1 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * lib/bind/menus.bind: remove the Layout menu entries, which I
4 somehow forgot earlier.
6 2000-11-03 Rob Lahaye <lahaye@postech.edu>
8 * lib/ui/old-default.ui: keep the old one here for reference (to
11 * lib/ui/default.ui: update the menu layout
13 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
15 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
16 Can now Apply to different insets without closing the dialog.
18 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
19 Can't actually DO anything with them yet, but I'd like a little
22 * src/frontends/xforms/input_validators.[ch]
23 (fl_lowercase_filter): new.
25 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
27 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
28 of MATH_CODE. This fixes a bug with math-macros in RTL text.
30 * src/text.C (PrepareToPrint): Show math-macros block aligned.
32 2000-11-02 Juergen Vigna <jug@sad.it>
34 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
35 on char insertion as it has already be updated by bv->updateInset().
37 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
38 if an inset inside was updated.
40 * lib/configure.cmd: commented out fax-search code
42 2000-11-01 Yves Bastide <stid@acm.org>
44 * src/tabular.C (OldFormatRead): set tabular language to the
47 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
49 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
50 class names with non-letter characters (from Yves Bastide).
52 * lib/ui/default.ui: change Item to OptItem in import menu.
53 Comment out fax stuff.
55 * lib/configure.m4: comment out fax-related stuff.
57 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
59 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
60 useful xforms helper functions. At present contains only formatted().
61 Input a string and it returns it with line breaks so that in fits
64 * src/frontends/xforms/Makefile.am: add new files.
66 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
67 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
70 * src/frontends/xforms/FormPreferences.[Ch]:
71 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
72 but lots of little clean ups. Removed enum State. Make use of
73 formatted(). Constify lots of methods. Perhaps best of all: removed
74 requirement for that horrible reinterpret_cast from pointer to long in
77 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
79 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
80 conditionalize build on xforms < 0.89
82 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
84 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
86 * src/LyXAction.C (init): comment out fax
88 * src/lyxrc.h: comment out the fax enums
89 comment out the fax variables
91 * src/commandtags.h: comment out LFUN_FAX
93 * src/lyxrc.C: disable fax variables.
94 (read): disable parsing of fax variables
95 (output): disable writing of fax variables
96 (getFeedback): now description for fax variables
98 * src/lyxfunc.C: comment out MenuFax
99 (Dispatch): disable LFUN_FAX
101 * src/lyx_cb.C (MenuFax): comment out
103 * src/WorkArea.C: add <cctype>
104 (work_area_handler): better key handling, should be ok now.
105 for accented chars + etc
107 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
108 lyx_sendfax.h and lyx_sendfax_man.C
110 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
111 (show): don't call InitLyXLookup when using xforms 0.89
113 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
115 * src/trans.C (AddDeadkey): better fix, the other one could crash...
117 * src/support/filetools.C (GetFileContents): close to dummy change
119 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
121 * src/trans.C (AddDeadkey): workaround stupid compilers.
123 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
125 * src/frontends/xforms/FormDocument.C (class_update): fix setting
126 of two-sided document.
128 2000-10-31 Juergen Vigna <jug@sad.it>
130 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
132 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
133 xposition to the Edit call.
135 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
137 * src/trans.C (AddDeadkey): cast explicitly to char.
139 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
141 * src/tabular.C (AsciiBottomHLine): simplify?
142 (AsciiTopHLine): simplify?
143 (print_n_chars): simplify
144 (DocBook): remove most of the << endl; we should flush the stream
145 as seldom as possible.
147 (TeXBottomHLine): ditto
150 (write_attribute): try a templified version.
151 (set_row_column_number_info): lesson scope of variables
153 * src/support/lstrings.h (tostr): new specialization of tostr
155 * src/trans.C (AddDeadkey): slightly cleaner fix.
157 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
159 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
160 '%%' in Toc menu labels.
163 * src/insets/insetlatexaccent.C (draw): Correct rendering when
164 font_norm is iso10646-1.
166 * src/font.C (ascent): Fixed for 16bit fonts
167 (descent,lbearing,rbearing): ditto
169 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
171 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
172 (getFeedback): new static method.
174 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
175 Now use combox rather than choice to display languages.
176 Feedback is now output using a new timer callback mechanism, identical
177 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
179 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
181 * src/minibuffer.C: fix for older compilers
183 2000-10-30 Juergen Vigna <jug@sad.it>
185 * src/insets/insettext.C (InsertInset): fixed this as the cursor
186 has to be Left of the inset otherwise LyXText won't find it!
188 * src/BufferView2.C (open_new_inset): delete the inset if it can
191 2000-10-30 Rob Lahaye <lahaye@postech.edu>
195 2000-10-29 Marko Vendelin <markov@ioc.ee>
196 * src/frontends/gnome/FormCitation.C
197 * src/frontends/gnome/FormCitation.h
198 * src/frontends/gnome/FormCopyright.C
199 * src/frontends/gnome/FormCopyright.h
200 * src/frontends/gnome/FormError.C
201 * src/frontends/gnome/FormError.h
202 * src/frontends/gnome/FormIndex.C
203 * src/frontends/gnome/FormIndex.h
204 * src/frontends/gnome/FormPrint.C
205 * src/frontends/gnome/FormPrint.h
206 * src/frontends/gnome/FormRef.C
207 * src/frontends/gnome/FormRef.h
208 * src/frontends/gnome/FormToc.C
209 * src/frontends/gnome/FormToc.h
210 * src/frontends/gnome/FormUrl.C
211 * src/frontends/gnome/FormUrl.h
212 * src/frontends/gnome/Menubar_pimpl.C
213 * src/frontends/gnome/mainapp.C
214 * src/frontends/gnome/mainapp.h
215 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
216 changing update() to updateSlot() where appropriate
218 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
220 * src/frontends/xforms/FormPreferences.[Ch]:
221 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
224 2000-10-28 Juergen Vigna <jug@sad.it>
226 * src/insets/insettabular.C (draw): fixed drawing bug.
228 * src/insets/insettext.C (clear):
230 (SetParagraphData): clearing the TEXT buffers when deleting the
231 paragraphs used by it.
233 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
235 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
237 2000-10-27 Juergen Vigna <jug@sad.it>
239 * src/tabular.C (~LyXTabular): removed not needed anymore.
241 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
244 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
246 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
249 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
252 * src/frontends/xforms/FormPreferences.[Ch]:
253 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
254 Reorganised as modules based on tabs. Much easier to follow the
255 flow and to add new tabs. Added warning and feedback messages.
258 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
260 * src/tabular.h (DocBook): add std:: qualifier.
262 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
264 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
265 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
268 * insettabular.C (DocBook): uses the tabular methods to export
271 * src/insets/insettext.h
272 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
274 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
276 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
279 * src/lyxfunc.C (MenuNew): lessen the scope of fname
280 moved misplaced AllowInput two lines up.
282 * src/buffer.C (readFile): compare float with float, not with int
284 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
286 * src/minibuffer.C: add "using SigC::slot" statement.
288 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
290 * src/frontends/xforms/forms/README: updated section about make.
292 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
293 Tidied some forms up, made two of form_tabular's tabs more
294 self-consistent, fixed Jean-Marc's size problem in form_preferences,
295 fixed translation problem with "Column".
297 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
299 * src/minibuffer.h: use Timeout instead of the xforms timer
301 (setTimer) rewrite for the Timeout, change to unsigned arg
302 (set): change to unsigned timer arg
305 * src/minibuffer.C (TimerCB): removed func
306 (C_MiniBuffer_TimerCB): removed func
307 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
308 (peek_event): use a switch statement
309 (add): don't use fl_add_timer.
310 (Set): rewrite to use the Timeout
313 * src/Timeout.[Ch] (setType): return a Timeout &
314 (setTimeout): ditto, change to unsigned arg for timeout
316 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
318 * src/mathed/formula.C (mathed_string_width): Use string instead
319 of a constant size char array.
321 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
323 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
324 the two recently added operator<< for SMInput and State.
326 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
328 (OkCancelPolicy): ditto
329 (OkCancelReadOnlyPolicy): ditto
330 (NoRepeatedApplyReadOnlyPolicy): ditto
331 (OkApplyCancelReadOnlyPolicy): ditto
332 (OkApplyCancelPolicy): ditto
333 (NoRepeatedApplyPolicy): ditto
335 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
337 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
338 add the usual std:: qualifiers.
340 2000-10-25 Juergen Vigna <jug@sad.it>
342 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
344 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
346 * src/support/filetools.C (MakeRelPath): change some types to
349 * src/frontends/ButtonPolicies.h (operator<<): new operator for
350 ButtonPolicy::SMInput and ButtonPolicy::State.
352 * src/FontLoader.C (reset): small cleanup
353 (unload): small cleanup
355 * src/FontInfo.C (getFontname): initialize error to 10000.0
357 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
359 * src/frontends/xforms/FormPreferences.[Ch]:
360 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
361 TeX encoding and default paper size sections.
363 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
365 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
368 * src/frontends/xforms/FormError.C (disconnect): use erase() to
369 make the message_ empty.
370 (FormError): don't initialize message_ in initializer list.
372 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
374 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
376 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
378 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
380 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
382 * src/frontends/kde/*data.[Ch]: _("") is not
385 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
387 * src/buffer.C: removed redundant using directive.
389 * src/frontends/DialogBase.h: revert to original definition of
392 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
393 stuff into two classes, one for each dialog, requires a new
394 element in the dialogs vector, FormTabularCreate.
396 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
399 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
400 method. Continues Allan's idea, but means that derived classes
401 don't need to worry about "update or hide?".
403 * src/frontends/xforms/FormError.C (showInset): add connection
406 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
407 one for each dialog. FormTabular now contains main tabular dialog
410 * src/frontends/xforms/FormTabularCreate.[Ch]:
411 * src/frontends/xforms/forms/form_tabular_create.fd: the create
414 * src/frontends/xforms/FormGraphics.[Ch]:
415 * src/frontends/xforms/forms/form_graphics.fd
416 * src/frontends/xforms/FormTabular.[Ch]:
417 * src/frontends/xforms/forms/form_tabular.fd: made daughter
418 classes of FormInset.
420 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
421 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
423 * src/frontends/xforms/Makefile.am:
424 * src/frontends/xforms/forms/makefile: added new files.
426 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
427 variable. added Signal0 hide signal, in keeping with other GUI-I
430 * src/support/lstrings.h: removed redundant std:: qualifier as
431 it's already declared in Lsstream.h.
433 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
435 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
439 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
441 * src/tabular.C (Ascii): minimize scope of cell.
443 * src/BufferView2.C (nextWord): return string() instead of 0;
445 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
447 * src/converter.h: add a std:: qualifier
449 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
451 * src/importer.[Ch]: New files. Used for importing files into LyX.
453 * src/lyxfunc.C (doImport): Use the new Importer class.
455 * src/converter.h: Add shortcut member to the Format class.
456 Used for holding the menu shortcut.
458 * src/converter.C and other files: Made a distinction between
459 format name and format extension. New formats can be defined using
460 the \format lyxrc tag.
461 Added two new converter flags: latex and disable.
463 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
465 * src/support/lyxlib.h: unify namespace/struct implementation.
466 Remove extra declarations.
468 * src/support/chdir.C (chdir): remove version taking char const *
470 * src/support/rename.C: ditto.
471 * src/support/lyxsum.C: ditto.
473 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
475 * src/frontends/xforms/FormBase.[Ch]:
476 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
477 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
478 work only for the next call to fl_show_form(). The correct place to set
479 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
480 done. FormBase also stores minw_, minh_ itself. All dialogs derived
481 from FormBase have the minimum size set; no more stupid crashes with
484 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
486 * lib/ui/default.ui: fix shortcut for Insert->Include File.
488 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
490 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
492 * src/support/lyxlib.h: changed second argument of mkdir to
493 unsigned long int (unsigned int would probably have been enough,
494 but...). Removed <sys/types.h> header.
495 * src/support/mkdir.C (mkdir): ditto.
499 2000-10-19 Juergen Vigna <jug@sad.it>
501 * src/lyxfunc.C (MenuNew): small fix (form John)
503 * src/screen.C (Update): removed unneeded code.
505 * src/tabular.C (Ascii): refixed int != uint bug!
507 * src/support/lyxlib.h: added sys/types.h include for now permits
508 compiling, but I don't like this!
510 2000-10-18 Juergen Vigna <jug@sad.it>
512 * src/text2.C (ClearSelection): if we clear the selection we need
513 more refresh so set the status apropriately
515 * src/insets/insettext.C (draw): hopefully finally fixed draw
518 2000-10-12 Juergen Vigna <jug@sad.it>
520 * src/insets/insettext.C (draw): another small fix and make a block
521 so that variables are localized.
523 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
525 * src/support/lstrings.C (lowercase, uppercase):
526 use explicit casts to remove compiler warnings.
528 * src/support/LRegex.C (Impl):
529 * src/support/StrPool.C (add):
530 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
531 (AddPath, MakeDisplayPath):
532 * src/support/lstrings.C (prefixIs, subst):
533 use correct type to remove compiler warnings.
535 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
537 * src/support/lyxlib.h:
538 * src/support/mkdir.C (mkdir): change parameter to mode_t for
539 portability and to remove compiler warning with DEC cxx.
541 * src/support/FileInfo.[Ch] (flagRWX): ditto.
543 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
545 * src/minibuffer.C (peek_event): retun 1 when there has been a
546 mouseclick in the minibuffer.
550 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
552 * src/frontends/xforms/FormParagraph.C: more space above/below
555 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
557 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
558 a char only if real_current_font was changed.
560 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
562 * NEWS: update somewhat for 1.1.6
564 * lib/ui/default.ui: clean up.
566 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
568 * lib/CREDITS: clean up
570 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
572 * src/combox.[Ch] (select): changed argument back to int
573 * src/combox.C (peek_event): removed num_bytes as it is declared but
576 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
577 modified calls to Combox::select() to remove warnings about type
580 * src/insets/insetbutton.C (width): explicit cast to remove warning
581 about type conversion.
583 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
586 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
587 sel_pos_end, refering to cursor position are changed to
588 LyXParagraph::size_type.
590 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
591 consistent with LyXCursor::pos().
592 (inset_pos): changed to LyXParagraph::size_type for same reason.
594 * src/insets/insettext.C (resizeLyXText): changed some temporary
595 variables refing to cursor position to LyXParagraph::size_type.
597 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
599 * src/frontends/kde/<various>: The Great Renaming,
602 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
604 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
606 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
608 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
609 0 when there are no arguments.
611 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
613 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
614 to segfaults when pressing Ok in InsetBibtex dialog.
616 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
618 * forms/layout_forms.fd:
619 * src/layout_forms.C (create_form_form_character): small change to use
620 labelframe rather than engraved frame + text
622 * src/lyx_gui.C (create_forms): initialise choice_language with some
623 arbitrary value to prevent segfault when dialog is shown.
625 2000-10-16 Baruch Even <baruch.even@writeme.com>
627 * src/converter.C (runLaTeX, scanLog): Added a warning when there
628 is no resulting file. This pertains only to LaTeX output.
630 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
632 * src/text.C (Backspace): Make sure that the row of the cursor is
635 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
638 * src/lyx_gui.C (init): Prevent a crash when only one font from
639 menu/popup fonts is not found.
641 * lib/lyxrc.example: Add an example for binding a key for language
644 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
646 * src/converter.C (GetReachable): Changed the returned type to
648 (IsReachable): New method
650 * src/MenuBackend.C (expand): Handle formats that appear more
653 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
655 * src/frontends/support/Makefile.am
656 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
659 * lib/CREDITS: add Garst Reese.
661 * src/support/snprintf.h: add extern "C" {} around the definitions.
663 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
665 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
668 * src/frontends/xforms/FormDocument.C:
669 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
670 compile without "conversion to integral type of smaller size"
673 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
675 * src/text.C (GetColumnNearX): Fixed disabled code.
677 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
679 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
682 * src/support/snprintf.[ch]: new files
684 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
686 * src/frontends/kde/formprintdialog.C: add
687 file browser for selecting postscript output
689 * src/frontends/kde/formprintdialogdata.C:
690 * src/frontends/kde/formprintdialogdata.h: re-generate
693 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
695 * src/frontends/gnome/Makefile.am:
696 * src/frontends/kde/Makefile.am: FormCommand.C
697 disappeared from xforms
699 * src/frontends/kde/FormCitation.C:
700 * src/frontends/kde/FormIndex.C: read-only
703 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
705 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
708 * src/bufferlist.C: add using directive.
710 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
712 * src/support/lyxfunctional.h: version of class_fun for void
713 returns added, const versions of back_inseter_fun and compare_fun
716 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
718 * src/frontends/xforms/FormInset.C (showInset): fix typo.
720 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
722 * ChangeLog: cleanup.
724 * lib/CREDITS: update to add all the contributors we've forgotten.
725 I have obviously missed some, so tell me whether there were
728 2000-10-13 Marko Vendelin <markov@ioc.ee>
730 * src/frontends/gnome/FormCitation.C
731 * src/frontends/gnome/FormCitation.h
732 * src/frontends/gnome/FormError.C
733 * src/frontends/gnome/FormIndex.C
734 * src/frontends/gnome/FormRef.C
735 * src/frontends/gnome/FormRef.h
736 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
738 * src/frontends/gnome/FormCitation.C
739 * src/frontends/gnome/FormCopyright.C
740 * src/frontends/gnome/FormError.C
741 * src/frontends/gnome/FormIndex.C
742 * src/frontends/gnome/FormRef.C
743 * src/frontends/gnome/FormToc.C
744 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
747 * src/frontends/gnome/Menubar_pimpl.C
748 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
751 2000-10-11 Baruch Even <baruch.even@writeme.com>
754 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
755 to convey its real action.
757 * src/minibuffer.C (peek_event): Added action when mouse clicks to
758 clear the minibuffer and prepare to enter a command.
760 * src/mathed/formula.C (LocalDispatch): Changed to conform with
761 the rename from ExecCommand to PrepareForCommand.
762 * src/lyxfunc.C (Dispatch): ditto.
764 2000-10-11 Baruch Even <baruch.even@writeme.com>
766 * src/buffer.C (writeFile): Added test for errors on writing, this
767 catches all errors and not only file system full errors as intended.
769 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
771 * src/lyx_gui.C (create_forms): better fix for crash with
772 translated interface.
774 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
776 * src/frontends/kde/Makefile.am:
777 * src/frontends/kde/FormCopyright.C:
778 * src/frontends/kde/formcopyrightdialog.C:
779 * src/frontends/kde/formcopyrightdialog.h:
780 * src/frontends/kde/formcopyrightdialogdata.C:
781 * src/frontends/kde/formcopyrightdialogdata.h:
782 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
783 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
784 copyright to use qtarch
786 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
788 * src/encoding.C (read): Fixed bug that caused an error message at
791 * po/Makefile.in.in: Fixed rule for ext_l10n.h
793 * lib/lyxrc.example: Fixed hebrew example.
795 2000-10-13 Allan Rae <rae@lyx.org>
797 * src/frontends/xforms/FormPreferences.C (input): reworking the
799 (build, update, apply): New inputs in various tabfolders
801 * src/frontends/xforms/FormToc.C: use new button policy.
802 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
803 dialogs that either can't use any existing policy or where it just
806 * src/frontends/xforms/FormTabular.h: removed copyright notice that
809 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
810 added a bool parameter which is ignored.
812 * src/buffer.C (setReadonly):
813 * src/BufferView_pimpl.C (buffer):
814 * src/frontends/kde/FormCopyright.h (update):
815 * src/frontends/kde/FormCitation.[Ch] (update):
816 * src/frontends/kde/FormIndex.[Ch] (update):
817 * src/frontends/kde/FormPrint.[Ch] (update):
818 * src/frontends/kde/FormRef.[Ch] (update):
819 * src/frontends/kde/FormToc.[Ch] (update):
820 * src/frontends/kde/FormUrl.[Ch] (update):
821 * src/frontends/gnome/FormCopyright.h (update):
822 * src/frontends/gnome/FormCitation.[Ch] (update):
823 * src/frontends/gnome/FormError.[Ch] (update):
824 * src/frontends/gnome/FormIndex.[Ch] (update):
825 * src/frontends/gnome/FormPrint.[Ch] (update):
826 * src/frontends/gnome/FormRef.h (update):
827 * src/frontends/gnome/FormToc.[Ch] (update):
828 * src/frontends/gnome/FormUrl.[Ch] (update):
829 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
830 to updateBufferDependent and DialogBase
832 * src/frontends/xforms/FormCitation.[hC]:
833 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
834 * src/frontends/xforms/FormError.[Ch]:
835 * src/frontends/xforms/FormGraphics.[Ch]:
836 * src/frontends/xforms/FormIndex.[Ch]:
837 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
838 and fixed readOnly handling.
839 * src/frontends/xforms/FormPrint.[Ch]:
840 * src/frontends/xforms/FormRef.[Ch]:
841 * src/frontends/xforms/FormTabular.[Ch]:
842 * src/frontends/xforms/FormToc.[Ch]:
843 * src/frontends/xforms/FormUrl.[Ch]:
844 * src/frontends/xforms/FormInset.[Ch]:
845 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
846 form of updateBufferDependent.
848 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
849 if form()->visible just in case someone does stuff to the form in a
852 * src/frontends/DialogBase.h (enum): removed enum since we can now use
853 the buttoncontroller for everything the enum used to be used for.
854 (update) It would seem we need to force all dialogs to use a bool
855 parameter or have two update functions. I chose to go with one.
856 I did try removing update() from here and FormBase and defining the
857 appropriate update signatures in FormBaseB[DI] but then ran into the
858 problem of the update() call in FormBase::show(). Whatever I did
859 to get around that would require another function and that just
860 got more confusing. Hence the decision to make everyone have an
861 update(bool). An alternative might have been to override show() in
862 FormBaseB[DI] and that would allow the different and appropriate
865 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
866 true == buffer change occurred. I decided against using a default
867 template parameter since not all compilers support that at present.
869 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
871 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
872 army knife" by removing functionality.
873 (clearStore): removed. All such housekeeping on hide()ing the dialog
874 is to be carried out by overloaded disconnect() methods.
875 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
876 superceded by Baruch's neat test (FormGraphics) to update an existing
877 dialog if a new signal is recieved rather than block all new signals
879 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
880 only to Inset dialogs.
881 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
882 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
884 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
886 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
887 as a base class to all inset dialogs. Used solely to connect/disconnect
888 the Inset::hide signal and to define what action to take on receipt of
889 a UpdateBufferDependent signal.
890 (FormCommand): now derived from FormInset.
892 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
895 * src/frontends/xforms/FormCopyright.[Ch]:
896 * src/frontends/xforms/FormPreferences.[Ch]:
897 now derived from FormBaseBI.
899 * src/frontends/xforms/FormDocument.[Ch]:
900 * src/frontends/xforms/FormParagraph.[Ch]:
901 * src/frontends/xforms/FormPrint.[Ch]:
902 now derived from FormBaseBD.
904 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
906 * src/frontends/xforms/FormCitation.[Ch]:
907 * src/frontends/xforms/FormError.[Ch]:
908 * src/frontends/xforms/FormRef.[Ch]:
909 * src/frontends/xforms/FormToc.[Ch]:
910 (clearStore): reworked as disconnect().
912 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
915 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
917 * src/converter.C (runLaTeX): constify buffer argument
920 * src/frontends/support/Makefile.am (INCLUDES): fix.
922 * src/buffer.h: add std:: qualifier
923 * src/insets/figinset.C (addpidwait): ditto
924 * src/MenuBackend.C: ditto
925 * src/buffer.C: ditto
926 * src/bufferlist.C: ditto
927 * src/layout.C: ditto
928 * src/lyxfunc.C: ditto
930 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
932 * src/lyxtext.h (bidi_level): change return type to
933 LyXParagraph::size_type.
935 * src/lyxparagraph.h: change size_type to
936 TextContainer::difference_type. This should really be
937 TextContainer::size_type, but we need currently to support signed
940 2000-10-11 Marko Vendelin <markov@ioc.ee>
941 * src/frontends/gnome/FormError.h
942 * src/frontends/gnome/FormRef.C
943 * src/frontends/gnome/FormRef.h
944 * src/frontends/gnome/FormError.C
945 * src/frontends/gnome/Makefile.am
946 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
947 to Gnome frontend. Both dialogs use "action" area.
949 2000-10-12 Baruch Even <baruch.even@writeme.com>
951 * src/graphics/GraphicsCacheItem_pimpl.C:
952 * src/graphics/Renderer.C:
953 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
956 2000-10-12 Juergen Vigna <jug@sad.it>
958 * src/insets/insettext.C (draw): fixed drawing bug (specifically
959 visible when selecting).
961 * development/Code_rules/Rules: fixed some typos.
963 2000-10-09 Baruch Even <baruch.even@writeme.com>
965 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
966 compiling on egcs 1.1.2 possible.
968 * src/filedlg.C (comp_direntry::operator() ): ditto.
970 2000-08-31 Baruch Even <baruch.even@writeme.com>
972 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
975 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
976 transient it now only gets freed when the object is destructed.
978 2000-08-24 Baruch Even <baruch.even@writeme.com>
980 * src/frontends/FormGraphics.h:
981 * src/frontends/FormGraphics.C: Changed to use ButtonController and
984 2000-08-20 Baruch Even <baruch.even@writeme.com>
986 * src/insets/insetgraphics.C:
987 (draw): Added messages to the drawn rectangle to report status.
988 (updateInset): Disabled the use of the inline graphics,
991 2000-08-17 Baruch Even <baruch.even@writeme.com>
993 * src/frontends/support: Directory added for the support of GUII LyX.
995 * src/frontends/support/LyXImage.h:
996 * src/frontends/support/LyXImage.C: Base class for GUII holding of
999 * src/frontends/support/LyXImage_X.h:
1000 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1001 version of LyXImage, this uses the Xlib Pixmap.
1003 * src/PainterBase.h:
1004 * src/PainterBase.C:
1006 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1007 replacement to Pixmap.
1009 * src/insets/insetgraphics.h:
1010 * src/insets/insetgraphics.C:
1011 * src/graphics/GraphicsCacheItem.h:
1012 * src/graphics/GraphicsCacheItem.C:
1013 * src/graphics/GraphicsCacheItem_pimpl.h:
1014 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1017 * src/graphics/GraphicsCacheItem.h:
1018 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1019 another copy of the object.
1021 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1022 of cacheHandle, this fixed a bug that sent LyX crashing.
1024 * src/graphics/XPM_Renderer.h:
1025 * src/graphics/XPM_Renderer.C:
1026 * src/graphics/EPS_Renderer.h:
1027 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1029 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1031 * src/lyxfunc.C (processKeySym): only handle the
1032 lockinginset/inset stuff if we have a buffer and text loaded...
1034 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1036 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1038 * src/support/lyxfunctional.h: add operator= that takes a reference
1040 * src/lyxserver.C (mkfifo): make first arg const
1042 * src/layout.h: renamed name(...) to setName(...) to work around
1045 * src/buffer.C (setFileName): had to change name of function to
1046 work around bugs in egcs. (renamed from fileName)
1048 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1050 * src/support/translator.h: move helper template classes to
1051 lyxfunctional.h, include "support/lyxfunctional.h"
1053 * src/support/lyxmanip.h: add delaration of fmt
1055 * src/support/lyxfunctional.h: new file
1056 (class_fun_t): new template class
1057 (class_fun): helper template function
1058 (back_insert_fun_iterator): new template class
1059 (back_inserter_fun): helper template function
1060 (compare_memfun_t): new template class
1061 (compare_memfun): helper template function
1062 (equal_1st_in_pair): moved here from translator
1063 (equal_2nd_in_pair): moved here from translator
1065 * src/support/fmt.C: new file
1066 (fmt): new func, can be used for a printf substitute when still
1067 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1069 * src/support/StrPool.C: add some comments
1071 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1074 * src/insets/figinset.C (addpidwait): use std::copy with
1075 ostream_iterator to fill the pidwaitlist
1077 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1079 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1082 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1085 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1087 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1088 (class_update): ditto
1089 (BulletPanel): ditto
1090 (CheckChoiceClass): move initialization of tc and tct
1092 * src/tabular.C: remove current_view
1093 (OldFormatRead): similar to right below [istream::ignore]
1095 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1096 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1097 unused [istream::ignore]
1099 * src/lyxfunc.C: include "support/lyxfunctional.h"
1100 (getInsetByCode): use std::find_if and compare_memfun
1102 * src/lyxfont.C (stateText): remove c_str()
1104 * src/lyx_main.C (setDebuggingLevel): make static
1105 (commandLineHelp): make static
1107 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1108 Screen* together with fl_get_display() and fl_screen
1110 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1111 togheter with fl_get_display() and fl_screen
1112 (create_forms): remove c_str()
1114 * src/layout.C: include "support/lyxfunctional.h"
1115 (hasLayout): use std::find_if and compare_memfun
1116 (GetLayout): use std::find_if and comapre_memfun
1117 (delete_layout): use std::remove_if and compare_memfun
1118 (NumberOfClass): use std:.find_if and compare_memfun
1120 * src/gettext.h: change for the new functions
1122 * src/gettext.C: new file, make _(char const * str) and _(string
1123 const & str) real functions.
1125 * src/font.C (width): rewrite slightly to avoid one extra variable
1127 * src/debug.C: initialize Debug::ANY here
1129 * src/commandtags.h: update number comments
1131 * src/combox.h (get): make const func
1133 (getline): make const
1135 * src/combox.C (input_cb): handle case where fl_get_input can
1138 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1139 "support/lyxfunctional.h", remove current_view variable.
1140 (resize): use std::for_each with std::mem_fun
1141 (getFileNames): use std::copy with back_inserter_fun
1142 (getBuffer): change arg type to unsigned int
1143 (emergencyWriteAll): call emergencyWrite with std::for_each and
1145 (emergencyWrite): new method, the for loop in emergencyWriteAll
1147 (exists): use std::find_if with compare_memfun
1148 (getBuffer): use std::find_if and compare_memfun
1150 * src/buffer.h: add typedefs for iterator_category, value_type
1151 difference_type, pointer and reference for inset_iterator
1152 add postfix ++ for inset_iterator
1153 make inset_iterator::getPos() const
1155 * src/buffer.C: added support/lyxmanip.h
1156 (readFile): use lyxerr << fmt instead of printf
1157 (makeLaTeXFile): use std::copy to write out encodings
1159 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1161 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1162 free and the char * temp.
1163 (hasMenu): use std::find_if and compare_memfun
1166 * src/Makefile.am (lyx_SOURCES): added gettext.C
1168 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1169 string::insert small change to avoid temporary
1171 * src/LColor.C (getGUIName): remove c_str()
1173 * several files: change all occurrences of fl_display to
1176 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1177 that -pedantic is not used for gcc 2.97 (cvs gcc)
1179 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1181 2000-10-11 Allan Rae <rae@lyx.org>
1183 * src/frontends/xforms/FormPreferences.C (input): template path must be
1184 a readable directory. It doesn't need to be writeable.
1185 (build, delete, update, apply): New inputs in the various tabfolders
1187 * src/frontends/xforms/forms/form_preferences.fd:
1188 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1189 several new entries to existing folders. Shuffled some existing stuff
1192 * src/frontends/xforms/forms/form_print.fd:
1193 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1194 Should probably rework PrinterParams as well. Note that the switch to
1195 collated is effectively the same as !unsorted so changing PrinterParams
1196 will require a lot of fiddly changes to reverse the existing logic.
1198 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1200 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1202 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1204 2000-10-10 Allan Rae <rae@lyx.org>
1207 * src/lyxfunc.C (Dispatch):
1209 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1212 * src/lyxrc.C (output): Only write the differences between system lyxrc
1213 and the users settings.
1216 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1218 I'll rewrite this later, after 1.1.6 probably, to keep a single
1219 LyXRC but two instances of a LyXRCStruct.
1221 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1223 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1225 * src/tabular.h: add a few std:: qualifiers.
1227 * src/encoding.C: add using directive.
1228 * src/language.C: ditto.
1230 * src/insets/insetquotes.C (Validate): use languages->lang()
1231 instead of only language.
1233 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1235 * lib/languages: New file.
1237 * lib/encodings: New file.
1239 * src/language.C (Languages): New class.
1240 (read): New method. Reads the languages from the 'languages' file.
1242 * src/encoding.C (Encodings): New class.
1243 (read): New method. Reads the encodings from the 'encodings' file.
1245 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1248 * src/bufferparams.h and a lot of files: Deleted the member language,
1249 and renamed language_info to language
1251 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1252 * src/lyxfont.C (latexWriteStartChanges): ditto.
1253 * src/paragraph.C (validate,TeXOnePar): ditto.
1255 * src/lyxfont.C (update): Restored deleted code.
1257 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1259 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1261 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1263 * src/insets/figinset.[Ch]:
1264 * src/insets/insetinclude.[Ch]:
1265 * src/insets/insetinclude.[Ch]:
1266 * src/insets/insetparent.[Ch]:
1267 * src/insets/insetref.[Ch]:
1268 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1270 * src/insets/*.[Ch]:
1271 * src/mathed/formula.[Ch]:
1272 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1274 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1275 * src/lyx_cb.C (FigureApplyCB):
1276 * src/lyxfunc.C (getStatus, Dispatch):
1277 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1280 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1282 * src/converter.[Ch] (Formats::View):
1283 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1285 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1286 *current_view->buffer(). This will change later, but this patch is way
1289 2000-10-09 Juergen Vigna <jug@sad.it>
1291 * src/text.C (GetRow): small fix.
1293 * src/BufferView_pimpl.C (cursorPrevious):
1294 (cursorNext): added LyXText parameter to function.
1296 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1297 keypress depending on cursor position.
1299 2000-10-06 Juergen Vigna <jug@sad.it>
1301 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1302 (copySelection): redone this function and also copy ascii representa-
1305 * src/tabular.C (Ascii):
1309 (print_n_chars): new functions to realize the ascii export of tabulars.
1311 2000-10-05 Juergen Vigna <jug@sad.it>
1313 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1314 if we don't have a buffer.
1316 2000-10-10 Allan Rae <rae@lyx.org>
1318 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1319 with closing dialog. It seems that nested tabfolders require hiding
1320 of inner tabfolders before hiding the dialog itself. Actually all I
1321 did was hide the active outer folder.
1323 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1324 unless there really is a buffer. hideBufferDependent is called
1327 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1328 POTFILES.in stays in $(srcdir).
1330 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1332 * lib/lyxrc.example: Few changes.
1334 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1336 * src/BufferView_pimpl.C (buffer): only need one the
1337 updateBufferDependent signal to be emitted once! Moved to the end of
1338 the method to allow bv_->text to be updated first.
1340 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1341 and hSignal_ with Dialogs * and BufferDependency variables.
1342 New Buffer * parent_, initialised when the dialog is launched. Used to
1343 check whether to update() or hide() dialog in the new, private
1344 updateOrHide() method that is connected to the updateBufferDependent
1345 signal. Daughter classes dictate what to do using the
1346 ChangedBufferAction enum, passed to the c-tor.
1348 * src/frontends/xforms/FormCitation.C:
1349 * src/frontends/xforms/FormCommand.C:
1350 * src/frontends/xforms/FormCopyright.C:
1351 * src/frontends/xforms/FormDocument.C:
1352 * src/frontends/xforms/FormError.C:
1353 * src/frontends/xforms/FormIndex.C:
1354 * src/frontends/xforms/FormPreferences.C:
1355 * src/frontends/xforms/FormPrint.C:
1356 * src/frontends/xforms/FormRef.C:
1357 * src/frontends/xforms/FormToc.C:
1358 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1361 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1362 ChangedBufferAction enum.
1364 * src/frontends/xforms/FormParagraph.[Ch]
1365 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1368 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1370 * lib/bind/cua.bind: fix a bit.
1371 * lib/bind/emacs.bind: ditto.
1373 * lib/bind/menus.bind: remove real menu entries from there.
1375 * src/spellchecker.C: make sure we only include strings.h when
1378 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1380 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1381 function. It enlarges the maximum number of pup when needed.
1382 (add_toc2): Open a new menu if maximum number of items per menu has
1385 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1387 * src/frontends/kde/FormPrint.C: fix error reporting
1389 * src/frontends/xforms/FormDocument.C: fix compiler
1392 * lib/.cvsignore: add Literate.nw
1394 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1397 * bufferview_funcs.[Ch]
1400 * text2.C: Add support for numbers in RTL text.
1402 2000-10-06 Allan Rae <rae@lyx.org>
1404 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1405 to be gettext.m4 friendly again. ext_l10n.h is now
1406 generated into $top_srcdir instead of $top_builddir
1407 so that lyx.pot will be built correctly -- without
1408 duplicate parsing of ext_l10n.h.
1410 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1412 * src/frontends/kde/FormCitation.C: make the dialog
1413 behave more sensibly
1415 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1417 * config/kde.m4: fix consecutive ./configure runs,
1418 look for qtarch, fix library order
1420 * src/frontends/kde/Makefile.am: tidy up,
1421 add Print dialog, add .dlg dependencies
1423 * src/frontends/kde/FormPrint.C:
1424 * src/frontends/kde/FormPrint.h:
1425 * src/frontends/kde/formprintdialog.C:
1426 * src/frontends/kde/formprintdialog.h:
1427 * src/frontends/kde/formprintdialogdata.C:
1428 * src/frontends/kde/formprintdialogdata.h:
1429 * src/frontends/kde/dlg/formprintdialog.dlg: add
1432 * src/frontends/kde/dlg/README: Added explanatory readme
1434 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1435 script to double-check qtarch's output
1437 * src/frontends/kde/formindexdialog.C:
1438 * src/frontends/kde/formindexdialogdata.C:
1439 * src/frontends/kde/formindexdialogdata.h:
1440 * src/frontends/kde/dlg/formindexdialog.dlg: update
1441 for qtarch, minor fixes
1443 2000-10-05 Allan Rae <rae@lyx.org>
1445 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1446 dialogs when switching buffers update them instead. It's up to each
1447 dialog to decide if it should still be visible or not.
1448 update() should return a bool to control visiblity within show().
1449 Or perhaps better to set a member variable and use that to control
1452 * lib/build-listerrors: create an empty "listerrors" file just to stop
1453 make trying to regenerate it all the time if you don't have noweb
1456 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1458 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1459 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1460 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1461 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1462 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1464 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1466 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1468 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1469 deleting buffer. Closes all buffer-dependent dialogs.
1471 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1473 * src/frontends/xforms/FormCitation.[Ch]:
1474 * src/frontends/xforms/FormPreferences.[Ch]:
1475 * src/frontends/xforms/FormPrint.[Ch]:
1476 * src/frontends/xforms/FormRef.[Ch]:
1477 * src/frontends/xforms/FormUrl.[Ch]: ditto
1479 * src/frontends/xforms/FormDocument.[Ch]:
1480 * src/frontends/xforms/forms/form_document.C.patch:
1481 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1482 pass through a single input() function.
1484 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1486 * lib/build-listerrors: return status as OK
1488 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1490 * lib/lyxrc.example: Updated to new export code
1492 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1494 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1497 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1500 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1501 LyX-Code is defined.
1502 * lib/layouts/amsbook.layout: ditto.
1504 * boost/Makefile.am: fix typo.
1506 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1508 (add_lastfiles): removed.
1509 (add_documents): removed.
1510 (add_formats): removed.
1512 * src/frontends/Menubar.C: remove useless "using" directive.
1514 * src/MenuBackend.h: add a new MenuItem constructor.
1516 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1519 2000-10-04 Allan Rae <rae@lyx.org>
1521 * lib/Makefile.am (listerrors):
1522 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1523 I haven't got notangle installed so Kayvan please test. The output
1524 should end up in $builddir. This also allows people who don't have
1525 noweb installed to complete the make process without error.
1527 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1528 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1529 by JMarc's picky compiler.
1531 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1534 * src/insets/insettabular.C (setPos): change for loop to not use
1535 sequencing operator. Please check this Jürgen.
1537 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1539 * src/insets/insetcite.C (getScreenLabel): ditto
1540 * src/support/filetools.C (QuoteName): ditto
1541 (ChangeExtension): ditto
1543 * src/BufferView_pimpl.C (scrollCB): make heigt int
1545 * src/BufferView2.C (insertInset): comment out unused arg
1547 * boost/Makefile.am (EXTRADIST): new variable
1549 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1551 * src/exporter.C (IsExportable): Fixed
1553 * lib/configure.m4: Small fix
1555 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1557 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1558 * src/insets/insetbib.C (bibitemWidest): ditto.
1559 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1561 2000-10-03 Juergen Vigna <jug@sad.it>
1563 * src/BufferView2.C (theLockingInset): removed const because of
1564 Agnus's compile problems.
1566 * src/insets/insettext.C (LocalDispatch): set the language of the
1567 surronding paragraph on inserting the first character.
1569 * various files: changed use of BufferView::the_locking_inset.
1571 * src/BufferView2.C (theLockingInset):
1572 (theLockingInset): new functions.
1574 * src/BufferView.h: removed the_locking_inset.
1576 * src/lyxtext.h: added the_locking_inset
1578 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1580 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1582 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1584 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1585 * src/mathed/math_cursor.C (IsAlpha): ditto.
1586 * src/mathed/math_inset.C (strnew): ditto.
1587 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1588 (IMetrics): cxp set but never used; removed.
1589 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1590 that the variable in question has been removed also!
1593 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1594 using the Buffer * passed to Latex(), using the BufferView * passed to
1595 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1597 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1598 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1600 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1601 * src/buffer.C (readInset): used new InsetBibtex c-tor
1602 * (getBibkeyList): used new InsetBibtex::getKeys
1604 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1607 * lib/build-listerrors
1609 * src/exporter.C: Add literate programming support to the export code
1612 * src/lyx_cb.C: Remove old literate code.
1614 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1617 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1618 * src/converter.C (View, Convert): Use QuoteName.
1620 * src/insets/figinset.C (Preview): Use Formats::View.
1622 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1624 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1626 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1627 the top of the function, because compaq cxx complains that the
1628 "goto exit_with_message" when the function is disabled bypasses
1630 (MenuNew): try a better fix for the generation of new file names.
1631 This time, I used AddName() instead of AddPath(), hoping Juergen
1634 2000-10-03 Allan Rae <rae@lyx.org>
1636 * src/frontends/xforms/forms/form_preferences.fd:
1637 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1638 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1639 "Look and Feel"->"General" but will need to be split up further into
1640 general output and general input tabs. Current plan is for four outer
1641 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1642 stuff; "Inputs" for input and import configuration; "Outputs" for
1643 output and export configuration; and one more whatever is left over
1644 called "General". The leftovers at present look like being which
1645 viewers to use, spellchecker, language support and might be better
1646 named "Support". I've put "Paths" in "Inputs" for the moment as this
1647 seems reasonable for now at least.
1648 One problem remains: X error kills LyX when you close Preferences.
1650 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1652 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1653 qualifier from form()
1654 * src/frontends/xforms/FormCitation.[Ch]:
1655 * src/frontends/xforms/FormCopyright.[Ch]:
1656 * src/frontends/xforms/FormDocument.[Ch]:
1657 * src/frontends/xforms/FormError.[Ch]:
1658 * src/frontends/xforms/FormIndex.[Ch]:
1659 * src/frontends/xforms/FormPreferences.[Ch]:
1660 * src/frontends/xforms/FormPrint.[Ch]:
1661 * src/frontends/xforms/FormRef.[Ch]:
1662 * src/frontends/xforms/FormToc.[Ch]:
1663 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1665 * src/frontends/xforms/FormCitation.[Ch]:
1666 * src/frontends/xforms/FormIndex.[Ch]:
1667 * src/frontends/xforms/FormRef.[Ch]:
1668 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1669 with Allan's naming policy
1671 * src/frontends/xforms/FormCitation.C: some static casts to remove
1674 2000-10-02 Juergen Vigna <jug@sad.it>
1676 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1677 now you can type or do stuff inside the table-cell also when in dummy
1678 position, fixed visible cursor.
1680 * src/insets/insettext.C (Edit): fixing cursor-view position.
1682 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1683 be used for equal functions in lyxfunc and insettext.
1685 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1687 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1689 * src/frontends/gnome/FormCitation.h:
1690 * src/frontends/gnome/FormCopyright.h:
1691 * src/frontends/gnome/FormIndex.h:
1692 * src/frontends/gnome/FormPrint.h:
1693 * src/frontends/gnome/FormToc.h:
1694 * src/frontends/gnome/FormUrl.h:
1695 * src/frontends/kde/FormCitation.h:
1696 * src/frontends/kde/FormCopyright.h:
1697 * src/frontends/kde/FormIndex.h:
1698 * src/frontends/kde/FormRef.h:
1699 * src/frontends/kde/FormToc.h:
1700 * src/frontends/kde/FormUrl.h: fix remaining users of
1703 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1705 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1706 from depth argument.
1707 (DocBookHandleCaption): ditto.
1708 (DocBookHandleFootnote): ditto.
1709 (SimpleDocBookOnePar): ditto.
1711 * src/frontends/xforms/FormDocument.h (form): remove extra
1712 FormDocument:: qualifier.
1714 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1716 * sigc++/handle.h: ditto.
1718 * src/lyx_gui_misc.C: add "using" directive.
1720 * src/cheaders/cstddef: new file, needed by the boost library (for
1723 2000-10-02 Juergen Vigna <jug@sad.it>
1725 * src/insets/insettext.C (SetFont): better support.
1727 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1729 * src/screen.C (DrawOneRow): some uint refixes!
1731 2000-10-02 Allan Rae <rae@lyx.org>
1733 * boost/.cvsignore: ignore Makefile as well
1735 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1736 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1738 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1739 Left this one out by accident.
1741 * src/frontends/xforms/FormBase.h (restore): default to calling
1742 update() since that will restore the original/currently-applied values.
1743 Any input() triggered error messages will require the derived classes
1744 to redefine restore().
1746 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1747 avoid a segfault. combo_doc_class is the main concern.
1749 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1751 * Simplify build-listerrors in view of GUI-less export ability!
1753 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1755 * src/lyx_main.C (easyParse): Disable gui when exporting
1757 * src/insets/figinset.C:
1760 * src/lyx_gui_misc.C
1761 * src/tabular.C: Changes to allow no-gui.
1763 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1765 * src/support/utility.hpp: removed file
1766 * src/support/block.h: removed file
1768 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1771 * src/mathed/formula.C: add support/lyxlib.h
1772 * src/mathed/formulamacro.C: ditto
1774 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1775 * src/lyxparagraph.h: ditto
1777 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1778 * src/frontends/Makefile.am (INCLUDES): ditto
1779 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1780 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1781 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1782 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1783 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1784 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1786 * src/BufferView.h: use boost/utility.hpp
1787 * src/LColor.h: ditto
1788 * src/LaTeX.h: ditto
1789 * src/LyXAction.h: ditto
1790 * src/LyXView.h: ditto
1791 * src/bufferlist.h: ditto
1792 * src/lastfiles.h: ditto
1793 * src/layout.h: ditto
1794 * src/lyx_gui.h: ditto
1795 * src/lyx_main.h: ditto
1796 * src/lyxlex.h: ditto
1797 * src/lyxrc.h: ditto
1798 * src/frontends/ButtonPolicies.h: ditto
1799 * src/frontends/Dialogs.h: ditto
1800 * src/frontends/xforms/FormBase.h: ditto
1801 * src/frontends/xforms/FormGraphics.h: ditto
1802 * src/frontends/xforms/FormParagraph.h: ditto
1803 * src/frontends/xforms/FormTabular.h: ditto
1804 * src/graphics/GraphicsCache.h: ditto
1805 * src/graphics/Renderer.h: ditto
1806 * src/insets/ExternalTemplate.h: ditto
1807 * src/insets/insetcommand.h: ditto
1808 * src/support/path.h: ditto
1810 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1811 and introduce clause for 2.97.
1813 * boost/libs/README: new file
1815 * boost/boost/utility.hpp: new file
1817 * boost/boost/config.hpp: new file
1819 * boost/boost/array.hpp: new file
1821 * boost/Makefile.am: new file
1823 * boost/.cvsignore: new file
1825 * configure.in (AC_OUTPUT): add boost/Makefile
1827 * Makefile.am (SUBDIRS): add boost
1829 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1831 * src/support/lstrings.C (suffixIs): Fixed.
1833 2000-10-01 Allan Rae <rae@lyx.org>
1835 * src/PrinterParams.h: moved things around to avoid the "can't
1836 inline call" warning.
1838 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1839 into doc++ documentation.
1841 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1843 * src/frontends/xforms/FormRef.C: make use of button controller
1844 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1845 cleaned up button controller usage.
1846 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1847 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1848 use the button controller
1850 * src/frontends/xforms/forms/*.fd: and associated generated files
1851 updated to reflect changes to FormBase. Some other FormXxxx files
1852 also got minor updates to reflect changes to FormBase.
1854 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1855 (hide): made virtual.
1856 (input): return a bool. true == valid input
1857 (RestoreCB, restore): new
1858 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1859 Changes to allow derived dialogs to use a ButtonController and
1860 make sense when doing so: OK button calls ok() and so on.
1862 * src/frontends/xforms/ButtonController.h (class ButtonController):
1863 Switch from template implementation to taking Policy parameter.
1864 Allows FormBase to provide a ButtonController for any dialog.
1866 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1867 Probably should rename connect and disconnect.
1868 (apply): use the radio button groups
1869 (form): needed by FormBase
1870 (build): setup the radio button groups
1872 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1874 * several files: type changes to reduce the number of warnings and
1875 to unify type hangling a bit. Still much to do.
1877 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1879 * lib/images/*: rename a bunch of icons to match Dekel converter
1882 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1885 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1887 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1889 * sigc++/handle.h: ditto for class Handle.
1891 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1893 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1895 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1897 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1898 removal of the "default" language.
1900 * src/combox.h (getline): Check that sel > 0
1902 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1904 * lib/examples/docbook_example.lyx
1905 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1907 * lib/layouts/docbook-book.layout: new docbook book layout.
1909 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1911 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1913 * src/insets/figinset.C (DocBook):fixed small typo.
1915 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1917 * src/insets/insetinclude.h: string include_label doesn't need to be
1920 2000-09-29 Allan Rae <rae@lyx.org>
1922 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1923 Allow derived type to control connection and disconnection from signals
1924 of its choice if desired.
1926 2000-09-28 Juergen Vigna <jug@sad.it>
1928 * src/insets/insettabular.C (update): fixed cursor setting when
1929 the_locking_inset changed.
1930 (draw): made this a bit cleaner.
1931 (InsetButtonPress): fixed!
1933 * various files: added LyXText Parameter to fitCursor call.
1935 * src/BufferView.C (fitCursor): added LyXText parameter.
1937 * src/insets/insettabular.C (draw): small draw fix.
1939 * src/tabular.C: right setting of left/right celllines.
1941 * src/tabular.[Ch]: fixed various types in funcions and structures.
1942 * src/insets/insettabular.C: ditto
1943 * src/frontends/xforms/FormTabular.C: ditto
1945 2000-09-28 Allan Rae <rae@lyx.org>
1947 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1948 that the #ifdef's had been applied to part of what should have been
1949 a complete condition. It's possible there are other tests that
1950 were specific to tables that are also wrong now that InsetTabular is
1951 being used. Now we need to fix the output of '\n' after a table in a
1952 float for the same reason as the original condition:
1953 "don't insert this if we would be adding it before or after a table
1954 in a float. This little trick is needed in order to allow use of
1955 tables in \subfigures or \subtables."
1956 Juergen can you check this?
1958 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1960 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1961 output to the ostream.
1963 * several files: fixed types based on warnings from cxx
1965 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1967 * src/frontends/kde/Makefile.am: fix rule for
1968 formindexdialogdata_moc.C
1970 * src/.cvsignore: add ext_l10n.h to ignore
1972 * acconfig.h: stop messing with __STRICT_ANSI__
1973 * config/gnome.m4: remove option to set -ansi
1974 * config/kde.m4: remove option to set -ansi
1975 * config/lyxinclude.m4: don't set -ansi
1977 2000-09-27 Juergen Vigna <jug@sad.it>
1979 * various files: remove "default" language check.
1981 * src/insets/insetquotes.C: removed use of current_view.
1983 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1984 the one should have red ears by now!
1986 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1987 in more then one paragraph. Fixed cursor-movement/selection.
1989 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1990 paragraphs inside a text inset.
1992 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1993 text-inset if this owner is an inset.
1995 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1997 * src/Bullet.h: changed type of font, character and size to int
1999 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2001 * src/insets/inseturl.[Ch]:
2002 * src/insets/insetref.[Ch]:
2003 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2005 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2007 * src/buffer.C (readFile): block-if statement rearranged to minimise
2008 bloat. Patch does not reverse Jean-Marc's change ;-)
2010 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2011 Class rewritten to store pointers to hide/update signals directly,
2012 rather than Dialogs *. Also defined an enum to ease use. All xforms
2013 forms can now be derived from this class.
2015 * src/frontends/xforms/FormCommand.[Ch]
2016 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2018 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2021 * src/frontends/xforms/forms/form_citation.fd
2022 * src/frontends/xforms/forms/form_copyright.fd
2023 * src/frontends/xforms/forms/form_error.fd
2024 * src/frontends/xforms/forms/form_index.fd
2025 * src/frontends/xforms/forms/form_ref.fd
2026 * src/frontends/xforms/forms/form_toc.fd
2027 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2029 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2031 * src/insets/insetfoot.C: removed redundent using directive.
2033 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2035 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2036 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2038 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2039 created in the constructors in different groups. Then set() just
2040 have to show the groups as needed. This fixes the redraw problems
2041 (and is how the old menu code worked).
2043 * src/support/lyxlib.h: declare the methods as static when we do
2044 not have namespaces.
2046 2000-09-26 Juergen Vigna <jug@sad.it>
2048 * src/buffer.C (asciiParagraph): new function.
2049 (writeFileAscii): new function with parameter ostream.
2050 (writeFileAscii): use now asciiParagraph.
2052 * various inset files: added the linelen parameter to the Ascii-func.
2054 * src/tabular.C (Write): fixed error in writing file introduced by
2055 the last changes from Lars.
2057 * lib/bind/menus.bind: removed not supported functions.
2059 * src/insets/insettext.C (Ascii): implemented this function.
2061 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2063 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2064 (Write): use of the write_attribute functions.
2066 * src/bufferlist.C (close): fixed reasking question!
2068 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2070 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2071 new files use the everwhere possible.
2074 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2075 src/log_form.C src/lyx.C:
2078 * src/buffer.C (runLaTeX): remove func
2080 * src/PaperLayout.C: removed file
2081 * src/ParagraphExtra.C: likewise
2082 * src/bullet_forms.C: likewise
2083 * src/bullet_forms.h: likewise
2084 * src/bullet_forms_cb.C: likewise
2086 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2087 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2090 * several files: remove all traces of the old fd_form_paragraph,
2091 and functions belonging to that.
2093 * several files: remove all traces of the old fd_form_document,
2094 and functions belonging to that.
2096 * several files: constify local variables were possible.
2098 * several files: remove all code that was dead when NEW_EXPORT was
2101 * several files: removed string::c_str in as many places as
2104 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2105 (e): be a bit more outspoken when patching
2106 (updatesrc): only move files if changed.
2108 * forms/layout_forms.h.patch: regenerated
2110 * forms/layout_forms.fd: remove form_document and form_paragraph
2111 and form_quotes and form_paper and form_table_options and
2112 form_paragraph_extra
2114 * forms/form1.fd: remove form_table
2116 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2117 the fdui->... rewrite. Update some comments to xforms 0.88
2119 * forms/bullet_forms.C.patch: removed file
2120 * forms/bullet_forms.fd: likewise
2121 * forms/bullet_forms.h.patch: likewise
2123 * development/Code_rules/Rules: added a section on switch
2124 statements. Updated some comment to xforms 0.88.
2126 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2128 * src/buffer.C (readFile): make sure that the whole version number
2129 is read after \lyxformat (even when it contains a comma)
2131 * lib/ui/default.ui: change shortcut of math menu to M-a.
2133 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2135 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2138 * src/LyXView.C (updateWindowTitle): show the full files name in
2139 window title, limited to 30 characters.
2141 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2142 When a number of characters has been given, we should not assume
2143 that the string is 0-terminated.
2145 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2146 calls (fixes some memory leaks)
2148 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2149 trans member on exit.
2151 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2153 * src/converter.C (GetReachable): fix typo.
2155 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2156 understand ',' instead of '.'.
2157 (GetInteger): rewrite to use strToInt().
2159 2000-09-26 Juergen Vigna <jug@sad.it>
2161 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2162 better visibility and error-message on wrong VSpace input.
2164 * src/language.C (initL): added english again.
2166 2000-09-25 Juergen Vigna <jug@sad.it>
2168 * src/frontends/kde/Dialogs.C (Dialogs):
2169 * src/frontends/gnome/Dialogs.C (Dialogs):
2170 * src/frontends/kde/Makefile.am:
2171 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2173 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2175 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2177 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2179 * src/frontends/xforms/FormParagraph.C:
2180 * src/frontends/xforms/FormParagraph.h:
2181 * src/frontends/xforms/form_paragraph.C:
2182 * src/frontends/xforms/form_paragraph.h:
2183 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2186 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2188 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2189 Paragraph-Data after use.
2191 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2192 non breakable paragraphs.
2194 2000-09-25 Garst R. Reese <reese@isn.net>
2196 * src/language.C (initL): added missing language_country codes.
2198 2000-09-25 Juergen Vigna <jug@sad.it>
2200 * src/insets/insettext.C (InsetText):
2201 (deleteLyXText): remove the not released LyXText structure!
2203 2000-09-24 Marko Vendelin <markov@ioc.ee>
2205 * src/frontends/gnome/mainapp.C
2206 * src/frontends/gnome/mainapp.h: added support for keyboard
2209 * src/frontends/gnome/FormCitation.C
2210 * src/frontends/gnome/FormCitation.h
2211 * src/frontends/gnome/Makefile.am
2212 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2213 FormCitation to use "action area" in mainapp window
2215 * src/frontends/gnome/Menubar_pimpl.C
2216 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2219 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2221 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2222 width/descent/ascent values if name is empty.
2223 (mathed_string_height): Use std::max.
2225 2000-09-25 Allan Rae <rae@lyx.org>
2227 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2228 segfault. This will be completely redesigned soon.
2230 * sigc++: updated libsigc++. Fixes struct timespec bug.
2232 * development/tools/makeLyXsigc.sh: .cvsignore addition
2234 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2236 * several files: removed almost all traces of the old table
2239 * src/TableLayout.C: removed file
2241 2000-09-22 Juergen Vigna <jug@sad.it>
2243 * src/frontends/kde/Dialogs.C: added credits forms.
2245 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2247 * src/frontends/gnome/Dialogs.C: added some forms.
2249 * src/spellchecker.C (init_spell_checker): set language in pspell code
2250 (RunSpellChecker): some modifications for setting language string.
2252 * src/language.[Ch]: added language_country code.
2254 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2256 * src/frontends/Dialogs.h: added new signal showError.
2257 Rearranged existing signals in some sort of alphabetical order.
2259 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2260 FormError.[Ch], form_error.[Ch]
2261 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2262 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2264 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2265 dialogs. I think that this can be used as the base to all these
2268 * src/frontends/xforms/FormError.[Ch]
2269 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2270 implementation of InsetError dialog.
2272 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2274 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2275 * src/frontends/kde/Makefile.am: ditto
2277 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2279 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2280 macrobf. This fixes a bug of invisible text.
2282 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2284 * lib/doc/LaTeXConfig.lyx.in: updated.
2286 * src/language.C (initL): remove language "francais" and change a
2287 bit the names of the two other french variations.
2289 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2290 string that may not be 0-terminated.
2292 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2294 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2296 2000-09-20 Marko Vendelin <markov@ioc.ee>
2298 * src/frontends/gnome/FormCitation.C
2299 * src/frontends/gnome/FormIndex.C
2300 * src/frontends/gnome/FormToc.C
2301 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2302 the variable initialization to shut up the warnings
2304 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2306 * src/table.[Ch]: deleted files
2308 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2311 2000-09-18 Juergen Vigna <jug@sad.it>
2313 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2314 problems with selection. Inserted new LFUN_PASTESELECTION.
2315 (InsetButtonPress): inserted handling of middle mouse-button paste.
2317 * src/spellchecker.C: changed word to word.c_str().
2319 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2321 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2322 included in the ``make dist'' tarball.
2324 2000-09-15 Juergen Vigna <jug@sad.it>
2326 * src/CutAndPaste.C (cutSelection): small fix return the right
2327 end position after cut inside one paragraph only.
2329 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2330 we are locked as otherwise we don't have a valid cursor position!
2332 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2334 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2336 * src/frontends/kde/FormRef.C: added using directive.
2337 * src/frontends/kde/FormToc.C: ditto
2339 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2341 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2343 2000-09-19 Marko Vendelin <markov@ioc.ee>
2345 * src/frontends/gnome/Menubar_pimpl.C
2346 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2347 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2349 * src/frontends/gnome/mainapp.C
2350 * src/frontends/gnome/mainapp.h: support for menu update used
2353 * src/frontends/gnome/mainapp.C
2354 * src/frontends/gnome/mainapp.h: support for "action" area in the
2355 main window. This area is used by small simple dialogs, such as
2358 * src/frontends/gnome/FormIndex.C
2359 * src/frontends/gnome/FormIndex.h
2360 * src/frontends/gnome/FormUrl.C
2361 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2364 * src/frontends/gnome/FormCitation.C
2365 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2366 action area. Only "Insert new citation" is implemented.
2368 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2370 * src/buffer.C (Dispatch): fix call to Dispatch
2371 * src/insets/insetref.C (Edit): likewise
2372 * src/insets/insetparent.C (Edit): likewise
2373 * src/insets/insetinclude.C (include_cb): likewise
2374 * src/frontends/xforms/FormUrl.C (apply): likewise
2375 * src/frontends/xforms/FormToc.C (apply): likewise
2376 * src/frontends/xforms/FormRef.C (apply): likewise
2377 * src/frontends/xforms/FormIndex.C (apply): likewise
2378 * src/frontends/xforms/FormCitation.C (apply): likewise
2379 * src/lyxserver.C (callback): likewise
2380 * src/lyxfunc.C (processKeySym): likewise
2381 (Dispatch): likewise
2382 (Dispatch): likewise
2383 * src/lyx_cb.C (LayoutsCB): likewise
2385 * Makefile.am (sourcedoc): small change
2387 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2389 * src/main.C (main): Don't make an empty GUIRunTime object. all
2390 methods are static. constify a bit remove unneded using + headers.
2392 * src/tabular.C: some more const to local vars move some loop vars
2394 * src/spellchecker.C: added some c_str after some word for pspell
2396 * src/frontends/GUIRunTime.h: add new static method setDefaults
2397 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2398 * src/frontends/kde/GUIRunTime.C (setDefaults):
2399 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2401 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2402 with strnew in arg, use correct emptystring when calling SetName.
2404 * several files: remove all commented code with relation to
2405 HAVE_SSTREAM beeing false. We now only support stringstream and
2408 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2410 * src/lyxfunc.C: construct correctly the automatic new file
2413 * src/text2.C (IsStringInText): change type of variable i to shut
2416 * src/support/sstream.h: do not use namespaces if the compiler
2417 does not support them.
2419 2000-09-15 Marko Vendelin <markov@ioc.ee>
2420 * src/frontends/gnome/FormCitation.C
2421 * src/frontends/gnome/FormCitation.h
2422 * src/frontends/gnome/diainsertcitation_interface.c
2423 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2424 regexp support to FormCitation [Gnome].
2426 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2429 * configure.in: remove unused KDE/GTKGUI define
2431 * src/frontends/kde/FormRef.C
2432 * src/frontends/kde/FormRef.h
2433 * src/frontends/kde/formrefdialog.C
2434 * src/frontends/kde/formrefdialog.h: double click will
2435 go to reference, now it is possible to change a cross-ref
2438 * src/frontends/kde/FormToc.C
2439 * src/frontends/kde/FormToc.h
2440 * src/frontends/kde/formtocdialog.C
2441 * src/frontends/kde/formtocdialog.h: add a depth
2444 * src/frontends/kde/Makefile.am: add QtLyXView.h
2447 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2449 * src/frontends/kde/FormCitation.h: added some using directives.
2451 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2453 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2456 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2459 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2461 * src/buffer.C (pop_tag): revert for the second time a change by
2462 Lars, who seems to really hate having non-local loop variables :)
2464 * src/Lsstream.h: add "using" statements.
2466 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2467 * src/buffer.C (writeFile): ditto
2469 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2471 * src/buffer.C (writeFile): try to fix the locale modified format
2472 number to always be as we want it.
2474 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2475 in XForms 0.89. C-space is now working again.
2477 * src/Lsstream.h src/support/sstream.h: new files.
2479 * also commented out all cases where strstream were used.
2481 * src/Bullet.h (c_str): remove method.
2483 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2485 * a lot of files: get rid of "char const *" and "char *" is as
2486 many places as possible. We only want to use them in interaction
2487 with system of other libraries, not inside lyx.
2489 * a lot of files: return const object is not of pod type. This
2490 helps ensure that temporary objects is not modified. And fits well
2491 with "programming by contract".
2493 * configure.in: check for the locale header too
2495 * Makefile.am (sourcedoc): new tag for generation of doc++
2498 2000-09-14 Juergen Vigna <jug@sad.it>
2500 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2501 callback to check which combo called it and do the right action.
2503 * src/combox.C (combo_cb): added combo * to the callbacks.
2504 (Hide): moved call of callback after Ungrab of the pointer.
2506 * src/intl.h: removed LCombo2 function.
2508 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2509 function as this can now be handled in one function.
2511 * src/combox.h: added Combox * to callback prototype.
2513 * src/frontends/xforms/Toolbar_pimpl.C:
2514 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2516 2000-09-14 Garst Reese <reese@isn.net>
2518 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2519 moved usepackage{xxx}'s to beginning of file. Changed left margin
2520 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2521 underlining from title. Thanks to John Culleton for useful suggestions.
2523 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2525 * src/lyxlex_pimpl.C (setFile): change error message to debug
2528 2000-09-13 Juergen Vigna <jug@sad.it>
2530 * src/frontends/xforms/FormDocument.C: implemented choice_class
2531 as combox and give callback to combo_language so OK/Apply is activated
2534 * src/bufferlist.C (newFile): small fix so already named files
2535 (via an open call) are not requested to be named again on the
2538 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2540 * src/frontends/kde/Makefile.am
2541 * src/frontends/kde/FormRef.C
2542 * src/frontends/kde/FormRef.h
2543 * src/frontends/kde/formrefdialog.C
2544 * src/frontends/kde/formrefdialog.h: implement
2547 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2549 * src/frontends/kde/formtocdialog.C
2550 * src/frontends/kde/formtocdialog.h
2551 * src/frontends/kde/FormToc.C
2552 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2554 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2556 * src/frontends/kde/FormCitation.C: fix thinko
2557 where we didn't always display the reference text
2560 * src/frontends/kde/formurldialog.C
2561 * src/frontends/kde/formurldialog.h
2562 * src/frontends/kde/FormUrl.C
2563 * src/frontends/kde/FormUrl.h: minor cleanups
2565 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2567 * src/frontends/kde/Makefile.am
2568 * src/frontends/kde/FormToc.C
2569 * src/frontends/kde/FormToc.h
2570 * src/frontends/kde/FormCitation.C
2571 * src/frontends/kde/FormCitation.h
2572 * src/frontends/kde/FormIndex.C
2573 * src/frontends/kde/FormIndex.h
2574 * src/frontends/kde/formtocdialog.C
2575 * src/frontends/kde/formtocdialog.h
2576 * src/frontends/kde/formcitationdialog.C
2577 * src/frontends/kde/formcitationdialog.h
2578 * src/frontends/kde/formindexdialog.C
2579 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2581 2000-09-12 Juergen Vigna <jug@sad.it>
2583 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2586 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2588 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2591 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2593 * src/converter.C (Add, Convert): Added support for converter flags:
2594 needaux, resultdir, resultfile.
2595 (Convert): Added new parameter view_file.
2596 (dvips_options): Fixed letter paper option.
2598 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2599 (Export, GetExportableFormats, GetViewableFormats): Added support
2602 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2604 (easyParse): Fixed to work with new export code.
2606 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2609 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2611 * lib/bind/*.bind: Replaced
2612 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2613 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2615 2000-09-11 Juergen Vigna <jug@sad.it>
2617 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2619 * src/main.C (main): now GUII defines global guiruntime!
2621 * src/frontends/gnome/GUIRunTime.C (initApplication):
2622 * src/frontends/kde/GUIRunTime.C (initApplication):
2623 * src/frontends/xforms/GUIRunTime.C (initApplication):
2624 * src/frontends/GUIRunTime.h: added new function initApplication.
2626 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2628 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2630 2000-09-08 Juergen Vigna <jug@sad.it>
2632 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2633 we have already "Reset".
2635 * src/language.C (initL): inserted "default" language and made this
2636 THE default language (and not american!)
2638 * src/paragraph.C: inserted handling of "default" language!
2640 * src/lyxfont.C: ditto
2644 * src/paragraph.C: output the \\par only if we have a following
2645 paragraph otherwise it's not needed.
2647 2000-09-05 Juergen Vigna <jug@sad.it>
2649 * config/pspell.m4: added entry to lyx-flags
2651 * src/spellchecker.C: modified version from Kevin for using pspell
2653 2000-09-01 Marko Vendelin <markov@ioc.ee>
2654 * src/frontends/gnome/Makefile.am
2655 * src/frontends/gnome/FormCitation.C
2656 * src/frontends/gnome/FormCitation.h
2657 * src/frontends/gnome/diainsertcitation_callbacks.c
2658 * src/frontends/gnome/diainsertcitation_callbacks.h
2659 * src/frontends/gnome/diainsertcitation_interface.c
2660 * src/frontends/gnome/diainsertcitation_interface.h
2661 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2662 dialog for Gnome frontend
2664 * src/main.C: Gnome libraries require keeping application name
2665 and its version as strings
2667 * src/frontends/gnome/mainapp.C: Change the name of the main window
2668 from GnomeLyX to PACKAGE
2670 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2672 * src/frontends/Liason.C: add "using: declaration.
2674 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2676 * src/mathed/math_macro.C (Metrics): Set the size of the template
2678 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2680 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2682 * src/converter.C (add_options): New function.
2683 (SetViewer): Change $$FName into '$$FName'.
2684 (View): Add options when running xdvi
2685 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2686 (Convert): The 3rd parameter is now the desired filename. Converts
2687 calls to lyx::rename if necessary.
2688 Add options when running dvips.
2689 (dvi_papersize,dvips_options): New methods.
2691 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2693 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2694 using a call to Converter::dvips_options.
2695 Fixed to work with nex export code.
2697 * src/support/copy.C
2698 * src/support/rename.C: New files
2700 * src/support/syscall.h
2701 * src/support/syscall.C: Added Starttype SystemDontWait.
2703 * lib/ui/default.ui: Changed to work with new export code
2705 * lib/configure.m4: Changed to work with new export code
2707 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2709 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2711 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2712 so that code compiles with DEC cxx.
2714 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2715 to work correctly! Also now supports the additional elements
2718 2000-09-01 Allan Rae <rae@lyx.org>
2720 * src/frontends/ButtonPolicies.C: renamed all the references to
2721 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2723 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2724 since it's a const not a type.
2726 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2728 2000-08-31 Juergen Vigna <jug@sad.it>
2730 * src/insets/figinset.C: Various changes to look if the filename has
2731 an extension and if not add it for inline previewing.
2733 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2735 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2736 make buttonStatus and isReadOnly be const methods. (also reflect
2737 this in derived classes.)
2739 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2740 (nextState): change to be static inline, pass the StateMachine as
2742 (PreferencesPolicy): remove casts
2743 (OkCancelPolicy): remvoe casts
2744 (OkCancelReadOnlyPolicy): remove casts
2745 (NoRepeatedApplyReadOnlyPolicy): remove casts
2746 (OkApplyCancelReadOnlyPolicy): remove casts
2747 (OkApplyCancelPolicy): remove casts
2748 (NoRepeatedApplyPolicy): remove casts
2750 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2752 * src/converter.C: added some using directives
2754 * src/frontends/ButtonPolicies.C: changes to overcome
2755 "need lvalue" error with DEC c++
2757 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2758 to WMHideCB for DEC c++
2760 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2762 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2763 to BulletBMTableCB for DEC c++
2765 2000-08-31 Allan Rae <rae@lyx.org>
2767 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2768 character dialog separately from old document dialogs combo_language.
2771 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2773 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2774 Removed LFUN_REF_CREATE.
2776 * src/MenuBackend.C: Added new tags: toc and references
2778 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2779 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2781 (add_toc, add_references): New methods.
2782 (create_submenu): Handle correctly the case when there is a
2783 seperator after optional menu items.
2785 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2786 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2787 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2789 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2791 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2793 * src/converter.[Ch]: New file for converting between different
2796 * src/export.[Ch]: New file for exporting a LyX file to different
2799 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2800 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2801 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2802 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2803 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2804 RunDocBook, MenuExport.
2806 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2807 Exporter::Preview methods if NEW_EXPORT is defined.
2809 * src/buffer.C (Dispatch): Use Exporter::Export.
2811 * src/lyxrc.C: Added new tags: \converter and \viewer.
2814 * src/LyXAction.C: Define new lyx-function: buffer-update.
2815 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2816 when NEW_EXPORT is defined.
2818 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2820 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2822 * lib/ui/default.ui: Added submenus "view" and "update" to the
2825 * src/filetools.C (GetExtension): New function.
2827 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2829 2000-08-29 Allan Rae <rae@lyx.org>
2831 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2833 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2834 (EnableDocumentLayout): removed
2835 (DisableDocumentLayout): removed
2836 (build): make use of ButtonController's read-only handling to
2837 de/activate various objects. Replaces both of the above functions.
2839 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2840 (readOnly): was read_only
2841 (refresh): fixed dumb mistakes with read_only_ handling
2843 * src/frontends/xforms/forms/form_document.fd:
2844 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2845 tabbed dialogs so the tabs look more like tabs and so its easier to
2846 work out which is the current tab.
2848 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2849 segfault with form_table
2851 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2853 2000-08-28 Juergen Vigna <jug@sad.it>
2855 * acconfig.h: added USE_PSPELL.
2857 * src/config.h.in: added USE_PSPELL.
2859 * autogen.sh: added pspell.m4
2861 * config/pspell.m4: new file.
2863 * src/spellchecker.C: implemented support for pspell libary.
2865 2000-08-25 Juergen Vigna <jug@sad.it>
2867 * src/LyXAction.C (init): renamed LFUN_TABLE to
2868 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2870 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2872 * src/lyxscreen.h: add force_clear variable and fuction to force
2873 a clear area when redrawing in LyXText.
2875 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2877 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2879 * some whitespace and comment changes.
2881 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2883 * src/buffer.C: up te LYX_FORMAT to 2.17
2885 2000-08-23 Juergen Vigna <jug@sad.it>
2887 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2890 * src/insets/insettabular.C (pasteSelection): delete the insets
2891 LyXText as it is not valid anymore.
2892 (copySelection): new function.
2893 (pasteSelection): new function.
2894 (cutSelection): new function.
2895 (LocalDispatch): implemented cut/copy/paste of cell selections.
2897 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2898 don't have a LyXText.
2900 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2902 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2905 2000-08-22 Juergen Vigna <jug@sad.it>
2907 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2908 ifdef form_table out if NEW_TABULAR.
2910 2000-08-21 Juergen Vigna <jug@sad.it>
2912 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2913 (draw): fixed draw position so that the cursor is positioned in the
2915 (InsetMotionNotify): hide/show cursor so the position is updated.
2916 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2917 using cellstart() function where it should be used.
2919 * src/insets/insettext.C (draw): ditto.
2921 * src/tabular.C: fixed initialization of some missing variables and
2922 made BoxType into an enum.
2924 2000-08-22 Marko Vendelin <markov@ioc.ee>
2925 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2926 stock menu item using action numerical value, not its string
2930 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2932 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2933 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2935 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2937 * src/frontends/xforms/GUIRunTime.C: new file
2939 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2940 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2942 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2944 * src/frontends/kde/GUIRunTime.C: new file
2946 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2947 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2949 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2951 * src/frontends/gnome/GUIRunTime.C: new file
2953 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2956 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2957 small change to documetentation.
2959 * src/frontends/GUIRunTime.C: removed file
2961 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2963 * src/lyxparagraph.h: enable NEW_TABULAR as default
2965 * src/lyxfunc.C (processKeySym): remove some commented code
2967 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2968 NEW_TABULAR around the fd_form_table_options.
2970 * src/lyx_gui.C (runTime): call the static member function as
2971 GUIRunTime::runTime().
2973 2000-08-21 Allan Rae <rae@lyx.org>
2975 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2978 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2980 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2982 2000-08-21 Allan Rae <rae@lyx.org>
2984 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2985 keep Garst happy ;-)
2986 * src/frontends/xforms/FormPreferences.C (build): use setOK
2987 * src/frontends/xforms/FormDocument.C (build): use setOK
2988 (FormDocument): use the appropriate policy.
2990 2000-08-21 Allan Rae <rae@lyx.org>
2992 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2993 automatic [de]activation of arbitrary objects when in a read-only state.
2995 * src/frontends/ButtonPolicies.h: More documentation
2996 (isReadOnly): added to support the above.
2998 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3000 2000-08-18 Juergen Vigna <jug@sad.it>
3002 * src/insets/insettabular.C (getStatus): changed to return func_status.
3004 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3005 display toggle menu entries if they are.
3007 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3008 new document layout now.
3010 * src/lyxfunc.C: ditto
3012 * src/lyx_gui_misc.C: ditto
3014 * src/lyx_gui.C: ditto
3016 * lib/ui/default.ui: removed paper and quotes layout as they are now
3017 all in the document layout tabbed folder.
3019 * src/frontends/xforms/forms/form_document.fd: added Restore
3020 button and callbacks for all inputs for Allan's ButtonPolicy.
3022 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3023 (CheckChoiceClass): added missing params setting on class change.
3024 (UpdateLayoutDocument): added for updating the layout on params.
3025 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3026 (FormDocument): Implemented Allan's ButtonPolicy with the
3029 2000-08-17 Allan Rae <rae@lyx.org>
3031 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3032 so we can at least see the credits again.
3034 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3035 controller calls for the appropriate callbacks. Note that since Ok
3036 calls apply followed by cancel, and apply isn't a valid input for the
3037 APPLIED state, the bc_ calls have to be made in the static callback not
3038 within each of the real callbacks.
3040 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3041 (setOk): renamed from setOkay()
3043 2000-08-17 Juergen Vigna <jug@sad.it>
3045 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3046 in the implementation part.
3047 (composeUIInfo): don't show optional menu-items.
3049 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3051 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3053 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3054 text-state when in a text-inset.
3056 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3058 2000-08-17 Marko Vendelin <markov@ioc.ee>
3059 * src/frontends/gnome/FormIndex.C
3060 * src/frontends/gnome/FormIndex.h
3061 * src/frontends/gnome/FormToc.C
3062 * src/frontends/gnome/FormToc.h
3063 * src/frontends/gnome/dialogs
3064 * src/frontends/gnome/diatoc_callbacks.c
3065 * src/frontends/gnome/diatoc_callbacks.h
3066 * src/frontends/gnome/diainsertindex_callbacks.h
3067 * src/frontends/gnome/diainsertindex_callbacks.c
3068 * src/frontends/gnome/diainsertindex_interface.c
3069 * src/frontends/gnome/diainsertindex_interface.h
3070 * src/frontends/gnome/diatoc_interface.h
3071 * src/frontends/gnome/diatoc_interface.c
3072 * src/frontends/gnome/Makefile.am: Table of Contents and
3073 Insert Index dialogs implementation for Gnome frontend
3075 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3077 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3079 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3082 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3084 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3085 destructor. Don't definde if you don't need it
3086 (processEvents): made static, non-blocking events processing for
3088 (runTime): static method. event loop for xforms
3089 * similar as above for kde and gnome.
3091 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3092 new Pimpl is correct
3093 (runTime): new method calss the real frontends runtime func.
3095 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3097 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3099 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3101 2000-08-16 Juergen Vigna <jug@sad.it>
3103 * src/lyx_gui.C (runTime): added GUII RunTime support.
3105 * src/frontends/Makefile.am:
3106 * src/frontends/GUIRunTime.[Ch]:
3107 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3108 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3109 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3111 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3113 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3114 as this is already set in ${FRONTEND_INCLUDE} if needed.
3116 * configure.in (CPPFLAGS): setting the include dir for the frontend
3117 directory and don't set FRONTEND=xforms for now as this is executed
3120 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3122 * src/frontends/kde/Makefile.am:
3123 * src/frontends/kde/FormUrl.C:
3124 * src/frontends/kde/FormUrl.h:
3125 * src/frontends/kde/formurldialog.h:
3126 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3128 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3130 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3132 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3134 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3137 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3139 * src/WorkArea.C (work_area_handler): more work to get te
3140 FL_KEYBOARD to work with xforms 0.88 too, please test.
3142 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3144 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3146 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3149 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3151 * src/Timeout.h: remove Qt::emit hack.
3153 * several files: changes to allo doc++ compilation
3155 * src/lyxfunc.C (processKeySym): new method
3156 (processKeyEvent): comment out if FL_REVISION < 89
3158 * src/WorkArea.C: change some debugging levels.
3159 (WorkArea): set wantkey to FL_KEY_ALL
3160 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3161 clearer code and the use of compose with XForms 0.89. Change to
3162 use signals instead of calling methods in bufferview directly.
3164 * src/Painter.C: change some debugging levels.
3166 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3169 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3170 (workAreaKeyPress): new method
3172 2000-08-14 Juergen Vigna <jug@sad.it>
3174 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3176 * config/kde.m4: addes some features
3178 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3179 include missing xforms dialogs.
3181 * src/Timeout.h: a hack to be able to compile with qt/kde.
3183 * sigc++/.cvsignore: added acinclude.m4
3185 * lib/.cvsignore: added listerros
3187 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3188 xforms tree as objects are needed for other frontends.
3190 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3191 linking with not yet implemented xforms objects.
3193 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3195 2000-08-14 Baruch Even <baruch.even@writeme.com>
3197 * src/frontends/xforms/FormGraphics.h:
3198 * src/frontends/xforms/FormGraphics.C:
3199 * src/frontends/xforms/RadioButtonGroup.h:
3200 * src/frontends/xforms/RadioButtonGroup.C:
3201 * src/insets/insetgraphics.h:
3202 * src/insets/insetgraphics.C:
3203 * src/insets/insetgraphicsParams.h:
3204 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3205 instead of spaces, and various other indentation issues to make the
3206 sources more consistent.
3208 2000-08-14 Marko Vendelin <markov@ioc.ee>
3210 * src/frontends/gnome/dialogs/diaprint.glade
3211 * src/frontends/gnome/FormPrint.C
3212 * src/frontends/gnome/FormPrint.h
3213 * src/frontends/gnome/diaprint_callbacks.c
3214 * src/frontends/gnome/diaprint_callbacks.h
3215 * src/frontends/gnome/diaprint_interface.c
3216 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3219 * src/frontends/gnome/dialogs/diainserturl.glade
3220 * src/frontends/gnome/FormUrl.C
3221 * src/frontends/gnome/FormUrl.h
3222 * src/frontends/gnome/diainserturl_callbacks.c
3223 * src/frontends/gnome/diainserturl_callbacks.h
3224 * src/frontends/gnome/diainserturl_interface.c
3225 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3226 Gnome implementation
3228 * src/frontends/gnome/Dialogs.C
3229 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3230 all other dialogs. Copy all unimplemented dialogs from Xforms
3233 * src/frontends/gnome/support.c
3234 * src/frontends/gnome/support.h: support files generated by Glade
3238 * config/gnome.m4: Gnome configuration scripts
3240 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3241 configure --help message
3243 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3244 only if there are no events pendling in Gnome/Gtk. This enhances
3245 the performance of menus.
3248 2000-08-14 Allan Rae <rae@lyx.org>
3250 * lib/Makefile.am: listerrors cleaning
3252 * lib/listerrors: removed -- generated file
3253 * acinclude.m4: ditto
3254 * sigc++/acinclude.m4: ditto
3256 * src/frontends/xforms/forms/form_citation.fd:
3257 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3260 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3261 `updatesrc` and now we have a `test` target that does what `updatesrc`
3262 used to do. I didn't like having an install target that wasn't related
3265 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3266 on all except FormGraphics. This may yet happen. Followed by a major
3267 cleanup including using FL_TRANSIENT for most of the dialogs. More
3268 changes to come when the ButtonController below is introduced.
3270 * src/frontends/xforms/ButtonController.h: New file for managing up to
3271 four buttons on a dialog according to an externally defined policy.
3272 * src/frontends/xforms/Makefile.am: added above
3274 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3275 Apply and Cancel/Close buttons and everything in between and beyond.
3276 * src/frontends/Makefile.am: added above.
3278 * src/frontends/xforms/forms/form_preferences.fd:
3279 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3280 and removed variable 'status' as a result. Fixed the set_minsize thing.
3281 Use the new screen-font-update after checking screen fonts were changed
3282 Added a "Restore" button to restore the original lyxrc values while
3283 editing. This restores everything not just the last input changed.
3284 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3286 * src/LyXAction.C: screen-font-update added for updating buffers after
3287 screen font settings have been changed.
3288 * src/commandtags.h: ditto
3289 * src/lyxfunc.C: ditto
3291 * forms/lyx.fd: removed screen fonts dialog.
3292 * src/lyx_gui.C: ditto
3293 * src/menus.[Ch]: ditto
3294 * src/lyx.[Ch]: ditto
3295 * src/lyx_cb.C: ditto + code from here moved to make
3296 screen-font-update. And people wonder why progress on GUII is
3297 slow. Look at how scattered this stuff was! It takes forever
3300 * forms/fdfix.sh: Fixup the spacing after commas.
3301 * forms/makefile: Remove date from generated files. Fewer clashes now.
3302 * forms/bullet_forms.C.patch: included someones handwritten changes
3304 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3305 once I've discovered why LyXRC was made noncopyable.
3306 * src/lyx_main.C: ditto
3308 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3310 * src/frontends/xforms/forms/fdfix.sh:
3311 * src/frontends/xforms/forms/fdfixh.sed:
3312 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3313 * src/frontends/xforms/Form*.[hC]:
3314 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3315 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3316 provide a destructor for the struct FD_form_xxxx. Another version of
3317 the set_[max|min]size workaround and a few other cleanups. Actually,
3318 Angus' patch from 20000809.
3320 2000-08-13 Baruch Even <baruch.even@writeme.com>
3322 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3325 2000-08-11 Juergen Vigna <jug@sad.it>
3327 * src/insets/insetgraphics.C (InsetGraphics): changing init
3328 order because of warnings.
3330 * src/frontends/xforms/forms/makefile: adding patching .C with
3333 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3334 from .C.patch to .c.patch
3336 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3337 order because of warning.
3339 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3341 * src/frontends/Liason.C (setMinibuffer): new helper function
3343 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3345 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3347 * lib/ui/default.ui: commented out PaperLayout entry
3349 * src/frontends/xforms/form_document.[Ch]: new added files
3351 * src/frontends/xforms/FormDocument.[Ch]: ditto
3353 * src/frontends/xforms/forms/form_document.fd: ditto
3355 * src/frontends/xforms/forms/form_document.C.patch: ditto
3357 2000-08-10 Juergen Vigna <jug@sad.it>
3359 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3360 (InsetGraphics): initialized cacheHandle to 0.
3361 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3363 2000-08-10 Baruch Even <baruch.even@writeme.com>
3365 * src/graphics/GraphicsCache.h:
3366 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3367 correctly as a cache.
3369 * src/graphics/GraphicsCacheItem.h:
3370 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3373 * src/graphics/GraphicsCacheItem_pimpl.h:
3374 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3377 * src/insets/insetgraphics.h:
3378 * src/insets/insetgraphics.C: Changed from using a signal notification
3379 to polling when image is not loaded.
3381 2000-08-10 Allan Rae <rae@lyx.org>
3383 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3384 that there are two functions that have to been taken out of line by
3385 hand and aren't taken care of in the script. (Just a reminder note)
3387 * sigc++/macros/*.h.m4: Updated as above.
3389 2000-08-09 Juergen Vigna <jug@sad.it>
3391 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3393 * src/insets/insettabular.C: make drawing of single cell smarter.
3395 2000-08-09 Marko Vendelin <markov@ioc.ee>
3396 * src/frontends/gnome/Menubar_pimpl.C
3397 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3398 implementation: new files
3400 * src/frontends/gnome/mainapp.C
3401 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3404 * src/main.C: create Gnome main window
3406 * src/frontends/xforms/Menubar_pimpl.h
3407 * src/frontends/Menubar.C
3408 * src/frontends/Menubar.h: added method Menubar::update that calls
3409 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3411 * src/LyXView.C: calls Menubar::update to update the state
3414 * src/frontends/gnome/Makefile.am: added new files
3416 * src/frontends/Makefile.am: added frontend compiler options
3418 2000-08-08 Juergen Vigna <jug@sad.it>
3420 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3422 * src/bufferlist.C (close):
3423 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3424 documents if exiting without saving.
3426 * src/buffer.C (save): use removeAutosaveFile()
3428 * src/support/filetools.C (removeAutosaveFile): new function.
3430 * src/lyx_cb.C (MenuWrite): returns a bool now.
3431 (MenuWriteAs): check if file could really be saved and revert to the
3433 (MenuWriteAs): removing old autosavefile if existant.
3435 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3436 before Goto toggle declaration, because of compiler warning.
3438 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3440 * src/lyxfunc.C (MenuNew): small fix.
3442 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3444 * src/bufferlist.C (newFile):
3445 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3447 * src/lyxrc.C: added new_ask_filename tag
3449 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3451 * src/lyx.fd: removed code pertaining to form_ref
3452 * src/lyx.[Ch]: ditto
3453 * src/lyx_cb.C: ditto
3454 * src/lyx_gui.C: ditto
3455 * src/lyx_gui_misc.C: ditto
3457 * src/BufferView_pimpl.C (restorePosition): update buffer only
3460 * src/commandtags.h (LFUN_REFTOGGLE): removed
3461 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3462 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3463 (LFUN_REFBACK): renamed LFUN_REF_BACK
3465 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3466 * src/menus.C: ditto
3467 * src/lyxfunc.C (Dispatch): ditto.
3468 InsertRef dialog is now GUI-independent.
3470 * src/texrow.C: added using std::endl;
3472 * src/insets/insetref.[Ch]: strip out large amounts of code.
3473 The inset is now a container and this functionality is now
3474 managed by a new FormRef dialog
3476 * src/frontends/Dialogs.h (showRef, createRef): new signals
3478 * src/frontends/xforms/FormIndex.[Ch],
3479 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3480 when setting dialog's min/max size
3481 * src/frontends/xforms/FormIndex.[Ch]: ditto
3483 * src/frontends/xforms/FormRef.[Ch],
3484 src/frontends/xforms/forms/form_ref.fd: new xforms
3485 implementation of an InsetRef dialog
3487 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3490 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3491 ios::nocreate is not part of the standard. Removed.
3493 2000-08-07 Baruch Even <baruch.even@writeme.com>
3495 * src/graphics/Renderer.h:
3496 * src/graphics/Renderer.C: Added base class for rendering of different
3497 image formats into Pixmaps.
3499 * src/graphics/XPM_Renderer.h:
3500 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3501 in a different class.
3503 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3504 easily add support for other formats.
3506 * src/insets/figinset.C: plugged a leak of an X resource.
3508 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3510 * src/CutAndPaste.[Ch]: make all metods static.
3512 * development/Code_rules/Rules: more work, added section on
3513 Exceptions, and a References section.
3515 * a lot of header files: work to make doc++ able to generate the
3516 source documentation, some workarounds of doc++ problems. Doc++ is
3517 now able to generate the documentation.
3519 2000-08-07 Juergen Vigna <jug@sad.it>
3521 * src/insets/insettabular.C (recomputeTextInsets): removed function
3523 * src/tabular.C (SetWidthOfMulticolCell):
3525 (calculate_width_of_column_NMC): fixed return value so that it really
3526 only returns true if the column-width has changed (there where
3527 problems with muliticolumn-cells in this column).
3529 2000-08-04 Juergen Vigna <jug@sad.it>
3531 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3532 also on the scrollstatus of the inset.
3533 (workAreaMotionNotify): ditto.
3535 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3537 2000-08-01 Juergen Vigna <jug@sad.it>
3539 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3541 * src/commandtags.h:
3542 * src/LyXAction.C (init):
3543 * src/insets/inset.C (LocalDispatch): added support for
3546 * src/insets/inset.C (scroll): new functions.
3548 * src/insets/insettext.C (removeNewlines): new function.
3549 (SetAutoBreakRows): removes forced newlines in the text of the
3550 paragraph if autoBreakRows is set to false.
3552 * src/tabular.C (Latex): generates a parbox around the cell contents
3555 * src/frontends/xforms/FormTabular.C (local_update): removed
3556 the radio_useparbox button.
3558 * src/tabular.C (UseParbox): new function
3560 2000-08-06 Baruch Even <baruch.even@writeme.com>
3562 * src/graphics/GraphicsCache.h:
3563 * src/graphics/GraphicsCache.C:
3564 * src/graphics/GraphicsCacheItem.h:
3565 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3568 * src/insets/insetgraphics.h:
3569 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3570 and the drawing of the inline image.
3572 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3573 loaded into the wrong position.
3575 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3578 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3580 * src/support/translator.h: move all typedefs to public section
3582 * src/support/filetools.C (MakeLatexName): return string const
3584 (TmpFileName): ditto
3585 (FileOpenSearch): ditto
3587 (LibFileSearch): ditto
3588 (i18nLibFileSearch): ditto
3591 (CreateTmpDir): ditto
3592 (CreateBufferTmpDir): ditto
3593 (CreateLyXTmpDir): ditto
3596 (MakeAbsPath): ditto
3598 (OnlyFilename): ditto
3600 (NormalizePath): ditto
3601 (CleanupPath): ditto
3602 (GetFileContents): ditto
3603 (ReplaceEnvironmentPath): ditto
3604 (MakeRelPath): ditto
3606 (ChangeExtension): ditto
3607 (MakeDisplayPath): ditto
3608 (do_popen): return cmdret const
3609 (findtexfile): return string const
3611 * src/support/DebugStream.h: add some /// to please doc++
3613 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3615 * src/texrow.C (same_rownumber): functor to use with find_if
3616 (getIdFromRow): rewritten to use find_if and to not update the
3617 positions. return true if row is found
3618 (increasePos): new method, use to update positions
3620 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3622 * src/lyxlex_pimpl.C (verifyTable): new method
3625 (GetString): return string const
3626 (pushTable): rewrite to use std::stack
3628 (setFile): better check
3631 * src/lyxlex.h: make LyXLex noncopyable
3633 * src/lyxlex.C (text): return char const * const
3634 (GetString): return string const
3635 (getLongString): return string const
3637 * src/lyx_gui_misc.C (askForText): return pair<...> const
3639 * src/lastfiles.[Ch] (operator): return string const
3641 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3642 istringstream not char const *.
3643 move token.end() out of loop.
3644 (readFile): move initializaton of token
3646 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3647 getIdFromRow is successful.
3649 * lib/bind/emacs.bind: don't include menus bind
3651 * development/Code_rules/Rules: the beginnings of making this
3652 better and covering more of the unwritten rules that we have.
3654 * development/Code_rules/Recommendations: a couple of wording
3657 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3659 * src/support/strerror.c: remove C++ comment.
3661 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3663 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3664 LFUN_INDEX_INSERT_LAST
3666 * src/texrow.C (getIdFromRow): changed from const_iterator to
3667 iterator, allowing code to compile with DEC cxx
3669 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3670 stores part of the class, as suggested by Allan. Will allow
3672 (apply): test to apply uses InsetCommandParams operator!=
3674 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3675 (apply): test to apply uses InsetCommandParams operator!=
3677 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3678 stores part of the class.
3679 (update): removed limits on min/max size.
3681 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3682 (apply): test to apply uses InsetCommandParams operator!=
3684 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3685 (Read, Write, scanCommand, getCommand): moved functionality
3686 into InsetCommandParams.
3688 (getScreenLabel): made pure virtual
3689 new InsetCommandParams operators== and !=
3691 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3692 c-tors based on InsetCommandParams. Removed others.
3693 * src/insets/insetinclude.[Ch]: ditto
3694 * src/insets/insetlabel.[Ch]: ditto
3695 * src/insets/insetparent.[Ch]: ditto
3696 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3698 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3699 insets derived from InsetCommand created using similar c-tors
3700 based on InsetCommandParams
3701 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3702 * src/menus.C (ShowRefsMenu): ditto
3703 * src/paragraph.C (Clone): ditto
3704 * src/text2.C (SetCounter): ditto
3705 * src/lyxfunc.C (Dispatch) ditto
3706 Also recreated old InsetIndex behaviour exactly. Can now
3707 index-insert at the start of a paragraph and index-insert-last
3708 without launching the pop-up.
3710 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3712 * lib/lyxrc.example: mark te pdf options as non functional.
3714 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3715 (isStrDbl): move tmpstr.end() out of loop.
3716 (strToDbl): move intialization of tmpstr
3717 (lowercase): return string const and move tmp.end() out of loop.
3718 (uppercase): return string const and move tmp.edn() out of loop.
3719 (prefixIs): add assertion
3724 (containsOnly): ditto
3725 (containsOnly): ditto
3726 (containsOnly): ditto
3727 (countChar): make last arg char not char const
3728 (token): return string const
3729 (subst): return string const, move tmp.end() out of loop.
3730 (subst): return string const, add assertion
3731 (strip): return string const
3732 (frontStrip): return string const, add assertion
3733 (frontStrip): return string const
3738 * src/support/lstrings.C: add inclde "LAssert.h"
3739 (isStrInt): move tmpstr.end() out of loop.
3741 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3742 toollist.end() out of loop.
3743 (deactivate): move toollist.end() out of loop.
3744 (update): move toollist.end() out of loop.
3745 (updateLayoutList): move tc.end() out of loop.
3746 (add): move toollist.end() out of loop.
3748 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3749 md.end() out of loop.
3751 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3753 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3756 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3757 (Erase): move insetlist.end() out of loop.
3759 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3760 ref to const string as first arg. Move initialization of some
3761 variables, whitespace changes.
3763 * src/kbmap.C (defkey): move table.end() out of loop.
3764 (kb_keymap): move table.end() out of loop.
3765 (findbinding): move table.end() out of loop.
3767 * src/MenuBackend.C (hasMenu): move end() out of loop.
3768 (getMenu): move end() out of loop.
3769 (getMenu): move menulist_.end() out of loop.
3771 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3773 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3776 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3777 (getFromLyXName): move infotab.end() out of loop.
3779 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3780 -fvtable-thunks -ffunction-sections -fdata-sections
3782 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3784 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3787 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3789 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3791 * src/frontends/xforms/FormCitation.[Ch],
3792 src/frontends/xforms/FormIndex.[Ch],
3793 src/frontends/xforms/FormToc.[Ch],
3794 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3796 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3798 * src/commandtags.h: renamed, created some flags for citation
3801 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3803 * src/lyxfunc.C (dispatch): use signals to insert index entry
3805 * src/frontends/Dialogs.h: new signal createIndex
3807 * src/frontends/xforms/FormCommand.[Ch],
3808 src/frontends/xforms/FormCitation.[Ch],
3809 src/frontends/xforms/FormToc.[Ch],
3810 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3812 * src/insets/insetindex.[Ch]: GUI-independent
3814 * src/frontends/xforms/FormIndex.[Ch],
3815 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3818 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3820 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3821 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3823 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3825 * src/insets/insetref.C (Latex): rewrite so that there is now
3826 question that a initialization is requested.
3828 * src/insets/insetcommand.h: reenable the hide signal
3830 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3832 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3833 fix handling of shortcuts (many bugs :)
3834 (add_lastfiles): ditto.
3836 * lib/ui/default.ui: fix a few shortcuts.
3838 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3840 * Makefile.am: Fix ``rpmdist'' target to return the exit
3841 status of the ``rpm'' command, instead of the last command in
3842 the chain (the ``rm lyx.xpm'' command, which always returns
3845 2000-08-02 Allan Rae <rae@lyx.org>
3847 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3848 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3849 * src/frontends/xforms/FormToc.C (FormToc): ditto
3851 * src/frontends/xforms/Makefile.am: A few forgotten files
3853 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3854 Signals-not-copyable-problem Lars' started commenting out.
3856 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3858 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3860 * src/insets/insetcommand.h: Signals is not copyable so anoter
3861 scheme for automatic hiding of forms must be used.
3863 * src/frontends/xforms/FormCitation.h: don't inerit from
3864 noncopyable, FormCommand already does that.
3865 * src/frontends/xforms/FormToc.h: ditto
3866 * src/frontends/xforms/FormUrl.h: ditto
3868 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3870 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3872 * src/insets/insetcommand.h (hide): new SigC::Signal0
3873 (d-tor) new virtual destructor emits hide signal
3875 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3876 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3878 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3879 LOF and LOT. Inset is now GUI-independent
3881 * src/insets/insetloa.[Ch]: redundant
3882 * src/insets/insetlof.[Ch]: ditto
3883 * src/insets/insetlot.[Ch]: ditto
3885 * src/frontends/xforms/forms/form_url.fd: tweaked!
3886 * src/frontends/xforms/forms/form_citation.fd: ditto
3888 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3889 dialogs dealing with InsetCommand insets
3891 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3892 FormCommand base class
3893 * src/frontends/xforms/FormUrl.[Ch]: ditto
3895 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3897 * src/frontends/xforms/FormToc.[Ch]: ditto
3899 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3900 passed a generic InsetCommand pointer
3901 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3903 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3904 and modified InsetTOC class
3905 * src/buffer.C: ditto
3907 * forms/lyx.fd: strip out old FD_form_toc code
3908 * src/lyx_gui_misc.C: ditto
3909 * src/lyx_gui.C: ditto
3910 * src/lyx_cb.C: ditto
3911 * src/lyx.[Ch]: ditto
3913 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3915 * src/support/utility.hpp: tr -d '\r'
3917 2000-08-01 Juergen Vigna <jug@sad.it>
3919 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3921 * src/commandtags.h:
3922 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3923 LFUN_TABULAR_FEATURES.
3925 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3926 LFUN_LAYOUT_TABULAR.
3928 * src/insets/insettabular.C (getStatus): implemented helper function.
3930 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3932 2000-07-31 Juergen Vigna <jug@sad.it>
3934 * src/text.C (draw): fixed screen update problem for text-insets.
3936 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3937 something changed probably this has to be added in various other
3940 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3942 2000-07-31 Baruch Even <baruch.even@writeme.com>
3944 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3945 templates to satisfy compaq cxx.
3948 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3950 * src/support/translator.h (equal_1st_in_pair::operator()): take
3951 const ref pair_type as arg.
3952 (equal_2nd_in_pair::operator()): ditto
3953 (Translator::~Translator): remove empty d-tor.
3955 * src/graphics/GraphicsCache.C: move include config.h to top, also
3956 put initialization of GraphicsCache::singleton here.
3957 (~GraphicsCache): move here
3958 (addFile): take const ref as arg
3961 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3963 * src/BufferView2.C (insertLyXFile): change te with/without header
3966 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3968 * src/frontends/xforms/FormGraphics.C (apply): add some
3969 static_cast. Not very nice, but required by compaq cxx.
3971 * src/frontends/xforms/RadioButtonGroup.h: include header
3972 <utility> instead of <pair.h>
3974 * src/insets/insetgraphicsParams.C: add using directive.
3975 (readResize): change return type to void.
3976 (readOrigin): ditto.
3978 * src/lyxfunc.C (getStatus): add missing break for build-program
3979 function; add test for Literate for export functions.
3981 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3982 entries in Options menu.
3984 2000-07-31 Baruch Even <baruch.even@writeme.com>
3986 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3987 protect against auto-allocation; release icon when needed.
3989 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3991 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3992 on usual typewriter.
3994 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3995 earlier czech.kmap), useful only for programming.
3997 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3999 * src/frontends/xforms/FormCitation.h: fix conditioning around
4002 2000-07-31 Juergen Vigna <jug@sad.it>
4004 * src/frontends/xforms/FormTabular.C (local_update): changed
4005 radio_linebreaks to radio_useparbox and added radio_useminipage.
4007 * src/tabular.C: made support for using minipages/parboxes.
4009 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4011 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4013 (descent): so the cursor is in the middle.
4014 (width): bit smaller box.
4016 * src/insets/insetgraphics.h: added display() function.
4018 2000-07-31 Baruch Even <baruch.even@writeme.com>
4020 * src/frontends/Dialogs.h: Added showGraphics signals.
4022 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4023 xforms form definition of the graphics dialog.
4025 * src/frontends/xforms/FormGraphics.h:
4026 * src/frontends/xforms/FormGraphics.C: Added files, the
4027 GUIndependent code of InsetGraphics
4029 * src/insets/insetgraphics.h:
4030 * src/insets/insetgraphics.C: Major writing to make it work.
4032 * src/insets/insetgraphicsParams.h:
4033 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4034 struct between InsetGraphics and GUI.
4036 * src/LaTeXFeatures.h:
4037 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4038 support for graphicx package.
4040 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4041 for the graphics inset.
4043 * src/support/translator.h: Added file, used in
4044 InsetGraphicsParams. this is a template to translate between two
4047 * src/frontends/xforms/RadioButtonGroup.h:
4048 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4049 way to easily control a radio button group.
4051 2000-07-28 Juergen Vigna <jug@sad.it>
4053 * src/insets/insettabular.C (LocalDispatch):
4054 (TabularFeatures): added support for lyx-functions of tabular features.
4055 (cellstart): refixed this function after someone wrongly changed it.
4057 * src/commandtags.h:
4058 * src/LyXAction.C (init): added support for tabular-features
4060 2000-07-28 Allan Rae <rae@lyx.org>
4062 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4063 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4064 triggers the callback for input checking. As a result we sometimes get
4065 "LyX: This shouldn't happen..." printed to cerr.
4066 (input): Started using status variable since I only free() on
4067 destruction. Some input checking for paths and font sizes.
4069 * src/frontends/xforms/FormPreferences.h: Use status to control
4070 activation of Ok and Apply
4072 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4073 callback. Also resized to stop segfaults with 0.88. The problem is
4074 that xforms-0.88 requires the folder to be wide enough to fit all the
4075 tabs. If it isn't it causes all sorts of problems.
4077 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4079 * src/frontends/xforms/forms/README: Reflect reality.
4081 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4082 * src/frontends/xforms/forms/makefile: ditto.
4084 * src/commandtags.h: Get access to new Preferences dialog
4085 * src/LyXAction.C: ditto
4086 * src/lyxfunc.C: ditto
4087 * lib/ui/default.ui: ditto
4089 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4091 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4093 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4096 * src/frontends/xforms/form_url.[Ch]: added.
4098 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4100 * src/insets/insetbib.h: fixed bug in previous commit
4102 * src/frontends/xforms/FormUrl.h: ditto
4104 * src/frontends/xforms/FormPrint.h: ditto
4106 * src/frontends/xforms/FormPreferences.h: ditto
4108 * src/frontends/xforms/FormCopyright.h: ditto
4110 * src/frontends/xforms/FormCitation.C: ditto
4112 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4113 private copyconstructor and private default contructor
4115 * src/support/Makefile.am: add utility.hpp
4117 * src/support/utility.hpp: new file from boost
4119 * src/insets/insetbib.h: set owner in clone
4121 * src/frontends/xforms/FormCitation.C: added missing include
4124 * src/insets/form_url.[Ch]: removed
4126 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4128 * development/lyx.spec.in
4129 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4130 file/directory re-organization.
4132 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4134 * src/insets/insetcommand.[Ch]: moved the string data and
4135 associated manipulation methods into a new stand-alone class
4136 InsetCommandParams. This class has two additional methods
4137 getAsString() and setFromString() allowing the contents to be
4138 moved around as a single string.
4139 (addContents) method removed.
4140 (setContents) method no longer virtual.
4142 * src/buffer.C (readInset): made use of new InsetCitation,
4143 InsetUrl constructors based on InsetCommandParams.
4145 * src/commandtags.h: add LFUN_INSERT_URL
4147 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4148 independent InsetUrl and use InsetCommandParams to extract
4149 string info and create new Insets.
4151 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4153 * src/frontends/xforms/FormCitation.C (apply): uses
4156 * src/frontends/xforms/form_url.C
4157 * src/frontends/xforms/form_url.h
4158 * src/frontends/xforms/FormUrl.h
4159 * src/frontends/xforms/FormUrl.C
4160 * src/frontends/xforms/forms/form_url.fd: new files
4162 * src/insets/insetcite.[Ch]: removed unused constructors.
4164 * src/insets/insetinclude.[Ch]: no longer store filename
4166 * src/insets/inseturl.[Ch]: GUI-independent.
4168 2000-07-26 Juergen Vigna <jug@sad.it>
4169 * renamed frontend from gtk to gnome as it is that what is realized
4170 and did the necessary changes in the files.
4172 2000-07-26 Marko Vendelin <markov@ioc.ee>
4174 * configure.in: cleaning up gnome configuration scripts
4176 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4178 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4179 shortcuts syndrom by redrawing them explicitely (a better solution
4180 would be appreciated).
4182 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4184 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4187 * src/lyx_cb.C (MenuExport): change html export to do the right
4188 thing depending of the document type (instead of having
4189 html-linuxdoc and html-docbook).
4190 * src/lyxfunc.C (getStatus): update for html
4191 * lib/ui/default.ui: simplify due to the above change.
4192 * src/menus.C (ShowFileMenu): update too (in case we need it).
4194 * src/MenuBackend.C (read): if a menu is defined twice, add the
4195 new entries to the exiting one.
4197 2000-07-26 Juergen Vigna <jug@sad.it>
4199 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4201 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4202 and return a bool if it did actual save the file.
4203 (AutoSave): don't autosave a unnamed doc.
4205 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4206 check if this is an UNNAMED new file and react to it.
4207 (newFile): set buffer to unnamed and change to not mark a new
4208 buffer dirty if I didn't do anything with it.
4210 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4212 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4214 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4215 friend as per Angus's patch posted to lyx-devel.
4217 * src/ext_l10n.h: updated
4219 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4220 gettext on the style string right before inserting them into the
4223 * autogen.sh: add code to extract style strings form layout files,
4224 not good enough yet.
4226 * src/frontends/gtk/.cvsignore: add MAKEFILE
4228 * src/MenuBackend.C (read): run the label strings through gettext
4229 before storing them in the containers.
4231 * src/ext_l10n.h: new file
4233 * autogen.sh : generate the ext_l10n.h file here
4235 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4237 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4240 * lib/ui/default.ui: fix a couple of typos.
4242 * config/gnome/gtk.m4: added (and added to the list of files in
4245 * src/insets/insetinclude.C (unique_id): fix when we are using
4246 lyxstring instead of basic_string<>.
4247 * src/insets/insettext.C (LocalDispatch): ditto.
4248 * src/support/filetools.C: ditto.
4250 * lib/configure.m4: create the ui/ directory if necessary.
4252 * src/LyXView.[Ch] (updateToolbar): new method.
4254 * src/BufferView_pimpl.C (buffer): update the toolbar when
4255 opening/closing buffer.
4257 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4259 * src/LyXAction.C (getActionName): enhance to return also the name
4260 and options of pseudo-actions.
4261 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4263 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4264 as an example of what is possible). Used in File->Build too (more
4265 useful) and in the import/export menus (to mimick the complicated
4266 handling of linuxdoc and friends). Try to update all the entries.
4268 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4271 * src/MenuBackend.C (read): Parse the new OptItem tag.
4273 * src/MenuBackend.h: Add a new optional_ data member (used if the
4274 entry should be omitted when the lyxfunc is disabled).
4276 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4277 function, used as a shortcut.
4278 (create_submenu): align correctly the shortcuts on the widest
4281 * src/MenuBackend.h: MenuItem.label() only returns the label of
4282 the menu without shortcut; new method shortcut().
4284 2000-07-14 Marko Vendelin <markov@ioc.ee>
4286 * src/frontends/gtk/Dialogs.C:
4287 * src/frontends/gtk/FormCopyright.C:
4288 * src/frontends/gtk/FormCopyright.h:
4289 * src/frontends/gtk/Makefile.am: added these source-files for the
4290 Gtk/Gnome support of the Copyright-Dialog.
4292 * src/main.C: added Gnome::Main initialization if using
4293 Gtk/Gnome frontend-GUI.
4295 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4297 * config/gnome/aclocal-include.m4
4298 * config/gnome/compiler-flags.m4
4299 * config/gnome/curses.m4
4300 * config/gnome/gnome--.m4
4301 * config/gnome/gnome-bonobo-check.m4
4302 * config/gnome/gnome-common.m4
4303 * config/gnome/gnome-fileutils.m4
4304 * config/gnome/gnome-ghttp-check.m4
4305 * config/gnome/gnome-gnorba-check.m4
4306 * config/gnome/gnome-guile-checks.m4
4307 * config/gnome/gnome-libgtop-check.m4
4308 * config/gnome/gnome-objc-checks.m4
4309 * config/gnome/gnome-orbit-check.m4
4310 * config/gnome/gnome-print-check.m4
4311 * config/gnome/gnome-pthread-check.m4
4312 * config/gnome/gnome-support.m4
4313 * config/gnome/gnome-undelfs.m4
4314 * config/gnome/gnome-vfs.m4
4315 * config/gnome/gnome-x-checks.m4
4316 * config/gnome/gnome-xml-check.m4
4317 * config/gnome/gnome.m4
4318 * config/gnome/gperf-check.m4
4319 * config/gnome/gtk--.m4
4320 * config/gnome/linger.m4
4321 * config/gnome/need-declaration.m4: added configuration scripts
4322 for Gtk/Gnome frontend-GUI
4324 * configure.in: added support for the --with-frontend=gtk option
4326 * autogen.sh: added config/gnome/* to list of config-files
4328 * acconfig.h: added define for GTKGUI-support
4330 * config/lyxinclude.m4: added --with-frontend[=value] option value
4331 for Gtk/Gnome frontend-GUI support.
4333 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4335 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4339 * src/paragraph.C (GetChar): remove non-const version
4341 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4342 (search_kw): use it.
4344 * src/lyx_main.C (init): if "preferences" exist, read that instead
4346 (ReadRcFile): return bool if the file could be read ok.
4347 (ReadUIFile): add a check to see if lex file is set ok.
4349 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4350 bastring can be used instead of lyxstring (still uses the old code
4351 if std::string is good enough or if lyxstring is used.)
4353 * src/encoding.C: make the arrays static, move ininle functions
4355 * src/encoding.h: from here.
4357 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4358 (parseSingleLyXformat2Token): move inset parsing to separate method
4359 (readInset): new private method
4361 * src/Variables.h: remove virtual from get().
4363 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4364 access to NEW_INSETS and NEW_TABULAR
4366 * src/MenuBackend.h: remove superfluous forward declaration of
4367 MenuItem. Add documentations tags "///", remove empty MenuItem
4368 destructor, remove private default contructor.
4370 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4372 (read): more string mlabel and mname to where they are used
4373 (read): remove unused variables mlabel and mname
4374 (defaults): unconditional clear, make menusetup take advantage of
4375 add returning Menu &.
4377 * src/LyXView.h: define NEW_MENUBAR as default
4379 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4380 to NEW_INSETS and NEW_TABULAR.
4381 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4382 defined. Change some of the "xxxx-inset-insert" functions names to
4385 * several files: more enahncements to NEW_INSETS and the resulting
4388 * lib/lyxrc.example (\date_insert_format): move to misc section
4390 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4391 bastring and use AC_CACHE_CHECK.
4392 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4393 the system have the newest methods. uses AC_CACHE_CHECK
4394 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4395 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4396 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4398 * configure.in: add LYX_CXX_GOOD_STD_STRING
4400 * acinclude.m4: recreated
4402 2000-07-24 Amir Karger <karger@lyx.org>
4404 * README: add Hebrew, Arabic kmaps
4407 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4409 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4412 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4414 * Lot of files: add pragma interface/implementation.
4416 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4418 * lib/ui/default.ui: new file (ans new directory). Contains the
4419 default menu and toolbar.
4421 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4422 global space. Toolbars are now read (as menus) in ui files.
4424 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4426 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4427 is disabled because the document is read-only. We want to have the
4428 toggle state of the function anyway.
4429 (getStatus): add code for LFUN_VC* functions (mimicking what is
4430 done in old-style menus)
4432 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4433 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4435 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4436 * src/BufferView_pimpl.C: ditto.
4437 * src/lyxfunc.C: ditto.
4439 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4440 default). This replaces old-style menus by new ones.
4442 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4443 MenuItem. Contain the data structure of a menu.
4445 * src/insets/insettext.C: use LyXView::setLayout instead of
4446 accessing directly the toolbar combox.
4447 * src/lyxfunc.C (Dispatch): ditto.
4449 * src/LyXView.C (setLayout): new method, which just calls
4450 Toolbar::setLayout().
4451 (updateLayoutChoice): move part of this method in Toolbar.
4453 * src/toolbar.[Ch]: removed.
4455 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4456 implementation the toolbar.
4458 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4459 the toolbar. It might make sense to merge it with ToolbarDefaults
4461 (setLayout): new function.
4462 (updateLayoutList): ditto.
4463 (openLayoutList): ditto.
4465 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4466 xforms implementation of the toolbar.
4467 (get_toolbar_func): comment out, since I do not
4468 know what it is good for.
4470 * src/ToolbarDefaults.h: Add the ItemType enum.
4472 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4473 for a list of allocated C strings. Used in Menubar xforms
4474 implementation to avoid memory leaks.
4476 * src/support/lstrings.[Ch] (uppercase): new version taking and
4480 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4481 * lib/bind/emacs.bind: ditto.
4483 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4485 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4486 forward decl of LyXView.
4488 * src/toolbar.C (toolbarItem): moved from toolbar.h
4489 (toolbarItem::clean): ditto
4490 (toolbarItem::~toolbarItem): ditto
4491 (toolbarItem::operator): ditto
4493 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4495 * src/paragraph.h: control the NEW_TABULAR define from here
4497 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4498 USE_TABULAR_INSETS to NEW_TABULAR
4500 * src/ToolbarDefaults.C: add include "lyxlex.h"
4502 * files using the old table/tabular: use NEW_TABULAR to control
4503 compilation of old tabular stuff.
4505 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4508 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4509 planemet in reading of old style floats, fix the \end_deeper
4510 problem when reading old style floats.
4512 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4514 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4516 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4518 * lib/bind/sciword.bind: updated.
4520 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4522 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4523 layout write problem
4525 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4527 * src/Makefile.am (INCLUDES): remove image directory from include
4530 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4531 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4533 * src/LyXView.C (create_form_form_main): read the application icon
4536 * lib/images/*.xpm: change the icons to use transparent color for
4539 * src/toolbar.C (update): change the color of the button when it
4542 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4544 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4545 setting explicitely the minibuffer.
4546 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4548 * src/LyXView.C (showState): new function. Shows font information
4549 in minibuffer and update toolbar state.
4550 (LyXView): call Toolbar::update after creating the
4553 * src/toolbar.C: change toollist to be a vector instead of a
4555 (BubbleTimerCB): get help string directly from the callback
4556 argument of the corresponding icon (which is the action)
4557 (set): remove unnecessary ugliness.
4558 (update): new function. update the icons (depressed, disabled)
4559 depending of the status of the corresponding action.
4561 * src/toolbar.h: remove help in toolbarItem
4563 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4565 * src/Painter.C (text): Added code for using symbol glyphs from
4566 iso10646 fonts. Currently diabled.
4568 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4571 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4572 magyar,turkish and usorbian.
4574 * src/paragraph.C (isMultiLingual): Made more efficient.
4576 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4579 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4580 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4581 Also changed the prototype to "bool math_insert_greek(char)".
4583 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4585 * lots of files: apply the NEW_INSETS on all code that will not be
4586 needed when we move to use the new insets. Enable the define in
4587 lyxparagrah.h to try it.
4589 * src/insets/insettabular.C (cellstart): change to be a static
4591 (InsetTabular): initialize buffer in the initializer list.
4593 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4595 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4596 form_print.h out of the header file. Replaced with forward
4597 declarations of the relevant struct.
4599 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4602 * src/commandtags.h: do not include "debug.h" which does not
4603 belong there. #include it in some other places because of this
4606 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4608 * src/insets/insetcaption.C: add a couple "using" directives.
4610 * src/toolbar.C (add): get the help text directly from lyxaction.
4612 (setPixmap): new function. Loads from disk and sets a pixmap on a
4613 botton; the name of the pixmap file is derived from the command
4616 * src/toolbar.h: remove members isBitmap and pixmap from
4619 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4620 * lib/images/: move many files from images/banner.xpm.
4622 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4624 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4625 * src/toolbar.C: ditto.
4626 * configure.in: ditto.
4627 * INSTALL: document.
4629 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4630 the spellchecker popup is closed from the WM.
4632 2000-07-19 Juergen Vigna <jug@sad.it>
4634 * src/insets/insetfloat.C (Write): small fix because we use the
4635 insetname for the type now!
4637 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4639 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4642 * src/frontends/Dialogs.h: removed hideCitation signal
4644 * src/insets/insetcite.h: added hide signal
4646 * src/insets/insetcite.C (~InsetCitation): emits new signal
4647 (getScreenLabel): "intelligent" label should now fit on the screen!
4649 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4651 * src/frontends/xforms/FormCitation.C (showInset): connects
4652 hide() to the inset's hide signal
4653 (show): modified to use fl_set_object_position rather than
4654 fl_set_object_geometry wherever possible
4656 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4658 * src/insets/lyxinset.h: add caption code
4660 * src/insets/insetfloat.C (type): new method
4662 * src/insets/insetcaption.C (Write): new method
4664 (LyxCode): new method
4666 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4667 to get it right together with using the FloatList.
4669 * src/commandtags.h: add LFUN_INSET_CAPTION
4670 * src/lyxfunc.C (Dispatch): handle it
4672 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4675 * src/Variables.[Ch]: make expand take a const reference, remove
4676 the destructor, some whitespace changes.
4678 * src/LyXAction.C (init): add caption-inset-insert
4680 * src/FloatList.C (FloatList): update the default floats a bit.
4682 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4684 * src/Variables.[Ch]: new files. Intended to be used for language
4685 specific strings (like \chaptername) and filename substitution in
4688 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4690 * lib/kbd/american.kmap: update
4692 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4694 * src/bufferparams.[Ch]: remove member allowAccents.
4696 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4698 * src/LaTeXLog.C: use the log_form.h header.
4699 * src/lyx_gui.C: ditto.
4700 * src/lyx_gui_misc.C: ditto.
4701 * src/lyxvc.h: ditto.
4703 * forms/log_form.fd: new file, created from latexoptions.fd. I
4704 kept the log popup and nuked the options form.
4706 * src/{la,}texoptions.[Ch]: removed.
4707 * src/lyx_cb.C (LaTeXOptions): ditto
4709 * src/lyx_gui.C (create_forms): do not handle the
4710 fd_latex_options form.
4712 2000-07-18 Juergen Vigna <jug@sad.it>
4714 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4715 name of the inset so that it can be requested outside (text2.C).
4717 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4720 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4722 * src/mathed/formula.h (ConvertFont): constify
4724 * src/mathed/formula.C (Read): add warning if \end_inset is not
4725 found on expected place.
4727 * src/insets/lyxinset.h (ConvertFont): consify
4729 * src/insets/insetquotes.C (ConvertFont): constify
4730 * src/insets/insetquotes.h: ditto
4732 * src/insets/insetinfo.h: add labelfont
4734 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4735 (ascent): use labelfont
4739 (Write): make .lyx file a bit nicer
4741 * src/insets/insetfloat.C (Write): simplify somewhat...
4742 (Read): add warning if arg is not found
4744 * src/insets/insetcollapsable.C: add using std::max
4745 (Read): move string token and add warning in arg is not found
4746 (draw): use std::max to get the right ty
4747 (getMaxWidth): simplify by using std::max
4749 * src/insets/insetsection.h: new file
4750 * src/insets/insetsection.C: new file
4751 * src/insets/insetcaption.h: new file
4752 * src/insets/insetcaption.C: new file
4754 * src/insets/inset.C (ConvertFont): constify signature
4756 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4757 insetcaption.[Ch] and insetsection.[Ch]
4759 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4760 uses to use LABEL_COUNTER_CHAPTER instead.
4761 * src/text2.C (SetCounter): here
4763 * src/counters.h: new file
4764 * src/counters.C: new file
4765 * src/Sectioning.h: new file
4766 * src/Sectioning.C: new file
4768 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4770 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4772 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4775 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4778 2000-07-17 Juergen Vigna <jug@sad.it>
4780 * src/tabular.C (Validate): check if array-package is needed.
4781 (SetVAlignment): added support for vertical alignment.
4782 (SetLTFoot): better support for longtable header/footers
4783 (Latex): modified to support added features.
4785 * src/LaTeXFeatures.[Ch]: added array-package.
4787 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4789 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4792 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4794 * configure.in: do not forget to put a space after -isystem.
4796 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4798 * lib/kbd/arabic.kmap: a few fixes.
4800 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4802 * some whitespace chagnes to a number of files.
4804 * src/support/DebugStream.h: change to make it easier for
4805 doc++ to parse correctly.
4806 * src/support/lyxstring.h: ditto
4808 * src/mathed/math_utils.C (compara): change to have only one
4810 (MathedLookupBOP): change because of the above.
4812 * src/mathed/math_delim.C (math_deco_compare): change to have only
4814 (search_deco): change becasue of the above.
4816 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4817 instead of manually coded one.
4819 * src/insets/insetquotes.C (Read): read the \end_inset too
4821 * src/insets/insetlatex.h: remove file
4822 * src/insets/insetlatex.C: remove file
4824 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4826 (InsetPrintIndex): remove destructor
4828 * src/insets/insetinclude.h: remove default constructor
4830 * src/insets/insetfloat.C: work to make it work better
4832 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4834 * src/insets/insetcite.h (InsetCitation): remove default constructor
4836 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4838 * src/text.C (GetColumnNearX): comment out some currently unused code.
4840 * src/paragraph.C (writeFile): move some initializations closer to
4842 (CutIntoMinibuffer): small change to use new matchIT operator
4846 (InsertInset): ditto
4849 (InsetIterator): ditto
4850 (Erase): small change to use new matchFT operator
4852 (GetFontSettings): ditto
4853 (HighestFontInRange): ditto
4856 * src/lyxparagraph.h: some chars changed to value_type
4857 (matchIT): because of some stronger checking (perhaps too strong)
4858 in SGI STL, the two operator() unified to one.
4861 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4863 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4864 the last inset read added
4865 (parseSingleLyXformat2Token): some more (future) compability code added
4866 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4867 (parseSingleLyXformat2Token): set last_inset_read
4868 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4869 (parseSingleLyXformat2Token): don't double intializw string next_token
4871 * src/TextCache.C (text_fits::operator()): add const's to the signature
4872 (has_buffer::operator()): ditto
4874 * src/Floating.h: add some comments on the class
4876 * src/FloatList.[Ch] (typeExist): new method
4879 * src/BackStack.h: added default constructor, wanted by Gcc.
4881 2000-07-14 Juergen Vigna <jug@sad.it>
4883 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4885 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4887 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4888 do a redraw when the window is resized!
4889 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4891 * src/insets/insettext.C (resizeLyXText): added function to correctly
4892 being able to resize the LyXWindow.
4894 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4896 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4898 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4899 crashes when closing dialog to a deleted inset.
4901 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4902 method! Now similar to other insets.
4904 2000-07-13 Juergen Vigna <jug@sad.it>
4906 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4908 * lib/examples/Literate.lyx: small patch!
4910 * src/insets/insetbib.C (Read): added this function because of wrong
4911 Write (without [begin|end]_inset).
4913 2000-07-11 Juergen Vigna <jug@sad.it>
4915 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4916 as the insertInset could not be good!
4918 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4919 the bool param should not be last.
4921 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4923 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4924 did submit that to Karl).
4926 * configure.in: use -isystem instead of -I for X headers. This
4927 fixes a problem on solaris with a recent gcc;
4928 put the front-end code after the X detection code;
4929 configure in sigc++ before lib/
4931 * src/lyx_main.C (commandLineHelp): remove -display from command
4934 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4936 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4937 Also put in Makefile rules for building the ``listerrors''
4938 program for parsing errors from literate programs written in LyX.
4940 * lib/build-listerrors: Added small shell script as part of compile
4941 process. This builds a working ``listerrors'' binary if noweb is
4942 installed and either 1) the VNC X server is installed on the machine,
4943 or 2) the user is compiling from within a GUI. The existence of a GUI
4944 is necessary to use the ``lyx --export'' feature for now. This
4945 hack can be removed once ``lyx --export'' no longer requires a GUI to
4948 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4950 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4951 now passed back correctly from gcc and placed "under" error
4952 buttons in a Literate LyX source.
4954 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4956 * src/text.C (GetColumnNearX): Better behavior when a RTL
4957 paragraph is ended by LTR text.
4959 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4962 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4964 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4965 true when clipboard is empty.
4967 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4969 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4970 row of the paragraph.
4971 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4972 to prevent calculation of bidi tables
4974 2000-07-07 Juergen Vigna <jug@sad.it>
4976 * src/screen.C (ToggleSelection): added y_offset and x_offset
4979 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4982 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4984 * src/insets/insettext.C: fixed Layout-Display!
4986 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4988 * configure.in: add check for strings.h header.
4990 * src/spellchecker.C: include <strings.h> in order to have a
4991 definition for bzero().
4993 2000-07-07 Juergen Vigna <jug@sad.it>
4995 * src/insets/insettext.C (draw): set the status of the bv->text to
4996 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4998 * src/screen.C (DrawOneRow):
4999 (DrawFromTo): redraw the actual row if something has changed in it
5002 * src/text.C (draw): call an update of the toplevel-inset if something
5003 has changed inside while drawing.
5005 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5007 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5009 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5010 processing inside class.
5012 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5013 processing inside class.
5015 * src/insets/insetindex.h new struct Holder, consistent with other
5018 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5019 citation dialog from main code and placed it in src/frontends/xforms.
5020 Dialog launched through signals instead of callbacks
5022 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5024 * lyx.man: update the options description.
5026 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5028 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5029 handle neg values, set min width to 590, add doc about -display
5031 2000-07-05 Juergen Vigna <jug@sad.it>
5033 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5034 calls to BufferView *.
5036 * src/insets/insettext.C (checkAndActivateInset): small fix non
5037 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5039 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5040 their \end_inset token!
5042 2000-07-04 edscott <edscott@imp.mx>
5044 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5045 lib/lyxrc.example: added option \wheel_jump
5047 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5049 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5050 remove support for -width,-height,-xpos and -ypos.
5052 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5054 * src/encoding.[Ch]: New files.
5056 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5057 (text): Call to the underline() method only when needed.
5059 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5061 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5062 encoding(s) for the document.
5064 * src/bufferparams.C (BufferParams): Changed default value of
5067 * src/language.C (newLang): Removed.
5068 (items[]): Added encoding information for all defined languages.
5070 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5071 encoding choice button.
5073 * src/lyxrc.h (font_norm_type): New member variable.
5074 (set_font_norm_type): New method.
5076 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5077 paragraphs with different encodings.
5079 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5080 (TransformChar): Changed to work correctly with Arabic points.
5081 (draw): Added support for drawing Arabic points.
5082 (draw): Removed code for drawing underbars (this is done by
5085 * src/support/textutils.h (IsPrintableNonspace): New function.
5087 * src/BufferView_pimpl.h: Added "using SigC::Object".
5088 * src/LyXView.h: ditto.
5090 * src/insets/insetinclude.h (include_label): Changed to mutable.
5092 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5094 * src/mathed/math_iter.h: remove empty destructor
5096 * src/mathed/math_cursor.h: remove empty destructor
5098 * src/insets/lyxinset.h: add THEOREM_CODE
5100 * src/insets/insettheorem.[Ch]: new files
5102 * src/insets/insetminipage.C: (InsertInset): remove
5104 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5106 (InsertInset): remove
5108 * src/insets/insetlist.C: (InsertList): remove
5110 * src/insets/insetfootlike.[Ch]: new files
5112 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5115 (InsertInset): ditto
5117 * src/insets/insetert.C: remove include Painter.h, reindent
5118 (InsertInset): move to header
5120 * src/insets/insetcollapsable.h: remove explicit from default
5121 contructor, remove empty destructor, add InsertInset
5123 * src/insets/insetcollapsable.C (InsertInset): new func
5125 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5127 * src/vspace.h: add explicit to constructor
5129 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5130 \textcompwordmark, please test this.
5132 * src/lyxrc.C: set ascii_linelen to 65 by default
5134 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5136 * src/commandtags.h: add LFUN_INSET_THEOREM
5138 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5139 (makeLinuxDocFile): remove _some_ of the nice logic
5140 (makeDocBookFile): ditto
5142 * src/Painter.[Ch]: (~Painter): removed
5144 * src/LyXAction.C (init): entry for insettheorem added
5146 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5148 (deplog): code to detect files generated by LaTeX, needs testing
5151 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5153 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5155 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5157 * src/LaTeX.C (deplog): Add a check for files that are going to be
5158 created by the first latex run, part of the project to remove the
5161 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5162 contents to the extension list.
5164 2000-07-04 Juergen Vigna <jug@sad.it>
5166 * src/text.C (NextBreakPoint): added support for needFullRow()
5168 * src/insets/lyxinset.h: added needFullRow()
5170 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5173 * src/insets/insettext.C: lots of changes for update!
5175 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5177 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5179 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5181 * src/insets/insetinclude.C (InsetInclude): fixed
5182 initialization of include_label.
5183 (unique_id): now returns a string.
5185 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5187 * src/LaTeXFeatures.h: new member IncludedFiles, for
5188 a map of key, included file name.
5190 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5191 with the included files for inclusion in SGML preamble,
5192 i. e., linuxdoc and docbook.
5195 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5196 nice (is the generated linuxdoc code to be exported?), that
5197 allows to remove column, and only_body that will be true for
5198 slave documents. Insets are allowed inside SGML font type.
5199 New handling of the SGML preamble for included files.
5200 (makeDocBookFile): the same for docbook.
5202 * src/insets/insetinclude.h:
5203 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5205 (DocBook): new export methods.
5207 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5208 and makeDocBookFile.
5210 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5211 formats to export with command line argument -x.
5213 2000-06-29 Juergen Vigna <jug@sad.it>
5215 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5216 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5218 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5219 region could already been cleared by an inset!
5221 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5223 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5226 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5228 (cursorToggle): remove special handling of lyx focus.
5230 2000-06-28 Juergen Vigna <jug@sad.it>
5232 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5235 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5237 * src/insets/insetindex.C (Edit): add a callback when popup is
5240 * src/insets/insettext.C (LocalDispatch):
5241 * src/insets/insetmarginal.h:
5242 * src/insets/insetlist.h:
5243 * src/insets/insetfoot.h:
5244 * src/insets/insetfloat.h:
5245 * src/insets/insetert.h: add a missing std:: qualifier.
5247 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5249 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5252 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5254 * src/insets/insettext.C (Read): remove tmptok unused variable
5255 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5256 (InsertInset): change for new InsetInset code
5258 * src/insets/insettext.h: add TEXT inline method
5260 * src/insets/insettext.C: remove TEXT macro
5262 * src/insets/insetmarginal.C (Write): new method
5263 (Latex): change output slightly
5265 * src/insets/insetfoot.C (Write): new method
5266 (Latex): change output slightly (don't use endl when no need)
5268 * src/insets/insetert.C (Write): new method
5270 * src/insets/insetcollapsable.h: make button_length, button_top_y
5271 and button_bottm_y protected.
5273 * src/insets/insetcollapsable.C (Write): simplify code by using
5274 tostr. Also do not output the float name, the children class
5275 should to that to get control over own arguments
5277 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5278 src/insets/insetminipage.[Ch]:
5281 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5283 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5285 * src/Makefile.am (lyx_SOURCES): add the new files
5287 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5288 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5289 * src/commandtags.h: ditto
5291 * src/LaTeXFeatures.h: add a std::set of used floattypes
5293 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5295 * src/FloatList.[Ch] src/Floating.h: new files
5297 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5299 * src/lyx_cb.C (TableApplyCB): ditto
5301 * src/text2.C: ditto
5302 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5303 (parseSingleLyXformat2Token): ditto + add code for
5304 backwards compability for old float styles + add code for new insets
5306 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5308 (InsertInset(size_type, Inset *, LyXFont)): new method
5309 (InsetChar(size_type, char)): changed to use the other InsetChar
5310 with a LyXFont(ALL_INHERIT).
5311 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5312 insert the META_INSET.
5314 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5316 * sigc++/thread.h (Threads): from here
5318 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5319 definition out of line
5320 * sigc++/scope.h: from here
5322 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5324 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5325 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5327 * Makefile.am (bindist): new target.
5329 * INSTALL: add instructions for doing a binary distribution.
5331 * development/tools/README.bin.example: update a bit.
5333 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5336 * lib/lyxrc.example: new lyxrc tag \set_color.
5338 * src/lyxfunc.C (Dispatch):
5339 * src/commandtags.h:
5340 * src/LyXAction.C: new lyxfunc "set-color".
5342 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5343 and an x11name given as strings.
5345 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5346 cache when a color is changed.
5348 2000-06-26 Juergen Vigna <jug@sad.it>
5350 * src/lyxrow.C (width): added this functions and variable.
5352 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5355 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5357 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5359 * images/undo_bw.xpm: new icon.
5360 * images/redo_bw.xpm: ditto.
5362 * configure.in (INSTALL_SCRIPT): change value to
5363 ${INSTALL} to avoid failures of install-script target.
5364 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5366 * src/BufferView.h: add a magic "friend" declaration to please
5369 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5371 * forms/cite.fd: modified to allow resizing without messing
5374 * src/insetcite.C: Uses code from cite.fd almost without
5376 User can now resize dialog in the x-direction.
5377 Resizing the dialog in the y-direction is prevented, as the
5378 code does this intelligently already.
5380 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5382 * INSTALL: remove obsolete entry in "problems" section.
5384 * lib/examples/sl_*.lyx: update of the slovenian examples.
5386 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5388 2000-06-23 Juergen Vigna <jug@sad.it>
5390 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5392 * src/buffer.C (resize): delete the LyXText of textinsets.
5394 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5396 * src/insets/lyxinset.h: added another parameter 'cleared' to
5397 the draw() function.
5399 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5400 unlocking inset in inset.
5402 2000-06-22 Juergen Vigna <jug@sad.it>
5404 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5405 of insets and moved first to LyXText.
5407 * src/mathed/formulamacro.[Ch]:
5408 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5410 2000-06-21 Juergen Vigna <jug@sad.it>
5412 * src/text.C (GetVisibleRow): look if I should clear the area or not
5413 using Inset::doClearArea() function.
5415 * src/insets/lyxinset.h: added doClearArea() function and
5416 modified draw(Painter &, ...) to draw(BufferView *, ...)
5418 * src/text2.C (UpdateInset): return bool insted of int
5420 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5422 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5423 combox in the character popup
5425 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5426 BufferParams const & params
5428 2000-06-20 Juergen Vigna <jug@sad.it>
5430 * src/insets/insettext.C (SetParagraphData): set insetowner on
5433 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5435 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5436 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5438 (form_main_): remove
5440 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5441 (create_form_form_main): remove FD_form_main stuff, connect to
5442 autosave_timeout signal
5444 * src/LyXView.[Ch] (getMainForm): remove
5445 (UpdateTimerCB): remove
5446 * src/BufferView_pimpl.h: inherit from SigC::Object
5448 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5449 signal instead of callback
5451 * src/BufferView.[Ch] (cursorToggleCB): remove
5453 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5455 * src/BufferView_pimpl.C: changes because of the one below
5457 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5458 instead of storing a pointer to a LyXText.
5460 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5462 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5464 * src/lyxparagraph.h
5466 * src/paragraph.C: Changed fontlist to a sorted vector.
5468 2000-06-19 Juergen Vigna <jug@sad.it>
5470 * src/BufferView.h: added screen() function.
5472 * src/insets/insettext.C (LocalDispatch): some selection code
5475 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5477 * src/insets/insettext.C (SetParagraphData):
5479 (InsetText): fixes for multiple paragraphs.
5481 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5483 * development/lyx.spec.in: Call configure with ``--without-warnings''
5484 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5485 This should be fine, however, since we generally don't want to be
5486 verbose when making an RPM.
5488 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5490 * lib/scripts/fig2pstex.py: New file
5492 2000-06-16 Juergen Vigna <jug@sad.it>
5494 * src/insets/insettabular.C (UpdateLocal):
5495 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5496 (LocalDispatch): Changed all functions to use LyXText.
5498 2000-06-15 Juergen Vigna <jug@sad.it>
5500 * src/text.C (SetHeightOfRow): call inset::update before requesting
5503 * src/insets/insettext.C (update):
5504 * src/insets/insettabular.C (update): added implementation
5506 * src/insets/lyxinset.h: added update function
5508 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5510 * src/text.C (SelectNextWord): protect against null pointers with
5511 old-style string streams. (fix from Paul Theo Gonciari
5514 * src/cite.[Ch]: remove erroneous files.
5516 * lib/configure.m4: update the list of created directories.
5518 * src/lyxrow.C: include <config.h>
5519 * src/lyxcursor.C: ditto.
5521 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5523 * lib/examples/decimal.lyx: new example file from Mike.
5525 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5526 to find template definitions (from Dekel)
5528 * src/frontends/.cvsignore: add a few things.
5530 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5532 * src/Timeout.C (TimeOut): remove default argument.
5534 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5537 * src/insets/ExternalTemplate.C: add a "using" directive.
5539 * src/lyx_main.h: remove the act_ struct, which seems unused
5542 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5544 * LyX Developers Meeting: All files changed, due to random C++ (by
5545 coincidence) code generator script.
5547 - external inset (cool!)
5548 - initial online editing of preferences
5549 - insettabular breaks insettext(s contents)
5551 - some DocBook fixes
5552 - example files update
5553 - other cool stuff, create a diff and look for yourself.
5555 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5557 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5558 -1 this is a non-line-breaking textinset.
5560 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5561 if there is no width set.
5563 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5565 * Lots of files: Merged the dialogbase branch.
5567 2000-06-09 Allan Rae <rae@lyx.org>
5569 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5570 and the Dispatch methods that used it.
5572 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5573 access to functions formerly kept in Dispatch.
5575 2000-05-19 Allan Rae <rae@lyx.org>
5577 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5578 made to_page and count_copies integers again. from_page remains a
5579 string however because I want to allow entry of a print range like
5580 "1,4,22-25" using this field.
5582 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5583 and printer-params-get. These aren't useful from the minibuffer but
5584 could be used by a script/LyXServer app provided it passes a suitable
5585 auto_mem_buffer. I guess I should take a look at how the LyXServer
5586 works and make it support xtl buffers.
5588 * sigc++/: updated to libsigc++-1.0.1
5590 * src/xtl/: updated to xtl-1.3.pl.11
5592 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5593 those changes done to the files in src/ are actually recreated when
5594 they get regenerated. Please don't ever accept a patch that changes a
5595 dialog unless that patch includes the changes to the corresponding *.fd
5598 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5599 stringOnlyContains, renamed it and generalised it.
5601 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5602 branch. Removed the remaining old form_print code.
5604 2000-04-26 Allan Rae <rae@lyx.org>
5606 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5607 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5609 2000-04-25 Allan Rae <rae@lyx.org>
5611 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5612 against a base of xtl-1.3.pl.4
5614 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5615 filter the Id: entries so they still show the xtl version number
5618 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5619 into the src/xtl code. Patch still pending with José (XTL)
5621 2000-04-24 Allan Rae <rae@lyx.org>
5623 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5624 both more generic and much safer. Use the new template functions.
5625 * src/buffer.[Ch] (Dispatch): ditto.
5627 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5628 and mem buffer more intelligently. Also a little general cleanup.
5631 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5632 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5633 * src/xtl/Makefile.am: ditto.
5634 * src/xtl/.cvsignore: ditto.
5635 * src/Makefile.am: ditto.
5637 * src/PrinterParams.h: Removed the macros member functions. Added a
5638 testInvariant member function. A bit of tidying up and commenting.
5639 Included Angus's idea for fixing operation with egcs-1.1.2.
5641 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5642 cool expansion of XTL's mem_buffer to support automatic memory
5643 management within the buffer itself. Removed the various macros and
5644 replaced them with template functions that use either auto_mem_buffer
5645 or mem_buffer depending on a #define. The mem_buffer support will
5646 disappear as soon as the auto_mem_buffer is confirmed to be good on
5647 other platforms/compilers. That is, it's there so you've got something
5650 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5651 effectively forked XTL. However I expect José will include my code
5652 into the next major release. Also fixed a memory leak.
5653 * src/xtl/text.h: ditto.
5654 * src/xtl/xdr.h: ditto.
5655 * src/xtl/giop.h: ditto.
5657 2000-04-16 Allan Rae <rae@lyx.org>
5659 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5660 by autogen.sh and removed by maintainer-clean anyway.
5661 * .cvsignore, sigc++/.cvsignore: Support the above.
5663 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5665 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5667 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5668 macros, renamed static callback-target member functions to suit new
5669 scheme and made them public.
5670 * src/frontends/xforms/forms/form_print.fd: ditto.
5671 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5673 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5676 * src/xtl/: New directory containing a minimal distribution of XTL.
5677 This is XTL-1.3.pl.4.
5679 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5681 2000-04-15 Allan Rae <rae@lyx.org>
5683 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5685 * sigc++/: Updated to libsigc++-1.0.0
5687 2000-04-14 Allan Rae <rae@lyx.org>
5689 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5690 use the generic ones in future. I'll modify my conversion script.
5692 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5694 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5695 (CloseAllBufferRelatedDialogs): Renamed.
5696 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5698 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5699 of the generic ones. These are the same ones my conversion script
5702 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5703 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5704 * src/buffer.C (Dispatch): ditto
5706 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5707 functions for updating and hiding buffer dependent dialogs.
5708 * src/BufferView.C (buffer): ditto
5709 * src/buffer.C (setReadonly): ditto
5710 * src/lyxfunc.C (CloseBuffer): ditto
5712 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5713 Dialogs.h, and hence all the SigC stuff, into every file that includes
5714 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5716 * src/BufferView2.C: reduce the number of headers included by buffer.h
5718 2000-04-11 Allan Rae <rae@lyx.org>
5720 * src/frontends/xforms/xform_macros.h: A small collection of macros
5721 for building C callbacks.
5723 * src/frontends/xforms/Makefile.am: Added above file.
5725 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5726 scheme again. This time it should work for JMarc. If this is
5727 successful I'll revise my conversion script to automate some of this.
5728 The static member functions in the class also have to be public for
5729 this scheme will work. If the scheme works (it's almost identical to
5730 the way BufferView::cursorToggleCB is handled so it should work) then
5731 FormCopyright and FormPrint will be ready for inclusion into the main
5732 trunk immediately after 1.1.5 is released -- provided we're prepared
5733 for complaints about lame compilers not handling XTL.
5735 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5737 2000-04-07 Allan Rae <rae@lyx.org>
5739 * config/lyxinclude.m4: A bit more tidying up (Angus)
5741 * src/LString.h: JMarc's <string> header fix
5743 * src/PrinterParams.h: Used string for most data to remove some
5744 ugly code in the Print dialog and avoid even uglier code when
5745 appending the ints to a string for output.
5747 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5748 and moved "default:" back to the end of switch statement. Cleaned
5749 up the printing so it uses the right function calls and so the
5750 "print to file" option actually puts the file in the right directory.
5752 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5754 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5755 and Ok+Apply button control into a separate method: input (Angus).
5756 (input) Cleaned it up and improved it to be very thorough now.
5757 (All CB) static_cast used instead of C style cast (Angus). This will
5758 probably change again once we've worked out how to keep gcc-2.8.1 happy
5759 with real C callbacks.
5760 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5761 ignore some of the bool settings and has random numbers instead. Needs
5762 some more investigation. Added other input length checks and checking
5763 of file and printer names.
5765 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5766 would link (Angus). Seems the old code doesn't compile with the pragma
5767 statement either. Separated callback entries from internal methods.
5769 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5771 2000-03-17 Allan Rae <rae@lyx.org>
5773 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5774 need it? Maybe it could go in Dialogs instead? I could make it a
5775 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5776 values to get the bool return value.
5777 (Dispatch): New overloaded method for xtl support.
5779 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5780 extern "C" callback instead of static member functions. Hopefully,
5781 JMarc will be able to compile this. I haven't changed
5782 forms/form_copyright.fd yet. Breaking one of my own rules already.
5784 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5785 because they aren't useful from the minibuffer. Maybe a LyXServer
5786 might want a help message though?
5788 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5790 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5791 xtl which needs both rtti and exceptions.
5793 * src/support/Makefile.am:
5794 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5796 * src/frontends/xforms/input_validators.[ch]: input filters and
5797 validators. These conrol what keys are valid in input boxes.
5798 Use them and write some more. Much better idea than waiting till
5799 after the user has pressed Ok to say that the input fields don't make
5802 * src/frontends/xforms/Makefile.am:
5803 * src/frontends/xforms/forms/form_print.fd:
5804 * src/frontends/xforms/forms/makefile:
5805 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5806 new scheme. Still have to make sure I haven't missed anything from
5807 the current implementation.
5809 * src/Makefile.am, src/PrinterParams.h: New data store.
5811 * other files: Added a couple of copyright notices.
5813 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5815 * src/insets/insetbib.h: move Holder struct in public space.
5817 * src/frontends/include/DialogBase.h: use SigC:: only when
5818 SIGC_CXX_NAMESPACES is defined.
5819 * src/frontends/include/Dialogs.h: ditto.
5821 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5823 * src/frontends/xforms/FormCopyright.[Ch]: do not
5824 mention SigC:: explicitely.
5826 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5828 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5829 deals with testing KDE in main configure.in
5830 * configure.in: ditto.
5832 2000-02-22 Allan Rae <rae@lyx.org>
5834 * Lots of files: Merged from HEAD
5836 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5837 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5839 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5841 * sigc++/: new minidist.
5843 2000-02-14 Allan Rae <rae@lyx.org>
5845 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5847 2000-02-08 Juergen Vigna <jug@sad.it>
5849 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5850 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5852 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5853 for this port and so it is much easier for other people to port
5854 dialogs in a common development environment.
5856 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5857 the QT/KDE implementation.
5859 * src/frontends/kde/Dialogs.C:
5860 * src/frontends/kde/FormCopyright.C:
5861 * src/frontends/kde/FormCopyright.h:
5862 * src/frontends/kde/Makefile.am:
5863 * src/frontends/kde/formcopyrightdialog.C:
5864 * src/frontends/kde/formcopyrightdialog.h:
5865 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5866 for the kde support of the Copyright-Dialog.
5868 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5869 subdir-substitution instead of hardcoded 'xforms' as we now have also
5872 * src/frontends/include/DialogBase.h (Object): just commented the
5873 label after #endif (nasty warning and I don't like warnings ;)
5875 * src/main.C (main): added KApplication initialization if using
5878 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5879 For now only the KDE event-loop is added if frontend==kde.
5881 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5883 * configure.in: added support for the --with-frontend[=value] option
5885 * autogen.sh: added kde.m4 file to list of config-files
5887 * acconfig.h: added define for KDEGUI-support
5889 * config/kde.m4: added configuration functions for KDE-port
5891 * config/lyxinclude.m4: added --with-frontend[=value] option with
5892 support for xforms and KDE.
5894 2000-02-08 Allan Rae <rae@lyx.org>
5896 * all Makefile.am: Fixed up so the make targets dist, distclean,
5897 install and uninstall all work even if builddir != srcdir. Still
5898 have a new sigc++ minidist update to come.
5900 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5902 2000-02-01 Allan Rae <rae@lyx.org>
5904 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5905 Many mods to get builddir != srcdir working.
5907 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5908 for building on NT and so we can do the builddir != srcdir stuff.
5910 2000-01-30 Allan Rae <rae@lyx.org>
5912 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5913 This will stay in "rae" branch. We probably don't really need it in
5914 the main trunk as anyone who wants to help programming it should get
5915 a full library installed also. So they can check both included and
5916 system supplied library compilation.
5918 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5919 Added a 'mini' distribution of libsigc++. If you feel the urge to
5920 change something in these directories - Resist it. If you can't
5921 resist the urge then you should modify the following script and rebuild
5922 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5923 all happen. Still uses a hacked version of libsigc++'s configure.in.
5924 I'm quite happy with the results. I'm not sure the extra work to turn
5925 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5926 worth the trouble and would probably lead to extra maintenance
5928 I haven't tested the following important make targets: install, dist.
5929 Not ready for prime time but very close. Maybe 1.1.5.
5931 * development/tools/makeLyXsigc.sh: A shell script to automatically
5932 generate our mini-dist of libsigc++. It can only be used with a CVS
5933 checkout of libsigc++ not a tarball distribution. It's well commented.
5934 This will end up as part of the libsigc++ distribution so other apps
5935 can easily have an included mini-dist. If someone makes mods to the
5936 sigc++ subpackage without modifying this script to generate those
5937 changes I'll be very upset!
5939 * src/frontends/: Started the gui/system indep structure.
5941 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5942 to access the gui-indep dialogs are in this class. Much improved
5943 design compared to previous revision. Lars, please refrain from
5944 moving this header into src/ like you did with Popups.h last time.
5946 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5948 * src/frontends/xforms/: Started the gui-indep system with a single
5949 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5952 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5953 Here you'll find a very useful makefile and automated fdfix.sh that
5954 makes updating dailogs a no-brainer -- provided you follow the rules
5955 set out in the README. I'm thinking about adding another script to
5956 automatically generate skeleton code for a new dialog given just the
5959 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5960 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5961 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5963 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5965 * src/support/LSubstring.C (operator): simplify
5967 * src/lyxtext.h: removed bparams, use buffer_->params instead
5969 * src/lyxrow.h: make Row a real class, move all variables to
5970 private and use accessors.
5972 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5974 (isRightToLeftPar): ditto
5975 (ChangeLanguage): ditto
5976 (isMultiLingual): ditto
5979 (SimpleTeXOnePar): ditto
5980 (TeXEnvironment): ditto
5981 (GetEndLabel): ditto
5983 (SetOnlyLayout): ditto
5984 (BreakParagraph): ditto
5985 (BreakParagraphConservative): ditto
5986 (GetFontSettings): ditto
5988 (CopyIntoMinibuffer): ditto
5989 (CutIntoMinibuffer): ditto
5990 (PasteParagraph): ditto
5991 (SetPExtraType): ditto
5992 (UnsetPExtraType): ditto
5993 (DocBookContTableRows): ditto
5994 (SimpleDocBookOneTablePar): ditto
5996 (TeXFootnote): ditto
5997 (SimpleTeXOneTablePar): ditto
5998 (TeXContTableRows): ditto
5999 (SimpleTeXSpecialChars): ditto
6002 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6003 to private and use accessors.
6005 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6006 this, we did not use it anymore and has not been for ages. Just a
6007 waste of cpu cycles.
6009 * src/language.h: make Language a real class, move all variables
6010 to private and use accessors.
6012 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6013 (create_view): remove
6014 (update): some changes for new timer
6015 (cursorToggle): use new timer
6016 (beforeChange): change for new timer
6018 * src/BufferView.h (cursorToggleCB): removed last paramter because
6021 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6022 (cursorToggleCB): change because of new timer code
6024 * lib/CREDITS: updated own mailaddress
6026 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6028 * src/support/filetools.C (PutEnv): fix the code in case neither
6029 putenv() nor setenv() have been found.
6031 * INSTALL: mention the install-strip Makefile target.
6033 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6034 read-only documents.
6036 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6038 * lib/reLyX/configure.in (VERSION): avoid using a previously
6039 generated reLyX wrapper to find out $prefix.
6041 * lib/examples/eu_adibide_lyx-atua.lyx:
6042 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6043 translation of the Tutorial (Dooteo)
6045 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6047 * forms/cite.fd: new citation dialog
6049 * src/insetcite.[Ch]: the new citation dialog is moved into
6052 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6055 * src/insets/insetcommand.h: data members made private.
6057 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6059 * LyX 1.1.5 released
6061 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6063 * src/version.h (LYX_RELEASE): to 1.1.5
6065 * src/spellchecker.C (RunSpellChecker): return false if the
6066 spellchecker dies upon creation.
6068 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6070 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6071 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6075 * lib/CREDITS: update entry for Martin Vermeer.
6077 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6079 * src/text.C (draw): Draw foreign language bars at the bottom of
6080 the row instead of at the baseline.
6082 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6084 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6086 * lib/bind/de_menus.bind: updated
6088 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6090 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6092 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6094 * src/menus.C (Limit_string_length): New function
6095 (ShowTocMenu): Limit the number of items/length of items in the
6098 * src/paragraph.C (String): Correct result for a paragraph inside
6101 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6103 * src/bufferlist.C (close): test of buf->getuser() == NULL
6105 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6107 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6108 Do not call to SetCursor when the paragraph is a closed footnote!
6110 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6112 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6115 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6117 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6120 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6121 reference popup, that activates the reference-back action
6123 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6125 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6126 the menus. Also fixed a bug.
6128 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6129 the math panels when switching buffers (unless new buffer is readonly).
6131 * src/BufferView.C (NoSavedPositions)
6132 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6134 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6136 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6137 less of dvi dirty or not.
6139 * src/trans_mgr.[Ch] (insert): change first parameter to string
6142 * src/chset.[Ch] (encodeString): add const to first parameter
6144 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6146 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6150 * src/LaTeX.C (deplog): better searching for dependency files in
6151 the latex log. Uses now regexps.
6153 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6154 instead of the box hack or \hfill.
6156 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6158 * src/lyxfunc.C (doImportHelper): do not create the file before
6159 doing the actual import.
6160 (doImportASCIIasLines): create a new file before doing the insert.
6161 (doImportASCIIasParagraphs): ditto.
6163 * lib/lyxrc.example: remove mention of non-existing commands
6165 * lyx.man: remove mention of color-related switches.
6167 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6169 * src/lyx_gui.C: remove all the color-related ressources, which
6170 are not used anymore.
6172 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6175 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6177 * src/lyxrc.C (read): Add a missing break in the switch
6179 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6181 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6183 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6186 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6188 * src/text.C (draw): draw bars under foreign language words.
6190 * src/LColor.[Ch]: add LColor::language
6192 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6194 * src/lyxcursor.h (boundary): New member variable
6196 * src/text.C (IsBoundary): New methods
6198 * src/text.C: Use the above for currect cursor movement when there
6199 is both RTL & LTR text.
6201 * src/text2.C: ditto
6203 * src/bufferview_funcs.C (ToggleAndShow): ditto
6205 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6207 * src/text.C (DeleteLineForward): set selection to true to avoid
6208 that DeleteEmptyParagraphMechanism does some magic. This is how it
6209 is done in all other functions, and seems reasonable.
6210 (DeleteWordForward): do not jump over non-word stuff, since
6211 CursorRightOneWord() already does it.
6213 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6214 DeleteWordBackward, since they seem safe to me (since selection is
6215 set to "true") DeleteEmptyParagraphMechanism does nothing.
6217 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6219 * src/lyx_main.C (easyParse): simplify the code by factoring the
6220 part that removes parameters from the command line.
6221 (LyX): check wether wrong command line options have been given.
6223 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6225 * src/lyx_main.C : add support for specifying user LyX
6226 directory via command line option -userdir.
6228 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6230 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6231 the number of items per popup.
6232 (Add_to_refs_menu): Ditto.
6234 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6236 * src/lyxparagraph.h: renamed ClearParagraph() to
6237 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6238 textclass as parameter, and do nothing if free_spacing is
6239 true. This fixes part of the line-delete-forward problems.
6241 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6242 (pasteSelection): ditto.
6243 (SwitchLayoutsBetweenClasses): more translatable strings.
6245 * src/text2.C (CutSelection): use StripLeadingSpaces.
6246 (PasteSelection): ditto.
6247 (DeleteEmptyParagraphMechanism): ditto.
6249 2000-05-26 Juergen Vigna <jug@sad.it>
6251 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6252 is not needed in tabular insets.
6254 * src/insets/insettabular.C (TabularFeatures): added missing features.
6256 * src/tabular.C (DeleteColumn):
6258 (AppendRow): implemented this functions
6259 (cellsturct::operator=): clone the inset too;
6261 2000-05-23 Juergen Vigna <jug@sad.it>
6263 * src/insets/insettabular.C (LocalDispatch): better selection support
6264 when having multicolumn-cells.
6266 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6268 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6270 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6272 * src/ColorHandler.C (getGCForeground): put more test into _()
6274 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6277 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6280 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6282 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6283 there are no labels, or when buffer is readonly.
6285 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6286 there are no labels, buffer is SGML, or when buffer is readonly.
6288 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6290 * src/LColor.C (LColor): change a couple of grey40 to grey60
6291 (LColor): rewore initalization to make compiles go some magnitude
6293 (getGUIName): don't use gettext until we need the string.
6295 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6297 * src/Bullet.[Ch]: Fixed a small bug.
6299 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6301 * src/paragraph.C (String): Several fixes/improvements
6303 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6305 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6307 * src/paragraph.C (String): give more correct output.
6309 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6311 * src/lyxfont.C (stateText) Do not output the language if it is
6312 eqaul to the language of the document.
6314 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6315 between two paragraphs with the same language.
6317 * src/paragraph.C (getParLanguage) Return a correct answer for an
6318 empty dummy paragraph.
6320 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6323 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6326 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6327 the menus/popup, if requested fonts are unavailable.
6329 2000-05-22 Juergen Vigna <jug@sad.it>
6331 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6332 movement support (Up/Down/Tab/Shift-Tab).
6333 (LocalDispatch): added also preliminari cursor-selection.
6335 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6337 * src/paragraph.C (PasteParagraph): Hopefully now right!
6339 2000-05-22 Garst R. Reese <reese@isn.net>
6341 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6342 of list, change all references to Environment to Command
6343 * tex/hollywood.cls : rewrite environments as commands, add
6344 \uppercase to interiorshot and exteriorshot to force uppecase.
6345 * tex/broadway.cls : rewrite environments as commands. Tweak
6348 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6350 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6351 size of items: use a constant intead of the hardcoded 40, and more
6352 importantly do not remove the %m and %x tags added at the end.
6353 (Add_to_refs_menu): use vector::size_type instead of
6354 unsigned int as basic types for the variables. _Please_ do not
6355 assume that size_t is equal to unsigned int. On an alpha, this is
6356 unsigned long, which is _not_ the same.
6358 * src/language.C (initL): remove language "hungarian", since it
6359 seems that "magyar" is better.
6361 2000-05-22 Juergen Vigna <jug@sad.it>
6363 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6365 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6368 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6369 next was deleted but not set to 0.
6371 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6373 * src/language.C (initL): change the initialization of languages
6374 so that compiles goes _fast_.
6376 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6379 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6381 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6385 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6387 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6389 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6393 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6396 * src/insets/insetlo*.[Ch]: Made editable
6398 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6400 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6401 the current selection.
6403 * src/BufferView_pimpl.C (stuffClipboard): new method
6405 * src/BufferView.C (stuffClipboard): new method
6407 * src/paragraph.C (String): new method
6409 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6410 LColor::ignore when lyxname is not found.
6412 * src/BufferView.C (pasteSelection): new method
6414 * src/BufferView_pimpl.C (pasteSelection): new method
6416 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6418 * src/WorkArea.C (request_clipboard_cb): new static function
6419 (getClipboard): new method
6420 (putClipboard): new method
6422 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6424 * LyX 1.1.5pre2 released
6426 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6428 * src/vspace.C (operator=): removed
6429 (operator=): removed
6431 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6433 * src/layout.C (NumberOfClass): manually set the type in make_pair
6434 (NumberOfLayout): ditto
6436 * src/language.C: use the Language constructor for ignore_lang
6438 * src/language.h: add constructors to struct Language
6440 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6442 * src/text2.C (SetCursorIntern): comment out #warning
6444 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6446 * src/mathed/math_iter.h: initialize sx and sw to 0
6448 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6450 * forms/lyx.fd: Redesign of form_ref
6452 * src/LaTeXFeatures.[Ch]
6456 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6459 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6460 and Buffer::inset_iterator.
6462 * src/menus.C: Added new menus: TOC and Refs.
6464 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6466 * src/buffer.C (getTocList): New method.
6468 * src/BufferView2.C (ChangeRefs): New method.
6470 * src/buffer.C (getLabelList): New method. It replaces the old
6471 getReferenceList. The return type is vector<string> instead of
6474 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6475 the old getLabel() and GetNumberOfLabels() methods.
6476 * src/insets/insetlabel.C (getLabelList): ditto
6477 * src/mathed/formula.C (getLabelList): ditto
6479 * src/paragraph.C (String): New method.
6481 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6482 Uses the new getTocList() method.
6483 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6484 which automatically updates the contents of the browser.
6485 (RefUpdateCB): Use the new getLabelList method.
6487 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6489 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6491 * src/spellchecker.C: Added using std::reverse;
6493 2000-05-19 Juergen Vigna <jug@sad.it>
6495 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6497 * src/insets/insettext.C (computeTextRows): small fix for display of
6498 1 character after a newline.
6500 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6503 2000-05-18 Juergen Vigna <jug@sad.it>
6505 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6506 when changing width of column.
6508 * src/tabular.C (set_row_column_number_info): setting of
6509 autobreak rows if necessary.
6511 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6513 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6515 * src/vc-backend.*: renamed stat() to status() and vcstat to
6516 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6517 compilation broke. The new name seems more relevant, anyway.
6519 2000-05-17 Juergen Vigna <jug@sad.it>
6521 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6522 which was wrong if the removing caused removing of rows!
6524 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6525 (pushToken): new function.
6527 * src/text2.C (CutSelection): fix problem discovered with purify
6529 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6531 * src/debug.C (showTags): enlarge the first column, now that we
6532 have 6-digits debug codes.
6534 * lib/layouts/hollywood.layout:
6535 * lib/tex/hollywood.cls:
6536 * lib/tex/brodway.cls:
6537 * lib/layouts/brodway.layout: more commands and fewer
6538 environments. Preambles moved in the .cls files. Broadway now has
6539 more options on scene numbering and less whitespace (from Garst)
6541 * src/insets/insetbib.C (getKeys): make sure that we are in the
6542 document directory, in case the bib file is there.
6544 * src/insets/insetbib.C (Latex): revert bogus change.
6546 2000-05-16 Juergen Vigna <jug@sad.it>
6548 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6549 the TabularLayout on cursor move.
6551 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6553 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6556 (draw): fixed cursor position and drawing so that the cursor is
6557 visible when before the tabular-inset.
6559 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6560 when creating from old insettext.
6562 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6564 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6566 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6567 * lib/tex/brodway.cls: ditto
6569 * lib/layouts/brodway.layout: change alignment of parenthical
6572 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6574 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6575 versions 0.88 and 0.89 are supported.
6577 2000-05-15 Juergen Vigna <jug@sad.it>
6579 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6582 * src/insets/insettext.C (computeTextRows): redone completely this
6583 function in a much cleaner way, because of problems when having a
6585 (draw): added a frame border when the inset is locked.
6586 (SetDrawLockedFrame): this sets if we draw the border or not.
6587 (SetFrameColor): this sets the frame color (default=insetframe).
6589 * src/insets/lyxinset.h: added x() and y() functions which return
6590 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6591 function which is needed to see if we have a locking inset of some
6592 type in this inset (needed for now in insettabular).
6594 * src/vspace.C (inPixels): the same function also without a BufferView
6595 parameter as so it is easier to use it in some ocasions.
6597 * src/lyxfunc.C: changed all places where insertInset was used so
6598 that now if it couldn't be inserted it is deleted!
6600 * src/TabularLayout.C:
6601 * src/TableLayout.C: added support for new tabular-inset!
6603 * src/BufferView2.C (insertInset): this now returns a bool if the
6604 inset was really inserted!!!
6606 * src/tabular.C (GetLastCellInRow):
6607 (GetFirstCellInRow): new helper functions.
6608 (Latex): implemented for new tabular class.
6612 (TeXTopHLine): new Latex() helper functions.
6614 2000-05-12 Juergen Vigna <jug@sad.it>
6616 * src/mathed/formulamacro.C (Read):
6617 * src/mathed/formula.C (Read): read also the \end_inset here!
6619 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6621 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6622 crush when saving formulae with unbalanced parenthesis.
6624 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6626 * src/layout.C: Add new keyword "endlabelstring" to layout file
6628 * src/text.C (GetVisibleRow): Draw endlabel string.
6630 * lib/layouts/broadway.layout
6631 * lib/layouts/hollywood.layout: Added endlabel for the
6632 Parenthetical layout.
6634 * lib/layouts/heb-article.layout: Do not use slanted font shape
6635 for Theorem like environments.
6637 * src/buffer.C (makeLaTeXFile): Always add "american" to
6638 the UsedLanguages list if document language is RTL.
6640 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6642 * add addendum to README.OS2 and small patch (from SMiyata)
6644 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6646 * many files: correct the calls to ChangeExtension().
6648 * src/support/filetools.C (ChangeExtension): remove the no_path
6649 argument, which does not belong there. Use OnlyFileName() instead.
6651 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6652 files when LaTeXing a non-nice latex file.
6654 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6655 a chain of "if". Return false when deadkeys are not handled.
6657 * src/lyx_main.C (LyX): adapted the code for default bindings.
6659 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6660 bindings for basic functionality (except deadkeys).
6661 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6663 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6664 several methods: handle override_x_deadkeys.
6666 * src/lyxrc.h: remove the "bindings" map, which did not make much
6667 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6669 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6671 * src/lyxfont.C (stateText): use a saner method to determine
6672 whether the font is "default". Seems to fix the crash with DEC
6675 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6677 2000-05-08 Juergen Vigna <jug@sad.it>
6679 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6680 TabularLayoutMenu with mouse-button-3
6681 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6683 * src/TabularLayout.C: added this file for having a Layout for
6686 2000-05-05 Juergen Vigna <jug@sad.it>
6688 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6689 recalculating inset-widths.
6690 (TabularFeatures): activated this function so that I can change
6691 tabular-features via menu.
6693 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6694 that I can test some functions with the Table menu.
6696 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6698 * src/lyxfont.C (stateText): guard against stupid c++libs.
6700 * src/tabular.C: add using std::vector
6701 some whitespace changes, + removed som autogenerated code.
6703 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6705 2000-05-05 Juergen Vigna <jug@sad.it>
6707 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6708 row, columns and cellstructures.
6710 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6712 * lib/lyxrc.example: remove obsolete entries.
6714 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6715 reading of protected_separator for free_spacing.
6717 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6719 * src/text.C (draw): do not display an exclamation mark in the
6720 margin for margin notes. This is confusing, ugly and
6723 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6724 AMS math' is checked.
6726 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6727 name to see whether including the amsmath package is needed.
6729 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6731 * src/paragraph.C (validate): Compute UsedLanguages correctly
6732 (don't insert the american language if it doesn't appear in the
6735 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6736 The argument of \thanks{} command is considered moving argument
6738 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6741 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6743 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6744 for appendix/minipage/depth. The lines can be now both in the footnote
6745 frame, and outside the frame.
6747 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6750 2000-05-05 Juergen Vigna <jug@sad.it>
6752 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6753 neede only in tabular.[Ch].
6755 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6757 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6759 (Write): write '~' for PROTECTED_SEPARATOR
6761 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6763 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6766 * src/mathed/formula.C (drawStr): rename size to siz.
6768 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6769 possibly fix a bug by not changing the pflags = flags to piflags =
6772 2000-05-05 Juergen Vigna <jug@sad.it>
6774 * src/insets/insetbib.C: moved using directive
6776 * src/ImportNoweb.C: small fix for being able to compile (missing
6779 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6781 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6782 to use clear, since we don't depend on this in the code. Add test
6785 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6787 * (various *.C files): add using std::foo directives to please dec
6790 * replace calls to string::clear() to string::erase() (Angus)
6792 * src/cheaders/cmath: modified to provide std::abs.
6794 2000-05-04 Juergen Vigna <jug@sad.it>
6796 * src/insets/insettext.C: Prepared all for inserting of multiple
6797 paragraphs. Still display stuff to do (alignment and other things),
6798 but I would like to use LyXText to do this when we cleaned out the
6799 table-support stuff.
6801 * src/insets/insettabular.C: Changed lot of stuff and added lots
6802 of functionality still a lot to do.
6804 * src/tabular.C: Various functions changed name and moved to be
6805 const functions. Added new Read and Write functions and changed
6806 lots of things so it works good with tabular-insets (also removed
6807 some stuff which is not needed anymore * hacks *).
6809 * src/lyxcursor.h: added operators == and != which just look if
6810 par and pos are (not) equal.
6812 * src/buffer.C (latexParagraphs): inserted this function to latex
6813 all paragraphs form par to endpar as then I can use this too for
6816 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6817 so that I can call this to from text insets with their own cursor.
6819 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6820 output off all paragraphs (because of the fix below)!
6822 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6823 the very last paragraph (this could be also the last paragraph of an
6826 * src/texrow.h: added rows() call which returns the count-variable.
6828 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6830 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6832 * lib/configure.m4: better autodetection of DocBook tools.
6834 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6836 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6838 * src/lyx_cb.C: add using std::reverse;
6840 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6843 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6844 selected files. Should fix repeated errors from generated files.
6846 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6848 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6850 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6851 the spellchecker popup.
6853 * lib/lyxrc.example: Removed the \number_inset section
6855 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6857 * src/insets/figinset.C (various): Use IsFileReadable() to make
6858 sure that the file actually exist. Relying on ghostscripts errors
6859 is a bad idea since they can lead to X server crashes.
6861 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6863 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6866 * lib/lyxrc.example: smallish typo in description of
6867 \view_dvi_paper_option
6869 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6872 * src/lyxfunc.C: doImportHelper to factor out common code of the
6873 various import methods. New functions doImportASCIIasLines,
6874 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6875 doImportLinuxDoc for the format specific parts.
6878 * buffer.C: Dispatch returns now a bool to indicate success
6881 * lyx_gui.C: Add getLyXView() for member access
6883 * lyx_main.C: Change logic for batch commands: First try
6884 Buffer::Dispatch (possibly without GUI), if that fails, use
6887 * lyx_main.C: Add support for --import command line switch.
6888 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6889 Available Formats: Everything accepted by 'buffer-import <format>'
6891 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6893 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6896 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6897 documents will be reformatted upon reentry.
6899 2000-04-27 Juergen Vigna <jug@sad.it>
6901 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6902 correctly only last pos this was a bug.
6904 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6906 * release of lyx-1.1.5pre1
6908 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6910 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6912 * src/menus.C: revert the change of naming (Figure->Graphic...)
6913 from 2000-04-11. It was incomplete and bad.
6915 * src/LColor.[Ch]: add LColor::depthbar.
6916 * src/text.C (GetVisibleRow): use it.
6918 * README: update the languages list.
6920 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6922 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6925 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6927 * README: remove sections that were just wrong.
6929 * src/text2.C (GetRowNearY): remove currentrow code
6931 * src/text.C (GetRow): remove currentrow code
6933 * src/screen.C (Update): rewritten a bit.
6934 (SmallUpdate): removed func
6936 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6938 (FullRebreak): return bool
6939 (currentrow): remove var
6940 (currentrow_y): ditto
6942 * src/lyxscreen.h (Draw): change arg to unsigned long
6943 (FitCursor): return bool
6944 (FitManualCursor): ditto
6945 (Smallpdate): remove func
6946 (first): change to unsigned long
6947 (DrawOneRow): change second arg to long (from long &)
6948 (screen_refresh_y): remove var
6949 (scree_refresh_row): ditto
6951 * src/lyxrow.h: change baseline to usigned int from unsigned
6952 short, this brings some implicit/unsigned issues out in the open.
6954 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6956 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6957 instead of smallUpdate.
6959 * src/lyxcursor.h: change y to unsigned long
6961 * src/buffer.h: don't call updateScrollbar after fitcursor
6963 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6964 where they are used. Removed "\\direction", this was not present
6965 in 1.1.4 and is already obsolete. Commented out some code that I
6966 believe to never be called.
6967 (runLiterate): don't call updateScrollbar after fitCursor
6969 (buildProgram): ditto
6972 * src/WorkArea.h (workWidth): change return val to unsigned
6975 (redraw): remove the button redraws
6976 (setScrollbarValue): change for scrollbar
6977 (getScrollbarValue): change for scrollbar
6978 (getScrollbarBounds): change for scrollbar
6980 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6981 (C_WorkArea_down_cb): removed func
6982 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6983 (resize): change for scrollbar
6984 (setScrollbar): ditto
6985 (setScrollbarBounds): ditto
6986 (setScrollbarIncrements): ditto
6987 (up_cb): removed func
6988 (down_cb): removed func
6989 (scroll_cb): change for scrollbar
6990 (work_area_handler): ditto
6992 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6993 when FitCursor did something.
6994 (updateScrollbar): some unsigned changes
6995 (downCB): removed func
6996 (scrollUpOnePage): removed func
6997 (scrollDownOnePage): remvoed func
6998 (workAreaMotionNotify): don't call screen->FitCursor but use
6999 fitCursor instead. and bool return val
7000 (workAreaButtonPress): ditto
7001 (workAreaButtonRelease): some unsigned changes
7002 (checkInsetHit): ditto
7003 (workAreaExpose): ditto
7004 (update): parts rewritten, comments about the signed char arg added
7005 (smallUpdate): removed func
7006 (cursorPrevious): call needed updateScrollbar
7009 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7012 * src/BufferView.[Ch] (upCB): removed func
7013 (downCB): removed func
7014 (smallUpdate): removed func
7016 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7018 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7019 currentrow, currentrow_y optimization. This did not help a lot and
7020 if we want to do this kind of optimization we should rather use
7021 cursor.row instead of the currentrow.
7023 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7024 buffer spacing and klyx spacing support.
7026 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7028 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7031 2000-04-26 Juergen Vigna <jug@sad.it>
7033 * src/insets/figinset.C: fixes to Lars sstream changes!
7035 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7037 * A lot of files: Added Ascii(ostream &) methods to all inset
7038 classes. Used when exporting to ASCII.
7040 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7041 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7044 * src/text2.C (ToggleFree): Disabled implicit word selection when
7045 there is a change in the language
7047 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7048 no output was generated for end-of-sentence inset.
7050 * src/insets/lyxinset.h
7053 * src/paragraph.C: Removed the insetnumber code
7055 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7057 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7059 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7060 no_babel and no_epsfig completely from the file.
7061 (parseSingleLyXformat2Token): add handling for per-paragraph
7062 spacing as written by klyx.
7064 * src/insets/figinset.C: applied patch by Andre. Made it work with
7067 2000-04-20 Juergen Vigna <jug@sad.it>
7069 * src/insets/insettext.C (cutSelection):
7070 (copySelection): Fixed with selection from right to left.
7071 (draw): now the rows are not recalculated at every draw.
7072 (computeTextRows): for now reset the inset-owner here (this is
7073 important for an undo or copy where the inset-owner is not set
7076 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7077 motion to the_locking_inset screen->first was forgotten, this was
7078 not important till we got multiline insets.
7080 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7082 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7083 code seems to be alright (it is code changed by Dekel, and the
7084 intent is indeed that all macros should be defined \protect'ed)
7086 * NEWS: a bit of reorganisation of the new user-visible features.
7088 2000-04-19 Juergen Vigna <jug@sad.it>
7090 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7091 position. Set the inset_owner of the used paragraph so that it knows
7092 that it is inside an inset. Fixed cursor handling with mouse and
7093 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7094 and cleanups to make TextInsets work better.
7096 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7097 Changed parameters of various functions and added LockInsetInInset().
7099 * src/insets/insettext.C:
7101 * src/insets/insetcollapsable.h:
7102 * src/insets/insetcollapsable.C:
7103 * src/insets/insetfoot.h:
7104 * src/insets/insetfoot.C:
7105 * src/insets/insetert.h:
7106 * src/insets/insetert.C: cleaned up the code so that it works now
7107 correctly with insettext.
7109 * src/insets/inset.C:
7110 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7111 that insets in insets are supported right.
7114 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7116 * src/paragraph.C: some small fixes
7118 * src/debug.h: inserted INSETS debug info
7120 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7121 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7123 * src/commandtags.h:
7124 * src/LyXAction.C: insert code for InsetTabular.
7126 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7127 not Button1MotionMask.
7128 (workAreaButtonRelease): send always a InsetButtonRelease event to
7130 (checkInsetHit): some setCursor fixes (always with insets).
7132 * src/BufferView2.C (lockInset): returns a bool now and extended for
7133 locking insets inside insets.
7134 (showLockedInsetCursor): it is important to have the cursor always
7135 before the locked inset.
7136 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7138 * src/BufferView.h: made lockInset return a bool.
7140 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7142 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7143 that is used also internally but can be called as public to have back
7144 a cursor pos which is not set internally.
7145 (SetCursorIntern): Changed to use above function.
7147 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7149 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7154 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7155 patches for things that should be in or should be changed.
7157 * src/* [insetfiles]: change "usigned char fragile" to bool
7158 fragile. There was only one point that could that be questioned
7159 and that is commented in formulamacro.C. Grep for "CHECK".
7161 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7162 (DeleteBuffer): take it out of CutAndPaste and make it static.
7164 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7166 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7167 output the spacing envir commands. Also the new commands used in
7168 the LaTeX output makes the result better.
7170 * src/Spacing.C (writeEnvirBegin): new method
7171 (writeEnvirEnd): new method
7173 2000-04-18 Juergen Vigna <jug@sad.it>
7175 * src/CutAndPaste.C: made textclass a static member of the class
7176 as otherwise it is not accesed right!!!
7178 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7180 * forms/layout_forms.fd
7181 * src/layout_forms.h
7182 * src/layout_forms.C (create_form_form_character)
7183 * src/lyx_cb.C (UserFreeFont)
7184 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7185 documents (in the layout->character popup).
7187 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7189 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7190 \spell_command was in fact not honored (from Kevin Atkinson).
7192 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7195 * src/lyx_gui.h: make lyxViews private (Angus)
7197 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7199 * src/mathed/math_write.C
7200 (MathMatrixInset::Write) Put \protect before \begin{array} and
7201 \end{array} if fragile
7202 (MathParInset::Write): Put \protect before \\ if fragile
7204 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7206 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7207 initialization if the LyXColorHandler must be done after the
7208 connections to the XServer has been established.
7210 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7211 get the background pixel from the lyxColorhandler so that the
7212 figures are rendered with the correct background color.
7213 (NextToken): removed functions.
7214 (GetPSSizes): use ifs >> string instead of NextToken.
7216 * src/Painter.[Ch]: the color cache moved out of this file.
7218 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7221 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7223 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7224 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7226 * src/BufferView.C (enterView): new func
7227 (leaveView): new func
7229 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7231 (leaveView): new func, undefines xterm cursor when approp.
7233 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7234 (AllowInput): delete the Workarea cursor handling from this func.
7236 * src/Painter.C (underline): draw a slimer underline in most cases.
7238 * src/lyx_main.C (error_handler): use extern "C"
7240 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7242 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7243 sent directly to me.
7245 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7246 to the list by Dekel.
7248 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7251 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7252 methods from lyx_cb.here.
7254 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7257 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7259 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7260 instead of using current_view directly.
7262 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7264 * src/LyXAction.C (init): add the paragraph-spacing command.
7266 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7268 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7270 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7271 different from the documents.
7273 * src/text.C (SetHeightOfRow): take paragraph spacing into
7274 account, paragraph spacing takes precedence over buffer spacing
7275 (GetVisibleRow): ditto
7277 * src/paragraph.C (writeFile): output the spacing parameter too.
7278 (validate): set the correct features if spacing is used in the
7280 (Clear): set spacing to default
7281 (MakeSameLayout): spacing too
7282 (HasSameLayout): spacing too
7283 (SetLayout): spacing too
7284 (TeXOnePar): output the spacing commands
7286 * src/lyxparagraph.h: added a spacing variable for use with
7287 per-paragraph spacing.
7289 * src/Spacing.h: add a Default spacing and a method to check if
7290 the current spacing is default. also added an operator==
7292 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7295 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7297 * src/lyxserver.C (callback): fix dispatch of functions
7299 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7300 printf() into lyxerr call.
7302 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7305 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7306 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7307 the "Float" from each of the subitems.
7308 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7310 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7311 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7312 documented the change so that the workaround can be nuked later.
7314 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7317 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7319 * src/buffer.C (getLatexName): ditto
7320 (setReadonly): ditto
7322 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7324 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7325 avoid some uses of current_view. Added also a bufferParams()
7326 method to get at this.
7328 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7330 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7332 * src/lyxparagraph.[Ch]: removed
7333 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7334 with operators used by lower_bound and
7335 upper_bound in InsetTable's
7336 Make struct InsetTable private again. Used matchpos.
7338 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7340 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7341 document, the language of existing text is changed (unless the
7342 document is multi-lingual)
7344 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7346 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7348 * A lot of files: A rewrite of the Right-to-Left support.
7350 2000-04-10 Juergen Vigna <jug@sad.it>
7352 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7353 misplaced cursor when inset in inset is locked.
7355 * src/insets/insettext.C (LocalDispatch): small fix so that a
7356 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7358 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7359 footnote font should be decreased in size twice when displaying.
7361 * src/insets/insettext.C (GetDrawFont): inserted this function as
7362 the drawing-font may differ from the real paragraph font.
7364 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7365 insets (inset in inset!).
7367 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7368 function here because we don't want footnotes inside footnotes.
7370 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7372 (init): now set the inset_owner in paragraph.C
7373 (LocalDispatch): added some resetPos() in the right position
7376 (pasteSelection): changed to use the new CutAndPaste-Class.
7378 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7379 which tells if it is allowed to insert another inset inside this one.
7381 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7382 SwitchLayoutsBetweenClasses.
7384 * src/text2.C (InsertInset): checking of the new paragraph-function
7386 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7387 is not needed anymore here!
7390 (PasteSelection): redone (also with #ifdef) so that now this uses
7391 the CutAndPaste-Class.
7392 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7395 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7396 from/to text/insets.
7398 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7399 so that the paragraph knows if it is inside an (text)-inset.
7400 (InsertFromMinibuffer): changed return-value to bool as now it
7401 may happen that an inset is not inserted in the paragraph.
7402 (InsertInsetAllowed): this checks if it is allowed to insert an
7403 inset in this paragraph.
7405 (BreakParagraphConservative):
7406 (BreakParagraph) : small change for the above change of the return
7407 value of InsertFromMinibuffer.
7409 * src/lyxparagraph.h: added inset_owner and the functions to handle
7410 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7412 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7414 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7415 functions from BufferView to BufferView::Pimpl to ease maintence.
7417 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7418 correctly. Also use SetCursorIntern instead of SetCursor.
7420 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7423 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7425 * src/WorkArea.C (belowMouse): manually implement below mouse.
7427 * src/*: Add "explicit" on several constructors, I added probably
7428 some unneeded ones. A couple of changes to code because of this.
7430 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7431 implementation and private parts from the users of BufferView. Not
7434 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7435 implementation and private parts from the users of LyXLex. Not
7438 * src/BufferView_pimpl.[Ch]: new files
7440 * src/lyxlex_pimpl.[Ch]: new files
7442 * src/LyXView.[Ch]: some inline functions move out-of-line
7444 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7446 * src/lyxparagraph.h: make struct InsetTable public.
7448 * src/support/lyxstring.h: change lyxstring::difference_type to be
7449 ptrdiff_t. Add std:: modifiers to streams.
7451 * src/font.C: include the <cctype> header, for islower() and
7454 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7456 * src/font.[Ch]: new files. Contains the metric functions for
7457 fonts, takes a LyXFont as parameter. Better separation of concepts.
7459 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7460 changes because of this.
7462 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7464 * src/*: compile with -Winline and move functions that don't
7467 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7470 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7472 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7473 (various files changed because of this)
7475 * src/Painter.C (text): fixed the drawing of smallcaps.
7477 * src/lyxfont.[Ch] (drawText): removed unused member func.
7480 * src/*.C: added needed "using" statements and "std::" qualifiers.
7482 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7484 * src/*.h: removed all use of "using" from header files use
7485 qualifier std:: instead.
7487 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7489 * src/text.C (Backspace): some additional cleanups (we already
7490 know whether cursor.pos is 0 or not).
7492 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7493 automake does not provide one).
7495 * src/bmtable.h: replace C++ comments with C comments.
7497 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7499 * src/screen.C (ShowCursor): Change the shape of the cursor if
7500 the current language is not equal to the language of the document.
7501 (If the cursor change its shape unexpectedly, then you've found a bug)
7503 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7506 * src/insets/insetnumber.[Ch]: New files.
7508 * src/LyXAction.C (init)
7509 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7512 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7514 * src/lyxparagraph.h
7515 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7516 (the vector is kept sorted).
7518 * src/text.C (GetVisibleRow): Draw selection correctly when there
7519 is both LTR and RTL text.
7521 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7522 which is much faster.
7524 * src/text.C (GetVisibleRow and other): Do not draw the last space
7525 in a row if the direction of the last letter is not equal to the
7526 direction of the paragraph.
7528 * src/lyxfont.C (latexWriteStartChanges):
7529 Check that font language is not equal to basefont language.
7530 (latexWriteEndChanges): ditto
7532 * src/lyx_cb.C (StyleReset): Don't change the language while using
7533 the font-default command.
7535 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7536 empty paragraph before a footnote.
7538 * src/insets/insetcommand.C (draw): Increase x correctly.
7540 * src/screen.C (ShowCursor): Change cursor shape if
7541 current language != document language.
7543 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7545 2000-03-31 Juergen Vigna <jug@sad.it>
7547 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7548 (Clone): changed mode how the paragraph-data is copied to the
7549 new clone-paragraph.
7551 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7552 GetInset(pos) with no inset anymore there (in inset UNDO)
7554 * src/insets/insetcommand.C (draw): small fix as here x is
7555 incremented not as much as width() returns (2 before, 2 behind = 4)
7557 2000-03-30 Juergen Vigna <jug@sad.it>
7559 * src/insets/insettext.C (InsetText): small fix in initialize
7560 widthOffset (should not be done in the init() function)
7562 2000-03-29 Amir Karger <karger@lyx.org>
7564 * lib/examples/it_ItemizeBullets.lyx: translation by
7567 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7569 2000-03-29 Juergen Vigna <jug@sad.it>
7571 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7573 * src/insets/insetfoot.C (Clone): small change as for the below
7574 new init function in the text-inset
7576 * src/insets/insettext.C (init): new function as I've seen that
7577 clone did not copy the Paragraph-Data!
7578 (LocalDispatch): Added code so that now we have some sort of Undo
7579 functionality (well actually we HAVE Undo ;)
7581 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7583 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7585 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7588 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7590 * src/main.C: added a runtime check that verifies that the xforms
7591 header used when building LyX and the library used when running
7592 LyX match. Exit with a message if they don't match. This is a
7593 version number check only.
7595 * src/buffer.C (save): Don't allocate memory on the heap for
7596 struct utimbuf times.
7598 * *: some using changes, use iosfwd instead of the real headers.
7600 * src/lyxfont.C use char const * instead of string for the static
7601 strings. Rewrite some functions to use sstream.
7603 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7605 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7608 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7610 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7611 of Geodesy (from Martin Vermeer)
7613 * lib/layouts/svjour.inc: include file for the Springer svjour
7614 class. It can be used to support journals other than JoG.
7616 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7617 Miskiewicz <misiek@pld.org.pl>)
7618 * lib/reLyX/Makefile.am: ditto.
7620 2000-03-27 Juergen Vigna <jug@sad.it>
7622 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7623 also some modifications with operations on selected text.
7625 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7626 problems with clicking on insets (last famous words ;)
7628 * src/insets/insetcommand.C (draw):
7629 (width): Changed to have a bit of space before and after the inset so
7630 that the blinking cursor can be seen (otherwise it was hidden)
7632 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7634 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7635 would not be added to the link list when an installed gettext (not
7636 part of libc) is found.
7638 2000-03-24 Juergen Vigna <jug@sad.it>
7640 * src/insets/insetcollapsable.C (Edit):
7641 * src/mathed/formula.C (InsetButtonRelease):
7642 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7645 * src/BufferView.C (workAreaButtonPress):
7646 (workAreaButtonRelease):
7647 (checkInsetHit): Finally fixed the clicking on insets be handled
7650 * src/insets/insetert.C (Edit): inserted this call so that ERT
7651 insets work always with LaTeX-font
7653 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7655 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7656 caused lyx to startup with no GUI in place, causing in a crash
7657 upon startup when called with arguments.
7659 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7661 * src/FontLoader.C: better initialization of dummyXFontStruct.
7663 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7665 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7666 for linuxdoc and docbook import and export format options.
7668 * lib/lyxrc.example Example of default values for the previous flags.
7670 * src/lyx_cb.C Use those flags instead of the hardwired values for
7671 linuxdoc and docbook export.
7673 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7676 * src/menus.C Added menus entries for the new import/exports formats.
7678 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7680 * src/lyxrc.*: Added support for running without Gui
7683 * src/FontLoader.C: sensible defaults if no fonts are needed
7685 * src/lyx_cb.C: New function ShowMessage (writes either to the
7686 minibuffer or cout in case of no gui
7687 New function AskOverwrite for common stuff
7688 Consequently various changes to call these functions
7690 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7691 wild guess at sensible screen resolution when having no gui
7693 * src/lyxfont.C: no gui, no fonts... set some defaults
7695 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7697 * src/LColor.C: made the command inset background a bit lighter.
7699 2000-03-20 Hartmut Goebel <goebel@noris.net>
7701 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7702 stdstruct.inc. Koma-Script added some title elements which
7703 otherwise have been listed below "bibliography". This split allows
7704 adding title elements to where they belong.
7706 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7707 define the additional title elements and then include
7710 * many other layout files: changed to include stdtitle.inc just
7711 before stdstruct.inc.
7713 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7715 * src/buffer.C: (save) Added the option to store all backup files
7716 in a single directory
7718 * src/lyxrc.[Ch]: Added variable \backupdir_path
7720 * lib/lyxrc.example: Added descriptions of recently added variables
7722 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7723 bibtex inset, not closing the bibtex popup when deleting the inset)
7725 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7727 * src/lyx_cb.C: add a couple using directives.
7729 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7730 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7731 import based on the filename.
7733 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7734 file would be imported at start, if the filename where of a sgml file.
7736 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7738 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7740 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7741 * src/lyxfont.h Replaced the member variable bits.direction by the
7742 member variable lang. Made many changes in other files.
7743 This allows having a multi-lingual document
7745 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7746 that change the current language to <l>.
7747 Removed the command "font-rtl"
7749 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7750 format for Hebrew documents)
7752 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7753 When auto_mathmode is "true", pressing a digit key in normal mode
7754 will cause entering into mathmode.
7755 If auto_mathmode is "rtl" then this behavior will be active only
7756 when writing right-to-left text.
7758 * src/text2.C (InsertStringA) The string is inserted using the
7761 * src/paragraph.C (GetEndLabel) Gives a correct result for
7762 footnote paragraphs.
7764 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7766 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7768 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7769 front of PasteParagraph. Never insert a ' '. This should at least
7770 fix some cause for the segfaults that we have been experiencing,
7771 it also fixes backspace behaviour slightly. (Phu!)
7773 * src/support/lstrings.C (compare_no_case): some change to make it
7774 compile with gcc 2.95.2 and stdlibc++-v3
7776 * src/text2.C (MeltFootnoteEnvironment): change type o
7777 first_footnote_par_is_not_empty to bool.
7779 * src/lyxparagraph.h: make text private. Changes in other files
7781 (fitToSize): new function
7782 (setContentsFromPar): new function
7783 (clearContents): new function
7784 (SetChar): new function
7786 * src/paragraph.C (readSimpleWholeFile): deleted.
7788 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7789 the file, just use a simple string instead. Also read the file in
7790 a more maintainable manner.
7792 * src/text2.C (InsertStringA): deleted.
7793 (InsertStringB): deleted.
7795 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7797 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7798 RedoParagraphs from the doublespace handling part, just set status
7799 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7800 done, but perhaps not like this.)
7802 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7804 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7805 character when inserting an inset.
7807 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7809 * src/bufferparams.C (readLanguage): now takes "default" into
7812 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7813 also initialize the toplevel_keymap with the default bindings from
7816 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7818 * all files using lyxrc: have lyxrc as a real variable and not a
7819 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7822 * src/lyxrc.C: remove double call to defaultKeyBindings
7824 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7825 toolbar defauls using lyxlex. Remove enums, structs, functions
7828 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7829 toolbar defaults. Also store default keybindings in a map.
7831 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7832 storing the toolbar defaults without any xforms dependencies.
7834 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7835 applied. Changed to use iterators.
7837 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7839 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7840 systems that don't have LINGUAS set to begin with.
7842 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7844 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7845 the list by Dekel Tsur.
7847 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7849 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7850 * src/insets/form_graphics.C: ditto.
7852 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7854 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7856 * src/bufferparams.C (readLanguage): use the new language map
7858 * src/intl.C (InitKeyMapper): use the new language map
7860 * src/lyx_gui.C (create_forms): use the new language map
7862 * src/language.[Ch]: New files. Used for holding the information
7863 about each language. Now! Use this new language map enhance it and
7864 make it really usable for our needs.
7866 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7868 * screen.C (ShowCursor): Removed duplicate code.
7869 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7870 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7872 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7875 * src/text.C Added TransformChar method. Used for rendering Arabic
7876 text correctly (change the glyphs of the letter according to the
7877 position in the word)
7882 * src/lyxrc.C Added lyxrc command {language_command_begin,
7883 language_command_end,language_command_ltr,language_command_rtl,
7884 language_package} which allows the use of either arabtex or Omega
7887 * src/lyx_gui.C (init)
7889 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7890 to use encoding for menu fonts which is different than the encoding
7893 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7894 do not load the babel package.
7895 To write an English document with Hebrew/Arabic, change the document
7896 language to "english".
7898 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7899 (alphaCounter): changed to return char
7900 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7902 * lib/lyxrc.example Added examples for Hebrew/Arabic
7905 * src/layout.C Added layout command endlabeltype
7907 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7909 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7911 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7913 * src/mathed/math_delim.C (search_deco): return a
7914 math_deco_struct* instead of index.
7916 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7918 * All files with a USE_OSTREAM_ONLY within: removed all code that
7919 was unused when USE_OSTREAM_ONLY is defined.
7921 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7922 of any less. Removed header and using.
7924 * src/text.C (GetVisibleRow): draw the string "Page Break
7925 (top/bottom)" on screen when drawing a pagebreak line.
7927 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7929 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7931 * src/mathed/math_macro.C (draw): do some cast magic.
7934 * src/mathed/math_defs.h: change byte* argument to byte const*.
7936 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7938 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7939 know it is right to return InsetFoot* too, but cxx does not like
7942 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7944 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7946 * src/mathed/math_delim.C: change == to proper assignment.
7948 2000-03-09 Juergen Vigna <jug@sad.it>
7950 * src/insets/insettext.C (setPos): fixed various cursor positioning
7951 problems (via mouse and cursor-keys)
7952 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7953 inset (still a small display problem but it works ;)
7955 * src/insets/insetcollapsable.C (draw): added button_top_y and
7956 button_bottom_y to have correct values for clicking on the inset.
7958 * src/support/lyxalgo.h: commented out 'using std::less'
7960 2000-03-08 Juergen Vigna <jug@sad.it>
7962 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7963 Button-Release event closes as it is alos the Release-Event
7966 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7968 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7970 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7971 can add multiple spaces in Scrap (literate programming) styles...
7972 which, by the way, is how I got hooked on LyX to begin with.
7974 * src/mathed/formula.C (Write): Added dummy variable to an
7975 inset::Latex() call.
7976 (Latex): Add free_spacing boolean to inset::Latex()
7978 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7980 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7981 virtual function to include the free_spacing boolean from
7982 the containing paragraph's style.
7984 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7985 Added free_spacing boolean arg to match inset.h
7987 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7988 Added free_spacing boolean arg to match inset.h
7990 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7991 Added free_spacing boolean and made sure that if in a free_spacing
7992 paragraph, that we output normal space if there is a protected space.
7994 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7995 Added free_spacing boolean arg to match inset.h
7997 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7998 Added free_spacing boolean arg to match inset.h
8000 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8001 Added free_spacing boolean arg to match inset.h
8003 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8004 Added free_spacing boolean arg to match inset.h
8006 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8007 Added free_spacing boolean arg to match inset.h
8009 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8010 free_spacing boolean arg to match inset.h
8012 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8013 Added free_spacing boolean arg to match inset.h
8015 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8016 Added free_spacing boolean arg to match inset.h
8018 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8019 Added free_spacing boolean arg to match inset.h
8021 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8022 Added free_spacing boolean arg to match inset.h
8024 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8025 Added free_spacing boolean arg to match inset.h
8027 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8028 free_spacing boolean arg to match inset.h
8030 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8031 free_spacing boolean arg to match inset.h
8033 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8034 ignore free_spacing paragraphs. The user's spaces are left
8037 * src/text.C (InsertChar): Fixed the free_spacing layout
8038 attribute behavior. Now, if free_spacing is set, you can
8039 add multiple spaces in a paragraph with impunity (and they
8040 get output verbatim).
8041 (SelectSelectedWord): Added dummy argument to inset::Latex()
8044 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8047 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8048 paragraph layouts now only input a simple space instead.
8049 Special character insets don't make any sense in free-spacing
8052 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8053 hard-spaces in the *input* file to simple spaces if the layout
8054 is free-spacing. This converts old files which had to have
8055 hard-spaces in free-spacing layouts where a simple space was
8057 (writeFileAscii): Added free_spacing check to pass to the newly
8058 reworked inset::Latex(...) methods. The inset::Latex() code
8059 ensures that hard-spaces in free-spacing paragraphs get output
8060 as spaces (rather than "~").
8062 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8064 * src/mathed/math_delim.C (draw): draw the empty placeholder
8065 delims with a onoffdash line.
8066 (struct math_deco_compare): struct that holds the "functors" used
8067 for the sort and the binary search in math_deco_table.
8068 (class init_deco_table): class used for initial sort of the
8070 (search_deco): use lower_bound to do a binary search in the
8073 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8075 * src/lyxrc.C: a small secret thingie...
8077 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8078 and to not flush the stream as often as it used to.
8080 * src/support/lyxalgo.h: new file
8081 (sorted): template function used for checking if a sequence is
8082 sorted or not. Two versions with and without user supplied
8083 compare. Uses same compare as std::sort.
8085 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8086 it and give warning on lyxerr.
8088 (struct compare_tags): struct with function operators used for
8089 checking if sorted, sorting and lower_bound.
8090 (search_kw): use lower_bound instead of manually implemented
8093 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8095 * src/insets/insetcollapsable.h: fix Clone() declaration.
8096 * src/insets/insetfoot.h: ditto.
8098 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8100 2000-03-08 Juergen Vigna <jug@sad.it>
8102 * src/insets/lyxinset.h: added owner call which tells us if
8103 this inset is inside another inset. Changed also the return-type
8104 of Editable to an enum so it tells clearer what the return-value is.
8106 * src/insets/insettext.C (computeTextRows): fixed computing of
8107 textinsets which split automatically on more rows.
8109 * src/insets/insetert.[Ch]: changed this to be of BaseType
8112 * src/insets/insetfoot.[Ch]: added footnote inset
8114 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8115 collapsable insets (like footnote, ert, ...)
8117 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8119 * src/lyxdraw.h: remvoe file
8121 * src/lyxdraw.C: remove file
8123 * src/insets/insettext.C: added <algorithm>.
8125 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8127 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8128 (matrix_cb): case MM_OK use string stream
8130 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8133 * src/mathed/math_macro.C (draw): use string stream
8134 (Metrics): use string stream
8136 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8137 directly to the ostream.
8139 * src/vspace.C (asString): use string stream.
8140 (asString): use string stream
8141 (asLatexString): use string stream
8143 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8144 setting Spacing::Other.
8146 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8147 sprintf when creating the stretch vale.
8149 * src/text2.C (alphaCounter): changed to return a string and to
8150 not use a static variable internally. Also fixed a one-off bug.
8151 (SetCounter): changed the drawing of the labels to use string
8152 streams instead of sprintf.
8154 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8155 manipulator to use a scheme that does not require library support.
8156 This is also the way it is done in the new GNU libstdc++. Should
8157 work with DEC cxx now.
8159 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8161 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8162 end. This fixes a bug.
8164 * src/mathed (all files concerned with file writing): apply the
8165 USE_OSTREAM_ONLY changes to mathed too.
8167 * src/support/DebugStream.h: make the constructor explicit.
8169 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8170 count and ostream squashed.
8172 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8174 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8176 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8177 ostringstream uses STL strings, and we might not.
8179 * src/insets/insetspecialchar.C: add using directive.
8180 * src/insets/insettext.C: ditto.
8182 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8184 * lib/layouts/seminar.layout: feeble attempt at a layout for
8185 seminar.cls, far from completet and could really use some looking
8186 at from people used to write layout files.
8188 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8189 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8190 a lot nicer and works nicely with ostreams.
8192 * src/mathed/formula.C (draw): a slightly different solution that
8193 the one posted to the list, but I think this one works too. (font
8194 size wrong in headers.)
8196 * src/insets/insettext.C (computeTextRows): some fiddling on
8197 Jürgens turf, added some comments that he should read.
8199 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8200 used and it gave compiler warnings.
8201 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8204 * src/lyx_gui.C (create_forms): do the right thing when
8205 show_banner is true/false.
8207 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8208 show_banner is false.
8210 * most file writing files: Now use iostreams to do almost all of
8211 the writing. Also instead of passing string &, we now use
8212 stringstreams. mathed output is still not adapted to iostreams.
8213 This change can be turned off by commenting out all the occurences
8214 of the "#define USE_OSTREAM_ONLY 1" lines.
8216 * src/WorkArea.C (createPixmap): don't output debug messages.
8217 (WorkArea): don't output debug messages.
8219 * lib/lyxrc.example: added a comment about the new variable
8222 * development/Code_rules/Rules: Added some more commente about how
8223 to build class interfaces and on how better encapsulation can be
8226 2000-03-03 Juergen Vigna <jug@sad.it>
8228 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8229 automatically with the width of the LyX-Window
8231 * src/insets/insettext.C (computeTextRows): fixed update bug in
8232 displaying text-insets (scrollvalues where not initialized!)
8234 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8236 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8237 id in the check of the result from lower_bound is not enough since
8238 lower_bound can return last too, and then res->id will not be a
8241 * all insets and some code that use them: I have conditionalized
8242 removed the Latex(string & out, ...) this means that only the
8243 Latex(ostream &, ...) will be used. This is a work in progress to
8244 move towards using streams for all output of files.
8246 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8249 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8251 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8252 routine (this fixes bug where greek letters were surrounded by too
8255 * src/support/filetools.C (findtexfile): change a bit the search
8256 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8257 no longer passed to kpsewhich, we may have to change that later.
8259 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8260 warning options to avoid problems with X header files (from Angus
8262 * acinclude.m4: regenerated.
8264 2000-03-02 Juergen Vigna <jug@sad.it>
8266 * src/insets/insettext.C (WriteParagraphData): Using the
8267 par->writeFile() function for writing paragraph-data.
8268 (Read): Using buffer->parseSingleLyXformat2Token()-function
8269 for parsing paragraph data!
8271 * src/buffer.C (readLyXformat2): removed all parse data and using
8272 the new parseSingleLyXformat2Token()-function.
8273 (parseSingleLyXformat2Token): added this function to parse (read)
8274 lyx-file-format (this is called also from text-insets now!)
8276 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8278 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8281 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8282 directly instead of going through a func. One very bad thing: a
8283 static LyXFindReplace, but I don't know where to place it.
8285 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8286 string instead of char[]. Also changed to static.
8287 (GetSelectionOrWordAtCursor): changed to static inline
8288 (SetSelectionOverLenChars): ditto.
8290 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8291 current_view and global variables. both classes has changed names
8292 and LyXFindReplace is not inherited from SearchForm.
8294 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8295 fl_form_search form.
8297 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8299 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8301 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8302 bound (from Kayvan).
8304 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8306 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8308 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8310 * some things that I should comment but the local pub says head to
8313 * comment out all code that belongs to the Roff code for Ascii
8314 export of tables. (this is unused)
8316 * src/LyXView.C: use correct type for global variable
8317 current_layout. (LyXTextClass::size_type)
8319 * some code to get the new insetgraphics closer to working I'd be
8320 grateful for any help.
8322 * src/BufferView2.C (insertInset): use the return type of
8323 NumberOfLayout properly. (also changes in other files)
8325 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8326 this as a test. I want to know what breaks because of this.
8328 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8330 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8332 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8333 to use a \makebox in the label, this allows proper justification
8334 with out using protected spaces or multiple hfills. Now it is
8335 "label" for left justified, "\hfill label\hfill" for center, and
8336 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8337 should be changed accordingly.
8339 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8341 * src/lyxtext.h: change SetLayout() to take a
8342 LyXTextClass::size_type instead of a char (when there is more than
8343 127 layouts in a class); also change type of copylayouttype.
8344 * src/text2.C (SetLayout): ditto.
8345 * src/LyXView.C (updateLayoutChoice): ditto.
8347 * src/LaTeX.C (scanLogFile): errors where the line number was not
8348 given just after the '!'-line were ignored (from Dekel Tsur).
8350 * lib/lyxrc.example: fix description of \date_insert_format
8352 * lib/layouts/llncs.layout: new layout, contributed by Martin
8355 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8357 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8358 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8359 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8360 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8361 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8362 paragraph.C, text.C, text2.C)
8364 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8366 * src/insets/insettext.C (LocalDispatch): remove extra break
8369 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8370 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8372 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8373 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8375 * src/insets/insetbib.h: move InsetBibkey::Holder and
8376 InsetCitation::Holder in public space.
8378 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8380 * src/insets/insettext.h: small change to get the new files from
8381 Juergen to compile (use "string", not "class string").
8383 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8384 const & as parameter to LocalDispatch, use LyXFont const & as
8385 paramter to some other func. This also had impacto on lyxinsets.h
8386 and the two mathed insets.
8388 2000-02-24 Juergen Vigna <jug@sad.it>
8391 * src/commandtags.h:
8393 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8397 * src/BufferView2.C: added/updated code for various inset-functions
8399 * src/insets/insetert.[Ch]: added implementation of InsetERT
8401 * src/insets/insettext.[Ch]: added implementation of InsetText
8403 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8404 (draw): added preliminary code for inset scrolling not finshed yet
8406 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8407 as it is in lyxfunc.C now
8409 * src/insets/lyxinset.h: Added functions for text-insets
8411 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8413 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8414 BufferView and reimplement the list as a queue put inside its own
8417 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8419 * several files: use the new interface to the "updateinsetlist"
8421 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8423 (work_area_handler): call BufferView::trippleClick on trippleclick.
8425 * src/BufferView.C (doubleClick): new function, selects word on
8427 (trippleClick): new function, selects line on trippleclick.
8429 2000-02-22 Allan Rae <rae@lyx.org>
8431 * lib/bind/xemacs.bind: buffer-previous not supported
8433 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8435 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8438 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8440 * src/bufferlist.C: get rid of current_view from this file
8442 * src/spellchecker.C: get rid of current_view from this file
8444 * src/vspace.C: get rid of current_view from this file
8445 (inPixels): added BufferView parameter for this func
8446 (asLatexCommand): added a BufferParams for this func
8448 * src/text.C src/text2.C: get rid of current_view from these
8451 * src/lyxfont.C (getFontDirection): move this function here from
8454 * src/bufferparams.C (getDocumentDirection): move this function
8457 * src/paragraph.C (getParDirection): move this function here from
8459 (getLetterDirection): ditto
8461 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8463 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8464 resize due to wrong pixmap beeing used. Also took the opurtunity
8465 to make the LyXScreen stateless on regard to WorkArea and some
8466 general cleanup in the same files.
8468 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8470 * src/Makefile.am: add missing direction.h
8472 * src/PainterBase.h: made the width functions const.
8474 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8477 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8479 * src/insets/insetlatexaccent.C (draw): make the accents draw
8480 better, at present this will only work well with iso8859-1.
8482 * several files: remove the old drawing code, now we use the new
8485 * several files: remove support for mono_video, reverse_video and
8488 2000-02-17 Juergen Vigna <jug@sad.it>
8490 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8491 int ** as we have to return the pointer, otherwise we have only
8492 NULL pointers in the returning function.
8494 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8496 * src/LaTeX.C (operator()): quote file name when running latex.
8498 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8500 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8501 (bubble tip), this removes our special handling of this.
8503 * Remove all code that is unused now that we have the new
8504 workarea. (Code that are not active when NEW_WA is defined.)
8506 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8508 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8510 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8511 nonexisting layout; correctly redirect obsoleted layouts.
8513 * lib/lyxrc.example: document \view_dvi_paper_option
8515 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8518 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8519 (PreviewDVI): handle the view_dvi_paper_option variable.
8520 [Both from Roland Krause]
8522 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8524 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8525 char const *, int, LyXFont)
8526 (text(int, int, string, LyXFont)): ditto
8528 * src/text.C (InsertCharInTable): attempt to fix the double-space
8529 feature in tables too.
8530 (BackspaceInTable): ditto.
8531 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8533 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8535 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8537 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8538 newly found text in textcache to this.
8539 (buffer): set the owner of the text put into the textcache to 0
8541 * src/insets/figinset.C (draw): fixed the drawing of figures with
8544 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8545 drawing of mathframe, hfills, protected space, table lines. I have
8546 now no outstanding drawing problems with the new Painter code.
8548 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8550 * src/PainterBase.C (ellipse, circle): do not specify the default
8553 * src/LColor.h: add using directive.
8555 * src/Painter.[Ch]: change return type of methods from Painter& to
8556 PainterBase&. Add a using directive.
8558 * src/WorkArea.C: wrap xforms callbacks in C functions
8561 * lib/layouts/foils.layout: font fix and simplifications from Carl
8564 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8566 * a lot of files: The Painter, LColor and WorkArea from the old
8567 devel branch has been ported to lyx-devel. Some new files and a
8568 lot of #ifdeffed code. The new workarea is enabled by default, but
8569 if you want to test the new Painter and LColor you have to compile
8570 with USE_PAINTER defined (do this in config.h f.ex.) There are
8571 still some rought edges, and I'd like some help to clear those
8572 out. It looks stable (loads and displays the Userguide very well).
8575 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8577 * src/buffer.C (pop_tag): revert to the previous implementation
8578 (use a global variable for both loops).
8580 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8582 * src/lyxrc.C (LyXRC): change slightly default date format.
8584 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8585 there is an English text with a footnote that starts with a Hebrew
8586 paragraph, or vice versa.
8587 (TeXFootnote): ditto.
8589 * src/text.C (LeftMargin): allow for negative values for
8590 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8593 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8594 for input encoding (cyrillic)
8596 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8598 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8601 * src/toolbar.C (set): ditto
8602 * src/insets/insetbib.C (create_form_citation_form): ditto
8604 * lib/CREDITS: added Dekel Tsur.
8606 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8607 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8608 hebrew supports files from Dekel Tsur.
8610 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8611 <tzafrir@technion.ac.il>
8613 * src/lyxrc.C: put \date_insert_format at the right place.
8615 * src/buffer.C (makeLaTeXFile): fix the handling of
8616 BufferParams::sides when writing out latex files.
8618 * src/BufferView2.C: add a "using" directive.
8620 * src/support/lyxsum.C (sum): when we use lyxstring,
8621 ostringstream::str needs an additional .c_str().
8623 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8625 * src/support/filetools.C (ChangeExtension): patch from Etienne
8628 * src/TextCache.C (show): remove const_cast and make second
8629 parameter non-const LyXText *.
8631 * src/TextCache.h: use non const LyXText in show.
8633 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8636 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8638 * src/support/lyxsum.C: rework to be more flexible.
8640 * several places: don't check if a pointer is 0 if you are going
8643 * src/text.C: remove some dead code.
8645 * src/insets/figinset.C: remove some dead code
8647 * src/buffer.C: move the BufferView funcs to BufferView2.C
8648 remove all support for insetlatexdel
8649 remove support for oldpapersize stuff
8650 made some member funcs const
8652 * src/kbmap.C: use a std::list to store the bindings in.
8654 * src/BufferView2.C: new file
8656 * src/kbsequence.[Ch]: new files
8658 * src/LyXAction.C + others: remove all trace of buffer-previous
8660 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8661 only have one copy in the binary of this table.
8663 * hebrew patch: moved some functions from LyXText to more
8664 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8666 * several files: remove support for XForms older than 0.88
8668 remove some #if 0 #endif code
8670 * src/TextCache.[Ch]: new file. Holds the textcache.
8672 * src/BufferView.C: changes to use the new TextCache interface.
8673 (waitForX): remove the now unused code.
8675 * src/BackStack.h: remove some commented code
8677 * lib/bind/emacs.bind: remove binding for buffer-previous
8679 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8681 * applied the hebrew patch.
8683 * src/lyxrow.h: make sure that all Row variables are initialized.
8685 * src/text2.C (TextHandleUndo): comment out a delete, this might
8686 introduce a memory leak, but should also help us to not try to
8687 read freed memory. We need to look at this one.
8689 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8690 (LyXParagraph): initalize footnotekind.
8692 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8693 forgot this when applying the patch. Please heed the warnings.
8695 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8696 (aka. reformat problem)
8698 * src/bufferlist.C (exists): made const, and use const_iterator
8699 (isLoaded): new func.
8700 (release): use std::find to find the correct buffer.
8702 * src/bufferlist.h: made getState a const func.
8703 made empty a const func.
8704 made exists a const func.
8707 2000-02-01 Juergen Vigna <jug@sad.it>
8709 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8711 * po/it.po: updated a bit the italian po file and also changed the
8712 'file nuovo' for newfile to 'filenuovo' without a space, this did
8715 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8716 for the new insert_date command.
8718 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8719 from jdblair, to insert a date into the current text conforming to
8720 a strftime format (for now only considering the locale-set and not
8721 the document-language).
8723 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8725 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8726 Bounds Read error seen by purify. The problem was that islower is
8727 a macros which takes an unsigned char and uses it as an index for
8728 in array of characters properties (and is thus subject to the
8732 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8733 correctly the paper sides radio buttons.
8734 (UpdateDocumentButtons): ditto.
8736 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8738 * src/kbmap.C (getsym + others): change to return unsigned int,
8739 returning a long can give problems on 64 bit systems. (I assume
8740 that int is 32bit on 64bit systems)
8742 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8744 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8745 LyXLookupString to be zero-terminated. Really fixes problems seen
8748 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8750 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8751 write a (char*)0 to the lyxerr stream.
8753 * src/lastfiles.C: move algorithm before the using statemets.
8755 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8757 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8758 complains otherwise).
8759 * src/table.C: ditto
8761 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8764 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8765 that I removed earlier... It is really needed.
8767 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8769 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8771 * INSTALL: update xforms home page URL.
8773 * lib/configure.m4: fix a bug with unreadable layout files.
8775 * src/table.C (calculate_width_of_column): add "using std::max"
8778 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8780 * several files: marked several lines with "DEL LINE", this is
8781 lines that can be deleted without changing anything.
8782 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8783 checks this anyway */
8786 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8788 * src/DepTable.C (update): add a "+" at the end when the checksum
8789 is different. (debugging string only)
8791 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8792 the next inset to not be displayed. This should also fix the list
8793 of labels in the "Insert Crossreference" dialog.
8795 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8797 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8798 when regex was not found.
8800 * src/support/lstrings.C (lowercase): use handcoded transform always.
8803 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8804 old_cursor.par->prev could be 0.
8806 * several files: changed post inc/dec to pre inc/dec
8808 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8809 write the lastfiles to file.
8811 * src/BufferView.C (buffer): only show TextCache info when debugging
8813 (resizeCurrentBuffer): ditto
8814 (workAreaExpose): ditto
8816 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8818 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8820 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8821 a bit better by removing the special case for \i and \j.
8823 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8825 * src/lyx_main.C (easyParse): remove test for bad comand line
8826 options, since this broke all xforms-related parsing.
8828 * src/kbmap.C (getsym): set return type to unsigned long, as
8829 declared in header. On an alpha, long is _not_ the same as int.
8831 * src/support/LOstream.h: add a "using std::flush;"
8833 * src/insets/figinset.C: ditto.
8835 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8837 * src/bufferlist.C (write): use blinding fast file copy instead of
8838 "a char at a time", now we are doing it the C++ way.
8840 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8841 std::list<int> instead.
8842 (addpidwait): reflect move to std::list<int>
8843 (sigchldchecker): ditto
8845 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8848 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8849 that obviously was wrong...
8851 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8852 c, this avoids warnings with purify and islower.
8854 * src/insets/figinset.C: rename struct queue to struct
8855 queue_element and rewrite to use a std::queue. gsqueue is now a
8856 std::queue<queue_element>
8857 (runqueue): reflect move to std::queue
8860 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8861 we would get "1" "0" instead of "true" "false. Also make the tostr
8864 2000-01-21 Juergen Vigna <jug@sad.it>
8866 * src/buffer.C (writeFileAscii): Disabled code for special groff
8867 handling of tabulars till I fix this in table.C
8869 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8871 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8873 * src/support/lyxlib.h: ditto.
8875 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8877 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8878 and 'j' look better. This might fix the "macron" bug that has been
8881 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8882 functions as one template function. Delete the old versions.
8884 * src/support/lyxsum.C: move using std::ifstream inside
8887 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8890 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8892 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8894 * src/insets/figinset.C (InitFigures): use new instead of malloc
8895 to allocate memory for figures and bitmaps.
8896 (DoneFigures): use delete[] instead of free to deallocate memory
8897 for figures and bitmaps.
8898 (runqueue): use new to allocate
8899 (getfigdata): use new/delete[] instead of malloc/free
8900 (RegisterFigure): ditto
8902 * some files: moved some declarations closer to first use, small
8903 whitespace changes use preincrement instead of postincrement where
8904 it does not make a difference.
8906 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8907 step on the way to use stl::containers for key maps.
8909 * src/bufferlist.h: add a typedef for const_iterator and const
8910 versions of begin and end.
8912 * src/bufferlist.[Ch]: change name of member variable _state to
8913 state_. (avoid reserved names)
8915 (getFileNames): returns the filenames of the buffers in a vector.
8917 * configure.in (ALL_LINGUAS): added ro
8919 * src/support/putenv.C: new file
8921 * src/support/mkdir.C: new file
8923 2000-01-20 Allan Rae <rae@lyx.org>
8925 * lib/layouts/IEEEtran.layout: Added several theorem environments
8927 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8928 couple of minor additions.
8930 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8931 (except for those in footnotes of course)
8933 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8935 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8937 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8938 std::sort and std::lower_bound instead of qsort and handwritten
8940 (struct compara): struct that holds the functors used by std::sort
8941 and std::lower_bound in MathedLookupBOP.
8943 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8945 * src/support/LAssert.h: do not do partial specialization. We do
8948 * src/support/lyxlib.h: note that lyx::getUserName() and
8949 lyx::date() are not in use right now. Should these be suppressed?
8951 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8952 (makeLinuxDocFile): do not put date and user name in linuxdoc
8955 * src/support/lyxlib.h (kill): change first argument to long int,
8956 since that's what solaris uses.
8958 * src/support/kill.C (kill): fix declaration to match prototype.
8960 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8961 actually check whether namespaces are supported. This is not what
8964 * src/support/lyxsum.C: add a using directive.
8966 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8968 * src/support/kill.C: if we have namespace support we don't have
8969 to include lyxlib.h.
8971 * src/support/lyxlib.h: use namespace lyx if supported.
8973 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8975 * src/support/date.C: new file
8977 * src/support/chdir.C: new file
8979 * src/support/getUserName.C: new file
8981 * src/support/getcwd.C: new file
8983 * src/support/abort.C: new file
8985 * src/support/kill.C: new file
8987 * src/support/lyxlib.h: moved all the functions in this file
8988 insede struct lyx. Added also kill and abort to this struct. This
8989 is a way to avoid the "kill is not defined in <csignal>", we make
8990 C++ wrappers for functions that are not ANSI C or ANSI C++.
8992 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8993 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8994 lyx it has been renamed to sum.
8996 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8998 * src/text.C: add using directives for std::min and std::max.
9000 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9002 * src/texrow.C (getIdFromRow): actually return something useful in
9003 id and pos. Hopefully fixes the bug with positionning of errorbox
9006 * src/lyx_main.C (easyParse): output an error and exit if an
9007 incorrect command line option has been given.
9009 * src/spellchecker.C (ispell_check_word): document a memory leak.
9011 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9012 where a "struct utimbuf" is allocated with "new" and deleted with
9015 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9017 * src/text2.C (CutSelection): don't delete double spaces.
9018 (PasteSelection): ditto
9019 (CopySelection): ditto
9021 * src/text.C (Backspace): don't delete double spaces.
9023 * src/lyxlex.C (next): fix a bug that were only present with
9024 conformant std::istream::get to read comment lines, use
9025 std::istream::getline instead. This seems to fix the problem.
9027 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9029 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9030 allowed to insert space before space" editing problem. Please read
9031 commends at the beginning of the function. Comments about usage
9034 * src/text.C (InsertChar): fix for the "not allowed to insert
9035 space before space" editing problem.
9037 * src/text2.C (DeleteEmptyParagraphMechanism): when
9038 IsEmptyTableRow can only return false this last "else if" will
9039 always be a no-op. Commented out.
9041 * src/text.C (RedoParagraph): As far as I can understand tmp
9042 cursor is not really needed.
9044 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9045 present it could only return false anyway.
9046 (several functions): Did something not so smart...added a const
9047 specifier on a lot of methods.
9049 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9050 and add a tmp->text.resize. The LyXParagraph constructor does the
9052 (BreakParagraphConservative): ditto
9054 * src/support/path.h (Path): add a define so that the wrong usage
9055 "Path("/tmp") will be flagged as a compilation error:
9056 "`unnamed_Path' undeclared (first use this function)"
9058 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9060 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9061 which was bogus for several reasons.
9063 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9067 * autogen.sh: do not use "type -path" (what's that anyway?).
9069 * src/support/filetools.C (findtexfile): remove extraneous space
9070 which caused a kpsewhich warning (at least with kpathsea version
9073 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9075 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9077 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9079 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9081 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9083 * src/paragraph.C (BreakParagraph): do not reserve space on text
9084 if we don't need to (otherwise, if pos_end < pos, we end up
9085 reserving huge amounts of memory due to bad unsigned karma).
9086 (BreakParagraphConservative): ditto, although I have not seen
9087 evidence the bug can happen here.
9089 * src/lyxparagraph.h: add a using std::list.
9091 2000-01-11 Juergen Vigna <jug@sad.it>
9093 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9096 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9098 * src/vc-backend.C (doVCCommand): change to be static and take one
9099 more parameter: the path to chdir too be fore executing the command.
9100 (retrive): new function equiv to "co -r"
9102 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9103 file_not_found_hook is true.
9105 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9107 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9108 if a file is readwrite,readonly...anything else.
9110 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9112 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9113 (CreatePostscript): name change from MenuRunDVIPS (or something)
9114 (PreviewPostscript): name change from MenuPreviewPS
9115 (PreviewDVI): name change from MenuPreviewDVI
9117 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9118 \view_pdf_command., \pdf_to_ps_command
9120 * lib/configure.m4: added search for PDF viewer, and search for
9121 PDF to PS converter.
9122 (lyxrc.defaults output): add \pdflatex_command,
9123 \view_pdf_command and \pdf_to_ps_command.
9125 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9127 * src/bufferlist.C (write): we don't use blocksize for anything so
9130 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9132 * src/support/block.h: disable operator T* (), since it causes
9133 problems with both compilers I tried. See comments in the file.
9135 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9138 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9139 variable LYX_DIR_10x to LYX_DIR_11x.
9141 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9143 * INSTALL: document --with-lyxname.
9146 * configure.in: new configure flag --with-lyxname which allows to
9147 choose the name under which lyx is installed. Default is "lyx", of
9148 course. It used to be possible to do this with --program-suffix,
9149 but the later has in fact a different meaning for autoconf.
9151 * src/support/lstrings.h (lstrchr): reformat a bit.
9153 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9154 * src/mathed/math_defs.h: ditto.
9156 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9158 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9159 true, decides if we create a backup file or not when saving. New
9160 tag and variable \pdf_mode, defaults to false. New tag and
9161 variable \pdflatex_command, defaults to pdflatex. New tag and
9162 variable \view_pdf_command, defaults to xpdf. New tag and variable
9163 \pdf_to_ps_command, defaults to pdf2ps.
9165 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9167 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9168 does not have a BufferView.
9169 (unlockInset): ditto + don't access the_locking_inset if the
9170 buffer does not have a BufferView.
9172 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9173 certain circumstances so that we don't continue a keyboard
9174 operation long after the key was released. Try f.ex. to load a
9175 large document, press PageDown for some seconds and then release
9176 it. Before this change the document would contine to scroll for
9177 some time, with this change it stops imidiatly.
9179 * src/support/block.h: don't allocate more space than needed. As
9180 long as we don't try to write to the arr[x] in a array_type arr[x]
9181 it is perfectly ok. (if you write to it you might segfault).
9182 added operator value_type*() so that is possible to pass the array
9183 to functions expecting a C-pointer.
9185 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9188 * intl/*: updated to gettext 0.10.35, tried to add our own
9189 required modifications. Please verify.
9191 * po/*: updated to gettext 0.10.35, tried to add our own required
9192 modifications. Please verify.
9194 * src/support/lstrings.C (tostr): go at fixing the problem with
9195 cxx and stringstream. When stringstream is used return
9196 oss.str().c_str() so that problems with lyxstring and basic_string
9197 are avoided. Note that the best solution would be for cxx to use
9198 basic_string all the way, but it is not conformant yet. (it seems)
9200 * src/lyx_cb.C + other files: moved several global functions to
9201 class BufferView, some have been moved to BufferView.[Ch] others
9202 are still located in lyx_cb.C. Code changes because of this. (part
9203 of "get rid of current_view project".)
9205 * src/buffer.C + other files: moved several Buffer functions to
9206 class BufferView, the functions are still present in buffer.C.
9207 Code changes because of this.
9209 * config/lcmessage.m4: updated to most recent. used when creating
9212 * config/progtest.m4: updated to most recent. used when creating
9215 * config/gettext.m4: updated to most recent. applied patch for
9218 * config/gettext.m4.patch: new file that shows what changes we
9219 have done to the local copy of gettext.m4.
9221 * config/libtool.m4: new file, used in creation of acinclude.m4
9223 * config/lyxinclude.m4: new file, this is the lyx created m4
9224 macros, used in making acinclude.m4.
9226 * autogen.sh: GNU m4 discovered as a separate task not as part of
9227 the lib/configure creation.
9228 Generate acinlucde from files in config. Actually cat
9229 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9230 easier to upgrade .m4 files that really are external.
9232 * src/Spacing.h: moved using std::istringstream to right after
9233 <sstream>. This should fix the problem seen with some compilers.
9235 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9237 * src/lyx_cb.C: began some work to remove the dependency a lot of
9238 functions have on BufferView::text, even if not really needed.
9239 (GetCurrentTextClass): removed this func, it only hid the
9242 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9243 forgot this in last commit.
9245 * src/Bullet.C (bulletEntry): use static char const *[] for the
9246 tables, becuase of this the return arg had to change to string.
9248 (~Bullet): removed unneeded destructor
9250 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9251 (insetSleep): moved from Buffer
9252 (insetWakeup): moved from Buffer
9253 (insetUnlock): moved from Buffer
9255 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9256 from Buffer to BufferView.
9258 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9260 * config/ltmain.sh: updated to version 1.3.4 of libtool
9262 * config/ltconfig: updated to version 1.3.4 of libtool
9264 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9267 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9268 Did I get that right?
9270 * src/lyxlex.h: add a "using" directive or two.
9271 * src/Spacing.h: ditto.
9272 * src/insets/figinset.C: ditto.
9273 * src/support/filetools.C: ditto.
9274 * src/support/lstrings.C: ditto.
9275 * src/BufferView.C: ditto.
9276 * src/bufferlist.C: ditto.
9277 * src/lyx_cb.C: ditto.
9278 * src/lyxlex.C: ditto.
9280 * NEWS: add some changes for 1.1.4.
9282 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9284 * src/BufferView.C: first go at a TextCache to speed up switching
9287 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9289 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9290 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9291 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9292 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9295 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9296 members of the struct are correctly initialized to 0 (detected by
9298 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9299 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9301 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9302 pidwait, since it was allocated with "new". This was potentially
9303 very bad. Thanks to Michael Schmitt for running purify for us.
9306 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9308 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9310 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9312 1999-12-30 Allan Rae <rae@lyx.org>
9314 * lib/templates/IEEEtran.lyx: minor change
9316 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9317 src/mathed/formula.C (LocalDispatch): askForText changes
9319 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9320 know when a user has cancelled input. Fixes annoying problems with
9321 inserting labels and version control.
9323 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9325 * src/support/lstrings.C (tostr): rewritten to use strstream and
9328 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9330 * src/support/filetools.C (IsFileWriteable): use fstream to check
9331 (IsDirWriteable): use fileinfo to check
9333 * src/support/filetools.h (FilePtr): whole class deleted
9335 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9337 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9339 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9341 * src/bufferlist.C (write): use ifstream and ofstream instead of
9344 * src/Spacing.h: use istrstream instead of sscanf
9346 * src/mathed/math_defs.h: change first arg to istream from FILE*
9348 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9350 * src/mathed/math_parser.C: have yyis to be an istream
9351 (LexGetArg): use istream (yyis)
9353 (mathed_parse): ditto
9354 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9356 * src/mathed/formula.C (Read): rewritten to use istream
9358 * src/mathed/formulamacro.C (Read): rewritten to use istream
9360 * src/lyxlex.h (~LyXLex): deleted desturctor
9361 (getStream): new function, returns an istream
9362 (getFile): deleted funtion
9363 (IsOK): return is.good();
9365 * src/lyxlex.C (LyXLex): delete file and owns_file
9366 (setFile): open an filebuf and assign that to a istream instead of
9368 (setStream): new function, takes an istream as arg.
9369 (setFile): deleted function
9370 (EatLine): rewritten us use istream instead of FILE*
9374 * src/table.C (LyXTable): use istream instead of FILE*
9375 (Read): rewritten to take an istream instead of FILE*
9377 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9379 * src/buffer.C (Dispatch): remove an extraneous break statement.
9381 * src/support/filetools.C (QuoteName): change to do simple
9382 'quoting'. More work is necessary. Also changed to do nothing
9383 under emx (needs fix too).
9384 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9386 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9387 config.h.in to the AC_DEFINE_UNQUOTED() call.
9388 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9389 needs char * as argument (because Solaris 7 declares it like
9392 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9393 remove definition of BZERO.
9395 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9397 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9398 defined, "lyxregex.h" if not.
9400 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9402 (REGEX): new variable that is set to regex.c lyxregex.h when
9403 AM_CONDITIONAL USE_REGEX is set.
9404 (libsupport_la_SOURCES): add $(REGEX)
9406 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9409 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9412 * configure.in: add call to LYX_REGEX
9414 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9415 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9417 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9419 * lib/bind/fi_menus.bind: new file, from
9420 pauli.virtanen@saunalahti.fi.
9422 * src/buffer.C (getBibkeyList): pass the parameter delim to
9423 InsetInclude::getKeys and InsetBibtex::getKeys.
9425 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9426 is passed to Buffer::getBibkeyList
9428 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9429 instead of the hardcoded comma.
9431 * src/insets/insetbib.C (getKeys): make sure that there are not
9432 leading blanks in bibtex keys. Normal latex does not care, but
9433 harvard.sty seems to dislike blanks at the beginning of citation
9434 keys. In particular, the retturn value of the function is
9436 * INSTALL: make it clear that libstdc++ is needed and that gcc
9437 2.7.x probably does not work.
9439 * src/support/filetools.C (findtexfile): make debug message go to
9441 * src/insets/insetbib.C (getKeys): ditto
9443 * src/debug.C (showTags): make sure that the output is correctly
9446 * configure.in: add a comment for TWO_COLOR_ICON define.
9448 * acconfig.h: remove all the entries that already defined in
9449 configure.in or acinclude.m4.
9451 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9452 to avoid user name, date and copyright.
9454 1999-12-21 Juergen Vigna <jug@sad.it>
9456 * src/table.C (Read): Now read bogus row format informations
9457 if the format is < 5 so that afterwards the table can
9458 be read by lyx but without any format-info. Fixed the
9459 crash we experienced when not doing this.
9461 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9463 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9464 (RedoDrawingOfParagraph): ditto
9465 (RedoParagraphs): ditto
9466 (RemoveTableRow): ditto
9468 * src/text.C (Fill): rename arg paperwidth -> paper_width
9470 * src/buffer.C (insertLyXFile): rename var filename -> fname
9471 (writeFile): rename arg filename -> fname
9472 (writeFileAscii): ditto
9473 (makeLaTeXFile): ditto
9474 (makeLinuxDocFile): ditto
9475 (makeDocBookFile): ditto
9477 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9480 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9482 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9485 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9486 compiled by a C compiler not C++.
9488 * src/layout.h (LyXTextClass): added typedef for const_iterator
9489 (LyXTextClassList): added typedef for const_iterator + member
9490 functions begin and end.
9492 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9493 iterators to fill the choice_class.
9494 (updateLayoutChoice): rewritten to use iterators to fill the
9495 layoutlist in the toolbar.
9497 * src/BufferView.h (BufferView::work_area_width): removed unused
9500 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9502 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9503 (sgmlCloseTag): ditto
9505 * src/support/lstrings.h: return type of countChar changed to
9508 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9509 what version of this func to use. Also made to return unsigned int.
9511 * configure.in: call LYX_STD_COUNT
9513 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9514 conforming std::count.
9516 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9518 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9519 and a subscript would give bad display (patch from Dekel Tsur
9520 <dekel@math.tau.ac.il>).
9522 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9524 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9527 * src/chset.h: add a few 'using' directives
9529 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9530 triggered when no buffer is active
9532 * src/layout.C: removed `break' after `return' in switch(), since
9535 * src/lyx_main.C (init): make sure LyX can be ran in place even
9536 when libtool has done its magic with shared libraries. Fix the
9537 test for the case when the system directory has not been found.
9539 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9540 name for the latex file.
9541 (MenuMakeHTML): ditto
9543 * src/buffer.h: add an optional boolean argument, which is passed
9546 1999-12-20 Allan Rae <rae@lyx.org>
9548 * lib/templates/IEEEtran.lyx: small correction and update.
9550 * configure.in: Attempted to use LYX_PATH_HEADER
9552 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9554 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9555 input from JMarc. Now use preprocessor to find the header.
9556 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9557 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9558 LYX_STL_STRING_FWD. See comments in file.
9560 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9562 * The global MiniBuffer * minibuffer variable is dead.
9564 * The global FD_form_main * fd_form_main variable is dead.
9566 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9568 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9570 * src/table.h: add the LOstream.h header
9571 * src/debug.h: ditto
9573 * src/LyXAction.h: change the explaination of the ReadOnly
9574 attribute: is indicates that the function _can_ be used.
9576 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9579 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9581 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9587 * src/paragraph.C (GetWord): assert on pos>=0
9590 * src/support/lyxstring.C: condition the use of an invariant on
9592 * src/support/lyxstring.h: ditto
9594 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9595 Use LAssert.h instead of plain assert().
9597 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9599 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9600 * src/support/filetools.C: ditto
9602 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9605 * INSTALL: document the new configure flags
9607 * configure.in: suppress --with-debug; add --enable-assertions
9609 * acinclude.m4: various changes in alignment of help strings.
9611 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9613 * src/kbmap.C: commented out the use of the hash map in kb_map,
9614 beginning of movement to a stl::container.
9616 * several files: removed code that was not in effect when
9617 MOVE_TEXT was defined.
9619 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9620 for escaping should not be used. We can discuss if the string
9621 should be enclosed in f.ex. [] instead of "".
9623 * src/trans_mgr.C (insert): use the new returned value from
9624 encodeString to get deadkeys and keymaps done correctly.
9626 * src/chset.C (encodeString): changed to return a pair, to tell
9627 what to use if we know the string.
9629 * src/lyxscreen.h (fillArc): new function.
9631 * src/FontInfo.C (resize): rewritten to use more std::string like
9632 structore, especially string::replace.
9634 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9637 * configure.in (chmod +x some scripts): remove config/gcc-hack
9639 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9641 * src/buffer.C (writeFile): change once again the top comment in a
9642 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9643 instead of an hardcoded version number.
9644 (makeDocBookFile): ditto
9646 * src/version.h: add new define LYX_DOCVERSION
9648 * po/de.po: update from Pit Sütterlin
9649 * lib/bind/de_menus.bind: ditto.
9651 * src/lyxfunc.C (Dispatch): call MenuExport()
9652 * src/buffer.C (Dispatch): ditto
9654 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9655 LyXFunc::Dispatch().
9656 (MenuExport): new function, moved from
9657 LyXFunc::Dispatch().
9659 * src/trans_mgr.C (insert): small cleanup
9660 * src/chset.C (loadFile): ditto
9662 * lib/kbd/iso8859-1.cdef: add missing backslashes
9664 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9666 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9667 help with placing the manually drawn accents better.
9669 (Draw): x2 and hg changed to float to minimize rounding errors and
9670 help place the accents better.
9672 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9673 unsigned short to char is just wrong...cast the char to unsigned
9674 char instead so that the two values can compare sanely. This
9675 should also make the display of insetlatexaccents better and
9676 perhaps also some other insets.
9678 (lbearing): new function
9681 1999-12-15 Allan Rae <rae@lyx.org>
9683 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9684 header that provides a wrapper around the very annoying SGI STL header
9687 * src/support/lyxstring.C, src/LString.h:
9688 removed old SGI-STL-compatability attempts.
9690 * configure.in: Use LYX_STL_STRING_FWD.
9692 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9693 stl_string_fwd.h is around and try to determine it's location.
9694 Major improvement over previous SGI STL 3.2 compatability.
9695 Three small problems remain with this function due to my zero
9696 knowledge of autoconf. JMarc and lgb see the comments in the code.
9698 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9700 * src/broken_const.h, config/hack-gcc, config/README: removed
9702 * configure.in: remove --with-gcc-hack option; do not call
9705 * INSTALL: remove documentation of --with-broken-const and
9708 * acconfig.h: remove all trace of BROKEN_CONST define
9710 * src/buffer.C (makeDocBookFile): update version number in output
9712 (SimpleDocBookOnePar): fix an assert when trying to a character
9713 access beyond string length
9716 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9718 * po/de.po: fix the Export menu
9720 * lyx.man: update the description of -dbg
9722 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9723 (commandLineHelp): updated
9724 (easyParse): show list of available debug levels if -dbg is passed
9727 * src/Makefile.am: add debug.C
9729 * src/debug.h: moved some code to debug.C
9731 * src/debug.C: new file. Contains code to set and show debug
9734 * src/layout.C: remove 'break' after 'continue' in switch
9735 statements, since these cannot be reached.
9737 1999-12-13 Allan Rae <rae@lyx.org>
9739 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9740 (in_word_set): hash() -> math_hash()
9742 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9744 * acconfig.h: Added a test for whether we are using exceptions in the
9745 current compilation run. If so USING_EXCEPTIONS is defined.
9747 * config.in: Check for existance of stl_string_fwd.h
9748 * src/LString.h: If compiling --with-included-string and SGI's
9749 STL version 3.2 is present (see above test) we need to block their
9750 forward declaration of string and supply a __get_c_string().
9751 However, it turns out this is only necessary if compiling with
9752 exceptions enabled so I've a bit more to add yet.
9754 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9755 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9756 src/support/LRegex.h, src/undo.h:
9757 Shuffle the order of the included files a little to ensure that
9758 LString.h gets included before anything that includes stl_string_fwd.h
9760 * src/support/lyxstring.C: We need to #include LString.h instead of
9761 lyxstring.h to get the necessary definition of __get_c_string.
9762 (__get_c_string): New function. This is defined static just like SGI's
9763 although why they need to do this I'm not sure. Perhaps it should be
9764 in lstrings.C instead.
9766 * lib/templates/IEEEtran.lyx: New template file.
9768 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9770 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9771 * intl/Makefile.in (MKINSTALLDIRS): ditto
9773 * src/LyXAction.C (init): changed to hold the LFUN data in a
9774 automatic array in stead of in callso to newFunc, this speeds up
9775 compilation a lot. Also all the memory used by the array is
9776 returned when the init is completed.
9778 * a lot of files: compiled with -Wold-style-cast, changed most of
9779 the reported offenders to C++ style casts. Did not change the
9780 offenders in C files.
9782 * src/trans.h (Match): change argument type to unsigned int.
9784 * src/support/DebugStream.C: fix some types on the streambufs so
9785 that it works on a conforming implementation.
9787 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9789 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9791 * src/support/lyxstring.C: remove the inline added earlier since
9792 they cause a bunch of unsatisfied symbols when linking with dec
9793 cxx. Cxx likes to have the body of inlines at the place where they
9796 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9797 accessing negative bounds in array. This fixes the crash when
9798 inserting accented characters.
9799 * src/trans.h (Match): ditto
9801 * src/buffer.C (Dispatch): since this is a void, it should not try
9802 to return anything...
9804 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9806 * src/buffer.h: removed the two friends from Buffer. Some changes
9807 because of this. Buffer::getFileName and Buffer::setFileName
9808 renamed to Buffer::fileName() and Buffer::fileName(...).
9810 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9812 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9813 and Buffer::update(short) to BufferView. This move is currently
9814 controlled by a define MOVE_TEXT, this will be removed when all
9815 shows to be ok. This move paves the way for better separation
9816 between buffer contents and buffer view. One side effect is that
9817 the BufferView needs a rebreak when swiching buffers, if we want
9818 to avoid this we can add a cache that holds pointers to LyXText's
9819 that is not currently in use.
9821 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9824 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9826 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9828 * lyx_main.C: new command line option -x (or --execute) and
9829 -e (or --export). Now direct conversion from .lyx to .tex
9830 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9831 Unfortunately, X is still needed and the GUI pops up during the
9834 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9836 * src/Spacing.C: add a using directive to bring stream stuff into
9838 * src/paragraph.C: ditto
9839 * src/buffer.C: ditto
9841 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9842 from Lars' announcement).
9844 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9845 example files from Tino Meinen.
9847 1999-12-06 Allan Rae <rae@lyx.org>
9849 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9851 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9853 * src/support/lyxstring.C: added a lot of inline for no good
9856 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9857 latexWriteEndChanges, they were not used.
9859 * src/layout.h (operator<<): output operator for PageSides
9861 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9863 * some example files: loaded in LyX 1.0.4 and saved again to update
9864 certain constructs (table format)
9866 * a lot of files: did the change to use fstream/iostream for all
9867 writing of files. Done with a close look at Andre Poenitz's patch.
9869 * some files: whitespace changes.
9871 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9873 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9874 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9875 architecture, we provide our own. It is used unconditionnally, but
9876 I do not think this is a performance problem. Thanks to Angus
9877 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9878 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9880 (GetInset): use my_memcpy.
9884 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9885 it is easier to understand, but it uses less TeX-only constructs now.
9887 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9888 elements contain spaces
9890 * lib/configure: regenerated
9892 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9893 elements contain spaces; display the list of programs that are
9896 * autogen.sh: make sure lib/configure is executable
9898 * lib/examples/*: rename the tutorial examples to begin with the
9899 two-letters language code.
9901 * src/lyxfunc.C (getStatus): do not query current font if no
9904 * src/lyx_cb.C (RunScript): use QuoteName
9905 (MenuRunDvips): ditto
9906 (PrintApplyCB): ditto
9908 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9909 around argument, so that it works well with the current shell.
9910 Does not work properly with OS/2 shells currently.
9912 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9913 * src/LyXSendto.C (SendtoApplyCB): ditto
9914 * src/lyxfunc.C (Dispatch): ditto
9915 * src/buffer.C (runLaTeX): ditto
9916 (runLiterate): ditto
9917 (buildProgram): ditto
9919 * src/lyx_cb.C (RunScript): ditto
9920 (MenuMakeLaTeX): ditto
9922 * src/buffer.h (getLatexName): new method
9924 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9926 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9928 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9929 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9930 (create_math_panel): ditto
9932 * src/lyxfunc.C (getStatus): re-activate the code which gets
9933 current font and cursor; add test for export to html.
9935 * src/lyxrc.C (read): remove unreachable break statements; add a
9938 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9940 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9942 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9943 introduced by faulty regex.
9944 * src/buffer.C: ditto
9945 * src/lastfiles.C: ditto
9946 * src/paragraph.C: ditto
9947 * src/table.C: ditto
9948 * src/vspace.C: ditto
9949 * src/insets/figinset.C: ditto
9950 Note: most of these is absolutely harmless, except the one in
9951 src/mathed formula.C.
9953 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9955 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9956 operation, yielding correct results for the reLyX command.
9958 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9960 * src/support/filetools.C (ExpandPath): removed an over eager
9962 (ReplaceEnvironmentPath): ditto
9964 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9965 shows that we are doing something fishy in our code...
9969 * src/lyxrc.C (read): use a double switch trick to get more help
9970 from the compiler. (the same trick is used in layout.C)
9971 (write): new function. opens a ofstream and pass that to output
9972 (output): new function, takes a ostream and writes the lyxrc
9973 elemts to it. uses a dummy switch to make sure no elements are
9976 * src/lyxlex.h: added a struct pushpophelper for use in functions
9977 with more than one exit point.
9979 * src/lyxlex.[Ch] (GetInteger): made it const
9983 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9985 * src/layout.[hC] : LayoutTags splitted into several enums, new
9986 methods created, better error handling cleaner use of lyxlex. Read
9989 * src/bmtable.[Ch]: change some member prototypes because of the
9990 image const changes.
9992 * commandtags.h, src/LyXAction.C (init): new function:
9993 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9994 This file is not read automatically but you can add \input
9995 preferences to your lyxrc if you want to. We need to discuss how
9998 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9999 in .aux, also remove .bib and .bst files from dependencies when
10002 * src/BufferView.C, src/LyXView.C: add const_cast several places
10003 because of changes to images.
10005 * lib/images/*: same change as for images/*
10007 * lib/lyxrc.example: Default for accept_compound is false not no.
10009 * images/*: changed to be const, however I have som misgivings
10010 about this change so it might be changed back.
10012 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10014 * lib/configure, po/POTFILES.in: regenerated
10016 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10018 * config/lib_configure.m4: removed
10020 * lib/configure.m4: new file (was config/lib_configure.m4)
10022 * configure.in: do not test for rtti, since we do not use it.
10024 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10026 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10027 doubling of allocated space scheme. This makes it faster for large
10028 strings end to use less memory for small strings. xtra rememoved.
10030 * src/insets/figinset.C (waitalarm): commented out.
10031 (GhostscriptMsg): use static_cast
10032 (GhostscriptMsg): use new instead of malloc to allocate memory for
10033 cmap. also delete the memory after use.
10035 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10037 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10038 for changes in bibtex database or style.
10039 (runBibTeX): remove all .bib and .bst files from dep before we
10041 (run): use scanAuc in when dep file already exist.
10043 * src/DepTable.C (remove_files_with_extension): new method
10044 (exist): new method
10046 * src/DepTable.[Ch]: made many of the methods const.
10048 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10050 * src/bufferparams.C: make sure that the default textclass is
10051 "article". It used to be the first one by description order, but
10052 now the first one is "docbook".
10054 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10055 string; call Debug::value.
10056 (easyParse): pass complete argument to setDebuggingLevel().
10058 * src/debug.h (value): fix the code that parses debug levels.
10060 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10063 * src/LyXAction.C: use Debug::ACTION as debug channel.
10065 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10067 * NEWS: updated for the future 1.1.3 release.
10069 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10070 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10071 it should. This is of course a controversial change (since many
10072 people will find that their lyx workscreen is suddenly full of
10073 red), but done for the sake of correctness.
10075 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10076 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10078 * src/insets/inseterror.h, src/insets/inseturl.h,
10079 src/insets/insetinfo.h, src/insets/figinset.h,
10080 src/mathed/formulamacro.h, src/mathed/math_macro.h
10081 (EditMessage): add a missing const and add _() to make sure that
10082 translation happens
10084 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10085 src/insets/insetbib.C, src/support/filetools.C: add `using'
10086 directives for cxx.
10088 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10089 doing 'Insert index of last word' at the beginning of a paragraph.
10091 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10093 * several files: white-space changes.
10095 * src/mathed/formula.C: removed IsAlpha and IsDigit
10097 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10098 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10101 * src/insets/figinset.C (GetPSSizes): don't break when
10102 "EndComments" is seen. But break when a boundingbox is read.
10104 * all classes inherited from Inset: return value of Clone
10105 changed back to Inset *.
10107 * all classes inherited form MathInset: return value of Clone
10108 changed back to MathedInset *.
10110 * src/insets/figinset.C (runqueue): use a ofstream to output the
10111 gs/ps file. Might need some setpresicion or setw. However I can
10112 see no problem with the current code.
10113 (runqueue): use sleep instead of the alarm/signal code. I just
10114 can't see the difference.
10116 * src/paragraph.C (LyXParagraph): reserve space in the new
10117 paragraph and resize the inserted paragraph to just fit.
10119 * src/lyxfunc.h (operator|=): added operator for func_status.
10121 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10122 check for readable file.
10124 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10125 check for readable file.
10126 (MenuMakeLinuxDoc): ditto
10127 (MenuMakeDocBook): ditto
10128 (MenuMakeAscii): ditto
10129 (InsertAsciiFile): split the test for openable and readable
10131 * src/bmtable.C (draw_bitmaptable): use
10132 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10134 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10135 findtexfile from LaTeX to filetools.
10137 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10138 instead of FilePtr. Needs to be verified by a literate user.
10140 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10142 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10143 (EditMessage): likewise.
10145 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10146 respectively as \textasciitilde and \textasciicircum.
10148 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10150 * src/support/lyxstring.h: made the methods that take iterators
10151 use const_iterator.
10153 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10154 (regexMatch): made is use the real regex class.
10156 * src/support/Makefile.am: changed to use libtool
10158 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10160 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10162 (MathIsInset ++): changed several macros to be inline functions
10165 * src/mathed/Makefile.am: changed to use libtool
10167 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10169 * src/insets/inset* : Clone changed to const and return type is
10170 the true insettype not just Inset*.
10172 * src/insets/Makefile.am: changed to use libtool
10174 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10176 * src/undo.[Ch] : added empty() and changed some of the method
10179 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10181 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10182 setID use block<> for the bullets array, added const several places.
10184 * src/lyxfunc.C (getStatus): new function
10186 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10187 LyXAction, added const to several funtions.
10189 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10190 a std::map, and to store the dir items in a vector.
10192 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10195 * src/LyXView.[Ch] + other files : changed currentView to view.
10197 * src/LyXAction.[Ch] : ported from the old devel branch.
10199 * src/.cvsignore: added .libs and a.out
10201 * configure.in : changes to use libtool.
10203 * acinclude.m4 : inserted libtool.m4
10205 * .cvsignore: added libtool
10207 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10209 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10210 file name in insets and mathed directories (otherwise the
10211 dependency is not taken in account under cygwin).
10213 * src/text2.C (InsertString[AB]): make sure that we do not try to
10214 read characters past the string length.
10216 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10218 * lib/doc/LaTeXConfig.lyx.in,
10219 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10221 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10222 file saying who created them and when this heppened; this is
10223 useless and annoys tools like cvs.
10225 * lib/layouts/g-brief-{en,de}.layout,
10226 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10227 from Thomas Hartkens <thomas@hartkens.de>.
10229 * src/{insets,mathed}/Makefile.am: do not declare an empty
10230 LDFLAGS, so that it can be set at configure time (useful on Irix
10233 * lib/reLyX/configure.in: make sure that the prefix is set
10234 correctly in LYX_DIR.
10236 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10238 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10239 be used by 'command-sequence' this allows to bind a key to a
10240 sequence of LyX-commands
10241 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10243 * src/LyXAction.C: add "command-sequence"
10245 * src/LyXFunction.C: handling of "command-sequence"
10247 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10248 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10250 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10252 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10254 * src/buffer.C (writeFile): Do not output a comment giving user
10255 and date at the beginning of a .lyx file. This is useless and
10256 annoys cvs anyway; update version number to 1.1.
10258 * src/Makefile.am (LYX_DIR): add this definition, so that a
10259 default path is hardcoded in LyX.
10261 * configure.in: Use LYX_GNU_GETTEXT.
10263 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10264 AM_GNU_GETTEXT with a bug fixed.
10266 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10268 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10270 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10271 which is used to point to LyX data is now LYX_DIR_11x.
10273 * lyx.man: convert to a unix text file; small updates.
10275 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10277 * src/support/LSubstring.[Ch]: made the second arg of most of the
10278 constructors be a const reference.
10280 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10283 * src/support/lyxstring.[Ch] (swap): added missing member function
10284 and specialization of swap(str, str);
10286 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10288 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10289 trace of the old one.
10291 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10292 put the member definitions in undo.C.
10294 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10295 NEW_TEXT and have now only code that was included when this was
10298 * src/intl.C (LCombo): use static_cast
10300 (DispatchCallback): ditto
10302 * src/definitions.h: removed whole file
10304 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10306 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10307 parsing and stores in a std:map. a regex defines the file format.
10308 removed unneeded members.
10310 * src/bufferparams.h: added several enums from definitions.h here.
10311 Removed unsused destructor. Changed some types to use proper enum
10312 types. use block to have the temp_bullets and user_defined_bullets
10313 and to make the whole class assignable.
10315 * src/bufferparams.C (Copy): removed this functions, use a default
10316 assignment instead.
10318 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10321 * src/buffer.C (readLyXformat2): commend out all that have with
10322 oldpapersize to do. also comment out all that hve to do with
10323 insetlatex and insetlatexdel.
10324 (setOldPaperStuff): commented out
10326 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10328 * src/LyXAction.C: remove use of inset-latex-insert
10330 * src/mathed/math_panel.C (button_cb): use static_cast
10332 * src/insets/Makefile.am (insets_o_SOURCES): removed
10335 * src/support/lyxstring.C (helper): use the unsigned long
10336 specifier, UL, instead of a static_cast.
10338 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10340 * src/support/block.h: new file. to be used as a c-style array in
10341 classes, so that the class can be assignable.
10343 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10345 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10346 NULL, make sure to return an empty string (it is not possible to
10347 set a string to NULL).
10349 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10351 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10353 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10355 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10356 link line, so that Irix users (for example) can set it explicitely to
10359 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10360 it can be overidden at make time (static or dynamic link, for
10363 * src/vc-backend.C, src/LaTeXFeatures.h,
10364 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10365 statements to bring templates to global namespace.
10367 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10369 * src/support/lyxstring.C (operator[] const): make it standard
10372 * src/minibuffer.C (Init): changed to reflect that more
10373 information is given from the lyxvc and need not be provided here.
10375 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10377 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10379 * src/LyXView.C (UpdateTimerCB): use static_cast
10380 (KeyPressMask_raw_callback): ditto
10382 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10383 buffer_, a lot of changes because of this. currentBuffer() ->
10384 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10385 also changes to other files because of this.
10387 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10389 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10390 have no support for RCS and partial support for CVS, will be
10393 * src/insets/ several files: changes because of function name
10394 changes in Bufferview and LyXView.
10396 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10398 * src/support/LSubstring.[Ch]: new files. These implement a
10399 Substring that can be very convenient to use. i.e. is this
10401 string a = "Mary had a little sheep";
10402 Substring(a, "sheep") = "lamb";
10403 a is now "Mary has a little lamb".
10405 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10406 out patterns and subpatterns of strings. It is used by LSubstring
10407 and also by vc-backend.C
10409 * src/support/lyxstring.C: went over all the assertions used and
10410 tried to correct the wrong ones and flag which of them is required
10411 by the standard. some bugs found because of this. Also removed a
10412 couple of assertions.
10414 * src/support/Makefile.am (libsupport_a_SOURCES): added
10415 LSubstring.[Ch] and LRegex.[Ch]
10417 * src/support/FileInfo.h: have struct stat buf as an object and
10418 not a pointer to one, some changes because of this.
10420 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10421 information in layout when adding the layouts preamble to the
10422 textclass preamble.
10424 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10427 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10428 because of bug in OS/2.
10430 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10432 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10433 \verbatim@font instead of \ttfamily, so that it can be redefined.
10435 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10436 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10437 src/layout.h, src/text2.C: add 'using' directive to bring the
10438 STL templates we need from the std:: namespace to the global one.
10439 Needed by DEC cxx in strict ansi mode.
10441 * src/support/LIstream.h,src/support/LOstream.h,
10442 src/support/lyxstring.h,src/table.h,
10443 src/lyxlookup.h: do not include <config.h> in header
10444 files. This should be done in the .C files only.
10446 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10450 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10452 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10453 from Kayvan to fix the tth invokation.
10455 * development/lyx.spec.in: updates from Kayvan to reflect the
10456 changes of file names.
10458 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10460 * src/text2.C (InsertStringB): use std::copy
10461 (InsertStringA): use std::copy
10463 * src/bufferlist.C: use a vector to store the buffers in. This is
10464 an internal change and should not affect any other thing.
10466 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10469 * src/text.C (Fill): fix potential bug, one off bug.
10471 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10473 * src/Makefile.am (lyx_main.o): add more files it depends on.
10475 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10477 * src/support/lyxstring.C: use size_t for the reference count,
10478 size, reserved memory and xtra.
10479 (internal_compare): new private member function. Now the compare
10480 functions should work for std::strings that have embedded '\0'
10482 (compare): all compare functions rewritten to use
10485 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10487 * src/support/lyxstring.C (compare): pass c_str()
10488 (compare): pass c_str
10489 (compare): pass c_str
10491 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10493 * src/support/DebugStream.C: <config.h> was not included correctly.
10495 * lib/configure: forgot to re-generate it :( I'll make this file
10496 auto generated soon.
10498 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10500 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10503 * src/support/lyxstring.C: some changes from length() to rep->sz.
10504 avoids a function call.
10506 * src/support/filetools.C (SpaceLess): yet another version of the
10507 algorithm...now per Jean-Marc's suggestions.
10509 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10511 * src/layout.C (less_textclass_desc): functor for use in sorting
10513 (LyXTextClass::Read): sort the textclasses after reading.
10515 * src/support/filetools.C (SpaceLess): new version of the
10516 SpaceLess functions. What problems does this one give? Please
10519 * images/banner_bw.xbm: made the arrays unsigned char *
10521 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10523 * src/support/lyxstring.C (find): remove bogus assertion in the
10524 two versions of find where this has not been done yet.
10526 * src/support/lyxlib.h: add missing int return type to
10529 * src/menus.C (ShowFileMenu): disable exporting to html if no
10530 html export command is present.
10532 * config/lib_configure.m4: add a test for an HTML converter. The
10533 programs checked for are, in this order: tth, latex2html and
10536 * lib/configure: generated from config/lib_configure.m4.
10538 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10539 html converter. The parameters are now passed through $$FName and
10540 $$OutName, instead of standard input/output.
10542 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10544 * lib/lyxrc.example: update description of \html_command.
10545 add "quotes" around \screen_font_xxx font setting examples to help
10546 people who use fonts with spaces in their names.
10548 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10550 * Distribution files: updates for v1.1.2
10552 * src/support/lyxstring.C (find): remove bogus assert and return
10553 npos for the same condition.
10555 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10557 * added patch for OS/2 from SMiyata.
10559 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10561 * src/text2.C (CutSelection): make space_wrapped a bool
10562 (CutSelection): dont declare int i until we have to.
10563 (alphaCounter): return a char const *.
10565 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10567 * src/support/syscall.C (Systemcalls::kill):
10568 src/support/filetools.C (PutEnv, PutEnvPath):
10569 src/lyx_cb.C (addNewlineAndDepth):
10570 src/FontInfo.C (FontInfo::resize): condition some #warning
10571 directives with WITH_WARNINGS.
10574 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10576 * src/layout.[Ch] + several files: access to class variables
10577 limited and made accessor functions instead a lot of code changed
10578 becuase of this. Also instead of returning pointers often a const
10579 reference is returned instead.
10581 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10583 * src/Makefile.am (dist-hook): added used to remove the CVS from
10584 cheaders upon creating a dist
10585 (EXTRA_DIST): added cheaders
10587 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10588 a character not as a small integer.
10590 * src/support/lyxstring.C (find): removed Assert and added i >=
10591 rep->sz to the first if.
10593 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10595 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10596 src/LyXView.C src/buffer.C src/bufferparams.C
10597 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10598 src/text2.C src/insets/insetinclude.C:
10599 lyxlayout renamed to textclasslist.
10601 * src/layout.C: some lyxerr changes.
10603 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10604 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10605 (LyXLayoutList): removed all traces of this class.
10606 (LyXTextClass::Read): rewrote LT_STYLE
10607 (LyXTextClass::hasLayout): new function
10608 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10609 both const and nonconst version.
10610 (LyXTextClass::delete_layout): new function.
10611 (LyXTextClassList::Style): bug fix. do the right thing if layout
10613 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10614 (LyXTextClassList::NameOfLayout): ditto
10615 (LyXTextClassList::Load): ditto
10617 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10619 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10621 * src/LyXAction.C (LookupFunc): added a workaround for sun
10622 compiler, on the other hand...we don't know if the current code
10623 compiles on sun at all...
10625 * src/support/filetools.C (CleanupPath): subst fix
10627 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10630 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10631 complained about this one?
10633 * src/insets/insetinclude.C (Latex): subst fix
10635 * src/insets/insetbib.C (getKeys): subst fix
10637 * src/LyXSendto.C (SendtoApplyCB): subst fix
10639 * src/lyx_main.C (init): subst fix
10641 * src/layout.C (Read): subst fix
10643 * src/lyx_sendfax_main.C (button_send): subst fix
10645 * src/buffer.C (RoffAsciiTable): subst fix
10647 * src/lyx_cb.C (MenuFax): subst fix
10648 (PrintApplyCB): subst fix
10650 1999-10-26 Juergen Vigna <jug@sad.it>
10652 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10654 (Read): Cleaned up this code so now we read only format vestion >= 5
10656 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10658 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10659 come nobody has complained about this one?
10661 * src/insets/insetinclude.C (Latex): subst fix
10663 * src/insets/insetbib.C (getKeys): subst fix
10665 * src/lyx_main.C (init): subst fix
10667 * src/layout.C (Read): subst fix
10669 * src/buffer.C (RoffAsciiTable): subst fix
10671 * src/lyx_cb.C (MenuFax): subst fix.
10673 * src/layout.[hC] + some other files: rewrote to use
10674 std::container to store textclasses and layouts in.
10675 Simplified, removed a lot of code. Make all classes
10676 assignable. Further simplifications and review of type
10677 use still to be one.
10679 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10680 lastfiles to create the lastfiles partr of the menu.
10682 * src/lastfiles.[Ch]: rewritten to use deque to store the
10683 lastfiles in. Uses fstream for reading and writing. Simplifies
10686 * src/support/syscall.C: remove explicit cast.
10688 * src/BufferView.C (CursorToggleCB): removed code snippets that
10689 were commented out.
10690 use explicat C++ style casts instead of C style casts. also use
10691 u_vdata instea of passing pointers in longs.
10693 * src/PaperLayout.C: removed code snippets that were commented out.
10695 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10697 * src/lyx_main.C: removed code snippets that wer commented out.
10699 * src/paragraph.C: removed code snippets that were commented out.
10701 * src/lyxvc.C (logClose): use static_cast
10703 (viewLog): remove explicit cast to void*
10704 (showLog): removed old commented code
10706 * src/menus.C: use static_cast instead of C style casts. use
10707 u_vdata instead of u_ldata. remove explicit cast to (long) for
10708 pointers. Removed old code that was commented out.
10710 * src/insets/inset.C: removed old commented func
10712 * src/insets/insetref.C (InsetRef): removed old code that had been
10713 commented out for a long time.
10715 (escape): removed C style cast
10717 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10719 * src/insets/insetlatex.C (Draw): removed old commented code
10720 (Read): rewritten to use string
10722 * src/insets/insetlabel.C (escape): removed C style cast
10724 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10726 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10727 old commented code.
10729 * src/insets/insetinclude.h: removed a couple of stupid bools
10731 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10732 (Clone): remove C style cast
10733 (getKeys): changed list to lst because of std::list
10735 * src/insets/inseterror.C (Draw): removed som old commented code.
10737 * src/insets/insetcommand.C (Draw): removed some old commented code.
10739 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10740 commented out forever.
10741 (bibitem_cb): use static_cast instead of C style cast
10742 use of vdata changed to u_vdata.
10744 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10746 (CloseUrlCB): use static_cast instead of C style cast.
10747 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10749 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10750 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10751 (CloseInfoCB): static_cast from ob->u_vdata instead.
10752 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10755 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10756 (C_InsetError_CloseErrorCB): forward the ob parameter
10757 (CloseErrorCB): static_cast from ob->u_vdata instead.
10759 * src/vspace.h: include LString.h since we use string in this class.
10761 * src/vspace.C (lyx_advance): changed name from advance because of
10762 nameclash with stl. And since we cannot use namespaces yet...I
10763 used a lyx_ prefix instead. Expect this to change when we begin
10766 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10768 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10769 and removed now defunct constructor and deconstructor.
10771 * src/BufferView.h: have backstack as a object not as a pointer.
10772 removed initialization from constructor. added include for BackStack
10774 * development/lyx.spec.in (%build): add CFLAGS also.
10776 * src/screen.C (drawFrame): removed another warning.
10778 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10780 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10781 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10782 README and ANNOUNCE a bit for the next release. More work is
10785 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10786 unbreakable if we are in freespacing mode (LyX-Code), but not in
10789 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10791 * src/BackStack.h: fixed initialization order in constructor
10793 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10795 * acinclude.m4 (VERSION): new rules for when a version is
10796 development, added also a variable for prerelease.
10797 (warnings): we set with_warnings=yes for prereleases
10798 (lyx_opt): prereleases compile with same optimization as development
10799 (CXXFLAGS): only use pedantic if we are a development version
10801 * src/BufferView.C (restorePosition): don't do anything if the
10802 backstack is empty.
10804 * src/BackStack.h: added member empty, use this to test if there
10805 is anything to pop...
10807 1999-10-25 Juergen Vigna <jug@sad.it>
10810 * forms/layout_forms.fd +
10811 * forms/latexoptions.fd +
10812 * lyx.fd: changed for various form resize issues
10814 * src/mathed/math_panel.C +
10815 * src/insets/inseterror.C +
10816 * src/insets/insetinfo.C +
10817 * src/insets/inseturl.C +
10818 * src/insets/inseturl.h +
10820 * src/LyXSendto.C +
10821 * src/PaperLayout.C +
10822 * src/ParagraphExtra.C +
10823 * src/TableLayout.C +
10825 * src/layout_forms.C +
10832 * src/menus.C: fixed various resize issues. So now forms can be
10833 resized savely or not be resized at all.
10835 * forms/form_url.fd +
10836 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10839 * src/insets/Makefile.am: added files form_url.[Ch]
10841 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10843 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10844 (and presumably 6.2).
10846 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10847 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10848 remaining static member callbacks.
10850 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10853 * src/support/lyxstring.h: declare struct Srep as friend of
10854 lyxstring, since DEC cxx complains otherwise.
10856 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10858 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10860 * src/LaTeX.C (run): made run_bibtex also depend on files with
10862 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10863 are put into the dependency file.
10865 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10866 the code has shown itself to work
10867 (create_ispell_pipe): removed another warning, added a comment
10870 * src/minibuffer.C (ExecutingCB): removed code that has been
10871 commented out a long time
10873 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10874 out code + a warning.
10876 * src/support/lyxstring.h: comment out the three private
10877 operators, when compiling with string ansi conforming compilers
10878 they make problems.
10880 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10882 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10883 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10886 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10889 * src/mathed/math_panel.C (create_math_panel): remove explicit
10892 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10895 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10896 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10897 to XCreatePixmapFromBitmapData
10898 (fl_set_bmtable_data): change the last argument to be unsigned
10900 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10901 and bh to be unsigned int, remove explicit casts in call to
10902 XReadBitmapFileData.
10904 * images/arrows.xbm: made the arrays unsigned char *
10905 * images/varsz.xbm: ditto
10906 * images/misc.xbm: ditto
10907 * images/greek.xbm: ditto
10908 * images/dots.xbm: ditto
10909 * images/brel.xbm: ditto
10910 * images/bop.xbm: ditto
10912 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10914 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10915 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10916 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10918 (LYX_CXX_CHEADERS): added <clocale> to the test.
10920 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10922 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10924 * src/support/lyxstring.C (append): fixed something that must be a
10925 bug, rep->assign was used instead of rep->append.
10927 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10930 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10931 lyx insert double chars. Fix spotted by Kayvan.
10933 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10935 * Fixed the tth support. I messed up with the Emacs patch apply feature
10936 and omitted the changes in lyxrc.C.
10938 1999-10-22 Juergen Vigna <jug@sad.it>
10940 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10942 * src/lyx_cb.C (MenuInsertRef) +
10943 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10944 the form cannot be resized under it limits (fixes a segfault)
10946 * src/lyx.C (create_form_form_ref) +
10947 * forms/lyx.fd: Changed Gravity on name input field so that it is
10950 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10952 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10953 <ostream> and <istream>.
10955 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10956 whether <fstream> provides the latest standard features, or if we
10957 have an oldstyle library (like in egcs).
10958 (LYX_CXX_STL_STRING): fix the test.
10960 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10961 code on MODERN_STL_STREAM.
10963 * src/support/lyxstring.h: use L{I,O}stream.h.
10965 * src/support/L{I,O}stream.h: new files, designed to setup
10966 correctly streams for our use
10967 - includes the right header depending on STL capabilities
10968 - puts std::ostream and std::endl (for LOStream.h) or
10969 std::istream (LIStream.h) in toplevel namespace.
10971 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10973 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10974 was a bib file that had been changed we ensure that bibtex is run.
10975 (runBibTeX): enhanced to extract the names of the bib files and
10976 getting their absolute path and enter them into the dep file.
10977 (findtexfile): static func that is used to look for tex-files,
10978 checks for absolute patchs and tries also with kpsewhich.
10979 Alternative ways of finding the correct files are wanted. Will
10981 (do_popen): function that runs a command using popen and returns
10982 the whole output of that command in a string. Should be moved to
10985 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10986 file with extension ext has changed.
10988 * src/insets/figinset.C: added ifdef guards around the fl_free
10989 code that jug commented out. Now it is commented out when
10990 compiling with XForms == 0.89.
10992 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10993 to lyxstring.C, and only keep a forward declaration in
10994 lyxstring.h. Simplifies the header file a bit and should help a
10995 bit on compile time too. Also changes to Srep will not mandate a
10996 recompile of code just using string.
10997 (~lyxstring): definition moved here since it uses srep.
10998 (size): definition moved here since it uses srep.
11000 * src/support/lyxstring.h: removed a couple of "inline" that should
11003 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11005 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11008 1999-10-21 Juergen Vigna <jug@sad.it>
11010 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11011 set to left if I just remove the width entry (or it is empty).
11013 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11014 paragraph when having dummy paragraphs.
11016 1999-10-20 Juergen Vigna <jug@sad.it>
11018 * src/insets/figinset.C: just commented some fl_free_form calls
11019 and added warnings so that this calls should be activated later
11020 again. This avoids for now a segfault, but we have a memory leak!
11022 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11023 'const char * argument' to 'string argument', this should
11024 fix some Asserts() in lyxstring.C.
11026 * src/lyxfunc.h: Removed the function argAsString(const char *)
11027 as it is not used anymore.
11029 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11031 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11034 * src/Literate.h: some funcs moved from public to private to make
11035 interface clearer. Unneeded args removed.
11037 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11039 (scanBuildLogFile): ditto
11041 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11042 normal TeX Error. Still room for improvement.
11044 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11046 * src/buffer.C (insertErrors): changes to make the error
11047 desctription show properly.
11049 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11052 * src/support/lyxstring.C (helper): changed to use
11053 sizeof(object->rep->ref).
11054 (operator>>): changed to use a pointer instead.
11056 * src/support/lyxstring.h: changed const reference & to value_type
11057 const & lets see if that helps.
11059 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11061 * Makefile.am (rpmdist): fixed to have non static package and
11064 * src/support/lyxstring.C: removed the compilation guards
11066 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11069 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11070 conditional compile of lyxstring.Ch
11072 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11073 stupid check, but it is a lot better than the bastring hack.
11074 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11076 * several files: changed string::erase into string::clear. Not
11079 * src/chset.C (encodeString): use a char temporary instead
11081 * src/table.C (TexEndOfCell): added tostr around
11082 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11083 (TexEndOfCell): ditto
11084 (TexEndOfCell): ditto
11085 (TexEndOfCell): ditto
11086 (DocBookEndOfCell): ditto
11087 (DocBookEndOfCell): ditto
11088 (DocBookEndOfCell): ditto
11089 (DocBookEndOfCell): ditto
11091 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11093 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11095 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11096 (MenuBuildProg): added tostr around ret
11097 (MenuRunChktex): added tostr around ret
11098 (DocumentApplyCB): added tostr around ret
11100 * src/chset.C (encodeString): added tostr around t->ic
11102 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11103 (makeLaTeXFile): added tostr around tocdepth
11104 (makeLaTeXFile): added tostr around ftcound - 1
11106 * src/insets/insetbib.C (setCounter): added tostr around counter.
11108 * src/support/lyxstring.h: added an operator+=(int) to catch more
11111 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11112 (lyxstring): We DON'T allow NULL pointers.
11114 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11116 * src/mathed/math_macro.C (MathMacroArgument::Write,
11117 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11118 when writing them out.
11120 * src/LString.C: remove, since it is not used anymore.
11122 * src/support/lyxstring.C: condition the content to
11123 USE_INCLUDED_STRING macro.
11125 * src/mathed/math_symbols.C, src/support/lstrings.C,
11126 src/support/lyxstring.C: add `using' directive to specify what
11127 we need in <algorithm>. I do not think that we need to
11128 conditionalize this, but any thought is appreciated.
11130 * many files: change all callback functions to "C" linkage
11131 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11132 strict_ansi. Those who were static are now global.
11133 The case of callbacks which are static class members is
11134 trickier, since we have to make C wrappers around them (see
11135 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11136 did not finish this yet, since it defeats the purpose of
11137 encapsulation, and I am not sure what the best route is.
11139 1999-10-19 Juergen Vigna <jug@sad.it>
11141 * src/support/lyxstring.C (lyxstring): we permit to have a null
11142 pointer as assignment value and just don't assign it.
11144 * src/vspace.C (nextToken): corrected this function substituting
11145 find_first(_not)_of with find_last_of.
11147 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11148 (TableOptCloseCB) (TableSpeCloseCB):
11149 inserted fl_set_focus call for problem with fl_hide_form() in
11152 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11154 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11157 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11159 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11160 LyXLex::next() and not eatline() to get its argument.
11162 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11164 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11165 instead, use fstreams for io of the depfile, removed unneeded
11166 functions and variables.
11168 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11169 vector instead, removed all functions and variables that is not in
11172 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11174 * src/buffer.C (insertErrors): use new interface to TeXError
11176 * Makefile.am (rpmdist): added a rpmdist target
11178 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11179 per Kayvan's instructions.
11181 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11183 * src/Makefile.am: add a definition for localedir, so that locales
11184 are found after installation (Kayvan)
11186 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11188 * development/.cvsignore: new file.
11190 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11192 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11193 C++ compiler provides wrappers for C headers and use our alternate
11196 * configure.in: use LYX_CXX_CHEADERS.
11198 * src/cheader/: new directory, populated with cname headers from
11199 libstdc++-2.8.1. They are a bit old, but probably good enough for
11200 what we want (support compilers who lack them).
11202 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11203 from includes. It turns out is was stupid.
11205 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11207 * lib/Makefile.am (install-data-local): forgot a ';'
11208 (install-data-local): forgot a '\'
11209 (libinstalldirs): needed after all. reintroduced.
11211 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11213 * configure.in (AC_OUTPUT): added lyx.spec
11215 * development/lyx.spec: removed file
11217 * development/lyx.spec.in: new file
11219 * po/*.po: merged with lyx.pot becuase of make distcheck
11221 * lib/Makefile.am (dist-hook): added dist-hook so that
11222 documentation files will be included when doing a make
11223 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11224 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11226 more: tried to make install do the right thing, exclude CVS dirs
11229 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11230 Path would fit in more nicely.
11232 * all files that used to use pathstack: uses now Path instead.
11233 This change was a lot easier than expected.
11235 * src/support/path.h: new file
11237 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11239 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11241 * src/support/lyxstring.C (getline): Default arg was given for
11244 * Configure.cmd: removed file
11246 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11248 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11249 streams classes and types, add the proper 'using' statements when
11250 MODERN_STL is defined.
11252 * src/debug.h: move the << operator definition after the inclusion
11255 * src/support/filetools.C: include "LAssert.h", which is needed
11258 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11261 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11262 include "debug.h" to define a proper ostream.
11264 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11266 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11267 method to the SystemCall class which can kill a process, but it's
11268 not fully implemented yet.
11270 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11272 * src/support/FileInfo.h: Better documentation
11274 * src/lyxfunc.C: Added support for buffer-export html
11276 * src/menus.C: Added Export->As HTML...
11278 * lib/bind/*.bind: Added short-cut for buffer-export html
11280 * src/lyxrc.*: Added support for new \tth_command
11282 * lib/lyxrc.example: Added stuff for new \tth_command
11284 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11286 * lib/Makefile.am (IMAGES): removed images/README
11287 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11288 installes in correct place. Check permisions is installed
11291 * src/LaTeX.C: some no-op changes moved declaration of some
11294 * src/LaTeX.h (LATEX_H): changed include guard name
11296 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11298 * lib/reLyX/Makefile.am: install noweb2lyx.
11300 * lib/Makefile.am: install configure.
11302 * lib/reLyX/configure.in: declare a config aux dir; set package
11303 name to lyx (not sure what the best solution is); generate noweb2lyx.
11305 * lib/layouts/egs.layout: fix the bibliography layout.
11307 1999-10-08 Jürgen Vigna <jug@sad.it>
11309 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11310 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11311 it returned without continuing to search the path.
11313 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11315 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11316 also fixes a bug. It is not allowed to do tricks with std::strings
11317 like: string a("hei"); &a[e]; this will not give what you
11318 think... Any reason for the complexity in this func?
11320 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11322 * Updated README and INSTALL a bit, mostly to check that my
11323 CVS rights are correctly set up.
11325 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11327 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11328 does not allow '\0' chars but lyxstring and std::string does.
11330 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11332 * autogen.sh (AUTOCONF): let the autogen script create the
11333 POTFILES.in file too. POTFILES.in should perhaps now not be
11334 included in the cvs module.
11336 * some more files changed to use C++ includes instead of C ones.
11338 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11340 (Reread): added tostr to nlink. buggy output otherwise.
11341 (Reread): added a string() around szMode when assigning to Buffer,
11342 without this I got a log of garbled info strings.
11344 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11347 * I have added several ostream & operator<<(ostream &, some_type)
11348 functions. This has been done to avoid casting and warnings when
11349 outputting enums to lyxerr. This as thus eliminated a lot of
11350 explicit casts and has made the code clearer. Among the enums
11351 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11352 mathed enums, some font enum the Debug::type enum.
11354 * src/support/lyxstring.h (clear): missing method. equivalent of
11357 * all files that contained "stderr": rewrote constructs that used
11358 stderr to use lyxerr instead. (except bmtable)
11360 * src/support/DebugStream.h (level): and the passed t with
11361 Debug::ANY to avoid spurious bits set.
11363 * src/debug.h (Debug::type value): made it accept strings of the
11364 type INFO,INIT,KEY.
11366 * configure.in (Check for programs): Added a check for kpsewhich,
11367 the latex generation will use this later to better the dicovery of
11370 * src/BufferView.C (create_view): we don't need to cast this to
11371 (void*) that is done automatically.
11372 (WorkAreaButtonPress): removed some dead code.
11374 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11376 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11377 is not overwritten when translated (David Sua'rez de Lis).
11379 * lib/CREDITS: Added David Sua'rez de Lis
11381 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11383 * src/bufferparams.C (BufferParams): default input encoding is now
11386 * acinclude.m4 (cross_compiling): comment out macro
11387 LYX_GXX_STRENGTH_REDUCE.
11389 * acconfig.h: make sure that const is not defined (to empty) when
11390 we are compiling C++. Remove commented out code using SIZEOF_xx
11393 * configure.in : move the test for const and inline as late as
11394 possible so that these C tests do not interefere with C++ ones.
11395 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11396 has not been proven.
11398 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11400 * src/table.C (getDocBookAlign): remove bad default value for
11401 isColumn parameter.
11403 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11405 (ShowFileMenu2): ditto.
11407 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11408 of files to ignore.
11410 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11412 * Most files: finished the change from the old error code to use
11413 DebugStream for all lyxerr debugging. Only minor changes remain
11414 (e.g. the setting of debug levels using strings instead of number)
11416 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11418 * src/layout.C (Add): Changed to use compare_no_case instead of
11421 * src/FontInfo.C: changed loop variable type too string::size_type.
11423 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11425 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11426 set ETAGS_ARGS to --c++
11428 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11430 * src/table.C (DocBookEndOfCell): commented out two unused variables
11432 * src/paragraph.C: commented out four unused variables.
11434 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11435 insed a if clause with type string::size_type.
11437 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11440 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11442 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11443 variable, also changed loop to go from 0 to lenght + 1, instead of
11444 -1 to length. This should be correct.
11446 * src/LaTeX.C (scanError): use string::size_type as loop variable
11449 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11450 (l.896) since y_tmp and row was not used anyway.
11452 * src/insets/insetref.C (escape): use string::size_type as loop
11455 * src/insets/insetquotes.C (Width): use string::size_type as loop
11457 (Draw): use string::size_type as loop variable type.
11459 * src/insets/insetlatexaccent.C (checkContents): use
11460 string::size_type as loop variable type.
11462 * src/insets/insetlabel.C (escape): use string::size_type as loop
11465 * src/insets/insetinfo.C: added an extern for current_view.
11467 * src/insets/insetcommand.C (scanCommand): use string::size_type
11468 as loop variable type.
11470 * most files: removed the RCS tags. With them we had to recompile
11471 a lot of files after a simple cvs commit. Also we have never used
11472 them for anything meaningful.
11474 * most files: tags-query-replace NULL 0. As adviced several plases
11475 we now use "0" instead of "NULL" in our code.
11477 * src/support/filetools.C (SpaceLess): use string::size_type as
11478 loop variable type.
11480 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11482 * src/paragraph.C: fixed up some more string stuff.
11484 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11486 * src/support/filetools.h: make modestr a std::string.
11488 * src/filetools.C (GetEnv): made ch really const.
11490 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11491 made code that used these use max/min from <algorithm> instead.
11493 * changed several c library include files to their equivalent c++
11494 library include files. All is not changed yet.
11496 * created a support subdir in src, put lyxstring and lstrings
11497 there + the extra files atexit, fileblock, strerror. Created
11498 Makefile.am. edited configure.in and src/Makefile.am to use this
11499 new subdir. More files moved to support.
11501 * imported som of the functions from repository lyx, filetools
11503 * ran tags-query-replace on LString -> string, corrected the bogus
11504 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11505 is still some errors in there. This is errors where too much or
11506 too litle get deleted from strings (string::erase, string::substr,
11507 string::replace), there can also be some off by one errors, or
11508 just plain wrong use of functions from lstrings. Viewing of quotes
11511 * LyX is now running fairly well with string, but there are
11512 certainly some bugs yet (see above) also string is quite different
11513 from LString among others in that it does not allow null pointers
11514 passed in and will abort if it gets any.
11516 * Added the revtex4 files I forgot when setting up the repository.
11518 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11520 * All over: Tried to clean everything up so that only the files
11521 that we really need are included in the cvs repository.
11522 * Switched to use automake.
11523 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11524 * Install has not been checked.
11526 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11528 * po/pt.po: Three errors:
11529 l.533 and l.538 format specification error
11530 l. 402 duplicate entry, I just deleted it.