1 2000-10-28 Juergen Vigna <jug@sad.it>
3 * src/insets/insettabular.C (draw): fixed drawing bug.
5 * src/insets/insettext.C (clear):
7 (SetParagraphData): clearing the TEXT buffers when deleting the
10 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
12 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
14 2000-10-27 Juergen Vigna <jug@sad.it>
16 * src/tabular.C (~LyXTabular): removed not needed anymore.
18 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
21 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
23 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
26 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
29 * src/frontends/xforms/FormPreferences.[Ch]:
30 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
31 Reorganised as modules based on tabs. Much easier to follow the
32 flow and to add new tabs. Added warning and feedback messages.
35 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
37 * src/tabular.h (DocBook): add std:: qualifier.
39 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
41 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
42 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
45 * insettabular.C (DocBook): uses the tabular methods to export
48 * src/insets/insettext.h
49 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
51 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
53 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
56 * src/lyxfunc.C (MenuNew): lessen the scope of fname
57 moved misplaced AllowInput two lines up.
59 * src/buffer.C (readFile): compare float with float, not with int
61 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
63 * src/minibuffer.C: add "using SigC::slot" statement.
65 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
67 * src/frontends/xforms/forms/README: updated section about make.
69 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
70 Tidied some forms up, made two of form_tabular's tabs more
71 self-consistent, fixed Jean-Marc's size problem in form_preferences,
72 fixed translation problem with "Column".
74 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
76 * src/minibuffer.h: use Timeout instead of the xforms timer
78 (setTimer) rewrite for the Timeout, change to unsigned arg
79 (set): change to unsigned timer arg
82 * src/minibuffer.C (TimerCB): removed func
83 (C_MiniBuffer_TimerCB): removed func
84 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
85 (peek_event): use a switch statement
86 (add): don't use fl_add_timer.
87 (Set): rewrite to use the Timeout
90 * src/Timeout.[Ch] (setType): return a Timeout &
91 (setTimeout): ditto, change to unsigned arg for timeout
93 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
95 * src/mathed/formula.C (mathed_string_width): Use string instead
96 of a constant size char array.
98 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
100 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
101 the two recently added operator<< for SMInput and State.
103 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
105 (OkCancelPolicy): ditto
106 (OkCancelReadOnlyPolicy): ditto
107 (NoRepeatedApplyReadOnlyPolicy): ditto
108 (OkApplyCancelReadOnlyPolicy): ditto
109 (OkApplyCancelPolicy): ditto
110 (NoRepeatedApplyPolicy): ditto
112 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
114 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
115 add the usual std:: qualifiers.
117 2000-10-25 Juergen Vigna <jug@sad.it>
119 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
121 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
123 * src/support/filetools.C (MakeRelPath): change some types to
126 * src/frontends/ButtonPolicies.h (operator<<): new operator for
127 ButtonPolicy::SMInput and ButtonPolicy::State.
129 * src/FontLoader.C (reset): small cleanup
130 (unload): small cleanup
132 * src/FontInfo.C (getFontname): initialize error to 10000.0
134 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
136 * src/frontends/xforms/FormPreferences.[Ch]:
137 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
138 TeX encoding and default paper size sections.
140 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
142 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
145 * src/frontends/xforms/FormError.C (disconnect): use erase() to
146 make the message_ empty.
147 (FormError): don't initialize message_ in initializer list.
149 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
151 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
153 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
155 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
157 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
159 * src/frontends/kde/*data.[Ch]: _("") is not
162 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
164 * src/buffer.C: removed redundant using directive.
166 * src/frontends/DialogBase.h: revert to original definition of
169 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
170 stuff into two classes, one for each dialog, requires a new
171 element in the dialogs vector, FormTabularCreate.
173 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
176 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
177 method. Continues Allan's idea, but means that derived classes
178 don't need to worry about "update or hide?".
180 * src/frontends/xforms/FormError.C (showInset): add connection
183 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
184 one for each dialog. FormTabular now contains main tabular dialog
187 * src/frontends/xforms/FormTabularCreate.[Ch]:
188 * src/frontends/xforms/forms/form_tabular_create.fd: the create
191 * src/frontends/xforms/FormGraphics.[Ch]:
192 * src/frontends/xforms/forms/form_graphics.fd
193 * src/frontends/xforms/FormTabular.[Ch]:
194 * src/frontends/xforms/forms/form_tabular.fd: made daughter
195 classes of FormInset.
197 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
198 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
200 * src/frontends/xforms/Makefile.am:
201 * src/frontends/xforms/forms/makefile: added new files.
203 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
204 variable. added Signal0 hide signal, in keeping with other GUI-I
207 * src/support/lstrings.h: removed redundant std:: qualifier as
208 it's already declared in Lsstream.h.
210 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
212 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
216 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
218 * src/tabular.C (Ascii): minimize scope of cell.
220 * src/BufferView2.C (nextWord): return string() instead of 0;
222 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
224 * src/converter.h: add a std:: qualifier
226 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
228 * src/importer.[Ch]: New files. Used for importing files into LyX.
230 * src/lyxfunc.C (doImport): Use the new Importer class.
232 * src/converter.h: Add shortcut member to the Format class.
233 Used for holding the menu shortcut.
235 * src/converter.C and other files: Made a distinction between
236 format name and format extension. New formats can be defined using
237 the \format lyxrc tag.
238 Added two new converter flags: latex and disable.
240 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
242 * src/support/lyxlib.h: unify namespace/struct implementation.
243 Remove extra declarations.
245 * src/support/chdir.C (chdir): remove version taking char const *
247 * src/support/rename.C: ditto.
248 * src/support/lyxsum.C: ditto.
250 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
252 * src/frontends/xforms/FormBase.[Ch]:
253 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
254 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
255 work only for the next call to fl_show_form(). The correct place to set
256 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
257 done. FormBase also stores minw_, minh_ itself. All dialogs derived
258 from FormBase have the minimum size set; no more stupid crashes with
261 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
263 * lib/ui/default.ui: fix shortcut for Insert->Include File.
265 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
267 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
269 * src/support/lyxlib.h: changed second argument of mkdir to
270 unsigned long int (unsigned int would probably have been enough,
271 but...). Removed <sys/types.h> header.
272 * src/support/mkdir.C (mkdir): ditto.
276 2000-10-19 Juergen Vigna <jug@sad.it>
278 * src/lyxfunc.C (MenuNew): small fix (form John)
280 * src/screen.C (Update): removed unneeded code.
282 * src/tabular.C (Ascii): refixed int != uint bug!
284 * src/support/lyxlib.h: added sys/types.h include for now permits
285 compiling, but I don't like this!
287 2000-10-18 Juergen Vigna <jug@sad.it>
289 * src/text2.C (ClearSelection): if we clear the selection we need
290 more refresh so set the status apropriately
292 * src/insets/insettext.C (draw): hopefully finally fixed draw
295 2000-10-12 Juergen Vigna <jug@sad.it>
297 * src/insets/insettext.C (draw): another small fix and make a block
298 so that variables are localized.
300 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
302 * src/support/lstrings.C (lowercase, uppercase):
303 use explicit casts to remove compiler warnings.
305 * src/support/LRegex.C (Impl):
306 * src/support/StrPool.C (add):
307 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
308 (AddPath, MakeDisplayPath):
309 * src/support/lstrings.C (prefixIs, subst):
310 use correct type to remove compiler warnings.
312 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
314 * src/support/lyxlib.h:
315 * src/support/mkdir.C (mkdir): change parameter to mode_t for
316 portability and to remove compiler warning with DEC cxx.
318 * src/support/FileInfo.[Ch] (flagRWX): ditto.
320 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
322 * src/minibuffer.C (peek_event): retun 1 when there has been a
323 mouseclick in the minibuffer.
327 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
329 * src/frontends/xforms/FormParagraph.C: more space above/below
332 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
334 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
335 a char only if real_current_font was changed.
337 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
339 * NEWS: update somewhat for 1.1.6
341 * lib/ui/default.ui: clean up.
343 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
345 * lib/CREDITS: clean up
347 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
349 * src/combox.[Ch] (select): changed argument back to int
350 * src/combox.C (peek_event): removed num_bytes as it is declared but
353 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
354 modified calls to Combox::select() to remove warnings about type
357 * src/insets/insetbutton.C (width): explicit cast to remove warning
358 about type conversion.
360 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
363 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
364 sel_pos_end, refering to cursor position are changed to
365 LyXParagraph::size_type.
367 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
368 consistent with LyXCursor::pos().
369 (inset_pos): changed to LyXParagraph::size_type for same reason.
371 * src/insets/insettext.C (resizeLyXText): changed some temporary
372 variables refing to cursor position to LyXParagraph::size_type.
374 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
376 * src/frontends/kde/<various>: The Great Renaming,
379 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
381 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
383 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
385 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
386 0 when there are no arguments.
388 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
390 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
391 to segfaults when pressing Ok in InsetBibtex dialog.
393 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
395 * forms/layout_forms.fd:
396 * src/layout_forms.C (create_form_form_character): small change to use
397 labelframe rather than engraved frame + text
399 * src/lyx_gui.C (create_forms): initialise choice_language with some
400 arbitrary value to prevent segfault when dialog is shown.
402 2000-10-16 Baruch Even <baruch.even@writeme.com>
404 * src/converter.C (runLaTeX, scanLog): Added a warning when there
405 is no resulting file. This pertains only to LaTeX output.
407 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
409 * src/text.C (Backspace): Make sure that the row of the cursor is
412 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
415 * src/lyx_gui.C (init): Prevent a crash when only one font from
416 menu/popup fonts is not found.
418 * lib/lyxrc.example: Add an example for binding a key for language
421 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
423 * src/converter.C (GetReachable): Changed the returned type to
425 (IsReachable): New method
427 * src/MenuBackend.C (expand): Handle formats that appear more
430 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
432 * src/frontends/support/Makefile.am
433 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
436 * lib/CREDITS: add Garst Reese.
438 * src/support/snprintf.h: add extern "C" {} around the definitions.
440 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
442 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
445 * src/frontends/xforms/FormDocument.C:
446 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
447 compile without "conversion to integral type of smaller size"
450 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
452 * src/text.C (GetColumnNearX): Fixed disabled code.
454 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
456 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
459 * src/support/snprintf.[ch]: new files
461 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
463 * src/frontends/kde/formprintdialog.C: add
464 file browser for selecting postscript output
466 * src/frontends/kde/formprintdialogdata.C:
467 * src/frontends/kde/formprintdialogdata.h: re-generate
470 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
472 * src/frontends/gnome/Makefile.am:
473 * src/frontends/kde/Makefile.am: FormCommand.C
474 disappeared from xforms
476 * src/frontends/kde/FormCitation.C:
477 * src/frontends/kde/FormIndex.C: read-only
480 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
482 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
485 * src/bufferlist.C: add using directive.
487 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
489 * src/support/lyxfunctional.h: version of class_fun for void
490 returns added, const versions of back_inseter_fun and compare_fun
493 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
495 * src/frontends/xforms/FormInset.C (showInset): fix typo.
497 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
499 * ChangeLog: cleanup.
501 * lib/CREDITS: update to add all the contributors we've forgotten.
502 I have obviously missed some, so tell me whether there were
505 2000-10-13 Marko Vendelin <markov@ioc.ee>
507 * src/frontends/gnome/FormCitation.C
508 * src/frontends/gnome/FormCitation.h
509 * src/frontends/gnome/FormError.C
510 * src/frontends/gnome/FormIndex.C
511 * src/frontends/gnome/FormRef.C
512 * src/frontends/gnome/FormRef.h
513 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
515 * src/frontends/gnome/FormCitation.C
516 * src/frontends/gnome/FormCopyright.C
517 * src/frontends/gnome/FormError.C
518 * src/frontends/gnome/FormIndex.C
519 * src/frontends/gnome/FormRef.C
520 * src/frontends/gnome/FormToc.C
521 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
524 * src/frontends/gnome/Menubar_pimpl.C
525 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
528 2000-10-11 Baruch Even <baruch.even@writeme.com>
531 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
532 to convey its real action.
534 * src/minibuffer.C (peek_event): Added action when mouse clicks to
535 clear the minibuffer and prepare to enter a command.
537 * src/mathed/formula.C (LocalDispatch): Changed to conform with
538 the rename from ExecCommand to PrepareForCommand.
539 * src/lyxfunc.C (Dispatch): ditto.
541 2000-10-11 Baruch Even <baruch.even@writeme.com>
543 * src/buffer.C (writeFile): Added test for errors on writing, this
544 catches all errors and not only file system full errors as intended.
546 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
548 * src/lyx_gui.C (create_forms): better fix for crash with
549 translated interface.
551 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
553 * src/frontends/kde/Makefile.am:
554 * src/frontends/kde/FormCopyright.C:
555 * src/frontends/kde/formcopyrightdialog.C:
556 * src/frontends/kde/formcopyrightdialog.h:
557 * src/frontends/kde/formcopyrightdialogdata.C:
558 * src/frontends/kde/formcopyrightdialogdata.h:
559 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
560 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
561 copyright to use qtarch
563 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
565 * src/encoding.C (read): Fixed bug that caused an error message at
568 * po/Makefile.in.in: Fixed rule for ext_l10n.h
570 * lib/lyxrc.example: Fixed hebrew example.
572 2000-10-13 Allan Rae <rae@lyx.org>
574 * src/frontends/xforms/FormPreferences.C (input): reworking the
576 (build, update, apply): New inputs in various tabfolders
578 * src/frontends/xforms/FormToc.C: use new button policy.
579 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
580 dialogs that either can't use any existing policy or where it just
583 * src/frontends/xforms/FormTabular.h: removed copyright notice that
586 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
587 added a bool parameter which is ignored.
589 * src/buffer.C (setReadonly):
590 * src/BufferView_pimpl.C (buffer):
591 * src/frontends/kde/FormCopyright.h (update):
592 * src/frontends/kde/FormCitation.[Ch] (update):
593 * src/frontends/kde/FormIndex.[Ch] (update):
594 * src/frontends/kde/FormPrint.[Ch] (update):
595 * src/frontends/kde/FormRef.[Ch] (update):
596 * src/frontends/kde/FormToc.[Ch] (update):
597 * src/frontends/kde/FormUrl.[Ch] (update):
598 * src/frontends/gnome/FormCopyright.h (update):
599 * src/frontends/gnome/FormCitation.[Ch] (update):
600 * src/frontends/gnome/FormError.[Ch] (update):
601 * src/frontends/gnome/FormIndex.[Ch] (update):
602 * src/frontends/gnome/FormPrint.[Ch] (update):
603 * src/frontends/gnome/FormRef.h (update):
604 * src/frontends/gnome/FormToc.[Ch] (update):
605 * src/frontends/gnome/FormUrl.[Ch] (update):
606 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
607 to updateBufferDependent and DialogBase
609 * src/frontends/xforms/FormCitation.[hC]:
610 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
611 * src/frontends/xforms/FormError.[Ch]:
612 * src/frontends/xforms/FormGraphics.[Ch]:
613 * src/frontends/xforms/FormIndex.[Ch]:
614 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
615 and fixed readOnly handling.
616 * src/frontends/xforms/FormPrint.[Ch]:
617 * src/frontends/xforms/FormRef.[Ch]:
618 * src/frontends/xforms/FormTabular.[Ch]:
619 * src/frontends/xforms/FormToc.[Ch]:
620 * src/frontends/xforms/FormUrl.[Ch]:
621 * src/frontends/xforms/FormInset.[Ch]:
622 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
623 form of updateBufferDependent.
625 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
626 if form()->visible just in case someone does stuff to the form in a
629 * src/frontends/DialogBase.h (enum): removed enum since we can now use
630 the buttoncontroller for everything the enum used to be used for.
631 (update) It would seem we need to force all dialogs to use a bool
632 parameter or have two update functions. I chose to go with one.
633 I did try removing update() from here and FormBase and defining the
634 appropriate update signatures in FormBaseB[DI] but then ran into the
635 problem of the update() call in FormBase::show(). Whatever I did
636 to get around that would require another function and that just
637 got more confusing. Hence the decision to make everyone have an
638 update(bool). An alternative might have been to override show() in
639 FormBaseB[DI] and that would allow the different and appropriate
642 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
643 true == buffer change occurred. I decided against using a default
644 template parameter since not all compilers support that at present.
646 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
648 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
649 army knife" by removing functionality.
650 (clearStore): removed. All such housekeeping on hide()ing the dialog
651 is to be carried out by overloaded disconnect() methods.
652 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
653 superceded by Baruch's neat test (FormGraphics) to update an existing
654 dialog if a new signal is recieved rather than block all new signals
656 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
657 only to Inset dialogs.
658 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
659 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
661 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
663 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
664 as a base class to all inset dialogs. Used solely to connect/disconnect
665 the Inset::hide signal and to define what action to take on receipt of
666 a UpdateBufferDependent signal.
667 (FormCommand): now derived from FormInset.
669 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
672 * src/frontends/xforms/FormCopyright.[Ch]:
673 * src/frontends/xforms/FormPreferences.[Ch]:
674 now derived from FormBaseBI.
676 * src/frontends/xforms/FormDocument.[Ch]:
677 * src/frontends/xforms/FormParagraph.[Ch]:
678 * src/frontends/xforms/FormPrint.[Ch]:
679 now derived from FormBaseBD.
681 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
683 * src/frontends/xforms/FormCitation.[Ch]:
684 * src/frontends/xforms/FormError.[Ch]:
685 * src/frontends/xforms/FormRef.[Ch]:
686 * src/frontends/xforms/FormToc.[Ch]:
687 (clearStore): reworked as disconnect().
689 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
692 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
694 * src/converter.C (runLaTeX): constify buffer argument
697 * src/frontends/support/Makefile.am (INCLUDES): fix.
699 * src/buffer.h: add std:: qualifier
700 * src/insets/figinset.C (addpidwait): ditto
701 * src/MenuBackend.C: ditto
702 * src/buffer.C: ditto
703 * src/bufferlist.C: ditto
704 * src/layout.C: ditto
705 * src/lyxfunc.C: ditto
707 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
709 * src/lyxtext.h (bidi_level): change return type to
710 LyXParagraph::size_type.
712 * src/lyxparagraph.h: change size_type to
713 TextContainer::difference_type. This should really be
714 TextContainer::size_type, but we need currently to support signed
717 2000-10-11 Marko Vendelin <markov@ioc.ee>
718 * src/frontends/gnome/FormError.h
719 * src/frontends/gnome/FormRef.C
720 * src/frontends/gnome/FormRef.h
721 * src/frontends/gnome/FormError.C
722 * src/frontends/gnome/Makefile.am
723 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
724 to Gnome frontend. Both dialogs use "action" area.
726 2000-10-12 Baruch Even <baruch.even@writeme.com>
728 * src/graphics/GraphicsCacheItem_pimpl.C:
729 * src/graphics/Renderer.C:
730 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
733 2000-10-12 Juergen Vigna <jug@sad.it>
735 * src/insets/insettext.C (draw): fixed drawing bug (specifically
736 visible when selecting).
738 * development/Code_rules/Rules: fixed some typos.
740 2000-10-09 Baruch Even <baruch.even@writeme.com>
742 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
743 compiling on egcs 1.1.2 possible.
745 * src/filedlg.C (comp_direntry::operator() ): ditto.
747 2000-08-31 Baruch Even <baruch.even@writeme.com>
749 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
752 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
753 transient it now only gets freed when the object is destructed.
755 2000-08-24 Baruch Even <baruch.even@writeme.com>
757 * src/frontends/FormGraphics.h:
758 * src/frontends/FormGraphics.C: Changed to use ButtonController and
761 2000-08-20 Baruch Even <baruch.even@writeme.com>
763 * src/insets/insetgraphics.C:
764 (draw): Added messages to the drawn rectangle to report status.
765 (updateInset): Disabled the use of the inline graphics,
768 2000-08-17 Baruch Even <baruch.even@writeme.com>
770 * src/frontends/support: Directory added for the support of GUII LyX.
772 * src/frontends/support/LyXImage.h:
773 * src/frontends/support/LyXImage.C: Base class for GUII holding of
776 * src/frontends/support/LyXImage_X.h:
777 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
778 version of LyXImage, this uses the Xlib Pixmap.
783 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
784 replacement to Pixmap.
786 * src/insets/insetgraphics.h:
787 * src/insets/insetgraphics.C:
788 * src/graphics/GraphicsCacheItem.h:
789 * src/graphics/GraphicsCacheItem.C:
790 * src/graphics/GraphicsCacheItem_pimpl.h:
791 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
794 * src/graphics/GraphicsCacheItem.h:
795 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
796 another copy of the object.
798 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
799 of cacheHandle, this fixed a bug that sent LyX crashing.
801 * src/graphics/XPM_Renderer.h:
802 * src/graphics/XPM_Renderer.C:
803 * src/graphics/EPS_Renderer.h:
804 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
806 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
808 * src/lyxfunc.C (processKeySym): only handle the
809 lockinginset/inset stuff if we have a buffer and text loaded...
811 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
813 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
815 * src/support/lyxfunctional.h: add operator= that takes a reference
817 * src/lyxserver.C (mkfifo): make first arg const
819 * src/layout.h: renamed name(...) to setName(...) to work around
822 * src/buffer.C (setFileName): had to change name of function to
823 work around bugs in egcs. (renamed from fileName)
825 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
827 * src/support/translator.h: move helper template classes to
828 lyxfunctional.h, include "support/lyxfunctional.h"
830 * src/support/lyxmanip.h: add delaration of fmt
832 * src/support/lyxfunctional.h: new file
833 (class_fun_t): new template class
834 (class_fun): helper template function
835 (back_insert_fun_iterator): new template class
836 (back_inserter_fun): helper template function
837 (compare_memfun_t): new template class
838 (compare_memfun): helper template function
839 (equal_1st_in_pair): moved here from translator
840 (equal_2nd_in_pair): moved here from translator
842 * src/support/fmt.C: new file
843 (fmt): new func, can be used for a printf substitute when still
844 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
846 * src/support/StrPool.C: add some comments
848 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
851 * src/insets/figinset.C (addpidwait): use std::copy with
852 ostream_iterator to fill the pidwaitlist
854 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
856 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
859 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
862 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
864 * src/frontends/xforms/FormDocument.C (build): remove c_str()
865 (class_update): ditto
867 (CheckChoiceClass): move initialization of tc and tct
869 * src/tabular.C: remove current_view
870 (OldFormatRead): similar to right below [istream::ignore]
872 * src/lyxlex_pimpl.C (next): add code for faster skipping of
873 chars, unfortunately this is buggy on gcc 2.95.2, so currently
874 unused [istream::ignore]
876 * src/lyxfunc.C: include "support/lyxfunctional.h"
877 (getInsetByCode): use std::find_if and compare_memfun
879 * src/lyxfont.C (stateText): remove c_str()
881 * src/lyx_main.C (setDebuggingLevel): make static
882 (commandLineHelp): make static
884 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
885 Screen* together with fl_get_display() and fl_screen
887 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
888 togheter with fl_get_display() and fl_screen
889 (create_forms): remove c_str()
891 * src/layout.C: include "support/lyxfunctional.h"
892 (hasLayout): use std::find_if and compare_memfun
893 (GetLayout): use std::find_if and comapre_memfun
894 (delete_layout): use std::remove_if and compare_memfun
895 (NumberOfClass): use std:.find_if and compare_memfun
897 * src/gettext.h: change for the new functions
899 * src/gettext.C: new file, make _(char const * str) and _(string
900 const & str) real functions.
902 * src/font.C (width): rewrite slightly to avoid one extra variable
904 * src/debug.C: initialize Debug::ANY here
906 * src/commandtags.h: update number comments
908 * src/combox.h (get): make const func
910 (getline): make const
912 * src/combox.C (input_cb): handle case where fl_get_input can
915 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
916 "support/lyxfunctional.h", remove current_view variable.
917 (resize): use std::for_each with std::mem_fun
918 (getFileNames): use std::copy with back_inserter_fun
919 (getBuffer): change arg type to unsigned int
920 (emergencyWriteAll): call emergencyWrite with std::for_each and
922 (emergencyWrite): new method, the for loop in emergencyWriteAll
924 (exists): use std::find_if with compare_memfun
925 (getBuffer): use std::find_if and compare_memfun
927 * src/buffer.h: add typedefs for iterator_category, value_type
928 difference_type, pointer and reference for inset_iterator
929 add postfix ++ for inset_iterator
930 make inset_iterator::getPos() const
932 * src/buffer.C: added support/lyxmanip.h
933 (readFile): use lyxerr << fmt instead of printf
934 (makeLaTeXFile): use std::copy to write out encodings
936 * src/Painter.C (text): rewrite slightly to avoid extra font variable
938 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
939 free and the char * temp.
940 (hasMenu): use std::find_if and compare_memfun
943 * src/Makefile.am (lyx_SOURCES): added gettext.C
945 * src/LyXAction.C (retrieveActionArg): clear the arg, use
946 string::insert small change to avoid temporary
948 * src/LColor.C (getGUIName): remove c_str()
950 * several files: change all occurrences of fl_display to
953 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
954 that -pedantic is not used for gcc 2.97 (cvs gcc)
956 * boost/Makefile.am: begin slowly to prepare for a real boost lib
958 2000-10-11 Allan Rae <rae@lyx.org>
960 * src/frontends/xforms/FormPreferences.C (input): template path must be
961 a readable directory. It doesn't need to be writeable.
962 (build, delete, update, apply): New inputs in the various tabfolders
964 * src/frontends/xforms/forms/form_preferences.fd:
965 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
966 several new entries to existing folders. Shuffled some existing stuff
969 * src/frontends/xforms/forms/form_print.fd:
970 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
971 Should probably rework PrinterParams as well. Note that the switch to
972 collated is effectively the same as !unsorted so changing PrinterParams
973 will require a lot of fiddly changes to reverse the existing logic.
975 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
977 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
979 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
981 2000-10-10 Allan Rae <rae@lyx.org>
984 * src/lyxfunc.C (Dispatch):
986 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
989 * src/lyxrc.C (output): Only write the differences between system lyxrc
990 and the users settings.
993 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
995 I'll rewrite this later, after 1.1.6 probably, to keep a single
996 LyXRC but two instances of a LyXRCStruct.
998 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1000 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1002 * src/tabular.h: add a few std:: qualifiers.
1004 * src/encoding.C: add using directive.
1005 * src/language.C: ditto.
1007 * src/insets/insetquotes.C (Validate): use languages->lang()
1008 instead of only language.
1010 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1012 * lib/languages: New file.
1014 * lib/encodings: New file.
1016 * src/language.C (Languages): New class.
1017 (read): New method. Reads the languages from the 'languages' file.
1019 * src/encoding.C (Encodings): New class.
1020 (read): New method. Reads the encodings from the 'encodings' file.
1022 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1025 * src/bufferparams.h and a lot of files: Deleted the member language,
1026 and renamed language_info to language
1028 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1029 * src/lyxfont.C (latexWriteStartChanges): ditto.
1030 * src/paragraph.C (validate,TeXOnePar): ditto.
1032 * src/lyxfont.C (update): Restored deleted code.
1034 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1036 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1038 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1040 * src/insets/figinset.[Ch]:
1041 * src/insets/insetinclude.[Ch]:
1042 * src/insets/insetinclude.[Ch]:
1043 * src/insets/insetparent.[Ch]:
1044 * src/insets/insetref.[Ch]:
1045 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1047 * src/insets/*.[Ch]:
1048 * src/mathed/formula.[Ch]:
1049 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1051 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1052 * src/lyx_cb.C (FigureApplyCB):
1053 * src/lyxfunc.C (getStatus, Dispatch):
1054 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1057 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1059 * src/converter.[Ch] (Formats::View):
1060 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1062 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1063 *current_view->buffer(). This will change later, but this patch is way
1066 2000-10-09 Juergen Vigna <jug@sad.it>
1068 * src/text.C (GetRow): small fix.
1070 * src/BufferView_pimpl.C (cursorPrevious):
1071 (cursorNext): added LyXText parameter to function.
1073 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1074 keypress depending on cursor position.
1076 2000-10-06 Juergen Vigna <jug@sad.it>
1078 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1079 (copySelection): redone this function and also copy ascii representa-
1082 * src/tabular.C (Ascii):
1086 (print_n_chars): new functions to realize the ascii export of tabulars.
1088 2000-10-05 Juergen Vigna <jug@sad.it>
1090 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1091 if we don't have a buffer.
1093 2000-10-10 Allan Rae <rae@lyx.org>
1095 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1096 with closing dialog. It seems that nested tabfolders require hiding
1097 of inner tabfolders before hiding the dialog itself. Actually all I
1098 did was hide the active outer folder.
1100 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1101 unless there really is a buffer. hideBufferDependent is called
1104 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1105 POTFILES.in stays in $(srcdir).
1107 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1109 * lib/lyxrc.example: Few changes.
1111 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1113 * src/BufferView_pimpl.C (buffer): only need one the
1114 updateBufferDependent signal to be emitted once! Moved to the end of
1115 the method to allow bv_->text to be updated first.
1117 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1118 and hSignal_ with Dialogs * and BufferDependency variables.
1119 New Buffer * parent_, initialised when the dialog is launched. Used to
1120 check whether to update() or hide() dialog in the new, private
1121 updateOrHide() method that is connected to the updateBufferDependent
1122 signal. Daughter classes dictate what to do using the
1123 ChangedBufferAction enum, passed to the c-tor.
1125 * src/frontends/xforms/FormCitation.C:
1126 * src/frontends/xforms/FormCommand.C:
1127 * src/frontends/xforms/FormCopyright.C:
1128 * src/frontends/xforms/FormDocument.C:
1129 * src/frontends/xforms/FormError.C:
1130 * src/frontends/xforms/FormIndex.C:
1131 * src/frontends/xforms/FormPreferences.C:
1132 * src/frontends/xforms/FormPrint.C:
1133 * src/frontends/xforms/FormRef.C:
1134 * src/frontends/xforms/FormToc.C:
1135 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1138 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1139 ChangedBufferAction enum.
1141 * src/frontends/xforms/FormParagraph.[Ch]
1142 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1145 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1147 * lib/bind/cua.bind: fix a bit.
1148 * lib/bind/emacs.bind: ditto.
1150 * lib/bind/menus.bind: remove real menu entries from there.
1152 * src/spellchecker.C: make sure we only include strings.h when
1155 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1157 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1158 function. It enlarges the maximum number of pup when needed.
1159 (add_toc2): Open a new menu if maximum number of items per menu has
1162 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1164 * src/frontends/kde/FormPrint.C: fix error reporting
1166 * src/frontends/xforms/FormDocument.C: fix compiler
1169 * lib/.cvsignore: add Literate.nw
1171 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1174 * bufferview_funcs.[Ch]
1177 * text2.C: Add support for numbers in RTL text.
1179 2000-10-06 Allan Rae <rae@lyx.org>
1181 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1182 to be gettext.m4 friendly again. ext_l10n.h is now
1183 generated into $top_srcdir instead of $top_builddir
1184 so that lyx.pot will be built correctly -- without
1185 duplicate parsing of ext_l10n.h.
1187 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1189 * src/frontends/kde/FormCitation.C: make the dialog
1190 behave more sensibly
1192 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1194 * config/kde.m4: fix consecutive ./configure runs,
1195 look for qtarch, fix library order
1197 * src/frontends/kde/Makefile.am: tidy up,
1198 add Print dialog, add .dlg dependencies
1200 * src/frontends/kde/FormPrint.C:
1201 * src/frontends/kde/FormPrint.h:
1202 * src/frontends/kde/formprintdialog.C:
1203 * src/frontends/kde/formprintdialog.h:
1204 * src/frontends/kde/formprintdialogdata.C:
1205 * src/frontends/kde/formprintdialogdata.h:
1206 * src/frontends/kde/dlg/formprintdialog.dlg: add
1209 * src/frontends/kde/dlg/README: Added explanatory readme
1211 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1212 script to double-check qtarch's output
1214 * src/frontends/kde/formindexdialog.C:
1215 * src/frontends/kde/formindexdialogdata.C:
1216 * src/frontends/kde/formindexdialogdata.h:
1217 * src/frontends/kde/dlg/formindexdialog.dlg: update
1218 for qtarch, minor fixes
1220 2000-10-05 Allan Rae <rae@lyx.org>
1222 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1223 dialogs when switching buffers update them instead. It's up to each
1224 dialog to decide if it should still be visible or not.
1225 update() should return a bool to control visiblity within show().
1226 Or perhaps better to set a member variable and use that to control
1229 * lib/build-listerrors: create an empty "listerrors" file just to stop
1230 make trying to regenerate it all the time if you don't have noweb
1233 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1235 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1236 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1237 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1238 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1239 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1241 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1243 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1245 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1246 deleting buffer. Closes all buffer-dependent dialogs.
1248 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1250 * src/frontends/xforms/FormCitation.[Ch]:
1251 * src/frontends/xforms/FormPreferences.[Ch]:
1252 * src/frontends/xforms/FormPrint.[Ch]:
1253 * src/frontends/xforms/FormRef.[Ch]:
1254 * src/frontends/xforms/FormUrl.[Ch]: ditto
1256 * src/frontends/xforms/FormDocument.[Ch]:
1257 * src/frontends/xforms/forms/form_document.C.patch:
1258 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1259 pass through a single input() function.
1261 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1263 * lib/build-listerrors: return status as OK
1265 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1267 * lib/lyxrc.example: Updated to new export code
1269 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1271 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1274 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1277 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1278 LyX-Code is defined.
1279 * lib/layouts/amsbook.layout: ditto.
1281 * boost/Makefile.am: fix typo.
1283 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1285 (add_lastfiles): removed.
1286 (add_documents): removed.
1287 (add_formats): removed.
1289 * src/frontends/Menubar.C: remove useless "using" directive.
1291 * src/MenuBackend.h: add a new MenuItem constructor.
1293 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1296 2000-10-04 Allan Rae <rae@lyx.org>
1298 * lib/Makefile.am (listerrors):
1299 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1300 I haven't got notangle installed so Kayvan please test. The output
1301 should end up in $builddir. This also allows people who don't have
1302 noweb installed to complete the make process without error.
1304 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1305 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1306 by JMarc's picky compiler.
1308 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1311 * src/insets/insettabular.C (setPos): change for loop to not use
1312 sequencing operator. Please check this Jürgen.
1314 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1316 * src/insets/insetcite.C (getScreenLabel): ditto
1317 * src/support/filetools.C (QuoteName): ditto
1318 (ChangeExtension): ditto
1320 * src/BufferView_pimpl.C (scrollCB): make heigt int
1322 * src/BufferView2.C (insertInset): comment out unused arg
1324 * boost/Makefile.am (EXTRADIST): new variable
1326 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1328 * src/exporter.C (IsExportable): Fixed
1330 * lib/configure.m4: Small fix
1332 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1334 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1335 * src/insets/insetbib.C (bibitemWidest): ditto.
1336 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1338 2000-10-03 Juergen Vigna <jug@sad.it>
1340 * src/BufferView2.C (theLockingInset): removed const because of
1341 Agnus's compile problems.
1343 * src/insets/insettext.C (LocalDispatch): set the language of the
1344 surronding paragraph on inserting the first character.
1346 * various files: changed use of BufferView::the_locking_inset.
1348 * src/BufferView2.C (theLockingInset):
1349 (theLockingInset): new functions.
1351 * src/BufferView.h: removed the_locking_inset.
1353 * src/lyxtext.h: added the_locking_inset
1355 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1357 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1359 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1361 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1362 * src/mathed/math_cursor.C (IsAlpha): ditto.
1363 * src/mathed/math_inset.C (strnew): ditto.
1364 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1365 (IMetrics): cxp set but never used; removed.
1366 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1367 that the variable in question has been removed also!
1370 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1371 using the Buffer * passed to Latex(), using the BufferView * passed to
1372 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1374 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1375 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1377 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1378 * src/buffer.C (readInset): used new InsetBibtex c-tor
1379 * (getBibkeyList): used new InsetBibtex::getKeys
1381 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1384 * lib/build-listerrors
1386 * src/exporter.C: Add literate programming support to the export code
1389 * src/lyx_cb.C: Remove old literate code.
1391 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1394 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1395 * src/converter.C (View, Convert): Use QuoteName.
1397 * src/insets/figinset.C (Preview): Use Formats::View.
1399 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1401 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1403 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1404 the top of the function, because compaq cxx complains that the
1405 "goto exit_with_message" when the function is disabled bypasses
1407 (MenuNew): try a better fix for the generation of new file names.
1408 This time, I used AddName() instead of AddPath(), hoping Juergen
1411 2000-10-03 Allan Rae <rae@lyx.org>
1413 * src/frontends/xforms/forms/form_preferences.fd:
1414 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1415 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1416 "Look and Feel"->"General" but will need to be split up further into
1417 general output and general input tabs. Current plan is for four outer
1418 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1419 stuff; "Inputs" for input and import configuration; "Outputs" for
1420 output and export configuration; and one more whatever is left over
1421 called "General". The leftovers at present look like being which
1422 viewers to use, spellchecker, language support and might be better
1423 named "Support". I've put "Paths" in "Inputs" for the moment as this
1424 seems reasonable for now at least.
1425 One problem remains: X error kills LyX when you close Preferences.
1427 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1429 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1430 qualifier from form()
1431 * src/frontends/xforms/FormCitation.[Ch]:
1432 * src/frontends/xforms/FormCopyright.[Ch]:
1433 * src/frontends/xforms/FormDocument.[Ch]:
1434 * src/frontends/xforms/FormError.[Ch]:
1435 * src/frontends/xforms/FormIndex.[Ch]:
1436 * src/frontends/xforms/FormPreferences.[Ch]:
1437 * src/frontends/xforms/FormPrint.[Ch]:
1438 * src/frontends/xforms/FormRef.[Ch]:
1439 * src/frontends/xforms/FormToc.[Ch]:
1440 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1442 * src/frontends/xforms/FormCitation.[Ch]:
1443 * src/frontends/xforms/FormIndex.[Ch]:
1444 * src/frontends/xforms/FormRef.[Ch]:
1445 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1446 with Allan's naming policy
1448 * src/frontends/xforms/FormCitation.C: some static casts to remove
1451 2000-10-02 Juergen Vigna <jug@sad.it>
1453 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1454 now you can type or do stuff inside the table-cell also when in dummy
1455 position, fixed visible cursor.
1457 * src/insets/insettext.C (Edit): fixing cursor-view position.
1459 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1460 be used for equal functions in lyxfunc and insettext.
1462 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1464 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1466 * src/frontends/gnome/FormCitation.h:
1467 * src/frontends/gnome/FormCopyright.h:
1468 * src/frontends/gnome/FormIndex.h:
1469 * src/frontends/gnome/FormPrint.h:
1470 * src/frontends/gnome/FormToc.h:
1471 * src/frontends/gnome/FormUrl.h:
1472 * src/frontends/kde/FormCitation.h:
1473 * src/frontends/kde/FormCopyright.h:
1474 * src/frontends/kde/FormIndex.h:
1475 * src/frontends/kde/FormRef.h:
1476 * src/frontends/kde/FormToc.h:
1477 * src/frontends/kde/FormUrl.h: fix remaining users of
1480 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1482 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1483 from depth argument.
1484 (DocBookHandleCaption): ditto.
1485 (DocBookHandleFootnote): ditto.
1486 (SimpleDocBookOnePar): ditto.
1488 * src/frontends/xforms/FormDocument.h (form): remove extra
1489 FormDocument:: qualifier.
1491 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1493 * sigc++/handle.h: ditto.
1495 * src/lyx_gui_misc.C: add "using" directive.
1497 * src/cheaders/cstddef: new file, needed by the boost library (for
1500 2000-10-02 Juergen Vigna <jug@sad.it>
1502 * src/insets/insettext.C (SetFont): better support.
1504 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1506 * src/screen.C (DrawOneRow): some uint refixes!
1508 2000-10-02 Allan Rae <rae@lyx.org>
1510 * boost/.cvsignore: ignore Makefile as well
1512 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1513 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1515 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1516 Left this one out by accident.
1518 * src/frontends/xforms/FormBase.h (restore): default to calling
1519 update() since that will restore the original/currently-applied values.
1520 Any input() triggered error messages will require the derived classes
1521 to redefine restore().
1523 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1524 avoid a segfault. combo_doc_class is the main concern.
1526 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1528 * Simplify build-listerrors in view of GUI-less export ability!
1530 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1532 * src/lyx_main.C (easyParse): Disable gui when exporting
1534 * src/insets/figinset.C:
1537 * src/lyx_gui_misc.C
1538 * src/tabular.C: Changes to allow no-gui.
1540 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1542 * src/support/utility.hpp: removed file
1543 * src/support/block.h: removed file
1545 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1548 * src/mathed/formula.C: add support/lyxlib.h
1549 * src/mathed/formulamacro.C: ditto
1551 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1552 * src/lyxparagraph.h: ditto
1554 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1555 * src/frontends/Makefile.am (INCLUDES): ditto
1556 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1557 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1558 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1559 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1560 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1561 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1563 * src/BufferView.h: use boost/utility.hpp
1564 * src/LColor.h: ditto
1565 * src/LaTeX.h: ditto
1566 * src/LyXAction.h: ditto
1567 * src/LyXView.h: ditto
1568 * src/bufferlist.h: ditto
1569 * src/lastfiles.h: ditto
1570 * src/layout.h: ditto
1571 * src/lyx_gui.h: ditto
1572 * src/lyx_main.h: ditto
1573 * src/lyxlex.h: ditto
1574 * src/lyxrc.h: ditto
1575 * src/frontends/ButtonPolicies.h: ditto
1576 * src/frontends/Dialogs.h: ditto
1577 * src/frontends/xforms/FormBase.h: ditto
1578 * src/frontends/xforms/FormGraphics.h: ditto
1579 * src/frontends/xforms/FormParagraph.h: ditto
1580 * src/frontends/xforms/FormTabular.h: ditto
1581 * src/graphics/GraphicsCache.h: ditto
1582 * src/graphics/Renderer.h: ditto
1583 * src/insets/ExternalTemplate.h: ditto
1584 * src/insets/insetcommand.h: ditto
1585 * src/support/path.h: ditto
1587 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1588 and introduce clause for 2.97.
1590 * boost/libs/README: new file
1592 * boost/boost/utility.hpp: new file
1594 * boost/boost/config.hpp: new file
1596 * boost/boost/array.hpp: new file
1598 * boost/Makefile.am: new file
1600 * boost/.cvsignore: new file
1602 * configure.in (AC_OUTPUT): add boost/Makefile
1604 * Makefile.am (SUBDIRS): add boost
1606 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1608 * src/support/lstrings.C (suffixIs): Fixed.
1610 2000-10-01 Allan Rae <rae@lyx.org>
1612 * src/PrinterParams.h: moved things around to avoid the "can't
1613 inline call" warning.
1615 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1616 into doc++ documentation.
1618 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1620 * src/frontends/xforms/FormRef.C: make use of button controller
1621 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1622 cleaned up button controller usage.
1623 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1624 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1625 use the button controller
1627 * src/frontends/xforms/forms/*.fd: and associated generated files
1628 updated to reflect changes to FormBase. Some other FormXxxx files
1629 also got minor updates to reflect changes to FormBase.
1631 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1632 (hide): made virtual.
1633 (input): return a bool. true == valid input
1634 (RestoreCB, restore): new
1635 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1636 Changes to allow derived dialogs to use a ButtonController and
1637 make sense when doing so: OK button calls ok() and so on.
1639 * src/frontends/xforms/ButtonController.h (class ButtonController):
1640 Switch from template implementation to taking Policy parameter.
1641 Allows FormBase to provide a ButtonController for any dialog.
1643 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1644 Probably should rename connect and disconnect.
1645 (apply): use the radio button groups
1646 (form): needed by FormBase
1647 (build): setup the radio button groups
1649 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1651 * several files: type changes to reduce the number of warnings and
1652 to unify type hangling a bit. Still much to do.
1654 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1656 * lib/images/*: rename a bunch of icons to match Dekel converter
1659 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1662 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1664 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1666 * sigc++/handle.h: ditto for class Handle.
1668 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1670 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1672 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1674 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1675 removal of the "default" language.
1677 * src/combox.h (getline): Check that sel > 0
1679 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1681 * lib/examples/docbook_example.lyx
1682 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1684 * lib/layouts/docbook-book.layout: new docbook book layout.
1686 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1688 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1690 * src/insets/figinset.C (DocBook):fixed small typo.
1692 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1694 * src/insets/insetinclude.h: string include_label doesn't need to be
1697 2000-09-29 Allan Rae <rae@lyx.org>
1699 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1700 Allow derived type to control connection and disconnection from signals
1701 of its choice if desired.
1703 2000-09-28 Juergen Vigna <jug@sad.it>
1705 * src/insets/insettabular.C (update): fixed cursor setting when
1706 the_locking_inset changed.
1707 (draw): made this a bit cleaner.
1708 (InsetButtonPress): fixed!
1710 * various files: added LyXText Parameter to fitCursor call.
1712 * src/BufferView.C (fitCursor): added LyXText parameter.
1714 * src/insets/insettabular.C (draw): small draw fix.
1716 * src/tabular.C: right setting of left/right celllines.
1718 * src/tabular.[Ch]: fixed various types in funcions and structures.
1719 * src/insets/insettabular.C: ditto
1720 * src/frontends/xforms/FormTabular.C: ditto
1722 2000-09-28 Allan Rae <rae@lyx.org>
1724 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1725 that the #ifdef's had been applied to part of what should have been
1726 a complete condition. It's possible there are other tests that
1727 were specific to tables that are also wrong now that InsetTabular is
1728 being used. Now we need to fix the output of '\n' after a table in a
1729 float for the same reason as the original condition:
1730 "don't insert this if we would be adding it before or after a table
1731 in a float. This little trick is needed in order to allow use of
1732 tables in \subfigures or \subtables."
1733 Juergen can you check this?
1735 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1737 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1738 output to the ostream.
1740 * several files: fixed types based on warnings from cxx
1742 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1744 * src/frontends/kde/Makefile.am: fix rule for
1745 formindexdialogdata_moc.C
1747 * src/.cvsignore: add ext_l10n.h to ignore
1749 * acconfig.h: stop messing with __STRICT_ANSI__
1750 * config/gnome.m4: remove option to set -ansi
1751 * config/kde.m4: remove option to set -ansi
1752 * config/lyxinclude.m4: don't set -ansi
1754 2000-09-27 Juergen Vigna <jug@sad.it>
1756 * various files: remove "default" language check.
1758 * src/insets/insetquotes.C: removed use of current_view.
1760 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1761 the one should have red ears by now!
1763 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1764 in more then one paragraph. Fixed cursor-movement/selection.
1766 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1767 paragraphs inside a text inset.
1769 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1770 text-inset if this owner is an inset.
1772 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1774 * src/Bullet.h: changed type of font, character and size to int
1776 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1778 * src/insets/inseturl.[Ch]:
1779 * src/insets/insetref.[Ch]:
1780 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1782 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1784 * src/buffer.C (readFile): block-if statement rearranged to minimise
1785 bloat. Patch does not reverse Jean-Marc's change ;-)
1787 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1788 Class rewritten to store pointers to hide/update signals directly,
1789 rather than Dialogs *. Also defined an enum to ease use. All xforms
1790 forms can now be derived from this class.
1792 * src/frontends/xforms/FormCommand.[Ch]
1793 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1795 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1798 * src/frontends/xforms/forms/form_citation.fd
1799 * src/frontends/xforms/forms/form_copyright.fd
1800 * src/frontends/xforms/forms/form_error.fd
1801 * src/frontends/xforms/forms/form_index.fd
1802 * src/frontends/xforms/forms/form_ref.fd
1803 * src/frontends/xforms/forms/form_toc.fd
1804 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1806 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1808 * src/insets/insetfoot.C: removed redundent using directive.
1810 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1812 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1813 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1815 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1816 created in the constructors in different groups. Then set() just
1817 have to show the groups as needed. This fixes the redraw problems
1818 (and is how the old menu code worked).
1820 * src/support/lyxlib.h: declare the methods as static when we do
1821 not have namespaces.
1823 2000-09-26 Juergen Vigna <jug@sad.it>
1825 * src/buffer.C (asciiParagraph): new function.
1826 (writeFileAscii): new function with parameter ostream.
1827 (writeFileAscii): use now asciiParagraph.
1829 * various inset files: added the linelen parameter to the Ascii-func.
1831 * src/tabular.C (Write): fixed error in writing file introduced by
1832 the last changes from Lars.
1834 * lib/bind/menus.bind: removed not supported functions.
1836 * src/insets/insettext.C (Ascii): implemented this function.
1838 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1840 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1841 (Write): use of the write_attribute functions.
1843 * src/bufferlist.C (close): fixed reasking question!
1845 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1847 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1848 new files use the everwhere possible.
1851 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1852 src/log_form.C src/lyx.C:
1855 * src/buffer.C (runLaTeX): remove func
1857 * src/PaperLayout.C: removed file
1858 * src/ParagraphExtra.C: likewise
1859 * src/bullet_forms.C: likewise
1860 * src/bullet_forms.h: likewise
1861 * src/bullet_forms_cb.C: likewise
1863 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1864 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1867 * several files: remove all traces of the old fd_form_paragraph,
1868 and functions belonging to that.
1870 * several files: remove all traces of the old fd_form_document,
1871 and functions belonging to that.
1873 * several files: constify local variables were possible.
1875 * several files: remove all code that was dead when NEW_EXPORT was
1878 * several files: removed string::c_str in as many places as
1881 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1882 (e): be a bit more outspoken when patching
1883 (updatesrc): only move files if changed.
1885 * forms/layout_forms.h.patch: regenerated
1887 * forms/layout_forms.fd: remove form_document and form_paragraph
1888 and form_quotes and form_paper and form_table_options and
1889 form_paragraph_extra
1891 * forms/form1.fd: remove form_table
1893 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1894 the fdui->... rewrite. Update some comments to xforms 0.88
1896 * forms/bullet_forms.C.patch: removed file
1897 * forms/bullet_forms.fd: likewise
1898 * forms/bullet_forms.h.patch: likewise
1900 * development/Code_rules/Rules: added a section on switch
1901 statements. Updated some comment to xforms 0.88.
1903 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1905 * src/buffer.C (readFile): make sure that the whole version number
1906 is read after \lyxformat (even when it contains a comma)
1908 * lib/ui/default.ui: change shortcut of math menu to M-a.
1910 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1912 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1915 * src/LyXView.C (updateWindowTitle): show the full files name in
1916 window title, limited to 30 characters.
1918 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1919 When a number of characters has been given, we should not assume
1920 that the string is 0-terminated.
1922 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1923 calls (fixes some memory leaks)
1925 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1926 trans member on exit.
1928 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1930 * src/converter.C (GetReachable): fix typo.
1932 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1933 understand ',' instead of '.'.
1934 (GetInteger): rewrite to use strToInt().
1936 2000-09-26 Juergen Vigna <jug@sad.it>
1938 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1939 better visibility and error-message on wrong VSpace input.
1941 * src/language.C (initL): added english again.
1943 2000-09-25 Juergen Vigna <jug@sad.it>
1945 * src/frontends/kde/Dialogs.C (Dialogs):
1946 * src/frontends/gnome/Dialogs.C (Dialogs):
1947 * src/frontends/kde/Makefile.am:
1948 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1950 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1952 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1954 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1956 * src/frontends/xforms/FormParagraph.C:
1957 * src/frontends/xforms/FormParagraph.h:
1958 * src/frontends/xforms/form_paragraph.C:
1959 * src/frontends/xforms/form_paragraph.h:
1960 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1963 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1965 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1966 Paragraph-Data after use.
1968 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1969 non breakable paragraphs.
1971 2000-09-25 Garst R. Reese <reese@isn.net>
1973 * src/language.C (initL): added missing language_country codes.
1975 2000-09-25 Juergen Vigna <jug@sad.it>
1977 * src/insets/insettext.C (InsetText):
1978 (deleteLyXText): remove the not released LyXText structure!
1980 2000-09-24 Marko Vendelin <markov@ioc.ee>
1982 * src/frontends/gnome/mainapp.C
1983 * src/frontends/gnome/mainapp.h: added support for keyboard
1986 * src/frontends/gnome/FormCitation.C
1987 * src/frontends/gnome/FormCitation.h
1988 * src/frontends/gnome/Makefile.am
1989 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1990 FormCitation to use "action area" in mainapp window
1992 * src/frontends/gnome/Menubar_pimpl.C
1993 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1996 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1998 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1999 width/descent/ascent values if name is empty.
2000 (mathed_string_height): Use std::max.
2002 2000-09-25 Allan Rae <rae@lyx.org>
2004 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2005 segfault. This will be completely redesigned soon.
2007 * sigc++: updated libsigc++. Fixes struct timespec bug.
2009 * development/tools/makeLyXsigc.sh: .cvsignore addition
2011 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2013 * several files: removed almost all traces of the old table
2016 * src/TableLayout.C: removed file
2018 2000-09-22 Juergen Vigna <jug@sad.it>
2020 * src/frontends/kde/Dialogs.C: added credits forms.
2022 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2024 * src/frontends/gnome/Dialogs.C: added some forms.
2026 * src/spellchecker.C (init_spell_checker): set language in pspell code
2027 (RunSpellChecker): some modifications for setting language string.
2029 * src/language.[Ch]: added language_country code.
2031 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2033 * src/frontends/Dialogs.h: added new signal showError.
2034 Rearranged existing signals in some sort of alphabetical order.
2036 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2037 FormError.[Ch], form_error.[Ch]
2038 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2039 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2041 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2042 dialogs. I think that this can be used as the base to all these
2045 * src/frontends/xforms/FormError.[Ch]
2046 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2047 implementation of InsetError dialog.
2049 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2051 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2052 * src/frontends/kde/Makefile.am: ditto
2054 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2056 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2057 macrobf. This fixes a bug of invisible text.
2059 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2061 * lib/doc/LaTeXConfig.lyx.in: updated.
2063 * src/language.C (initL): remove language "francais" and change a
2064 bit the names of the two other french variations.
2066 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2067 string that may not be 0-terminated.
2069 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2071 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2073 2000-09-20 Marko Vendelin <markov@ioc.ee>
2075 * src/frontends/gnome/FormCitation.C
2076 * src/frontends/gnome/FormIndex.C
2077 * src/frontends/gnome/FormToc.C
2078 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2079 the variable initialization to shut up the warnings
2081 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2083 * src/table.[Ch]: deleted files
2085 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2088 2000-09-18 Juergen Vigna <jug@sad.it>
2090 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2091 problems with selection. Inserted new LFUN_PASTESELECTION.
2092 (InsetButtonPress): inserted handling of middle mouse-button paste.
2094 * src/spellchecker.C: changed word to word.c_str().
2096 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2098 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2099 included in the ``make dist'' tarball.
2101 2000-09-15 Juergen Vigna <jug@sad.it>
2103 * src/CutAndPaste.C (cutSelection): small fix return the right
2104 end position after cut inside one paragraph only.
2106 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2107 we are locked as otherwise we don't have a valid cursor position!
2109 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2111 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2113 * src/frontends/kde/FormRef.C: added using directive.
2114 * src/frontends/kde/FormToc.C: ditto
2116 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2118 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2120 2000-09-19 Marko Vendelin <markov@ioc.ee>
2122 * src/frontends/gnome/Menubar_pimpl.C
2123 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2124 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2126 * src/frontends/gnome/mainapp.C
2127 * src/frontends/gnome/mainapp.h: support for menu update used
2130 * src/frontends/gnome/mainapp.C
2131 * src/frontends/gnome/mainapp.h: support for "action" area in the
2132 main window. This area is used by small simple dialogs, such as
2135 * src/frontends/gnome/FormIndex.C
2136 * src/frontends/gnome/FormIndex.h
2137 * src/frontends/gnome/FormUrl.C
2138 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2141 * src/frontends/gnome/FormCitation.C
2142 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2143 action area. Only "Insert new citation" is implemented.
2145 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2147 * src/buffer.C (Dispatch): fix call to Dispatch
2148 * src/insets/insetref.C (Edit): likewise
2149 * src/insets/insetparent.C (Edit): likewise
2150 * src/insets/insetinclude.C (include_cb): likewise
2151 * src/frontends/xforms/FormUrl.C (apply): likewise
2152 * src/frontends/xforms/FormToc.C (apply): likewise
2153 * src/frontends/xforms/FormRef.C (apply): likewise
2154 * src/frontends/xforms/FormIndex.C (apply): likewise
2155 * src/frontends/xforms/FormCitation.C (apply): likewise
2156 * src/lyxserver.C (callback): likewise
2157 * src/lyxfunc.C (processKeySym): likewise
2158 (Dispatch): likewise
2159 (Dispatch): likewise
2160 * src/lyx_cb.C (LayoutsCB): likewise
2162 * Makefile.am (sourcedoc): small change
2164 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2166 * src/main.C (main): Don't make an empty GUIRunTime object. all
2167 methods are static. constify a bit remove unneded using + headers.
2169 * src/tabular.C: some more const to local vars move some loop vars
2171 * src/spellchecker.C: added some c_str after some word for pspell
2173 * src/frontends/GUIRunTime.h: add new static method setDefaults
2174 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2175 * src/frontends/kde/GUIRunTime.C (setDefaults):
2176 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2178 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2179 with strnew in arg, use correct emptystring when calling SetName.
2181 * several files: remove all commented code with relation to
2182 HAVE_SSTREAM beeing false. We now only support stringstream and
2185 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2187 * src/lyxfunc.C: construct correctly the automatic new file
2190 * src/text2.C (IsStringInText): change type of variable i to shut
2193 * src/support/sstream.h: do not use namespaces if the compiler
2194 does not support them.
2196 2000-09-15 Marko Vendelin <markov@ioc.ee>
2197 * src/frontends/gnome/FormCitation.C
2198 * src/frontends/gnome/FormCitation.h
2199 * src/frontends/gnome/diainsertcitation_interface.c
2200 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2201 regexp support to FormCitation [Gnome].
2203 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2206 * configure.in: remove unused KDE/GTKGUI define
2208 * src/frontends/kde/FormRef.C
2209 * src/frontends/kde/FormRef.h
2210 * src/frontends/kde/formrefdialog.C
2211 * src/frontends/kde/formrefdialog.h: double click will
2212 go to reference, now it is possible to change a cross-ref
2215 * src/frontends/kde/FormToc.C
2216 * src/frontends/kde/FormToc.h
2217 * src/frontends/kde/formtocdialog.C
2218 * src/frontends/kde/formtocdialog.h: add a depth
2221 * src/frontends/kde/Makefile.am: add QtLyXView.h
2224 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2226 * src/frontends/kde/FormCitation.h: added some using directives.
2228 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2230 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2233 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2236 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2238 * src/buffer.C (pop_tag): revert for the second time a change by
2239 Lars, who seems to really hate having non-local loop variables :)
2241 * src/Lsstream.h: add "using" statements.
2243 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2244 * src/buffer.C (writeFile): ditto
2246 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2248 * src/buffer.C (writeFile): try to fix the locale modified format
2249 number to always be as we want it.
2251 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2252 in XForms 0.89. C-space is now working again.
2254 * src/Lsstream.h src/support/sstream.h: new files.
2256 * also commented out all cases where strstream were used.
2258 * src/Bullet.h (c_str): remove method.
2260 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2262 * a lot of files: get rid of "char const *" and "char *" is as
2263 many places as possible. We only want to use them in interaction
2264 with system of other libraries, not inside lyx.
2266 * a lot of files: return const object is not of pod type. This
2267 helps ensure that temporary objects is not modified. And fits well
2268 with "programming by contract".
2270 * configure.in: check for the locale header too
2272 * Makefile.am (sourcedoc): new tag for generation of doc++
2275 2000-09-14 Juergen Vigna <jug@sad.it>
2277 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2278 callback to check which combo called it and do the right action.
2280 * src/combox.C (combo_cb): added combo * to the callbacks.
2281 (Hide): moved call of callback after Ungrab of the pointer.
2283 * src/intl.h: removed LCombo2 function.
2285 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2286 function as this can now be handled in one function.
2288 * src/combox.h: added Combox * to callback prototype.
2290 * src/frontends/xforms/Toolbar_pimpl.C:
2291 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2293 2000-09-14 Garst Reese <reese@isn.net>
2295 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2296 moved usepackage{xxx}'s to beginning of file. Changed left margin
2297 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2298 underlining from title. Thanks to John Culleton for useful suggestions.
2300 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2302 * src/lyxlex_pimpl.C (setFile): change error message to debug
2305 2000-09-13 Juergen Vigna <jug@sad.it>
2307 * src/frontends/xforms/FormDocument.C: implemented choice_class
2308 as combox and give callback to combo_language so OK/Apply is activated
2311 * src/bufferlist.C (newFile): small fix so already named files
2312 (via an open call) are not requested to be named again on the
2315 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2317 * src/frontends/kde/Makefile.am
2318 * src/frontends/kde/FormRef.C
2319 * src/frontends/kde/FormRef.h
2320 * src/frontends/kde/formrefdialog.C
2321 * src/frontends/kde/formrefdialog.h: implement
2324 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2326 * src/frontends/kde/formtocdialog.C
2327 * src/frontends/kde/formtocdialog.h
2328 * src/frontends/kde/FormToc.C
2329 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2331 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2333 * src/frontends/kde/FormCitation.C: fix thinko
2334 where we didn't always display the reference text
2337 * src/frontends/kde/formurldialog.C
2338 * src/frontends/kde/formurldialog.h
2339 * src/frontends/kde/FormUrl.C
2340 * src/frontends/kde/FormUrl.h: minor cleanups
2342 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2344 * src/frontends/kde/Makefile.am
2345 * src/frontends/kde/FormToc.C
2346 * src/frontends/kde/FormToc.h
2347 * src/frontends/kde/FormCitation.C
2348 * src/frontends/kde/FormCitation.h
2349 * src/frontends/kde/FormIndex.C
2350 * src/frontends/kde/FormIndex.h
2351 * src/frontends/kde/formtocdialog.C
2352 * src/frontends/kde/formtocdialog.h
2353 * src/frontends/kde/formcitationdialog.C
2354 * src/frontends/kde/formcitationdialog.h
2355 * src/frontends/kde/formindexdialog.C
2356 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2358 2000-09-12 Juergen Vigna <jug@sad.it>
2360 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2363 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2365 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2368 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2370 * src/converter.C (Add, Convert): Added support for converter flags:
2371 needaux, resultdir, resultfile.
2372 (Convert): Added new parameter view_file.
2373 (dvips_options): Fixed letter paper option.
2375 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2376 (Export, GetExportableFormats, GetViewableFormats): Added support
2379 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2381 (easyParse): Fixed to work with new export code.
2383 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2386 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2388 * lib/bind/*.bind: Replaced
2389 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2390 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2392 2000-09-11 Juergen Vigna <jug@sad.it>
2394 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2396 * src/main.C (main): now GUII defines global guiruntime!
2398 * src/frontends/gnome/GUIRunTime.C (initApplication):
2399 * src/frontends/kde/GUIRunTime.C (initApplication):
2400 * src/frontends/xforms/GUIRunTime.C (initApplication):
2401 * src/frontends/GUIRunTime.h: added new function initApplication.
2403 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2405 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2407 2000-09-08 Juergen Vigna <jug@sad.it>
2409 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2410 we have already "Reset".
2412 * src/language.C (initL): inserted "default" language and made this
2413 THE default language (and not american!)
2415 * src/paragraph.C: inserted handling of "default" language!
2417 * src/lyxfont.C: ditto
2421 * src/paragraph.C: output the \\par only if we have a following
2422 paragraph otherwise it's not needed.
2424 2000-09-05 Juergen Vigna <jug@sad.it>
2426 * config/pspell.m4: added entry to lyx-flags
2428 * src/spellchecker.C: modified version from Kevin for using pspell
2430 2000-09-01 Marko Vendelin <markov@ioc.ee>
2431 * src/frontends/gnome/Makefile.am
2432 * src/frontends/gnome/FormCitation.C
2433 * src/frontends/gnome/FormCitation.h
2434 * src/frontends/gnome/diainsertcitation_callbacks.c
2435 * src/frontends/gnome/diainsertcitation_callbacks.h
2436 * src/frontends/gnome/diainsertcitation_interface.c
2437 * src/frontends/gnome/diainsertcitation_interface.h
2438 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2439 dialog for Gnome frontend
2441 * src/main.C: Gnome libraries require keeping application name
2442 and its version as strings
2444 * src/frontends/gnome/mainapp.C: Change the name of the main window
2445 from GnomeLyX to PACKAGE
2447 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2449 * src/frontends/Liason.C: add "using: declaration.
2451 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2453 * src/mathed/math_macro.C (Metrics): Set the size of the template
2455 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2457 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2459 * src/converter.C (add_options): New function.
2460 (SetViewer): Change $$FName into '$$FName'.
2461 (View): Add options when running xdvi
2462 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2463 (Convert): The 3rd parameter is now the desired filename. Converts
2464 calls to lyx::rename if necessary.
2465 Add options when running dvips.
2466 (dvi_papersize,dvips_options): New methods.
2468 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2470 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2471 using a call to Converter::dvips_options.
2472 Fixed to work with nex export code.
2474 * src/support/copy.C
2475 * src/support/rename.C: New files
2477 * src/support/syscall.h
2478 * src/support/syscall.C: Added Starttype SystemDontWait.
2480 * lib/ui/default.ui: Changed to work with new export code
2482 * lib/configure.m4: Changed to work with new export code
2484 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2486 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2488 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2489 so that code compiles with DEC cxx.
2491 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2492 to work correctly! Also now supports the additional elements
2495 2000-09-01 Allan Rae <rae@lyx.org>
2497 * src/frontends/ButtonPolicies.C: renamed all the references to
2498 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2500 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2501 since it's a const not a type.
2503 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2505 2000-08-31 Juergen Vigna <jug@sad.it>
2507 * src/insets/figinset.C: Various changes to look if the filename has
2508 an extension and if not add it for inline previewing.
2510 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2512 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2513 make buttonStatus and isReadOnly be const methods. (also reflect
2514 this in derived classes.)
2516 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2517 (nextState): change to be static inline, pass the StateMachine as
2519 (PreferencesPolicy): remove casts
2520 (OkCancelPolicy): remvoe casts
2521 (OkCancelReadOnlyPolicy): remove casts
2522 (NoRepeatedApplyReadOnlyPolicy): remove casts
2523 (OkApplyCancelReadOnlyPolicy): remove casts
2524 (OkApplyCancelPolicy): remove casts
2525 (NoRepeatedApplyPolicy): remove casts
2527 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2529 * src/converter.C: added some using directives
2531 * src/frontends/ButtonPolicies.C: changes to overcome
2532 "need lvalue" error with DEC c++
2534 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2535 to WMHideCB for DEC c++
2537 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2539 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2540 to BulletBMTableCB for DEC c++
2542 2000-08-31 Allan Rae <rae@lyx.org>
2544 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2545 character dialog separately from old document dialogs combo_language.
2548 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2550 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2551 Removed LFUN_REF_CREATE.
2553 * src/MenuBackend.C: Added new tags: toc and references
2555 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2556 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2558 (add_toc, add_references): New methods.
2559 (create_submenu): Handle correctly the case when there is a
2560 seperator after optional menu items.
2562 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2563 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2564 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2566 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2568 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2570 * src/converter.[Ch]: New file for converting between different
2573 * src/export.[Ch]: New file for exporting a LyX file to different
2576 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2577 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2578 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2579 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2580 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2581 RunDocBook, MenuExport.
2583 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2584 Exporter::Preview methods if NEW_EXPORT is defined.
2586 * src/buffer.C (Dispatch): Use Exporter::Export.
2588 * src/lyxrc.C: Added new tags: \converter and \viewer.
2591 * src/LyXAction.C: Define new lyx-function: buffer-update.
2592 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2593 when NEW_EXPORT is defined.
2595 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2597 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2599 * lib/ui/default.ui: Added submenus "view" and "update" to the
2602 * src/filetools.C (GetExtension): New function.
2604 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2606 2000-08-29 Allan Rae <rae@lyx.org>
2608 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2610 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2611 (EnableDocumentLayout): removed
2612 (DisableDocumentLayout): removed
2613 (build): make use of ButtonController's read-only handling to
2614 de/activate various objects. Replaces both of the above functions.
2616 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2617 (readOnly): was read_only
2618 (refresh): fixed dumb mistakes with read_only_ handling
2620 * src/frontends/xforms/forms/form_document.fd:
2621 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2622 tabbed dialogs so the tabs look more like tabs and so its easier to
2623 work out which is the current tab.
2625 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2626 segfault with form_table
2628 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2630 2000-08-28 Juergen Vigna <jug@sad.it>
2632 * acconfig.h: added USE_PSPELL.
2634 * src/config.h.in: added USE_PSPELL.
2636 * autogen.sh: added pspell.m4
2638 * config/pspell.m4: new file.
2640 * src/spellchecker.C: implemented support for pspell libary.
2642 2000-08-25 Juergen Vigna <jug@sad.it>
2644 * src/LyXAction.C (init): renamed LFUN_TABLE to
2645 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2647 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2649 * src/lyxscreen.h: add force_clear variable and fuction to force
2650 a clear area when redrawing in LyXText.
2652 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2654 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2656 * some whitespace and comment changes.
2658 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2660 * src/buffer.C: up te LYX_FORMAT to 2.17
2662 2000-08-23 Juergen Vigna <jug@sad.it>
2664 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2667 * src/insets/insettabular.C (pasteSelection): delete the insets
2668 LyXText as it is not valid anymore.
2669 (copySelection): new function.
2670 (pasteSelection): new function.
2671 (cutSelection): new function.
2672 (LocalDispatch): implemented cut/copy/paste of cell selections.
2674 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2675 don't have a LyXText.
2677 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2679 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2682 2000-08-22 Juergen Vigna <jug@sad.it>
2684 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2685 ifdef form_table out if NEW_TABULAR.
2687 2000-08-21 Juergen Vigna <jug@sad.it>
2689 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2690 (draw): fixed draw position so that the cursor is positioned in the
2692 (InsetMotionNotify): hide/show cursor so the position is updated.
2693 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2694 using cellstart() function where it should be used.
2696 * src/insets/insettext.C (draw): ditto.
2698 * src/tabular.C: fixed initialization of some missing variables and
2699 made BoxType into an enum.
2701 2000-08-22 Marko Vendelin <markov@ioc.ee>
2702 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2703 stock menu item using action numerical value, not its string
2707 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2709 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2710 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2712 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2714 * src/frontends/xforms/GUIRunTime.C: new file
2716 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2717 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2719 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2721 * src/frontends/kde/GUIRunTime.C: new file
2723 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2724 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2726 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2728 * src/frontends/gnome/GUIRunTime.C: new file
2730 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2733 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2734 small change to documetentation.
2736 * src/frontends/GUIRunTime.C: removed file
2738 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2740 * src/lyxparagraph.h: enable NEW_TABULAR as default
2742 * src/lyxfunc.C (processKeySym): remove some commented code
2744 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2745 NEW_TABULAR around the fd_form_table_options.
2747 * src/lyx_gui.C (runTime): call the static member function as
2748 GUIRunTime::runTime().
2750 2000-08-21 Allan Rae <rae@lyx.org>
2752 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2755 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2757 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2759 2000-08-21 Allan Rae <rae@lyx.org>
2761 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2762 keep Garst happy ;-)
2763 * src/frontends/xforms/FormPreferences.C (build): use setOK
2764 * src/frontends/xforms/FormDocument.C (build): use setOK
2765 (FormDocument): use the appropriate policy.
2767 2000-08-21 Allan Rae <rae@lyx.org>
2769 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2770 automatic [de]activation of arbitrary objects when in a read-only state.
2772 * src/frontends/ButtonPolicies.h: More documentation
2773 (isReadOnly): added to support the above.
2775 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2777 2000-08-18 Juergen Vigna <jug@sad.it>
2779 * src/insets/insettabular.C (getStatus): changed to return func_status.
2781 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2782 display toggle menu entries if they are.
2784 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2785 new document layout now.
2787 * src/lyxfunc.C: ditto
2789 * src/lyx_gui_misc.C: ditto
2791 * src/lyx_gui.C: ditto
2793 * lib/ui/default.ui: removed paper and quotes layout as they are now
2794 all in the document layout tabbed folder.
2796 * src/frontends/xforms/forms/form_document.fd: added Restore
2797 button and callbacks for all inputs for Allan's ButtonPolicy.
2799 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2800 (CheckChoiceClass): added missing params setting on class change.
2801 (UpdateLayoutDocument): added for updating the layout on params.
2802 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2803 (FormDocument): Implemented Allan's ButtonPolicy with the
2806 2000-08-17 Allan Rae <rae@lyx.org>
2808 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2809 so we can at least see the credits again.
2811 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2812 controller calls for the appropriate callbacks. Note that since Ok
2813 calls apply followed by cancel, and apply isn't a valid input for the
2814 APPLIED state, the bc_ calls have to be made in the static callback not
2815 within each of the real callbacks.
2817 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2818 (setOk): renamed from setOkay()
2820 2000-08-17 Juergen Vigna <jug@sad.it>
2822 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2823 in the implementation part.
2824 (composeUIInfo): don't show optional menu-items.
2826 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2828 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2830 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2831 text-state when in a text-inset.
2833 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2835 2000-08-17 Marko Vendelin <markov@ioc.ee>
2836 * src/frontends/gnome/FormIndex.C
2837 * src/frontends/gnome/FormIndex.h
2838 * src/frontends/gnome/FormToc.C
2839 * src/frontends/gnome/FormToc.h
2840 * src/frontends/gnome/dialogs
2841 * src/frontends/gnome/diatoc_callbacks.c
2842 * src/frontends/gnome/diatoc_callbacks.h
2843 * src/frontends/gnome/diainsertindex_callbacks.h
2844 * src/frontends/gnome/diainsertindex_callbacks.c
2845 * src/frontends/gnome/diainsertindex_interface.c
2846 * src/frontends/gnome/diainsertindex_interface.h
2847 * src/frontends/gnome/diatoc_interface.h
2848 * src/frontends/gnome/diatoc_interface.c
2849 * src/frontends/gnome/Makefile.am: Table of Contents and
2850 Insert Index dialogs implementation for Gnome frontend
2852 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2854 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2856 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2859 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2861 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2862 destructor. Don't definde if you don't need it
2863 (processEvents): made static, non-blocking events processing for
2865 (runTime): static method. event loop for xforms
2866 * similar as above for kde and gnome.
2868 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2869 new Pimpl is correct
2870 (runTime): new method calss the real frontends runtime func.
2872 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2874 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2876 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2878 2000-08-16 Juergen Vigna <jug@sad.it>
2880 * src/lyx_gui.C (runTime): added GUII RunTime support.
2882 * src/frontends/Makefile.am:
2883 * src/frontends/GUIRunTime.[Ch]:
2884 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2885 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2886 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2888 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2890 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2891 as this is already set in ${FRONTEND_INCLUDE} if needed.
2893 * configure.in (CPPFLAGS): setting the include dir for the frontend
2894 directory and don't set FRONTEND=xforms for now as this is executed
2897 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2899 * src/frontends/kde/Makefile.am:
2900 * src/frontends/kde/FormUrl.C:
2901 * src/frontends/kde/FormUrl.h:
2902 * src/frontends/kde/formurldialog.h:
2903 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2905 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2907 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2909 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2911 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2914 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2916 * src/WorkArea.C (work_area_handler): more work to get te
2917 FL_KEYBOARD to work with xforms 0.88 too, please test.
2919 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2921 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2923 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2926 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2928 * src/Timeout.h: remove Qt::emit hack.
2930 * several files: changes to allo doc++ compilation
2932 * src/lyxfunc.C (processKeySym): new method
2933 (processKeyEvent): comment out if FL_REVISION < 89
2935 * src/WorkArea.C: change some debugging levels.
2936 (WorkArea): set wantkey to FL_KEY_ALL
2937 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2938 clearer code and the use of compose with XForms 0.89. Change to
2939 use signals instead of calling methods in bufferview directly.
2941 * src/Painter.C: change some debugging levels.
2943 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2946 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2947 (workAreaKeyPress): new method
2949 2000-08-14 Juergen Vigna <jug@sad.it>
2951 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2953 * config/kde.m4: addes some features
2955 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2956 include missing xforms dialogs.
2958 * src/Timeout.h: a hack to be able to compile with qt/kde.
2960 * sigc++/.cvsignore: added acinclude.m4
2962 * lib/.cvsignore: added listerros
2964 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2965 xforms tree as objects are needed for other frontends.
2967 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2968 linking with not yet implemented xforms objects.
2970 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2972 2000-08-14 Baruch Even <baruch.even@writeme.com>
2974 * src/frontends/xforms/FormGraphics.h:
2975 * src/frontends/xforms/FormGraphics.C:
2976 * src/frontends/xforms/RadioButtonGroup.h:
2977 * src/frontends/xforms/RadioButtonGroup.C:
2978 * src/insets/insetgraphics.h:
2979 * src/insets/insetgraphics.C:
2980 * src/insets/insetgraphicsParams.h:
2981 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2982 instead of spaces, and various other indentation issues to make the
2983 sources more consistent.
2985 2000-08-14 Marko Vendelin <markov@ioc.ee>
2987 * src/frontends/gnome/dialogs/diaprint.glade
2988 * src/frontends/gnome/FormPrint.C
2989 * src/frontends/gnome/FormPrint.h
2990 * src/frontends/gnome/diaprint_callbacks.c
2991 * src/frontends/gnome/diaprint_callbacks.h
2992 * src/frontends/gnome/diaprint_interface.c
2993 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2996 * src/frontends/gnome/dialogs/diainserturl.glade
2997 * src/frontends/gnome/FormUrl.C
2998 * src/frontends/gnome/FormUrl.h
2999 * src/frontends/gnome/diainserturl_callbacks.c
3000 * src/frontends/gnome/diainserturl_callbacks.h
3001 * src/frontends/gnome/diainserturl_interface.c
3002 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3003 Gnome implementation
3005 * src/frontends/gnome/Dialogs.C
3006 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3007 all other dialogs. Copy all unimplemented dialogs from Xforms
3010 * src/frontends/gnome/support.c
3011 * src/frontends/gnome/support.h: support files generated by Glade
3015 * config/gnome.m4: Gnome configuration scripts
3017 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3018 configure --help message
3020 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3021 only if there are no events pendling in Gnome/Gtk. This enhances
3022 the performance of menus.
3025 2000-08-14 Allan Rae <rae@lyx.org>
3027 * lib/Makefile.am: listerrors cleaning
3029 * lib/listerrors: removed -- generated file
3030 * acinclude.m4: ditto
3031 * sigc++/acinclude.m4: ditto
3033 * src/frontends/xforms/forms/form_citation.fd:
3034 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3037 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3038 `updatesrc` and now we have a `test` target that does what `updatesrc`
3039 used to do. I didn't like having an install target that wasn't related
3042 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3043 on all except FormGraphics. This may yet happen. Followed by a major
3044 cleanup including using FL_TRANSIENT for most of the dialogs. More
3045 changes to come when the ButtonController below is introduced.
3047 * src/frontends/xforms/ButtonController.h: New file for managing up to
3048 four buttons on a dialog according to an externally defined policy.
3049 * src/frontends/xforms/Makefile.am: added above
3051 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3052 Apply and Cancel/Close buttons and everything in between and beyond.
3053 * src/frontends/Makefile.am: added above.
3055 * src/frontends/xforms/forms/form_preferences.fd:
3056 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3057 and removed variable 'status' as a result. Fixed the set_minsize thing.
3058 Use the new screen-font-update after checking screen fonts were changed
3059 Added a "Restore" button to restore the original lyxrc values while
3060 editing. This restores everything not just the last input changed.
3061 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3063 * src/LyXAction.C: screen-font-update added for updating buffers after
3064 screen font settings have been changed.
3065 * src/commandtags.h: ditto
3066 * src/lyxfunc.C: ditto
3068 * forms/lyx.fd: removed screen fonts dialog.
3069 * src/lyx_gui.C: ditto
3070 * src/menus.[Ch]: ditto
3071 * src/lyx.[Ch]: ditto
3072 * src/lyx_cb.C: ditto + code from here moved to make
3073 screen-font-update. And people wonder why progress on GUII is
3074 slow. Look at how scattered this stuff was! It takes forever
3077 * forms/fdfix.sh: Fixup the spacing after commas.
3078 * forms/makefile: Remove date from generated files. Fewer clashes now.
3079 * forms/bullet_forms.C.patch: included someones handwritten changes
3081 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3082 once I've discovered why LyXRC was made noncopyable.
3083 * src/lyx_main.C: ditto
3085 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3087 * src/frontends/xforms/forms/fdfix.sh:
3088 * src/frontends/xforms/forms/fdfixh.sed:
3089 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3090 * src/frontends/xforms/Form*.[hC]:
3091 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3092 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3093 provide a destructor for the struct FD_form_xxxx. Another version of
3094 the set_[max|min]size workaround and a few other cleanups. Actually,
3095 Angus' patch from 20000809.
3097 2000-08-13 Baruch Even <baruch.even@writeme.com>
3099 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3102 2000-08-11 Juergen Vigna <jug@sad.it>
3104 * src/insets/insetgraphics.C (InsetGraphics): changing init
3105 order because of warnings.
3107 * src/frontends/xforms/forms/makefile: adding patching .C with
3110 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3111 from .C.patch to .c.patch
3113 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3114 order because of warning.
3116 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3118 * src/frontends/Liason.C (setMinibuffer): new helper function
3120 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3122 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3124 * lib/ui/default.ui: commented out PaperLayout entry
3126 * src/frontends/xforms/form_document.[Ch]: new added files
3128 * src/frontends/xforms/FormDocument.[Ch]: ditto
3130 * src/frontends/xforms/forms/form_document.fd: ditto
3132 * src/frontends/xforms/forms/form_document.C.patch: ditto
3134 2000-08-10 Juergen Vigna <jug@sad.it>
3136 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3137 (InsetGraphics): initialized cacheHandle to 0.
3138 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3140 2000-08-10 Baruch Even <baruch.even@writeme.com>
3142 * src/graphics/GraphicsCache.h:
3143 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3144 correctly as a cache.
3146 * src/graphics/GraphicsCacheItem.h:
3147 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3150 * src/graphics/GraphicsCacheItem_pimpl.h:
3151 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3154 * src/insets/insetgraphics.h:
3155 * src/insets/insetgraphics.C: Changed from using a signal notification
3156 to polling when image is not loaded.
3158 2000-08-10 Allan Rae <rae@lyx.org>
3160 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3161 that there are two functions that have to been taken out of line by
3162 hand and aren't taken care of in the script. (Just a reminder note)
3164 * sigc++/macros/*.h.m4: Updated as above.
3166 2000-08-09 Juergen Vigna <jug@sad.it>
3168 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3170 * src/insets/insettabular.C: make drawing of single cell smarter.
3172 2000-08-09 Marko Vendelin <markov@ioc.ee>
3173 * src/frontends/gnome/Menubar_pimpl.C
3174 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3175 implementation: new files
3177 * src/frontends/gnome/mainapp.C
3178 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3181 * src/main.C: create Gnome main window
3183 * src/frontends/xforms/Menubar_pimpl.h
3184 * src/frontends/Menubar.C
3185 * src/frontends/Menubar.h: added method Menubar::update that calls
3186 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3188 * src/LyXView.C: calls Menubar::update to update the state
3191 * src/frontends/gnome/Makefile.am: added new files
3193 * src/frontends/Makefile.am: added frontend compiler options
3195 2000-08-08 Juergen Vigna <jug@sad.it>
3197 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3199 * src/bufferlist.C (close):
3200 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3201 documents if exiting without saving.
3203 * src/buffer.C (save): use removeAutosaveFile()
3205 * src/support/filetools.C (removeAutosaveFile): new function.
3207 * src/lyx_cb.C (MenuWrite): returns a bool now.
3208 (MenuWriteAs): check if file could really be saved and revert to the
3210 (MenuWriteAs): removing old autosavefile if existant.
3212 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3213 before Goto toggle declaration, because of compiler warning.
3215 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3217 * src/lyxfunc.C (MenuNew): small fix.
3219 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3221 * src/bufferlist.C (newFile):
3222 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3224 * src/lyxrc.C: added new_ask_filename tag
3226 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3228 * src/lyx.fd: removed code pertaining to form_ref
3229 * src/lyx.[Ch]: ditto
3230 * src/lyx_cb.C: ditto
3231 * src/lyx_gui.C: ditto
3232 * src/lyx_gui_misc.C: ditto
3234 * src/BufferView_pimpl.C (restorePosition): update buffer only
3237 * src/commandtags.h (LFUN_REFTOGGLE): removed
3238 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3239 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3240 (LFUN_REFBACK): renamed LFUN_REF_BACK
3242 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3243 * src/menus.C: ditto
3244 * src/lyxfunc.C (Dispatch): ditto.
3245 InsertRef dialog is now GUI-independent.
3247 * src/texrow.C: added using std::endl;
3249 * src/insets/insetref.[Ch]: strip out large amounts of code.
3250 The inset is now a container and this functionality is now
3251 managed by a new FormRef dialog
3253 * src/frontends/Dialogs.h (showRef, createRef): new signals
3255 * src/frontends/xforms/FormIndex.[Ch],
3256 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3257 when setting dialog's min/max size
3258 * src/frontends/xforms/FormIndex.[Ch]: ditto
3260 * src/frontends/xforms/FormRef.[Ch],
3261 src/frontends/xforms/forms/form_ref.fd: new xforms
3262 implementation of an InsetRef dialog
3264 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3267 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3268 ios::nocreate is not part of the standard. Removed.
3270 2000-08-07 Baruch Even <baruch.even@writeme.com>
3272 * src/graphics/Renderer.h:
3273 * src/graphics/Renderer.C: Added base class for rendering of different
3274 image formats into Pixmaps.
3276 * src/graphics/XPM_Renderer.h:
3277 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3278 in a different class.
3280 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3281 easily add support for other formats.
3283 * src/insets/figinset.C: plugged a leak of an X resource.
3285 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3287 * src/CutAndPaste.[Ch]: make all metods static.
3289 * development/Code_rules/Rules: more work, added section on
3290 Exceptions, and a References section.
3292 * a lot of header files: work to make doc++ able to generate the
3293 source documentation, some workarounds of doc++ problems. Doc++ is
3294 now able to generate the documentation.
3296 2000-08-07 Juergen Vigna <jug@sad.it>
3298 * src/insets/insettabular.C (recomputeTextInsets): removed function
3300 * src/tabular.C (SetWidthOfMulticolCell):
3302 (calculate_width_of_column_NMC): fixed return value so that it really
3303 only returns true if the column-width has changed (there where
3304 problems with muliticolumn-cells in this column).
3306 2000-08-04 Juergen Vigna <jug@sad.it>
3308 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3309 also on the scrollstatus of the inset.
3310 (workAreaMotionNotify): ditto.
3312 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3314 2000-08-01 Juergen Vigna <jug@sad.it>
3316 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3318 * src/commandtags.h:
3319 * src/LyXAction.C (init):
3320 * src/insets/inset.C (LocalDispatch): added support for
3323 * src/insets/inset.C (scroll): new functions.
3325 * src/insets/insettext.C (removeNewlines): new function.
3326 (SetAutoBreakRows): removes forced newlines in the text of the
3327 paragraph if autoBreakRows is set to false.
3329 * src/tabular.C (Latex): generates a parbox around the cell contents
3332 * src/frontends/xforms/FormTabular.C (local_update): removed
3333 the radio_useparbox button.
3335 * src/tabular.C (UseParbox): new function
3337 2000-08-06 Baruch Even <baruch.even@writeme.com>
3339 * src/graphics/GraphicsCache.h:
3340 * src/graphics/GraphicsCache.C:
3341 * src/graphics/GraphicsCacheItem.h:
3342 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3345 * src/insets/insetgraphics.h:
3346 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3347 and the drawing of the inline image.
3349 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3350 loaded into the wrong position.
3352 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3355 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3357 * src/support/translator.h: move all typedefs to public section
3359 * src/support/filetools.C (MakeLatexName): return string const
3361 (TmpFileName): ditto
3362 (FileOpenSearch): ditto
3364 (LibFileSearch): ditto
3365 (i18nLibFileSearch): ditto
3368 (CreateTmpDir): ditto
3369 (CreateBufferTmpDir): ditto
3370 (CreateLyXTmpDir): ditto
3373 (MakeAbsPath): ditto
3375 (OnlyFilename): ditto
3377 (NormalizePath): ditto
3378 (CleanupPath): ditto
3379 (GetFileContents): ditto
3380 (ReplaceEnvironmentPath): ditto
3381 (MakeRelPath): ditto
3383 (ChangeExtension): ditto
3384 (MakeDisplayPath): ditto
3385 (do_popen): return cmdret const
3386 (findtexfile): return string const
3388 * src/support/DebugStream.h: add some /// to please doc++
3390 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3392 * src/texrow.C (same_rownumber): functor to use with find_if
3393 (getIdFromRow): rewritten to use find_if and to not update the
3394 positions. return true if row is found
3395 (increasePos): new method, use to update positions
3397 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3399 * src/lyxlex_pimpl.C (verifyTable): new method
3402 (GetString): return string const
3403 (pushTable): rewrite to use std::stack
3405 (setFile): better check
3408 * src/lyxlex.h: make LyXLex noncopyable
3410 * src/lyxlex.C (text): return char const * const
3411 (GetString): return string const
3412 (getLongString): return string const
3414 * src/lyx_gui_misc.C (askForText): return pair<...> const
3416 * src/lastfiles.[Ch] (operator): return string const
3418 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3419 istringstream not char const *.
3420 move token.end() out of loop.
3421 (readFile): move initializaton of token
3423 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3424 getIdFromRow is successful.
3426 * lib/bind/emacs.bind: don't include menus bind
3428 * development/Code_rules/Rules: the beginnings of making this
3429 better and covering more of the unwritten rules that we have.
3431 * development/Code_rules/Recommendations: a couple of wording
3434 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3436 * src/support/strerror.c: remove C++ comment.
3438 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3440 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3441 LFUN_INDEX_INSERT_LAST
3443 * src/texrow.C (getIdFromRow): changed from const_iterator to
3444 iterator, allowing code to compile with DEC cxx
3446 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3447 stores part of the class, as suggested by Allan. Will allow
3449 (apply): test to apply uses InsetCommandParams operator!=
3451 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3452 (apply): test to apply uses InsetCommandParams operator!=
3454 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3455 stores part of the class.
3456 (update): removed limits on min/max size.
3458 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3459 (apply): test to apply uses InsetCommandParams operator!=
3461 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3462 (Read, Write, scanCommand, getCommand): moved functionality
3463 into InsetCommandParams.
3465 (getScreenLabel): made pure virtual
3466 new InsetCommandParams operators== and !=
3468 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3469 c-tors based on InsetCommandParams. Removed others.
3470 * src/insets/insetinclude.[Ch]: ditto
3471 * src/insets/insetlabel.[Ch]: ditto
3472 * src/insets/insetparent.[Ch]: ditto
3473 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3475 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3476 insets derived from InsetCommand created using similar c-tors
3477 based on InsetCommandParams
3478 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3479 * src/menus.C (ShowRefsMenu): ditto
3480 * src/paragraph.C (Clone): ditto
3481 * src/text2.C (SetCounter): ditto
3482 * src/lyxfunc.C (Dispatch) ditto
3483 Also recreated old InsetIndex behaviour exactly. Can now
3484 index-insert at the start of a paragraph and index-insert-last
3485 without launching the pop-up.
3487 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3489 * lib/lyxrc.example: mark te pdf options as non functional.
3491 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3492 (isStrDbl): move tmpstr.end() out of loop.
3493 (strToDbl): move intialization of tmpstr
3494 (lowercase): return string const and move tmp.end() out of loop.
3495 (uppercase): return string const and move tmp.edn() out of loop.
3496 (prefixIs): add assertion
3501 (containsOnly): ditto
3502 (containsOnly): ditto
3503 (containsOnly): ditto
3504 (countChar): make last arg char not char const
3505 (token): return string const
3506 (subst): return string const, move tmp.end() out of loop.
3507 (subst): return string const, add assertion
3508 (strip): return string const
3509 (frontStrip): return string const, add assertion
3510 (frontStrip): return string const
3515 * src/support/lstrings.C: add inclde "LAssert.h"
3516 (isStrInt): move tmpstr.end() out of loop.
3518 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3519 toollist.end() out of loop.
3520 (deactivate): move toollist.end() out of loop.
3521 (update): move toollist.end() out of loop.
3522 (updateLayoutList): move tc.end() out of loop.
3523 (add): move toollist.end() out of loop.
3525 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3526 md.end() out of loop.
3528 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3530 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3533 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3534 (Erase): move insetlist.end() out of loop.
3536 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3537 ref to const string as first arg. Move initialization of some
3538 variables, whitespace changes.
3540 * src/kbmap.C (defkey): move table.end() out of loop.
3541 (kb_keymap): move table.end() out of loop.
3542 (findbinding): move table.end() out of loop.
3544 * src/MenuBackend.C (hasMenu): move end() out of loop.
3545 (getMenu): move end() out of loop.
3546 (getMenu): move menulist_.end() out of loop.
3548 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3550 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3553 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3554 (getFromLyXName): move infotab.end() out of loop.
3556 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3557 -fvtable-thunks -ffunction-sections -fdata-sections
3559 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3561 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3564 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3566 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3568 * src/frontends/xforms/FormCitation.[Ch],
3569 src/frontends/xforms/FormIndex.[Ch],
3570 src/frontends/xforms/FormToc.[Ch],
3571 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3573 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3575 * src/commandtags.h: renamed, created some flags for citation
3578 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3580 * src/lyxfunc.C (dispatch): use signals to insert index entry
3582 * src/frontends/Dialogs.h: new signal createIndex
3584 * src/frontends/xforms/FormCommand.[Ch],
3585 src/frontends/xforms/FormCitation.[Ch],
3586 src/frontends/xforms/FormToc.[Ch],
3587 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3589 * src/insets/insetindex.[Ch]: GUI-independent
3591 * src/frontends/xforms/FormIndex.[Ch],
3592 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3595 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3597 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3598 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3600 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3602 * src/insets/insetref.C (Latex): rewrite so that there is now
3603 question that a initialization is requested.
3605 * src/insets/insetcommand.h: reenable the hide signal
3607 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3609 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3610 fix handling of shortcuts (many bugs :)
3611 (add_lastfiles): ditto.
3613 * lib/ui/default.ui: fix a few shortcuts.
3615 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3617 * Makefile.am: Fix ``rpmdist'' target to return the exit
3618 status of the ``rpm'' command, instead of the last command in
3619 the chain (the ``rm lyx.xpm'' command, which always returns
3622 2000-08-02 Allan Rae <rae@lyx.org>
3624 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3625 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3626 * src/frontends/xforms/FormToc.C (FormToc): ditto
3628 * src/frontends/xforms/Makefile.am: A few forgotten files
3630 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3631 Signals-not-copyable-problem Lars' started commenting out.
3633 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3635 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3637 * src/insets/insetcommand.h: Signals is not copyable so anoter
3638 scheme for automatic hiding of forms must be used.
3640 * src/frontends/xforms/FormCitation.h: don't inerit from
3641 noncopyable, FormCommand already does that.
3642 * src/frontends/xforms/FormToc.h: ditto
3643 * src/frontends/xforms/FormUrl.h: ditto
3645 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3647 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3649 * src/insets/insetcommand.h (hide): new SigC::Signal0
3650 (d-tor) new virtual destructor emits hide signal
3652 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3653 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3655 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3656 LOF and LOT. Inset is now GUI-independent
3658 * src/insets/insetloa.[Ch]: redundant
3659 * src/insets/insetlof.[Ch]: ditto
3660 * src/insets/insetlot.[Ch]: ditto
3662 * src/frontends/xforms/forms/form_url.fd: tweaked!
3663 * src/frontends/xforms/forms/form_citation.fd: ditto
3665 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3666 dialogs dealing with InsetCommand insets
3668 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3669 FormCommand base class
3670 * src/frontends/xforms/FormUrl.[Ch]: ditto
3672 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3674 * src/frontends/xforms/FormToc.[Ch]: ditto
3676 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3677 passed a generic InsetCommand pointer
3678 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3680 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3681 and modified InsetTOC class
3682 * src/buffer.C: ditto
3684 * forms/lyx.fd: strip out old FD_form_toc code
3685 * src/lyx_gui_misc.C: ditto
3686 * src/lyx_gui.C: ditto
3687 * src/lyx_cb.C: ditto
3688 * src/lyx.[Ch]: ditto
3690 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3692 * src/support/utility.hpp: tr -d '\r'
3694 2000-08-01 Juergen Vigna <jug@sad.it>
3696 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3698 * src/commandtags.h:
3699 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3700 LFUN_TABULAR_FEATURES.
3702 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3703 LFUN_LAYOUT_TABULAR.
3705 * src/insets/insettabular.C (getStatus): implemented helper function.
3707 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3709 2000-07-31 Juergen Vigna <jug@sad.it>
3711 * src/text.C (draw): fixed screen update problem for text-insets.
3713 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3714 something changed probably this has to be added in various other
3717 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3719 2000-07-31 Baruch Even <baruch.even@writeme.com>
3721 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3722 templates to satisfy compaq cxx.
3725 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3727 * src/support/translator.h (equal_1st_in_pair::operator()): take
3728 const ref pair_type as arg.
3729 (equal_2nd_in_pair::operator()): ditto
3730 (Translator::~Translator): remove empty d-tor.
3732 * src/graphics/GraphicsCache.C: move include config.h to top, also
3733 put initialization of GraphicsCache::singleton here.
3734 (~GraphicsCache): move here
3735 (addFile): take const ref as arg
3738 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3740 * src/BufferView2.C (insertLyXFile): change te with/without header
3743 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3745 * src/frontends/xforms/FormGraphics.C (apply): add some
3746 static_cast. Not very nice, but required by compaq cxx.
3748 * src/frontends/xforms/RadioButtonGroup.h: include header
3749 <utility> instead of <pair.h>
3751 * src/insets/insetgraphicsParams.C: add using directive.
3752 (readResize): change return type to void.
3753 (readOrigin): ditto.
3755 * src/lyxfunc.C (getStatus): add missing break for build-program
3756 function; add test for Literate for export functions.
3758 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3759 entries in Options menu.
3761 2000-07-31 Baruch Even <baruch.even@writeme.com>
3763 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3764 protect against auto-allocation; release icon when needed.
3766 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3768 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3769 on usual typewriter.
3771 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3772 earlier czech.kmap), useful only for programming.
3774 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3776 * src/frontends/xforms/FormCitation.h: fix conditioning around
3779 2000-07-31 Juergen Vigna <jug@sad.it>
3781 * src/frontends/xforms/FormTabular.C (local_update): changed
3782 radio_linebreaks to radio_useparbox and added radio_useminipage.
3784 * src/tabular.C: made support for using minipages/parboxes.
3786 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3788 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3790 (descent): so the cursor is in the middle.
3791 (width): bit smaller box.
3793 * src/insets/insetgraphics.h: added display() function.
3795 2000-07-31 Baruch Even <baruch.even@writeme.com>
3797 * src/frontends/Dialogs.h: Added showGraphics signals.
3799 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3800 xforms form definition of the graphics dialog.
3802 * src/frontends/xforms/FormGraphics.h:
3803 * src/frontends/xforms/FormGraphics.C: Added files, the
3804 GUIndependent code of InsetGraphics
3806 * src/insets/insetgraphics.h:
3807 * src/insets/insetgraphics.C: Major writing to make it work.
3809 * src/insets/insetgraphicsParams.h:
3810 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3811 struct between InsetGraphics and GUI.
3813 * src/LaTeXFeatures.h:
3814 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3815 support for graphicx package.
3817 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3818 for the graphics inset.
3820 * src/support/translator.h: Added file, used in
3821 InsetGraphicsParams. this is a template to translate between two
3824 * src/frontends/xforms/RadioButtonGroup.h:
3825 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3826 way to easily control a radio button group.
3828 2000-07-28 Juergen Vigna <jug@sad.it>
3830 * src/insets/insettabular.C (LocalDispatch):
3831 (TabularFeatures): added support for lyx-functions of tabular features.
3832 (cellstart): refixed this function after someone wrongly changed it.
3834 * src/commandtags.h:
3835 * src/LyXAction.C (init): added support for tabular-features
3837 2000-07-28 Allan Rae <rae@lyx.org>
3839 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3840 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3841 triggers the callback for input checking. As a result we sometimes get
3842 "LyX: This shouldn't happen..." printed to cerr.
3843 (input): Started using status variable since I only free() on
3844 destruction. Some input checking for paths and font sizes.
3846 * src/frontends/xforms/FormPreferences.h: Use status to control
3847 activation of Ok and Apply
3849 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3850 callback. Also resized to stop segfaults with 0.88. The problem is
3851 that xforms-0.88 requires the folder to be wide enough to fit all the
3852 tabs. If it isn't it causes all sorts of problems.
3854 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3856 * src/frontends/xforms/forms/README: Reflect reality.
3858 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3859 * src/frontends/xforms/forms/makefile: ditto.
3861 * src/commandtags.h: Get access to new Preferences dialog
3862 * src/LyXAction.C: ditto
3863 * src/lyxfunc.C: ditto
3864 * lib/ui/default.ui: ditto
3866 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3868 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3870 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3873 * src/frontends/xforms/form_url.[Ch]: added.
3875 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3877 * src/insets/insetbib.h: fixed bug in previous commit
3879 * src/frontends/xforms/FormUrl.h: ditto
3881 * src/frontends/xforms/FormPrint.h: ditto
3883 * src/frontends/xforms/FormPreferences.h: ditto
3885 * src/frontends/xforms/FormCopyright.h: ditto
3887 * src/frontends/xforms/FormCitation.C: ditto
3889 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3890 private copyconstructor and private default contructor
3892 * src/support/Makefile.am: add utility.hpp
3894 * src/support/utility.hpp: new file from boost
3896 * src/insets/insetbib.h: set owner in clone
3898 * src/frontends/xforms/FormCitation.C: added missing include
3901 * src/insets/form_url.[Ch]: removed
3903 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3905 * development/lyx.spec.in
3906 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3907 file/directory re-organization.
3909 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3911 * src/insets/insetcommand.[Ch]: moved the string data and
3912 associated manipulation methods into a new stand-alone class
3913 InsetCommandParams. This class has two additional methods
3914 getAsString() and setFromString() allowing the contents to be
3915 moved around as a single string.
3916 (addContents) method removed.
3917 (setContents) method no longer virtual.
3919 * src/buffer.C (readInset): made use of new InsetCitation,
3920 InsetUrl constructors based on InsetCommandParams.
3922 * src/commandtags.h: add LFUN_INSERT_URL
3924 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3925 independent InsetUrl and use InsetCommandParams to extract
3926 string info and create new Insets.
3928 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3930 * src/frontends/xforms/FormCitation.C (apply): uses
3933 * src/frontends/xforms/form_url.C
3934 * src/frontends/xforms/form_url.h
3935 * src/frontends/xforms/FormUrl.h
3936 * src/frontends/xforms/FormUrl.C
3937 * src/frontends/xforms/forms/form_url.fd: new files
3939 * src/insets/insetcite.[Ch]: removed unused constructors.
3941 * src/insets/insetinclude.[Ch]: no longer store filename
3943 * src/insets/inseturl.[Ch]: GUI-independent.
3945 2000-07-26 Juergen Vigna <jug@sad.it>
3946 * renamed frontend from gtk to gnome as it is that what is realized
3947 and did the necessary changes in the files.
3949 2000-07-26 Marko Vendelin <markov@ioc.ee>
3951 * configure.in: cleaning up gnome configuration scripts
3953 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3955 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3956 shortcuts syndrom by redrawing them explicitely (a better solution
3957 would be appreciated).
3959 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3961 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3964 * src/lyx_cb.C (MenuExport): change html export to do the right
3965 thing depending of the document type (instead of having
3966 html-linuxdoc and html-docbook).
3967 * src/lyxfunc.C (getStatus): update for html
3968 * lib/ui/default.ui: simplify due to the above change.
3969 * src/menus.C (ShowFileMenu): update too (in case we need it).
3971 * src/MenuBackend.C (read): if a menu is defined twice, add the
3972 new entries to the exiting one.
3974 2000-07-26 Juergen Vigna <jug@sad.it>
3976 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3978 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3979 and return a bool if it did actual save the file.
3980 (AutoSave): don't autosave a unnamed doc.
3982 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3983 check if this is an UNNAMED new file and react to it.
3984 (newFile): set buffer to unnamed and change to not mark a new
3985 buffer dirty if I didn't do anything with it.
3987 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3989 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3991 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3992 friend as per Angus's patch posted to lyx-devel.
3994 * src/ext_l10n.h: updated
3996 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3997 gettext on the style string right before inserting them into the
4000 * autogen.sh: add code to extract style strings form layout files,
4001 not good enough yet.
4003 * src/frontends/gtk/.cvsignore: add MAKEFILE
4005 * src/MenuBackend.C (read): run the label strings through gettext
4006 before storing them in the containers.
4008 * src/ext_l10n.h: new file
4010 * autogen.sh : generate the ext_l10n.h file here
4012 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4014 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4017 * lib/ui/default.ui: fix a couple of typos.
4019 * config/gnome/gtk.m4: added (and added to the list of files in
4022 * src/insets/insetinclude.C (unique_id): fix when we are using
4023 lyxstring instead of basic_string<>.
4024 * src/insets/insettext.C (LocalDispatch): ditto.
4025 * src/support/filetools.C: ditto.
4027 * lib/configure.m4: create the ui/ directory if necessary.
4029 * src/LyXView.[Ch] (updateToolbar): new method.
4031 * src/BufferView_pimpl.C (buffer): update the toolbar when
4032 opening/closing buffer.
4034 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4036 * src/LyXAction.C (getActionName): enhance to return also the name
4037 and options of pseudo-actions.
4038 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4040 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4041 as an example of what is possible). Used in File->Build too (more
4042 useful) and in the import/export menus (to mimick the complicated
4043 handling of linuxdoc and friends). Try to update all the entries.
4045 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4048 * src/MenuBackend.C (read): Parse the new OptItem tag.
4050 * src/MenuBackend.h: Add a new optional_ data member (used if the
4051 entry should be omitted when the lyxfunc is disabled).
4053 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4054 function, used as a shortcut.
4055 (create_submenu): align correctly the shortcuts on the widest
4058 * src/MenuBackend.h: MenuItem.label() only returns the label of
4059 the menu without shortcut; new method shortcut().
4061 2000-07-14 Marko Vendelin <markov@ioc.ee>
4063 * src/frontends/gtk/Dialogs.C:
4064 * src/frontends/gtk/FormCopyright.C:
4065 * src/frontends/gtk/FormCopyright.h:
4066 * src/frontends/gtk/Makefile.am: added these source-files for the
4067 Gtk/Gnome support of the Copyright-Dialog.
4069 * src/main.C: added Gnome::Main initialization if using
4070 Gtk/Gnome frontend-GUI.
4072 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4074 * config/gnome/aclocal-include.m4
4075 * config/gnome/compiler-flags.m4
4076 * config/gnome/curses.m4
4077 * config/gnome/gnome--.m4
4078 * config/gnome/gnome-bonobo-check.m4
4079 * config/gnome/gnome-common.m4
4080 * config/gnome/gnome-fileutils.m4
4081 * config/gnome/gnome-ghttp-check.m4
4082 * config/gnome/gnome-gnorba-check.m4
4083 * config/gnome/gnome-guile-checks.m4
4084 * config/gnome/gnome-libgtop-check.m4
4085 * config/gnome/gnome-objc-checks.m4
4086 * config/gnome/gnome-orbit-check.m4
4087 * config/gnome/gnome-print-check.m4
4088 * config/gnome/gnome-pthread-check.m4
4089 * config/gnome/gnome-support.m4
4090 * config/gnome/gnome-undelfs.m4
4091 * config/gnome/gnome-vfs.m4
4092 * config/gnome/gnome-x-checks.m4
4093 * config/gnome/gnome-xml-check.m4
4094 * config/gnome/gnome.m4
4095 * config/gnome/gperf-check.m4
4096 * config/gnome/gtk--.m4
4097 * config/gnome/linger.m4
4098 * config/gnome/need-declaration.m4: added configuration scripts
4099 for Gtk/Gnome frontend-GUI
4101 * configure.in: added support for the --with-frontend=gtk option
4103 * autogen.sh: added config/gnome/* to list of config-files
4105 * acconfig.h: added define for GTKGUI-support
4107 * config/lyxinclude.m4: added --with-frontend[=value] option value
4108 for Gtk/Gnome frontend-GUI support.
4110 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4112 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4116 * src/paragraph.C (GetChar): remove non-const version
4118 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4119 (search_kw): use it.
4121 * src/lyx_main.C (init): if "preferences" exist, read that instead
4123 (ReadRcFile): return bool if the file could be read ok.
4124 (ReadUIFile): add a check to see if lex file is set ok.
4126 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4127 bastring can be used instead of lyxstring (still uses the old code
4128 if std::string is good enough or if lyxstring is used.)
4130 * src/encoding.C: make the arrays static, move ininle functions
4132 * src/encoding.h: from here.
4134 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4135 (parseSingleLyXformat2Token): move inset parsing to separate method
4136 (readInset): new private method
4138 * src/Variables.h: remove virtual from get().
4140 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4141 access to NEW_INSETS and NEW_TABULAR
4143 * src/MenuBackend.h: remove superfluous forward declaration of
4144 MenuItem. Add documentations tags "///", remove empty MenuItem
4145 destructor, remove private default contructor.
4147 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4149 (read): more string mlabel and mname to where they are used
4150 (read): remove unused variables mlabel and mname
4151 (defaults): unconditional clear, make menusetup take advantage of
4152 add returning Menu &.
4154 * src/LyXView.h: define NEW_MENUBAR as default
4156 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4157 to NEW_INSETS and NEW_TABULAR.
4158 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4159 defined. Change some of the "xxxx-inset-insert" functions names to
4162 * several files: more enahncements to NEW_INSETS and the resulting
4165 * lib/lyxrc.example (\date_insert_format): move to misc section
4167 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4168 bastring and use AC_CACHE_CHECK.
4169 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4170 the system have the newest methods. uses AC_CACHE_CHECK
4171 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4172 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4173 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4175 * configure.in: add LYX_CXX_GOOD_STD_STRING
4177 * acinclude.m4: recreated
4179 2000-07-24 Amir Karger <karger@lyx.org>
4181 * README: add Hebrew, Arabic kmaps
4184 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4186 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4189 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4191 * Lot of files: add pragma interface/implementation.
4193 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4195 * lib/ui/default.ui: new file (ans new directory). Contains the
4196 default menu and toolbar.
4198 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4199 global space. Toolbars are now read (as menus) in ui files.
4201 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4203 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4204 is disabled because the document is read-only. We want to have the
4205 toggle state of the function anyway.
4206 (getStatus): add code for LFUN_VC* functions (mimicking what is
4207 done in old-style menus)
4209 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4210 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4212 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4213 * src/BufferView_pimpl.C: ditto.
4214 * src/lyxfunc.C: ditto.
4216 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4217 default). This replaces old-style menus by new ones.
4219 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4220 MenuItem. Contain the data structure of a menu.
4222 * src/insets/insettext.C: use LyXView::setLayout instead of
4223 accessing directly the toolbar combox.
4224 * src/lyxfunc.C (Dispatch): ditto.
4226 * src/LyXView.C (setLayout): new method, which just calls
4227 Toolbar::setLayout().
4228 (updateLayoutChoice): move part of this method in Toolbar.
4230 * src/toolbar.[Ch]: removed.
4232 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4233 implementation the toolbar.
4235 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4236 the toolbar. It might make sense to merge it with ToolbarDefaults
4238 (setLayout): new function.
4239 (updateLayoutList): ditto.
4240 (openLayoutList): ditto.
4242 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4243 xforms implementation of the toolbar.
4244 (get_toolbar_func): comment out, since I do not
4245 know what it is good for.
4247 * src/ToolbarDefaults.h: Add the ItemType enum.
4249 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4250 for a list of allocated C strings. Used in Menubar xforms
4251 implementation to avoid memory leaks.
4253 * src/support/lstrings.[Ch] (uppercase): new version taking and
4257 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4258 * lib/bind/emacs.bind: ditto.
4260 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4262 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4263 forward decl of LyXView.
4265 * src/toolbar.C (toolbarItem): moved from toolbar.h
4266 (toolbarItem::clean): ditto
4267 (toolbarItem::~toolbarItem): ditto
4268 (toolbarItem::operator): ditto
4270 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4272 * src/paragraph.h: control the NEW_TABULAR define from here
4274 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4275 USE_TABULAR_INSETS to NEW_TABULAR
4277 * src/ToolbarDefaults.C: add include "lyxlex.h"
4279 * files using the old table/tabular: use NEW_TABULAR to control
4280 compilation of old tabular stuff.
4282 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4285 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4286 planemet in reading of old style floats, fix the \end_deeper
4287 problem when reading old style floats.
4289 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4291 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4293 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4295 * lib/bind/sciword.bind: updated.
4297 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4299 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4300 layout write problem
4302 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4304 * src/Makefile.am (INCLUDES): remove image directory from include
4307 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4308 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4310 * src/LyXView.C (create_form_form_main): read the application icon
4313 * lib/images/*.xpm: change the icons to use transparent color for
4316 * src/toolbar.C (update): change the color of the button when it
4319 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4321 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4322 setting explicitely the minibuffer.
4323 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4325 * src/LyXView.C (showState): new function. Shows font information
4326 in minibuffer and update toolbar state.
4327 (LyXView): call Toolbar::update after creating the
4330 * src/toolbar.C: change toollist to be a vector instead of a
4332 (BubbleTimerCB): get help string directly from the callback
4333 argument of the corresponding icon (which is the action)
4334 (set): remove unnecessary ugliness.
4335 (update): new function. update the icons (depressed, disabled)
4336 depending of the status of the corresponding action.
4338 * src/toolbar.h: remove help in toolbarItem
4340 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4342 * src/Painter.C (text): Added code for using symbol glyphs from
4343 iso10646 fonts. Currently diabled.
4345 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4348 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4349 magyar,turkish and usorbian.
4351 * src/paragraph.C (isMultiLingual): Made more efficient.
4353 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4356 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4357 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4358 Also changed the prototype to "bool math_insert_greek(char)".
4360 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4362 * lots of files: apply the NEW_INSETS on all code that will not be
4363 needed when we move to use the new insets. Enable the define in
4364 lyxparagrah.h to try it.
4366 * src/insets/insettabular.C (cellstart): change to be a static
4368 (InsetTabular): initialize buffer in the initializer list.
4370 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4372 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4373 form_print.h out of the header file. Replaced with forward
4374 declarations of the relevant struct.
4376 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4379 * src/commandtags.h: do not include "debug.h" which does not
4380 belong there. #include it in some other places because of this
4383 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4385 * src/insets/insetcaption.C: add a couple "using" directives.
4387 * src/toolbar.C (add): get the help text directly from lyxaction.
4389 (setPixmap): new function. Loads from disk and sets a pixmap on a
4390 botton; the name of the pixmap file is derived from the command
4393 * src/toolbar.h: remove members isBitmap and pixmap from
4396 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4397 * lib/images/: move many files from images/banner.xpm.
4399 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4401 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4402 * src/toolbar.C: ditto.
4403 * configure.in: ditto.
4404 * INSTALL: document.
4406 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4407 the spellchecker popup is closed from the WM.
4409 2000-07-19 Juergen Vigna <jug@sad.it>
4411 * src/insets/insetfloat.C (Write): small fix because we use the
4412 insetname for the type now!
4414 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4416 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4419 * src/frontends/Dialogs.h: removed hideCitation signal
4421 * src/insets/insetcite.h: added hide signal
4423 * src/insets/insetcite.C (~InsetCitation): emits new signal
4424 (getScreenLabel): "intelligent" label should now fit on the screen!
4426 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4428 * src/frontends/xforms/FormCitation.C (showInset): connects
4429 hide() to the inset's hide signal
4430 (show): modified to use fl_set_object_position rather than
4431 fl_set_object_geometry wherever possible
4433 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4435 * src/insets/lyxinset.h: add caption code
4437 * src/insets/insetfloat.C (type): new method
4439 * src/insets/insetcaption.C (Write): new method
4441 (LyxCode): new method
4443 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4444 to get it right together with using the FloatList.
4446 * src/commandtags.h: add LFUN_INSET_CAPTION
4447 * src/lyxfunc.C (Dispatch): handle it
4449 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4452 * src/Variables.[Ch]: make expand take a const reference, remove
4453 the destructor, some whitespace changes.
4455 * src/LyXAction.C (init): add caption-inset-insert
4457 * src/FloatList.C (FloatList): update the default floats a bit.
4459 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4461 * src/Variables.[Ch]: new files. Intended to be used for language
4462 specific strings (like \chaptername) and filename substitution in
4465 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4467 * lib/kbd/american.kmap: update
4469 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4471 * src/bufferparams.[Ch]: remove member allowAccents.
4473 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4475 * src/LaTeXLog.C: use the log_form.h header.
4476 * src/lyx_gui.C: ditto.
4477 * src/lyx_gui_misc.C: ditto.
4478 * src/lyxvc.h: ditto.
4480 * forms/log_form.fd: new file, created from latexoptions.fd. I
4481 kept the log popup and nuked the options form.
4483 * src/{la,}texoptions.[Ch]: removed.
4484 * src/lyx_cb.C (LaTeXOptions): ditto
4486 * src/lyx_gui.C (create_forms): do not handle the
4487 fd_latex_options form.
4489 2000-07-18 Juergen Vigna <jug@sad.it>
4491 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4492 name of the inset so that it can be requested outside (text2.C).
4494 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4497 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4499 * src/mathed/formula.h (ConvertFont): constify
4501 * src/mathed/formula.C (Read): add warning if \end_inset is not
4502 found on expected place.
4504 * src/insets/lyxinset.h (ConvertFont): consify
4506 * src/insets/insetquotes.C (ConvertFont): constify
4507 * src/insets/insetquotes.h: ditto
4509 * src/insets/insetinfo.h: add labelfont
4511 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4512 (ascent): use labelfont
4516 (Write): make .lyx file a bit nicer
4518 * src/insets/insetfloat.C (Write): simplify somewhat...
4519 (Read): add warning if arg is not found
4521 * src/insets/insetcollapsable.C: add using std::max
4522 (Read): move string token and add warning in arg is not found
4523 (draw): use std::max to get the right ty
4524 (getMaxWidth): simplify by using std::max
4526 * src/insets/insetsection.h: new file
4527 * src/insets/insetsection.C: new file
4528 * src/insets/insetcaption.h: new file
4529 * src/insets/insetcaption.C: new file
4531 * src/insets/inset.C (ConvertFont): constify signature
4533 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4534 insetcaption.[Ch] and insetsection.[Ch]
4536 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4537 uses to use LABEL_COUNTER_CHAPTER instead.
4538 * src/text2.C (SetCounter): here
4540 * src/counters.h: new file
4541 * src/counters.C: new file
4542 * src/Sectioning.h: new file
4543 * src/Sectioning.C: new file
4545 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4547 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4549 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4552 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4555 2000-07-17 Juergen Vigna <jug@sad.it>
4557 * src/tabular.C (Validate): check if array-package is needed.
4558 (SetVAlignment): added support for vertical alignment.
4559 (SetLTFoot): better support for longtable header/footers
4560 (Latex): modified to support added features.
4562 * src/LaTeXFeatures.[Ch]: added array-package.
4564 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4566 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4569 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4571 * configure.in: do not forget to put a space after -isystem.
4573 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4575 * lib/kbd/arabic.kmap: a few fixes.
4577 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4579 * some whitespace chagnes to a number of files.
4581 * src/support/DebugStream.h: change to make it easier for
4582 doc++ to parse correctly.
4583 * src/support/lyxstring.h: ditto
4585 * src/mathed/math_utils.C (compara): change to have only one
4587 (MathedLookupBOP): change because of the above.
4589 * src/mathed/math_delim.C (math_deco_compare): change to have only
4591 (search_deco): change becasue of the above.
4593 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4594 instead of manually coded one.
4596 * src/insets/insetquotes.C (Read): read the \end_inset too
4598 * src/insets/insetlatex.h: remove file
4599 * src/insets/insetlatex.C: remove file
4601 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4603 (InsetPrintIndex): remove destructor
4605 * src/insets/insetinclude.h: remove default constructor
4607 * src/insets/insetfloat.C: work to make it work better
4609 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4611 * src/insets/insetcite.h (InsetCitation): remove default constructor
4613 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4615 * src/text.C (GetColumnNearX): comment out some currently unused code.
4617 * src/paragraph.C (writeFile): move some initializations closer to
4619 (CutIntoMinibuffer): small change to use new matchIT operator
4623 (InsertInset): ditto
4626 (InsetIterator): ditto
4627 (Erase): small change to use new matchFT operator
4629 (GetFontSettings): ditto
4630 (HighestFontInRange): ditto
4633 * src/lyxparagraph.h: some chars changed to value_type
4634 (matchIT): because of some stronger checking (perhaps too strong)
4635 in SGI STL, the two operator() unified to one.
4638 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4640 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4641 the last inset read added
4642 (parseSingleLyXformat2Token): some more (future) compability code added
4643 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4644 (parseSingleLyXformat2Token): set last_inset_read
4645 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4646 (parseSingleLyXformat2Token): don't double intializw string next_token
4648 * src/TextCache.C (text_fits::operator()): add const's to the signature
4649 (has_buffer::operator()): ditto
4651 * src/Floating.h: add some comments on the class
4653 * src/FloatList.[Ch] (typeExist): new method
4656 * src/BackStack.h: added default constructor, wanted by Gcc.
4658 2000-07-14 Juergen Vigna <jug@sad.it>
4660 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4662 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4664 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4665 do a redraw when the window is resized!
4666 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4668 * src/insets/insettext.C (resizeLyXText): added function to correctly
4669 being able to resize the LyXWindow.
4671 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4673 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4675 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4676 crashes when closing dialog to a deleted inset.
4678 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4679 method! Now similar to other insets.
4681 2000-07-13 Juergen Vigna <jug@sad.it>
4683 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4685 * lib/examples/Literate.lyx: small patch!
4687 * src/insets/insetbib.C (Read): added this function because of wrong
4688 Write (without [begin|end]_inset).
4690 2000-07-11 Juergen Vigna <jug@sad.it>
4692 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4693 as the insertInset could not be good!
4695 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4696 the bool param should not be last.
4698 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4700 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4701 did submit that to Karl).
4703 * configure.in: use -isystem instead of -I for X headers. This
4704 fixes a problem on solaris with a recent gcc;
4705 put the front-end code after the X detection code;
4706 configure in sigc++ before lib/
4708 * src/lyx_main.C (commandLineHelp): remove -display from command
4711 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4713 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4714 Also put in Makefile rules for building the ``listerrors''
4715 program for parsing errors from literate programs written in LyX.
4717 * lib/build-listerrors: Added small shell script as part of compile
4718 process. This builds a working ``listerrors'' binary if noweb is
4719 installed and either 1) the VNC X server is installed on the machine,
4720 or 2) the user is compiling from within a GUI. The existence of a GUI
4721 is necessary to use the ``lyx --export'' feature for now. This
4722 hack can be removed once ``lyx --export'' no longer requires a GUI to
4725 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4727 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4728 now passed back correctly from gcc and placed "under" error
4729 buttons in a Literate LyX source.
4731 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4733 * src/text.C (GetColumnNearX): Better behavior when a RTL
4734 paragraph is ended by LTR text.
4736 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4739 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4741 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4742 true when clipboard is empty.
4744 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4746 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4747 row of the paragraph.
4748 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4749 to prevent calculation of bidi tables
4751 2000-07-07 Juergen Vigna <jug@sad.it>
4753 * src/screen.C (ToggleSelection): added y_offset and x_offset
4756 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4759 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4761 * src/insets/insettext.C: fixed Layout-Display!
4763 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4765 * configure.in: add check for strings.h header.
4767 * src/spellchecker.C: include <strings.h> in order to have a
4768 definition for bzero().
4770 2000-07-07 Juergen Vigna <jug@sad.it>
4772 * src/insets/insettext.C (draw): set the status of the bv->text to
4773 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4775 * src/screen.C (DrawOneRow):
4776 (DrawFromTo): redraw the actual row if something has changed in it
4779 * src/text.C (draw): call an update of the toplevel-inset if something
4780 has changed inside while drawing.
4782 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4784 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4786 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4787 processing inside class.
4789 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4790 processing inside class.
4792 * src/insets/insetindex.h new struct Holder, consistent with other
4795 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4796 citation dialog from main code and placed it in src/frontends/xforms.
4797 Dialog launched through signals instead of callbacks
4799 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4801 * lyx.man: update the options description.
4803 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4805 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4806 handle neg values, set min width to 590, add doc about -display
4808 2000-07-05 Juergen Vigna <jug@sad.it>
4810 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4811 calls to BufferView *.
4813 * src/insets/insettext.C (checkAndActivateInset): small fix non
4814 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4816 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4817 their \end_inset token!
4819 2000-07-04 edscott <edscott@imp.mx>
4821 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4822 lib/lyxrc.example: added option \wheel_jump
4824 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4826 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4827 remove support for -width,-height,-xpos and -ypos.
4829 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4831 * src/encoding.[Ch]: New files.
4833 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4834 (text): Call to the underline() method only when needed.
4836 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4838 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4839 encoding(s) for the document.
4841 * src/bufferparams.C (BufferParams): Changed default value of
4844 * src/language.C (newLang): Removed.
4845 (items[]): Added encoding information for all defined languages.
4847 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4848 encoding choice button.
4850 * src/lyxrc.h (font_norm_type): New member variable.
4851 (set_font_norm_type): New method.
4853 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4854 paragraphs with different encodings.
4856 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4857 (TransformChar): Changed to work correctly with Arabic points.
4858 (draw): Added support for drawing Arabic points.
4859 (draw): Removed code for drawing underbars (this is done by
4862 * src/support/textutils.h (IsPrintableNonspace): New function.
4864 * src/BufferView_pimpl.h: Added "using SigC::Object".
4865 * src/LyXView.h: ditto.
4867 * src/insets/insetinclude.h (include_label): Changed to mutable.
4869 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4871 * src/mathed/math_iter.h: remove empty destructor
4873 * src/mathed/math_cursor.h: remove empty destructor
4875 * src/insets/lyxinset.h: add THEOREM_CODE
4877 * src/insets/insettheorem.[Ch]: new files
4879 * src/insets/insetminipage.C: (InsertInset): remove
4881 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4883 (InsertInset): remove
4885 * src/insets/insetlist.C: (InsertList): remove
4887 * src/insets/insetfootlike.[Ch]: new files
4889 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4892 (InsertInset): ditto
4894 * src/insets/insetert.C: remove include Painter.h, reindent
4895 (InsertInset): move to header
4897 * src/insets/insetcollapsable.h: remove explicit from default
4898 contructor, remove empty destructor, add InsertInset
4900 * src/insets/insetcollapsable.C (InsertInset): new func
4902 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4904 * src/vspace.h: add explicit to constructor
4906 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4907 \textcompwordmark, please test this.
4909 * src/lyxrc.C: set ascii_linelen to 65 by default
4911 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4913 * src/commandtags.h: add LFUN_INSET_THEOREM
4915 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4916 (makeLinuxDocFile): remove _some_ of the nice logic
4917 (makeDocBookFile): ditto
4919 * src/Painter.[Ch]: (~Painter): removed
4921 * src/LyXAction.C (init): entry for insettheorem added
4923 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4925 (deplog): code to detect files generated by LaTeX, needs testing
4928 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4930 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4932 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4934 * src/LaTeX.C (deplog): Add a check for files that are going to be
4935 created by the first latex run, part of the project to remove the
4938 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4939 contents to the extension list.
4941 2000-07-04 Juergen Vigna <jug@sad.it>
4943 * src/text.C (NextBreakPoint): added support for needFullRow()
4945 * src/insets/lyxinset.h: added needFullRow()
4947 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4950 * src/insets/insettext.C: lots of changes for update!
4952 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4954 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4956 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4958 * src/insets/insetinclude.C (InsetInclude): fixed
4959 initialization of include_label.
4960 (unique_id): now returns a string.
4962 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4964 * src/LaTeXFeatures.h: new member IncludedFiles, for
4965 a map of key, included file name.
4967 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4968 with the included files for inclusion in SGML preamble,
4969 i. e., linuxdoc and docbook.
4972 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4973 nice (is the generated linuxdoc code to be exported?), that
4974 allows to remove column, and only_body that will be true for
4975 slave documents. Insets are allowed inside SGML font type.
4976 New handling of the SGML preamble for included files.
4977 (makeDocBookFile): the same for docbook.
4979 * src/insets/insetinclude.h:
4980 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4982 (DocBook): new export methods.
4984 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4985 and makeDocBookFile.
4987 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4988 formats to export with command line argument -x.
4990 2000-06-29 Juergen Vigna <jug@sad.it>
4992 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4993 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4995 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4996 region could already been cleared by an inset!
4998 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5000 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5003 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5005 (cursorToggle): remove special handling of lyx focus.
5007 2000-06-28 Juergen Vigna <jug@sad.it>
5009 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5012 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5014 * src/insets/insetindex.C (Edit): add a callback when popup is
5017 * src/insets/insettext.C (LocalDispatch):
5018 * src/insets/insetmarginal.h:
5019 * src/insets/insetlist.h:
5020 * src/insets/insetfoot.h:
5021 * src/insets/insetfloat.h:
5022 * src/insets/insetert.h: add a missing std:: qualifier.
5024 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5026 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5029 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5031 * src/insets/insettext.C (Read): remove tmptok unused variable
5032 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5033 (InsertInset): change for new InsetInset code
5035 * src/insets/insettext.h: add TEXT inline method
5037 * src/insets/insettext.C: remove TEXT macro
5039 * src/insets/insetmarginal.C (Write): new method
5040 (Latex): change output slightly
5042 * src/insets/insetfoot.C (Write): new method
5043 (Latex): change output slightly (don't use endl when no need)
5045 * src/insets/insetert.C (Write): new method
5047 * src/insets/insetcollapsable.h: make button_length, button_top_y
5048 and button_bottm_y protected.
5050 * src/insets/insetcollapsable.C (Write): simplify code by using
5051 tostr. Also do not output the float name, the children class
5052 should to that to get control over own arguments
5054 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5055 src/insets/insetminipage.[Ch]:
5058 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5060 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5062 * src/Makefile.am (lyx_SOURCES): add the new files
5064 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5065 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5066 * src/commandtags.h: ditto
5068 * src/LaTeXFeatures.h: add a std::set of used floattypes
5070 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5072 * src/FloatList.[Ch] src/Floating.h: new files
5074 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5076 * src/lyx_cb.C (TableApplyCB): ditto
5078 * src/text2.C: ditto
5079 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5080 (parseSingleLyXformat2Token): ditto + add code for
5081 backwards compability for old float styles + add code for new insets
5083 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5085 (InsertInset(size_type, Inset *, LyXFont)): new method
5086 (InsetChar(size_type, char)): changed to use the other InsetChar
5087 with a LyXFont(ALL_INHERIT).
5088 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5089 insert the META_INSET.
5091 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5093 * sigc++/thread.h (Threads): from here
5095 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5096 definition out of line
5097 * sigc++/scope.h: from here
5099 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5101 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5102 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5104 * Makefile.am (bindist): new target.
5106 * INSTALL: add instructions for doing a binary distribution.
5108 * development/tools/README.bin.example: update a bit.
5110 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5113 * lib/lyxrc.example: new lyxrc tag \set_color.
5115 * src/lyxfunc.C (Dispatch):
5116 * src/commandtags.h:
5117 * src/LyXAction.C: new lyxfunc "set-color".
5119 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5120 and an x11name given as strings.
5122 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5123 cache when a color is changed.
5125 2000-06-26 Juergen Vigna <jug@sad.it>
5127 * src/lyxrow.C (width): added this functions and variable.
5129 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5132 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5134 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5136 * images/undo_bw.xpm: new icon.
5137 * images/redo_bw.xpm: ditto.
5139 * configure.in (INSTALL_SCRIPT): change value to
5140 ${INSTALL} to avoid failures of install-script target.
5141 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5143 * src/BufferView.h: add a magic "friend" declaration to please
5146 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5148 * forms/cite.fd: modified to allow resizing without messing
5151 * src/insetcite.C: Uses code from cite.fd almost without
5153 User can now resize dialog in the x-direction.
5154 Resizing the dialog in the y-direction is prevented, as the
5155 code does this intelligently already.
5157 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5159 * INSTALL: remove obsolete entry in "problems" section.
5161 * lib/examples/sl_*.lyx: update of the slovenian examples.
5163 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5165 2000-06-23 Juergen Vigna <jug@sad.it>
5167 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5169 * src/buffer.C (resize): delete the LyXText of textinsets.
5171 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5173 * src/insets/lyxinset.h: added another parameter 'cleared' to
5174 the draw() function.
5176 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5177 unlocking inset in inset.
5179 2000-06-22 Juergen Vigna <jug@sad.it>
5181 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5182 of insets and moved first to LyXText.
5184 * src/mathed/formulamacro.[Ch]:
5185 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5187 2000-06-21 Juergen Vigna <jug@sad.it>
5189 * src/text.C (GetVisibleRow): look if I should clear the area or not
5190 using Inset::doClearArea() function.
5192 * src/insets/lyxinset.h: added doClearArea() function and
5193 modified draw(Painter &, ...) to draw(BufferView *, ...)
5195 * src/text2.C (UpdateInset): return bool insted of int
5197 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5199 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5200 combox in the character popup
5202 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5203 BufferParams const & params
5205 2000-06-20 Juergen Vigna <jug@sad.it>
5207 * src/insets/insettext.C (SetParagraphData): set insetowner on
5210 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5212 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5213 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5215 (form_main_): remove
5217 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5218 (create_form_form_main): remove FD_form_main stuff, connect to
5219 autosave_timeout signal
5221 * src/LyXView.[Ch] (getMainForm): remove
5222 (UpdateTimerCB): remove
5223 * src/BufferView_pimpl.h: inherit from SigC::Object
5225 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5226 signal instead of callback
5228 * src/BufferView.[Ch] (cursorToggleCB): remove
5230 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5232 * src/BufferView_pimpl.C: changes because of the one below
5234 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5235 instead of storing a pointer to a LyXText.
5237 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5239 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5241 * src/lyxparagraph.h
5243 * src/paragraph.C: Changed fontlist to a sorted vector.
5245 2000-06-19 Juergen Vigna <jug@sad.it>
5247 * src/BufferView.h: added screen() function.
5249 * src/insets/insettext.C (LocalDispatch): some selection code
5252 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5254 * src/insets/insettext.C (SetParagraphData):
5256 (InsetText): fixes for multiple paragraphs.
5258 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5260 * development/lyx.spec.in: Call configure with ``--without-warnings''
5261 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5262 This should be fine, however, since we generally don't want to be
5263 verbose when making an RPM.
5265 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5267 * lib/scripts/fig2pstex.py: New file
5269 2000-06-16 Juergen Vigna <jug@sad.it>
5271 * src/insets/insettabular.C (UpdateLocal):
5272 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5273 (LocalDispatch): Changed all functions to use LyXText.
5275 2000-06-15 Juergen Vigna <jug@sad.it>
5277 * src/text.C (SetHeightOfRow): call inset::update before requesting
5280 * src/insets/insettext.C (update):
5281 * src/insets/insettabular.C (update): added implementation
5283 * src/insets/lyxinset.h: added update function
5285 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5287 * src/text.C (SelectNextWord): protect against null pointers with
5288 old-style string streams. (fix from Paul Theo Gonciari
5291 * src/cite.[Ch]: remove erroneous files.
5293 * lib/configure.m4: update the list of created directories.
5295 * src/lyxrow.C: include <config.h>
5296 * src/lyxcursor.C: ditto.
5298 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5300 * lib/examples/decimal.lyx: new example file from Mike.
5302 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5303 to find template definitions (from Dekel)
5305 * src/frontends/.cvsignore: add a few things.
5307 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5309 * src/Timeout.C (TimeOut): remove default argument.
5311 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5314 * src/insets/ExternalTemplate.C: add a "using" directive.
5316 * src/lyx_main.h: remove the act_ struct, which seems unused
5319 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5321 * LyX Developers Meeting: All files changed, due to random C++ (by
5322 coincidence) code generator script.
5324 - external inset (cool!)
5325 - initial online editing of preferences
5326 - insettabular breaks insettext(s contents)
5328 - some DocBook fixes
5329 - example files update
5330 - other cool stuff, create a diff and look for yourself.
5332 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5334 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5335 -1 this is a non-line-breaking textinset.
5337 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5338 if there is no width set.
5340 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5342 * Lots of files: Merged the dialogbase branch.
5344 2000-06-09 Allan Rae <rae@lyx.org>
5346 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5347 and the Dispatch methods that used it.
5349 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5350 access to functions formerly kept in Dispatch.
5352 2000-05-19 Allan Rae <rae@lyx.org>
5354 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5355 made to_page and count_copies integers again. from_page remains a
5356 string however because I want to allow entry of a print range like
5357 "1,4,22-25" using this field.
5359 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5360 and printer-params-get. These aren't useful from the minibuffer but
5361 could be used by a script/LyXServer app provided it passes a suitable
5362 auto_mem_buffer. I guess I should take a look at how the LyXServer
5363 works and make it support xtl buffers.
5365 * sigc++/: updated to libsigc++-1.0.1
5367 * src/xtl/: updated to xtl-1.3.pl.11
5369 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5370 those changes done to the files in src/ are actually recreated when
5371 they get regenerated. Please don't ever accept a patch that changes a
5372 dialog unless that patch includes the changes to the corresponding *.fd
5375 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5376 stringOnlyContains, renamed it and generalised it.
5378 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5379 branch. Removed the remaining old form_print code.
5381 2000-04-26 Allan Rae <rae@lyx.org>
5383 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5384 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5386 2000-04-25 Allan Rae <rae@lyx.org>
5388 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5389 against a base of xtl-1.3.pl.4
5391 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5392 filter the Id: entries so they still show the xtl version number
5395 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5396 into the src/xtl code. Patch still pending with José (XTL)
5398 2000-04-24 Allan Rae <rae@lyx.org>
5400 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5401 both more generic and much safer. Use the new template functions.
5402 * src/buffer.[Ch] (Dispatch): ditto.
5404 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5405 and mem buffer more intelligently. Also a little general cleanup.
5408 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5409 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5410 * src/xtl/Makefile.am: ditto.
5411 * src/xtl/.cvsignore: ditto.
5412 * src/Makefile.am: ditto.
5414 * src/PrinterParams.h: Removed the macros member functions. Added a
5415 testInvariant member function. A bit of tidying up and commenting.
5416 Included Angus's idea for fixing operation with egcs-1.1.2.
5418 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5419 cool expansion of XTL's mem_buffer to support automatic memory
5420 management within the buffer itself. Removed the various macros and
5421 replaced them with template functions that use either auto_mem_buffer
5422 or mem_buffer depending on a #define. The mem_buffer support will
5423 disappear as soon as the auto_mem_buffer is confirmed to be good on
5424 other platforms/compilers. That is, it's there so you've got something
5427 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5428 effectively forked XTL. However I expect José will include my code
5429 into the next major release. Also fixed a memory leak.
5430 * src/xtl/text.h: ditto.
5431 * src/xtl/xdr.h: ditto.
5432 * src/xtl/giop.h: ditto.
5434 2000-04-16 Allan Rae <rae@lyx.org>
5436 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5437 by autogen.sh and removed by maintainer-clean anyway.
5438 * .cvsignore, sigc++/.cvsignore: Support the above.
5440 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5442 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5444 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5445 macros, renamed static callback-target member functions to suit new
5446 scheme and made them public.
5447 * src/frontends/xforms/forms/form_print.fd: ditto.
5448 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5450 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5453 * src/xtl/: New directory containing a minimal distribution of XTL.
5454 This is XTL-1.3.pl.4.
5456 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5458 2000-04-15 Allan Rae <rae@lyx.org>
5460 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5462 * sigc++/: Updated to libsigc++-1.0.0
5464 2000-04-14 Allan Rae <rae@lyx.org>
5466 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5467 use the generic ones in future. I'll modify my conversion script.
5469 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5471 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5472 (CloseAllBufferRelatedDialogs): Renamed.
5473 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5475 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5476 of the generic ones. These are the same ones my conversion script
5479 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5480 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5481 * src/buffer.C (Dispatch): ditto
5483 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5484 functions for updating and hiding buffer dependent dialogs.
5485 * src/BufferView.C (buffer): ditto
5486 * src/buffer.C (setReadonly): ditto
5487 * src/lyxfunc.C (CloseBuffer): ditto
5489 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5490 Dialogs.h, and hence all the SigC stuff, into every file that includes
5491 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5493 * src/BufferView2.C: reduce the number of headers included by buffer.h
5495 2000-04-11 Allan Rae <rae@lyx.org>
5497 * src/frontends/xforms/xform_macros.h: A small collection of macros
5498 for building C callbacks.
5500 * src/frontends/xforms/Makefile.am: Added above file.
5502 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5503 scheme again. This time it should work for JMarc. If this is
5504 successful I'll revise my conversion script to automate some of this.
5505 The static member functions in the class also have to be public for
5506 this scheme will work. If the scheme works (it's almost identical to
5507 the way BufferView::cursorToggleCB is handled so it should work) then
5508 FormCopyright and FormPrint will be ready for inclusion into the main
5509 trunk immediately after 1.1.5 is released -- provided we're prepared
5510 for complaints about lame compilers not handling XTL.
5512 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5514 2000-04-07 Allan Rae <rae@lyx.org>
5516 * config/lyxinclude.m4: A bit more tidying up (Angus)
5518 * src/LString.h: JMarc's <string> header fix
5520 * src/PrinterParams.h: Used string for most data to remove some
5521 ugly code in the Print dialog and avoid even uglier code when
5522 appending the ints to a string for output.
5524 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5525 and moved "default:" back to the end of switch statement. Cleaned
5526 up the printing so it uses the right function calls and so the
5527 "print to file" option actually puts the file in the right directory.
5529 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5531 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5532 and Ok+Apply button control into a separate method: input (Angus).
5533 (input) Cleaned it up and improved it to be very thorough now.
5534 (All CB) static_cast used instead of C style cast (Angus). This will
5535 probably change again once we've worked out how to keep gcc-2.8.1 happy
5536 with real C callbacks.
5537 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5538 ignore some of the bool settings and has random numbers instead. Needs
5539 some more investigation. Added other input length checks and checking
5540 of file and printer names.
5542 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5543 would link (Angus). Seems the old code doesn't compile with the pragma
5544 statement either. Separated callback entries from internal methods.
5546 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5548 2000-03-17 Allan Rae <rae@lyx.org>
5550 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5551 need it? Maybe it could go in Dialogs instead? I could make it a
5552 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5553 values to get the bool return value.
5554 (Dispatch): New overloaded method for xtl support.
5556 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5557 extern "C" callback instead of static member functions. Hopefully,
5558 JMarc will be able to compile this. I haven't changed
5559 forms/form_copyright.fd yet. Breaking one of my own rules already.
5561 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5562 because they aren't useful from the minibuffer. Maybe a LyXServer
5563 might want a help message though?
5565 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5567 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5568 xtl which needs both rtti and exceptions.
5570 * src/support/Makefile.am:
5571 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5573 * src/frontends/xforms/input_validators.[ch]: input filters and
5574 validators. These conrol what keys are valid in input boxes.
5575 Use them and write some more. Much better idea than waiting till
5576 after the user has pressed Ok to say that the input fields don't make
5579 * src/frontends/xforms/Makefile.am:
5580 * src/frontends/xforms/forms/form_print.fd:
5581 * src/frontends/xforms/forms/makefile:
5582 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5583 new scheme. Still have to make sure I haven't missed anything from
5584 the current implementation.
5586 * src/Makefile.am, src/PrinterParams.h: New data store.
5588 * other files: Added a couple of copyright notices.
5590 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5592 * src/insets/insetbib.h: move Holder struct in public space.
5594 * src/frontends/include/DialogBase.h: use SigC:: only when
5595 SIGC_CXX_NAMESPACES is defined.
5596 * src/frontends/include/Dialogs.h: ditto.
5598 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5600 * src/frontends/xforms/FormCopyright.[Ch]: do not
5601 mention SigC:: explicitely.
5603 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5605 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5606 deals with testing KDE in main configure.in
5607 * configure.in: ditto.
5609 2000-02-22 Allan Rae <rae@lyx.org>
5611 * Lots of files: Merged from HEAD
5613 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5614 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5616 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5618 * sigc++/: new minidist.
5620 2000-02-14 Allan Rae <rae@lyx.org>
5622 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5624 2000-02-08 Juergen Vigna <jug@sad.it>
5626 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5627 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5629 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5630 for this port and so it is much easier for other people to port
5631 dialogs in a common development environment.
5633 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5634 the QT/KDE implementation.
5636 * src/frontends/kde/Dialogs.C:
5637 * src/frontends/kde/FormCopyright.C:
5638 * src/frontends/kde/FormCopyright.h:
5639 * src/frontends/kde/Makefile.am:
5640 * src/frontends/kde/formcopyrightdialog.C:
5641 * src/frontends/kde/formcopyrightdialog.h:
5642 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5643 for the kde support of the Copyright-Dialog.
5645 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5646 subdir-substitution instead of hardcoded 'xforms' as we now have also
5649 * src/frontends/include/DialogBase.h (Object): just commented the
5650 label after #endif (nasty warning and I don't like warnings ;)
5652 * src/main.C (main): added KApplication initialization if using
5655 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5656 For now only the KDE event-loop is added if frontend==kde.
5658 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5660 * configure.in: added support for the --with-frontend[=value] option
5662 * autogen.sh: added kde.m4 file to list of config-files
5664 * acconfig.h: added define for KDEGUI-support
5666 * config/kde.m4: added configuration functions for KDE-port
5668 * config/lyxinclude.m4: added --with-frontend[=value] option with
5669 support for xforms and KDE.
5671 2000-02-08 Allan Rae <rae@lyx.org>
5673 * all Makefile.am: Fixed up so the make targets dist, distclean,
5674 install and uninstall all work even if builddir != srcdir. Still
5675 have a new sigc++ minidist update to come.
5677 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5679 2000-02-01 Allan Rae <rae@lyx.org>
5681 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5682 Many mods to get builddir != srcdir working.
5684 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5685 for building on NT and so we can do the builddir != srcdir stuff.
5687 2000-01-30 Allan Rae <rae@lyx.org>
5689 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5690 This will stay in "rae" branch. We probably don't really need it in
5691 the main trunk as anyone who wants to help programming it should get
5692 a full library installed also. So they can check both included and
5693 system supplied library compilation.
5695 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5696 Added a 'mini' distribution of libsigc++. If you feel the urge to
5697 change something in these directories - Resist it. If you can't
5698 resist the urge then you should modify the following script and rebuild
5699 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5700 all happen. Still uses a hacked version of libsigc++'s configure.in.
5701 I'm quite happy with the results. I'm not sure the extra work to turn
5702 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5703 worth the trouble and would probably lead to extra maintenance
5705 I haven't tested the following important make targets: install, dist.
5706 Not ready for prime time but very close. Maybe 1.1.5.
5708 * development/tools/makeLyXsigc.sh: A shell script to automatically
5709 generate our mini-dist of libsigc++. It can only be used with a CVS
5710 checkout of libsigc++ not a tarball distribution. It's well commented.
5711 This will end up as part of the libsigc++ distribution so other apps
5712 can easily have an included mini-dist. If someone makes mods to the
5713 sigc++ subpackage without modifying this script to generate those
5714 changes I'll be very upset!
5716 * src/frontends/: Started the gui/system indep structure.
5718 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5719 to access the gui-indep dialogs are in this class. Much improved
5720 design compared to previous revision. Lars, please refrain from
5721 moving this header into src/ like you did with Popups.h last time.
5723 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5725 * src/frontends/xforms/: Started the gui-indep system with a single
5726 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5729 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5730 Here you'll find a very useful makefile and automated fdfix.sh that
5731 makes updating dailogs a no-brainer -- provided you follow the rules
5732 set out in the README. I'm thinking about adding another script to
5733 automatically generate skeleton code for a new dialog given just the
5736 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5737 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5738 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5740 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5742 * src/support/LSubstring.C (operator): simplify
5744 * src/lyxtext.h: removed bparams, use buffer_->params instead
5746 * src/lyxrow.h: make Row a real class, move all variables to
5747 private and use accessors.
5749 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5751 (isRightToLeftPar): ditto
5752 (ChangeLanguage): ditto
5753 (isMultiLingual): ditto
5756 (SimpleTeXOnePar): ditto
5757 (TeXEnvironment): ditto
5758 (GetEndLabel): ditto
5760 (SetOnlyLayout): ditto
5761 (BreakParagraph): ditto
5762 (BreakParagraphConservative): ditto
5763 (GetFontSettings): ditto
5765 (CopyIntoMinibuffer): ditto
5766 (CutIntoMinibuffer): ditto
5767 (PasteParagraph): ditto
5768 (SetPExtraType): ditto
5769 (UnsetPExtraType): ditto
5770 (DocBookContTableRows): ditto
5771 (SimpleDocBookOneTablePar): ditto
5773 (TeXFootnote): ditto
5774 (SimpleTeXOneTablePar): ditto
5775 (TeXContTableRows): ditto
5776 (SimpleTeXSpecialChars): ditto
5779 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5780 to private and use accessors.
5782 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5783 this, we did not use it anymore and has not been for ages. Just a
5784 waste of cpu cycles.
5786 * src/language.h: make Language a real class, move all variables
5787 to private and use accessors.
5789 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5790 (create_view): remove
5791 (update): some changes for new timer
5792 (cursorToggle): use new timer
5793 (beforeChange): change for new timer
5795 * src/BufferView.h (cursorToggleCB): removed last paramter because
5798 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5799 (cursorToggleCB): change because of new timer code
5801 * lib/CREDITS: updated own mailaddress
5803 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5805 * src/support/filetools.C (PutEnv): fix the code in case neither
5806 putenv() nor setenv() have been found.
5808 * INSTALL: mention the install-strip Makefile target.
5810 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5811 read-only documents.
5813 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5815 * lib/reLyX/configure.in (VERSION): avoid using a previously
5816 generated reLyX wrapper to find out $prefix.
5818 * lib/examples/eu_adibide_lyx-atua.lyx:
5819 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5820 translation of the Tutorial (Dooteo)
5822 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5824 * forms/cite.fd: new citation dialog
5826 * src/insetcite.[Ch]: the new citation dialog is moved into
5829 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5832 * src/insets/insetcommand.h: data members made private.
5834 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5836 * LyX 1.1.5 released
5838 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5840 * src/version.h (LYX_RELEASE): to 1.1.5
5842 * src/spellchecker.C (RunSpellChecker): return false if the
5843 spellchecker dies upon creation.
5845 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5847 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5848 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5852 * lib/CREDITS: update entry for Martin Vermeer.
5854 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5856 * src/text.C (draw): Draw foreign language bars at the bottom of
5857 the row instead of at the baseline.
5859 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5861 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5863 * lib/bind/de_menus.bind: updated
5865 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5867 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5869 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5871 * src/menus.C (Limit_string_length): New function
5872 (ShowTocMenu): Limit the number of items/length of items in the
5875 * src/paragraph.C (String): Correct result for a paragraph inside
5878 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5880 * src/bufferlist.C (close): test of buf->getuser() == NULL
5882 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5884 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5885 Do not call to SetCursor when the paragraph is a closed footnote!
5887 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5889 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5892 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5894 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5897 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5898 reference popup, that activates the reference-back action
5900 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5902 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5903 the menus. Also fixed a bug.
5905 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5906 the math panels when switching buffers (unless new buffer is readonly).
5908 * src/BufferView.C (NoSavedPositions)
5909 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5911 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5913 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5914 less of dvi dirty or not.
5916 * src/trans_mgr.[Ch] (insert): change first parameter to string
5919 * src/chset.[Ch] (encodeString): add const to first parameter
5921 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5923 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5927 * src/LaTeX.C (deplog): better searching for dependency files in
5928 the latex log. Uses now regexps.
5930 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5931 instead of the box hack or \hfill.
5933 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5935 * src/lyxfunc.C (doImportHelper): do not create the file before
5936 doing the actual import.
5937 (doImportASCIIasLines): create a new file before doing the insert.
5938 (doImportASCIIasParagraphs): ditto.
5940 * lib/lyxrc.example: remove mention of non-existing commands
5942 * lyx.man: remove mention of color-related switches.
5944 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5946 * src/lyx_gui.C: remove all the color-related ressources, which
5947 are not used anymore.
5949 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5952 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5954 * src/lyxrc.C (read): Add a missing break in the switch
5956 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5958 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5960 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5963 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5965 * src/text.C (draw): draw bars under foreign language words.
5967 * src/LColor.[Ch]: add LColor::language
5969 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5971 * src/lyxcursor.h (boundary): New member variable
5973 * src/text.C (IsBoundary): New methods
5975 * src/text.C: Use the above for currect cursor movement when there
5976 is both RTL & LTR text.
5978 * src/text2.C: ditto
5980 * src/bufferview_funcs.C (ToggleAndShow): ditto
5982 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5984 * src/text.C (DeleteLineForward): set selection to true to avoid
5985 that DeleteEmptyParagraphMechanism does some magic. This is how it
5986 is done in all other functions, and seems reasonable.
5987 (DeleteWordForward): do not jump over non-word stuff, since
5988 CursorRightOneWord() already does it.
5990 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5991 DeleteWordBackward, since they seem safe to me (since selection is
5992 set to "true") DeleteEmptyParagraphMechanism does nothing.
5994 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5996 * src/lyx_main.C (easyParse): simplify the code by factoring the
5997 part that removes parameters from the command line.
5998 (LyX): check wether wrong command line options have been given.
6000 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6002 * src/lyx_main.C : add support for specifying user LyX
6003 directory via command line option -userdir.
6005 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6007 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6008 the number of items per popup.
6009 (Add_to_refs_menu): Ditto.
6011 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6013 * src/lyxparagraph.h: renamed ClearParagraph() to
6014 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6015 textclass as parameter, and do nothing if free_spacing is
6016 true. This fixes part of the line-delete-forward problems.
6018 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6019 (pasteSelection): ditto.
6020 (SwitchLayoutsBetweenClasses): more translatable strings.
6022 * src/text2.C (CutSelection): use StripLeadingSpaces.
6023 (PasteSelection): ditto.
6024 (DeleteEmptyParagraphMechanism): ditto.
6026 2000-05-26 Juergen Vigna <jug@sad.it>
6028 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6029 is not needed in tabular insets.
6031 * src/insets/insettabular.C (TabularFeatures): added missing features.
6033 * src/tabular.C (DeleteColumn):
6035 (AppendRow): implemented this functions
6036 (cellsturct::operator=): clone the inset too;
6038 2000-05-23 Juergen Vigna <jug@sad.it>
6040 * src/insets/insettabular.C (LocalDispatch): better selection support
6041 when having multicolumn-cells.
6043 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6045 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6047 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6049 * src/ColorHandler.C (getGCForeground): put more test into _()
6051 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6054 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6057 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6059 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6060 there are no labels, or when buffer is readonly.
6062 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6063 there are no labels, buffer is SGML, or when buffer is readonly.
6065 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6067 * src/LColor.C (LColor): change a couple of grey40 to grey60
6068 (LColor): rewore initalization to make compiles go some magnitude
6070 (getGUIName): don't use gettext until we need the string.
6072 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6074 * src/Bullet.[Ch]: Fixed a small bug.
6076 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6078 * src/paragraph.C (String): Several fixes/improvements
6080 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6082 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6084 * src/paragraph.C (String): give more correct output.
6086 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6088 * src/lyxfont.C (stateText) Do not output the language if it is
6089 eqaul to the language of the document.
6091 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6092 between two paragraphs with the same language.
6094 * src/paragraph.C (getParLanguage) Return a correct answer for an
6095 empty dummy paragraph.
6097 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6100 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6103 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6104 the menus/popup, if requested fonts are unavailable.
6106 2000-05-22 Juergen Vigna <jug@sad.it>
6108 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6109 movement support (Up/Down/Tab/Shift-Tab).
6110 (LocalDispatch): added also preliminari cursor-selection.
6112 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6114 * src/paragraph.C (PasteParagraph): Hopefully now right!
6116 2000-05-22 Garst R. Reese <reese@isn.net>
6118 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6119 of list, change all references to Environment to Command
6120 * tex/hollywood.cls : rewrite environments as commands, add
6121 \uppercase to interiorshot and exteriorshot to force uppecase.
6122 * tex/broadway.cls : rewrite environments as commands. Tweak
6125 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6127 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6128 size of items: use a constant intead of the hardcoded 40, and more
6129 importantly do not remove the %m and %x tags added at the end.
6130 (Add_to_refs_menu): use vector::size_type instead of
6131 unsigned int as basic types for the variables. _Please_ do not
6132 assume that size_t is equal to unsigned int. On an alpha, this is
6133 unsigned long, which is _not_ the same.
6135 * src/language.C (initL): remove language "hungarian", since it
6136 seems that "magyar" is better.
6138 2000-05-22 Juergen Vigna <jug@sad.it>
6140 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6142 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6145 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6146 next was deleted but not set to 0.
6148 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6150 * src/language.C (initL): change the initialization of languages
6151 so that compiles goes _fast_.
6153 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6156 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6158 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6162 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6164 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6166 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6170 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6173 * src/insets/insetlo*.[Ch]: Made editable
6175 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6177 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6178 the current selection.
6180 * src/BufferView_pimpl.C (stuffClipboard): new method
6182 * src/BufferView.C (stuffClipboard): new method
6184 * src/paragraph.C (String): new method
6186 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6187 LColor::ignore when lyxname is not found.
6189 * src/BufferView.C (pasteSelection): new method
6191 * src/BufferView_pimpl.C (pasteSelection): new method
6193 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6195 * src/WorkArea.C (request_clipboard_cb): new static function
6196 (getClipboard): new method
6197 (putClipboard): new method
6199 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6201 * LyX 1.1.5pre2 released
6203 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6205 * src/vspace.C (operator=): removed
6206 (operator=): removed
6208 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6210 * src/layout.C (NumberOfClass): manually set the type in make_pair
6211 (NumberOfLayout): ditto
6213 * src/language.C: use the Language constructor for ignore_lang
6215 * src/language.h: add constructors to struct Language
6217 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6219 * src/text2.C (SetCursorIntern): comment out #warning
6221 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6223 * src/mathed/math_iter.h: initialize sx and sw to 0
6225 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6227 * forms/lyx.fd: Redesign of form_ref
6229 * src/LaTeXFeatures.[Ch]
6233 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6236 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6237 and Buffer::inset_iterator.
6239 * src/menus.C: Added new menus: TOC and Refs.
6241 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6243 * src/buffer.C (getTocList): New method.
6245 * src/BufferView2.C (ChangeRefs): New method.
6247 * src/buffer.C (getLabelList): New method. It replaces the old
6248 getReferenceList. The return type is vector<string> instead of
6251 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6252 the old getLabel() and GetNumberOfLabels() methods.
6253 * src/insets/insetlabel.C (getLabelList): ditto
6254 * src/mathed/formula.C (getLabelList): ditto
6256 * src/paragraph.C (String): New method.
6258 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6259 Uses the new getTocList() method.
6260 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6261 which automatically updates the contents of the browser.
6262 (RefUpdateCB): Use the new getLabelList method.
6264 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6266 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6268 * src/spellchecker.C: Added using std::reverse;
6270 2000-05-19 Juergen Vigna <jug@sad.it>
6272 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6274 * src/insets/insettext.C (computeTextRows): small fix for display of
6275 1 character after a newline.
6277 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6280 2000-05-18 Juergen Vigna <jug@sad.it>
6282 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6283 when changing width of column.
6285 * src/tabular.C (set_row_column_number_info): setting of
6286 autobreak rows if necessary.
6288 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6290 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6292 * src/vc-backend.*: renamed stat() to status() and vcstat to
6293 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6294 compilation broke. The new name seems more relevant, anyway.
6296 2000-05-17 Juergen Vigna <jug@sad.it>
6298 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6299 which was wrong if the removing caused removing of rows!
6301 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6302 (pushToken): new function.
6304 * src/text2.C (CutSelection): fix problem discovered with purify
6306 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6308 * src/debug.C (showTags): enlarge the first column, now that we
6309 have 6-digits debug codes.
6311 * lib/layouts/hollywood.layout:
6312 * lib/tex/hollywood.cls:
6313 * lib/tex/brodway.cls:
6314 * lib/layouts/brodway.layout: more commands and fewer
6315 environments. Preambles moved in the .cls files. Broadway now has
6316 more options on scene numbering and less whitespace (from Garst)
6318 * src/insets/insetbib.C (getKeys): make sure that we are in the
6319 document directory, in case the bib file is there.
6321 * src/insets/insetbib.C (Latex): revert bogus change.
6323 2000-05-16 Juergen Vigna <jug@sad.it>
6325 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6326 the TabularLayout on cursor move.
6328 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6330 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6333 (draw): fixed cursor position and drawing so that the cursor is
6334 visible when before the tabular-inset.
6336 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6337 when creating from old insettext.
6339 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6341 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6343 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6344 * lib/tex/brodway.cls: ditto
6346 * lib/layouts/brodway.layout: change alignment of parenthical
6349 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6351 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6352 versions 0.88 and 0.89 are supported.
6354 2000-05-15 Juergen Vigna <jug@sad.it>
6356 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6359 * src/insets/insettext.C (computeTextRows): redone completely this
6360 function in a much cleaner way, because of problems when having a
6362 (draw): added a frame border when the inset is locked.
6363 (SetDrawLockedFrame): this sets if we draw the border or not.
6364 (SetFrameColor): this sets the frame color (default=insetframe).
6366 * src/insets/lyxinset.h: added x() and y() functions which return
6367 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6368 function which is needed to see if we have a locking inset of some
6369 type in this inset (needed for now in insettabular).
6371 * src/vspace.C (inPixels): the same function also without a BufferView
6372 parameter as so it is easier to use it in some ocasions.
6374 * src/lyxfunc.C: changed all places where insertInset was used so
6375 that now if it couldn't be inserted it is deleted!
6377 * src/TabularLayout.C:
6378 * src/TableLayout.C: added support for new tabular-inset!
6380 * src/BufferView2.C (insertInset): this now returns a bool if the
6381 inset was really inserted!!!
6383 * src/tabular.C (GetLastCellInRow):
6384 (GetFirstCellInRow): new helper functions.
6385 (Latex): implemented for new tabular class.
6389 (TeXTopHLine): new Latex() helper functions.
6391 2000-05-12 Juergen Vigna <jug@sad.it>
6393 * src/mathed/formulamacro.C (Read):
6394 * src/mathed/formula.C (Read): read also the \end_inset here!
6396 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6398 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6399 crush when saving formulae with unbalanced parenthesis.
6401 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6403 * src/layout.C: Add new keyword "endlabelstring" to layout file
6405 * src/text.C (GetVisibleRow): Draw endlabel string.
6407 * lib/layouts/broadway.layout
6408 * lib/layouts/hollywood.layout: Added endlabel for the
6409 Parenthetical layout.
6411 * lib/layouts/heb-article.layout: Do not use slanted font shape
6412 for Theorem like environments.
6414 * src/buffer.C (makeLaTeXFile): Always add "american" to
6415 the UsedLanguages list if document language is RTL.
6417 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6419 * add addendum to README.OS2 and small patch (from SMiyata)
6421 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6423 * many files: correct the calls to ChangeExtension().
6425 * src/support/filetools.C (ChangeExtension): remove the no_path
6426 argument, which does not belong there. Use OnlyFileName() instead.
6428 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6429 files when LaTeXing a non-nice latex file.
6431 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6432 a chain of "if". Return false when deadkeys are not handled.
6434 * src/lyx_main.C (LyX): adapted the code for default bindings.
6436 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6437 bindings for basic functionality (except deadkeys).
6438 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6440 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6441 several methods: handle override_x_deadkeys.
6443 * src/lyxrc.h: remove the "bindings" map, which did not make much
6444 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6446 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6448 * src/lyxfont.C (stateText): use a saner method to determine
6449 whether the font is "default". Seems to fix the crash with DEC
6452 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6454 2000-05-08 Juergen Vigna <jug@sad.it>
6456 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6457 TabularLayoutMenu with mouse-button-3
6458 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6460 * src/TabularLayout.C: added this file for having a Layout for
6463 2000-05-05 Juergen Vigna <jug@sad.it>
6465 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6466 recalculating inset-widths.
6467 (TabularFeatures): activated this function so that I can change
6468 tabular-features via menu.
6470 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6471 that I can test some functions with the Table menu.
6473 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6475 * src/lyxfont.C (stateText): guard against stupid c++libs.
6477 * src/tabular.C: add using std::vector
6478 some whitespace changes, + removed som autogenerated code.
6480 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6482 2000-05-05 Juergen Vigna <jug@sad.it>
6484 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6485 row, columns and cellstructures.
6487 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6489 * lib/lyxrc.example: remove obsolete entries.
6491 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6492 reading of protected_separator for free_spacing.
6494 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6496 * src/text.C (draw): do not display an exclamation mark in the
6497 margin for margin notes. This is confusing, ugly and
6500 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6501 AMS math' is checked.
6503 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6504 name to see whether including the amsmath package is needed.
6506 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6508 * src/paragraph.C (validate): Compute UsedLanguages correctly
6509 (don't insert the american language if it doesn't appear in the
6512 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6513 The argument of \thanks{} command is considered moving argument
6515 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6518 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6520 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6521 for appendix/minipage/depth. The lines can be now both in the footnote
6522 frame, and outside the frame.
6524 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6527 2000-05-05 Juergen Vigna <jug@sad.it>
6529 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6530 neede only in tabular.[Ch].
6532 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6534 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6536 (Write): write '~' for PROTECTED_SEPARATOR
6538 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6540 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6543 * src/mathed/formula.C (drawStr): rename size to siz.
6545 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6546 possibly fix a bug by not changing the pflags = flags to piflags =
6549 2000-05-05 Juergen Vigna <jug@sad.it>
6551 * src/insets/insetbib.C: moved using directive
6553 * src/ImportNoweb.C: small fix for being able to compile (missing
6556 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6558 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6559 to use clear, since we don't depend on this in the code. Add test
6562 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6564 * (various *.C files): add using std::foo directives to please dec
6567 * replace calls to string::clear() to string::erase() (Angus)
6569 * src/cheaders/cmath: modified to provide std::abs.
6571 2000-05-04 Juergen Vigna <jug@sad.it>
6573 * src/insets/insettext.C: Prepared all for inserting of multiple
6574 paragraphs. Still display stuff to do (alignment and other things),
6575 but I would like to use LyXText to do this when we cleaned out the
6576 table-support stuff.
6578 * src/insets/insettabular.C: Changed lot of stuff and added lots
6579 of functionality still a lot to do.
6581 * src/tabular.C: Various functions changed name and moved to be
6582 const functions. Added new Read and Write functions and changed
6583 lots of things so it works good with tabular-insets (also removed
6584 some stuff which is not needed anymore * hacks *).
6586 * src/lyxcursor.h: added operators == and != which just look if
6587 par and pos are (not) equal.
6589 * src/buffer.C (latexParagraphs): inserted this function to latex
6590 all paragraphs form par to endpar as then I can use this too for
6593 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6594 so that I can call this to from text insets with their own cursor.
6596 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6597 output off all paragraphs (because of the fix below)!
6599 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6600 the very last paragraph (this could be also the last paragraph of an
6603 * src/texrow.h: added rows() call which returns the count-variable.
6605 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6607 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6609 * lib/configure.m4: better autodetection of DocBook tools.
6611 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6613 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6615 * src/lyx_cb.C: add using std::reverse;
6617 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6620 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6621 selected files. Should fix repeated errors from generated files.
6623 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6625 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6627 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6628 the spellchecker popup.
6630 * lib/lyxrc.example: Removed the \number_inset section
6632 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6634 * src/insets/figinset.C (various): Use IsFileReadable() to make
6635 sure that the file actually exist. Relying on ghostscripts errors
6636 is a bad idea since they can lead to X server crashes.
6638 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6640 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6643 * lib/lyxrc.example: smallish typo in description of
6644 \view_dvi_paper_option
6646 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6649 * src/lyxfunc.C: doImportHelper to factor out common code of the
6650 various import methods. New functions doImportASCIIasLines,
6651 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6652 doImportLinuxDoc for the format specific parts.
6655 * buffer.C: Dispatch returns now a bool to indicate success
6658 * lyx_gui.C: Add getLyXView() for member access
6660 * lyx_main.C: Change logic for batch commands: First try
6661 Buffer::Dispatch (possibly without GUI), if that fails, use
6664 * lyx_main.C: Add support for --import command line switch.
6665 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6666 Available Formats: Everything accepted by 'buffer-import <format>'
6668 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6670 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6673 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6674 documents will be reformatted upon reentry.
6676 2000-04-27 Juergen Vigna <jug@sad.it>
6678 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6679 correctly only last pos this was a bug.
6681 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6683 * release of lyx-1.1.5pre1
6685 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6687 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6689 * src/menus.C: revert the change of naming (Figure->Graphic...)
6690 from 2000-04-11. It was incomplete and bad.
6692 * src/LColor.[Ch]: add LColor::depthbar.
6693 * src/text.C (GetVisibleRow): use it.
6695 * README: update the languages list.
6697 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6699 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6702 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6704 * README: remove sections that were just wrong.
6706 * src/text2.C (GetRowNearY): remove currentrow code
6708 * src/text.C (GetRow): remove currentrow code
6710 * src/screen.C (Update): rewritten a bit.
6711 (SmallUpdate): removed func
6713 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6715 (FullRebreak): return bool
6716 (currentrow): remove var
6717 (currentrow_y): ditto
6719 * src/lyxscreen.h (Draw): change arg to unsigned long
6720 (FitCursor): return bool
6721 (FitManualCursor): ditto
6722 (Smallpdate): remove func
6723 (first): change to unsigned long
6724 (DrawOneRow): change second arg to long (from long &)
6725 (screen_refresh_y): remove var
6726 (scree_refresh_row): ditto
6728 * src/lyxrow.h: change baseline to usigned int from unsigned
6729 short, this brings some implicit/unsigned issues out in the open.
6731 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6733 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6734 instead of smallUpdate.
6736 * src/lyxcursor.h: change y to unsigned long
6738 * src/buffer.h: don't call updateScrollbar after fitcursor
6740 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6741 where they are used. Removed "\\direction", this was not present
6742 in 1.1.4 and is already obsolete. Commented out some code that I
6743 believe to never be called.
6744 (runLiterate): don't call updateScrollbar after fitCursor
6746 (buildProgram): ditto
6749 * src/WorkArea.h (workWidth): change return val to unsigned
6752 (redraw): remove the button redraws
6753 (setScrollbarValue): change for scrollbar
6754 (getScrollbarValue): change for scrollbar
6755 (getScrollbarBounds): change for scrollbar
6757 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6758 (C_WorkArea_down_cb): removed func
6759 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6760 (resize): change for scrollbar
6761 (setScrollbar): ditto
6762 (setScrollbarBounds): ditto
6763 (setScrollbarIncrements): ditto
6764 (up_cb): removed func
6765 (down_cb): removed func
6766 (scroll_cb): change for scrollbar
6767 (work_area_handler): ditto
6769 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6770 when FitCursor did something.
6771 (updateScrollbar): some unsigned changes
6772 (downCB): removed func
6773 (scrollUpOnePage): removed func
6774 (scrollDownOnePage): remvoed func
6775 (workAreaMotionNotify): don't call screen->FitCursor but use
6776 fitCursor instead. and bool return val
6777 (workAreaButtonPress): ditto
6778 (workAreaButtonRelease): some unsigned changes
6779 (checkInsetHit): ditto
6780 (workAreaExpose): ditto
6781 (update): parts rewritten, comments about the signed char arg added
6782 (smallUpdate): removed func
6783 (cursorPrevious): call needed updateScrollbar
6786 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6789 * src/BufferView.[Ch] (upCB): removed func
6790 (downCB): removed func
6791 (smallUpdate): removed func
6793 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6795 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6796 currentrow, currentrow_y optimization. This did not help a lot and
6797 if we want to do this kind of optimization we should rather use
6798 cursor.row instead of the currentrow.
6800 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6801 buffer spacing and klyx spacing support.
6803 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6805 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6808 2000-04-26 Juergen Vigna <jug@sad.it>
6810 * src/insets/figinset.C: fixes to Lars sstream changes!
6812 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6814 * A lot of files: Added Ascii(ostream &) methods to all inset
6815 classes. Used when exporting to ASCII.
6817 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6818 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6821 * src/text2.C (ToggleFree): Disabled implicit word selection when
6822 there is a change in the language
6824 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6825 no output was generated for end-of-sentence inset.
6827 * src/insets/lyxinset.h
6830 * src/paragraph.C: Removed the insetnumber code
6832 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6834 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6836 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6837 no_babel and no_epsfig completely from the file.
6838 (parseSingleLyXformat2Token): add handling for per-paragraph
6839 spacing as written by klyx.
6841 * src/insets/figinset.C: applied patch by Andre. Made it work with
6844 2000-04-20 Juergen Vigna <jug@sad.it>
6846 * src/insets/insettext.C (cutSelection):
6847 (copySelection): Fixed with selection from right to left.
6848 (draw): now the rows are not recalculated at every draw.
6849 (computeTextRows): for now reset the inset-owner here (this is
6850 important for an undo or copy where the inset-owner is not set
6853 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6854 motion to the_locking_inset screen->first was forgotten, this was
6855 not important till we got multiline insets.
6857 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6859 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6860 code seems to be alright (it is code changed by Dekel, and the
6861 intent is indeed that all macros should be defined \protect'ed)
6863 * NEWS: a bit of reorganisation of the new user-visible features.
6865 2000-04-19 Juergen Vigna <jug@sad.it>
6867 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6868 position. Set the inset_owner of the used paragraph so that it knows
6869 that it is inside an inset. Fixed cursor handling with mouse and
6870 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6871 and cleanups to make TextInsets work better.
6873 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6874 Changed parameters of various functions and added LockInsetInInset().
6876 * src/insets/insettext.C:
6878 * src/insets/insetcollapsable.h:
6879 * src/insets/insetcollapsable.C:
6880 * src/insets/insetfoot.h:
6881 * src/insets/insetfoot.C:
6882 * src/insets/insetert.h:
6883 * src/insets/insetert.C: cleaned up the code so that it works now
6884 correctly with insettext.
6886 * src/insets/inset.C:
6887 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6888 that insets in insets are supported right.
6891 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6893 * src/paragraph.C: some small fixes
6895 * src/debug.h: inserted INSETS debug info
6897 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6898 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6900 * src/commandtags.h:
6901 * src/LyXAction.C: insert code for InsetTabular.
6903 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6904 not Button1MotionMask.
6905 (workAreaButtonRelease): send always a InsetButtonRelease event to
6907 (checkInsetHit): some setCursor fixes (always with insets).
6909 * src/BufferView2.C (lockInset): returns a bool now and extended for
6910 locking insets inside insets.
6911 (showLockedInsetCursor): it is important to have the cursor always
6912 before the locked inset.
6913 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6915 * src/BufferView.h: made lockInset return a bool.
6917 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6919 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6920 that is used also internally but can be called as public to have back
6921 a cursor pos which is not set internally.
6922 (SetCursorIntern): Changed to use above function.
6924 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6926 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6931 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6932 patches for things that should be in or should be changed.
6934 * src/* [insetfiles]: change "usigned char fragile" to bool
6935 fragile. There was only one point that could that be questioned
6936 and that is commented in formulamacro.C. Grep for "CHECK".
6938 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6939 (DeleteBuffer): take it out of CutAndPaste and make it static.
6941 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6943 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6944 output the spacing envir commands. Also the new commands used in
6945 the LaTeX output makes the result better.
6947 * src/Spacing.C (writeEnvirBegin): new method
6948 (writeEnvirEnd): new method
6950 2000-04-18 Juergen Vigna <jug@sad.it>
6952 * src/CutAndPaste.C: made textclass a static member of the class
6953 as otherwise it is not accesed right!!!
6955 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6957 * forms/layout_forms.fd
6958 * src/layout_forms.h
6959 * src/layout_forms.C (create_form_form_character)
6960 * src/lyx_cb.C (UserFreeFont)
6961 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6962 documents (in the layout->character popup).
6964 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6966 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6967 \spell_command was in fact not honored (from Kevin Atkinson).
6969 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6972 * src/lyx_gui.h: make lyxViews private (Angus)
6974 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6976 * src/mathed/math_write.C
6977 (MathMatrixInset::Write) Put \protect before \begin{array} and
6978 \end{array} if fragile
6979 (MathParInset::Write): Put \protect before \\ if fragile
6981 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6983 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6984 initialization if the LyXColorHandler must be done after the
6985 connections to the XServer has been established.
6987 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6988 get the background pixel from the lyxColorhandler so that the
6989 figures are rendered with the correct background color.
6990 (NextToken): removed functions.
6991 (GetPSSizes): use ifs >> string instead of NextToken.
6993 * src/Painter.[Ch]: the color cache moved out of this file.
6995 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6998 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7000 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7001 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7003 * src/BufferView.C (enterView): new func
7004 (leaveView): new func
7006 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7008 (leaveView): new func, undefines xterm cursor when approp.
7010 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7011 (AllowInput): delete the Workarea cursor handling from this func.
7013 * src/Painter.C (underline): draw a slimer underline in most cases.
7015 * src/lyx_main.C (error_handler): use extern "C"
7017 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7019 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7020 sent directly to me.
7022 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7023 to the list by Dekel.
7025 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7028 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7029 methods from lyx_cb.here.
7031 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7034 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7036 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7037 instead of using current_view directly.
7039 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7041 * src/LyXAction.C (init): add the paragraph-spacing command.
7043 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7045 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7047 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7048 different from the documents.
7050 * src/text.C (SetHeightOfRow): take paragraph spacing into
7051 account, paragraph spacing takes precedence over buffer spacing
7052 (GetVisibleRow): ditto
7054 * src/paragraph.C (writeFile): output the spacing parameter too.
7055 (validate): set the correct features if spacing is used in the
7057 (Clear): set spacing to default
7058 (MakeSameLayout): spacing too
7059 (HasSameLayout): spacing too
7060 (SetLayout): spacing too
7061 (TeXOnePar): output the spacing commands
7063 * src/lyxparagraph.h: added a spacing variable for use with
7064 per-paragraph spacing.
7066 * src/Spacing.h: add a Default spacing and a method to check if
7067 the current spacing is default. also added an operator==
7069 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7072 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7074 * src/lyxserver.C (callback): fix dispatch of functions
7076 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7077 printf() into lyxerr call.
7079 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7082 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7083 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7084 the "Float" from each of the subitems.
7085 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7087 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7088 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7089 documented the change so that the workaround can be nuked later.
7091 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7094 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7096 * src/buffer.C (getLatexName): ditto
7097 (setReadonly): ditto
7099 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7101 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7102 avoid some uses of current_view. Added also a bufferParams()
7103 method to get at this.
7105 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7107 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7109 * src/lyxparagraph.[Ch]: removed
7110 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7111 with operators used by lower_bound and
7112 upper_bound in InsetTable's
7113 Make struct InsetTable private again. Used matchpos.
7115 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7117 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7118 document, the language of existing text is changed (unless the
7119 document is multi-lingual)
7121 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7123 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7125 * A lot of files: A rewrite of the Right-to-Left support.
7127 2000-04-10 Juergen Vigna <jug@sad.it>
7129 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7130 misplaced cursor when inset in inset is locked.
7132 * src/insets/insettext.C (LocalDispatch): small fix so that a
7133 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7135 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7136 footnote font should be decreased in size twice when displaying.
7138 * src/insets/insettext.C (GetDrawFont): inserted this function as
7139 the drawing-font may differ from the real paragraph font.
7141 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7142 insets (inset in inset!).
7144 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7145 function here because we don't want footnotes inside footnotes.
7147 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7149 (init): now set the inset_owner in paragraph.C
7150 (LocalDispatch): added some resetPos() in the right position
7153 (pasteSelection): changed to use the new CutAndPaste-Class.
7155 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7156 which tells if it is allowed to insert another inset inside this one.
7158 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7159 SwitchLayoutsBetweenClasses.
7161 * src/text2.C (InsertInset): checking of the new paragraph-function
7163 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7164 is not needed anymore here!
7167 (PasteSelection): redone (also with #ifdef) so that now this uses
7168 the CutAndPaste-Class.
7169 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7172 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7173 from/to text/insets.
7175 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7176 so that the paragraph knows if it is inside an (text)-inset.
7177 (InsertFromMinibuffer): changed return-value to bool as now it
7178 may happen that an inset is not inserted in the paragraph.
7179 (InsertInsetAllowed): this checks if it is allowed to insert an
7180 inset in this paragraph.
7182 (BreakParagraphConservative):
7183 (BreakParagraph) : small change for the above change of the return
7184 value of InsertFromMinibuffer.
7186 * src/lyxparagraph.h: added inset_owner and the functions to handle
7187 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7189 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7191 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7192 functions from BufferView to BufferView::Pimpl to ease maintence.
7194 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7195 correctly. Also use SetCursorIntern instead of SetCursor.
7197 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7200 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7202 * src/WorkArea.C (belowMouse): manually implement below mouse.
7204 * src/*: Add "explicit" on several constructors, I added probably
7205 some unneeded ones. A couple of changes to code because of this.
7207 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7208 implementation and private parts from the users of BufferView. Not
7211 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7212 implementation and private parts from the users of LyXLex. Not
7215 * src/BufferView_pimpl.[Ch]: new files
7217 * src/lyxlex_pimpl.[Ch]: new files
7219 * src/LyXView.[Ch]: some inline functions move out-of-line
7221 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7223 * src/lyxparagraph.h: make struct InsetTable public.
7225 * src/support/lyxstring.h: change lyxstring::difference_type to be
7226 ptrdiff_t. Add std:: modifiers to streams.
7228 * src/font.C: include the <cctype> header, for islower() and
7231 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7233 * src/font.[Ch]: new files. Contains the metric functions for
7234 fonts, takes a LyXFont as parameter. Better separation of concepts.
7236 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7237 changes because of this.
7239 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7241 * src/*: compile with -Winline and move functions that don't
7244 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7247 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7249 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7250 (various files changed because of this)
7252 * src/Painter.C (text): fixed the drawing of smallcaps.
7254 * src/lyxfont.[Ch] (drawText): removed unused member func.
7257 * src/*.C: added needed "using" statements and "std::" qualifiers.
7259 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7261 * src/*.h: removed all use of "using" from header files use
7262 qualifier std:: instead.
7264 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7266 * src/text.C (Backspace): some additional cleanups (we already
7267 know whether cursor.pos is 0 or not).
7269 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7270 automake does not provide one).
7272 * src/bmtable.h: replace C++ comments with C comments.
7274 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7276 * src/screen.C (ShowCursor): Change the shape of the cursor if
7277 the current language is not equal to the language of the document.
7278 (If the cursor change its shape unexpectedly, then you've found a bug)
7280 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7283 * src/insets/insetnumber.[Ch]: New files.
7285 * src/LyXAction.C (init)
7286 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7289 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7291 * src/lyxparagraph.h
7292 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7293 (the vector is kept sorted).
7295 * src/text.C (GetVisibleRow): Draw selection correctly when there
7296 is both LTR and RTL text.
7298 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7299 which is much faster.
7301 * src/text.C (GetVisibleRow and other): Do not draw the last space
7302 in a row if the direction of the last letter is not equal to the
7303 direction of the paragraph.
7305 * src/lyxfont.C (latexWriteStartChanges):
7306 Check that font language is not equal to basefont language.
7307 (latexWriteEndChanges): ditto
7309 * src/lyx_cb.C (StyleReset): Don't change the language while using
7310 the font-default command.
7312 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7313 empty paragraph before a footnote.
7315 * src/insets/insetcommand.C (draw): Increase x correctly.
7317 * src/screen.C (ShowCursor): Change cursor shape if
7318 current language != document language.
7320 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7322 2000-03-31 Juergen Vigna <jug@sad.it>
7324 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7325 (Clone): changed mode how the paragraph-data is copied to the
7326 new clone-paragraph.
7328 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7329 GetInset(pos) with no inset anymore there (in inset UNDO)
7331 * src/insets/insetcommand.C (draw): small fix as here x is
7332 incremented not as much as width() returns (2 before, 2 behind = 4)
7334 2000-03-30 Juergen Vigna <jug@sad.it>
7336 * src/insets/insettext.C (InsetText): small fix in initialize
7337 widthOffset (should not be done in the init() function)
7339 2000-03-29 Amir Karger <karger@lyx.org>
7341 * lib/examples/it_ItemizeBullets.lyx: translation by
7344 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7346 2000-03-29 Juergen Vigna <jug@sad.it>
7348 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7350 * src/insets/insetfoot.C (Clone): small change as for the below
7351 new init function in the text-inset
7353 * src/insets/insettext.C (init): new function as I've seen that
7354 clone did not copy the Paragraph-Data!
7355 (LocalDispatch): Added code so that now we have some sort of Undo
7356 functionality (well actually we HAVE Undo ;)
7358 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7360 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7362 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7365 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7367 * src/main.C: added a runtime check that verifies that the xforms
7368 header used when building LyX and the library used when running
7369 LyX match. Exit with a message if they don't match. This is a
7370 version number check only.
7372 * src/buffer.C (save): Don't allocate memory on the heap for
7373 struct utimbuf times.
7375 * *: some using changes, use iosfwd instead of the real headers.
7377 * src/lyxfont.C use char const * instead of string for the static
7378 strings. Rewrite some functions to use sstream.
7380 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7382 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7385 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7387 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7388 of Geodesy (from Martin Vermeer)
7390 * lib/layouts/svjour.inc: include file for the Springer svjour
7391 class. It can be used to support journals other than JoG.
7393 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7394 Miskiewicz <misiek@pld.org.pl>)
7395 * lib/reLyX/Makefile.am: ditto.
7397 2000-03-27 Juergen Vigna <jug@sad.it>
7399 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7400 also some modifications with operations on selected text.
7402 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7403 problems with clicking on insets (last famous words ;)
7405 * src/insets/insetcommand.C (draw):
7406 (width): Changed to have a bit of space before and after the inset so
7407 that the blinking cursor can be seen (otherwise it was hidden)
7409 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7411 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7412 would not be added to the link list when an installed gettext (not
7413 part of libc) is found.
7415 2000-03-24 Juergen Vigna <jug@sad.it>
7417 * src/insets/insetcollapsable.C (Edit):
7418 * src/mathed/formula.C (InsetButtonRelease):
7419 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7422 * src/BufferView.C (workAreaButtonPress):
7423 (workAreaButtonRelease):
7424 (checkInsetHit): Finally fixed the clicking on insets be handled
7427 * src/insets/insetert.C (Edit): inserted this call so that ERT
7428 insets work always with LaTeX-font
7430 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7432 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7433 caused lyx to startup with no GUI in place, causing in a crash
7434 upon startup when called with arguments.
7436 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7438 * src/FontLoader.C: better initialization of dummyXFontStruct.
7440 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7442 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7443 for linuxdoc and docbook import and export format options.
7445 * lib/lyxrc.example Example of default values for the previous flags.
7447 * src/lyx_cb.C Use those flags instead of the hardwired values for
7448 linuxdoc and docbook export.
7450 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7453 * src/menus.C Added menus entries for the new import/exports formats.
7455 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7457 * src/lyxrc.*: Added support for running without Gui
7460 * src/FontLoader.C: sensible defaults if no fonts are needed
7462 * src/lyx_cb.C: New function ShowMessage (writes either to the
7463 minibuffer or cout in case of no gui
7464 New function AskOverwrite for common stuff
7465 Consequently various changes to call these functions
7467 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7468 wild guess at sensible screen resolution when having no gui
7470 * src/lyxfont.C: no gui, no fonts... set some defaults
7472 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7474 * src/LColor.C: made the command inset background a bit lighter.
7476 2000-03-20 Hartmut Goebel <goebel@noris.net>
7478 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7479 stdstruct.inc. Koma-Script added some title elements which
7480 otherwise have been listed below "bibliography". This split allows
7481 adding title elements to where they belong.
7483 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7484 define the additional title elements and then include
7487 * many other layout files: changed to include stdtitle.inc just
7488 before stdstruct.inc.
7490 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7492 * src/buffer.C: (save) Added the option to store all backup files
7493 in a single directory
7495 * src/lyxrc.[Ch]: Added variable \backupdir_path
7497 * lib/lyxrc.example: Added descriptions of recently added variables
7499 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7500 bibtex inset, not closing the bibtex popup when deleting the inset)
7502 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7504 * src/lyx_cb.C: add a couple using directives.
7506 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7507 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7508 import based on the filename.
7510 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7511 file would be imported at start, if the filename where of a sgml file.
7513 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7515 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7517 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7518 * src/lyxfont.h Replaced the member variable bits.direction by the
7519 member variable lang. Made many changes in other files.
7520 This allows having a multi-lingual document
7522 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7523 that change the current language to <l>.
7524 Removed the command "font-rtl"
7526 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7527 format for Hebrew documents)
7529 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7530 When auto_mathmode is "true", pressing a digit key in normal mode
7531 will cause entering into mathmode.
7532 If auto_mathmode is "rtl" then this behavior will be active only
7533 when writing right-to-left text.
7535 * src/text2.C (InsertStringA) The string is inserted using the
7538 * src/paragraph.C (GetEndLabel) Gives a correct result for
7539 footnote paragraphs.
7541 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7543 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7545 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7546 front of PasteParagraph. Never insert a ' '. This should at least
7547 fix some cause for the segfaults that we have been experiencing,
7548 it also fixes backspace behaviour slightly. (Phu!)
7550 * src/support/lstrings.C (compare_no_case): some change to make it
7551 compile with gcc 2.95.2 and stdlibc++-v3
7553 * src/text2.C (MeltFootnoteEnvironment): change type o
7554 first_footnote_par_is_not_empty to bool.
7556 * src/lyxparagraph.h: make text private. Changes in other files
7558 (fitToSize): new function
7559 (setContentsFromPar): new function
7560 (clearContents): new function
7561 (SetChar): new function
7563 * src/paragraph.C (readSimpleWholeFile): deleted.
7565 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7566 the file, just use a simple string instead. Also read the file in
7567 a more maintainable manner.
7569 * src/text2.C (InsertStringA): deleted.
7570 (InsertStringB): deleted.
7572 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7574 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7575 RedoParagraphs from the doublespace handling part, just set status
7576 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7577 done, but perhaps not like this.)
7579 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7581 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7582 character when inserting an inset.
7584 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7586 * src/bufferparams.C (readLanguage): now takes "default" into
7589 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7590 also initialize the toplevel_keymap with the default bindings from
7593 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7595 * all files using lyxrc: have lyxrc as a real variable and not a
7596 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7599 * src/lyxrc.C: remove double call to defaultKeyBindings
7601 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7602 toolbar defauls using lyxlex. Remove enums, structs, functions
7605 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7606 toolbar defaults. Also store default keybindings in a map.
7608 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7609 storing the toolbar defaults without any xforms dependencies.
7611 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7612 applied. Changed to use iterators.
7614 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7616 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7617 systems that don't have LINGUAS set to begin with.
7619 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7621 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7622 the list by Dekel Tsur.
7624 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7626 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7627 * src/insets/form_graphics.C: ditto.
7629 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7631 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7633 * src/bufferparams.C (readLanguage): use the new language map
7635 * src/intl.C (InitKeyMapper): use the new language map
7637 * src/lyx_gui.C (create_forms): use the new language map
7639 * src/language.[Ch]: New files. Used for holding the information
7640 about each language. Now! Use this new language map enhance it and
7641 make it really usable for our needs.
7643 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7645 * screen.C (ShowCursor): Removed duplicate code.
7646 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7647 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7649 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7652 * src/text.C Added TransformChar method. Used for rendering Arabic
7653 text correctly (change the glyphs of the letter according to the
7654 position in the word)
7659 * src/lyxrc.C Added lyxrc command {language_command_begin,
7660 language_command_end,language_command_ltr,language_command_rtl,
7661 language_package} which allows the use of either arabtex or Omega
7664 * src/lyx_gui.C (init)
7666 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7667 to use encoding for menu fonts which is different than the encoding
7670 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7671 do not load the babel package.
7672 To write an English document with Hebrew/Arabic, change the document
7673 language to "english".
7675 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7676 (alphaCounter): changed to return char
7677 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7679 * lib/lyxrc.example Added examples for Hebrew/Arabic
7682 * src/layout.C Added layout command endlabeltype
7684 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7686 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7688 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7690 * src/mathed/math_delim.C (search_deco): return a
7691 math_deco_struct* instead of index.
7693 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7695 * All files with a USE_OSTREAM_ONLY within: removed all code that
7696 was unused when USE_OSTREAM_ONLY is defined.
7698 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7699 of any less. Removed header and using.
7701 * src/text.C (GetVisibleRow): draw the string "Page Break
7702 (top/bottom)" on screen when drawing a pagebreak line.
7704 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7706 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7708 * src/mathed/math_macro.C (draw): do some cast magic.
7711 * src/mathed/math_defs.h: change byte* argument to byte const*.
7713 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7715 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7716 know it is right to return InsetFoot* too, but cxx does not like
7719 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7721 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7723 * src/mathed/math_delim.C: change == to proper assignment.
7725 2000-03-09 Juergen Vigna <jug@sad.it>
7727 * src/insets/insettext.C (setPos): fixed various cursor positioning
7728 problems (via mouse and cursor-keys)
7729 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7730 inset (still a small display problem but it works ;)
7732 * src/insets/insetcollapsable.C (draw): added button_top_y and
7733 button_bottom_y to have correct values for clicking on the inset.
7735 * src/support/lyxalgo.h: commented out 'using std::less'
7737 2000-03-08 Juergen Vigna <jug@sad.it>
7739 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7740 Button-Release event closes as it is alos the Release-Event
7743 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7745 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7747 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7748 can add multiple spaces in Scrap (literate programming) styles...
7749 which, by the way, is how I got hooked on LyX to begin with.
7751 * src/mathed/formula.C (Write): Added dummy variable to an
7752 inset::Latex() call.
7753 (Latex): Add free_spacing boolean to inset::Latex()
7755 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7757 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7758 virtual function to include the free_spacing boolean from
7759 the containing paragraph's style.
7761 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7762 Added free_spacing boolean arg to match inset.h
7764 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7765 Added free_spacing boolean arg to match inset.h
7767 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7768 Added free_spacing boolean and made sure that if in a free_spacing
7769 paragraph, that we output normal space if there is a protected space.
7771 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7772 Added free_spacing boolean arg to match inset.h
7774 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7775 Added free_spacing boolean arg to match inset.h
7777 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7778 Added free_spacing boolean arg to match inset.h
7780 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7781 Added free_spacing boolean arg to match inset.h
7783 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7784 Added free_spacing boolean arg to match inset.h
7786 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7787 free_spacing boolean arg to match inset.h
7789 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7790 Added free_spacing boolean arg to match inset.h
7792 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7793 Added free_spacing boolean arg to match inset.h
7795 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7796 Added free_spacing boolean arg to match inset.h
7798 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7799 Added free_spacing boolean arg to match inset.h
7801 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7802 Added free_spacing boolean arg to match inset.h
7804 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7805 free_spacing boolean arg to match inset.h
7807 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7808 free_spacing boolean arg to match inset.h
7810 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7811 ignore free_spacing paragraphs. The user's spaces are left
7814 * src/text.C (InsertChar): Fixed the free_spacing layout
7815 attribute behavior. Now, if free_spacing is set, you can
7816 add multiple spaces in a paragraph with impunity (and they
7817 get output verbatim).
7818 (SelectSelectedWord): Added dummy argument to inset::Latex()
7821 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7824 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7825 paragraph layouts now only input a simple space instead.
7826 Special character insets don't make any sense in free-spacing
7829 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7830 hard-spaces in the *input* file to simple spaces if the layout
7831 is free-spacing. This converts old files which had to have
7832 hard-spaces in free-spacing layouts where a simple space was
7834 (writeFileAscii): Added free_spacing check to pass to the newly
7835 reworked inset::Latex(...) methods. The inset::Latex() code
7836 ensures that hard-spaces in free-spacing paragraphs get output
7837 as spaces (rather than "~").
7839 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7841 * src/mathed/math_delim.C (draw): draw the empty placeholder
7842 delims with a onoffdash line.
7843 (struct math_deco_compare): struct that holds the "functors" used
7844 for the sort and the binary search in math_deco_table.
7845 (class init_deco_table): class used for initial sort of the
7847 (search_deco): use lower_bound to do a binary search in the
7850 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7852 * src/lyxrc.C: a small secret thingie...
7854 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7855 and to not flush the stream as often as it used to.
7857 * src/support/lyxalgo.h: new file
7858 (sorted): template function used for checking if a sequence is
7859 sorted or not. Two versions with and without user supplied
7860 compare. Uses same compare as std::sort.
7862 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7863 it and give warning on lyxerr.
7865 (struct compare_tags): struct with function operators used for
7866 checking if sorted, sorting and lower_bound.
7867 (search_kw): use lower_bound instead of manually implemented
7870 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7872 * src/insets/insetcollapsable.h: fix Clone() declaration.
7873 * src/insets/insetfoot.h: ditto.
7875 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7877 2000-03-08 Juergen Vigna <jug@sad.it>
7879 * src/insets/lyxinset.h: added owner call which tells us if
7880 this inset is inside another inset. Changed also the return-type
7881 of Editable to an enum so it tells clearer what the return-value is.
7883 * src/insets/insettext.C (computeTextRows): fixed computing of
7884 textinsets which split automatically on more rows.
7886 * src/insets/insetert.[Ch]: changed this to be of BaseType
7889 * src/insets/insetfoot.[Ch]: added footnote inset
7891 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7892 collapsable insets (like footnote, ert, ...)
7894 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7896 * src/lyxdraw.h: remvoe file
7898 * src/lyxdraw.C: remove file
7900 * src/insets/insettext.C: added <algorithm>.
7902 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7904 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7905 (matrix_cb): case MM_OK use string stream
7907 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7910 * src/mathed/math_macro.C (draw): use string stream
7911 (Metrics): use string stream
7913 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7914 directly to the ostream.
7916 * src/vspace.C (asString): use string stream.
7917 (asString): use string stream
7918 (asLatexString): use string stream
7920 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7921 setting Spacing::Other.
7923 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7924 sprintf when creating the stretch vale.
7926 * src/text2.C (alphaCounter): changed to return a string and to
7927 not use a static variable internally. Also fixed a one-off bug.
7928 (SetCounter): changed the drawing of the labels to use string
7929 streams instead of sprintf.
7931 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7932 manipulator to use a scheme that does not require library support.
7933 This is also the way it is done in the new GNU libstdc++. Should
7934 work with DEC cxx now.
7936 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7938 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7939 end. This fixes a bug.
7941 * src/mathed (all files concerned with file writing): apply the
7942 USE_OSTREAM_ONLY changes to mathed too.
7944 * src/support/DebugStream.h: make the constructor explicit.
7946 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7947 count and ostream squashed.
7949 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7951 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7953 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7954 ostringstream uses STL strings, and we might not.
7956 * src/insets/insetspecialchar.C: add using directive.
7957 * src/insets/insettext.C: ditto.
7959 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7961 * lib/layouts/seminar.layout: feeble attempt at a layout for
7962 seminar.cls, far from completet and could really use some looking
7963 at from people used to write layout files.
7965 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7966 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7967 a lot nicer and works nicely with ostreams.
7969 * src/mathed/formula.C (draw): a slightly different solution that
7970 the one posted to the list, but I think this one works too. (font
7971 size wrong in headers.)
7973 * src/insets/insettext.C (computeTextRows): some fiddling on
7974 Jürgens turf, added some comments that he should read.
7976 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7977 used and it gave compiler warnings.
7978 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7981 * src/lyx_gui.C (create_forms): do the right thing when
7982 show_banner is true/false.
7984 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7985 show_banner is false.
7987 * most file writing files: Now use iostreams to do almost all of
7988 the writing. Also instead of passing string &, we now use
7989 stringstreams. mathed output is still not adapted to iostreams.
7990 This change can be turned off by commenting out all the occurences
7991 of the "#define USE_OSTREAM_ONLY 1" lines.
7993 * src/WorkArea.C (createPixmap): don't output debug messages.
7994 (WorkArea): don't output debug messages.
7996 * lib/lyxrc.example: added a comment about the new variable
7999 * development/Code_rules/Rules: Added some more commente about how
8000 to build class interfaces and on how better encapsulation can be
8003 2000-03-03 Juergen Vigna <jug@sad.it>
8005 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8006 automatically with the width of the LyX-Window
8008 * src/insets/insettext.C (computeTextRows): fixed update bug in
8009 displaying text-insets (scrollvalues where not initialized!)
8011 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8013 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8014 id in the check of the result from lower_bound is not enough since
8015 lower_bound can return last too, and then res->id will not be a
8018 * all insets and some code that use them: I have conditionalized
8019 removed the Latex(string & out, ...) this means that only the
8020 Latex(ostream &, ...) will be used. This is a work in progress to
8021 move towards using streams for all output of files.
8023 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8026 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8028 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8029 routine (this fixes bug where greek letters were surrounded by too
8032 * src/support/filetools.C (findtexfile): change a bit the search
8033 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8034 no longer passed to kpsewhich, we may have to change that later.
8036 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8037 warning options to avoid problems with X header files (from Angus
8039 * acinclude.m4: regenerated.
8041 2000-03-02 Juergen Vigna <jug@sad.it>
8043 * src/insets/insettext.C (WriteParagraphData): Using the
8044 par->writeFile() function for writing paragraph-data.
8045 (Read): Using buffer->parseSingleLyXformat2Token()-function
8046 for parsing paragraph data!
8048 * src/buffer.C (readLyXformat2): removed all parse data and using
8049 the new parseSingleLyXformat2Token()-function.
8050 (parseSingleLyXformat2Token): added this function to parse (read)
8051 lyx-file-format (this is called also from text-insets now!)
8053 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8055 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8058 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8059 directly instead of going through a func. One very bad thing: a
8060 static LyXFindReplace, but I don't know where to place it.
8062 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8063 string instead of char[]. Also changed to static.
8064 (GetSelectionOrWordAtCursor): changed to static inline
8065 (SetSelectionOverLenChars): ditto.
8067 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8068 current_view and global variables. both classes has changed names
8069 and LyXFindReplace is not inherited from SearchForm.
8071 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8072 fl_form_search form.
8074 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8076 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8078 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8079 bound (from Kayvan).
8081 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8083 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8085 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8087 * some things that I should comment but the local pub says head to
8090 * comment out all code that belongs to the Roff code for Ascii
8091 export of tables. (this is unused)
8093 * src/LyXView.C: use correct type for global variable
8094 current_layout. (LyXTextClass::size_type)
8096 * some code to get the new insetgraphics closer to working I'd be
8097 grateful for any help.
8099 * src/BufferView2.C (insertInset): use the return type of
8100 NumberOfLayout properly. (also changes in other files)
8102 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8103 this as a test. I want to know what breaks because of this.
8105 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8107 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8109 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8110 to use a \makebox in the label, this allows proper justification
8111 with out using protected spaces or multiple hfills. Now it is
8112 "label" for left justified, "\hfill label\hfill" for center, and
8113 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8114 should be changed accordingly.
8116 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8118 * src/lyxtext.h: change SetLayout() to take a
8119 LyXTextClass::size_type instead of a char (when there is more than
8120 127 layouts in a class); also change type of copylayouttype.
8121 * src/text2.C (SetLayout): ditto.
8122 * src/LyXView.C (updateLayoutChoice): ditto.
8124 * src/LaTeX.C (scanLogFile): errors where the line number was not
8125 given just after the '!'-line were ignored (from Dekel Tsur).
8127 * lib/lyxrc.example: fix description of \date_insert_format
8129 * lib/layouts/llncs.layout: new layout, contributed by Martin
8132 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8134 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8135 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8136 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8137 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8138 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8139 paragraph.C, text.C, text2.C)
8141 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8143 * src/insets/insettext.C (LocalDispatch): remove extra break
8146 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8147 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8149 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8150 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8152 * src/insets/insetbib.h: move InsetBibkey::Holder and
8153 InsetCitation::Holder in public space.
8155 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8157 * src/insets/insettext.h: small change to get the new files from
8158 Juergen to compile (use "string", not "class string").
8160 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8161 const & as parameter to LocalDispatch, use LyXFont const & as
8162 paramter to some other func. This also had impacto on lyxinsets.h
8163 and the two mathed insets.
8165 2000-02-24 Juergen Vigna <jug@sad.it>
8168 * src/commandtags.h:
8170 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8174 * src/BufferView2.C: added/updated code for various inset-functions
8176 * src/insets/insetert.[Ch]: added implementation of InsetERT
8178 * src/insets/insettext.[Ch]: added implementation of InsetText
8180 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8181 (draw): added preliminary code for inset scrolling not finshed yet
8183 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8184 as it is in lyxfunc.C now
8186 * src/insets/lyxinset.h: Added functions for text-insets
8188 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8190 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8191 BufferView and reimplement the list as a queue put inside its own
8194 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8196 * several files: use the new interface to the "updateinsetlist"
8198 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8200 (work_area_handler): call BufferView::trippleClick on trippleclick.
8202 * src/BufferView.C (doubleClick): new function, selects word on
8204 (trippleClick): new function, selects line on trippleclick.
8206 2000-02-22 Allan Rae <rae@lyx.org>
8208 * lib/bind/xemacs.bind: buffer-previous not supported
8210 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8212 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8215 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8217 * src/bufferlist.C: get rid of current_view from this file
8219 * src/spellchecker.C: get rid of current_view from this file
8221 * src/vspace.C: get rid of current_view from this file
8222 (inPixels): added BufferView parameter for this func
8223 (asLatexCommand): added a BufferParams for this func
8225 * src/text.C src/text2.C: get rid of current_view from these
8228 * src/lyxfont.C (getFontDirection): move this function here from
8231 * src/bufferparams.C (getDocumentDirection): move this function
8234 * src/paragraph.C (getParDirection): move this function here from
8236 (getLetterDirection): ditto
8238 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8240 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8241 resize due to wrong pixmap beeing used. Also took the opurtunity
8242 to make the LyXScreen stateless on regard to WorkArea and some
8243 general cleanup in the same files.
8245 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8247 * src/Makefile.am: add missing direction.h
8249 * src/PainterBase.h: made the width functions const.
8251 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8254 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8256 * src/insets/insetlatexaccent.C (draw): make the accents draw
8257 better, at present this will only work well with iso8859-1.
8259 * several files: remove the old drawing code, now we use the new
8262 * several files: remove support for mono_video, reverse_video and
8265 2000-02-17 Juergen Vigna <jug@sad.it>
8267 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8268 int ** as we have to return the pointer, otherwise we have only
8269 NULL pointers in the returning function.
8271 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8273 * src/LaTeX.C (operator()): quote file name when running latex.
8275 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8277 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8278 (bubble tip), this removes our special handling of this.
8280 * Remove all code that is unused now that we have the new
8281 workarea. (Code that are not active when NEW_WA is defined.)
8283 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8285 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8287 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8288 nonexisting layout; correctly redirect obsoleted layouts.
8290 * lib/lyxrc.example: document \view_dvi_paper_option
8292 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8295 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8296 (PreviewDVI): handle the view_dvi_paper_option variable.
8297 [Both from Roland Krause]
8299 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8301 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8302 char const *, int, LyXFont)
8303 (text(int, int, string, LyXFont)): ditto
8305 * src/text.C (InsertCharInTable): attempt to fix the double-space
8306 feature in tables too.
8307 (BackspaceInTable): ditto.
8308 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8310 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8312 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8314 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8315 newly found text in textcache to this.
8316 (buffer): set the owner of the text put into the textcache to 0
8318 * src/insets/figinset.C (draw): fixed the drawing of figures with
8321 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8322 drawing of mathframe, hfills, protected space, table lines. I have
8323 now no outstanding drawing problems with the new Painter code.
8325 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8327 * src/PainterBase.C (ellipse, circle): do not specify the default
8330 * src/LColor.h: add using directive.
8332 * src/Painter.[Ch]: change return type of methods from Painter& to
8333 PainterBase&. Add a using directive.
8335 * src/WorkArea.C: wrap xforms callbacks in C functions
8338 * lib/layouts/foils.layout: font fix and simplifications from Carl
8341 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8343 * a lot of files: The Painter, LColor and WorkArea from the old
8344 devel branch has been ported to lyx-devel. Some new files and a
8345 lot of #ifdeffed code. The new workarea is enabled by default, but
8346 if you want to test the new Painter and LColor you have to compile
8347 with USE_PAINTER defined (do this in config.h f.ex.) There are
8348 still some rought edges, and I'd like some help to clear those
8349 out. It looks stable (loads and displays the Userguide very well).
8352 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8354 * src/buffer.C (pop_tag): revert to the previous implementation
8355 (use a global variable for both loops).
8357 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8359 * src/lyxrc.C (LyXRC): change slightly default date format.
8361 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8362 there is an English text with a footnote that starts with a Hebrew
8363 paragraph, or vice versa.
8364 (TeXFootnote): ditto.
8366 * src/text.C (LeftMargin): allow for negative values for
8367 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8370 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8371 for input encoding (cyrillic)
8373 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8375 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8378 * src/toolbar.C (set): ditto
8379 * src/insets/insetbib.C (create_form_citation_form): ditto
8381 * lib/CREDITS: added Dekel Tsur.
8383 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8384 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8385 hebrew supports files from Dekel Tsur.
8387 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8388 <tzafrir@technion.ac.il>
8390 * src/lyxrc.C: put \date_insert_format at the right place.
8392 * src/buffer.C (makeLaTeXFile): fix the handling of
8393 BufferParams::sides when writing out latex files.
8395 * src/BufferView2.C: add a "using" directive.
8397 * src/support/lyxsum.C (sum): when we use lyxstring,
8398 ostringstream::str needs an additional .c_str().
8400 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8402 * src/support/filetools.C (ChangeExtension): patch from Etienne
8405 * src/TextCache.C (show): remove const_cast and make second
8406 parameter non-const LyXText *.
8408 * src/TextCache.h: use non const LyXText in show.
8410 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8413 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8415 * src/support/lyxsum.C: rework to be more flexible.
8417 * several places: don't check if a pointer is 0 if you are going
8420 * src/text.C: remove some dead code.
8422 * src/insets/figinset.C: remove some dead code
8424 * src/buffer.C: move the BufferView funcs to BufferView2.C
8425 remove all support for insetlatexdel
8426 remove support for oldpapersize stuff
8427 made some member funcs const
8429 * src/kbmap.C: use a std::list to store the bindings in.
8431 * src/BufferView2.C: new file
8433 * src/kbsequence.[Ch]: new files
8435 * src/LyXAction.C + others: remove all trace of buffer-previous
8437 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8438 only have one copy in the binary of this table.
8440 * hebrew patch: moved some functions from LyXText to more
8441 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8443 * several files: remove support for XForms older than 0.88
8445 remove some #if 0 #endif code
8447 * src/TextCache.[Ch]: new file. Holds the textcache.
8449 * src/BufferView.C: changes to use the new TextCache interface.
8450 (waitForX): remove the now unused code.
8452 * src/BackStack.h: remove some commented code
8454 * lib/bind/emacs.bind: remove binding for buffer-previous
8456 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8458 * applied the hebrew patch.
8460 * src/lyxrow.h: make sure that all Row variables are initialized.
8462 * src/text2.C (TextHandleUndo): comment out a delete, this might
8463 introduce a memory leak, but should also help us to not try to
8464 read freed memory. We need to look at this one.
8466 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8467 (LyXParagraph): initalize footnotekind.
8469 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8470 forgot this when applying the patch. Please heed the warnings.
8472 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8473 (aka. reformat problem)
8475 * src/bufferlist.C (exists): made const, and use const_iterator
8476 (isLoaded): new func.
8477 (release): use std::find to find the correct buffer.
8479 * src/bufferlist.h: made getState a const func.
8480 made empty a const func.
8481 made exists a const func.
8484 2000-02-01 Juergen Vigna <jug@sad.it>
8486 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8488 * po/it.po: updated a bit the italian po file and also changed the
8489 'file nuovo' for newfile to 'filenuovo' without a space, this did
8492 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8493 for the new insert_date command.
8495 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8496 from jdblair, to insert a date into the current text conforming to
8497 a strftime format (for now only considering the locale-set and not
8498 the document-language).
8500 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8502 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8503 Bounds Read error seen by purify. The problem was that islower is
8504 a macros which takes an unsigned char and uses it as an index for
8505 in array of characters properties (and is thus subject to the
8509 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8510 correctly the paper sides radio buttons.
8511 (UpdateDocumentButtons): ditto.
8513 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8515 * src/kbmap.C (getsym + others): change to return unsigned int,
8516 returning a long can give problems on 64 bit systems. (I assume
8517 that int is 32bit on 64bit systems)
8519 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8521 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8522 LyXLookupString to be zero-terminated. Really fixes problems seen
8525 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8527 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8528 write a (char*)0 to the lyxerr stream.
8530 * src/lastfiles.C: move algorithm before the using statemets.
8532 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8534 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8535 complains otherwise).
8536 * src/table.C: ditto
8538 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8541 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8542 that I removed earlier... It is really needed.
8544 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8546 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8548 * INSTALL: update xforms home page URL.
8550 * lib/configure.m4: fix a bug with unreadable layout files.
8552 * src/table.C (calculate_width_of_column): add "using std::max"
8555 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8557 * several files: marked several lines with "DEL LINE", this is
8558 lines that can be deleted without changing anything.
8559 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8560 checks this anyway */
8563 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8565 * src/DepTable.C (update): add a "+" at the end when the checksum
8566 is different. (debugging string only)
8568 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8569 the next inset to not be displayed. This should also fix the list
8570 of labels in the "Insert Crossreference" dialog.
8572 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8574 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8575 when regex was not found.
8577 * src/support/lstrings.C (lowercase): use handcoded transform always.
8580 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8581 old_cursor.par->prev could be 0.
8583 * several files: changed post inc/dec to pre inc/dec
8585 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8586 write the lastfiles to file.
8588 * src/BufferView.C (buffer): only show TextCache info when debugging
8590 (resizeCurrentBuffer): ditto
8591 (workAreaExpose): ditto
8593 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8595 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8597 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8598 a bit better by removing the special case for \i and \j.
8600 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8602 * src/lyx_main.C (easyParse): remove test for bad comand line
8603 options, since this broke all xforms-related parsing.
8605 * src/kbmap.C (getsym): set return type to unsigned long, as
8606 declared in header. On an alpha, long is _not_ the same as int.
8608 * src/support/LOstream.h: add a "using std::flush;"
8610 * src/insets/figinset.C: ditto.
8612 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8614 * src/bufferlist.C (write): use blinding fast file copy instead of
8615 "a char at a time", now we are doing it the C++ way.
8617 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8618 std::list<int> instead.
8619 (addpidwait): reflect move to std::list<int>
8620 (sigchldchecker): ditto
8622 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8625 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8626 that obviously was wrong...
8628 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8629 c, this avoids warnings with purify and islower.
8631 * src/insets/figinset.C: rename struct queue to struct
8632 queue_element and rewrite to use a std::queue. gsqueue is now a
8633 std::queue<queue_element>
8634 (runqueue): reflect move to std::queue
8637 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8638 we would get "1" "0" instead of "true" "false. Also make the tostr
8641 2000-01-21 Juergen Vigna <jug@sad.it>
8643 * src/buffer.C (writeFileAscii): Disabled code for special groff
8644 handling of tabulars till I fix this in table.C
8646 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8648 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8650 * src/support/lyxlib.h: ditto.
8652 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8654 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8655 and 'j' look better. This might fix the "macron" bug that has been
8658 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8659 functions as one template function. Delete the old versions.
8661 * src/support/lyxsum.C: move using std::ifstream inside
8664 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8667 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8669 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8671 * src/insets/figinset.C (InitFigures): use new instead of malloc
8672 to allocate memory for figures and bitmaps.
8673 (DoneFigures): use delete[] instead of free to deallocate memory
8674 for figures and bitmaps.
8675 (runqueue): use new to allocate
8676 (getfigdata): use new/delete[] instead of malloc/free
8677 (RegisterFigure): ditto
8679 * some files: moved some declarations closer to first use, small
8680 whitespace changes use preincrement instead of postincrement where
8681 it does not make a difference.
8683 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8684 step on the way to use stl::containers for key maps.
8686 * src/bufferlist.h: add a typedef for const_iterator and const
8687 versions of begin and end.
8689 * src/bufferlist.[Ch]: change name of member variable _state to
8690 state_. (avoid reserved names)
8692 (getFileNames): returns the filenames of the buffers in a vector.
8694 * configure.in (ALL_LINGUAS): added ro
8696 * src/support/putenv.C: new file
8698 * src/support/mkdir.C: new file
8700 2000-01-20 Allan Rae <rae@lyx.org>
8702 * lib/layouts/IEEEtran.layout: Added several theorem environments
8704 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8705 couple of minor additions.
8707 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8708 (except for those in footnotes of course)
8710 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8712 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8714 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8715 std::sort and std::lower_bound instead of qsort and handwritten
8717 (struct compara): struct that holds the functors used by std::sort
8718 and std::lower_bound in MathedLookupBOP.
8720 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8722 * src/support/LAssert.h: do not do partial specialization. We do
8725 * src/support/lyxlib.h: note that lyx::getUserName() and
8726 lyx::date() are not in use right now. Should these be suppressed?
8728 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8729 (makeLinuxDocFile): do not put date and user name in linuxdoc
8732 * src/support/lyxlib.h (kill): change first argument to long int,
8733 since that's what solaris uses.
8735 * src/support/kill.C (kill): fix declaration to match prototype.
8737 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8738 actually check whether namespaces are supported. This is not what
8741 * src/support/lyxsum.C: add a using directive.
8743 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8745 * src/support/kill.C: if we have namespace support we don't have
8746 to include lyxlib.h.
8748 * src/support/lyxlib.h: use namespace lyx if supported.
8750 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8752 * src/support/date.C: new file
8754 * src/support/chdir.C: new file
8756 * src/support/getUserName.C: new file
8758 * src/support/getcwd.C: new file
8760 * src/support/abort.C: new file
8762 * src/support/kill.C: new file
8764 * src/support/lyxlib.h: moved all the functions in this file
8765 insede struct lyx. Added also kill and abort to this struct. This
8766 is a way to avoid the "kill is not defined in <csignal>", we make
8767 C++ wrappers for functions that are not ANSI C or ANSI C++.
8769 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8770 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8771 lyx it has been renamed to sum.
8773 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8775 * src/text.C: add using directives for std::min and std::max.
8777 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8779 * src/texrow.C (getIdFromRow): actually return something useful in
8780 id and pos. Hopefully fixes the bug with positionning of errorbox
8783 * src/lyx_main.C (easyParse): output an error and exit if an
8784 incorrect command line option has been given.
8786 * src/spellchecker.C (ispell_check_word): document a memory leak.
8788 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8789 where a "struct utimbuf" is allocated with "new" and deleted with
8792 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8794 * src/text2.C (CutSelection): don't delete double spaces.
8795 (PasteSelection): ditto
8796 (CopySelection): ditto
8798 * src/text.C (Backspace): don't delete double spaces.
8800 * src/lyxlex.C (next): fix a bug that were only present with
8801 conformant std::istream::get to read comment lines, use
8802 std::istream::getline instead. This seems to fix the problem.
8804 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8806 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8807 allowed to insert space before space" editing problem. Please read
8808 commends at the beginning of the function. Comments about usage
8811 * src/text.C (InsertChar): fix for the "not allowed to insert
8812 space before space" editing problem.
8814 * src/text2.C (DeleteEmptyParagraphMechanism): when
8815 IsEmptyTableRow can only return false this last "else if" will
8816 always be a no-op. Commented out.
8818 * src/text.C (RedoParagraph): As far as I can understand tmp
8819 cursor is not really needed.
8821 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8822 present it could only return false anyway.
8823 (several functions): Did something not so smart...added a const
8824 specifier on a lot of methods.
8826 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8827 and add a tmp->text.resize. The LyXParagraph constructor does the
8829 (BreakParagraphConservative): ditto
8831 * src/support/path.h (Path): add a define so that the wrong usage
8832 "Path("/tmp") will be flagged as a compilation error:
8833 "`unnamed_Path' undeclared (first use this function)"
8835 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8837 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8838 which was bogus for several reasons.
8840 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8844 * autogen.sh: do not use "type -path" (what's that anyway?).
8846 * src/support/filetools.C (findtexfile): remove extraneous space
8847 which caused a kpsewhich warning (at least with kpathsea version
8850 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8852 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8854 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8856 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8858 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8860 * src/paragraph.C (BreakParagraph): do not reserve space on text
8861 if we don't need to (otherwise, if pos_end < pos, we end up
8862 reserving huge amounts of memory due to bad unsigned karma).
8863 (BreakParagraphConservative): ditto, although I have not seen
8864 evidence the bug can happen here.
8866 * src/lyxparagraph.h: add a using std::list.
8868 2000-01-11 Juergen Vigna <jug@sad.it>
8870 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8873 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8875 * src/vc-backend.C (doVCCommand): change to be static and take one
8876 more parameter: the path to chdir too be fore executing the command.
8877 (retrive): new function equiv to "co -r"
8879 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8880 file_not_found_hook is true.
8882 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8884 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8885 if a file is readwrite,readonly...anything else.
8887 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8889 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8890 (CreatePostscript): name change from MenuRunDVIPS (or something)
8891 (PreviewPostscript): name change from MenuPreviewPS
8892 (PreviewDVI): name change from MenuPreviewDVI
8894 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8895 \view_pdf_command., \pdf_to_ps_command
8897 * lib/configure.m4: added search for PDF viewer, and search for
8898 PDF to PS converter.
8899 (lyxrc.defaults output): add \pdflatex_command,
8900 \view_pdf_command and \pdf_to_ps_command.
8902 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8904 * src/bufferlist.C (write): we don't use blocksize for anything so
8907 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8909 * src/support/block.h: disable operator T* (), since it causes
8910 problems with both compilers I tried. See comments in the file.
8912 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8915 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8916 variable LYX_DIR_10x to LYX_DIR_11x.
8918 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8920 * INSTALL: document --with-lyxname.
8923 * configure.in: new configure flag --with-lyxname which allows to
8924 choose the name under which lyx is installed. Default is "lyx", of
8925 course. It used to be possible to do this with --program-suffix,
8926 but the later has in fact a different meaning for autoconf.
8928 * src/support/lstrings.h (lstrchr): reformat a bit.
8930 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8931 * src/mathed/math_defs.h: ditto.
8933 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8935 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8936 true, decides if we create a backup file or not when saving. New
8937 tag and variable \pdf_mode, defaults to false. New tag and
8938 variable \pdflatex_command, defaults to pdflatex. New tag and
8939 variable \view_pdf_command, defaults to xpdf. New tag and variable
8940 \pdf_to_ps_command, defaults to pdf2ps.
8942 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8944 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8945 does not have a BufferView.
8946 (unlockInset): ditto + don't access the_locking_inset if the
8947 buffer does not have a BufferView.
8949 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8950 certain circumstances so that we don't continue a keyboard
8951 operation long after the key was released. Try f.ex. to load a
8952 large document, press PageDown for some seconds and then release
8953 it. Before this change the document would contine to scroll for
8954 some time, with this change it stops imidiatly.
8956 * src/support/block.h: don't allocate more space than needed. As
8957 long as we don't try to write to the arr[x] in a array_type arr[x]
8958 it is perfectly ok. (if you write to it you might segfault).
8959 added operator value_type*() so that is possible to pass the array
8960 to functions expecting a C-pointer.
8962 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8965 * intl/*: updated to gettext 0.10.35, tried to add our own
8966 required modifications. Please verify.
8968 * po/*: updated to gettext 0.10.35, tried to add our own required
8969 modifications. Please verify.
8971 * src/support/lstrings.C (tostr): go at fixing the problem with
8972 cxx and stringstream. When stringstream is used return
8973 oss.str().c_str() so that problems with lyxstring and basic_string
8974 are avoided. Note that the best solution would be for cxx to use
8975 basic_string all the way, but it is not conformant yet. (it seems)
8977 * src/lyx_cb.C + other files: moved several global functions to
8978 class BufferView, some have been moved to BufferView.[Ch] others
8979 are still located in lyx_cb.C. Code changes because of this. (part
8980 of "get rid of current_view project".)
8982 * src/buffer.C + other files: moved several Buffer functions to
8983 class BufferView, the functions are still present in buffer.C.
8984 Code changes because of this.
8986 * config/lcmessage.m4: updated to most recent. used when creating
8989 * config/progtest.m4: updated to most recent. used when creating
8992 * config/gettext.m4: updated to most recent. applied patch for
8995 * config/gettext.m4.patch: new file that shows what changes we
8996 have done to the local copy of gettext.m4.
8998 * config/libtool.m4: new file, used in creation of acinclude.m4
9000 * config/lyxinclude.m4: new file, this is the lyx created m4
9001 macros, used in making acinclude.m4.
9003 * autogen.sh: GNU m4 discovered as a separate task not as part of
9004 the lib/configure creation.
9005 Generate acinlucde from files in config. Actually cat
9006 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9007 easier to upgrade .m4 files that really are external.
9009 * src/Spacing.h: moved using std::istringstream to right after
9010 <sstream>. This should fix the problem seen with some compilers.
9012 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9014 * src/lyx_cb.C: began some work to remove the dependency a lot of
9015 functions have on BufferView::text, even if not really needed.
9016 (GetCurrentTextClass): removed this func, it only hid the
9019 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9020 forgot this in last commit.
9022 * src/Bullet.C (bulletEntry): use static char const *[] for the
9023 tables, becuase of this the return arg had to change to string.
9025 (~Bullet): removed unneeded destructor
9027 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9028 (insetSleep): moved from Buffer
9029 (insetWakeup): moved from Buffer
9030 (insetUnlock): moved from Buffer
9032 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9033 from Buffer to BufferView.
9035 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9037 * config/ltmain.sh: updated to version 1.3.4 of libtool
9039 * config/ltconfig: updated to version 1.3.4 of libtool
9041 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9044 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9045 Did I get that right?
9047 * src/lyxlex.h: add a "using" directive or two.
9048 * src/Spacing.h: ditto.
9049 * src/insets/figinset.C: ditto.
9050 * src/support/filetools.C: ditto.
9051 * src/support/lstrings.C: ditto.
9052 * src/BufferView.C: ditto.
9053 * src/bufferlist.C: ditto.
9054 * src/lyx_cb.C: ditto.
9055 * src/lyxlex.C: ditto.
9057 * NEWS: add some changes for 1.1.4.
9059 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9061 * src/BufferView.C: first go at a TextCache to speed up switching
9064 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9066 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9067 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9068 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9069 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9072 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9073 members of the struct are correctly initialized to 0 (detected by
9075 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9076 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9078 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9079 pidwait, since it was allocated with "new". This was potentially
9080 very bad. Thanks to Michael Schmitt for running purify for us.
9083 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9085 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9087 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9089 1999-12-30 Allan Rae <rae@lyx.org>
9091 * lib/templates/IEEEtran.lyx: minor change
9093 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9094 src/mathed/formula.C (LocalDispatch): askForText changes
9096 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9097 know when a user has cancelled input. Fixes annoying problems with
9098 inserting labels and version control.
9100 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9102 * src/support/lstrings.C (tostr): rewritten to use strstream and
9105 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9107 * src/support/filetools.C (IsFileWriteable): use fstream to check
9108 (IsDirWriteable): use fileinfo to check
9110 * src/support/filetools.h (FilePtr): whole class deleted
9112 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9114 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9116 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9118 * src/bufferlist.C (write): use ifstream and ofstream instead of
9121 * src/Spacing.h: use istrstream instead of sscanf
9123 * src/mathed/math_defs.h: change first arg to istream from FILE*
9125 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9127 * src/mathed/math_parser.C: have yyis to be an istream
9128 (LexGetArg): use istream (yyis)
9130 (mathed_parse): ditto
9131 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9133 * src/mathed/formula.C (Read): rewritten to use istream
9135 * src/mathed/formulamacro.C (Read): rewritten to use istream
9137 * src/lyxlex.h (~LyXLex): deleted desturctor
9138 (getStream): new function, returns an istream
9139 (getFile): deleted funtion
9140 (IsOK): return is.good();
9142 * src/lyxlex.C (LyXLex): delete file and owns_file
9143 (setFile): open an filebuf and assign that to a istream instead of
9145 (setStream): new function, takes an istream as arg.
9146 (setFile): deleted function
9147 (EatLine): rewritten us use istream instead of FILE*
9151 * src/table.C (LyXTable): use istream instead of FILE*
9152 (Read): rewritten to take an istream instead of FILE*
9154 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9156 * src/buffer.C (Dispatch): remove an extraneous break statement.
9158 * src/support/filetools.C (QuoteName): change to do simple
9159 'quoting'. More work is necessary. Also changed to do nothing
9160 under emx (needs fix too).
9161 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9163 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9164 config.h.in to the AC_DEFINE_UNQUOTED() call.
9165 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9166 needs char * as argument (because Solaris 7 declares it like
9169 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9170 remove definition of BZERO.
9172 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9174 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9175 defined, "lyxregex.h" if not.
9177 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9179 (REGEX): new variable that is set to regex.c lyxregex.h when
9180 AM_CONDITIONAL USE_REGEX is set.
9181 (libsupport_la_SOURCES): add $(REGEX)
9183 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9186 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9189 * configure.in: add call to LYX_REGEX
9191 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9192 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9194 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9196 * lib/bind/fi_menus.bind: new file, from
9197 pauli.virtanen@saunalahti.fi.
9199 * src/buffer.C (getBibkeyList): pass the parameter delim to
9200 InsetInclude::getKeys and InsetBibtex::getKeys.
9202 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9203 is passed to Buffer::getBibkeyList
9205 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9206 instead of the hardcoded comma.
9208 * src/insets/insetbib.C (getKeys): make sure that there are not
9209 leading blanks in bibtex keys. Normal latex does not care, but
9210 harvard.sty seems to dislike blanks at the beginning of citation
9211 keys. In particular, the retturn value of the function is
9213 * INSTALL: make it clear that libstdc++ is needed and that gcc
9214 2.7.x probably does not work.
9216 * src/support/filetools.C (findtexfile): make debug message go to
9218 * src/insets/insetbib.C (getKeys): ditto
9220 * src/debug.C (showTags): make sure that the output is correctly
9223 * configure.in: add a comment for TWO_COLOR_ICON define.
9225 * acconfig.h: remove all the entries that already defined in
9226 configure.in or acinclude.m4.
9228 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9229 to avoid user name, date and copyright.
9231 1999-12-21 Juergen Vigna <jug@sad.it>
9233 * src/table.C (Read): Now read bogus row format informations
9234 if the format is < 5 so that afterwards the table can
9235 be read by lyx but without any format-info. Fixed the
9236 crash we experienced when not doing this.
9238 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9240 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9241 (RedoDrawingOfParagraph): ditto
9242 (RedoParagraphs): ditto
9243 (RemoveTableRow): ditto
9245 * src/text.C (Fill): rename arg paperwidth -> paper_width
9247 * src/buffer.C (insertLyXFile): rename var filename -> fname
9248 (writeFile): rename arg filename -> fname
9249 (writeFileAscii): ditto
9250 (makeLaTeXFile): ditto
9251 (makeLinuxDocFile): ditto
9252 (makeDocBookFile): ditto
9254 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9257 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9259 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9262 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9263 compiled by a C compiler not C++.
9265 * src/layout.h (LyXTextClass): added typedef for const_iterator
9266 (LyXTextClassList): added typedef for const_iterator + member
9267 functions begin and end.
9269 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9270 iterators to fill the choice_class.
9271 (updateLayoutChoice): rewritten to use iterators to fill the
9272 layoutlist in the toolbar.
9274 * src/BufferView.h (BufferView::work_area_width): removed unused
9277 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9279 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9280 (sgmlCloseTag): ditto
9282 * src/support/lstrings.h: return type of countChar changed to
9285 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9286 what version of this func to use. Also made to return unsigned int.
9288 * configure.in: call LYX_STD_COUNT
9290 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9291 conforming std::count.
9293 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9295 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9296 and a subscript would give bad display (patch from Dekel Tsur
9297 <dekel@math.tau.ac.il>).
9299 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9301 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9304 * src/chset.h: add a few 'using' directives
9306 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9307 triggered when no buffer is active
9309 * src/layout.C: removed `break' after `return' in switch(), since
9312 * src/lyx_main.C (init): make sure LyX can be ran in place even
9313 when libtool has done its magic with shared libraries. Fix the
9314 test for the case when the system directory has not been found.
9316 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9317 name for the latex file.
9318 (MenuMakeHTML): ditto
9320 * src/buffer.h: add an optional boolean argument, which is passed
9323 1999-12-20 Allan Rae <rae@lyx.org>
9325 * lib/templates/IEEEtran.lyx: small correction and update.
9327 * configure.in: Attempted to use LYX_PATH_HEADER
9329 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9331 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9332 input from JMarc. Now use preprocessor to find the header.
9333 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9334 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9335 LYX_STL_STRING_FWD. See comments in file.
9337 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9339 * The global MiniBuffer * minibuffer variable is dead.
9341 * The global FD_form_main * fd_form_main variable is dead.
9343 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9345 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9347 * src/table.h: add the LOstream.h header
9348 * src/debug.h: ditto
9350 * src/LyXAction.h: change the explaination of the ReadOnly
9351 attribute: is indicates that the function _can_ be used.
9353 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9356 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9358 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9364 * src/paragraph.C (GetWord): assert on pos>=0
9367 * src/support/lyxstring.C: condition the use of an invariant on
9369 * src/support/lyxstring.h: ditto
9371 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9372 Use LAssert.h instead of plain assert().
9374 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9376 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9377 * src/support/filetools.C: ditto
9379 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9382 * INSTALL: document the new configure flags
9384 * configure.in: suppress --with-debug; add --enable-assertions
9386 * acinclude.m4: various changes in alignment of help strings.
9388 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9390 * src/kbmap.C: commented out the use of the hash map in kb_map,
9391 beginning of movement to a stl::container.
9393 * several files: removed code that was not in effect when
9394 MOVE_TEXT was defined.
9396 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9397 for escaping should not be used. We can discuss if the string
9398 should be enclosed in f.ex. [] instead of "".
9400 * src/trans_mgr.C (insert): use the new returned value from
9401 encodeString to get deadkeys and keymaps done correctly.
9403 * src/chset.C (encodeString): changed to return a pair, to tell
9404 what to use if we know the string.
9406 * src/lyxscreen.h (fillArc): new function.
9408 * src/FontInfo.C (resize): rewritten to use more std::string like
9409 structore, especially string::replace.
9411 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9414 * configure.in (chmod +x some scripts): remove config/gcc-hack
9416 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9418 * src/buffer.C (writeFile): change once again the top comment in a
9419 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9420 instead of an hardcoded version number.
9421 (makeDocBookFile): ditto
9423 * src/version.h: add new define LYX_DOCVERSION
9425 * po/de.po: update from Pit Sütterlin
9426 * lib/bind/de_menus.bind: ditto.
9428 * src/lyxfunc.C (Dispatch): call MenuExport()
9429 * src/buffer.C (Dispatch): ditto
9431 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9432 LyXFunc::Dispatch().
9433 (MenuExport): new function, moved from
9434 LyXFunc::Dispatch().
9436 * src/trans_mgr.C (insert): small cleanup
9437 * src/chset.C (loadFile): ditto
9439 * lib/kbd/iso8859-1.cdef: add missing backslashes
9441 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9443 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9444 help with placing the manually drawn accents better.
9446 (Draw): x2 and hg changed to float to minimize rounding errors and
9447 help place the accents better.
9449 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9450 unsigned short to char is just wrong...cast the char to unsigned
9451 char instead so that the two values can compare sanely. This
9452 should also make the display of insetlatexaccents better and
9453 perhaps also some other insets.
9455 (lbearing): new function
9458 1999-12-15 Allan Rae <rae@lyx.org>
9460 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9461 header that provides a wrapper around the very annoying SGI STL header
9464 * src/support/lyxstring.C, src/LString.h:
9465 removed old SGI-STL-compatability attempts.
9467 * configure.in: Use LYX_STL_STRING_FWD.
9469 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9470 stl_string_fwd.h is around and try to determine it's location.
9471 Major improvement over previous SGI STL 3.2 compatability.
9472 Three small problems remain with this function due to my zero
9473 knowledge of autoconf. JMarc and lgb see the comments in the code.
9475 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9477 * src/broken_const.h, config/hack-gcc, config/README: removed
9479 * configure.in: remove --with-gcc-hack option; do not call
9482 * INSTALL: remove documentation of --with-broken-const and
9485 * acconfig.h: remove all trace of BROKEN_CONST define
9487 * src/buffer.C (makeDocBookFile): update version number in output
9489 (SimpleDocBookOnePar): fix an assert when trying to a character
9490 access beyond string length
9493 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9495 * po/de.po: fix the Export menu
9497 * lyx.man: update the description of -dbg
9499 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9500 (commandLineHelp): updated
9501 (easyParse): show list of available debug levels if -dbg is passed
9504 * src/Makefile.am: add debug.C
9506 * src/debug.h: moved some code to debug.C
9508 * src/debug.C: new file. Contains code to set and show debug
9511 * src/layout.C: remove 'break' after 'continue' in switch
9512 statements, since these cannot be reached.
9514 1999-12-13 Allan Rae <rae@lyx.org>
9516 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9517 (in_word_set): hash() -> math_hash()
9519 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9521 * acconfig.h: Added a test for whether we are using exceptions in the
9522 current compilation run. If so USING_EXCEPTIONS is defined.
9524 * config.in: Check for existance of stl_string_fwd.h
9525 * src/LString.h: If compiling --with-included-string and SGI's
9526 STL version 3.2 is present (see above test) we need to block their
9527 forward declaration of string and supply a __get_c_string().
9528 However, it turns out this is only necessary if compiling with
9529 exceptions enabled so I've a bit more to add yet.
9531 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9532 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9533 src/support/LRegex.h, src/undo.h:
9534 Shuffle the order of the included files a little to ensure that
9535 LString.h gets included before anything that includes stl_string_fwd.h
9537 * src/support/lyxstring.C: We need to #include LString.h instead of
9538 lyxstring.h to get the necessary definition of __get_c_string.
9539 (__get_c_string): New function. This is defined static just like SGI's
9540 although why they need to do this I'm not sure. Perhaps it should be
9541 in lstrings.C instead.
9543 * lib/templates/IEEEtran.lyx: New template file.
9545 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9547 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9548 * intl/Makefile.in (MKINSTALLDIRS): ditto
9550 * src/LyXAction.C (init): changed to hold the LFUN data in a
9551 automatic array in stead of in callso to newFunc, this speeds up
9552 compilation a lot. Also all the memory used by the array is
9553 returned when the init is completed.
9555 * a lot of files: compiled with -Wold-style-cast, changed most of
9556 the reported offenders to C++ style casts. Did not change the
9557 offenders in C files.
9559 * src/trans.h (Match): change argument type to unsigned int.
9561 * src/support/DebugStream.C: fix some types on the streambufs so
9562 that it works on a conforming implementation.
9564 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9566 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9568 * src/support/lyxstring.C: remove the inline added earlier since
9569 they cause a bunch of unsatisfied symbols when linking with dec
9570 cxx. Cxx likes to have the body of inlines at the place where they
9573 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9574 accessing negative bounds in array. This fixes the crash when
9575 inserting accented characters.
9576 * src/trans.h (Match): ditto
9578 * src/buffer.C (Dispatch): since this is a void, it should not try
9579 to return anything...
9581 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9583 * src/buffer.h: removed the two friends from Buffer. Some changes
9584 because of this. Buffer::getFileName and Buffer::setFileName
9585 renamed to Buffer::fileName() and Buffer::fileName(...).
9587 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9589 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9590 and Buffer::update(short) to BufferView. This move is currently
9591 controlled by a define MOVE_TEXT, this will be removed when all
9592 shows to be ok. This move paves the way for better separation
9593 between buffer contents and buffer view. One side effect is that
9594 the BufferView needs a rebreak when swiching buffers, if we want
9595 to avoid this we can add a cache that holds pointers to LyXText's
9596 that is not currently in use.
9598 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9601 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9603 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9605 * lyx_main.C: new command line option -x (or --execute) and
9606 -e (or --export). Now direct conversion from .lyx to .tex
9607 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9608 Unfortunately, X is still needed and the GUI pops up during the
9611 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9613 * src/Spacing.C: add a using directive to bring stream stuff into
9615 * src/paragraph.C: ditto
9616 * src/buffer.C: ditto
9618 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9619 from Lars' announcement).
9621 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9622 example files from Tino Meinen.
9624 1999-12-06 Allan Rae <rae@lyx.org>
9626 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9628 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9630 * src/support/lyxstring.C: added a lot of inline for no good
9633 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9634 latexWriteEndChanges, they were not used.
9636 * src/layout.h (operator<<): output operator for PageSides
9638 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9640 * some example files: loaded in LyX 1.0.4 and saved again to update
9641 certain constructs (table format)
9643 * a lot of files: did the change to use fstream/iostream for all
9644 writing of files. Done with a close look at Andre Poenitz's patch.
9646 * some files: whitespace changes.
9648 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9650 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9651 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9652 architecture, we provide our own. It is used unconditionnally, but
9653 I do not think this is a performance problem. Thanks to Angus
9654 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9655 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9657 (GetInset): use my_memcpy.
9661 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9662 it is easier to understand, but it uses less TeX-only constructs now.
9664 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9665 elements contain spaces
9667 * lib/configure: regenerated
9669 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9670 elements contain spaces; display the list of programs that are
9673 * autogen.sh: make sure lib/configure is executable
9675 * lib/examples/*: rename the tutorial examples to begin with the
9676 two-letters language code.
9678 * src/lyxfunc.C (getStatus): do not query current font if no
9681 * src/lyx_cb.C (RunScript): use QuoteName
9682 (MenuRunDvips): ditto
9683 (PrintApplyCB): ditto
9685 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9686 around argument, so that it works well with the current shell.
9687 Does not work properly with OS/2 shells currently.
9689 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9690 * src/LyXSendto.C (SendtoApplyCB): ditto
9691 * src/lyxfunc.C (Dispatch): ditto
9692 * src/buffer.C (runLaTeX): ditto
9693 (runLiterate): ditto
9694 (buildProgram): ditto
9696 * src/lyx_cb.C (RunScript): ditto
9697 (MenuMakeLaTeX): ditto
9699 * src/buffer.h (getLatexName): new method
9701 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9703 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9705 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9706 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9707 (create_math_panel): ditto
9709 * src/lyxfunc.C (getStatus): re-activate the code which gets
9710 current font and cursor; add test for export to html.
9712 * src/lyxrc.C (read): remove unreachable break statements; add a
9715 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9717 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9719 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9720 introduced by faulty regex.
9721 * src/buffer.C: ditto
9722 * src/lastfiles.C: ditto
9723 * src/paragraph.C: ditto
9724 * src/table.C: ditto
9725 * src/vspace.C: ditto
9726 * src/insets/figinset.C: ditto
9727 Note: most of these is absolutely harmless, except the one in
9728 src/mathed formula.C.
9730 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9732 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9733 operation, yielding correct results for the reLyX command.
9735 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9737 * src/support/filetools.C (ExpandPath): removed an over eager
9739 (ReplaceEnvironmentPath): ditto
9741 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9742 shows that we are doing something fishy in our code...
9746 * src/lyxrc.C (read): use a double switch trick to get more help
9747 from the compiler. (the same trick is used in layout.C)
9748 (write): new function. opens a ofstream and pass that to output
9749 (output): new function, takes a ostream and writes the lyxrc
9750 elemts to it. uses a dummy switch to make sure no elements are
9753 * src/lyxlex.h: added a struct pushpophelper for use in functions
9754 with more than one exit point.
9756 * src/lyxlex.[Ch] (GetInteger): made it const
9760 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9762 * src/layout.[hC] : LayoutTags splitted into several enums, new
9763 methods created, better error handling cleaner use of lyxlex. Read
9766 * src/bmtable.[Ch]: change some member prototypes because of the
9767 image const changes.
9769 * commandtags.h, src/LyXAction.C (init): new function:
9770 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9771 This file is not read automatically but you can add \input
9772 preferences to your lyxrc if you want to. We need to discuss how
9775 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9776 in .aux, also remove .bib and .bst files from dependencies when
9779 * src/BufferView.C, src/LyXView.C: add const_cast several places
9780 because of changes to images.
9782 * lib/images/*: same change as for images/*
9784 * lib/lyxrc.example: Default for accept_compound is false not no.
9786 * images/*: changed to be const, however I have som misgivings
9787 about this change so it might be changed back.
9789 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9791 * lib/configure, po/POTFILES.in: regenerated
9793 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9795 * config/lib_configure.m4: removed
9797 * lib/configure.m4: new file (was config/lib_configure.m4)
9799 * configure.in: do not test for rtti, since we do not use it.
9801 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9803 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9804 doubling of allocated space scheme. This makes it faster for large
9805 strings end to use less memory for small strings. xtra rememoved.
9807 * src/insets/figinset.C (waitalarm): commented out.
9808 (GhostscriptMsg): use static_cast
9809 (GhostscriptMsg): use new instead of malloc to allocate memory for
9810 cmap. also delete the memory after use.
9812 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9814 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9815 for changes in bibtex database or style.
9816 (runBibTeX): remove all .bib and .bst files from dep before we
9818 (run): use scanAuc in when dep file already exist.
9820 * src/DepTable.C (remove_files_with_extension): new method
9823 * src/DepTable.[Ch]: made many of the methods const.
9825 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9827 * src/bufferparams.C: make sure that the default textclass is
9828 "article". It used to be the first one by description order, but
9829 now the first one is "docbook".
9831 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9832 string; call Debug::value.
9833 (easyParse): pass complete argument to setDebuggingLevel().
9835 * src/debug.h (value): fix the code that parses debug levels.
9837 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9840 * src/LyXAction.C: use Debug::ACTION as debug channel.
9842 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9844 * NEWS: updated for the future 1.1.3 release.
9846 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9847 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9848 it should. This is of course a controversial change (since many
9849 people will find that their lyx workscreen is suddenly full of
9850 red), but done for the sake of correctness.
9852 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9853 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9855 * src/insets/inseterror.h, src/insets/inseturl.h,
9856 src/insets/insetinfo.h, src/insets/figinset.h,
9857 src/mathed/formulamacro.h, src/mathed/math_macro.h
9858 (EditMessage): add a missing const and add _() to make sure that
9861 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9862 src/insets/insetbib.C, src/support/filetools.C: add `using'
9865 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9866 doing 'Insert index of last word' at the beginning of a paragraph.
9868 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9870 * several files: white-space changes.
9872 * src/mathed/formula.C: removed IsAlpha and IsDigit
9874 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9875 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9878 * src/insets/figinset.C (GetPSSizes): don't break when
9879 "EndComments" is seen. But break when a boundingbox is read.
9881 * all classes inherited from Inset: return value of Clone
9882 changed back to Inset *.
9884 * all classes inherited form MathInset: return value of Clone
9885 changed back to MathedInset *.
9887 * src/insets/figinset.C (runqueue): use a ofstream to output the
9888 gs/ps file. Might need some setpresicion or setw. However I can
9889 see no problem with the current code.
9890 (runqueue): use sleep instead of the alarm/signal code. I just
9891 can't see the difference.
9893 * src/paragraph.C (LyXParagraph): reserve space in the new
9894 paragraph and resize the inserted paragraph to just fit.
9896 * src/lyxfunc.h (operator|=): added operator for func_status.
9898 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9899 check for readable file.
9901 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9902 check for readable file.
9903 (MenuMakeLinuxDoc): ditto
9904 (MenuMakeDocBook): ditto
9905 (MenuMakeAscii): ditto
9906 (InsertAsciiFile): split the test for openable and readable
9908 * src/bmtable.C (draw_bitmaptable): use
9909 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9911 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9912 findtexfile from LaTeX to filetools.
9914 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9915 instead of FilePtr. Needs to be verified by a literate user.
9917 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9919 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9920 (EditMessage): likewise.
9922 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9923 respectively as \textasciitilde and \textasciicircum.
9925 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9927 * src/support/lyxstring.h: made the methods that take iterators
9930 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9931 (regexMatch): made is use the real regex class.
9933 * src/support/Makefile.am: changed to use libtool
9935 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9937 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9939 (MathIsInset ++): changed several macros to be inline functions
9942 * src/mathed/Makefile.am: changed to use libtool
9944 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9946 * src/insets/inset* : Clone changed to const and return type is
9947 the true insettype not just Inset*.
9949 * src/insets/Makefile.am: changed to use libtool
9951 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9953 * src/undo.[Ch] : added empty() and changed some of the method
9956 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9958 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9959 setID use block<> for the bullets array, added const several places.
9961 * src/lyxfunc.C (getStatus): new function
9963 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9964 LyXAction, added const to several funtions.
9966 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9967 a std::map, and to store the dir items in a vector.
9969 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9972 * src/LyXView.[Ch] + other files : changed currentView to view.
9974 * src/LyXAction.[Ch] : ported from the old devel branch.
9976 * src/.cvsignore: added .libs and a.out
9978 * configure.in : changes to use libtool.
9980 * acinclude.m4 : inserted libtool.m4
9982 * .cvsignore: added libtool
9984 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9986 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9987 file name in insets and mathed directories (otherwise the
9988 dependency is not taken in account under cygwin).
9990 * src/text2.C (InsertString[AB]): make sure that we do not try to
9991 read characters past the string length.
9993 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9995 * lib/doc/LaTeXConfig.lyx.in,
9996 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9998 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9999 file saying who created them and when this heppened; this is
10000 useless and annoys tools like cvs.
10002 * lib/layouts/g-brief-{en,de}.layout,
10003 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10004 from Thomas Hartkens <thomas@hartkens.de>.
10006 * src/{insets,mathed}/Makefile.am: do not declare an empty
10007 LDFLAGS, so that it can be set at configure time (useful on Irix
10010 * lib/reLyX/configure.in: make sure that the prefix is set
10011 correctly in LYX_DIR.
10013 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10015 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10016 be used by 'command-sequence' this allows to bind a key to a
10017 sequence of LyX-commands
10018 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10020 * src/LyXAction.C: add "command-sequence"
10022 * src/LyXFunction.C: handling of "command-sequence"
10024 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10025 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10027 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10029 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10031 * src/buffer.C (writeFile): Do not output a comment giving user
10032 and date at the beginning of a .lyx file. This is useless and
10033 annoys cvs anyway; update version number to 1.1.
10035 * src/Makefile.am (LYX_DIR): add this definition, so that a
10036 default path is hardcoded in LyX.
10038 * configure.in: Use LYX_GNU_GETTEXT.
10040 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10041 AM_GNU_GETTEXT with a bug fixed.
10043 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10045 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10047 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10048 which is used to point to LyX data is now LYX_DIR_11x.
10050 * lyx.man: convert to a unix text file; small updates.
10052 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10054 * src/support/LSubstring.[Ch]: made the second arg of most of the
10055 constructors be a const reference.
10057 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10060 * src/support/lyxstring.[Ch] (swap): added missing member function
10061 and specialization of swap(str, str);
10063 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10065 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10066 trace of the old one.
10068 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10069 put the member definitions in undo.C.
10071 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10072 NEW_TEXT and have now only code that was included when this was
10075 * src/intl.C (LCombo): use static_cast
10077 (DispatchCallback): ditto
10079 * src/definitions.h: removed whole file
10081 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10083 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10084 parsing and stores in a std:map. a regex defines the file format.
10085 removed unneeded members.
10087 * src/bufferparams.h: added several enums from definitions.h here.
10088 Removed unsused destructor. Changed some types to use proper enum
10089 types. use block to have the temp_bullets and user_defined_bullets
10090 and to make the whole class assignable.
10092 * src/bufferparams.C (Copy): removed this functions, use a default
10093 assignment instead.
10095 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10098 * src/buffer.C (readLyXformat2): commend out all that have with
10099 oldpapersize to do. also comment out all that hve to do with
10100 insetlatex and insetlatexdel.
10101 (setOldPaperStuff): commented out
10103 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10105 * src/LyXAction.C: remove use of inset-latex-insert
10107 * src/mathed/math_panel.C (button_cb): use static_cast
10109 * src/insets/Makefile.am (insets_o_SOURCES): removed
10112 * src/support/lyxstring.C (helper): use the unsigned long
10113 specifier, UL, instead of a static_cast.
10115 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10117 * src/support/block.h: new file. to be used as a c-style array in
10118 classes, so that the class can be assignable.
10120 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10122 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10123 NULL, make sure to return an empty string (it is not possible to
10124 set a string to NULL).
10126 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10128 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10130 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10132 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10133 link line, so that Irix users (for example) can set it explicitely to
10136 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10137 it can be overidden at make time (static or dynamic link, for
10140 * src/vc-backend.C, src/LaTeXFeatures.h,
10141 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10142 statements to bring templates to global namespace.
10144 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10146 * src/support/lyxstring.C (operator[] const): make it standard
10149 * src/minibuffer.C (Init): changed to reflect that more
10150 information is given from the lyxvc and need not be provided here.
10152 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10154 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10156 * src/LyXView.C (UpdateTimerCB): use static_cast
10157 (KeyPressMask_raw_callback): ditto
10159 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10160 buffer_, a lot of changes because of this. currentBuffer() ->
10161 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10162 also changes to other files because of this.
10164 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10166 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10167 have no support for RCS and partial support for CVS, will be
10170 * src/insets/ several files: changes because of function name
10171 changes in Bufferview and LyXView.
10173 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10175 * src/support/LSubstring.[Ch]: new files. These implement a
10176 Substring that can be very convenient to use. i.e. is this
10178 string a = "Mary had a little sheep";
10179 Substring(a, "sheep") = "lamb";
10180 a is now "Mary has a little lamb".
10182 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10183 out patterns and subpatterns of strings. It is used by LSubstring
10184 and also by vc-backend.C
10186 * src/support/lyxstring.C: went over all the assertions used and
10187 tried to correct the wrong ones and flag which of them is required
10188 by the standard. some bugs found because of this. Also removed a
10189 couple of assertions.
10191 * src/support/Makefile.am (libsupport_a_SOURCES): added
10192 LSubstring.[Ch] and LRegex.[Ch]
10194 * src/support/FileInfo.h: have struct stat buf as an object and
10195 not a pointer to one, some changes because of this.
10197 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10198 information in layout when adding the layouts preamble to the
10199 textclass preamble.
10201 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10204 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10205 because of bug in OS/2.
10207 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10209 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10210 \verbatim@font instead of \ttfamily, so that it can be redefined.
10212 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10213 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10214 src/layout.h, src/text2.C: add 'using' directive to bring the
10215 STL templates we need from the std:: namespace to the global one.
10216 Needed by DEC cxx in strict ansi mode.
10218 * src/support/LIstream.h,src/support/LOstream.h,
10219 src/support/lyxstring.h,src/table.h,
10220 src/lyxlookup.h: do not include <config.h> in header
10221 files. This should be done in the .C files only.
10223 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10227 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10229 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10230 from Kayvan to fix the tth invokation.
10232 * development/lyx.spec.in: updates from Kayvan to reflect the
10233 changes of file names.
10235 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10237 * src/text2.C (InsertStringB): use std::copy
10238 (InsertStringA): use std::copy
10240 * src/bufferlist.C: use a vector to store the buffers in. This is
10241 an internal change and should not affect any other thing.
10243 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10246 * src/text.C (Fill): fix potential bug, one off bug.
10248 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10250 * src/Makefile.am (lyx_main.o): add more files it depends on.
10252 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10254 * src/support/lyxstring.C: use size_t for the reference count,
10255 size, reserved memory and xtra.
10256 (internal_compare): new private member function. Now the compare
10257 functions should work for std::strings that have embedded '\0'
10259 (compare): all compare functions rewritten to use
10262 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10264 * src/support/lyxstring.C (compare): pass c_str()
10265 (compare): pass c_str
10266 (compare): pass c_str
10268 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10270 * src/support/DebugStream.C: <config.h> was not included correctly.
10272 * lib/configure: forgot to re-generate it :( I'll make this file
10273 auto generated soon.
10275 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10277 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10280 * src/support/lyxstring.C: some changes from length() to rep->sz.
10281 avoids a function call.
10283 * src/support/filetools.C (SpaceLess): yet another version of the
10284 algorithm...now per Jean-Marc's suggestions.
10286 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10288 * src/layout.C (less_textclass_desc): functor for use in sorting
10290 (LyXTextClass::Read): sort the textclasses after reading.
10292 * src/support/filetools.C (SpaceLess): new version of the
10293 SpaceLess functions. What problems does this one give? Please
10296 * images/banner_bw.xbm: made the arrays unsigned char *
10298 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10300 * src/support/lyxstring.C (find): remove bogus assertion in the
10301 two versions of find where this has not been done yet.
10303 * src/support/lyxlib.h: add missing int return type to
10306 * src/menus.C (ShowFileMenu): disable exporting to html if no
10307 html export command is present.
10309 * config/lib_configure.m4: add a test for an HTML converter. The
10310 programs checked for are, in this order: tth, latex2html and
10313 * lib/configure: generated from config/lib_configure.m4.
10315 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10316 html converter. The parameters are now passed through $$FName and
10317 $$OutName, instead of standard input/output.
10319 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10321 * lib/lyxrc.example: update description of \html_command.
10322 add "quotes" around \screen_font_xxx font setting examples to help
10323 people who use fonts with spaces in their names.
10325 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10327 * Distribution files: updates for v1.1.2
10329 * src/support/lyxstring.C (find): remove bogus assert and return
10330 npos for the same condition.
10332 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10334 * added patch for OS/2 from SMiyata.
10336 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10338 * src/text2.C (CutSelection): make space_wrapped a bool
10339 (CutSelection): dont declare int i until we have to.
10340 (alphaCounter): return a char const *.
10342 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10344 * src/support/syscall.C (Systemcalls::kill):
10345 src/support/filetools.C (PutEnv, PutEnvPath):
10346 src/lyx_cb.C (addNewlineAndDepth):
10347 src/FontInfo.C (FontInfo::resize): condition some #warning
10348 directives with WITH_WARNINGS.
10351 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10353 * src/layout.[Ch] + several files: access to class variables
10354 limited and made accessor functions instead a lot of code changed
10355 becuase of this. Also instead of returning pointers often a const
10356 reference is returned instead.
10358 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10360 * src/Makefile.am (dist-hook): added used to remove the CVS from
10361 cheaders upon creating a dist
10362 (EXTRA_DIST): added cheaders
10364 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10365 a character not as a small integer.
10367 * src/support/lyxstring.C (find): removed Assert and added i >=
10368 rep->sz to the first if.
10370 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10372 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10373 src/LyXView.C src/buffer.C src/bufferparams.C
10374 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10375 src/text2.C src/insets/insetinclude.C:
10376 lyxlayout renamed to textclasslist.
10378 * src/layout.C: some lyxerr changes.
10380 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10381 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10382 (LyXLayoutList): removed all traces of this class.
10383 (LyXTextClass::Read): rewrote LT_STYLE
10384 (LyXTextClass::hasLayout): new function
10385 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10386 both const and nonconst version.
10387 (LyXTextClass::delete_layout): new function.
10388 (LyXTextClassList::Style): bug fix. do the right thing if layout
10390 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10391 (LyXTextClassList::NameOfLayout): ditto
10392 (LyXTextClassList::Load): ditto
10394 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10396 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10398 * src/LyXAction.C (LookupFunc): added a workaround for sun
10399 compiler, on the other hand...we don't know if the current code
10400 compiles on sun at all...
10402 * src/support/filetools.C (CleanupPath): subst fix
10404 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10407 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10408 complained about this one?
10410 * src/insets/insetinclude.C (Latex): subst fix
10412 * src/insets/insetbib.C (getKeys): subst fix
10414 * src/LyXSendto.C (SendtoApplyCB): subst fix
10416 * src/lyx_main.C (init): subst fix
10418 * src/layout.C (Read): subst fix
10420 * src/lyx_sendfax_main.C (button_send): subst fix
10422 * src/buffer.C (RoffAsciiTable): subst fix
10424 * src/lyx_cb.C (MenuFax): subst fix
10425 (PrintApplyCB): subst fix
10427 1999-10-26 Juergen Vigna <jug@sad.it>
10429 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10431 (Read): Cleaned up this code so now we read only format vestion >= 5
10433 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10435 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10436 come nobody has complained about this one?
10438 * src/insets/insetinclude.C (Latex): subst fix
10440 * src/insets/insetbib.C (getKeys): subst fix
10442 * src/lyx_main.C (init): subst fix
10444 * src/layout.C (Read): subst fix
10446 * src/buffer.C (RoffAsciiTable): subst fix
10448 * src/lyx_cb.C (MenuFax): subst fix.
10450 * src/layout.[hC] + some other files: rewrote to use
10451 std::container to store textclasses and layouts in.
10452 Simplified, removed a lot of code. Make all classes
10453 assignable. Further simplifications and review of type
10454 use still to be one.
10456 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10457 lastfiles to create the lastfiles partr of the menu.
10459 * src/lastfiles.[Ch]: rewritten to use deque to store the
10460 lastfiles in. Uses fstream for reading and writing. Simplifies
10463 * src/support/syscall.C: remove explicit cast.
10465 * src/BufferView.C (CursorToggleCB): removed code snippets that
10466 were commented out.
10467 use explicat C++ style casts instead of C style casts. also use
10468 u_vdata instea of passing pointers in longs.
10470 * src/PaperLayout.C: removed code snippets that were commented out.
10472 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10474 * src/lyx_main.C: removed code snippets that wer commented out.
10476 * src/paragraph.C: removed code snippets that were commented out.
10478 * src/lyxvc.C (logClose): use static_cast
10480 (viewLog): remove explicit cast to void*
10481 (showLog): removed old commented code
10483 * src/menus.C: use static_cast instead of C style casts. use
10484 u_vdata instead of u_ldata. remove explicit cast to (long) for
10485 pointers. Removed old code that was commented out.
10487 * src/insets/inset.C: removed old commented func
10489 * src/insets/insetref.C (InsetRef): removed old code that had been
10490 commented out for a long time.
10492 (escape): removed C style cast
10494 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10496 * src/insets/insetlatex.C (Draw): removed old commented code
10497 (Read): rewritten to use string
10499 * src/insets/insetlabel.C (escape): removed C style cast
10501 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10503 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10504 old commented code.
10506 * src/insets/insetinclude.h: removed a couple of stupid bools
10508 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10509 (Clone): remove C style cast
10510 (getKeys): changed list to lst because of std::list
10512 * src/insets/inseterror.C (Draw): removed som old commented code.
10514 * src/insets/insetcommand.C (Draw): removed some old commented code.
10516 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10517 commented out forever.
10518 (bibitem_cb): use static_cast instead of C style cast
10519 use of vdata changed to u_vdata.
10521 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10523 (CloseUrlCB): use static_cast instead of C style cast.
10524 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10526 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10527 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10528 (CloseInfoCB): static_cast from ob->u_vdata instead.
10529 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10532 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10533 (C_InsetError_CloseErrorCB): forward the ob parameter
10534 (CloseErrorCB): static_cast from ob->u_vdata instead.
10536 * src/vspace.h: include LString.h since we use string in this class.
10538 * src/vspace.C (lyx_advance): changed name from advance because of
10539 nameclash with stl. And since we cannot use namespaces yet...I
10540 used a lyx_ prefix instead. Expect this to change when we begin
10543 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10545 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10546 and removed now defunct constructor and deconstructor.
10548 * src/BufferView.h: have backstack as a object not as a pointer.
10549 removed initialization from constructor. added include for BackStack
10551 * development/lyx.spec.in (%build): add CFLAGS also.
10553 * src/screen.C (drawFrame): removed another warning.
10555 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10557 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10558 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10559 README and ANNOUNCE a bit for the next release. More work is
10562 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10563 unbreakable if we are in freespacing mode (LyX-Code), but not in
10566 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10568 * src/BackStack.h: fixed initialization order in constructor
10570 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10572 * acinclude.m4 (VERSION): new rules for when a version is
10573 development, added also a variable for prerelease.
10574 (warnings): we set with_warnings=yes for prereleases
10575 (lyx_opt): prereleases compile with same optimization as development
10576 (CXXFLAGS): only use pedantic if we are a development version
10578 * src/BufferView.C (restorePosition): don't do anything if the
10579 backstack is empty.
10581 * src/BackStack.h: added member empty, use this to test if there
10582 is anything to pop...
10584 1999-10-25 Juergen Vigna <jug@sad.it>
10587 * forms/layout_forms.fd +
10588 * forms/latexoptions.fd +
10589 * lyx.fd: changed for various form resize issues
10591 * src/mathed/math_panel.C +
10592 * src/insets/inseterror.C +
10593 * src/insets/insetinfo.C +
10594 * src/insets/inseturl.C +
10595 * src/insets/inseturl.h +
10597 * src/LyXSendto.C +
10598 * src/PaperLayout.C +
10599 * src/ParagraphExtra.C +
10600 * src/TableLayout.C +
10602 * src/layout_forms.C +
10609 * src/menus.C: fixed various resize issues. So now forms can be
10610 resized savely or not be resized at all.
10612 * forms/form_url.fd +
10613 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10616 * src/insets/Makefile.am: added files form_url.[Ch]
10618 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10620 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10621 (and presumably 6.2).
10623 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10624 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10625 remaining static member callbacks.
10627 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10630 * src/support/lyxstring.h: declare struct Srep as friend of
10631 lyxstring, since DEC cxx complains otherwise.
10633 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10635 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10637 * src/LaTeX.C (run): made run_bibtex also depend on files with
10639 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10640 are put into the dependency file.
10642 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10643 the code has shown itself to work
10644 (create_ispell_pipe): removed another warning, added a comment
10647 * src/minibuffer.C (ExecutingCB): removed code that has been
10648 commented out a long time
10650 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10651 out code + a warning.
10653 * src/support/lyxstring.h: comment out the three private
10654 operators, when compiling with string ansi conforming compilers
10655 they make problems.
10657 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10659 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10660 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10663 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10666 * src/mathed/math_panel.C (create_math_panel): remove explicit
10669 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10672 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10673 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10674 to XCreatePixmapFromBitmapData
10675 (fl_set_bmtable_data): change the last argument to be unsigned
10677 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10678 and bh to be unsigned int, remove explicit casts in call to
10679 XReadBitmapFileData.
10681 * images/arrows.xbm: made the arrays unsigned char *
10682 * images/varsz.xbm: ditto
10683 * images/misc.xbm: ditto
10684 * images/greek.xbm: ditto
10685 * images/dots.xbm: ditto
10686 * images/brel.xbm: ditto
10687 * images/bop.xbm: ditto
10689 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10691 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10692 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10693 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10695 (LYX_CXX_CHEADERS): added <clocale> to the test.
10697 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10699 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10701 * src/support/lyxstring.C (append): fixed something that must be a
10702 bug, rep->assign was used instead of rep->append.
10704 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10707 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10708 lyx insert double chars. Fix spotted by Kayvan.
10710 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10712 * Fixed the tth support. I messed up with the Emacs patch apply feature
10713 and omitted the changes in lyxrc.C.
10715 1999-10-22 Juergen Vigna <jug@sad.it>
10717 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10719 * src/lyx_cb.C (MenuInsertRef) +
10720 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10721 the form cannot be resized under it limits (fixes a segfault)
10723 * src/lyx.C (create_form_form_ref) +
10724 * forms/lyx.fd: Changed Gravity on name input field so that it is
10727 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10729 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10730 <ostream> and <istream>.
10732 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10733 whether <fstream> provides the latest standard features, or if we
10734 have an oldstyle library (like in egcs).
10735 (LYX_CXX_STL_STRING): fix the test.
10737 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10738 code on MODERN_STL_STREAM.
10740 * src/support/lyxstring.h: use L{I,O}stream.h.
10742 * src/support/L{I,O}stream.h: new files, designed to setup
10743 correctly streams for our use
10744 - includes the right header depending on STL capabilities
10745 - puts std::ostream and std::endl (for LOStream.h) or
10746 std::istream (LIStream.h) in toplevel namespace.
10748 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10750 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10751 was a bib file that had been changed we ensure that bibtex is run.
10752 (runBibTeX): enhanced to extract the names of the bib files and
10753 getting their absolute path and enter them into the dep file.
10754 (findtexfile): static func that is used to look for tex-files,
10755 checks for absolute patchs and tries also with kpsewhich.
10756 Alternative ways of finding the correct files are wanted. Will
10758 (do_popen): function that runs a command using popen and returns
10759 the whole output of that command in a string. Should be moved to
10762 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10763 file with extension ext has changed.
10765 * src/insets/figinset.C: added ifdef guards around the fl_free
10766 code that jug commented out. Now it is commented out when
10767 compiling with XForms == 0.89.
10769 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10770 to lyxstring.C, and only keep a forward declaration in
10771 lyxstring.h. Simplifies the header file a bit and should help a
10772 bit on compile time too. Also changes to Srep will not mandate a
10773 recompile of code just using string.
10774 (~lyxstring): definition moved here since it uses srep.
10775 (size): definition moved here since it uses srep.
10777 * src/support/lyxstring.h: removed a couple of "inline" that should
10780 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10782 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10785 1999-10-21 Juergen Vigna <jug@sad.it>
10787 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10788 set to left if I just remove the width entry (or it is empty).
10790 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10791 paragraph when having dummy paragraphs.
10793 1999-10-20 Juergen Vigna <jug@sad.it>
10795 * src/insets/figinset.C: just commented some fl_free_form calls
10796 and added warnings so that this calls should be activated later
10797 again. This avoids for now a segfault, but we have a memory leak!
10799 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10800 'const char * argument' to 'string argument', this should
10801 fix some Asserts() in lyxstring.C.
10803 * src/lyxfunc.h: Removed the function argAsString(const char *)
10804 as it is not used anymore.
10806 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10808 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10811 * src/Literate.h: some funcs moved from public to private to make
10812 interface clearer. Unneeded args removed.
10814 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10816 (scanBuildLogFile): ditto
10818 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10819 normal TeX Error. Still room for improvement.
10821 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10823 * src/buffer.C (insertErrors): changes to make the error
10824 desctription show properly.
10826 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10829 * src/support/lyxstring.C (helper): changed to use
10830 sizeof(object->rep->ref).
10831 (operator>>): changed to use a pointer instead.
10833 * src/support/lyxstring.h: changed const reference & to value_type
10834 const & lets see if that helps.
10836 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10838 * Makefile.am (rpmdist): fixed to have non static package and
10841 * src/support/lyxstring.C: removed the compilation guards
10843 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10846 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10847 conditional compile of lyxstring.Ch
10849 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10850 stupid check, but it is a lot better than the bastring hack.
10851 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10853 * several files: changed string::erase into string::clear. Not
10856 * src/chset.C (encodeString): use a char temporary instead
10858 * src/table.C (TexEndOfCell): added tostr around
10859 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10860 (TexEndOfCell): ditto
10861 (TexEndOfCell): ditto
10862 (TexEndOfCell): ditto
10863 (DocBookEndOfCell): ditto
10864 (DocBookEndOfCell): ditto
10865 (DocBookEndOfCell): ditto
10866 (DocBookEndOfCell): ditto
10868 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10870 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10872 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10873 (MenuBuildProg): added tostr around ret
10874 (MenuRunChktex): added tostr around ret
10875 (DocumentApplyCB): added tostr around ret
10877 * src/chset.C (encodeString): added tostr around t->ic
10879 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10880 (makeLaTeXFile): added tostr around tocdepth
10881 (makeLaTeXFile): added tostr around ftcound - 1
10883 * src/insets/insetbib.C (setCounter): added tostr around counter.
10885 * src/support/lyxstring.h: added an operator+=(int) to catch more
10888 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10889 (lyxstring): We DON'T allow NULL pointers.
10891 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10893 * src/mathed/math_macro.C (MathMacroArgument::Write,
10894 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10895 when writing them out.
10897 * src/LString.C: remove, since it is not used anymore.
10899 * src/support/lyxstring.C: condition the content to
10900 USE_INCLUDED_STRING macro.
10902 * src/mathed/math_symbols.C, src/support/lstrings.C,
10903 src/support/lyxstring.C: add `using' directive to specify what
10904 we need in <algorithm>. I do not think that we need to
10905 conditionalize this, but any thought is appreciated.
10907 * many files: change all callback functions to "C" linkage
10908 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10909 strict_ansi. Those who were static are now global.
10910 The case of callbacks which are static class members is
10911 trickier, since we have to make C wrappers around them (see
10912 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10913 did not finish this yet, since it defeats the purpose of
10914 encapsulation, and I am not sure what the best route is.
10916 1999-10-19 Juergen Vigna <jug@sad.it>
10918 * src/support/lyxstring.C (lyxstring): we permit to have a null
10919 pointer as assignment value and just don't assign it.
10921 * src/vspace.C (nextToken): corrected this function substituting
10922 find_first(_not)_of with find_last_of.
10924 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10925 (TableOptCloseCB) (TableSpeCloseCB):
10926 inserted fl_set_focus call for problem with fl_hide_form() in
10929 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10931 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10934 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10936 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10937 LyXLex::next() and not eatline() to get its argument.
10939 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10941 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10942 instead, use fstreams for io of the depfile, removed unneeded
10943 functions and variables.
10945 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10946 vector instead, removed all functions and variables that is not in
10949 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10951 * src/buffer.C (insertErrors): use new interface to TeXError
10953 * Makefile.am (rpmdist): added a rpmdist target
10955 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10956 per Kayvan's instructions.
10958 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10960 * src/Makefile.am: add a definition for localedir, so that locales
10961 are found after installation (Kayvan)
10963 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10965 * development/.cvsignore: new file.
10967 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10969 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10970 C++ compiler provides wrappers for C headers and use our alternate
10973 * configure.in: use LYX_CXX_CHEADERS.
10975 * src/cheader/: new directory, populated with cname headers from
10976 libstdc++-2.8.1. They are a bit old, but probably good enough for
10977 what we want (support compilers who lack them).
10979 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10980 from includes. It turns out is was stupid.
10982 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10984 * lib/Makefile.am (install-data-local): forgot a ';'
10985 (install-data-local): forgot a '\'
10986 (libinstalldirs): needed after all. reintroduced.
10988 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10990 * configure.in (AC_OUTPUT): added lyx.spec
10992 * development/lyx.spec: removed file
10994 * development/lyx.spec.in: new file
10996 * po/*.po: merged with lyx.pot becuase of make distcheck
10998 * lib/Makefile.am (dist-hook): added dist-hook so that
10999 documentation files will be included when doing a make
11000 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11001 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11003 more: tried to make install do the right thing, exclude CVS dirs
11006 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11007 Path would fit in more nicely.
11009 * all files that used to use pathstack: uses now Path instead.
11010 This change was a lot easier than expected.
11012 * src/support/path.h: new file
11014 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11016 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11018 * src/support/lyxstring.C (getline): Default arg was given for
11021 * Configure.cmd: removed file
11023 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11025 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11026 streams classes and types, add the proper 'using' statements when
11027 MODERN_STL is defined.
11029 * src/debug.h: move the << operator definition after the inclusion
11032 * src/support/filetools.C: include "LAssert.h", which is needed
11035 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11038 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11039 include "debug.h" to define a proper ostream.
11041 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11043 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11044 method to the SystemCall class which can kill a process, but it's
11045 not fully implemented yet.
11047 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11049 * src/support/FileInfo.h: Better documentation
11051 * src/lyxfunc.C: Added support for buffer-export html
11053 * src/menus.C: Added Export->As HTML...
11055 * lib/bind/*.bind: Added short-cut for buffer-export html
11057 * src/lyxrc.*: Added support for new \tth_command
11059 * lib/lyxrc.example: Added stuff for new \tth_command
11061 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11063 * lib/Makefile.am (IMAGES): removed images/README
11064 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11065 installes in correct place. Check permisions is installed
11068 * src/LaTeX.C: some no-op changes moved declaration of some
11071 * src/LaTeX.h (LATEX_H): changed include guard name
11073 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11075 * lib/reLyX/Makefile.am: install noweb2lyx.
11077 * lib/Makefile.am: install configure.
11079 * lib/reLyX/configure.in: declare a config aux dir; set package
11080 name to lyx (not sure what the best solution is); generate noweb2lyx.
11082 * lib/layouts/egs.layout: fix the bibliography layout.
11084 1999-10-08 Jürgen Vigna <jug@sad.it>
11086 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11087 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11088 it returned without continuing to search the path.
11090 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11092 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11093 also fixes a bug. It is not allowed to do tricks with std::strings
11094 like: string a("hei"); &a[e]; this will not give what you
11095 think... Any reason for the complexity in this func?
11097 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11099 * Updated README and INSTALL a bit, mostly to check that my
11100 CVS rights are correctly set up.
11102 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11104 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11105 does not allow '\0' chars but lyxstring and std::string does.
11107 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11109 * autogen.sh (AUTOCONF): let the autogen script create the
11110 POTFILES.in file too. POTFILES.in should perhaps now not be
11111 included in the cvs module.
11113 * some more files changed to use C++ includes instead of C ones.
11115 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11117 (Reread): added tostr to nlink. buggy output otherwise.
11118 (Reread): added a string() around szMode when assigning to Buffer,
11119 without this I got a log of garbled info strings.
11121 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11124 * I have added several ostream & operator<<(ostream &, some_type)
11125 functions. This has been done to avoid casting and warnings when
11126 outputting enums to lyxerr. This as thus eliminated a lot of
11127 explicit casts and has made the code clearer. Among the enums
11128 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11129 mathed enums, some font enum the Debug::type enum.
11131 * src/support/lyxstring.h (clear): missing method. equivalent of
11134 * all files that contained "stderr": rewrote constructs that used
11135 stderr to use lyxerr instead. (except bmtable)
11137 * src/support/DebugStream.h (level): and the passed t with
11138 Debug::ANY to avoid spurious bits set.
11140 * src/debug.h (Debug::type value): made it accept strings of the
11141 type INFO,INIT,KEY.
11143 * configure.in (Check for programs): Added a check for kpsewhich,
11144 the latex generation will use this later to better the dicovery of
11147 * src/BufferView.C (create_view): we don't need to cast this to
11148 (void*) that is done automatically.
11149 (WorkAreaButtonPress): removed some dead code.
11151 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11153 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11154 is not overwritten when translated (David Sua'rez de Lis).
11156 * lib/CREDITS: Added David Sua'rez de Lis
11158 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11160 * src/bufferparams.C (BufferParams): default input encoding is now
11163 * acinclude.m4 (cross_compiling): comment out macro
11164 LYX_GXX_STRENGTH_REDUCE.
11166 * acconfig.h: make sure that const is not defined (to empty) when
11167 we are compiling C++. Remove commented out code using SIZEOF_xx
11170 * configure.in : move the test for const and inline as late as
11171 possible so that these C tests do not interefere with C++ ones.
11172 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11173 has not been proven.
11175 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11177 * src/table.C (getDocBookAlign): remove bad default value for
11178 isColumn parameter.
11180 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11182 (ShowFileMenu2): ditto.
11184 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11185 of files to ignore.
11187 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11189 * Most files: finished the change from the old error code to use
11190 DebugStream for all lyxerr debugging. Only minor changes remain
11191 (e.g. the setting of debug levels using strings instead of number)
11193 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11195 * src/layout.C (Add): Changed to use compare_no_case instead of
11198 * src/FontInfo.C: changed loop variable type too string::size_type.
11200 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11202 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11203 set ETAGS_ARGS to --c++
11205 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11207 * src/table.C (DocBookEndOfCell): commented out two unused variables
11209 * src/paragraph.C: commented out four unused variables.
11211 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11212 insed a if clause with type string::size_type.
11214 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11217 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11219 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11220 variable, also changed loop to go from 0 to lenght + 1, instead of
11221 -1 to length. This should be correct.
11223 * src/LaTeX.C (scanError): use string::size_type as loop variable
11226 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11227 (l.896) since y_tmp and row was not used anyway.
11229 * src/insets/insetref.C (escape): use string::size_type as loop
11232 * src/insets/insetquotes.C (Width): use string::size_type as loop
11234 (Draw): use string::size_type as loop variable type.
11236 * src/insets/insetlatexaccent.C (checkContents): use
11237 string::size_type as loop variable type.
11239 * src/insets/insetlabel.C (escape): use string::size_type as loop
11242 * src/insets/insetinfo.C: added an extern for current_view.
11244 * src/insets/insetcommand.C (scanCommand): use string::size_type
11245 as loop variable type.
11247 * most files: removed the RCS tags. With them we had to recompile
11248 a lot of files after a simple cvs commit. Also we have never used
11249 them for anything meaningful.
11251 * most files: tags-query-replace NULL 0. As adviced several plases
11252 we now use "0" instead of "NULL" in our code.
11254 * src/support/filetools.C (SpaceLess): use string::size_type as
11255 loop variable type.
11257 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11259 * src/paragraph.C: fixed up some more string stuff.
11261 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11263 * src/support/filetools.h: make modestr a std::string.
11265 * src/filetools.C (GetEnv): made ch really const.
11267 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11268 made code that used these use max/min from <algorithm> instead.
11270 * changed several c library include files to their equivalent c++
11271 library include files. All is not changed yet.
11273 * created a support subdir in src, put lyxstring and lstrings
11274 there + the extra files atexit, fileblock, strerror. Created
11275 Makefile.am. edited configure.in and src/Makefile.am to use this
11276 new subdir. More files moved to support.
11278 * imported som of the functions from repository lyx, filetools
11280 * ran tags-query-replace on LString -> string, corrected the bogus
11281 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11282 is still some errors in there. This is errors where too much or
11283 too litle get deleted from strings (string::erase, string::substr,
11284 string::replace), there can also be some off by one errors, or
11285 just plain wrong use of functions from lstrings. Viewing of quotes
11288 * LyX is now running fairly well with string, but there are
11289 certainly some bugs yet (see above) also string is quite different
11290 from LString among others in that it does not allow null pointers
11291 passed in and will abort if it gets any.
11293 * Added the revtex4 files I forgot when setting up the repository.
11295 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11297 * All over: Tried to clean everything up so that only the files
11298 that we really need are included in the cvs repository.
11299 * Switched to use automake.
11300 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11301 * Install has not been checked.
11303 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11305 * po/pt.po: Three errors:
11306 l.533 and l.538 format specification error
11307 l. 402 duplicate entry, I just deleted it.