1 2000-09-28 Juergen Vigna <jug@sad.it>
3 * src/insets/insettabular.C (update): fixed cursor setting when
4 the_locking_inset changed.
5 (draw): made this a bit cleaner.
7 * various files: added LyXText Parameter to fitCursor call.
9 * src/BufferView.C (fitCursor): added LyXText parameter.
11 * src/insets/insettabular.C (draw): small draw fix.
13 * src/tabular.C: right setting of left/right celllines.
15 * src/tabular.[Ch]: fixed various types in funcions and structures.
16 * src/insets/insettabular.C: ditto
17 * src/frontends/xforms/FormTabular.C: ditto
19 2000-09-28 Allan Rae <rae@lyx.org>
21 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
22 that the #ifdef's had been applied to part of what should have been
23 a complete condition. It's possible there are other tests that
24 were specific to tables that are also wrong now that InsetTabular is
25 being used. Now we need to fix the output of '\n' after a table in a
26 float for the same reason as the original condition:
27 "don't insert this if we would be adding it before or after a table
28 in a float. This little trick is needed in order to allow use of
29 tables in \subfigures or \subtables."
30 Juergen can you check this?
32 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
34 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
35 outputed to the ostream.
37 * several files: fixed types based on warnings from cxx
39 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
41 * src/frontends/kde/Makefile.am: fix rule for
42 formindexdialogdata_moc.C
44 * src/.cvsignore: add ext_l10n.h to ignore
46 * acconfig.h: stop messing with __STRICT_ANSI__
47 * config/gnome.m4: remove option to set -ansi
48 * config/kde.m4: remove option to set -ansi
49 * config/lyxinclude.m4: don't set -ansi
51 2000-09-27 Juergen Vigna <jug@sad.it>
53 * various files: remove "default" language check.
55 * src/insets/insetquotes.C: removed use of current_view.
57 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
58 the one should have red ears by now!
60 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
61 in more then one paragraph. Fixed cursor-movement/selection.
63 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
64 paragraphs inside a text inset.
66 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
67 text-inset if this owner is an inset.
69 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
71 * src/Bullet.h: changed type of font, character and size to int
73 * src/buffer.C (asciiParagraph): remove actcell and fname1.
75 * src/insets/inseturl.[Ch]:
76 * src/insets/insetref.[Ch]:
77 * src/insets/insetlabel.[Ch]: add linelen to Ascii
79 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
81 * src/buffer.C (readFile): block-if statement rearranged to minimise
82 bloat. Patch does not reverse Jean-Marc's change ;-)
84 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
85 Class rewritten to store pointers to hide/update signals directly,
86 rather than Dialogs *. Also defined an enum to ease use. All xforms
87 forms can now be derived from this class.
89 * src/frontends/xforms/FormCommand.[Ch]
90 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
92 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
95 * src/frontends/xforms/forms/form_citation.fd
96 * src/frontends/xforms/forms/form_copyright.fd
97 * src/frontends/xforms/forms/form_error.fd
98 * src/frontends/xforms/forms/form_index.fd
99 * src/frontends/xforms/forms/form_ref.fd
100 * src/frontends/xforms/forms/form_toc.fd
101 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
103 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
105 * src/insets/insetfoot.C: removed redundent using directive.
107 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
109 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
110 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
112 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
113 created in the constructors in different groups. Then set() just
114 have to show the groups as needed. This fixes the redraw problems
115 (and is how the old menu code worked).
117 * src/support/lyxlib.h: declare the methods as static when we do
120 2000-09-26 Juergen Vigna <jug@sad.it>
122 * src/buffer.C (asciiParagraph): new function.
123 (writeFileAscii): new function with parameter ostream.
124 (writeFileAscii): use now asciiParagraph.
126 * various inset files: added the linelen parameter to the Ascii-func.
128 * src/tabular.C (Write): fixed error in writing file introduced by
129 the last changes from Lars.
131 * lib/bind/menus.bind: removed not supported functions.
133 * src/insets/insettext.C (Ascii): implemented this function.
135 * src/insets/lyxinset.h (Ascii): added linelen parameter.
137 * src/tabular.C (write_attribute[int,string,bool]): new functions.
138 (Write): use of the write_attribute functions.
140 * src/bufferlist.C (close): fixed reasking question!
142 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
144 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
145 new files use the everwhere possible.
148 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
149 src/log_form.C src/lyx.C:
152 * src/buffer.C (runLaTeX): remove func
154 * src/PaperLayout.C: removed file
155 * src/ParagraphExtra.C: likewise
156 * src/bullet_forms.C: likewise
157 * src/bullet_forms.h: likewise
158 * src/bullet_forms_cb.C: likewise
160 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
161 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
164 * several files: remove all traces of the old fd_form_paragraph,
165 and functions belonging to that.
167 * several files: remove all traces of the old fd_form_document,
168 and functions belonging to that.
170 * several files: constify local variables were possible.
172 * several files: remove all code that was dead when NEW_EXPORT was
175 * several files: removed string::c_str in as many places as
178 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
179 (e): be a bit more outspoken when patching
180 (updatesrc): only move files if changed.
182 * forms/layout_forms.h.patch: regenerated
184 * forms/layout_forms.fd: remove form_document and form_paragraph
185 and form_quotes and form_paper and form_table_options and
188 * forms/form1.fd: remove form_table
190 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
191 the fdui->... rewrite. Update some comments to xforms 0.88
193 * forms/bullet_forms.C.patch: removed file
194 * forms/bullet_forms.fd: likewise
195 * forms/bullet_forms.h.patch: likewise
197 * development/Code_rules/Rules: added a section on switch
198 statements. Updated some comment to xforms 0.88.
200 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
202 * src/buffer.C (readFile): make sure that the whole version number
203 is read after \lyxformat (even when it contains a comma)
205 * lib/ui/default.ui: change shortcut of math menu to M-a.
207 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
209 * src/vspace.C (nextToken): use isStrDbl() to check for proper
212 * src/LyXView.C (updateWindowTitle): show the full files name in
213 window title, limited to 30 characters.
215 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
216 When a number of characters has been given, we should not assume
217 that the string is 0-terminated.
219 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
220 calls (fixes some memory leaks)
222 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
223 trans member on exit.
225 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
227 * src/converter.C (GetReachable): fix typo.
229 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
230 understand ',' instead of '.'.
231 (GetInteger): rewrite to use strToInt().
233 2000-09-26 Juergen Vigna <jug@sad.it>
235 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
236 better visibility and error-message on wrong VSpace input.
238 * src/language.C (initL): added english again.
240 2000-09-25 Juergen Vigna <jug@sad.it>
242 * src/frontends/kde/Dialogs.C (Dialogs):
243 * src/frontends/gnome/Dialogs.C (Dialogs):
244 * src/frontends/kde/Makefile.am:
245 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
247 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
249 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
251 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
253 * src/frontends/xforms/FormParagraph.C:
254 * src/frontends/xforms/FormParagraph.h:
255 * src/frontends/xforms/form_paragraph.C:
256 * src/frontends/xforms/form_paragraph.h:
257 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
260 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
262 * src/tabular.C (OldFormatRead): forgot to delete the temporary
263 Paragraph-Data after use.
265 * src/insets/insettext.C (LocalDispatch): don't set the layout on
266 non breakable paragraphs.
268 2000-09-25 Garst R. Reese <reese@isn.net>
270 * src/language.C (initL): added missing language_country codes.
272 2000-09-25 Juergen Vigna <jug@sad.it>
274 * src/insets/insettext.C (InsetText):
275 (deleteLyXText): remove the not released LyXText structure!
277 2000-09-24 Marko Vendelin <markov@ioc.ee>
279 * src/frontends/gnome/mainapp.C
280 * src/frontends/gnome/mainapp.h: added support for keyboard
283 * src/frontends/gnome/FormCitation.C
284 * src/frontends/gnome/FormCitation.h
285 * src/frontends/gnome/Makefile.am
286 * src/frontends/gnome/pixbutton.h: completed the rewrite of
287 FormCitation to use "action area" in mainapp window
289 * src/frontends/gnome/Menubar_pimpl.C
290 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
293 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
295 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
296 width/descent/ascent values if name is empty.
297 (mathed_string_height): Use std::max.
299 2000-09-25 Allan Rae <rae@lyx.org>
301 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
302 segfault. This will be completely redesigned soon.
304 * sigc++: updated libsigc++. Fixes struct timespec bug.
306 * development/tools/makeLyXsigc.sh: .cvsignore addition
308 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
310 * several files: removed almost all traces of the old table
313 * src/TableLayout.C: removed file
315 2000-09-22 Juergen Vigna <jug@sad.it>
317 * src/frontends/kde/Dialogs.C: added credits forms.
319 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
321 * src/frontends/gnome/Dialogs.C: added some forms.
323 * src/spellchecker.C (init_spell_checker): set language in pspell code
324 (RunSpellChecker): some modifications for setting language string.
326 * src/language.[Ch]: added language_country code.
328 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
330 * src/frontends/Dialogs.h: added new signal showError.
331 Rearranged existing signals in some sort of alphabetical order.
333 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
334 FormError.[Ch], form_error.[Ch]
335 * src/frontends/xforms/forms/makefile: added new file form_error.fd
336 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
338 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
339 dialogs. I think that this can be used as the base to all these
342 * src/frontends/xforms/FormError.[Ch]
343 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
344 implementation of InsetError dialog.
346 * src/insets/inseterror.[Ch]: rendered GUI-independent.
348 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
349 * src/frontends/kde/Makefile.am: ditto
351 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
353 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
354 macrobf. This fixes a bug of invisible text.
356 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
358 * lib/doc/LaTeXConfig.lyx.in: updated.
360 * src/language.C (initL): remove language "francais" and change a
361 bit the names of the two other french variations.
363 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
364 string that may not be 0-terminated.
366 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
368 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
370 2000-09-20 Marko Vendelin <markov@ioc.ee>
372 * src/frontends/gnome/FormCitation.C
373 * src/frontends/gnome/FormIndex.C
374 * src/frontends/gnome/FormToc.C
375 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
376 the variable initialization to shut up the warnings
378 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
380 * src/table.[Ch]: deleted files
382 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
385 2000-09-18 Juergen Vigna <jug@sad.it>
387 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
388 problems with selection. Inserted new LFUN_PASTESELECTION.
389 (InsetButtonPress): inserted handling of middle mouse-button paste.
391 * src/spellchecker.C: changed word to word.c_str().
393 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
395 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
396 included in the ``make dist'' tarball.
398 2000-09-15 Juergen Vigna <jug@sad.it>
400 * src/CutAndPaste.C (cutSelection): small fix return the right
401 end position after cut inside one paragraph only.
403 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
404 we are locked as otherwise we don't have a valid cursor position!
406 * src/insets/figinset.C (draw): small bugfix but why is this needed???
408 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
410 * src/frontends/kde/FormRef.C: added using directive.
411 * src/frontends/kde/FormToc.C: ditto
413 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
415 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
417 2000-09-19 Marko Vendelin <markov@ioc.ee>
419 * src/frontends/gnome/Menubar_pimpl.C
420 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
421 Toc, ViewFormats, UpdateFormats, and ExportFormats.
423 * src/frontends/gnome/mainapp.C
424 * src/frontends/gnome/mainapp.h: support for menu update used
427 * src/frontends/gnome/mainapp.C
428 * src/frontends/gnome/mainapp.h: support for "action" area in the
429 main window. This area is used by small simple dialogs, such as
432 * src/frontends/gnome/FormIndex.C
433 * src/frontends/gnome/FormIndex.h
434 * src/frontends/gnome/FormUrl.C
435 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
438 * src/frontends/gnome/FormCitation.C
439 * src/frontends/gnome/FormCitation.h: rewrite to use main window
440 action area. Only "Insert new citation" is implemented.
442 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
444 * src/buffer.C (Dispatch): fix call to Dispatch
445 * src/insets/insetref.C (Edit): likewise
446 * src/insets/insetparent.C (Edit): likewise
447 * src/insets/insetinclude.C (include_cb): likewise
448 * src/frontends/xforms/FormUrl.C (apply): likewise
449 * src/frontends/xforms/FormToc.C (apply): likewise
450 * src/frontends/xforms/FormRef.C (apply): likewise
451 * src/frontends/xforms/FormIndex.C (apply): likewise
452 * src/frontends/xforms/FormCitation.C (apply): likewise
453 * src/lyxserver.C (callback): likewise
454 * src/lyxfunc.C (processKeySym): likewise
457 * src/lyx_cb.C (LayoutsCB): likewise
459 * Makefile.am (sourcedoc): small change
461 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
463 * src/main.C (main): Don't make an empty GUIRunTime object. all
464 methods are static. constify a bit remove unneded using + headers.
466 * src/tabular.C: some more const to local vars move some loop vars
468 * src/spellchecker.C: added some c_str after some word for pspell
470 * src/frontends/GUIRunTime.h: add new static method setDefaults
471 * src/frontends/xforms/GUIRunTime.C (setDefaults):
472 * src/frontends/kde/GUIRunTime.C (setDefaults):
473 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
475 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
476 with strnew in arg, use correct emptystring when calling SetName.
478 * several files: remove all commented code with relation to
479 HAVE_SSTREAM beeing false. We now only support stringstream and
482 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
484 * src/lyxfunc.C: construct correctly the automatic new file
487 * src/text2.C (IsStringInText): change type of variable i to shut
490 * src/support/sstream.h: do not use namespaces if the compiler
491 does not support them.
493 2000-09-15 Marko Vendelin <markov@ioc.ee>
494 * src/frontends/gnome/FormCitation.C
495 * src/frontends/gnome/FormCitation.h
496 * src/frontends/gnome/diainsertcitation_interface.c
497 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
498 regexp support to FormCitation [Gnome].
500 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
503 * configure.in: remove unused KDE/GTKGUI define
505 * src/frontends/kde/FormRef.C
506 * src/frontends/kde/FormRef.h
507 * src/frontends/kde/formrefdialog.C
508 * src/frontends/kde/formrefdialog.h: double click will
509 go to reference, now it is possible to change a cross-ref
512 * src/frontends/kde/FormToc.C
513 * src/frontends/kde/FormToc.h
514 * src/frontends/kde/formtocdialog.C
515 * src/frontends/kde/formtocdialog.h: add a depth
518 * src/frontends/kde/Makefile.am: add QtLyXView.h
521 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
523 * src/frontends/kde/FormCitation.h: added some using directives.
525 * src/frontends/kde/FormToc.h: corrected definition of doTree.
527 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
530 * src/mathed/math_defs.h: redefine SetAlign to use string rather
533 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
535 * src/buffer.C (pop_tag): revert for the second time a change by
536 Lars, who seems to really hate having non-local loop variables :)
538 * src/Lsstream.h: add "using" statements.
540 * src/support/copy.C (copy): add a bunch of std:: qualifiers
541 * src/buffer.C (writeFile): ditto
543 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
545 * src/buffer.C (writeFile): try to fix the locale modified format
546 number to always be as we want it.
548 * src/WorkArea.C (work_area_handler): try to workaround the bugs
549 in XForms 0.89. C-space is now working again.
551 * src/Lsstream.h src/support/sstream.h: new files.
553 * also commented out all cases where strstream were used.
555 * src/Bullet.h (c_str): remove method.
557 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
559 * a lot of files: get rid of "char const *" and "char *" is as
560 many places as possible. We only want to use them in interaction
561 with system of other libraries, not inside lyx.
563 * a lot of files: return const object is not of pod type. This
564 helps ensure that temporary objects is not modified. And fits well
565 with "programming by contract".
567 * configure.in: check for the locale header too
569 * Makefile.am (sourcedoc): new tag for generation of doc++
572 2000-09-14 Juergen Vigna <jug@sad.it>
574 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
575 callback to check which combo called it and do the right action.
577 * src/combox.C (combo_cb): added combo * to the callbacks.
578 (Hide): moved call of callback after Ungrab of the pointer.
580 * src/intl.h: removed LCombo2 function.
582 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
583 function as this can now be handled in one function.
585 * src/combox.h: added Combox * to callback prototype.
587 * src/frontends/xforms/Toolbar_pimpl.C:
588 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
590 2000-09-14 Garst Reese <reese@isn.net>
592 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
593 moved usepackage{xxx}'s to beginning of file. Changed left margin
594 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
595 underlining from title. Thanks to John Culleton for useful suggestions.
597 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
599 * src/lyxlex_pimpl.C (setFile): change error message to debug
602 2000-09-13 Juergen Vigna <jug@sad.it>
604 * src/frontends/xforms/FormDocument.C: implemented choice_class
605 as combox and give callback to combo_language so OK/Apply is activated
608 * src/bufferlist.C (newFile): small fix so already named files
609 (via an open call) are not requested to be named again on the
612 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
614 * src/frontends/kde/Makefile.am
615 * src/frontends/kde/FormRef.C
616 * src/frontends/kde/FormRef.h
617 * src/frontends/kde/formrefdialog.C
618 * src/frontends/kde/formrefdialog.h: implement
621 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
623 * src/frontends/kde/formtocdialog.C
624 * src/frontends/kde/formtocdialog.h
625 * src/frontends/kde/FormToc.C
626 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
628 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
630 * src/frontends/kde/FormCitation.C: fix thinko
631 where we didn't always display the reference text
634 * src/frontends/kde/formurldialog.C
635 * src/frontends/kde/formurldialog.h
636 * src/frontends/kde/FormUrl.C
637 * src/frontends/kde/FormUrl.h: minor cleanups
639 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
641 * src/frontends/kde/Makefile.am
642 * src/frontends/kde/FormToc.C
643 * src/frontends/kde/FormToc.h
644 * src/frontends/kde/FormCitation.C
645 * src/frontends/kde/FormCitation.h
646 * src/frontends/kde/FormIndex.C
647 * src/frontends/kde/FormIndex.h
648 * src/frontends/kde/formtocdialog.C
649 * src/frontends/kde/formtocdialog.h
650 * src/frontends/kde/formcitationdialog.C
651 * src/frontends/kde/formcitationdialog.h
652 * src/frontends/kde/formindexdialog.C
653 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
655 2000-09-12 Juergen Vigna <jug@sad.it>
657 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
660 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
662 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
665 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
667 * src/converter.C (Add, Convert): Added support for converter flags:
668 needaux, resultdir, resultfile.
669 (Convert): Added new parameter view_file.
670 (dvips_options): Fixed letter paper option.
672 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
673 (Export, GetExportableFormats, GetViewableFormats): Added support
676 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
678 (easyParse): Fixed to work with new export code.
680 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
683 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
685 * lib/bind/*.bind: Replaced
686 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
687 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
689 2000-09-11 Juergen Vigna <jug@sad.it>
691 * src/lyx_gui.C (runTime): uses global guiruntime variable.
693 * src/main.C (main): now GUII defines global guiruntime!
695 * src/frontends/gnome/GUIRunTime.C (initApplication):
696 * src/frontends/kde/GUIRunTime.C (initApplication):
697 * src/frontends/xforms/GUIRunTime.C (initApplication):
698 * src/frontends/GUIRunTime.h: added new function initApplication.
700 * src/spellchecker.C (sc_accept_word): change to add_to_session.
702 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
704 2000-09-08 Juergen Vigna <jug@sad.it>
706 * src/lyx_gui.C (create_forms): don't display the "default" entry as
707 we have already "Reset".
709 * src/language.C (initL): inserted "default" language and made this
710 THE default language (and not american!)
712 * src/paragraph.C: inserted handling of "default" language!
714 * src/lyxfont.C: ditto
718 * src/paragraph.C: output the \\par only if we have a following
719 paragraph otherwise it's not needed.
721 2000-09-05 Juergen Vigna <jug@sad.it>
723 * config/pspell.m4: added entry to lyx-flags
725 * src/spellchecker.C: modified version from Kevin for using pspell
727 2000-09-01 Marko Vendelin <markov@ioc.ee>
728 * src/frontends/gnome/Makefile.am
729 * src/frontends/gnome/FormCitation.C
730 * src/frontends/gnome/FormCitation.h
731 * src/frontends/gnome/diainsertcitation_callbacks.c
732 * src/frontends/gnome/diainsertcitation_callbacks.h
733 * src/frontends/gnome/diainsertcitation_interface.c
734 * src/frontends/gnome/diainsertcitation_interface.h
735 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
736 dialog for Gnome frontend
738 * src/main.C: Gnome libraries require keeping application name
739 and its version as strings
741 * src/frontends/gnome/mainapp.C: Change the name of the main window
742 from GnomeLyX to PACKAGE
744 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
746 * src/frontends/Liason.C: add "using: declaration.
748 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
750 * src/mathed/math_macro.C (Metrics): Set the size of the template
752 * src/mathed/formulamacro.C (Latex): Fixed the returned value
754 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
756 * src/converter.C (add_options): New function.
757 (SetViewer): Change $$FName into '$$FName'.
758 (View): Add options when running xdvi
759 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
760 (Convert): The 3rd parameter is now the desired filename. Converts
761 calls to lyx::rename if necessary.
762 Add options when running dvips.
763 (dvi_papersize,dvips_options): New methods.
765 * src/exporter.C (Export): Use getLatexName() instead of fileName().
767 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
768 using a call to Converter::dvips_options.
769 Fixed to work with nex export code.
772 * src/support/rename.C: New files
774 * src/support/syscall.h
775 * src/support/syscall.C: Added Starttype SystemDontWait.
777 * lib/ui/default.ui: Changed to work with new export code
779 * lib/configure.m4: Changed to work with new export code
781 * src/encoding.C: Changed latex name for iso8859_7 encoding.
783 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
785 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
786 so that code compiles with DEC cxx.
788 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
789 to work correctly! Also now supports the additional elements
792 2000-09-01 Allan Rae <rae@lyx.org>
794 * src/frontends/ButtonPolicies.C: renamed all the references to
795 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
797 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
798 since it's a const not a type.
800 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
802 2000-08-31 Juergen Vigna <jug@sad.it>
804 * src/insets/figinset.C: Various changes to look if the filename has
805 an extension and if not add it for inline previewing.
807 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
809 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
810 make buttonStatus and isReadOnly be const methods. (also reflect
811 this in derived classes.)
813 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
814 (nextState): change to be static inline, pass the StateMachine as
816 (PreferencesPolicy): remove casts
817 (OkCancelPolicy): remvoe casts
818 (OkCancelReadOnlyPolicy): remove casts
819 (NoRepeatedApplyReadOnlyPolicy): remove casts
820 (OkApplyCancelReadOnlyPolicy): remove casts
821 (OkApplyCancelPolicy): remove casts
822 (NoRepeatedApplyPolicy): remove casts
824 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
826 * src/converter.C: added some using directives
828 * src/frontends/ButtonPolicies.C: changes to overcome
829 "need lvalue" error with DEC c++
831 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
832 to WMHideCB for DEC c++
834 * src/frontends/xforms/Menubar_pimpl.C: added using directive
836 * src/frontends/xforms/forms/form_document.C.patch: use C callback
837 to BulletBMTableCB for DEC c++
839 2000-08-31 Allan Rae <rae@lyx.org>
841 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
842 character dialog separately from old document dialogs combo_language.
845 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
847 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
848 Removed LFUN_REF_CREATE.
850 * src/MenuBackend.C: Added new tags: toc and references
852 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
853 (add_lastfiles, add_documents, add_formats): Removed the unused smn
855 (add_toc, add_references): New methods.
856 (create_submenu): Handle correctly the case when there is a
857 seperator after optional menu items.
859 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
860 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
861 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
863 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
865 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
867 * src/converter.[Ch]: New file for converting between different
870 * src/export.[Ch]: New file for exporting a LyX file to different
873 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
874 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
875 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
876 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
877 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
878 RunDocBook, MenuExport.
880 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
881 Exporter::Preview methods if NEW_EXPORT is defined.
883 * src/buffer.C (Dispatch): Use Exporter::Export.
885 * src/lyxrc.C: Added new tags: \converter and \viewer.
888 * src/LyXAction.C: Define new lyx-function: buffer-update.
889 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
890 when NEW_EXPORT is defined.
892 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
894 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
896 * lib/ui/default.ui: Added submenus "view" and "update" to the
899 * src/filetools.C (GetExtension): New function.
901 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
903 2000-08-29 Allan Rae <rae@lyx.org>
905 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
907 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
908 (EnableDocumentLayout): removed
909 (DisableDocumentLayout): removed
910 (build): make use of ButtonController's read-only handling to
911 de/activate various objects. Replaces both of the above functions.
913 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
914 (readOnly): was read_only
915 (refresh): fixed dumb mistakes with read_only_ handling
917 * src/frontends/xforms/forms/form_document.fd:
918 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
919 tabbed dialogs so the tabs look more like tabs and so its easier to
920 work out which is the current tab.
922 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
923 segfault with form_table
925 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
927 2000-08-28 Juergen Vigna <jug@sad.it>
929 * acconfig.h: added USE_PSPELL.
931 * src/config.h.in: added USE_PSPELL.
933 * autogen.sh: added pspell.m4
935 * config/pspell.m4: new file.
937 * src/spellchecker.C: implemented support for pspell libary.
939 2000-08-25 Juergen Vigna <jug@sad.it>
941 * src/LyXAction.C (init): renamed LFUN_TABLE to
942 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
944 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
946 * src/lyxscreen.h: add force_clear variable and fuction to force
947 a clear area when redrawing in LyXText.
949 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
951 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
953 * some whitespace and comment changes.
955 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
957 * src/buffer.C: up te LYX_FORMAT to 2.17
959 2000-08-23 Juergen Vigna <jug@sad.it>
961 * src/BufferView_pimpl.C (tripleClick): disable this when in a
964 * src/insets/insettabular.C (pasteSelection): delete the insets
965 LyXText as it is not valid anymore.
966 (copySelection): new function.
967 (pasteSelection): new function.
968 (cutSelection): new function.
969 (LocalDispatch): implemented cut/copy/paste of cell selections.
971 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
972 don't have a LyXText.
974 * src/LyXAction.C (init): a NEW_TABULAR define too much.
976 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
979 2000-08-22 Juergen Vigna <jug@sad.it>
981 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
982 ifdef form_table out if NEW_TABULAR.
984 2000-08-21 Juergen Vigna <jug@sad.it>
986 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
987 (draw): fixed draw position so that the cursor is positioned in the
989 (InsetMotionNotify): hide/show cursor so the position is updated.
990 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
991 using cellstart() function where it should be used.
993 * src/insets/insettext.C (draw): ditto.
995 * src/tabular.C: fixed initialization of some missing variables and
996 made BoxType into an enum.
998 2000-08-22 Marko Vendelin <markov@ioc.ee>
999 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1000 stock menu item using action numerical value, not its string
1004 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1006 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1007 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1009 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1011 * src/frontends/xforms/GUIRunTime.C: new file
1013 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1014 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1016 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1018 * src/frontends/kde/GUIRunTime.C: new file
1020 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1021 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1023 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1025 * src/frontends/gnome/GUIRunTime.C: new file
1027 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1030 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1031 small change to documetentation.
1033 * src/frontends/GUIRunTime.C: removed file
1035 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1037 * src/lyxparagraph.h: enable NEW_TABULAR as default
1039 * src/lyxfunc.C (processKeySym): remove some commented code
1041 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1042 NEW_TABULAR around the fd_form_table_options.
1044 * src/lyx_gui.C (runTime): call the static member function as
1045 GUIRunTime::runTime().
1047 2000-08-21 Allan Rae <rae@lyx.org>
1049 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1052 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1054 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1056 2000-08-21 Allan Rae <rae@lyx.org>
1058 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1059 keep Garst happy ;-)
1060 * src/frontends/xforms/FormPreferences.C (build): use setOK
1061 * src/frontends/xforms/FormDocument.C (build): use setOK
1062 (FormDocument): use the appropriate policy.
1064 2000-08-21 Allan Rae <rae@lyx.org>
1066 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1067 automatic [de]activation of arbitrary objects when in a read-only state.
1069 * src/frontends/ButtonPolicies.h: More documentation
1070 (isReadOnly): added to support the above.
1072 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1074 2000-08-18 Juergen Vigna <jug@sad.it>
1076 * src/insets/insettabular.C (getStatus): changed to return func_status.
1078 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1079 display toggle menu entries if they are.
1081 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1082 new document layout now.
1084 * src/lyxfunc.C: ditto
1086 * src/lyx_gui_misc.C: ditto
1088 * src/lyx_gui.C: ditto
1090 * lib/ui/default.ui: removed paper and quotes layout as they are now
1091 all in the document layout tabbed folder.
1093 * src/frontends/xforms/forms/form_document.fd: added Restore
1094 button and callbacks for all inputs for Allan's ButtonPolicy.
1096 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1097 (CheckChoiceClass): added missing params setting on class change.
1098 (UpdateLayoutDocument): added for updating the layout on params.
1099 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1100 (FormDocument): Implemented Allan's ButtonPolicy with the
1103 2000-08-17 Allan Rae <rae@lyx.org>
1105 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1106 so we can at least see the credits again.
1108 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1109 controller calls for the appropriate callbacks. Note that since Ok
1110 calls apply followed by cancel, and apply isn't a valid input for the
1111 APPLIED state, the bc_ calls have to be made in the static callback not
1112 within each of the real callbacks.
1114 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1115 (setOk): renamed from setOkay()
1117 2000-08-17 Juergen Vigna <jug@sad.it>
1119 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1120 in the implementation part.
1121 (composeUIInfo): don't show optional menu-items.
1123 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1125 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1127 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1128 text-state when in a text-inset.
1130 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1132 2000-08-17 Marko Vendelin <markov@ioc.ee>
1133 * src/frontends/gnome/FormIndex.C
1134 * src/frontends/gnome/FormIndex.h
1135 * src/frontends/gnome/FormToc.C
1136 * src/frontends/gnome/FormToc.h
1137 * src/frontends/gnome/dialogs
1138 * src/frontends/gnome/diatoc_callbacks.c
1139 * src/frontends/gnome/diatoc_callbacks.h
1140 * src/frontends/gnome/diainsertindex_callbacks.h
1141 * src/frontends/gnome/diainsertindex_callbacks.c
1142 * src/frontends/gnome/diainsertindex_interface.c
1143 * src/frontends/gnome/diainsertindex_interface.h
1144 * src/frontends/gnome/diatoc_interface.h
1145 * src/frontends/gnome/diatoc_interface.c
1146 * src/frontends/gnome/Makefile.am: Table of Contents and
1147 Insert Index dialogs implementation for Gnome frontend
1149 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1151 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1153 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1156 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1158 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1159 destructor. Don't definde if you don't need it
1160 (processEvents): made static, non-blocking events processing for
1162 (runTime): static method. event loop for xforms
1163 * similar as above for kde and gnome.
1165 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1166 new Pimpl is correct
1167 (runTime): new method calss the real frontends runtime func.
1169 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1171 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1173 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1175 2000-08-16 Juergen Vigna <jug@sad.it>
1177 * src/lyx_gui.C (runTime): added GUII RunTime support.
1179 * src/frontends/Makefile.am:
1180 * src/frontends/GUIRunTime.[Ch]:
1181 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1182 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1183 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1185 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1187 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1188 as this is already set in ${FRONTEND_INCLUDE} if needed.
1190 * configure.in (CPPFLAGS): setting the include dir for the frontend
1191 directory and don't set FRONTEND=xforms for now as this is executed
1194 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1196 * src/frontends/kde/Makefile.am:
1197 * src/frontends/kde/FormUrl.C:
1198 * src/frontends/kde/FormUrl.h:
1199 * src/frontends/kde/formurldialog.h:
1200 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1202 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1204 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1206 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1208 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1211 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1213 * src/WorkArea.C (work_area_handler): more work to get te
1214 FL_KEYBOARD to work with xforms 0.88 too, please test.
1216 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1218 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1220 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1223 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1225 * src/Timeout.h: remove Qt::emit hack.
1227 * several files: changes to allo doc++ compilation
1229 * src/lyxfunc.C (processKeySym): new method
1230 (processKeyEvent): comment out if FL_REVISION < 89
1232 * src/WorkArea.C: change some debugging levels.
1233 (WorkArea): set wantkey to FL_KEY_ALL
1234 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1235 clearer code and the use of compose with XForms 0.89. Change to
1236 use signals instead of calling methods in bufferview directly.
1238 * src/Painter.C: change some debugging levels.
1240 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1243 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1244 (workAreaKeyPress): new method
1246 2000-08-14 Juergen Vigna <jug@sad.it>
1248 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1250 * config/kde.m4: addes some features
1252 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1253 include missing xforms dialogs.
1255 * src/Timeout.h: a hack to be able to compile with qt/kde.
1257 * sigc++/.cvsignore: added acinclude.m4
1259 * lib/.cvsignore: added listerros
1261 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1262 xforms tree as objects are needed for other frontends.
1264 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1265 linking with not yet implemented xforms objects.
1267 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1269 2000-08-14 Baruch Even <baruch.even@writeme.com>
1271 * src/frontends/xforms/FormGraphics.h:
1272 * src/frontends/xforms/FormGraphics.C:
1273 * src/frontends/xforms/RadioButtonGroup.h:
1274 * src/frontends/xforms/RadioButtonGroup.C:
1275 * src/insets/insetgraphics.h:
1276 * src/insets/insetgraphics.C:
1277 * src/insets/insetgraphicsParams.h:
1278 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1279 instead of spaces, and various other indentation issues to make the
1280 sources more consistent.
1282 2000-08-14 Marko Vendelin <markov@ioc.ee>
1284 * src/frontends/gnome/dialogs/diaprint.glade
1285 * src/frontends/gnome/FormPrint.C
1286 * src/frontends/gnome/FormPrint.h
1287 * src/frontends/gnome/diaprint_callbacks.c
1288 * src/frontends/gnome/diaprint_callbacks.h
1289 * src/frontends/gnome/diaprint_interface.c
1290 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1293 * src/frontends/gnome/dialogs/diainserturl.glade
1294 * src/frontends/gnome/FormUrl.C
1295 * src/frontends/gnome/FormUrl.h
1296 * src/frontends/gnome/diainserturl_callbacks.c
1297 * src/frontends/gnome/diainserturl_callbacks.h
1298 * src/frontends/gnome/diainserturl_interface.c
1299 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1300 Gnome implementation
1302 * src/frontends/gnome/Dialogs.C
1303 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1304 all other dialogs. Copy all unimplemented dialogs from Xforms
1307 * src/frontends/gnome/support.c
1308 * src/frontends/gnome/support.h: support files generated by Glade
1312 * config/gnome.m4: Gnome configuration scripts
1314 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1315 configure --help message
1317 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1318 only if there are no events pendling in Gnome/Gtk. This enhances
1319 the performance of menus.
1322 2000-08-14 Allan Rae <rae@lyx.org>
1324 * lib/Makefile.am: listerrors cleaning
1326 * lib/listerrors: removed -- generated file
1327 * acinclude.m4: ditto
1328 * sigc++/acinclude.m4: ditto
1330 * src/frontends/xforms/forms/form_citation.fd:
1331 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1334 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1335 `updatesrc` and now we have a `test` target that does what `updatesrc`
1336 used to do. I didn't like having an install target that wasn't related
1339 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1340 on all except FormGraphics. This may yet happen. Followed by a major
1341 cleanup including using FL_TRANSIENT for most of the dialogs. More
1342 changes to come when the ButtonController below is introduced.
1344 * src/frontends/xforms/ButtonController.h: New file for managing up to
1345 four buttons on a dialog according to an externally defined policy.
1346 * src/frontends/xforms/Makefile.am: added above
1348 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1349 Apply and Cancel/Close buttons and everything in between and beyond.
1350 * src/frontends/Makefile.am: added above.
1352 * src/frontends/xforms/forms/form_preferences.fd:
1353 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1354 and removed variable 'status' as a result. Fixed the set_minsize thing.
1355 Use the new screen-font-update after checking screen fonts were changed
1356 Added a "Restore" button to restore the original lyxrc values while
1357 editing. This restores everything not just the last input changed.
1358 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1360 * src/LyXAction.C: screen-font-update added for updating buffers after
1361 screen font settings have been changed.
1362 * src/commandtags.h: ditto
1363 * src/lyxfunc.C: ditto
1365 * forms/lyx.fd: removed screen fonts dialog.
1366 * src/lyx_gui.C: ditto
1367 * src/menus.[Ch]: ditto
1368 * src/lyx.[Ch]: ditto
1369 * src/lyx_cb.C: ditto + code from here moved to make
1370 screen-font-update. And people wonder why progress on GUII is
1371 slow. Look at how scattered this stuff was! It takes forever
1374 * forms/fdfix.sh: Fixup the spacing after commas.
1375 * forms/makefile: Remove date from generated files. Fewer clashes now.
1376 * forms/bullet_forms.C.patch: included someones handwritten changes
1378 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1379 once I've discovered why LyXRC was made noncopyable.
1380 * src/lyx_main.C: ditto
1382 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1384 * src/frontends/xforms/forms/fdfix.sh:
1385 * src/frontends/xforms/forms/fdfixh.sed:
1386 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1387 * src/frontends/xforms/Form*.[hC]:
1388 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1389 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1390 provide a destructor for the struct FD_form_xxxx. Another version of
1391 the set_[max|min]size workaround and a few other cleanups. Actually,
1392 Angus' patch from 20000809.
1394 2000-08-13 Baruch Even <baruch.even@writeme.com>
1396 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1399 2000-08-11 Juergen Vigna <jug@sad.it>
1401 * src/insets/insetgraphics.C (InsetGraphics): changing init
1402 order because of warnings.
1404 * src/frontends/xforms/forms/makefile: adding patching .C with
1407 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1408 from .C.patch to .c.patch
1410 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1411 order because of warning.
1413 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1415 * src/frontends/Liason.C (setMinibuffer): new helper function
1417 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1419 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1421 * lib/ui/default.ui: commented out PaperLayout entry
1423 * src/frontends/xforms/form_document.[Ch]: new added files
1425 * src/frontends/xforms/FormDocument.[Ch]: ditto
1427 * src/frontends/xforms/forms/form_document.fd: ditto
1429 * src/frontends/xforms/forms/form_document.C.patch: ditto
1431 2000-08-10 Juergen Vigna <jug@sad.it>
1433 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1434 (InsetGraphics): initialized cacheHandle to 0.
1435 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1437 2000-08-10 Baruch Even <baruch.even@writeme.com>
1439 * src/graphics/GraphicsCache.h:
1440 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1441 correctly as a cache.
1443 * src/graphics/GraphicsCacheItem.h:
1444 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1447 * src/graphics/GraphicsCacheItem_pimpl.h:
1448 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1451 * src/insets/insetgraphics.h:
1452 * src/insets/insetgraphics.C: Changed from using a signal notification
1453 to polling when image is not loaded.
1455 2000-08-10 Allan Rae <rae@lyx.org>
1457 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1458 that there are two functions that have to been taken out of line by
1459 hand and aren't taken care of in the script. (Just a reminder note)
1461 * sigc++/macros/*.h.m4: Updated as above.
1463 2000-08-09 Juergen Vigna <jug@sad.it>
1465 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1467 * src/insets/insettabular.C: make drawing of single cell smarter.
1469 2000-08-09 Marko Vendelin <markov@ioc.ee>
1470 * src/frontends/gnome/Menubar_pimpl.C
1471 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1472 implementation: new files
1474 * src/frontends/gnome/mainapp.C
1475 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1478 * src/main.C: create Gnome main window
1480 * src/frontends/xforms/Menubar_pimpl.h
1481 * src/frontends/Menubar.C
1482 * src/frontends/Menubar.h: added method Menubar::update that calls
1483 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1485 * src/LyXView.C: calls Menubar::update to update the state
1488 * src/frontends/gnome/Makefile.am: added new files
1490 * src/frontends/Makefile.am: added frontend compiler options
1492 2000-08-08 Juergen Vigna <jug@sad.it>
1494 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1496 * src/bufferlist.C (close):
1497 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1498 documents if exiting without saving.
1500 * src/buffer.C (save): use removeAutosaveFile()
1502 * src/support/filetools.C (removeAutosaveFile): new function.
1504 * src/lyx_cb.C (MenuWrite): returns a bool now.
1505 (MenuWriteAs): check if file could really be saved and revert to the
1507 (MenuWriteAs): removing old autosavefile if existant.
1509 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1510 before Goto toggle declaration, because of compiler warning.
1512 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1514 * src/lyxfunc.C (MenuNew): small fix.
1516 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1518 * src/bufferlist.C (newFile):
1519 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1521 * src/lyxrc.C: added new_ask_filename tag
1523 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1525 * src/lyx.fd: removed code pertaining to form_ref
1526 * src/lyx.[Ch]: ditto
1527 * src/lyx_cb.C: ditto
1528 * src/lyx_gui.C: ditto
1529 * src/lyx_gui_misc.C: ditto
1531 * src/BufferView_pimpl.C (restorePosition): update buffer only
1534 * src/commandtags.h (LFUN_REFTOGGLE): removed
1535 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1536 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1537 (LFUN_REFBACK): renamed LFUN_REF_BACK
1539 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1540 * src/menus.C: ditto
1541 * src/lyxfunc.C (Dispatch): ditto.
1542 InsertRef dialog is now GUI-independent.
1544 * src/texrow.C: added using std::endl;
1546 * src/insets/insetref.[Ch]: strip out large amounts of code.
1547 The inset is now a container and this functionality is now
1548 managed by a new FormRef dialog
1550 * src/frontends/Dialogs.h (showRef, createRef): new signals
1552 * src/frontends/xforms/FormIndex.[Ch],
1553 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1554 when setting dialog's min/max size
1555 * src/frontends/xforms/FormIndex.[Ch]: ditto
1557 * src/frontends/xforms/FormRef.[Ch],
1558 src/frontends/xforms/forms/form_ref.fd: new xforms
1559 implementation of an InsetRef dialog
1561 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1564 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1565 ios::nocreate is not part of the standard. Removed.
1567 2000-08-07 Baruch Even <baruch.even@writeme.com>
1569 * src/graphics/Renderer.h:
1570 * src/graphics/Renderer.C: Added base class for rendering of different
1571 image formats into Pixmaps.
1573 * src/graphics/XPM_Renderer.h:
1574 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1575 in a different class.
1577 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1578 easily add support for other formats.
1580 * src/insets/figinset.C: plugged a leak of an X resource.
1582 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1584 * src/CutAndPaste.[Ch]: make all metods static.
1586 * development/Code_rules/Rules: more work, added section on
1587 Exceptions, and a References section.
1589 * a lot of header files: work to make doc++ able to generate the
1590 source documentation, some workarounds of doc++ problems. Doc++ is
1591 now able to generate the documentation.
1593 2000-08-07 Juergen Vigna <jug@sad.it>
1595 * src/insets/insettabular.C (recomputeTextInsets): removed function
1597 * src/tabular.C (SetWidthOfMulticolCell):
1599 (calculate_width_of_column_NMC): fixed return value so that it really
1600 only returns true if the column-width has changed (there where
1601 problems with muliticolumn-cells in this column).
1603 2000-08-04 Juergen Vigna <jug@sad.it>
1605 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1606 also on the scrollstatus of the inset.
1607 (workAreaMotionNotify): ditto.
1609 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1611 2000-08-01 Juergen Vigna <jug@sad.it>
1613 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1615 * src/commandtags.h:
1616 * src/LyXAction.C (init):
1617 * src/insets/inset.C (LocalDispatch): added support for
1620 * src/insets/inset.C (scroll): new functions.
1622 * src/insets/insettext.C (removeNewlines): new function.
1623 (SetAutoBreakRows): removes forced newlines in the text of the
1624 paragraph if autoBreakRows is set to false.
1626 * src/tabular.C (Latex): generates a parbox around the cell contents
1629 * src/frontends/xforms/FormTabular.C (local_update): removed
1630 the radio_useparbox button.
1632 * src/tabular.C (UseParbox): new function
1634 2000-08-06 Baruch Even <baruch.even@writeme.com>
1636 * src/graphics/GraphicsCache.h:
1637 * src/graphics/GraphicsCache.C:
1638 * src/graphics/GraphicsCacheItem.h:
1639 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1642 * src/insets/insetgraphics.h:
1643 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1644 drawing of the inline image.
1646 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1647 into the wrong position.
1649 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1652 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1654 * src/support/translator.h: move all typedefs to public section
1656 * src/support/filetools.C (MakeLatexName): return string const
1658 (TmpFileName): ditto
1659 (FileOpenSearch): ditto
1661 (LibFileSearch): ditto
1662 (i18nLibFileSearch): ditto
1665 (CreateTmpDir): ditto
1666 (CreateBufferTmpDir): ditto
1667 (CreateLyXTmpDir): ditto
1670 (MakeAbsPath): ditto
1672 (OnlyFilename): ditto
1674 (NormalizePath): ditto
1675 (CleanupPath): ditto
1676 (GetFileContents): ditto
1677 (ReplaceEnvironmentPath): ditto
1678 (MakeRelPath): ditto
1680 (ChangeExtension): ditto
1681 (MakeDisplayPath): ditto
1682 (do_popen): return cmdret const
1683 (findtexfile): return string const
1685 * src/support/DebugStream.h: add some /// to please doc++
1687 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1689 * src/texrow.C (same_rownumber): functor to use with find_if
1690 (getIdFromRow): rewritten to use find_if and to not update the
1691 positions. return true if row is found
1692 (increasePos): new method, use to update positions
1694 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1696 * src/lyxlex_pimpl.C (verifyTable): new method
1699 (GetString): return string const
1700 (pushTable): rewrite to use std::stack
1702 (setFile): better check
1705 * src/lyxlex.h: make LyXLex noncopyable
1707 * src/lyxlex.C (text): return char const * const
1708 (GetString): return string const
1709 (getLongString): return string const
1711 * src/lyx_gui_misc.C (askForText): return pair<...> const
1713 * src/lastfiles.[Ch] (operator): return string const
1715 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1716 istringstream not char const *.
1717 move token.end() out of loop.
1718 (readFile): move initializaton of token
1720 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1721 getIdFromRow is successful.
1723 * lib/bind/emacs.bind: don't include menus bind
1725 * development/Code_rules/Rules: the beginnings of making this
1726 better and covering more of the unwritten rules that we have.
1728 * development/Code_rules/Recommendations: a couple of wording
1731 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1733 * src/support/strerror.c: remove C++ comment.
1735 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1737 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1738 LFUN_INDEX_INSERT_LAST
1740 * src/texrow.C (getIdFromRow): changed from const_iterator to
1741 iterator, allowing code to compile with DEC cxx
1743 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1744 stores part of the class, as suggested by Allan. Will allow
1746 (apply): test to apply uses InsetCommandParams operator!=
1748 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1749 (apply): test to apply uses InsetCommandParams operator!=
1751 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1752 stores part of the class.
1753 (update): removed limits on min/max size.
1755 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1756 (apply): test to apply uses InsetCommandParams operator!=
1758 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1759 (Read, Write, scanCommand, getCommand): moved functionality
1760 into InsetCommandParams.
1762 (getScreenLabel): made pure virtual
1763 new InsetCommandParams operators== and !=
1765 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1766 c-tors based on InsetCommandParams. Removed others.
1767 * src/insets/insetinclude.[Ch]: ditto
1768 * src/insets/insetlabel.[Ch]: ditto
1769 * src/insets/insetparent.[Ch]: ditto
1770 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1772 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1773 insets derived from InsetCommand created using similar c-tors
1774 based on InsetCommandParams
1775 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1776 * src/menus.C (ShowRefsMenu): ditto
1777 * src/paragraph.C (Clone): ditto
1778 * src/text2.C (SetCounter): ditto
1779 * src/lyxfunc.C (Dispatch) ditto
1780 Also recreated old InsetIndex behaviour exactly. Can now
1781 index-insert at the start of a paragraph and index-insert-last
1782 without launching the pop-up.
1784 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1786 * lib/lyxrc.example: mark te pdf options as non functional.
1788 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1789 (isStrDbl): move tmpstr.end() out of loop.
1790 (strToDbl): move intialization of tmpstr
1791 (lowercase): return string const and move tmp.end() out of loop.
1792 (uppercase): return string const and move tmp.edn() out of loop.
1793 (prefixIs): add assertion
1798 (containsOnly): ditto
1799 (containsOnly): ditto
1800 (containsOnly): ditto
1801 (countChar): make last arg char not char const
1802 (token): return string const
1803 (subst): return string const, move tmp.end() out of loop.
1804 (subst): return string const, add assertion
1805 (strip): return string const
1806 (frontStrip): return string const, add assertion
1807 (frontStrip): return string const
1812 * src/support/lstrings.C: add inclde "LAssert.h"
1813 (isStrInt): move tmpstr.end() out of loop.
1815 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1816 toollist.end() out of loop.
1817 (deactivate): move toollist.end() out of loop.
1818 (update): move toollist.end() out of loop.
1819 (updateLayoutList): move tc.end() out of loop.
1820 (add): move toollist.end() out of loop.
1822 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1823 md.end() out of loop.
1825 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1827 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1830 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1831 (Erase): move insetlist.end() out of loop.
1833 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1834 ref to const string as first arg. Move initialization of some
1835 variables, whitespace changes.
1837 * src/kbmap.C (defkey): move table.end() out of loop.
1838 (kb_keymap): move table.end() out of loop.
1839 (findbinding): move table.end() out of loop.
1841 * src/MenuBackend.C (hasMenu): move end() out of loop.
1842 (getMenu): move end() out of loop.
1843 (getMenu): move menulist_.end() out of loop.
1845 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1847 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1850 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1851 (getFromLyXName): move infotab.end() out of loop.
1853 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1854 -fvtable-thunks -ffunction-sections -fdata-sections
1856 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1858 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1861 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1863 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1865 * src/frontends/xforms/FormCitation.[Ch],
1866 src/frontends/xforms/FormIndex.[Ch],
1867 src/frontends/xforms/FormToc.[Ch],
1868 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1870 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1872 * src/commandtags.h: renamed, created some flags for citation
1875 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1877 * src/lyxfunc.C (dispatch): use signals to insert index entry
1879 * src/frontends/Dialogs.h: new signal createIndex
1881 * src/frontends/xforms/FormCommand.[Ch],
1882 src/frontends/xforms/FormCitation.[Ch],
1883 src/frontends/xforms/FormToc.[Ch],
1884 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1886 * src/insets/insetindex.[Ch]: GUI-independent
1888 * src/frontends/xforms/FormIndex.[Ch],
1889 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1892 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1894 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1895 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1897 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1899 * src/insets/insetref.C (Latex): rewrite so that there is now
1900 question that a initialization is requested.
1902 * src/insets/insetcommand.h: reenable the hide signal
1904 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1906 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1907 fix handling of shortcuts (many bugs :)
1908 (add_lastfiles): ditto.
1910 * lib/ui/default.ui: fix a few shortcuts.
1912 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1914 * Makefile.am: Fix ``rpmdist'' target to return the exit
1915 status of the ``rpm'' command, instead of the last command in
1916 the chain (the ``rm lyx.xpm'' command, which always returns
1919 2000-08-02 Allan Rae <rae@lyx.org>
1921 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1922 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1923 * src/frontends/xforms/FormToc.C (FormToc): ditto
1925 * src/frontends/xforms/Makefile.am: A few forgotten files
1927 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1928 Signals-not-copyable-problem Lars' started commenting out.
1930 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1932 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1934 * src/insets/insetcommand.h: Signals is not copyable so anoter
1935 scheme for automatic hiding of forms must be used.
1937 * src/frontends/xforms/FormCitation.h: don't inerit from
1938 noncopyable, FormCommand already does that.
1939 * src/frontends/xforms/FormToc.h: ditto
1940 * src/frontends/xforms/FormUrl.h: ditto
1942 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1944 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1946 * src/insets/insetcommand.h (hide): new SigC::Signal0
1947 (d-tor) new virtual destructor emits hide signal
1949 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1950 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1952 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1953 LOF and LOT. Inset is now GUI-independent
1955 * src/insets/insetloa.[Ch]: redundant
1956 * src/insets/insetlof.[Ch]: ditto
1957 * src/insets/insetlot.[Ch]: ditto
1959 * src/frontends/xforms/forms/form_url.fd: tweaked!
1960 * src/frontends/xforms/forms/form_citation.fd: ditto
1962 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1963 dialogs dealing with InsetCommand insets
1965 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1966 FormCommand base class
1967 * src/frontends/xforms/FormUrl.[Ch]: ditto
1969 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1971 * src/frontends/xforms/FormToc.[Ch]: ditto
1973 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1974 passed a generic InsetCommand pointer
1975 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1977 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1978 and modified InsetTOC class
1979 * src/buffer.C: ditto
1981 * forms/lyx.fd: strip out old FD_form_toc code
1982 * src/lyx_gui_misc.C: ditto
1983 * src/lyx_gui.C: ditto
1984 * src/lyx_cb.C: ditto
1985 * src/lyx.[Ch]: ditto
1987 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1989 * src/support/utility.hpp: tr -d '\r'
1991 2000-08-01 Juergen Vigna <jug@sad.it>
1993 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1995 * src/commandtags.h:
1996 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1997 LFUN_TABULAR_FEATURES.
1999 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2000 LFUN_LAYOUT_TABULAR.
2002 * src/insets/insettabular.C (getStatus): implemented helper function.
2004 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2006 2000-07-31 Juergen Vigna <jug@sad.it>
2008 * src/text.C (draw): fixed screen update problem for text-insets.
2010 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2011 something changed probably this has to be added in various other
2014 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2016 2000-07-31 Baruch Even <baruch.even@writeme.com>
2018 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2019 templates to satisfy compaq cxx.
2022 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2024 * src/support/translator.h (equal_1st_in_pair::operator()): take
2025 const ref pair_type as arg.
2026 (equal_2nd_in_pair::operator()): ditto
2027 (Translator::~Translator): remove empty d-tor.
2029 * src/graphics/GraphicsCache.C: move include config.h to top, also
2030 put initialization of GraphicsCache::singleton here.
2031 (~GraphicsCache): move here
2032 (addFile): take const ref as arg
2035 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2037 * src/BufferView2.C (insertLyXFile): change te with/without header
2040 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2042 * src/frontends/xforms/FormGraphics.C (apply): add some
2043 static_cast. Not very nice, but required by compaq cxx.
2045 * src/frontends/xforms/RadioButtonGroup.h: include header
2046 <utility> instead of <pair.h>
2048 * src/insets/insetgraphicsParams.C: add using directive.
2049 (readResize): change return type to void.
2050 (readOrigin): ditto.
2052 * src/lyxfunc.C (getStatus): add missing break for build-program
2053 function; add test for Literate for export functions.
2055 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2056 entries in Options menu.
2058 2000-07-31 Baruch Even <baruch.even@writeme.com>
2060 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2061 protect against auto-allocation; release icon when needed.
2063 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2065 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2066 on usual typewriter.
2068 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2069 earlier czech.kmap), useful only for programming.
2071 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2073 * src/frontends/xforms/FormCitation.h: fix conditioning around
2076 2000-07-31 Juergen Vigna <jug@sad.it>
2078 * src/frontends/xforms/FormTabular.C (local_update): changed
2079 radio_linebreaks to radio_useparbox and added radio_useminipage.
2081 * src/tabular.C: made support for using minipages/parboxes.
2083 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2085 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2087 (descent): so the cursor is in the middle.
2088 (width): bit smaller box.
2090 * src/insets/insetgraphics.h: added display() function.
2092 2000-07-31 Baruch Even <baruch.even@writeme.com>
2094 * src/frontends/Dialogs.h: Added showGraphics signals.
2096 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2097 xforms form definition of the graphics dialog.
2099 * src/frontends/xforms/FormGraphics.h:
2100 * src/frontends/xforms/FormGraphics.C: Added files, the
2101 GUIndependent code of InsetGraphics
2103 * src/insets/insetgraphics.h:
2104 * src/insets/insetgraphics.C: Major writing to make it work.
2106 * src/insets/insetgraphicsParams.h:
2107 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2108 struct between InsetGraphics and GUI.
2110 * src/LaTeXFeatures.h:
2111 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2112 support for graphicx package.
2114 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2115 for the graphics inset.
2117 * src/support/translator.h: Added file, used in
2118 InsetGraphicsParams. this is a template to translate between two
2121 * src/frontends/xforms/RadioButtonGroup.h:
2122 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2123 way to easily control a radio button group.
2125 2000-07-28 Juergen Vigna <jug@sad.it>
2127 * src/insets/insettabular.C (LocalDispatch):
2128 (TabularFeatures): added support for lyx-functions of tabular features.
2129 (cellstart): refixed this function after someone wrongly changed it.
2131 * src/commandtags.h:
2132 * src/LyXAction.C (init): added support for tabular-features
2134 2000-07-28 Allan Rae <rae@lyx.org>
2136 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2137 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2138 triggers the callback for input checking. As a result we sometimes get
2139 "LyX: This shouldn't happen..." printed to cerr.
2140 (input): Started using status variable since I only free() on
2141 destruction. Some input checking for paths and font sizes.
2143 * src/frontends/xforms/FormPreferences.h: Use status to control
2144 activation of Ok and Apply
2146 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2147 callback. Also resized to stop segfaults with 0.88. The problem is
2148 that xforms-0.88 requires the folder to be wide enough to fit all the
2149 tabs. If it isn't it causes all sorts of problems.
2151 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2153 * src/frontends/xforms/forms/README: Reflect reality.
2155 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2156 * src/frontends/xforms/forms/makefile: ditto.
2158 * src/commandtags.h: Get access to new Preferences dialog
2159 * src/LyXAction.C: ditto
2160 * src/lyxfunc.C: ditto
2161 * lib/ui/default.ui: ditto
2163 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2165 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2167 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2170 * src/frontends/xforms/form_url.[Ch]: added.
2172 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2174 * src/insets/insetbib.h: fixed bug in previous commit
2176 * src/frontends/xforms/FormUrl.h: ditto
2178 * src/frontends/xforms/FormPrint.h: ditto
2180 * src/frontends/xforms/FormPreferences.h: ditto
2182 * src/frontends/xforms/FormCopyright.h: ditto
2184 * src/frontends/xforms/FormCitation.C: ditto
2186 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2187 private copyconstructor and private default contructor
2189 * src/support/Makefile.am: add utility.hpp
2191 * src/support/utility.hpp: new file from boost
2193 * src/insets/insetbib.h: set owner in clone
2195 * src/frontends/xforms/FormCitation.C: added missing include
2198 * src/insets/form_url.[Ch]: removed
2200 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2202 * development/lyx.spec.in
2203 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2204 file/directory re-organization.
2206 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2208 * src/insets/insetcommand.[Ch]: moved the string data and
2209 associated manipulation methods into a new stand-alone class
2210 InsetCommandParams. This class has two additional methods
2211 getAsString() and setFromString() allowing the contents to be
2212 moved around as a single string.
2213 (addContents) method removed.
2214 (setContents) method no longer virtual.
2216 * src/buffer.C (readInset): made use of new InsetCitation,
2217 InsetUrl constructors based on InsetCommandParams.
2219 * src/commandtags.h: add LFUN_INSERT_URL
2221 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2222 independent InsetUrl and use InsetCommandParams to extract
2223 string info and create new Insets.
2225 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2227 * src/frontends/xforms/FormCitation.C (apply): uses
2230 * src/frontends/xforms/form_url.C
2231 * src/frontends/xforms/form_url.h
2232 * src/frontends/xforms/FormUrl.h
2233 * src/frontends/xforms/FormUrl.C
2234 * src/frontends/xforms/forms/form_url.fd: new files
2236 * src/insets/insetcite.[Ch]: removed unused constructors.
2238 * src/insets/insetinclude.[Ch]: no longer store filename
2240 * src/insets/inseturl.[Ch]: GUI-independent.
2242 2000-07-26 Juergen Vigna <jug@sad.it>
2243 * renamed frontend from gtk to gnome as it is that what is realized
2244 and did the necessary changes in the files.
2246 2000-07-26 Marko Vendelin <markov@ioc.ee>
2248 * configure.in: cleaning up gnome configuration scripts
2250 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2252 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2253 shortcuts syndrom by redrawing them explicitely (a better solution
2254 would be appreciated).
2256 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2258 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2261 * src/lyx_cb.C (MenuExport): change html export to do the right
2262 thing depending of the document type (instead of having
2263 html-linuxdoc and html-docbook).
2264 * src/lyxfunc.C (getStatus): update for html
2265 * lib/ui/default.ui: simplify due to the above change.
2266 * src/menus.C (ShowFileMenu): update too (in case we need it).
2268 * src/MenuBackend.C (read): if a menu is defined twice, add the
2269 new entries to the exiting one.
2271 2000-07-26 Juergen Vigna <jug@sad.it>
2273 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2275 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2276 and return a bool if it did actual save the file.
2277 (AutoSave): don't autosave a unnamed doc.
2279 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2280 check if this is an UNNAMED new file and react to it.
2281 (newFile): set buffer to unnamed and change to not mark a new
2282 buffer dirty if I didn't do anything with it.
2284 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2286 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2288 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2289 friend as per Angus's patch posted to lyx-devel.
2291 * src/ext_l10n.h: updated
2293 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2294 gettext on the style string right before inserting them into the
2297 * autogen.sh: add code to extract style strings form layout files,
2298 not good enough yet.
2300 * src/frontends/gtk/.cvsignore: add MAKEFILE
2302 * src/MenuBackend.C (read): run the label strings through gettext
2303 before storing them in the containers.
2305 * src/ext_l10n.h: new file
2307 * autogen.sh : generate the ext_l10n.h file here
2309 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2311 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2314 * lib/ui/default.ui: fix a couple of typos.
2316 * config/gnome/gtk.m4: added (and added to the list of files in
2319 * src/insets/insetinclude.C (unique_id): fix when we are using
2320 lyxstring instead of basic_string<>.
2321 * src/insets/insettext.C (LocalDispatch): ditto.
2322 * src/support/filetools.C: ditto.
2324 * lib/configure.m4: create the ui/ directory if necessary.
2326 * src/LyXView.[Ch] (updateToolbar): new method.
2328 * src/BufferView_pimpl.C (buffer): update the toolbar when
2329 opening/closing buffer.
2331 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2333 * src/LyXAction.C (getActionName): enhance to return also the name
2334 and options of pseudo-actions.
2335 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2337 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2338 as an example of what is possible). Used in File->Build too (more
2339 useful) and in the import/export menus (to mimick the complicated
2340 handling of linuxdoc and friends). Try to update all the entries.
2342 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2345 * src/MenuBackend.C (read): Parse the new OptItem tag.
2347 * src/MenuBackend.h: Add a new optional_ data member (used if the
2348 entry should be omitted when the lyxfunc is disabled).
2350 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2351 function, used as a shortcut.
2352 (create_submenu): align correctly the shortcuts on the widest
2355 * src/MenuBackend.h: MenuItem.label() only returns the label of
2356 the menu without shortcut; new method shortcut().
2358 2000-07-14 Marko Vendelin <markov@ioc.ee>
2360 * src/frontends/gtk/Dialogs.C:
2361 * src/frontends/gtk/FormCopyright.C:
2362 * src/frontends/gtk/FormCopyright.h:
2363 * src/frontends/gtk/Makefile.am: added these source-files for the
2364 Gtk/Gnome support of the Copyright-Dialog.
2366 * src/main.C: added Gnome::Main initialization if using
2367 Gtk/Gnome frontend-GUI.
2369 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2371 * config/gnome/aclocal-include.m4
2372 * config/gnome/compiler-flags.m4
2373 * config/gnome/curses.m4
2374 * config/gnome/gnome--.m4
2375 * config/gnome/gnome-bonobo-check.m4
2376 * config/gnome/gnome-common.m4
2377 * config/gnome/gnome-fileutils.m4
2378 * config/gnome/gnome-ghttp-check.m4
2379 * config/gnome/gnome-gnorba-check.m4
2380 * config/gnome/gnome-guile-checks.m4
2381 * config/gnome/gnome-libgtop-check.m4
2382 * config/gnome/gnome-objc-checks.m4
2383 * config/gnome/gnome-orbit-check.m4
2384 * config/gnome/gnome-print-check.m4
2385 * config/gnome/gnome-pthread-check.m4
2386 * config/gnome/gnome-support.m4
2387 * config/gnome/gnome-undelfs.m4
2388 * config/gnome/gnome-vfs.m4
2389 * config/gnome/gnome-x-checks.m4
2390 * config/gnome/gnome-xml-check.m4
2391 * config/gnome/gnome.m4
2392 * config/gnome/gperf-check.m4
2393 * config/gnome/gtk--.m4
2394 * config/gnome/linger.m4
2395 * config/gnome/need-declaration.m4: added configuration scripts
2396 for Gtk/Gnome frontend-GUI
2398 * configure.in: added support for the --with-frontend=gtk option
2400 * autogen.sh: added config/gnome/* to list of config-files
2402 * acconfig.h: added define for GTKGUI-support
2404 * config/lyxinclude.m4: added --with-frontend[=value] option value
2405 for Gtk/Gnome frontend-GUI support.
2407 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2409 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2413 * src/paragraph.C (GetChar): remove non-const version
2415 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2416 (search_kw): use it.
2418 * src/lyx_main.C (init): if "preferences" exist, read that instead
2420 (ReadRcFile): return bool if the file could be read ok.
2421 (ReadUIFile): add a check to see if lex file is set ok.
2423 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2424 bastring can be used instead of lyxstring (still uses the old code
2425 if std::string is good enough or if lyxstring is used.)
2427 * src/encoding.C: make the arrays static, move ininle functions
2429 * src/encoding.h: from here.
2431 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2432 (parseSingleLyXformat2Token): move inset parsing to separate method
2433 (readInset): new private method
2435 * src/Variables.h: remove virtual from get().
2437 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2438 access to NEW_INSETS and NEW_TABULAR
2440 * src/MenuBackend.h: remove superfluous forward declaration of
2441 MenuItem. Add documentations tags "///", remove empty MenuItem
2442 destructor, remove private default contructor.
2444 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2446 (read): more string mlabel and mname to where they are used
2447 (read): remove unused variables mlabel and mname
2448 (defaults): unconditional clear, make menusetup take advantage of
2449 add returning Menu &.
2451 * src/LyXView.h: define NEW_MENUBAR as default
2453 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2454 to NEW_INSETS and NEW_TABULAR.
2455 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2456 defined. Change some of the "xxxx-inset-insert" functions names to
2459 * several files: more enahncements to NEW_INSETS and the resulting
2462 * lib/lyxrc.example (\date_insert_format): move to misc section
2464 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2465 bastring and use AC_CACHE_CHECK.
2466 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2467 the system have the newest methods. uses AC_CACHE_CHECK
2468 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2469 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2470 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2472 * configure.in: add LYX_CXX_GOOD_STD_STRING
2474 * acinclude.m4: recreated
2476 2000-07-24 Amir Karger
2478 * README: add Hebrew, Arabic kmaps
2481 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2483 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2486 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2488 * Lot of files: add pragma interface/implementation.
2490 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2492 * lib/ui/default.ui: new file (ans new directory). Contains the
2493 default menu and toolbar.
2495 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2496 global space. Toolbars are now read (as menus) in ui files.
2498 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2500 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2501 is disabled because the document is read-only. We want to have the
2502 toggle state of the function anyway.
2503 (getStatus): add code for LFUN_VC* functions (mimicking what is
2504 done in old-style menus)
2506 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2507 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2509 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2510 * src/BufferView_pimpl.C: ditto.
2511 * src/lyxfunc.C: ditto.
2513 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2514 default). This replaces old-style menus by new ones.
2516 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2517 MenuItem. Contain the data structure of a menu.
2519 * src/insets/insettext.C: use LyXView::setLayout instead of
2520 accessing directly the toolbar combox.
2521 * src/lyxfunc.C (Dispatch): ditto.
2523 * src/LyXView.C (setLayout): new method, which just calls
2524 Toolbar::setLayout().
2525 (updateLayoutChoice): move part of this method in Toolbar.
2527 * src/toolbar.[Ch]: removed.
2529 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2530 implementation the toolbar.
2532 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2533 the toolbar. It might make sense to merge it with ToolbarDefaults
2535 (setLayout): new function.
2536 (updateLayoutList): ditto.
2537 (openLayoutList): ditto.
2539 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2540 xforms implementation of the toolbar.
2541 (get_toolbar_func): comment out, since I do not
2542 know what it is good for.
2544 * src/ToolbarDefaults.h: Add the ItemType enum.
2546 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2547 for a list of allocated C strings. Used in Menubar xforms
2548 implementation to avoid memory leaks.
2550 * src/support/lstrings.[Ch] (uppercase): new version taking and
2554 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2555 * lib/bind/emacs.bind: ditto.
2557 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2559 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2560 forward decl of LyXView.
2562 * src/toolbar.C (toolbarItem): moved from toolbar.h
2563 (toolbarItem::clean): ditto
2564 (toolbarItem::~toolbarItem): ditto
2565 (toolbarItem::operator): ditto
2567 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2569 * src/paragraph.h: control the NEW_TABULAR define from here
2571 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2572 USE_TABULAR_INSETS to NEW_TABULAR
2574 * src/ToolbarDefaults.C: add include "lyxlex.h"
2576 * files using the old table/tabular: use NEW_TABULAR to control
2577 compilation of old tabular stuff.
2579 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2582 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2583 planemet in reading of old style floats, fix the \end_deeper
2584 problem when reading old style floats.
2586 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2588 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2590 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2592 * lib/bind/sciword.bind: updated.
2594 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2596 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2597 layout write problem
2599 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2601 * src/Makefile.am (INCLUDES): remove image directory from include
2604 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2605 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2607 * src/LyXView.C (create_form_form_main): read the application icon
2610 * lib/images/*.xpm: change the icons to use transparent color for
2613 * src/toolbar.C (update): change the color of the button when it
2616 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2618 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2619 setting explicitely the minibuffer.
2620 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2622 * src/LyXView.C (showState): new function. Shows font information
2623 in minibuffer and update toolbar state.
2624 (LyXView): call Toolbar::update after creating the
2627 * src/toolbar.C: change toollist to be a vector instead of a
2629 (BubbleTimerCB): get help string directly from the callback
2630 argument of the corresponding icon (which is the action)
2631 (set): remove unnecessary ugliness.
2632 (update): new function. update the icons (depressed, disabled)
2633 depending of the status of the corresponding action.
2635 * src/toolbar.h: remove help in toolbarItem
2637 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2639 * src/Painter.C (text): Added code for using symbol glyphs from
2640 iso10646 fonts. Currently diabled.
2642 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2645 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2646 magyar,turkish and usorbian.
2648 * src/paragraph.C (isMultiLingual): Made more efficient.
2650 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2653 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2654 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2655 Also changed the prototype to "bool math_insert_greek(char)".
2657 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2659 * lots of files: apply the NEW_INSETS on all code that will not be
2660 needed when we move to use the new insets. Enable the define in
2661 lyxparagrah.h to try it.
2663 * src/insets/insettabular.C (cellstart): change to be a static
2665 (InsetTabular): initialize buffer in the initializer list.
2667 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2669 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2670 form_print.h out of the header file. Replaced with forward
2671 declarations of the relevant struct.
2673 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2676 * src/commandtags.h: do not include "debug.h" which does not
2677 belong there. #include it in some other places because of this
2680 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2682 * src/insets/insetcaption.C: add a couple "using" directives.
2684 * src/toolbar.C (add): get the help text directly from lyxaction.
2686 (setPixmap): new function. Loads from disk and sets a pixmap on a
2687 botton; the name of the pixmap file is derived from the command
2690 * src/toolbar.h: remove members isBitmap and pixmap from
2693 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2694 * lib/images/: move many files from images/banner.xpm.
2696 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2698 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2699 * src/toolbar.C: ditto.
2700 * configure.in: ditto.
2701 * INSTALL: document.
2703 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2704 the spellchecker popup is closed from the WM.
2706 2000-07-19 Juergen Vigna <jug@sad.it>
2708 * src/insets/insetfloat.C (Write): small fix because we use the
2709 insetname for the type now!
2711 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2713 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2716 * src/frontends/Dialogs.h: removed hideCitation signal
2718 * src/insets/insetcite.h: added hide signal
2720 * src/insets/insetcite.C (~InsetCitation): emits new signal
2721 (getScreenLabel): "intelligent" label should now fit on the screen!
2723 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2725 * src/frontends/xforms/FormCitation.C (showInset): connects
2726 hide() to the inset's hide signal
2727 (show): modified to use fl_set_object_position rather than
2728 fl_set_object_geometry wherever possible
2730 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2732 * src/insets/lyxinset.h: add caption code
2734 * src/insets/insetfloat.C (type): new method
2736 * src/insets/insetcaption.C (Write): new method
2738 (LyxCode): new method
2740 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2741 to get it right together with using the FloatList.
2743 * src/commandtags.h: add LFUN_INSET_CAPTION
2744 * src/lyxfunc.C (Dispatch): handle it
2746 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2749 * src/Variables.[Ch]: make expand take a const reference, remove
2750 the destructor, some whitespace changes.
2752 * src/LyXAction.C (init): add caption-inset-insert
2754 * src/FloatList.C (FloatList): update the default floats a bit.
2756 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2758 * src/Variables.[Ch]: new files. Intended to be used for language
2759 specific strings (like \chaptername) and filename substitution in
2762 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2764 * lib/kbd/american.kmap: update
2766 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2768 * src/bufferparams.[Ch]: remove member allowAccents.
2770 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2772 * src/LaTeXLog.C: use the log_form.h header.
2773 * src/lyx_gui.C: ditto.
2774 * src/lyx_gui_misc.C: ditto.
2775 * src/lyxvc.h: ditto.
2777 * forms/log_form.fd: new file, created from latexoptions.fd. I
2778 kept the log popup and nuked the options form.
2780 * src/{la,}texoptions.[Ch]: removed.
2781 * src/lyx_cb.C (LaTeXOptions): ditto
2783 * src/lyx_gui.C (create_forms): do not handle the
2784 fd_latex_options form.
2786 2000-07-18 Juergen Vigna <jug@sad.it>
2788 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2789 name of the inset so that it can be requested outside (text2.C).
2791 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2794 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2796 * src/mathed/formula.h (ConvertFont): constify
2798 * src/mathed/formula.C (Read): add warning if \end_inset is not
2799 found on expected place.
2801 * src/insets/lyxinset.h (ConvertFont): consify
2803 * src/insets/insetquotes.C (ConvertFont): constify
2804 * src/insets/insetquotes.h: ditto
2806 * src/insets/insetinfo.h: add labelfont
2808 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2809 (ascent): use labelfont
2813 (Write): make .lyx file a bit nicer
2815 * src/insets/insetfloat.C (Write): simplify somewhat...
2816 (Read): add warning if arg is not found
2818 * src/insets/insetcollapsable.C: add using std::max
2819 (Read): move string token and add warning in arg is not found
2820 (draw): use std::max to get the right ty
2821 (getMaxWidth): simplify by using std::max
2823 * src/insets/insetsection.h: new file
2824 * src/insets/insetsection.C: new file
2825 * src/insets/insetcaption.h: new file
2826 * src/insets/insetcaption.C: new file
2828 * src/insets/inset.C (ConvertFont): constify signature
2830 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2831 insetcaption.[Ch] and insetsection.[Ch]
2833 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2834 uses to use LABEL_COUNTER_CHAPTER instead.
2835 * src/text2.C (SetCounter): here
2837 * src/counters.h: new file
2838 * src/counters.C: new file
2839 * src/Sectioning.h: new file
2840 * src/Sectioning.C: new file
2842 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2844 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2846 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2849 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2852 2000-07-17 Juergen Vigna <jug@sad.it>
2854 * src/tabular.C (Validate): check if array-package is needed.
2855 (SetVAlignment): added support for vertical alignment.
2856 (SetLTFoot): better support for longtable header/footers
2857 (Latex): modified to support added features.
2859 * src/LaTeXFeatures.[Ch]: added array-package.
2861 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2863 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2866 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2868 * configure.in: do not forget to put a space after -isystem.
2870 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2872 * lib/kbd/arabic.kmap: a few fixes.
2874 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2876 * some whitespace chagnes to a number of files.
2878 * src/support/DebugStream.h: change to make it easier for
2879 doc++ to parse correctly.
2880 * src/support/lyxstring.h: ditto
2882 * src/mathed/math_utils.C (compara): change to have only one
2884 (MathedLookupBOP): change because of the above.
2886 * src/mathed/math_delim.C (math_deco_compare): change to have only
2888 (search_deco): change becasue of the above.
2890 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2891 instead of manually coded one.
2893 * src/insets/insetquotes.C (Read): read the \end_inset too
2895 * src/insets/insetlatex.h: remove file
2896 * src/insets/insetlatex.C: remove file
2898 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2900 (InsetPrintIndex): remove destructor
2902 * src/insets/insetinclude.h: remove default constructor
2904 * src/insets/insetfloat.C: work to make it work better
2906 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2908 * src/insets/insetcite.h (InsetCitation): remove default constructor
2910 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2912 * src/text.C (GetColumnNearX): comment out some currently unused code.
2914 * src/paragraph.C (writeFile): move some initializations closer to
2916 (CutIntoMinibuffer): small change to use new matchIT operator
2920 (InsertInset): ditto
2923 (InsetIterator): ditto
2924 (Erase): small change to use new matchFT operator
2926 (GetFontSettings): ditto
2927 (HighestFontInRange): ditto
2930 * src/lyxparagraph.h: some chars changed to value_type
2931 (matchIT): because of some stronger checking (perhaps too strong)
2932 in SGI STL, the two operator() unified to one.
2935 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2937 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2938 the last inset read added
2939 (parseSingleLyXformat2Token): some more (future) compability code added
2940 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2941 (parseSingleLyXformat2Token): set last_inset_read
2942 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2943 (parseSingleLyXformat2Token): don't double intializw string next_token
2945 * src/TextCache.C (text_fits::operator()): add const's to the signature
2946 (has_buffer::operator()): ditto
2948 * src/Floating.h: add some comments on the class
2950 * src/FloatList.[Ch] (typeExist): new method
2953 * src/BackStack.h: added default constructor, wanted by Gcc.
2955 2000-07-14 Juergen Vigna <jug@sad.it>
2957 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2959 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2961 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2962 do a redraw when the window is resized!
2963 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2965 * src/insets/insettext.C (resizeLyXText): added function to correctly
2966 being able to resize the LyXWindow.
2968 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2970 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2972 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2973 crashes when closing dialog to a deleted inset.
2975 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2976 method! Now similar to other insets.
2978 2000-07-13 Juergen Vigna <jug@sad.it>
2980 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2982 * lib/examples/Literate.lyx: small patch!
2984 * src/insets/insetbib.C (Read): added this function because of wrong
2985 Write (without [begin|end]_inset).
2987 2000-07-11 Juergen Vigna <jug@sad.it>
2989 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2990 as the insertInset could not be good!
2992 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2993 the bool param should not be last.
2995 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2997 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2998 did submit that to Karl).
3000 * configure.in: use -isystem instead of -I for X headers. This
3001 fixes a problem on solaris with a recent gcc;
3002 put the front-end code after the X detection code;
3003 configure in sigc++ before lib/
3005 * src/lyx_main.C (commandLineHelp): remove -display from command
3008 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3010 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3011 Also put in Makefile rules for building the ``listerrors''
3012 program for parsing errors from literate programs written in LyX.
3014 * lib/build-listerrors: Added small shell script as part of compile
3015 process. This builds a working ``listerrors'' binary if noweb is
3016 installed and either 1) the VNC X server is installed on the machine,
3017 or 2) the user is compiling from within a GUI. The existence of a GUI
3018 is necessary to use the ``lyx --export'' feature for now. This
3019 hack can be removed once ``lyx --export'' no longer requires a GUI to
3022 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3024 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3025 now passed back correctly from gcc and placed "under" error
3026 buttons in a Literate LyX source.
3028 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3030 * src/text.C (GetColumnNearX): Better behavior when a RTL
3031 paragraph is ended by LTR text.
3033 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3036 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3038 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3039 true when clipboard is empty.
3041 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3043 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3044 row of the paragraph.
3045 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3046 to prevent calculation of bidi tables
3048 2000-07-07 Juergen Vigna <jug@sad.it>
3050 * src/screen.C (ToggleSelection): added y_offset and x_offset
3053 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3056 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3058 * src/insets/insettext.C: fixed Layout-Display!
3060 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3062 * configure.in: add check for strings.h header.
3064 * src/spellchecker.C: include <strings.h> in order to have a
3065 definition for bzero().
3067 2000-07-07 Juergen Vigna <jug@sad.it>
3069 * src/insets/insettext.C (draw): set the status of the bv->text to
3070 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3072 * src/screen.C (DrawOneRow):
3073 (DrawFromTo): redraw the actual row if something has changed in it
3076 * src/text.C (draw): call an update of the toplevel-inset if something
3077 has changed inside while drawing.
3079 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3081 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3083 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3084 processing inside class.
3086 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3087 processing inside class.
3089 * src/insets/insetindex.h new struct Holder, consistent with other
3092 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3093 citation dialog from main code and placed it in src/frontends/xforms.
3094 Dialog launched through signals instead of callbacks
3096 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3098 * lyx.man: update the options description.
3100 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3102 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3103 handle neg values, set min width to 590, add doc about -display
3105 2000-07-05 Juergen Vigna <jug@sad.it>
3107 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3108 calls to BufferView *.
3110 * src/insets/insettext.C (checkAndActivateInset): small fix non
3111 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3113 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3114 their \end_inset token!
3116 2000-07-04 edscott <edscott@imp.mx>
3118 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3119 lib/lyxrc.example: added option \wheel_jump
3121 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3123 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3124 remove support for -width,-height,-xpos and -ypos.
3126 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3128 * src/encoding.[Ch]: New files.
3130 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3131 (text): Call to the underline() method only when needed.
3133 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3135 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3136 encoding(s) for the document.
3138 * src/bufferparams.C (BufferParams): Changed default value of
3141 * src/language.C (newLang): Removed.
3142 (items[]): Added encoding information for all defined languages.
3144 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3145 encoding choice button.
3147 * src/lyxrc.h (font_norm_type): New member variable.
3148 (set_font_norm_type): New method.
3150 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3151 paragraphs with different encodings.
3153 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3154 (TransformChar): Changed to work correctly with Arabic points.
3155 (draw): Added support for drawing Arabic points.
3156 (draw): Removed code for drawing underbars (this is done by
3159 * src/support/textutils.h (IsPrintableNonspace): New function.
3161 * src/BufferView_pimpl.h: Added "using SigC::Object".
3162 * src/LyXView.h: ditto.
3164 * src/insets/insetinclude.h (include_label): Changed to mutable.
3166 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3168 * src/mathed/math_iter.h: remove empty destructor
3170 * src/mathed/math_cursor.h: remove empty destructor
3172 * src/insets/lyxinset.h: add THEOREM_CODE
3174 * src/insets/insettheorem.[Ch]: new files
3176 * src/insets/insetminipage.C: (InsertInset): remove
3178 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3180 (InsertInset): remove
3182 * src/insets/insetlist.C: (InsertList): remove
3184 * src/insets/insetfootlike.[Ch]: new files
3186 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3189 (InsertInset): ditto
3191 * src/insets/insetert.C: remove include Painter.h, reindent
3192 (InsertInset): move to header
3194 * src/insets/insetcollapsable.h: remove explicit from default
3195 contructor, remove empty destructor, add InsertInset
3197 * src/insets/insetcollapsable.C (InsertInset): new func
3199 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3201 * src/vspace.h: add explicit to constructor
3203 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3204 \textcompwordmark, please test this.
3206 * src/lyxrc.C: set ascii_linelen to 65 by default
3208 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3210 * src/commandtags.h: add LFUN_INSET_THEOREM
3212 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3213 (makeLinuxDocFile): remove _some_ of the nice logic
3214 (makeDocBookFile): ditto
3216 * src/Painter.[Ch]: (~Painter): removed
3218 * src/LyXAction.C (init): entry for insettheorem added
3220 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3222 (deplog): code to detect files generated by LaTeX, needs testing
3225 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3227 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3229 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3231 * src/LaTeX.C (deplog): Add a check for files that are going to be
3232 created by the first latex run, part of the project to remove the
3235 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3236 contents to the extension list.
3238 2000-07-04 Juergen Vigna <jug@sad.it>
3240 * src/text.C (NextBreakPoint): added support for needFullRow()
3242 * src/insets/lyxinset.h: added needFullRow()
3244 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3247 * src/insets/insettext.C: lots of changes for update!
3249 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3251 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3253 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3255 * src/insets/insetinclude.C (InsetInclude): fixed
3256 initialization of include_label.
3257 (unique_id): now returns a string.
3259 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3261 * src/LaTeXFeatures.h: new member IncludedFiles, for
3262 a map of key, included file name.
3264 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3265 with the included files for inclusion in SGML preamble,
3266 i. e., linuxdoc and docbook.
3269 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3270 nice (is the generated linuxdoc code to be exported?), that
3271 allows to remove column, and only_body that will be true for
3272 slave documents. Insets are allowed inside SGML font type.
3273 New handling of the SGML preamble for included files.
3274 (makeDocBookFile): the same for docbook.
3276 * src/insets/insetinclude.h:
3277 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3279 (DocBook): new export methods.
3281 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3282 and makeDocBookFile.
3284 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3285 formats to export with command line argument -x.
3287 2000-06-29 Juergen Vigna <jug@sad.it>
3289 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3290 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3292 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3293 region could already been cleared by an inset!
3295 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3297 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3300 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3302 (cursorToggle): remove special handling of lyx focus.
3304 2000-06-28 Juergen Vigna <jug@sad.it>
3306 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3309 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3311 * src/insets/insetindex.C (Edit): add a callback when popup is
3314 * src/insets/insettext.C (LocalDispatch):
3315 * src/insets/insetmarginal.h:
3316 * src/insets/insetlist.h:
3317 * src/insets/insetfoot.h:
3318 * src/insets/insetfloat.h:
3319 * src/insets/insetert.h: add a missing std:: qualifier.
3321 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3323 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3326 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3328 * src/insets/insettext.C (Read): remove tmptok unused variable
3329 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3330 (InsertInset): change for new InsetInset code
3332 * src/insets/insettext.h: add TEXT inline method
3334 * src/insets/insettext.C: remove TEXT macro
3336 * src/insets/insetmarginal.C (Write): new method
3337 (Latex): change output slightly
3339 * src/insets/insetfoot.C (Write): new method
3340 (Latex): change output slightly (don't use endl when no need)
3342 * src/insets/insetert.C (Write): new method
3344 * src/insets/insetcollapsable.h: make button_length, button_top_y
3345 and button_bottm_y protected.
3347 * src/insets/insetcollapsable.C (Write): simplify code by using
3348 tostr. Also do not output the float name, the children class
3349 should to that to get control over own arguments
3351 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3352 src/insets/insetminipage.[Ch]:
3355 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3357 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3359 * src/Makefile.am (lyx_SOURCES): add the new files
3361 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3362 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3363 * src/commandtags.h: ditto
3365 * src/LaTeXFeatures.h: add a std::set of used floattypes
3367 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3369 * src/FloatList.[Ch] src/Floating.h: new files
3371 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3373 * src/lyx_cb.C (TableApplyCB): ditto
3375 * src/text2.C: ditto
3376 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3377 (parseSingleLyXformat2Token): ditto + add code for
3378 backwards compability for old float styles + add code for new insets
3380 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3382 (InsertInset(size_type, Inset *, LyXFont)): new method
3383 (InsetChar(size_type, char)): changed to use the other InsetChar
3384 with a LyXFont(ALL_INHERIT).
3385 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3386 insert the META_INSET.
3388 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3390 * sigc++/thread.h (Threads): from here
3392 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3393 definition out of line
3394 * sigc++/scope.h: from here
3396 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3398 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3399 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3401 * Makefile.am (bindist): new target.
3403 * INSTALL: add instructions for doing a binary distribution.
3405 * development/tools/README.bin.example: update a bit.
3407 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3410 * lib/lyxrc.example: new lyxrc tag \set_color.
3412 * src/lyxfunc.C (Dispatch):
3413 * src/commandtags.h:
3414 * src/LyXAction.C: new lyxfunc "set-color".
3416 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3417 and an x11name given as strings.
3419 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3420 cache when a color is changed.
3422 2000-06-26 Juergen Vigna <jug@sad.it>
3424 * src/lyxrow.C (width): added this functions and variable.
3426 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3429 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3431 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3433 * images/undo_bw.xpm: new icon.
3434 * images/redo_bw.xpm: ditto.
3436 * configure.in (INSTALL_SCRIPT): change value to
3437 ${INSTALL} to avoid failures of install-script target.
3438 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3440 * src/BufferView.h: add a magic "friend" declaration to please
3443 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3445 * forms/cite.fd: modified to allow resizing without messing
3448 * src/insetcite.C: Uses code from cite.fd almost without
3450 User can now resize dialog in the x-direction.
3451 Resizing the dialog in the y-direction is prevented, as the
3452 code does this intelligently already.
3454 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3456 * INSTALL: remove obsolete entry in "problems" section.
3458 * lib/examples/sl_*.lyx: update of the slovenian examples.
3460 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3462 2000-06-23 Juergen Vigna <jug@sad.it>
3464 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3466 * src/buffer.C (resize): delete the LyXText of textinsets.
3468 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3470 * src/insets/lyxinset.h: added another parameter 'cleared' to
3471 the draw() function.
3473 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3474 unlocking inset in inset.
3476 2000-06-22 Juergen Vigna <jug@sad.it>
3478 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3479 of insets and moved first to LyXText.
3481 * src/mathed/formulamacro.[Ch]:
3482 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3484 2000-06-21 Juergen Vigna <jug@sad.it>
3486 * src/text.C (GetVisibleRow): look if I should clear the area or not
3487 using Inset::doClearArea() function.
3489 * src/insets/lyxinset.h: added doClearArea() function and
3490 modified draw(Painter &, ...) to draw(BufferView *, ...)
3492 * src/text2.C (UpdateInset): return bool insted of int
3494 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3496 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3497 combox in the character popup
3499 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3500 BufferParams const & params
3502 2000-06-20 Juergen Vigna <jug@sad.it>
3504 * src/insets/insettext.C (SetParagraphData): set insetowner on
3507 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3509 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3510 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3512 (form_main_): remove
3514 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3515 (create_form_form_main): remove FD_form_main stuff, connect to
3516 autosave_timeout signal
3518 * src/LyXView.[Ch] (getMainForm): remove
3519 (UpdateTimerCB): remove
3520 * src/BufferView_pimpl.h: inherit from SigC::Object
3522 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3523 signal instead of callback
3525 * src/BufferView.[Ch] (cursorToggleCB): remove
3527 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3529 * src/BufferView_pimpl.C: changes because of the one below
3531 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3532 instead of storing a pointer to a LyXText.
3534 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3536 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3538 * src/lyxparagraph.h
3540 * src/paragraph.C: Changed fontlist to a sorted vector.
3542 2000-06-19 Juergen Vigna <jug@sad.it>
3544 * src/BufferView.h: added screen() function.
3546 * src/insets/insettext.C (LocalDispatch): some selection code
3549 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3551 * src/insets/insettext.C (SetParagraphData):
3553 (InsetText): fixes for multiple paragraphs.
3555 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3557 * development/lyx.spec.in: Call configure with ``--without-warnings''
3558 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3559 This should be fine, however, since we generally don't want to be
3560 verbose when making an RPM.
3562 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3564 * lib/scripts/fig2pstex.py: New file
3566 2000-06-16 Juergen Vigna <jug@sad.it>
3568 * src/insets/insettabular.C (UpdateLocal):
3569 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3570 (LocalDispatch): Changed all functions to use LyXText.
3572 2000-06-15 Juergen Vigna <jug@sad.it>
3574 * src/text.C (SetHeightOfRow): call inset::update before requesting
3577 * src/insets/insettext.C (update):
3578 * src/insets/insettabular.C (update): added implementation
3580 * src/insets/lyxinset.h: added update function
3582 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3584 * src/text.C (SelectNextWord): protect against null pointers with
3585 old-style string streams. (fix from Paul Theo Gonciari
3588 * src/cite.[Ch]: remove erroneous files.
3590 * lib/configure.m4: update the list of created directories.
3592 * src/lyxrow.C: include <config.h>
3593 * src/lyxcursor.C: ditto.
3595 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3597 * lib/examples/decimal.lyx: new example file from Mike.
3599 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3600 to find template definitions (from Dekel)
3602 * src/frontends/.cvsignore: add a few things.
3604 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3606 * src/Timeout.C (TimeOut): remove default argument.
3608 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3611 * src/insets/ExternalTemplate.C: add a "using" directive.
3613 * src/lyx_main.h: remove the act_ struct, which seems unused
3616 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3618 * LyX Developers Meeting: All files changed, due to random C++ (by
3619 coincidence) code generator script.
3621 - external inset (cool!)
3622 - initial online editing of preferences
3623 - insettabular breaks insettext(s contents)
3625 - some DocBook fixes
3626 - example files update
3627 - other cool stuff, create a diff and look for yourself.
3629 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3631 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3632 -1 this is a non-line-breaking textinset.
3634 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3635 if there is no width set.
3637 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3639 * Lots of files: Merged the dialogbase branch.
3641 2000-06-09 Allan Rae <rae@lyx.org>
3643 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3644 and the Dispatch methods that used it.
3646 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3647 access to functions formerly kept in Dispatch.
3649 2000-05-19 Allan Rae <rae@lyx.org>
3651 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3652 made to_page and count_copies integers again. from_page remains a
3653 string however because I want to allow entry of a print range like
3654 "1,4,22-25" using this field.
3656 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3657 and printer-params-get. These aren't useful from the minibuffer but
3658 could be used by a script/LyXServer app provided it passes a suitable
3659 auto_mem_buffer. I guess I should take a look at how the LyXServer
3660 works and make it support xtl buffers.
3662 * sigc++/: updated to libsigc++-1.0.1
3664 * src/xtl/: updated to xtl-1.3.pl.11
3666 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3667 those changes done to the files in src/ are actually recreated when
3668 they get regenerated. Please don't ever accept a patch that changes a
3669 dialog unless that patch includes the changes to the corresponding *.fd
3672 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3673 stringOnlyContains, renamed it and generalised it.
3675 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3676 branch. Removed the remaining old form_print code.
3678 2000-04-26 Allan Rae <rae@lyx.org>
3680 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3681 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3683 2000-04-25 Allan Rae <rae@lyx.org>
3685 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3686 against a base of xtl-1.3.pl.4
3688 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3689 filter the Id: entries so they still show the xtl version number
3692 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3693 into the src/xtl code. Patch still pending with José (XTL)
3695 2000-04-24 Allan Rae <rae@lyx.org>
3697 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3698 both more generic and much safer. Use the new template functions.
3699 * src/buffer.[Ch] (Dispatch): ditto.
3701 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3702 and mem buffer more intelligently. Also a little general cleanup.
3705 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3706 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3707 * src/xtl/Makefile.am: ditto.
3708 * src/xtl/.cvsignore: ditto.
3709 * src/Makefile.am: ditto.
3711 * src/PrinterParams.h: Removed the macros member functions. Added a
3712 testInvariant member function. A bit of tidying up and commenting.
3713 Included Angus's idea for fixing operation with egcs-1.1.2.
3715 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3716 cool expansion of XTL's mem_buffer to support automatic memory
3717 management within the buffer itself. Removed the various macros and
3718 replaced them with template functions that use either auto_mem_buffer
3719 or mem_buffer depending on a #define. The mem_buffer support will
3720 disappear as soon as the auto_mem_buffer is confirmed to be good on
3721 other platforms/compilers. That is, it's there so you've got something
3724 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3725 effectively forked XTL. However I expect José will include my code
3726 into the next major release. Also fixed a memory leak.
3727 * src/xtl/text.h: ditto.
3728 * src/xtl/xdr.h: ditto.
3729 * src/xtl/giop.h: ditto.
3731 2000-04-16 Allan Rae <rae@lyx.org>
3733 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3734 by autogen.sh and removed by maintainer-clean anyway.
3735 * .cvsignore, sigc++/.cvsignore: Support the above.
3737 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3739 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3741 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3742 macros, renamed static callback-target member functions to suit new
3743 scheme and made them public.
3744 * src/frontends/xforms/forms/form_print.fd: ditto.
3745 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3747 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3750 * src/xtl/: New directory containing a minimal distribution of XTL.
3751 This is XTL-1.3.pl.4.
3753 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3755 2000-04-15 Allan Rae <rae@lyx.org>
3757 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3759 * sigc++/: Updated to libsigc++-1.0.0
3761 2000-04-14 Allan Rae <rae@lyx.org>
3763 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3764 use the generic ones in future. I'll modify my conversion script.
3766 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3768 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3769 (CloseAllBufferRelatedDialogs): Renamed.
3770 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3772 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3773 of the generic ones. These are the same ones my conversion script
3776 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3777 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3778 * src/buffer.C (Dispatch): ditto
3780 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3781 functions for updating and hiding buffer dependent dialogs.
3782 * src/BufferView.C (buffer): ditto
3783 * src/buffer.C (setReadonly): ditto
3784 * src/lyxfunc.C (CloseBuffer): ditto
3786 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3787 Dialogs.h, and hence all the SigC stuff, into every file that includes
3788 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3790 * src/BufferView2.C: reduce the number of headers included by buffer.h
3792 2000-04-11 Allan Rae <rae@lyx.org>
3794 * src/frontends/xforms/xform_macros.h: A small collection of macros
3795 for building C callbacks.
3797 * src/frontends/xforms/Makefile.am: Added above file.
3799 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3800 scheme again. This time it should work for JMarc. If this is
3801 successful I'll revise my conversion script to automate some of this.
3802 The static member functions in the class also have to be public for
3803 this scheme will work. If the scheme works (it's almost identical to
3804 the way BufferView::cursorToggleCB is handled so it should work) then
3805 FormCopyright and FormPrint will be ready for inclusion into the main
3806 trunk immediately after 1.1.5 is released -- provided we're prepared
3807 for complaints about lame compilers not handling XTL.
3809 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3811 2000-04-07 Allan Rae <rae@lyx.org>
3813 * config/lyxinclude.m4: A bit more tidying up (Angus)
3815 * src/LString.h: JMarc's <string> header fix
3817 * src/PrinterParams.h: Used string for most data to remove some
3818 ugly code in the Print dialog and avoid even uglier code when
3819 appending the ints to a string for output.
3821 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3822 and moved "default:" back to the end of switch statement. Cleaned
3823 up the printing so it uses the right function calls and so the
3824 "print to file" option actually puts the file in the right directory.
3826 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3828 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3829 and Ok+Apply button control into a separate method: input (Angus).
3830 (input) Cleaned it up and improved it to be very thorough now.
3831 (All CB) static_cast used instead of C style cast (Angus). This will
3832 probably change again once we've worked out how to keep gcc-2.8.1 happy
3833 with real C callbacks.
3834 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3835 ignore some of the bool settings and has random numbers instead. Needs
3836 some more investigation. Added other input length checks and checking
3837 of file and printer names.
3839 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3840 would link (Angus). Seems the old code doesn't compile with the pragma
3841 statement either. Separated callback entries from internal methods.
3843 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3845 2000-03-17 Allan Rae <rae@lyx.org>
3847 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3848 need it? Maybe it could go in Dialogs instead? I could make it a
3849 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3850 values to get the bool return value.
3851 (Dispatch): New overloaded method for xtl support.
3853 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3854 extern "C" callback instead of static member functions. Hopefully,
3855 JMarc will be able to compile this. I haven't changed
3856 forms/form_copyright.fd yet. Breaking one of my own rules already.
3858 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3859 because they aren't useful from the minibuffer. Maybe a LyXServer
3860 might want a help message though?
3862 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3864 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3865 xtl which needs both rtti and exceptions.
3867 * src/support/Makefile.am:
3868 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3870 * src/frontends/xforms/input_validators.[ch]: input filters and
3871 validators. These conrol what keys are valid in input boxes.
3872 Use them and write some more. Much better idea than waiting till
3873 after the user has pressed Ok to say that the input fields don't make
3876 * src/frontends/xforms/Makefile.am:
3877 * src/frontends/xforms/forms/form_print.fd:
3878 * src/frontends/xforms/forms/makefile:
3879 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3880 new scheme. Still have to make sure I haven't missed anything from
3881 the current implementation.
3883 * src/Makefile.am, src/PrinterParams.h: New data store.
3885 * other files: Added a couple of copyright notices.
3887 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3889 * src/insets/insetbib.h: move Holder struct in public space.
3891 * src/frontends/include/DialogBase.h: use SigC:: only when
3892 SIGC_CXX_NAMESPACES is defined.
3893 * src/frontends/include/Dialogs.h: ditto.
3895 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3897 * src/frontends/xforms/FormCopyright.[Ch]: do not
3898 mention SigC:: explicitely.
3900 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3902 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3903 deals with testing KDE in main configure.in
3904 * configure.in: ditto.
3906 2000-02-22 Allan Rae <rae@lyx.org>
3908 * Lots of files: Merged from HEAD
3910 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3911 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3913 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3915 * sigc++/: new minidist.
3917 2000-02-14 Allan Rae <rae@lyx.org>
3919 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3921 2000-02-08 Juergen Vigna <jug@sad.it>
3923 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3924 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3926 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3927 for this port and so it is much easier for other people to port
3928 dialogs in a common development environment.
3930 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3931 the QT/KDE implementation.
3933 * src/frontends/kde/Dialogs.C:
3934 * src/frontends/kde/FormCopyright.C:
3935 * src/frontends/kde/FormCopyright.h:
3936 * src/frontends/kde/Makefile.am:
3937 * src/frontends/kde/formcopyrightdialog.C:
3938 * src/frontends/kde/formcopyrightdialog.h:
3939 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3940 for the kde support of the Copyright-Dialog.
3942 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3943 subdir-substitution instead of hardcoded 'xforms' as we now have also
3946 * src/frontends/include/DialogBase.h (Object): just commented the
3947 label after #endif (nasty warning and I don't like warnings ;)
3949 * src/main.C (main): added KApplication initialization if using
3952 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3953 For now only the KDE event-loop is added if frontend==kde.
3955 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3957 * configure.in: added support for the --with-frontend[=value] option
3959 * autogen.sh: added kde.m4 file to list of config-files
3961 * acconfig.h: added define for KDEGUI-support
3963 * config/kde.m4: added configuration functions for KDE-port
3965 * config/lyxinclude.m4: added --with-frontend[=value] option with
3966 support for xforms and KDE.
3968 2000-02-08 Allan Rae <rae@lyx.org>
3970 * all Makefile.am: Fixed up so the make targets dist, distclean,
3971 install and uninstall all work even if builddir != srcdir. Still
3972 have a new sigc++ minidist update to come.
3974 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3976 2000-02-01 Allan Rae <rae@lyx.org>
3978 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3979 Many mods to get builddir != srcdir working.
3981 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3982 for building on NT and so we can do the builddir != srcdir stuff.
3984 2000-01-30 Allan Rae <rae@lyx.org>
3986 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3987 This will stay in "rae" branch. We probably don't really need it in
3988 the main trunk as anyone who wants to help programming it should get
3989 a full library installed also. So they can check both included and
3990 system supplied library compilation.
3992 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3993 Added a 'mini' distribution of libsigc++. If you feel the urge to
3994 change something in these directories - Resist it. If you can't
3995 resist the urge then you should modify the following script and rebuild
3996 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3997 all happen. Still uses a hacked version of libsigc++'s configure.in.
3998 I'm quite happy with the results. I'm not sure the extra work to turn
3999 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4000 worth the trouble and would probably lead to extra maintenance
4002 I haven't tested the following important make targets: install, dist.
4003 Not ready for prime time but very close. Maybe 1.1.5.
4005 * development/tools/makeLyXsigc.sh: A shell script to automatically
4006 generate our mini-dist of libsigc++. It can only be used with a CVS
4007 checkout of libsigc++ not a tarball distribution. It's well commented.
4008 This will end up as part of the libsigc++ distribution so other apps
4009 can easily have an included mini-dist. If someone makes mods to the
4010 sigc++ subpackage without modifying this script to generate those
4011 changes I'll be very upset!
4013 * src/frontends/: Started the gui/system indep structure.
4015 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4016 to access the gui-indep dialogs are in this class. Much improved
4017 design compared to previous revision. Lars, please refrain from
4018 moving this header into src/ like you did with Popups.h last time.
4020 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4022 * src/frontends/xforms/: Started the gui-indep system with a single
4023 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4026 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4027 Here you'll find a very useful makefile and automated fdfix.sh that
4028 makes updating dailogs a no-brainer -- provided you follow the rules
4029 set out in the README. I'm thinking about adding another script to
4030 automatically generate skeleton code for a new dialog given just the
4033 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4034 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4035 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4037 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4039 * src/support/LSubstring.C (operator): simplify
4041 * src/lyxtext.h: removed bparams, use buffer_->params instead
4043 * src/lyxrow.h: make Row a real class, move all variables to
4044 private and use accessors.
4046 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4048 (isRightToLeftPar): ditto
4049 (ChangeLanguage): ditto
4050 (isMultiLingual): ditto
4053 (SimpleTeXOnePar): ditto
4054 (TeXEnvironment): ditto
4055 (GetEndLabel): ditto
4057 (SetOnlyLayout): ditto
4058 (BreakParagraph): ditto
4059 (BreakParagraphConservative): ditto
4060 (GetFontSettings): ditto
4062 (CopyIntoMinibuffer): ditto
4063 (CutIntoMinibuffer): ditto
4064 (PasteParagraph): ditto
4065 (SetPExtraType): ditto
4066 (UnsetPExtraType): ditto
4067 (DocBookContTableRows): ditto
4068 (SimpleDocBookOneTablePar): ditto
4070 (TeXFootnote): ditto
4071 (SimpleTeXOneTablePar): ditto
4072 (TeXContTableRows): ditto
4073 (SimpleTeXSpecialChars): ditto
4076 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4077 to private and use accessors.
4079 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4080 this, we did not use it anymore and has not been for ages. Just a
4081 waste of cpu cycles.
4083 * src/language.h: make Language a real class, move all variables
4084 to private and use accessors.
4086 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4087 (create_view): remove
4088 (update): some changes for new timer
4089 (cursorToggle): use new timer
4090 (beforeChange): change for new timer
4092 * src/BufferView.h (cursorToggleCB): removed last paramter because
4095 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4096 (cursorToggleCB): change because of new timer code
4098 * lib/CREDITS: updated own mailaddress
4100 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4102 * src/support/filetools.C (PutEnv): fix the code in case neither
4103 putenv() nor setenv() have been found.
4105 * INSTALL: mention the install-strip Makefile target.
4107 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4108 read-only documents.
4110 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4112 * lib/reLyX/configure.in (VERSION): avoid using a previously
4113 generated reLyX wrapper to find out $prefix.
4115 * lib/examples/eu_adibide_lyx-atua.lyx:
4116 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4117 translation of the Tutorial (Dooteo)
4119 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4121 * forms/cite.fd: new citation dialog
4123 * src/insetcite.[Ch]: the new citation dialog is moved into
4126 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4129 * src/insets/insetcommand.h: data members made private.
4131 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4133 * LyX 1.1.5 released
4135 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4137 * src/version.h (LYX_RELEASE): to 1.1.5
4139 * src/spellchecker.C (RunSpellChecker): return false if the
4140 spellchecker dies upon creation.
4142 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4144 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4145 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4149 * lib/CREDITS: update entry for Martin Vermeer.
4151 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4153 * src/text.C (draw): Draw foreign language bars at the bottom of
4154 the row instead of at the baseline.
4156 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4158 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4160 * lib/bind/de_menus.bind: updated
4162 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4164 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4166 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4168 * src/menus.C (Limit_string_length): New function
4169 (ShowTocMenu): Limit the number of items/length of items in the
4172 * src/paragraph.C (String): Correct result for a paragraph inside
4175 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4177 * src/bufferlist.C (close): test of buf->getuser() == NULL
4179 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4181 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4182 Do not call to SetCursor when the paragraph is a closed footnote!
4184 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4186 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4189 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4191 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4194 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4195 reference popup, that activates the reference-back action
4197 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4199 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4200 the menus. Also fixed a bug.
4202 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4203 the math panels when switching buffers (unless new buffer is readonly).
4205 * src/BufferView.C (NoSavedPositions)
4206 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4208 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4210 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4211 less of dvi dirty or not.
4213 * src/trans_mgr.[Ch] (insert): change first parameter to string
4216 * src/chset.[Ch] (encodeString): add const to first parameter
4218 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4220 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4224 * src/LaTeX.C (deplog): better searching for dependency files in
4225 the latex log. Uses now regexps.
4227 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4228 instead of the box hack or \hfill.
4230 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4232 * src/lyxfunc.C (doImportHelper): do not create the file before
4233 doing the actual import.
4234 (doImportASCIIasLines): create a new file before doing the insert.
4235 (doImportASCIIasParagraphs): ditto.
4237 * lib/lyxrc.example: remove mention of non-existing commands
4239 * lyx.man: remove mention of color-related switches.
4241 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4243 * src/lyx_gui.C: remove all the color-related ressources, which
4244 are not used anymore.
4246 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4249 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4251 * src/lyxrc.C (read): Add a missing break in the switch
4253 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4255 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4257 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4260 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4262 * src/text.C (draw): draw bars under foreign language words.
4264 * src/LColor.[Ch]: add LColor::language
4266 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4268 * src/lyxcursor.h (boundary): New member variable
4270 * src/text.C (IsBoundary): New methods
4272 * src/text.C: Use the above for currect cursor movement when there
4273 is both RTL & LTR text.
4275 * src/text2.C: ditto
4277 * src/bufferview_funcs.C (ToggleAndShow): ditto
4279 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4281 * src/text.C (DeleteLineForward): set selection to true to avoid
4282 that DeleteEmptyParagraphMechanism does some magic. This is how it
4283 is done in all other functions, and seems reasonable.
4284 (DeleteWordForward): do not jump over non-word stuff, since
4285 CursorRightOneWord() already does it.
4287 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4288 DeleteWordBackward, since they seem safe to me (since selection is
4289 set to "true") DeleteEmptyParagraphMechanism does nothing.
4291 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4293 * src/lyx_main.C (easyParse): simplify the code by factoring the
4294 part that removes parameters from the command line.
4295 (LyX): check wether wrong command line options have been given.
4297 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4299 * src/lyx_main.C : add support for specifying user LyX
4300 directory via command line option -userdir.
4302 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4304 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4305 the number of items per popup.
4306 (Add_to_refs_menu): Ditto.
4308 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4310 * src/lyxparagraph.h: renamed ClearParagraph() to
4311 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4312 textclass as parameter, and do nothing if free_spacing is
4313 true. This fixes part of the line-delete-forward problems.
4315 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4316 (pasteSelection): ditto.
4317 (SwitchLayoutsBetweenClasses): more translatable strings.
4319 * src/text2.C (CutSelection): use StripLeadingSpaces.
4320 (PasteSelection): ditto.
4321 (DeleteEmptyParagraphMechanism): ditto.
4323 2000-05-26 Juergen Vigna <jug@sad.it>
4325 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4326 is not needed in tabular insets.
4328 * src/insets/insettabular.C (TabularFeatures): added missing features.
4330 * src/tabular.C (DeleteColumn):
4332 (AppendRow): implemented this functions
4333 (cellsturct::operator=): clone the inset too;
4335 2000-05-23 Juergen Vigna <jug@sad.it>
4337 * src/insets/insettabular.C (LocalDispatch): better selection support
4338 when having multicolumn-cells.
4340 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4342 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4344 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4346 * src/ColorHandler.C (getGCForeground): put more test into _()
4348 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4351 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4354 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4356 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4357 there are no labels, or when buffer is readonly.
4359 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4360 there are no labels, buffer is SGML, or when buffer is readonly.
4362 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4364 * src/LColor.C (LColor): change a couple of grey40 to grey60
4365 (LColor): rewore initalization to make compiles go some magnitude
4367 (getGUIName): don't use gettext until we need the string.
4369 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4371 * src/Bullet.[Ch]: Fixed a small bug.
4373 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4375 * src/paragraph.C (String): Several fixes/improvements
4377 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4379 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4381 * src/paragraph.C (String): give more correct output.
4383 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4385 * src/lyxfont.C (stateText) Do not output the language if it is
4386 eqaul to the language of the document.
4388 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4389 between two paragraphs with the same language.
4391 * src/paragraph.C (getParLanguage) Return a correct answer for an
4392 empty dummy paragraph.
4394 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4397 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4400 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4401 the menus/popup, if requested fonts are unavailable.
4403 2000-05-22 Juergen Vigna <jug@sad.it>
4405 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4406 movement support (Up/Down/Tab/Shift-Tab).
4407 (LocalDispatch): added also preliminari cursor-selection.
4409 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4411 * src/paragraph.C (PasteParagraph): Hopefully now right!
4413 2000-05-22 Garst R. Reese <reese@isn.net>
4415 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4416 of list, change all references to Environment to Command
4417 * tex/hollywood.cls : rewrite environments as commands, add
4418 \uppercase to interiorshot and exteriorshot to force uppecase.
4419 * tex/broadway.cls : rewrite environments as commands. Tweak
4422 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4424 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4425 size of items: use a constant intead of the hardcoded 40, and more
4426 importantly do not remove the %m and %x tags added at the end.
4427 (Add_to_refs_menu): use vector::size_type instead of
4428 unsigned int as basic types for the variables. _Please_ do not
4429 assume that size_t is equal to unsigned int. On an alpha, this is
4430 unsigned long, which is _not_ the same.
4432 * src/language.C (initL): remove language "hungarian", since it
4433 seems that "magyar" is better.
4435 2000-05-22 Juergen Vigna <jug@sad.it>
4437 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4439 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4442 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4443 next was deleted but not set to 0.
4445 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4447 * src/language.C (initL): change the initialization of languages
4448 so that compiles goes _fast_.
4450 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4453 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4455 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4459 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4461 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4463 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4467 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4470 * src/insets/insetlo*.[Ch]: Made editable
4472 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4474 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4475 the current selection.
4477 * src/BufferView_pimpl.C (stuffClipboard): new method
4479 * src/BufferView.C (stuffClipboard): new method
4481 * src/paragraph.C (String): new method
4483 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4484 LColor::ignore when lyxname is not found.
4486 * src/BufferView.C (pasteSelection): new method
4488 * src/BufferView_pimpl.C (pasteSelection): new method
4490 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4492 * src/WorkArea.C (request_clipboard_cb): new static function
4493 (getClipboard): new method
4494 (putClipboard): new method
4496 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4498 * LyX 1.1.5pre2 released
4500 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4502 * src/vspace.C (operator=): removed
4503 (operator=): removed
4505 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4507 * src/layout.C (NumberOfClass): manually set the type in make_pair
4508 (NumberOfLayout): ditto
4510 * src/language.C: use the Language constructor for ignore_lang
4512 * src/language.h: add constructors to struct Language
4514 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4516 * src/text2.C (SetCursorIntern): comment out #warning
4518 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4520 * src/mathed/math_iter.h: initialize sx and sw to 0
4522 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4524 * forms/lyx.fd: Redesign of form_ref
4526 * src/LaTeXFeatures.[Ch]
4530 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4533 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4534 and Buffer::inset_iterator.
4536 * src/menus.C: Added new menus: TOC and Refs.
4538 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4540 * src/buffer.C (getTocList): New method.
4542 * src/BufferView2.C (ChangeRefs): New method.
4544 * src/buffer.C (getLabelList): New method. It replaces the old
4545 getReferenceList. The return type is vector<string> instead of
4548 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4549 the old getLabel() and GetNumberOfLabels() methods.
4550 * src/insets/insetlabel.C (getLabelList): ditto
4551 * src/mathed/formula.C (getLabelList): ditto
4553 * src/paragraph.C (String): New method.
4555 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4556 Uses the new getTocList() method.
4557 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4558 which automatically updates the contents of the browser.
4559 (RefUpdateCB): Use the new getLabelList method.
4561 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4563 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4565 * src/spellchecker.C: Added using std::reverse;
4567 2000-05-19 Juergen Vigna <jug@sad.it>
4569 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4571 * src/insets/insettext.C (computeTextRows): small fix for display of
4572 1 character after a newline.
4574 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4577 2000-05-18 Juergen Vigna <jug@sad.it>
4579 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4580 when changing width of column.
4582 * src/tabular.C (set_row_column_number_info): setting of
4583 autobreak rows if necessary.
4585 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4587 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4589 * src/vc-backend.*: renamed stat() to status() and vcstat to
4590 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4591 compilation broke. The new name seems more relevant, anyway.
4593 2000-05-17 Juergen Vigna <jug@sad.it>
4595 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4596 which was wrong if the removing caused removing of rows!
4598 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4599 (pushToken): new function.
4601 * src/text2.C (CutSelection): fix problem discovered with purify
4603 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4605 * src/debug.C (showTags): enlarge the first column, now that we
4606 have 6-digits debug codes.
4608 * lib/layouts/hollywood.layout:
4609 * lib/tex/hollywood.cls:
4610 * lib/tex/brodway.cls:
4611 * lib/layouts/brodway.layout: more commands and fewer
4612 environments. Preambles moved in the .cls files. Broadway now has
4613 more options on scene numbering and less whitespace (from Garst)
4615 * src/insets/insetbib.C (getKeys): make sure that we are in the
4616 document directory, in case the bib file is there.
4618 * src/insets/insetbib.C (Latex): revert bogus change.
4620 2000-05-16 Juergen Vigna <jug@sad.it>
4622 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4623 the TabularLayout on cursor move.
4625 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4627 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4630 (draw): fixed cursor position and drawing so that the cursor is
4631 visible when before the tabular-inset.
4633 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4634 when creating from old insettext.
4636 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4638 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4640 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4641 * lib/tex/brodway.cls: ditto
4643 * lib/layouts/brodway.layout: change alignment of parenthical
4646 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4648 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4649 versions 0.88 and 0.89 are supported.
4651 2000-05-15 Juergen Vigna <jug@sad.it>
4653 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4656 * src/insets/insettext.C (computeTextRows): redone completely this
4657 function in a much cleaner way, because of problems when having a
4659 (draw): added a frame border when the inset is locked.
4660 (SetDrawLockedFrame): this sets if we draw the border or not.
4661 (SetFrameColor): this sets the frame color (default=insetframe).
4663 * src/insets/lyxinset.h: added x() and y() functions which return
4664 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4665 function which is needed to see if we have a locking inset of some
4666 type in this inset (needed for now in insettabular).
4668 * src/vspace.C (inPixels): the same function also without a BufferView
4669 parameter as so it is easier to use it in some ocasions.
4671 * src/lyxfunc.C: changed all places where insertInset was used so
4672 that now if it couldn't be inserted it is deleted!
4674 * src/TabularLayout.C:
4675 * src/TableLayout.C: added support for new tabular-inset!
4677 * src/BufferView2.C (insertInset): this now returns a bool if the
4678 inset was really inserted!!!
4680 * src/tabular.C (GetLastCellInRow):
4681 (GetFirstCellInRow): new helper functions.
4682 (Latex): implemented for new tabular class.
4686 (TeXTopHLine): new Latex() helper functions.
4688 2000-05-12 Juergen Vigna <jug@sad.it>
4690 * src/mathed/formulamacro.C (Read):
4691 * src/mathed/formula.C (Read): read also the \end_inset here!
4693 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4695 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4696 crush when saving formulae with unbalanced parenthesis.
4698 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4700 * src/layout.C: Add new keyword "endlabelstring" to layout file
4702 * src/text.C (GetVisibleRow): Draw endlabel string.
4704 * lib/layouts/broadway.layout
4705 * lib/layouts/hollywood.layout: Added endlabel for the
4706 Parenthetical layout.
4708 * lib/layouts/heb-article.layout: Do not use slanted font shape
4709 for Theorem like environments.
4711 * src/buffer.C (makeLaTeXFile): Always add "american" to
4712 the UsedLanguages list if document language is RTL.
4714 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4716 * add addendum to README.OS2 and small patch (from SMiyata)
4718 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4720 * many files: correct the calls to ChangeExtension().
4722 * src/support/filetools.C (ChangeExtension): remove the no_path
4723 argument, which does not belong there. Use OnlyFileName() instead.
4725 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4726 files when LaTeXing a non-nice latex file.
4728 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4729 a chain of "if". Return false when deadkeys are not handled.
4731 * src/lyx_main.C (LyX): adapted the code for default bindings.
4733 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4734 bindings for basic functionality (except deadkeys).
4735 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4737 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4738 several methods: handle override_x_deadkeys.
4740 * src/lyxrc.h: remove the "bindings" map, which did not make much
4741 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4743 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4745 * src/lyxfont.C (stateText): use a saner method to determine
4746 whether the font is "default". Seems to fix the crash with DEC
4749 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4751 2000-05-08 Juergen Vigna <jug@sad.it>
4753 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4754 TabularLayoutMenu with mouse-button-3
4755 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4757 * src/TabularLayout.C: added this file for having a Layout for
4760 2000-05-05 Juergen Vigna <jug@sad.it>
4762 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4763 recalculating inset-widths.
4764 (TabularFeatures): activated this function so that I can change
4765 tabular-features via menu.
4767 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4768 that I can test some functions with the Table menu.
4770 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4772 * src/lyxfont.C (stateText): guard against stupid c++libs.
4774 * src/tabular.C: add using std::vector
4775 some whitespace changes, + removed som autogenerated code.
4777 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4779 2000-05-05 Juergen Vigna <jug@sad.it>
4781 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4782 row, columns and cellstructures.
4784 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4786 * lib/lyxrc.example: remove obsolete entries.
4788 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4789 reading of protected_separator for free_spacing.
4791 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4793 * src/text.C (draw): do not display an exclamation mark in the
4794 margin for margin notes. This is confusing, ugly and
4797 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4798 AMS math' is checked.
4800 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4801 name to see whether including the amsmath package is needed.
4803 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4805 * src/paragraph.C (validate): Compute UsedLanguages correctly
4806 (don't insert the american language if it doesn't appear in the
4809 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4810 The argument of \thanks{} command is considered moving argument
4812 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4815 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4817 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4818 for appendix/minipage/depth. The lines can be now both in the footnote
4819 frame, and outside the frame.
4821 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4824 2000-05-05 Juergen Vigna <jug@sad.it>
4826 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4827 neede only in tabular.[Ch].
4829 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4831 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4833 (Write): write '~' for PROTECTED_SEPARATOR
4835 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4837 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4840 * src/mathed/formula.C (drawStr): rename size to siz.
4842 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4843 possibly fix a bug by not changing the pflags = flags to piflags =
4846 2000-05-05 Juergen Vigna <jug@sad.it>
4848 * src/insets/insetbib.C: moved using directive
4850 * src/ImportNoweb.C: small fix for being able to compile (missing
4853 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4855 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4856 to use clear, since we don't depend on this in the code. Add test
4859 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4861 * (various *.C files): add using std::foo directives to please dec
4864 * replace calls to string::clear() to string::erase() (Angus)
4866 * src/cheaders/cmath: modified to provide std::abs.
4868 2000-05-04 Juergen Vigna <jug@sad.it>
4870 * src/insets/insettext.C: Prepared all for inserting of multiple
4871 paragraphs. Still display stuff to do (alignment and other things),
4872 but I would like to use LyXText to do this when we cleaned out the
4873 table-support stuff.
4875 * src/insets/insettabular.C: Changed lot of stuff and added lots
4876 of functionality still a lot to do.
4878 * src/tabular.C: Various functions changed name and moved to be
4879 const functions. Added new Read and Write functions and changed
4880 lots of things so it works good with tabular-insets (also removed
4881 some stuff which is not needed anymore * hacks *).
4883 * src/lyxcursor.h: added operators == and != which just look if
4884 par and pos are (not) equal.
4886 * src/buffer.C (latexParagraphs): inserted this function to latex
4887 all paragraphs form par to endpar as then I can use this too for
4890 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4891 so that I can call this to from text insets with their own cursor.
4893 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4894 output off all paragraphs (because of the fix below)!
4896 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4897 the very last paragraph (this could be also the last paragraph of an
4900 * src/texrow.h: added rows() call which returns the count-variable.
4902 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4904 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4906 * lib/configure.m4: better autodetection of DocBook tools.
4908 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4910 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4912 * src/lyx_cb.C: add using std::reverse;
4914 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4917 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4918 selected files. Should fix repeated errors from generated files.
4920 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4922 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4924 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4925 the spellchecker popup.
4927 * lib/lyxrc.example: Removed the \number_inset section
4929 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4931 * src/insets/figinset.C (various): Use IsFileReadable() to make
4932 sure that the file actually exist. Relying on ghostscripts errors
4933 is a bad idea since they can lead to X server crashes.
4935 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4937 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4940 * lib/lyxrc.example: smallish typo in description of
4941 \view_dvi_paper_option
4943 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4946 * src/lyxfunc.C: doImportHelper to factor out common code of the
4947 various import methods. New functions doImportASCIIasLines,
4948 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4949 doImportLinuxDoc for the format specific parts.
4952 * buffer.C: Dispatch returns now a bool to indicate success
4955 * lyx_gui.C: Add getLyXView() for member access
4957 * lyx_main.C: Change logic for batch commands: First try
4958 Buffer::Dispatch (possibly without GUI), if that fails, use
4961 * lyx_main.C: Add support for --import command line switch.
4962 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4963 Available Formats: Everything accepted by 'buffer-import <format>'
4965 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4967 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4970 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4971 documents will be reformatted upon reentry.
4973 2000-04-27 Juergen Vigna <jug@sad.it>
4975 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4976 correctly only last pos this was a bug.
4978 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4980 * release of lyx-1.1.5pre1
4982 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4984 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4986 * src/menus.C: revert the change of naming (Figure->Graphic...)
4987 from 2000-04-11. It was incomplete and bad.
4989 * src/LColor.[Ch]: add LColor::depthbar.
4990 * src/text.C (GetVisibleRow): use it.
4992 * README: update the languages list.
4994 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4996 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4999 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5001 * README: remove sections that were just wrong.
5003 * src/text2.C (GetRowNearY): remove currentrow code
5005 * src/text.C (GetRow): remove currentrow code
5007 * src/screen.C (Update): rewritten a bit.
5008 (SmallUpdate): removed func
5010 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5012 (FullRebreak): return bool
5013 (currentrow): remove var
5014 (currentrow_y): ditto
5016 * src/lyxscreen.h (Draw): change arg to unsigned long
5017 (FitCursor): return bool
5018 (FitManualCursor): ditto
5019 (Smallpdate): remove func
5020 (first): change to unsigned long
5021 (DrawOneRow): change second arg to long (from long &)
5022 (screen_refresh_y): remove var
5023 (scree_refresh_row): ditto
5025 * src/lyxrow.h: change baseline to usigned int from unsigned
5026 short, this brings some implicit/unsigned issues out in the open.
5028 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5030 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5031 instead of smallUpdate.
5033 * src/lyxcursor.h: change y to unsigned long
5035 * src/buffer.h: don't call updateScrollbar after fitcursor
5037 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5038 where they are used. Removed "\\direction", this was not present
5039 in 1.1.4 and is already obsolete. Commented out some code that I
5040 believe to never be called.
5041 (runLiterate): don't call updateScrollbar after fitCursor
5043 (buildProgram): ditto
5046 * src/WorkArea.h (workWidth): change return val to unsigned
5049 (redraw): remove the button redraws
5050 (setScrollbarValue): change for scrollbar
5051 (getScrollbarValue): change for scrollbar
5052 (getScrollbarBounds): change for scrollbar
5054 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5055 (C_WorkArea_down_cb): removed func
5056 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5057 (resize): change for scrollbar
5058 (setScrollbar): ditto
5059 (setScrollbarBounds): ditto
5060 (setScrollbarIncrements): ditto
5061 (up_cb): removed func
5062 (down_cb): removed func
5063 (scroll_cb): change for scrollbar
5064 (work_area_handler): ditto
5066 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5067 when FitCursor did something.
5068 (updateScrollbar): some unsigned changes
5069 (downCB): removed func
5070 (scrollUpOnePage): removed func
5071 (scrollDownOnePage): remvoed func
5072 (workAreaMotionNotify): don't call screen->FitCursor but use
5073 fitCursor instead. and bool return val
5074 (workAreaButtonPress): ditto
5075 (workAreaButtonRelease): some unsigned changes
5076 (checkInsetHit): ditto
5077 (workAreaExpose): ditto
5078 (update): parts rewritten, comments about the signed char arg added
5079 (smallUpdate): removed func
5080 (cursorPrevious): call needed updateScrollbar
5083 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5086 * src/BufferView.[Ch] (upCB): removed func
5087 (downCB): removed func
5088 (smallUpdate): removed func
5090 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5092 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5093 currentrow, currentrow_y optimization. This did not help a lot and
5094 if we want to do this kind of optimization we should rather use
5095 cursor.row instead of the currentrow.
5097 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5098 buffer spacing and klyx spacing support.
5100 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5102 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5105 2000-04-26 Juergen Vigna <jug@sad.it>
5107 * src/insets/figinset.C: fixes to Lars sstream changes!
5109 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5111 * A lot of files: Added Ascii(ostream &) methods to all inset
5112 classes. Used when exporting to ASCII.
5114 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5115 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5118 * src/text2.C (ToggleFree): Disabled implicit word selection when
5119 there is a change in the language
5121 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5122 no output was generated for end-of-sentence inset.
5124 * src/insets/lyxinset.h
5127 * src/paragraph.C: Removed the insetnumber code
5129 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5131 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5133 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5134 no_babel and no_epsfig completely from the file.
5135 (parseSingleLyXformat2Token): add handling for per-paragraph
5136 spacing as written by klyx.
5138 * src/insets/figinset.C: applied patch by Andre. Made it work with
5141 2000-04-20 Juergen Vigna <jug@sad.it>
5143 * src/insets/insettext.C (cutSelection):
5144 (copySelection): Fixed with selection from right to left.
5145 (draw): now the rows are not recalculated at every draw.
5146 (computeTextRows): for now reset the inset-owner here (this is
5147 important for an undo or copy where the inset-owner is not set
5150 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5151 motion to the_locking_inset screen->first was forgotten, this was
5152 not important till we got multiline insets.
5154 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5156 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5157 code seems to be alright (it is code changed by Dekel, and the
5158 intent is indeed that all macros should be defined \protect'ed)
5160 * NEWS: a bit of reorganisation of the new user-visible features.
5162 2000-04-19 Juergen Vigna <jug@sad.it>
5164 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5165 position. Set the inset_owner of the used paragraph so that it knows
5166 that it is inside an inset. Fixed cursor handling with mouse and
5167 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5168 and cleanups to make TextInsets work better.
5170 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5171 Changed parameters of various functions and added LockInsetInInset().
5173 * src/insets/insettext.C:
5175 * src/insets/insetcollapsable.h:
5176 * src/insets/insetcollapsable.C:
5177 * src/insets/insetfoot.h:
5178 * src/insets/insetfoot.C:
5179 * src/insets/insetert.h:
5180 * src/insets/insetert.C: cleaned up the code so that it works now
5181 correctly with insettext.
5183 * src/insets/inset.C:
5184 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5185 that insets in insets are supported right.
5188 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5190 * src/paragraph.C: some small fixes
5192 * src/debug.h: inserted INSETS debug info
5194 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5195 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5197 * src/commandtags.h:
5198 * src/LyXAction.C: insert code for InsetTabular.
5200 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5201 not Button1MotionMask.
5202 (workAreaButtonRelease): send always a InsetButtonRelease event to
5204 (checkInsetHit): some setCursor fixes (always with insets).
5206 * src/BufferView2.C (lockInset): returns a bool now and extended for
5207 locking insets inside insets.
5208 (showLockedInsetCursor): it is important to have the cursor always
5209 before the locked inset.
5210 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5212 * src/BufferView.h: made lockInset return a bool.
5214 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5216 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5217 that is used also internally but can be called as public to have back
5218 a cursor pos which is not set internally.
5219 (SetCursorIntern): Changed to use above function.
5221 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5223 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5228 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5229 patches for things that should be in or should be changed.
5231 * src/* [insetfiles]: change "usigned char fragile" to bool
5232 fragile. There was only one point that could that be questioned
5233 and that is commented in formulamacro.C. Grep for "CHECK".
5235 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5236 (DeleteBuffer): take it out of CutAndPaste and make it static.
5238 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5240 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5241 output the spacing envir commands. Also the new commands used in
5242 the LaTeX output makes the result better.
5244 * src/Spacing.C (writeEnvirBegin): new method
5245 (writeEnvirEnd): new method
5247 2000-04-18 Juergen Vigna <jug@sad.it>
5249 * src/CutAndPaste.C: made textclass a static member of the class
5250 as otherwise it is not accesed right!!!
5252 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5254 * forms/layout_forms.fd
5255 * src/layout_forms.h
5256 * src/layout_forms.C (create_form_form_character)
5257 * src/lyx_cb.C (UserFreeFont)
5258 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5259 documents (in the layout->character popup).
5261 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5263 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5264 \spell_command was in fact not honored (from Kevin Atkinson).
5266 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5269 * src/lyx_gui.h: make lyxViews private (Angus)
5271 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5273 * src/mathed/math_write.C
5274 (MathMatrixInset::Write) Put \protect before \begin{array} and
5275 \end{array} if fragile
5276 (MathParInset::Write): Put \protect before \\ if fragile
5278 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5280 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5281 initialization if the LyXColorHandler must be done after the
5282 connections to the XServer has been established.
5284 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5285 get the background pixel from the lyxColorhandler so that the
5286 figures are rendered with the correct background color.
5287 (NextToken): removed functions.
5288 (GetPSSizes): use ifs >> string instead of NextToken.
5290 * src/Painter.[Ch]: the color cache moved out of this file.
5292 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5295 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5297 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5298 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5300 * src/BufferView.C (enterView): new func
5301 (leaveView): new func
5303 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5305 (leaveView): new func, undefines xterm cursor when approp.
5307 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5308 (AllowInput): delete the Workarea cursor handling from this func.
5310 * src/Painter.C (underline): draw a slimer underline in most cases.
5312 * src/lyx_main.C (error_handler): use extern "C"
5314 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5316 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5317 sent directly to me.
5319 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5320 to the list by Dekel.
5322 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5325 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5326 methods from lyx_cb.here.
5328 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5331 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5333 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5334 instead of using current_view directly.
5336 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5338 * src/LyXAction.C (init): add the paragraph-spacing command.
5340 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5342 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5344 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5345 different from the documents.
5347 * src/text.C (SetHeightOfRow): take paragraph spacing into
5348 account, paragraph spacing takes precedence over buffer spacing
5349 (GetVisibleRow): ditto
5351 * src/paragraph.C (writeFile): output the spacing parameter too.
5352 (validate): set the correct features if spacing is used in the
5354 (Clear): set spacing to default
5355 (MakeSameLayout): spacing too
5356 (HasSameLayout): spacing too
5357 (SetLayout): spacing too
5358 (TeXOnePar): output the spacing commands
5360 * src/lyxparagraph.h: added a spacing variable for use with
5361 per-paragraph spacing.
5363 * src/Spacing.h: add a Default spacing and a method to check if
5364 the current spacing is default. also added an operator==
5366 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5369 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5371 * src/lyxserver.C (callback): fix dispatch of functions
5373 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5374 printf() into lyxerr call.
5376 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5379 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5380 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5381 the "Float" from each of the subitems.
5382 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5384 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5385 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5386 documented the change so that the workaround can be nuked later.
5388 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5391 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5393 * src/buffer.C (getLatexName): ditto
5394 (setReadonly): ditto
5396 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5398 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5399 avoid some uses of current_view. Added also a bufferParams()
5400 method to get at this.
5402 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5404 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5406 * src/lyxparagraph.[Ch]: removed
5407 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5408 with operators used by lower_bound and
5409 upper_bound in InsetTable's
5410 Make struct InsetTable private again. Used matchpos.
5412 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5414 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5415 document, the language of existing text is changed (unless the
5416 document is multi-lingual)
5418 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5420 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5422 * A lot of files: A rewrite of the Right-to-Left support.
5424 2000-04-10 Juergen Vigna <jug@sad.it>
5426 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5427 misplaced cursor when inset in inset is locked.
5429 * src/insets/insettext.C (LocalDispatch): small fix so that a
5430 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5432 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5433 footnote font should be decreased in size twice when displaying.
5435 * src/insets/insettext.C (GetDrawFont): inserted this function as
5436 the drawing-font may differ from the real paragraph font.
5438 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5439 insets (inset in inset!).
5441 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5442 function here because we don't want footnotes inside footnotes.
5444 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5446 (init): now set the inset_owner in paragraph.C
5447 (LocalDispatch): added some resetPos() in the right position
5450 (pasteSelection): changed to use the new CutAndPaste-Class.
5452 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5453 which tells if it is allowed to insert another inset inside this one.
5455 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5456 SwitchLayoutsBetweenClasses.
5458 * src/text2.C (InsertInset): checking of the new paragraph-function
5460 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5461 is not needed anymore here!
5464 (PasteSelection): redone (also with #ifdef) so that now this uses
5465 the CutAndPaste-Class.
5466 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5469 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5470 from/to text/insets.
5472 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5473 so that the paragraph knows if it is inside an (text)-inset.
5474 (InsertFromMinibuffer): changed return-value to bool as now it
5475 may happen that an inset is not inserted in the paragraph.
5476 (InsertInsetAllowed): this checks if it is allowed to insert an
5477 inset in this paragraph.
5479 (BreakParagraphConservative):
5480 (BreakParagraph) : small change for the above change of the return
5481 value of InsertFromMinibuffer.
5483 * src/lyxparagraph.h: added inset_owner and the functions to handle
5484 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5486 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5488 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5489 functions from BufferView to BufferView::Pimpl to ease maintence.
5491 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5492 correctly. Also use SetCursorIntern instead of SetCursor.
5494 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5497 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5499 * src/WorkArea.C (belowMouse): manually implement below mouse.
5501 * src/*: Add "explicit" on several constructors, I added probably
5502 some unneeded ones. A couple of changes to code because of this.
5504 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5505 implementation and private parts from the users of BufferView. Not
5508 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5509 implementation and private parts from the users of LyXLex. Not
5512 * src/BufferView_pimpl.[Ch]: new files
5514 * src/lyxlex_pimpl.[Ch]: new files
5516 * src/LyXView.[Ch]: some inline functions move out-of-line
5518 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5520 * src/lyxparagraph.h: make struct InsetTable public.
5522 * src/support/lyxstring.h: change lyxstring::difference_type to be
5523 ptrdiff_t. Add std:: modifiers to streams.
5525 * src/font.C: include the <cctype> header, for islower() and
5528 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5530 * src/font.[Ch]: new files. Contains the metric functions for
5531 fonts, takes a LyXFont as parameter. Better separation of concepts.
5533 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5534 changes because of this.
5536 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5538 * src/*: compile with -Winline and move functions that don't
5541 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5544 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5546 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5547 (various files changed because of this)
5549 * src/Painter.C (text): fixed the drawing of smallcaps.
5551 * src/lyxfont.[Ch] (drawText): removed unused member func.
5554 * src/*.C: added needed "using" statements and "std::" qualifiers.
5556 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5558 * src/*.h: removed all use of "using" from header files use
5559 qualifier std:: instead.
5561 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5563 * src/text.C (Backspace): some additional cleanups (we already
5564 know whether cursor.pos is 0 or not).
5566 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5567 automake does not provide one).
5569 * src/bmtable.h: replace C++ comments with C comments.
5571 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5573 * src/screen.C (ShowCursor): Change the shape of the cursor if
5574 the current language is not equal to the language of the document.
5575 (If the cursor change its shape unexpectedly, then you've found a bug)
5577 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5580 * src/insets/insetnumber.[Ch]: New files.
5582 * src/LyXAction.C (init)
5583 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5586 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5588 * src/lyxparagraph.h
5589 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5590 (the vector is kept sorted).
5592 * src/text.C (GetVisibleRow): Draw selection correctly when there
5593 is both LTR and RTL text.
5595 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5596 which is much faster.
5598 * src/text.C (GetVisibleRow and other): Do not draw the last space
5599 in a row if the direction of the last letter is not equal to the
5600 direction of the paragraph.
5602 * src/lyxfont.C (latexWriteStartChanges):
5603 Check that font language is not equal to basefont language.
5604 (latexWriteEndChanges): ditto
5606 * src/lyx_cb.C (StyleReset): Don't change the language while using
5607 the font-default command.
5609 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5610 empty paragraph before a footnote.
5612 * src/insets/insetcommand.C (draw): Increase x correctly.
5614 * src/screen.C (ShowCursor): Change cursor shape if
5615 current language != document language.
5617 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5619 2000-03-31 Juergen Vigna <jug@sad.it>
5621 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5622 (Clone): changed mode how the paragraph-data is copied to the
5623 new clone-paragraph.
5625 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5626 GetInset(pos) with no inset anymore there (in inset UNDO)
5628 * src/insets/insetcommand.C (draw): small fix as here x is
5629 incremented not as much as width() returns (2 before, 2 behind = 4)
5631 2000-03-30 Juergen Vigna <jug@sad.it>
5633 * src/insets/insettext.C (InsetText): small fix in initialize
5634 widthOffset (should not be done in the init() function)
5636 2000-03-29 Amir Karger <karger@lyx.org>
5638 * lib/examples/it_ItemizeBullets.lyx: translation by
5641 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5643 2000-03-29 Juergen Vigna <jug@sad.it>
5645 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5647 * src/insets/insetfoot.C (Clone): small change as for the below
5648 new init function in the text-inset
5650 * src/insets/insettext.C (init): new function as I've seen that
5651 clone did not copy the Paragraph-Data!
5652 (LocalDispatch): Added code so that now we have some sort of Undo
5653 functionality (well actually we HAVE Undo ;)
5655 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5657 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5659 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5662 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5664 * src/main.C: added a runtime check that verifies that the xforms
5665 header used when building LyX and the library used when running
5666 LyX match. Exit with a message if they don't match. This is a
5667 version number check only.
5669 * src/buffer.C (save): Don't allocate memory on the heap for
5670 struct utimbuf times.
5672 * *: some using changes, use iosfwd instead of the real headers.
5674 * src/lyxfont.C use char const * instead of string for the static
5675 strings. Rewrite some functions to use sstream.
5677 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5679 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5682 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5684 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5685 of Geodesy (from Martin Vermeer)
5687 * lib/layouts/svjour.inc: include file for the Springer svjour
5688 class. It can be used to support journals other than JoG.
5690 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5691 Miskiewicz <misiek@pld.org.pl>)
5692 * lib/reLyX/Makefile.am: ditto.
5694 2000-03-27 Juergen Vigna <jug@sad.it>
5696 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5697 also some modifications with operations on selected text.
5699 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5700 problems with clicking on insets (last famous words ;)
5702 * src/insets/insetcommand.C (draw):
5703 (width): Changed to have a bit of space before and after the inset so
5704 that the blinking cursor can be seen (otherwise it was hidden)
5706 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5708 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5709 would not be added to the link list when an installed gettext (not
5710 part of libc) is found.
5712 2000-03-24 Juergen Vigna <jug@sad.it>
5714 * src/insets/insetcollapsable.C (Edit):
5715 * src/mathed/formula.C (InsetButtonRelease):
5716 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5719 * src/BufferView.C (workAreaButtonPress):
5720 (workAreaButtonRelease):
5721 (checkInsetHit): Finally fixed the clicking on insets be handled
5724 * src/insets/insetert.C (Edit): inserted this call so that ERT
5725 insets work always with LaTeX-font
5727 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5729 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5730 caused lyx to startup with no GUI in place, causing in a crash
5731 upon startup when called with arguments.
5733 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5735 * src/FontLoader.C: better initialization of dummyXFontStruct.
5737 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5739 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5740 for linuxdoc and docbook import and export format options.
5742 * lib/lyxrc.example Example of default values for the previous flags.
5744 * src/lyx_cb.C Use those flags instead of the hardwired values for
5745 linuxdoc and docbook export.
5747 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5750 * src/menus.C Added menus entries for the new import/exports formats.
5752 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5754 * src/lyxrc.*: Added support for running without Gui
5757 * src/FontLoader.C: sensible defaults if no fonts are needed
5759 * src/lyx_cb.C: New function ShowMessage (writes either to the
5760 minibuffer or cout in case of no gui
5761 New function AskOverwrite for common stuff
5762 Consequently various changes to call these functions
5764 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5765 wild guess at sensible screen resolution when having no gui
5767 * src/lyxfont.C: no gui, no fonts... set some defaults
5769 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5771 * src/LColor.C: made the command inset background a bit lighter.
5773 2000-03-20 Hartmut Goebel <goebel@noris.net>
5775 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5776 stdstruct.inc. Koma-Script added some title elements which
5777 otherwise have been listed below "bibliography". This split allows
5778 adding title elements to where they belong.
5780 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5781 define the additional tilte elements and then include
5784 * many other layout files: changed to include stdtitle.inc just
5785 before stdstruct.inc.
5787 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5789 * src/buffer.C: (save) Added the option to store all backup files
5790 in a single directory
5792 * src/lyxrc.[Ch]: Added variable \backupdir_path
5794 * lib/lyxrc.example: Added descriptions of recently added variables
5796 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5797 bibtex inset, not closing the bibtex popup when deleting the inset)
5799 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5801 * src/lyx_cb.C: add a couple using directives.
5803 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5804 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5805 import based on the filename.
5807 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5808 file would be imported at start, if the filename where of a sgml file.
5810 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5812 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5814 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5815 * src/lyxfont.h Replaced the member variable bits.direction by the
5816 member variable lang. Made many changes in other files.
5817 This allows having a multi-lingual document
5819 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5820 that change the current language to <l>.
5821 Removed the command "font-rtl"
5823 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5824 format for Hebrew documents)
5826 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5827 When auto_mathmode is "true", pressing a digit key in normal mode
5828 will cause entering into mathmode.
5829 If auto_mathmode is "rtl" then this behavior will be active only
5830 when writing right-to-left text.
5832 * src/text2.C (InsertStringA) The string is inserted using the
5835 * src/paragraph.C (GetEndLabel) Gives a correct result for
5836 footnote paragraphs.
5838 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5840 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5842 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5843 front of PasteParagraph. Never insert a ' '. This should at least
5844 fix some cause for the segfaults that we have been experiencing,
5845 it also fixes backspace behaviour slightly. (Phu!)
5847 * src/support/lstrings.C (compare_no_case): some change to make it
5848 compile with gcc 2.95.2 and stdlibc++-v3
5850 * src/text2.C (MeltFootnoteEnvironment): change type o
5851 first_footnote_par_is_not_empty to bool.
5853 * src/lyxparagraph.h: make text private. Changes in other files
5855 (fitToSize): new function
5856 (setContentsFromPar): new function
5857 (clearContents): new function
5858 (SetChar): new function
5860 * src/paragraph.C (readSimpleWholeFile): deleted.
5862 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5863 the file, just use a simple string instead. Also read the file in
5864 a more maintainable manner.
5866 * src/text2.C (InsertStringA): deleted.
5867 (InsertStringB): deleted.
5869 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5871 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5872 RedoParagraphs from the doublespace handling part, just set status
5873 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5874 done, but perhaps not like this.)
5876 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5878 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5879 character when inserting an inset.
5881 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5883 * src/bufferparams.C (readLanguage): now takes "default" into
5886 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5887 also initialize the toplevel_keymap with the default bindings from
5890 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5892 * all files using lyxrc: have lyxrc as a real variable and not a
5893 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5896 * src/lyxrc.C: remove double call to defaultKeyBindings
5898 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5899 toolbar defauls using lyxlex. Remove enums, structs, functions
5902 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5903 toolbar defaults. Also store default keybindings in a map.
5905 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5906 storing the toolbar defaults without any xforms dependencies.
5908 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5909 applied. Changed to use iterators.
5911 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5913 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5914 systems that don't have LINGUAS set to begin with.
5916 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5918 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5919 the list by Dekel Tsur.
5921 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5923 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5924 * src/insets/form_graphics.C: ditto.
5926 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5928 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5930 * src/bufferparams.C (readLanguage): use the new language map
5932 * src/intl.C (InitKeyMapper): use the new language map
5934 * src/lyx_gui.C (create_forms): use the new language map
5936 * src/language.[Ch]: New files. Used for holding the information
5937 about each language. Now! Use this new language map enhance it and
5938 make it really usable for our needs.
5940 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5942 * screen.C (ShowCursor): Removed duplicate code.
5943 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5944 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5946 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5949 * src/text.C Added TransformChar method. Used for rendering Arabic
5950 text correctly (change the glyphs of the letter according to the
5951 position in the word)
5956 * src/lyxrc.C Added lyxrc command {language_command_begin,
5957 language_command_end,language_command_ltr,language_command_rtl,
5958 language_package} which allows the use of either arabtex or Omega
5961 * src/lyx_gui.C (init)
5963 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5964 to use encoding for menu fonts which is different than the encoding
5967 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5968 do not load the babel package.
5969 To write an English document with Hebrew/Arabic, change the document
5970 language to "english".
5972 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5973 (alphaCounter): changed to return char
5974 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5976 * lib/lyxrc.example Added examples for Hebrew/Arabic
5979 * src/layout.C Added layout command endlabeltype
5981 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5983 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5985 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5987 * src/mathed/math_delim.C (search_deco): return a
5988 math_deco_struct* instead of index.
5990 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5992 * All files with a USE_OSTREAM_ONLY within: removed all code that
5993 was unused when USE_OSTREAM_ONLY is defined.
5995 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5996 of any less. Removed header and using.
5998 * src/text.C (GetVisibleRow): draw the string "Page Break
5999 (top/bottom)" on screen when drawing a pagebreak line.
6001 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6003 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6005 * src/mathed/math_macro.C (draw): do some cast magic.
6008 * src/mathed/math_defs.h: change byte* argument to byte const*.
6010 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6012 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6013 know it is right to return InsetFoot* too, but cxx does not like
6016 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6018 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6020 * src/mathed/math_delim.C: change == to proper assignment.
6022 2000-03-09 Juergen Vigna <jug@sad.it>
6024 * src/insets/insettext.C (setPos): fixed various cursor positioning
6025 problems (via mouse and cursor-keys)
6026 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6027 inset (still a small display problem but it works ;)
6029 * src/insets/insetcollapsable.C (draw): added button_top_y and
6030 button_bottom_y to have correct values for clicking on the inset.
6032 * src/support/lyxalgo.h: commented out 'using std::less'
6034 2000-03-08 Juergen Vigna <jug@sad.it>
6036 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6037 Button-Release event closes as it is alos the Release-Event
6040 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6042 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6044 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6045 can add multiple spaces in Scrap (literate programming) styles...
6046 which, by the way, is how I got hooked on LyX to begin with.
6048 * src/mathed/formula.C (Write): Added dummy variable to an
6049 inset::Latex() call.
6050 (Latex): Add free_spacing boolean to inset::Latex()
6052 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6054 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6055 virtual function to include the free_spacing boolean from
6056 the containing paragraph's style.
6058 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6059 Added free_spacing boolean arg to match inset.h
6061 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6062 Added free_spacing boolean arg to match inset.h
6064 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6065 Added free_spacing boolean and made sure that if in a free_spacing
6066 paragraph, that we output normal space if there is a protected space.
6068 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6069 Added free_spacing boolean arg to match inset.h
6071 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6072 Added free_spacing boolean arg to match inset.h
6074 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6075 Added free_spacing boolean arg to match inset.h
6077 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6078 Added free_spacing boolean arg to match inset.h
6080 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6081 Added free_spacing boolean arg to match inset.h
6083 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6084 free_spacing boolean arg to match inset.h
6086 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6087 Added free_spacing boolean arg to match inset.h
6089 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6090 Added free_spacing boolean arg to match inset.h
6092 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6093 Added free_spacing boolean arg to match inset.h
6095 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6096 Added free_spacing boolean arg to match inset.h
6098 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6099 Added free_spacing boolean arg to match inset.h
6101 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6102 free_spacing boolean arg to match inset.h
6104 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6105 free_spacing boolean arg to match inset.h
6107 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6108 ignore free_spacing paragraphs. The user's spaces are left
6111 * src/text.C (InsertChar): Fixed the free_spacing layout
6112 attribute behavior. Now, if free_spacing is set, you can
6113 add multiple spaces in a paragraph with impunity (and they
6114 get output verbatim).
6115 (SelectSelectedWord): Added dummy argument to inset::Latex()
6118 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6121 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6122 paragraph layouts now only input a simple space instead.
6123 Special character insets don't make any sense in free-spacing
6126 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6127 hard-spaces in the *input* file to simple spaces if the layout
6128 is free-spacing. This converts old files which had to have
6129 hard-spaces in free-spacing layouts where a simple space was
6131 (writeFileAscii): Added free_spacing check to pass to the newly
6132 reworked inset::Latex(...) methods. The inset::Latex() code
6133 ensures that hard-spaces in free-spacing paragraphs get output
6134 as spaces (rather than "~").
6136 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6138 * src/mathed/math_delim.C (draw): draw the empty placeholder
6139 delims with a onoffdash line.
6140 (struct math_deco_compare): struct that holds the "functors" used
6141 for the sort and the binary search in math_deco_table.
6142 (class init_deco_table): class used for initial sort of the
6144 (search_deco): use lower_bound to do a binary search in the
6147 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6149 * src/lyxrc.C: a small secret thingie...
6151 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6152 and to not flush the stream as often as it used to.
6154 * src/support/lyxalgo.h: new file
6155 (sorted): template function used for checking if a sequence is
6156 sorted or not. Two versions with and without user supplied
6157 compare. Uses same compare as std::sort.
6159 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6160 it and give warning on lyxerr.
6162 (struct compare_tags): struct with function operators used for
6163 checking if sorted, sorting and lower_bound.
6164 (search_kw): use lower_bound instead of manually implemented
6167 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6169 * src/insets/insetcollapsable.h: fix Clone() declaration.
6170 * src/insets/insetfoot.h: ditto.
6172 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6174 2000-03-08 Juergen Vigna <jug@sad.it>
6176 * src/insets/lyxinset.h: added owner call which tells us if
6177 this inset is inside another inset. Changed also the return-type
6178 of Editable to an enum so it tells clearer what the return-value is.
6180 * src/insets/insettext.C (computeTextRows): fixed computing of
6181 textinsets which split automatically on more rows.
6183 * src/insets/insetert.[Ch]: changed this to be of BaseType
6186 * src/insets/insetfoot.[Ch]: added footnote inset
6188 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6189 collapsable insets (like footnote, ert, ...)
6191 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6193 * src/lyxdraw.h: remvoe file
6195 * src/lyxdraw.C: remove file
6197 * src/insets/insettext.C: added <algorithm>.
6199 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6201 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6202 (matrix_cb): case MM_OK use string stream
6204 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6207 * src/mathed/math_macro.C (draw): use string stream
6208 (Metrics): use string stream
6210 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6211 directly to the ostream.
6213 * src/vspace.C (asString): use string stream.
6214 (asString): use string stream
6215 (asLatexString): use string stream
6217 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6218 setting Spacing::Other.
6220 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6221 sprintf when creating the stretch vale.
6223 * src/text2.C (alphaCounter): changed to return a string and to
6224 not use a static variable internally. Also fixed a one-off bug.
6225 (SetCounter): changed the drawing of the labels to use string
6226 streams instead of sprintf.
6228 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6229 manipulator to use a scheme that does not require library support.
6230 This is also the way it is done in the new GNU libstdc++. Should
6231 work with DEC cxx now.
6233 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6235 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6236 end. This fixes a bug.
6238 * src/mathed (all files concerned with file writing): apply the
6239 USE_OSTREAM_ONLY changes to mathed too.
6241 * src/support/DebugStream.h: make the constructor explicit.
6243 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6244 count and ostream squashed.
6246 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6248 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6250 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6251 ostringstream uses STL strings, and we might not.
6253 * src/insets/insetspecialchar.C: add using directive.
6254 * src/insets/insettext.C: ditto.
6256 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6258 * lib/layouts/seminar.layout: feeble attempt at a layout for
6259 seminar.cls, far from completet and could really use some looking
6260 at from people used to write layout files.
6262 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6263 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6264 a lot nicer and works nicely with ostreams.
6266 * src/mathed/formula.C (draw): a slightly different solution that
6267 the one posted to the list, but I think this one works too. (font
6268 size wrong in headers.)
6270 * src/insets/insettext.C (computeTextRows): some fiddling on
6271 Jürgens turf, added some comments that he should read.
6273 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6274 used and it gave compiler warnings.
6275 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6278 * src/lyx_gui.C (create_forms): do the right thing when
6279 show_banner is true/false.
6281 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6282 show_banner is false.
6284 * most file writing files: Now use iostreams to do almost all of
6285 the writing. Also instead of passing string &, we now use
6286 stringstreams. mathed output is still not adapted to iostreams.
6287 This change can be turned off by commenting out all the occurences
6288 of the "#define USE_OSTREAM_ONLY 1" lines.
6290 * src/WorkArea.C (createPixmap): don't output debug messages.
6291 (WorkArea): don't output debug messages.
6293 * lib/lyxrc.example: added a comment about the new variable
6296 * development/Code_rules/Rules: Added some more commente about how
6297 to build class interfaces and on how better encapsulation can be
6300 2000-03-03 Juergen Vigna <jug@sad.it>
6302 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6303 automatically with the width of the LyX-Window
6305 * src/insets/insettext.C (computeTextRows): fixed update bug in
6306 displaying text-insets (scrollvalues where not initialized!)
6308 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6310 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6311 id in the check of the result from lower_bound is not enough since
6312 lower_bound can return last too, and then res->id will not be a
6315 * all insets and some code that use them: I have conditionalized
6316 removed the Latex(string & out, ...) this means that only the
6317 Latex(ostream &, ...) will be used. This is a work in progress to
6318 move towards using streams for all output of files.
6320 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6323 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6325 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6326 routine (this fixes bug where greek letters were surrounded by too
6329 * src/support/filetools.C (findtexfile): change a bit the search
6330 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6331 no longer passed to kpsewhich, we may have to change that later.
6333 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6334 warning options to avoid problems with X header files (from Angus
6336 * acinclude.m4: regenerated.
6338 2000-03-02 Juergen Vigna <jug@sad.it>
6340 * src/insets/insettext.C (WriteParagraphData): Using the
6341 par->writeFile() function for writing paragraph-data.
6342 (Read): Using buffer->parseSingleLyXformat2Token()-function
6343 for parsing paragraph data!
6345 * src/buffer.C (readLyXformat2): removed all parse data and using
6346 the new parseSingleLyXformat2Token()-function.
6347 (parseSingleLyXformat2Token): added this function to parse (read)
6348 lyx-file-format (this is called also from text-insets now!)
6350 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6352 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6355 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6356 directly instead of going through a func. One very bad thing: a
6357 static LyXFindReplace, but I don't know where to place it.
6359 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6360 string instead of char[]. Also changed to static.
6361 (GetSelectionOrWordAtCursor): changed to static inline
6362 (SetSelectionOverLenChars): ditto.
6364 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6365 current_view and global variables. both classes has changed names
6366 and LyXFindReplace is not inherited from SearchForm.
6368 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6369 fl_form_search form.
6371 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6373 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6375 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6376 bound (from Kayvan).
6378 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6380 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6382 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6384 * some things that I should comment but the local pub says head to
6387 * comment out all code that belongs to the Roff code for Ascii
6388 export of tables. (this is unused)
6390 * src/LyXView.C: use correct type for global variable
6391 current_layout. (LyXTextClass::size_type)
6393 * some code to get the new insetgraphics closer to working I'd be
6394 grateful for any help.
6396 * src/BufferView2.C (insertInset): use the return type of
6397 NumberOfLayout properly. (also changes in other files)
6399 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6400 this as a test. I want to know what breaks because of this.
6402 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6404 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6406 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6407 to use a \makebox in the label, this allows proper justification
6408 with out using protected spaces or multiple hfills. Now it is
6409 "label" for left justified, "\hfill label\hfill" for center, and
6410 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6411 should be changed accordingly.
6413 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6415 * src/lyxtext.h: change SetLayout() to take a
6416 LyXTextClass::size_type instead of a char (when there is more than
6417 127 layouts in a class); also change type of copylayouttype.
6418 * src/text2.C (SetLayout): ditto.
6419 * src/LyXView.C (updateLayoutChoice): ditto.
6421 * src/LaTeX.C (scanLogFile): errors where the line number was not
6422 given just after the '!'-line were ignored (from Dekel Tsur).
6424 * lib/lyxrc.example: fix description of \date_insert_format
6426 * lib/layouts/llncs.layout: new layout, contributed by Martin
6429 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6431 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6432 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6433 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6434 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6435 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6436 paragraph.C, text.C, text2.C)
6438 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6440 * src/insets/insettext.C (LocalDispatch): remove extra break
6443 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6444 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6446 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6447 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6449 * src/insets/insetbib.h: move InsetBibkey::Holder and
6450 InsetCitation::Holder in public space.
6452 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6454 * src/insets/insettext.h: small change to get the new files from
6455 Juergen to compile (use "string", not "class string").
6457 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6458 const & as parameter to LocalDispatch, use LyXFont const & as
6459 paramter to some other func. This also had impacto on lyxinsets.h
6460 and the two mathed insets.
6462 2000-02-24 Juergen Vigna <jug@sad.it>
6465 * src/commandtags.h:
6467 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6471 * src/BufferView2.C: added/updated code for various inset-functions
6473 * src/insets/insetert.[Ch]: added implementation of InsetERT
6475 * src/insets/insettext.[Ch]: added implementation of InsetText
6477 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6478 (draw): added preliminary code for inset scrolling not finshed yet
6480 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6481 as it is in lyxfunc.C now
6483 * src/insets/lyxinset.h: Added functions for text-insets
6485 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6487 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6488 BufferView and reimplement the list as a queue put inside its own
6491 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6493 * several files: use the new interface to the "updateinsetlist"
6495 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6497 (work_area_handler): call BufferView::trippleClick on trippleclick.
6499 * src/BufferView.C (doubleClick): new function, selects word on
6501 (trippleClick): new function, selects line on trippleclick.
6503 2000-02-22 Allan Rae <rae@lyx.org>
6505 * lib/bind/xemacs.bind: buffer-previous not supported
6507 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6509 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6512 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6514 * src/bufferlist.C: get rid of current_view from this file
6516 * src/spellchecker.C: get rid of current_view from this file
6518 * src/vspace.C: get rid of current_view from this file
6519 (inPixels): added BufferView parameter for this func
6520 (asLatexCommand): added a BufferParams for this func
6522 * src/text.C src/text2.C: get rid of current_view from these
6525 * src/lyxfont.C (getFontDirection): move this function here from
6528 * src/bufferparams.C (getDocumentDirection): move this function
6531 * src/paragraph.C (getParDirection): move this function here from
6533 (getLetterDirection): ditto
6535 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6537 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6538 resize due to wrong pixmap beeing used. Also took the opurtunity
6539 to make the LyXScreen stateless on regard to WorkArea and some
6540 general cleanup in the same files.
6542 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6544 * src/Makefile.am: add missing direction.h
6546 * src/PainterBase.h: made the width functions const.
6548 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6551 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6553 * src/insets/insetlatexaccent.C (draw): make the accents draw
6554 better, at present this will only work well with iso8859-1.
6556 * several files: remove the old drawing code, now we use the new
6559 * several files: remove support for mono_video, reverse_video and
6562 2000-02-17 Juergen Vigna <jug@sad.it>
6564 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6565 int ** as we have to return the pointer, otherwise we have only
6566 NULL pointers in the returning function.
6568 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6570 * src/LaTeX.C (operator()): quote file name when running latex.
6572 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6574 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6575 (bubble tip), this removes our special handling of this.
6577 * Remove all code that is unused now that we have the new
6578 workarea. (Code that are not active when NEW_WA is defined.)
6580 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6582 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6584 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6585 nonexisting layout; correctly redirect obsoleted layouts.
6587 * lib/lyxrc.example: document \view_dvi_paper_option
6589 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6592 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6593 (PreviewDVI): handle the view_dvi_paper_option variable.
6594 [Both from Roland Krause]
6596 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6598 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6599 char const *, int, LyXFont)
6600 (text(int, int, string, LyXFont)): ditto
6602 * src/text.C (InsertCharInTable): attempt to fix the double-space
6603 feature in tables too.
6604 (BackspaceInTable): ditto.
6605 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6607 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6609 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6611 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6612 newly found text in textcache to this.
6613 (buffer): set the owner of the text put into the textcache to 0
6615 * src/insets/figinset.C (draw): fixed the drawing of figures with
6618 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6619 drawing of mathframe, hfills, protected space, table lines. I have
6620 now no outstanding drawing problems with the new Painter code.
6622 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6624 * src/PainterBase.C (ellipse, circle): do not specify the default
6627 * src/LColor.h: add using directive.
6629 * src/Painter.[Ch]: change return type of methods from Painter& to
6630 PainterBase&. Add a using directive.
6632 * src/WorkArea.C: wrap xforms callbacks in C functions
6635 * lib/layouts/foils.layout: font fix and simplifications from Carl
6638 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6640 * a lot of files: The Painter, LColor and WorkArea from the old
6641 devel branch has been ported to lyx-devel. Some new files and a
6642 lot of #ifdeffed code. The new workarea is enabled by default, but
6643 if you want to test the new Painter and LColor you have to compile
6644 with USE_PAINTER defined (do this in config.h f.ex.) There are
6645 still some rought edges, and I'd like some help to clear those
6646 out. It looks stable (loads and displays the Userguide very well).
6649 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6651 * src/buffer.C (pop_tag): revert to the previous implementation
6652 (use a global variable for both loops).
6654 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6656 * src/lyxrc.C (LyXRC): change slightly default date format.
6658 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6659 there is an English text with a footnote that starts with a Hebrew
6660 paragraph, or vice versa.
6661 (TeXFootnote): ditto.
6663 * src/text.C (LeftMargin): allow for negative values for
6664 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6667 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6668 for input encoding (cyrillic)
6670 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6672 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6675 * src/toolbar.C (set): ditto
6676 * src/insets/insetbib.C (create_form_citation_form): ditto
6678 * lib/CREDITS: added Dekel Tsur.
6680 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6681 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6682 hebrew supports files from Dekel Tsur.
6684 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6685 <tzafrir@technion.ac.il>
6687 * src/lyxrc.C: put \date_insert_format at the right place.
6689 * src/buffer.C (makeLaTeXFile): fix the handling of
6690 BufferParams::sides when writing out latex files.
6692 * src/BufferView2.C: add a "using" directive.
6694 * src/support/lyxsum.C (sum): when we use lyxstring,
6695 ostringstream::str needs an additional .c_str().
6697 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6699 * src/support/filetools.C (ChangeExtension): patch from Etienne
6702 * src/TextCache.C (show): remove const_cast and make second
6703 parameter non-const LyXText *.
6705 * src/TextCache.h: use non const LyXText in show.
6707 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6710 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6712 * src/support/lyxsum.C: rework to be more flexible.
6714 * several places: don't check if a pointer is 0 if you are going
6717 * src/text.C: remove some dead code.
6719 * src/insets/figinset.C: remove some dead code
6721 * src/buffer.C: move the BufferView funcs to BufferView2.C
6722 remove all support for insetlatexdel
6723 remove support for oldpapersize stuff
6724 made some member funcs const
6726 * src/kbmap.C: use a std::list to store the bindings in.
6728 * src/BufferView2.C: new file
6730 * src/kbsequence.[Ch]: new files
6732 * src/LyXAction.C + others: remove all trace of buffer-previous
6734 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6735 only have one copy in the binary of this table.
6737 * hebrew patch: moved some functions from LyXText to more
6738 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6740 * several files: remove support for XForms older than 0.88
6742 remove some #if 0 #endif code
6744 * src/TextCache.[Ch]: new file. Holds the textcache.
6746 * src/BufferView.C: changes to use the new TextCache interface.
6747 (waitForX): remove the now unused code.
6749 * src/BackStack.h: remove some commented code
6751 * lib/bind/emacs.bind: remove binding for buffer-previous
6753 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6755 * applied the hebrew patch.
6757 * src/lyxrow.h: make sure that all Row variables are initialized.
6759 * src/text2.C (TextHandleUndo): comment out a delete, this might
6760 introduce a memory leak, but should also help us to not try to
6761 read freed memory. We need to look at this one.
6763 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6764 (LyXParagraph): initalize footnotekind.
6766 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6767 forgot this when applying the patch. Please heed the warnings.
6769 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6770 (aka. reformat problem)
6772 * src/bufferlist.C (exists): made const, and use const_iterator
6773 (isLoaded): new func.
6774 (release): use std::find to find the correct buffer.
6776 * src/bufferlist.h: made getState a const func.
6777 made empty a const func.
6778 made exists a const func.
6781 2000-02-01 Juergen Vigna <jug@sad.it>
6783 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6785 * po/it.po: updated a bit the italian po file and also changed the
6786 'file nuovo' for newfile to 'filenuovo' without a space, this did
6789 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6790 for the new insert_date command.
6792 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6793 from jdblair, to insert a date into the current text conforming to
6794 a strftime format (for now only considering the locale-set and not
6795 the document-language).
6797 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6799 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6800 Bounds Read error seen by purify. The problem was that islower is
6801 a macros which takes an unsigned char and uses it as an index for
6802 in array of characters properties (and is thus subject to the
6806 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6807 correctly the paper sides radio buttons.
6808 (UpdateDocumentButtons): ditto.
6810 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6812 * src/kbmap.C (getsym + others): change to return unsigned int,
6813 returning a long can give problems on 64 bit systems. (I assume
6814 that int is 32bit on 64bit systems)
6816 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6818 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6819 LyXLookupString to be zero-terminated. Really fixes problems seen
6822 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6824 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6825 write a (char*)0 to the lyxerr stream.
6827 * src/lastfiles.C: move algorithm before the using statemets.
6829 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6831 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6832 complains otherwise).
6833 * src/table.C: ditto
6835 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6838 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6839 that I removed earlier... It is really needed.
6841 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6843 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6845 * INSTALL: update xforms home page URL.
6847 * lib/configure.m4: fix a bug with unreadable layout files.
6849 * src/table.C (calculate_width_of_column): add "using std::max"
6852 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6854 * several files: marked several lines with "DEL LINE", this is
6855 lines that can be deleted without changing anything.
6856 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6857 checks this anyway */
6860 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6862 * src/DepTable.C (update): add a "+" at the end when the checksum
6863 is different. (debugging string only)
6865 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6866 the next inset to not be displayed. This should also fix the list
6867 of labels in the "Insert Crossreference" dialog.
6869 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6871 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6872 when regex was not found.
6874 * src/support/lstrings.C (lowercase): use handcoded transform always.
6877 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6878 old_cursor.par->prev could be 0.
6880 * several files: changed post inc/dec to pre inc/dec
6882 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6883 write the lastfiles to file.
6885 * src/BufferView.C (buffer): only show TextCache info when debugging
6887 (resizeCurrentBuffer): ditto
6888 (workAreaExpose): ditto
6890 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6892 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6894 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6895 a bit better by removing the special case for \i and \j.
6897 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6899 * src/lyx_main.C (easyParse): remove test for bad comand line
6900 options, since this broke all xforms-related parsing.
6902 * src/kbmap.C (getsym): set return type to unsigned long, as
6903 declared in header. On an alpha, long is _not_ the same as int.
6905 * src/support/LOstream.h: add a "using std::flush;"
6907 * src/insets/figinset.C: ditto.
6909 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6911 * src/bufferlist.C (write): use blinding fast file copy instead of
6912 "a char at a time", now we are doing it the C++ way.
6914 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6915 std::list<int> instead.
6916 (addpidwait): reflect move to std::list<int>
6917 (sigchldchecker): ditto
6919 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6922 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6923 that obviously was wrong...
6925 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6926 c, this avoids warnings with purify and islower.
6928 * src/insets/figinset.C: rename struct queue to struct
6929 queue_element and rewrite to use a std::queue. gsqueue is now a
6930 std::queue<queue_element>
6931 (runqueue): reflect move to std::queue
6934 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6935 we would get "1" "0" instead of "true" "false. Also make the tostr
6938 2000-01-21 Juergen Vigna <jug@sad.it>
6940 * src/buffer.C (writeFileAscii): Disabled code for special groff
6941 handling of tabulars till I fix this in table.C
6943 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6945 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6947 * src/support/lyxlib.h: ditto.
6949 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6951 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6952 and 'j' look better. This might fix the "macron" bug that has been
6955 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6956 functions as one template function. Delete the old versions.
6958 * src/support/lyxsum.C: move using std::ifstream inside
6961 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6964 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6966 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6968 * src/insets/figinset.C (InitFigures): use new instead of malloc
6969 to allocate memory for figures and bitmaps.
6970 (DoneFigures): use delete[] instead of free to deallocate memory
6971 for figures and bitmaps.
6972 (runqueue): use new to allocate
6973 (getfigdata): use new/delete[] instead of malloc/free
6974 (RegisterFigure): ditto
6976 * some files: moved some declarations closer to first use, small
6977 whitespace changes use preincrement instead of postincrement where
6978 it does not make a difference.
6980 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6981 step on the way to use stl::containers for key maps.
6983 * src/bufferlist.h: add a typedef for const_iterator and const
6984 versions of begin and end.
6986 * src/bufferlist.[Ch]: change name of member variable _state to
6987 state_. (avoid reserved names)
6989 (getFileNames): returns the filenames of the buffers in a vector.
6991 * configure.in (ALL_LINGUAS): added ro
6993 * src/support/putenv.C: new file
6995 * src/support/mkdir.C: new file
6997 2000-01-20 Allan Rae <rae@lyx.org>
6999 * lib/layouts/IEEEtran.layout: Added several theorem environments
7001 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7002 couple of minor additions.
7004 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7005 (except for those in footnotes of course)
7007 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7009 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7011 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7012 std::sort and std::lower_bound instead of qsort and handwritten
7014 (struct compara): struct that holds the functors used by std::sort
7015 and std::lower_bound in MathedLookupBOP.
7017 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7019 * src/support/LAssert.h: do not do partial specialization. We do
7022 * src/support/lyxlib.h: note that lyx::getUserName() and
7023 lyx::date() are not in use right now. Should these be suppressed?
7025 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7026 (makeLinuxDocFile): do not put date and user name in linuxdoc
7029 * src/support/lyxlib.h (kill): change first argument to long int,
7030 since that's what solaris uses.
7032 * src/support/kill.C (kill): fix declaration to match prototype.
7034 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7035 actually check whether namespaces are supported. This is not what
7038 * src/support/lyxsum.C: add a using directive.
7040 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7042 * src/support/kill.C: if we have namespace support we don't have
7043 to include lyxlib.h.
7045 * src/support/lyxlib.h: use namespace lyx if supported.
7047 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7049 * src/support/date.C: new file
7051 * src/support/chdir.C: new file
7053 * src/support/getUserName.C: new file
7055 * src/support/getcwd.C: new file
7057 * src/support/abort.C: new file
7059 * src/support/kill.C: new file
7061 * src/support/lyxlib.h: moved all the functions in this file
7062 insede struct lyx. Added also kill and abort to this struct. This
7063 is a way to avoid the "kill is not defined in <csignal>", we make
7064 C++ wrappers for functions that are not ANSI C or ANSI C++.
7066 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7067 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7068 lyx it has been renamed to sum.
7070 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7072 * src/text.C: add using directives for std::min and std::max.
7074 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7076 * src/texrow.C (getIdFromRow): actually return something useful in
7077 id and pos. Hopefully fixes the bug with positionning of errorbox
7080 * src/lyx_main.C (easyParse): output an error and exit if an
7081 incorrect command line option has been given.
7083 * src/spellchecker.C (ispell_check_word): document a memory leak.
7085 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7086 where a "struct utimbuf" is allocated with "new" and deleted with
7089 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7091 * src/text2.C (CutSelection): don't delete double spaces.
7092 (PasteSelection): ditto
7093 (CopySelection): ditto
7095 * src/text.C (Backspace): don't delete double spaces.
7097 * src/lyxlex.C (next): fix a bug that were only present with
7098 conformant std::istream::get to read comment lines, use
7099 std::istream::getline instead. This seems to fix the problem.
7101 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7103 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7104 allowed to insert space before space" editing problem. Please read
7105 commends at the beginning of the function. Comments about usage
7108 * src/text.C (InsertChar): fix for the "not allowed to insert
7109 space before space" editing problem.
7111 * src/text2.C (DeleteEmptyParagraphMechanism): when
7112 IsEmptyTableRow can only return false this last "else if" will
7113 always be a no-op. Commented out.
7115 * src/text.C (RedoParagraph): As far as I can understand tmp
7116 cursor is not really needed.
7118 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7119 present it could only return false anyway.
7120 (several functions): Did something not so smart...added a const
7121 specifier on a lot of methods.
7123 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7124 and add a tmp->text.resize. The LyXParagraph constructor does the
7126 (BreakParagraphConservative): ditto
7128 * src/support/path.h (Path): add a define so that the wrong usage
7129 "Path("/tmp") will be flagged as a compilation error:
7130 "`unnamed_Path' undeclared (first use this function)"
7132 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7134 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7135 which was bogus for several reasons.
7137 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7141 * autogen.sh: do not use "type -path" (what's that anyway?).
7143 * src/support/filetools.C (findtexfile): remove extraneous space
7144 which caused a kpsewhich warning (at least with kpathsea version
7147 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7149 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7151 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7153 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7155 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7157 * src/paragraph.C (BreakParagraph): do not reserve space on text
7158 if we don't need to (otherwise, if pos_end < pos, we end up
7159 reserving huge amounts of memory due to bad unsigned karma).
7160 (BreakParagraphConservative): ditto, although I have not seen
7161 evidence the bug can happen here.
7163 * src/lyxparagraph.h: add a using std::list.
7165 2000-01-11 Juergen Vigna <jug@sad.it>
7167 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7170 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7172 * src/vc-backend.C (doVCCommand): change to be static and take one
7173 more parameter: the path to chdir too be fore executing the command.
7174 (retrive): new function equiv to "co -r"
7176 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7177 file_not_found_hook is true.
7179 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7181 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7182 if a file is readwrite,readonly...anything else.
7184 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7186 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7187 (CreatePostscript): name change from MenuRunDVIPS (or something)
7188 (PreviewPostscript): name change from MenuPreviewPS
7189 (PreviewDVI): name change from MenuPreviewDVI
7191 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7192 \view_pdf_command., \pdf_to_ps_command
7194 * lib/configure.m4: added search for PDF viewer, and search for
7195 PDF to PS converter.
7196 (lyxrc.defaults output): add \pdflatex_command,
7197 \view_pdf_command and \pdf_to_ps_command.
7199 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7201 * src/bufferlist.C (write): we don't use blocksize for anything so
7204 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7206 * src/support/block.h: disable operator T* (), since it causes
7207 problems with both compilers I tried. See comments in the file.
7209 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7212 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7213 variable LYX_DIR_10x to LYX_DIR_11x.
7215 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7217 * INSTALL: document --with-lyxname.
7220 * configure.in: new configure flag --with-lyxname which allows to
7221 choose the name under which lyx is installed. Default is "lyx", of
7222 course. It used to be possible to do this with --program-suffix,
7223 but the later has in fact a different meaning for autoconf.
7225 * src/support/lstrings.h (lstrchr): reformat a bit.
7227 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7228 * src/mathed/math_defs.h: ditto.
7230 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7232 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7233 true, decides if we create a backup file or not when saving. New
7234 tag and variable \pdf_mode, defaults to false. New tag and
7235 variable \pdflatex_command, defaults to pdflatex. New tag and
7236 variable \view_pdf_command, defaults to xpdf. New tag and variable
7237 \pdf_to_ps_command, defaults to pdf2ps.
7239 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7241 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7242 does not have a BufferView.
7243 (unlockInset): ditto + don't access the_locking_inset if the
7244 buffer does not have a BufferView.
7246 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7247 certain circumstances so that we don't continue a keyboard
7248 operation long after the key was released. Try f.ex. to load a
7249 large document, press PageDown for some seconds and then release
7250 it. Before this change the document would contine to scroll for
7251 some time, with this change it stops imidiatly.
7253 * src/support/block.h: don't allocate more space than needed. As
7254 long as we don't try to write to the arr[x] in a array_type arr[x]
7255 it is perfectly ok. (if you write to it you might segfault).
7256 added operator value_type*() so that is possible to pass the array
7257 to functions expecting a C-pointer.
7259 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7262 * intl/*: updated to gettext 0.10.35, tried to add our own
7263 required modifications. Please verify.
7265 * po/*: updated to gettext 0.10.35, tried to add our own required
7266 modifications. Please verify.
7268 * src/support/lstrings.C (tostr): go at fixing the problem with
7269 cxx and stringstream. When stringstream is used return
7270 oss.str().c_str() so that problems with lyxstring and basic_string
7271 are avoided. Note that the best solution would be for cxx to use
7272 basic_string all the way, but it is not conformant yet. (it seems)
7274 * src/lyx_cb.C + other files: moved several global functions to
7275 class BufferView, some have been moved to BufferView.[Ch] others
7276 are still located in lyx_cb.C. Code changes because of this. (part
7277 of "get rid of current_view project".)
7279 * src/buffer.C + other files: moved several Buffer functions to
7280 class BufferView, the functions are still present in buffer.C.
7281 Code changes because of this.
7283 * config/lcmessage.m4: updated to most recent. used when creating
7286 * config/progtest.m4: updated to most recent. used when creating
7289 * config/gettext.m4: updated to most recent. applied patch for
7292 * config/gettext.m4.patch: new file that shows what changes we
7293 have done to the local copy of gettext.m4.
7295 * config/libtool.m4: new file, used in creation of acinclude.m4
7297 * config/lyxinclude.m4: new file, this is the lyx created m4
7298 macros, used in making acinclude.m4.
7300 * autogen.sh: GNU m4 discovered as a separate task not as part of
7301 the lib/configure creation.
7302 Generate acinlucde from files in config. Actually cat
7303 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7304 easier to upgrade .m4 files that really are external.
7306 * src/Spacing.h: moved using std::istringstream to right after
7307 <sstream>. This should fix the problem seen with some compilers.
7309 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7311 * src/lyx_cb.C: began some work to remove the dependency a lot of
7312 functions have on BufferView::text, even if not really needed.
7313 (GetCurrentTextClass): removed this func, it only hid the
7316 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7317 forgot this in last commit.
7319 * src/Bullet.C (bulletEntry): use static char const *[] for the
7320 tables, becuase of this the return arg had to change to string.
7322 (~Bullet): removed unneeded destructor
7324 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7325 (insetSleep): moved from Buffer
7326 (insetWakeup): moved from Buffer
7327 (insetUnlock): moved from Buffer
7329 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7330 from Buffer to BufferView.
7332 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7334 * config/ltmain.sh: updated to version 1.3.4 of libtool
7336 * config/ltconfig: updated to version 1.3.4 of libtool
7338 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7341 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7342 Did I get that right?
7344 * src/lyxlex.h: add a "using" directive or two.
7345 * src/Spacing.h: ditto.
7346 * src/insets/figinset.C: ditto.
7347 * src/support/filetools.C: ditto.
7348 * src/support/lstrings.C: ditto.
7349 * src/BufferView.C: ditto.
7350 * src/bufferlist.C: ditto.
7351 * src/lyx_cb.C: ditto.
7352 * src/lyxlex.C: ditto.
7354 * NEWS: add some changes for 1.1.4.
7356 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7358 * src/BufferView.C: first go at a TextCache to speed up switching
7361 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7363 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7364 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7365 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7366 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7369 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7370 members of the struct are correctly initialized to 0 (detected by
7372 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7373 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7375 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7376 pidwait, since it was allocated with "new". This was potentially
7377 very bad. Thanks to Michael Schmitt for running purify for us.
7380 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7382 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7384 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7386 1999-12-30 Allan Rae <rae@lyx.org>
7388 * lib/templates/IEEEtran.lyx: minor change
7390 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7391 src/mathed/formula.C (LocalDispatch): askForText changes
7393 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7394 know when a user has cancelled input. Fixes annoying problems with
7395 inserting labels and version control.
7397 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7399 * src/support/lstrings.C (tostr): rewritten to use strstream and
7402 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7404 * src/support/filetools.C (IsFileWriteable): use fstream to check
7405 (IsDirWriteable): use fileinfo to check
7407 * src/support/filetools.h (FilePtr): whole class deleted
7409 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7411 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7413 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7415 * src/bufferlist.C (write): use ifstream and ofstream instead of
7418 * src/Spacing.h: use istrstream instead of sscanf
7420 * src/mathed/math_defs.h: change first arg to istream from FILE*
7422 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7424 * src/mathed/math_parser.C: have yyis to be an istream
7425 (LexGetArg): use istream (yyis)
7427 (mathed_parse): ditto
7428 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7430 * src/mathed/formula.C (Read): rewritten to use istream
7432 * src/mathed/formulamacro.C (Read): rewritten to use istream
7434 * src/lyxlex.h (~LyXLex): deleted desturctor
7435 (getStream): new function, returns an istream
7436 (getFile): deleted funtion
7437 (IsOK): return is.good();
7439 * src/lyxlex.C (LyXLex): delete file and owns_file
7440 (setFile): open an filebuf and assign that to a istream instead of
7442 (setStream): new function, takes an istream as arg.
7443 (setFile): deleted function
7444 (EatLine): rewritten us use istream instead of FILE*
7448 * src/table.C (LyXTable): use istream instead of FILE*
7449 (Read): rewritten to take an istream instead of FILE*
7451 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7453 * src/buffer.C (Dispatch): remove an extraneous break statement.
7455 * src/support/filetools.C (QuoteName): change to do simple
7456 'quoting'. More work is necessary. Also changed to do nothing
7457 under emx (needs fix too).
7458 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7460 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7461 config.h.in to the AC_DEFINE_UNQUOTED() call.
7462 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7463 needs char * as argument (because Solaris 7 declares it like
7466 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7467 remove definition of BZERO.
7469 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7471 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7472 defined, "lyxregex.h" if not.
7474 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7476 (REGEX): new variable that is set to regex.c lyxregex.h when
7477 AM_CONDITIONAL USE_REGEX is set.
7478 (libsupport_la_SOURCES): add $(REGEX)
7480 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7483 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7486 * configure.in: add call to LYX_REGEX
7488 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7489 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7491 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7493 * lib/bind/fi_menus.bind: new file, from
7494 pauli.virtanen@saunalahti.fi.
7496 * src/buffer.C (getBibkeyList): pass the parameter delim to
7497 InsetInclude::getKeys and InsetBibtex::getKeys.
7499 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7500 is passed to Buffer::getBibkeyList
7502 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7503 instead of the hardcoded comma.
7505 * src/insets/insetbib.C (getKeys): make sure that there are not
7506 leading blanks in bibtex keys. Normal latex does not care, but
7507 harvard.sty seems to dislike blanks at the beginning of citation
7508 keys. In particular, the retturn value of the function is
7510 * INSTALL: make it clear that libstdc++ is needed and that gcc
7511 2.7.x probably does not work.
7513 * src/support/filetools.C (findtexfile): make debug message go to
7515 * src/insets/insetbib.C (getKeys): ditto
7517 * src/debug.C (showTags): make sure that the output is correctly
7520 * configure.in: add a comment for TWO_COLOR_ICON define.
7522 * acconfig.h: remove all the entries that already defined in
7523 configure.in or acinclude.m4.
7525 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7526 to avoid user name, date and copyright.
7528 1999-12-21 Juergen Vigna <jug@sad.it>
7530 * src/table.C (Read): Now read bogus row format informations
7531 if the format is < 5 so that afterwards the table can
7532 be read by lyx but without any format-info. Fixed the
7533 crash we experienced when not doing this.
7535 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7537 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7538 (RedoDrawingOfParagraph): ditto
7539 (RedoParagraphs): ditto
7540 (RemoveTableRow): ditto
7542 * src/text.C (Fill): rename arg paperwidth -> paper_width
7544 * src/buffer.C (insertLyXFile): rename var filename -> fname
7545 (writeFile): rename arg filename -> fname
7546 (writeFileAscii): ditto
7547 (makeLaTeXFile): ditto
7548 (makeLinuxDocFile): ditto
7549 (makeDocBookFile): ditto
7551 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7554 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7556 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7559 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7560 compiled by a C compiler not C++.
7562 * src/layout.h (LyXTextClass): added typedef for const_iterator
7563 (LyXTextClassList): added typedef for const_iterator + member
7564 functions begin and end.
7566 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7567 iterators to fill the choice_class.
7568 (updateLayoutChoice): rewritten to use iterators to fill the
7569 layoutlist in the toolbar.
7571 * src/BufferView.h (BufferView::work_area_width): removed unused
7574 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7576 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7577 (sgmlCloseTag): ditto
7579 * src/support/lstrings.h: return type of countChar changed to
7582 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7583 what version of this func to use. Also made to return unsigned int.
7585 * configure.in: call LYX_STD_COUNT
7587 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7588 conforming std::count.
7590 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7592 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7593 and a subscript would give bad display (patch from Dekel Tsur
7594 <dekel@math.tau.ac.il>).
7596 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7598 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7601 * src/chset.h: add a few 'using' directives
7603 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7604 triggered when no buffer is active
7606 * src/layout.C: removed `break' after `return' in switch(), since
7609 * src/lyx_main.C (init): make sure LyX can be ran in place even
7610 when libtool has done its magic with shared libraries. Fix the
7611 test for the case when the system directory has not been found.
7613 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7614 name for the latex file.
7615 (MenuMakeHTML): ditto
7617 * src/buffer.h: add an optional boolean argument, which is passed
7620 1999-12-20 Allan Rae <rae@lyx.org>
7622 * lib/templates/IEEEtran.lyx: small correction and update.
7624 * configure.in: Attempted to use LYX_PATH_HEADER
7626 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7628 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7629 input from JMarc. Now use preprocessor to find the header.
7630 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7631 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7632 LYX_STL_STRING_FWD. See comments in file.
7634 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7636 * The global MiniBuffer * minibuffer variable is dead.
7638 * The global FD_form_main * fd_form_main variable is dead.
7640 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7642 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7644 * src/table.h: add the LOstream.h header
7645 * src/debug.h: ditto
7647 * src/LyXAction.h: change the explaination of the ReadOnly
7648 attribute: is indicates that the function _can_ be used.
7650 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7653 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7655 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7661 * src/paragraph.C (GetWord): assert on pos>=0
7664 * src/support/lyxstring.C: condition the use of an invariant on
7666 * src/support/lyxstring.h: ditto
7668 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7669 Use LAssert.h instead of plain assert().
7671 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7673 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7674 * src/support/filetools.C: ditto
7676 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7679 * INSTALL: document the new configure flags
7681 * configure.in: suppress --with-debug; add --enable-assertions
7683 * acinclude.m4: various changes in alignment of help strings.
7685 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7687 * src/kbmap.C: commented out the use of the hash map in kb_map,
7688 beginning of movement to a stl::container.
7690 * several files: removed code that was not in effect when
7691 MOVE_TEXT was defined.
7693 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7694 for escaping should not be used. We can discuss if the string
7695 should be enclosed in f.ex. [] instead of "".
7697 * src/trans_mgr.C (insert): use the new returned value from
7698 encodeString to get deadkeys and keymaps done correctly.
7700 * src/chset.C (encodeString): changed to return a pair, to tell
7701 what to use if we know the string.
7703 * src/lyxscreen.h (fillArc): new function.
7705 * src/FontInfo.C (resize): rewritten to use more std::string like
7706 structore, especially string::replace.
7708 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7711 * configure.in (chmod +x some scripts): remove config/gcc-hack
7713 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7715 * src/buffer.C (writeFile): change once again the top comment in a
7716 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7717 instead of an hardcoded version number.
7718 (makeDocBookFile): ditto
7720 * src/version.h: add new define LYX_DOCVERSION
7722 * po/de.po: update from Pit Sütterlin
7723 * lib/bind/de_menus.bind: ditto.
7725 * src/lyxfunc.C (Dispatch): call MenuExport()
7726 * src/buffer.C (Dispatch): ditto
7728 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7729 LyXFunc::Dispatch().
7730 (MenuExport): new function, moved from
7731 LyXFunc::Dispatch().
7733 * src/trans_mgr.C (insert): small cleanup
7734 * src/chset.C (loadFile): ditto
7736 * lib/kbd/iso8859-1.cdef: add missing backslashes
7738 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7740 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7741 help with placing the manually drawn accents better.
7743 (Draw): x2 and hg changed to float to minimize rounding errors and
7744 help place the accents better.
7746 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7747 unsigned short to char is just wrong...cast the char to unsigned
7748 char instead so that the two values can compare sanely. This
7749 should also make the display of insetlatexaccents better and
7750 perhaps also some other insets.
7752 (lbearing): new function
7755 1999-12-15 Allan Rae <rae@lyx.org>
7757 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7758 header that provides a wrapper around the very annoying SGI STL header
7761 * src/support/lyxstring.C, src/LString.h:
7762 removed old SGI-STL-compatability attempts.
7764 * configure.in: Use LYX_STL_STRING_FWD.
7766 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7767 stl_string_fwd.h is around and try to determine it's location.
7768 Major improvement over previous SGI STL 3.2 compatability.
7769 Three small problems remain with this function due to my zero
7770 knowledge of autoconf. JMarc and lgb see the comments in the code.
7772 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7774 * src/broken_const.h, config/hack-gcc, config/README: removed
7776 * configure.in: remove --with-gcc-hack option; do not call
7779 * INSTALL: remove documentation of --with-broken-const and
7782 * acconfig.h: remove all trace of BROKEN_CONST define
7784 * src/buffer.C (makeDocBookFile): update version number in output
7786 (SimpleDocBookOnePar): fix an assert when trying to a character
7787 access beyond string length
7790 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7792 * po/de.po: fix the Export menu
7794 * lyx.man: update the description of -dbg
7796 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7797 (commandLineHelp): updated
7798 (easyParse): show list of available debug levels if -dbg is passed
7801 * src/Makefile.am: add debug.C
7803 * src/debug.h: moved some code to debug.C
7805 * src/debug.C: new file. Contains code to set and show debug
7808 * src/layout.C: remove 'break' after 'continue' in switch
7809 statements, since these cannot be reached.
7811 1999-12-13 Allan Rae <rae@lyx.org>
7813 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7814 (in_word_set): hash() -> math_hash()
7816 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7818 * acconfig.h: Added a test for whether we are using exceptions in the
7819 current compilation run. If so USING_EXCEPTIONS is defined.
7821 * config.in: Check for existance of stl_string_fwd.h
7822 * src/LString.h: If compiling --with-included-string and SGI's
7823 STL version 3.2 is present (see above test) we need to block their
7824 forward declaration of string and supply a __get_c_string().
7825 However, it turns out this is only necessary if compiling with
7826 exceptions enabled so I've a bit more to add yet.
7828 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7829 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7830 src/support/LRegex.h, src/undo.h:
7831 Shuffle the order of the included files a little to ensure that
7832 LString.h gets included before anything that includes stl_string_fwd.h
7834 * src/support/lyxstring.C: We need to #include LString.h instead of
7835 lyxstring.h to get the necessary definition of __get_c_string.
7836 (__get_c_string): New function. This is defined static just like SGI's
7837 although why they need to do this I'm not sure. Perhaps it should be
7838 in lstrings.C instead.
7840 * lib/templates/IEEEtran.lyx: New template file.
7842 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7844 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7845 * intl/Makefile.in (MKINSTALLDIRS): ditto
7847 * src/LyXAction.C (init): changed to hold the LFUN data in a
7848 automatic array in stead of in callso to newFunc, this speeds up
7849 compilation a lot. Also all the memory used by the array is
7850 returned when the init is completed.
7852 * a lot of files: compiled with -Wold-style-cast, changed most of
7853 the reported offenders to C++ style casts. Did not change the
7854 offenders in C files.
7856 * src/trans.h (Match): change argument type to unsigned int.
7858 * src/support/DebugStream.C: fix some types on the streambufs so
7859 that it works on a conforming implementation.
7861 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7863 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7865 * src/support/lyxstring.C: remove the inline added earlier since
7866 they cause a bunch of unsatisfied symbols when linking with dec
7867 cxx. Cxx likes to have the body of inlines at the place where they
7870 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7871 accessing negative bounds in array. This fixes the crash when
7872 inserting accented characters.
7873 * src/trans.h (Match): ditto
7875 * src/buffer.C (Dispatch): since this is a void, it should not try
7876 to return anything...
7878 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7880 * src/buffer.h: removed the two friends from Buffer. Some changes
7881 because of this. Buffer::getFileName and Buffer::setFileName
7882 renamed to Buffer::fileName() and Buffer::fileName(...).
7884 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7886 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7887 and Buffer::update(short) to BufferView. This move is currently
7888 controlled by a define MOVE_TEXT, this will be removed when all
7889 shows to be ok. This move paves the way for better separation
7890 between buffer contents and buffer view. One side effect is that
7891 the BufferView needs a rebreak when swiching buffers, if we want
7892 to avoid this we can add a cache that holds pointers to LyXText's
7893 that is not currently in use.
7895 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7898 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7900 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7902 * lyx_main.C: new command line option -x (or --execute) and
7903 -e (or --export). Now direct conversion from .lyx to .tex
7904 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7905 Unfortunately, X is still needed and the GUI pops up during the
7908 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7910 * src/Spacing.C: add a using directive to bring stream stuff into
7912 * src/paragraph.C: ditto
7913 * src/buffer.C: ditto
7915 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7916 from Lars' announcement).
7918 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7919 example files from Tino Meinen.
7921 1999-12-06 Allan Rae <rae@lyx.org>
7923 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7925 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7927 * src/support/lyxstring.C: added a lot of inline for no good
7930 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7931 latexWriteEndChanges, they were not used.
7933 * src/layout.h (operator<<): output operator for PageSides
7935 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7937 * some example files: loaded in LyX 1.0.4 and saved again to update
7938 certain constructs (table format)
7940 * a lot of files: did the change to use fstream/iostream for all
7941 writing of files. Done with a close look at Andre Poenitz's patch.
7943 * some files: whitespace changes.
7945 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7947 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7948 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7949 architecture, we provide our own. It is used unconditionnally, but
7950 I do not think this is a performance problem. Thanks to Angus
7951 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7952 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7954 (GetInset): use my_memcpy.
7958 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7959 it is easier to understand, but it uses less TeX-only constructs now.
7961 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7962 elements contain spaces
7964 * lib/configure: regenerated
7966 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7967 elements contain spaces; display the list of programs that are
7970 * autogen.sh: make sure lib/configure is executable
7972 * lib/examples/*: rename the tutorial examples to begin with the
7973 two-letters language code.
7975 * src/lyxfunc.C (getStatus): do not query current font if no
7978 * src/lyx_cb.C (RunScript): use QuoteName
7979 (MenuRunDvips): ditto
7980 (PrintApplyCB): ditto
7982 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7983 around argument, so that it works well with the current shell.
7984 Does not work properly with OS/2 shells currently.
7986 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7987 * src/LyXSendto.C (SendtoApplyCB): ditto
7988 * src/lyxfunc.C (Dispatch): ditto
7989 * src/buffer.C (runLaTeX): ditto
7990 (runLiterate): ditto
7991 (buildProgram): ditto
7993 * src/lyx_cb.C (RunScript): ditto
7994 (MenuMakeLaTeX): ditto
7996 * src/buffer.h (getLatexName): new method
7998 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8000 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8002 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8003 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8004 (create_math_panel): ditto
8006 * src/lyxfunc.C (getStatus): re-activate the code which gets
8007 current font and cursor; add test for export to html.
8009 * src/lyxrc.C (read): remove unreachable break statements; add a
8012 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8014 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8016 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8017 introduced by faulty regex.
8018 * src/buffer.C: ditto
8019 * src/lastfiles.C: ditto
8020 * src/paragraph.C: ditto
8021 * src/table.C: ditto
8022 * src/vspace.C: ditto
8023 * src/insets/figinset.C: ditto
8024 Note: most of these is absolutely harmless, except the one in
8025 src/mathed formula.C.
8027 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8029 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8030 operation, yielding correct results for the reLyX command.
8032 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8034 * src/support/filetools.C (ExpandPath): removed an over eager
8036 (ReplaceEnvironmentPath): ditto
8038 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8039 shows that we are doing something fishy in our code...
8043 * src/lyxrc.C (read): use a double switch trick to get more help
8044 from the compiler. (the same trick is used in layout.C)
8045 (write): new function. opens a ofstream and pass that to output
8046 (output): new function, takes a ostream and writes the lyxrc
8047 elemts to it. uses a dummy switch to make sure no elements are
8050 * src/lyxlex.h: added a struct pushpophelper for use in functions
8051 with more than one exit point.
8053 * src/lyxlex.[Ch] (GetInteger): made it const
8057 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8059 * src/layout.[hC] : LayoutTags splitted into several enums, new
8060 methods created, better error handling cleaner use of lyxlex. Read
8063 * src/bmtable.[Ch]: change some member prototypes because of the
8064 image const changes.
8066 * commandtags.h, src/LyXAction.C (init): new function:
8067 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8068 This file is not read automatically but you can add \input
8069 preferences to your lyxrc if you want to. We need to discuss how
8072 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8073 in .aux, also remove .bib and .bst files from dependencies when
8076 * src/BufferView.C, src/LyXView.C: add const_cast several places
8077 because of changes to images.
8079 * lib/images/*: same change as for images/*
8081 * lib/lyxrc.example: Default for accept_compound is false not no.
8083 * images/*: changed to be const, however I have som misgivings
8084 about this change so it might be changed back.
8086 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8088 * lib/configure, po/POTFILES.in: regenerated
8090 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8092 * config/lib_configure.m4: removed
8094 * lib/configure.m4: new file (was config/lib_configure.m4)
8096 * configure.in: do not test for rtti, since we do not use it.
8098 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8100 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8101 doubling of allocated space scheme. This makes it faster for large
8102 strings end to use less memory for small strings. xtra rememoved.
8104 * src/insets/figinset.C (waitalarm): commented out.
8105 (GhostscriptMsg): use static_cast
8106 (GhostscriptMsg): use new instead of malloc to allocate memory for
8107 cmap. also delete the memory after use.
8109 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8111 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8112 for changes in bibtex database or style.
8113 (runBibTeX): remove all .bib and .bst files from dep before we
8115 (run): use scanAuc in when dep file already exist.
8117 * src/DepTable.C (remove_files_with_extension): new method
8120 * src/DepTable.[Ch]: made many of the methods const.
8122 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8124 * src/bufferparams.C: make sure that the default textclass is
8125 "article". It used to be the first one by description order, but
8126 now the first one is "docbook".
8128 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8129 string; call Debug::value.
8130 (easyParse): pass complete argument to setDebuggingLevel().
8132 * src/debug.h (value): fix the code that parses debug levels.
8134 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8137 * src/LyXAction.C: use Debug::ACTION as debug channel.
8139 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8141 * NEWS: updated for the future 1.1.3 release.
8143 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8144 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8145 it should. This is of course a controversial change (since many
8146 people will find that their lyx workscreen is suddenly full of
8147 red), but done for the sake of correctness.
8149 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8150 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8152 * src/insets/inseterror.h, src/insets/inseturl.h,
8153 src/insets/insetinfo.h, src/insets/figinset.h,
8154 src/mathed/formulamacro.h, src/mathed/math_macro.h
8155 (EditMessage): add a missing const and add _() to make sure that
8158 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8159 src/insets/insetbib.C, src/support/filetools.C: add `using'
8162 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8163 doing 'Insert index of last word' at the beginning of a paragraph.
8165 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8167 * several files: white-space changes.
8169 * src/mathed/formula.C: removed IsAlpha and IsDigit
8171 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8172 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8175 * src/insets/figinset.C (GetPSSizes): don't break when
8176 "EndComments" is seen. But break when a boundingbox is read.
8178 * all classes inherited from Inset: return value of Clone
8179 changed back to Inset *.
8181 * all classes inherited form MathInset: return value of Clone
8182 changed back to MathedInset *.
8184 * src/insets/figinset.C (runqueue): use a ofstream to output the
8185 gs/ps file. Might need some setpresicion or setw. However I can
8186 see no problem with the current code.
8187 (runqueue): use sleep instead of the alarm/signal code. I just
8188 can't see the difference.
8190 * src/paragraph.C (LyXParagraph): reserve space in the new
8191 paragraph and resize the inserted paragraph to just fit.
8193 * src/lyxfunc.h (operator|=): added operator for func_status.
8195 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8196 check for readable file.
8198 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8199 check for readable file.
8200 (MenuMakeLinuxDoc): ditto
8201 (MenuMakeDocBook): ditto
8202 (MenuMakeAscii): ditto
8203 (InsertAsciiFile): split the test for openable and readable
8205 * src/bmtable.C (draw_bitmaptable): use
8206 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8208 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8209 findtexfile from LaTeX to filetools.
8211 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8212 instead of FilePtr. Needs to be verified by a literate user.
8214 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8216 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8217 (EditMessage): likewise.
8219 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8220 respectively as \textasciitilde and \textasciicircum.
8222 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8224 * src/support/lyxstring.h: made the methods that take iterators
8227 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8228 (regexMatch): made is use the real regex class.
8230 * src/support/Makefile.am: changed to use libtool
8232 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8234 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8236 (MathIsInset ++): changed several macros to be inline functions
8239 * src/mathed/Makefile.am: changed to use libtool
8241 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8243 * src/insets/inset* : Clone changed to const and return type is
8244 the true insettype not just Inset*.
8246 * src/insets/Makefile.am: changed to use libtool
8248 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8250 * src/undo.[Ch] : added empty() and changed some of the method
8253 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8255 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8256 setID use block<> for the bullets array, added const several places.
8258 * src/lyxfunc.C (getStatus): new function
8260 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8261 LyXAction, added const to several funtions.
8263 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8264 a std::map, and to store the dir items in a vector.
8266 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8269 * src/LyXView.[Ch] + other files : changed currentView to view.
8271 * src/LyXAction.[Ch] : ported from the old devel branch.
8273 * src/.cvsignore: added .libs and a.out
8275 * configure.in : changes to use libtool.
8277 * acinclude.m4 : inserted libtool.m4
8279 * .cvsignore: added libtool
8281 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8283 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8284 file name in insets and mathed directories (otherwise the
8285 dependency is not taken in account under cygwin).
8287 * src/text2.C (InsertString[AB]): make sure that we do not try to
8288 read characters past the string length.
8290 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8292 * lib/doc/LaTeXConfig.lyx.in,
8293 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8295 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8296 file saying who created them and when this heppened; this is
8297 useless and annoys tools like cvs.
8299 * lib/layouts/g-brief-{en,de}.layout,
8300 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8301 from Thomas Hartkens <thomas@hartkens.de>.
8303 * src/{insets,mathed}/Makefile.am: do not declare an empty
8304 LDFLAGS, so that it can be set at configure time (useful on Irix
8307 * lib/reLyX/configure.in: make sure that the prefix is set
8308 correctly in LYX_DIR.
8310 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8312 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8313 be used by 'command-sequence' this allows to bind a key to a
8314 sequence of LyX-commands
8315 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8317 * src/LyXAction.C: add "command-sequence"
8319 * src/LyXFunction.C: handling of "command-sequence"
8321 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8322 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8324 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8326 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8328 * src/buffer.C (writeFile): Do not output a comment giving user
8329 and date at the beginning of a .lyx file. This is useless and
8330 annoys cvs anyway; update version number to 1.1.
8332 * src/Makefile.am (LYX_DIR): add this definition, so that a
8333 default path is hardcoded in LyX.
8335 * configure.in: Use LYX_GNU_GETTEXT.
8337 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8338 AM_GNU_GETTEXT with a bug fixed.
8340 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8342 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8344 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8345 which is used to point to LyX data is now LYX_DIR_11x.
8347 * lyx.man: convert to a unix text file; small updates.
8349 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8351 * src/support/LSubstring.[Ch]: made the second arg of most of the
8352 constructors be a const reference.
8354 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8357 * src/support/lyxstring.[Ch] (swap): added missing member function
8358 and specialization of swap(str, str);
8360 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8362 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8363 trace of the old one.
8365 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8366 put the member definitions in undo.C.
8368 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8369 NEW_TEXT and have now only code that was included when this was
8372 * src/intl.C (LCombo): use static_cast
8374 (DispatchCallback): ditto
8376 * src/definitions.h: removed whole file
8378 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8380 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8381 parsing and stores in a std:map. a regex defines the file format.
8382 removed unneeded members.
8384 * src/bufferparams.h: added several enums from definitions.h here.
8385 Removed unsused destructor. Changed some types to use proper enum
8386 types. use block to have the temp_bullets and user_defined_bullets
8387 and to make the whole class assignable.
8389 * src/bufferparams.C (Copy): removed this functions, use a default
8392 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8395 * src/buffer.C (readLyXformat2): commend out all that have with
8396 oldpapersize to do. also comment out all that hve to do with
8397 insetlatex and insetlatexdel.
8398 (setOldPaperStuff): commented out
8400 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8402 * src/LyXAction.C: remove use of inset-latex-insert
8404 * src/mathed/math_panel.C (button_cb): use static_cast
8406 * src/insets/Makefile.am (insets_o_SOURCES): removed
8409 * src/support/lyxstring.C (helper): use the unsigned long
8410 specifier, UL, instead of a static_cast.
8412 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8414 * src/support/block.h: new file. to be used as a c-style array in
8415 classes, so that the class can be assignable.
8417 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8419 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8420 NULL, make sure to return an empty string (it is not possible to
8421 set a string to NULL).
8423 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8425 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8427 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8429 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8430 link line, so that Irix users (for example) can set it explicitely to
8433 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8434 it can be overidden at make time (static or dynamic link, for
8437 * src/vc-backend.C, src/LaTeXFeatures.h,
8438 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8439 statements to bring templates to global namespace.
8441 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8443 * src/support/lyxstring.C (operator[] const): make it standard
8446 * src/minibuffer.C (Init): changed to reflect that more
8447 information is given from the lyxvc and need not be provided here.
8449 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8451 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8453 * src/LyXView.C (UpdateTimerCB): use static_cast
8454 (KeyPressMask_raw_callback): ditto
8456 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8457 buffer_, a lot of changes because of this. currentBuffer() ->
8458 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8459 also changes to other files because of this.
8461 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8463 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8464 have no support for RCS and partial support for CVS, will be
8467 * src/insets/ several files: changes because of function name
8468 changes in Bufferview and LyXView.
8470 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8472 * src/support/LSubstring.[Ch]: new files. These implement a
8473 Substring that can be very convenient to use. i.e. is this
8475 string a = "Mary had a little sheep";
8476 Substring(a, "sheep") = "lamb";
8477 a is now "Mary has a little lamb".
8479 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8480 out patterns and subpatterns of strings. It is used by LSubstring
8481 and also by vc-backend.C
8483 * src/support/lyxstring.C: went over all the assertions used and
8484 tried to correct the wrong ones and flag which of them is required
8485 by the standard. some bugs found because of this. Also removed a
8486 couple of assertions.
8488 * src/support/Makefile.am (libsupport_a_SOURCES): added
8489 LSubstring.[Ch] and LRegex.[Ch]
8491 * src/support/FileInfo.h: have struct stat buf as an object and
8492 not a pointer to one, some changes because of this.
8494 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8495 information in layout when adding the layouts preamble to the
8498 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8501 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8502 because of bug in OS/2.
8504 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8506 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8507 \verbatim@font instead of \ttfamily, so that it can be redefined.
8509 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8510 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8511 src/layout.h, src/text2.C: add 'using' directive to bring the
8512 STL templates we need from the std:: namespace to the global one.
8513 Needed by DEC cxx in strict ansi mode.
8515 * src/support/LIstream.h,src/support/LOstream.h,
8516 src/support/lyxstring.h,src/table.h,
8517 src/lyxlookup.h: do not include <config.h> in header
8518 files. This should be done in the .C files only.
8520 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8524 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8526 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8527 from Kayvan to fix the tth invokation.
8529 * development/lyx.spec.in: updates from Kayvan to reflect the
8530 changes of file names.
8532 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8534 * src/text2.C (InsertStringB): use std::copy
8535 (InsertStringA): use std::copy
8537 * src/bufferlist.C: use a vector to store the buffers in. This is
8538 an internal change and should not affect any other thing.
8540 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8543 * src/text.C (Fill): fix potential bug, one off bug.
8545 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8547 * src/Makefile.am (lyx_main.o): add more files it depends on.
8549 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8551 * src/support/lyxstring.C: use size_t for the reference count,
8552 size, reserved memory and xtra.
8553 (internal_compare): new private member function. Now the compare
8554 functions should work for std::strings that have embedded '\0'
8556 (compare): all compare functions rewritten to use
8559 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8561 * src/support/lyxstring.C (compare): pass c_str()
8562 (compare): pass c_str
8563 (compare): pass c_str
8565 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8567 * src/support/DebugStream.C: <config.h> was not included correctly.
8569 * lib/configure: forgot to re-generate it :( I'll make this file
8570 auto generated soon.
8572 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8574 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8577 * src/support/lyxstring.C: some changes from length() to rep->sz.
8578 avoids a function call.
8580 * src/support/filetools.C (SpaceLess): yet another version of the
8581 algorithm...now per Jean-Marc's suggestions.
8583 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8585 * src/layout.C (less_textclass_desc): functor for use in sorting
8587 (LyXTextClass::Read): sort the textclasses after reading.
8589 * src/support/filetools.C (SpaceLess): new version of the
8590 SpaceLess functions. What problems does this one give? Please
8593 * images/banner_bw.xbm: made the arrays unsigned char *
8595 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8597 * src/support/lyxstring.C (find): remove bogus assertion in the
8598 two versions of find where this has not been done yet.
8600 * src/support/lyxlib.h: add missing int return type to
8603 * src/menus.C (ShowFileMenu): disable exporting to html if no
8604 html export command is present.
8606 * config/lib_configure.m4: add a test for an HTML converter. The
8607 programs checked for are, in this order: tth, latex2html and
8610 * lib/configure: generated from config/lib_configure.m4.
8612 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8613 html converter. The parameters are now passed through $$FName and
8614 $$OutName, instead of standard input/output.
8616 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8618 * lib/lyxrc.example: update description of \html_command.
8619 add "quotes" around \screen_font_xxx font setting examples to help
8620 people who use fonts with spaces in their names.
8622 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8624 * Distribution files: updates for v1.1.2
8626 * src/support/lyxstring.C (find): remove bogus assert and return
8627 npos for the same condition.
8629 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8631 * added patch for OS/2 from SMiyata.
8633 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8635 * src/text2.C (CutSelection): make space_wrapped a bool
8636 (CutSelection): dont declare int i until we have to.
8637 (alphaCounter): return a char const *.
8639 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8641 * src/support/syscall.C (Systemcalls::kill):
8642 src/support/filetools.C (PutEnv, PutEnvPath):
8643 src/lyx_cb.C (addNewlineAndDepth):
8644 src/FontInfo.C (FontInfo::resize): condition some #warning
8645 directives with WITH_WARNINGS.
8648 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8650 * src/layout.[Ch] + several files: access to class variables
8651 limited and made accessor functions instead a lot of code changed
8652 becuase of this. Also instead of returning pointers often a const
8653 reference is returned instead.
8655 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8657 * src/Makefile.am (dist-hook): added used to remove the CVS from
8658 cheaders upon creating a dist
8659 (EXTRA_DIST): added cheaders
8661 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8662 a character not as a small integer.
8664 * src/support/lyxstring.C (find): removed Assert and added i >=
8665 rep->sz to the first if.
8667 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8669 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8670 src/LyXView.C src/buffer.C src/bufferparams.C
8671 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8672 src/text2.C src/insets/insetinclude.C:
8673 lyxlayout renamed to textclasslist.
8675 * src/layout.C: some lyxerr changes.
8677 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8678 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8679 (LyXLayoutList): removed all traces of this class.
8680 (LyXTextClass::Read): rewrote LT_STYLE
8681 (LyXTextClass::hasLayout): new function
8682 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8683 both const and nonconst version.
8684 (LyXTextClass::delete_layout): new function.
8685 (LyXTextClassList::Style): bug fix. do the right thing if layout
8687 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8688 (LyXTextClassList::NameOfLayout): ditto
8689 (LyXTextClassList::Load): ditto
8691 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8693 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8695 * src/LyXAction.C (LookupFunc): added a workaround for sun
8696 compiler, on the other hand...we don't know if the current code
8697 compiles on sun at all...
8699 * src/support/filetools.C (CleanupPath): subst fix
8701 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8704 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8705 complained about this one?
8707 * src/insets/insetinclude.C (Latex): subst fix
8709 * src/insets/insetbib.C (getKeys): subst fix
8711 * src/LyXSendto.C (SendtoApplyCB): subst fix
8713 * src/lyx_main.C (init): subst fix
8715 * src/layout.C (Read): subst fix
8717 * src/lyx_sendfax_main.C (button_send): subst fix
8719 * src/buffer.C (RoffAsciiTable): subst fix
8721 * src/lyx_cb.C (MenuFax): subst fix
8722 (PrintApplyCB): subst fix
8724 1999-10-26 Juergen Vigna <jug@sad.it>
8726 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8728 (Read): Cleaned up this code so now we read only format vestion >= 5
8730 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8732 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8733 come nobody has complained about this one?
8735 * src/insets/insetinclude.C (Latex): subst fix
8737 * src/insets/insetbib.C (getKeys): subst fix
8739 * src/lyx_main.C (init): subst fix
8741 * src/layout.C (Read): subst fix
8743 * src/buffer.C (RoffAsciiTable): subst fix
8745 * src/lyx_cb.C (MenuFax): subst fix.
8747 * src/layout.[hC] + some other files: rewrote to use
8748 std::container to store textclasses and layouts in.
8749 Simplified, removed a lot of code. Make all classes
8750 assignable. Further simplifications and review of type
8751 use still to be one.
8753 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8754 lastfiles to create the lastfiles partr of the menu.
8756 * src/lastfiles.[Ch]: rewritten to use deque to store the
8757 lastfiles in. Uses fstream for reading and writing. Simplifies
8760 * src/support/syscall.C: remove explicit cast.
8762 * src/BufferView.C (CursorToggleCB): removed code snippets that
8764 use explicat C++ style casts instead of C style casts. also use
8765 u_vdata instea of passing pointers in longs.
8767 * src/PaperLayout.C: removed code snippets that were commented out.
8769 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8771 * src/lyx_main.C: removed code snippets that wer commented out.
8773 * src/paragraph.C: removed code snippets that were commented out.
8775 * src/lyxvc.C (logClose): use static_cast
8777 (viewLog): remove explicit cast to void*
8778 (showLog): removed old commented code
8780 * src/menus.C: use static_cast instead of C style casts. use
8781 u_vdata instead of u_ldata. remove explicit cast to (long) for
8782 pointers. Removed old code that was commented out.
8784 * src/insets/inset.C: removed old commented func
8786 * src/insets/insetref.C (InsetRef): removed old code that had been
8787 commented out for a long time.
8789 (escape): removed C style cast
8791 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8793 * src/insets/insetlatex.C (Draw): removed old commented code
8794 (Read): rewritten to use string
8796 * src/insets/insetlabel.C (escape): removed C style cast
8798 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8800 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8803 * src/insets/insetinclude.h: removed a couple of stupid bools
8805 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8806 (Clone): remove C style cast
8807 (getKeys): changed list to lst because of std::list
8809 * src/insets/inseterror.C (Draw): removed som old commented code.
8811 * src/insets/insetcommand.C (Draw): removed some old commented code.
8813 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8814 commented out forever.
8815 (bibitem_cb): use static_cast instead of C style cast
8816 use of vdata changed to u_vdata.
8818 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8820 (CloseUrlCB): use static_cast instead of C style cast.
8821 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8823 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8824 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8825 (CloseInfoCB): static_cast from ob->u_vdata instead.
8826 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8829 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8830 (C_InsetError_CloseErrorCB): forward the ob parameter
8831 (CloseErrorCB): static_cast from ob->u_vdata instead.
8833 * src/vspace.h: include LString.h since we use string in this class.
8835 * src/vspace.C (lyx_advance): changed name from advance because of
8836 nameclash with stl. And since we cannot use namespaces yet...I
8837 used a lyx_ prefix instead. Expect this to change when we begin
8840 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8842 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8843 and removed now defunct constructor and deconstructor.
8845 * src/BufferView.h: have backstack as a object not as a pointer.
8846 removed initialization from constructor. added include for BackStack
8848 * development/lyx.spec.in (%build): add CFLAGS also.
8850 * src/screen.C (drawFrame): removed another warning.
8852 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8854 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8855 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8856 README and ANNOUNCE a bit for the next release. More work is
8859 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8860 unbreakable if we are in freespacing mode (LyX-Code), but not in
8863 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8865 * src/BackStack.h: fixed initialization order in constructor
8867 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8869 * acinclude.m4 (VERSION): new rules for when a version is
8870 development, added also a variable for prerelease.
8871 (warnings): we set with_warnings=yes for prereleases
8872 (lyx_opt): prereleases compile with same optimization as development
8873 (CXXFLAGS): only use pedantic if we are a development version
8875 * src/BufferView.C (restorePosition): don't do anything if the
8878 * src/BackStack.h: added member empty, use this to test if there
8879 is anything to pop...
8881 1999-10-25 Juergen Vigna <jug@sad.it>
8884 * forms/layout_forms.fd +
8885 * forms/latexoptions.fd +
8886 * lyx.fd: changed for various form resize issues
8888 * src/mathed/math_panel.C +
8889 * src/insets/inseterror.C +
8890 * src/insets/insetinfo.C +
8891 * src/insets/inseturl.C +
8892 * src/insets/inseturl.h +
8895 * src/PaperLayout.C +
8896 * src/ParagraphExtra.C +
8897 * src/TableLayout.C +
8899 * src/layout_forms.C +
8906 * src/menus.C: fixed various resize issues. So now forms can be
8907 resized savely or not be resized at all.
8909 * forms/form_url.fd +
8910 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8913 * src/insets/Makefile.am: added files form_url.[Ch]
8915 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8917 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8918 (and presumably 6.2).
8920 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8921 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8922 remaining static member callbacks.
8924 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8927 * src/support/lyxstring.h: declare struct Srep as friend of
8928 lyxstring, since DEC cxx complains otherwise.
8930 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8932 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8934 * src/LaTeX.C (run): made run_bibtex also depend on files with
8936 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8937 are put into the dependency file.
8939 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8940 the code has shown itself to work
8941 (create_ispell_pipe): removed another warning, added a comment
8944 * src/minibuffer.C (ExecutingCB): removed code that has been
8945 commented out a long time
8947 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8948 out code + a warning.
8950 * src/support/lyxstring.h: comment out the three private
8951 operators, when compiling with string ansi conforming compilers
8954 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8956 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8957 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8960 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8963 * src/mathed/math_panel.C (create_math_panel): remove explicit
8966 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8969 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8970 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8971 to XCreatePixmapFromBitmapData
8972 (fl_set_bmtable_data): change the last argument to be unsigned
8974 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8975 and bh to be unsigned int, remove explicit casts in call to
8976 XReadBitmapFileData.
8978 * images/arrows.xbm: made the arrays unsigned char *
8979 * images/varsz.xbm: ditto
8980 * images/misc.xbm: ditto
8981 * images/greek.xbm: ditto
8982 * images/dots.xbm: ditto
8983 * images/brel.xbm: ditto
8984 * images/bop.xbm: ditto
8986 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8988 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8989 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8990 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8992 (LYX_CXX_CHEADERS): added <clocale> to the test.
8994 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8996 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8998 * src/support/lyxstring.C (append): fixed something that must be a
8999 bug, rep->assign was used instead of rep->append.
9001 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9004 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9005 lyx insert double chars. Fix spotted by Kayvan.
9007 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9009 * Fixed the tth support. I messed up with the Emacs patch apply feature
9010 and omitted the changes in lyxrc.C.
9012 1999-10-22 Juergen Vigna <jug@sad.it>
9014 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9016 * src/lyx_cb.C (MenuInsertRef) +
9017 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9018 the form cannot be resized under it limits (fixes a segfault)
9020 * src/lyx.C (create_form_form_ref) +
9021 * forms/lyx.fd: Changed Gravity on name input field so that it is
9024 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9026 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9027 <ostream> and <istream>.
9029 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9030 whether <fstream> provides the latest standard features, or if we
9031 have an oldstyle library (like in egcs).
9032 (LYX_CXX_STL_STRING): fix the test.
9034 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9035 code on MODERN_STL_STREAM.
9037 * src/support/lyxstring.h: use L{I,O}stream.h.
9039 * src/support/L{I,O}stream.h: new files, designed to setup
9040 correctly streams for our use
9041 - includes the right header depending on STL capabilities
9042 - puts std::ostream and std::endl (for LOStream.h) or
9043 std::istream (LIStream.h) in toplevel namespace.
9045 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9047 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9048 was a bib file that had been changed we ensure that bibtex is run.
9049 (runBibTeX): enhanced to extract the names of the bib files and
9050 getting their absolute path and enter them into the dep file.
9051 (findtexfile): static func that is used to look for tex-files,
9052 checks for absolute patchs and tries also with kpsewhich.
9053 Alternative ways of finding the correct files are wanted. Will
9055 (do_popen): function that runs a command using popen and returns
9056 the whole output of that command in a string. Should be moved to
9059 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9060 file with extension ext has changed.
9062 * src/insets/figinset.C: added ifdef guards around the fl_free
9063 code that jug commented out. Now it is commented out when
9064 compiling with XForms == 0.89.
9066 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9067 to lyxstring.C, and only keep a forward declaration in
9068 lyxstring.h. Simplifies the header file a bit and should help a
9069 bit on compile time too. Also changes to Srep will not mandate a
9070 recompile of code just using string.
9071 (~lyxstring): definition moved here since it uses srep.
9072 (size): definition moved here since it uses srep.
9074 * src/support/lyxstring.h: removed a couple of "inline" that should
9077 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9079 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9082 1999-10-21 Juergen Vigna <jug@sad.it>
9084 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9085 set to left if I just remove the width entry (or it is empty).
9087 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9088 paragraph when having dummy paragraphs.
9090 1999-10-20 Juergen Vigna <jug@sad.it>
9092 * src/insets/figinset.C: just commented some fl_free_form calls
9093 and added warnings so that this calls should be activated later
9094 again. This avoids for now a segfault, but we have a memory leak!
9096 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9097 'const char * argument' to 'string argument', this should
9098 fix some Asserts() in lyxstring.C.
9100 * src/lyxfunc.h: Removed the function argAsString(const char *)
9101 as it is not used anymore.
9103 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9105 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9108 * src/Literate.h: some funcs moved from public to private to make
9109 interface clearer. Unneeded args removed.
9111 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9113 (scanBuildLogFile): ditto
9115 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9116 normal TeX Error. Still room for improvement.
9118 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9120 * src/buffer.C (insertErrors): changes to make the error
9121 desctription show properly.
9123 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9126 * src/support/lyxstring.C (helper): changed to use
9127 sizeof(object->rep->ref).
9128 (operator>>): changed to use a pointer instead.
9130 * src/support/lyxstring.h: changed const reference & to value_type
9131 const & lets see if that helps.
9133 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9135 * Makefile.am (rpmdist): fixed to have non static package and
9138 * src/support/lyxstring.C: removed the compilation guards
9140 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9143 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9144 conditional compile of lyxstring.Ch
9146 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9147 stupid check, but it is a lot better than the bastring hack.
9148 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9150 * several files: changed string::erase into string::clear. Not
9153 * src/chset.C (encodeString): use a char temporary instead
9155 * src/table.C (TexEndOfCell): added tostr around
9156 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9157 (TexEndOfCell): ditto
9158 (TexEndOfCell): ditto
9159 (TexEndOfCell): ditto
9160 (DocBookEndOfCell): ditto
9161 (DocBookEndOfCell): ditto
9162 (DocBookEndOfCell): ditto
9163 (DocBookEndOfCell): ditto
9165 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9167 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9169 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9170 (MenuBuildProg): added tostr around ret
9171 (MenuRunChktex): added tostr around ret
9172 (DocumentApplyCB): added tostr around ret
9174 * src/chset.C (encodeString): added tostr around t->ic
9176 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9177 (makeLaTeXFile): added tostr around tocdepth
9178 (makeLaTeXFile): added tostr around ftcound - 1
9180 * src/insets/insetbib.C (setCounter): added tostr around counter.
9182 * src/support/lyxstring.h: added an operator+=(int) to catch more
9185 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9186 (lyxstring): We DON'T allow NULL pointers.
9188 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9190 * src/mathed/math_macro.C (MathMacroArgument::Write,
9191 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9192 when writing them out.
9194 * src/LString.C: remove, since it is not used anymore.
9196 * src/support/lyxstring.C: condition the content to
9197 USE_INCLUDED_STRING macro.
9199 * src/mathed/math_symbols.C, src/support/lstrings.C,
9200 src/support/lyxstring.C: add `using' directive to specify what
9201 we need in <algorithm>. I do not think that we need to
9202 conditionalize this, but any thought is appreciated.
9204 * many files: change all callback functions to "C" linkage
9205 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9206 strict_ansi. Those who were static are now global.
9207 The case of callbacks which are static class members is
9208 trickier, since we have to make C wrappers around them (see
9209 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9210 did not finish this yet, since it defeats the purpose of
9211 encapsulation, and I am not sure what the best route is.
9213 1999-10-19 Juergen Vigna <jug@sad.it>
9215 * src/support/lyxstring.C (lyxstring): we permit to have a null
9216 pointer as assignment value and just don't assign it.
9218 * src/vspace.C (nextToken): corrected this function substituting
9219 find_first(_not)_of with find_last_of.
9221 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9222 (TableOptCloseCB) (TableSpeCloseCB):
9223 inserted fl_set_focus call for problem with fl_hide_form() in
9226 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9228 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9231 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9233 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9234 LyXLex::next() and not eatline() to get its argument.
9236 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9238 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9239 instead, use fstreams for io of the depfile, removed unneeded
9240 functions and variables.
9242 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9243 vector instead, removed all functions and variables that is not in
9246 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9248 * src/buffer.C (insertErrors): use new interface to TeXError
9250 * Makefile.am (rpmdist): added a rpmdist target
9252 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9253 per Kayvan's instructions.
9255 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9257 * src/Makefile.am: add a definition for localedir, so that locales
9258 are found after installation (Kayvan)
9260 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9262 * development/.cvsignore: new file.
9264 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9266 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9267 C++ compiler provides wrappers for C headers and use our alternate
9270 * configure.in: use LYX_CXX_CHEADERS.
9272 * src/cheader/: new directory, populated with cname headers from
9273 libstdc++-2.8.1. They are a bit old, but probably good enough for
9274 what we want (support compilers who lack them).
9276 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9277 from includes. It turns out is was stupid.
9279 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9281 * lib/Makefile.am (install-data-local): forgot a ';'
9282 (install-data-local): forgot a '\'
9283 (libinstalldirs): needed after all. reintroduced.
9285 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9287 * configure.in (AC_OUTPUT): added lyx.spec
9289 * development/lyx.spec: removed file
9291 * development/lyx.spec.in: new file
9293 * po/*.po: merged with lyx.pot becuase of make distcheck
9295 * lib/Makefile.am (dist-hook): added dist-hook so that
9296 documentation files will be included when doing a make
9297 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9298 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9300 more: tried to make install do the right thing, exclude CVS dirs
9303 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9304 Path would fit in more nicely.
9306 * all files that used to use pathstack: uses now Path instead.
9307 This change was a lot easier than expected.
9309 * src/support/path.h: new file
9311 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9313 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9315 * src/support/lyxstring.C (getline): Default arg was given for
9318 * Configure.cmd: removed file
9320 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9322 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9323 streams classes and types, add the proper 'using' statements when
9324 MODERN_STL is defined.
9326 * src/debug.h: move the << operator definition after the inclusion
9329 * src/support/filetools.C: include "LAssert.h", which is needed
9332 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9335 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9336 include "debug.h" to define a proper ostream.
9338 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9340 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9341 method to the SystemCall class which can kill a process, but it's
9342 not fully implemented yet.
9344 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9346 * src/support/FileInfo.h: Better documentation
9348 * src/lyxfunc.C: Added support for buffer-export html
9350 * src/menus.C: Added Export->As HTML...
9352 * lib/bind/*.bind: Added short-cut for buffer-export html
9354 * src/lyxrc.*: Added support for new \tth_command
9356 * lib/lyxrc.example: Added stuff for new \tth_command
9358 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9360 * lib/Makefile.am (IMAGES): removed images/README
9361 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9362 installes in correct place. Check permisions is installed
9365 * src/LaTeX.C: some no-op changes moved declaration of some
9368 * src/LaTeX.h (LATEX_H): changed include guard name
9370 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9372 * lib/reLyX/Makefile.am: install noweb2lyx.
9374 * lib/Makefile.am: install configure.
9376 * lib/reLyX/configure.in: declare a config aux dir; set package
9377 name to lyx (not sure what the best solution is); generate noweb2lyx.
9379 * lib/layouts/egs.layout: fix the bibliography layout.
9381 1999-10-08 Jürgen Vigna <jug@sad.it>
9383 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9384 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9385 it returned without continuing to search the path.
9387 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9389 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9390 also fixes a bug. It is not allowed to do tricks with std::strings
9391 like: string a("hei"); &a[e]; this will not give what you
9392 think... Any reason for the complexity in this func?
9394 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9396 * Updated README and INSTALL a bit, mostly to check that my
9397 CVS rights are correctly set up.
9399 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9401 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9402 does not allow '\0' chars but lyxstring and std::string does.
9404 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9406 * autogen.sh (AUTOCONF): let the autogen script create the
9407 POTFILES.in file too. POTFILES.in should perhaps now not be
9408 included in the cvs module.
9410 * some more files changed to use C++ includes instead of C ones.
9412 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9414 (Reread): added tostr to nlink. buggy output otherwise.
9415 (Reread): added a string() around szMode when assigning to Buffer,
9416 without this I got a log of garbled info strings.
9418 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9421 * I have added several ostream & operator<<(ostream &, some_type)
9422 functions. This has been done to avoid casting and warnings when
9423 outputting enums to lyxerr. This as thus eliminated a lot of
9424 explicit casts and has made the code clearer. Among the enums
9425 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9426 mathed enums, some font enum the Debug::type enum.
9428 * src/support/lyxstring.h (clear): missing method. equivalent of
9431 * all files that contained "stderr": rewrote constructs that used
9432 stderr to use lyxerr instead. (except bmtable)
9434 * src/support/DebugStream.h (level): and the passed t with
9435 Debug::ANY to avoid spurious bits set.
9437 * src/debug.h (Debug::type value): made it accept strings of the
9440 * configure.in (Check for programs): Added a check for kpsewhich,
9441 the latex generation will use this later to better the dicovery of
9444 * src/BufferView.C (create_view): we don't need to cast this to
9445 (void*) that is done automatically.
9446 (WorkAreaButtonPress): removed some dead code.
9448 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9450 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9451 is not overwritten when translated (David Sua'rez de Lis).
9453 * lib/CREDITS: Added David Sua'rez de Lis
9455 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9457 * src/bufferparams.C (BufferParams): default input encoding is now
9460 * acinclude.m4 (cross_compiling): comment out macro
9461 LYX_GXX_STRENGTH_REDUCE.
9463 * acconfig.h: make sure that const is not defined (to empty) when
9464 we are compiling C++. Remove commented out code using SIZEOF_xx
9467 * configure.in : move the test for const and inline as late as
9468 possible so that these C tests do not interefere with C++ ones.
9469 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9470 has not been proven.
9472 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9474 * src/table.C (getDocBookAlign): remove bad default value for
9477 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9479 (ShowFileMenu2): ditto.
9481 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9484 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9486 * Most files: finished the change from the old error code to use
9487 DebugStream for all lyxerr debugging. Only minor changes remain
9488 (e.g. the setting of debug levels using strings instead of number)
9490 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9492 * src/layout.C (Add): Changed to use compare_no_case instead of
9495 * src/FontInfo.C: changed loop variable type too string::size_type.
9497 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9499 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9500 set ETAGS_ARGS to --c++
9502 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9504 * src/table.C (DocBookEndOfCell): commented out two unused variables
9506 * src/paragraph.C: commented out four unused variables.
9508 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9509 insed a if clause with type string::size_type.
9511 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9514 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9516 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9517 variable, also changed loop to go from 0 to lenght + 1, instead of
9518 -1 to length. This should be correct.
9520 * src/LaTeX.C (scanError): use string::size_type as loop variable
9523 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9524 (l.896) since y_tmp and row was not used anyway.
9526 * src/insets/insetref.C (escape): use string::size_type as loop
9529 * src/insets/insetquotes.C (Width): use string::size_type as loop
9531 (Draw): use string::size_type as loop variable type.
9533 * src/insets/insetlatexaccent.C (checkContents): use
9534 string::size_type as loop variable type.
9536 * src/insets/insetlabel.C (escape): use string::size_type as loop
9539 * src/insets/insetinfo.C: added an extern for current_view.
9541 * src/insets/insetcommand.C (scanCommand): use string::size_type
9542 as loop variable type.
9544 * most files: removed the RCS tags. With them we had to recompile
9545 a lot of files after a simple cvs commit. Also we have never used
9546 them for anything meaningful.
9548 * most files: tags-query-replace NULL 0. As adviced several plases
9549 we now use "0" instead of "NULL" in our code.
9551 * src/support/filetools.C (SpaceLess): use string::size_type as
9554 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9556 * src/paragraph.C: fixed up some more string stuff.
9558 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9560 * src/support/filetools.h: make modestr a std::string.
9562 * src/filetools.C (GetEnv): made ch really const.
9564 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9565 made code that used these use max/min from <algorithm> instead.
9567 * changed several c library include files to their equivalent c++
9568 library include files. All is not changed yet.
9570 * created a support subdir in src, put lyxstring and lstrings
9571 there + the extra files atexit, fileblock, strerror. Created
9572 Makefile.am. edited configure.in and src/Makefile.am to use this
9573 new subdir. More files moved to support.
9575 * imported som of the functions from repository lyx, filetools
9577 * ran tags-query-replace on LString -> string, corrected the bogus
9578 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9579 is still some errors in there. This is errors where too much or
9580 too litle get deleted from strings (string::erase, string::substr,
9581 string::replace), there can also be some off by one errors, or
9582 just plain wrong use of functions from lstrings. Viewing of quotes
9585 * LyX is now running fairly well with string, but there are
9586 certainly some bugs yet (see above) also string is quite different
9587 from LString among others in that it does not allow null pointers
9588 passed in and will abort if it gets any.
9590 * Added the revtex4 files I forgot when setting up the repository.
9592 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9594 * All over: Tried to clean everything up so that only the files
9595 that we really need are included in the cvs repository.
9596 * Switched to use automake.
9597 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9598 * Install has not been checked.
9600 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9602 * po/pt.po: Three errors:
9603 l.533 and l.538 format specification error
9604 l. 402 duplicate entry, I just deleted it.