1 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
3 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
4 (Buffer const &), not a (BufferParams const &) and so fix a crash
5 caused by using current_view before it had been initialised. Not
6 the best way to do this, but much easier than changing
7 Inset::Clone(Buffer const &) to Inset::Clone().
10 * src/tabular.C: changed call to CopyIntoMinibuffer().
12 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
14 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
16 * src/lyxfunc.C (getStatus): disable insertion of floats in a
19 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
21 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
22 changed filter for screen fonts input filter from int to float
24 * src/frontends/xforms/input_validators.c: removed.
25 * src/frontends/xforms/input_validators.C: new file. Can now call C++
26 functions from within the filter functions.
28 * src/frontends/xforms/input_validators.[Ch]
29 (fl_unsigned_float_filter): new filter function.
31 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
32 confused now! And if you think I'm going to do this in
33 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
35 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
37 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
39 * src/WorkArea.C (work_area_handler): don't handle button requests
40 if xbutton.button == 0
42 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
44 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
45 It creates a lot of interesting problems.
47 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
49 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
50 the menu exists in the current menubar before opening it.
52 * src/MenuBackend.C (hasSubmenu): new method.
54 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
55 action value by offsetting actions by a large constant (so that
56 bogs choice result will be less than this constant).
58 * lib/bind/fi_menus.bind: more cleanup to menus.
59 * lib/bind/sciword.bind: ditto.
60 * lib/bind/xemacs.bind: ditto.
61 * lib/bind/emacs.bind: ditto.
62 * lib/bind/pt_menus.bind: ditto.
63 * lib/bind/hu_menus.bind: ditto.
65 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
67 * INSTALL: update PROBLEMS section.
69 * src/lyxlookup.h: remove condition on xforms version, since we
70 should not include it if not appropriate.
72 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
74 * src/LColor.C: "latex text" -> "latex inset" (from
77 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
79 * src/frontends/kde/FormTabularCreate.C:
80 * src/frontends/kde/citationdlg.C:
81 * src/frontends/kde/copyrightdlg.C:
82 * src/frontends/kde/paradlg.C:
83 * src/frontends/kde/paraextradlg.C:
84 * src/frontends/kde/parageneraldlg.C:
85 * src/frontends/kde/printdlg.C:
86 * src/frontends/kde/refdlg.C:
87 * src/frontends/kde/tabcreatedlg.C:
88 * src/frontends/kde/tocdlg.C:
89 * src/frontends/kde/urldlg.C: add necessary headers
92 * src/frontends/kde/dlg/emptytable.C:
93 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
94 default parameters (from Angus Leeming)
96 * src/frontends/kde/dlg/moc/.cvsignore:
97 * src/frontends/kde/dlg/.cvsignore:
98 * src/frontends/kde/moc/.cvsignore: fix the library name
101 * src/frontends/kde/paradlg.C:
102 * src/frontends/kde/parageneraldlg.C:
103 * src/frontends/kde/dlg/para.dlg:
104 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
106 * src/frontends/kde/dlg/README: clarified qtarch version
108 * src/frontends/kde/dlg/Makefile.am: removed the
109 dlg rules as they created spontaneous rebuilds
110 (not a good idea as it requires qtarch)
112 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
114 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
115 fixlevel along with xforms version.
117 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
118 xforms version is strictly less than 0.89.5.
119 * src/lyx_gui.C (LyXGUI): ditto.
120 * src/LyXView.C (show): ditto.
122 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
124 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
125 movement in inset in RTL text.
126 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
127 (workAreaButtonRelease): Do not open a float when there is a selection.
129 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
131 * src/spellchecker.C (RunSpellChecker): Open all floats before
134 * src/text.C (InsertChar): Consider "," as a part of a number
135 (for LTR numbers in RTL text code).
136 (IsBoundary): Fixed (and simplified).
137 (InsertChar): Recalculate cursor boundary.
140 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
142 * src/spellchecker.C: fix figures with pspell enabled
144 * src/insets/figinset.C: workaround for gs hang xforms bug
146 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
148 * lib/bind/??_menus.bind: comment out the entries corresponding to
149 real menus. They should be eventually removed, but I'll let the
150 language maintainers do that.
152 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
154 * src/frontends/kde/parageneraldlg.C:
155 * src/frontends/kde/parageneraldlg.h: don't use
156 a derived class for SpaceAbove/Below
158 * src/frontends/kde/dlg/README: add some info
160 * src/frontends/kde/dlg/*: update data files, update
163 * src/frontends/kde/dlg/moc/Makefile.am: add
166 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
168 * configure.in: add new KDE Makefiles
169 * src/vspace.h: return GlueLength not a normal one
170 * src/support/lstrings.h:
171 * src/support/lstrings.C: add isStrUnsignedInt(),
174 * src/frontends/kde/*: big reorganisation, update
175 FormParagraph, add FormTabCreate
177 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
179 * lib/ui/default.ui: small grammatical change.
181 * src/frontends/xforms/xform_macros.h: removed.
183 * src/frontends/xforms/FormBase.C:
184 * src/frontends/xforms/FormPreferences.C:
185 * src/frontends/xforms/Makefile.am: changes associated with removing
186 xform_macros.h. Should make Lars' debugging a little easier.
188 * src/frontends/xforms/FormPreferences.C:
189 * src/frontends/xforms/FormPreferences.h:
190 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
191 longer use X11 color name database. HSV and RGB dials/sliders.
192 Please let this be the end of this!
194 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
196 * Several files: Allow compilation when the compiler doesn't
199 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
202 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
203 command line options.
205 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
207 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
208 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
211 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
213 * src/frontends/xforms/FormRef.C (updateBrowser):
214 * src/frontends/xforms/forms/form_ref.fd: try clicking on
215 different insets with the sort key active. Now apply this patch!
217 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
219 * src/frontends/xforms/FormPrint.C: set to valid()
220 when we update from the passed parameters.
222 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
224 * src/LColor.C (getFromGUIName): internationalise the comparison.
226 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
227 FormPreferences choice.
229 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
232 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
234 * src/lyxrc.C: more detail for the printer program config
237 * src/LColor.C: ert->latex text. LColor needs a big revamp
238 but will have to wait till after 1.1.6
240 * src/buffer.C: bring up a dialog if we load a document
241 with an un-installed text class, rather than just complain
244 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
246 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
247 the browser form for a combox in a tabbed folder. Bug fix courtesy of
248 Steve Lamont <spl@ncmir.ucsd.edu>.
250 * src/frontends/xforms/FormDocument.C (build):
251 * src/frontends/xforms/FormPreferences.C (Language::build):
252 pass tabfolders to Combox::add() in order to use this work around.
254 * src/frontends/xforms/FormCitation.C (connect): remove max size
256 (update): sort list of bibliography keys.
258 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
260 No max size limitation. Same popup for new and existing insets. Fixes
261 bugs reported by Rob Lahaye.
263 * src/frontends/xforms/FormCitation.C (c-tor):
264 * src/frontends/xforms/FormCopyright.C (c-tor):
265 * src/frontends/xforms/FormError.C (c-tor):
266 * src/frontends/xforms/FormGraphics.C (c-tor):
267 * src/frontends/xforms/FormIndex.C (c-tor):
268 * src/frontends/xforms/FormRef.C (c-tor):
269 * src/frontends/xforms/FormToc.C (c-tor):
270 * src/frontends/xforms/FormUrl.C (c-tor):
271 use correct policy for ButtonController.
273 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
275 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
278 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
280 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
281 Some resizing changes.
283 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
285 * configure.in: fix typo
287 * lib/languages: add ukraninian and change no to no_NO
289 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
291 * src/bufferview_funcs.C (FontSize): use setLyXSize
293 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
295 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
296 to check for systems where mkstemp() is available but not declared
297 in headers. The new autoconf macro lyx_CHECK_DECL can be used
298 to check for declarations in headers.
300 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
302 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
304 * forms/makefile: added bibforms.fd, include_form.fd.
305 Removed lyx_sendfax.fd.
307 * src/LaTeXLog.C (ShowLatexLog):
308 * src/LyXAction.C (init):
309 * src/bufferparams.C (readLanguage): altered messages as suggested by
312 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
315 * src/credits.C: made fd_form_credits non-static, so that it can be
316 redrawn should the xforms colors be re-mapped.
317 * src/spellchecker.C ditto fd_form_spell_options.
319 * src/filedlg.[Ch] (redraw):
320 * src/intl.[Ch] (redraw):
321 * src/lyxfr0.[Ch] (redraw):
322 * src/insets/figinset.[Ch] (redraw):
323 * src/insets/insetexternal.[Ch] (redraw):
324 new methods, connected to Dialogs::redrawGUI.
326 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
327 to be connected to Dialogs::redrawGUI.
329 * src/frontends/xforms/FormCitation.C (build):
330 * src/frontends/xforms/FormCopyright.C (build):
331 * src/frontends/xforms/FormError.C (build):
332 * src/frontends/xforms/FormGraphics.C (build):
333 * src/frontends/xforms/FormIndex.C (build):
334 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
335 * src/frontends/xforms/FormToc.C (build):
336 * src/frontends/xforms/FormUrl.C (build):
337 use the ButtonController correctly.
339 * src/frontends/xforms/FormCopyright.C (build):
340 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
341 the .fd file and into build().
343 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
345 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
347 * src/frontends/xforms/forms/form_citation.fd:
348 * src/frontends/xforms/forms/form_copyright.fd:
349 * src/frontends/xforms/forms/form_error.fd:
350 * src/frontends/xforms/forms/form_graphics.fd:
351 * src/frontends/xforms/forms/form_index.fd:
352 * src/frontends/xforms/forms/form_toc.fd:
353 * src/frontends/xforms/forms/form_url.fd:
354 renamed some of the objects. Named others explicitly for the first time.
355 Added Restore and Apply buttons where appropriate.
357 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
360 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
362 * src/version.h: try the pre2 again
364 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
366 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
368 * src/frontends/kde/FormParagraph.C: added using directive.
370 * src/frontends/kde/paradlg.C: added config.h and using directive.
372 * src/frontends/kde/paradlg.h: added std::qualifier.
374 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
376 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
378 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
380 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
382 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
384 * src/version.h: set back to 1.1.6cvs
386 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
388 * src/version.h: set to 1.1.6pre2
390 2000-11-20 Marko Vendelin <markov@ioc.ee>
392 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
394 * src/frontends/gnome/Makefile.am: updated list of XForms object files
396 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
398 * src/LColor.C (init):
399 * src/lyxrc.C (getDescription): changed some comments as suggested by
402 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
403 disconnect the redrawGUI signal in best-practice fashion.
405 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
406 long_opts_tab to reflect the change in name of this tabfolder, as
407 suggested by John Levon.
408 (connect, disconnect): new methods. Don't do much at present other than
409 ensuring that we can't resize the dialog. This just makes xforms go
411 (lots of methods in Colors): made void rather than bool. The idea is
412 to have an isOk() function that keeps track of whether any input is
413 genuinely invalid and should therefore block Save, Apply.
414 Easier to manipulate the counters rapidly.
415 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
416 compiler will like this code. Much cleaner way of doing things.
418 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
420 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
421 rather than simple counters, following suggestion by John Levon.
423 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
424 than engraved frame + text.
426 * src/frontends/xforms/forms/makefile: removed spurious command.
428 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
430 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
432 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
435 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
437 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
438 see what Lars has changed and what is just white space!
439 Now used X directly to ascertain the RGB color associated with the
441 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
443 Added some sort capability.
444 The X11 color name database input is only displayed if the database
445 isn't found in the standard place.
446 Got rid of struct compare_converter; it wasn't used.
447 Probably some other stuff that I've forgotten.
449 * src/frontends/xforms/FormPreferences.h: changed the names of some
450 methods in the Colors struct. Added a couple of structs to help sort
451 colors by name and by RGBColor.
453 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
454 functions into a new class RWInfo.
456 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
457 The dialog is now almost navigable using the keyboard. Unfortunately,
458 the cursor has to be inside a browser for it to be activated. There is
459 no visual feedback for the key shortcuts to the arrow keys (use
460 Alt-appropriate arrow key, Alt-x).
462 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
465 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
466 xform_helpers.[Ch]. See above.
468 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
470 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
472 * src/screen.C (setCursorColor): new method. Sets the color of the
474 (ShowManualCursor): call it.
475 Constify some local variables.
477 * src/LColor.[Ch] (LColor): add entry for cursor
478 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
481 2000-11-19 Juergen Vigna <jug@sad.it>
483 * src/insets/insettabular.C (draw): fixed text border redraw problem.
484 (calculate_dimensions_of_cells): try to boost up when inserting chars.
486 2000-11-15 Rob Lahaye <lahaye@postech.edu>
488 * lib/ui/default.ui: OptItem used for Fax entry
490 2000-11-17 Matej Cepl <cepl@bigfoot.com>
492 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
494 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
496 * src/vspace.C (nextToken): fix so it can handle length phrases like
497 "10mm+-20mm", "40inplus16mmminus10cm" etc.
499 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
501 * src/frontends/xforms/FormPreferences.C: constify several variables
502 (BrowserLyX): rewrite to not need the choice variable
503 (Modify): rewrite to not need the choide variable
504 (compare_converter): make operator const
506 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
507 correct the writing of \set_color
508 (getDescription): return a const string
510 * src/kbsequence.[Ch] (addkey): remove dead code
512 * src/Painter.C (text): remove some commented code
514 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
516 * src/ColorHandler.[Ch]: removed some header files from .h file.
517 Included LColor.h in .C file.
519 * src/LColor.[Ch]: made class copyable so that I could create a
520 system_lcolor instance.
522 * src/Painter.h: removed LColor.h.
524 * src/lyx_gui.C (create_forms): used AddName.
526 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
527 of user preferences/lyxrc file.
529 * src/lyxrc.C (output): output changes to lcolor.
531 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
533 Moved class xformColor to files xform_helpers.[Ch]. These files,
534 Color.[Ch], could now be moved into src if they would be useful to
537 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
538 Also moved FormPreferences::browseFile here as it can be used by any
539 xform dialog with a "Browse" button. FormGraphics is a perfect example.
541 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
542 ReadableFile): changed the FormPreferences methods a little and moved
543 them here as they'll be useful elsewhere also.
545 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
546 Removed some header files and used forward declarations instead.
548 Removed some methods as they'll be useful elsewhere (see above).
550 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
551 Can also now modify the LyX LColors. However, for reasons that I don't
552 yet understand, it appears that we can use
553 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
554 present. The problem appears to lie in ColorHandler, because I can
555 change the color using LColor.SetColor(). Similarly, when reading in a
556 preferences file with some set_color instances, I'll get a warning
557 like: Color sea green is undefined or may not be redefined
558 Bad lyxrc set_color for sea green
560 Once the buffer is loaded, however, I can happily change to this color.
562 Finally, it appears that I have to set the color of "inset frame"
563 explicitly, or it oscillates from "black" to "indian red" with each
566 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
568 * ANNOUNCE: corrected a spelling mistake.
570 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
573 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
575 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
577 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
580 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
581 match the requirements from the standard better. This is required
582 to work with gnu libstdc++-v3
584 * src/frontends/xforms/FormPreferences.C: add explict pair
585 arguments to browse calls. include support/lyxmanip.h remvoe
586 extern fmt. whitespace changes. reorder variables in
587 FormPreferences.h, to match initalizaton order.
589 * several files: constify more local variables.
591 * src/buffer.C: remove some commented functions.
593 * src/DepTable.C (remove_files_with_extension): temporary
594 work around for gcc 2.97
595 * src/filedlg.C (find): ditto
596 * src/Variables.C (set): ditto
597 * src/LyXAction.C (searchActionArg): ditto
598 (retrieveActionArg): ditto
600 * configure.in: check for mktemp too
602 * UPGRADING: prepare for 1.1.6
604 * Makefile.am (lgbtags): add backup tags for when etags are
605 different than usual.
607 * ANNOUNCE: prepare for 1.1.6
609 * src/support/tempname.C (make_tempfile): new function, wrapper
610 around mkstemp and mktemp. Only mkstemp has been tested.
613 2000-11-14 Rob Lahaye <lahaye@postech.edu>
615 * default.ui: capitalized some menu items to improve shortcuts.
617 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
619 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
621 * src/frontends/xforms/Dialogs.C: add "using" directive.
623 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
625 * src/filedlg.C (Select): highlight suggested file in browser, if
628 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
629 each tab folder is encapsulated in its own class.
630 The Language keymaps are now chosen using a text input and a
631 browser button, rather than a Combox.
632 All the browser buttons are now functional, although LyXFileDlg
633 still needs to be modified to make it straighhtforward to return a
634 directory if that is what is desired.
636 * src/frontends/xforms/forms/form_preferences.fd: use text input
637 and browse button to input the Language keymaps. Add a few
638 callbacks for the browse buttons.
640 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
642 * src/support/tempname.C (tempName): small changes to make it
643 safer. remove the '.' before XXXXXX
645 * src/support/filetools.C (TmpFileName): remove func
648 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
649 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
650 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
651 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
653 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
656 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
659 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
660 for bp (this fixes a reproducible hard crash)
662 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
665 * src/frontends/xforms/FormBase.h: make bp_ private
666 (FormBaseBI): remove default for bp
669 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
672 * src/frontends/xforms/Color.C (RGBColor): made several vars
673 const, changed initialization of j to allow it to be const
676 * several files: added const to local variables.
678 * src/lyx_cb.C: removed several function prototypes and moved them
682 (UpdateLayoutPreamble):
684 (MenuInsertLabel): add BufferView as arguemnt
685 (LayoutsCB): make tmp const
687 * src/layout_forms.h: regenerated
689 * src/debug.C: add Debug::FILES
690 (showLevel) (showTags): translate the desc
692 * src/debug.h: add FILES as debug target
694 * src/bufferlist.C: use current_view as an interim measure becuase
695 of added arguments to MenuWrite and MenuWriteAs
697 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
699 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
701 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
702 libstdc++ is compiled with.
704 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
706 * lib/layouts/docbook-book.layout
707 * lib/layouts/docbook.layout
708 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
709 those paragraphs are expresse as SGML comments <!-- -->.
711 * src/LaTeXFeatures.h
712 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
713 parameter, this allows to express all the include files as relative
714 paths to the master buffer. The verbatim insert works as the other
717 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
719 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
721 (MakeDocBookFile): top_element is always written. Some clean up, as
722 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
724 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
725 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
726 a reference is written instead of the name.
727 (Validate): use the relative path for the filename.
729 * src/insets/insetlabel.C (DocBook): write end tag, for XML
732 * src/support/filetools.h
733 * src/support/filetools.C (IsSGMLFilename): added.
736 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
738 * development/OS2/quick_fix.patch:
740 * README.OS2: quick update to the OS/2 port.
742 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
744 * src/converter.C: add "using" directive.
746 * src/frontends/xforms/FormPreferences.C: add "using" directive.
747 (compare_converter): add "int" as return type.
749 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
752 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
754 * src/lyx_gui.C (create_forms): map the xform colours, should a
755 mapping exist. Ie, call XformColor::read().
757 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
758 and struct HSV as HSVColor.
759 (XformColor::read, XformColor::write) : new methods that
760 input/output any changes to the cform GUI colors.
762 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
765 * src/frontends/xforms/FormPreferences.C Lots of little changes
766 associated with the changed name of the RGB and HSV structs. Can
767 now save changes to xforms GUI to file. Commented out
768 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
769 used currently anyway.
771 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
773 * src/converter.C: A lot of changes:
774 - It is no longer possible to choose between two or more ways to
775 export to some format (the new code uses only the shortest path).
776 However, it is still possible to choose between pdflatex/ps2pdf
777 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
778 - Added several methods that makes the FormPreferences code simpler.
779 - Changed the tokens $$FName and $$OutName to $$i and $$o.
781 * src/exporter.C (Export): lyxrc.use_pdf is set before
782 makeLaTeXFile is called. This works but not very nice.
784 * src/frontends/xforms/FormPreferences.C: The formats/converters
785 tabs are now fully functional.
787 * src/buffer.C (getTocList): Add numbers to the captions.
789 * lib/lyxrc.example: Removed fax section
791 * src/support/rename.C (rename): Delete the old file if lyx::copy
794 2000-11-13 Rob Lahaye <lahaye@postech.edu>
796 * lib/ui/default.ui: minor polishing.
798 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
800 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
803 * lib/Makefile.am (DOCINST): do not install everything in the
804 documentation directory.
806 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
808 * src/bufferlist.C (newFile): set the filename to the constructed
811 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
812 constructed "newfileXX.lyx" name to the dialog
814 * src/frontends/DialogBase.h: make update() non-abstract so
815 KDE doesn't need to implement two update methods for every form
817 * src/frontends/kde/Makefile.am: add missing xforms objects
820 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
822 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
824 * src/frontends/xforms/Color.[Ch]: new files, defining the color
825 structs RGB and HSV. May not be the best place for these files.
826 Perhaps move them into src ?
828 * src/frontends/xforms/Makefile.am: added new files.
830 * src/frontends/xforms/forms/form_preferences.fd:
831 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
832 replaced all instances of "colour" with "color"!
834 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
837 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
838 tab. Can now alter the colors of the xform's GUI on the fly. With
839 the aid of a single static Signal (see below), can "Apply" these
840 changes to all currently open dialogs. (Well, to all of the NEW
841 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
842 subsequently opened dialogs will, of course, also have the new
843 color scheme. Cannot yet save (or load) the choices to file, so
844 they are lost when exiting LyX.
846 * src/frontends/Dialogs.h:
847 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
848 Used to trigger a redraw of any dialogs connected to it because,
849 for example, the GUI colours have been re-mapped.
851 * src/frontends/xforms/FormBase.[Ch]:
852 * src/frontends/xforms/FormDocument.[Ch]:
853 * src/frontends/xforms/FormParagraph.[Ch]:
854 * src/frontends/xforms/FormPreferences.[Ch]:
855 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
856 method, to be connected to Dialogs::redrawGUI. Method must be
857 virtual, because dialogs with tabbed folders need to redraw the
858 forms of each tab folder.
860 * src/LyXView.C (d-tor):
861 * src/frontends/xforms/FormBase.C (d-tor): connected
862 Dialogs::redrawGUI signal to redraw().
864 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
865 removed Assert, because it is identical to that in FormBase.
867 2000-11-10 Rob Lahaye <lahaye@postech.edu>
869 * lib/ui/default.ui: minor polishing.
871 2000-11-10 Juergen Vigna <jug@sad.it>
873 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
874 (deleteLyXText): ditto
876 * src/insets/insettabular.C (InsetButtonPress): don't clear the
877 selection on mouse-button-3.
879 * src/insets/insettabular.h: new function clearSelection(), use this
880 functions inside insettabular.C.
882 * src/insets/insettabular.C (TabularFeatures): clear the selection
883 on remove_row/column.
885 * src/insets/inset.C (scroll): fixed some scroll stuff.
887 * src/insets/insettabular.C (draw): fixed another minor draw problem.
889 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
891 * lib/CREDITS: add Yves Bastide
893 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
895 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
896 check whether C library functions are in the global namespace.
898 * configure.in: calls it.
900 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
903 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
905 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
906 iterators to prevent crash.
908 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
910 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
912 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
913 shortcut for xforms CB to the preemptive or post-handler function.
915 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
916 removed the HIDDEN_TIMER as it's no longer used.
917 Various other small changes.
919 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
920 preemptive handler to obtain feedback, rather than the post-handler.
921 (ColoursLoadBrowser): find "black" and "white" based on RGB values
923 Formats tab is now complete. Converters tab is nearly so.
925 2000-11-09 Juergen Vigna <jug@sad.it>
927 * src/insets/insettext.C (~InsetText):
930 (SetParagraphData): set cache.second to 0 after deleting it!
931 (getLyXText): check if cache.second is not 0 if finding it.
933 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
935 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
936 lyxlex to parse the rgb.txt file.
939 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
940 replace the default '#' comment character.
942 * src/support/tempname.C: add "using" directive
943 * src/frontends/ButtonPolicies.C: ditto.
945 * src/support/filetools.C (DirList): add an explicit cast to avoid
946 a compile error (probably not the right fix)
948 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
950 * src/support/filetools.C (DirList): implement using system functions
952 * src/support/tempname.C: new file
954 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
956 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
958 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
961 * src/frontends/xforms/ButtonController.C: new file
963 * src/os2_defines.h: remove getcwd define
965 * src/lyxvc.C: include support/lyxlib.h
966 (showLog): use lyx::tempName
968 * src/lyx_cb.C: comment out includes that we don't need
969 (AutoSave): use lyx::tempName
971 * src/filedlg.C: include support/lyxlib.h
972 (Reread): use lyx::getcwd
974 * src/converter.C: include support/filetools.h
975 (add_options): change to static inline, make tail const
976 (Add): make old_viewer const
977 (GetAllFormats): make it a const method, use const_iterator
978 (enable): make static inline
979 (SplitFormat): make using_format const
981 * src/LaTeX.C (run): use lyx::getcwd
983 * configure.in: check for mkstemp as well
985 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
987 * src/converter.[Ch] (GetAllCommands): new method.
989 * src/support/filetools.[Ch] (DirList): new method.
991 * src/frontends/xforms/FormPreferences.C: started (just!) adding
992 functionality to the converters tab.
993 The formats tab is now nearly complete.
994 The kbmap choices in Languages tab now display the contents of
995 system_lyxdir/kbd/*.kmap in readable form.
997 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
998 Moved some variables into the class.
1000 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1001 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1002 colour of active folder to lighter grey instead. Any takers?
1003 (form_colours): added an "Apply" button.
1004 (form_converters): added a "Flags" input field.
1005 (form_formats): added a "Shortcut" input field. Note that we can't use
1006 names such as "input_shortcut" as this buggers up the sed script stuff.
1008 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1016 * src/lyx_sendfax_main.C:
1019 * src/spellchecker.C:
1020 * src/insets/figinset.C:
1021 * src/insets/insetbib.C:
1022 * src/insets/insetexternal.C:
1023 * src/insets/insetinclude.C:
1024 * src/insets/insetinfo.C:
1025 * src/mathed/math_panel.C:
1026 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1027 all "daughter" dialogs now have identical "feel".
1029 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1031 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1032 used (and was only used in one place prior to this patch. Incorrectly!)
1034 * src/frontends/xforms/FormDocument.C: changed some instances of
1035 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1036 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1037 for options_->input_float_placement. This fixes a bug reported by
1040 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1041 functionality into d-tor.
1043 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1044 input of numerals also.
1046 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1047 fl_set_form_atclose(). Can now close dialog from window manager,
1048 fixing a bug reported by Rob Lahaye.
1050 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1052 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1053 are no longer dark. Haven't yet worked out how to lighten the colour of
1054 the active tabfolder. Any ideas anybody?
1055 Adjusted Colours tab a little.
1056 Added Shortcut field to converters tab. Note that we can't create an
1057 fdesign label like "input_shortcut" as this buggers up the sed-script
1060 * src/frontends/xforms/FormPreferences.[Ch]:
1061 (feedback): fixed crash due to to ob=0.
1062 (LanguagesXXX): the kbmap choices now contain the files
1063 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1064 be replaced by an input with a file browse button, but since the browse
1065 buttons don'y yet work, this'll do for the moment.
1066 (FormatsXXX): think that this is now nearly fully functional.
1067 Some points/questions though:
1068 1. Does "Apply" remove formats if no longer present?
1069 2. I think that the browser should list the GUI names rather than the
1071 3. Must ensure that we can't delete Formats used by an existing
1074 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1075 if this is the best way to do this.
1077 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1079 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1081 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1082 for variable assignment.
1084 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1086 * src/lib/ui/default.ui: added sub/superscripts to menu as
1087 Insert->Special characters and cleaned-up the file a bit
1089 2000-11-07 Allan Rae <rae@lyx.org>
1091 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1092 ob isn't 0 before using it. See comments in function.
1094 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1096 * src/frontends/xforms/form_*.C: regenerated
1098 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1100 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1102 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1103 compiling with gcc-2.96
1105 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1107 * src/support/lyxstring.C: add a couple "using" directives.
1109 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1110 a .c_str() here too for good measure.
1111 * src/Spacing.C (set): ditto.
1112 * src/lyxfunc.C (Dispatch): ditto.
1114 * src/insets/insettabular.C (copySelection): change .str() to
1115 .str().c_str() to fix problems with lyxstring.
1116 * src/support/filetools.C (GetFileContents): ditto.
1117 * src/buffer.C (asciiParagraph): ditto.
1118 * src/paragraph.C (String): ditto.
1120 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1121 * lib/bind/sciword.bind: ditto.
1123 * src/LyXAction.C (init): remove "symbol-insert" function, which
1124 shared LFUN_INSERT_MATH with "math-insert".
1126 * lib/configure.m4: == is not a valid operator for command test.
1128 * src/lyxrc.C: add using directive.
1130 * src/converter.h: add std:: qualifier.
1132 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1134 * src/converter.[Ch] and other files: Change the Format class to a
1135 real class, and create two instances: formats and system_format.
1137 * src/lyxrc.C (output): Output the difference between formats and
1140 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1141 (buildFormats): Insert formats into browser.
1142 (inputFormats): Made the browser and add button functional.
1143 (applyFormats): Update formats from format_vec.
1145 * src/converter.C: Changed all (*it). to it->
1146 (Format::dummy): New method.
1147 (Format::importer): New format flag.
1148 (Formats::GetAllFormats): New method.
1149 (Formats::Add): Delete format from the map if prettyname is empty.
1150 (Converter::Convert): Print an error message if moving the file fails.
1151 (Converter::GetReachableTo): New method
1153 * src/MenuBackend.[Ch]: Add support for importformats tag.
1155 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1157 * lib/configure.m4: Add word->tex and ps->fax converters.
1159 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1160 Return fax to file menu.
1164 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1166 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1169 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1172 * src/lyxfunc.C (processKeyEvent): removed
1174 * src/bufferlist.C (emergencyWrite): removed the out commented
1175 emergency write code.
1177 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1179 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1181 * many files: change formatting to be a bit more uniform for
1182 if,while,for,switch statements, remove some parantesis not needed.
1185 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1187 * config/kde.m4: make config more robust when KDEDIR is set
1189 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1191 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1192 not returned a pixmap for "math-insert".
1194 * src/LyXAction.C (init): sort the entries a bit.
1196 2000-11-03 Juergen Vigna <jug@sad.it>
1198 * src/insets/insettabular.h: added fixed number to update codes so
1199 that update is only in one direction.
1201 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1204 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1205 before call to edit because of redraw.
1207 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1209 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1211 * lib/ui/default.ui: Populate "edit_float" menu
1213 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1215 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1216 "floats-operate". The name is ugly (and the func also), but this
1217 is just a band-aid until we switch to new insets.
1219 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1221 * lib/ui/default.ui: update again the menu layout (fix some
1224 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1226 * src/MenuBackend.h (fulllabel): new method.
1228 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1229 the menu shortcuts of a menu are unique and whether they
1230 correspond to a letter of the label.
1231 (expand): call checkShortcuts when debugging.
1233 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1235 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1237 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1239 * lib/examples/*.lyx : '\language default' => '\language english'
1241 * lib/examples/it_splash.lyx : except where it should be italian
1243 * lib/templates/*.lyx : the same
1245 * doc/*.lyx* : the same
1247 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1249 * lib/bind/menus.bind: remove the Layout menu entries, which I
1250 somehow forgot earlier.
1252 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1254 * lib/ui/old-default.ui: keep the old one here for reference (to
1257 * lib/ui/default.ui: update the menu layout
1259 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1261 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1262 Can now Apply to different insets without closing the dialog.
1264 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1265 Can't actually DO anything with them yet, but I'd like a little
1268 * src/frontends/xforms/input_validators.[ch]
1269 (fl_lowercase_filter): new.
1271 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1273 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1274 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1276 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1278 2000-11-02 Juergen Vigna <jug@sad.it>
1280 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1281 on char insertion as it has already be updated by bv->updateInset().
1283 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1284 if an inset inside was updated.
1286 * lib/configure.cmd: commented out fax-search code
1288 2000-11-01 Yves Bastide <stid@acm.org>
1290 * src/tabular.C (OldFormatRead): set tabular language to the
1293 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1295 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1296 class names with non-letter characters (from Yves Bastide).
1298 * lib/ui/default.ui: change Item to OptItem in import menu.
1299 Comment out fax stuff.
1301 * lib/configure.m4: comment out fax-related stuff.
1303 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1305 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1306 useful xforms helper functions. At present contains only formatted().
1307 Input a string and it returns it with line breaks so that in fits
1310 * src/frontends/xforms/Makefile.am: add new files.
1312 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1313 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1316 * src/frontends/xforms/FormPreferences.[Ch]:
1317 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1318 but lots of little clean ups. Removed enum State. Make use of
1319 formatted(). Constify lots of methods. Perhaps best of all: removed
1320 requirement for that horrible reinterpret_cast from pointer to long in
1323 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1325 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1326 conditionalize build on xforms < 0.89
1328 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1330 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1332 * src/LyXAction.C (init): comment out fax
1334 * src/lyxrc.h: comment out the fax enums
1335 comment out the fax variables
1337 * src/commandtags.h: comment out LFUN_FAX
1339 * src/lyxrc.C: disable fax variables.
1340 (read): disable parsing of fax variables
1341 (output): disable writing of fax variables
1342 (getFeedback): now description for fax variables
1344 * src/lyxfunc.C: comment out MenuFax
1345 (Dispatch): disable LFUN_FAX
1347 * src/lyx_cb.C (MenuFax): comment out
1349 * src/WorkArea.C: add <cctype>
1350 (work_area_handler): better key handling, should be ok now.
1351 for accented chars + etc
1353 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1354 lyx_sendfax.h and lyx_sendfax_man.C
1356 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1357 (show): don't call InitLyXLookup when using xforms 0.89
1359 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1361 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1363 * src/support/filetools.C (GetFileContents): close to dummy change
1365 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1367 * src/trans.C (AddDeadkey): workaround stupid compilers.
1369 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1371 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1372 of two-sided document.
1374 2000-10-31 Juergen Vigna <jug@sad.it>
1376 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1378 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1379 xposition to the Edit call.
1381 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1383 * src/trans.C (AddDeadkey): cast explicitly to char.
1385 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1387 * src/tabular.C (AsciiBottomHLine): simplify?
1388 (AsciiTopHLine): simplify?
1389 (print_n_chars): simplify
1390 (DocBook): remove most of the << endl; we should flush the stream
1391 as seldom as possible.
1393 (TeXBottomHLine): ditto
1394 (TeXTopHLine): ditto
1396 (write_attribute): try a templified version.
1397 (set_row_column_number_info): lesson scope of variables
1399 * src/support/lstrings.h (tostr): new specialization of tostr
1401 * src/trans.C (AddDeadkey): slightly cleaner fix.
1403 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1405 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1406 '%%' in Toc menu labels.
1409 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1410 font_norm is iso10646-1.
1412 * src/font.C (ascent): Fixed for 16bit fonts
1413 (descent,lbearing,rbearing): ditto
1415 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1417 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1418 (getFeedback): new static method.
1420 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1421 Now use combox rather than choice to display languages.
1422 Feedback is now output using a new timer callback mechanism, identical
1423 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1425 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1427 * src/minibuffer.C: fix for older compilers
1429 2000-10-30 Juergen Vigna <jug@sad.it>
1431 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1432 has to be Left of the inset otherwise LyXText won't find it!
1434 * src/BufferView2.C (open_new_inset): delete the inset if it can
1437 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1439 * lyx.man: fix typo.
1441 2000-10-29 Marko Vendelin <markov@ioc.ee>
1442 * src/frontends/gnome/FormCitation.C
1443 * src/frontends/gnome/FormCitation.h
1444 * src/frontends/gnome/FormCopyright.C
1445 * src/frontends/gnome/FormCopyright.h
1446 * src/frontends/gnome/FormError.C
1447 * src/frontends/gnome/FormError.h
1448 * src/frontends/gnome/FormIndex.C
1449 * src/frontends/gnome/FormIndex.h
1450 * src/frontends/gnome/FormPrint.C
1451 * src/frontends/gnome/FormPrint.h
1452 * src/frontends/gnome/FormRef.C
1453 * src/frontends/gnome/FormRef.h
1454 * src/frontends/gnome/FormToc.C
1455 * src/frontends/gnome/FormToc.h
1456 * src/frontends/gnome/FormUrl.C
1457 * src/frontends/gnome/FormUrl.h
1458 * src/frontends/gnome/Menubar_pimpl.C
1459 * src/frontends/gnome/mainapp.C
1460 * src/frontends/gnome/mainapp.h
1461 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1462 changing update() to updateSlot() where appropriate
1464 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1466 * src/frontends/xforms/FormPreferences.[Ch]:
1467 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1470 2000-10-28 Juergen Vigna <jug@sad.it>
1472 * src/insets/insettabular.C (draw): fixed drawing bug.
1474 * src/insets/insettext.C (clear):
1476 (SetParagraphData): clearing the TEXT buffers when deleting the
1477 paragraphs used by it.
1479 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1481 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1483 2000-10-27 Juergen Vigna <jug@sad.it>
1485 * src/tabular.C (~LyXTabular): removed not needed anymore.
1487 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1490 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1492 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1495 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1498 * src/frontends/xforms/FormPreferences.[Ch]:
1499 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1500 Reorganised as modules based on tabs. Much easier to follow the
1501 flow and to add new tabs. Added warning and feedback messages.
1504 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1506 * src/tabular.h (DocBook): add std:: qualifier.
1508 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1510 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1511 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1514 * insettabular.C (DocBook): uses the tabular methods to export
1517 * src/insets/insettext.h
1518 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1520 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1522 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1525 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1526 moved misplaced AllowInput two lines up.
1528 * src/buffer.C (readFile): compare float with float, not with int
1530 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1532 * src/minibuffer.C: add "using SigC::slot" statement.
1534 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1536 * src/frontends/xforms/forms/README: updated section about make.
1538 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1539 Tidied some forms up, made two of form_tabular's tabs more
1540 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1541 fixed translation problem with "Column".
1543 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1545 * src/minibuffer.h: use Timeout instead of the xforms timer
1547 (setTimer) rewrite for the Timeout, change to unsigned arg
1548 (set): change to unsigned timer arg
1551 * src/minibuffer.C (TimerCB): removed func
1552 (C_MiniBuffer_TimerCB): removed func
1553 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1554 (peek_event): use a switch statement
1555 (add): don't use fl_add_timer.
1556 (Set): rewrite to use the Timeout
1559 * src/Timeout.[Ch] (setType): return a Timeout &
1560 (setTimeout): ditto, change to unsigned arg for timeout
1562 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1564 * src/mathed/formula.C (mathed_string_width): Use string instead
1565 of a constant size char array.
1567 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1569 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1570 the two recently added operator<< for SMInput and State.
1572 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1574 (OkCancelPolicy): ditto
1575 (OkCancelReadOnlyPolicy): ditto
1576 (NoRepeatedApplyReadOnlyPolicy): ditto
1577 (OkApplyCancelReadOnlyPolicy): ditto
1578 (OkApplyCancelPolicy): ditto
1579 (NoRepeatedApplyPolicy): ditto
1581 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1583 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1584 add the usual std:: qualifiers.
1586 2000-10-25 Juergen Vigna <jug@sad.it>
1588 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1590 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1592 * src/support/filetools.C (MakeRelPath): change some types to
1595 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1596 ButtonPolicy::SMInput and ButtonPolicy::State.
1598 * src/FontLoader.C (reset): small cleanup
1599 (unload): small cleanup
1601 * src/FontInfo.C (getFontname): initialize error to 10000.0
1603 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1605 * src/frontends/xforms/FormPreferences.[Ch]:
1606 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1607 TeX encoding and default paper size sections.
1609 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1611 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1614 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1615 make the message_ empty.
1616 (FormError): don't initialize message_ in initializer list.
1618 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1620 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1622 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1624 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1626 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1628 * src/frontends/kde/*data.[Ch]: _("") is not
1631 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1633 * src/buffer.C: removed redundant using directive.
1635 * src/frontends/DialogBase.h: revert to original definition of
1638 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1639 stuff into two classes, one for each dialog, requires a new
1640 element in the dialogs vector, FormTabularCreate.
1642 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1645 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1646 method. Continues Allan's idea, but means that derived classes
1647 don't need to worry about "update or hide?".
1649 * src/frontends/xforms/FormError.C (showInset): add connection
1652 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1653 one for each dialog. FormTabular now contains main tabular dialog
1656 * src/frontends/xforms/FormTabularCreate.[Ch]:
1657 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1660 * src/frontends/xforms/FormGraphics.[Ch]:
1661 * src/frontends/xforms/forms/form_graphics.fd
1662 * src/frontends/xforms/FormTabular.[Ch]:
1663 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1664 classes of FormInset.
1666 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1667 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1669 * src/frontends/xforms/Makefile.am:
1670 * src/frontends/xforms/forms/makefile: added new files.
1672 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1673 variable. added Signal0 hide signal, in keeping with other GUI-I
1676 * src/support/lstrings.h: removed redundant std:: qualifier as
1677 it's already declared in Lsstream.h.
1679 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1681 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1685 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1687 * src/tabular.C (Ascii): minimize scope of cell.
1689 * src/BufferView2.C (nextWord): return string() instead of 0;
1691 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1693 * src/converter.h: add a std:: qualifier
1695 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1697 * src/importer.[Ch]: New files. Used for importing files into LyX.
1699 * src/lyxfunc.C (doImport): Use the new Importer class.
1701 * src/converter.h: Add shortcut member to the Format class.
1702 Used for holding the menu shortcut.
1704 * src/converter.C and other files: Made a distinction between
1705 format name and format extension. New formats can be defined using
1706 the \format lyxrc tag.
1707 Added two new converter flags: latex and disable.
1709 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1711 * src/support/lyxlib.h: unify namespace/struct implementation.
1712 Remove extra declarations.
1714 * src/support/chdir.C (chdir): remove version taking char const *
1716 * src/support/rename.C: ditto.
1717 * src/support/lyxsum.C: ditto.
1719 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1721 * src/frontends/xforms/FormBase.[Ch]:
1722 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1723 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1724 work only for the next call to fl_show_form(). The correct place to set
1725 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1726 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1727 from FormBase have the minimum size set; no more stupid crashes with
1730 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1732 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1734 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1736 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1738 * src/support/lyxlib.h: changed second argument of mkdir to
1739 unsigned long int (unsigned int would probably have been enough,
1740 but...). Removed <sys/types.h> header.
1741 * src/support/mkdir.C (mkdir): ditto.
1745 2000-10-19 Juergen Vigna <jug@sad.it>
1747 * src/lyxfunc.C (MenuNew): small fix (form John)
1749 * src/screen.C (Update): removed unneeded code.
1751 * src/tabular.C (Ascii): refixed int != uint bug!
1753 * src/support/lyxlib.h: added sys/types.h include for now permits
1754 compiling, but I don't like this!
1756 2000-10-18 Juergen Vigna <jug@sad.it>
1758 * src/text2.C (ClearSelection): if we clear the selection we need
1759 more refresh so set the status apropriately
1761 * src/insets/insettext.C (draw): hopefully finally fixed draw
1764 2000-10-12 Juergen Vigna <jug@sad.it>
1766 * src/insets/insettext.C (draw): another small fix and make a block
1767 so that variables are localized.
1769 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1771 * src/support/lstrings.C (lowercase, uppercase):
1772 use explicit casts to remove compiler warnings.
1774 * src/support/LRegex.C (Impl):
1775 * src/support/StrPool.C (add):
1776 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1777 (AddPath, MakeDisplayPath):
1778 * src/support/lstrings.C (prefixIs, subst):
1779 use correct type to remove compiler warnings.
1781 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1783 * src/support/lyxlib.h:
1784 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1785 portability and to remove compiler warning with DEC cxx.
1787 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1789 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1791 * src/minibuffer.C (peek_event): retun 1 when there has been a
1792 mouseclick in the minibuffer.
1796 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1798 * src/frontends/xforms/FormParagraph.C: more space above/below
1801 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1803 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1804 a char only if real_current_font was changed.
1806 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1808 * NEWS: update somewhat for 1.1.6
1810 * lib/ui/default.ui: clean up.
1812 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1814 * lib/CREDITS: clean up
1816 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1818 * src/combox.[Ch] (select): changed argument back to int
1819 * src/combox.C (peek_event): removed num_bytes as it is declared but
1822 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1823 modified calls to Combox::select() to remove warnings about type
1826 * src/insets/insetbutton.C (width): explicit cast to remove warning
1827 about type conversion.
1829 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1832 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1833 sel_pos_end, refering to cursor position are changed to
1834 LyXParagraph::size_type.
1836 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1837 consistent with LyXCursor::pos().
1838 (inset_pos): changed to LyXParagraph::size_type for same reason.
1840 * src/insets/insettext.C (resizeLyXText): changed some temporary
1841 variables refing to cursor position to LyXParagraph::size_type.
1843 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1845 * src/frontends/kde/<various>: The Great Renaming,
1848 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1850 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1852 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1854 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1855 0 when there are no arguments.
1857 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1859 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1860 to segfaults when pressing Ok in InsetBibtex dialog.
1862 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1864 * forms/layout_forms.fd:
1865 * src/layout_forms.C (create_form_form_character): small change to use
1866 labelframe rather than engraved frame + text
1868 * src/lyx_gui.C (create_forms): initialise choice_language with some
1869 arbitrary value to prevent segfault when dialog is shown.
1871 2000-10-16 Baruch Even <baruch.even@writeme.com>
1873 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1874 is no resulting file. This pertains only to LaTeX output.
1876 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1878 * src/text.C (Backspace): Make sure that the row of the cursor is
1881 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1884 * src/lyx_gui.C (init): Prevent a crash when only one font from
1885 menu/popup fonts is not found.
1887 * lib/lyxrc.example: Add an example for binding a key for language
1890 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1892 * src/converter.C (GetReachable): Changed the returned type to
1894 (IsReachable): New method
1896 * src/MenuBackend.C (expand): Handle formats that appear more
1899 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1901 * src/frontends/support/Makefile.am
1902 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1905 * lib/CREDITS: add Garst Reese.
1907 * src/support/snprintf.h: add extern "C" {} around the definitions.
1909 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1911 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1914 * src/frontends/xforms/FormDocument.C:
1915 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1916 compile without "conversion to integral type of smaller size"
1919 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1921 * src/text.C (GetColumnNearX): Fixed disabled code.
1923 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1925 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1928 * src/support/snprintf.[ch]: new files
1930 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1932 * src/frontends/kde/formprintdialog.C: add
1933 file browser for selecting postscript output
1935 * src/frontends/kde/formprintdialogdata.C:
1936 * src/frontends/kde/formprintdialogdata.h: re-generate
1939 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1941 * src/frontends/gnome/Makefile.am:
1942 * src/frontends/kde/Makefile.am: FormCommand.C
1943 disappeared from xforms
1945 * src/frontends/kde/FormCitation.C:
1946 * src/frontends/kde/FormIndex.C: read-only
1949 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1951 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1954 * src/bufferlist.C: add using directive.
1956 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1958 * src/support/lyxfunctional.h: version of class_fun for void
1959 returns added, const versions of back_inseter_fun and compare_fun
1962 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1964 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1966 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1968 * ChangeLog: cleanup.
1970 * lib/CREDITS: update to add all the contributors we've forgotten.
1971 I have obviously missed some, so tell me whether there were
1974 2000-10-13 Marko Vendelin <markov@ioc.ee>
1976 * src/frontends/gnome/FormCitation.C
1977 * src/frontends/gnome/FormCitation.h
1978 * src/frontends/gnome/FormError.C
1979 * src/frontends/gnome/FormIndex.C
1980 * src/frontends/gnome/FormRef.C
1981 * src/frontends/gnome/FormRef.h
1982 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1984 * src/frontends/gnome/FormCitation.C
1985 * src/frontends/gnome/FormCopyright.C
1986 * src/frontends/gnome/FormError.C
1987 * src/frontends/gnome/FormIndex.C
1988 * src/frontends/gnome/FormRef.C
1989 * src/frontends/gnome/FormToc.C
1990 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1993 * src/frontends/gnome/Menubar_pimpl.C
1994 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1997 2000-10-11 Baruch Even <baruch.even@writeme.com>
2000 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2001 to convey its real action.
2003 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2004 clear the minibuffer and prepare to enter a command.
2006 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2007 the rename from ExecCommand to PrepareForCommand.
2008 * src/lyxfunc.C (Dispatch): ditto.
2010 2000-10-11 Baruch Even <baruch.even@writeme.com>
2012 * src/buffer.C (writeFile): Added test for errors on writing, this
2013 catches all errors and not only file system full errors as intended.
2015 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2017 * src/lyx_gui.C (create_forms): better fix for crash with
2018 translated interface.
2020 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2022 * src/frontends/kde/Makefile.am:
2023 * src/frontends/kde/FormCopyright.C:
2024 * src/frontends/kde/formcopyrightdialog.C:
2025 * src/frontends/kde/formcopyrightdialog.h:
2026 * src/frontends/kde/formcopyrightdialogdata.C:
2027 * src/frontends/kde/formcopyrightdialogdata.h:
2028 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2029 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2030 copyright to use qtarch
2032 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2034 * src/encoding.C (read): Fixed bug that caused an error message at
2035 the end of the file.
2037 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2039 * lib/lyxrc.example: Fixed hebrew example.
2041 2000-10-13 Allan Rae <rae@lyx.org>
2043 * src/frontends/xforms/FormPreferences.C (input): reworking the
2045 (build, update, apply): New inputs in various tabfolders
2047 * src/frontends/xforms/FormToc.C: use new button policy.
2048 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2049 dialogs that either can't use any existing policy or where it just
2052 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2055 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2056 added a bool parameter which is ignored.
2058 * src/buffer.C (setReadonly):
2059 * src/BufferView_pimpl.C (buffer):
2060 * src/frontends/kde/FormCopyright.h (update):
2061 * src/frontends/kde/FormCitation.[Ch] (update):
2062 * src/frontends/kde/FormIndex.[Ch] (update):
2063 * src/frontends/kde/FormPrint.[Ch] (update):
2064 * src/frontends/kde/FormRef.[Ch] (update):
2065 * src/frontends/kde/FormToc.[Ch] (update):
2066 * src/frontends/kde/FormUrl.[Ch] (update):
2067 * src/frontends/gnome/FormCopyright.h (update):
2068 * src/frontends/gnome/FormCitation.[Ch] (update):
2069 * src/frontends/gnome/FormError.[Ch] (update):
2070 * src/frontends/gnome/FormIndex.[Ch] (update):
2071 * src/frontends/gnome/FormPrint.[Ch] (update):
2072 * src/frontends/gnome/FormRef.h (update):
2073 * src/frontends/gnome/FormToc.[Ch] (update):
2074 * src/frontends/gnome/FormUrl.[Ch] (update):
2075 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2076 to updateBufferDependent and DialogBase
2078 * src/frontends/xforms/FormCitation.[hC]:
2079 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2080 * src/frontends/xforms/FormError.[Ch]:
2081 * src/frontends/xforms/FormGraphics.[Ch]:
2082 * src/frontends/xforms/FormIndex.[Ch]:
2083 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2084 and fixed readOnly handling.
2085 * src/frontends/xforms/FormPrint.[Ch]:
2086 * src/frontends/xforms/FormRef.[Ch]:
2087 * src/frontends/xforms/FormTabular.[Ch]:
2088 * src/frontends/xforms/FormToc.[Ch]:
2089 * src/frontends/xforms/FormUrl.[Ch]:
2090 * src/frontends/xforms/FormInset.[Ch]:
2091 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2092 form of updateBufferDependent.
2094 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2095 if form()->visible just in case someone does stuff to the form in a
2098 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2099 the buttoncontroller for everything the enum used to be used for.
2100 (update) It would seem we need to force all dialogs to use a bool
2101 parameter or have two update functions. I chose to go with one.
2102 I did try removing update() from here and FormBase and defining the
2103 appropriate update signatures in FormBaseB[DI] but then ran into the
2104 problem of the update() call in FormBase::show(). Whatever I did
2105 to get around that would require another function and that just
2106 got more confusing. Hence the decision to make everyone have an
2107 update(bool). An alternative might have been to override show() in
2108 FormBaseB[DI] and that would allow the different and appropriate
2111 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2112 true == buffer change occurred. I decided against using a default
2113 template parameter since not all compilers support that at present.
2115 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2117 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2118 army knife" by removing functionality.
2119 (clearStore): removed. All such housekeeping on hide()ing the dialog
2120 is to be carried out by overloaded disconnect() methods.
2121 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2122 superceded by Baruch's neat test (FormGraphics) to update an existing
2123 dialog if a new signal is recieved rather than block all new signals
2125 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2126 only to Inset dialogs.
2127 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2128 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2130 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2132 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2133 as a base class to all inset dialogs. Used solely to connect/disconnect
2134 the Inset::hide signal and to define what action to take on receipt of
2135 a UpdateBufferDependent signal.
2136 (FormCommand): now derived from FormInset.
2138 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2141 * src/frontends/xforms/FormCopyright.[Ch]:
2142 * src/frontends/xforms/FormPreferences.[Ch]:
2143 now derived from FormBaseBI.
2145 * src/frontends/xforms/FormDocument.[Ch]:
2146 * src/frontends/xforms/FormParagraph.[Ch]:
2147 * src/frontends/xforms/FormPrint.[Ch]:
2148 now derived from FormBaseBD.
2150 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2152 * src/frontends/xforms/FormCitation.[Ch]:
2153 * src/frontends/xforms/FormError.[Ch]:
2154 * src/frontends/xforms/FormRef.[Ch]:
2155 * src/frontends/xforms/FormToc.[Ch]:
2156 (clearStore): reworked as disconnect().
2158 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2161 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2163 * src/converter.C (runLaTeX): constify buffer argument
2166 * src/frontends/support/Makefile.am (INCLUDES): fix.
2168 * src/buffer.h: add std:: qualifier
2169 * src/insets/figinset.C (addpidwait): ditto
2170 * src/MenuBackend.C: ditto
2171 * src/buffer.C: ditto
2172 * src/bufferlist.C: ditto
2173 * src/layout.C: ditto
2174 * src/lyxfunc.C: ditto
2176 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2178 * src/lyxtext.h (bidi_level): change return type to
2179 LyXParagraph::size_type.
2181 * src/lyxparagraph.h: change size_type to
2182 TextContainer::difference_type. This should really be
2183 TextContainer::size_type, but we need currently to support signed
2186 2000-10-11 Marko Vendelin <markov@ioc.ee>
2187 * src/frontends/gnome/FormError.h
2188 * src/frontends/gnome/FormRef.C
2189 * src/frontends/gnome/FormRef.h
2190 * src/frontends/gnome/FormError.C
2191 * src/frontends/gnome/Makefile.am
2192 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2193 to Gnome frontend. Both dialogs use "action" area.
2195 2000-10-12 Baruch Even <baruch.even@writeme.com>
2197 * src/graphics/GraphicsCacheItem_pimpl.C:
2198 * src/graphics/Renderer.C:
2199 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2202 2000-10-12 Juergen Vigna <jug@sad.it>
2204 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2205 visible when selecting).
2207 * development/Code_rules/Rules: fixed some typos.
2209 2000-10-09 Baruch Even <baruch.even@writeme.com>
2211 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2212 compiling on egcs 1.1.2 possible.
2214 * src/filedlg.C (comp_direntry::operator() ): ditto.
2216 2000-08-31 Baruch Even <baruch.even@writeme.com>
2218 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2221 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2222 transient it now only gets freed when the object is destructed.
2224 2000-08-24 Baruch Even <baruch.even@writeme.com>
2226 * src/frontends/FormGraphics.h:
2227 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2230 2000-08-20 Baruch Even <baruch.even@writeme.com>
2232 * src/insets/insetgraphics.C:
2233 (draw): Added messages to the drawn rectangle to report status.
2234 (updateInset): Disabled the use of the inline graphics,
2237 2000-08-17 Baruch Even <baruch.even@writeme.com>
2239 * src/frontends/support: Directory added for the support of GUII LyX.
2241 * src/frontends/support/LyXImage.h:
2242 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2245 * src/frontends/support/LyXImage_X.h:
2246 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2247 version of LyXImage, this uses the Xlib Pixmap.
2249 * src/PainterBase.h:
2250 * src/PainterBase.C:
2252 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2253 replacement to Pixmap.
2255 * src/insets/insetgraphics.h:
2256 * src/insets/insetgraphics.C:
2257 * src/graphics/GraphicsCacheItem.h:
2258 * src/graphics/GraphicsCacheItem.C:
2259 * src/graphics/GraphicsCacheItem_pimpl.h:
2260 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2263 * src/graphics/GraphicsCacheItem.h:
2264 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2265 another copy of the object.
2267 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2268 of cacheHandle, this fixed a bug that sent LyX crashing.
2270 * src/graphics/XPM_Renderer.h:
2271 * src/graphics/XPM_Renderer.C:
2272 * src/graphics/EPS_Renderer.h:
2273 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2275 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2277 * src/lyxfunc.C (processKeySym): only handle the
2278 lockinginset/inset stuff if we have a buffer and text loaded...
2280 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2282 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2284 * src/support/lyxfunctional.h: add operator= that takes a reference
2286 * src/lyxserver.C (mkfifo): make first arg const
2288 * src/layout.h: renamed name(...) to setName(...) to work around
2291 * src/buffer.C (setFileName): had to change name of function to
2292 work around bugs in egcs. (renamed from fileName)
2294 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2296 * src/support/translator.h: move helper template classes to
2297 lyxfunctional.h, include "support/lyxfunctional.h"
2299 * src/support/lyxmanip.h: add delaration of fmt
2301 * src/support/lyxfunctional.h: new file
2302 (class_fun_t): new template class
2303 (class_fun): helper template function
2304 (back_insert_fun_iterator): new template class
2305 (back_inserter_fun): helper template function
2306 (compare_memfun_t): new template class
2307 (compare_memfun): helper template function
2308 (equal_1st_in_pair): moved here from translator
2309 (equal_2nd_in_pair): moved here from translator
2311 * src/support/fmt.C: new file
2312 (fmt): new func, can be used for a printf substitute when still
2313 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2315 * src/support/StrPool.C: add some comments
2317 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2320 * src/insets/figinset.C (addpidwait): use std::copy with
2321 ostream_iterator to fill the pidwaitlist
2323 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2325 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2328 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2331 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2333 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2334 (class_update): ditto
2335 (BulletPanel): ditto
2336 (CheckChoiceClass): move initialization of tc and tct
2338 * src/tabular.C: remove current_view
2339 (OldFormatRead): similar to right below [istream::ignore]
2341 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2342 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2343 unused [istream::ignore]
2345 * src/lyxfunc.C: include "support/lyxfunctional.h"
2346 (getInsetByCode): use std::find_if and compare_memfun
2348 * src/lyxfont.C (stateText): remove c_str()
2350 * src/lyx_main.C (setDebuggingLevel): make static
2351 (commandLineHelp): make static
2353 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2354 Screen* together with fl_get_display() and fl_screen
2356 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2357 togheter with fl_get_display() and fl_screen
2358 (create_forms): remove c_str()
2360 * src/layout.C: include "support/lyxfunctional.h"
2361 (hasLayout): use std::find_if and compare_memfun
2362 (GetLayout): use std::find_if and comapre_memfun
2363 (delete_layout): use std::remove_if and compare_memfun
2364 (NumberOfClass): use std:.find_if and compare_memfun
2366 * src/gettext.h: change for the new functions
2368 * src/gettext.C: new file, make _(char const * str) and _(string
2369 const & str) real functions.
2371 * src/font.C (width): rewrite slightly to avoid one extra variable
2373 * src/debug.C: initialize Debug::ANY here
2375 * src/commandtags.h: update number comments
2377 * src/combox.h (get): make const func
2379 (getline): make const
2381 * src/combox.C (input_cb): handle case where fl_get_input can
2384 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2385 "support/lyxfunctional.h", remove current_view variable.
2386 (resize): use std::for_each with std::mem_fun
2387 (getFileNames): use std::copy with back_inserter_fun
2388 (getBuffer): change arg type to unsigned int
2389 (emergencyWriteAll): call emergencyWrite with std::for_each and
2391 (emergencyWrite): new method, the for loop in emergencyWriteAll
2393 (exists): use std::find_if with compare_memfun
2394 (getBuffer): use std::find_if and compare_memfun
2396 * src/buffer.h: add typedefs for iterator_category, value_type
2397 difference_type, pointer and reference for inset_iterator
2398 add postfix ++ for inset_iterator
2399 make inset_iterator::getPos() const
2401 * src/buffer.C: added support/lyxmanip.h
2402 (readFile): use lyxerr << fmt instead of printf
2403 (makeLaTeXFile): use std::copy to write out encodings
2405 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2407 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2408 free and the char * temp.
2409 (hasMenu): use std::find_if and compare_memfun
2412 * src/Makefile.am (lyx_SOURCES): added gettext.C
2414 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2415 string::insert small change to avoid temporary
2417 * src/LColor.C (getGUIName): remove c_str()
2419 * several files: change all occurrences of fl_display to
2422 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2423 that -pedantic is not used for gcc 2.97 (cvs gcc)
2425 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2427 2000-10-11 Allan Rae <rae@lyx.org>
2429 * src/frontends/xforms/FormPreferences.C (input): template path must be
2430 a readable directory. It doesn't need to be writeable.
2431 (build, delete, update, apply): New inputs in the various tabfolders
2433 * src/frontends/xforms/forms/form_preferences.fd:
2434 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2435 several new entries to existing folders. Shuffled some existing stuff
2438 * src/frontends/xforms/forms/form_print.fd:
2439 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2440 Should probably rework PrinterParams as well. Note that the switch to
2441 collated is effectively the same as !unsorted so changing PrinterParams
2442 will require a lot of fiddly changes to reverse the existing logic.
2444 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2446 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2448 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2450 2000-10-10 Allan Rae <rae@lyx.org>
2453 * src/lyxfunc.C (Dispatch):
2455 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2458 * src/lyxrc.C (output): Only write the differences between system lyxrc
2459 and the users settings.
2462 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2464 I'll rewrite this later, after 1.1.6 probably, to keep a single
2465 LyXRC but two instances of a LyXRCStruct.
2467 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2469 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2471 * src/tabular.h: add a few std:: qualifiers.
2473 * src/encoding.C: add using directive.
2474 * src/language.C: ditto.
2476 * src/insets/insetquotes.C (Validate): use languages->lang()
2477 instead of only language.
2479 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2481 * lib/languages: New file.
2483 * lib/encodings: New file.
2485 * src/language.C (Languages): New class.
2486 (read): New method. Reads the languages from the 'languages' file.
2488 * src/encoding.C (Encodings): New class.
2489 (read): New method. Reads the encodings from the 'encodings' file.
2491 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2494 * src/bufferparams.h and a lot of files: Deleted the member language,
2495 and renamed language_info to language
2497 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2498 * src/lyxfont.C (latexWriteStartChanges): ditto.
2499 * src/paragraph.C (validate,TeXOnePar): ditto.
2501 * src/lyxfont.C (update): Restored deleted code.
2503 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2505 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2507 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2509 * src/insets/figinset.[Ch]:
2510 * src/insets/insetinclude.[Ch]:
2511 * src/insets/insetinclude.[Ch]:
2512 * src/insets/insetparent.[Ch]:
2513 * src/insets/insetref.[Ch]:
2514 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2516 * src/insets/*.[Ch]:
2517 * src/mathed/formula.[Ch]:
2518 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2520 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2521 * src/lyx_cb.C (FigureApplyCB):
2522 * src/lyxfunc.C (getStatus, Dispatch):
2523 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2526 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2528 * src/converter.[Ch] (Formats::View):
2529 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2531 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2532 *current_view->buffer(). This will change later, but this patch is way
2535 2000-10-09 Juergen Vigna <jug@sad.it>
2537 * src/text.C (GetRow): small fix.
2539 * src/BufferView_pimpl.C (cursorPrevious):
2540 (cursorNext): added LyXText parameter to function.
2542 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2543 keypress depending on cursor position.
2545 2000-10-06 Juergen Vigna <jug@sad.it>
2547 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2548 (copySelection): redone this function and also copy ascii representa-
2551 * src/tabular.C (Ascii):
2555 (print_n_chars): new functions to realize the ascii export of tabulars.
2557 2000-10-05 Juergen Vigna <jug@sad.it>
2559 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2560 if we don't have a buffer.
2562 2000-10-10 Allan Rae <rae@lyx.org>
2564 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2565 with closing dialog. It seems that nested tabfolders require hiding
2566 of inner tabfolders before hiding the dialog itself. Actually all I
2567 did was hide the active outer folder.
2569 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2570 unless there really is a buffer. hideBufferDependent is called
2573 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2574 POTFILES.in stays in $(srcdir).
2576 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2578 * lib/lyxrc.example: Few changes.
2580 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2582 * src/BufferView_pimpl.C (buffer): only need one the
2583 updateBufferDependent signal to be emitted once! Moved to the end of
2584 the method to allow bv_->text to be updated first.
2586 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2587 and hSignal_ with Dialogs * and BufferDependency variables.
2588 New Buffer * parent_, initialised when the dialog is launched. Used to
2589 check whether to update() or hide() dialog in the new, private
2590 updateOrHide() method that is connected to the updateBufferDependent
2591 signal. Daughter classes dictate what to do using the
2592 ChangedBufferAction enum, passed to the c-tor.
2594 * src/frontends/xforms/FormCitation.C:
2595 * src/frontends/xforms/FormCommand.C:
2596 * src/frontends/xforms/FormCopyright.C:
2597 * src/frontends/xforms/FormDocument.C:
2598 * src/frontends/xforms/FormError.C:
2599 * src/frontends/xforms/FormIndex.C:
2600 * src/frontends/xforms/FormPreferences.C:
2601 * src/frontends/xforms/FormPrint.C:
2602 * src/frontends/xforms/FormRef.C:
2603 * src/frontends/xforms/FormToc.C:
2604 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2607 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2608 ChangedBufferAction enum.
2610 * src/frontends/xforms/FormParagraph.[Ch]
2611 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2614 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2616 * lib/bind/cua.bind: fix a bit.
2617 * lib/bind/emacs.bind: ditto.
2619 * lib/bind/menus.bind: remove real menu entries from there.
2621 * src/spellchecker.C: make sure we only include strings.h when
2624 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2626 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2627 function. It enlarges the maximum number of pup when needed.
2628 (add_toc2): Open a new menu if maximum number of items per menu has
2631 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2633 * src/frontends/kde/FormPrint.C: fix error reporting
2635 * src/frontends/xforms/FormDocument.C: fix compiler
2638 * lib/.cvsignore: add Literate.nw
2640 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2643 * bufferview_funcs.[Ch]
2646 * text2.C: Add support for numbers in RTL text.
2648 2000-10-06 Allan Rae <rae@lyx.org>
2650 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2651 to be gettext.m4 friendly again. ext_l10n.h is now
2652 generated into $top_srcdir instead of $top_builddir
2653 so that lyx.pot will be built correctly -- without
2654 duplicate parsing of ext_l10n.h.
2656 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2658 * src/frontends/kde/FormCitation.C: make the dialog
2659 behave more sensibly
2661 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2663 * config/kde.m4: fix consecutive ./configure runs,
2664 look for qtarch, fix library order
2666 * src/frontends/kde/Makefile.am: tidy up,
2667 add Print dialog, add .dlg dependencies
2669 * src/frontends/kde/FormPrint.C:
2670 * src/frontends/kde/FormPrint.h:
2671 * src/frontends/kde/formprintdialog.C:
2672 * src/frontends/kde/formprintdialog.h:
2673 * src/frontends/kde/formprintdialogdata.C:
2674 * src/frontends/kde/formprintdialogdata.h:
2675 * src/frontends/kde/dlg/formprintdialog.dlg: add
2678 * src/frontends/kde/dlg/README: Added explanatory readme
2680 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2681 script to double-check qtarch's output
2683 * src/frontends/kde/formindexdialog.C:
2684 * src/frontends/kde/formindexdialogdata.C:
2685 * src/frontends/kde/formindexdialogdata.h:
2686 * src/frontends/kde/dlg/formindexdialog.dlg: update
2687 for qtarch, minor fixes
2689 2000-10-05 Allan Rae <rae@lyx.org>
2691 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2692 dialogs when switching buffers update them instead. It's up to each
2693 dialog to decide if it should still be visible or not.
2694 update() should return a bool to control visiblity within show().
2695 Or perhaps better to set a member variable and use that to control
2698 * lib/build-listerrors: create an empty "listerrors" file just to stop
2699 make trying to regenerate it all the time if you don't have noweb
2702 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2704 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2705 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2706 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2707 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2708 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2710 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2712 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2714 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2715 deleting buffer. Closes all buffer-dependent dialogs.
2717 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2719 * src/frontends/xforms/FormCitation.[Ch]:
2720 * src/frontends/xforms/FormPreferences.[Ch]:
2721 * src/frontends/xforms/FormPrint.[Ch]:
2722 * src/frontends/xforms/FormRef.[Ch]:
2723 * src/frontends/xforms/FormUrl.[Ch]: ditto
2725 * src/frontends/xforms/FormDocument.[Ch]:
2726 * src/frontends/xforms/forms/form_document.C.patch:
2727 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2728 pass through a single input() function.
2730 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2732 * lib/build-listerrors: return status as OK
2734 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2736 * lib/lyxrc.example: Updated to new export code
2738 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2740 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2743 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2746 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2747 LyX-Code is defined.
2748 * lib/layouts/amsbook.layout: ditto.
2750 * boost/Makefile.am: fix typo.
2752 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2754 (add_lastfiles): removed.
2755 (add_documents): removed.
2756 (add_formats): removed.
2758 * src/frontends/Menubar.C: remove useless "using" directive.
2760 * src/MenuBackend.h: add a new MenuItem constructor.
2762 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2765 2000-10-04 Allan Rae <rae@lyx.org>
2767 * lib/Makefile.am (listerrors):
2768 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2769 I haven't got notangle installed so Kayvan please test. The output
2770 should end up in $builddir. This also allows people who don't have
2771 noweb installed to complete the make process without error.
2773 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2774 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2775 by JMarc's picky compiler.
2777 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2780 * src/insets/insettabular.C (setPos): change for loop to not use
2781 sequencing operator. Please check this Jürgen.
2783 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2785 * src/insets/insetcite.C (getScreenLabel): ditto
2786 * src/support/filetools.C (QuoteName): ditto
2787 (ChangeExtension): ditto
2789 * src/BufferView_pimpl.C (scrollCB): make heigt int
2791 * src/BufferView2.C (insertInset): comment out unused arg
2793 * boost/Makefile.am (EXTRADIST): new variable
2795 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2797 * src/exporter.C (IsExportable): Fixed
2799 * lib/configure.m4: Small fix
2801 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2803 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2804 * src/insets/insetbib.C (bibitemWidest): ditto.
2805 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2807 2000-10-03 Juergen Vigna <jug@sad.it>
2809 * src/BufferView2.C (theLockingInset): removed const because of
2810 Agnus's compile problems.
2812 * src/insets/insettext.C (LocalDispatch): set the language of the
2813 surronding paragraph on inserting the first character.
2815 * various files: changed use of BufferView::the_locking_inset.
2817 * src/BufferView2.C (theLockingInset):
2818 (theLockingInset): new functions.
2820 * src/BufferView.h: removed the_locking_inset.
2822 * src/lyxtext.h: added the_locking_inset
2824 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2826 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2828 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2830 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2831 * src/mathed/math_cursor.C (IsAlpha): ditto.
2832 * src/mathed/math_inset.C (strnew): ditto.
2833 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2834 (IMetrics): cxp set but never used; removed.
2835 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2836 that the variable in question has been removed also!
2839 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2840 using the Buffer * passed to Latex(), using the BufferView * passed to
2841 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2843 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2844 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2846 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2847 * src/buffer.C (readInset): used new InsetBibtex c-tor
2848 * (getBibkeyList): used new InsetBibtex::getKeys
2850 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2853 * lib/build-listerrors
2855 * src/exporter.C: Add literate programming support to the export code
2858 * src/lyx_cb.C: Remove old literate code.
2860 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2863 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2864 * src/converter.C (View, Convert): Use QuoteName.
2866 * src/insets/figinset.C (Preview): Use Formats::View.
2868 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2870 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2872 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2873 the top of the function, because compaq cxx complains that the
2874 "goto exit_with_message" when the function is disabled bypasses
2876 (MenuNew): try a better fix for the generation of new file names.
2877 This time, I used AddName() instead of AddPath(), hoping Juergen
2880 2000-10-03 Allan Rae <rae@lyx.org>
2882 * src/frontends/xforms/forms/form_preferences.fd:
2883 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2884 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2885 "Look and Feel"->"General" but will need to be split up further into
2886 general output and general input tabs. Current plan is for four outer
2887 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2888 stuff; "Inputs" for input and import configuration; "Outputs" for
2889 output and export configuration; and one more whatever is left over
2890 called "General". The leftovers at present look like being which
2891 viewers to use, spellchecker, language support and might be better
2892 named "Support". I've put "Paths" in "Inputs" for the moment as this
2893 seems reasonable for now at least.
2894 One problem remains: X error kills LyX when you close Preferences.
2896 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2898 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2899 qualifier from form()
2900 * src/frontends/xforms/FormCitation.[Ch]:
2901 * src/frontends/xforms/FormCopyright.[Ch]:
2902 * src/frontends/xforms/FormDocument.[Ch]:
2903 * src/frontends/xforms/FormError.[Ch]:
2904 * src/frontends/xforms/FormIndex.[Ch]:
2905 * src/frontends/xforms/FormPreferences.[Ch]:
2906 * src/frontends/xforms/FormPrint.[Ch]:
2907 * src/frontends/xforms/FormRef.[Ch]:
2908 * src/frontends/xforms/FormToc.[Ch]:
2909 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2911 * src/frontends/xforms/FormCitation.[Ch]:
2912 * src/frontends/xforms/FormIndex.[Ch]:
2913 * src/frontends/xforms/FormRef.[Ch]:
2914 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2915 with Allan's naming policy
2917 * src/frontends/xforms/FormCitation.C: some static casts to remove
2920 2000-10-02 Juergen Vigna <jug@sad.it>
2922 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2923 now you can type or do stuff inside the table-cell also when in dummy
2924 position, fixed visible cursor.
2926 * src/insets/insettext.C (Edit): fixing cursor-view position.
2928 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2929 be used for equal functions in lyxfunc and insettext.
2931 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2933 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2935 * src/frontends/gnome/FormCitation.h:
2936 * src/frontends/gnome/FormCopyright.h:
2937 * src/frontends/gnome/FormIndex.h:
2938 * src/frontends/gnome/FormPrint.h:
2939 * src/frontends/gnome/FormToc.h:
2940 * src/frontends/gnome/FormUrl.h:
2941 * src/frontends/kde/FormCitation.h:
2942 * src/frontends/kde/FormCopyright.h:
2943 * src/frontends/kde/FormIndex.h:
2944 * src/frontends/kde/FormRef.h:
2945 * src/frontends/kde/FormToc.h:
2946 * src/frontends/kde/FormUrl.h: fix remaining users of
2949 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2951 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2952 from depth argument.
2953 (DocBookHandleCaption): ditto.
2954 (DocBookHandleFootnote): ditto.
2955 (SimpleDocBookOnePar): ditto.
2957 * src/frontends/xforms/FormDocument.h (form): remove extra
2958 FormDocument:: qualifier.
2960 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2962 * sigc++/handle.h: ditto.
2964 * src/lyx_gui_misc.C: add "using" directive.
2966 * src/cheaders/cstddef: new file, needed by the boost library (for
2969 2000-10-02 Juergen Vigna <jug@sad.it>
2971 * src/insets/insettext.C (SetFont): better support.
2973 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2975 * src/screen.C (DrawOneRow): some uint refixes!
2977 2000-10-02 Allan Rae <rae@lyx.org>
2979 * boost/.cvsignore: ignore Makefile as well
2981 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2982 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2984 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2985 Left this one out by accident.
2987 * src/frontends/xforms/FormBase.h (restore): default to calling
2988 update() since that will restore the original/currently-applied values.
2989 Any input() triggered error messages will require the derived classes
2990 to redefine restore().
2992 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2993 avoid a segfault. combo_doc_class is the main concern.
2995 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2997 * Simplify build-listerrors in view of GUI-less export ability!
2999 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3001 * src/lyx_main.C (easyParse): Disable gui when exporting
3003 * src/insets/figinset.C:
3006 * src/lyx_gui_misc.C
3007 * src/tabular.C: Changes to allow no-gui.
3009 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3011 * src/support/utility.hpp: removed file
3012 * src/support/block.h: removed file
3014 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3017 * src/mathed/formula.C: add support/lyxlib.h
3018 * src/mathed/formulamacro.C: ditto
3020 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3021 * src/lyxparagraph.h: ditto
3023 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3024 * src/frontends/Makefile.am (INCLUDES): ditto
3025 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3026 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3027 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3028 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3029 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3030 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3032 * src/BufferView.h: use boost/utility.hpp
3033 * src/LColor.h: ditto
3034 * src/LaTeX.h: ditto
3035 * src/LyXAction.h: ditto
3036 * src/LyXView.h: ditto
3037 * src/bufferlist.h: ditto
3038 * src/lastfiles.h: ditto
3039 * src/layout.h: ditto
3040 * src/lyx_gui.h: ditto
3041 * src/lyx_main.h: ditto
3042 * src/lyxlex.h: ditto
3043 * src/lyxrc.h: ditto
3044 * src/frontends/ButtonPolicies.h: ditto
3045 * src/frontends/Dialogs.h: ditto
3046 * src/frontends/xforms/FormBase.h: ditto
3047 * src/frontends/xforms/FormGraphics.h: ditto
3048 * src/frontends/xforms/FormParagraph.h: ditto
3049 * src/frontends/xforms/FormTabular.h: ditto
3050 * src/graphics/GraphicsCache.h: ditto
3051 * src/graphics/Renderer.h: ditto
3052 * src/insets/ExternalTemplate.h: ditto
3053 * src/insets/insetcommand.h: ditto
3054 * src/support/path.h: ditto
3056 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3057 and introduce clause for 2.97.
3059 * boost/libs/README: new file
3061 * boost/boost/utility.hpp: new file
3063 * boost/boost/config.hpp: new file
3065 * boost/boost/array.hpp: new file
3067 * boost/Makefile.am: new file
3069 * boost/.cvsignore: new file
3071 * configure.in (AC_OUTPUT): add boost/Makefile
3073 * Makefile.am (SUBDIRS): add boost
3075 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3077 * src/support/lstrings.C (suffixIs): Fixed.
3079 2000-10-01 Allan Rae <rae@lyx.org>
3081 * src/PrinterParams.h: moved things around to avoid the "can't
3082 inline call" warning.
3084 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3085 into doc++ documentation.
3087 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3089 * src/frontends/xforms/FormRef.C: make use of button controller
3090 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3091 cleaned up button controller usage.
3092 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3093 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3094 use the button controller
3096 * src/frontends/xforms/forms/*.fd: and associated generated files
3097 updated to reflect changes to FormBase. Some other FormXxxx files
3098 also got minor updates to reflect changes to FormBase.
3100 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3101 (hide): made virtual.
3102 (input): return a bool. true == valid input
3103 (RestoreCB, restore): new
3104 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3105 Changes to allow derived dialogs to use a ButtonController and
3106 make sense when doing so: OK button calls ok() and so on.
3108 * src/frontends/xforms/ButtonController.h (class ButtonController):
3109 Switch from template implementation to taking Policy parameter.
3110 Allows FormBase to provide a ButtonController for any dialog.
3112 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3113 Probably should rename connect and disconnect.
3114 (apply): use the radio button groups
3115 (form): needed by FormBase
3116 (build): setup the radio button groups
3118 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3120 * several files: type changes to reduce the number of warnings and
3121 to unify type hangling a bit. Still much to do.
3123 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3125 * lib/images/*: rename a bunch of icons to match Dekel converter
3128 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3131 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3133 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3135 * sigc++/handle.h: ditto for class Handle.
3137 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3139 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3141 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3143 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3144 removal of the "default" language.
3146 * src/combox.h (getline): Check that sel > 0
3148 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3150 * lib/examples/docbook_example.lyx
3151 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3153 * lib/layouts/docbook-book.layout: new docbook book layout.
3155 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3157 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3159 * src/insets/figinset.C (DocBook):fixed small typo.
3161 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3163 * src/insets/insetinclude.h: string include_label doesn't need to be
3166 2000-09-29 Allan Rae <rae@lyx.org>
3168 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3169 Allow derived type to control connection and disconnection from signals
3170 of its choice if desired.
3172 2000-09-28 Juergen Vigna <jug@sad.it>
3174 * src/insets/insettabular.C (update): fixed cursor setting when
3175 the_locking_inset changed.
3176 (draw): made this a bit cleaner.
3177 (InsetButtonPress): fixed!
3179 * various files: added LyXText Parameter to fitCursor call.
3181 * src/BufferView.C (fitCursor): added LyXText parameter.
3183 * src/insets/insettabular.C (draw): small draw fix.
3185 * src/tabular.C: right setting of left/right celllines.
3187 * src/tabular.[Ch]: fixed various types in funcions and structures.
3188 * src/insets/insettabular.C: ditto
3189 * src/frontends/xforms/FormTabular.C: ditto
3191 2000-09-28 Allan Rae <rae@lyx.org>
3193 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3194 that the #ifdef's had been applied to part of what should have been
3195 a complete condition. It's possible there are other tests that
3196 were specific to tables that are also wrong now that InsetTabular is
3197 being used. Now we need to fix the output of '\n' after a table in a
3198 float for the same reason as the original condition:
3199 "don't insert this if we would be adding it before or after a table
3200 in a float. This little trick is needed in order to allow use of
3201 tables in \subfigures or \subtables."
3202 Juergen can you check this?
3204 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3206 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3207 output to the ostream.
3209 * several files: fixed types based on warnings from cxx
3211 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3213 * src/frontends/kde/Makefile.am: fix rule for
3214 formindexdialogdata_moc.C
3216 * src/.cvsignore: add ext_l10n.h to ignore
3218 * acconfig.h: stop messing with __STRICT_ANSI__
3219 * config/gnome.m4: remove option to set -ansi
3220 * config/kde.m4: remove option to set -ansi
3221 * config/lyxinclude.m4: don't set -ansi
3223 2000-09-27 Juergen Vigna <jug@sad.it>
3225 * various files: remove "default" language check.
3227 * src/insets/insetquotes.C: removed use of current_view.
3229 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3230 the one should have red ears by now!
3232 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3233 in more then one paragraph. Fixed cursor-movement/selection.
3235 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3236 paragraphs inside a text inset.
3238 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3239 text-inset if this owner is an inset.
3241 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3243 * src/Bullet.h: changed type of font, character and size to int
3245 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3247 * src/insets/inseturl.[Ch]:
3248 * src/insets/insetref.[Ch]:
3249 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3251 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3253 * src/buffer.C (readFile): block-if statement rearranged to minimise
3254 bloat. Patch does not reverse Jean-Marc's change ;-)
3256 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3257 Class rewritten to store pointers to hide/update signals directly,
3258 rather than Dialogs *. Also defined an enum to ease use. All xforms
3259 forms can now be derived from this class.
3261 * src/frontends/xforms/FormCommand.[Ch]
3262 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3264 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3267 * src/frontends/xforms/forms/form_citation.fd
3268 * src/frontends/xforms/forms/form_copyright.fd
3269 * src/frontends/xforms/forms/form_error.fd
3270 * src/frontends/xforms/forms/form_index.fd
3271 * src/frontends/xforms/forms/form_ref.fd
3272 * src/frontends/xforms/forms/form_toc.fd
3273 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3275 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3277 * src/insets/insetfoot.C: removed redundent using directive.
3279 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3281 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3282 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3284 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3285 created in the constructors in different groups. Then set() just
3286 have to show the groups as needed. This fixes the redraw problems
3287 (and is how the old menu code worked).
3289 * src/support/lyxlib.h: declare the methods as static when we do
3290 not have namespaces.
3292 2000-09-26 Juergen Vigna <jug@sad.it>
3294 * src/buffer.C (asciiParagraph): new function.
3295 (writeFileAscii): new function with parameter ostream.
3296 (writeFileAscii): use now asciiParagraph.
3298 * various inset files: added the linelen parameter to the Ascii-func.
3300 * src/tabular.C (Write): fixed error in writing file introduced by
3301 the last changes from Lars.
3303 * lib/bind/menus.bind: removed not supported functions.
3305 * src/insets/insettext.C (Ascii): implemented this function.
3307 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3309 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3310 (Write): use of the write_attribute functions.
3312 * src/bufferlist.C (close): fixed reasking question!
3314 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3316 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3317 new files use the everwhere possible.
3320 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3321 src/log_form.C src/lyx.C:
3324 * src/buffer.C (runLaTeX): remove func
3326 * src/PaperLayout.C: removed file
3327 * src/ParagraphExtra.C: likewise
3328 * src/bullet_forms.C: likewise
3329 * src/bullet_forms.h: likewise
3330 * src/bullet_forms_cb.C: likewise
3332 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3333 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3336 * several files: remove all traces of the old fd_form_paragraph,
3337 and functions belonging to that.
3339 * several files: remove all traces of the old fd_form_document,
3340 and functions belonging to that.
3342 * several files: constify local variables were possible.
3344 * several files: remove all code that was dead when NEW_EXPORT was
3347 * several files: removed string::c_str in as many places as
3350 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3351 (e): be a bit more outspoken when patching
3352 (updatesrc): only move files if changed.
3354 * forms/layout_forms.h.patch: regenerated
3356 * forms/layout_forms.fd: remove form_document and form_paragraph
3357 and form_quotes and form_paper and form_table_options and
3358 form_paragraph_extra
3360 * forms/form1.fd: remove form_table
3362 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3363 the fdui->... rewrite. Update some comments to xforms 0.88
3365 * forms/bullet_forms.C.patch: removed file
3366 * forms/bullet_forms.fd: likewise
3367 * forms/bullet_forms.h.patch: likewise
3369 * development/Code_rules/Rules: added a section on switch
3370 statements. Updated some comment to xforms 0.88.
3372 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3374 * src/buffer.C (readFile): make sure that the whole version number
3375 is read after \lyxformat (even when it contains a comma)
3377 * lib/ui/default.ui: change shortcut of math menu to M-a.
3379 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3381 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3384 * src/LyXView.C (updateWindowTitle): show the full files name in
3385 window title, limited to 30 characters.
3387 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3388 When a number of characters has been given, we should not assume
3389 that the string is 0-terminated.
3391 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3392 calls (fixes some memory leaks)
3394 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3395 trans member on exit.
3397 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3399 * src/converter.C (GetReachable): fix typo.
3401 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3402 understand ',' instead of '.'.
3403 (GetInteger): rewrite to use strToInt().
3405 2000-09-26 Juergen Vigna <jug@sad.it>
3407 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3408 better visibility and error-message on wrong VSpace input.
3410 * src/language.C (initL): added english again.
3412 2000-09-25 Juergen Vigna <jug@sad.it>
3414 * src/frontends/kde/Dialogs.C (Dialogs):
3415 * src/frontends/gnome/Dialogs.C (Dialogs):
3416 * src/frontends/kde/Makefile.am:
3417 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3419 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3421 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3423 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3425 * src/frontends/xforms/FormParagraph.C:
3426 * src/frontends/xforms/FormParagraph.h:
3427 * src/frontends/xforms/form_paragraph.C:
3428 * src/frontends/xforms/form_paragraph.h:
3429 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3432 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3434 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3435 Paragraph-Data after use.
3437 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3438 non breakable paragraphs.
3440 2000-09-25 Garst R. Reese <reese@isn.net>
3442 * src/language.C (initL): added missing language_country codes.
3444 2000-09-25 Juergen Vigna <jug@sad.it>
3446 * src/insets/insettext.C (InsetText):
3447 (deleteLyXText): remove the not released LyXText structure!
3449 2000-09-24 Marko Vendelin <markov@ioc.ee>
3451 * src/frontends/gnome/mainapp.C
3452 * src/frontends/gnome/mainapp.h: added support for keyboard
3455 * src/frontends/gnome/FormCitation.C
3456 * src/frontends/gnome/FormCitation.h
3457 * src/frontends/gnome/Makefile.am
3458 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3459 FormCitation to use "action area" in mainapp window
3461 * src/frontends/gnome/Menubar_pimpl.C
3462 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3465 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3467 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3468 width/descent/ascent values if name is empty.
3469 (mathed_string_height): Use std::max.
3471 2000-09-25 Allan Rae <rae@lyx.org>
3473 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3474 segfault. This will be completely redesigned soon.
3476 * sigc++: updated libsigc++. Fixes struct timespec bug.
3478 * development/tools/makeLyXsigc.sh: .cvsignore addition
3480 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3482 * several files: removed almost all traces of the old table
3485 * src/TableLayout.C: removed file
3487 2000-09-22 Juergen Vigna <jug@sad.it>
3489 * src/frontends/kde/Dialogs.C: added credits forms.
3491 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3493 * src/frontends/gnome/Dialogs.C: added some forms.
3495 * src/spellchecker.C (init_spell_checker): set language in pspell code
3496 (RunSpellChecker): some modifications for setting language string.
3498 * src/language.[Ch]: added language_country code.
3500 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3502 * src/frontends/Dialogs.h: added new signal showError.
3503 Rearranged existing signals in some sort of alphabetical order.
3505 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3506 FormError.[Ch], form_error.[Ch]
3507 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3508 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3510 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3511 dialogs. I think that this can be used as the base to all these
3514 * src/frontends/xforms/FormError.[Ch]
3515 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3516 implementation of InsetError dialog.
3518 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3520 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3521 * src/frontends/kde/Makefile.am: ditto
3523 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3525 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3526 macrobf. This fixes a bug of invisible text.
3528 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3530 * lib/doc/LaTeXConfig.lyx.in: updated.
3532 * src/language.C (initL): remove language "francais" and change a
3533 bit the names of the two other french variations.
3535 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3536 string that may not be 0-terminated.
3538 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3540 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3542 2000-09-20 Marko Vendelin <markov@ioc.ee>
3544 * src/frontends/gnome/FormCitation.C
3545 * src/frontends/gnome/FormIndex.C
3546 * src/frontends/gnome/FormToc.C
3547 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3548 the variable initialization to shut up the warnings
3550 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3552 * src/table.[Ch]: deleted files
3554 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3557 2000-09-18 Juergen Vigna <jug@sad.it>
3559 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3560 problems with selection. Inserted new LFUN_PASTESELECTION.
3561 (InsetButtonPress): inserted handling of middle mouse-button paste.
3563 * src/spellchecker.C: changed word to word.c_str().
3565 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3567 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3568 included in the ``make dist'' tarball.
3570 2000-09-15 Juergen Vigna <jug@sad.it>
3572 * src/CutAndPaste.C (cutSelection): small fix return the right
3573 end position after cut inside one paragraph only.
3575 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3576 we are locked as otherwise we don't have a valid cursor position!
3578 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3580 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3582 * src/frontends/kde/FormRef.C: added using directive.
3583 * src/frontends/kde/FormToc.C: ditto
3585 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3587 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3589 2000-09-19 Marko Vendelin <markov@ioc.ee>
3591 * src/frontends/gnome/Menubar_pimpl.C
3592 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3593 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3595 * src/frontends/gnome/mainapp.C
3596 * src/frontends/gnome/mainapp.h: support for menu update used
3599 * src/frontends/gnome/mainapp.C
3600 * src/frontends/gnome/mainapp.h: support for "action" area in the
3601 main window. This area is used by small simple dialogs, such as
3604 * src/frontends/gnome/FormIndex.C
3605 * src/frontends/gnome/FormIndex.h
3606 * src/frontends/gnome/FormUrl.C
3607 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3610 * src/frontends/gnome/FormCitation.C
3611 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3612 action area. Only "Insert new citation" is implemented.
3614 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3616 * src/buffer.C (Dispatch): fix call to Dispatch
3617 * src/insets/insetref.C (Edit): likewise
3618 * src/insets/insetparent.C (Edit): likewise
3619 * src/insets/insetinclude.C (include_cb): likewise
3620 * src/frontends/xforms/FormUrl.C (apply): likewise
3621 * src/frontends/xforms/FormToc.C (apply): likewise
3622 * src/frontends/xforms/FormRef.C (apply): likewise
3623 * src/frontends/xforms/FormIndex.C (apply): likewise
3624 * src/frontends/xforms/FormCitation.C (apply): likewise
3625 * src/lyxserver.C (callback): likewise
3626 * src/lyxfunc.C (processKeySym): likewise
3627 (Dispatch): likewise
3628 (Dispatch): likewise
3629 * src/lyx_cb.C (LayoutsCB): likewise
3631 * Makefile.am (sourcedoc): small change
3633 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3635 * src/main.C (main): Don't make an empty GUIRunTime object. all
3636 methods are static. constify a bit remove unneded using + headers.
3638 * src/tabular.C: some more const to local vars move some loop vars
3640 * src/spellchecker.C: added some c_str after some word for pspell
3642 * src/frontends/GUIRunTime.h: add new static method setDefaults
3643 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3644 * src/frontends/kde/GUIRunTime.C (setDefaults):
3645 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3647 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3648 with strnew in arg, use correct emptystring when calling SetName.
3650 * several files: remove all commented code with relation to
3651 HAVE_SSTREAM beeing false. We now only support stringstream and
3654 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3656 * src/lyxfunc.C: construct correctly the automatic new file
3659 * src/text2.C (IsStringInText): change type of variable i to shut
3662 * src/support/sstream.h: do not use namespaces if the compiler
3663 does not support them.
3665 2000-09-15 Marko Vendelin <markov@ioc.ee>
3666 * src/frontends/gnome/FormCitation.C
3667 * src/frontends/gnome/FormCitation.h
3668 * src/frontends/gnome/diainsertcitation_interface.c
3669 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3670 regexp support to FormCitation [Gnome].
3672 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3675 * configure.in: remove unused KDE/GTKGUI define
3677 * src/frontends/kde/FormRef.C
3678 * src/frontends/kde/FormRef.h
3679 * src/frontends/kde/formrefdialog.C
3680 * src/frontends/kde/formrefdialog.h: double click will
3681 go to reference, now it is possible to change a cross-ref
3684 * src/frontends/kde/FormToc.C
3685 * src/frontends/kde/FormToc.h
3686 * src/frontends/kde/formtocdialog.C
3687 * src/frontends/kde/formtocdialog.h: add a depth
3690 * src/frontends/kde/Makefile.am: add QtLyXView.h
3693 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3695 * src/frontends/kde/FormCitation.h: added some using directives.
3697 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3699 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3702 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3705 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3707 * src/buffer.C (pop_tag): revert for the second time a change by
3708 Lars, who seems to really hate having non-local loop variables :)
3710 * src/Lsstream.h: add "using" statements.
3712 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3713 * src/buffer.C (writeFile): ditto
3715 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3717 * src/buffer.C (writeFile): try to fix the locale modified format
3718 number to always be as we want it.
3720 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3721 in XForms 0.89. C-space is now working again.
3723 * src/Lsstream.h src/support/sstream.h: new files.
3725 * also commented out all cases where strstream were used.
3727 * src/Bullet.h (c_str): remove method.
3729 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3731 * a lot of files: get rid of "char const *" and "char *" is as
3732 many places as possible. We only want to use them in interaction
3733 with system of other libraries, not inside lyx.
3735 * a lot of files: return const object is not of pod type. This
3736 helps ensure that temporary objects is not modified. And fits well
3737 with "programming by contract".
3739 * configure.in: check for the locale header too
3741 * Makefile.am (sourcedoc): new tag for generation of doc++
3744 2000-09-14 Juergen Vigna <jug@sad.it>
3746 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3747 callback to check which combo called it and do the right action.
3749 * src/combox.C (combo_cb): added combo * to the callbacks.
3750 (Hide): moved call of callback after Ungrab of the pointer.
3752 * src/intl.h: removed LCombo2 function.
3754 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3755 function as this can now be handled in one function.
3757 * src/combox.h: added Combox * to callback prototype.
3759 * src/frontends/xforms/Toolbar_pimpl.C:
3760 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3762 2000-09-14 Garst Reese <reese@isn.net>
3764 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3765 moved usepackage{xxx}'s to beginning of file. Changed left margin
3766 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3767 underlining from title. Thanks to John Culleton for useful suggestions.
3769 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3771 * src/lyxlex_pimpl.C (setFile): change error message to debug
3774 2000-09-13 Juergen Vigna <jug@sad.it>
3776 * src/frontends/xforms/FormDocument.C: implemented choice_class
3777 as combox and give callback to combo_language so OK/Apply is activated
3780 * src/bufferlist.C (newFile): small fix so already named files
3781 (via an open call) are not requested to be named again on the
3784 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3786 * src/frontends/kde/Makefile.am
3787 * src/frontends/kde/FormRef.C
3788 * src/frontends/kde/FormRef.h
3789 * src/frontends/kde/formrefdialog.C
3790 * src/frontends/kde/formrefdialog.h: implement
3793 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3795 * src/frontends/kde/formtocdialog.C
3796 * src/frontends/kde/formtocdialog.h
3797 * src/frontends/kde/FormToc.C
3798 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3800 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3802 * src/frontends/kde/FormCitation.C: fix thinko
3803 where we didn't always display the reference text
3806 * src/frontends/kde/formurldialog.C
3807 * src/frontends/kde/formurldialog.h
3808 * src/frontends/kde/FormUrl.C
3809 * src/frontends/kde/FormUrl.h: minor cleanups
3811 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3813 * src/frontends/kde/Makefile.am
3814 * src/frontends/kde/FormToc.C
3815 * src/frontends/kde/FormToc.h
3816 * src/frontends/kde/FormCitation.C
3817 * src/frontends/kde/FormCitation.h
3818 * src/frontends/kde/FormIndex.C
3819 * src/frontends/kde/FormIndex.h
3820 * src/frontends/kde/formtocdialog.C
3821 * src/frontends/kde/formtocdialog.h
3822 * src/frontends/kde/formcitationdialog.C
3823 * src/frontends/kde/formcitationdialog.h
3824 * src/frontends/kde/formindexdialog.C
3825 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3827 2000-09-12 Juergen Vigna <jug@sad.it>
3829 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3832 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3834 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3837 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3839 * src/converter.C (Add, Convert): Added support for converter flags:
3840 needaux, resultdir, resultfile.
3841 (Convert): Added new parameter view_file.
3842 (dvips_options): Fixed letter paper option.
3844 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3845 (Export, GetExportableFormats, GetViewableFormats): Added support
3848 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3850 (easyParse): Fixed to work with new export code.
3852 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3855 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3857 * lib/bind/*.bind: Replaced
3858 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3859 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3861 2000-09-11 Juergen Vigna <jug@sad.it>
3863 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3865 * src/main.C (main): now GUII defines global guiruntime!
3867 * src/frontends/gnome/GUIRunTime.C (initApplication):
3868 * src/frontends/kde/GUIRunTime.C (initApplication):
3869 * src/frontends/xforms/GUIRunTime.C (initApplication):
3870 * src/frontends/GUIRunTime.h: added new function initApplication.
3872 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3874 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3876 2000-09-08 Juergen Vigna <jug@sad.it>
3878 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3879 we have already "Reset".
3881 * src/language.C (initL): inserted "default" language and made this
3882 THE default language (and not american!)
3884 * src/paragraph.C: inserted handling of "default" language!
3886 * src/lyxfont.C: ditto
3890 * src/paragraph.C: output the \\par only if we have a following
3891 paragraph otherwise it's not needed.
3893 2000-09-05 Juergen Vigna <jug@sad.it>
3895 * config/pspell.m4: added entry to lyx-flags
3897 * src/spellchecker.C: modified version from Kevin for using pspell
3899 2000-09-01 Marko Vendelin <markov@ioc.ee>
3900 * src/frontends/gnome/Makefile.am
3901 * src/frontends/gnome/FormCitation.C
3902 * src/frontends/gnome/FormCitation.h
3903 * src/frontends/gnome/diainsertcitation_callbacks.c
3904 * src/frontends/gnome/diainsertcitation_callbacks.h
3905 * src/frontends/gnome/diainsertcitation_interface.c
3906 * src/frontends/gnome/diainsertcitation_interface.h
3907 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3908 dialog for Gnome frontend
3910 * src/main.C: Gnome libraries require keeping application name
3911 and its version as strings
3913 * src/frontends/gnome/mainapp.C: Change the name of the main window
3914 from GnomeLyX to PACKAGE
3916 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3918 * src/frontends/Liason.C: add "using: declaration.
3920 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3922 * src/mathed/math_macro.C (Metrics): Set the size of the template
3924 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3926 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3928 * src/converter.C (add_options): New function.
3929 (SetViewer): Change $$FName into '$$FName'.
3930 (View): Add options when running xdvi
3931 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3932 (Convert): The 3rd parameter is now the desired filename. Converts
3933 calls to lyx::rename if necessary.
3934 Add options when running dvips.
3935 (dvi_papersize,dvips_options): New methods.
3937 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3939 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3940 using a call to Converter::dvips_options.
3941 Fixed to work with nex export code.
3943 * src/support/copy.C
3944 * src/support/rename.C: New files
3946 * src/support/syscall.h
3947 * src/support/syscall.C: Added Starttype SystemDontWait.
3949 * lib/ui/default.ui: Changed to work with new export code
3951 * lib/configure.m4: Changed to work with new export code
3953 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3955 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3957 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3958 so that code compiles with DEC cxx.
3960 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3961 to work correctly! Also now supports the additional elements
3964 2000-09-01 Allan Rae <rae@lyx.org>
3966 * src/frontends/ButtonPolicies.C: renamed all the references to
3967 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3969 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3970 since it's a const not a type.
3972 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3974 2000-08-31 Juergen Vigna <jug@sad.it>
3976 * src/insets/figinset.C: Various changes to look if the filename has
3977 an extension and if not add it for inline previewing.
3979 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3981 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3982 make buttonStatus and isReadOnly be const methods. (also reflect
3983 this in derived classes.)
3985 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3986 (nextState): change to be static inline, pass the StateMachine as
3988 (PreferencesPolicy): remove casts
3989 (OkCancelPolicy): remvoe casts
3990 (OkCancelReadOnlyPolicy): remove casts
3991 (NoRepeatedApplyReadOnlyPolicy): remove casts
3992 (OkApplyCancelReadOnlyPolicy): remove casts
3993 (OkApplyCancelPolicy): remove casts
3994 (NoRepeatedApplyPolicy): remove casts
3996 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3998 * src/converter.C: added some using directives
4000 * src/frontends/ButtonPolicies.C: changes to overcome
4001 "need lvalue" error with DEC c++
4003 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4004 to WMHideCB for DEC c++
4006 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4008 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4009 to BulletBMTableCB for DEC c++
4011 2000-08-31 Allan Rae <rae@lyx.org>
4013 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4014 character dialog separately from old document dialogs combo_language.
4017 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4019 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4020 Removed LFUN_REF_CREATE.
4022 * src/MenuBackend.C: Added new tags: toc and references
4024 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4025 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4027 (add_toc, add_references): New methods.
4028 (create_submenu): Handle correctly the case when there is a
4029 seperator after optional menu items.
4031 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4032 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4033 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4035 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4037 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4039 * src/converter.[Ch]: New file for converting between different
4042 * src/export.[Ch]: New file for exporting a LyX file to different
4045 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4046 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4047 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4048 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4049 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4050 RunDocBook, MenuExport.
4052 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4053 Exporter::Preview methods if NEW_EXPORT is defined.
4055 * src/buffer.C (Dispatch): Use Exporter::Export.
4057 * src/lyxrc.C: Added new tags: \converter and \viewer.
4060 * src/LyXAction.C: Define new lyx-function: buffer-update.
4061 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4062 when NEW_EXPORT is defined.
4064 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4066 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4068 * lib/ui/default.ui: Added submenus "view" and "update" to the
4071 * src/filetools.C (GetExtension): New function.
4073 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4075 2000-08-29 Allan Rae <rae@lyx.org>
4077 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4079 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4080 (EnableDocumentLayout): removed
4081 (DisableDocumentLayout): removed
4082 (build): make use of ButtonController's read-only handling to
4083 de/activate various objects. Replaces both of the above functions.
4085 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4086 (readOnly): was read_only
4087 (refresh): fixed dumb mistakes with read_only_ handling
4089 * src/frontends/xforms/forms/form_document.fd:
4090 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4091 tabbed dialogs so the tabs look more like tabs and so its easier to
4092 work out which is the current tab.
4094 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4095 segfault with form_table
4097 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4099 2000-08-28 Juergen Vigna <jug@sad.it>
4101 * acconfig.h: added USE_PSPELL.
4103 * src/config.h.in: added USE_PSPELL.
4105 * autogen.sh: added pspell.m4
4107 * config/pspell.m4: new file.
4109 * src/spellchecker.C: implemented support for pspell libary.
4111 2000-08-25 Juergen Vigna <jug@sad.it>
4113 * src/LyXAction.C (init): renamed LFUN_TABLE to
4114 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4116 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4118 * src/lyxscreen.h: add force_clear variable and fuction to force
4119 a clear area when redrawing in LyXText.
4121 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4123 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4125 * some whitespace and comment changes.
4127 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4129 * src/buffer.C: up te LYX_FORMAT to 2.17
4131 2000-08-23 Juergen Vigna <jug@sad.it>
4133 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4136 * src/insets/insettabular.C (pasteSelection): delete the insets
4137 LyXText as it is not valid anymore.
4138 (copySelection): new function.
4139 (pasteSelection): new function.
4140 (cutSelection): new function.
4141 (LocalDispatch): implemented cut/copy/paste of cell selections.
4143 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4144 don't have a LyXText.
4146 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4148 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4151 2000-08-22 Juergen Vigna <jug@sad.it>
4153 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4154 ifdef form_table out if NEW_TABULAR.
4156 2000-08-21 Juergen Vigna <jug@sad.it>
4158 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4159 (draw): fixed draw position so that the cursor is positioned in the
4161 (InsetMotionNotify): hide/show cursor so the position is updated.
4162 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4163 using cellstart() function where it should be used.
4165 * src/insets/insettext.C (draw): ditto.
4167 * src/tabular.C: fixed initialization of some missing variables and
4168 made BoxType into an enum.
4170 2000-08-22 Marko Vendelin <markov@ioc.ee>
4171 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4172 stock menu item using action numerical value, not its string
4176 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4178 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4179 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4181 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4183 * src/frontends/xforms/GUIRunTime.C: new file
4185 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4186 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4188 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4190 * src/frontends/kde/GUIRunTime.C: new file
4192 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4193 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4195 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4197 * src/frontends/gnome/GUIRunTime.C: new file
4199 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4202 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4203 small change to documetentation.
4205 * src/frontends/GUIRunTime.C: removed file
4207 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4209 * src/lyxparagraph.h: enable NEW_TABULAR as default
4211 * src/lyxfunc.C (processKeySym): remove some commented code
4213 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4214 NEW_TABULAR around the fd_form_table_options.
4216 * src/lyx_gui.C (runTime): call the static member function as
4217 GUIRunTime::runTime().
4219 2000-08-21 Allan Rae <rae@lyx.org>
4221 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4224 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4226 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4228 2000-08-21 Allan Rae <rae@lyx.org>
4230 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4231 keep Garst happy ;-)
4232 * src/frontends/xforms/FormPreferences.C (build): use setOK
4233 * src/frontends/xforms/FormDocument.C (build): use setOK
4234 (FormDocument): use the appropriate policy.
4236 2000-08-21 Allan Rae <rae@lyx.org>
4238 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4239 automatic [de]activation of arbitrary objects when in a read-only state.
4241 * src/frontends/ButtonPolicies.h: More documentation
4242 (isReadOnly): added to support the above.
4244 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4246 2000-08-18 Juergen Vigna <jug@sad.it>
4248 * src/insets/insettabular.C (getStatus): changed to return func_status.
4250 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4251 display toggle menu entries if they are.
4253 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4254 new document layout now.
4256 * src/lyxfunc.C: ditto
4258 * src/lyx_gui_misc.C: ditto
4260 * src/lyx_gui.C: ditto
4262 * lib/ui/default.ui: removed paper and quotes layout as they are now
4263 all in the document layout tabbed folder.
4265 * src/frontends/xforms/forms/form_document.fd: added Restore
4266 button and callbacks for all inputs for Allan's ButtonPolicy.
4268 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4269 (CheckChoiceClass): added missing params setting on class change.
4270 (UpdateLayoutDocument): added for updating the layout on params.
4271 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4272 (FormDocument): Implemented Allan's ButtonPolicy with the
4275 2000-08-17 Allan Rae <rae@lyx.org>
4277 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4278 so we can at least see the credits again.
4280 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4281 controller calls for the appropriate callbacks. Note that since Ok
4282 calls apply followed by cancel, and apply isn't a valid input for the
4283 APPLIED state, the bc_ calls have to be made in the static callback not
4284 within each of the real callbacks.
4286 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4287 (setOk): renamed from setOkay()
4289 2000-08-17 Juergen Vigna <jug@sad.it>
4291 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4292 in the implementation part.
4293 (composeUIInfo): don't show optional menu-items.
4295 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4297 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4299 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4300 text-state when in a text-inset.
4302 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4304 2000-08-17 Marko Vendelin <markov@ioc.ee>
4305 * src/frontends/gnome/FormIndex.C
4306 * src/frontends/gnome/FormIndex.h
4307 * src/frontends/gnome/FormToc.C
4308 * src/frontends/gnome/FormToc.h
4309 * src/frontends/gnome/dialogs
4310 * src/frontends/gnome/diatoc_callbacks.c
4311 * src/frontends/gnome/diatoc_callbacks.h
4312 * src/frontends/gnome/diainsertindex_callbacks.h
4313 * src/frontends/gnome/diainsertindex_callbacks.c
4314 * src/frontends/gnome/diainsertindex_interface.c
4315 * src/frontends/gnome/diainsertindex_interface.h
4316 * src/frontends/gnome/diatoc_interface.h
4317 * src/frontends/gnome/diatoc_interface.c
4318 * src/frontends/gnome/Makefile.am: Table of Contents and
4319 Insert Index dialogs implementation for Gnome frontend
4321 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4323 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4325 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4328 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4330 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4331 destructor. Don't definde if you don't need it
4332 (processEvents): made static, non-blocking events processing for
4334 (runTime): static method. event loop for xforms
4335 * similar as above for kde and gnome.
4337 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4338 new Pimpl is correct
4339 (runTime): new method calss the real frontends runtime func.
4341 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4343 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4345 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4347 2000-08-16 Juergen Vigna <jug@sad.it>
4349 * src/lyx_gui.C (runTime): added GUII RunTime support.
4351 * src/frontends/Makefile.am:
4352 * src/frontends/GUIRunTime.[Ch]:
4353 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4354 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4355 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4357 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4359 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4360 as this is already set in ${FRONTEND_INCLUDE} if needed.
4362 * configure.in (CPPFLAGS): setting the include dir for the frontend
4363 directory and don't set FRONTEND=xforms for now as this is executed
4366 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4368 * src/frontends/kde/Makefile.am:
4369 * src/frontends/kde/FormUrl.C:
4370 * src/frontends/kde/FormUrl.h:
4371 * src/frontends/kde/formurldialog.h:
4372 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4374 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4376 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4378 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4380 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4383 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4385 * src/WorkArea.C (work_area_handler): more work to get te
4386 FL_KEYBOARD to work with xforms 0.88 too, please test.
4388 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4390 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4392 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4395 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4397 * src/Timeout.h: remove Qt::emit hack.
4399 * several files: changes to allo doc++ compilation
4401 * src/lyxfunc.C (processKeySym): new method
4402 (processKeyEvent): comment out if FL_REVISION < 89
4404 * src/WorkArea.C: change some debugging levels.
4405 (WorkArea): set wantkey to FL_KEY_ALL
4406 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4407 clearer code and the use of compose with XForms 0.89. Change to
4408 use signals instead of calling methods in bufferview directly.
4410 * src/Painter.C: change some debugging levels.
4412 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4415 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4416 (workAreaKeyPress): new method
4418 2000-08-14 Juergen Vigna <jug@sad.it>
4420 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4422 * config/kde.m4: addes some features
4424 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4425 include missing xforms dialogs.
4427 * src/Timeout.h: a hack to be able to compile with qt/kde.
4429 * sigc++/.cvsignore: added acinclude.m4
4431 * lib/.cvsignore: added listerros
4433 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4434 xforms tree as objects are needed for other frontends.
4436 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4437 linking with not yet implemented xforms objects.
4439 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4441 2000-08-14 Baruch Even <baruch.even@writeme.com>
4443 * src/frontends/xforms/FormGraphics.h:
4444 * src/frontends/xforms/FormGraphics.C:
4445 * src/frontends/xforms/RadioButtonGroup.h:
4446 * src/frontends/xforms/RadioButtonGroup.C:
4447 * src/insets/insetgraphics.h:
4448 * src/insets/insetgraphics.C:
4449 * src/insets/insetgraphicsParams.h:
4450 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4451 instead of spaces, and various other indentation issues to make the
4452 sources more consistent.
4454 2000-08-14 Marko Vendelin <markov@ioc.ee>
4456 * src/frontends/gnome/dialogs/diaprint.glade
4457 * src/frontends/gnome/FormPrint.C
4458 * src/frontends/gnome/FormPrint.h
4459 * src/frontends/gnome/diaprint_callbacks.c
4460 * src/frontends/gnome/diaprint_callbacks.h
4461 * src/frontends/gnome/diaprint_interface.c
4462 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4465 * src/frontends/gnome/dialogs/diainserturl.glade
4466 * src/frontends/gnome/FormUrl.C
4467 * src/frontends/gnome/FormUrl.h
4468 * src/frontends/gnome/diainserturl_callbacks.c
4469 * src/frontends/gnome/diainserturl_callbacks.h
4470 * src/frontends/gnome/diainserturl_interface.c
4471 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4472 Gnome implementation
4474 * src/frontends/gnome/Dialogs.C
4475 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4476 all other dialogs. Copy all unimplemented dialogs from Xforms
4479 * src/frontends/gnome/support.c
4480 * src/frontends/gnome/support.h: support files generated by Glade
4484 * config/gnome.m4: Gnome configuration scripts
4486 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4487 configure --help message
4489 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4490 only if there are no events pendling in Gnome/Gtk. This enhances
4491 the performance of menus.
4494 2000-08-14 Allan Rae <rae@lyx.org>
4496 * lib/Makefile.am: listerrors cleaning
4498 * lib/listerrors: removed -- generated file
4499 * acinclude.m4: ditto
4500 * sigc++/acinclude.m4: ditto
4502 * src/frontends/xforms/forms/form_citation.fd:
4503 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4506 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4507 `updatesrc` and now we have a `test` target that does what `updatesrc`
4508 used to do. I didn't like having an install target that wasn't related
4511 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4512 on all except FormGraphics. This may yet happen. Followed by a major
4513 cleanup including using FL_TRANSIENT for most of the dialogs. More
4514 changes to come when the ButtonController below is introduced.
4516 * src/frontends/xforms/ButtonController.h: New file for managing up to
4517 four buttons on a dialog according to an externally defined policy.
4518 * src/frontends/xforms/Makefile.am: added above
4520 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4521 Apply and Cancel/Close buttons and everything in between and beyond.
4522 * src/frontends/Makefile.am: added above.
4524 * src/frontends/xforms/forms/form_preferences.fd:
4525 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4526 and removed variable 'status' as a result. Fixed the set_minsize thing.
4527 Use the new screen-font-update after checking screen fonts were changed
4528 Added a "Restore" button to restore the original lyxrc values while
4529 editing. This restores everything not just the last input changed.
4530 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4532 * src/LyXAction.C: screen-font-update added for updating buffers after
4533 screen font settings have been changed.
4534 * src/commandtags.h: ditto
4535 * src/lyxfunc.C: ditto
4537 * forms/lyx.fd: removed screen fonts dialog.
4538 * src/lyx_gui.C: ditto
4539 * src/menus.[Ch]: ditto
4540 * src/lyx.[Ch]: ditto
4541 * src/lyx_cb.C: ditto + code from here moved to make
4542 screen-font-update. And people wonder why progress on GUII is
4543 slow. Look at how scattered this stuff was! It takes forever
4546 * forms/fdfix.sh: Fixup the spacing after commas.
4547 * forms/makefile: Remove date from generated files. Fewer clashes now.
4548 * forms/bullet_forms.C.patch: included someones handwritten changes
4550 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4551 once I've discovered why LyXRC was made noncopyable.
4552 * src/lyx_main.C: ditto
4554 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4556 * src/frontends/xforms/forms/fdfix.sh:
4557 * src/frontends/xforms/forms/fdfixh.sed:
4558 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4559 * src/frontends/xforms/Form*.[hC]:
4560 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4561 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4562 provide a destructor for the struct FD_form_xxxx. Another version of
4563 the set_[max|min]size workaround and a few other cleanups. Actually,
4564 Angus' patch from 20000809.
4566 2000-08-13 Baruch Even <baruch.even@writeme.com>
4568 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4571 2000-08-11 Juergen Vigna <jug@sad.it>
4573 * src/insets/insetgraphics.C (InsetGraphics): changing init
4574 order because of warnings.
4576 * src/frontends/xforms/forms/makefile: adding patching .C with
4579 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4580 from .C.patch to .c.patch
4582 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4583 order because of warning.
4585 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4587 * src/frontends/Liason.C (setMinibuffer): new helper function
4589 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4591 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4593 * lib/ui/default.ui: commented out PaperLayout entry
4595 * src/frontends/xforms/form_document.[Ch]: new added files
4597 * src/frontends/xforms/FormDocument.[Ch]: ditto
4599 * src/frontends/xforms/forms/form_document.fd: ditto
4601 * src/frontends/xforms/forms/form_document.C.patch: ditto
4603 2000-08-10 Juergen Vigna <jug@sad.it>
4605 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4606 (InsetGraphics): initialized cacheHandle to 0.
4607 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4609 2000-08-10 Baruch Even <baruch.even@writeme.com>
4611 * src/graphics/GraphicsCache.h:
4612 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4613 correctly as a cache.
4615 * src/graphics/GraphicsCacheItem.h:
4616 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4619 * src/graphics/GraphicsCacheItem_pimpl.h:
4620 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4623 * src/insets/insetgraphics.h:
4624 * src/insets/insetgraphics.C: Changed from using a signal notification
4625 to polling when image is not loaded.
4627 2000-08-10 Allan Rae <rae@lyx.org>
4629 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4630 that there are two functions that have to been taken out of line by
4631 hand and aren't taken care of in the script. (Just a reminder note)
4633 * sigc++/macros/*.h.m4: Updated as above.
4635 2000-08-09 Juergen Vigna <jug@sad.it>
4637 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4639 * src/insets/insettabular.C: make drawing of single cell smarter.
4641 2000-08-09 Marko Vendelin <markov@ioc.ee>
4642 * src/frontends/gnome/Menubar_pimpl.C
4643 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4644 implementation: new files
4646 * src/frontends/gnome/mainapp.C
4647 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4650 * src/main.C: create Gnome main window
4652 * src/frontends/xforms/Menubar_pimpl.h
4653 * src/frontends/Menubar.C
4654 * src/frontends/Menubar.h: added method Menubar::update that calls
4655 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4657 * src/LyXView.C: calls Menubar::update to update the state
4660 * src/frontends/gnome/Makefile.am: added new files
4662 * src/frontends/Makefile.am: added frontend compiler options
4664 2000-08-08 Juergen Vigna <jug@sad.it>
4666 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4668 * src/bufferlist.C (close):
4669 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4670 documents if exiting without saving.
4672 * src/buffer.C (save): use removeAutosaveFile()
4674 * src/support/filetools.C (removeAutosaveFile): new function.
4676 * src/lyx_cb.C (MenuWrite): returns a bool now.
4677 (MenuWriteAs): check if file could really be saved and revert to the
4679 (MenuWriteAs): removing old autosavefile if existant.
4681 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4682 before Goto toggle declaration, because of compiler warning.
4684 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4686 * src/lyxfunc.C (MenuNew): small fix.
4688 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4690 * src/bufferlist.C (newFile):
4691 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4693 * src/lyxrc.C: added new_ask_filename tag
4695 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4697 * src/lyx.fd: removed code pertaining to form_ref
4698 * src/lyx.[Ch]: ditto
4699 * src/lyx_cb.C: ditto
4700 * src/lyx_gui.C: ditto
4701 * src/lyx_gui_misc.C: ditto
4703 * src/BufferView_pimpl.C (restorePosition): update buffer only
4706 * src/commandtags.h (LFUN_REFTOGGLE): removed
4707 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4708 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4709 (LFUN_REFBACK): renamed LFUN_REF_BACK
4711 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4712 * src/menus.C: ditto
4713 * src/lyxfunc.C (Dispatch): ditto.
4714 InsertRef dialog is now GUI-independent.
4716 * src/texrow.C: added using std::endl;
4718 * src/insets/insetref.[Ch]: strip out large amounts of code.
4719 The inset is now a container and this functionality is now
4720 managed by a new FormRef dialog
4722 * src/frontends/Dialogs.h (showRef, createRef): new signals
4724 * src/frontends/xforms/FormIndex.[Ch],
4725 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4726 when setting dialog's min/max size
4727 * src/frontends/xforms/FormIndex.[Ch]: ditto
4729 * src/frontends/xforms/FormRef.[Ch],
4730 src/frontends/xforms/forms/form_ref.fd: new xforms
4731 implementation of an InsetRef dialog
4733 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4736 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4737 ios::nocreate is not part of the standard. Removed.
4739 2000-08-07 Baruch Even <baruch.even@writeme.com>
4741 * src/graphics/Renderer.h:
4742 * src/graphics/Renderer.C: Added base class for rendering of different
4743 image formats into Pixmaps.
4745 * src/graphics/XPM_Renderer.h:
4746 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4747 in a different class.
4749 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4750 easily add support for other formats.
4752 * src/insets/figinset.C: plugged a leak of an X resource.
4754 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4756 * src/CutAndPaste.[Ch]: make all metods static.
4758 * development/Code_rules/Rules: more work, added section on
4759 Exceptions, and a References section.
4761 * a lot of header files: work to make doc++ able to generate the
4762 source documentation, some workarounds of doc++ problems. Doc++ is
4763 now able to generate the documentation.
4765 2000-08-07 Juergen Vigna <jug@sad.it>
4767 * src/insets/insettabular.C (recomputeTextInsets): removed function
4769 * src/tabular.C (SetWidthOfMulticolCell):
4771 (calculate_width_of_column_NMC): fixed return value so that it really
4772 only returns true if the column-width has changed (there where
4773 problems with muliticolumn-cells in this column).
4775 2000-08-04 Juergen Vigna <jug@sad.it>
4777 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4778 also on the scrollstatus of the inset.
4779 (workAreaMotionNotify): ditto.
4781 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4783 2000-08-01 Juergen Vigna <jug@sad.it>
4785 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4787 * src/commandtags.h:
4788 * src/LyXAction.C (init):
4789 * src/insets/inset.C (LocalDispatch): added support for
4792 * src/insets/inset.C (scroll): new functions.
4794 * src/insets/insettext.C (removeNewlines): new function.
4795 (SetAutoBreakRows): removes forced newlines in the text of the
4796 paragraph if autoBreakRows is set to false.
4798 * src/tabular.C (Latex): generates a parbox around the cell contents
4801 * src/frontends/xforms/FormTabular.C (local_update): removed
4802 the radio_useparbox button.
4804 * src/tabular.C (UseParbox): new function
4806 2000-08-06 Baruch Even <baruch.even@writeme.com>
4808 * src/graphics/GraphicsCache.h:
4809 * src/graphics/GraphicsCache.C:
4810 * src/graphics/GraphicsCacheItem.h:
4811 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4814 * src/insets/insetgraphics.h:
4815 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4816 and the drawing of the inline image.
4818 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4819 loaded into the wrong position.
4821 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4824 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4826 * src/support/translator.h: move all typedefs to public section
4828 * src/support/filetools.C (MakeLatexName): return string const
4830 (TmpFileName): ditto
4831 (FileOpenSearch): ditto
4833 (LibFileSearch): ditto
4834 (i18nLibFileSearch): ditto
4837 (CreateTmpDir): ditto
4838 (CreateBufferTmpDir): ditto
4839 (CreateLyXTmpDir): ditto
4842 (MakeAbsPath): ditto
4844 (OnlyFilename): ditto
4846 (NormalizePath): ditto
4847 (CleanupPath): ditto
4848 (GetFileContents): ditto
4849 (ReplaceEnvironmentPath): ditto
4850 (MakeRelPath): ditto
4852 (ChangeExtension): ditto
4853 (MakeDisplayPath): ditto
4854 (do_popen): return cmdret const
4855 (findtexfile): return string const
4857 * src/support/DebugStream.h: add some /// to please doc++
4859 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4861 * src/texrow.C (same_rownumber): functor to use with find_if
4862 (getIdFromRow): rewritten to use find_if and to not update the
4863 positions. return true if row is found
4864 (increasePos): new method, use to update positions
4866 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4868 * src/lyxlex_pimpl.C (verifyTable): new method
4871 (GetString): return string const
4872 (pushTable): rewrite to use std::stack
4874 (setFile): better check
4877 * src/lyxlex.h: make LyXLex noncopyable
4879 * src/lyxlex.C (text): return char const * const
4880 (GetString): return string const
4881 (getLongString): return string const
4883 * src/lyx_gui_misc.C (askForText): return pair<...> const
4885 * src/lastfiles.[Ch] (operator): return string const
4887 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4888 istringstream not char const *.
4889 move token.end() out of loop.
4890 (readFile): move initializaton of token
4892 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4893 getIdFromRow is successful.
4895 * lib/bind/emacs.bind: don't include menus bind
4897 * development/Code_rules/Rules: the beginnings of making this
4898 better and covering more of the unwritten rules that we have.
4900 * development/Code_rules/Recommendations: a couple of wording
4903 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4905 * src/support/strerror.c: remove C++ comment.
4907 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4909 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4910 LFUN_INDEX_INSERT_LAST
4912 * src/texrow.C (getIdFromRow): changed from const_iterator to
4913 iterator, allowing code to compile with DEC cxx
4915 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4916 stores part of the class, as suggested by Allan. Will allow
4918 (apply): test to apply uses InsetCommandParams operator!=
4920 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4921 (apply): test to apply uses InsetCommandParams operator!=
4923 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4924 stores part of the class.
4925 (update): removed limits on min/max size.
4927 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4928 (apply): test to apply uses InsetCommandParams operator!=
4930 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4931 (Read, Write, scanCommand, getCommand): moved functionality
4932 into InsetCommandParams.
4934 (getScreenLabel): made pure virtual
4935 new InsetCommandParams operators== and !=
4937 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4938 c-tors based on InsetCommandParams. Removed others.
4939 * src/insets/insetinclude.[Ch]: ditto
4940 * src/insets/insetlabel.[Ch]: ditto
4941 * src/insets/insetparent.[Ch]: ditto
4942 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4944 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4945 insets derived from InsetCommand created using similar c-tors
4946 based on InsetCommandParams
4947 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4948 * src/menus.C (ShowRefsMenu): ditto
4949 * src/paragraph.C (Clone): ditto
4950 * src/text2.C (SetCounter): ditto
4951 * src/lyxfunc.C (Dispatch) ditto
4952 Also recreated old InsetIndex behaviour exactly. Can now
4953 index-insert at the start of a paragraph and index-insert-last
4954 without launching the pop-up.
4956 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4958 * lib/lyxrc.example: mark te pdf options as non functional.
4960 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4961 (isStrDbl): move tmpstr.end() out of loop.
4962 (strToDbl): move intialization of tmpstr
4963 (lowercase): return string const and move tmp.end() out of loop.
4964 (uppercase): return string const and move tmp.edn() out of loop.
4965 (prefixIs): add assertion
4970 (containsOnly): ditto
4971 (containsOnly): ditto
4972 (containsOnly): ditto
4973 (countChar): make last arg char not char const
4974 (token): return string const
4975 (subst): return string const, move tmp.end() out of loop.
4976 (subst): return string const, add assertion
4977 (strip): return string const
4978 (frontStrip): return string const, add assertion
4979 (frontStrip): return string const
4984 * src/support/lstrings.C: add inclde "LAssert.h"
4985 (isStrInt): move tmpstr.end() out of loop.
4987 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4988 toollist.end() out of loop.
4989 (deactivate): move toollist.end() out of loop.
4990 (update): move toollist.end() out of loop.
4991 (updateLayoutList): move tc.end() out of loop.
4992 (add): move toollist.end() out of loop.
4994 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4995 md.end() out of loop.
4997 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4999 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5002 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5003 (Erase): move insetlist.end() out of loop.
5005 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5006 ref to const string as first arg. Move initialization of some
5007 variables, whitespace changes.
5009 * src/kbmap.C (defkey): move table.end() out of loop.
5010 (kb_keymap): move table.end() out of loop.
5011 (findbinding): move table.end() out of loop.
5013 * src/MenuBackend.C (hasMenu): move end() out of loop.
5014 (getMenu): move end() out of loop.
5015 (getMenu): move menulist_.end() out of loop.
5017 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5019 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5022 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5023 (getFromLyXName): move infotab.end() out of loop.
5025 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5026 -fvtable-thunks -ffunction-sections -fdata-sections
5028 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5030 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5033 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5035 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5037 * src/frontends/xforms/FormCitation.[Ch],
5038 src/frontends/xforms/FormIndex.[Ch],
5039 src/frontends/xforms/FormToc.[Ch],
5040 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5042 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5044 * src/commandtags.h: renamed, created some flags for citation
5047 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5049 * src/lyxfunc.C (dispatch): use signals to insert index entry
5051 * src/frontends/Dialogs.h: new signal createIndex
5053 * src/frontends/xforms/FormCommand.[Ch],
5054 src/frontends/xforms/FormCitation.[Ch],
5055 src/frontends/xforms/FormToc.[Ch],
5056 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5058 * src/insets/insetindex.[Ch]: GUI-independent
5060 * src/frontends/xforms/FormIndex.[Ch],
5061 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5064 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5066 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5067 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5069 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5071 * src/insets/insetref.C (Latex): rewrite so that there is now
5072 question that a initialization is requested.
5074 * src/insets/insetcommand.h: reenable the hide signal
5076 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5078 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5079 fix handling of shortcuts (many bugs :)
5080 (add_lastfiles): ditto.
5082 * lib/ui/default.ui: fix a few shortcuts.
5084 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5086 * Makefile.am: Fix ``rpmdist'' target to return the exit
5087 status of the ``rpm'' command, instead of the last command in
5088 the chain (the ``rm lyx.xpm'' command, which always returns
5091 2000-08-02 Allan Rae <rae@lyx.org>
5093 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5094 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5095 * src/frontends/xforms/FormToc.C (FormToc): ditto
5097 * src/frontends/xforms/Makefile.am: A few forgotten files
5099 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5100 Signals-not-copyable-problem Lars' started commenting out.
5102 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5104 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5106 * src/insets/insetcommand.h: Signals is not copyable so anoter
5107 scheme for automatic hiding of forms must be used.
5109 * src/frontends/xforms/FormCitation.h: don't inerit from
5110 noncopyable, FormCommand already does that.
5111 * src/frontends/xforms/FormToc.h: ditto
5112 * src/frontends/xforms/FormUrl.h: ditto
5114 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5116 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5118 * src/insets/insetcommand.h (hide): new SigC::Signal0
5119 (d-tor) new virtual destructor emits hide signal
5121 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5122 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5124 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5125 LOF and LOT. Inset is now GUI-independent
5127 * src/insets/insetloa.[Ch]: redundant
5128 * src/insets/insetlof.[Ch]: ditto
5129 * src/insets/insetlot.[Ch]: ditto
5131 * src/frontends/xforms/forms/form_url.fd: tweaked!
5132 * src/frontends/xforms/forms/form_citation.fd: ditto
5134 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5135 dialogs dealing with InsetCommand insets
5137 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5138 FormCommand base class
5139 * src/frontends/xforms/FormUrl.[Ch]: ditto
5141 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5143 * src/frontends/xforms/FormToc.[Ch]: ditto
5145 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5146 passed a generic InsetCommand pointer
5147 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5149 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5150 and modified InsetTOC class
5151 * src/buffer.C: ditto
5153 * forms/lyx.fd: strip out old FD_form_toc code
5154 * src/lyx_gui_misc.C: ditto
5155 * src/lyx_gui.C: ditto
5156 * src/lyx_cb.C: ditto
5157 * src/lyx.[Ch]: ditto
5159 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5161 * src/support/utility.hpp: tr -d '\r'
5163 2000-08-01 Juergen Vigna <jug@sad.it>
5165 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5167 * src/commandtags.h:
5168 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5169 LFUN_TABULAR_FEATURES.
5171 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5172 LFUN_LAYOUT_TABULAR.
5174 * src/insets/insettabular.C (getStatus): implemented helper function.
5176 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5178 2000-07-31 Juergen Vigna <jug@sad.it>
5180 * src/text.C (draw): fixed screen update problem for text-insets.
5182 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5183 something changed probably this has to be added in various other
5186 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5188 2000-07-31 Baruch Even <baruch.even@writeme.com>
5190 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5191 templates to satisfy compaq cxx.
5194 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5196 * src/support/translator.h (equal_1st_in_pair::operator()): take
5197 const ref pair_type as arg.
5198 (equal_2nd_in_pair::operator()): ditto
5199 (Translator::~Translator): remove empty d-tor.
5201 * src/graphics/GraphicsCache.C: move include config.h to top, also
5202 put initialization of GraphicsCache::singleton here.
5203 (~GraphicsCache): move here
5204 (addFile): take const ref as arg
5207 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5209 * src/BufferView2.C (insertLyXFile): change te with/without header
5212 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5214 * src/frontends/xforms/FormGraphics.C (apply): add some
5215 static_cast. Not very nice, but required by compaq cxx.
5217 * src/frontends/xforms/RadioButtonGroup.h: include header
5218 <utility> instead of <pair.h>
5220 * src/insets/insetgraphicsParams.C: add using directive.
5221 (readResize): change return type to void.
5222 (readOrigin): ditto.
5224 * src/lyxfunc.C (getStatus): add missing break for build-program
5225 function; add test for Literate for export functions.
5227 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5228 entries in Options menu.
5230 2000-07-31 Baruch Even <baruch.even@writeme.com>
5232 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5233 protect against auto-allocation; release icon when needed.
5235 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5237 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5238 on usual typewriter.
5240 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5241 earlier czech.kmap), useful only for programming.
5243 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5245 * src/frontends/xforms/FormCitation.h: fix conditioning around
5248 2000-07-31 Juergen Vigna <jug@sad.it>
5250 * src/frontends/xforms/FormTabular.C (local_update): changed
5251 radio_linebreaks to radio_useparbox and added radio_useminipage.
5253 * src/tabular.C: made support for using minipages/parboxes.
5255 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5257 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5259 (descent): so the cursor is in the middle.
5260 (width): bit smaller box.
5262 * src/insets/insetgraphics.h: added display() function.
5264 2000-07-31 Baruch Even <baruch.even@writeme.com>
5266 * src/frontends/Dialogs.h: Added showGraphics signals.
5268 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5269 xforms form definition of the graphics dialog.
5271 * src/frontends/xforms/FormGraphics.h:
5272 * src/frontends/xforms/FormGraphics.C: Added files, the
5273 GUIndependent code of InsetGraphics
5275 * src/insets/insetgraphics.h:
5276 * src/insets/insetgraphics.C: Major writing to make it work.
5278 * src/insets/insetgraphicsParams.h:
5279 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5280 struct between InsetGraphics and GUI.
5282 * src/LaTeXFeatures.h:
5283 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5284 support for graphicx package.
5286 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5287 for the graphics inset.
5289 * src/support/translator.h: Added file, used in
5290 InsetGraphicsParams. this is a template to translate between two
5293 * src/frontends/xforms/RadioButtonGroup.h:
5294 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5295 way to easily control a radio button group.
5297 2000-07-28 Juergen Vigna <jug@sad.it>
5299 * src/insets/insettabular.C (LocalDispatch):
5300 (TabularFeatures): added support for lyx-functions of tabular features.
5301 (cellstart): refixed this function after someone wrongly changed it.
5303 * src/commandtags.h:
5304 * src/LyXAction.C (init): added support for tabular-features
5306 2000-07-28 Allan Rae <rae@lyx.org>
5308 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5309 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5310 triggers the callback for input checking. As a result we sometimes get
5311 "LyX: This shouldn't happen..." printed to cerr.
5312 (input): Started using status variable since I only free() on
5313 destruction. Some input checking for paths and font sizes.
5315 * src/frontends/xforms/FormPreferences.h: Use status to control
5316 activation of Ok and Apply
5318 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5319 callback. Also resized to stop segfaults with 0.88. The problem is
5320 that xforms-0.88 requires the folder to be wide enough to fit all the
5321 tabs. If it isn't it causes all sorts of problems.
5323 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5325 * src/frontends/xforms/forms/README: Reflect reality.
5327 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5328 * src/frontends/xforms/forms/makefile: ditto.
5330 * src/commandtags.h: Get access to new Preferences dialog
5331 * src/LyXAction.C: ditto
5332 * src/lyxfunc.C: ditto
5333 * lib/ui/default.ui: ditto
5335 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5337 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5339 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5342 * src/frontends/xforms/form_url.[Ch]: added.
5344 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5346 * src/insets/insetbib.h: fixed bug in previous commit
5348 * src/frontends/xforms/FormUrl.h: ditto
5350 * src/frontends/xforms/FormPrint.h: ditto
5352 * src/frontends/xforms/FormPreferences.h: ditto
5354 * src/frontends/xforms/FormCopyright.h: ditto
5356 * src/frontends/xforms/FormCitation.C: ditto
5358 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5359 private copyconstructor and private default contructor
5361 * src/support/Makefile.am: add utility.hpp
5363 * src/support/utility.hpp: new file from boost
5365 * src/insets/insetbib.h: set owner in clone
5367 * src/frontends/xforms/FormCitation.C: added missing include
5370 * src/insets/form_url.[Ch]: removed
5372 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5374 * development/lyx.spec.in
5375 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5376 file/directory re-organization.
5378 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5380 * src/insets/insetcommand.[Ch]: moved the string data and
5381 associated manipulation methods into a new stand-alone class
5382 InsetCommandParams. This class has two additional methods
5383 getAsString() and setFromString() allowing the contents to be
5384 moved around as a single string.
5385 (addContents) method removed.
5386 (setContents) method no longer virtual.
5388 * src/buffer.C (readInset): made use of new InsetCitation,
5389 InsetUrl constructors based on InsetCommandParams.
5391 * src/commandtags.h: add LFUN_INSERT_URL
5393 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5394 independent InsetUrl and use InsetCommandParams to extract
5395 string info and create new Insets.
5397 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5399 * src/frontends/xforms/FormCitation.C (apply): uses
5402 * src/frontends/xforms/form_url.C
5403 * src/frontends/xforms/form_url.h
5404 * src/frontends/xforms/FormUrl.h
5405 * src/frontends/xforms/FormUrl.C
5406 * src/frontends/xforms/forms/form_url.fd: new files
5408 * src/insets/insetcite.[Ch]: removed unused constructors.
5410 * src/insets/insetinclude.[Ch]: no longer store filename
5412 * src/insets/inseturl.[Ch]: GUI-independent.
5414 2000-07-26 Juergen Vigna <jug@sad.it>
5415 * renamed frontend from gtk to gnome as it is that what is realized
5416 and did the necessary changes in the files.
5418 2000-07-26 Marko Vendelin <markov@ioc.ee>
5420 * configure.in: cleaning up gnome configuration scripts
5422 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5424 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5425 shortcuts syndrom by redrawing them explicitely (a better solution
5426 would be appreciated).
5428 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5430 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5433 * src/lyx_cb.C (MenuExport): change html export to do the right
5434 thing depending of the document type (instead of having
5435 html-linuxdoc and html-docbook).
5436 * src/lyxfunc.C (getStatus): update for html
5437 * lib/ui/default.ui: simplify due to the above change.
5438 * src/menus.C (ShowFileMenu): update too (in case we need it).
5440 * src/MenuBackend.C (read): if a menu is defined twice, add the
5441 new entries to the exiting one.
5443 2000-07-26 Juergen Vigna <jug@sad.it>
5445 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5447 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5448 and return a bool if it did actual save the file.
5449 (AutoSave): don't autosave a unnamed doc.
5451 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5452 check if this is an UNNAMED new file and react to it.
5453 (newFile): set buffer to unnamed and change to not mark a new
5454 buffer dirty if I didn't do anything with it.
5456 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5458 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5460 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5461 friend as per Angus's patch posted to lyx-devel.
5463 * src/ext_l10n.h: updated
5465 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5466 gettext on the style string right before inserting them into the
5469 * autogen.sh: add code to extract style strings form layout files,
5470 not good enough yet.
5472 * src/frontends/gtk/.cvsignore: add MAKEFILE
5474 * src/MenuBackend.C (read): run the label strings through gettext
5475 before storing them in the containers.
5477 * src/ext_l10n.h: new file
5479 * autogen.sh : generate the ext_l10n.h file here
5481 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5483 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5486 * lib/ui/default.ui: fix a couple of typos.
5488 * config/gnome/gtk.m4: added (and added to the list of files in
5491 * src/insets/insetinclude.C (unique_id): fix when we are using
5492 lyxstring instead of basic_string<>.
5493 * src/insets/insettext.C (LocalDispatch): ditto.
5494 * src/support/filetools.C: ditto.
5496 * lib/configure.m4: create the ui/ directory if necessary.
5498 * src/LyXView.[Ch] (updateToolbar): new method.
5500 * src/BufferView_pimpl.C (buffer): update the toolbar when
5501 opening/closing buffer.
5503 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5505 * src/LyXAction.C (getActionName): enhance to return also the name
5506 and options of pseudo-actions.
5507 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5509 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5510 as an example of what is possible). Used in File->Build too (more
5511 useful) and in the import/export menus (to mimick the complicated
5512 handling of linuxdoc and friends). Try to update all the entries.
5514 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5517 * src/MenuBackend.C (read): Parse the new OptItem tag.
5519 * src/MenuBackend.h: Add a new optional_ data member (used if the
5520 entry should be omitted when the lyxfunc is disabled).
5522 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5523 function, used as a shortcut.
5524 (create_submenu): align correctly the shortcuts on the widest
5527 * src/MenuBackend.h: MenuItem.label() only returns the label of
5528 the menu without shortcut; new method shortcut().
5530 2000-07-14 Marko Vendelin <markov@ioc.ee>
5532 * src/frontends/gtk/Dialogs.C:
5533 * src/frontends/gtk/FormCopyright.C:
5534 * src/frontends/gtk/FormCopyright.h:
5535 * src/frontends/gtk/Makefile.am: added these source-files for the
5536 Gtk/Gnome support of the Copyright-Dialog.
5538 * src/main.C: added Gnome::Main initialization if using
5539 Gtk/Gnome frontend-GUI.
5541 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5543 * config/gnome/aclocal-include.m4
5544 * config/gnome/compiler-flags.m4
5545 * config/gnome/curses.m4
5546 * config/gnome/gnome--.m4
5547 * config/gnome/gnome-bonobo-check.m4
5548 * config/gnome/gnome-common.m4
5549 * config/gnome/gnome-fileutils.m4
5550 * config/gnome/gnome-ghttp-check.m4
5551 * config/gnome/gnome-gnorba-check.m4
5552 * config/gnome/gnome-guile-checks.m4
5553 * config/gnome/gnome-libgtop-check.m4
5554 * config/gnome/gnome-objc-checks.m4
5555 * config/gnome/gnome-orbit-check.m4
5556 * config/gnome/gnome-print-check.m4
5557 * config/gnome/gnome-pthread-check.m4
5558 * config/gnome/gnome-support.m4
5559 * config/gnome/gnome-undelfs.m4
5560 * config/gnome/gnome-vfs.m4
5561 * config/gnome/gnome-x-checks.m4
5562 * config/gnome/gnome-xml-check.m4
5563 * config/gnome/gnome.m4
5564 * config/gnome/gperf-check.m4
5565 * config/gnome/gtk--.m4
5566 * config/gnome/linger.m4
5567 * config/gnome/need-declaration.m4: added configuration scripts
5568 for Gtk/Gnome frontend-GUI
5570 * configure.in: added support for the --with-frontend=gtk option
5572 * autogen.sh: added config/gnome/* to list of config-files
5574 * acconfig.h: added define for GTKGUI-support
5576 * config/lyxinclude.m4: added --with-frontend[=value] option value
5577 for Gtk/Gnome frontend-GUI support.
5579 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5581 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5585 * src/paragraph.C (GetChar): remove non-const version
5587 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5588 (search_kw): use it.
5590 * src/lyx_main.C (init): if "preferences" exist, read that instead
5592 (ReadRcFile): return bool if the file could be read ok.
5593 (ReadUIFile): add a check to see if lex file is set ok.
5595 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5596 bastring can be used instead of lyxstring (still uses the old code
5597 if std::string is good enough or if lyxstring is used.)
5599 * src/encoding.C: make the arrays static, move ininle functions
5601 * src/encoding.h: from here.
5603 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5604 (parseSingleLyXformat2Token): move inset parsing to separate method
5605 (readInset): new private method
5607 * src/Variables.h: remove virtual from get().
5609 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5610 access to NEW_INSETS and NEW_TABULAR
5612 * src/MenuBackend.h: remove superfluous forward declaration of
5613 MenuItem. Add documentations tags "///", remove empty MenuItem
5614 destructor, remove private default contructor.
5616 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5618 (read): more string mlabel and mname to where they are used
5619 (read): remove unused variables mlabel and mname
5620 (defaults): unconditional clear, make menusetup take advantage of
5621 add returning Menu &.
5623 * src/LyXView.h: define NEW_MENUBAR as default
5625 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5626 to NEW_INSETS and NEW_TABULAR.
5627 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5628 defined. Change some of the "xxxx-inset-insert" functions names to
5631 * several files: more enahncements to NEW_INSETS and the resulting
5634 * lib/lyxrc.example (\date_insert_format): move to misc section
5636 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5637 bastring and use AC_CACHE_CHECK.
5638 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5639 the system have the newest methods. uses AC_CACHE_CHECK
5640 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5641 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5642 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5644 * configure.in: add LYX_CXX_GOOD_STD_STRING
5646 * acinclude.m4: recreated
5648 2000-07-24 Amir Karger <karger@lyx.org>
5650 * README: add Hebrew, Arabic kmaps
5653 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5655 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5658 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5660 * Lot of files: add pragma interface/implementation.
5662 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5664 * lib/ui/default.ui: new file (ans new directory). Contains the
5665 default menu and toolbar.
5667 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5668 global space. Toolbars are now read (as menus) in ui files.
5670 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5672 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5673 is disabled because the document is read-only. We want to have the
5674 toggle state of the function anyway.
5675 (getStatus): add code for LFUN_VC* functions (mimicking what is
5676 done in old-style menus)
5678 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5679 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5681 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5682 * src/BufferView_pimpl.C: ditto.
5683 * src/lyxfunc.C: ditto.
5685 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5686 default). This replaces old-style menus by new ones.
5688 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5689 MenuItem. Contain the data structure of a menu.
5691 * src/insets/insettext.C: use LyXView::setLayout instead of
5692 accessing directly the toolbar combox.
5693 * src/lyxfunc.C (Dispatch): ditto.
5695 * src/LyXView.C (setLayout): new method, which just calls
5696 Toolbar::setLayout().
5697 (updateLayoutChoice): move part of this method in Toolbar.
5699 * src/toolbar.[Ch]: removed.
5701 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5702 implementation the toolbar.
5704 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5705 the toolbar. It might make sense to merge it with ToolbarDefaults
5707 (setLayout): new function.
5708 (updateLayoutList): ditto.
5709 (openLayoutList): ditto.
5711 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5712 xforms implementation of the toolbar.
5713 (get_toolbar_func): comment out, since I do not
5714 know what it is good for.
5716 * src/ToolbarDefaults.h: Add the ItemType enum.
5718 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5719 for a list of allocated C strings. Used in Menubar xforms
5720 implementation to avoid memory leaks.
5722 * src/support/lstrings.[Ch] (uppercase): new version taking and
5726 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5727 * lib/bind/emacs.bind: ditto.
5729 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5731 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5732 forward decl of LyXView.
5734 * src/toolbar.C (toolbarItem): moved from toolbar.h
5735 (toolbarItem::clean): ditto
5736 (toolbarItem::~toolbarItem): ditto
5737 (toolbarItem::operator): ditto
5739 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5741 * src/paragraph.h: control the NEW_TABULAR define from here
5743 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5744 USE_TABULAR_INSETS to NEW_TABULAR
5746 * src/ToolbarDefaults.C: add include "lyxlex.h"
5748 * files using the old table/tabular: use NEW_TABULAR to control
5749 compilation of old tabular stuff.
5751 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5754 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5755 planemet in reading of old style floats, fix the \end_deeper
5756 problem when reading old style floats.
5758 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5760 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5762 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5764 * lib/bind/sciword.bind: updated.
5766 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5768 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5769 layout write problem
5771 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5773 * src/Makefile.am (INCLUDES): remove image directory from include
5776 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5777 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5779 * src/LyXView.C (create_form_form_main): read the application icon
5782 * lib/images/*.xpm: change the icons to use transparent color for
5785 * src/toolbar.C (update): change the color of the button when it
5788 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5790 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5791 setting explicitely the minibuffer.
5792 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5794 * src/LyXView.C (showState): new function. Shows font information
5795 in minibuffer and update toolbar state.
5796 (LyXView): call Toolbar::update after creating the
5799 * src/toolbar.C: change toollist to be a vector instead of a
5801 (BubbleTimerCB): get help string directly from the callback
5802 argument of the corresponding icon (which is the action)
5803 (set): remove unnecessary ugliness.
5804 (update): new function. update the icons (depressed, disabled)
5805 depending of the status of the corresponding action.
5807 * src/toolbar.h: remove help in toolbarItem
5809 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5811 * src/Painter.C (text): Added code for using symbol glyphs from
5812 iso10646 fonts. Currently diabled.
5814 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5817 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5818 magyar,turkish and usorbian.
5820 * src/paragraph.C (isMultiLingual): Made more efficient.
5822 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5825 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5826 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5827 Also changed the prototype to "bool math_insert_greek(char)".
5829 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5831 * lots of files: apply the NEW_INSETS on all code that will not be
5832 needed when we move to use the new insets. Enable the define in
5833 lyxparagrah.h to try it.
5835 * src/insets/insettabular.C (cellstart): change to be a static
5837 (InsetTabular): initialize buffer in the initializer list.
5839 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5841 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5842 form_print.h out of the header file. Replaced with forward
5843 declarations of the relevant struct.
5845 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5848 * src/commandtags.h: do not include "debug.h" which does not
5849 belong there. #include it in some other places because of this
5852 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5854 * src/insets/insetcaption.C: add a couple "using" directives.
5856 * src/toolbar.C (add): get the help text directly from lyxaction.
5858 (setPixmap): new function. Loads from disk and sets a pixmap on a
5859 botton; the name of the pixmap file is derived from the command
5862 * src/toolbar.h: remove members isBitmap and pixmap from
5865 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5866 * lib/images/: move many files from images/banner.xpm.
5868 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5870 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5871 * src/toolbar.C: ditto.
5872 * configure.in: ditto.
5873 * INSTALL: document.
5875 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5876 the spellchecker popup is closed from the WM.
5878 2000-07-19 Juergen Vigna <jug@sad.it>
5880 * src/insets/insetfloat.C (Write): small fix because we use the
5881 insetname for the type now!
5883 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5885 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5888 * src/frontends/Dialogs.h: removed hideCitation signal
5890 * src/insets/insetcite.h: added hide signal
5892 * src/insets/insetcite.C (~InsetCitation): emits new signal
5893 (getScreenLabel): "intelligent" label should now fit on the screen!
5895 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5897 * src/frontends/xforms/FormCitation.C (showInset): connects
5898 hide() to the inset's hide signal
5899 (show): modified to use fl_set_object_position rather than
5900 fl_set_object_geometry wherever possible
5902 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5904 * src/insets/lyxinset.h: add caption code
5906 * src/insets/insetfloat.C (type): new method
5908 * src/insets/insetcaption.C (Write): new method
5910 (LyxCode): new method
5912 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5913 to get it right together with using the FloatList.
5915 * src/commandtags.h: add LFUN_INSET_CAPTION
5916 * src/lyxfunc.C (Dispatch): handle it
5918 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5921 * src/Variables.[Ch]: make expand take a const reference, remove
5922 the destructor, some whitespace changes.
5924 * src/LyXAction.C (init): add caption-inset-insert
5926 * src/FloatList.C (FloatList): update the default floats a bit.
5928 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5930 * src/Variables.[Ch]: new files. Intended to be used for language
5931 specific strings (like \chaptername) and filename substitution in
5934 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5936 * lib/kbd/american.kmap: update
5938 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5940 * src/bufferparams.[Ch]: remove member allowAccents.
5942 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5944 * src/LaTeXLog.C: use the log_form.h header.
5945 * src/lyx_gui.C: ditto.
5946 * src/lyx_gui_misc.C: ditto.
5947 * src/lyxvc.h: ditto.
5949 * forms/log_form.fd: new file, created from latexoptions.fd. I
5950 kept the log popup and nuked the options form.
5952 * src/{la,}texoptions.[Ch]: removed.
5953 * src/lyx_cb.C (LaTeXOptions): ditto
5955 * src/lyx_gui.C (create_forms): do not handle the
5956 fd_latex_options form.
5958 2000-07-18 Juergen Vigna <jug@sad.it>
5960 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5961 name of the inset so that it can be requested outside (text2.C).
5963 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5966 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5968 * src/mathed/formula.h (ConvertFont): constify
5970 * src/mathed/formula.C (Read): add warning if \end_inset is not
5971 found on expected place.
5973 * src/insets/lyxinset.h (ConvertFont): consify
5975 * src/insets/insetquotes.C (ConvertFont): constify
5976 * src/insets/insetquotes.h: ditto
5978 * src/insets/insetinfo.h: add labelfont
5980 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5981 (ascent): use labelfont
5985 (Write): make .lyx file a bit nicer
5987 * src/insets/insetfloat.C (Write): simplify somewhat...
5988 (Read): add warning if arg is not found
5990 * src/insets/insetcollapsable.C: add using std::max
5991 (Read): move string token and add warning in arg is not found
5992 (draw): use std::max to get the right ty
5993 (getMaxWidth): simplify by using std::max
5995 * src/insets/insetsection.h: new file
5996 * src/insets/insetsection.C: new file
5997 * src/insets/insetcaption.h: new file
5998 * src/insets/insetcaption.C: new file
6000 * src/insets/inset.C (ConvertFont): constify signature
6002 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6003 insetcaption.[Ch] and insetsection.[Ch]
6005 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6006 uses to use LABEL_COUNTER_CHAPTER instead.
6007 * src/text2.C (SetCounter): here
6009 * src/counters.h: new file
6010 * src/counters.C: new file
6011 * src/Sectioning.h: new file
6012 * src/Sectioning.C: new file
6014 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6016 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6018 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6021 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6024 2000-07-17 Juergen Vigna <jug@sad.it>
6026 * src/tabular.C (Validate): check if array-package is needed.
6027 (SetVAlignment): added support for vertical alignment.
6028 (SetLTFoot): better support for longtable header/footers
6029 (Latex): modified to support added features.
6031 * src/LaTeXFeatures.[Ch]: added array-package.
6033 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6035 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6038 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6040 * configure.in: do not forget to put a space after -isystem.
6042 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6044 * lib/kbd/arabic.kmap: a few fixes.
6046 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6048 * some whitespace chagnes to a number of files.
6050 * src/support/DebugStream.h: change to make it easier for
6051 doc++ to parse correctly.
6052 * src/support/lyxstring.h: ditto
6054 * src/mathed/math_utils.C (compara): change to have only one
6056 (MathedLookupBOP): change because of the above.
6058 * src/mathed/math_delim.C (math_deco_compare): change to have only
6060 (search_deco): change becasue of the above.
6062 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6063 instead of manually coded one.
6065 * src/insets/insetquotes.C (Read): read the \end_inset too
6067 * src/insets/insetlatex.h: remove file
6068 * src/insets/insetlatex.C: remove file
6070 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6072 (InsetPrintIndex): remove destructor
6074 * src/insets/insetinclude.h: remove default constructor
6076 * src/insets/insetfloat.C: work to make it work better
6078 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6080 * src/insets/insetcite.h (InsetCitation): remove default constructor
6082 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6084 * src/text.C (GetColumnNearX): comment out some currently unused code.
6086 * src/paragraph.C (writeFile): move some initializations closer to
6088 (CutIntoMinibuffer): small change to use new matchIT operator
6092 (InsertInset): ditto
6095 (InsetIterator): ditto
6096 (Erase): small change to use new matchFT operator
6098 (GetFontSettings): ditto
6099 (HighestFontInRange): ditto
6102 * src/lyxparagraph.h: some chars changed to value_type
6103 (matchIT): because of some stronger checking (perhaps too strong)
6104 in SGI STL, the two operator() unified to one.
6107 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6109 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6110 the last inset read added
6111 (parseSingleLyXformat2Token): some more (future) compability code added
6112 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6113 (parseSingleLyXformat2Token): set last_inset_read
6114 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6115 (parseSingleLyXformat2Token): don't double intializw string next_token
6117 * src/TextCache.C (text_fits::operator()): add const's to the signature
6118 (has_buffer::operator()): ditto
6120 * src/Floating.h: add some comments on the class
6122 * src/FloatList.[Ch] (typeExist): new method
6125 * src/BackStack.h: added default constructor, wanted by Gcc.
6127 2000-07-14 Juergen Vigna <jug@sad.it>
6129 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6131 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6133 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6134 do a redraw when the window is resized!
6135 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6137 * src/insets/insettext.C (resizeLyXText): added function to correctly
6138 being able to resize the LyXWindow.
6140 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6142 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6144 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6145 crashes when closing dialog to a deleted inset.
6147 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6148 method! Now similar to other insets.
6150 2000-07-13 Juergen Vigna <jug@sad.it>
6152 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6154 * lib/examples/Literate.lyx: small patch!
6156 * src/insets/insetbib.C (Read): added this function because of wrong
6157 Write (without [begin|end]_inset).
6159 2000-07-11 Juergen Vigna <jug@sad.it>
6161 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6162 as the insertInset could not be good!
6164 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6165 the bool param should not be last.
6167 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6169 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6170 did submit that to Karl).
6172 * configure.in: use -isystem instead of -I for X headers. This
6173 fixes a problem on solaris with a recent gcc;
6174 put the front-end code after the X detection code;
6175 configure in sigc++ before lib/
6177 * src/lyx_main.C (commandLineHelp): remove -display from command
6180 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6182 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6183 Also put in Makefile rules for building the ``listerrors''
6184 program for parsing errors from literate programs written in LyX.
6186 * lib/build-listerrors: Added small shell script as part of compile
6187 process. This builds a working ``listerrors'' binary if noweb is
6188 installed and either 1) the VNC X server is installed on the machine,
6189 or 2) the user is compiling from within a GUI. The existence of a GUI
6190 is necessary to use the ``lyx --export'' feature for now. This
6191 hack can be removed once ``lyx --export'' no longer requires a GUI to
6194 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6196 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6197 now passed back correctly from gcc and placed "under" error
6198 buttons in a Literate LyX source.
6200 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6202 * src/text.C (GetColumnNearX): Better behavior when a RTL
6203 paragraph is ended by LTR text.
6205 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6208 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6210 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6211 true when clipboard is empty.
6213 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6215 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6216 row of the paragraph.
6217 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6218 to prevent calculation of bidi tables
6220 2000-07-07 Juergen Vigna <jug@sad.it>
6222 * src/screen.C (ToggleSelection): added y_offset and x_offset
6225 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6228 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6230 * src/insets/insettext.C: fixed Layout-Display!
6232 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6234 * configure.in: add check for strings.h header.
6236 * src/spellchecker.C: include <strings.h> in order to have a
6237 definition for bzero().
6239 2000-07-07 Juergen Vigna <jug@sad.it>
6241 * src/insets/insettext.C (draw): set the status of the bv->text to
6242 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6244 * src/screen.C (DrawOneRow):
6245 (DrawFromTo): redraw the actual row if something has changed in it
6248 * src/text.C (draw): call an update of the toplevel-inset if something
6249 has changed inside while drawing.
6251 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6253 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6255 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6256 processing inside class.
6258 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6259 processing inside class.
6261 * src/insets/insetindex.h new struct Holder, consistent with other
6264 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6265 citation dialog from main code and placed it in src/frontends/xforms.
6266 Dialog launched through signals instead of callbacks
6268 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6270 * lyx.man: update the options description.
6272 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6274 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6275 handle neg values, set min width to 590, add doc about -display
6277 2000-07-05 Juergen Vigna <jug@sad.it>
6279 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6280 calls to BufferView *.
6282 * src/insets/insettext.C (checkAndActivateInset): small fix non
6283 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6285 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6286 their \end_inset token!
6288 2000-07-04 edscott <edscott@imp.mx>
6290 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6291 lib/lyxrc.example: added option \wheel_jump
6293 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6295 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6296 remove support for -width,-height,-xpos and -ypos.
6298 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6300 * src/encoding.[Ch]: New files.
6302 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6303 (text): Call to the underline() method only when needed.
6305 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6307 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6308 encoding(s) for the document.
6310 * src/bufferparams.C (BufferParams): Changed default value of
6313 * src/language.C (newLang): Removed.
6314 (items[]): Added encoding information for all defined languages.
6316 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6317 encoding choice button.
6319 * src/lyxrc.h (font_norm_type): New member variable.
6320 (set_font_norm_type): New method.
6322 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6323 paragraphs with different encodings.
6325 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6326 (TransformChar): Changed to work correctly with Arabic points.
6327 (draw): Added support for drawing Arabic points.
6328 (draw): Removed code for drawing underbars (this is done by
6331 * src/support/textutils.h (IsPrintableNonspace): New function.
6333 * src/BufferView_pimpl.h: Added "using SigC::Object".
6334 * src/LyXView.h: ditto.
6336 * src/insets/insetinclude.h (include_label): Changed to mutable.
6338 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6340 * src/mathed/math_iter.h: remove empty destructor
6342 * src/mathed/math_cursor.h: remove empty destructor
6344 * src/insets/lyxinset.h: add THEOREM_CODE
6346 * src/insets/insettheorem.[Ch]: new files
6348 * src/insets/insetminipage.C: (InsertInset): remove
6350 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6352 (InsertInset): remove
6354 * src/insets/insetlist.C: (InsertList): remove
6356 * src/insets/insetfootlike.[Ch]: new files
6358 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6361 (InsertInset): ditto
6363 * src/insets/insetert.C: remove include Painter.h, reindent
6364 (InsertInset): move to header
6366 * src/insets/insetcollapsable.h: remove explicit from default
6367 contructor, remove empty destructor, add InsertInset
6369 * src/insets/insetcollapsable.C (InsertInset): new func
6371 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6373 * src/vspace.h: add explicit to constructor
6375 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6376 \textcompwordmark, please test this.
6378 * src/lyxrc.C: set ascii_linelen to 65 by default
6380 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6382 * src/commandtags.h: add LFUN_INSET_THEOREM
6384 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6385 (makeLinuxDocFile): remove _some_ of the nice logic
6386 (makeDocBookFile): ditto
6388 * src/Painter.[Ch]: (~Painter): removed
6390 * src/LyXAction.C (init): entry for insettheorem added
6392 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6394 (deplog): code to detect files generated by LaTeX, needs testing
6397 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6399 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6401 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6403 * src/LaTeX.C (deplog): Add a check for files that are going to be
6404 created by the first latex run, part of the project to remove the
6407 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6408 contents to the extension list.
6410 2000-07-04 Juergen Vigna <jug@sad.it>
6412 * src/text.C (NextBreakPoint): added support for needFullRow()
6414 * src/insets/lyxinset.h: added needFullRow()
6416 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6419 * src/insets/insettext.C: lots of changes for update!
6421 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6423 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6425 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6427 * src/insets/insetinclude.C (InsetInclude): fixed
6428 initialization of include_label.
6429 (unique_id): now returns a string.
6431 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6433 * src/LaTeXFeatures.h: new member IncludedFiles, for
6434 a map of key, included file name.
6436 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6437 with the included files for inclusion in SGML preamble,
6438 i. e., linuxdoc and docbook.
6441 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6442 nice (is the generated linuxdoc code to be exported?), that
6443 allows to remove column, and only_body that will be true for
6444 slave documents. Insets are allowed inside SGML font type.
6445 New handling of the SGML preamble for included files.
6446 (makeDocBookFile): the same for docbook.
6448 * src/insets/insetinclude.h:
6449 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6451 (DocBook): new export methods.
6453 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6454 and makeDocBookFile.
6456 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6457 formats to export with command line argument -x.
6459 2000-06-29 Juergen Vigna <jug@sad.it>
6461 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6462 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6464 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6465 region could already been cleared by an inset!
6467 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6469 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6472 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6474 (cursorToggle): remove special handling of lyx focus.
6476 2000-06-28 Juergen Vigna <jug@sad.it>
6478 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6481 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6483 * src/insets/insetindex.C (Edit): add a callback when popup is
6486 * src/insets/insettext.C (LocalDispatch):
6487 * src/insets/insetmarginal.h:
6488 * src/insets/insetlist.h:
6489 * src/insets/insetfoot.h:
6490 * src/insets/insetfloat.h:
6491 * src/insets/insetert.h: add a missing std:: qualifier.
6493 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6495 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6498 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6500 * src/insets/insettext.C (Read): remove tmptok unused variable
6501 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6502 (InsertInset): change for new InsetInset code
6504 * src/insets/insettext.h: add TEXT inline method
6506 * src/insets/insettext.C: remove TEXT macro
6508 * src/insets/insetmarginal.C (Write): new method
6509 (Latex): change output slightly
6511 * src/insets/insetfoot.C (Write): new method
6512 (Latex): change output slightly (don't use endl when no need)
6514 * src/insets/insetert.C (Write): new method
6516 * src/insets/insetcollapsable.h: make button_length, button_top_y
6517 and button_bottm_y protected.
6519 * src/insets/insetcollapsable.C (Write): simplify code by using
6520 tostr. Also do not output the float name, the children class
6521 should to that to get control over own arguments
6523 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6524 src/insets/insetminipage.[Ch]:
6527 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6529 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6531 * src/Makefile.am (lyx_SOURCES): add the new files
6533 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6534 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6535 * src/commandtags.h: ditto
6537 * src/LaTeXFeatures.h: add a std::set of used floattypes
6539 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6541 * src/FloatList.[Ch] src/Floating.h: new files
6543 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6545 * src/lyx_cb.C (TableApplyCB): ditto
6547 * src/text2.C: ditto
6548 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6549 (parseSingleLyXformat2Token): ditto + add code for
6550 backwards compability for old float styles + add code for new insets
6552 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6554 (InsertInset(size_type, Inset *, LyXFont)): new method
6555 (InsetChar(size_type, char)): changed to use the other InsetChar
6556 with a LyXFont(ALL_INHERIT).
6557 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6558 insert the META_INSET.
6560 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6562 * sigc++/thread.h (Threads): from here
6564 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6565 definition out of line
6566 * sigc++/scope.h: from here
6568 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6570 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6571 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6573 * Makefile.am (bindist): new target.
6575 * INSTALL: add instructions for doing a binary distribution.
6577 * development/tools/README.bin.example: update a bit.
6579 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6582 * lib/lyxrc.example: new lyxrc tag \set_color.
6584 * src/lyxfunc.C (Dispatch):
6585 * src/commandtags.h:
6586 * src/LyXAction.C: new lyxfunc "set-color".
6588 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6589 and an x11name given as strings.
6591 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6592 cache when a color is changed.
6594 2000-06-26 Juergen Vigna <jug@sad.it>
6596 * src/lyxrow.C (width): added this functions and variable.
6598 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6601 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6603 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6605 * images/undo_bw.xpm: new icon.
6606 * images/redo_bw.xpm: ditto.
6608 * configure.in (INSTALL_SCRIPT): change value to
6609 ${INSTALL} to avoid failures of install-script target.
6610 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6612 * src/BufferView.h: add a magic "friend" declaration to please
6615 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6617 * forms/cite.fd: modified to allow resizing without messing
6620 * src/insetcite.C: Uses code from cite.fd almost without
6622 User can now resize dialog in the x-direction.
6623 Resizing the dialog in the y-direction is prevented, as the
6624 code does this intelligently already.
6626 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6628 * INSTALL: remove obsolete entry in "problems" section.
6630 * lib/examples/sl_*.lyx: update of the slovenian examples.
6632 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6634 2000-06-23 Juergen Vigna <jug@sad.it>
6636 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6638 * src/buffer.C (resize): delete the LyXText of textinsets.
6640 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6642 * src/insets/lyxinset.h: added another parameter 'cleared' to
6643 the draw() function.
6645 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6646 unlocking inset in inset.
6648 2000-06-22 Juergen Vigna <jug@sad.it>
6650 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6651 of insets and moved first to LyXText.
6653 * src/mathed/formulamacro.[Ch]:
6654 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6656 2000-06-21 Juergen Vigna <jug@sad.it>
6658 * src/text.C (GetVisibleRow): look if I should clear the area or not
6659 using Inset::doClearArea() function.
6661 * src/insets/lyxinset.h: added doClearArea() function and
6662 modified draw(Painter &, ...) to draw(BufferView *, ...)
6664 * src/text2.C (UpdateInset): return bool insted of int
6666 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6668 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6669 combox in the character popup
6671 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6672 BufferParams const & params
6674 2000-06-20 Juergen Vigna <jug@sad.it>
6676 * src/insets/insettext.C (SetParagraphData): set insetowner on
6679 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6681 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6682 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6684 (form_main_): remove
6686 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6687 (create_form_form_main): remove FD_form_main stuff, connect to
6688 autosave_timeout signal
6690 * src/LyXView.[Ch] (getMainForm): remove
6691 (UpdateTimerCB): remove
6692 * src/BufferView_pimpl.h: inherit from SigC::Object
6694 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6695 signal instead of callback
6697 * src/BufferView.[Ch] (cursorToggleCB): remove
6699 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6701 * src/BufferView_pimpl.C: changes because of the one below
6703 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6704 instead of storing a pointer to a LyXText.
6706 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6708 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6710 * src/lyxparagraph.h
6712 * src/paragraph.C: Changed fontlist to a sorted vector.
6714 2000-06-19 Juergen Vigna <jug@sad.it>
6716 * src/BufferView.h: added screen() function.
6718 * src/insets/insettext.C (LocalDispatch): some selection code
6721 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6723 * src/insets/insettext.C (SetParagraphData):
6725 (InsetText): fixes for multiple paragraphs.
6727 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6729 * development/lyx.spec.in: Call configure with ``--without-warnings''
6730 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6731 This should be fine, however, since we generally don't want to be
6732 verbose when making an RPM.
6734 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6736 * lib/scripts/fig2pstex.py: New file
6738 2000-06-16 Juergen Vigna <jug@sad.it>
6740 * src/insets/insettabular.C (UpdateLocal):
6741 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6742 (LocalDispatch): Changed all functions to use LyXText.
6744 2000-06-15 Juergen Vigna <jug@sad.it>
6746 * src/text.C (SetHeightOfRow): call inset::update before requesting
6749 * src/insets/insettext.C (update):
6750 * src/insets/insettabular.C (update): added implementation
6752 * src/insets/lyxinset.h: added update function
6754 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6756 * src/text.C (SelectNextWord): protect against null pointers with
6757 old-style string streams. (fix from Paul Theo Gonciari
6760 * src/cite.[Ch]: remove erroneous files.
6762 * lib/configure.m4: update the list of created directories.
6764 * src/lyxrow.C: include <config.h>
6765 * src/lyxcursor.C: ditto.
6767 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6769 * lib/examples/decimal.lyx: new example file from Mike.
6771 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6772 to find template definitions (from Dekel)
6774 * src/frontends/.cvsignore: add a few things.
6776 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6778 * src/Timeout.C (TimeOut): remove default argument.
6780 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6783 * src/insets/ExternalTemplate.C: add a "using" directive.
6785 * src/lyx_main.h: remove the act_ struct, which seems unused
6788 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6790 * LyX Developers Meeting: All files changed, due to random C++ (by
6791 coincidence) code generator script.
6793 - external inset (cool!)
6794 - initial online editing of preferences
6795 - insettabular breaks insettext(s contents)
6797 - some DocBook fixes
6798 - example files update
6799 - other cool stuff, create a diff and look for yourself.
6801 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6803 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6804 -1 this is a non-line-breaking textinset.
6806 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6807 if there is no width set.
6809 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6811 * Lots of files: Merged the dialogbase branch.
6813 2000-06-09 Allan Rae <rae@lyx.org>
6815 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6816 and the Dispatch methods that used it.
6818 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6819 access to functions formerly kept in Dispatch.
6821 2000-05-19 Allan Rae <rae@lyx.org>
6823 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6824 made to_page and count_copies integers again. from_page remains a
6825 string however because I want to allow entry of a print range like
6826 "1,4,22-25" using this field.
6828 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6829 and printer-params-get. These aren't useful from the minibuffer but
6830 could be used by a script/LyXServer app provided it passes a suitable
6831 auto_mem_buffer. I guess I should take a look at how the LyXServer
6832 works and make it support xtl buffers.
6834 * sigc++/: updated to libsigc++-1.0.1
6836 * src/xtl/: updated to xtl-1.3.pl.11
6838 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6839 those changes done to the files in src/ are actually recreated when
6840 they get regenerated. Please don't ever accept a patch that changes a
6841 dialog unless that patch includes the changes to the corresponding *.fd
6844 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6845 stringOnlyContains, renamed it and generalised it.
6847 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6848 branch. Removed the remaining old form_print code.
6850 2000-04-26 Allan Rae <rae@lyx.org>
6852 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6853 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6855 2000-04-25 Allan Rae <rae@lyx.org>
6857 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6858 against a base of xtl-1.3.pl.4
6860 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6861 filter the Id: entries so they still show the xtl version number
6864 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6865 into the src/xtl code. Patch still pending with José (XTL)
6867 2000-04-24 Allan Rae <rae@lyx.org>
6869 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6870 both more generic and much safer. Use the new template functions.
6871 * src/buffer.[Ch] (Dispatch): ditto.
6873 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6874 and mem buffer more intelligently. Also a little general cleanup.
6877 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6878 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6879 * src/xtl/Makefile.am: ditto.
6880 * src/xtl/.cvsignore: ditto.
6881 * src/Makefile.am: ditto.
6883 * src/PrinterParams.h: Removed the macros member functions. Added a
6884 testInvariant member function. A bit of tidying up and commenting.
6885 Included Angus's idea for fixing operation with egcs-1.1.2.
6887 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6888 cool expansion of XTL's mem_buffer to support automatic memory
6889 management within the buffer itself. Removed the various macros and
6890 replaced them with template functions that use either auto_mem_buffer
6891 or mem_buffer depending on a #define. The mem_buffer support will
6892 disappear as soon as the auto_mem_buffer is confirmed to be good on
6893 other platforms/compilers. That is, it's there so you've got something
6896 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6897 effectively forked XTL. However I expect José will include my code
6898 into the next major release. Also fixed a memory leak.
6899 * src/xtl/text.h: ditto.
6900 * src/xtl/xdr.h: ditto.
6901 * src/xtl/giop.h: ditto.
6903 2000-04-16 Allan Rae <rae@lyx.org>
6905 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6906 by autogen.sh and removed by maintainer-clean anyway.
6907 * .cvsignore, sigc++/.cvsignore: Support the above.
6909 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6911 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6913 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6914 macros, renamed static callback-target member functions to suit new
6915 scheme and made them public.
6916 * src/frontends/xforms/forms/form_print.fd: ditto.
6917 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6919 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6922 * src/xtl/: New directory containing a minimal distribution of XTL.
6923 This is XTL-1.3.pl.4.
6925 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6927 2000-04-15 Allan Rae <rae@lyx.org>
6929 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6931 * sigc++/: Updated to libsigc++-1.0.0
6933 2000-04-14 Allan Rae <rae@lyx.org>
6935 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6936 use the generic ones in future. I'll modify my conversion script.
6938 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6940 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6941 (CloseAllBufferRelatedDialogs): Renamed.
6942 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6944 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6945 of the generic ones. These are the same ones my conversion script
6948 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6949 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6950 * src/buffer.C (Dispatch): ditto
6952 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6953 functions for updating and hiding buffer dependent dialogs.
6954 * src/BufferView.C (buffer): ditto
6955 * src/buffer.C (setReadonly): ditto
6956 * src/lyxfunc.C (CloseBuffer): ditto
6958 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6959 Dialogs.h, and hence all the SigC stuff, into every file that includes
6960 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6962 * src/BufferView2.C: reduce the number of headers included by buffer.h
6964 2000-04-11 Allan Rae <rae@lyx.org>
6966 * src/frontends/xforms/xform_macros.h: A small collection of macros
6967 for building C callbacks.
6969 * src/frontends/xforms/Makefile.am: Added above file.
6971 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6972 scheme again. This time it should work for JMarc. If this is
6973 successful I'll revise my conversion script to automate some of this.
6974 The static member functions in the class also have to be public for
6975 this scheme will work. If the scheme works (it's almost identical to
6976 the way BufferView::cursorToggleCB is handled so it should work) then
6977 FormCopyright and FormPrint will be ready for inclusion into the main
6978 trunk immediately after 1.1.5 is released -- provided we're prepared
6979 for complaints about lame compilers not handling XTL.
6981 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6983 2000-04-07 Allan Rae <rae@lyx.org>
6985 * config/lyxinclude.m4: A bit more tidying up (Angus)
6987 * src/LString.h: JMarc's <string> header fix
6989 * src/PrinterParams.h: Used string for most data to remove some
6990 ugly code in the Print dialog and avoid even uglier code when
6991 appending the ints to a string for output.
6993 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6994 and moved "default:" back to the end of switch statement. Cleaned
6995 up the printing so it uses the right function calls and so the
6996 "print to file" option actually puts the file in the right directory.
6998 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7000 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7001 and Ok+Apply button control into a separate method: input (Angus).
7002 (input) Cleaned it up and improved it to be very thorough now.
7003 (All CB) static_cast used instead of C style cast (Angus). This will
7004 probably change again once we've worked out how to keep gcc-2.8.1 happy
7005 with real C callbacks.
7006 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7007 ignore some of the bool settings and has random numbers instead. Needs
7008 some more investigation. Added other input length checks and checking
7009 of file and printer names.
7011 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7012 would link (Angus). Seems the old code doesn't compile with the pragma
7013 statement either. Separated callback entries from internal methods.
7015 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7017 2000-03-17 Allan Rae <rae@lyx.org>
7019 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7020 need it? Maybe it could go in Dialogs instead? I could make it a
7021 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7022 values to get the bool return value.
7023 (Dispatch): New overloaded method for xtl support.
7025 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7026 extern "C" callback instead of static member functions. Hopefully,
7027 JMarc will be able to compile this. I haven't changed
7028 forms/form_copyright.fd yet. Breaking one of my own rules already.
7030 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7031 because they aren't useful from the minibuffer. Maybe a LyXServer
7032 might want a help message though?
7034 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7036 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7037 xtl which needs both rtti and exceptions.
7039 * src/support/Makefile.am:
7040 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7042 * src/frontends/xforms/input_validators.[ch]: input filters and
7043 validators. These conrol what keys are valid in input boxes.
7044 Use them and write some more. Much better idea than waiting till
7045 after the user has pressed Ok to say that the input fields don't make
7048 * src/frontends/xforms/Makefile.am:
7049 * src/frontends/xforms/forms/form_print.fd:
7050 * src/frontends/xforms/forms/makefile:
7051 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7052 new scheme. Still have to make sure I haven't missed anything from
7053 the current implementation.
7055 * src/Makefile.am, src/PrinterParams.h: New data store.
7057 * other files: Added a couple of copyright notices.
7059 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7061 * src/insets/insetbib.h: move Holder struct in public space.
7063 * src/frontends/include/DialogBase.h: use SigC:: only when
7064 SIGC_CXX_NAMESPACES is defined.
7065 * src/frontends/include/Dialogs.h: ditto.
7067 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7069 * src/frontends/xforms/FormCopyright.[Ch]: do not
7070 mention SigC:: explicitely.
7072 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7074 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7075 deals with testing KDE in main configure.in
7076 * configure.in: ditto.
7078 2000-02-22 Allan Rae <rae@lyx.org>
7080 * Lots of files: Merged from HEAD
7082 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7083 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7085 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7087 * sigc++/: new minidist.
7089 2000-02-14 Allan Rae <rae@lyx.org>
7091 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7093 2000-02-08 Juergen Vigna <jug@sad.it>
7095 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7096 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7098 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7099 for this port and so it is much easier for other people to port
7100 dialogs in a common development environment.
7102 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7103 the QT/KDE implementation.
7105 * src/frontends/kde/Dialogs.C:
7106 * src/frontends/kde/FormCopyright.C:
7107 * src/frontends/kde/FormCopyright.h:
7108 * src/frontends/kde/Makefile.am:
7109 * src/frontends/kde/formcopyrightdialog.C:
7110 * src/frontends/kde/formcopyrightdialog.h:
7111 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7112 for the kde support of the Copyright-Dialog.
7114 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7115 subdir-substitution instead of hardcoded 'xforms' as we now have also
7118 * src/frontends/include/DialogBase.h (Object): just commented the
7119 label after #endif (nasty warning and I don't like warnings ;)
7121 * src/main.C (main): added KApplication initialization if using
7124 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7125 For now only the KDE event-loop is added if frontend==kde.
7127 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7129 * configure.in: added support for the --with-frontend[=value] option
7131 * autogen.sh: added kde.m4 file to list of config-files
7133 * acconfig.h: added define for KDEGUI-support
7135 * config/kde.m4: added configuration functions for KDE-port
7137 * config/lyxinclude.m4: added --with-frontend[=value] option with
7138 support for xforms and KDE.
7140 2000-02-08 Allan Rae <rae@lyx.org>
7142 * all Makefile.am: Fixed up so the make targets dist, distclean,
7143 install and uninstall all work even if builddir != srcdir. Still
7144 have a new sigc++ minidist update to come.
7146 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7148 2000-02-01 Allan Rae <rae@lyx.org>
7150 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7151 Many mods to get builddir != srcdir working.
7153 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7154 for building on NT and so we can do the builddir != srcdir stuff.
7156 2000-01-30 Allan Rae <rae@lyx.org>
7158 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7159 This will stay in "rae" branch. We probably don't really need it in
7160 the main trunk as anyone who wants to help programming it should get
7161 a full library installed also. So they can check both included and
7162 system supplied library compilation.
7164 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7165 Added a 'mini' distribution of libsigc++. If you feel the urge to
7166 change something in these directories - Resist it. If you can't
7167 resist the urge then you should modify the following script and rebuild
7168 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7169 all happen. Still uses a hacked version of libsigc++'s configure.in.
7170 I'm quite happy with the results. I'm not sure the extra work to turn
7171 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7172 worth the trouble and would probably lead to extra maintenance
7174 I haven't tested the following important make targets: install, dist.
7175 Not ready for prime time but very close. Maybe 1.1.5.
7177 * development/tools/makeLyXsigc.sh: A shell script to automatically
7178 generate our mini-dist of libsigc++. It can only be used with a CVS
7179 checkout of libsigc++ not a tarball distribution. It's well commented.
7180 This will end up as part of the libsigc++ distribution so other apps
7181 can easily have an included mini-dist. If someone makes mods to the
7182 sigc++ subpackage without modifying this script to generate those
7183 changes I'll be very upset!
7185 * src/frontends/: Started the gui/system indep structure.
7187 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7188 to access the gui-indep dialogs are in this class. Much improved
7189 design compared to previous revision. Lars, please refrain from
7190 moving this header into src/ like you did with Popups.h last time.
7192 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7194 * src/frontends/xforms/: Started the gui-indep system with a single
7195 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7198 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7199 Here you'll find a very useful makefile and automated fdfix.sh that
7200 makes updating dailogs a no-brainer -- provided you follow the rules
7201 set out in the README. I'm thinking about adding another script to
7202 automatically generate skeleton code for a new dialog given just the
7205 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7206 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7207 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7209 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7211 * src/support/LSubstring.C (operator): simplify
7213 * src/lyxtext.h: removed bparams, use buffer_->params instead
7215 * src/lyxrow.h: make Row a real class, move all variables to
7216 private and use accessors.
7218 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7220 (isRightToLeftPar): ditto
7221 (ChangeLanguage): ditto
7222 (isMultiLingual): ditto
7225 (SimpleTeXOnePar): ditto
7226 (TeXEnvironment): ditto
7227 (GetEndLabel): ditto
7229 (SetOnlyLayout): ditto
7230 (BreakParagraph): ditto
7231 (BreakParagraphConservative): ditto
7232 (GetFontSettings): ditto
7234 (CopyIntoMinibuffer): ditto
7235 (CutIntoMinibuffer): ditto
7236 (PasteParagraph): ditto
7237 (SetPExtraType): ditto
7238 (UnsetPExtraType): ditto
7239 (DocBookContTableRows): ditto
7240 (SimpleDocBookOneTablePar): ditto
7242 (TeXFootnote): ditto
7243 (SimpleTeXOneTablePar): ditto
7244 (TeXContTableRows): ditto
7245 (SimpleTeXSpecialChars): ditto
7248 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7249 to private and use accessors.
7251 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7252 this, we did not use it anymore and has not been for ages. Just a
7253 waste of cpu cycles.
7255 * src/language.h: make Language a real class, move all variables
7256 to private and use accessors.
7258 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7259 (create_view): remove
7260 (update): some changes for new timer
7261 (cursorToggle): use new timer
7262 (beforeChange): change for new timer
7264 * src/BufferView.h (cursorToggleCB): removed last paramter because
7267 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7268 (cursorToggleCB): change because of new timer code
7270 * lib/CREDITS: updated own mailaddress
7272 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7274 * src/support/filetools.C (PutEnv): fix the code in case neither
7275 putenv() nor setenv() have been found.
7277 * INSTALL: mention the install-strip Makefile target.
7279 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7280 read-only documents.
7282 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7284 * lib/reLyX/configure.in (VERSION): avoid using a previously
7285 generated reLyX wrapper to find out $prefix.
7287 * lib/examples/eu_adibide_lyx-atua.lyx:
7288 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7289 translation of the Tutorial (Dooteo)
7291 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7293 * forms/cite.fd: new citation dialog
7295 * src/insetcite.[Ch]: the new citation dialog is moved into
7298 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7301 * src/insets/insetcommand.h: data members made private.
7303 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7305 * LyX 1.1.5 released
7307 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7309 * src/version.h (LYX_RELEASE): to 1.1.5
7311 * src/spellchecker.C (RunSpellChecker): return false if the
7312 spellchecker dies upon creation.
7314 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7316 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7317 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7321 * lib/CREDITS: update entry for Martin Vermeer.
7323 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7325 * src/text.C (draw): Draw foreign language bars at the bottom of
7326 the row instead of at the baseline.
7328 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7330 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7332 * lib/bind/de_menus.bind: updated
7334 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7336 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7338 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7340 * src/menus.C (Limit_string_length): New function
7341 (ShowTocMenu): Limit the number of items/length of items in the
7344 * src/paragraph.C (String): Correct result for a paragraph inside
7347 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7349 * src/bufferlist.C (close): test of buf->getuser() == NULL
7351 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7353 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7354 Do not call to SetCursor when the paragraph is a closed footnote!
7356 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7358 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7361 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7363 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7366 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7367 reference popup, that activates the reference-back action
7369 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7371 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7372 the menus. Also fixed a bug.
7374 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7375 the math panels when switching buffers (unless new buffer is readonly).
7377 * src/BufferView.C (NoSavedPositions)
7378 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7380 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7382 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7383 less of dvi dirty or not.
7385 * src/trans_mgr.[Ch] (insert): change first parameter to string
7388 * src/chset.[Ch] (encodeString): add const to first parameter
7390 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7392 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7396 * src/LaTeX.C (deplog): better searching for dependency files in
7397 the latex log. Uses now regexps.
7399 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7400 instead of the box hack or \hfill.
7402 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7404 * src/lyxfunc.C (doImportHelper): do not create the file before
7405 doing the actual import.
7406 (doImportASCIIasLines): create a new file before doing the insert.
7407 (doImportASCIIasParagraphs): ditto.
7409 * lib/lyxrc.example: remove mention of non-existing commands
7411 * lyx.man: remove mention of color-related switches.
7413 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7415 * src/lyx_gui.C: remove all the color-related ressources, which
7416 are not used anymore.
7418 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7421 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7423 * src/lyxrc.C (read): Add a missing break in the switch
7425 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7427 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7429 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7432 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7434 * src/text.C (draw): draw bars under foreign language words.
7436 * src/LColor.[Ch]: add LColor::language
7438 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7440 * src/lyxcursor.h (boundary): New member variable
7442 * src/text.C (IsBoundary): New methods
7444 * src/text.C: Use the above for currect cursor movement when there
7445 is both RTL & LTR text.
7447 * src/text2.C: ditto
7449 * src/bufferview_funcs.C (ToggleAndShow): ditto
7451 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7453 * src/text.C (DeleteLineForward): set selection to true to avoid
7454 that DeleteEmptyParagraphMechanism does some magic. This is how it
7455 is done in all other functions, and seems reasonable.
7456 (DeleteWordForward): do not jump over non-word stuff, since
7457 CursorRightOneWord() already does it.
7459 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7460 DeleteWordBackward, since they seem safe to me (since selection is
7461 set to "true") DeleteEmptyParagraphMechanism does nothing.
7463 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7465 * src/lyx_main.C (easyParse): simplify the code by factoring the
7466 part that removes parameters from the command line.
7467 (LyX): check wether wrong command line options have been given.
7469 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7471 * src/lyx_main.C : add support for specifying user LyX
7472 directory via command line option -userdir.
7474 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7476 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7477 the number of items per popup.
7478 (Add_to_refs_menu): Ditto.
7480 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7482 * src/lyxparagraph.h: renamed ClearParagraph() to
7483 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7484 textclass as parameter, and do nothing if free_spacing is
7485 true. This fixes part of the line-delete-forward problems.
7487 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7488 (pasteSelection): ditto.
7489 (SwitchLayoutsBetweenClasses): more translatable strings.
7491 * src/text2.C (CutSelection): use StripLeadingSpaces.
7492 (PasteSelection): ditto.
7493 (DeleteEmptyParagraphMechanism): ditto.
7495 2000-05-26 Juergen Vigna <jug@sad.it>
7497 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7498 is not needed in tabular insets.
7500 * src/insets/insettabular.C (TabularFeatures): added missing features.
7502 * src/tabular.C (DeleteColumn):
7504 (AppendRow): implemented this functions
7505 (cellsturct::operator=): clone the inset too;
7507 2000-05-23 Juergen Vigna <jug@sad.it>
7509 * src/insets/insettabular.C (LocalDispatch): better selection support
7510 when having multicolumn-cells.
7512 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7514 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7516 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7518 * src/ColorHandler.C (getGCForeground): put more test into _()
7520 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7523 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7526 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7528 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7529 there are no labels, or when buffer is readonly.
7531 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7532 there are no labels, buffer is SGML, or when buffer is readonly.
7534 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7536 * src/LColor.C (LColor): change a couple of grey40 to grey60
7537 (LColor): rewore initalization to make compiles go some magnitude
7539 (getGUIName): don't use gettext until we need the string.
7541 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7543 * src/Bullet.[Ch]: Fixed a small bug.
7545 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7547 * src/paragraph.C (String): Several fixes/improvements
7549 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7551 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7553 * src/paragraph.C (String): give more correct output.
7555 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7557 * src/lyxfont.C (stateText) Do not output the language if it is
7558 eqaul to the language of the document.
7560 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7561 between two paragraphs with the same language.
7563 * src/paragraph.C (getParLanguage) Return a correct answer for an
7564 empty dummy paragraph.
7566 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7569 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7572 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7573 the menus/popup, if requested fonts are unavailable.
7575 2000-05-22 Juergen Vigna <jug@sad.it>
7577 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7578 movement support (Up/Down/Tab/Shift-Tab).
7579 (LocalDispatch): added also preliminari cursor-selection.
7581 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7583 * src/paragraph.C (PasteParagraph): Hopefully now right!
7585 2000-05-22 Garst R. Reese <reese@isn.net>
7587 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7588 of list, change all references to Environment to Command
7589 * tex/hollywood.cls : rewrite environments as commands, add
7590 \uppercase to interiorshot and exteriorshot to force uppecase.
7591 * tex/broadway.cls : rewrite environments as commands. Tweak
7594 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7596 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7597 size of items: use a constant intead of the hardcoded 40, and more
7598 importantly do not remove the %m and %x tags added at the end.
7599 (Add_to_refs_menu): use vector::size_type instead of
7600 unsigned int as basic types for the variables. _Please_ do not
7601 assume that size_t is equal to unsigned int. On an alpha, this is
7602 unsigned long, which is _not_ the same.
7604 * src/language.C (initL): remove language "hungarian", since it
7605 seems that "magyar" is better.
7607 2000-05-22 Juergen Vigna <jug@sad.it>
7609 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7611 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7614 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7615 next was deleted but not set to 0.
7617 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7619 * src/language.C (initL): change the initialization of languages
7620 so that compiles goes _fast_.
7622 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7625 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7627 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7631 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7633 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7635 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7639 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7642 * src/insets/insetlo*.[Ch]: Made editable
7644 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7646 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7647 the current selection.
7649 * src/BufferView_pimpl.C (stuffClipboard): new method
7651 * src/BufferView.C (stuffClipboard): new method
7653 * src/paragraph.C (String): new method
7655 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7656 LColor::ignore when lyxname is not found.
7658 * src/BufferView.C (pasteSelection): new method
7660 * src/BufferView_pimpl.C (pasteSelection): new method
7662 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7664 * src/WorkArea.C (request_clipboard_cb): new static function
7665 (getClipboard): new method
7666 (putClipboard): new method
7668 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7670 * LyX 1.1.5pre2 released
7672 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7674 * src/vspace.C (operator=): removed
7675 (operator=): removed
7677 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7679 * src/layout.C (NumberOfClass): manually set the type in make_pair
7680 (NumberOfLayout): ditto
7682 * src/language.C: use the Language constructor for ignore_lang
7684 * src/language.h: add constructors to struct Language
7686 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7688 * src/text2.C (SetCursorIntern): comment out #warning
7690 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7692 * src/mathed/math_iter.h: initialize sx and sw to 0
7694 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7696 * forms/lyx.fd: Redesign of form_ref
7698 * src/LaTeXFeatures.[Ch]
7702 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7705 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7706 and Buffer::inset_iterator.
7708 * src/menus.C: Added new menus: TOC and Refs.
7710 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7712 * src/buffer.C (getTocList): New method.
7714 * src/BufferView2.C (ChangeRefs): New method.
7716 * src/buffer.C (getLabelList): New method. It replaces the old
7717 getReferenceList. The return type is vector<string> instead of
7720 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7721 the old getLabel() and GetNumberOfLabels() methods.
7722 * src/insets/insetlabel.C (getLabelList): ditto
7723 * src/mathed/formula.C (getLabelList): ditto
7725 * src/paragraph.C (String): New method.
7727 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7728 Uses the new getTocList() method.
7729 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7730 which automatically updates the contents of the browser.
7731 (RefUpdateCB): Use the new getLabelList method.
7733 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7735 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7737 * src/spellchecker.C: Added using std::reverse;
7739 2000-05-19 Juergen Vigna <jug@sad.it>
7741 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7743 * src/insets/insettext.C (computeTextRows): small fix for display of
7744 1 character after a newline.
7746 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7749 2000-05-18 Juergen Vigna <jug@sad.it>
7751 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7752 when changing width of column.
7754 * src/tabular.C (set_row_column_number_info): setting of
7755 autobreak rows if necessary.
7757 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7759 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7761 * src/vc-backend.*: renamed stat() to status() and vcstat to
7762 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7763 compilation broke. The new name seems more relevant, anyway.
7765 2000-05-17 Juergen Vigna <jug@sad.it>
7767 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7768 which was wrong if the removing caused removing of rows!
7770 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7771 (pushToken): new function.
7773 * src/text2.C (CutSelection): fix problem discovered with purify
7775 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7777 * src/debug.C (showTags): enlarge the first column, now that we
7778 have 6-digits debug codes.
7780 * lib/layouts/hollywood.layout:
7781 * lib/tex/hollywood.cls:
7782 * lib/tex/brodway.cls:
7783 * lib/layouts/brodway.layout: more commands and fewer
7784 environments. Preambles moved in the .cls files. Broadway now has
7785 more options on scene numbering and less whitespace (from Garst)
7787 * src/insets/insetbib.C (getKeys): make sure that we are in the
7788 document directory, in case the bib file is there.
7790 * src/insets/insetbib.C (Latex): revert bogus change.
7792 2000-05-16 Juergen Vigna <jug@sad.it>
7794 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7795 the TabularLayout on cursor move.
7797 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7799 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7802 (draw): fixed cursor position and drawing so that the cursor is
7803 visible when before the tabular-inset.
7805 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7806 when creating from old insettext.
7808 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7810 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7812 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7813 * lib/tex/brodway.cls: ditto
7815 * lib/layouts/brodway.layout: change alignment of parenthical
7818 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7820 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7821 versions 0.88 and 0.89 are supported.
7823 2000-05-15 Juergen Vigna <jug@sad.it>
7825 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7828 * src/insets/insettext.C (computeTextRows): redone completely this
7829 function in a much cleaner way, because of problems when having a
7831 (draw): added a frame border when the inset is locked.
7832 (SetDrawLockedFrame): this sets if we draw the border or not.
7833 (SetFrameColor): this sets the frame color (default=insetframe).
7835 * src/insets/lyxinset.h: added x() and y() functions which return
7836 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7837 function which is needed to see if we have a locking inset of some
7838 type in this inset (needed for now in insettabular).
7840 * src/vspace.C (inPixels): the same function also without a BufferView
7841 parameter as so it is easier to use it in some ocasions.
7843 * src/lyxfunc.C: changed all places where insertInset was used so
7844 that now if it couldn't be inserted it is deleted!
7846 * src/TabularLayout.C:
7847 * src/TableLayout.C: added support for new tabular-inset!
7849 * src/BufferView2.C (insertInset): this now returns a bool if the
7850 inset was really inserted!!!
7852 * src/tabular.C (GetLastCellInRow):
7853 (GetFirstCellInRow): new helper functions.
7854 (Latex): implemented for new tabular class.
7858 (TeXTopHLine): new Latex() helper functions.
7860 2000-05-12 Juergen Vigna <jug@sad.it>
7862 * src/mathed/formulamacro.C (Read):
7863 * src/mathed/formula.C (Read): read also the \end_inset here!
7865 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7867 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7868 crush when saving formulae with unbalanced parenthesis.
7870 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7872 * src/layout.C: Add new keyword "endlabelstring" to layout file
7874 * src/text.C (GetVisibleRow): Draw endlabel string.
7876 * lib/layouts/broadway.layout
7877 * lib/layouts/hollywood.layout: Added endlabel for the
7878 Parenthetical layout.
7880 * lib/layouts/heb-article.layout: Do not use slanted font shape
7881 for Theorem like environments.
7883 * src/buffer.C (makeLaTeXFile): Always add "american" to
7884 the UsedLanguages list if document language is RTL.
7886 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7888 * add addendum to README.OS2 and small patch (from SMiyata)
7890 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7892 * many files: correct the calls to ChangeExtension().
7894 * src/support/filetools.C (ChangeExtension): remove the no_path
7895 argument, which does not belong there. Use OnlyFileName() instead.
7897 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7898 files when LaTeXing a non-nice latex file.
7900 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7901 a chain of "if". Return false when deadkeys are not handled.
7903 * src/lyx_main.C (LyX): adapted the code for default bindings.
7905 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7906 bindings for basic functionality (except deadkeys).
7907 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7909 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7910 several methods: handle override_x_deadkeys.
7912 * src/lyxrc.h: remove the "bindings" map, which did not make much
7913 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7915 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7917 * src/lyxfont.C (stateText): use a saner method to determine
7918 whether the font is "default". Seems to fix the crash with DEC
7921 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7923 2000-05-08 Juergen Vigna <jug@sad.it>
7925 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7926 TabularLayoutMenu with mouse-button-3
7927 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7929 * src/TabularLayout.C: added this file for having a Layout for
7932 2000-05-05 Juergen Vigna <jug@sad.it>
7934 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7935 recalculating inset-widths.
7936 (TabularFeatures): activated this function so that I can change
7937 tabular-features via menu.
7939 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7940 that I can test some functions with the Table menu.
7942 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7944 * src/lyxfont.C (stateText): guard against stupid c++libs.
7946 * src/tabular.C: add using std::vector
7947 some whitespace changes, + removed som autogenerated code.
7949 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7951 2000-05-05 Juergen Vigna <jug@sad.it>
7953 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7954 row, columns and cellstructures.
7956 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7958 * lib/lyxrc.example: remove obsolete entries.
7960 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7961 reading of protected_separator for free_spacing.
7963 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7965 * src/text.C (draw): do not display an exclamation mark in the
7966 margin for margin notes. This is confusing, ugly and
7969 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7970 AMS math' is checked.
7972 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7973 name to see whether including the amsmath package is needed.
7975 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7977 * src/paragraph.C (validate): Compute UsedLanguages correctly
7978 (don't insert the american language if it doesn't appear in the
7981 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7982 The argument of \thanks{} command is considered moving argument
7984 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7987 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7989 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7990 for appendix/minipage/depth. The lines can be now both in the footnote
7991 frame, and outside the frame.
7993 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7996 2000-05-05 Juergen Vigna <jug@sad.it>
7998 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7999 neede only in tabular.[Ch].
8001 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8003 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8005 (Write): write '~' for PROTECTED_SEPARATOR
8007 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8009 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8012 * src/mathed/formula.C (drawStr): rename size to siz.
8014 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8015 possibly fix a bug by not changing the pflags = flags to piflags =
8018 2000-05-05 Juergen Vigna <jug@sad.it>
8020 * src/insets/insetbib.C: moved using directive
8022 * src/ImportNoweb.C: small fix for being able to compile (missing
8025 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8027 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8028 to use clear, since we don't depend on this in the code. Add test
8031 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8033 * (various *.C files): add using std::foo directives to please dec
8036 * replace calls to string::clear() to string::erase() (Angus)
8038 * src/cheaders/cmath: modified to provide std::abs.
8040 2000-05-04 Juergen Vigna <jug@sad.it>
8042 * src/insets/insettext.C: Prepared all for inserting of multiple
8043 paragraphs. Still display stuff to do (alignment and other things),
8044 but I would like to use LyXText to do this when we cleaned out the
8045 table-support stuff.
8047 * src/insets/insettabular.C: Changed lot of stuff and added lots
8048 of functionality still a lot to do.
8050 * src/tabular.C: Various functions changed name and moved to be
8051 const functions. Added new Read and Write functions and changed
8052 lots of things so it works good with tabular-insets (also removed
8053 some stuff which is not needed anymore * hacks *).
8055 * src/lyxcursor.h: added operators == and != which just look if
8056 par and pos are (not) equal.
8058 * src/buffer.C (latexParagraphs): inserted this function to latex
8059 all paragraphs form par to endpar as then I can use this too for
8062 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8063 so that I can call this to from text insets with their own cursor.
8065 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8066 output off all paragraphs (because of the fix below)!
8068 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8069 the very last paragraph (this could be also the last paragraph of an
8072 * src/texrow.h: added rows() call which returns the count-variable.
8074 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8076 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8078 * lib/configure.m4: better autodetection of DocBook tools.
8080 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8082 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8084 * src/lyx_cb.C: add using std::reverse;
8086 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8089 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8090 selected files. Should fix repeated errors from generated files.
8092 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8094 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8096 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8097 the spellchecker popup.
8099 * lib/lyxrc.example: Removed the \number_inset section
8101 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8103 * src/insets/figinset.C (various): Use IsFileReadable() to make
8104 sure that the file actually exist. Relying on ghostscripts errors
8105 is a bad idea since they can lead to X server crashes.
8107 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8109 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8112 * lib/lyxrc.example: smallish typo in description of
8113 \view_dvi_paper_option
8115 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8118 * src/lyxfunc.C: doImportHelper to factor out common code of the
8119 various import methods. New functions doImportASCIIasLines,
8120 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8121 doImportLinuxDoc for the format specific parts.
8124 * buffer.C: Dispatch returns now a bool to indicate success
8127 * lyx_gui.C: Add getLyXView() for member access
8129 * lyx_main.C: Change logic for batch commands: First try
8130 Buffer::Dispatch (possibly without GUI), if that fails, use
8133 * lyx_main.C: Add support for --import command line switch.
8134 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8135 Available Formats: Everything accepted by 'buffer-import <format>'
8137 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8139 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8142 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8143 documents will be reformatted upon reentry.
8145 2000-04-27 Juergen Vigna <jug@sad.it>
8147 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8148 correctly only last pos this was a bug.
8150 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8152 * release of lyx-1.1.5pre1
8154 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8156 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8158 * src/menus.C: revert the change of naming (Figure->Graphic...)
8159 from 2000-04-11. It was incomplete and bad.
8161 * src/LColor.[Ch]: add LColor::depthbar.
8162 * src/text.C (GetVisibleRow): use it.
8164 * README: update the languages list.
8166 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8168 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8171 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8173 * README: remove sections that were just wrong.
8175 * src/text2.C (GetRowNearY): remove currentrow code
8177 * src/text.C (GetRow): remove currentrow code
8179 * src/screen.C (Update): rewritten a bit.
8180 (SmallUpdate): removed func
8182 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8184 (FullRebreak): return bool
8185 (currentrow): remove var
8186 (currentrow_y): ditto
8188 * src/lyxscreen.h (Draw): change arg to unsigned long
8189 (FitCursor): return bool
8190 (FitManualCursor): ditto
8191 (Smallpdate): remove func
8192 (first): change to unsigned long
8193 (DrawOneRow): change second arg to long (from long &)
8194 (screen_refresh_y): remove var
8195 (scree_refresh_row): ditto
8197 * src/lyxrow.h: change baseline to usigned int from unsigned
8198 short, this brings some implicit/unsigned issues out in the open.
8200 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8202 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8203 instead of smallUpdate.
8205 * src/lyxcursor.h: change y to unsigned long
8207 * src/buffer.h: don't call updateScrollbar after fitcursor
8209 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8210 where they are used. Removed "\\direction", this was not present
8211 in 1.1.4 and is already obsolete. Commented out some code that I
8212 believe to never be called.
8213 (runLiterate): don't call updateScrollbar after fitCursor
8215 (buildProgram): ditto
8218 * src/WorkArea.h (workWidth): change return val to unsigned
8221 (redraw): remove the button redraws
8222 (setScrollbarValue): change for scrollbar
8223 (getScrollbarValue): change for scrollbar
8224 (getScrollbarBounds): change for scrollbar
8226 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8227 (C_WorkArea_down_cb): removed func
8228 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8229 (resize): change for scrollbar
8230 (setScrollbar): ditto
8231 (setScrollbarBounds): ditto
8232 (setScrollbarIncrements): ditto
8233 (up_cb): removed func
8234 (down_cb): removed func
8235 (scroll_cb): change for scrollbar
8236 (work_area_handler): ditto
8238 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8239 when FitCursor did something.
8240 (updateScrollbar): some unsigned changes
8241 (downCB): removed func
8242 (scrollUpOnePage): removed func
8243 (scrollDownOnePage): remvoed func
8244 (workAreaMotionNotify): don't call screen->FitCursor but use
8245 fitCursor instead. and bool return val
8246 (workAreaButtonPress): ditto
8247 (workAreaButtonRelease): some unsigned changes
8248 (checkInsetHit): ditto
8249 (workAreaExpose): ditto
8250 (update): parts rewritten, comments about the signed char arg added
8251 (smallUpdate): removed func
8252 (cursorPrevious): call needed updateScrollbar
8255 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8258 * src/BufferView.[Ch] (upCB): removed func
8259 (downCB): removed func
8260 (smallUpdate): removed func
8262 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8264 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8265 currentrow, currentrow_y optimization. This did not help a lot and
8266 if we want to do this kind of optimization we should rather use
8267 cursor.row instead of the currentrow.
8269 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8270 buffer spacing and klyx spacing support.
8272 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8274 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8277 2000-04-26 Juergen Vigna <jug@sad.it>
8279 * src/insets/figinset.C: fixes to Lars sstream changes!
8281 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8283 * A lot of files: Added Ascii(ostream &) methods to all inset
8284 classes. Used when exporting to ASCII.
8286 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8287 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8290 * src/text2.C (ToggleFree): Disabled implicit word selection when
8291 there is a change in the language
8293 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8294 no output was generated for end-of-sentence inset.
8296 * src/insets/lyxinset.h
8299 * src/paragraph.C: Removed the insetnumber code
8301 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8303 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8305 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8306 no_babel and no_epsfig completely from the file.
8307 (parseSingleLyXformat2Token): add handling for per-paragraph
8308 spacing as written by klyx.
8310 * src/insets/figinset.C: applied patch by Andre. Made it work with
8313 2000-04-20 Juergen Vigna <jug@sad.it>
8315 * src/insets/insettext.C (cutSelection):
8316 (copySelection): Fixed with selection from right to left.
8317 (draw): now the rows are not recalculated at every draw.
8318 (computeTextRows): for now reset the inset-owner here (this is
8319 important for an undo or copy where the inset-owner is not set
8322 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8323 motion to the_locking_inset screen->first was forgotten, this was
8324 not important till we got multiline insets.
8326 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8328 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8329 code seems to be alright (it is code changed by Dekel, and the
8330 intent is indeed that all macros should be defined \protect'ed)
8332 * NEWS: a bit of reorganisation of the new user-visible features.
8334 2000-04-19 Juergen Vigna <jug@sad.it>
8336 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8337 position. Set the inset_owner of the used paragraph so that it knows
8338 that it is inside an inset. Fixed cursor handling with mouse and
8339 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8340 and cleanups to make TextInsets work better.
8342 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8343 Changed parameters of various functions and added LockInsetInInset().
8345 * src/insets/insettext.C:
8347 * src/insets/insetcollapsable.h:
8348 * src/insets/insetcollapsable.C:
8349 * src/insets/insetfoot.h:
8350 * src/insets/insetfoot.C:
8351 * src/insets/insetert.h:
8352 * src/insets/insetert.C: cleaned up the code so that it works now
8353 correctly with insettext.
8355 * src/insets/inset.C:
8356 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8357 that insets in insets are supported right.
8360 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8362 * src/paragraph.C: some small fixes
8364 * src/debug.h: inserted INSETS debug info
8366 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8367 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8369 * src/commandtags.h:
8370 * src/LyXAction.C: insert code for InsetTabular.
8372 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8373 not Button1MotionMask.
8374 (workAreaButtonRelease): send always a InsetButtonRelease event to
8376 (checkInsetHit): some setCursor fixes (always with insets).
8378 * src/BufferView2.C (lockInset): returns a bool now and extended for
8379 locking insets inside insets.
8380 (showLockedInsetCursor): it is important to have the cursor always
8381 before the locked inset.
8382 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8384 * src/BufferView.h: made lockInset return a bool.
8386 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8388 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8389 that is used also internally but can be called as public to have back
8390 a cursor pos which is not set internally.
8391 (SetCursorIntern): Changed to use above function.
8393 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8395 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8400 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8401 patches for things that should be in or should be changed.
8403 * src/* [insetfiles]: change "usigned char fragile" to bool
8404 fragile. There was only one point that could that be questioned
8405 and that is commented in formulamacro.C. Grep for "CHECK".
8407 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8408 (DeleteBuffer): take it out of CutAndPaste and make it static.
8410 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8412 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8413 output the spacing envir commands. Also the new commands used in
8414 the LaTeX output makes the result better.
8416 * src/Spacing.C (writeEnvirBegin): new method
8417 (writeEnvirEnd): new method
8419 2000-04-18 Juergen Vigna <jug@sad.it>
8421 * src/CutAndPaste.C: made textclass a static member of the class
8422 as otherwise it is not accesed right!!!
8424 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8426 * forms/layout_forms.fd
8427 * src/layout_forms.h
8428 * src/layout_forms.C (create_form_form_character)
8429 * src/lyx_cb.C (UserFreeFont)
8430 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8431 documents (in the layout->character popup).
8433 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8435 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8436 \spell_command was in fact not honored (from Kevin Atkinson).
8438 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8441 * src/lyx_gui.h: make lyxViews private (Angus)
8443 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8445 * src/mathed/math_write.C
8446 (MathMatrixInset::Write) Put \protect before \begin{array} and
8447 \end{array} if fragile
8448 (MathParInset::Write): Put \protect before \\ if fragile
8450 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8452 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8453 initialization if the LyXColorHandler must be done after the
8454 connections to the XServer has been established.
8456 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8457 get the background pixel from the lyxColorhandler so that the
8458 figures are rendered with the correct background color.
8459 (NextToken): removed functions.
8460 (GetPSSizes): use ifs >> string instead of NextToken.
8462 * src/Painter.[Ch]: the color cache moved out of this file.
8464 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8467 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8469 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8470 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8472 * src/BufferView.C (enterView): new func
8473 (leaveView): new func
8475 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8477 (leaveView): new func, undefines xterm cursor when approp.
8479 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8480 (AllowInput): delete the Workarea cursor handling from this func.
8482 * src/Painter.C (underline): draw a slimer underline in most cases.
8484 * src/lyx_main.C (error_handler): use extern "C"
8486 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8488 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8489 sent directly to me.
8491 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8492 to the list by Dekel.
8494 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8497 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8498 methods from lyx_cb.here.
8500 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8503 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8505 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8506 instead of using current_view directly.
8508 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8510 * src/LyXAction.C (init): add the paragraph-spacing command.
8512 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8514 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8516 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8517 different from the documents.
8519 * src/text.C (SetHeightOfRow): take paragraph spacing into
8520 account, paragraph spacing takes precedence over buffer spacing
8521 (GetVisibleRow): ditto
8523 * src/paragraph.C (writeFile): output the spacing parameter too.
8524 (validate): set the correct features if spacing is used in the
8526 (Clear): set spacing to default
8527 (MakeSameLayout): spacing too
8528 (HasSameLayout): spacing too
8529 (SetLayout): spacing too
8530 (TeXOnePar): output the spacing commands
8532 * src/lyxparagraph.h: added a spacing variable for use with
8533 per-paragraph spacing.
8535 * src/Spacing.h: add a Default spacing and a method to check if
8536 the current spacing is default. also added an operator==
8538 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8541 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8543 * src/lyxserver.C (callback): fix dispatch of functions
8545 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8546 printf() into lyxerr call.
8548 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8551 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8552 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8553 the "Float" from each of the subitems.
8554 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8556 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8557 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8558 documented the change so that the workaround can be nuked later.
8560 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8563 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8565 * src/buffer.C (getLatexName): ditto
8566 (setReadonly): ditto
8568 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8570 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8571 avoid some uses of current_view. Added also a bufferParams()
8572 method to get at this.
8574 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8576 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8578 * src/lyxparagraph.[Ch]: removed
8579 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8580 with operators used by lower_bound and
8581 upper_bound in InsetTable's
8582 Make struct InsetTable private again. Used matchpos.
8584 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8586 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8587 document, the language of existing text is changed (unless the
8588 document is multi-lingual)
8590 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8592 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8594 * A lot of files: A rewrite of the Right-to-Left support.
8596 2000-04-10 Juergen Vigna <jug@sad.it>
8598 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8599 misplaced cursor when inset in inset is locked.
8601 * src/insets/insettext.C (LocalDispatch): small fix so that a
8602 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8604 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8605 footnote font should be decreased in size twice when displaying.
8607 * src/insets/insettext.C (GetDrawFont): inserted this function as
8608 the drawing-font may differ from the real paragraph font.
8610 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8611 insets (inset in inset!).
8613 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8614 function here because we don't want footnotes inside footnotes.
8616 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8618 (init): now set the inset_owner in paragraph.C
8619 (LocalDispatch): added some resetPos() in the right position
8622 (pasteSelection): changed to use the new CutAndPaste-Class.
8624 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8625 which tells if it is allowed to insert another inset inside this one.
8627 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8628 SwitchLayoutsBetweenClasses.
8630 * src/text2.C (InsertInset): checking of the new paragraph-function
8632 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8633 is not needed anymore here!
8636 (PasteSelection): redone (also with #ifdef) so that now this uses
8637 the CutAndPaste-Class.
8638 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8641 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8642 from/to text/insets.
8644 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8645 so that the paragraph knows if it is inside an (text)-inset.
8646 (InsertFromMinibuffer): changed return-value to bool as now it
8647 may happen that an inset is not inserted in the paragraph.
8648 (InsertInsetAllowed): this checks if it is allowed to insert an
8649 inset in this paragraph.
8651 (BreakParagraphConservative):
8652 (BreakParagraph) : small change for the above change of the return
8653 value of InsertFromMinibuffer.
8655 * src/lyxparagraph.h: added inset_owner and the functions to handle
8656 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8658 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8660 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8661 functions from BufferView to BufferView::Pimpl to ease maintence.
8663 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8664 correctly. Also use SetCursorIntern instead of SetCursor.
8666 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8669 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8671 * src/WorkArea.C (belowMouse): manually implement below mouse.
8673 * src/*: Add "explicit" on several constructors, I added probably
8674 some unneeded ones. A couple of changes to code because of this.
8676 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8677 implementation and private parts from the users of BufferView. Not
8680 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8681 implementation and private parts from the users of LyXLex. Not
8684 * src/BufferView_pimpl.[Ch]: new files
8686 * src/lyxlex_pimpl.[Ch]: new files
8688 * src/LyXView.[Ch]: some inline functions move out-of-line
8690 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8692 * src/lyxparagraph.h: make struct InsetTable public.
8694 * src/support/lyxstring.h: change lyxstring::difference_type to be
8695 ptrdiff_t. Add std:: modifiers to streams.
8697 * src/font.C: include the <cctype> header, for islower() and
8700 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8702 * src/font.[Ch]: new files. Contains the metric functions for
8703 fonts, takes a LyXFont as parameter. Better separation of concepts.
8705 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8706 changes because of this.
8708 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8710 * src/*: compile with -Winline and move functions that don't
8713 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8716 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8718 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8719 (various files changed because of this)
8721 * src/Painter.C (text): fixed the drawing of smallcaps.
8723 * src/lyxfont.[Ch] (drawText): removed unused member func.
8726 * src/*.C: added needed "using" statements and "std::" qualifiers.
8728 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8730 * src/*.h: removed all use of "using" from header files use
8731 qualifier std:: instead.
8733 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8735 * src/text.C (Backspace): some additional cleanups (we already
8736 know whether cursor.pos is 0 or not).
8738 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8739 automake does not provide one).
8741 * src/bmtable.h: replace C++ comments with C comments.
8743 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8745 * src/screen.C (ShowCursor): Change the shape of the cursor if
8746 the current language is not equal to the language of the document.
8747 (If the cursor change its shape unexpectedly, then you've found a bug)
8749 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8752 * src/insets/insetnumber.[Ch]: New files.
8754 * src/LyXAction.C (init)
8755 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8758 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8760 * src/lyxparagraph.h
8761 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8762 (the vector is kept sorted).
8764 * src/text.C (GetVisibleRow): Draw selection correctly when there
8765 is both LTR and RTL text.
8767 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8768 which is much faster.
8770 * src/text.C (GetVisibleRow and other): Do not draw the last space
8771 in a row if the direction of the last letter is not equal to the
8772 direction of the paragraph.
8774 * src/lyxfont.C (latexWriteStartChanges):
8775 Check that font language is not equal to basefont language.
8776 (latexWriteEndChanges): ditto
8778 * src/lyx_cb.C (StyleReset): Don't change the language while using
8779 the font-default command.
8781 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8782 empty paragraph before a footnote.
8784 * src/insets/insetcommand.C (draw): Increase x correctly.
8786 * src/screen.C (ShowCursor): Change cursor shape if
8787 current language != document language.
8789 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8791 2000-03-31 Juergen Vigna <jug@sad.it>
8793 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8794 (Clone): changed mode how the paragraph-data is copied to the
8795 new clone-paragraph.
8797 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8798 GetInset(pos) with no inset anymore there (in inset UNDO)
8800 * src/insets/insetcommand.C (draw): small fix as here x is
8801 incremented not as much as width() returns (2 before, 2 behind = 4)
8803 2000-03-30 Juergen Vigna <jug@sad.it>
8805 * src/insets/insettext.C (InsetText): small fix in initialize
8806 widthOffset (should not be done in the init() function)
8808 2000-03-29 Amir Karger <karger@lyx.org>
8810 * lib/examples/it_ItemizeBullets.lyx: translation by
8813 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8815 2000-03-29 Juergen Vigna <jug@sad.it>
8817 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8819 * src/insets/insetfoot.C (Clone): small change as for the below
8820 new init function in the text-inset
8822 * src/insets/insettext.C (init): new function as I've seen that
8823 clone did not copy the Paragraph-Data!
8824 (LocalDispatch): Added code so that now we have some sort of Undo
8825 functionality (well actually we HAVE Undo ;)
8827 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8829 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8831 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8834 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8836 * src/main.C: added a runtime check that verifies that the xforms
8837 header used when building LyX and the library used when running
8838 LyX match. Exit with a message if they don't match. This is a
8839 version number check only.
8841 * src/buffer.C (save): Don't allocate memory on the heap for
8842 struct utimbuf times.
8844 * *: some using changes, use iosfwd instead of the real headers.
8846 * src/lyxfont.C use char const * instead of string for the static
8847 strings. Rewrite some functions to use sstream.
8849 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8851 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8854 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8856 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8857 of Geodesy (from Martin Vermeer)
8859 * lib/layouts/svjour.inc: include file for the Springer svjour
8860 class. It can be used to support journals other than JoG.
8862 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8863 Miskiewicz <misiek@pld.org.pl>)
8864 * lib/reLyX/Makefile.am: ditto.
8866 2000-03-27 Juergen Vigna <jug@sad.it>
8868 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8869 also some modifications with operations on selected text.
8871 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8872 problems with clicking on insets (last famous words ;)
8874 * src/insets/insetcommand.C (draw):
8875 (width): Changed to have a bit of space before and after the inset so
8876 that the blinking cursor can be seen (otherwise it was hidden)
8878 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8880 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8881 would not be added to the link list when an installed gettext (not
8882 part of libc) is found.
8884 2000-03-24 Juergen Vigna <jug@sad.it>
8886 * src/insets/insetcollapsable.C (Edit):
8887 * src/mathed/formula.C (InsetButtonRelease):
8888 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8891 * src/BufferView.C (workAreaButtonPress):
8892 (workAreaButtonRelease):
8893 (checkInsetHit): Finally fixed the clicking on insets be handled
8896 * src/insets/insetert.C (Edit): inserted this call so that ERT
8897 insets work always with LaTeX-font
8899 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8901 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8902 caused lyx to startup with no GUI in place, causing in a crash
8903 upon startup when called with arguments.
8905 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8907 * src/FontLoader.C: better initialization of dummyXFontStruct.
8909 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8911 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8912 for linuxdoc and docbook import and export format options.
8914 * lib/lyxrc.example Example of default values for the previous flags.
8916 * src/lyx_cb.C Use those flags instead of the hardwired values for
8917 linuxdoc and docbook export.
8919 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8922 * src/menus.C Added menus entries for the new import/exports formats.
8924 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8926 * src/lyxrc.*: Added support for running without Gui
8929 * src/FontLoader.C: sensible defaults if no fonts are needed
8931 * src/lyx_cb.C: New function ShowMessage (writes either to the
8932 minibuffer or cout in case of no gui
8933 New function AskOverwrite for common stuff
8934 Consequently various changes to call these functions
8936 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8937 wild guess at sensible screen resolution when having no gui
8939 * src/lyxfont.C: no gui, no fonts... set some defaults
8941 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8943 * src/LColor.C: made the command inset background a bit lighter.
8945 2000-03-20 Hartmut Goebel <goebel@noris.net>
8947 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8948 stdstruct.inc. Koma-Script added some title elements which
8949 otherwise have been listed below "bibliography". This split allows
8950 adding title elements to where they belong.
8952 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8953 define the additional title elements and then include
8956 * many other layout files: changed to include stdtitle.inc just
8957 before stdstruct.inc.
8959 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8961 * src/buffer.C: (save) Added the option to store all backup files
8962 in a single directory
8964 * src/lyxrc.[Ch]: Added variable \backupdir_path
8966 * lib/lyxrc.example: Added descriptions of recently added variables
8968 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8969 bibtex inset, not closing the bibtex popup when deleting the inset)
8971 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8973 * src/lyx_cb.C: add a couple using directives.
8975 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8976 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8977 import based on the filename.
8979 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8980 file would be imported at start, if the filename where of a sgml file.
8982 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8984 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8986 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8987 * src/lyxfont.h Replaced the member variable bits.direction by the
8988 member variable lang. Made many changes in other files.
8989 This allows having a multi-lingual document
8991 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8992 that change the current language to <l>.
8993 Removed the command "font-rtl"
8995 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8996 format for Hebrew documents)
8998 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8999 When auto_mathmode is "true", pressing a digit key in normal mode
9000 will cause entering into mathmode.
9001 If auto_mathmode is "rtl" then this behavior will be active only
9002 when writing right-to-left text.
9004 * src/text2.C (InsertStringA) The string is inserted using the
9007 * src/paragraph.C (GetEndLabel) Gives a correct result for
9008 footnote paragraphs.
9010 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9012 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9014 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9015 front of PasteParagraph. Never insert a ' '. This should at least
9016 fix some cause for the segfaults that we have been experiencing,
9017 it also fixes backspace behaviour slightly. (Phu!)
9019 * src/support/lstrings.C (compare_no_case): some change to make it
9020 compile with gcc 2.95.2 and stdlibc++-v3
9022 * src/text2.C (MeltFootnoteEnvironment): change type o
9023 first_footnote_par_is_not_empty to bool.
9025 * src/lyxparagraph.h: make text private. Changes in other files
9027 (fitToSize): new function
9028 (setContentsFromPar): new function
9029 (clearContents): new function
9030 (SetChar): new function
9032 * src/paragraph.C (readSimpleWholeFile): deleted.
9034 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9035 the file, just use a simple string instead. Also read the file in
9036 a more maintainable manner.
9038 * src/text2.C (InsertStringA): deleted.
9039 (InsertStringB): deleted.
9041 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9043 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9044 RedoParagraphs from the doublespace handling part, just set status
9045 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9046 done, but perhaps not like this.)
9048 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9050 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9051 character when inserting an inset.
9053 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9055 * src/bufferparams.C (readLanguage): now takes "default" into
9058 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9059 also initialize the toplevel_keymap with the default bindings from
9062 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9064 * all files using lyxrc: have lyxrc as a real variable and not a
9065 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9068 * src/lyxrc.C: remove double call to defaultKeyBindings
9070 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9071 toolbar defauls using lyxlex. Remove enums, structs, functions
9074 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9075 toolbar defaults. Also store default keybindings in a map.
9077 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9078 storing the toolbar defaults without any xforms dependencies.
9080 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9081 applied. Changed to use iterators.
9083 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9085 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9086 systems that don't have LINGUAS set to begin with.
9088 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9090 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9091 the list by Dekel Tsur.
9093 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9095 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9096 * src/insets/form_graphics.C: ditto.
9098 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9100 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9102 * src/bufferparams.C (readLanguage): use the new language map
9104 * src/intl.C (InitKeyMapper): use the new language map
9106 * src/lyx_gui.C (create_forms): use the new language map
9108 * src/language.[Ch]: New files. Used for holding the information
9109 about each language. Now! Use this new language map enhance it and
9110 make it really usable for our needs.
9112 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9114 * screen.C (ShowCursor): Removed duplicate code.
9115 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9116 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9118 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9121 * src/text.C Added TransformChar method. Used for rendering Arabic
9122 text correctly (change the glyphs of the letter according to the
9123 position in the word)
9128 * src/lyxrc.C Added lyxrc command {language_command_begin,
9129 language_command_end,language_command_ltr,language_command_rtl,
9130 language_package} which allows the use of either arabtex or Omega
9133 * src/lyx_gui.C (init)
9135 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9136 to use encoding for menu fonts which is different than the encoding
9139 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9140 do not load the babel package.
9141 To write an English document with Hebrew/Arabic, change the document
9142 language to "english".
9144 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9145 (alphaCounter): changed to return char
9146 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9148 * lib/lyxrc.example Added examples for Hebrew/Arabic
9151 * src/layout.C Added layout command endlabeltype
9153 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9155 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9157 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9159 * src/mathed/math_delim.C (search_deco): return a
9160 math_deco_struct* instead of index.
9162 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9164 * All files with a USE_OSTREAM_ONLY within: removed all code that
9165 was unused when USE_OSTREAM_ONLY is defined.
9167 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9168 of any less. Removed header and using.
9170 * src/text.C (GetVisibleRow): draw the string "Page Break
9171 (top/bottom)" on screen when drawing a pagebreak line.
9173 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9175 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9177 * src/mathed/math_macro.C (draw): do some cast magic.
9180 * src/mathed/math_defs.h: change byte* argument to byte const*.
9182 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9184 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9185 know it is right to return InsetFoot* too, but cxx does not like
9188 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9190 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9192 * src/mathed/math_delim.C: change == to proper assignment.
9194 2000-03-09 Juergen Vigna <jug@sad.it>
9196 * src/insets/insettext.C (setPos): fixed various cursor positioning
9197 problems (via mouse and cursor-keys)
9198 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9199 inset (still a small display problem but it works ;)
9201 * src/insets/insetcollapsable.C (draw): added button_top_y and
9202 button_bottom_y to have correct values for clicking on the inset.
9204 * src/support/lyxalgo.h: commented out 'using std::less'
9206 2000-03-08 Juergen Vigna <jug@sad.it>
9208 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9209 Button-Release event closes as it is alos the Release-Event
9212 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9214 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9216 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9217 can add multiple spaces in Scrap (literate programming) styles...
9218 which, by the way, is how I got hooked on LyX to begin with.
9220 * src/mathed/formula.C (Write): Added dummy variable to an
9221 inset::Latex() call.
9222 (Latex): Add free_spacing boolean to inset::Latex()
9224 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9226 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9227 virtual function to include the free_spacing boolean from
9228 the containing paragraph's style.
9230 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9231 Added free_spacing boolean arg to match inset.h
9233 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9234 Added free_spacing boolean arg to match inset.h
9236 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9237 Added free_spacing boolean and made sure that if in a free_spacing
9238 paragraph, that we output normal space if there is a protected space.
9240 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9241 Added free_spacing boolean arg to match inset.h
9243 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9244 Added free_spacing boolean arg to match inset.h
9246 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9247 Added free_spacing boolean arg to match inset.h
9249 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9250 Added free_spacing boolean arg to match inset.h
9252 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9253 Added free_spacing boolean arg to match inset.h
9255 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9256 free_spacing boolean arg to match inset.h
9258 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9259 Added free_spacing boolean arg to match inset.h
9261 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9262 Added free_spacing boolean arg to match inset.h
9264 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9265 Added free_spacing boolean arg to match inset.h
9267 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9268 Added free_spacing boolean arg to match inset.h
9270 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9271 Added free_spacing boolean arg to match inset.h
9273 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9274 free_spacing boolean arg to match inset.h
9276 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9277 free_spacing boolean arg to match inset.h
9279 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9280 ignore free_spacing paragraphs. The user's spaces are left
9283 * src/text.C (InsertChar): Fixed the free_spacing layout
9284 attribute behavior. Now, if free_spacing is set, you can
9285 add multiple spaces in a paragraph with impunity (and they
9286 get output verbatim).
9287 (SelectSelectedWord): Added dummy argument to inset::Latex()
9290 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9293 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9294 paragraph layouts now only input a simple space instead.
9295 Special character insets don't make any sense in free-spacing
9298 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9299 hard-spaces in the *input* file to simple spaces if the layout
9300 is free-spacing. This converts old files which had to have
9301 hard-spaces in free-spacing layouts where a simple space was
9303 (writeFileAscii): Added free_spacing check to pass to the newly
9304 reworked inset::Latex(...) methods. The inset::Latex() code
9305 ensures that hard-spaces in free-spacing paragraphs get output
9306 as spaces (rather than "~").
9308 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9310 * src/mathed/math_delim.C (draw): draw the empty placeholder
9311 delims with a onoffdash line.
9312 (struct math_deco_compare): struct that holds the "functors" used
9313 for the sort and the binary search in math_deco_table.
9314 (class init_deco_table): class used for initial sort of the
9316 (search_deco): use lower_bound to do a binary search in the
9319 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9321 * src/lyxrc.C: a small secret thingie...
9323 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9324 and to not flush the stream as often as it used to.
9326 * src/support/lyxalgo.h: new file
9327 (sorted): template function used for checking if a sequence is
9328 sorted or not. Two versions with and without user supplied
9329 compare. Uses same compare as std::sort.
9331 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9332 it and give warning on lyxerr.
9334 (struct compare_tags): struct with function operators used for
9335 checking if sorted, sorting and lower_bound.
9336 (search_kw): use lower_bound instead of manually implemented
9339 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9341 * src/insets/insetcollapsable.h: fix Clone() declaration.
9342 * src/insets/insetfoot.h: ditto.
9344 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9346 2000-03-08 Juergen Vigna <jug@sad.it>
9348 * src/insets/lyxinset.h: added owner call which tells us if
9349 this inset is inside another inset. Changed also the return-type
9350 of Editable to an enum so it tells clearer what the return-value is.
9352 * src/insets/insettext.C (computeTextRows): fixed computing of
9353 textinsets which split automatically on more rows.
9355 * src/insets/insetert.[Ch]: changed this to be of BaseType
9358 * src/insets/insetfoot.[Ch]: added footnote inset
9360 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9361 collapsable insets (like footnote, ert, ...)
9363 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9365 * src/lyxdraw.h: remvoe file
9367 * src/lyxdraw.C: remove file
9369 * src/insets/insettext.C: added <algorithm>.
9371 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9373 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9374 (matrix_cb): case MM_OK use string stream
9376 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9379 * src/mathed/math_macro.C (draw): use string stream
9380 (Metrics): use string stream
9382 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9383 directly to the ostream.
9385 * src/vspace.C (asString): use string stream.
9386 (asString): use string stream
9387 (asLatexString): use string stream
9389 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9390 setting Spacing::Other.
9392 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9393 sprintf when creating the stretch vale.
9395 * src/text2.C (alphaCounter): changed to return a string and to
9396 not use a static variable internally. Also fixed a one-off bug.
9397 (SetCounter): changed the drawing of the labels to use string
9398 streams instead of sprintf.
9400 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9401 manipulator to use a scheme that does not require library support.
9402 This is also the way it is done in the new GNU libstdc++. Should
9403 work with DEC cxx now.
9405 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9407 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9408 end. This fixes a bug.
9410 * src/mathed (all files concerned with file writing): apply the
9411 USE_OSTREAM_ONLY changes to mathed too.
9413 * src/support/DebugStream.h: make the constructor explicit.
9415 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9416 count and ostream squashed.
9418 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9420 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9422 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9423 ostringstream uses STL strings, and we might not.
9425 * src/insets/insetspecialchar.C: add using directive.
9426 * src/insets/insettext.C: ditto.
9428 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9430 * lib/layouts/seminar.layout: feeble attempt at a layout for
9431 seminar.cls, far from completet and could really use some looking
9432 at from people used to write layout files.
9434 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9435 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9436 a lot nicer and works nicely with ostreams.
9438 * src/mathed/formula.C (draw): a slightly different solution that
9439 the one posted to the list, but I think this one works too. (font
9440 size wrong in headers.)
9442 * src/insets/insettext.C (computeTextRows): some fiddling on
9443 Jürgens turf, added some comments that he should read.
9445 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9446 used and it gave compiler warnings.
9447 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9450 * src/lyx_gui.C (create_forms): do the right thing when
9451 show_banner is true/false.
9453 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9454 show_banner is false.
9456 * most file writing files: Now use iostreams to do almost all of
9457 the writing. Also instead of passing string &, we now use
9458 stringstreams. mathed output is still not adapted to iostreams.
9459 This change can be turned off by commenting out all the occurences
9460 of the "#define USE_OSTREAM_ONLY 1" lines.
9462 * src/WorkArea.C (createPixmap): don't output debug messages.
9463 (WorkArea): don't output debug messages.
9465 * lib/lyxrc.example: added a comment about the new variable
9468 * development/Code_rules/Rules: Added some more commente about how
9469 to build class interfaces and on how better encapsulation can be
9472 2000-03-03 Juergen Vigna <jug@sad.it>
9474 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9475 automatically with the width of the LyX-Window
9477 * src/insets/insettext.C (computeTextRows): fixed update bug in
9478 displaying text-insets (scrollvalues where not initialized!)
9480 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9482 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9483 id in the check of the result from lower_bound is not enough since
9484 lower_bound can return last too, and then res->id will not be a
9487 * all insets and some code that use them: I have conditionalized
9488 removed the Latex(string & out, ...) this means that only the
9489 Latex(ostream &, ...) will be used. This is a work in progress to
9490 move towards using streams for all output of files.
9492 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9495 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9497 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9498 routine (this fixes bug where greek letters were surrounded by too
9501 * src/support/filetools.C (findtexfile): change a bit the search
9502 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9503 no longer passed to kpsewhich, we may have to change that later.
9505 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9506 warning options to avoid problems with X header files (from Angus
9508 * acinclude.m4: regenerated.
9510 2000-03-02 Juergen Vigna <jug@sad.it>
9512 * src/insets/insettext.C (WriteParagraphData): Using the
9513 par->writeFile() function for writing paragraph-data.
9514 (Read): Using buffer->parseSingleLyXformat2Token()-function
9515 for parsing paragraph data!
9517 * src/buffer.C (readLyXformat2): removed all parse data and using
9518 the new parseSingleLyXformat2Token()-function.
9519 (parseSingleLyXformat2Token): added this function to parse (read)
9520 lyx-file-format (this is called also from text-insets now!)
9522 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9524 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9527 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9528 directly instead of going through a func. One very bad thing: a
9529 static LyXFindReplace, but I don't know where to place it.
9531 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9532 string instead of char[]. Also changed to static.
9533 (GetSelectionOrWordAtCursor): changed to static inline
9534 (SetSelectionOverLenChars): ditto.
9536 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9537 current_view and global variables. both classes has changed names
9538 and LyXFindReplace is not inherited from SearchForm.
9540 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9541 fl_form_search form.
9543 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9545 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9547 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9548 bound (from Kayvan).
9550 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9552 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9554 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9556 * some things that I should comment but the local pub says head to
9559 * comment out all code that belongs to the Roff code for Ascii
9560 export of tables. (this is unused)
9562 * src/LyXView.C: use correct type for global variable
9563 current_layout. (LyXTextClass::size_type)
9565 * some code to get the new insetgraphics closer to working I'd be
9566 grateful for any help.
9568 * src/BufferView2.C (insertInset): use the return type of
9569 NumberOfLayout properly. (also changes in other files)
9571 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9572 this as a test. I want to know what breaks because of this.
9574 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9576 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9578 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9579 to use a \makebox in the label, this allows proper justification
9580 with out using protected spaces or multiple hfills. Now it is
9581 "label" for left justified, "\hfill label\hfill" for center, and
9582 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9583 should be changed accordingly.
9585 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9587 * src/lyxtext.h: change SetLayout() to take a
9588 LyXTextClass::size_type instead of a char (when there is more than
9589 127 layouts in a class); also change type of copylayouttype.
9590 * src/text2.C (SetLayout): ditto.
9591 * src/LyXView.C (updateLayoutChoice): ditto.
9593 * src/LaTeX.C (scanLogFile): errors where the line number was not
9594 given just after the '!'-line were ignored (from Dekel Tsur).
9596 * lib/lyxrc.example: fix description of \date_insert_format
9598 * lib/layouts/llncs.layout: new layout, contributed by Martin
9601 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9603 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9604 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9605 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9606 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9607 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9608 paragraph.C, text.C, text2.C)
9610 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9612 * src/insets/insettext.C (LocalDispatch): remove extra break
9615 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9616 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9618 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9619 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9621 * src/insets/insetbib.h: move InsetBibkey::Holder and
9622 InsetCitation::Holder in public space.
9624 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9626 * src/insets/insettext.h: small change to get the new files from
9627 Juergen to compile (use "string", not "class string").
9629 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9630 const & as parameter to LocalDispatch, use LyXFont const & as
9631 paramter to some other func. This also had impacto on lyxinsets.h
9632 and the two mathed insets.
9634 2000-02-24 Juergen Vigna <jug@sad.it>
9637 * src/commandtags.h:
9639 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9643 * src/BufferView2.C: added/updated code for various inset-functions
9645 * src/insets/insetert.[Ch]: added implementation of InsetERT
9647 * src/insets/insettext.[Ch]: added implementation of InsetText
9649 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9650 (draw): added preliminary code for inset scrolling not finshed yet
9652 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9653 as it is in lyxfunc.C now
9655 * src/insets/lyxinset.h: Added functions for text-insets
9657 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9659 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9660 BufferView and reimplement the list as a queue put inside its own
9663 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9665 * several files: use the new interface to the "updateinsetlist"
9667 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9669 (work_area_handler): call BufferView::trippleClick on trippleclick.
9671 * src/BufferView.C (doubleClick): new function, selects word on
9673 (trippleClick): new function, selects line on trippleclick.
9675 2000-02-22 Allan Rae <rae@lyx.org>
9677 * lib/bind/xemacs.bind: buffer-previous not supported
9679 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9681 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9684 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9686 * src/bufferlist.C: get rid of current_view from this file
9688 * src/spellchecker.C: get rid of current_view from this file
9690 * src/vspace.C: get rid of current_view from this file
9691 (inPixels): added BufferView parameter for this func
9692 (asLatexCommand): added a BufferParams for this func
9694 * src/text.C src/text2.C: get rid of current_view from these
9697 * src/lyxfont.C (getFontDirection): move this function here from
9700 * src/bufferparams.C (getDocumentDirection): move this function
9703 * src/paragraph.C (getParDirection): move this function here from
9705 (getLetterDirection): ditto
9707 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9709 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9710 resize due to wrong pixmap beeing used. Also took the opurtunity
9711 to make the LyXScreen stateless on regard to WorkArea and some
9712 general cleanup in the same files.
9714 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9716 * src/Makefile.am: add missing direction.h
9718 * src/PainterBase.h: made the width functions const.
9720 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9723 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9725 * src/insets/insetlatexaccent.C (draw): make the accents draw
9726 better, at present this will only work well with iso8859-1.
9728 * several files: remove the old drawing code, now we use the new
9731 * several files: remove support for mono_video, reverse_video and
9734 2000-02-17 Juergen Vigna <jug@sad.it>
9736 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9737 int ** as we have to return the pointer, otherwise we have only
9738 NULL pointers in the returning function.
9740 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9742 * src/LaTeX.C (operator()): quote file name when running latex.
9744 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9746 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9747 (bubble tip), this removes our special handling of this.
9749 * Remove all code that is unused now that we have the new
9750 workarea. (Code that are not active when NEW_WA is defined.)
9752 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9754 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9756 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9757 nonexisting layout; correctly redirect obsoleted layouts.
9759 * lib/lyxrc.example: document \view_dvi_paper_option
9761 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9764 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9765 (PreviewDVI): handle the view_dvi_paper_option variable.
9766 [Both from Roland Krause]
9768 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9770 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9771 char const *, int, LyXFont)
9772 (text(int, int, string, LyXFont)): ditto
9774 * src/text.C (InsertCharInTable): attempt to fix the double-space
9775 feature in tables too.
9776 (BackspaceInTable): ditto.
9777 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9779 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9781 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9783 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9784 newly found text in textcache to this.
9785 (buffer): set the owner of the text put into the textcache to 0
9787 * src/insets/figinset.C (draw): fixed the drawing of figures with
9790 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9791 drawing of mathframe, hfills, protected space, table lines. I have
9792 now no outstanding drawing problems with the new Painter code.
9794 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9796 * src/PainterBase.C (ellipse, circle): do not specify the default
9799 * src/LColor.h: add using directive.
9801 * src/Painter.[Ch]: change return type of methods from Painter& to
9802 PainterBase&. Add a using directive.
9804 * src/WorkArea.C: wrap xforms callbacks in C functions
9807 * lib/layouts/foils.layout: font fix and simplifications from Carl
9810 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9812 * a lot of files: The Painter, LColor and WorkArea from the old
9813 devel branch has been ported to lyx-devel. Some new files and a
9814 lot of #ifdeffed code. The new workarea is enabled by default, but
9815 if you want to test the new Painter and LColor you have to compile
9816 with USE_PAINTER defined (do this in config.h f.ex.) There are
9817 still some rought edges, and I'd like some help to clear those
9818 out. It looks stable (loads and displays the Userguide very well).
9821 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9823 * src/buffer.C (pop_tag): revert to the previous implementation
9824 (use a global variable for both loops).
9826 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9828 * src/lyxrc.C (LyXRC): change slightly default date format.
9830 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9831 there is an English text with a footnote that starts with a Hebrew
9832 paragraph, or vice versa.
9833 (TeXFootnote): ditto.
9835 * src/text.C (LeftMargin): allow for negative values for
9836 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9839 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9840 for input encoding (cyrillic)
9842 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9844 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9847 * src/toolbar.C (set): ditto
9848 * src/insets/insetbib.C (create_form_citation_form): ditto
9850 * lib/CREDITS: added Dekel Tsur.
9852 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9853 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9854 hebrew supports files from Dekel Tsur.
9856 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9857 <tzafrir@technion.ac.il>
9859 * src/lyxrc.C: put \date_insert_format at the right place.
9861 * src/buffer.C (makeLaTeXFile): fix the handling of
9862 BufferParams::sides when writing out latex files.
9864 * src/BufferView2.C: add a "using" directive.
9866 * src/support/lyxsum.C (sum): when we use lyxstring,
9867 ostringstream::str needs an additional .c_str().
9869 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9871 * src/support/filetools.C (ChangeExtension): patch from Etienne
9874 * src/TextCache.C (show): remove const_cast and make second
9875 parameter non-const LyXText *.
9877 * src/TextCache.h: use non const LyXText in show.
9879 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9882 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9884 * src/support/lyxsum.C: rework to be more flexible.
9886 * several places: don't check if a pointer is 0 if you are going
9889 * src/text.C: remove some dead code.
9891 * src/insets/figinset.C: remove some dead code
9893 * src/buffer.C: move the BufferView funcs to BufferView2.C
9894 remove all support for insetlatexdel
9895 remove support for oldpapersize stuff
9896 made some member funcs const
9898 * src/kbmap.C: use a std::list to store the bindings in.
9900 * src/BufferView2.C: new file
9902 * src/kbsequence.[Ch]: new files
9904 * src/LyXAction.C + others: remove all trace of buffer-previous
9906 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9907 only have one copy in the binary of this table.
9909 * hebrew patch: moved some functions from LyXText to more
9910 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9912 * several files: remove support for XForms older than 0.88
9914 remove some #if 0 #endif code
9916 * src/TextCache.[Ch]: new file. Holds the textcache.
9918 * src/BufferView.C: changes to use the new TextCache interface.
9919 (waitForX): remove the now unused code.
9921 * src/BackStack.h: remove some commented code
9923 * lib/bind/emacs.bind: remove binding for buffer-previous
9925 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9927 * applied the hebrew patch.
9929 * src/lyxrow.h: make sure that all Row variables are initialized.
9931 * src/text2.C (TextHandleUndo): comment out a delete, this might
9932 introduce a memory leak, but should also help us to not try to
9933 read freed memory. We need to look at this one.
9935 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9936 (LyXParagraph): initalize footnotekind.
9938 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9939 forgot this when applying the patch. Please heed the warnings.
9941 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9942 (aka. reformat problem)
9944 * src/bufferlist.C (exists): made const, and use const_iterator
9945 (isLoaded): new func.
9946 (release): use std::find to find the correct buffer.
9948 * src/bufferlist.h: made getState a const func.
9949 made empty a const func.
9950 made exists a const func.
9953 2000-02-01 Juergen Vigna <jug@sad.it>
9955 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9957 * po/it.po: updated a bit the italian po file and also changed the
9958 'file nuovo' for newfile to 'filenuovo' without a space, this did
9961 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9962 for the new insert_date command.
9964 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9965 from jdblair, to insert a date into the current text conforming to
9966 a strftime format (for now only considering the locale-set and not
9967 the document-language).
9969 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9971 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9972 Bounds Read error seen by purify. The problem was that islower is
9973 a macros which takes an unsigned char and uses it as an index for
9974 in array of characters properties (and is thus subject to the
9978 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9979 correctly the paper sides radio buttons.
9980 (UpdateDocumentButtons): ditto.
9982 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9984 * src/kbmap.C (getsym + others): change to return unsigned int,
9985 returning a long can give problems on 64 bit systems. (I assume
9986 that int is 32bit on 64bit systems)
9988 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9990 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9991 LyXLookupString to be zero-terminated. Really fixes problems seen
9994 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9996 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9997 write a (char*)0 to the lyxerr stream.
9999 * src/lastfiles.C: move algorithm before the using statemets.
10001 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10003 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10004 complains otherwise).
10005 * src/table.C: ditto
10007 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10010 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10011 that I removed earlier... It is really needed.
10013 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10015 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10017 * INSTALL: update xforms home page URL.
10019 * lib/configure.m4: fix a bug with unreadable layout files.
10021 * src/table.C (calculate_width_of_column): add "using std::max"
10024 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10026 * several files: marked several lines with "DEL LINE", this is
10027 lines that can be deleted without changing anything.
10028 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10029 checks this anyway */
10032 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10034 * src/DepTable.C (update): add a "+" at the end when the checksum
10035 is different. (debugging string only)
10037 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10038 the next inset to not be displayed. This should also fix the list
10039 of labels in the "Insert Crossreference" dialog.
10041 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10043 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10044 when regex was not found.
10046 * src/support/lstrings.C (lowercase): use handcoded transform always.
10049 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10050 old_cursor.par->prev could be 0.
10052 * several files: changed post inc/dec to pre inc/dec
10054 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10055 write the lastfiles to file.
10057 * src/BufferView.C (buffer): only show TextCache info when debugging
10059 (resizeCurrentBuffer): ditto
10060 (workAreaExpose): ditto
10062 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10064 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10066 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10067 a bit better by removing the special case for \i and \j.
10069 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10071 * src/lyx_main.C (easyParse): remove test for bad comand line
10072 options, since this broke all xforms-related parsing.
10074 * src/kbmap.C (getsym): set return type to unsigned long, as
10075 declared in header. On an alpha, long is _not_ the same as int.
10077 * src/support/LOstream.h: add a "using std::flush;"
10079 * src/insets/figinset.C: ditto.
10081 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10083 * src/bufferlist.C (write): use blinding fast file copy instead of
10084 "a char at a time", now we are doing it the C++ way.
10086 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10087 std::list<int> instead.
10088 (addpidwait): reflect move to std::list<int>
10089 (sigchldchecker): ditto
10091 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10094 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10095 that obviously was wrong...
10097 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10098 c, this avoids warnings with purify and islower.
10100 * src/insets/figinset.C: rename struct queue to struct
10101 queue_element and rewrite to use a std::queue. gsqueue is now a
10102 std::queue<queue_element>
10103 (runqueue): reflect move to std::queue
10106 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10107 we would get "1" "0" instead of "true" "false. Also make the tostr
10110 2000-01-21 Juergen Vigna <jug@sad.it>
10112 * src/buffer.C (writeFileAscii): Disabled code for special groff
10113 handling of tabulars till I fix this in table.C
10115 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10117 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10119 * src/support/lyxlib.h: ditto.
10121 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10123 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10124 and 'j' look better. This might fix the "macron" bug that has been
10127 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10128 functions as one template function. Delete the old versions.
10130 * src/support/lyxsum.C: move using std::ifstream inside
10133 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10136 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10138 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10140 * src/insets/figinset.C (InitFigures): use new instead of malloc
10141 to allocate memory for figures and bitmaps.
10142 (DoneFigures): use delete[] instead of free to deallocate memory
10143 for figures and bitmaps.
10144 (runqueue): use new to allocate
10145 (getfigdata): use new/delete[] instead of malloc/free
10146 (RegisterFigure): ditto
10148 * some files: moved some declarations closer to first use, small
10149 whitespace changes use preincrement instead of postincrement where
10150 it does not make a difference.
10152 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10153 step on the way to use stl::containers for key maps.
10155 * src/bufferlist.h: add a typedef for const_iterator and const
10156 versions of begin and end.
10158 * src/bufferlist.[Ch]: change name of member variable _state to
10159 state_. (avoid reserved names)
10161 (getFileNames): returns the filenames of the buffers in a vector.
10163 * configure.in (ALL_LINGUAS): added ro
10165 * src/support/putenv.C: new file
10167 * src/support/mkdir.C: new file
10169 2000-01-20 Allan Rae <rae@lyx.org>
10171 * lib/layouts/IEEEtran.layout: Added several theorem environments
10173 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10174 couple of minor additions.
10176 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10177 (except for those in footnotes of course)
10179 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10181 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10183 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10184 std::sort and std::lower_bound instead of qsort and handwritten
10186 (struct compara): struct that holds the functors used by std::sort
10187 and std::lower_bound in MathedLookupBOP.
10189 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10191 * src/support/LAssert.h: do not do partial specialization. We do
10192 not really need it.
10194 * src/support/lyxlib.h: note that lyx::getUserName() and
10195 lyx::date() are not in use right now. Should these be suppressed?
10197 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10198 (makeLinuxDocFile): do not put date and user name in linuxdoc
10201 * src/support/lyxlib.h (kill): change first argument to long int,
10202 since that's what solaris uses.
10204 * src/support/kill.C (kill): fix declaration to match prototype.
10206 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10207 actually check whether namespaces are supported. This is not what
10210 * src/support/lyxsum.C: add a using directive.
10212 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10214 * src/support/kill.C: if we have namespace support we don't have
10215 to include lyxlib.h.
10217 * src/support/lyxlib.h: use namespace lyx if supported.
10219 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10221 * src/support/date.C: new file
10223 * src/support/chdir.C: new file
10225 * src/support/getUserName.C: new file
10227 * src/support/getcwd.C: new file
10229 * src/support/abort.C: new file
10231 * src/support/kill.C: new file
10233 * src/support/lyxlib.h: moved all the functions in this file
10234 insede struct lyx. Added also kill and abort to this struct. This
10235 is a way to avoid the "kill is not defined in <csignal>", we make
10236 C++ wrappers for functions that are not ANSI C or ANSI C++.
10238 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10239 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10240 lyx it has been renamed to sum.
10242 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10244 * src/text.C: add using directives for std::min and std::max.
10246 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10248 * src/texrow.C (getIdFromRow): actually return something useful in
10249 id and pos. Hopefully fixes the bug with positionning of errorbox
10252 * src/lyx_main.C (easyParse): output an error and exit if an
10253 incorrect command line option has been given.
10255 * src/spellchecker.C (ispell_check_word): document a memory leak.
10257 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10258 where a "struct utimbuf" is allocated with "new" and deleted with
10261 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10263 * src/text2.C (CutSelection): don't delete double spaces.
10264 (PasteSelection): ditto
10265 (CopySelection): ditto
10267 * src/text.C (Backspace): don't delete double spaces.
10269 * src/lyxlex.C (next): fix a bug that were only present with
10270 conformant std::istream::get to read comment lines, use
10271 std::istream::getline instead. This seems to fix the problem.
10273 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10275 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10276 allowed to insert space before space" editing problem. Please read
10277 commends at the beginning of the function. Comments about usage
10280 * src/text.C (InsertChar): fix for the "not allowed to insert
10281 space before space" editing problem.
10283 * src/text2.C (DeleteEmptyParagraphMechanism): when
10284 IsEmptyTableRow can only return false this last "else if" will
10285 always be a no-op. Commented out.
10287 * src/text.C (RedoParagraph): As far as I can understand tmp
10288 cursor is not really needed.
10290 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10291 present it could only return false anyway.
10292 (several functions): Did something not so smart...added a const
10293 specifier on a lot of methods.
10295 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10296 and add a tmp->text.resize. The LyXParagraph constructor does the
10298 (BreakParagraphConservative): ditto
10300 * src/support/path.h (Path): add a define so that the wrong usage
10301 "Path("/tmp") will be flagged as a compilation error:
10302 "`unnamed_Path' undeclared (first use this function)"
10304 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10306 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10307 which was bogus for several reasons.
10309 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10311 (runBibTeX): ditto.
10313 * autogen.sh: do not use "type -path" (what's that anyway?).
10315 * src/support/filetools.C (findtexfile): remove extraneous space
10316 which caused a kpsewhich warning (at least with kpathsea version
10319 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10321 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10323 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10325 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10327 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10329 * src/paragraph.C (BreakParagraph): do not reserve space on text
10330 if we don't need to (otherwise, if pos_end < pos, we end up
10331 reserving huge amounts of memory due to bad unsigned karma).
10332 (BreakParagraphConservative): ditto, although I have not seen
10333 evidence the bug can happen here.
10335 * src/lyxparagraph.h: add a using std::list.
10337 2000-01-11 Juergen Vigna <jug@sad.it>
10339 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10340 could not be found.
10342 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10344 * src/vc-backend.C (doVCCommand): change to be static and take one
10345 more parameter: the path to chdir too be fore executing the command.
10346 (retrive): new function equiv to "co -r"
10348 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10349 file_not_found_hook is true.
10351 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10353 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10354 if a file is readwrite,readonly...anything else.
10356 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10358 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10359 (CreatePostscript): name change from MenuRunDVIPS (or something)
10360 (PreviewPostscript): name change from MenuPreviewPS
10361 (PreviewDVI): name change from MenuPreviewDVI
10363 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10364 \view_pdf_command., \pdf_to_ps_command
10366 * lib/configure.m4: added search for PDF viewer, and search for
10367 PDF to PS converter.
10368 (lyxrc.defaults output): add \pdflatex_command,
10369 \view_pdf_command and \pdf_to_ps_command.
10371 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10373 * src/bufferlist.C (write): we don't use blocksize for anything so
10376 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10378 * src/support/block.h: disable operator T* (), since it causes
10379 problems with both compilers I tried. See comments in the file.
10381 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10384 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10385 variable LYX_DIR_10x to LYX_DIR_11x.
10387 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10389 * INSTALL: document --with-lyxname.
10392 * configure.in: new configure flag --with-lyxname which allows to
10393 choose the name under which lyx is installed. Default is "lyx", of
10394 course. It used to be possible to do this with --program-suffix,
10395 but the later has in fact a different meaning for autoconf.
10397 * src/support/lstrings.h (lstrchr): reformat a bit.
10399 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10400 * src/mathed/math_defs.h: ditto.
10402 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10404 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10405 true, decides if we create a backup file or not when saving. New
10406 tag and variable \pdf_mode, defaults to false. New tag and
10407 variable \pdflatex_command, defaults to pdflatex. New tag and
10408 variable \view_pdf_command, defaults to xpdf. New tag and variable
10409 \pdf_to_ps_command, defaults to pdf2ps.
10411 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10413 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10414 does not have a BufferView.
10415 (unlockInset): ditto + don't access the_locking_inset if the
10416 buffer does not have a BufferView.
10418 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10419 certain circumstances so that we don't continue a keyboard
10420 operation long after the key was released. Try f.ex. to load a
10421 large document, press PageDown for some seconds and then release
10422 it. Before this change the document would contine to scroll for
10423 some time, with this change it stops imidiatly.
10425 * src/support/block.h: don't allocate more space than needed. As
10426 long as we don't try to write to the arr[x] in a array_type arr[x]
10427 it is perfectly ok. (if you write to it you might segfault).
10428 added operator value_type*() so that is possible to pass the array
10429 to functions expecting a C-pointer.
10431 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10434 * intl/*: updated to gettext 0.10.35, tried to add our own
10435 required modifications. Please verify.
10437 * po/*: updated to gettext 0.10.35, tried to add our own required
10438 modifications. Please verify.
10440 * src/support/lstrings.C (tostr): go at fixing the problem with
10441 cxx and stringstream. When stringstream is used return
10442 oss.str().c_str() so that problems with lyxstring and basic_string
10443 are avoided. Note that the best solution would be for cxx to use
10444 basic_string all the way, but it is not conformant yet. (it seems)
10446 * src/lyx_cb.C + other files: moved several global functions to
10447 class BufferView, some have been moved to BufferView.[Ch] others
10448 are still located in lyx_cb.C. Code changes because of this. (part
10449 of "get rid of current_view project".)
10451 * src/buffer.C + other files: moved several Buffer functions to
10452 class BufferView, the functions are still present in buffer.C.
10453 Code changes because of this.
10455 * config/lcmessage.m4: updated to most recent. used when creating
10458 * config/progtest.m4: updated to most recent. used when creating
10461 * config/gettext.m4: updated to most recent. applied patch for
10464 * config/gettext.m4.patch: new file that shows what changes we
10465 have done to the local copy of gettext.m4.
10467 * config/libtool.m4: new file, used in creation of acinclude.m4
10469 * config/lyxinclude.m4: new file, this is the lyx created m4
10470 macros, used in making acinclude.m4.
10472 * autogen.sh: GNU m4 discovered as a separate task not as part of
10473 the lib/configure creation.
10474 Generate acinlucde from files in config. Actually cat
10475 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10476 easier to upgrade .m4 files that really are external.
10478 * src/Spacing.h: moved using std::istringstream to right after
10479 <sstream>. This should fix the problem seen with some compilers.
10481 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10483 * src/lyx_cb.C: began some work to remove the dependency a lot of
10484 functions have on BufferView::text, even if not really needed.
10485 (GetCurrentTextClass): removed this func, it only hid the
10488 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10489 forgot this in last commit.
10491 * src/Bullet.C (bulletEntry): use static char const *[] for the
10492 tables, becuase of this the return arg had to change to string.
10493 (bulletSize): ditto
10494 (~Bullet): removed unneeded destructor
10496 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10497 (insetSleep): moved from Buffer
10498 (insetWakeup): moved from Buffer
10499 (insetUnlock): moved from Buffer
10501 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10502 from Buffer to BufferView.
10504 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10506 * config/ltmain.sh: updated to version 1.3.4 of libtool
10508 * config/ltconfig: updated to version 1.3.4 of libtool
10510 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10513 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10514 Did I get that right?
10516 * src/lyxlex.h: add a "using" directive or two.
10517 * src/Spacing.h: ditto.
10518 * src/insets/figinset.C: ditto.
10519 * src/support/filetools.C: ditto.
10520 * src/support/lstrings.C: ditto.
10521 * src/BufferView.C: ditto.
10522 * src/bufferlist.C: ditto.
10523 * src/lyx_cb.C: ditto.
10524 * src/lyxlex.C: ditto.
10526 * NEWS: add some changes for 1.1.4.
10528 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10530 * src/BufferView.C: first go at a TextCache to speed up switching
10533 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10535 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10536 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10537 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10538 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10541 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10542 members of the struct are correctly initialized to 0 (detected by
10544 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10545 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10547 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10548 pidwait, since it was allocated with "new". This was potentially
10549 very bad. Thanks to Michael Schmitt for running purify for us.
10552 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10554 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10556 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10558 1999-12-30 Allan Rae <rae@lyx.org>
10560 * lib/templates/IEEEtran.lyx: minor change
10562 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10563 src/mathed/formula.C (LocalDispatch): askForText changes
10565 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10566 know when a user has cancelled input. Fixes annoying problems with
10567 inserting labels and version control.
10569 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10571 * src/support/lstrings.C (tostr): rewritten to use strstream and
10574 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10576 * src/support/filetools.C (IsFileWriteable): use fstream to check
10577 (IsDirWriteable): use fileinfo to check
10579 * src/support/filetools.h (FilePtr): whole class deleted
10581 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10583 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10585 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10587 * src/bufferlist.C (write): use ifstream and ofstream instead of
10590 * src/Spacing.h: use istrstream instead of sscanf
10592 * src/mathed/math_defs.h: change first arg to istream from FILE*
10594 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10596 * src/mathed/math_parser.C: have yyis to be an istream
10597 (LexGetArg): use istream (yyis)
10599 (mathed_parse): ditto
10600 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10602 * src/mathed/formula.C (Read): rewritten to use istream
10604 * src/mathed/formulamacro.C (Read): rewritten to use istream
10606 * src/lyxlex.h (~LyXLex): deleted desturctor
10607 (getStream): new function, returns an istream
10608 (getFile): deleted funtion
10609 (IsOK): return is.good();
10611 * src/lyxlex.C (LyXLex): delete file and owns_file
10612 (setFile): open an filebuf and assign that to a istream instead of
10614 (setStream): new function, takes an istream as arg.
10615 (setFile): deleted function
10616 (EatLine): rewritten us use istream instead of FILE*
10620 * src/table.C (LyXTable): use istream instead of FILE*
10621 (Read): rewritten to take an istream instead of FILE*
10623 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10625 * src/buffer.C (Dispatch): remove an extraneous break statement.
10627 * src/support/filetools.C (QuoteName): change to do simple
10628 'quoting'. More work is necessary. Also changed to do nothing
10629 under emx (needs fix too).
10630 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10632 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10633 config.h.in to the AC_DEFINE_UNQUOTED() call.
10634 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10635 needs char * as argument (because Solaris 7 declares it like
10638 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10639 remove definition of BZERO.
10641 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10643 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10644 defined, "lyxregex.h" if not.
10646 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10648 (REGEX): new variable that is set to regex.c lyxregex.h when
10649 AM_CONDITIONAL USE_REGEX is set.
10650 (libsupport_la_SOURCES): add $(REGEX)
10652 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10655 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10658 * configure.in: add call to LYX_REGEX
10660 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10661 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10663 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10665 * lib/bind/fi_menus.bind: new file, from
10666 pauli.virtanen@saunalahti.fi.
10668 * src/buffer.C (getBibkeyList): pass the parameter delim to
10669 InsetInclude::getKeys and InsetBibtex::getKeys.
10671 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10672 is passed to Buffer::getBibkeyList
10674 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10675 instead of the hardcoded comma.
10677 * src/insets/insetbib.C (getKeys): make sure that there are not
10678 leading blanks in bibtex keys. Normal latex does not care, but
10679 harvard.sty seems to dislike blanks at the beginning of citation
10680 keys. In particular, the retturn value of the function is
10682 * INSTALL: make it clear that libstdc++ is needed and that gcc
10683 2.7.x probably does not work.
10685 * src/support/filetools.C (findtexfile): make debug message go to
10687 * src/insets/insetbib.C (getKeys): ditto
10689 * src/debug.C (showTags): make sure that the output is correctly
10692 * configure.in: add a comment for TWO_COLOR_ICON define.
10694 * acconfig.h: remove all the entries that already defined in
10695 configure.in or acinclude.m4.
10697 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10698 to avoid user name, date and copyright.
10700 1999-12-21 Juergen Vigna <jug@sad.it>
10702 * src/table.C (Read): Now read bogus row format informations
10703 if the format is < 5 so that afterwards the table can
10704 be read by lyx but without any format-info. Fixed the
10705 crash we experienced when not doing this.
10707 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10709 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10710 (RedoDrawingOfParagraph): ditto
10711 (RedoParagraphs): ditto
10712 (RemoveTableRow): ditto
10714 * src/text.C (Fill): rename arg paperwidth -> paper_width
10716 * src/buffer.C (insertLyXFile): rename var filename -> fname
10717 (writeFile): rename arg filename -> fname
10718 (writeFileAscii): ditto
10719 (makeLaTeXFile): ditto
10720 (makeLinuxDocFile): ditto
10721 (makeDocBookFile): ditto
10723 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10726 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10728 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10731 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10732 compiled by a C compiler not C++.
10734 * src/layout.h (LyXTextClass): added typedef for const_iterator
10735 (LyXTextClassList): added typedef for const_iterator + member
10736 functions begin and end.
10738 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10739 iterators to fill the choice_class.
10740 (updateLayoutChoice): rewritten to use iterators to fill the
10741 layoutlist in the toolbar.
10743 * src/BufferView.h (BufferView::work_area_width): removed unused
10746 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10748 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10749 (sgmlCloseTag): ditto
10751 * src/support/lstrings.h: return type of countChar changed to
10754 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10755 what version of this func to use. Also made to return unsigned int.
10757 * configure.in: call LYX_STD_COUNT
10759 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10760 conforming std::count.
10762 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10764 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10765 and a subscript would give bad display (patch from Dekel Tsur
10766 <dekel@math.tau.ac.il>).
10768 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10770 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10773 * src/chset.h: add a few 'using' directives
10775 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10776 triggered when no buffer is active
10778 * src/layout.C: removed `break' after `return' in switch(), since
10781 * src/lyx_main.C (init): make sure LyX can be ran in place even
10782 when libtool has done its magic with shared libraries. Fix the
10783 test for the case when the system directory has not been found.
10785 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10786 name for the latex file.
10787 (MenuMakeHTML): ditto
10789 * src/buffer.h: add an optional boolean argument, which is passed
10790 to ChangeExtension.
10792 1999-12-20 Allan Rae <rae@lyx.org>
10794 * lib/templates/IEEEtran.lyx: small correction and update.
10796 * configure.in: Attempted to use LYX_PATH_HEADER
10798 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10800 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10801 input from JMarc. Now use preprocessor to find the header.
10802 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10803 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10804 LYX_STL_STRING_FWD. See comments in file.
10806 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10808 * The global MiniBuffer * minibuffer variable is dead.
10810 * The global FD_form_main * fd_form_main variable is dead.
10812 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10814 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10816 * src/table.h: add the LOstream.h header
10817 * src/debug.h: ditto
10819 * src/LyXAction.h: change the explaination of the ReadOnly
10820 attribute: is indicates that the function _can_ be used.
10822 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10825 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10827 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10833 * src/paragraph.C (GetWord): assert on pos>=0
10836 * src/support/lyxstring.C: condition the use of an invariant on
10838 * src/support/lyxstring.h: ditto
10840 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10841 Use LAssert.h instead of plain assert().
10843 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10845 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10846 * src/support/filetools.C: ditto
10848 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10851 * INSTALL: document the new configure flags
10853 * configure.in: suppress --with-debug; add --enable-assertions
10855 * acinclude.m4: various changes in alignment of help strings.
10857 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10859 * src/kbmap.C: commented out the use of the hash map in kb_map,
10860 beginning of movement to a stl::container.
10862 * several files: removed code that was not in effect when
10863 MOVE_TEXT was defined.
10865 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10866 for escaping should not be used. We can discuss if the string
10867 should be enclosed in f.ex. [] instead of "".
10869 * src/trans_mgr.C (insert): use the new returned value from
10870 encodeString to get deadkeys and keymaps done correctly.
10872 * src/chset.C (encodeString): changed to return a pair, to tell
10873 what to use if we know the string.
10875 * src/lyxscreen.h (fillArc): new function.
10877 * src/FontInfo.C (resize): rewritten to use more std::string like
10878 structore, especially string::replace.
10880 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10883 * configure.in (chmod +x some scripts): remove config/gcc-hack
10885 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10887 * src/buffer.C (writeFile): change once again the top comment in a
10888 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10889 instead of an hardcoded version number.
10890 (makeDocBookFile): ditto
10892 * src/version.h: add new define LYX_DOCVERSION
10894 * po/de.po: update from Pit Sütterlin
10895 * lib/bind/de_menus.bind: ditto.
10897 * src/lyxfunc.C (Dispatch): call MenuExport()
10898 * src/buffer.C (Dispatch): ditto
10900 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10901 LyXFunc::Dispatch().
10902 (MenuExport): new function, moved from
10903 LyXFunc::Dispatch().
10905 * src/trans_mgr.C (insert): small cleanup
10906 * src/chset.C (loadFile): ditto
10908 * lib/kbd/iso8859-1.cdef: add missing backslashes
10910 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10912 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10913 help with placing the manually drawn accents better.
10915 (Draw): x2 and hg changed to float to minimize rounding errors and
10916 help place the accents better.
10918 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10919 unsigned short to char is just wrong...cast the char to unsigned
10920 char instead so that the two values can compare sanely. This
10921 should also make the display of insetlatexaccents better and
10922 perhaps also some other insets.
10924 (lbearing): new function
10927 1999-12-15 Allan Rae <rae@lyx.org>
10929 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10930 header that provides a wrapper around the very annoying SGI STL header
10933 * src/support/lyxstring.C, src/LString.h:
10934 removed old SGI-STL-compatability attempts.
10936 * configure.in: Use LYX_STL_STRING_FWD.
10938 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10939 stl_string_fwd.h is around and try to determine it's location.
10940 Major improvement over previous SGI STL 3.2 compatability.
10941 Three small problems remain with this function due to my zero
10942 knowledge of autoconf. JMarc and lgb see the comments in the code.
10944 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10946 * src/broken_const.h, config/hack-gcc, config/README: removed
10948 * configure.in: remove --with-gcc-hack option; do not call
10951 * INSTALL: remove documentation of --with-broken-const and
10954 * acconfig.h: remove all trace of BROKEN_CONST define
10956 * src/buffer.C (makeDocBookFile): update version number in output
10958 (SimpleDocBookOnePar): fix an assert when trying to a character
10959 access beyond string length
10962 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10964 * po/de.po: fix the Export menu
10966 * lyx.man: update the description of -dbg
10968 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10969 (commandLineHelp): updated
10970 (easyParse): show list of available debug levels if -dbg is passed
10973 * src/Makefile.am: add debug.C
10975 * src/debug.h: moved some code to debug.C
10977 * src/debug.C: new file. Contains code to set and show debug
10980 * src/layout.C: remove 'break' after 'continue' in switch
10981 statements, since these cannot be reached.
10983 1999-12-13 Allan Rae <rae@lyx.org>
10985 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10986 (in_word_set): hash() -> math_hash()
10988 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10990 * acconfig.h: Added a test for whether we are using exceptions in the
10991 current compilation run. If so USING_EXCEPTIONS is defined.
10993 * config.in: Check for existance of stl_string_fwd.h
10994 * src/LString.h: If compiling --with-included-string and SGI's
10995 STL version 3.2 is present (see above test) we need to block their
10996 forward declaration of string and supply a __get_c_string().
10997 However, it turns out this is only necessary if compiling with
10998 exceptions enabled so I've a bit more to add yet.
11000 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11001 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11002 src/support/LRegex.h, src/undo.h:
11003 Shuffle the order of the included files a little to ensure that
11004 LString.h gets included before anything that includes stl_string_fwd.h
11006 * src/support/lyxstring.C: We need to #include LString.h instead of
11007 lyxstring.h to get the necessary definition of __get_c_string.
11008 (__get_c_string): New function. This is defined static just like SGI's
11009 although why they need to do this I'm not sure. Perhaps it should be
11010 in lstrings.C instead.
11012 * lib/templates/IEEEtran.lyx: New template file.
11014 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11016 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11017 * intl/Makefile.in (MKINSTALLDIRS): ditto
11019 * src/LyXAction.C (init): changed to hold the LFUN data in a
11020 automatic array in stead of in callso to newFunc, this speeds up
11021 compilation a lot. Also all the memory used by the array is
11022 returned when the init is completed.
11024 * a lot of files: compiled with -Wold-style-cast, changed most of
11025 the reported offenders to C++ style casts. Did not change the
11026 offenders in C files.
11028 * src/trans.h (Match): change argument type to unsigned int.
11030 * src/support/DebugStream.C: fix some types on the streambufs so
11031 that it works on a conforming implementation.
11033 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11035 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11037 * src/support/lyxstring.C: remove the inline added earlier since
11038 they cause a bunch of unsatisfied symbols when linking with dec
11039 cxx. Cxx likes to have the body of inlines at the place where they
11042 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11043 accessing negative bounds in array. This fixes the crash when
11044 inserting accented characters.
11045 * src/trans.h (Match): ditto
11047 * src/buffer.C (Dispatch): since this is a void, it should not try
11048 to return anything...
11050 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11052 * src/buffer.h: removed the two friends from Buffer. Some changes
11053 because of this. Buffer::getFileName and Buffer::setFileName
11054 renamed to Buffer::fileName() and Buffer::fileName(...).
11056 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11058 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11059 and Buffer::update(short) to BufferView. This move is currently
11060 controlled by a define MOVE_TEXT, this will be removed when all
11061 shows to be ok. This move paves the way for better separation
11062 between buffer contents and buffer view. One side effect is that
11063 the BufferView needs a rebreak when swiching buffers, if we want
11064 to avoid this we can add a cache that holds pointers to LyXText's
11065 that is not currently in use.
11067 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11070 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11072 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11074 * lyx_main.C: new command line option -x (or --execute) and
11075 -e (or --export). Now direct conversion from .lyx to .tex
11076 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11077 Unfortunately, X is still needed and the GUI pops up during the
11080 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11082 * src/Spacing.C: add a using directive to bring stream stuff into
11084 * src/paragraph.C: ditto
11085 * src/buffer.C: ditto
11087 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11088 from Lars' announcement).
11090 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11091 example files from Tino Meinen.
11093 1999-12-06 Allan Rae <rae@lyx.org>
11095 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11097 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11099 * src/support/lyxstring.C: added a lot of inline for no good
11102 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11103 latexWriteEndChanges, they were not used.
11105 * src/layout.h (operator<<): output operator for PageSides
11107 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11109 * some example files: loaded in LyX 1.0.4 and saved again to update
11110 certain constructs (table format)
11112 * a lot of files: did the change to use fstream/iostream for all
11113 writing of files. Done with a close look at Andre Poenitz's patch.
11115 * some files: whitespace changes.
11117 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11119 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11120 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11121 architecture, we provide our own. It is used unconditionnally, but
11122 I do not think this is a performance problem. Thanks to Angus
11123 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11124 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11126 (GetInset): use my_memcpy.
11130 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11131 it is easier to understand, but it uses less TeX-only constructs now.
11133 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11134 elements contain spaces
11136 * lib/configure: regenerated
11138 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11139 elements contain spaces; display the list of programs that are
11142 * autogen.sh: make sure lib/configure is executable
11144 * lib/examples/*: rename the tutorial examples to begin with the
11145 two-letters language code.
11147 * src/lyxfunc.C (getStatus): do not query current font if no
11150 * src/lyx_cb.C (RunScript): use QuoteName
11151 (MenuRunDvips): ditto
11152 (PrintApplyCB): ditto
11154 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11155 around argument, so that it works well with the current shell.
11156 Does not work properly with OS/2 shells currently.
11158 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11159 * src/LyXSendto.C (SendtoApplyCB): ditto
11160 * src/lyxfunc.C (Dispatch): ditto
11161 * src/buffer.C (runLaTeX): ditto
11162 (runLiterate): ditto
11163 (buildProgram): ditto
11165 * src/lyx_cb.C (RunScript): ditto
11166 (MenuMakeLaTeX): ditto
11168 * src/buffer.h (getLatexName): new method
11170 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11172 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11174 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11175 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11176 (create_math_panel): ditto
11178 * src/lyxfunc.C (getStatus): re-activate the code which gets
11179 current font and cursor; add test for export to html.
11181 * src/lyxrc.C (read): remove unreachable break statements; add a
11184 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11186 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11188 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11189 introduced by faulty regex.
11190 * src/buffer.C: ditto
11191 * src/lastfiles.C: ditto
11192 * src/paragraph.C: ditto
11193 * src/table.C: ditto
11194 * src/vspace.C: ditto
11195 * src/insets/figinset.C: ditto
11196 Note: most of these is absolutely harmless, except the one in
11197 src/mathed formula.C.
11199 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11201 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11202 operation, yielding correct results for the reLyX command.
11204 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11206 * src/support/filetools.C (ExpandPath): removed an over eager
11208 (ReplaceEnvironmentPath): ditto
11210 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11211 shows that we are doing something fishy in our code...
11212 (BubblePost): ditto
11215 * src/lyxrc.C (read): use a double switch trick to get more help
11216 from the compiler. (the same trick is used in layout.C)
11217 (write): new function. opens a ofstream and pass that to output
11218 (output): new function, takes a ostream and writes the lyxrc
11219 elemts to it. uses a dummy switch to make sure no elements are
11222 * src/lyxlex.h: added a struct pushpophelper for use in functions
11223 with more than one exit point.
11225 * src/lyxlex.[Ch] (GetInteger): made it const
11229 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11231 * src/layout.[hC] : LayoutTags splitted into several enums, new
11232 methods created, better error handling cleaner use of lyxlex. Read
11235 * src/bmtable.[Ch]: change some member prototypes because of the
11236 image const changes.
11238 * commandtags.h, src/LyXAction.C (init): new function:
11239 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11240 This file is not read automatically but you can add \input
11241 preferences to your lyxrc if you want to. We need to discuss how
11244 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11245 in .aux, also remove .bib and .bst files from dependencies when
11248 * src/BufferView.C, src/LyXView.C: add const_cast several places
11249 because of changes to images.
11251 * lib/images/*: same change as for images/*
11253 * lib/lyxrc.example: Default for accept_compound is false not no.
11255 * images/*: changed to be const, however I have som misgivings
11256 about this change so it might be changed back.
11258 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11260 * lib/configure, po/POTFILES.in: regenerated
11262 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11264 * config/lib_configure.m4: removed
11266 * lib/configure.m4: new file (was config/lib_configure.m4)
11268 * configure.in: do not test for rtti, since we do not use it.
11270 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11272 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11273 doubling of allocated space scheme. This makes it faster for large
11274 strings end to use less memory for small strings. xtra rememoved.
11276 * src/insets/figinset.C (waitalarm): commented out.
11277 (GhostscriptMsg): use static_cast
11278 (GhostscriptMsg): use new instead of malloc to allocate memory for
11279 cmap. also delete the memory after use.
11281 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11283 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11284 for changes in bibtex database or style.
11285 (runBibTeX): remove all .bib and .bst files from dep before we
11287 (run): use scanAuc in when dep file already exist.
11289 * src/DepTable.C (remove_files_with_extension): new method
11290 (exist): new method
11292 * src/DepTable.[Ch]: made many of the methods const.
11294 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11296 * src/bufferparams.C: make sure that the default textclass is
11297 "article". It used to be the first one by description order, but
11298 now the first one is "docbook".
11300 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11301 string; call Debug::value.
11302 (easyParse): pass complete argument to setDebuggingLevel().
11304 * src/debug.h (value): fix the code that parses debug levels.
11306 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11309 * src/LyXAction.C: use Debug::ACTION as debug channel.
11311 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11313 * NEWS: updated for the future 1.1.3 release.
11315 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11316 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11317 it should. This is of course a controversial change (since many
11318 people will find that their lyx workscreen is suddenly full of
11319 red), but done for the sake of correctness.
11321 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11322 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11324 * src/insets/inseterror.h, src/insets/inseturl.h,
11325 src/insets/insetinfo.h, src/insets/figinset.h,
11326 src/mathed/formulamacro.h, src/mathed/math_macro.h
11327 (EditMessage): add a missing const and add _() to make sure that
11328 translation happens
11330 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11331 src/insets/insetbib.C, src/support/filetools.C: add `using'
11332 directives for cxx.
11334 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11335 doing 'Insert index of last word' at the beginning of a paragraph.
11337 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11339 * several files: white-space changes.
11341 * src/mathed/formula.C: removed IsAlpha and IsDigit
11343 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11344 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11347 * src/insets/figinset.C (GetPSSizes): don't break when
11348 "EndComments" is seen. But break when a boundingbox is read.
11350 * all classes inherited from Inset: return value of Clone
11351 changed back to Inset *.
11353 * all classes inherited form MathInset: return value of Clone
11354 changed back to MathedInset *.
11356 * src/insets/figinset.C (runqueue): use a ofstream to output the
11357 gs/ps file. Might need some setpresicion or setw. However I can
11358 see no problem with the current code.
11359 (runqueue): use sleep instead of the alarm/signal code. I just
11360 can't see the difference.
11362 * src/paragraph.C (LyXParagraph): reserve space in the new
11363 paragraph and resize the inserted paragraph to just fit.
11365 * src/lyxfunc.h (operator|=): added operator for func_status.
11367 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11368 check for readable file.
11370 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11371 check for readable file.
11372 (MenuMakeLinuxDoc): ditto
11373 (MenuMakeDocBook): ditto
11374 (MenuMakeAscii): ditto
11375 (InsertAsciiFile): split the test for openable and readable
11377 * src/bmtable.C (draw_bitmaptable): use
11378 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11380 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11381 findtexfile from LaTeX to filetools.
11383 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11384 instead of FilePtr. Needs to be verified by a literate user.
11386 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11388 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11389 (EditMessage): likewise.
11391 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11392 respectively as \textasciitilde and \textasciicircum.
11394 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11396 * src/support/lyxstring.h: made the methods that take iterators
11397 use const_iterator.
11399 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11400 (regexMatch): made is use the real regex class.
11402 * src/support/Makefile.am: changed to use libtool
11404 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11406 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11408 (MathIsInset ++): changed several macros to be inline functions
11411 * src/mathed/Makefile.am: changed to use libtool
11413 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11415 * src/insets/inset* : Clone changed to const and return type is
11416 the true insettype not just Inset*.
11418 * src/insets/Makefile.am: changed to use libtool
11420 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11422 * src/undo.[Ch] : added empty() and changed some of the method
11425 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11427 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11428 setID use block<> for the bullets array, added const several places.
11430 * src/lyxfunc.C (getStatus): new function
11432 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11433 LyXAction, added const to several funtions.
11435 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11436 a std::map, and to store the dir items in a vector.
11438 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11441 * src/LyXView.[Ch] + other files : changed currentView to view.
11443 * src/LyXAction.[Ch] : ported from the old devel branch.
11445 * src/.cvsignore: added .libs and a.out
11447 * configure.in : changes to use libtool.
11449 * acinclude.m4 : inserted libtool.m4
11451 * .cvsignore: added libtool
11453 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11455 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11456 file name in insets and mathed directories (otherwise the
11457 dependency is not taken in account under cygwin).
11459 * src/text2.C (InsertString[AB]): make sure that we do not try to
11460 read characters past the string length.
11462 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11464 * lib/doc/LaTeXConfig.lyx.in,
11465 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11467 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11468 file saying who created them and when this heppened; this is
11469 useless and annoys tools like cvs.
11471 * lib/layouts/g-brief-{en,de}.layout,
11472 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11473 from Thomas Hartkens <thomas@hartkens.de>.
11475 * src/{insets,mathed}/Makefile.am: do not declare an empty
11476 LDFLAGS, so that it can be set at configure time (useful on Irix
11479 * lib/reLyX/configure.in: make sure that the prefix is set
11480 correctly in LYX_DIR.
11482 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11484 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11485 be used by 'command-sequence' this allows to bind a key to a
11486 sequence of LyX-commands
11487 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11489 * src/LyXAction.C: add "command-sequence"
11491 * src/LyXFunction.C: handling of "command-sequence"
11493 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11494 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11496 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11498 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11500 * src/buffer.C (writeFile): Do not output a comment giving user
11501 and date at the beginning of a .lyx file. This is useless and
11502 annoys cvs anyway; update version number to 1.1.
11504 * src/Makefile.am (LYX_DIR): add this definition, so that a
11505 default path is hardcoded in LyX.
11507 * configure.in: Use LYX_GNU_GETTEXT.
11509 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11510 AM_GNU_GETTEXT with a bug fixed.
11512 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11514 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11516 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11517 which is used to point to LyX data is now LYX_DIR_11x.
11519 * lyx.man: convert to a unix text file; small updates.
11521 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11523 * src/support/LSubstring.[Ch]: made the second arg of most of the
11524 constructors be a const reference.
11526 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11529 * src/support/lyxstring.[Ch] (swap): added missing member function
11530 and specialization of swap(str, str);
11532 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11534 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11535 trace of the old one.
11537 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11538 put the member definitions in undo.C.
11540 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11541 NEW_TEXT and have now only code that was included when this was
11544 * src/intl.C (LCombo): use static_cast
11546 (DispatchCallback): ditto
11548 * src/definitions.h: removed whole file
11550 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11552 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11553 parsing and stores in a std:map. a regex defines the file format.
11554 removed unneeded members.
11556 * src/bufferparams.h: added several enums from definitions.h here.
11557 Removed unsused destructor. Changed some types to use proper enum
11558 types. use block to have the temp_bullets and user_defined_bullets
11559 and to make the whole class assignable.
11561 * src/bufferparams.C (Copy): removed this functions, use a default
11562 assignment instead.
11564 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11567 * src/buffer.C (readLyXformat2): commend out all that have with
11568 oldpapersize to do. also comment out all that hve to do with
11569 insetlatex and insetlatexdel.
11570 (setOldPaperStuff): commented out
11572 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11574 * src/LyXAction.C: remove use of inset-latex-insert
11576 * src/mathed/math_panel.C (button_cb): use static_cast
11578 * src/insets/Makefile.am (insets_o_SOURCES): removed
11581 * src/support/lyxstring.C (helper): use the unsigned long
11582 specifier, UL, instead of a static_cast.
11584 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11586 * src/support/block.h: new file. to be used as a c-style array in
11587 classes, so that the class can be assignable.
11589 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11591 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11592 NULL, make sure to return an empty string (it is not possible to
11593 set a string to NULL).
11595 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11597 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11599 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11601 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11602 link line, so that Irix users (for example) can set it explicitely to
11605 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11606 it can be overidden at make time (static or dynamic link, for
11609 * src/vc-backend.C, src/LaTeXFeatures.h,
11610 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11611 statements to bring templates to global namespace.
11613 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11615 * src/support/lyxstring.C (operator[] const): make it standard
11618 * src/minibuffer.C (Init): changed to reflect that more
11619 information is given from the lyxvc and need not be provided here.
11621 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11623 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11625 * src/LyXView.C (UpdateTimerCB): use static_cast
11626 (KeyPressMask_raw_callback): ditto
11628 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11629 buffer_, a lot of changes because of this. currentBuffer() ->
11630 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11631 also changes to other files because of this.
11633 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11635 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11636 have no support for RCS and partial support for CVS, will be
11639 * src/insets/ several files: changes because of function name
11640 changes in Bufferview and LyXView.
11642 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11644 * src/support/LSubstring.[Ch]: new files. These implement a
11645 Substring that can be very convenient to use. i.e. is this
11647 string a = "Mary had a little sheep";
11648 Substring(a, "sheep") = "lamb";
11649 a is now "Mary has a little lamb".
11651 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11652 out patterns and subpatterns of strings. It is used by LSubstring
11653 and also by vc-backend.C
11655 * src/support/lyxstring.C: went over all the assertions used and
11656 tried to correct the wrong ones and flag which of them is required
11657 by the standard. some bugs found because of this. Also removed a
11658 couple of assertions.
11660 * src/support/Makefile.am (libsupport_a_SOURCES): added
11661 LSubstring.[Ch] and LRegex.[Ch]
11663 * src/support/FileInfo.h: have struct stat buf as an object and
11664 not a pointer to one, some changes because of this.
11666 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11667 information in layout when adding the layouts preamble to the
11668 textclass preamble.
11670 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11673 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11674 because of bug in OS/2.
11676 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11678 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11679 \verbatim@font instead of \ttfamily, so that it can be redefined.
11681 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11682 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11683 src/layout.h, src/text2.C: add 'using' directive to bring the
11684 STL templates we need from the std:: namespace to the global one.
11685 Needed by DEC cxx in strict ansi mode.
11687 * src/support/LIstream.h,src/support/LOstream.h,
11688 src/support/lyxstring.h,src/table.h,
11689 src/lyxlookup.h: do not include <config.h> in header
11690 files. This should be done in the .C files only.
11692 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11696 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11698 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11699 from Kayvan to fix the tth invokation.
11701 * development/lyx.spec.in: updates from Kayvan to reflect the
11702 changes of file names.
11704 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11706 * src/text2.C (InsertStringB): use std::copy
11707 (InsertStringA): use std::copy
11709 * src/bufferlist.C: use a vector to store the buffers in. This is
11710 an internal change and should not affect any other thing.
11712 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11715 * src/text.C (Fill): fix potential bug, one off bug.
11717 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11719 * src/Makefile.am (lyx_main.o): add more files it depends on.
11721 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11723 * src/support/lyxstring.C: use size_t for the reference count,
11724 size, reserved memory and xtra.
11725 (internal_compare): new private member function. Now the compare
11726 functions should work for std::strings that have embedded '\0'
11728 (compare): all compare functions rewritten to use
11731 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11733 * src/support/lyxstring.C (compare): pass c_str()
11734 (compare): pass c_str
11735 (compare): pass c_str
11737 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11739 * src/support/DebugStream.C: <config.h> was not included correctly.
11741 * lib/configure: forgot to re-generate it :( I'll make this file
11742 auto generated soon.
11744 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11746 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11749 * src/support/lyxstring.C: some changes from length() to rep->sz.
11750 avoids a function call.
11752 * src/support/filetools.C (SpaceLess): yet another version of the
11753 algorithm...now per Jean-Marc's suggestions.
11755 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11757 * src/layout.C (less_textclass_desc): functor for use in sorting
11759 (LyXTextClass::Read): sort the textclasses after reading.
11761 * src/support/filetools.C (SpaceLess): new version of the
11762 SpaceLess functions. What problems does this one give? Please
11765 * images/banner_bw.xbm: made the arrays unsigned char *
11767 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11769 * src/support/lyxstring.C (find): remove bogus assertion in the
11770 two versions of find where this has not been done yet.
11772 * src/support/lyxlib.h: add missing int return type to
11775 * src/menus.C (ShowFileMenu): disable exporting to html if no
11776 html export command is present.
11778 * config/lib_configure.m4: add a test for an HTML converter. The
11779 programs checked for are, in this order: tth, latex2html and
11782 * lib/configure: generated from config/lib_configure.m4.
11784 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11785 html converter. The parameters are now passed through $$FName and
11786 $$OutName, instead of standard input/output.
11788 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11790 * lib/lyxrc.example: update description of \html_command.
11791 add "quotes" around \screen_font_xxx font setting examples to help
11792 people who use fonts with spaces in their names.
11794 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11796 * Distribution files: updates for v1.1.2
11798 * src/support/lyxstring.C (find): remove bogus assert and return
11799 npos for the same condition.
11801 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11803 * added patch for OS/2 from SMiyata.
11805 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11807 * src/text2.C (CutSelection): make space_wrapped a bool
11808 (CutSelection): dont declare int i until we have to.
11809 (alphaCounter): return a char const *.
11811 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11813 * src/support/syscall.C (Systemcalls::kill):
11814 src/support/filetools.C (PutEnv, PutEnvPath):
11815 src/lyx_cb.C (addNewlineAndDepth):
11816 src/FontInfo.C (FontInfo::resize): condition some #warning
11817 directives with WITH_WARNINGS.
11820 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11822 * src/layout.[Ch] + several files: access to class variables
11823 limited and made accessor functions instead a lot of code changed
11824 becuase of this. Also instead of returning pointers often a const
11825 reference is returned instead.
11827 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11829 * src/Makefile.am (dist-hook): added used to remove the CVS from
11830 cheaders upon creating a dist
11831 (EXTRA_DIST): added cheaders
11833 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11834 a character not as a small integer.
11836 * src/support/lyxstring.C (find): removed Assert and added i >=
11837 rep->sz to the first if.
11839 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11841 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11842 src/LyXView.C src/buffer.C src/bufferparams.C
11843 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11844 src/text2.C src/insets/insetinclude.C:
11845 lyxlayout renamed to textclasslist.
11847 * src/layout.C: some lyxerr changes.
11849 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11850 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11851 (LyXLayoutList): removed all traces of this class.
11852 (LyXTextClass::Read): rewrote LT_STYLE
11853 (LyXTextClass::hasLayout): new function
11854 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11855 both const and nonconst version.
11856 (LyXTextClass::delete_layout): new function.
11857 (LyXTextClassList::Style): bug fix. do the right thing if layout
11859 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11860 (LyXTextClassList::NameOfLayout): ditto
11861 (LyXTextClassList::Load): ditto
11863 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11865 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11867 * src/LyXAction.C (LookupFunc): added a workaround for sun
11868 compiler, on the other hand...we don't know if the current code
11869 compiles on sun at all...
11871 * src/support/filetools.C (CleanupPath): subst fix
11873 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11876 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11877 complained about this one?
11879 * src/insets/insetinclude.C (Latex): subst fix
11881 * src/insets/insetbib.C (getKeys): subst fix
11883 * src/LyXSendto.C (SendtoApplyCB): subst fix
11885 * src/lyx_main.C (init): subst fix
11887 * src/layout.C (Read): subst fix
11889 * src/lyx_sendfax_main.C (button_send): subst fix
11891 * src/buffer.C (RoffAsciiTable): subst fix
11893 * src/lyx_cb.C (MenuFax): subst fix
11894 (PrintApplyCB): subst fix
11896 1999-10-26 Juergen Vigna <jug@sad.it>
11898 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11900 (Read): Cleaned up this code so now we read only format vestion >= 5
11902 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11904 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11905 come nobody has complained about this one?
11907 * src/insets/insetinclude.C (Latex): subst fix
11909 * src/insets/insetbib.C (getKeys): subst fix
11911 * src/lyx_main.C (init): subst fix
11913 * src/layout.C (Read): subst fix
11915 * src/buffer.C (RoffAsciiTable): subst fix
11917 * src/lyx_cb.C (MenuFax): subst fix.
11919 * src/layout.[hC] + some other files: rewrote to use
11920 std::container to store textclasses and layouts in.
11921 Simplified, removed a lot of code. Make all classes
11922 assignable. Further simplifications and review of type
11923 use still to be one.
11925 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11926 lastfiles to create the lastfiles partr of the menu.
11928 * src/lastfiles.[Ch]: rewritten to use deque to store the
11929 lastfiles in. Uses fstream for reading and writing. Simplifies
11932 * src/support/syscall.C: remove explicit cast.
11934 * src/BufferView.C (CursorToggleCB): removed code snippets that
11935 were commented out.
11936 use explicat C++ style casts instead of C style casts. also use
11937 u_vdata instea of passing pointers in longs.
11939 * src/PaperLayout.C: removed code snippets that were commented out.
11941 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11943 * src/lyx_main.C: removed code snippets that wer commented out.
11945 * src/paragraph.C: removed code snippets that were commented out.
11947 * src/lyxvc.C (logClose): use static_cast
11949 (viewLog): remove explicit cast to void*
11950 (showLog): removed old commented code
11952 * src/menus.C: use static_cast instead of C style casts. use
11953 u_vdata instead of u_ldata. remove explicit cast to (long) for
11954 pointers. Removed old code that was commented out.
11956 * src/insets/inset.C: removed old commented func
11958 * src/insets/insetref.C (InsetRef): removed old code that had been
11959 commented out for a long time.
11961 (escape): removed C style cast
11963 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11965 * src/insets/insetlatex.C (Draw): removed old commented code
11966 (Read): rewritten to use string
11968 * src/insets/insetlabel.C (escape): removed C style cast
11970 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11972 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11973 old commented code.
11975 * src/insets/insetinclude.h: removed a couple of stupid bools
11977 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11978 (Clone): remove C style cast
11979 (getKeys): changed list to lst because of std::list
11981 * src/insets/inseterror.C (Draw): removed som old commented code.
11983 * src/insets/insetcommand.C (Draw): removed some old commented code.
11985 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11986 commented out forever.
11987 (bibitem_cb): use static_cast instead of C style cast
11988 use of vdata changed to u_vdata.
11990 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11992 (CloseUrlCB): use static_cast instead of C style cast.
11993 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11995 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11996 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11997 (CloseInfoCB): static_cast from ob->u_vdata instead.
11998 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12001 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12002 (C_InsetError_CloseErrorCB): forward the ob parameter
12003 (CloseErrorCB): static_cast from ob->u_vdata instead.
12005 * src/vspace.h: include LString.h since we use string in this class.
12007 * src/vspace.C (lyx_advance): changed name from advance because of
12008 nameclash with stl. And since we cannot use namespaces yet...I
12009 used a lyx_ prefix instead. Expect this to change when we begin
12012 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12014 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12015 and removed now defunct constructor and deconstructor.
12017 * src/BufferView.h: have backstack as a object not as a pointer.
12018 removed initialization from constructor. added include for BackStack
12020 * development/lyx.spec.in (%build): add CFLAGS also.
12022 * src/screen.C (drawFrame): removed another warning.
12024 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12026 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12027 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12028 README and ANNOUNCE a bit for the next release. More work is
12031 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12032 unbreakable if we are in freespacing mode (LyX-Code), but not in
12035 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12037 * src/BackStack.h: fixed initialization order in constructor
12039 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12041 * acinclude.m4 (VERSION): new rules for when a version is
12042 development, added also a variable for prerelease.
12043 (warnings): we set with_warnings=yes for prereleases
12044 (lyx_opt): prereleases compile with same optimization as development
12045 (CXXFLAGS): only use pedantic if we are a development version
12047 * src/BufferView.C (restorePosition): don't do anything if the
12048 backstack is empty.
12050 * src/BackStack.h: added member empty, use this to test if there
12051 is anything to pop...
12053 1999-10-25 Juergen Vigna <jug@sad.it>
12056 * forms/layout_forms.fd +
12057 * forms/latexoptions.fd +
12058 * lyx.fd: changed for various form resize issues
12060 * src/mathed/math_panel.C +
12061 * src/insets/inseterror.C +
12062 * src/insets/insetinfo.C +
12063 * src/insets/inseturl.C +
12064 * src/insets/inseturl.h +
12066 * src/LyXSendto.C +
12067 * src/PaperLayout.C +
12068 * src/ParagraphExtra.C +
12069 * src/TableLayout.C +
12071 * src/layout_forms.C +
12078 * src/menus.C: fixed various resize issues. So now forms can be
12079 resized savely or not be resized at all.
12081 * forms/form_url.fd +
12082 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12085 * src/insets/Makefile.am: added files form_url.[Ch]
12087 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12089 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12090 (and presumably 6.2).
12092 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12093 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12094 remaining static member callbacks.
12096 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12099 * src/support/lyxstring.h: declare struct Srep as friend of
12100 lyxstring, since DEC cxx complains otherwise.
12102 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12104 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12106 * src/LaTeX.C (run): made run_bibtex also depend on files with
12108 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12109 are put into the dependency file.
12111 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12112 the code has shown itself to work
12113 (create_ispell_pipe): removed another warning, added a comment
12116 * src/minibuffer.C (ExecutingCB): removed code that has been
12117 commented out a long time
12119 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12120 out code + a warning.
12122 * src/support/lyxstring.h: comment out the three private
12123 operators, when compiling with string ansi conforming compilers
12124 they make problems.
12126 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12128 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12129 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12132 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12135 * src/mathed/math_panel.C (create_math_panel): remove explicit
12138 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12141 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12142 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12143 to XCreatePixmapFromBitmapData
12144 (fl_set_bmtable_data): change the last argument to be unsigned
12146 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12147 and bh to be unsigned int, remove explicit casts in call to
12148 XReadBitmapFileData.
12150 * images/arrows.xbm: made the arrays unsigned char *
12151 * images/varsz.xbm: ditto
12152 * images/misc.xbm: ditto
12153 * images/greek.xbm: ditto
12154 * images/dots.xbm: ditto
12155 * images/brel.xbm: ditto
12156 * images/bop.xbm: ditto
12158 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12160 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12161 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12162 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12164 (LYX_CXX_CHEADERS): added <clocale> to the test.
12166 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12168 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12170 * src/support/lyxstring.C (append): fixed something that must be a
12171 bug, rep->assign was used instead of rep->append.
12173 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12176 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12177 lyx insert double chars. Fix spotted by Kayvan.
12179 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12181 * Fixed the tth support. I messed up with the Emacs patch apply feature
12182 and omitted the changes in lyxrc.C.
12184 1999-10-22 Juergen Vigna <jug@sad.it>
12186 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12188 * src/lyx_cb.C (MenuInsertRef) +
12189 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12190 the form cannot be resized under it limits (fixes a segfault)
12192 * src/lyx.C (create_form_form_ref) +
12193 * forms/lyx.fd: Changed Gravity on name input field so that it is
12196 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12198 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12199 <ostream> and <istream>.
12201 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12202 whether <fstream> provides the latest standard features, or if we
12203 have an oldstyle library (like in egcs).
12204 (LYX_CXX_STL_STRING): fix the test.
12206 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12207 code on MODERN_STL_STREAM.
12209 * src/support/lyxstring.h: use L{I,O}stream.h.
12211 * src/support/L{I,O}stream.h: new files, designed to setup
12212 correctly streams for our use
12213 - includes the right header depending on STL capabilities
12214 - puts std::ostream and std::endl (for LOStream.h) or
12215 std::istream (LIStream.h) in toplevel namespace.
12217 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12219 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12220 was a bib file that had been changed we ensure that bibtex is run.
12221 (runBibTeX): enhanced to extract the names of the bib files and
12222 getting their absolute path and enter them into the dep file.
12223 (findtexfile): static func that is used to look for tex-files,
12224 checks for absolute patchs and tries also with kpsewhich.
12225 Alternative ways of finding the correct files are wanted. Will
12227 (do_popen): function that runs a command using popen and returns
12228 the whole output of that command in a string. Should be moved to
12231 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12232 file with extension ext has changed.
12234 * src/insets/figinset.C: added ifdef guards around the fl_free
12235 code that jug commented out. Now it is commented out when
12236 compiling with XForms == 0.89.
12238 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12239 to lyxstring.C, and only keep a forward declaration in
12240 lyxstring.h. Simplifies the header file a bit and should help a
12241 bit on compile time too. Also changes to Srep will not mandate a
12242 recompile of code just using string.
12243 (~lyxstring): definition moved here since it uses srep.
12244 (size): definition moved here since it uses srep.
12246 * src/support/lyxstring.h: removed a couple of "inline" that should
12249 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12251 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12254 1999-10-21 Juergen Vigna <jug@sad.it>
12256 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12257 set to left if I just remove the width entry (or it is empty).
12259 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12260 paragraph when having dummy paragraphs.
12262 1999-10-20 Juergen Vigna <jug@sad.it>
12264 * src/insets/figinset.C: just commented some fl_free_form calls
12265 and added warnings so that this calls should be activated later
12266 again. This avoids for now a segfault, but we have a memory leak!
12268 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12269 'const char * argument' to 'string argument', this should
12270 fix some Asserts() in lyxstring.C.
12272 * src/lyxfunc.h: Removed the function argAsString(const char *)
12273 as it is not used anymore.
12275 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12277 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12280 * src/Literate.h: some funcs moved from public to private to make
12281 interface clearer. Unneeded args removed.
12283 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12285 (scanBuildLogFile): ditto
12287 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12288 normal TeX Error. Still room for improvement.
12290 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12292 * src/buffer.C (insertErrors): changes to make the error
12293 desctription show properly.
12295 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12298 * src/support/lyxstring.C (helper): changed to use
12299 sizeof(object->rep->ref).
12300 (operator>>): changed to use a pointer instead.
12302 * src/support/lyxstring.h: changed const reference & to value_type
12303 const & lets see if that helps.
12305 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12307 * Makefile.am (rpmdist): fixed to have non static package and
12310 * src/support/lyxstring.C: removed the compilation guards
12312 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12315 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12316 conditional compile of lyxstring.Ch
12318 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12319 stupid check, but it is a lot better than the bastring hack.
12320 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12322 * several files: changed string::erase into string::clear. Not
12325 * src/chset.C (encodeString): use a char temporary instead
12327 * src/table.C (TexEndOfCell): added tostr around
12328 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12329 (TexEndOfCell): ditto
12330 (TexEndOfCell): ditto
12331 (TexEndOfCell): ditto
12332 (DocBookEndOfCell): ditto
12333 (DocBookEndOfCell): ditto
12334 (DocBookEndOfCell): ditto
12335 (DocBookEndOfCell): ditto
12337 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12339 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12341 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12342 (MenuBuildProg): added tostr around ret
12343 (MenuRunChktex): added tostr around ret
12344 (DocumentApplyCB): added tostr around ret
12346 * src/chset.C (encodeString): added tostr around t->ic
12348 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12349 (makeLaTeXFile): added tostr around tocdepth
12350 (makeLaTeXFile): added tostr around ftcound - 1
12352 * src/insets/insetbib.C (setCounter): added tostr around counter.
12354 * src/support/lyxstring.h: added an operator+=(int) to catch more
12357 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12358 (lyxstring): We DON'T allow NULL pointers.
12360 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12362 * src/mathed/math_macro.C (MathMacroArgument::Write,
12363 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12364 when writing them out.
12366 * src/LString.C: remove, since it is not used anymore.
12368 * src/support/lyxstring.C: condition the content to
12369 USE_INCLUDED_STRING macro.
12371 * src/mathed/math_symbols.C, src/support/lstrings.C,
12372 src/support/lyxstring.C: add `using' directive to specify what
12373 we need in <algorithm>. I do not think that we need to
12374 conditionalize this, but any thought is appreciated.
12376 * many files: change all callback functions to "C" linkage
12377 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12378 strict_ansi. Those who were static are now global.
12379 The case of callbacks which are static class members is
12380 trickier, since we have to make C wrappers around them (see
12381 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12382 did not finish this yet, since it defeats the purpose of
12383 encapsulation, and I am not sure what the best route is.
12385 1999-10-19 Juergen Vigna <jug@sad.it>
12387 * src/support/lyxstring.C (lyxstring): we permit to have a null
12388 pointer as assignment value and just don't assign it.
12390 * src/vspace.C (nextToken): corrected this function substituting
12391 find_first(_not)_of with find_last_of.
12393 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12394 (TableOptCloseCB) (TableSpeCloseCB):
12395 inserted fl_set_focus call for problem with fl_hide_form() in
12398 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12400 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12403 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12405 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12406 LyXLex::next() and not eatline() to get its argument.
12408 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12410 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12411 instead, use fstreams for io of the depfile, removed unneeded
12412 functions and variables.
12414 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12415 vector instead, removed all functions and variables that is not in
12418 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12420 * src/buffer.C (insertErrors): use new interface to TeXError
12422 * Makefile.am (rpmdist): added a rpmdist target
12424 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12425 per Kayvan's instructions.
12427 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12429 * src/Makefile.am: add a definition for localedir, so that locales
12430 are found after installation (Kayvan)
12432 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12434 * development/.cvsignore: new file.
12436 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12438 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12439 C++ compiler provides wrappers for C headers and use our alternate
12442 * configure.in: use LYX_CXX_CHEADERS.
12444 * src/cheader/: new directory, populated with cname headers from
12445 libstdc++-2.8.1. They are a bit old, but probably good enough for
12446 what we want (support compilers who lack them).
12448 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12449 from includes. It turns out is was stupid.
12451 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12453 * lib/Makefile.am (install-data-local): forgot a ';'
12454 (install-data-local): forgot a '\'
12455 (libinstalldirs): needed after all. reintroduced.
12457 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12459 * configure.in (AC_OUTPUT): added lyx.spec
12461 * development/lyx.spec: removed file
12463 * development/lyx.spec.in: new file
12465 * po/*.po: merged with lyx.pot becuase of make distcheck
12467 * lib/Makefile.am (dist-hook): added dist-hook so that
12468 documentation files will be included when doing a make
12469 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12470 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12472 more: tried to make install do the right thing, exclude CVS dirs
12475 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12476 Path would fit in more nicely.
12478 * all files that used to use pathstack: uses now Path instead.
12479 This change was a lot easier than expected.
12481 * src/support/path.h: new file
12483 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12485 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12487 * src/support/lyxstring.C (getline): Default arg was given for
12490 * Configure.cmd: removed file
12492 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12494 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12495 streams classes and types, add the proper 'using' statements when
12496 MODERN_STL is defined.
12498 * src/debug.h: move the << operator definition after the inclusion
12501 * src/support/filetools.C: include "LAssert.h", which is needed
12504 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12507 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12508 include "debug.h" to define a proper ostream.
12510 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12512 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12513 method to the SystemCall class which can kill a process, but it's
12514 not fully implemented yet.
12516 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12518 * src/support/FileInfo.h: Better documentation
12520 * src/lyxfunc.C: Added support for buffer-export html
12522 * src/menus.C: Added Export->As HTML...
12524 * lib/bind/*.bind: Added short-cut for buffer-export html
12526 * src/lyxrc.*: Added support for new \tth_command
12528 * lib/lyxrc.example: Added stuff for new \tth_command
12530 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12532 * lib/Makefile.am (IMAGES): removed images/README
12533 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12534 installes in correct place. Check permisions is installed
12537 * src/LaTeX.C: some no-op changes moved declaration of some
12540 * src/LaTeX.h (LATEX_H): changed include guard name
12542 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12544 * lib/reLyX/Makefile.am: install noweb2lyx.
12546 * lib/Makefile.am: install configure.
12548 * lib/reLyX/configure.in: declare a config aux dir; set package
12549 name to lyx (not sure what the best solution is); generate noweb2lyx.
12551 * lib/layouts/egs.layout: fix the bibliography layout.
12553 1999-10-08 Jürgen Vigna <jug@sad.it>
12555 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12556 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12557 it returned without continuing to search the path.
12559 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12561 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12562 also fixes a bug. It is not allowed to do tricks with std::strings
12563 like: string a("hei"); &a[e]; this will not give what you
12564 think... Any reason for the complexity in this func?
12566 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12568 * Updated README and INSTALL a bit, mostly to check that my
12569 CVS rights are correctly set up.
12571 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12573 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12574 does not allow '\0' chars but lyxstring and std::string does.
12576 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12578 * autogen.sh (AUTOCONF): let the autogen script create the
12579 POTFILES.in file too. POTFILES.in should perhaps now not be
12580 included in the cvs module.
12582 * some more files changed to use C++ includes instead of C ones.
12584 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12586 (Reread): added tostr to nlink. buggy output otherwise.
12587 (Reread): added a string() around szMode when assigning to Buffer,
12588 without this I got a log of garbled info strings.
12590 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12593 * I have added several ostream & operator<<(ostream &, some_type)
12594 functions. This has been done to avoid casting and warnings when
12595 outputting enums to lyxerr. This as thus eliminated a lot of
12596 explicit casts and has made the code clearer. Among the enums
12597 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12598 mathed enums, some font enum the Debug::type enum.
12600 * src/support/lyxstring.h (clear): missing method. equivalent of
12603 * all files that contained "stderr": rewrote constructs that used
12604 stderr to use lyxerr instead. (except bmtable)
12606 * src/support/DebugStream.h (level): and the passed t with
12607 Debug::ANY to avoid spurious bits set.
12609 * src/debug.h (Debug::type value): made it accept strings of the
12610 type INFO,INIT,KEY.
12612 * configure.in (Check for programs): Added a check for kpsewhich,
12613 the latex generation will use this later to better the dicovery of
12616 * src/BufferView.C (create_view): we don't need to cast this to
12617 (void*) that is done automatically.
12618 (WorkAreaButtonPress): removed some dead code.
12620 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12622 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12623 is not overwritten when translated (David Sua'rez de Lis).
12625 * lib/CREDITS: Added David Sua'rez de Lis
12627 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12629 * src/bufferparams.C (BufferParams): default input encoding is now
12632 * acinclude.m4 (cross_compiling): comment out macro
12633 LYX_GXX_STRENGTH_REDUCE.
12635 * acconfig.h: make sure that const is not defined (to empty) when
12636 we are compiling C++. Remove commented out code using SIZEOF_xx
12639 * configure.in : move the test for const and inline as late as
12640 possible so that these C tests do not interefere with C++ ones.
12641 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12642 has not been proven.
12644 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12646 * src/table.C (getDocBookAlign): remove bad default value for
12647 isColumn parameter.
12649 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12651 (ShowFileMenu2): ditto.
12653 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12654 of files to ignore.
12656 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12658 * Most files: finished the change from the old error code to use
12659 DebugStream for all lyxerr debugging. Only minor changes remain
12660 (e.g. the setting of debug levels using strings instead of number)
12662 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12664 * src/layout.C (Add): Changed to use compare_no_case instead of
12667 * src/FontInfo.C: changed loop variable type too string::size_type.
12669 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12671 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12672 set ETAGS_ARGS to --c++
12674 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12676 * src/table.C (DocBookEndOfCell): commented out two unused variables
12678 * src/paragraph.C: commented out four unused variables.
12680 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12681 insed a if clause with type string::size_type.
12683 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12686 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12688 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12689 variable, also changed loop to go from 0 to lenght + 1, instead of
12690 -1 to length. This should be correct.
12692 * src/LaTeX.C (scanError): use string::size_type as loop variable
12695 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12696 (l.896) since y_tmp and row was not used anyway.
12698 * src/insets/insetref.C (escape): use string::size_type as loop
12701 * src/insets/insetquotes.C (Width): use string::size_type as loop
12703 (Draw): use string::size_type as loop variable type.
12705 * src/insets/insetlatexaccent.C (checkContents): use
12706 string::size_type as loop variable type.
12708 * src/insets/insetlabel.C (escape): use string::size_type as loop
12711 * src/insets/insetinfo.C: added an extern for current_view.
12713 * src/insets/insetcommand.C (scanCommand): use string::size_type
12714 as loop variable type.
12716 * most files: removed the RCS tags. With them we had to recompile
12717 a lot of files after a simple cvs commit. Also we have never used
12718 them for anything meaningful.
12720 * most files: tags-query-replace NULL 0. As adviced several plases
12721 we now use "0" instead of "NULL" in our code.
12723 * src/support/filetools.C (SpaceLess): use string::size_type as
12724 loop variable type.
12726 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12728 * src/paragraph.C: fixed up some more string stuff.
12730 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12732 * src/support/filetools.h: make modestr a std::string.
12734 * src/filetools.C (GetEnv): made ch really const.
12736 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12737 made code that used these use max/min from <algorithm> instead.
12739 * changed several c library include files to their equivalent c++
12740 library include files. All is not changed yet.
12742 * created a support subdir in src, put lyxstring and lstrings
12743 there + the extra files atexit, fileblock, strerror. Created
12744 Makefile.am. edited configure.in and src/Makefile.am to use this
12745 new subdir. More files moved to support.
12747 * imported som of the functions from repository lyx, filetools
12749 * ran tags-query-replace on LString -> string, corrected the bogus
12750 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12751 is still some errors in there. This is errors where too much or
12752 too litle get deleted from strings (string::erase, string::substr,
12753 string::replace), there can also be some off by one errors, or
12754 just plain wrong use of functions from lstrings. Viewing of quotes
12757 * LyX is now running fairly well with string, but there are
12758 certainly some bugs yet (see above) also string is quite different
12759 from LString among others in that it does not allow null pointers
12760 passed in and will abort if it gets any.
12762 * Added the revtex4 files I forgot when setting up the repository.
12764 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12766 * All over: Tried to clean everything up so that only the files
12767 that we really need are included in the cvs repository.
12768 * Switched to use automake.
12769 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12770 * Install has not been checked.
12772 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12774 * po/pt.po: Three errors:
12775 l.533 and l.538 format specification error
12776 l. 402 duplicate entry, I just deleted it.