otherwise it is not accesed right!!!
5288 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5290 * forms/layout_forms.fd
5291 * src/layout_forms.h
5292 * src/layout_forms.C (create_form_form_character)
5293 * src/lyx_cb.C (UserFreeFont)
5294 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5295 documents (in the layout->character popup).
5297 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5299 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5300 \spell_command was in fact not honored (from Kevin Atkinson).
5302 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5305 * src/lyx_gui.h: make lyxViews private (Angus)
5307 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5309 * src/mathed/math_write.C
5310 (MathMatrixInset::Write) Put \protect before \begin{array} and
5311 \end{array} if fragile
5312 (MathParInset::Write): Put \protect before \\ if fragile
5314 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5316 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5317 initialization if the LyXColorHandler must be done after the
5318 connections to the XServer has been established.
5320 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5321 get the background pixel from the lyxColorhandler so that the
5322 figures are rendered with the correct background color.
5323 (NextToken): removed functions.
5324 (GetPSSizes): use ifs >> string instead of NextToken.
5326 * src/Painter.[Ch]: the color cache moved out of this file.
5328 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5331 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5333 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5334 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5336 * src/BufferView.C (enterView): new func
5337 (leaveView): new func
5339 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5341 (leaveView): new func, undefines xterm cursor when approp.
5343 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5344 (AllowInput): delete the Workarea cursor handling from this func.
5346 * src/Painter.C (underline): draw a slimer underline in most cases.
5348 * src/lyx_main.C (error_handler): use extern "C"
5350 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5352 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5353 sent directly to me.
5355 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5356 to the list by Dekel.
5358 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5361 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5362 methods from lyx_cb.here.
5364 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5367 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5369 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5370 instead of using current_view directly.
5372 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5374 * src/LyXAction.C (init): add the paragraph-spacing command.
5376 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5378 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5380 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5381 different from the documents.
5383 * src/text.C (SetHeightOfRow): take paragraph spacing into
5384 account, paragraph spacing takes precedence over buffer spacing
5385 (GetVisibleRow): ditto
5387 * src/paragraph.C (writeFile): output the spacing parameter too.
5388 (validate): set the correct features if spacing is used in the
5390 (Clear): set spacing to default
5391 (MakeSameLayout): spacing too
5392 (HasSameLayout): spacing too
5393 (SetLayout): spacing too
5394 (TeXOnePar): output the spacing commands
5396 * src/lyxparagraph.h: added a spacing variable for use with
5397 per-paragraph spacing.
5399 * src/Spacing.h: add a Default spacing and a method to check if
5400 the current spacing is default. also added an operator==
5402 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5405 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5407 * src/lyxserver.C (callback): fix dispatch of functions
5409 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5410 printf() into lyxerr call.
5412 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5415 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5416 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5417 the "Float" from each of the subitems.
5418 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5420 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5421 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5422 documented the change so that the workaround can be nuked later.
5424 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5427 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5429 * src/buffer.C (getLatexName): ditto
5430 (setReadonly): ditto
5432 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5434 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5435 avoid some uses of current_view. Added also a bufferParams()
5436 method to get at this.
5438 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5440 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5442 * src/lyxparagraph.[Ch]: removed
5443 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5444 with operators used by lower_bound and
5445 upper_bound in InsetTable's
5446 Make struct InsetTable private again. Used matchpos.
5448 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5450 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5451 document, the language of existing text is changed (unless the
5452 document is multi-lingual)
5454 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5456 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5458 * A lot of files: A rewrite of the Right-to-Left support.
5460 2000-04-10 Juergen Vigna <jug@sad.it>
5462 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5463 misplaced cursor when inset in inset is locked.
5465 * src/insets/insettext.C (LocalDispatch): small fix so that a
5466 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5468 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5469 footnote font should be decreased in size twice when displaying.
5471 * src/insets/insettext.C (GetDrawFont): inserted this function as
5472 the drawing-font may differ from the real paragraph font.
5474 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5475 insets (inset in inset!).
5477 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5478 function here because we don't want footnotes inside footnotes.
5480 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5482 (init): now set the inset_owner in paragraph.C
5483 (LocalDispatch): added some resetPos() in the right position
5486 (pasteSelection): changed to use the new CutAndPaste-Class.
5488 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5489 which tells if it is allowed to insert another inset inside this one.
5491 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5492 SwitchLayoutsBetweenClasses.
5494 * src/text2.C (InsertInset): checking of the new paragraph-function
5496 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5497 is not needed anymore here!
5500 (PasteSelection): redone (also with #ifdef) so that now this uses
5501 the CutAndPaste-Class.
5502 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5505 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5506 from/to text/insets.
5508 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5509 so that the paragraph knows if it is inside an (text)-inset.
5510 (InsertFromMinibuffer): changed return-value to bool as now it
5511 may happen that an inset is not inserted in the paragraph.
5512 (InsertInsetAllowed): this checks if it is allowed to insert an
5513 inset in this paragraph.
5515 (BreakParagraphConservative):
5516 (BreakParagraph) : small change for the above change of the return
5517 value of InsertFromMinibuffer.
5519 * src/lyxparagraph.h: added inset_owner and the functions to handle
5520 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5522 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5524 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5525 functions from BufferView to BufferView::Pimpl to ease maintence.
5527 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5528 correctly. Also use SetCursorIntern instead of SetCursor.
5530 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5533 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5535 * src/WorkArea.C (belowMouse): manually implement below mouse.
5537 * src/*: Add "explicit" on several constructors, I added probably
5538 some unneeded ones. A couple of changes to code because of this.
5540 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5541 implementation and private parts from the users of BufferView. Not
5544 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5545 implementation and private parts from the users of LyXLex. Not
5548 * src/BufferView_pimpl.[Ch]: new files
5550 * src/lyxlex_pimpl.[Ch]: new files
5552 * src/LyXView.[Ch]: some inline functions move out-of-line
5554 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5556 * src/lyxparagraph.h: make struct InsetTable public.
5558 * src/support/lyxstring.h: change lyxstring::difference_type to be
5559 ptrdiff_t. Add std:: modifiers to streams.
5561 * src/font.C: include the <cctype> header, for islower() and
5564 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5566 * src/font.[Ch]: new files. Contains the metric functions for
5567 fonts, takes a LyXFont as parameter. Better separation of concepts.
5569 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5570 changes because of this.
5572 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5574 * src/*: compile with -Winline and move functions that don't
5577 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5580 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5582 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5583 (various files changed because of this)
5585 * src/Painter.C (text): fixed the drawing of smallcaps.
5587 * src/lyxfont.[Ch] (drawText): removed unused member func.
5590 * src/*.C: added needed "using" statements and "std::" qualifiers.
5592 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5594 * src/*.h: removed all use of "using" from header files use
5595 qualifier std:: instead.
5597 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5599 * src/text.C (Backspace): some additional cleanups (we already
5600 know whether cursor.pos is 0 or not).
5602 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5603 automake does not provide one).
5605 * src/bmtable.h: replace C++ comments with C comments.
5607 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5609 * src/screen.C (ShowCursor): Change the shape of the cursor if
5610 the current language is not equal to the language of the document.
5611 (If the cursor change its shape unexpectedly, then you've found a bug)
5613 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5616 * src/insets/insetnumber.[Ch]: New files.
5618 * src/LyXAction.C (init)
5619 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5622 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5624 * src/lyxparagraph.h
5625 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5626 (the vector is kept sorted).
5628 * src/text.C (GetVisibleRow): Draw selection correctly when there
5629 is both LTR and RTL text.
5631 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5632 which is much faster.
5634 * src/text.C (GetVisibleRow and other): Do not draw the last space
5635 in a row if the direction of the last letter is not equal to the
5636 direction of the paragraph.
5638 * src/lyxfont.C (latexWriteStartChanges):
5639 Check that font language is not equal to basefont language.
5640 (latexWriteEndChanges): ditto
5642 * src/lyx_cb.C (StyleReset): Don't change the language while using
5643 the font-default command.
5645 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5646 empty paragraph before a footnote.
5648 * src/insets/insetcommand.C (draw): Increase x correctly.
5650 * src/screen.C (ShowCursor): Change cursor shape if
5651 current language != document language.
5653 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5655 2000-03-31 Juergen Vigna <jug@sad.it>
5657 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5658 (Clone): changed mode how the paragraph-data is copied to the
5659 new clone-paragraph.
5661 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5662 GetInset(pos) with no inset anymore there (in inset UNDO)
5664 * src/insets/insetcommand.C (draw): small fix as here x is
5665 incremented not as much as width() returns (2 before, 2 behind = 4)
5667 2000-03-30 Juergen Vigna <jug@sad.it>
5669 * src/insets/insettext.C (InsetText): small fix in initialize
5670 widthOffset (should not be done in the init() function)
5672 2000-03-29 Amir Karger <karger@lyx.org>
5674 * lib/examples/it_ItemizeBullets.lyx: translation by
5677 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5679 2000-03-29 Juergen Vigna <jug@sad.it>
5681 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5683 * src/insets/insetfoot.C (Clone): small change as for the below
5684 new init function in the text-inset
5686 * src/insets/insettext.C (init): new function as I've seen that
5687 clone did not copy the Paragraph-Data!
5688 (LocalDispatch): Added code so that now we have some sort of Undo
5689 functionality (well actually we HAVE Undo ;)
5691 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5693 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5695 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5698 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5700 * src/main.C: added a runtime check that verifies that the xforms
5701 header used when building LyX and the library used when running
5702 LyX match. Exit with a message if they don't match. This is a
5703 version number check only.
5705 * src/buffer.C (save): Don't allocate memory on the heap for
5706 struct utimbuf times.
5708 * *: some using changes, use iosfwd instead of the real headers.
5710 * src/lyxfont.C use char const * instead of string for the static
5711 strings. Rewrite some functions to use sstream.
5713 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5715 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5718 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5720 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5721 of Geodesy (from Martin Vermeer)
5723 * lib/layouts/svjour.inc: include file for the Springer svjour
5724 class. It can be used to support journals other than JoG.
5726 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5727 Miskiewicz <misiek@pld.org.pl>)
5728 * lib/reLyX/Makefile.am: ditto.
5730 2000-03-27 Juergen Vigna <jug@sad.it>
5732 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5733 also some modifications with operations on selected text.
5735 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5736 problems with clicking on insets (last famous words ;)
5738 * src/insets/insetcommand.C (draw):
5739 (width): Changed to have a bit of space before and after the inset so
5740 that the blinking cursor can be seen (otherwise it was hidden)
5742 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5744 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5745 would not be added to the link list when an installed gettext (not
5746 part of libc) is found.
5748 2000-03-24 Juergen Vigna <jug@sad.it>
5750 * src/insets/insetcollapsable.C (Edit):
5751 * src/mathed/formula.C (InsetButtonRelease):
5752 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5755 * src/BufferView.C (workAreaButtonPress):
5756 (workAreaButtonRelease):
5757 (checkInsetHit): Finally fixed the clicking on insets be handled
5760 * src/insets/insetert.C (Edit): inserted this call so that ERT
5761 insets work always with LaTeX-font
5763 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5765 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5766 caused lyx to startup with no GUI in place, causing in a crash
5767 upon startup when called with arguments.
5769 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5771 * src/FontLoader.C: better initialization of dummyXFontStruct.
5773 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5775 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5776 for linuxdoc and docbook import and export format options.
5778 * lib/lyxrc.example Example of default values for the previous flags.
5780 * src/lyx_cb.C Use those flags instead of the hardwired values for
5781 linuxdoc and docbook export.
5783 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5786 * src/menus.C Added menus entries for the new import/exports formats.
5788 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5790 * src/lyxrc.*: Added support for running without Gui
5793 * src/FontLoader.C: sensible defaults if no fonts are needed
5795 * src/lyx_cb.C: New function ShowMessage (writes either to the
5796 minibuffer or cout in case of no gui
5797 New function AskOverwrite for common stuff
5798 Consequently various changes to call these functions
5800 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5801 wild guess at sensible screen resolution when having no gui
5803 * src/lyxfont.C: no gui, no fonts... set some defaults
5805 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5807 * src/LColor.C: made the command inset background a bit lighter.
5809 2000-03-20 Hartmut Goebel <goebel@noris.net>
5811 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5812 stdstruct.inc. Koma-Script added some title elements which
5813 otherwise have been listed below "bibliography". This split allows
5814 adding title elements to where they belong.
5816 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5817 define the additional tilte elements and then include
5820 * many other layout files: changed to include stdtitle.inc just
5821 before stdstruct.inc.
5823 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5825 * src/buffer.C: (save) Added the option to store all backup files
5826 in a single directory
5828 * src/lyxrc.[Ch]: Added variable \backupdir_path
5830 * lib/lyxrc.example: Added descriptions of recently added variables
5832 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5833 bibtex inset, not closing the bibtex popup when deleting the inset)
5835 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5837 * src/lyx_cb.C: add a couple using directives.
5839 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5840 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5841 import based on the filename.
5843 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5844 file would be imported at start, if the filename where of a sgml file.
5846 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5848 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5850 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5851 * src/lyxfont.h Replaced the member variable bits.direction by the
5852 member variable lang. Made many changes in other files.
5853 This allows having a multi-lingual document
5855 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5856 that change the current language to <l>.
5857 Removed the command "font-rtl"
5859 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5860 format for Hebrew documents)
5862 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5863 When auto_mathmode is "true", pressing a digit key in normal mode
5864 will cause entering into mathmode.
5865 If auto_mathmode is "rtl" then this behavior will be active only
5866 when writing right-to-left text.
5868 * src/text2.C (InsertStringA) The string is inserted using the
5871 * src/paragraph.C (GetEndLabel) Gives a correct result for
5872 footnote paragraphs.
5874 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5876 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5878 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5879 front of PasteParagraph. Never insert a ' '. This should at least
5880 fix some cause for the segfaults that we have been experiencing,
5881 it also fixes backspace behaviour slightly. (Phu!)
5883 * src/support/lstrings.C (compare_no_case): some change to make it
5884 compile with gcc 2.95.2 and stdlibc++-v3
5886 * src/text2.C (MeltFootnoteEnvironment): change type o
5887 first_footnote_par_is_not_empty to bool.
5889 * src/lyxparagraph.h: make text private. Changes in other files
5891 (fitToSize): new function
5892 (setContentsFromPar): new function
5893 (clearContents): new function
5894 (SetChar): new function
5896 * src/paragraph.C (readSimpleWholeFile): deleted.
5898 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5899 the file, just use a simple string instead. Also read the file in
5900 a more maintainable manner.
5902 * src/text2.C (InsertStringA): deleted.
5903 (InsertStringB): deleted.
5905 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5907 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5908 RedoParagraphs from the doublespace handling part, just set status
5909 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5910 done, but perhaps not like this.)
5912 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5914 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5915 character when inserting an inset.
5917 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5919 * src/bufferparams.C (readLanguage): now takes "default" into
5922 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5923 also initialize the toplevel_keymap with the default bindings from
5926 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5928 * all files using lyxrc: have lyxrc as a real variable and not a
5929 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5932 * src/lyxrc.C: remove double call to defaultKeyBindings
5934 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5935 toolbar defauls using lyxlex. Remove enums, structs, functions
5938 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5939 toolbar defaults. Also store default keybindings in a map.
5941 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5942 storing the toolbar defaults without any xforms dependencies.
5944 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5945 applied. Changed to use iterators.
5947 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5949 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5950 systems that don't have LINGUAS set to begin with.
5952 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5954 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5955 the list by Dekel Tsur.
5957 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5959 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5960 * src/insets/form_graphics.C: ditto.
5962 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5964 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5966 * src/bufferparams.C (readLanguage): use the new language map
5968 * src/intl.C (InitKeyMapper): use the new language map
5970 * src/lyx_gui.C (create_forms): use the new language map
5972 * src/language.[Ch]: New files. Used for holding the information
5973 about each language. Now! Use this new language map enhance it and
5974 make it really usable for our needs.
5976 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5978 * screen.C (ShowCursor): Removed duplicate code.
5979 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5980 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5982 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5985 * src/text.C Added TransformChar method. Used for rendering Arabic
5986 text correctly (change the glyphs of the letter according to the
5987 position in the word)
5992 * src/lyxrc.C Added lyxrc command {language_command_begin,
5993 language_command_end,language_command_ltr,language_command_rtl,
5994 language_package} which allows the use of either arabtex or Omega
5997 * src/lyx_gui.C (init)
5999 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6000 to use encoding for menu fonts which is different than the encoding
6003 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6004 do not load the babel package.
6005 To write an English document with Hebrew/Arabic, change the document
6006 language to "english".
6008 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6009 (alphaCounter): changed to return char
6010 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6012 * lib/lyxrc.example Added examples for Hebrew/Arabic
6015 * src/layout.C Added layout command endlabeltype
6017 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6019 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6021 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6023 * src/mathed/math_delim.C (search_deco): return a
6024 math_deco_struct* instead of index.
6026 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6028 * All files with a USE_OSTREAM_ONLY within: removed all code that
6029 was unused when USE_OSTREAM_ONLY is defined.
6031 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6032 of any less. Removed header and using.
6034 * src/text.C (GetVisibleRow): draw the string "Page Break
6035 (top/bottom)" on screen when drawing a pagebreak line.
6037 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6039 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6041 * src/mathed/math_macro.C (draw): do some cast magic.
6044 * src/mathed/math_defs.h: change byte* argument to byte const*.
6046 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6048 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6049 know it is right to return InsetFoot* too, but cxx does not like
6052 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6054 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6056 * src/mathed/math_delim.C: change == to proper assignment.
6058 2000-03-09 Juergen Vigna <jug@sad.it>
6060 * src/insets/insettext.C (setPos): fixed various cursor positioning
6061 problems (via mouse and cursor-keys)
6062 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6063 inset (still a small display problem but it works ;)
6065 * src/insets/insetcollapsable.C (draw): added button_top_y and
6066 button_bottom_y to have correct values for clicking on the inset.
6068 * src/support/lyxalgo.h: commented out 'using std::less'
6070 2000-03-08 Juergen Vigna <jug@sad.it>
6072 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6073 Button-Release event closes as it is alos the Release-Event
6076 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6078 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6080 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6081 can add multiple spaces in Scrap (literate programming) styles...
6082 which, by the way, is how I got hooked on LyX to begin with.
6084 * src/mathed/formula.C (Write): Added dummy variable to an
6085 inset::Latex() call.
6086 (Latex): Add free_spacing boolean to inset::Latex()
6088 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6090 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6091 virtual function to include the free_spacing boolean from
6092 the containing paragraph's style.
6094 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6095 Added free_spacing boolean arg to match inset.h
6097 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6098 Added free_spacing boolean arg to match inset.h
6100 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6101 Added free_spacing boolean and made sure that if in a free_spacing
6102 paragraph, that we output normal space if there is a protected space.
6104 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6105 Added free_spacing boolean arg to match inset.h
6107 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6108 Added free_spacing boolean arg to match inset.h
6110 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6111 Added free_spacing boolean arg to match inset.h
6113 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6114 Added free_spacing boolean arg to match inset.h
6116 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6117 Added free_spacing boolean arg to match inset.h
6119 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6120 free_spacing boolean arg to match inset.h
6122 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6123 Added free_spacing boolean arg to match inset.h
6125 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6126 Added free_spacing boolean arg to match inset.h
6128 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6129 Added free_spacing boolean arg to match inset.h
6131 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6132 Added free_spacing boolean arg to match inset.h
6134 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6135 Added free_spacing boolean arg to match inset.h
6137 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6138 free_spacing boolean arg to match inset.h
6140 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6141 free_spacing boolean arg to match inset.h
6143 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6144 ignore free_spacing paragraphs. The user's spaces are left
6147 * src/text.C (InsertChar): Fixed the free_spacing layout
6148 attribute behavior. Now, if free_spacing is set, you can
6149 add multiple spaces in a paragraph with impunity (and they
6150 get output verbatim).
6151 (SelectSelectedWord): Added dummy argument to inset::Latex()
6154 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6157 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6158 paragraph layouts now only input a simple space instead.
6159 Special character insets don't make any sense in free-spacing
6162 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6163 hard-spaces in the *input* file to simple spaces if the layout
6164 is free-spacing. This converts old files which had to have
6165 hard-spaces in free-spacing layouts where a simple space was
6167 (writeFileAscii): Added free_spacing check to pass to the newly
6168 reworked inset::Latex(...) methods. The inset::Latex() code
6169 ensures that hard-spaces in free-spacing paragraphs get output
6170 as spaces (rather than "~").
6172 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6174 * src/mathed/math_delim.C (draw): draw the empty placeholder
6175 delims with a onoffdash line.
6176 (struct math_deco_compare): struct that holds the "functors" used
6177 for the sort and the binary search in math_deco_table.
6178 (class init_deco_table): class used for initial sort of the
6180 (search_deco): use lower_bound to do a binary search in the
6183 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6185 * src/lyxrc.C: a small secret thingie...
6187 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6188 and to not flush the stream as often as it used to.
6190 * src/support/lyxalgo.h: new file
6191 (sorted): template function used for checking if a sequence is
6192 sorted or not. Two versions with and without user supplied
6193 compare. Uses same compare as std::sort.
6195 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6196 it and give warning on lyxerr.
6198 (struct compare_tags): struct with function operators used for
6199 checking if sorted, sorting and lower_bound.
6200 (search_kw): use lower_bound instead of manually implemented
6203 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6205 * src/insets/insetcollapsable.h: fix Clone() declaration.
6206 * src/insets/insetfoot.h: ditto.
6208 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6210 2000-03-08 Juergen Vigna <jug@sad.it>
6212 * src/insets/lyxinset.h: added owner call which tells us if
6213 this inset is inside another inset. Changed also the return-type
6214 of Editable to an enum so it tells clearer what the return-value is.
6216 * src/insets/insettext.C (computeTextRows): fixed computing of
6217 textinsets which split automatically on more rows.
6219 * src/insets/insetert.[Ch]: changed this to be of BaseType
6222 * src/insets/insetfoot.[Ch]: added footnote inset
6224 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6225 collapsable insets (like footnote, ert, ...)
6227 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6229 * src/lyxdraw.h: remvoe file
6231 * src/lyxdraw.C: remove file
6233 * src/insets/insettext.C: added <algorithm>.
6235 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6237 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6238 (matrix_cb): case MM_OK use string stream
6240 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6243 * src/mathed/math_macro.C (draw): use string stream
6244 (Metrics): use string stream
6246 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6247 directly to the ostream.
6249 * src/vspace.C (asString): use string stream.
6250 (asString): use string stream
6251 (asLatexString): use string stream
6253 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6254 setting Spacing::Other.
6256 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6257 sprintf when creating the stretch vale.
6259 * src/text2.C (alphaCounter): changed to return a string and to
6260 not use a static variable internally. Also fixed a one-off bug.
6261 (SetCounter): changed the drawing of the labels to use string
6262 streams instead of sprintf.
6264 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6265 manipulator to use a scheme that does not require library support.
6266 This is also the way it is done in the new GNU libstdc++. Should
6267 work with DEC cxx now.
6269 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6271 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6272 end. This fixes a bug.
6274 * src/mathed (all files concerned with file writing): apply the
6275 USE_OSTREAM_ONLY changes to mathed too.
6277 * src/support/DebugStream.h: make the constructor explicit.
6279 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6280 count and ostream squashed.
6282 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6284 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6286 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6287 ostringstream uses STL strings, and we might not.
6289 * src/insets/insetspecialchar.C: add using directive.
6290 * src/insets/insettext.C: ditto.
6292 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6294 * lib/layouts/seminar.layout: feeble attempt at a layout for
6295 seminar.cls, far from completet and could really use some looking
6296 at from people used to write layout files.
6298 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6299 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6300 a lot nicer and works nicely with ostreams.
6302 * src/mathed/formula.C (draw): a slightly different solution that
6303 the one posted to the list, but I think this one works too. (font
6304 size wrong in headers.)
6306 * src/insets/insettext.C (computeTextRows): some fiddling on
6307 Jürgens turf, added some comments that he should read.
6309 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6310 used and it gave compiler warnings.
6311 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6314 * src/lyx_gui.C (create_forms): do the right thing when
6315 show_banner is true/false.
6317 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6318 show_banner is false.
6320 * most file writing files: Now use iostreams to do almost all of
6321 the writing. Also instead of passing string &, we now use
6322 stringstreams. mathed output is still not adapted to iostreams.
6323 This change can be turned off by commenting out all the occurences
6324 of the "#define USE_OSTREAM_ONLY 1" lines.
6326 * src/WorkArea.C (createPixmap): don't output debug messages.
6327 (WorkArea): don't output debug messages.
6329 * lib/lyxrc.example: added a comment about the new variable
6332 * development/Code_rules/Rules: Added some more commente about how
6333 to build class interfaces and on how better encapsulation can be
6336 2000-03-03 Juergen Vigna <jug@sad.it>
6338 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6339 automatically with the width of the LyX-Window
6341 * src/insets/insettext.C (computeTextRows): fixed update bug in
6342 displaying text-insets (scrollvalues where not initialized!)
6344 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6346 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6347 id in the check of the result from lower_bound is not enough since
6348 lower_bound can return last too, and then res->id will not be a
6351 * all insets and some code that use them: I have conditionalized
6352 removed the Latex(string & out, ...) this means that only the
6353 Latex(ostream &, ...) will be used. This is a work in progress to
6354 move towards using streams for all output of files.
6356 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6359 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6361 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6362 routine (this fixes bug where greek letters were surrounded by too
6365 * src/support/filetools.C (findtexfile): change a bit the search
6366 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6367 no longer passed to kpsewhich, we may have to change that later.
6369 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6370 warning options to avoid problems with X header files (from Angus
6372 * acinclude.m4: regenerated.
6374 2000-03-02 Juergen Vigna <jug@sad.it>
6376 * src/insets/insettext.C (WriteParagraphData): Using the
6377 par->writeFile() function for writing paragraph-data.
6378 (Read): Using buffer->parseSingleLyXformat2Token()-function
6379 for parsing paragraph data!
6381 * src/buffer.C (readLyXformat2): removed all parse data and using
6382 the new parseSingleLyXformat2Token()-function.
6383 (parseSingleLyXformat2Token): added this function to parse (read)
6384 lyx-file-format (this is called also from text-insets now!)
6386 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6388 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6391 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6392 directly instead of going through a func. One very bad thing: a
6393 static LyXFindReplace, but I don't know where to place it.
6395 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6396 string instead of char[]. Also changed to static.
6397 (GetSelectionOrWordAtCursor): changed to static inline
6398 (SetSelectionOverLenChars): ditto.
6400 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6401 current_view and global variables. both classes has changed names
6402 and LyXFindReplace is not inherited from SearchForm.
6404 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6405 fl_form_search form.
6407 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6409 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6411 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6412 bound (from Kayvan).
6414 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6416 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6418 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6420 * some things that I should comment but the local pub says head to
6423 * comment out all code that belongs to the Roff code for Ascii
6424 export of tables. (this is unused)
6426 * src/LyXView.C: use correct type for global variable
6427 current_layout. (LyXTextClass::size_type)
6429 * some code to get the new insetgraphics closer to working I'd be
6430 grateful for any help.
6432 * src/BufferView2.C (insertInset): use the return type of
6433 NumberOfLayout properly. (also changes in other files)
6435 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6436 this as a test. I want to know what breaks because of this.
6438 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6440 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6442 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6443 to use a \makebox in the label, this allows proper justification
6444 with out using protected spaces or multiple hfills. Now it is
6445 "label" for left justified, "\hfill label\hfill" for center, and
6446 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6447 should be changed accordingly.
6449 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6451 * src/lyxtext.h: change SetLayout() to take a
6452 LyXTextClass::size_type instead of a char (when there is more than
6453 127 layouts in a class); also change type of copylayouttype.
6454 * src/text2.C (SetLayout): ditto.
6455 * src/LyXView.C (updateLayoutChoice): ditto.
6457 * src/LaTeX.C (scanLogFile): errors where the line number was not
6458 given just after the '!'-line were ignored (from Dekel Tsur).
6460 * lib/lyxrc.example: fix description of \date_insert_format
6462 * lib/layouts/llncs.layout: new layout, contributed by Martin
6465 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6467 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6468 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6469 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6470 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6471 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6472 paragraph.C, text.C, text2.C)
6474 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6476 * src/insets/insettext.C (LocalDispatch): remove extra break
6479 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6480 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6482 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6483 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6485 * src/insets/insetbib.h: move InsetBibkey::Holder and
6486 InsetCitation::Holder in public space.
6488 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6490 * src/insets/insettext.h: small change to get the new files from
6491 Juergen to compile (use "string", not "class string").
6493 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6494 const & as parameter to LocalDispatch, use LyXFont const & as
6495 paramter to some other func. This also had impacto on lyxinsets.h
6496 and the two mathed insets.
6498 2000-02-24 Juergen Vigna <jug@sad.it>
6501 * src/commandtags.h:
6503 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6507 * src/BufferView2.C: added/updated code for various inset-functions
6509 * src/insets/insetert.[Ch]: added implementation of InsetERT
6511 * src/insets/insettext.[Ch]: added implementation of InsetText
6513 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6514 (draw): added preliminary code for inset scrolling not finshed yet
6516 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6517 as it is in lyxfunc.C now
6519 * src/insets/lyxinset.h: Added functions for text-insets
6521 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6523 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6524 BufferView and reimplement the list as a queue put inside its own
6527 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6529 * several files: use the new interface to the "updateinsetlist"
6531 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6533 (work_area_handler): call BufferView::trippleClick on trippleclick.
6535 * src/BufferView.C (doubleClick): new function, selects word on
6537 (trippleClick): new function, selects line on trippleclick.
6539 2000-02-22 Allan Rae <rae@lyx.org>
6541 * lib/bind/xemacs.bind: buffer-previous not supported
6543 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6545 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6548 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6550 * src/bufferlist.C: get rid of current_view from this file
6552 * src/spellchecker.C: get rid of current_view from this file
6554 * src/vspace.C: get rid of current_view from this file
6555 (inPixels): added BufferView parameter for this func
6556 (asLatexCommand): added a BufferParams for this func
6558 * src/text.C src/text2.C: get rid of current_view from these
6561 * src/lyxfont.C (getFontDirection): move this function here from
6564 * src/bufferparams.C (getDocumentDirection): move this function
6567 * src/paragraph.C (getParDirection): move this function here from
6569 (getLetterDirection): ditto
6571 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6573 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6574 resize due to wrong pixmap beeing used. Also took the opurtunity
6575 to make the LyXScreen stateless on regard to WorkArea and some
6576 general cleanup in the same files.
6578 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6580 * src/Makefile.am: add missing direction.h
6582 * src/PainterBase.h: made the width functions const.
6584 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6587 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6589 * src/insets/insetlatexaccent.C (draw): make the accents draw
6590 better, at present this will only work well with iso8859-1.
6592 * several files: remove the old drawing code, now we use the new
6595 * several files: remove support for mono_video, reverse_video and
6598 2000-02-17 Juergen Vigna <jug@sad.it>
6600 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6601 int ** as we have to return the pointer, otherwise we have only
6602 NULL pointers in the returning function.
6604 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6606 * src/LaTeX.C (operator()): quote file name when running latex.
6608 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6610 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6611 (bubble tip), this removes our special handling of this.
6613 * Remove all code that is unused now that we have the new
6614 workarea. (Code that are not active when NEW_WA is defined.)
6616 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6618 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6620 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6621 nonexisting layout; correctly redirect obsoleted layouts.
6623 * lib/lyxrc.example: document \view_dvi_paper_option
6625 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6628 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6629 (PreviewDVI): handle the view_dvi_paper_option variable.
6630 [Both from Roland Krause]
6632 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6634 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6635 char const *, int, LyXFont)
6636 (text(int, int, string, LyXFont)): ditto
6638 * src/text.C (InsertCharInTable): attempt to fix the double-space
6639 feature in tables too.
6640 (BackspaceInTable): ditto.
6641 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6643 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6645 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6647 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6648 newly found text in textcache to this.
6649 (buffer): set the owner of the text put into the textcache to 0
6651 * src/insets/figinset.C (draw): fixed the drawing of figures with
6654 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6655 drawing of mathframe, hfills, protected space, table lines. I have
6656 now no outstanding drawing problems with the new Painter code.
6658 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6660 * src/PainterBase.C (ellipse, circle): do not specify the default
6663 * src/LColor.h: add using directive.
6665 * src/Painter.[Ch]: change return type of methods from Painter& to
6666 PainterBase&. Add a using directive.
6668 * src/WorkArea.C: wrap xforms callbacks in C functions
6671 * lib/layouts/foils.layout: font fix and simplifications from Carl
6674 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6676 * a lot of files: The Painter, LColor and WorkArea from the old
6677 devel branch has been ported to lyx-devel. Some new files and a
6678 lot of #ifdeffed code. The new workarea is enabled by default, but
6679 if you want to test the new Painter and LColor you have to compile
6680 with USE_PAINTER defined (do this in config.h f.ex.) There are
6681 still some rought edges, and I'd like some help to clear those
6682 out. It looks stable (loads and displays the Userguide very well).
6685 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6687 * src/buffer.C (pop_tag): revert to the previous implementation
6688 (use a global variable for both loops).
6690 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6692 * src/lyxrc.C (LyXRC): change slightly default date format.
6694 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6695 there is an English text with a footnote that starts with a Hebrew
6696 paragraph, or vice versa.
6697 (TeXFootnote): ditto.
6699 * src/text.C (LeftMargin): allow for negative values for
6700 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6703 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6704 for input encoding (cyrillic)
6706 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6708 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6711 * src/toolbar.C (set): ditto
6712 * src/insets/insetbib.C (create_form_citation_form): ditto
6714 * lib/CREDITS: added Dekel Tsur.
6716 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6717 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6718 hebrew supports files from Dekel Tsur.
6720 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6721 <tzafrir@technion.ac.il>
6723 * src/lyxrc.C: put \date_insert_format at the right place.
6725 * src/buffer.C (makeLaTeXFile): fix the handling of
6726 BufferParams::sides when writing out latex files.
6728 * src/BufferView2.C: add a "using" directive.
6730 * src/support/lyxsum.C (sum): when we use lyxstring,
6731 ostringstream::str needs an additional .c_str().
6733 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6735 * src/support/filetools.C (ChangeExtension): patch from Etienne
6738 * src/TextCache.C (show): remove const_cast and make second
6739 parameter non-const LyXText *.
6741 * src/TextCache.h: use non const LyXText in show.
6743 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6746 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6748 * src/support/lyxsum.C: rework to be more flexible.
6750 * several places: don't check if a pointer is 0 if you are going
6753 * src/text.C: remove some dead code.
6755 * src/insets/figinset.C: remove some dead code
6757 * src/buffer.C: move the BufferView funcs to BufferView2.C
6758 remove all support for insetlatexdel
6759 remove support for oldpapersize stuff
6760 made some member funcs const
6762 * src/kbmap.C: use a std::list to store the bindings in.
6764 * src/BufferView2.C: new file
6766 * src/kbsequence.[Ch]: new files
6768 * src/LyXAction.C + others: remove all trace of buffer-previous
6770 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6771 only have one copy in the binary of this table.
6773 * hebrew patch: moved some functions from LyXText to more
6774 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6776 * several files: remove support for XForms older than 0.88
6778 remove some #if 0 #endif code
6780 * src/TextCache.[Ch]: new file. Holds the textcache.
6782 * src/BufferView.C: changes to use the new TextCache interface.
6783 (waitForX): remove the now unused code.
6785 * src/BackStack.h: remove some commented code
6787 * lib/bind/emacs.bind: remove binding for buffer-previous
6789 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6791 * applied the hebrew patch.
6793 * src/lyxrow.h: make sure that all Row variables are initialized.
6795 * src/text2.C (TextHandleUndo): comment out a delete, this might
6796 introduce a memory leak, but should also help us to not try to
6797 read freed memory. We need to look at this one.
6799 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6800 (LyXParagraph): initalize footnotekind.
6802 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6803 forgot this when applying the patch. Please heed the warnings.
6805 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6806 (aka. reformat problem)
6808 * src/bufferlist.C (exists): made const, and use const_iterator
6809 (isLoaded): new func.
6810 (release): use std::find to find the correct buffer.
6812 * src/bufferlist.h: made getState a const func.
6813 made empty a const func.
6814 made exists a const func.
6817 2000-02-01 Juergen Vigna <jug@sad.it>
6819 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6821 * po/it.po: updated a bit the italian po file and also changed the
6822 'file nuovo' for newfile to 'filenuovo' without a space, this did
6825 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6826 for the new insert_date command.
6828 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6829 from jdblair, to insert a date into the current text conforming to
6830 a strftime format (for now only considering the locale-set and not
6831 the document-language).
6833 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6835 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6836 Bounds Read error seen by purify. The problem was that islower is
6837 a macros which takes an unsigned char and uses it as an index for
6838 in array of characters properties (and is thus subject to the
6842 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6843 correctly the paper sides radio buttons.
6844 (UpdateDocumentButtons): ditto.
6846 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6848 * src/kbmap.C (getsym + others): change to return unsigned int,
6849 returning a long can give problems on 64 bit systems. (I assume
6850 that int is 32bit on 64bit systems)
6852 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6854 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6855 LyXLookupString to be zero-terminated. Really fixes problems seen
6858 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6860 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6861 write a (char*)0 to the lyxerr stream.
6863 * src/lastfiles.C: move algorithm before the using statemets.
6865 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6867 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6868 complains otherwise).
6869 * src/table.C: ditto
6871 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6874 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6875 that I removed earlier... It is really needed.
6877 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6879 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6881 * INSTALL: update xforms home page URL.
6883 * lib/configure.m4: fix a bug with unreadable layout files.
6885 * src/table.C (calculate_width_of_column): add "using std::max"
6888 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6890 * several files: marked several lines with "DEL LINE", this is
6891 lines that can be deleted without changing anything.
6892 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6893 checks this anyway */
6896 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6898 * src/DepTable.C (update): add a "+" at the end when the checksum
6899 is different. (debugging string only)
6901 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6902 the next inset to not be displayed. This should also fix the list
6903 of labels in the "Insert Crossreference" dialog.
6905 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6907 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6908 when regex was not found.
6910 * src/support/lstrings.C (lowercase): use handcoded transform always.
6913 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6914 old_cursor.par->prev could be 0.
6916 * several files: changed post inc/dec to pre inc/dec
6918 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6919 write the lastfiles to file.
6921 * src/BufferView.C (buffer): only show TextCache info when debugging
6923 (resizeCurrentBuffer): ditto
6924 (workAreaExpose): ditto
6926 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6928 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6930 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6931 a bit better by removing the special case for \i and \j.
6933 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6935 * src/lyx_main.C (easyParse): remove test for bad comand line
6936 options, since this broke all xforms-related parsing.
6938 * src/kbmap.C (getsym): set return type to unsigned long, as
6939 declared in header. On an alpha, long is _not_ the same as int.
6941 * src/support/LOstream.h: add a "using std::flush;"
6943 * src/insets/figinset.C: ditto.
6945 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6947 * src/bufferlist.C (write): use blinding fast file copy instead of
6948 "a char at a time", now we are doing it the C++ way.
6950 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6951 std::list<int> instead.
6952 (addpidwait): reflect move to std::list<int>
6953 (sigchldchecker): ditto
6955 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6958 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6959 that obviously was wrong...
6961 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6962 c, this avoids warnings with purify and islower.
6964 * src/insets/figinset.C: rename struct queue to struct
6965 queue_element and rewrite to use a std::queue. gsqueue is now a
6966 std::queue<queue_element>
6967 (runqueue): reflect move to std::queue
6970 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6971 we would get "1" "0" instead of "true" "false. Also make the tostr
6974 2000-01-21 Juergen Vigna <jug@sad.it>
6976 * src/buffer.C (writeFileAscii): Disabled code for special groff
6977 handling of tabulars till I fix this in table.C
6979 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6981 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6983 * src/support/lyxlib.h: ditto.
6985 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6987 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6988 and 'j' look better. This might fix the "macron" bug that has been
6991 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6992 functions as one template function. Delete the old versions.
6994 * src/support/lyxsum.C: move using std::ifstream inside
6997 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7000 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7002 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7004 * src/insets/figinset.C (InitFigures): use new instead of malloc
7005 to allocate memory for figures and bitmaps.
7006 (DoneFigures): use delete[] instead of free to deallocate memory
7007 for figures and bitmaps.
7008 (runqueue): use new to allocate
7009 (getfigdata): use new/delete[] instead of malloc/free
7010 (RegisterFigure): ditto
7012 * some files: moved some declarations closer to first use, small
7013 whitespace changes use preincrement instead of postincrement where
7014 it does not make a difference.
7016 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7017 step on the way to use stl::containers for key maps.
7019 * src/bufferlist.h: add a typedef for const_iterator and const
7020 versions of begin and end.
7022 * src/bufferlist.[Ch]: change name of member variable _state to
7023 state_. (avoid reserved names)
7025 (getFileNames): returns the filenames of the buffers in a vector.
7027 * configure.in (ALL_LINGUAS): added ro
7029 * src/support/putenv.C: new file
7031 * src/support/mkdir.C: new file
7033 2000-01-20 Allan Rae <rae@lyx.org>
7035 * lib/layouts/IEEEtran.layout: Added several theorem environments
7037 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7038 couple of minor additions.
7040 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7041 (except for those in footnotes of course)
7043 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7045 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7047 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7048 std::sort and std::lower_bound instead of qsort and handwritten
7050 (struct compara): struct that holds the functors used by std::sort
7051 and std::lower_bound in MathedLookupBOP.
7053 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7055 * src/support/LAssert.h: do not do partial specialization. We do
7058 * src/support/lyxlib.h: note that lyx::getUserName() and
7059 lyx::date() are not in use right now. Should these be suppressed?
7061 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7062 (makeLinuxDocFile): do not put date and user name in linuxdoc
7065 * src/support/lyxlib.h (kill): change first argument to long int,
7066 since that's what solaris uses.
7068 * src/support/kill.C (kill): fix declaration to match prototype.
7070 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7071 actually check whether namespaces are supported. This is not what
7074 * src/support/lyxsum.C: add a using directive.
7076 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7078 * src/support/kill.C: if we have namespace support we don't have
7079 to include lyxlib.h.
7081 * src/support/lyxlib.h: use namespace lyx if supported.
7083 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7085 * src/support/date.C: new file
7087 * src/support/chdir.C: new file
7089 * src/support/getUserName.C: new file
7091 * src/support/getcwd.C: new file
7093 * src/support/abort.C: new file
7095 * src/support/kill.C: new file
7097 * src/support/lyxlib.h: moved all the functions in this file
7098 insede struct lyx. Added also kill and abort to this struct. This
7099 is a way to avoid the "kill is not defined in <csignal>", we make
7100 C++ wrappers for functions that are not ANSI C or ANSI C++.
7102 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7103 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7104 lyx it has been renamed to sum.
7106 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7108 * src/text.C: add using directives for std::min and std::max.
7110 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7112 * src/texrow.C (getIdFromRow): actually return something useful in
7113 id and pos. Hopefully fixes the bug with positionning of errorbox
7116 * src/lyx_main.C (easyParse): output an error and exit if an
7117 incorrect command line option has been given.
7119 * src/spellchecker.C (ispell_check_word): document a memory leak.
7121 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7122 where a "struct utimbuf" is allocated with "new" and deleted with
7125 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7127 * src/text2.C (CutSelection): don't delete double spaces.
7128 (PasteSelection): ditto
7129 (CopySelection): ditto
7131 * src/text.C (Backspace): don't delete double spaces.
7133 * src/lyxlex.C (next): fix a bug that were only present with
7134 conformant std::istream::get to read comment lines, use
7135 std::istream::getline instead. This seems to fix the problem.
7137 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7139 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7140 allowed to insert space before space" editing problem. Please read
7141 commends at the beginning of the function. Comments about usage
7144 * src/text.C (InsertChar): fix for the "not allowed to insert
7145 space before space" editing problem.
7147 * src/text2.C (DeleteEmptyParagraphMechanism): when
7148 IsEmptyTableRow can only return false this last "else if" will
7149 always be a no-op. Commented out.
7151 * src/text.C (RedoParagraph): As far as I can understand tmp
7152 cursor is not really needed.
7154 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7155 present it could only return false anyway.
7156 (several functions): Did something not so smart...added a const
7157 specifier on a lot of methods.
7159 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7160 and add a tmp->text.resize. The LyXParagraph constructor does the
7162 (BreakParagraphConservative): ditto
7164 * src/support/path.h (Path): add a define so that the wrong usage
7165 "Path("/tmp") will be flagged as a compilation error:
7166 "`unnamed_Path' undeclared (first use this function)"
7168 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7170 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7171 which was bogus for several reasons.
7173 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7177 * autogen.sh: do not use "type -path" (what's that anyway?).
7179 * src/support/filetools.C (findtexfile): remove extraneous space
7180 which caused a kpsewhich warning (at least with kpathsea version
7183 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7185 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7187 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7189 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7191 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7193 * src/paragraph.C (BreakParagraph): do not reserve space on text
7194 if we don't need to (otherwise, if pos_end < pos, we end up
7195 reserving huge amounts of memory due to bad unsigned karma).
7196 (BreakParagraphConservative): ditto, although I have not seen
7197 evidence the bug can happen here.
7199 * src/lyxparagraph.h: add a using std::list.
7201 2000-01-11 Juergen Vigna <jug@sad.it>
7203 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7206 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7208 * src/vc-backend.C (doVCCommand): change to be static and take one
7209 more parameter: the path to chdir too be fore executing the command.
7210 (retrive): new function equiv to "co -r"
7212 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7213 file_not_found_hook is true.
7215 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7217 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7218 if a file is readwrite,readonly...anything else.
7220 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7222 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7223 (CreatePostscript): name change from MenuRunDVIPS (or something)
7224 (PreviewPostscript): name change from MenuPreviewPS
7225 (PreviewDVI): name change from MenuPreviewDVI
7227 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7228 \view_pdf_command., \pdf_to_ps_command
7230 * lib/configure.m4: added search for PDF viewer, and search for
7231 PDF to PS converter.
7232 (lyxrc.defaults output): add \pdflatex_command,
7233 \view_pdf_command and \pdf_to_ps_command.
7235 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7237 * src/bufferlist.C (write): we don't use blocksize for anything so
7240 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7242 * src/support/block.h: disable operator T* (), since it causes
7243 problems with both compilers I tried. See comments in the file.
7245 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7248 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7249 variable LYX_DIR_10x to LYX_DIR_11x.
7251 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7253 * INSTALL: document --with-lyxname.
7256 * configure.in: new configure flag --with-lyxname which allows to
7257 choose the name under which lyx is installed. Default is "lyx", of
7258 course. It used to be possible to do this with --program-suffix,
7259 but the later has in fact a different meaning for autoconf.
7261 * src/support/lstrings.h (lstrchr): reformat a bit.
7263 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7264 * src/mathed/math_defs.h: ditto.
7266 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7268 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7269 true, decides if we create a backup file or not when saving. New
7270 tag and variable \pdf_mode, defaults to false. New tag and
7271 variable \pdflatex_command, defaults to pdflatex. New tag and
7272 variable \view_pdf_command, defaults to xpdf. New tag and variable
7273 \pdf_to_ps_command, defaults to pdf2ps.
7275 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7277 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7278 does not have a BufferView.
7279 (unlockInset): ditto + don't access the_locking_inset if the
7280 buffer does not have a BufferView.
7282 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7283 certain circumstances so that we don't continue a keyboard
7284 operation long after the key was released. Try f.ex. to load a
7285 large document, press PageDown for some seconds and then release
7286 it. Before this change the document would contine to scroll for
7287 some time, with this change it stops imidiatly.
7289 * src/support/block.h: don't allocate more space than needed. As
7290 long as we don't try to write to the arr[x] in a array_type arr[x]
7291 it is perfectly ok. (if you write to it you might segfault).
7292 added operator value_type*() so that is possible to pass the array
7293 to functions expecting a C-pointer.
7295 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7298 * intl/*: updated to gettext 0.10.35, tried to add our own
7299 required modifications. Please verify.
7301 * po/*: updated to gettext 0.10.35, tried to add our own required
7302 modifications. Please verify.
7304 * src/support/lstrings.C (tostr): go at fixing the problem with
7305 cxx and stringstream. When stringstream is used return
7306 oss.str().c_str() so that problems with lyxstring and basic_string
7307 are avoided. Note that the best solution would be for cxx to use
7308 basic_string all the way, but it is not conformant yet. (it seems)
7310 * src/lyx_cb.C + other files: moved several global functions to
7311 class BufferView, some have been moved to BufferView.[Ch] others
7312 are still located in lyx_cb.C. Code changes because of this. (part
7313 of "get rid of current_view project".)
7315 * src/buffer.C + other files: moved several Buffer functions to
7316 class BufferView, the functions are still present in buffer.C.
7317 Code changes because of this.
7319 * config/lcmessage.m4: updated to most recent. used when creating
7322 * config/progtest.m4: updated to most recent. used when creating
7325 * config/gettext.m4: updated to most recent. applied patch for
7328 * config/gettext.m4.patch: new file that shows what changes we
7329 have done to the local copy of gettext.m4.
7331 * config/libtool.m4: new file, used in creation of acinclude.m4
7333 * config/lyxinclude.m4: new file, this is the lyx created m4
7334 macros, used in making acinclude.m4.
7336 * autogen.sh: GNU m4 discovered as a separate task not as part of
7337 the lib/configure creation.
7338 Generate acinlucde from files in config. Actually cat
7339 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7340 easier to upgrade .m4 files that really are external.
7342 * src/Spacing.h: moved using std::istringstream to right after
7343 <sstream>. This should fix the problem seen with some compilers.
7345 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7347 * src/lyx_cb.C: began some work to remove the dependency a lot of
7348 functions have on BufferView::text, even if not really needed.
7349 (GetCurrentTextClass): removed this func, it only hid the
7352 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7353 forgot this in last commit.
7355 * src/Bullet.C (bulletEntry): use static char const *[] for the
7356 tables, becuase of this the return arg had to change to string.
7358 (~Bullet): removed unneeded destructor
7360 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7361 (insetSleep): moved from Buffer
7362 (insetWakeup): moved from Buffer
7363 (insetUnlock): moved from Buffer
7365 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7366 from Buffer to BufferView.
7368 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7370 * config/ltmain.sh: updated to version 1.3.4 of libtool
7372 * config/ltconfig: updated to version 1.3.4 of libtool
7374 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7377 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7378 Did I get that right?
7380 * src/lyxlex.h: add a "using" directive or two.
7381 * src/Spacing.h: ditto.
7382 * src/insets/figinset.C: ditto.
7383 * src/support/filetools.C: ditto.
7384 * src/support/lstrings.C: ditto.
7385 * src/BufferView.C: ditto.
7386 * src/bufferlist.C: ditto.
7387 * src/lyx_cb.C: ditto.
7388 * src/lyxlex.C: ditto.
7390 * NEWS: add some changes for 1.1.4.
7392 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7394 * src/BufferView.C: first go at a TextCache to speed up switching
7397 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7399 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7400 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7401 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7402 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7405 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7406 members of the struct are correctly initialized to 0 (detected by
7408 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7409 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7411 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7412 pidwait, since it was allocated with "new". This was potentially
7413 very bad. Thanks to Michael Schmitt for running purify for us.
7416 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7418 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7420 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7422 1999-12-30 Allan Rae <rae@lyx.org>
7424 * lib/templates/IEEEtran.lyx: minor change
7426 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7427 src/mathed/formula.C (LocalDispatch): askForText changes
7429 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7430 know when a user has cancelled input. Fixes annoying problems with
7431 inserting labels and version control.
7433 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7435 * src/support/lstrings.C (tostr): rewritten to use strstream and
7438 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7440 * src/support/filetools.C (IsFileWriteable): use fstream to check
7441 (IsDirWriteable): use fileinfo to check
7443 * src/support/filetools.h (FilePtr): whole class deleted
7445 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7447 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7449 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7451 * src/bufferlist.C (write): use ifstream and ofstream instead of
7454 * src/Spacing.h: use istrstream instead of sscanf
7456 * src/mathed/math_defs.h: change first arg to istream from FILE*
7458 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7460 * src/mathed/math_parser.C: have yyis to be an istream
7461 (LexGetArg): use istream (yyis)
7463 (mathed_parse): ditto
7464 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7466 * src/mathed/formula.C (Read): rewritten to use istream
7468 * src/mathed/formulamacro.C (Read): rewritten to use istream
7470 * src/lyxlex.h (~LyXLex): deleted desturctor
7471 (getStream): new function, returns an istream
7472 (getFile): deleted funtion
7473 (IsOK): return is.good();
7475 * src/lyxlex.C (LyXLex): delete file and owns_file
7476 (setFile): open an filebuf and assign that to a istream instead of
7478 (setStream): new function, takes an istream as arg.
7479 (setFile): deleted function
7480 (EatLine): rewritten us use istream instead of FILE*
7484 * src/table.C (LyXTable): use istream instead of FILE*
7485 (Read): rewritten to take an istream instead of FILE*
7487 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7489 * src/buffer.C (Dispatch): remove an extraneous break statement.
7491 * src/support/filetools.C (QuoteName): change to do simple
7492 'quoting'. More work is necessary. Also changed to do nothing
7493 under emx (needs fix too).
7494 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7496 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7497 config.h.in to the AC_DEFINE_UNQUOTED() call.
7498 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7499 needs char * as argument (because Solaris 7 declares it like
7502 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7503 remove definition of BZERO.
7505 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7507 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7508 defined, "lyxregex.h" if not.
7510 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7512 (REGEX): new variable that is set to regex.c lyxregex.h when
7513 AM_CONDITIONAL USE_REGEX is set.
7514 (libsupport_la_SOURCES): add $(REGEX)
7516 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7519 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7522 * configure.in: add call to LYX_REGEX
7524 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7525 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7527 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7529 * lib/bind/fi_menus.bind: new file, from
7530 pauli.virtanen@saunalahti.fi.
7532 * src/buffer.C (getBibkeyList): pass the parameter delim to
7533 InsetInclude::getKeys and InsetBibtex::getKeys.
7535 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7536 is passed to Buffer::getBibkeyList
7538 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7539 instead of the hardcoded comma.
7541 * src/insets/insetbib.C (getKeys): make sure that there are not
7542 leading blanks in bibtex keys. Normal latex does not care, but
7543 harvard.sty seems to dislike blanks at the beginning of citation
7544 keys. In particular, the retturn value of the function is
7546 * INSTALL: make it clear that libstdc++ is needed and that gcc
7547 2.7.x probably does not work.
7549 * src/support/filetools.C (findtexfile): make debug message go to
7551 * src/insets/insetbib.C (getKeys): ditto
7553 * src/debug.C (showTags): make sure that the output is correctly
7556 * configure.in: add a comment for TWO_COLOR_ICON define.
7558 * acconfig.h: remove all the entries that already defined in
7559 configure.in or acinclude.m4.
7561 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7562 to avoid user name, date and copyright.
7564 1999-12-21 Juergen Vigna <jug@sad.it>
7566 * src/table.C (Read): Now read bogus row format informations
7567 if the format is < 5 so that afterwards the table can
7568 be read by lyx but without any format-info. Fixed the
7569 crash we experienced when not doing this.
7571 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7573 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7574 (RedoDrawingOfParagraph): ditto
7575 (RedoParagraphs): ditto
7576 (RemoveTableRow): ditto
7578 * src/text.C (Fill): rename arg paperwidth -> paper_width
7580 * src/buffer.C (insertLyXFile): rename var filename -> fname
7581 (writeFile): rename arg filename -> fname
7582 (writeFileAscii): ditto
7583 (makeLaTeXFile): ditto
7584 (makeLinuxDocFile): ditto
7585 (makeDocBookFile): ditto
7587 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7590 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7592 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7595 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7596 compiled by a C compiler not C++.
7598 * src/layout.h (LyXTextClass): added typedef for const_iterator
7599 (LyXTextClassList): added typedef for const_iterator + member
7600 functions begin and end.
7602 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7603 iterators to fill the choice_class.
7604 (updateLayoutChoice): rewritten to use iterators to fill the
7605 layoutlist in the toolbar.
7607 * src/BufferView.h (BufferView::work_area_width): removed unused
7610 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7612 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7613 (sgmlCloseTag): ditto
7615 * src/support/lstrings.h: return type of countChar changed to
7618 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7619 what version of this func to use. Also made to return unsigned int.
7621 * configure.in: call LYX_STD_COUNT
7623 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7624 conforming std::count.
7626 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7628 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7629 and a subscript would give bad display (patch from Dekel Tsur
7630 <dekel@math.tau.ac.il>).
7632 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7634 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7637 * src/chset.h: add a few 'using' directives
7639 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7640 triggered when no buffer is active
7642 * src/layout.C: removed `break' after `return' in switch(), since
7645 * src/lyx_main.C (init): make sure LyX can be ran in place even
7646 when libtool has done its magic with shared libraries. Fix the
7647 test for the case when the system directory has not been found.
7649 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7650 name for the latex file.
7651 (MenuMakeHTML): ditto
7653 * src/buffer.h: add an optional boolean argument, which is passed
7656 1999-12-20 Allan Rae <rae@lyx.org>
7658 * lib/templates/IEEEtran.lyx: small correction and update.
7660 * configure.in: Attempted to use LYX_PATH_HEADER
7662 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7664 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7665 input from JMarc. Now use preprocessor to find the header.
7666 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7667 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7668 LYX_STL_STRING_FWD. See comments in file.
7670 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7672 * The global MiniBuffer * minibuffer variable is dead.
7674 * The global FD_form_main * fd_form_main variable is dead.
7676 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7678 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7680 * src/table.h: add the LOstream.h header
7681 * src/debug.h: ditto
7683 * src/LyXAction.h: change the explaination of the ReadOnly
7684 attribute: is indicates that the function _can_ be used.
7686 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7689 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7691 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7697 * src/paragraph.C (GetWord): assert on pos>=0
7700 * src/support/lyxstring.C: condition the use of an invariant on
7702 * src/support/lyxstring.h: ditto
7704 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7705 Use LAssert.h instead of plain assert().
7707 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7709 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7710 * src/support/filetools.C: ditto
7712 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7715 * INSTALL: document the new configure flags
7717 * configure.in: suppress --with-debug; add --enable-assertions
7719 * acinclude.m4: various changes in alignment of help strings.
7721 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7723 * src/kbmap.C: commented out the use of the hash map in kb_map,
7724 beginning of movement to a stl::container.
7726 * several files: removed code that was not in effect when
7727 MOVE_TEXT was defined.
7729 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7730 for escaping should not be used. We can discuss if the string
7731 should be enclosed in f.ex. [] instead of "".
7733 * src/trans_mgr.C (insert): use the new returned value from
7734 encodeString to get deadkeys and keymaps done correctly.
7736 * src/chset.C (encodeString): changed to return a pair, to tell
7737 what to use if we know the string.
7739 * src/lyxscreen.h (fillArc): new function.
7741 * src/FontInfo.C (resize): rewritten to use more std::string like
7742 structore, especially string::replace.
7744 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7747 * configure.in (chmod +x some scripts): remove config/gcc-hack
7749 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7751 * src/buffer.C (writeFile): change once again the top comment in a
7752 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7753 instead of an hardcoded version number.
7754 (makeDocBookFile): ditto
7756 * src/version.h: add new define LYX_DOCVERSION
7758 * po/de.po: update from Pit Sütterlin
7759 * lib/bind/de_menus.bind: ditto.
7761 * src/lyxfunc.C (Dispatch): call MenuExport()
7762 * src/buffer.C (Dispatch): ditto
7764 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7765 LyXFunc::Dispatch().
7766 (MenuExport): new function, moved from
7767 LyXFunc::Dispatch().
7769 * src/trans_mgr.C (insert): small cleanup
7770 * src/chset.C (loadFile): ditto
7772 * lib/kbd/iso8859-1.cdef: add missing backslashes
7774 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7776 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7777 help with placing the manually drawn accents better.
7779 (Draw): x2 and hg changed to float to minimize rounding errors and
7780 help place the accents better.
7782 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7783 unsigned short to char is just wrong...cast the char to unsigned
7784 char instead so that the two values can compare sanely. This
7785 should also make the display of insetlatexaccents better and
7786 perhaps also some other insets.
7788 (lbearing): new function
7791 1999-12-15 Allan Rae <rae@lyx.org>
7793 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7794 header that provides a wrapper around the very annoying SGI STL header
7797 * src/support/lyxstring.C, src/LString.h:
7798 removed old SGI-STL-compatability attempts.
7800 * configure.in: Use LYX_STL_STRING_FWD.
7802 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7803 stl_string_fwd.h is around and try to determine it's location.
7804 Major improvement over previous SGI STL 3.2 compatability.
7805 Three small problems remain with this function due to my zero
7806 knowledge of autoconf. JMarc and lgb see the comments in the code.
7808 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7810 * src/broken_const.h, config/hack-gcc, config/README: removed
7812 * configure.in: remove --with-gcc-hack option; do not call
7815 * INSTALL: remove documentation of --with-broken-const and
7818 * acconfig.h: remove all trace of BROKEN_CONST define
7820 * src/buffer.C (makeDocBookFile): update version number in output
7822 (SimpleDocBookOnePar): fix an assert when trying to a character
7823 access beyond string length
7826 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7828 * po/de.po: fix the Export menu
7830 * lyx.man: update the description of -dbg
7832 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7833 (commandLineHelp): updated
7834 (easyParse): show list of available debug levels if -dbg is passed
7837 * src/Makefile.am: add debug.C
7839 * src/debug.h: moved some code to debug.C
7841 * src/debug.C: new file. Contains code to set and show debug
7844 * src/layout.C: remove 'break' after 'continue' in switch
7845 statements, since these cannot be reached.
7847 1999-12-13 Allan Rae <rae@lyx.org>
7849 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7850 (in_word_set): hash() -> math_hash()
7852 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7854 * acconfig.h: Added a test for whether we are using exceptions in the
7855 current compilation run. If so USING_EXCEPTIONS is defined.
7857 * config.in: Check for existance of stl_string_fwd.h
7858 * src/LString.h: If compiling --with-included-string and SGI's
7859 STL version 3.2 is present (see above test) we need to block their
7860 forward declaration of string and supply a __get_c_string().
7861 However, it turns out this is only necessary if compiling with
7862 exceptions enabled so I've a bit more to add yet.
7864 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7865 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7866 src/support/LRegex.h, src/undo.h:
7867 Shuffle the order of the included files a little to ensure that
7868 LString.h gets included before anything that includes stl_string_fwd.h
7870 * src/support/lyxstring.C: We need to #include LString.h instead of
7871 lyxstring.h to get the necessary definition of __get_c_string.
7872 (__get_c_string): New function. This is defined static just like SGI's
7873 although why they need to do this I'm not sure. Perhaps it should be
7874 in lstrings.C instead.
7876 * lib/templates/IEEEtran.lyx: New template file.
7878 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7880 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7881 * intl/Makefile.in (MKINSTALLDIRS): ditto
7883 * src/LyXAction.C (init): changed to hold the LFUN data in a
7884 automatic array in stead of in callso to newFunc, this speeds up
7885 compilation a lot. Also all the memory used by the array is
7886 returned when the init is completed.
7888 * a lot of files: compiled with -Wold-style-cast, changed most of
7889 the reported offenders to C++ style casts. Did not change the
7890 offenders in C files.
7892 * src/trans.h (Match): change argument type to unsigned int.
7894 * src/support/DebugStream.C: fix some types on the streambufs so
7895 that it works on a conforming implementation.
7897 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7899 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7901 * src/support/lyxstring.C: remove the inline added earlier since
7902 they cause a bunch of unsatisfied symbols when linking with dec
7903 cxx. Cxx likes to have the body of inlines at the place where they
7906 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7907 accessing negative bounds in array. This fixes the crash when
7908 inserting accented characters.
7909 * src/trans.h (Match): ditto
7911 * src/buffer.C (Dispatch): since this is a void, it should not try
7912 to return anything...
7914 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7916 * src/buffer.h: removed the two friends from Buffer. Some changes
7917 because of this. Buffer::getFileName and Buffer::setFileName
7918 renamed to Buffer::fileName() and Buffer::fileName(...).
7920 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7922 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7923 and Buffer::update(short) to BufferView. This move is currently
7924 controlled by a define MOVE_TEXT, this will be removed when all
7925 shows to be ok. This move paves the way for better separation
7926 between buffer contents and buffer view. One side effect is that
7927 the BufferView needs a rebreak when swiching buffers, if we want
7928 to avoid this we can add a cache that holds pointers to LyXText's
7929 that is not currently in use.
7931 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7934 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7936 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7938 * lyx_main.C: new command line option -x (or --execute) and
7939 -e (or --export). Now direct conversion from .lyx to .tex
7940 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7941 Unfortunately, X is still needed and the GUI pops up during the
7944 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7946 * src/Spacing.C: add a using directive to bring stream stuff into
7948 * src/paragraph.C: ditto
7949 * src/buffer.C: ditto
7951 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7952 from Lars' announcement).
7954 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7955 example files from Tino Meinen.
7957 1999-12-06 Allan Rae <rae@lyx.org>
7959 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7961 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7963 * src/support/lyxstring.C: added a lot of inline for no good
7966 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7967 latexWriteEndChanges, they were not used.
7969 * src/layout.h (operator<<): output operator for PageSides
7971 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7973 * some example files: loaded in LyX 1.0.4 and saved again to update
7974 certain constructs (table format)
7976 * a lot of files: did the change to use fstream/iostream for all
7977 writing of files. Done with a close look at Andre Poenitz's patch.
7979 * some files: whitespace changes.
7981 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7983 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7984 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7985 architecture, we provide our own. It is used unconditionnally, but
7986 I do not think this is a performance problem. Thanks to Angus
7987 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7988 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7990 (GetInset): use my_memcpy.
7994 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7995 it is easier to understand, but it uses less TeX-only constructs now.
7997 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7998 elements contain spaces
8000 * lib/configure: regenerated
8002 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8003 elements contain spaces; display the list of programs that are
8006 * autogen.sh: make sure lib/configure is executable
8008 * lib/examples/*: rename the tutorial examples to begin with the
8009 two-letters language code.
8011 * src/lyxfunc.C (getStatus): do not query current font if no
8014 * src/lyx_cb.C (RunScript): use QuoteName
8015 (MenuRunDvips): ditto
8016 (PrintApplyCB): ditto
8018 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8019 around argument, so that it works well with the current shell.
8020 Does not work properly with OS/2 shells currently.
8022 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8023 * src/LyXSendto.C (SendtoApplyCB): ditto
8024 * src/lyxfunc.C (Dispatch): ditto
8025 * src/buffer.C (runLaTeX): ditto
8026 (runLiterate): ditto
8027 (buildProgram): ditto
8029 * src/lyx_cb.C (RunScript): ditto
8030 (MenuMakeLaTeX): ditto
8032 * src/buffer.h (getLatexName): new method
8034 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8036 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8038 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8039 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8040 (create_math_panel): ditto
8042 * src/lyxfunc.C (getStatus): re-activate the code which gets
8043 current font and cursor; add test for export to html.
8045 * src/lyxrc.C (read): remove unreachable break statements; add a
8048 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8050 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8052 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8053 introduced by faulty regex.
8054 * src/buffer.C: ditto
8055 * src/lastfiles.C: ditto
8056 * src/paragraph.C: ditto
8057 * src/table.C: ditto
8058 * src/vspace.C: ditto
8059 * src/insets/figinset.C: ditto
8060 Note: most of these is absolutely harmless, except the one in
8061 src/mathed formula.C.
8063 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8065 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8066 operation, yielding correct results for the reLyX command.
8068 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8070 * src/support/filetools.C (ExpandPath): removed an over eager
8072 (ReplaceEnvironmentPath): ditto
8074 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8075 shows that we are doing something fishy in our code...
8079 * src/lyxrc.C (read): use a double switch trick to get more help
8080 from the compiler. (the same trick is used in layout.C)
8081 (write): new function. opens a ofstream and pass that to output
8082 (output): new function, takes a ostream and writes the lyxrc
8083 elemts to it. uses a dummy switch to make sure no elements are
8086 * src/lyxlex.h: added a struct pushpophelper for use in functions
8087 with more than one exit point.
8089 * src/lyxlex.[Ch] (GetInteger): made it const
8093 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8095 * src/layout.[hC] : LayoutTags splitted into several enums, new
8096 methods created, better error handling cleaner use of lyxlex. Read
8099 * src/bmtable.[Ch]: change some member prototypes because of the
8100 image const changes.
8102 * commandtags.h, src/LyXAction.C (init): new function:
8103 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8104 This file is not read automatically but you can add \input
8105 preferences to your lyxrc if you want to. We need to discuss how
8108 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8109 in .aux, also remove .bib and .bst files from dependencies when
8112 * src/BufferView.C, src/LyXView.C: add const_cast several places
8113 because of changes to images.
8115 * lib/images/*: same change as for images/*
8117 * lib/lyxrc.example: Default for accept_compound is false not no.
8119 * images/*: changed to be const, however I have som misgivings
8120 about this change so it might be changed back.
8122 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8124 * lib/configure, po/POTFILES.in: regenerated
8126 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8128 * config/lib_configure.m4: removed
8130 * lib/configure.m4: new file (was config/lib_configure.m4)
8132 * configure.in: do not test for rtti, since we do not use it.
8134 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8136 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8137 doubling of allocated space scheme. This makes it faster for large
8138 strings end to use less memory for small strings. xtra rememoved.
8140 * src/insets/figinset.C (waitalarm): commented out.
8141 (GhostscriptMsg): use static_cast
8142 (GhostscriptMsg): use new instead of malloc to allocate memory for
8143 cmap. also delete the memory after use.
8145 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8147 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8148 for changes in bibtex database or style.
8149 (runBibTeX): remove all .bib and .bst files from dep before we
8151 (run): use scanAuc in when dep file already exist.
8153 * src/DepTable.C (remove_files_with_extension): new method
8156 * src/DepTable.[Ch]: made many of the methods const.
8158 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8160 * src/bufferparams.C: make sure that the default textclass is
8161 "article". It used to be the first one by description order, but
8162 now the first one is "docbook".
8164 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8165 string; call Debug::value.
8166 (easyParse): pass complete argument to setDebuggingLevel().
8168 * src/debug.h (value): fix the code that parses debug levels.
8170 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8173 * src/LyXAction.C: use Debug::ACTION as debug channel.
8175 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8177 * NEWS: updated for the future 1.1.3 release.
8179 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8180 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8181 it should. This is of course a controversial change (since many
8182 people will find that their lyx workscreen is suddenly full of
8183 red), but done for the sake of correctness.
8185 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8186 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8188 * src/insets/inseterror.h, src/insets/inseturl.h,
8189 src/insets/insetinfo.h, src/insets/figinset.h,
8190 src/mathed/formulamacro.h, src/mathed/math_macro.h
8191 (EditMessage): add a missing const and add _() to make sure that
8194 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8195 src/insets/insetbib.C, src/support/filetools.C: add `using'
8198 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8199 doing 'Insert index of last word' at the beginning of a paragraph.
8201 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8203 * several files: white-space changes.
8205 * src/mathed/formula.C: removed IsAlpha and IsDigit
8207 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8208 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8211 * src/insets/figinset.C (GetPSSizes): don't break when
8212 "EndComments" is seen. But break when a boundingbox is read.
8214 * all classes inherited from Inset: return value of Clone
8215 changed back to Inset *.
8217 * all classes inherited form MathInset: return value of Clone
8218 changed back to MathedInset *.
8220 * src/insets/figinset.C (runqueue): use a ofstream to output the
8221 gs/ps file. Might need some setpresicion or setw. However I can
8222 see no problem with the current code.
8223 (runqueue): use sleep instead of the alarm/signal code. I just
8224 can't see the difference.
8226 * src/paragraph.C (LyXParagraph): reserve space in the new
8227 paragraph and resize the inserted paragraph to just fit.
8229 * src/lyxfunc.h (operator|=): added operator for func_status.
8231 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8232 check for readable file.
8234 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8235 check for readable file.
8236 (MenuMakeLinuxDoc): ditto
8237 (MenuMakeDocBook): ditto
8238 (MenuMakeAscii): ditto
8239 (InsertAsciiFile): split the test for openable and readable
8241 * src/bmtable.C (draw_bitmaptable): use
8242 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8244 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8245 findtexfile from LaTeX to filetools.
8247 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8248 instead of FilePtr. Needs to be verified by a literate user.
8250 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8252 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8253 (EditMessage): likewise.
8255 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8256 respectively as \textasciitilde and \textasciicircum.
8258 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8260 * src/support/lyxstring.h: made the methods that take iterators
8263 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8264 (regexMatch): made is use the real regex class.
8266 * src/support/Makefile.am: changed to use libtool
8268 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8270 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8272 (MathIsInset ++): changed several macros to be inline functions
8275 * src/mathed/Makefile.am: changed to use libtool
8277 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8279 * src/insets/inset* : Clone changed to const and return type is
8280 the true insettype not just Inset*.
8282 * src/insets/Makefile.am: changed to use libtool
8284 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8286 * src/undo.[Ch] : added empty() and changed some of the method
8289 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8291 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8292 setID use block<> for the bullets array, added const several places.
8294 * src/lyxfunc.C (getStatus): new function
8296 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8297 LyXAction, added const to several funtions.
8299 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8300 a std::map, and to store the dir items in a vector.
8302 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8305 * src/LyXView.[Ch] + other files : changed currentView to view.
8307 * src/LyXAction.[Ch] : ported from the old devel branch.
8309 * src/.cvsignore: added .libs and a.out
8311 * configure.in : changes to use libtool.
8313 * acinclude.m4 : inserted libtool.m4
8315 * .cvsignore: added libtool
8317 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8319 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8320 file name in insets and mathed directories (otherwise the
8321 dependency is not taken in account under cygwin).
8323 * src/text2.C (InsertString[AB]): make sure that we do not try to
8324 read characters past the string length.
8326 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8328 * lib/doc/LaTeXConfig.lyx.in,
8329 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8331 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8332 file saying who created them and when this heppened; this is
8333 useless and annoys tools like cvs.
8335 * lib/layouts/g-brief-{en,de}.layout,
8336 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8337 from Thomas Hartkens <thomas@hartkens.de>.
8339 * src/{insets,mathed}/Makefile.am: do not declare an empty
8340 LDFLAGS, so that it can be set at configure time (useful on Irix
8343 * lib/reLyX/configure.in: make sure that the prefix is set
8344 correctly in LYX_DIR.
8346 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8348 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8349 be used by 'command-sequence' this allows to bind a key to a
8350 sequence of LyX-commands
8351 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8353 * src/LyXAction.C: add "command-sequence"
8355 * src/LyXFunction.C: handling of "command-sequence"
8357 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8358 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8360 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8362 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8364 * src/buffer.C (writeFile): Do not output a comment giving user
8365 and date at the beginning of a .lyx file. This is useless and
8366 annoys cvs anyway; update version number to 1.1.
8368 * src/Makefile.am (LYX_DIR): add this definition, so that a
8369 default path is hardcoded in LyX.
8371 * configure.in: Use LYX_GNU_GETTEXT.
8373 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8374 AM_GNU_GETTEXT with a bug fixed.
8376 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8378 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8380 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8381 which is used to point to LyX data is now LYX_DIR_11x.
8383 * lyx.man: convert to a unix text file; small updates.
8385 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8387 * src/support/LSubstring.[Ch]: made the second arg of most of the
8388 constructors be a const reference.
8390 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8393 * src/support/lyxstring.[Ch] (swap): added missing member function
8394 and specialization of swap(str, str);
8396 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8398 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8399 trace of the old one.
8401 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8402 put the member definitions in undo.C.
8404 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8405 NEW_TEXT and have now only code that was included when this was
8408 * src/intl.C (LCombo): use static_cast
8410 (DispatchCallback): ditto
8412 * src/definitions.h: removed whole file
8414 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8416 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8417 parsing and stores in a std:map. a regex defines the file format.
8418 removed unneeded members.
8420 * src/bufferparams.h: added several enums from definitions.h here.
8421 Removed unsused destructor. Changed some types to use proper enum
8422 types. use block to have the temp_bullets and user_defined_bullets
8423 and to make the whole class assignable.
8425 * src/bufferparams.C (Copy): removed this functions, use a default
8428 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8431 * src/buffer.C (readLyXformat2): commend out all that have with
8432 oldpapersize to do. also comment out all that hve to do with
8433 insetlatex and insetlatexdel.
8434 (setOldPaperStuff): commented out
8436 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8438 * src/LyXAction.C: remove use of inset-latex-insert
8440 * src/mathed/math_panel.C (button_cb): use static_cast
8442 * src/insets/Makefile.am (insets_o_SOURCES): removed
8445 * src/support/lyxstring.C (helper): use the unsigned long
8446 specifier, UL, instead of a static_cast.
8448 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8450 * src/support/block.h: new file. to be used as a c-style array in
8451 classes, so that the class can be assignable.
8453 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8455 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8456 NULL, make sure to return an empty string (it is not possible to
8457 set a string to NULL).
8459 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8461 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8463 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8465 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8466 link line, so that Irix users (for example) can set it explicitely to
8469 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8470 it can be overidden at make time (static or dynamic link, for
8473 * src/vc-backend.C, src/LaTeXFeatures.h,
8474 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8475 statements to bring templates to global namespace.
8477 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8479 * src/support/lyxstring.C (operator[] const): make it standard
8482 * src/minibuffer.C (Init): changed to reflect that more
8483 information is given from the lyxvc and need not be provided here.
8485 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8487 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8489 * src/LyXView.C (UpdateTimerCB): use static_cast
8490 (KeyPressMask_raw_callback): ditto
8492 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8493 buffer_, a lot of changes because of this. currentBuffer() ->
8494 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8495 also changes to other files because of this.
8497 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8499 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8500 have no support for RCS and partial support for CVS, will be
8503 * src/insets/ several files: changes because of function name
8504 changes in Bufferview and LyXView.
8506 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8508 * src/support/LSubstring.[Ch]: new files. These implement a
8509 Substring that can be very convenient to use. i.e. is this
8511 string a = "Mary had a little sheep";
8512 Substring(a, "sheep") = "lamb";
8513 a is now "Mary has a little lamb".
8515 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8516 out patterns and subpatterns of strings. It is used by LSubstring
8517 and also by vc-backend.C
8519 * src/support/lyxstring.C: went over all the assertions used and
8520 tried to correct the wrong ones and flag which of them is required
8521 by the standard. some bugs found because of this. Also removed a
8522 couple of assertions.
8524 * src/support/Makefile.am (libsupport_a_SOURCES): added
8525 LSubstring.[Ch] and LRegex.[Ch]
8527 * src/support/FileInfo.h: have struct stat buf as an object and
8528 not a pointer to one, some changes because of this.
8530 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8531 information in layout when adding the layouts preamble to the
8534 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8537 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8538 because of bug in OS/2.
8540 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8542 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8543 \verbatim@font instead of \ttfamily, so that it can be redefined.
8545 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8546 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8547 src/layout.h, src/text2.C: add 'using' directive to bring the
8548 STL templates we need from the std:: namespace to the global one.
8549 Needed by DEC cxx in strict ansi mode.
8551 * src/support/LIstream.h,src/support/LOstream.h,
8552 src/support/lyxstring.h,src/table.h,
8553 src/lyxlookup.h: do not include <config.h> in header
8554 files. This should be done in the .C files only.
8556 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8560 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8562 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8563 from Kayvan to fix the tth invokation.
8565 * development/lyx.spec.in: updates from Kayvan to reflect the
8566 changes of file names.
8568 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8570 * src/text2.C (InsertStringB): use std::copy
8571 (InsertStringA): use std::copy
8573 * src/bufferlist.C: use a vector to store the buffers in. This is
8574 an internal change and should not affect any other thing.
8576 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8579 * src/text.C (Fill): fix potential bug, one off bug.
8581 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8583 * src/Makefile.am (lyx_main.o): add more files it depends on.
8585 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8587 * src/support/lyxstring.C: use size_t for the reference count,
8588 size, reserved memory and xtra.
8589 (internal_compare): new private member function. Now the compare
8590 functions should work for std::strings that have embedded '\0'
8592 (compare): all compare functions rewritten to use
8595 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8597 * src/support/lyxstring.C (compare): pass c_str()
8598 (compare): pass c_str
8599 (compare): pass c_str
8601 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8603 * src/support/DebugStream.C: <config.h> was not included correctly.
8605 * lib/configure: forgot to re-generate it :( I'll make this file
8606 auto generated soon.
8608 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8610 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8613 * src/support/lyxstring.C: some changes from length() to rep->sz.
8614 avoids a function call.
8616 * src/support/filetools.C (SpaceLess): yet another version of the
8617 algorithm...now per Jean-Marc's suggestions.
8619 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8621 * src/layout.C (less_textclass_desc): functor for use in sorting
8623 (LyXTextClass::Read): sort the textclasses after reading.
8625 * src/support/filetools.C (SpaceLess): new version of the
8626 SpaceLess functions. What problems does this one give? Please
8629 * images/banner_bw.xbm: made the arrays unsigned char *
8631 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8633 * src/support/lyxstring.C (find): remove bogus assertion in the
8634 two versions of find where this has not been done yet.
8636 * src/support/lyxlib.h: add missing int return type to
8639 * src/menus.C (ShowFileMenu): disable exporting to html if no
8640 html export command is present.
8642 * config/lib_configure.m4: add a test for an HTML converter. The
8643 programs checked for are, in this order: tth, latex2html and
8646 * lib/configure: generated from config/lib_configure.m4.
8648 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8649 html converter. The parameters are now passed through $$FName and
8650 $$OutName, instead of standard input/output.
8652 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8654 * lib/lyxrc.example: update description of \html_command.
8655 add "quotes" around \screen_font_xxx font setting examples to help
8656 people who use fonts with spaces in their names.
8658 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8660 * Distribution files: updates for v1.1.2
8662 * src/support/lyxstring.C (find): remove bogus assert and return
8663 npos for the same condition.
8665 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8667 * added patch for OS/2 from SMiyata.
8669 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8671 * src/text2.C (CutSelection): make space_wrapped a bool
8672 (CutSelection): dont declare int i until we have to.
8673 (alphaCounter): return a char const *.
8675 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8677 * src/support/syscall.C (Systemcalls::kill):
8678 src/support/filetools.C (PutEnv, PutEnvPath):
8679 src/lyx_cb.C (addNewlineAndDepth):
8680 src/FontInfo.C (FontInfo::resize): condition some #warning
8681 directives with WITH_WARNINGS.
8684 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8686 * src/layout.[Ch] + several files: access to class variables
8687 limited and made accessor functions instead a lot of code changed
8688 becuase of this. Also instead of returning pointers often a const
8689 reference is returned instead.
8691 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8693 * src/Makefile.am (dist-hook): added used to remove the CVS from
8694 cheaders upon creating a dist
8695 (EXTRA_DIST): added cheaders
8697 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8698 a character not as a small integer.
8700 * src/support/lyxstring.C (find): removed Assert and added i >=
8701 rep->sz to the first if.
8703 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8705 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8706 src/LyXView.C src/buffer.C src/bufferparams.C
8707 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8708 src/text2.C src/insets/insetinclude.C:
8709 lyxlayout renamed to textclasslist.
8711 * src/layout.C: some lyxerr changes.
8713 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8714 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8715 (LyXLayoutList): removed all traces of this class.
8716 (LyXTextClass::Read): rewrote LT_STYLE
8717 (LyXTextClass::hasLayout): new function
8718 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8719 both const and nonconst version.
8720 (LyXTextClass::delete_layout): new function.
8721 (LyXTextClassList::Style): bug fix. do the right thing if layout
8723 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8724 (LyXTextClassList::NameOfLayout): ditto
8725 (LyXTextClassList::Load): ditto
8727 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8729 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8731 * src/LyXAction.C (LookupFunc): added a workaround for sun
8732 compiler, on the other hand...we don't know if the current code
8733 compiles on sun at all...
8735 * src/support/filetools.C (CleanupPath): subst fix
8737 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8740 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8741 complained about this one?
8743 * src/insets/insetinclude.C (Latex): subst fix
8745 * src/insets/insetbib.C (getKeys): subst fix
8747 * src/LyXSendto.C (SendtoApplyCB): subst fix
8749 * src/lyx_main.C (init): subst fix
8751 * src/layout.C (Read): subst fix
8753 * src/lyx_sendfax_main.C (button_send): subst fix
8755 * src/buffer.C (RoffAsciiTable): subst fix
8757 * src/lyx_cb.C (MenuFax): subst fix
8758 (PrintApplyCB): subst fix
8760 1999-10-26 Juergen Vigna <jug@sad.it>
8762 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8764 (Read): Cleaned up this code so now we read only format vestion >= 5
8766 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8768 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8769 come nobody has complained about this one?
8771 * src/insets/insetinclude.C (Latex): subst fix
8773 * src/insets/insetbib.C (getKeys): subst fix
8775 * src/lyx_main.C (init): subst fix
8777 * src/layout.C (Read): subst fix
8779 * src/buffer.C (RoffAsciiTable): subst fix
8781 * src/lyx_cb.C (MenuFax): subst fix.
8783 * src/layout.[hC] + some other files: rewrote to use
8784 std::container to store textclasses and layouts in.
8785 Simplified, removed a lot of code. Make all classes
8786 assignable. Further simplifications and review of type
8787 use still to be one.
8789 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8790 lastfiles to create the lastfiles partr of the menu.
8792 * src/lastfiles.[Ch]: rewritten to use deque to store the
8793 lastfiles in. Uses fstream for reading and writing. Simplifies
8796 * src/support/syscall.C: remove explicit cast.
8798 * src/BufferView.C (CursorToggleCB): removed code snippets that
8800 use explicat C++ style casts instead of C style casts. also use
8801 u_vdata instea of passing pointers in longs.
8803 * src/PaperLayout.C: removed code snippets that were commented out.
8805 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8807 * src/lyx_main.C: removed code snippets that wer commented out.
8809 * src/paragraph.C: removed code snippets that were commented out.
8811 * src/lyxvc.C (logClose): use static_cast
8813 (viewLog): remove explicit cast to void*
8814 (showLog): removed old commented code
8816 * src/menus.C: use static_cast instead of C style casts. use
8817 u_vdata instead of u_ldata. remove explicit cast to (long) for
8818 pointers. Removed old code that was commented out.
8820 * src/insets/inset.C: removed old commented func
8822 * src/insets/insetref.C (InsetRef): removed old code that had been
8823 commented out for a long time.
8825 (escape): removed C style cast
8827 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8829 * src/insets/insetlatex.C (Draw): removed old commented code
8830 (Read): rewritten to use string
8832 * src/insets/insetlabel.C (escape): removed C style cast
8834 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8836 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8839 * src/insets/insetinclude.h: removed a couple of stupid bools
8841 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8842 (Clone): remove C style cast
8843 (getKeys): changed list to lst because of std::list
8845 * src/insets/inseterror.C (Draw): removed som old commented code.
8847 * src/insets/insetcommand.C (Draw): removed some old commented code.
8849 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8850 commented out forever.
8851 (bibitem_cb): use static_cast instead of C style cast
8852 use of vdata changed to u_vdata.
8854 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8856 (CloseUrlCB): use static_cast instead of C style cast.
8857 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8859 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8860 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8861 (CloseInfoCB): static_cast from ob->u_vdata instead.
8862 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8865 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8866 (C_InsetError_CloseErrorCB): forward the ob parameter
8867 (CloseErrorCB): static_cast from ob->u_vdata instead.
8869 * src/vspace.h: include LString.h since we use string in this class.
8871 * src/vspace.C (lyx_advance): changed name from advance because of
8872 nameclash with stl. And since we cannot use namespaces yet...I
8873 used a lyx_ prefix instead. Expect this to change when we begin
8876 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8878 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8879 and removed now defunct constructor and deconstructor.
8881 * src/BufferView.h: have backstack as a object not as a pointer.
8882 removed initialization from constructor. added include for BackStack
8884 * development/lyx.spec.in (%build): add CFLAGS also.
8886 * src/screen.C (drawFrame): removed another warning.
8888 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8890 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8891 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8892 README and ANNOUNCE a bit for the next release. More work is
8895 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8896 unbreakable if we are in freespacing mode (LyX-Code), but not in
8899 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8901 * src/BackStack.h: fixed initialization order in constructor
8903 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8905 * acinclude.m4 (VERSION): new rules for when a version is
8906 development, added also a variable for prerelease.
8907 (warnings): we set with_warnings=yes for prereleases
8908 (lyx_opt): prereleases compile with same optimization as development
8909 (CXXFLAGS): only use pedantic if we are a development version
8911 * src/BufferView.C (restorePosition): don't do anything if the
8914 * src/BackStack.h: added member empty, use this to test if there
8915 is anything to pop...
8917 1999-10-25 Juergen Vigna <jug@sad.it>
8920 * forms/layout_forms.fd +
8921 * forms/latexoptions.fd +
8922 * lyx.fd: changed for various form resize issues
8924 * src/mathed/math_panel.C +
8925 * src/insets/inseterror.C +
8926 * src/insets/insetinfo.C +
8927 * src/insets/inseturl.C +
8928 * src/insets/inseturl.h +
8931 * src/PaperLayout.C +
8932 * src/ParagraphExtra.C +
8933 * src/TableLayout.C +
8935 * src/layout_forms.C +
8942 * src/menus.C: fixed various resize issues. So now forms can be
8943 resized savely or not be resized at all.
8945 * forms/form_url.fd +
8946 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8949 * src/insets/Makefile.am: added files form_url.[Ch]
8951 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8953 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8954 (and presumably 6.2).
8956 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8957 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8958 remaining static member callbacks.
8960 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8963 * src/support/lyxstring.h: declare struct Srep as friend of
8964 lyxstring, since DEC cxx complains otherwise.
8966 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8968 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8970 * src/LaTeX.C (run): made run_bibtex also depend on files with
8972 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8973 are put into the dependency file.
8975 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8976 the code has shown itself to work
8977 (create_ispell_pipe): removed another warning, added a comment
8980 * src/minibuffer.C (ExecutingCB): removed code that has been
8981 commented out a long time
8983 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8984 out code + a warning.
8986 * src/support/lyxstring.h: comment out the three private
8987 operators, when compiling with string ansi conforming compilers
8990 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8992 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8993 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8996 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8999 * src/mathed/math_panel.C (create_math_panel): remove explicit
9002 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9005 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9006 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9007 to XCreatePixmapFromBitmapData
9008 (fl_set_bmtable_data): change the last argument to be unsigned
9010 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9011 and bh to be unsigned int, remove explicit casts in call to
9012 XReadBitmapFileData.
9014 * images/arrows.xbm: made the arrays unsigned char *
9015 * images/varsz.xbm: ditto
9016 * images/misc.xbm: ditto
9017 * images/greek.xbm: ditto
9018 * images/dots.xbm: ditto
9019 * images/brel.xbm: ditto
9020 * images/bop.xbm: ditto
9022 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9024 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9025 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9026 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9028 (LYX_CXX_CHEADERS): added <clocale> to the test.
9030 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9032 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9034 * src/support/lyxstring.C (append): fixed something that must be a
9035 bug, rep->assign was used instead of rep->append.
9037 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9040 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9041 lyx insert double chars. Fix spotted by Kayvan.
9043 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9045 * Fixed the tth support. I messed up with the Emacs patch apply feature
9046 and omitted the changes in lyxrc.C.
9048 1999-10-22 Juergen Vigna <jug@sad.it>
9050 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9052 * src/lyx_cb.C (MenuInsertRef) +
9053 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9054 the form cannot be resized under it limits (fixes a segfault)
9056 * src/lyx.C (create_form_form_ref) +
9057 * forms/lyx.fd: Changed Gravity on name input field so that it is
9060 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9062 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9063 <ostream> and <istream>.
9065 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9066 whether <fstream> provides the latest standard features, or if we
9067 have an oldstyle library (like in egcs).
9068 (LYX_CXX_STL_STRING): fix the test.
9070 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9071 code on MODERN_STL_STREAM.
9073 * src/support/lyxstring.h: use L{I,O}stream.h.
9075 * src/support/L{I,O}stream.h: new files, designed to setup
9076 correctly streams for our use
9077 - includes the right header depending on STL capabilities
9078 - puts std::ostream and std::endl (for LOStream.h) or
9079 std::istream (LIStream.h) in toplevel namespace.
9081 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9083 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9084 was a bib file that had been changed we ensure that bibtex is run.
9085 (runBibTeX): enhanced to extract the names of the bib files and
9086 getting their absolute path and enter them into the dep file.
9087 (findtexfile): static func that is used to look for tex-files,
9088 checks for absolute patchs and tries also with kpsewhich.
9089 Alternative ways of finding the correct files are wanted. Will
9091 (do_popen): function that runs a command using popen and returns
9092 the whole output of that command in a string. Should be moved to
9095 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9096 file with extension ext has changed.
9098 * src/insets/figinset.C: added ifdef guards around the fl_free
9099 code that jug commented out. Now it is commented out when
9100 compiling with XForms == 0.89.
9102 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9103 to lyxstring.C, and only keep a forward declaration in
9104 lyxstring.h. Simplifies the header file a bit and should help a
9105 bit on compile time too. Also changes to Srep will not mandate a
9106 recompile of code just using string.
9107 (~lyxstring): definition moved here since it uses srep.
9108 (size): definition moved here since it uses srep.
9110 * src/support/lyxstring.h: removed a couple of "inline" that should
9113 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9115 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9118 1999-10-21 Juergen Vigna <jug@sad.it>
9120 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9121 set to left if I just remove the width entry (or it is empty).
9123 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9124 paragraph when having dummy paragraphs.
9126 1999-10-20 Juergen Vigna <jug@sad.it>
9128 * src/insets/figinset.C: just commented some fl_free_form calls
9129 and added warnings so that this calls should be activated later
9130 again. This avoids for now a segfault, but we have a memory leak!
9132 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9133 'const char * argument' to 'string argument', this should
9134 fix some Asserts() in lyxstring.C.
9136 * src/lyxfunc.h: Removed the function argAsString(const char *)
9137 as it is not used anymore.
9139 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9141 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9144 * src/Literate.h: some funcs moved from public to private to make
9145 interface clearer. Unneeded args removed.
9147 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9149 (scanBuildLogFile): ditto
9151 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9152 normal TeX Error. Still room for improvement.
9154 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9156 * src/buffer.C (insertErrors): changes to make the error
9157 desctription show properly.
9159 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9162 * src/support/lyxstring.C (helper): changed to use
9163 sizeof(object->rep->ref).
9164 (operator>>): changed to use a pointer instead.
9166 * src/support/lyxstring.h: changed const reference & to value_type
9167 const & lets see if that helps.
9169 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9171 * Makefile.am (rpmdist): fixed to have non static package and
9174 * src/support/lyxstring.C: removed the compilation guards
9176 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9179 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9180 conditional compile of lyxstring.Ch
9182 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9183 stupid check, but it is a lot better than the bastring hack.
9184 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9186 * several files: changed string::erase into string::clear. Not
9189 * src/chset.C (encodeString): use a char temporary instead
9191 * src/table.C (TexEndOfCell): added tostr around
9192 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9193 (TexEndOfCell): ditto
9194 (TexEndOfCell): ditto
9195 (TexEndOfCell): ditto
9196 (DocBookEndOfCell): ditto
9197 (DocBookEndOfCell): ditto
9198 (DocBookEndOfCell): ditto
9199 (DocBookEndOfCell): ditto
9201 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9203 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9205 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9206 (MenuBuildProg): added tostr around ret
9207 (MenuRunChktex): added tostr around ret
9208 (DocumentApplyCB): added tostr around ret
9210 * src/chset.C (encodeString): added tostr around t->ic
9212 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9213 (makeLaTeXFile): added tostr around tocdepth
9214 (makeLaTeXFile): added tostr around ftcound - 1
9216 * src/insets/insetbib.C (setCounter): added tostr around counter.
9218 * src/support/lyxstring.h: added an operator+=(int) to catch more
9221 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9222 (lyxstring): We DON'T allow NULL pointers.
9224 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9226 * src/mathed/math_macro.C (MathMacroArgument::Write,
9227 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9228 when writing them out.
9230 * src/LString.C: remove, since it is not used anymore.
9232 * src/support/lyxstring.C: condition the content to
9233 USE_INCLUDED_STRING macro.
9235 * src/mathed/math_symbols.C, src/support/lstrings.C,
9236 src/support/lyxstring.C: add `using' directive to specify what
9237 we need in <algorithm>. I do not think that we need to
9238 conditionalize this, but any thought is appreciated.
9240 * many files: change all callback functions to "C" linkage
9241 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9242 strict_ansi. Those who were static are now global.
9243 The case of callbacks which are static class members is
9244 trickier, since we have to make C wrappers around them (see
9245 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9246 did not finish this yet, since it defeats the purpose of
9247 encapsulation, and I am not sure what the best route is.
9249 1999-10-19 Juergen Vigna <jug@sad.it>
9251 * src/support/lyxstring.C (lyxstring): we permit to have a null
9252 pointer as assignment value and just don't assign it.
9254 * src/vspace.C (nextToken): corrected this function substituting
9255 find_first(_not)_of with find_last_of.
9257 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9258 (TableOptCloseCB) (TableSpeCloseCB):
9259 inserted fl_set_focus call for problem with fl_hide_form() in
9262 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9264 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9267 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9269 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9270 LyXLex::next() and not eatline() to get its argument.
9272 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9274 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9275 instead, use fstreams for io of the depfile, removed unneeded
9276 functions and variables.
9278 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9279 vector instead, removed all functions and variables that is not in
9282 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9284 * src/buffer.C (insertErrors): use new interface to TeXError
9286 * Makefile.am (rpmdist): added a rpmdist target
9288 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9289 per Kayvan's instructions.
9291 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9293 * src/Makefile.am: add a definition for localedir, so that locales
9294 are found after installation (Kayvan)
9296 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9298 * development/.cvsignore: new file.
9300 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9302 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9303 C++ compiler provides wrappers for C headers and use our alternate
9306 * configure.in: use LYX_CXX_CHEADERS.
9308 * src/cheader/: new directory, populated with cname headers from
9309 libstdc++-2.8.1. They are a bit old, but probably good enough for
9310 what we want (support compilers who lack them).
9312 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9313 from includes. It turns out is was stupid.
9315 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9317 * lib/Makefile.am (install-data-local): forgot a ';'
9318 (install-data-local): forgot a '\'
9319 (libinstalldirs): needed after all. reintroduced.
9321 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9323 * configure.in (AC_OUTPUT): added lyx.spec
9325 * development/lyx.spec: removed file
9327 * development/lyx.spec.in: new file
9329 * po/*.po: merged with lyx.pot becuase of make distcheck
9331 * lib/Makefile.am (dist-hook): added dist-hook so that
9332 documentation files will be included when doing a make
9333 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9334 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9336 more: tried to make install do the right thing, exclude CVS dirs
9339 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9340 Path would fit in more nicely.
9342 * all files that used to use pathstack: uses now Path instead.
9343 This change was a lot easier than expected.
9345 * src/support/path.h: new file
9347 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9349 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9351 * src/support/lyxstring.C (getline): Default arg was given for
9354 * Configure.cmd: removed file
9356 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9358 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9359 streams classes and types, add the proper 'using' statements when
9360 MODERN_STL is defined.
9362 * src/debug.h: move the << operator definition after the inclusion
9365 * src/support/filetools.C: include "LAssert.h", which is needed
9368 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9371 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9372 include "debug.h" to define a proper ostream.
9374 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9376 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9377 method to the SystemCall class which can kill a process, but it's
9378 not fully implemented yet.
9380 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9382 * src/support/FileInfo.h: Better documentation
9384 * src/lyxfunc.C: Added support for buffer-export html
9386 * src/menus.C: Added Export->As HTML...
9388 * lib/bind/*.bind: Added short-cut for buffer-export html
9390 * src/lyxrc.*: Added support for new \tth_command
9392 * lib/lyxrc.example: Added stuff for new \tth_command
9394 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9396 * lib/Makefile.am (IMAGES): removed images/README
9397 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9398 installes in correct place. Check permisions is installed
9401 * src/LaTeX.C: some no-op changes moved declaration of some
9404 * src/LaTeX.h (LATEX_H): changed include guard name
9406 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9408 * lib/reLyX/Makefile.am: install noweb2lyx.
9410 * lib/Makefile.am: install configure.
9412 * lib/reLyX/configure.in: declare a config aux dir; set package
9413 name to lyx (not sure what the best solution is); generate noweb2lyx.
9415 * lib/layouts/egs.layout: fix the bibliography layout.
9417 1999-10-08 Jürgen Vigna <jug@sad.it>
9419 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9420 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9421 it returned without continuing to search the path.
9423 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9425 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9426 also fixes a bug. It is not allowed to do tricks with std::strings
9427 like: string a("hei"); &a[e]; this will not give what you
9428 think... Any reason for the complexity in this func?
9430 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9432 * Updated README and INSTALL a bit, mostly to check that my
9433 CVS rights are correctly set up.
9435 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9437 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9438 does not allow '\0' chars but lyxstring and std::string does.
9440 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9442 * autogen.sh (AUTOCONF): let the autogen script create the
9443 POTFILES.in file too. POTFILES.in should perhaps now not be
9444 included in the cvs module.
9446 * some more files changed to use C++ includes instead of C ones.
9448 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9450 (Reread): added tostr to nlink. buggy output otherwise.
9451 (Reread): added a string() around szMode when assigning to Buffer,
9452 without this I got a log of garbled info strings.
9454 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9457 * I have added several ostream & operator<<(ostream &, some_type)
9458 functions. This has been done to avoid casting and warnings when
9459 outputting enums to lyxerr. This as thus eliminated a lot of
9460 explicit casts and has made the code clearer. Among the enums
9461 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9462 mathed enums, some font enum the Debug::type enum.
9464 * src/support/lyxstring.h (clear): missing method. equivalent of
9467 * all files that contained "stderr": rewrote constructs that used
9468 stderr to use lyxerr instead. (except bmtable)
9470 * src/support/DebugStream.h (level): and the passed t with
9471 Debug::ANY to avoid spurious bits set.
9473 * src/debug.h (Debug::type value): made it accept strings of the
9476 * configure.in (Check for programs): Added a check for kpsewhich,
9477 the latex generation will use this later to better the dicovery of
9480 * src/BufferView.C (create_view): we don't need to cast this to
9481 (void*) that is done automatically.
9482 (WorkAreaButtonPress): removed some dead code.
9484 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9486 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9487 is not overwritten when translated (David Sua'rez de Lis).
9489 * lib/CREDITS: Added David Sua'rez de Lis
9491 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9493 * src/bufferparams.C (BufferParams): default input encoding is now
9496 * acinclude.m4 (cross_compiling): comment out macro
9497 LYX_GXX_STRENGTH_REDUCE.
9499 * acconfig.h: make sure that const is not defined (to empty) when
9500 we are compiling C++. Remove commented out code using SIZEOF_xx
9503 * configure.in : move the test for const and inline as late as
9504 possible so that these C tests do not interefere with C++ ones.
9505 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9506 has not been proven.
9508 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9510 * src/table.C (getDocBookAlign): remove bad default value for
9513 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9515 (ShowFileMenu2): ditto.
9517 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9520 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9522 * Most files: finished the change from the old error code to use
9523 DebugStream for all lyxerr debugging. Only minor changes remain
9524 (e.g. the setting of debug levels using strings instead of number)
9526 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9528 * src/layout.C (Add): Changed to use compare_no_case instead of
9531 * src/FontInfo.C: changed loop variable type too string::size_type.
9533 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9535 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9536 set ETAGS_ARGS to --c++
9538 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9540 * src/table.C (DocBookEndOfCell): commented out two unused variables
9542 * src/paragraph.C: commented out four unused variables.
9544 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9545 insed a if clause with type string::size_type.
9547 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9550 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9552 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9553 variable, also changed loop to go from 0 to lenght + 1, instead of
9554 -1 to length. This should be correct.
9556 * src/LaTeX.C (scanError): use string::size_type as loop variable
9559 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9560 (l.896) since y_tmp and row was not used anyway.
9562 * src/insets/insetref.C (escape): use string::size_type as loop
9565 * src/insets/insetquotes.C (Width): use string::size_type as loop
9567 (Draw): use string::size_type as loop variable type.
9569 * src/insets/insetlatexaccent.C (checkContents): use
9570 string::size_type as loop variable type.
9572 * src/insets/insetlabel.C (escape): use string::size_type as loop
9575 * src/insets/insetinfo.C: added an extern for current_view.
9577 * src/insets/insetcommand.C (scanCommand): use string::size_type
9578 as loop variable type.
9580 * most files: removed the RCS tags. With them we had to recompile
9581 a lot of files after a simple cvs commit. Also we have never used
9582 them for anything meaningful.
9584 * most files: tags-query-replace NULL 0. As adviced several plases
9585 we now use "0" instead of "NULL" in our code.
9587 * src/support/filetools.C (SpaceLess): use string::size_type as
9590 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9592 * src/paragraph.C: fixed up some more string stuff.
9594 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9596 * src/support/filetools.h: make modestr a std::string.
9598 * src/filetools.C (GetEnv): made ch really const.
9600 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9601 made code that used these use max/min from <algorithm> instead.
9603 * changed several c library include files to their equivalent c++
9604 library include files. All is not changed yet.
9606 * created a support subdir in src, put lyxstring and lstrings
9607 there + the extra files atexit, fileblock, strerror. Created
9608 Makefile.am. edited configure.in and src/Makefile.am to use this
9609 new subdir. More files moved to support.
9611 * imported som of the functions from repository lyx, filetools
9613 * ran tags-query-replace on LString -> string, corrected the bogus
9614 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9615 is still some errors in there. This is errors where too much or
9616 too litle get deleted from strings (string::erase, string::substr,
9617 string::replace), there can also be some off by one errors, or
9618 just plain wrong use of functions from lstrings. Viewing of quotes
9621 * LyX is now running fairly well with string, but there are
9622 certainly some bugs yet (see above) also string is quite different
9623 from LString among others in that it does not allow null pointers
9624 passed in and will abort if it gets any.
9626 * Added the revtex4 files I forgot when setting up the repository.
9628 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9630 * All over: Tried to clean everything up so that only the files
9631 that we really need are included in the cvs repository.
9632 * Switched to use automake.
9633 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9634 * Install has not been checked.
9636 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9638 * po/pt.po: Three errors:
9639 l.533 and l.538 format specification error
9640 l. 402 duplicate entry, I just deleted it.