1 2001-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/buffer.h: change format to int, and change name to file_format
5 * src/buffer.C: change LYX_FORMAT to int, and bump version number
7 (readLyXformat2): handle it
10 (writeFile): handle it
12 2001-01-10 Dekel Tsur <dekelts@tau.ac.il>
14 * src/insets/insettext.C (LocalDispatch): Add handling of
15 LFUN_BREAKPARAGRAPHKEEPLAYOUT.
17 2001-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
19 * src/tabular.C (Write): write lowercase identifiers
20 (Read): read lowercase identifiers
22 2001-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
24 * src/support/lyxstring.C (rfind): better fix (from Dekel).
26 * src/tabular.h: add a couple std:: qualifiers.
28 2001-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
30 * src/support/lyxstring.C (rfind): also test the first char in the
31 string and be sure that t >= 0.
33 2001-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
35 * src/tabular.C (ReadNew): new method
36 (Read): changed to call ReadNew or ReadOld depending on the
37 tabular version found.
39 * src/tabular-old.C: new file with the support functions and the
43 * src/frontends/xforms/FormDocument.C (CheckChoiceClass): make tc
44 unsigned to remove a signed/usigned warning.
46 * src/tabular.C (tostr): new spesializations, replaces type2string
47 (Write): use the new spesializations
49 2001-01-09 Juergen Vigna <jug@sad.it>
51 * src/tabular.C (OldFormatRead): convert the footer/header information
53 (getTokenValue): chaned this functions again.
54 (string2type): added a bunch of this functions per type.
55 (Write): use type2string and write columns first.
56 (type2string): added a bunch of this functions per type.
58 (TeXTopHLine): check row parameter.
60 2001-01-08 Dekel Tsur <dekelts@tau.ac.il>
62 * src/tabular.C (getTokenValue): Fix crash with malformed files.
63 (Read): Read the rotate attribute.
65 2001-01-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
67 * src/frontends/xforms/FormDocument.C (CheckChoiceClass): fix
68 class switching; do not do anything if class has not been changed.
70 2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
72 * lib/build-listerrors: Exit if literate-article doesn't appear in
75 2001-01-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
77 * src/combox.h (getline): small fix for sun CC 6.0
78 * src/combox.C (input_cb): ditto.
79 * src/spellchecker.C (sigchldhandler): ditto.
81 * src/lyx_main.C (init): do not query for creation of user
82 directory when running without a GUI.
84 2001-01-08 Dekel Tsur <dekelts@tau.ac.il>
86 * src/mathed/formula.C (LocalDispatch): Toggle font properties.
88 2001-01-07 Dekel Tsur <dekelts@tau.ac.il>
90 * BufferView2.C (open_new_inset): Added 2nd argument.
91 (getParentText, getParentLanguage): New methods.
93 * src/lyxfunc.C (Dispatch): Fixed handling of LFUN_LEFT and
94 LFUN_INSET_TABULAR for RTL text.
96 * src/tabular.C (Latex): Put \R{} around RTL cells.
98 * src/text2.C (InsertInset): Change cursor position for highly
101 * src/frontends/xforms/FormTabularCreate.C (apply): Create the
102 tabular inset by calling to LyXFunc::Dispatch(LFUN_INSET_TABULAR,...)
104 * src/insets/insettabular.C (LocalDispatch): When dispatching
105 LFUN_TAB/LFUN_SHIFT_TAB, if the insettext of the old cell was
106 locked, then the insettext of the new cell will be locked.
107 (moveLeft, moveRight): Fixed for RTL tabulars.
108 (moveNextCell, movePrevCell): Ditto.
109 (isRightToLeft): New method.
111 * src/insets/insettext.C (LocalDispatch): Fixed handling of
112 non-dispatched function in the locking inset.
113 (Edit): If the inset is empty set the language of the current font
114 to the language to the surronding text (this code was moved from
115 LocalDispatch to allow the user to change the languaeg before
117 (moveRight, moveLeft): Fixed for RTL text.
118 (checkAndActivateInset): Fixed.
120 * src/tabular.C (OldFormatRead): Use ALL_INHERIT font as the base font.
122 2001-01-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
124 * src/frontends/xforms/Toolbar_pimpl.C (BubbleTimerCB): translate
128 * src/spellchecker.C (sigchldhandler): add an #ifndef USE_PSPELL
129 around some ispell code.
131 * src/lyxcursor.[Ch]: add proper constructor, to avoid tons of
132 Unitialized Memory Read in purify.
134 * lib/examples/nl_splash.lyx: update from Tino Meinen.
136 2001-01-04 Dekel Tsur <dekelts@tau.ac.il>
138 * src/frontends/xforms/FormDocument.C (FormDocument::build):
139 Disable class_->choice_doc_class and language_->choice_language to
140 allow using the class/language combox with keyboard.
142 2001-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
144 * src/support/snprintf.c (va_copy): only define va_copy if undefined
146 2001-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
148 * src/lyxvc.C (showLog): give the tempfile a mask
150 * src/lyx_cb.C (AutoSave): five tempfile a mask, enter the failed
153 * src/support/filetools.C (IsDirWriteable): give the tempfile a
154 mask and unlink the tempfile after use.
156 2001-01-04 Juergen Vigna <jug@sad.it>
158 * src/insets/insettabular.C (resetPos): an extra scroll, but we
159 really should redo all this scrolling code!
160 (TabularFeatures): unlock the_locking_inset before add/del rows/colums.
162 * src/text.C (GetVisibleRow): check that y/h values are good otherwise
165 * src/insets/insettabular.C (LocalDispatch): fixes to PASTESELECTION.
166 (pasteSelection): pay attention to multicolumn cells.
167 (calculate_dimensions_of_cells): forgot to reset maxAsc/Desc.
169 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
171 * src/mathed/math_panel.C (deco_cb): check the decoration index is
174 * src/frontends/xforms/FormPreferences.C (feedback): apply
175 formatting to the translated string, not to the original one.
176 (printWarning): ditto.
178 * src/gettext.C (_): translate empty string with empty string.
180 * src/frontends/xforms/FormCopyright.C (build): use _() instead of
185 * UPGRADING: mention that tabular format has been changed.
187 2001-01-03 Juergen Vigna <jug@sad.it>
189 * src/insets/insettabular.C (InsetButtonPress): look for button==2
190 and do Clipboard Paste!
192 * src/insets/insettext.C (SetText): added function.
194 * src/insets/insettabular.C (LocalDispatch): Fixed LFUN_PASTE and
195 new LFUN_PASTESELECTION.
197 * src/insets/insettext.C (draw): don't clear if top_x changes.
199 * src/insets/insettabular.C (draw): clear only if the inset didn't
200 change in the draw routine.
202 * src/insets/insettext.C (width): make the width dependant on the
205 * src/text.C (draw): comment out the UpdateInset call.
207 * src/screen.C (DrawOneRow):
208 (DrawFromTo): check for bv->text->status not text->status.
210 * src/insets/insettabular.C (calculate_dimensions_of_cells): calculate
211 dimensions of ascent-descent for the whole row.
213 * src/insets/insettext.C (draw): check also for need_update == INIT.
215 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
217 * Makefile.am (EXTRA_DIST): add autogen.sh
219 2001-01-03 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
221 * development/OS2/quick_fix.patch:
222 * lib/configure.cmd: update OS/2 support files.
224 2001-01-02 Juergen Vigna <jug@sad.it>
226 * src/insets/insettabular.C (pasteSelection): rewritten correctly.
228 * src/tabular.C (TeXTopHLine):
229 (TeXBottomHLine): fixed Lars new code.
231 * src/insets/insettext.C (LocalDispatch): added support for math_greek.
233 * src/mathed/math_symbols.C (math_insert_greek): removed current_view
234 from this function and added a BufferView * parameter.
236 * src/mathed/math_symbols.C (math_insert_symbol): ditto
238 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
240 * src/version.h: set to pre3
242 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
244 * src/Makefile.am (lyx_SOURCES): added Floating.C
246 * src/Floating.h: moved all the inlines to Floating.C
248 * src/Floating.C: new file
250 2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
252 * src/frontends/xforms/FormPreferences.C (feedback): fix
253 description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
255 2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
257 * src/support/FileInfo.h: move unistd.h to after sys/types.h and
260 * src/support/FileInfo.C: don't include sys/types. and sys/stat.h
262 * src/mathed/math_inset.h: move LString.h to be included first
264 * src/insets/insetfloat.C: adjust for change in private variable names
266 * src/frontends/xforms/xform_helpers.h : don't include config.h
268 * src/frontends/xforms/xform_helpers.C: adjust the order of
269 includes, some whitespace changes.
271 * src/trans.C (Load): constify filename and res
273 * src/text2.C (SetCounter): call Floating::name()
275 * src/screen.C: change to not use owner from WorkArea, but from
278 * src/lyxfunc.C: adjust because of changes in Intl.
280 * src/intl.h: make trans a object instead of pointer, inlucd
281 trans_mgr.h in this file.
282 (getTrans): return a reference to TransManager
284 * src/intl.C: don't include trans_mgr.h here
285 modify calls to trans to work on object instead of on pointer
287 * src/WorkArea.h: add using for Signal1
288 comment out forward decl of BufferView.
290 remove class variable owner_ and getter method for this.
292 * src/WorkArea.C: don't include BufferView.h
293 (WorkArea): change to not take a BufferView.h, use signals
295 (scroll_cb): emit signal
297 * src/LaTeXFeatures.C: include Floatlist.h
298 (getPackages): only load float.sty when needed
299 (getMacros): prepare for outputting the correct code to preamble.
301 * src/Floating.h: make all variables private + rename to var_.
302 (Floating): default ctor
303 (Floating): complex ctor to set a complete Floating
309 * src/FloatList.C (FloatList): use Floating's constructor
312 (newFloat): call type()
313 (defaultPlacement): call placement()
314 (operator): new operator
316 * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
317 (scrollUp): call pimpl's scrollCB
319 (pasteClipboard): constify clip
321 * src/BufferView2.C (insertLyXFile): constify fname, fi and c.
322 (insertErrors): constify desctext, errortext, msgtxt and errorrow
323 (open_new_inset): delete some commented code.
325 * src/BufferView.[Ch] (enterView): comment out
328 (workAreaMotionNotify): ditto
329 (workAreaButtonPress): ditto
332 (workAreaButtonRelease): ditto
333 (workAreaExpose): ditto
335 * config/lyxinclude.m4 (cross_compiling): small stuff to be able
336 to compile with cvs gcc (2.97).
338 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
340 * lib/ui/default.ui: menu structure cleanup.
342 * lib/languages: add description of entries.
344 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
346 * src/insets/ExternalTemplate.C (readTemplates): change debug
348 (readTemplate): use lyxlex.printError to report read errors.
351 * src/insets/insetexternal.C (Read): suppress debug message when
354 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
356 * src/insets/insetinclude.C (Ascii): New method. Currently
357 supports only verbatim input.
359 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
361 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
363 2000-12-22 Juergen Vigna <jug@sad.it>
365 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
366 have a selection and button == 3.
367 (UpdateLocal): if what == INIT clear selection if existent!
368 (InsetButtonPress): don't activate the cell inset on button==3
370 (LocalDispatch): move curor up/down if exiting an inset which this
373 2000-12-20 Juergen Vigna <jug@sad.it>
375 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
376 calling for the math-panel (do not unlock the math-inset if locked)!
378 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
379 text-insets (with x-offset).
381 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
382 alignment of multicolumn-cells.
384 2000-12-19 Juergen Vigna <jug@sad.it>
386 * src/lyxfunc.C (Dispatch):
387 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
390 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
392 * src/WorkArea.C (work_area_handler): simplify the key/keysym
393 handling for XForms 0.89, this might have rendered some cases
394 unusable. I have at least deadkeys, accent-xxx and KP_x working.
395 Please report proplems.
397 * src/lyxfunc.C (processKeySym): make the self-insert handling
400 2000-12-18 Baruch Even <baruch.even@writeme.com>
402 * src/LaTeX.C (deplog): fix spelling errors
403 * src/text2.C (CutSelection): ditto
404 * src/lyxfunc.C (Dispatch): ditto
406 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
408 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
410 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
411 and h_align in default init.
412 adjust calls to MathedRowSt
414 * src/mathed/math_iter.C: adjust calls to MathedRowSt
415 * src/mathed/math_iter.h (getAD): ditto
417 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
418 methods setBaseline, ascent, descent
419 (class MathMatrixInset): remove method GetAlign, change h_align
422 * src/lyxfunc.C (processKeySym): discover the correct argument if
423 the action is LFUN_SELFINSERT
425 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
427 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
430 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
432 * src/support/copy.C: don't include filetools.h
434 * lib/images: revert to old banner, drop the cucumber.
436 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
438 * src/converter.C (Formats::View): Change the current directory to
439 the directory of the file.
441 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
443 * src/kbsequence.C (addkey): also clear sequence and modifiers if
446 * src/BufferView2.C (theLockingInset): return 0 if text is 0
448 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
450 * Many files: Fix RTL support for insettext.
452 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
454 * README: add mention of broken ghostscript versions, remove
455 reference to non-existent BUGS file
457 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
459 * src/support/lstrings.C (compare_no_case): small fix. When passed
460 length, should use it in the size comparison.
462 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
464 * src/insets/insetexternal.C (getScreenLabel): Return a default
465 value if the template label is empty.
467 * src/lyxlookup.C: do not condition on FL_REVISION.
470 * src/sp_form.C: fix the font size of some text entries
472 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
473 after TOC when there is no TOC.
475 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
476 bind file if it has not been done yet.
477 (read): remove local bindFile variable. Try to fix the handling of
478 RC_BIND and RC_BINDFILE.
480 * src/lyx_main.C (init): use readBindFileIfNeeded().
482 * lib/languages: Change description of german to "German (new
485 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
487 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
488 "Apply" buttons if arg is non-zero.
490 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
491 launching the popup if sufficient info is passed to
492 LFUN_CITATION_CREATE.
494 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
496 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
497 labels (disabled in 1.1.6).
499 * src/lyxrc.[Ch]: New variable label_init_length
501 * mathed/formula.C (LocalDispatch): Preserve the label when
502 changing from display math to eqnarray (however, the label
503 do not appear at the first line, as one might expects, but at the
505 (LocalDispatch): When inserting a label to a formula which already
506 have a label, the old label is used as default value.
507 Also, if the label is changed, then all references to the label
510 * src/mathed/math_iter.C (setLabel): Allow to set the label
511 even if it is empty. This is needed to allow deletion of a label
514 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
515 refernces only if the old label appears once in the document.
517 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
519 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
520 <gehlert@Rcs1.urz.tu-dresden.de>
522 * src/frontends/xforms/FormBase.C: comment out debug.h
524 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
525 code in xform_helpers instead.
526 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
528 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
529 Use N_(), rather than _() when creating strings to pass to browseFile()
530 because browseFile calls gettext() itself now.
532 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
533 display the filename correctly.
535 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
537 * src/converter.C (Move): New method. Used to move file or files
538 from temp dir to the output dir. (this fixes the bug that
539 exporting linuxdoc/docbook document to html would not move all
540 html file from temp directory).
542 * src/support/filetools.C (DirList): Fixed.
544 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
546 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
548 * src/converter.C (Add): Remove $$i when setting latex_command.
550 * src/text.C (IsBoundary): Return false when pos = 0.
552 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
554 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
556 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
558 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
559 need to empty the fields to turn off use of the geometry package!
561 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
563 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
564 (Buffer const &), not a (BufferParams const &) and so fix a crash
565 caused by using current_view before it had been initialised. Not
566 the best way to do this, but much easier than changing
567 Inset::Clone(Buffer const &) to Inset::Clone().
570 * src/tabular.C: changed call to CopyIntoMinibuffer().
572 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
574 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
576 * src/lyxfunc.C (getStatus): disable insertion of floats in a
579 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
581 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
582 changed filter for screen fonts input filter from int to float
584 * src/frontends/xforms/input_validators.c: removed.
585 * src/frontends/xforms/input_validators.C: new file. Can now call C++
586 functions from within the filter functions.
588 * src/frontends/xforms/input_validators.[Ch]
589 (fl_unsigned_float_filter): new filter function.
591 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
592 confused now! And if you think I'm going to do this in
593 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
595 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
597 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
599 * src/WorkArea.C (work_area_handler): don't handle button requests
600 if xbutton.button == 0
602 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
604 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
605 It creates a lot of interesting problems.
607 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
609 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
610 the menu exists in the current menubar before opening it.
612 * src/MenuBackend.C (hasSubmenu): new method.
614 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
615 action value by offsetting actions by a large constant (so that
616 bogs choice result will be less than this constant).
618 * lib/bind/fi_menus.bind: more cleanup to menus.
619 * lib/bind/sciword.bind: ditto.
620 * lib/bind/xemacs.bind: ditto.
621 * lib/bind/emacs.bind: ditto.
622 * lib/bind/pt_menus.bind: ditto.
623 * lib/bind/hu_menus.bind: ditto.
625 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
627 * INSTALL: update PROBLEMS section.
629 * src/lyxlookup.h: remove condition on xforms version, since we
630 should not include it if not appropriate.
632 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
634 * src/LColor.C: "latex text" -> "latex inset" (from
637 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
639 * src/frontends/kde/FormTabularCreate.C:
640 * src/frontends/kde/citationdlg.C:
641 * src/frontends/kde/copyrightdlg.C:
642 * src/frontends/kde/paradlg.C:
643 * src/frontends/kde/paraextradlg.C:
644 * src/frontends/kde/parageneraldlg.C:
645 * src/frontends/kde/printdlg.C:
646 * src/frontends/kde/refdlg.C:
647 * src/frontends/kde/tabcreatedlg.C:
648 * src/frontends/kde/tocdlg.C:
649 * src/frontends/kde/urldlg.C: add necessary headers
652 * src/frontends/kde/dlg/emptytable.C:
653 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
654 default parameters (from Angus Leeming)
656 * src/frontends/kde/dlg/moc/.cvsignore:
657 * src/frontends/kde/dlg/.cvsignore:
658 * src/frontends/kde/moc/.cvsignore: fix the library name
661 * src/frontends/kde/paradlg.C:
662 * src/frontends/kde/parageneraldlg.C:
663 * src/frontends/kde/dlg/para.dlg:
664 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
666 * src/frontends/kde/dlg/README: clarified qtarch version
668 * src/frontends/kde/dlg/Makefile.am: removed the
669 dlg rules as they created spontaneous rebuilds
670 (not a good idea as it requires qtarch)
672 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
674 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
675 fixlevel along with xforms version.
677 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
678 xforms version is strictly less than 0.89.5.
679 * src/lyx_gui.C (LyXGUI): ditto.
680 * src/LyXView.C (show): ditto.
682 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
684 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
685 movement in inset in RTL text.
686 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
687 (workAreaButtonRelease): Do not open a float when there is a selection.
689 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
691 * src/spellchecker.C (RunSpellChecker): Open all floats before
694 * src/text.C (InsertChar): Consider "," as a part of a number
695 (for LTR numbers in RTL text code).
696 (IsBoundary): Fixed (and simplified).
697 (InsertChar): Recalculate cursor boundary.
700 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
702 * src/spellchecker.C: fix figures with pspell enabled
704 * src/insets/figinset.C: workaround for gs hang xforms bug
706 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
708 * lib/bind/??_menus.bind: comment out the entries corresponding to
709 real menus. They should be eventually removed, but I'll let the
710 language maintainers do that.
712 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
714 * src/frontends/kde/parageneraldlg.C:
715 * src/frontends/kde/parageneraldlg.h: don't use
716 a derived class for SpaceAbove/Below
718 * src/frontends/kde/dlg/README: add some info
720 * src/frontends/kde/dlg/*: update data files, update
723 * src/frontends/kde/dlg/moc/Makefile.am: add
726 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
728 * configure.in: add new KDE Makefiles
729 * src/vspace.h: return GlueLength not a normal one
730 * src/support/lstrings.h:
731 * src/support/lstrings.C: add isStrUnsignedInt(),
734 * src/frontends/kde/*: big reorganisation, update
735 FormParagraph, add FormTabCreate
737 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
739 * lib/ui/default.ui: small grammatical change.
741 * src/frontends/xforms/xform_macros.h: removed.
743 * src/frontends/xforms/FormBase.C:
744 * src/frontends/xforms/FormPreferences.C:
745 * src/frontends/xforms/Makefile.am: changes associated with removing
746 xform_macros.h. Should make Lars' debugging a little easier.
748 * src/frontends/xforms/FormPreferences.C:
749 * src/frontends/xforms/FormPreferences.h:
750 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
751 longer use X11 color name database. HSV and RGB dials/sliders.
752 Please let this be the end of this!
754 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
756 * Several files: Allow compilation when the compiler doesn't
759 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
762 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
763 command line options.
765 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
767 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
768 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
771 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
773 * src/frontends/xforms/FormRef.C (updateBrowser):
774 * src/frontends/xforms/forms/form_ref.fd: try clicking on
775 different insets with the sort key active. Now apply this patch!
777 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
779 * src/frontends/xforms/FormPrint.C: set to valid()
780 when we update from the passed parameters.
782 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
784 * src/LColor.C (getFromGUIName): internationalise the comparison.
786 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
787 FormPreferences choice.
789 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
792 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
794 * src/lyxrc.C: more detail for the printer program config
797 * src/LColor.C: ert->latex text. LColor needs a big revamp
798 but will have to wait till after 1.1.6
800 * src/buffer.C: bring up a dialog if we load a document
801 with an un-installed text class, rather than just complain
804 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
806 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
807 the browser form for a combox in a tabbed folder. Bug fix courtesy of
808 Steve Lamont <spl@ncmir.ucsd.edu>.
810 * src/frontends/xforms/FormDocument.C (build):
811 * src/frontends/xforms/FormPreferences.C (Language::build):
812 pass tabfolders to Combox::add() in order to use this work around.
814 * src/frontends/xforms/FormCitation.C (connect): remove max size
816 (update): sort list of bibliography keys.
818 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
820 No max size limitation. Same popup for new and existing insets. Fixes
821 bugs reported by Rob Lahaye.
823 * src/frontends/xforms/FormCitation.C (c-tor):
824 * src/frontends/xforms/FormCopyright.C (c-tor):
825 * src/frontends/xforms/FormError.C (c-tor):
826 * src/frontends/xforms/FormGraphics.C (c-tor):
827 * src/frontends/xforms/FormIndex.C (c-tor):
828 * src/frontends/xforms/FormRef.C (c-tor):
829 * src/frontends/xforms/FormToc.C (c-tor):
830 * src/frontends/xforms/FormUrl.C (c-tor):
831 use correct policy for ButtonController.
833 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
835 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
838 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
840 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
841 Some resizing changes.
843 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
845 * configure.in: fix typo
847 * lib/languages: add ukraninian and change no to no_NO
849 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
851 * src/bufferview_funcs.C (FontSize): use setLyXSize
853 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
855 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
856 to check for systems where mkstemp() is available but not declared
857 in headers. The new autoconf macro lyx_CHECK_DECL can be used
858 to check for declarations in headers.
860 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
862 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
864 * forms/makefile: added bibforms.fd, include_form.fd.
865 Removed lyx_sendfax.fd.
867 * src/LaTeXLog.C (ShowLatexLog):
868 * src/LyXAction.C (init):
869 * src/bufferparams.C (readLanguage): altered messages as suggested by
872 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
875 * src/credits.C: made fd_form_credits non-static, so that it can be
876 redrawn should the xforms colors be re-mapped.
877 * src/spellchecker.C ditto fd_form_spell_options.
879 * src/filedlg.[Ch] (redraw):
880 * src/intl.[Ch] (redraw):
881 * src/lyxfr0.[Ch] (redraw):
882 * src/insets/figinset.[Ch] (redraw):
883 * src/insets/insetexternal.[Ch] (redraw):
884 new methods, connected to Dialogs::redrawGUI.
886 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
887 to be connected to Dialogs::redrawGUI.
889 * src/frontends/xforms/FormCitation.C (build):
890 * src/frontends/xforms/FormCopyright.C (build):
891 * src/frontends/xforms/FormError.C (build):
892 * src/frontends/xforms/FormGraphics.C (build):
893 * src/frontends/xforms/FormIndex.C (build):
894 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
895 * src/frontends/xforms/FormToc.C (build):
896 * src/frontends/xforms/FormUrl.C (build):
897 use the ButtonController correctly.
899 * src/frontends/xforms/FormCopyright.C (build):
900 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
901 the .fd file and into build().
903 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
905 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
907 * src/frontends/xforms/forms/form_citation.fd:
908 * src/frontends/xforms/forms/form_copyright.fd:
909 * src/frontends/xforms/forms/form_error.fd:
910 * src/frontends/xforms/forms/form_graphics.fd:
911 * src/frontends/xforms/forms/form_index.fd:
912 * src/frontends/xforms/forms/form_toc.fd:
913 * src/frontends/xforms/forms/form_url.fd:
914 renamed some of the objects. Named others explicitly for the first time.
915 Added Restore and Apply buttons where appropriate.
917 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
920 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
922 * src/version.h: try the pre2 again
924 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
926 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
928 * src/frontends/kde/FormParagraph.C: added using directive.
930 * src/frontends/kde/paradlg.C: added config.h and using directive.
932 * src/frontends/kde/paradlg.h: added std::qualifier.
934 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
936 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
938 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
940 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
942 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
944 * src/version.h: set back to 1.1.6cvs
946 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
948 * src/version.h: set to 1.1.6pre2
950 2000-11-20 Marko Vendelin <markov@ioc.ee>
952 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
954 * src/frontends/gnome/Makefile.am: updated list of XForms object files
956 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
958 * src/LColor.C (init):
959 * src/lyxrc.C (getDescription): changed some comments as suggested by
962 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
963 disconnect the redrawGUI signal in best-practice fashion.
965 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
966 long_opts_tab to reflect the change in name of this tabfolder, as
967 suggested by John Levon.
968 (connect, disconnect): new methods. Don't do much at present other than
969 ensuring that we can't resize the dialog. This just makes xforms go
971 (lots of methods in Colors): made void rather than bool. The idea is
972 to have an isOk() function that keeps track of whether any input is
973 genuinely invalid and should therefore block Save, Apply.
974 Easier to manipulate the counters rapidly.
975 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
976 compiler will like this code. Much cleaner way of doing things.
978 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
980 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
981 rather than simple counters, following suggestion by John Levon.
983 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
984 than engraved frame + text.
986 * src/frontends/xforms/forms/makefile: removed spurious command.
988 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
990 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
992 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
995 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
997 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
998 see what Lars has changed and what is just white space!
999 Now used X directly to ascertain the RGB color associated with the
1001 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
1003 Added some sort capability.
1004 The X11 color name database input is only displayed if the database
1005 isn't found in the standard place.
1006 Got rid of struct compare_converter; it wasn't used.
1007 Probably some other stuff that I've forgotten.
1009 * src/frontends/xforms/FormPreferences.h: changed the names of some
1010 methods in the Colors struct. Added a couple of structs to help sort
1011 colors by name and by RGBColor.
1013 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
1014 functions into a new class RWInfo.
1016 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
1017 The dialog is now almost navigable using the keyboard. Unfortunately,
1018 the cursor has to be inside a browser for it to be activated. There is
1019 no visual feedback for the key shortcuts to the arrow keys (use
1020 Alt-appropriate arrow key, Alt-x).
1022 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
1025 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
1026 xform_helpers.[Ch]. See above.
1028 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1030 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
1032 * src/screen.C (setCursorColor): new method. Sets the color of the
1034 (ShowManualCursor): call it.
1035 Constify some local variables.
1037 * src/LColor.[Ch] (LColor): add entry for cursor
1038 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
1041 2000-11-19 Juergen Vigna <jug@sad.it>
1043 * src/insets/insettabular.C (draw): fixed text border redraw problem.
1044 (calculate_dimensions_of_cells): try to boost up when inserting chars.
1046 2000-11-15 Rob Lahaye <lahaye@postech.edu>
1048 * lib/ui/default.ui: OptItem used for Fax entry
1050 2000-11-17 Matej Cepl <cepl@bigfoot.com>
1052 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
1054 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
1056 * src/vspace.C (nextToken): fix so it can handle length phrases like
1057 "10mm+-20mm", "40inplus16mmminus10cm" etc.
1059 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1061 * src/frontends/xforms/FormPreferences.C: constify several variables
1062 (BrowserLyX): rewrite to not need the choice variable
1063 (Modify): rewrite to not need the choide variable
1064 (compare_converter): make operator const
1066 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
1067 correct the writing of \set_color
1068 (getDescription): return a const string
1070 * src/kbsequence.[Ch] (addkey): remove dead code
1072 * src/Painter.C (text): remove some commented code
1074 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
1076 * src/ColorHandler.[Ch]: removed some header files from .h file.
1077 Included LColor.h in .C file.
1079 * src/LColor.[Ch]: made class copyable so that I could create a
1080 system_lcolor instance.
1082 * src/Painter.h: removed LColor.h.
1084 * src/lyx_gui.C (create_forms): used AddName.
1086 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
1087 of user preferences/lyxrc file.
1089 * src/lyxrc.C (output): output changes to lcolor.
1091 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
1093 Moved class xformColor to files xform_helpers.[Ch]. These files,
1094 Color.[Ch], could now be moved into src if they would be useful to
1097 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
1098 Also moved FormPreferences::browseFile here as it can be used by any
1099 xform dialog with a "Browse" button. FormGraphics is a perfect example.
1101 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
1102 ReadableFile): changed the FormPreferences methods a little and moved
1103 them here as they'll be useful elsewhere also.
1105 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
1106 Removed some header files and used forward declarations instead.
1108 Removed some methods as they'll be useful elsewhere (see above).
1110 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
1111 Can also now modify the LyX LColors. However, for reasons that I don't
1112 yet understand, it appears that we can use
1113 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
1114 present. The problem appears to lie in ColorHandler, because I can
1115 change the color using LColor.SetColor(). Similarly, when reading in a
1116 preferences file with some set_color instances, I'll get a warning
1117 like: Color sea green is undefined or may not be redefined
1118 Bad lyxrc set_color for sea green
1120 Once the buffer is loaded, however, I can happily change to this color.
1122 Finally, it appears that I have to set the color of "inset frame"
1123 explicitly, or it oscillates from "black" to "indian red" with each
1126 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
1128 * ANNOUNCE: corrected a spelling mistake.
1130 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
1133 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1135 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
1137 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
1140 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
1141 match the requirements from the standard better. This is required
1142 to work with gnu libstdc++-v3
1144 * src/frontends/xforms/FormPreferences.C: add explict pair
1145 arguments to browse calls. include support/lyxmanip.h remvoe
1146 extern fmt. whitespace changes. reorder variables in
1147 FormPreferences.h, to match initalizaton order.
1149 * several files: constify more local variables.
1151 * src/buffer.C: remove some commented functions.
1153 * src/DepTable.C (remove_files_with_extension): temporary
1154 work around for gcc 2.97
1155 * src/filedlg.C (find): ditto
1156 * src/Variables.C (set): ditto
1157 * src/LyXAction.C (searchActionArg): ditto
1158 (retrieveActionArg): ditto
1160 * configure.in: check for mktemp too
1162 * UPGRADING: prepare for 1.1.6
1164 * Makefile.am (lgbtags): add backup tags for when etags are
1165 different than usual.
1167 * ANNOUNCE: prepare for 1.1.6
1169 * src/support/tempname.C (make_tempfile): new function, wrapper
1170 around mkstemp and mktemp. Only mkstemp has been tested.
1171 (tempName): call it.
1173 2000-11-14 Rob Lahaye <lahaye@postech.edu>
1175 * default.ui: capitalized some menu items to improve shortcuts.
1177 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1179 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
1181 * src/frontends/xforms/Dialogs.C: add "using" directive.
1183 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
1185 * src/filedlg.C (Select): highlight suggested file in browser, if
1188 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
1189 each tab folder is encapsulated in its own class.
1190 The Language keymaps are now chosen using a text input and a
1191 browser button, rather than a Combox.
1192 All the browser buttons are now functional, although LyXFileDlg
1193 still needs to be modified to make it straighhtforward to return a
1194 directory if that is what is desired.
1196 * src/frontends/xforms/forms/form_preferences.fd: use text input
1197 and browse button to input the Language keymaps. Add a few
1198 callbacks for the browse buttons.
1200 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1202 * src/support/tempname.C (tempName): small changes to make it
1203 safer. remove the '.' before XXXXXX
1205 * src/support/filetools.C (TmpFileName): remove func
1208 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
1209 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
1210 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
1211 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
1213 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
1214 (FormCommand): ditto
1216 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
1219 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
1220 for bp (this fixes a reproducible hard crash)
1222 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
1225 * src/frontends/xforms/FormBase.h: make bp_ private
1226 (FormBaseBI): remove default for bp
1229 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
1232 * src/frontends/xforms/Color.C (RGBColor): made several vars
1233 const, changed initialization of j to allow it to be const
1236 * several files: added const to local variables.
1238 * src/lyx_cb.C: removed several function prototypes and moved them
1242 (UpdateLayoutPreamble):
1244 (MenuInsertLabel): add BufferView as arguemnt
1245 (LayoutsCB): make tmp const
1247 * src/layout_forms.h: regenerated
1249 * src/debug.C: add Debug::FILES
1250 (showLevel) (showTags): translate the desc
1252 * src/debug.h: add FILES as debug target
1254 * src/bufferlist.C: use current_view as an interim measure becuase
1255 of added arguments to MenuWrite and MenuWriteAs
1257 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
1259 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
1261 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
1262 libstdc++ is compiled with.
1264 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
1266 * lib/layouts/docbook-book.layout
1267 * lib/layouts/docbook.layout
1268 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
1269 those paragraphs are expresse as SGML comments <!-- -->.
1271 * src/LaTeXFeatures.h
1272 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
1273 parameter, this allows to express all the include files as relative
1274 paths to the master buffer. The verbatim insert works as the other
1277 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
1279 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
1281 (MakeDocBookFile): top_element is always written. Some clean up, as
1282 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
1284 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
1285 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
1286 a reference is written instead of the name.
1287 (Validate): use the relative path for the filename.
1289 * src/insets/insetlabel.C (DocBook): write end tag, for XML
1292 * src/support/filetools.h
1293 * src/support/filetools.C (IsSGMLFilename): added.
1296 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
1298 * development/OS2/quick_fix.patch:
1299 * lib/configure.cmd:
1300 * README.OS2: quick update to the OS/2 port.
1302 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1304 * src/converter.C: add "using" directive.
1306 * src/frontends/xforms/FormPreferences.C: add "using" directive.
1307 (compare_converter): add "int" as return type.
1309 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
1312 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
1314 * src/lyx_gui.C (create_forms): map the xform colours, should a
1315 mapping exist. Ie, call XformColor::read().
1317 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
1318 and struct HSV as HSVColor.
1319 (XformColor::read, XformColor::write) : new methods that
1320 input/output any changes to the cform GUI colors.
1322 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
1325 * src/frontends/xforms/FormPreferences.C Lots of little changes
1326 associated with the changed name of the RGB and HSV structs. Can
1327 now save changes to xforms GUI to file. Commented out
1328 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
1329 used currently anyway.
1331 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
1333 * src/converter.C: A lot of changes:
1334 - It is no longer possible to choose between two or more ways to
1335 export to some format (the new code uses only the shortest path).
1336 However, it is still possible to choose between pdflatex/ps2pdf
1337 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1338 - Added several methods that makes the FormPreferences code simpler.
1339 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1341 * src/exporter.C (Export): lyxrc.use_pdf is set before
1342 makeLaTeXFile is called. This works but not very nice.
1344 * src/frontends/xforms/FormPreferences.C: The formats/converters
1345 tabs are now fully functional.
1347 * src/buffer.C (getTocList): Add numbers to the captions.
1349 * lib/lyxrc.example: Removed fax section
1351 * src/support/rename.C (rename): Delete the old file if lyx::copy
1354 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1356 * lib/ui/default.ui: minor polishing.
1358 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1360 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1363 * lib/Makefile.am (DOCINST): do not install everything in the
1364 documentation directory.
1366 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1368 * src/bufferlist.C (newFile): set the filename to the constructed
1371 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1372 constructed "newfileXX.lyx" name to the dialog
1374 * src/frontends/DialogBase.h: make update() non-abstract so
1375 KDE doesn't need to implement two update methods for every form
1377 * src/frontends/kde/Makefile.am: add missing xforms objects
1380 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1382 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1384 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1385 structs RGB and HSV. May not be the best place for these files.
1386 Perhaps move them into src ?
1388 * src/frontends/xforms/Makefile.am: added new files.
1390 * src/frontends/xforms/forms/form_preferences.fd:
1391 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1392 replaced all instances of "colour" with "color"!
1394 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1397 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1398 tab. Can now alter the colors of the xform's GUI on the fly. With
1399 the aid of a single static Signal (see below), can "Apply" these
1400 changes to all currently open dialogs. (Well, to all of the NEW
1401 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1402 subsequently opened dialogs will, of course, also have the new
1403 color scheme. Cannot yet save (or load) the choices to file, so
1404 they are lost when exiting LyX.
1406 * src/frontends/Dialogs.h:
1407 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1408 Used to trigger a redraw of any dialogs connected to it because,
1409 for example, the GUI colours have been re-mapped.
1411 * src/frontends/xforms/FormBase.[Ch]:
1412 * src/frontends/xforms/FormDocument.[Ch]:
1413 * src/frontends/xforms/FormParagraph.[Ch]:
1414 * src/frontends/xforms/FormPreferences.[Ch]:
1415 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1416 method, to be connected to Dialogs::redrawGUI. Method must be
1417 virtual, because dialogs with tabbed folders need to redraw the
1418 forms of each tab folder.
1420 * src/LyXView.C (d-tor):
1421 * src/frontends/xforms/FormBase.C (d-tor): connected
1422 Dialogs::redrawGUI signal to redraw().
1424 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1425 removed Assert, because it is identical to that in FormBase.
1427 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1429 * lib/ui/default.ui: minor polishing.
1431 2000-11-10 Juergen Vigna <jug@sad.it>
1433 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1434 (deleteLyXText): ditto
1436 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1437 selection on mouse-button-3.
1439 * src/insets/insettabular.h: new function clearSelection(), use this
1440 functions inside insettabular.C.
1442 * src/insets/insettabular.C (TabularFeatures): clear the selection
1443 on remove_row/column.
1445 * src/insets/inset.C (scroll): fixed some scroll stuff.
1447 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1449 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1451 * lib/CREDITS: add Yves Bastide
1453 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1455 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1456 check whether C library functions are in the global namespace.
1458 * configure.in: calls it.
1460 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1461 #ifndef __GLIBCPP__.
1463 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1465 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1466 iterators to prevent crash.
1468 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1470 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1472 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1473 shortcut for xforms CB to the preemptive or post-handler function.
1475 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1476 removed the HIDDEN_TIMER as it's no longer used.
1477 Various other small changes.
1479 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1480 preemptive handler to obtain feedback, rather than the post-handler.
1481 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1483 Formats tab is now complete. Converters tab is nearly so.
1485 2000-11-09 Juergen Vigna <jug@sad.it>
1487 * src/insets/insettext.C (~InsetText):
1490 (SetParagraphData): set cache.second to 0 after deleting it!
1491 (getLyXText): check if cache.second is not 0 if finding it.
1493 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1495 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1496 lyxlex to parse the rgb.txt file.
1499 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1500 replace the default '#' comment character.
1502 * src/support/tempname.C: add "using" directive
1503 * src/frontends/ButtonPolicies.C: ditto.
1505 * src/support/filetools.C (DirList): add an explicit cast to avoid
1506 a compile error (probably not the right fix)
1508 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1510 * src/support/filetools.C (DirList): implement using system functions
1512 * src/support/tempname.C: new file
1514 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1516 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1518 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1521 * src/frontends/xforms/ButtonController.C: new file
1523 * src/os2_defines.h: remove getcwd define
1525 * src/lyxvc.C: include support/lyxlib.h
1526 (showLog): use lyx::tempName
1528 * src/lyx_cb.C: comment out includes that we don't need
1529 (AutoSave): use lyx::tempName
1531 * src/filedlg.C: include support/lyxlib.h
1532 (Reread): use lyx::getcwd
1534 * src/converter.C: include support/filetools.h
1535 (add_options): change to static inline, make tail const
1536 (Add): make old_viewer const
1537 (GetAllFormats): make it a const method, use const_iterator
1538 (enable): make static inline
1539 (SplitFormat): make using_format const
1541 * src/LaTeX.C (run): use lyx::getcwd
1543 * configure.in: check for mkstemp as well
1545 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1547 * src/converter.[Ch] (GetAllCommands): new method.
1549 * src/support/filetools.[Ch] (DirList): new method.
1551 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1552 functionality to the converters tab.
1553 The formats tab is now nearly complete.
1554 The kbmap choices in Languages tab now display the contents of
1555 system_lyxdir/kbd/*.kmap in readable form.
1557 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1558 Moved some variables into the class.
1560 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1561 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1562 colour of active folder to lighter grey instead. Any takers?
1563 (form_colours): added an "Apply" button.
1564 (form_converters): added a "Flags" input field.
1565 (form_formats): added a "Shortcut" input field. Note that we can't use
1566 names such as "input_shortcut" as this buggers up the sed script stuff.
1568 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1576 * src/lyx_sendfax_main.C:
1579 * src/spellchecker.C:
1580 * src/insets/figinset.C:
1581 * src/insets/insetbib.C:
1582 * src/insets/insetexternal.C:
1583 * src/insets/insetinclude.C:
1584 * src/insets/insetinfo.C:
1585 * src/mathed/math_panel.C:
1586 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1587 all "daughter" dialogs now have identical "feel".
1589 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1591 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1592 used (and was only used in one place prior to this patch. Incorrectly!)
1594 * src/frontends/xforms/FormDocument.C: changed some instances of
1595 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1596 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1597 for options_->input_float_placement. This fixes a bug reported by
1600 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1601 functionality into d-tor.
1603 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1604 input of numerals also.
1606 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1607 fl_set_form_atclose(). Can now close dialog from window manager,
1608 fixing a bug reported by Rob Lahaye.
1610 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1612 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1613 are no longer dark. Haven't yet worked out how to lighten the colour of
1614 the active tabfolder. Any ideas anybody?
1615 Adjusted Colours tab a little.
1616 Added Shortcut field to converters tab. Note that we can't create an
1617 fdesign label like "input_shortcut" as this buggers up the sed-script
1620 * src/frontends/xforms/FormPreferences.[Ch]:
1621 (feedback): fixed crash due to to ob=0.
1622 (LanguagesXXX): the kbmap choices now contain the files
1623 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1624 be replaced by an input with a file browse button, but since the browse
1625 buttons don'y yet work, this'll do for the moment.
1626 (FormatsXXX): think that this is now nearly fully functional.
1627 Some points/questions though:
1628 1. Does "Apply" remove formats if no longer present?
1629 2. I think that the browser should list the GUI names rather than the
1631 3. Must ensure that we can't delete Formats used by an existing
1634 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1635 if this is the best way to do this.
1637 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1639 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1641 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1642 for variable assignment.
1644 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1646 * src/lib/ui/default.ui: added sub/superscripts to menu as
1647 Insert->Special characters and cleaned-up the file a bit
1649 2000-11-07 Allan Rae <rae@lyx.org>
1651 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1652 ob isn't 0 before using it. See comments in function.
1654 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1656 * src/frontends/xforms/form_*.C: regenerated
1658 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1660 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1662 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1663 compiling with gcc-2.96
1665 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1667 * src/support/lyxstring.C: add a couple "using" directives.
1669 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1670 a .c_str() here too for good measure.
1671 * src/Spacing.C (set): ditto.
1672 * src/lyxfunc.C (Dispatch): ditto.
1674 * src/insets/insettabular.C (copySelection): change .str() to
1675 .str().c_str() to fix problems with lyxstring.
1676 * src/support/filetools.C (GetFileContents): ditto.
1677 * src/buffer.C (asciiParagraph): ditto.
1678 * src/paragraph.C (String): ditto.
1680 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1681 * lib/bind/sciword.bind: ditto.
1683 * src/LyXAction.C (init): remove "symbol-insert" function, which
1684 shared LFUN_INSERT_MATH with "math-insert".
1686 * lib/configure.m4: == is not a valid operator for command test.
1688 * src/lyxrc.C: add using directive.
1690 * src/converter.h: add std:: qualifier.
1692 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1694 * src/converter.[Ch] and other files: Change the Format class to a
1695 real class, and create two instances: formats and system_format.
1697 * src/lyxrc.C (output): Output the difference between formats and
1700 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1701 (buildFormats): Insert formats into browser.
1702 (inputFormats): Made the browser and add button functional.
1703 (applyFormats): Update formats from format_vec.
1705 * src/converter.C: Changed all (*it). to it->
1706 (Format::dummy): New method.
1707 (Format::importer): New format flag.
1708 (Formats::GetAllFormats): New method.
1709 (Formats::Add): Delete format from the map if prettyname is empty.
1710 (Converter::Convert): Print an error message if moving the file fails.
1711 (Converter::GetReachableTo): New method
1713 * src/MenuBackend.[Ch]: Add support for importformats tag.
1715 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1717 * lib/configure.m4: Add word->tex and ps->fax converters.
1719 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1720 Return fax to file menu.
1724 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1726 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1729 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1732 * src/lyxfunc.C (processKeyEvent): removed
1734 * src/bufferlist.C (emergencyWrite): removed the out commented
1735 emergency write code.
1737 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1739 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1741 * many files: change formatting to be a bit more uniform for
1742 if,while,for,switch statements, remove some parantesis not needed.
1745 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1747 * config/kde.m4: make config more robust when KDEDIR is set
1749 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1751 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1752 not returned a pixmap for "math-insert".
1754 * src/LyXAction.C (init): sort the entries a bit.
1756 2000-11-03 Juergen Vigna <jug@sad.it>
1758 * src/insets/insettabular.h: added fixed number to update codes so
1759 that update is only in one direction.
1761 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1764 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1765 before call to edit because of redraw.
1767 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1769 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1771 * lib/ui/default.ui: Populate "edit_float" menu
1773 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1775 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1776 "floats-operate". The name is ugly (and the func also), but this
1777 is just a band-aid until we switch to new insets.
1779 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1781 * lib/ui/default.ui: update again the menu layout (fix some
1784 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1786 * src/MenuBackend.h (fulllabel): new method.
1788 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1789 the menu shortcuts of a menu are unique and whether they
1790 correspond to a letter of the label.
1791 (expand): call checkShortcuts when debugging.
1793 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1795 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1797 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1799 * lib/examples/*.lyx : '\language default' => '\language english'
1801 * lib/examples/it_splash.lyx : except where it should be italian
1803 * lib/templates/*.lyx : the same
1805 * doc/*.lyx* : the same
1807 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1809 * lib/bind/menus.bind: remove the Layout menu entries, which I
1810 somehow forgot earlier.
1812 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1814 * lib/ui/old-default.ui: keep the old one here for reference (to
1817 * lib/ui/default.ui: update the menu layout
1819 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1821 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1822 Can now Apply to different insets without closing the dialog.
1824 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1825 Can't actually DO anything with them yet, but I'd like a little
1828 * src/frontends/xforms/input_validators.[ch]
1829 (fl_lowercase_filter): new.
1831 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1833 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1834 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1836 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1838 2000-11-02 Juergen Vigna <jug@sad.it>
1840 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1841 on char insertion as it has already be updated by bv->updateInset().
1843 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1844 if an inset inside was updated.
1846 * lib/configure.cmd: commented out fax-search code
1848 2000-11-01 Yves Bastide <stid@acm.org>
1850 * src/tabular.C (OldFormatRead): set tabular language to the
1853 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1855 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1856 class names with non-letter characters (from Yves Bastide).
1858 * lib/ui/default.ui: change Item to OptItem in import menu.
1859 Comment out fax stuff.
1861 * lib/configure.m4: comment out fax-related stuff.
1863 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1865 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1866 useful xforms helper functions. At present contains only formatted().
1867 Input a string and it returns it with line breaks so that in fits
1870 * src/frontends/xforms/Makefile.am: add new files.
1872 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1873 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1876 * src/frontends/xforms/FormPreferences.[Ch]:
1877 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1878 but lots of little clean ups. Removed enum State. Make use of
1879 formatted(). Constify lots of methods. Perhaps best of all: removed
1880 requirement for that horrible reinterpret_cast from pointer to long in
1883 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1885 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1886 conditionalize build on xforms < 0.89
1888 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1890 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1892 * src/LyXAction.C (init): comment out fax
1894 * src/lyxrc.h: comment out the fax enums
1895 comment out the fax variables
1897 * src/commandtags.h: comment out LFUN_FAX
1899 * src/lyxrc.C: disable fax variables.
1900 (read): disable parsing of fax variables
1901 (output): disable writing of fax variables
1902 (getFeedback): now description for fax variables
1904 * src/lyxfunc.C: comment out MenuFax
1905 (Dispatch): disable LFUN_FAX
1907 * src/lyx_cb.C (MenuFax): comment out
1909 * src/WorkArea.C: add <cctype>
1910 (work_area_handler): better key handling, should be ok now.
1911 for accented chars + etc
1913 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1914 lyx_sendfax.h and lyx_sendfax_man.C
1916 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1917 (show): don't call InitLyXLookup when using xforms 0.89
1919 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1921 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1923 * src/support/filetools.C (GetFileContents): close to dummy change
1925 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1927 * src/trans.C (AddDeadkey): workaround stupid compilers.
1929 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1931 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1932 of two-sided document.
1934 2000-10-31 Juergen Vigna <jug@sad.it>
1936 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1938 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1939 xposition to the Edit call.
1941 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1943 * src/trans.C (AddDeadkey): cast explicitly to char.
1945 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1947 * src/tabular.C (AsciiBottomHLine): simplify?
1948 (AsciiTopHLine): simplify?
1949 (print_n_chars): simplify
1950 (DocBook): remove most of the << endl; we should flush the stream
1951 as seldom as possible.
1953 (TeXBottomHLine): ditto
1954 (TeXTopHLine): ditto
1956 (write_attribute): try a templified version.
1957 (set_row_column_number_info): lesson scope of variables
1959 * src/support/lstrings.h (tostr): new specialization of tostr
1961 * src/trans.C (AddDeadkey): slightly cleaner fix.
1963 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1965 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1966 '%%' in Toc menu labels.
1969 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1970 font_norm is iso10646-1.
1972 * src/font.C (ascent): Fixed for 16bit fonts
1973 (descent,lbearing,rbearing): ditto
1975 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1977 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1978 (getFeedback): new static method.
1980 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1981 Now use combox rather than choice to display languages.
1982 Feedback is now output using a new timer callback mechanism, identical
1983 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1985 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1987 * src/minibuffer.C: fix for older compilers
1989 2000-10-30 Juergen Vigna <jug@sad.it>
1991 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1992 has to be Left of the inset otherwise LyXText won't find it!
1994 * src/BufferView2.C (open_new_inset): delete the inset if it can
1997 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1999 * lyx.man: fix typo.
2001 2000-10-29 Marko Vendelin <markov@ioc.ee>
2002 * src/frontends/gnome/FormCitation.C
2003 * src/frontends/gnome/FormCitation.h
2004 * src/frontends/gnome/FormCopyright.C
2005 * src/frontends/gnome/FormCopyright.h
2006 * src/frontends/gnome/FormError.C
2007 * src/frontends/gnome/FormError.h
2008 * src/frontends/gnome/FormIndex.C
2009 * src/frontends/gnome/FormIndex.h
2010 * src/frontends/gnome/FormPrint.C
2011 * src/frontends/gnome/FormPrint.h
2012 * src/frontends/gnome/FormRef.C
2013 * src/frontends/gnome/FormRef.h
2014 * src/frontends/gnome/FormToc.C
2015 * src/frontends/gnome/FormToc.h
2016 * src/frontends/gnome/FormUrl.C
2017 * src/frontends/gnome/FormUrl.h
2018 * src/frontends/gnome/Menubar_pimpl.C
2019 * src/frontends/gnome/mainapp.C
2020 * src/frontends/gnome/mainapp.h
2021 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
2022 changing update() to updateSlot() where appropriate
2024 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
2026 * src/frontends/xforms/FormPreferences.[Ch]:
2027 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
2030 2000-10-28 Juergen Vigna <jug@sad.it>
2032 * src/insets/insettabular.C (draw): fixed drawing bug.
2034 * src/insets/insettext.C (clear):
2036 (SetParagraphData): clearing the TEXT buffers when deleting the
2037 paragraphs used by it.
2039 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
2041 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
2043 2000-10-27 Juergen Vigna <jug@sad.it>
2045 * src/tabular.C (~LyXTabular): removed not needed anymore.
2047 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
2050 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
2052 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
2055 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
2058 * src/frontends/xforms/FormPreferences.[Ch]:
2059 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
2060 Reorganised as modules based on tabs. Much easier to follow the
2061 flow and to add new tabs. Added warning and feedback messages.
2064 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2066 * src/tabular.h (DocBook): add std:: qualifier.
2068 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
2070 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
2071 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
2074 * insettabular.C (DocBook): uses the tabular methods to export
2077 * src/insets/insettext.h
2078 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
2080 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2082 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
2085 * src/lyxfunc.C (MenuNew): lessen the scope of fname
2086 moved misplaced AllowInput two lines up.
2088 * src/buffer.C (readFile): compare float with float, not with int
2090 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2092 * src/minibuffer.C: add "using SigC::slot" statement.
2094 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
2096 * src/frontends/xforms/forms/README: updated section about make.
2098 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
2099 Tidied some forms up, made two of form_tabular's tabs more
2100 self-consistent, fixed Jean-Marc's size problem in form_preferences,
2101 fixed translation problem with "Column".
2103 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2105 * src/minibuffer.h: use Timeout instead of the xforms timer
2107 (setTimer) rewrite for the Timeout, change to unsigned arg
2108 (set): change to unsigned timer arg
2111 * src/minibuffer.C (TimerCB): removed func
2112 (C_MiniBuffer_TimerCB): removed func
2113 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
2114 (peek_event): use a switch statement
2115 (add): don't use fl_add_timer.
2116 (Set): rewrite to use the Timeout
2119 * src/Timeout.[Ch] (setType): return a Timeout &
2120 (setTimeout): ditto, change to unsigned arg for timeout
2122 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
2124 * src/mathed/formula.C (mathed_string_width): Use string instead
2125 of a constant size char array.
2127 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2129 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
2130 the two recently added operator<< for SMInput and State.
2132 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
2134 (OkCancelPolicy): ditto
2135 (OkCancelReadOnlyPolicy): ditto
2136 (NoRepeatedApplyReadOnlyPolicy): ditto
2137 (OkApplyCancelReadOnlyPolicy): ditto
2138 (OkApplyCancelPolicy): ditto
2139 (NoRepeatedApplyPolicy): ditto
2141 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2143 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
2144 add the usual std:: qualifiers.
2146 2000-10-25 Juergen Vigna <jug@sad.it>
2148 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
2150 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2152 * src/support/filetools.C (MakeRelPath): change some types to
2155 * src/frontends/ButtonPolicies.h (operator<<): new operator for
2156 ButtonPolicy::SMInput and ButtonPolicy::State.
2158 * src/FontLoader.C (reset): small cleanup
2159 (unload): small cleanup
2161 * src/FontInfo.C (getFontname): initialize error to 10000.0
2163 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2165 * src/frontends/xforms/FormPreferences.[Ch]:
2166 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
2167 TeX encoding and default paper size sections.
2169 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2171 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
2174 * src/frontends/xforms/FormError.C (disconnect): use erase() to
2175 make the message_ empty.
2176 (FormError): don't initialize message_ in initializer list.
2178 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2180 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
2182 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2184 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
2186 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
2188 * src/frontends/kde/*data.[Ch]: _("") is not
2191 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2193 * src/buffer.C: removed redundant using directive.
2195 * src/frontends/DialogBase.h: revert to original definition of
2198 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
2199 stuff into two classes, one for each dialog, requires a new
2200 element in the dialogs vector, FormTabularCreate.
2202 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
2205 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
2206 method. Continues Allan's idea, but means that derived classes
2207 don't need to worry about "update or hide?".
2209 * src/frontends/xforms/FormError.C (showInset): add connection
2212 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
2213 one for each dialog. FormTabular now contains main tabular dialog
2216 * src/frontends/xforms/FormTabularCreate.[Ch]:
2217 * src/frontends/xforms/forms/form_tabular_create.fd: the create
2220 * src/frontends/xforms/FormGraphics.[Ch]:
2221 * src/frontends/xforms/forms/form_graphics.fd
2222 * src/frontends/xforms/FormTabular.[Ch]:
2223 * src/frontends/xforms/forms/form_tabular.fd: made daughter
2224 classes of FormInset.
2226 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
2227 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
2229 * src/frontends/xforms/Makefile.am:
2230 * src/frontends/xforms/forms/makefile: added new files.
2232 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
2233 variable. added Signal0 hide signal, in keeping with other GUI-I
2236 * src/support/lstrings.h: removed redundant std:: qualifier as
2237 it's already declared in Lsstream.h.
2239 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2241 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
2245 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2247 * src/tabular.C (Ascii): minimize scope of cell.
2249 * src/BufferView2.C (nextWord): return string() instead of 0;
2251 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2253 * src/converter.h: add a std:: qualifier
2255 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
2257 * src/importer.[Ch]: New files. Used for importing files into LyX.
2259 * src/lyxfunc.C (doImport): Use the new Importer class.
2261 * src/converter.h: Add shortcut member to the Format class.
2262 Used for holding the menu shortcut.
2264 * src/converter.C and other files: Made a distinction between
2265 format name and format extension. New formats can be defined using
2266 the \format lyxrc tag.
2267 Added two new converter flags: latex and disable.
2269 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2271 * src/support/lyxlib.h: unify namespace/struct implementation.
2272 Remove extra declarations.
2274 * src/support/chdir.C (chdir): remove version taking char const *
2276 * src/support/rename.C: ditto.
2277 * src/support/lyxsum.C: ditto.
2279 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
2281 * src/frontends/xforms/FormBase.[Ch]:
2282 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
2283 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
2284 work only for the next call to fl_show_form(). The correct place to set
2285 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
2286 done. FormBase also stores minw_, minh_ itself. All dialogs derived
2287 from FormBase have the minimum size set; no more stupid crashes with
2290 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2292 * lib/ui/default.ui: fix shortcut for Insert->Include File.
2294 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2296 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
2298 * src/support/lyxlib.h: changed second argument of mkdir to
2299 unsigned long int (unsigned int would probably have been enough,
2300 but...). Removed <sys/types.h> header.
2301 * src/support/mkdir.C (mkdir): ditto.
2305 2000-10-19 Juergen Vigna <jug@sad.it>
2307 * src/lyxfunc.C (MenuNew): small fix (form John)
2309 * src/screen.C (Update): removed unneeded code.
2311 * src/tabular.C (Ascii): refixed int != uint bug!
2313 * src/support/lyxlib.h: added sys/types.h include for now permits
2314 compiling, but I don't like this!
2316 2000-10-18 Juergen Vigna <jug@sad.it>
2318 * src/text2.C (ClearSelection): if we clear the selection we need
2319 more refresh so set the status apropriately
2321 * src/insets/insettext.C (draw): hopefully finally fixed draw
2324 2000-10-12 Juergen Vigna <jug@sad.it>
2326 * src/insets/insettext.C (draw): another small fix and make a block
2327 so that variables are localized.
2329 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
2331 * src/support/lstrings.C (lowercase, uppercase):
2332 use explicit casts to remove compiler warnings.
2334 * src/support/LRegex.C (Impl):
2335 * src/support/StrPool.C (add):
2336 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2337 (AddPath, MakeDisplayPath):
2338 * src/support/lstrings.C (prefixIs, subst):
2339 use correct type to remove compiler warnings.
2341 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2343 * src/support/lyxlib.h:
2344 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2345 portability and to remove compiler warning with DEC cxx.
2347 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2349 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2351 * src/minibuffer.C (peek_event): retun 1 when there has been a
2352 mouseclick in the minibuffer.
2356 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2358 * src/frontends/xforms/FormParagraph.C: more space above/below
2361 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2363 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2364 a char only if real_current_font was changed.
2366 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2368 * NEWS: update somewhat for 1.1.6
2370 * lib/ui/default.ui: clean up.
2372 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2374 * lib/CREDITS: clean up
2376 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2378 * src/combox.[Ch] (select): changed argument back to int
2379 * src/combox.C (peek_event): removed num_bytes as it is declared but
2382 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2383 modified calls to Combox::select() to remove warnings about type
2386 * src/insets/insetbutton.C (width): explicit cast to remove warning
2387 about type conversion.
2389 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2392 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2393 sel_pos_end, refering to cursor position are changed to
2394 LyXParagraph::size_type.
2396 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2397 consistent with LyXCursor::pos().
2398 (inset_pos): changed to LyXParagraph::size_type for same reason.
2400 * src/insets/insettext.C (resizeLyXText): changed some temporary
2401 variables refing to cursor position to LyXParagraph::size_type.
2403 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2405 * src/frontends/kde/<various>: The Great Renaming,
2408 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2410 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2412 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2414 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2415 0 when there are no arguments.
2417 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2419 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2420 to segfaults when pressing Ok in InsetBibtex dialog.
2422 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2424 * forms/layout_forms.fd:
2425 * src/layout_forms.C (create_form_form_character): small change to use
2426 labelframe rather than engraved frame + text
2428 * src/lyx_gui.C (create_forms): initialise choice_language with some
2429 arbitrary value to prevent segfault when dialog is shown.
2431 2000-10-16 Baruch Even <baruch.even@writeme.com>
2433 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2434 is no resulting file. This pertains only to LaTeX output.
2436 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2438 * src/text.C (Backspace): Make sure that the row of the cursor is
2441 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2444 * src/lyx_gui.C (init): Prevent a crash when only one font from
2445 menu/popup fonts is not found.
2447 * lib/lyxrc.example: Add an example for binding a key for language
2450 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2452 * src/converter.C (GetReachable): Changed the returned type to
2454 (IsReachable): New method
2456 * src/MenuBackend.C (expand): Handle formats that appear more
2459 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2461 * src/frontends/support/Makefile.am
2462 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2465 * lib/CREDITS: add Garst Reese.
2467 * src/support/snprintf.h: add extern "C" {} around the definitions.
2469 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2471 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2474 * src/frontends/xforms/FormDocument.C:
2475 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2476 compile without "conversion to integral type of smaller size"
2479 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2481 * src/text.C (GetColumnNearX): Fixed disabled code.
2483 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2485 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2488 * src/support/snprintf.[ch]: new files
2490 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2492 * src/frontends/kde/formprintdialog.C: add
2493 file browser for selecting postscript output
2495 * src/frontends/kde/formprintdialogdata.C:
2496 * src/frontends/kde/formprintdialogdata.h: re-generate
2499 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2501 * src/frontends/gnome/Makefile.am:
2502 * src/frontends/kde/Makefile.am: FormCommand.C
2503 disappeared from xforms
2505 * src/frontends/kde/FormCitation.C:
2506 * src/frontends/kde/FormIndex.C: read-only
2509 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2511 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2514 * src/bufferlist.C: add using directive.
2516 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2518 * src/support/lyxfunctional.h: version of class_fun for void
2519 returns added, const versions of back_inseter_fun and compare_fun
2522 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2524 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2526 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2528 * ChangeLog: cleanup.
2530 * lib/CREDITS: update to add all the contributors we've forgotten.
2531 I have obviously missed some, so tell me whether there were
2534 2000-10-13 Marko Vendelin <markov@ioc.ee>
2536 * src/frontends/gnome/FormCitation.C
2537 * src/frontends/gnome/FormCitation.h
2538 * src/frontends/gnome/FormError.C
2539 * src/frontends/gnome/FormIndex.C
2540 * src/frontends/gnome/FormRef.C
2541 * src/frontends/gnome/FormRef.h
2542 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2544 * src/frontends/gnome/FormCitation.C
2545 * src/frontends/gnome/FormCopyright.C
2546 * src/frontends/gnome/FormError.C
2547 * src/frontends/gnome/FormIndex.C
2548 * src/frontends/gnome/FormRef.C
2549 * src/frontends/gnome/FormToc.C
2550 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2553 * src/frontends/gnome/Menubar_pimpl.C
2554 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2557 2000-10-11 Baruch Even <baruch.even@writeme.com>
2560 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2561 to convey its real action.
2563 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2564 clear the minibuffer and prepare to enter a command.
2566 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2567 the rename from ExecCommand to PrepareForCommand.
2568 * src/lyxfunc.C (Dispatch): ditto.
2570 2000-10-11 Baruch Even <baruch.even@writeme.com>
2572 * src/buffer.C (writeFile): Added test for errors on writing, this
2573 catches all errors and not only file system full errors as intended.
2575 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2577 * src/lyx_gui.C (create_forms): better fix for crash with
2578 translated interface.
2580 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2582 * src/frontends/kde/Makefile.am:
2583 * src/frontends/kde/FormCopyright.C:
2584 * src/frontends/kde/formcopyrightdialog.C:
2585 * src/frontends/kde/formcopyrightdialog.h:
2586 * src/frontends/kde/formcopyrightdialogdata.C:
2587 * src/frontends/kde/formcopyrightdialogdata.h:
2588 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2589 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2590 copyright to use qtarch
2592 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2594 * src/encoding.C (read): Fixed bug that caused an error message at
2595 the end of the file.
2597 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2599 * lib/lyxrc.example: Fixed hebrew example.
2601 2000-10-13 Allan Rae <rae@lyx.org>
2603 * src/frontends/xforms/FormPreferences.C (input): reworking the
2605 (build, update, apply): New inputs in various tabfolders
2607 * src/frontends/xforms/FormToc.C: use new button policy.
2608 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2609 dialogs that either can't use any existing policy or where it just
2612 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2615 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2616 added a bool parameter which is ignored.
2618 * src/buffer.C (setReadonly):
2619 * src/BufferView_pimpl.C (buffer):
2620 * src/frontends/kde/FormCopyright.h (update):
2621 * src/frontends/kde/FormCitation.[Ch] (update):
2622 * src/frontends/kde/FormIndex.[Ch] (update):
2623 * src/frontends/kde/FormPrint.[Ch] (update):
2624 * src/frontends/kde/FormRef.[Ch] (update):
2625 * src/frontends/kde/FormToc.[Ch] (update):
2626 * src/frontends/kde/FormUrl.[Ch] (update):
2627 * src/frontends/gnome/FormCopyright.h (update):
2628 * src/frontends/gnome/FormCitation.[Ch] (update):
2629 * src/frontends/gnome/FormError.[Ch] (update):
2630 * src/frontends/gnome/FormIndex.[Ch] (update):
2631 * src/frontends/gnome/FormPrint.[Ch] (update):
2632 * src/frontends/gnome/FormRef.h (update):
2633 * src/frontends/gnome/FormToc.[Ch] (update):
2634 * src/frontends/gnome/FormUrl.[Ch] (update):
2635 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2636 to updateBufferDependent and DialogBase
2638 * src/frontends/xforms/FormCitation.[hC]:
2639 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2640 * src/frontends/xforms/FormError.[Ch]:
2641 * src/frontends/xforms/FormGraphics.[Ch]:
2642 * src/frontends/xforms/FormIndex.[Ch]:
2643 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2644 and fixed readOnly handling.
2645 * src/frontends/xforms/FormPrint.[Ch]:
2646 * src/frontends/xforms/FormRef.[Ch]:
2647 * src/frontends/xforms/FormTabular.[Ch]:
2648 * src/frontends/xforms/FormToc.[Ch]:
2649 * src/frontends/xforms/FormUrl.[Ch]:
2650 * src/frontends/xforms/FormInset.[Ch]:
2651 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2652 form of updateBufferDependent.
2654 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2655 if form()->visible just in case someone does stuff to the form in a
2658 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2659 the buttoncontroller for everything the enum used to be used for.
2660 (update) It would seem we need to force all dialogs to use a bool
2661 parameter or have two update functions. I chose to go with one.
2662 I did try removing update() from here and FormBase and defining the
2663 appropriate update signatures in FormBaseB[DI] but then ran into the
2664 problem of the update() call in FormBase::show(). Whatever I did
2665 to get around that would require another function and that just
2666 got more confusing. Hence the decision to make everyone have an
2667 update(bool). An alternative might have been to override show() in
2668 FormBaseB[DI] and that would allow the different and appropriate
2671 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2672 true == buffer change occurred. I decided against using a default
2673 template parameter since not all compilers support that at present.
2675 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2677 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2678 army knife" by removing functionality.
2679 (clearStore): removed. All such housekeeping on hide()ing the dialog
2680 is to be carried out by overloaded disconnect() methods.
2681 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2682 superceded by Baruch's neat test (FormGraphics) to update an existing
2683 dialog if a new signal is recieved rather than block all new signals
2685 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2686 only to Inset dialogs.
2687 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2688 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2690 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2692 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2693 as a base class to all inset dialogs. Used solely to connect/disconnect
2694 the Inset::hide signal and to define what action to take on receipt of
2695 a UpdateBufferDependent signal.
2696 (FormCommand): now derived from FormInset.
2698 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2701 * src/frontends/xforms/FormCopyright.[Ch]:
2702 * src/frontends/xforms/FormPreferences.[Ch]:
2703 now derived from FormBaseBI.
2705 * src/frontends/xforms/FormDocument.[Ch]:
2706 * src/frontends/xforms/FormParagraph.[Ch]:
2707 * src/frontends/xforms/FormPrint.[Ch]:
2708 now derived from FormBaseBD.
2710 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2712 * src/frontends/xforms/FormCitation.[Ch]:
2713 * src/frontends/xforms/FormError.[Ch]:
2714 * src/frontends/xforms/FormRef.[Ch]:
2715 * src/frontends/xforms/FormToc.[Ch]:
2716 (clearStore): reworked as disconnect().
2718 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2721 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2723 * src/converter.C (runLaTeX): constify buffer argument
2726 * src/frontends/support/Makefile.am (INCLUDES): fix.
2728 * src/buffer.h: add std:: qualifier
2729 * src/insets/figinset.C (addpidwait): ditto
2730 * src/MenuBackend.C: ditto
2731 * src/buffer.C: ditto
2732 * src/bufferlist.C: ditto
2733 * src/layout.C: ditto
2734 * src/lyxfunc.C: ditto
2736 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2738 * src/lyxtext.h (bidi_level): change return type to
2739 LyXParagraph::size_type.
2741 * src/lyxparagraph.h: change size_type to
2742 TextContainer::difference_type. This should really be
2743 TextContainer::size_type, but we need currently to support signed
2746 2000-10-11 Marko Vendelin <markov@ioc.ee>
2747 * src/frontends/gnome/FormError.h
2748 * src/frontends/gnome/FormRef.C
2749 * src/frontends/gnome/FormRef.h
2750 * src/frontends/gnome/FormError.C
2751 * src/frontends/gnome/Makefile.am
2752 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2753 to Gnome frontend. Both dialogs use "action" area.
2755 2000-10-12 Baruch Even <baruch.even@writeme.com>
2757 * src/graphics/GraphicsCacheItem_pimpl.C:
2758 * src/graphics/Renderer.C:
2759 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2762 2000-10-12 Juergen Vigna <jug@sad.it>
2764 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2765 visible when selecting).
2767 * development/Code_rules/Rules: fixed some typos.
2769 2000-10-09 Baruch Even <baruch.even@writeme.com>
2771 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2772 compiling on egcs 1.1.2 possible.
2774 * src/filedlg.C (comp_direntry::operator() ): ditto.
2776 2000-08-31 Baruch Even <baruch.even@writeme.com>
2778 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2781 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2782 transient it now only gets freed when the object is destructed.
2784 2000-08-24 Baruch Even <baruch.even@writeme.com>
2786 * src/frontends/FormGraphics.h:
2787 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2790 2000-08-20 Baruch Even <baruch.even@writeme.com>
2792 * src/insets/insetgraphics.C:
2793 (draw): Added messages to the drawn rectangle to report status.
2794 (updateInset): Disabled the use of the inline graphics,
2797 2000-08-17 Baruch Even <baruch.even@writeme.com>
2799 * src/frontends/support: Directory added for the support of GUII LyX.
2801 * src/frontends/support/LyXImage.h:
2802 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2805 * src/frontends/support/LyXImage_X.h:
2806 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2807 version of LyXImage, this uses the Xlib Pixmap.
2809 * src/PainterBase.h:
2810 * src/PainterBase.C:
2812 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2813 replacement to Pixmap.
2815 * src/insets/insetgraphics.h:
2816 * src/insets/insetgraphics.C:
2817 * src/graphics/GraphicsCacheItem.h:
2818 * src/graphics/GraphicsCacheItem.C:
2819 * src/graphics/GraphicsCacheItem_pimpl.h:
2820 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2823 * src/graphics/GraphicsCacheItem.h:
2824 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2825 another copy of the object.
2827 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2828 of cacheHandle, this fixed a bug that sent LyX crashing.
2830 * src/graphics/XPM_Renderer.h:
2831 * src/graphics/XPM_Renderer.C:
2832 * src/graphics/EPS_Renderer.h:
2833 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2835 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2837 * src/lyxfunc.C (processKeySym): only handle the
2838 lockinginset/inset stuff if we have a buffer and text loaded...
2840 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2842 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2844 * src/support/lyxfunctional.h: add operator= that takes a reference
2846 * src/lyxserver.C (mkfifo): make first arg const
2848 * src/layout.h: renamed name(...) to setName(...) to work around
2851 * src/buffer.C (setFileName): had to change name of function to
2852 work around bugs in egcs. (renamed from fileName)
2854 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2856 * src/support/translator.h: move helper template classes to
2857 lyxfunctional.h, include "support/lyxfunctional.h"
2859 * src/support/lyxmanip.h: add delaration of fmt
2861 * src/support/lyxfunctional.h: new file
2862 (class_fun_t): new template class
2863 (class_fun): helper template function
2864 (back_insert_fun_iterator): new template class
2865 (back_inserter_fun): helper template function
2866 (compare_memfun_t): new template class
2867 (compare_memfun): helper template function
2868 (equal_1st_in_pair): moved here from translator
2869 (equal_2nd_in_pair): moved here from translator
2871 * src/support/fmt.C: new file
2872 (fmt): new func, can be used for a printf substitute when still
2873 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2875 * src/support/StrPool.C: add some comments
2877 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2880 * src/insets/figinset.C (addpidwait): use std::copy with
2881 ostream_iterator to fill the pidwaitlist
2883 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2885 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2888 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2891 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2893 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2894 (class_update): ditto
2895 (BulletPanel): ditto
2896 (CheckChoiceClass): move initialization of tc and tct
2898 * src/tabular.C: remove current_view
2899 (OldFormatRead): similar to right below [istream::ignore]
2901 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2902 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2903 unused [istream::ignore]
2905 * src/lyxfunc.C: include "support/lyxfunctional.h"
2906 (getInsetByCode): use std::find_if and compare_memfun
2908 * src/lyxfont.C (stateText): remove c_str()
2910 * src/lyx_main.C (setDebuggingLevel): make static
2911 (commandLineHelp): make static
2913 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2914 Screen* together with fl_get_display() and fl_screen
2916 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2917 togheter with fl_get_display() and fl_screen
2918 (create_forms): remove c_str()
2920 * src/layout.C: include "support/lyxfunctional.h"
2921 (hasLayout): use std::find_if and compare_memfun
2922 (GetLayout): use std::find_if and comapre_memfun
2923 (delete_layout): use std::remove_if and compare_memfun
2924 (NumberOfClass): use std:.find_if and compare_memfun
2926 * src/gettext.h: change for the new functions
2928 * src/gettext.C: new file, make _(char const * str) and _(string
2929 const & str) real functions.
2931 * src/font.C (width): rewrite slightly to avoid one extra variable
2933 * src/debug.C: initialize Debug::ANY here
2935 * src/commandtags.h: update number comments
2937 * src/combox.h (get): make const func
2939 (getline): make const
2941 * src/combox.C (input_cb): handle case where fl_get_input can
2944 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2945 "support/lyxfunctional.h", remove current_view variable.
2946 (resize): use std::for_each with std::mem_fun
2947 (getFileNames): use std::copy with back_inserter_fun
2948 (getBuffer): change arg type to unsigned int
2949 (emergencyWriteAll): call emergencyWrite with std::for_each and
2951 (emergencyWrite): new method, the for loop in emergencyWriteAll
2953 (exists): use std::find_if with compare_memfun
2954 (getBuffer): use std::find_if and compare_memfun
2956 * src/buffer.h: add typedefs for iterator_category, value_type
2957 difference_type, pointer and reference for inset_iterator
2958 add postfix ++ for inset_iterator
2959 make inset_iterator::getPos() const
2961 * src/buffer.C: added support/lyxmanip.h
2962 (readFile): use lyxerr << fmt instead of printf
2963 (makeLaTeXFile): use std::copy to write out encodings
2965 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2967 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2968 free and the char * temp.
2969 (hasMenu): use std::find_if and compare_memfun
2972 * src/Makefile.am (lyx_SOURCES): added gettext.C
2974 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2975 string::insert small change to avoid temporary
2977 * src/LColor.C (getGUIName): remove c_str()
2979 * several files: change all occurrences of fl_display to
2982 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2983 that -pedantic is not used for gcc 2.97 (cvs gcc)
2985 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2987 2000-10-11 Allan Rae <rae@lyx.org>
2989 * src/frontends/xforms/FormPreferences.C (input): template path must be
2990 a readable directory. It doesn't need to be writeable.
2991 (build, delete, update, apply): New inputs in the various tabfolders
2993 * src/frontends/xforms/forms/form_preferences.fd:
2994 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2995 several new entries to existing folders. Shuffled some existing stuff
2998 * src/frontends/xforms/forms/form_print.fd:
2999 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
3000 Should probably rework PrinterParams as well. Note that the switch to
3001 collated is effectively the same as !unsorted so changing PrinterParams
3002 will require a lot of fiddly changes to reverse the existing logic.
3004 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
3006 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
3008 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
3010 2000-10-10 Allan Rae <rae@lyx.org>
3013 * src/lyxfunc.C (Dispatch):
3015 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
3018 * src/lyxrc.C (output): Only write the differences between system lyxrc
3019 and the users settings.
3022 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
3024 I'll rewrite this later, after 1.1.6 probably, to keep a single
3025 LyXRC but two instances of a LyXRCStruct.
3027 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3029 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
3031 * src/tabular.h: add a few std:: qualifiers.
3033 * src/encoding.C: add using directive.
3034 * src/language.C: ditto.
3036 * src/insets/insetquotes.C (Validate): use languages->lang()
3037 instead of only language.
3039 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
3041 * lib/languages: New file.
3043 * lib/encodings: New file.
3045 * src/language.C (Languages): New class.
3046 (read): New method. Reads the languages from the 'languages' file.
3048 * src/encoding.C (Encodings): New class.
3049 (read): New method. Reads the encodings from the 'encodings' file.
3051 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
3054 * src/bufferparams.h and a lot of files: Deleted the member language,
3055 and renamed language_info to language
3057 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
3058 * src/lyxfont.C (latexWriteStartChanges): ditto.
3059 * src/paragraph.C (validate,TeXOnePar): ditto.
3061 * src/lyxfont.C (update): Restored deleted code.
3063 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
3065 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
3067 * src/BufferView_pimpl.C (buffer): cleaned up a little.
3069 * src/insets/figinset.[Ch]:
3070 * src/insets/insetinclude.[Ch]:
3071 * src/insets/insetinclude.[Ch]:
3072 * src/insets/insetparent.[Ch]:
3073 * src/insets/insetref.[Ch]:
3074 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
3076 * src/insets/*.[Ch]:
3077 * src/mathed/formula.[Ch]:
3078 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
3080 * src/buffer.C (parseSingleLyXformat2Token, readInset):
3081 * src/lyx_cb.C (FigureApplyCB):
3082 * src/lyxfunc.C (getStatus, Dispatch):
3083 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
3086 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
3088 * src/converter.[Ch] (Formats::View):
3089 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
3091 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
3092 *current_view->buffer(). This will change later, but this patch is way
3095 2000-10-09 Juergen Vigna <jug@sad.it>
3097 * src/text.C (GetRow): small fix.
3099 * src/BufferView_pimpl.C (cursorPrevious):
3100 (cursorNext): added LyXText parameter to function.
3102 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
3103 keypress depending on cursor position.
3105 2000-10-06 Juergen Vigna <jug@sad.it>
3107 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
3108 (copySelection): redone this function and also copy ascii representa-
3111 * src/tabular.C (Ascii):
3115 (print_n_chars): new functions to realize the ascii export of tabulars.
3117 2000-10-05 Juergen Vigna <jug@sad.it>
3119 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
3120 if we don't have a buffer.
3122 2000-10-10 Allan Rae <rae@lyx.org>
3124 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
3125 with closing dialog. It seems that nested tabfolders require hiding
3126 of inner tabfolders before hiding the dialog itself. Actually all I
3127 did was hide the active outer folder.
3129 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
3130 unless there really is a buffer. hideBufferDependent is called
3133 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
3134 POTFILES.in stays in $(srcdir).
3136 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
3138 * lib/lyxrc.example: Few changes.
3140 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
3142 * src/BufferView_pimpl.C (buffer): only need one the
3143 updateBufferDependent signal to be emitted once! Moved to the end of
3144 the method to allow bv_->text to be updated first.
3146 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
3147 and hSignal_ with Dialogs * and BufferDependency variables.
3148 New Buffer * parent_, initialised when the dialog is launched. Used to
3149 check whether to update() or hide() dialog in the new, private
3150 updateOrHide() method that is connected to the updateBufferDependent
3151 signal. Daughter classes dictate what to do using the
3152 ChangedBufferAction enum, passed to the c-tor.
3154 * src/frontends/xforms/FormCitation.C:
3155 * src/frontends/xforms/FormCommand.C:
3156 * src/frontends/xforms/FormCopyright.C:
3157 * src/frontends/xforms/FormDocument.C:
3158 * src/frontends/xforms/FormError.C:
3159 * src/frontends/xforms/FormIndex.C:
3160 * src/frontends/xforms/FormPreferences.C:
3161 * src/frontends/xforms/FormPrint.C:
3162 * src/frontends/xforms/FormRef.C:
3163 * src/frontends/xforms/FormToc.C:
3164 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
3167 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
3168 ChangedBufferAction enum.
3170 * src/frontends/xforms/FormParagraph.[Ch]
3171 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
3174 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3176 * lib/bind/cua.bind: fix a bit.
3177 * lib/bind/emacs.bind: ditto.
3179 * lib/bind/menus.bind: remove real menu entries from there.
3181 * src/spellchecker.C: make sure we only include strings.h when
3184 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3186 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
3187 function. It enlarges the maximum number of pup when needed.
3188 (add_toc2): Open a new menu if maximum number of items per menu has
3191 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
3193 * src/frontends/kde/FormPrint.C: fix error reporting
3195 * src/frontends/xforms/FormDocument.C: fix compiler
3198 * lib/.cvsignore: add Literate.nw
3200 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3203 * bufferview_funcs.[Ch]
3206 * text2.C: Add support for numbers in RTL text.
3208 2000-10-06 Allan Rae <rae@lyx.org>
3210 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
3211 to be gettext.m4 friendly again. ext_l10n.h is now
3212 generated into $top_srcdir instead of $top_builddir
3213 so that lyx.pot will be built correctly -- without
3214 duplicate parsing of ext_l10n.h.
3216 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3218 * src/frontends/kde/FormCitation.C: make the dialog
3219 behave more sensibly
3221 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
3223 * config/kde.m4: fix consecutive ./configure runs,
3224 look for qtarch, fix library order
3226 * src/frontends/kde/Makefile.am: tidy up,
3227 add Print dialog, add .dlg dependencies
3229 * src/frontends/kde/FormPrint.C:
3230 * src/frontends/kde/FormPrint.h:
3231 * src/frontends/kde/formprintdialog.C:
3232 * src/frontends/kde/formprintdialog.h:
3233 * src/frontends/kde/formprintdialogdata.C:
3234 * src/frontends/kde/formprintdialogdata.h:
3235 * src/frontends/kde/dlg/formprintdialog.dlg: add
3238 * src/frontends/kde/dlg/README: Added explanatory readme
3240 * src/frontends/kde/dlg/checkinitorder.pl: small perl
3241 script to double-check qtarch's output
3243 * src/frontends/kde/formindexdialog.C:
3244 * src/frontends/kde/formindexdialogdata.C:
3245 * src/frontends/kde/formindexdialogdata.h:
3246 * src/frontends/kde/dlg/formindexdialog.dlg: update
3247 for qtarch, minor fixes
3249 2000-10-05 Allan Rae <rae@lyx.org>
3251 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
3252 dialogs when switching buffers update them instead. It's up to each
3253 dialog to decide if it should still be visible or not.
3254 update() should return a bool to control visiblity within show().
3255 Or perhaps better to set a member variable and use that to control
3258 * lib/build-listerrors: create an empty "listerrors" file just to stop
3259 make trying to regenerate it all the time if you don't have noweb
3262 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
3264 * po/Makefile.in.in (ext_l10n.h): added a rule to build
3265 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
3266 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
3267 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
3268 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
3270 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
3272 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
3274 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
3275 deleting buffer. Closes all buffer-dependent dialogs.
3277 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
3279 * src/frontends/xforms/FormCitation.[Ch]:
3280 * src/frontends/xforms/FormPreferences.[Ch]:
3281 * src/frontends/xforms/FormPrint.[Ch]:
3282 * src/frontends/xforms/FormRef.[Ch]:
3283 * src/frontends/xforms/FormUrl.[Ch]: ditto
3285 * src/frontends/xforms/FormDocument.[Ch]:
3286 * src/frontends/xforms/forms/form_document.C.patch:
3287 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
3288 pass through a single input() function.
3290 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3292 * lib/build-listerrors: return status as OK
3294 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
3296 * lib/lyxrc.example: Updated to new export code
3298 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3300 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
3303 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
3306 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
3307 LyX-Code is defined.
3308 * lib/layouts/amsbook.layout: ditto.
3310 * boost/Makefile.am: fix typo.
3312 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
3314 (add_lastfiles): removed.
3315 (add_documents): removed.
3316 (add_formats): removed.
3318 * src/frontends/Menubar.C: remove useless "using" directive.
3320 * src/MenuBackend.h: add a new MenuItem constructor.
3322 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
3325 2000-10-04 Allan Rae <rae@lyx.org>
3327 * lib/Makefile.am (listerrors):
3328 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
3329 I haven't got notangle installed so Kayvan please test. The output
3330 should end up in $builddir. This also allows people who don't have
3331 noweb installed to complete the make process without error.
3333 * src/frontends/xforms/FormCommand.[Ch] (showInset):
3334 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
3335 by JMarc's picky compiler.
3337 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3340 * src/insets/insettabular.C (setPos): change for loop to not use
3341 sequencing operator. Please check this Jürgen.
3343 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3345 * src/insets/insetcite.C (getScreenLabel): ditto
3346 * src/support/filetools.C (QuoteName): ditto
3347 (ChangeExtension): ditto
3349 * src/BufferView_pimpl.C (scrollCB): make heigt int
3351 * src/BufferView2.C (insertInset): comment out unused arg
3353 * boost/Makefile.am (EXTRADIST): new variable
3355 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3357 * src/exporter.C (IsExportable): Fixed
3359 * lib/configure.m4: Small fix
3361 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3363 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3364 * src/insets/insetbib.C (bibitemWidest): ditto.
3365 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3367 2000-10-03 Juergen Vigna <jug@sad.it>
3369 * src/BufferView2.C (theLockingInset): removed const because of
3370 Agnus's compile problems.
3372 * src/insets/insettext.C (LocalDispatch): set the language of the
3373 surronding paragraph on inserting the first character.
3375 * various files: changed use of BufferView::the_locking_inset.
3377 * src/BufferView2.C (theLockingInset):
3378 (theLockingInset): new functions.
3380 * src/BufferView.h: removed the_locking_inset.
3382 * src/lyxtext.h: added the_locking_inset
3384 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3386 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3388 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3390 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3391 * src/mathed/math_cursor.C (IsAlpha): ditto.
3392 * src/mathed/math_inset.C (strnew): ditto.
3393 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3394 (IMetrics): cxp set but never used; removed.
3395 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3396 that the variable in question has been removed also!
3399 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3400 using the Buffer * passed to Latex(), using the BufferView * passed to
3401 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3403 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3404 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3406 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3407 * src/buffer.C (readInset): used new InsetBibtex c-tor
3408 * (getBibkeyList): used new InsetBibtex::getKeys
3410 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3413 * lib/build-listerrors
3415 * src/exporter.C: Add literate programming support to the export code
3418 * src/lyx_cb.C: Remove old literate code.
3420 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3423 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3424 * src/converter.C (View, Convert): Use QuoteName.
3426 * src/insets/figinset.C (Preview): Use Formats::View.
3428 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3430 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3432 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3433 the top of the function, because compaq cxx complains that the
3434 "goto exit_with_message" when the function is disabled bypasses
3436 (MenuNew): try a better fix for the generation of new file names.
3437 This time, I used AddName() instead of AddPath(), hoping Juergen
3440 2000-10-03 Allan Rae <rae@lyx.org>
3442 * src/frontends/xforms/forms/form_preferences.fd:
3443 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3444 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3445 "Look and Feel"->"General" but will need to be split up further into
3446 general output and general input tabs. Current plan is for four outer
3447 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3448 stuff; "Inputs" for input and import configuration; "Outputs" for
3449 output and export configuration; and one more whatever is left over
3450 called "General". The leftovers at present look like being which
3451 viewers to use, spellchecker, language support and might be better
3452 named "Support". I've put "Paths" in "Inputs" for the moment as this
3453 seems reasonable for now at least.
3454 One problem remains: X error kills LyX when you close Preferences.
3456 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3458 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3459 qualifier from form()
3460 * src/frontends/xforms/FormCitation.[Ch]:
3461 * src/frontends/xforms/FormCopyright.[Ch]:
3462 * src/frontends/xforms/FormDocument.[Ch]:
3463 * src/frontends/xforms/FormError.[Ch]:
3464 * src/frontends/xforms/FormIndex.[Ch]:
3465 * src/frontends/xforms/FormPreferences.[Ch]:
3466 * src/frontends/xforms/FormPrint.[Ch]:
3467 * src/frontends/xforms/FormRef.[Ch]:
3468 * src/frontends/xforms/FormToc.[Ch]:
3469 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3471 * src/frontends/xforms/FormCitation.[Ch]:
3472 * src/frontends/xforms/FormIndex.[Ch]:
3473 * src/frontends/xforms/FormRef.[Ch]:
3474 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3475 with Allan's naming policy
3477 * src/frontends/xforms/FormCitation.C: some static casts to remove
3480 2000-10-02 Juergen Vigna <jug@sad.it>
3482 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3483 now you can type or do stuff inside the table-cell also when in dummy
3484 position, fixed visible cursor.
3486 * src/insets/insettext.C (Edit): fixing cursor-view position.
3488 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3489 be used for equal functions in lyxfunc and insettext.
3491 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3493 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3495 * src/frontends/gnome/FormCitation.h:
3496 * src/frontends/gnome/FormCopyright.h:
3497 * src/frontends/gnome/FormIndex.h:
3498 * src/frontends/gnome/FormPrint.h:
3499 * src/frontends/gnome/FormToc.h:
3500 * src/frontends/gnome/FormUrl.h:
3501 * src/frontends/kde/FormCitation.h:
3502 * src/frontends/kde/FormCopyright.h:
3503 * src/frontends/kde/FormIndex.h:
3504 * src/frontends/kde/FormRef.h:
3505 * src/frontends/kde/FormToc.h:
3506 * src/frontends/kde/FormUrl.h: fix remaining users of
3509 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3511 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3512 from depth argument.
3513 (DocBookHandleCaption): ditto.
3514 (DocBookHandleFootnote): ditto.
3515 (SimpleDocBookOnePar): ditto.
3517 * src/frontends/xforms/FormDocument.h (form): remove extra
3518 FormDocument:: qualifier.
3520 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3522 * sigc++/handle.h: ditto.
3524 * src/lyx_gui_misc.C: add "using" directive.
3526 * src/cheaders/cstddef: new file, needed by the boost library (for
3529 2000-10-02 Juergen Vigna <jug@sad.it>
3531 * src/insets/insettext.C (SetFont): better support.
3533 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3535 * src/screen.C (DrawOneRow): some uint refixes!
3537 2000-10-02 Allan Rae <rae@lyx.org>
3539 * boost/.cvsignore: ignore Makefile as well
3541 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3542 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3544 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3545 Left this one out by accident.
3547 * src/frontends/xforms/FormBase.h (restore): default to calling
3548 update() since that will restore the original/currently-applied values.
3549 Any input() triggered error messages will require the derived classes
3550 to redefine restore().
3552 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3553 avoid a segfault. combo_doc_class is the main concern.
3555 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3557 * Simplify build-listerrors in view of GUI-less export ability!
3559 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3561 * src/lyx_main.C (easyParse): Disable gui when exporting
3563 * src/insets/figinset.C:
3566 * src/lyx_gui_misc.C
3567 * src/tabular.C: Changes to allow no-gui.
3569 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3571 * src/support/utility.hpp: removed file
3572 * src/support/block.h: removed file
3574 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3577 * src/mathed/formula.C: add support/lyxlib.h
3578 * src/mathed/formulamacro.C: ditto
3580 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3581 * src/lyxparagraph.h: ditto
3583 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3584 * src/frontends/Makefile.am (INCLUDES): ditto
3585 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3586 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3587 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3588 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3589 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3590 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3592 * src/BufferView.h: use boost/utility.hpp
3593 * src/LColor.h: ditto
3594 * src/LaTeX.h: ditto
3595 * src/LyXAction.h: ditto
3596 * src/LyXView.h: ditto
3597 * src/bufferlist.h: ditto
3598 * src/lastfiles.h: ditto
3599 * src/layout.h: ditto
3600 * src/lyx_gui.h: ditto
3601 * src/lyx_main.h: ditto
3602 * src/lyxlex.h: ditto
3603 * src/lyxrc.h: ditto
3604 * src/frontends/ButtonPolicies.h: ditto
3605 * src/frontends/Dialogs.h: ditto
3606 * src/frontends/xforms/FormBase.h: ditto
3607 * src/frontends/xforms/FormGraphics.h: ditto
3608 * src/frontends/xforms/FormParagraph.h: ditto
3609 * src/frontends/xforms/FormTabular.h: ditto
3610 * src/graphics/GraphicsCache.h: ditto
3611 * src/graphics/Renderer.h: ditto
3612 * src/insets/ExternalTemplate.h: ditto
3613 * src/insets/insetcommand.h: ditto
3614 * src/support/path.h: ditto
3616 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3617 and introduce clause for 2.97.
3619 * boost/libs/README: new file
3621 * boost/boost/utility.hpp: new file
3623 * boost/boost/config.hpp: new file
3625 * boost/boost/array.hpp: new file
3627 * boost/Makefile.am: new file
3629 * boost/.cvsignore: new file
3631 * configure.in (AC_OUTPUT): add boost/Makefile
3633 * Makefile.am (SUBDIRS): add boost
3635 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3637 * src/support/lstrings.C (suffixIs): Fixed.
3639 2000-10-01 Allan Rae <rae@lyx.org>
3641 * src/PrinterParams.h: moved things around to avoid the "can't
3642 inline call" warning.
3644 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3645 into doc++ documentation.
3647 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3649 * src/frontends/xforms/FormRef.C: make use of button controller
3650 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3651 cleaned up button controller usage.
3652 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3653 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3654 use the button controller
3656 * src/frontends/xforms/forms/*.fd: and associated generated files
3657 updated to reflect changes to FormBase. Some other FormXxxx files
3658 also got minor updates to reflect changes to FormBase.
3660 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3661 (hide): made virtual.
3662 (input): return a bool. true == valid input
3663 (RestoreCB, restore): new
3664 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3665 Changes to allow derived dialogs to use a ButtonController and
3666 make sense when doing so: OK button calls ok() and so on.
3668 * src/frontends/xforms/ButtonController.h (class ButtonController):
3669 Switch from template implementation to taking Policy parameter.
3670 Allows FormBase to provide a ButtonController for any dialog.
3672 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3673 Probably should rename connect and disconnect.
3674 (apply): use the radio button groups
3675 (form): needed by FormBase
3676 (build): setup the radio button groups
3678 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3680 * several files: type changes to reduce the number of warnings and
3681 to unify type hangling a bit. Still much to do.
3683 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3685 * lib/images/*: rename a bunch of icons to match Dekel converter
3688 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3691 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3693 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3695 * sigc++/handle.h: ditto for class Handle.
3697 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3699 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3701 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3703 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3704 removal of the "default" language.
3706 * src/combox.h (getline): Check that sel > 0
3708 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3710 * lib/examples/docbook_example.lyx
3711 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3713 * lib/layouts/docbook-book.layout: new docbook book layout.
3715 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3717 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3719 * src/insets/figinset.C (DocBook):fixed small typo.
3721 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3723 * src/insets/insetinclude.h: string include_label doesn't need to be
3726 2000-09-29 Allan Rae <rae@lyx.org>
3728 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3729 Allow derived type to control connection and disconnection from signals
3730 of its choice if desired.
3732 2000-09-28 Juergen Vigna <jug@sad.it>
3734 * src/insets/insettabular.C (update): fixed cursor setting when
3735 the_locking_inset changed.
3736 (draw): made this a bit cleaner.
3737 (InsetButtonPress): fixed!
3739 * various files: added LyXText Parameter to fitCursor call.
3741 * src/BufferView.C (fitCursor): added LyXText parameter.
3743 * src/insets/insettabular.C (draw): small draw fix.
3745 * src/tabular.C: right setting of left/right celllines.
3747 * src/tabular.[Ch]: fixed various types in funcions and structures.
3748 * src/insets/insettabular.C: ditto
3749 * src/frontends/xforms/FormTabular.C: ditto
3751 2000-09-28 Allan Rae <rae@lyx.org>
3753 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3754 that the #ifdef's had been applied to part of what should have been
3755 a complete condition. It's possible there are other tests that
3756 were specific to tables that are also wrong now that InsetTabular is
3757 being used. Now we need to fix the output of '\n' after a table in a
3758 float for the same reason as the original condition:
3759 "don't insert this if we would be adding it before or after a table
3760 in a float. This little trick is needed in order to allow use of
3761 tables in \subfigures or \subtables."
3762 Juergen can you check this?
3764 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3766 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3767 output to the ostream.
3769 * several files: fixed types based on warnings from cxx
3771 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3773 * src/frontends/kde/Makefile.am: fix rule for
3774 formindexdialogdata_moc.C
3776 * src/.cvsignore: add ext_l10n.h to ignore
3778 * acconfig.h: stop messing with __STRICT_ANSI__
3779 * config/gnome.m4: remove option to set -ansi
3780 * config/kde.m4: remove option to set -ansi
3781 * config/lyxinclude.m4: don't set -ansi
3783 2000-09-27 Juergen Vigna <jug@sad.it>
3785 * various files: remove "default" language check.
3787 * src/insets/insetquotes.C: removed use of current_view.
3789 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3790 the one should have red ears by now!
3792 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3793 in more then one paragraph. Fixed cursor-movement/selection.
3795 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3796 paragraphs inside a text inset.
3798 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3799 text-inset if this owner is an inset.
3801 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3803 * src/Bullet.h: changed type of font, character and size to int
3805 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3807 * src/insets/inseturl.[Ch]:
3808 * src/insets/insetref.[Ch]:
3809 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3811 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3813 * src/buffer.C (readFile): block-if statement rearranged to minimise
3814 bloat. Patch does not reverse Jean-Marc's change ;-)
3816 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3817 Class rewritten to store pointers to hide/update signals directly,
3818 rather than Dialogs *. Also defined an enum to ease use. All xforms
3819 forms can now be derived from this class.
3821 * src/frontends/xforms/FormCommand.[Ch]
3822 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3824 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3827 * src/frontends/xforms/forms/form_citation.fd
3828 * src/frontends/xforms/forms/form_copyright.fd
3829 * src/frontends/xforms/forms/form_error.fd
3830 * src/frontends/xforms/forms/form_index.fd
3831 * src/frontends/xforms/forms/form_ref.fd
3832 * src/frontends/xforms/forms/form_toc.fd
3833 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3835 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3837 * src/insets/insetfoot.C: removed redundent using directive.
3839 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3841 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3842 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3844 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3845 created in the constructors in different groups. Then set() just
3846 have to show the groups as needed. This fixes the redraw problems
3847 (and is how the old menu code worked).
3849 * src/support/lyxlib.h: declare the methods as static when we do
3850 not have namespaces.
3852 2000-09-26 Juergen Vigna <jug@sad.it>
3854 * src/buffer.C (asciiParagraph): new function.
3855 (writeFileAscii): new function with parameter ostream.
3856 (writeFileAscii): use now asciiParagraph.
3858 * various inset files: added the linelen parameter to the Ascii-func.
3860 * src/tabular.C (Write): fixed error in writing file introduced by
3861 the last changes from Lars.
3863 * lib/bind/menus.bind: removed not supported functions.
3865 * src/insets/insettext.C (Ascii): implemented this function.
3867 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3869 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3870 (Write): use of the write_attribute functions.
3872 * src/bufferlist.C (close): fixed reasking question!
3874 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3876 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3877 new files use the everwhere possible.
3880 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3881 src/log_form.C src/lyx.C:
3884 * src/buffer.C (runLaTeX): remove func
3886 * src/PaperLayout.C: removed file
3887 * src/ParagraphExtra.C: likewise
3888 * src/bullet_forms.C: likewise
3889 * src/bullet_forms.h: likewise
3890 * src/bullet_forms_cb.C: likewise
3892 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3893 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3896 * several files: remove all traces of the old fd_form_paragraph,
3897 and functions belonging to that.
3899 * several files: remove all traces of the old fd_form_document,
3900 and functions belonging to that.
3902 * several files: constify local variables were possible.
3904 * several files: remove all code that was dead when NEW_EXPORT was
3907 * several files: removed string::c_str in as many places as
3910 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3911 (e): be a bit more outspoken when patching
3912 (updatesrc): only move files if changed.
3914 * forms/layout_forms.h.patch: regenerated
3916 * forms/layout_forms.fd: remove form_document and form_paragraph
3917 and form_quotes and form_paper and form_table_options and
3918 form_paragraph_extra
3920 * forms/form1.fd: remove form_table
3922 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3923 the fdui->... rewrite. Update some comments to xforms 0.88
3925 * forms/bullet_forms.C.patch: removed file
3926 * forms/bullet_forms.fd: likewise
3927 * forms/bullet_forms.h.patch: likewise
3929 * development/Code_rules/Rules: added a section on switch
3930 statements. Updated some comment to xforms 0.88.
3932 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3934 * src/buffer.C (readFile): make sure that the whole version number
3935 is read after \lyxformat (even when it contains a comma)
3937 * lib/ui/default.ui: change shortcut of math menu to M-a.
3939 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3941 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3944 * src/LyXView.C (updateWindowTitle): show the full files name in
3945 window title, limited to 30 characters.
3947 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3948 When a number of characters has been given, we should not assume
3949 that the string is 0-terminated.
3951 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3952 calls (fixes some memory leaks)
3954 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3955 trans member on exit.
3957 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3959 * src/converter.C (GetReachable): fix typo.
3961 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3962 understand ',' instead of '.'.
3963 (GetInteger): rewrite to use strToInt().
3965 2000-09-26 Juergen Vigna <jug@sad.it>
3967 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3968 better visibility and error-message on wrong VSpace input.
3970 * src/language.C (initL): added english again.
3972 2000-09-25 Juergen Vigna <jug@sad.it>
3974 * src/frontends/kde/Dialogs.C (Dialogs):
3975 * src/frontends/gnome/Dialogs.C (Dialogs):
3976 * src/frontends/kde/Makefile.am:
3977 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3979 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3981 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3983 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3985 * src/frontends/xforms/FormParagraph.C:
3986 * src/frontends/xforms/FormParagraph.h:
3987 * src/frontends/xforms/form_paragraph.C:
3988 * src/frontends/xforms/form_paragraph.h:
3989 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3992 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3994 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3995 Paragraph-Data after use.
3997 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3998 non breakable paragraphs.
4000 2000-09-25 Garst R. Reese <reese@isn.net>
4002 * src/language.C (initL): added missing language_country codes.
4004 2000-09-25 Juergen Vigna <jug@sad.it>
4006 * src/insets/insettext.C (InsetText):
4007 (deleteLyXText): remove the not released LyXText structure!
4009 2000-09-24 Marko Vendelin <markov@ioc.ee>
4011 * src/frontends/gnome/mainapp.C
4012 * src/frontends/gnome/mainapp.h: added support for keyboard
4015 * src/frontends/gnome/FormCitation.C
4016 * src/frontends/gnome/FormCitation.h
4017 * src/frontends/gnome/Makefile.am
4018 * src/frontends/gnome/pixbutton.h: completed the rewrite of
4019 FormCitation to use "action area" in mainapp window
4021 * src/frontends/gnome/Menubar_pimpl.C
4022 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
4025 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
4027 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
4028 width/descent/ascent values if name is empty.
4029 (mathed_string_height): Use std::max.
4031 2000-09-25 Allan Rae <rae@lyx.org>
4033 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
4034 segfault. This will be completely redesigned soon.
4036 * sigc++: updated libsigc++. Fixes struct timespec bug.
4038 * development/tools/makeLyXsigc.sh: .cvsignore addition
4040 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
4042 * several files: removed almost all traces of the old table
4045 * src/TableLayout.C: removed file
4047 2000-09-22 Juergen Vigna <jug@sad.it>
4049 * src/frontends/kde/Dialogs.C: added credits forms.
4051 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
4053 * src/frontends/gnome/Dialogs.C: added some forms.
4055 * src/spellchecker.C (init_spell_checker): set language in pspell code
4056 (RunSpellChecker): some modifications for setting language string.
4058 * src/language.[Ch]: added language_country code.
4060 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
4062 * src/frontends/Dialogs.h: added new signal showError.
4063 Rearranged existing signals in some sort of alphabetical order.
4065 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
4066 FormError.[Ch], form_error.[Ch]
4067 * src/frontends/xforms/forms/makefile: added new file form_error.fd
4068 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
4070 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
4071 dialogs. I think that this can be used as the base to all these
4074 * src/frontends/xforms/FormError.[Ch]
4075 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
4076 implementation of InsetError dialog.
4078 * src/insets/inseterror.[Ch]: rendered GUI-independent.
4080 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
4081 * src/frontends/kde/Makefile.am: ditto
4083 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
4085 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
4086 macrobf. This fixes a bug of invisible text.
4088 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4090 * lib/doc/LaTeXConfig.lyx.in: updated.
4092 * src/language.C (initL): remove language "francais" and change a
4093 bit the names of the two other french variations.
4095 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
4096 string that may not be 0-terminated.
4098 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4100 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
4102 2000-09-20 Marko Vendelin <markov@ioc.ee>
4104 * src/frontends/gnome/FormCitation.C
4105 * src/frontends/gnome/FormIndex.C
4106 * src/frontends/gnome/FormToc.C
4107 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
4108 the variable initialization to shut up the warnings
4110 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4112 * src/table.[Ch]: deleted files
4114 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
4117 2000-09-18 Juergen Vigna <jug@sad.it>
4119 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
4120 problems with selection. Inserted new LFUN_PASTESELECTION.
4121 (InsetButtonPress): inserted handling of middle mouse-button paste.
4123 * src/spellchecker.C: changed word to word.c_str().
4125 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
4127 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
4128 included in the ``make dist'' tarball.
4130 2000-09-15 Juergen Vigna <jug@sad.it>
4132 * src/CutAndPaste.C (cutSelection): small fix return the right
4133 end position after cut inside one paragraph only.
4135 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
4136 we are locked as otherwise we don't have a valid cursor position!
4138 * src/insets/figinset.C (draw): small bugfix but why is this needed???
4140 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
4142 * src/frontends/kde/FormRef.C: added using directive.
4143 * src/frontends/kde/FormToc.C: ditto
4145 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
4147 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
4149 2000-09-19 Marko Vendelin <markov@ioc.ee>
4151 * src/frontends/gnome/Menubar_pimpl.C
4152 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
4153 Toc, ViewFormats, UpdateFormats, and ExportFormats.
4155 * src/frontends/gnome/mainapp.C
4156 * src/frontends/gnome/mainapp.h: support for menu update used
4159 * src/frontends/gnome/mainapp.C
4160 * src/frontends/gnome/mainapp.h: support for "action" area in the
4161 main window. This area is used by small simple dialogs, such as
4164 * src/frontends/gnome/FormIndex.C
4165 * src/frontends/gnome/FormIndex.h
4166 * src/frontends/gnome/FormUrl.C
4167 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
4170 * src/frontends/gnome/FormCitation.C
4171 * src/frontends/gnome/FormCitation.h: rewrite to use main window
4172 action area. Only "Insert new citation" is implemented.
4174 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4176 * src/buffer.C (Dispatch): fix call to Dispatch
4177 * src/insets/insetref.C (Edit): likewise
4178 * src/insets/insetparent.C (Edit): likewise
4179 * src/insets/insetinclude.C (include_cb): likewise
4180 * src/frontends/xforms/FormUrl.C (apply): likewise
4181 * src/frontends/xforms/FormToc.C (apply): likewise
4182 * src/frontends/xforms/FormRef.C (apply): likewise
4183 * src/frontends/xforms/FormIndex.C (apply): likewise
4184 * src/frontends/xforms/FormCitation.C (apply): likewise
4185 * src/lyxserver.C (callback): likewise
4186 * src/lyxfunc.C (processKeySym): likewise
4187 (Dispatch): likewise
4188 (Dispatch): likewise
4189 * src/lyx_cb.C (LayoutsCB): likewise
4191 * Makefile.am (sourcedoc): small change
4193 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4195 * src/main.C (main): Don't make an empty GUIRunTime object. all
4196 methods are static. constify a bit remove unneded using + headers.
4198 * src/tabular.C: some more const to local vars move some loop vars
4200 * src/spellchecker.C: added some c_str after some word for pspell
4202 * src/frontends/GUIRunTime.h: add new static method setDefaults
4203 * src/frontends/xforms/GUIRunTime.C (setDefaults):
4204 * src/frontends/kde/GUIRunTime.C (setDefaults):
4205 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
4207 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
4208 with strnew in arg, use correct emptystring when calling SetName.
4210 * several files: remove all commented code with relation to
4211 HAVE_SSTREAM beeing false. We now only support stringstream and
4214 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4216 * src/lyxfunc.C: construct correctly the automatic new file
4219 * src/text2.C (IsStringInText): change type of variable i to shut
4222 * src/support/sstream.h: do not use namespaces if the compiler
4223 does not support them.
4225 2000-09-15 Marko Vendelin <markov@ioc.ee>
4226 * src/frontends/gnome/FormCitation.C
4227 * src/frontends/gnome/FormCitation.h
4228 * src/frontends/gnome/diainsertcitation_interface.c
4229 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
4230 regexp support to FormCitation [Gnome].
4232 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
4235 * configure.in: remove unused KDE/GTKGUI define
4237 * src/frontends/kde/FormRef.C
4238 * src/frontends/kde/FormRef.h
4239 * src/frontends/kde/formrefdialog.C
4240 * src/frontends/kde/formrefdialog.h: double click will
4241 go to reference, now it is possible to change a cross-ref
4244 * src/frontends/kde/FormToc.C
4245 * src/frontends/kde/FormToc.h
4246 * src/frontends/kde/formtocdialog.C
4247 * src/frontends/kde/formtocdialog.h: add a depth
4250 * src/frontends/kde/Makefile.am: add QtLyXView.h
4253 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
4255 * src/frontends/kde/FormCitation.h: added some using directives.
4257 * src/frontends/kde/FormToc.h: corrected definition of doTree.
4259 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
4262 * src/mathed/math_defs.h: redefine SetAlign to use string rather
4265 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4267 * src/buffer.C (pop_tag): revert for the second time a change by
4268 Lars, who seems to really hate having non-local loop variables :)
4270 * src/Lsstream.h: add "using" statements.
4272 * src/support/copy.C (copy): add a bunch of std:: qualifiers
4273 * src/buffer.C (writeFile): ditto
4275 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4277 * src/buffer.C (writeFile): try to fix the locale modified format
4278 number to always be as we want it.
4280 * src/WorkArea.C (work_area_handler): try to workaround the bugs
4281 in XForms 0.89. C-space is now working again.
4283 * src/Lsstream.h src/support/sstream.h: new files.
4285 * also commented out all cases where strstream were used.
4287 * src/Bullet.h (c_str): remove method.
4289 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
4291 * a lot of files: get rid of "char const *" and "char *" is as
4292 many places as possible. We only want to use them in interaction
4293 with system of other libraries, not inside lyx.
4295 * a lot of files: return const object is not of pod type. This
4296 helps ensure that temporary objects is not modified. And fits well
4297 with "programming by contract".
4299 * configure.in: check for the locale header too
4301 * Makefile.am (sourcedoc): new tag for generation of doc++
4304 2000-09-14 Juergen Vigna <jug@sad.it>
4306 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
4307 callback to check which combo called it and do the right action.
4309 * src/combox.C (combo_cb): added combo * to the callbacks.
4310 (Hide): moved call of callback after Ungrab of the pointer.
4312 * src/intl.h: removed LCombo2 function.
4314 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
4315 function as this can now be handled in one function.
4317 * src/combox.h: added Combox * to callback prototype.
4319 * src/frontends/xforms/Toolbar_pimpl.C:
4320 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
4322 2000-09-14 Garst Reese <reese@isn.net>
4324 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
4325 moved usepackage{xxx}'s to beginning of file. Changed left margin
4326 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
4327 underlining from title. Thanks to John Culleton for useful suggestions.
4329 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4331 * src/lyxlex_pimpl.C (setFile): change error message to debug
4334 2000-09-13 Juergen Vigna <jug@sad.it>
4336 * src/frontends/xforms/FormDocument.C: implemented choice_class
4337 as combox and give callback to combo_language so OK/Apply is activated
4340 * src/bufferlist.C (newFile): small fix so already named files
4341 (via an open call) are not requested to be named again on the
4344 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4346 * src/frontends/kde/Makefile.am
4347 * src/frontends/kde/FormRef.C
4348 * src/frontends/kde/FormRef.h
4349 * src/frontends/kde/formrefdialog.C
4350 * src/frontends/kde/formrefdialog.h: implement
4353 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4355 * src/frontends/kde/formtocdialog.C
4356 * src/frontends/kde/formtocdialog.h
4357 * src/frontends/kde/FormToc.C
4358 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4360 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4362 * src/frontends/kde/FormCitation.C: fix thinko
4363 where we didn't always display the reference text
4366 * src/frontends/kde/formurldialog.C
4367 * src/frontends/kde/formurldialog.h
4368 * src/frontends/kde/FormUrl.C
4369 * src/frontends/kde/FormUrl.h: minor cleanups
4371 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4373 * src/frontends/kde/Makefile.am
4374 * src/frontends/kde/FormToc.C
4375 * src/frontends/kde/FormToc.h
4376 * src/frontends/kde/FormCitation.C
4377 * src/frontends/kde/FormCitation.h
4378 * src/frontends/kde/FormIndex.C
4379 * src/frontends/kde/FormIndex.h
4380 * src/frontends/kde/formtocdialog.C
4381 * src/frontends/kde/formtocdialog.h
4382 * src/frontends/kde/formcitationdialog.C
4383 * src/frontends/kde/formcitationdialog.h
4384 * src/frontends/kde/formindexdialog.C
4385 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4387 2000-09-12 Juergen Vigna <jug@sad.it>
4389 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4392 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4394 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4397 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4399 * src/converter.C (Add, Convert): Added support for converter flags:
4400 needaux, resultdir, resultfile.
4401 (Convert): Added new parameter view_file.
4402 (dvips_options): Fixed letter paper option.
4404 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4405 (Export, GetExportableFormats, GetViewableFormats): Added support
4408 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4410 (easyParse): Fixed to work with new export code.
4412 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4415 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4417 * lib/bind/*.bind: Replaced
4418 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4419 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4421 2000-09-11 Juergen Vigna <jug@sad.it>
4423 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4425 * src/main.C (main): now GUII defines global guiruntime!
4427 * src/frontends/gnome/GUIRunTime.C (initApplication):
4428 * src/frontends/kde/GUIRunTime.C (initApplication):
4429 * src/frontends/xforms/GUIRunTime.C (initApplication):
4430 * src/frontends/GUIRunTime.h: added new function initApplication.
4432 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4434 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4436 2000-09-08 Juergen Vigna <jug@sad.it>
4438 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4439 we have already "Reset".
4441 * src/language.C (initL): inserted "default" language and made this
4442 THE default language (and not american!)
4444 * src/paragraph.C: inserted handling of "default" language!
4446 * src/lyxfont.C: ditto
4450 * src/paragraph.C: output the \\par only if we have a following
4451 paragraph otherwise it's not needed.
4453 2000-09-05 Juergen Vigna <jug@sad.it>
4455 * config/pspell.m4: added entry to lyx-flags
4457 * src/spellchecker.C: modified version from Kevin for using pspell
4459 2000-09-01 Marko Vendelin <markov@ioc.ee>
4460 * src/frontends/gnome/Makefile.am
4461 * src/frontends/gnome/FormCitation.C
4462 * src/frontends/gnome/FormCitation.h
4463 * src/frontends/gnome/diainsertcitation_callbacks.c
4464 * src/frontends/gnome/diainsertcitation_callbacks.h
4465 * src/frontends/gnome/diainsertcitation_interface.c
4466 * src/frontends/gnome/diainsertcitation_interface.h
4467 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4468 dialog for Gnome frontend
4470 * src/main.C: Gnome libraries require keeping application name
4471 and its version as strings
4473 * src/frontends/gnome/mainapp.C: Change the name of the main window
4474 from GnomeLyX to PACKAGE
4476 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4478 * src/frontends/Liason.C: add "using: declaration.
4480 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4482 * src/mathed/math_macro.C (Metrics): Set the size of the template
4484 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4486 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4488 * src/converter.C (add_options): New function.
4489 (SetViewer): Change $$FName into '$$FName'.
4490 (View): Add options when running xdvi
4491 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4492 (Convert): The 3rd parameter is now the desired filename. Converts
4493 calls to lyx::rename if necessary.
4494 Add options when running dvips.
4495 (dvi_papersize,dvips_options): New methods.
4497 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4499 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4500 using a call to Converter::dvips_options.
4501 Fixed to work with nex export code.
4503 * src/support/copy.C
4504 * src/support/rename.C: New files
4506 * src/support/syscall.h
4507 * src/support/syscall.C: Added Starttype SystemDontWait.
4509 * lib/ui/default.ui: Changed to work with new export code
4511 * lib/configure.m4: Changed to work with new export code
4513 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4515 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4517 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4518 so that code compiles with DEC cxx.
4520 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4521 to work correctly! Also now supports the additional elements
4524 2000-09-01 Allan Rae <rae@lyx.org>
4526 * src/frontends/ButtonPolicies.C: renamed all the references to
4527 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4529 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4530 since it's a const not a type.
4532 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4534 2000-08-31 Juergen Vigna <jug@sad.it>
4536 * src/insets/figinset.C: Various changes to look if the filename has
4537 an extension and if not add it for inline previewing.
4539 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4541 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4542 make buttonStatus and isReadOnly be const methods. (also reflect
4543 this in derived classes.)
4545 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4546 (nextState): change to be static inline, pass the StateMachine as
4548 (PreferencesPolicy): remove casts
4549 (OkCancelPolicy): remvoe casts
4550 (OkCancelReadOnlyPolicy): remove casts
4551 (NoRepeatedApplyReadOnlyPolicy): remove casts
4552 (OkApplyCancelReadOnlyPolicy): remove casts
4553 (OkApplyCancelPolicy): remove casts
4554 (NoRepeatedApplyPolicy): remove casts
4556 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4558 * src/converter.C: added some using directives
4560 * src/frontends/ButtonPolicies.C: changes to overcome
4561 "need lvalue" error with DEC c++
4563 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4564 to WMHideCB for DEC c++
4566 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4568 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4569 to BulletBMTableCB for DEC c++
4571 2000-08-31 Allan Rae <rae@lyx.org>
4573 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4574 character dialog separately from old document dialogs combo_language.
4577 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4579 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4580 Removed LFUN_REF_CREATE.
4582 * src/MenuBackend.C: Added new tags: toc and references
4584 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4585 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4587 (add_toc, add_references): New methods.
4588 (create_submenu): Handle correctly the case when there is a
4589 seperator after optional menu items.
4591 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4592 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4593 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4595 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4597 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4599 * src/converter.[Ch]: New file for converting between different
4602 * src/export.[Ch]: New file for exporting a LyX file to different
4605 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4606 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4607 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4608 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4609 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4610 RunDocBook, MenuExport.
4612 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4613 Exporter::Preview methods if NEW_EXPORT is defined.
4615 * src/buffer.C (Dispatch): Use Exporter::Export.
4617 * src/lyxrc.C: Added new tags: \converter and \viewer.
4620 * src/LyXAction.C: Define new lyx-function: buffer-update.
4621 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4622 when NEW_EXPORT is defined.
4624 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4626 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4628 * lib/ui/default.ui: Added submenus "view" and "update" to the
4631 * src/filetools.C (GetExtension): New function.
4633 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4635 2000-08-29 Allan Rae <rae@lyx.org>
4637 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4639 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4640 (EnableDocumentLayout): removed
4641 (DisableDocumentLayout): removed
4642 (build): make use of ButtonController's read-only handling to
4643 de/activate various objects. Replaces both of the above functions.
4645 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4646 (readOnly): was read_only
4647 (refresh): fixed dumb mistakes with read_only_ handling
4649 * src/frontends/xforms/forms/form_document.fd:
4650 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4651 tabbed dialogs so the tabs look more like tabs and so its easier to
4652 work out which is the current tab.
4654 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4655 segfault with form_table
4657 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4659 2000-08-28 Juergen Vigna <jug@sad.it>
4661 * acconfig.h: added USE_PSPELL.
4663 * src/config.h.in: added USE_PSPELL.
4665 * autogen.sh: added pspell.m4
4667 * config/pspell.m4: new file.
4669 * src/spellchecker.C: implemented support for pspell libary.
4671 2000-08-25 Juergen Vigna <jug@sad.it>
4673 * src/LyXAction.C (init): renamed LFUN_TABLE to
4674 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4676 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4678 * src/lyxscreen.h: add force_clear variable and fuction to force
4679 a clear area when redrawing in LyXText.
4681 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4683 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4685 * some whitespace and comment changes.
4687 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4689 * src/buffer.C: up te LYX_FORMAT to 2.17
4691 2000-08-23 Juergen Vigna <jug@sad.it>
4693 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4696 * src/insets/insettabular.C (pasteSelection): delete the insets
4697 LyXText as it is not valid anymore.
4698 (copySelection): new function.
4699 (pasteSelection): new function.
4700 (cutSelection): new function.
4701 (LocalDispatch): implemented cut/copy/paste of cell selections.
4703 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4704 don't have a LyXText.
4706 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4708 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4711 2000-08-22 Juergen Vigna <jug@sad.it>
4713 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4714 ifdef form_table out if NEW_TABULAR.
4716 2000-08-21 Juergen Vigna <jug@sad.it>
4718 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4719 (draw): fixed draw position so that the cursor is positioned in the
4721 (InsetMotionNotify): hide/show cursor so the position is updated.
4722 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4723 using cellstart() function where it should be used.
4725 * src/insets/insettext.C (draw): ditto.
4727 * src/tabular.C: fixed initialization of some missing variables and
4728 made BoxType into an enum.
4730 2000-08-22 Marko Vendelin <markov@ioc.ee>
4731 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4732 stock menu item using action numerical value, not its string
4736 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4738 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4739 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4741 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4743 * src/frontends/xforms/GUIRunTime.C: new file
4745 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4746 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4748 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4750 * src/frontends/kde/GUIRunTime.C: new file
4752 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4753 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4755 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4757 * src/frontends/gnome/GUIRunTime.C: new file
4759 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4762 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4763 small change to documetentation.
4765 * src/frontends/GUIRunTime.C: removed file
4767 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4769 * src/lyxparagraph.h: enable NEW_TABULAR as default
4771 * src/lyxfunc.C (processKeySym): remove some commented code
4773 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4774 NEW_TABULAR around the fd_form_table_options.
4776 * src/lyx_gui.C (runTime): call the static member function as
4777 GUIRunTime::runTime().
4779 2000-08-21 Allan Rae <rae@lyx.org>
4781 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4784 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4786 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4788 2000-08-21 Allan Rae <rae@lyx.org>
4790 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4791 keep Garst happy ;-)
4792 * src/frontends/xforms/FormPreferences.C (build): use setOK
4793 * src/frontends/xforms/FormDocument.C (build): use setOK
4794 (FormDocument): use the appropriate policy.
4796 2000-08-21 Allan Rae <rae@lyx.org>
4798 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4799 automatic [de]activation of arbitrary objects when in a read-only state.
4801 * src/frontends/ButtonPolicies.h: More documentation
4802 (isReadOnly): added to support the above.
4804 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4806 2000-08-18 Juergen Vigna <jug@sad.it>
4808 * src/insets/insettabular.C (getStatus): changed to return func_status.
4810 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4811 display toggle menu entries if they are.
4813 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4814 new document layout now.
4816 * src/lyxfunc.C: ditto
4818 * src/lyx_gui_misc.C: ditto
4820 * src/lyx_gui.C: ditto
4822 * lib/ui/default.ui: removed paper and quotes layout as they are now
4823 all in the document layout tabbed folder.
4825 * src/frontends/xforms/forms/form_document.fd: added Restore
4826 button and callbacks for all inputs for Allan's ButtonPolicy.
4828 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4829 (CheckChoiceClass): added missing params setting on class change.
4830 (UpdateLayoutDocument): added for updating the layout on params.
4831 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4832 (FormDocument): Implemented Allan's ButtonPolicy with the
4835 2000-08-17 Allan Rae <rae@lyx.org>
4837 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4838 so we can at least see the credits again.
4840 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4841 controller calls for the appropriate callbacks. Note that since Ok
4842 calls apply followed by cancel, and apply isn't a valid input for the
4843 APPLIED state, the bc_ calls have to be made in the static callback not
4844 within each of the real callbacks.
4846 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4847 (setOk): renamed from setOkay()
4849 2000-08-17 Juergen Vigna <jug@sad.it>
4851 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4852 in the implementation part.
4853 (composeUIInfo): don't show optional menu-items.
4855 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4857 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4859 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4860 text-state when in a text-inset.
4862 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4864 2000-08-17 Marko Vendelin <markov@ioc.ee>
4865 * src/frontends/gnome/FormIndex.C
4866 * src/frontends/gnome/FormIndex.h
4867 * src/frontends/gnome/FormToc.C
4868 * src/frontends/gnome/FormToc.h
4869 * src/frontends/gnome/dialogs
4870 * src/frontends/gnome/diatoc_callbacks.c
4871 * src/frontends/gnome/diatoc_callbacks.h
4872 * src/frontends/gnome/diainsertindex_callbacks.h
4873 * src/frontends/gnome/diainsertindex_callbacks.c
4874 * src/frontends/gnome/diainsertindex_interface.c
4875 * src/frontends/gnome/diainsertindex_interface.h
4876 * src/frontends/gnome/diatoc_interface.h
4877 * src/frontends/gnome/diatoc_interface.c
4878 * src/frontends/gnome/Makefile.am: Table of Contents and
4879 Insert Index dialogs implementation for Gnome frontend
4881 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4883 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4885 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4888 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4890 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4891 destructor. Don't definde if you don't need it
4892 (processEvents): made static, non-blocking events processing for
4894 (runTime): static method. event loop for xforms
4895 * similar as above for kde and gnome.
4897 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4898 new Pimpl is correct
4899 (runTime): new method calss the real frontends runtime func.
4901 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4903 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4905 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4907 2000-08-16 Juergen Vigna <jug@sad.it>
4909 * src/lyx_gui.C (runTime): added GUII RunTime support.
4911 * src/frontends/Makefile.am:
4912 * src/frontends/GUIRunTime.[Ch]:
4913 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4914 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4915 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4917 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4919 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4920 as this is already set in ${FRONTEND_INCLUDE} if needed.
4922 * configure.in (CPPFLAGS): setting the include dir for the frontend
4923 directory and don't set FRONTEND=xforms for now as this is executed
4926 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4928 * src/frontends/kde/Makefile.am:
4929 * src/frontends/kde/FormUrl.C:
4930 * src/frontends/kde/FormUrl.h:
4931 * src/frontends/kde/formurldialog.h:
4932 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4934 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4936 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4938 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4940 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4943 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4945 * src/WorkArea.C (work_area_handler): more work to get te
4946 FL_KEYBOARD to work with xforms 0.88 too, please test.
4948 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4950 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4952 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4955 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4957 * src/Timeout.h: remove Qt::emit hack.
4959 * several files: changes to allo doc++ compilation
4961 * src/lyxfunc.C (processKeySym): new method
4962 (processKeyEvent): comment out if FL_REVISION < 89
4964 * src/WorkArea.C: change some debugging levels.
4965 (WorkArea): set wantkey to FL_KEY_ALL
4966 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4967 clearer code and the use of compose with XForms 0.89. Change to
4968 use signals instead of calling methods in bufferview directly.
4970 * src/Painter.C: change some debugging levels.
4972 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4975 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4976 (workAreaKeyPress): new method
4978 2000-08-14 Juergen Vigna <jug@sad.it>
4980 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4982 * config/kde.m4: addes some features
4984 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4985 include missing xforms dialogs.
4987 * src/Timeout.h: a hack to be able to compile with qt/kde.
4989 * sigc++/.cvsignore: added acinclude.m4
4991 * lib/.cvsignore: added listerros
4993 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4994 xforms tree as objects are needed for other frontends.
4996 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4997 linking with not yet implemented xforms objects.
4999 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
5001 2000-08-14 Baruch Even <baruch.even@writeme.com>
5003 * src/frontends/xforms/FormGraphics.h:
5004 * src/frontends/xforms/FormGraphics.C:
5005 * src/frontends/xforms/RadioButtonGroup.h:
5006 * src/frontends/xforms/RadioButtonGroup.C:
5007 * src/insets/insetgraphics.h:
5008 * src/insets/insetgraphics.C:
5009 * src/insets/insetgraphicsParams.h:
5010 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
5011 instead of spaces, and various other indentation issues to make the
5012 sources more consistent.
5014 2000-08-14 Marko Vendelin <markov@ioc.ee>
5016 * src/frontends/gnome/dialogs/diaprint.glade
5017 * src/frontends/gnome/FormPrint.C
5018 * src/frontends/gnome/FormPrint.h
5019 * src/frontends/gnome/diaprint_callbacks.c
5020 * src/frontends/gnome/diaprint_callbacks.h
5021 * src/frontends/gnome/diaprint_interface.c
5022 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
5025 * src/frontends/gnome/dialogs/diainserturl.glade
5026 * src/frontends/gnome/FormUrl.C
5027 * src/frontends/gnome/FormUrl.h
5028 * src/frontends/gnome/diainserturl_callbacks.c
5029 * src/frontends/gnome/diainserturl_callbacks.h
5030 * src/frontends/gnome/diainserturl_interface.c
5031 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
5032 Gnome implementation
5034 * src/frontends/gnome/Dialogs.C
5035 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
5036 all other dialogs. Copy all unimplemented dialogs from Xforms
5039 * src/frontends/gnome/support.c
5040 * src/frontends/gnome/support.h: support files generated by Glade
5044 * config/gnome.m4: Gnome configuration scripts
5046 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
5047 configure --help message
5049 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
5050 only if there are no events pendling in Gnome/Gtk. This enhances
5051 the performance of menus.
5054 2000-08-14 Allan Rae <rae@lyx.org>
5056 * lib/Makefile.am: listerrors cleaning
5058 * lib/listerrors: removed -- generated file
5059 * acinclude.m4: ditto
5060 * sigc++/acinclude.m4: ditto
5062 * src/frontends/xforms/forms/form_citation.fd:
5063 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
5066 * src/frontends/xforms/forms/makefile: I renamed the `install` target
5067 `updatesrc` and now we have a `test` target that does what `updatesrc`
5068 used to do. I didn't like having an install target that wasn't related
5071 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
5072 on all except FormGraphics. This may yet happen. Followed by a major
5073 cleanup including using FL_TRANSIENT for most of the dialogs. More
5074 changes to come when the ButtonController below is introduced.
5076 * src/frontends/xforms/ButtonController.h: New file for managing up to
5077 four buttons on a dialog according to an externally defined policy.
5078 * src/frontends/xforms/Makefile.am: added above
5080 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
5081 Apply and Cancel/Close buttons and everything in between and beyond.
5082 * src/frontends/Makefile.am: added above.
5084 * src/frontends/xforms/forms/form_preferences.fd:
5085 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
5086 and removed variable 'status' as a result. Fixed the set_minsize thing.
5087 Use the new screen-font-update after checking screen fonts were changed
5088 Added a "Restore" button to restore the original lyxrc values while
5089 editing. This restores everything not just the last input changed.
5090 That's still a tricky one. As is the "LyX: this shouldn't happen..."
5092 * src/LyXAction.C: screen-font-update added for updating buffers after
5093 screen font settings have been changed.
5094 * src/commandtags.h: ditto
5095 * src/lyxfunc.C: ditto
5097 * forms/lyx.fd: removed screen fonts dialog.
5098 * src/lyx_gui.C: ditto
5099 * src/menus.[Ch]: ditto
5100 * src/lyx.[Ch]: ditto
5101 * src/lyx_cb.C: ditto + code from here moved to make
5102 screen-font-update. And people wonder why progress on GUII is
5103 slow. Look at how scattered this stuff was! It takes forever
5106 * forms/fdfix.sh: Fixup the spacing after commas.
5107 * forms/makefile: Remove date from generated files. Fewer clashes now.
5108 * forms/bullet_forms.C.patch: included someones handwritten changes
5110 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
5111 once I've discovered why LyXRC was made noncopyable.
5112 * src/lyx_main.C: ditto
5114 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
5116 * src/frontends/xforms/forms/fdfix.sh:
5117 * src/frontends/xforms/forms/fdfixh.sed:
5118 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
5119 * src/frontends/xforms/Form*.[hC]:
5120 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
5121 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
5122 provide a destructor for the struct FD_form_xxxx. Another version of
5123 the set_[max|min]size workaround and a few other cleanups. Actually,
5124 Angus' patch from 20000809.
5126 2000-08-13 Baruch Even <baruch.even@writeme.com>
5128 * src/insets/insetgraphics.C (Clone): Added several fields that needed
5131 2000-08-11 Juergen Vigna <jug@sad.it>
5133 * src/insets/insetgraphics.C (InsetGraphics): changing init
5134 order because of warnings.
5136 * src/frontends/xforms/forms/makefile: adding patching .C with
5139 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
5140 from .C.patch to .c.patch
5142 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
5143 order because of warning.
5145 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
5147 * src/frontends/Liason.C (setMinibuffer): new helper function
5149 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
5151 * src/lyxfunc.C (Dispatch): calling new Document-Layout
5153 * lib/ui/default.ui: commented out PaperLayout entry
5155 * src/frontends/xforms/form_document.[Ch]: new added files
5157 * src/frontends/xforms/FormDocument.[Ch]: ditto
5159 * src/frontends/xforms/forms/form_document.fd: ditto
5161 * src/frontends/xforms/forms/form_document.C.patch: ditto
5163 2000-08-10 Juergen Vigna <jug@sad.it>
5165 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
5166 (InsetGraphics): initialized cacheHandle to 0.
5167 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
5169 2000-08-10 Baruch Even <baruch.even@writeme.com>
5171 * src/graphics/GraphicsCache.h:
5172 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
5173 correctly as a cache.
5175 * src/graphics/GraphicsCacheItem.h:
5176 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
5179 * src/graphics/GraphicsCacheItem_pimpl.h:
5180 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
5183 * src/insets/insetgraphics.h:
5184 * src/insets/insetgraphics.C: Changed from using a signal notification
5185 to polling when image is not loaded.
5187 2000-08-10 Allan Rae <rae@lyx.org>
5189 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
5190 that there are two functions that have to been taken out of line by
5191 hand and aren't taken care of in the script. (Just a reminder note)
5193 * sigc++/macros/*.h.m4: Updated as above.
5195 2000-08-09 Juergen Vigna <jug@sad.it>
5197 * src/insets/insettext.C (draw): small fix for clearing rectangle.
5199 * src/insets/insettabular.C: make drawing of single cell smarter.
5201 2000-08-09 Marko Vendelin <markov@ioc.ee>
5202 * src/frontends/gnome/Menubar_pimpl.C
5203 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
5204 implementation: new files
5206 * src/frontends/gnome/mainapp.C
5207 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
5210 * src/main.C: create Gnome main window
5212 * src/frontends/xforms/Menubar_pimpl.h
5213 * src/frontends/Menubar.C
5214 * src/frontends/Menubar.h: added method Menubar::update that calls
5215 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
5217 * src/LyXView.C: calls Menubar::update to update the state
5220 * src/frontends/gnome/Makefile.am: added new files
5222 * src/frontends/Makefile.am: added frontend compiler options
5224 2000-08-08 Juergen Vigna <jug@sad.it>
5226 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
5228 * src/bufferlist.C (close):
5229 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
5230 documents if exiting without saving.
5232 * src/buffer.C (save): use removeAutosaveFile()
5234 * src/support/filetools.C (removeAutosaveFile): new function.
5236 * src/lyx_cb.C (MenuWrite): returns a bool now.
5237 (MenuWriteAs): check if file could really be saved and revert to the
5239 (MenuWriteAs): removing old autosavefile if existant.
5241 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
5242 before Goto toggle declaration, because of compiler warning.
5244 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
5246 * src/lyxfunc.C (MenuNew): small fix.
5248 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
5250 * src/bufferlist.C (newFile):
5251 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
5253 * src/lyxrc.C: added new_ask_filename tag
5255 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
5257 * src/lyx.fd: removed code pertaining to form_ref
5258 * src/lyx.[Ch]: ditto
5259 * src/lyx_cb.C: ditto
5260 * src/lyx_gui.C: ditto
5261 * src/lyx_gui_misc.C: ditto
5263 * src/BufferView_pimpl.C (restorePosition): update buffer only
5266 * src/commandtags.h (LFUN_REFTOGGLE): removed
5267 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
5268 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
5269 (LFUN_REFBACK): renamed LFUN_REF_BACK
5271 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
5272 * src/menus.C: ditto
5273 * src/lyxfunc.C (Dispatch): ditto.
5274 InsertRef dialog is now GUI-independent.
5276 * src/texrow.C: added using std::endl;
5278 * src/insets/insetref.[Ch]: strip out large amounts of code.
5279 The inset is now a container and this functionality is now
5280 managed by a new FormRef dialog
5282 * src/frontends/Dialogs.h (showRef, createRef): new signals
5284 * src/frontends/xforms/FormIndex.[Ch],
5285 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
5286 when setting dialog's min/max size
5287 * src/frontends/xforms/FormIndex.[Ch]: ditto
5289 * src/frontends/xforms/FormRef.[Ch],
5290 src/frontends/xforms/forms/form_ref.fd: new xforms
5291 implementation of an InsetRef dialog
5293 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
5296 * src/graphics/XPM_Renderer.C (isImageFormatOK):
5297 ios::nocreate is not part of the standard. Removed.
5299 2000-08-07 Baruch Even <baruch.even@writeme.com>
5301 * src/graphics/Renderer.h:
5302 * src/graphics/Renderer.C: Added base class for rendering of different
5303 image formats into Pixmaps.
5305 * src/graphics/XPM_Renderer.h:
5306 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
5307 in a different class.
5309 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
5310 easily add support for other formats.
5312 * src/insets/figinset.C: plugged a leak of an X resource.
5314 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5316 * src/CutAndPaste.[Ch]: make all metods static.
5318 * development/Code_rules/Rules: more work, added section on
5319 Exceptions, and a References section.
5321 * a lot of header files: work to make doc++ able to generate the
5322 source documentation, some workarounds of doc++ problems. Doc++ is
5323 now able to generate the documentation.
5325 2000-08-07 Juergen Vigna <jug@sad.it>
5327 * src/insets/insettabular.C (recomputeTextInsets): removed function
5329 * src/tabular.C (SetWidthOfMulticolCell):
5331 (calculate_width_of_column_NMC): fixed return value so that it really
5332 only returns true if the column-width has changed (there where
5333 problems with muliticolumn-cells in this column).
5335 2000-08-04 Juergen Vigna <jug@sad.it>
5337 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5338 also on the scrollstatus of the inset.
5339 (workAreaMotionNotify): ditto.
5341 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5343 2000-08-01 Juergen Vigna <jug@sad.it>
5345 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5347 * src/commandtags.h:
5348 * src/LyXAction.C (init):
5349 * src/insets/inset.C (LocalDispatch): added support for
5352 * src/insets/inset.C (scroll): new functions.
5354 * src/insets/insettext.C (removeNewlines): new function.
5355 (SetAutoBreakRows): removes forced newlines in the text of the
5356 paragraph if autoBreakRows is set to false.
5358 * src/tabular.C (Latex): generates a parbox around the cell contents
5361 * src/frontends/xforms/FormTabular.C (local_update): removed
5362 the radio_useparbox button.
5364 * src/tabular.C (UseParbox): new function
5366 2000-08-06 Baruch Even <baruch.even@writeme.com>
5368 * src/graphics/GraphicsCache.h:
5369 * src/graphics/GraphicsCache.C:
5370 * src/graphics/GraphicsCacheItem.h:
5371 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5374 * src/insets/insetgraphics.h:
5375 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5376 and the drawing of the inline image.
5378 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5379 loaded into the wrong position.
5381 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5384 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5386 * src/support/translator.h: move all typedefs to public section
5388 * src/support/filetools.C (MakeLatexName): return string const
5390 (TmpFileName): ditto
5391 (FileOpenSearch): ditto
5393 (LibFileSearch): ditto
5394 (i18nLibFileSearch): ditto
5397 (CreateTmpDir): ditto
5398 (CreateBufferTmpDir): ditto
5399 (CreateLyXTmpDir): ditto
5402 (MakeAbsPath): ditto
5404 (OnlyFilename): ditto
5406 (NormalizePath): ditto
5407 (CleanupPath): ditto
5408 (GetFileContents): ditto
5409 (ReplaceEnvironmentPath): ditto
5410 (MakeRelPath): ditto
5412 (ChangeExtension): ditto
5413 (MakeDisplayPath): ditto
5414 (do_popen): return cmdret const
5415 (findtexfile): return string const
5417 * src/support/DebugStream.h: add some /// to please doc++
5419 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5421 * src/texrow.C (same_rownumber): functor to use with find_if
5422 (getIdFromRow): rewritten to use find_if and to not update the
5423 positions. return true if row is found
5424 (increasePos): new method, use to update positions
5426 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5428 * src/lyxlex_pimpl.C (verifyTable): new method
5431 (GetString): return string const
5432 (pushTable): rewrite to use std::stack
5434 (setFile): better check
5437 * src/lyxlex.h: make LyXLex noncopyable
5439 * src/lyxlex.C (text): return char const * const
5440 (GetString): return string const
5441 (getLongString): return string const
5443 * src/lyx_gui_misc.C (askForText): return pair<...> const
5445 * src/lastfiles.[Ch] (operator): return string const
5447 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5448 istringstream not char const *.
5449 move token.end() out of loop.
5450 (readFile): move initializaton of token
5452 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5453 getIdFromRow is successful.
5455 * lib/bind/emacs.bind: don't include menus bind
5457 * development/Code_rules/Rules: the beginnings of making this
5458 better and covering more of the unwritten rules that we have.
5460 * development/Code_rules/Recommendations: a couple of wording
5463 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5465 * src/support/strerror.c: remove C++ comment.
5467 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5469 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5470 LFUN_INDEX_INSERT_LAST
5472 * src/texrow.C (getIdFromRow): changed from const_iterator to
5473 iterator, allowing code to compile with DEC cxx
5475 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5476 stores part of the class, as suggested by Allan. Will allow
5478 (apply): test to apply uses InsetCommandParams operator!=
5480 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5481 (apply): test to apply uses InsetCommandParams operator!=
5483 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5484 stores part of the class.
5485 (update): removed limits on min/max size.
5487 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5488 (apply): test to apply uses InsetCommandParams operator!=
5490 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5491 (Read, Write, scanCommand, getCommand): moved functionality
5492 into InsetCommandParams.
5494 (getScreenLabel): made pure virtual
5495 new InsetCommandParams operators== and !=
5497 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5498 c-tors based on InsetCommandParams. Removed others.
5499 * src/insets/insetinclude.[Ch]: ditto
5500 * src/insets/insetlabel.[Ch]: ditto
5501 * src/insets/insetparent.[Ch]: ditto
5502 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5504 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5505 insets derived from InsetCommand created using similar c-tors
5506 based on InsetCommandParams
5507 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5508 * src/menus.C (ShowRefsMenu): ditto
5509 * src/paragraph.C (Clone): ditto
5510 * src/text2.C (SetCounter): ditto
5511 * src/lyxfunc.C (Dispatch) ditto
5512 Also recreated old InsetIndex behaviour exactly. Can now
5513 index-insert at the start of a paragraph and index-insert-last
5514 without launching the pop-up.
5516 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5518 * lib/lyxrc.example: mark te pdf options as non functional.
5520 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5521 (isStrDbl): move tmpstr.end() out of loop.
5522 (strToDbl): move intialization of tmpstr
5523 (lowercase): return string const and move tmp.end() out of loop.
5524 (uppercase): return string const and move tmp.edn() out of loop.
5525 (prefixIs): add assertion
5530 (containsOnly): ditto
5531 (containsOnly): ditto
5532 (containsOnly): ditto
5533 (countChar): make last arg char not char const
5534 (token): return string const
5535 (subst): return string const, move tmp.end() out of loop.
5536 (subst): return string const, add assertion
5537 (strip): return string const
5538 (frontStrip): return string const, add assertion
5539 (frontStrip): return string const
5544 * src/support/lstrings.C: add inclde "LAssert.h"
5545 (isStrInt): move tmpstr.end() out of loop.
5547 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5548 toollist.end() out of loop.
5549 (deactivate): move toollist.end() out of loop.
5550 (update): move toollist.end() out of loop.
5551 (updateLayoutList): move tc.end() out of loop.
5552 (add): move toollist.end() out of loop.
5554 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5555 md.end() out of loop.
5557 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5559 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5562 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5563 (Erase): move insetlist.end() out of loop.
5565 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5566 ref to const string as first arg. Move initialization of some
5567 variables, whitespace changes.
5569 * src/kbmap.C (defkey): move table.end() out of loop.
5570 (kb_keymap): move table.end() out of loop.
5571 (findbinding): move table.end() out of loop.
5573 * src/MenuBackend.C (hasMenu): move end() out of loop.
5574 (getMenu): move end() out of loop.
5575 (getMenu): move menulist_.end() out of loop.
5577 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5579 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5582 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5583 (getFromLyXName): move infotab.end() out of loop.
5585 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5586 -fvtable-thunks -ffunction-sections -fdata-sections
5588 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5590 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5593 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5595 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5597 * src/frontends/xforms/FormCitation.[Ch],
5598 src/frontends/xforms/FormIndex.[Ch],
5599 src/frontends/xforms/FormToc.[Ch],
5600 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5602 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5604 * src/commandtags.h: renamed, created some flags for citation
5607 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5609 * src/lyxfunc.C (dispatch): use signals to insert index entry
5611 * src/frontends/Dialogs.h: new signal createIndex
5613 * src/frontends/xforms/FormCommand.[Ch],
5614 src/frontends/xforms/FormCitation.[Ch],
5615 src/frontends/xforms/FormToc.[Ch],
5616 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5618 * src/insets/insetindex.[Ch]: GUI-independent
5620 * src/frontends/xforms/FormIndex.[Ch],
5621 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5624 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5626 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5627 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5629 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5631 * src/insets/insetref.C (Latex): rewrite so that there is now
5632 question that a initialization is requested.
5634 * src/insets/insetcommand.h: reenable the hide signal
5636 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5638 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5639 fix handling of shortcuts (many bugs :)
5640 (add_lastfiles): ditto.
5642 * lib/ui/default.ui: fix a few shortcuts.
5644 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5646 * Makefile.am: Fix ``rpmdist'' target to return the exit
5647 status of the ``rpm'' command, instead of the last command in
5648 the chain (the ``rm lyx.xpm'' command, which always returns
5651 2000-08-02 Allan Rae <rae@lyx.org>
5653 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5654 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5655 * src/frontends/xforms/FormToc.C (FormToc): ditto
5657 * src/frontends/xforms/Makefile.am: A few forgotten files
5659 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5660 Signals-not-copyable-problem Lars' started commenting out.
5662 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5664 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5666 * src/insets/insetcommand.h: Signals is not copyable so anoter
5667 scheme for automatic hiding of forms must be used.
5669 * src/frontends/xforms/FormCitation.h: don't inerit from
5670 noncopyable, FormCommand already does that.
5671 * src/frontends/xforms/FormToc.h: ditto
5672 * src/frontends/xforms/FormUrl.h: ditto
5674 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5676 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5678 * src/insets/insetcommand.h (hide): new SigC::Signal0
5679 (d-tor) new virtual destructor emits hide signal
5681 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5682 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5684 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5685 LOF and LOT. Inset is now GUI-independent
5687 * src/insets/insetloa.[Ch]: redundant
5688 * src/insets/insetlof.[Ch]: ditto
5689 * src/insets/insetlot.[Ch]: ditto
5691 * src/frontends/xforms/forms/form_url.fd: tweaked!
5692 * src/frontends/xforms/forms/form_citation.fd: ditto
5694 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5695 dialogs dealing with InsetCommand insets
5697 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5698 FormCommand base class
5699 * src/frontends/xforms/FormUrl.[Ch]: ditto
5701 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5703 * src/frontends/xforms/FormToc.[Ch]: ditto
5705 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5706 passed a generic InsetCommand pointer
5707 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5709 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5710 and modified InsetTOC class
5711 * src/buffer.C: ditto
5713 * forms/lyx.fd: strip out old FD_form_toc code
5714 * src/lyx_gui_misc.C: ditto
5715 * src/lyx_gui.C: ditto
5716 * src/lyx_cb.C: ditto
5717 * src/lyx.[Ch]: ditto
5719 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5721 * src/support/utility.hpp: tr -d '\r'
5723 2000-08-01 Juergen Vigna <jug@sad.it>
5725 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5727 * src/commandtags.h:
5728 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5729 LFUN_TABULAR_FEATURES.
5731 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5732 LFUN_LAYOUT_TABULAR.
5734 * src/insets/insettabular.C (getStatus): implemented helper function.
5736 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5738 2000-07-31 Juergen Vigna <jug@sad.it>
5740 * src/text.C (draw): fixed screen update problem for text-insets.
5742 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5743 something changed probably this has to be added in various other
5746 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5748 2000-07-31 Baruch Even <baruch.even@writeme.com>
5750 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5751 templates to satisfy compaq cxx.
5754 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5756 * src/support/translator.h (equal_1st_in_pair::operator()): take
5757 const ref pair_type as arg.
5758 (equal_2nd_in_pair::operator()): ditto
5759 (Translator::~Translator): remove empty d-tor.
5761 * src/graphics/GraphicsCache.C: move include config.h to top, also
5762 put initialization of GraphicsCache::singleton here.
5763 (~GraphicsCache): move here
5764 (addFile): take const ref as arg
5767 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5769 * src/BufferView2.C (insertLyXFile): change te with/without header
5772 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5774 * src/frontends/xforms/FormGraphics.C (apply): add some
5775 static_cast. Not very nice, but required by compaq cxx.
5777 * src/frontends/xforms/RadioButtonGroup.h: include header
5778 <utility> instead of <pair.h>
5780 * src/insets/insetgraphicsParams.C: add using directive.
5781 (readResize): change return type to void.
5782 (readOrigin): ditto.
5784 * src/lyxfunc.C (getStatus): add missing break for build-program
5785 function; add test for Literate for export functions.
5787 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5788 entries in Options menu.
5790 2000-07-31 Baruch Even <baruch.even@writeme.com>
5792 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5793 protect against auto-allocation; release icon when needed.
5795 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5797 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5798 on usual typewriter.
5800 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5801 earlier czech.kmap), useful only for programming.
5803 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5805 * src/frontends/xforms/FormCitation.h: fix conditioning around
5808 2000-07-31 Juergen Vigna <jug@sad.it>
5810 * src/frontends/xforms/FormTabular.C (local_update): changed
5811 radio_linebreaks to radio_useparbox and added radio_useminipage.
5813 * src/tabular.C: made support for using minipages/parboxes.
5815 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5817 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5819 (descent): so the cursor is in the middle.
5820 (width): bit smaller box.
5822 * src/insets/insetgraphics.h: added display() function.
5824 2000-07-31 Baruch Even <baruch.even@writeme.com>
5826 * src/frontends/Dialogs.h: Added showGraphics signals.
5828 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5829 xforms form definition of the graphics dialog.
5831 * src/frontends/xforms/FormGraphics.h:
5832 * src/frontends/xforms/FormGraphics.C: Added files, the
5833 GUIndependent code of InsetGraphics
5835 * src/insets/insetgraphics.h:
5836 * src/insets/insetgraphics.C: Major writing to make it work.
5838 * src/insets/insetgraphicsParams.h:
5839 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5840 struct between InsetGraphics and GUI.
5842 * src/LaTeXFeatures.h:
5843 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5844 support for graphicx package.
5846 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5847 for the graphics inset.
5849 * src/support/translator.h: Added file, used in
5850 InsetGraphicsParams. this is a template to translate between two
5853 * src/frontends/xforms/RadioButtonGroup.h:
5854 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5855 way to easily control a radio button group.
5857 2000-07-28 Juergen Vigna <jug@sad.it>
5859 * src/insets/insettabular.C (LocalDispatch):
5860 (TabularFeatures): added support for lyx-functions of tabular features.
5861 (cellstart): refixed this function after someone wrongly changed it.
5863 * src/commandtags.h:
5864 * src/LyXAction.C (init): added support for tabular-features
5866 2000-07-28 Allan Rae <rae@lyx.org>
5868 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5869 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5870 triggers the callback for input checking. As a result we sometimes get
5871 "LyX: This shouldn't happen..." printed to cerr.
5872 (input): Started using status variable since I only free() on
5873 destruction. Some input checking for paths and font sizes.
5875 * src/frontends/xforms/FormPreferences.h: Use status to control
5876 activation of Ok and Apply
5878 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5879 callback. Also resized to stop segfaults with 0.88. The problem is
5880 that xforms-0.88 requires the folder to be wide enough to fit all the
5881 tabs. If it isn't it causes all sorts of problems.
5883 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5885 * src/frontends/xforms/forms/README: Reflect reality.
5887 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5888 * src/frontends/xforms/forms/makefile: ditto.
5890 * src/commandtags.h: Get access to new Preferences dialog
5891 * src/LyXAction.C: ditto
5892 * src/lyxfunc.C: ditto
5893 * lib/ui/default.ui: ditto
5895 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5897 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5899 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5902 * src/frontends/xforms/form_url.[Ch]: added.
5904 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5906 * src/insets/insetbib.h: fixed bug in previous commit
5908 * src/frontends/xforms/FormUrl.h: ditto
5910 * src/frontends/xforms/FormPrint.h: ditto
5912 * src/frontends/xforms/FormPreferences.h: ditto
5914 * src/frontends/xforms/FormCopyright.h: ditto
5916 * src/frontends/xforms/FormCitation.C: ditto
5918 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5919 private copyconstructor and private default contructor
5921 * src/support/Makefile.am: add utility.hpp
5923 * src/support/utility.hpp: new file from boost
5925 * src/insets/insetbib.h: set owner in clone
5927 * src/frontends/xforms/FormCitation.C: added missing include
5930 * src/insets/form_url.[Ch]: removed
5932 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5934 * development/lyx.spec.in
5935 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5936 file/directory re-organization.
5938 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5940 * src/insets/insetcommand.[Ch]: moved the string data and
5941 associated manipulation methods into a new stand-alone class
5942 InsetCommandParams. This class has two additional methods
5943 getAsString() and setFromString() allowing the contents to be
5944 moved around as a single string.
5945 (addContents) method removed.
5946 (setContents) method no longer virtual.
5948 * src/buffer.C (readInset): made use of new InsetCitation,
5949 InsetUrl constructors based on InsetCommandParams.
5951 * src/commandtags.h: add LFUN_INSERT_URL
5953 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5954 independent InsetUrl and use InsetCommandParams to extract
5955 string info and create new Insets.
5957 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5959 * src/frontends/xforms/FormCitation.C (apply): uses
5962 * src/frontends/xforms/form_url.C
5963 * src/frontends/xforms/form_url.h
5964 * src/frontends/xforms/FormUrl.h
5965 * src/frontends/xforms/FormUrl.C
5966 * src/frontends/xforms/forms/form_url.fd: new files
5968 * src/insets/insetcite.[Ch]: removed unused constructors.
5970 * src/insets/insetinclude.[Ch]: no longer store filename
5972 * src/insets/inseturl.[Ch]: GUI-independent.
5974 2000-07-26 Juergen Vigna <jug@sad.it>
5975 * renamed frontend from gtk to gnome as it is that what is realized
5976 and did the necessary changes in the files.
5978 2000-07-26 Marko Vendelin <markov@ioc.ee>
5980 * configure.in: cleaning up gnome configuration scripts
5982 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5984 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5985 shortcuts syndrom by redrawing them explicitely (a better solution
5986 would be appreciated).
5988 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5990 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5993 * src/lyx_cb.C (MenuExport): change html export to do the right
5994 thing depending of the document type (instead of having
5995 html-linuxdoc and html-docbook).
5996 * src/lyxfunc.C (getStatus): update for html
5997 * lib/ui/default.ui: simplify due to the above change.
5998 * src/menus.C (ShowFileMenu): update too (in case we need it).
6000 * src/MenuBackend.C (read): if a menu is defined twice, add the
6001 new entries to the exiting one.
6003 2000-07-26 Juergen Vigna <jug@sad.it>
6005 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
6007 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
6008 and return a bool if it did actual save the file.
6009 (AutoSave): don't autosave a unnamed doc.
6011 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
6012 check if this is an UNNAMED new file and react to it.
6013 (newFile): set buffer to unnamed and change to not mark a new
6014 buffer dirty if I didn't do anything with it.
6016 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
6018 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6020 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
6021 friend as per Angus's patch posted to lyx-devel.
6023 * src/ext_l10n.h: updated
6025 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
6026 gettext on the style string right before inserting them into the
6029 * autogen.sh: add code to extract style strings form layout files,
6030 not good enough yet.
6032 * src/frontends/gtk/.cvsignore: add MAKEFILE
6034 * src/MenuBackend.C (read): run the label strings through gettext
6035 before storing them in the containers.
6037 * src/ext_l10n.h: new file
6039 * autogen.sh : generate the ext_l10n.h file here
6041 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6043 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
6046 * lib/ui/default.ui: fix a couple of typos.
6048 * config/gnome/gtk.m4: added (and added to the list of files in
6051 * src/insets/insetinclude.C (unique_id): fix when we are using
6052 lyxstring instead of basic_string<>.
6053 * src/insets/insettext.C (LocalDispatch): ditto.
6054 * src/support/filetools.C: ditto.
6056 * lib/configure.m4: create the ui/ directory if necessary.
6058 * src/LyXView.[Ch] (updateToolbar): new method.
6060 * src/BufferView_pimpl.C (buffer): update the toolbar when
6061 opening/closing buffer.
6063 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6065 * src/LyXAction.C (getActionName): enhance to return also the name
6066 and options of pseudo-actions.
6067 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
6069 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
6070 as an example of what is possible). Used in File->Build too (more
6071 useful) and in the import/export menus (to mimick the complicated
6072 handling of linuxdoc and friends). Try to update all the entries.
6074 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
6077 * src/MenuBackend.C (read): Parse the new OptItem tag.
6079 * src/MenuBackend.h: Add a new optional_ data member (used if the
6080 entry should be omitted when the lyxfunc is disabled).
6082 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
6083 function, used as a shortcut.
6084 (create_submenu): align correctly the shortcuts on the widest
6087 * src/MenuBackend.h: MenuItem.label() only returns the label of
6088 the menu without shortcut; new method shortcut().
6090 2000-07-14 Marko Vendelin <markov@ioc.ee>
6092 * src/frontends/gtk/Dialogs.C:
6093 * src/frontends/gtk/FormCopyright.C:
6094 * src/frontends/gtk/FormCopyright.h:
6095 * src/frontends/gtk/Makefile.am: added these source-files for the
6096 Gtk/Gnome support of the Copyright-Dialog.
6098 * src/main.C: added Gnome::Main initialization if using
6099 Gtk/Gnome frontend-GUI.
6101 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
6103 * config/gnome/aclocal-include.m4
6104 * config/gnome/compiler-flags.m4
6105 * config/gnome/curses.m4
6106 * config/gnome/gnome--.m4
6107 * config/gnome/gnome-bonobo-check.m4
6108 * config/gnome/gnome-common.m4
6109 * config/gnome/gnome-fileutils.m4
6110 * config/gnome/gnome-ghttp-check.m4
6111 * config/gnome/gnome-gnorba-check.m4
6112 * config/gnome/gnome-guile-checks.m4
6113 * config/gnome/gnome-libgtop-check.m4
6114 * config/gnome/gnome-objc-checks.m4
6115 * config/gnome/gnome-orbit-check.m4
6116 * config/gnome/gnome-print-check.m4
6117 * config/gnome/gnome-pthread-check.m4
6118 * config/gnome/gnome-support.m4
6119 * config/gnome/gnome-undelfs.m4
6120 * config/gnome/gnome-vfs.m4
6121 * config/gnome/gnome-x-checks.m4
6122 * config/gnome/gnome-xml-check.m4
6123 * config/gnome/gnome.m4
6124 * config/gnome/gperf-check.m4
6125 * config/gnome/gtk--.m4
6126 * config/gnome/linger.m4
6127 * config/gnome/need-declaration.m4: added configuration scripts
6128 for Gtk/Gnome frontend-GUI
6130 * configure.in: added support for the --with-frontend=gtk option
6132 * autogen.sh: added config/gnome/* to list of config-files
6134 * acconfig.h: added define for GTKGUI-support
6136 * config/lyxinclude.m4: added --with-frontend[=value] option value
6137 for Gtk/Gnome frontend-GUI support.
6139 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6141 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
6145 * src/paragraph.C (GetChar): remove non-const version
6147 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
6148 (search_kw): use it.
6150 * src/lyx_main.C (init): if "preferences" exist, read that instead
6152 (ReadRcFile): return bool if the file could be read ok.
6153 (ReadUIFile): add a check to see if lex file is set ok.
6155 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
6156 bastring can be used instead of lyxstring (still uses the old code
6157 if std::string is good enough or if lyxstring is used.)
6159 * src/encoding.C: make the arrays static, move ininle functions
6161 * src/encoding.h: from here.
6163 * src/buffer.C: have last_isnet_read as a file scope variable for now.
6164 (parseSingleLyXformat2Token): move inset parsing to separate method
6165 (readInset): new private method
6167 * src/Variables.h: remove virtual from get().
6169 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
6170 access to NEW_INSETS and NEW_TABULAR
6172 * src/MenuBackend.h: remove superfluous forward declaration of
6173 MenuItem. Add documentations tags "///", remove empty MenuItem
6174 destructor, remove private default contructor.
6176 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
6178 (read): more string mlabel and mname to where they are used
6179 (read): remove unused variables mlabel and mname
6180 (defaults): unconditional clear, make menusetup take advantage of
6181 add returning Menu &.
6183 * src/LyXView.h: define NEW_MENUBAR as default
6185 * src/LyXAction.C: include lyxparagraph.h temporary to get access
6186 to NEW_INSETS and NEW_TABULAR.
6187 (init): commetn out some funcs that is obsolete when NEW_INSETS is
6188 defined. Change some of the "xxxx-inset-insert" functions names to
6191 * several files: more enahncements to NEW_INSETS and the resulting
6194 * lib/lyxrc.example (\date_insert_format): move to misc section
6196 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
6197 bastring and use AC_CACHE_CHECK.
6198 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
6199 the system have the newest methods. uses AC_CACHE_CHECK
6200 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
6201 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
6202 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
6204 * configure.in: add LYX_CXX_GOOD_STD_STRING
6206 * acinclude.m4: recreated
6208 2000-07-24 Amir Karger <karger@lyx.org>
6210 * README: add Hebrew, Arabic kmaps
6213 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6215 * src/buffer.C (writeFileAscii): Define actcell as an int instead
6218 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6220 * Lot of files: add pragma interface/implementation.
6222 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
6224 * lib/ui/default.ui: new file (ans new directory). Contains the
6225 default menu and toolbar.
6227 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
6228 global space. Toolbars are now read (as menus) in ui files.
6230 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
6232 * src/lyxfunc.C (getStatus): do not exit immediately if a command
6233 is disabled because the document is read-only. We want to have the
6234 toggle state of the function anyway.
6235 (getStatus): add code for LFUN_VC* functions (mimicking what is
6236 done in old-style menus)
6238 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
6239 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
6241 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
6242 * src/BufferView_pimpl.C: ditto.
6243 * src/lyxfunc.C: ditto.
6245 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
6246 default). This replaces old-style menus by new ones.
6248 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
6249 MenuItem. Contain the data structure of a menu.
6251 * src/insets/insettext.C: use LyXView::setLayout instead of
6252 accessing directly the toolbar combox.
6253 * src/lyxfunc.C (Dispatch): ditto.
6255 * src/LyXView.C (setLayout): new method, which just calls
6256 Toolbar::setLayout().
6257 (updateLayoutChoice): move part of this method in Toolbar.
6259 * src/toolbar.[Ch]: removed.
6261 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
6262 implementation the toolbar.
6264 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
6265 the toolbar. It might make sense to merge it with ToolbarDefaults
6267 (setLayout): new function.
6268 (updateLayoutList): ditto.
6269 (openLayoutList): ditto.
6271 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
6272 xforms implementation of the toolbar.
6273 (get_toolbar_func): comment out, since I do not
6274 know what it is good for.
6276 * src/ToolbarDefaults.h: Add the ItemType enum.
6278 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
6279 for a list of allocated C strings. Used in Menubar xforms
6280 implementation to avoid memory leaks.
6282 * src/support/lstrings.[Ch] (uppercase): new version taking and
6286 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
6287 * lib/bind/emacs.bind: ditto.
6289 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6291 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
6292 forward decl of LyXView.
6294 * src/toolbar.C (toolbarItem): moved from toolbar.h
6295 (toolbarItem::clean): ditto
6296 (toolbarItem::~toolbarItem): ditto
6297 (toolbarItem::operator): ditto
6299 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
6301 * src/paragraph.h: control the NEW_TABULAR define from here
6303 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
6304 USE_TABULAR_INSETS to NEW_TABULAR
6306 * src/ToolbarDefaults.C: add include "lyxlex.h"
6308 * files using the old table/tabular: use NEW_TABULAR to control
6309 compilation of old tabular stuff.
6311 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
6314 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
6315 planemet in reading of old style floats, fix the \end_deeper
6316 problem when reading old style floats.
6318 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6320 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
6322 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
6324 * lib/bind/sciword.bind: updated.
6326 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6328 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
6329 layout write problem
6331 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6333 * src/Makefile.am (INCLUDES): remove image directory from include
6336 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6337 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6339 * src/LyXView.C (create_form_form_main): read the application icon
6342 * lib/images/*.xpm: change the icons to use transparent color for
6345 * src/toolbar.C (update): change the color of the button when it
6348 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6350 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6351 setting explicitely the minibuffer.
6352 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6354 * src/LyXView.C (showState): new function. Shows font information
6355 in minibuffer and update toolbar state.
6356 (LyXView): call Toolbar::update after creating the
6359 * src/toolbar.C: change toollist to be a vector instead of a
6361 (BubbleTimerCB): get help string directly from the callback
6362 argument of the corresponding icon (which is the action)
6363 (set): remove unnecessary ugliness.
6364 (update): new function. update the icons (depressed, disabled)
6365 depending of the status of the corresponding action.
6367 * src/toolbar.h: remove help in toolbarItem
6369 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6371 * src/Painter.C (text): Added code for using symbol glyphs from
6372 iso10646 fonts. Currently diabled.
6374 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6377 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6378 magyar,turkish and usorbian.
6380 * src/paragraph.C (isMultiLingual): Made more efficient.
6382 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6385 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6386 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6387 Also changed the prototype to "bool math_insert_greek(char)".
6389 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6391 * lots of files: apply the NEW_INSETS on all code that will not be
6392 needed when we move to use the new insets. Enable the define in
6393 lyxparagrah.h to try it.
6395 * src/insets/insettabular.C (cellstart): change to be a static
6397 (InsetTabular): initialize buffer in the initializer list.
6399 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6401 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6402 form_print.h out of the header file. Replaced with forward
6403 declarations of the relevant struct.
6405 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6408 * src/commandtags.h: do not include "debug.h" which does not
6409 belong there. #include it in some other places because of this
6412 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6414 * src/insets/insetcaption.C: add a couple "using" directives.
6416 * src/toolbar.C (add): get the help text directly from lyxaction.
6418 (setPixmap): new function. Loads from disk and sets a pixmap on a
6419 botton; the name of the pixmap file is derived from the command
6422 * src/toolbar.h: remove members isBitmap and pixmap from
6425 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6426 * lib/images/: move many files from images/banner.xpm.
6428 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6430 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6431 * src/toolbar.C: ditto.
6432 * configure.in: ditto.
6433 * INSTALL: document.
6435 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6436 the spellchecker popup is closed from the WM.
6438 2000-07-19 Juergen Vigna <jug@sad.it>
6440 * src/insets/insetfloat.C (Write): small fix because we use the
6441 insetname for the type now!
6443 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6445 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6448 * src/frontends/Dialogs.h: removed hideCitation signal
6450 * src/insets/insetcite.h: added hide signal
6452 * src/insets/insetcite.C (~InsetCitation): emits new signal
6453 (getScreenLabel): "intelligent" label should now fit on the screen!
6455 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6457 * src/frontends/xforms/FormCitation.C (showInset): connects
6458 hide() to the inset's hide signal
6459 (show): modified to use fl_set_object_position rather than
6460 fl_set_object_geometry wherever possible
6462 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6464 * src/insets/lyxinset.h: add caption code
6466 * src/insets/insetfloat.C (type): new method
6468 * src/insets/insetcaption.C (Write): new method
6470 (LyxCode): new method
6472 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6473 to get it right together with using the FloatList.
6475 * src/commandtags.h: add LFUN_INSET_CAPTION
6476 * src/lyxfunc.C (Dispatch): handle it
6478 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6481 * src/Variables.[Ch]: make expand take a const reference, remove
6482 the destructor, some whitespace changes.
6484 * src/LyXAction.C (init): add caption-inset-insert
6486 * src/FloatList.C (FloatList): update the default floats a bit.
6488 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6490 * src/Variables.[Ch]: new files. Intended to be used for language
6491 specific strings (like \chaptername) and filename substitution in
6494 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6496 * lib/kbd/american.kmap: update
6498 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6500 * src/bufferparams.[Ch]: remove member allowAccents.
6502 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6504 * src/LaTeXLog.C: use the log_form.h header.
6505 * src/lyx_gui.C: ditto.
6506 * src/lyx_gui_misc.C: ditto.
6507 * src/lyxvc.h: ditto.
6509 * forms/log_form.fd: new file, created from latexoptions.fd. I
6510 kept the log popup and nuked the options form.
6512 * src/{la,}texoptions.[Ch]: removed.
6513 * src/lyx_cb.C (LaTeXOptions): ditto
6515 * src/lyx_gui.C (create_forms): do not handle the
6516 fd_latex_options form.
6518 2000-07-18 Juergen Vigna <jug@sad.it>
6520 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6521 name of the inset so that it can be requested outside (text2.C).
6523 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6526 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6528 * src/mathed/formula.h (ConvertFont): constify
6530 * src/mathed/formula.C (Read): add warning if \end_inset is not
6531 found on expected place.
6533 * src/insets/lyxinset.h (ConvertFont): consify
6535 * src/insets/insetquotes.C (ConvertFont): constify
6536 * src/insets/insetquotes.h: ditto
6538 * src/insets/insetinfo.h: add labelfont
6540 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6541 (ascent): use labelfont
6545 (Write): make .lyx file a bit nicer
6547 * src/insets/insetfloat.C (Write): simplify somewhat...
6548 (Read): add warning if arg is not found
6550 * src/insets/insetcollapsable.C: add using std::max
6551 (Read): move string token and add warning in arg is not found
6552 (draw): use std::max to get the right ty
6553 (getMaxWidth): simplify by using std::max
6555 * src/insets/insetsection.h: new file
6556 * src/insets/insetsection.C: new file
6557 * src/insets/insetcaption.h: new file
6558 * src/insets/insetcaption.C: new file
6560 * src/insets/inset.C (ConvertFont): constify signature
6562 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6563 insetcaption.[Ch] and insetsection.[Ch]
6565 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6566 uses to use LABEL_COUNTER_CHAPTER instead.
6567 * src/text2.C (SetCounter): here
6569 * src/counters.h: new file
6570 * src/counters.C: new file
6571 * src/Sectioning.h: new file
6572 * src/Sectioning.C: new file
6574 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6576 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6578 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6581 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6584 2000-07-17 Juergen Vigna <jug@sad.it>
6586 * src/tabular.C (Validate): check if array-package is needed.
6587 (SetVAlignment): added support for vertical alignment.
6588 (SetLTFoot): better support for longtable header/footers
6589 (Latex): modified to support added features.
6591 * src/LaTeXFeatures.[Ch]: added array-package.
6593 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6595 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6598 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6600 * configure.in: do not forget to put a space after -isystem.
6602 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6604 * lib/kbd/arabic.kmap: a few fixes.
6606 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6608 * some whitespace chagnes to a number of files.
6610 * src/support/DebugStream.h: change to make it easier for
6611 doc++ to parse correctly.
6612 * src/support/lyxstring.h: ditto
6614 * src/mathed/math_utils.C (compara): change to have only one
6616 (MathedLookupBOP): change because of the above.
6618 * src/mathed/math_delim.C (math_deco_compare): change to have only
6620 (search_deco): change becasue of the above.
6622 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6623 instead of manually coded one.
6625 * src/insets/insetquotes.C (Read): read the \end_inset too
6627 * src/insets/insetlatex.h: remove file
6628 * src/insets/insetlatex.C: remove file
6630 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6632 (InsetPrintIndex): remove destructor
6634 * src/insets/insetinclude.h: remove default constructor
6636 * src/insets/insetfloat.C: work to make it work better
6638 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6640 * src/insets/insetcite.h (InsetCitation): remove default constructor
6642 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6644 * src/text.C (GetColumnNearX): comment out some currently unused code.
6646 * src/paragraph.C (writeFile): move some initializations closer to
6648 (CutIntoMinibuffer): small change to use new matchIT operator
6652 (InsertInset): ditto
6655 (InsetIterator): ditto
6656 (Erase): small change to use new matchFT operator
6658 (GetFontSettings): ditto
6659 (HighestFontInRange): ditto
6662 * src/lyxparagraph.h: some chars changed to value_type
6663 (matchIT): because of some stronger checking (perhaps too strong)
6664 in SGI STL, the two operator() unified to one.
6667 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6669 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6670 the last inset read added
6671 (parseSingleLyXformat2Token): some more (future) compability code added
6672 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6673 (parseSingleLyXformat2Token): set last_inset_read
6674 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6675 (parseSingleLyXformat2Token): don't double intializw string next_token
6677 * src/TextCache.C (text_fits::operator()): add const's to the signature
6678 (has_buffer::operator()): ditto
6680 * src/Floating.h: add some comments on the class
6682 * src/FloatList.[Ch] (typeExist): new method
6685 * src/BackStack.h: added default constructor, wanted by Gcc.
6687 2000-07-14 Juergen Vigna <jug@sad.it>
6689 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6691 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6693 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6694 do a redraw when the window is resized!
6695 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6697 * src/insets/insettext.C (resizeLyXText): added function to correctly
6698 being able to resize the LyXWindow.
6700 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6702 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6704 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6705 crashes when closing dialog to a deleted inset.
6707 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6708 method! Now similar to other insets.
6710 2000-07-13 Juergen Vigna <jug@sad.it>
6712 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6714 * lib/examples/Literate.lyx: small patch!
6716 * src/insets/insetbib.C (Read): added this function because of wrong
6717 Write (without [begin|end]_inset).
6719 2000-07-11 Juergen Vigna <jug@sad.it>
6721 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6722 as the insertInset could not be good!
6724 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6725 the bool param should not be last.
6727 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6729 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6730 did submit that to Karl).
6732 * configure.in: use -isystem instead of -I for X headers. This
6733 fixes a problem on solaris with a recent gcc;
6734 put the front-end code after the X detection code;
6735 configure in sigc++ before lib/
6737 * src/lyx_main.C (commandLineHelp): remove -display from command
6740 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6742 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6743 Also put in Makefile rules for building the ``listerrors''
6744 program for parsing errors from literate programs written in LyX.
6746 * lib/build-listerrors: Added small shell script as part of compile
6747 process. This builds a working ``listerrors'' binary if noweb is
6748 installed and either 1) the VNC X server is installed on the machine,
6749 or 2) the user is compiling from within a GUI. The existence of a GUI
6750 is necessary to use the ``lyx --export'' feature for now. This
6751 hack can be removed once ``lyx --export'' no longer requires a GUI to
6754 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6756 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6757 now passed back correctly from gcc and placed "under" error
6758 buttons in a Literate LyX source.
6760 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6762 * src/text.C (GetColumnNearX): Better behavior when a RTL
6763 paragraph is ended by LTR text.
6765 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6768 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6770 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6771 true when clipboard is empty.
6773 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6775 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6776 row of the paragraph.
6777 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6778 to prevent calculation of bidi tables
6780 2000-07-07 Juergen Vigna <jug@sad.it>
6782 * src/screen.C (ToggleSelection): added y_offset and x_offset
6785 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6788 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6790 * src/insets/insettext.C: fixed Layout-Display!
6792 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6794 * configure.in: add check for strings.h header.
6796 * src/spellchecker.C: include <strings.h> in order to have a
6797 definition for bzero().
6799 2000-07-07 Juergen Vigna <jug@sad.it>
6801 * src/insets/insettext.C (draw): set the status of the bv->text to
6802 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6804 * src/screen.C (DrawOneRow):
6805 (DrawFromTo): redraw the actual row if something has changed in it
6808 * src/text.C (draw): call an update of the toplevel-inset if something
6809 has changed inside while drawing.
6811 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6813 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6815 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6816 processing inside class.
6818 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6819 processing inside class.
6821 * src/insets/insetindex.h new struct Holder, consistent with other
6824 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6825 citation dialog from main code and placed it in src/frontends/xforms.
6826 Dialog launched through signals instead of callbacks
6828 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6830 * lyx.man: update the options description.
6832 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6834 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6835 handle neg values, set min width to 590, add doc about -display
6837 2000-07-05 Juergen Vigna <jug@sad.it>
6839 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6840 calls to BufferView *.
6842 * src/insets/insettext.C (checkAndActivateInset): small fix non
6843 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6845 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6846 their \end_inset token!
6848 2000-07-04 edscott <edscott@imp.mx>
6850 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6851 lib/lyxrc.example: added option \wheel_jump
6853 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6855 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6856 remove support for -width,-height,-xpos and -ypos.
6858 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6860 * src/encoding.[Ch]: New files.
6862 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6863 (text): Call to the underline() method only when needed.
6865 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6867 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6868 encoding(s) for the document.
6870 * src/bufferparams.C (BufferParams): Changed default value of
6873 * src/language.C (newLang): Removed.
6874 (items[]): Added encoding information for all defined languages.
6876 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6877 encoding choice button.
6879 * src/lyxrc.h (font_norm_type): New member variable.
6880 (set_font_norm_type): New method.
6882 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6883 paragraphs with different encodings.
6885 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6886 (TransformChar): Changed to work correctly with Arabic points.
6887 (draw): Added support for drawing Arabic points.
6888 (draw): Removed code for drawing underbars (this is done by
6891 * src/support/textutils.h (IsPrintableNonspace): New function.
6893 * src/BufferView_pimpl.h: Added "using SigC::Object".
6894 * src/LyXView.h: ditto.
6896 * src/insets/insetinclude.h (include_label): Changed to mutable.
6898 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6900 * src/mathed/math_iter.h: remove empty destructor
6902 * src/mathed/math_cursor.h: remove empty destructor
6904 * src/insets/lyxinset.h: add THEOREM_CODE
6906 * src/insets/insettheorem.[Ch]: new files
6908 * src/insets/insetminipage.C: (InsertInset): remove
6910 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6912 (InsertInset): remove
6914 * src/insets/insetlist.C: (InsertList): remove
6916 * src/insets/insetfootlike.[Ch]: new files
6918 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6921 (InsertInset): ditto
6923 * src/insets/insetert.C: remove include Painter.h, reindent
6924 (InsertInset): move to header
6926 * src/insets/insetcollapsable.h: remove explicit from default
6927 contructor, remove empty destructor, add InsertInset
6929 * src/insets/insetcollapsable.C (InsertInset): new func
6931 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6933 * src/vspace.h: add explicit to constructor
6935 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6936 \textcompwordmark, please test this.
6938 * src/lyxrc.C: set ascii_linelen to 65 by default
6940 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6942 * src/commandtags.h: add LFUN_INSET_THEOREM
6944 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6945 (makeLinuxDocFile): remove _some_ of the nice logic
6946 (makeDocBookFile): ditto
6948 * src/Painter.[Ch]: (~Painter): removed
6950 * src/LyXAction.C (init): entry for insettheorem added
6952 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6954 (deplog): code to detect files generated by LaTeX, needs testing
6957 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6959 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6961 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6963 * src/LaTeX.C (deplog): Add a check for files that are going to be
6964 created by the first latex run, part of the project to remove the
6967 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6968 contents to the extension list.
6970 2000-07-04 Juergen Vigna <jug@sad.it>
6972 * src/text.C (NextBreakPoint): added support for needFullRow()
6974 * src/insets/lyxinset.h: added needFullRow()
6976 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6979 * src/insets/insettext.C: lots of changes for update!
6981 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6983 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6985 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6987 * src/insets/insetinclude.C (InsetInclude): fixed
6988 initialization of include_label.
6989 (unique_id): now returns a string.
6991 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6993 * src/LaTeXFeatures.h: new member IncludedFiles, for
6994 a map of key, included file name.
6996 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6997 with the included files for inclusion in SGML preamble,
6998 i. e., linuxdoc and docbook.
7001 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
7002 nice (is the generated linuxdoc code to be exported?), that
7003 allows to remove column, and only_body that will be true for
7004 slave documents. Insets are allowed inside SGML font type.
7005 New handling of the SGML preamble for included files.
7006 (makeDocBookFile): the same for docbook.
7008 * src/insets/insetinclude.h:
7009 * src/insets/insetinclude.C (Validate): keeps a list of included files.
7011 (DocBook): new export methods.
7013 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
7014 and makeDocBookFile.
7016 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
7017 formats to export with command line argument -x.
7019 2000-06-29 Juergen Vigna <jug@sad.it>
7021 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
7022 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
7024 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
7025 region could already been cleared by an inset!
7027 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7029 * src/BufferView_pimpl.h: remove member variables lyx_focus and
7032 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
7034 (cursorToggle): remove special handling of lyx focus.
7036 2000-06-28 Juergen Vigna <jug@sad.it>
7038 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
7041 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7043 * src/insets/insetindex.C (Edit): add a callback when popup is
7046 * src/insets/insettext.C (LocalDispatch):
7047 * src/insets/insetmarginal.h:
7048 * src/insets/insetlist.h:
7049 * src/insets/insetfoot.h:
7050 * src/insets/insetfloat.h:
7051 * src/insets/insetert.h: add a missing std:: qualifier.
7053 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7055 * src/support/lyxsum.C (sum): '\0' teminate file read when using
7058 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
7060 * src/insets/insettext.C (Read): remove tmptok unused variable
7061 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
7062 (InsertInset): change for new InsetInset code
7064 * src/insets/insettext.h: add TEXT inline method
7066 * src/insets/insettext.C: remove TEXT macro
7068 * src/insets/insetmarginal.C (Write): new method
7069 (Latex): change output slightly
7071 * src/insets/insetfoot.C (Write): new method
7072 (Latex): change output slightly (don't use endl when no need)
7074 * src/insets/insetert.C (Write): new method
7076 * src/insets/insetcollapsable.h: make button_length, button_top_y
7077 and button_bottm_y protected.
7079 * src/insets/insetcollapsable.C (Write): simplify code by using
7080 tostr. Also do not output the float name, the children class
7081 should to that to get control over own arguments
7083 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
7084 src/insets/insetminipage.[Ch]:
7087 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
7089 * src/lyxfunc.C (Dispatch): cases for new insets/commands
7091 * src/Makefile.am (lyx_SOURCES): add the new files
7093 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
7094 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
7095 * src/commandtags.h: ditto
7097 * src/LaTeXFeatures.h: add a std::set of used floattypes
7099 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
7101 * src/FloatList.[Ch] src/Floating.h: new files
7103 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
7105 * src/lyx_cb.C (TableApplyCB): ditto
7107 * src/text2.C: ditto
7108 * src/buffer.C (SimpleLinuxDocOnePar): ditto
7109 (parseSingleLyXformat2Token): ditto + add code for
7110 backwards compability for old float styles + add code for new insets
7112 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
7114 (InsertInset(size_type, Inset *, LyXFont)): new method
7115 (InsetChar(size_type, char)): changed to use the other InsetChar
7116 with a LyXFont(ALL_INHERIT).
7117 (InsetInset(size_type, Inset*)): changed to use InsetChar to
7118 insert the META_INSET.
7120 * sigc++/thread.cc (Privete<int>::operator int&): move definition
7122 * sigc++/thread.h (Threads): from here
7124 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
7125 definition out of line
7126 * sigc++/scope.h: from here
7128 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7130 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
7131 is specified (adapted from a patch from edscott <edscott@imp.mx>).
7133 * Makefile.am (bindist): new target.
7135 * INSTALL: add instructions for doing a binary distribution.
7137 * development/tools/README.bin.example: update a bit.
7139 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
7142 * lib/lyxrc.example: new lyxrc tag \set_color.
7144 * src/lyxfunc.C (Dispatch):
7145 * src/commandtags.h:
7146 * src/LyXAction.C: new lyxfunc "set-color".
7148 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
7149 and an x11name given as strings.
7151 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
7152 cache when a color is changed.
7154 2000-06-26 Juergen Vigna <jug@sad.it>
7156 * src/lyxrow.C (width): added this functions and variable.
7158 * src/insets/insetcite.C (create_form_citation_form): some Gravity
7161 * src/text.C (SetHeightOfRow): fixed calcualting of width.
7163 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7165 * images/undo_bw.xpm: new icon.
7166 * images/redo_bw.xpm: ditto.
7168 * configure.in (INSTALL_SCRIPT): change value to
7169 ${INSTALL} to avoid failures of install-script target.
7170 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
7172 * src/BufferView.h: add a magic "friend" declaration to please
7175 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
7177 * forms/cite.fd: modified to allow resizing without messing
7180 * src/insetcite.C: Uses code from cite.fd almost without
7182 User can now resize dialog in the x-direction.
7183 Resizing the dialog in the y-direction is prevented, as the
7184 code does this intelligently already.
7186 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7188 * INSTALL: remove obsolete entry in "problems" section.
7190 * lib/examples/sl_*.lyx: update of the slovenian examples.
7192 * src/support/FileInfo.[Ch] (getBlockSize): remove.
7194 2000-06-23 Juergen Vigna <jug@sad.it>
7196 * src/lyxtext.h: added a 'cleared' flag to draw() function.
7198 * src/buffer.C (resize): delete the LyXText of textinsets.
7200 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
7202 * src/insets/lyxinset.h: added another parameter 'cleared' to
7203 the draw() function.
7205 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
7206 unlocking inset in inset.
7208 2000-06-22 Juergen Vigna <jug@sad.it>
7210 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
7211 of insets and moved first to LyXText.
7213 * src/mathed/formulamacro.[Ch]:
7214 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
7216 2000-06-21 Juergen Vigna <jug@sad.it>
7218 * src/text.C (GetVisibleRow): look if I should clear the area or not
7219 using Inset::doClearArea() function.
7221 * src/insets/lyxinset.h: added doClearArea() function and
7222 modified draw(Painter &, ...) to draw(BufferView *, ...)
7224 * src/text2.C (UpdateInset): return bool insted of int
7226 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
7228 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
7229 combox in the character popup
7231 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
7232 BufferParams const & params
7234 2000-06-20 Juergen Vigna <jug@sad.it>
7236 * src/insets/insettext.C (SetParagraphData): set insetowner on
7239 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7241 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
7242 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
7244 (form_main_): remove
7246 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
7247 (create_form_form_main): remove FD_form_main stuff, connect to
7248 autosave_timeout signal
7250 * src/LyXView.[Ch] (getMainForm): remove
7251 (UpdateTimerCB): remove
7252 * src/BufferView_pimpl.h: inherit from SigC::Object
7254 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
7255 signal instead of callback
7257 * src/BufferView.[Ch] (cursorToggleCB): remove
7259 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7261 * src/BufferView_pimpl.C: changes because of the one below
7263 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
7264 instead of storing a pointer to a LyXText.
7266 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
7268 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
7270 * src/lyxparagraph.h
7272 * src/paragraph.C: Changed fontlist to a sorted vector.
7274 2000-06-19 Juergen Vigna <jug@sad.it>
7276 * src/BufferView.h: added screen() function.
7278 * src/insets/insettext.C (LocalDispatch): some selection code
7281 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
7283 * src/insets/insettext.C (SetParagraphData):
7285 (InsetText): fixes for multiple paragraphs.
7287 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
7289 * development/lyx.spec.in: Call configure with ``--without-warnings''
7290 to work around a bug with the Makefiles when doing ``make lyxrpm''.
7291 This should be fine, however, since we generally don't want to be
7292 verbose when making an RPM.
7294 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
7296 * lib/scripts/fig2pstex.py: New file
7298 2000-06-16 Juergen Vigna <jug@sad.it>
7300 * src/insets/insettabular.C (UpdateLocal):
7301 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
7302 (LocalDispatch): Changed all functions to use LyXText.
7304 2000-06-15 Juergen Vigna <jug@sad.it>
7306 * src/text.C (SetHeightOfRow): call inset::update before requesting
7309 * src/insets/insettext.C (update):
7310 * src/insets/insettabular.C (update): added implementation
7312 * src/insets/lyxinset.h: added update function
7314 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7316 * src/text.C (SelectNextWord): protect against null pointers with
7317 old-style string streams. (fix from Paul Theo Gonciari
7320 * src/cite.[Ch]: remove erroneous files.
7322 * lib/configure.m4: update the list of created directories.
7324 * src/lyxrow.C: include <config.h>
7325 * src/lyxcursor.C: ditto.
7327 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7329 * lib/examples/decimal.lyx: new example file from Mike.
7331 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
7332 to find template definitions (from Dekel)
7334 * src/frontends/.cvsignore: add a few things.
7336 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7338 * src/Timeout.C (TimeOut): remove default argument.
7340 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7343 * src/insets/ExternalTemplate.C: add a "using" directive.
7345 * src/lyx_main.h: remove the act_ struct, which seems unused
7348 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7350 * LyX Developers Meeting: All files changed, due to random C++ (by
7351 coincidence) code generator script.
7353 - external inset (cool!)
7354 - initial online editing of preferences
7355 - insettabular breaks insettext(s contents)
7357 - some DocBook fixes
7358 - example files update
7359 - other cool stuff, create a diff and look for yourself.
7361 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7363 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7364 -1 this is a non-line-breaking textinset.
7366 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7367 if there is no width set.
7369 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7371 * Lots of files: Merged the dialogbase branch.
7373 2000-06-09 Allan Rae <rae@lyx.org>
7375 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7376 and the Dispatch methods that used it.
7378 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7379 access to functions formerly kept in Dispatch.
7381 2000-05-19 Allan Rae <rae@lyx.org>
7383 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7384 made to_page and count_copies integers again. from_page remains a
7385 string however because I want to allow entry of a print range like
7386 "1,4,22-25" using this field.
7388 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7389 and printer-params-get. These aren't useful from the minibuffer but
7390 could be used by a script/LyXServer app provided it passes a suitable
7391 auto_mem_buffer. I guess I should take a look at how the LyXServer
7392 works and make it support xtl buffers.
7394 * sigc++/: updated to libsigc++-1.0.1
7396 * src/xtl/: updated to xtl-1.3.pl.11
7398 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7399 those changes done to the files in src/ are actually recreated when
7400 they get regenerated. Please don't ever accept a patch that changes a
7401 dialog unless that patch includes the changes to the corresponding *.fd
7404 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7405 stringOnlyContains, renamed it and generalised it.
7407 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7408 branch. Removed the remaining old form_print code.
7410 2000-04-26 Allan Rae <rae@lyx.org>
7412 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7413 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7415 2000-04-25 Allan Rae <rae@lyx.org>
7417 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7418 against a base of xtl-1.3.pl.4
7420 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7421 filter the Id: entries so they still show the xtl version number
7424 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7425 into the src/xtl code. Patch still pending with José (XTL)
7427 2000-04-24 Allan Rae <rae@lyx.org>
7429 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7430 both more generic and much safer. Use the new template functions.
7431 * src/buffer.[Ch] (Dispatch): ditto.
7433 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7434 and mem buffer more intelligently. Also a little general cleanup.
7437 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7438 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7439 * src/xtl/Makefile.am: ditto.
7440 * src/xtl/.cvsignore: ditto.
7441 * src/Makefile.am: ditto.
7443 * src/PrinterParams.h: Removed the macros member functions. Added a
7444 testInvariant member function. A bit of tidying up and commenting.
7445 Included Angus's idea for fixing operation with egcs-1.1.2.
7447 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7448 cool expansion of XTL's mem_buffer to support automatic memory
7449 management within the buffer itself. Removed the various macros and
7450 replaced them with template functions that use either auto_mem_buffer
7451 or mem_buffer depending on a #define. The mem_buffer support will
7452 disappear as soon as the auto_mem_buffer is confirmed to be good on
7453 other platforms/compilers. That is, it's there so you've got something
7456 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7457 effectively forked XTL. However I expect José will include my code
7458 into the next major release. Also fixed a memory leak.
7459 * src/xtl/text.h: ditto.
7460 * src/xtl/xdr.h: ditto.
7461 * src/xtl/giop.h: ditto.
7463 2000-04-16 Allan Rae <rae@lyx.org>
7465 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7466 by autogen.sh and removed by maintainer-clean anyway.
7467 * .cvsignore, sigc++/.cvsignore: Support the above.
7469 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7471 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7473 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7474 macros, renamed static callback-target member functions to suit new
7475 scheme and made them public.
7476 * src/frontends/xforms/forms/form_print.fd: ditto.
7477 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7479 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7482 * src/xtl/: New directory containing a minimal distribution of XTL.
7483 This is XTL-1.3.pl.4.
7485 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7487 2000-04-15 Allan Rae <rae@lyx.org>
7489 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7491 * sigc++/: Updated to libsigc++-1.0.0
7493 2000-04-14 Allan Rae <rae@lyx.org>
7495 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7496 use the generic ones in future. I'll modify my conversion script.
7498 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7500 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7501 (CloseAllBufferRelatedDialogs): Renamed.
7502 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7504 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7505 of the generic ones. These are the same ones my conversion script
7508 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7509 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7510 * src/buffer.C (Dispatch): ditto
7512 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7513 functions for updating and hiding buffer dependent dialogs.
7514 * src/BufferView.C (buffer): ditto
7515 * src/buffer.C (setReadonly): ditto
7516 * src/lyxfunc.C (CloseBuffer): ditto
7518 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7519 Dialogs.h, and hence all the SigC stuff, into every file that includes
7520 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7522 * src/BufferView2.C: reduce the number of headers included by buffer.h
7524 2000-04-11 Allan Rae <rae@lyx.org>
7526 * src/frontends/xforms/xform_macros.h: A small collection of macros
7527 for building C callbacks.
7529 * src/frontends/xforms/Makefile.am: Added above file.
7531 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7532 scheme again. This time it should work for JMarc. If this is
7533 successful I'll revise my conversion script to automate some of this.
7534 The static member functions in the class also have to be public for
7535 this scheme will work. If the scheme works (it's almost identical to
7536 the way BufferView::cursorToggleCB is handled so it should work) then
7537 FormCopyright and FormPrint will be ready for inclusion into the main
7538 trunk immediately after 1.1.5 is released -- provided we're prepared
7539 for complaints about lame compilers not handling XTL.
7541 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7543 2000-04-07 Allan Rae <rae@lyx.org>
7545 * config/lyxinclude.m4: A bit more tidying up (Angus)
7547 * src/LString.h: JMarc's <string> header fix
7549 * src/PrinterParams.h: Used string for most data to remove some
7550 ugly code in the Print dialog and avoid even uglier code when
7551 appending the ints to a string for output.
7553 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7554 and moved "default:" back to the end of switch statement. Cleaned
7555 up the printing so it uses the right function calls and so the
7556 "print to file" option actually puts the file in the right directory.
7558 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7560 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7561 and Ok+Apply button control into a separate method: input (Angus).
7562 (input) Cleaned it up and improved it to be very thorough now.
7563 (All CB) static_cast used instead of C style cast (Angus). This will
7564 probably change again once we've worked out how to keep gcc-2.8.1 happy
7565 with real C callbacks.
7566 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7567 ignore some of the bool settings and has random numbers instead. Needs
7568 some more investigation. Added other input length checks and checking
7569 of file and printer names.
7571 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7572 would link (Angus). Seems the old code doesn't compile with the pragma
7573 statement either. Separated callback entries from internal methods.
7575 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7577 2000-03-17 Allan Rae <rae@lyx.org>
7579 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7580 need it? Maybe it could go in Dialogs instead? I could make it a
7581 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7582 values to get the bool return value.
7583 (Dispatch): New overloaded method for xtl support.
7585 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7586 extern "C" callback instead of static member functions. Hopefully,
7587 JMarc will be able to compile this. I haven't changed
7588 forms/form_copyright.fd yet. Breaking one of my own rules already.
7590 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7591 because they aren't useful from the minibuffer. Maybe a LyXServer
7592 might want a help message though?
7594 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7596 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7597 xtl which needs both rtti and exceptions.
7599 * src/support/Makefile.am:
7600 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7602 * src/frontends/xforms/input_validators.[ch]: input filters and
7603 validators. These conrol what keys are valid in input boxes.
7604 Use them and write some more. Much better idea than waiting till
7605 after the user has pressed Ok to say that the input fields don't make
7608 * src/frontends/xforms/Makefile.am:
7609 * src/frontends/xforms/forms/form_print.fd:
7610 * src/frontends/xforms/forms/makefile:
7611 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7612 new scheme. Still have to make sure I haven't missed anything from
7613 the current implementation.
7615 * src/Makefile.am, src/PrinterParams.h: New data store.
7617 * other files: Added a couple of copyright notices.
7619 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7621 * src/insets/insetbib.h: move Holder struct in public space.
7623 * src/frontends/include/DialogBase.h: use SigC:: only when
7624 SIGC_CXX_NAMESPACES is defined.
7625 * src/frontends/include/Dialogs.h: ditto.
7627 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7629 * src/frontends/xforms/FormCopyright.[Ch]: do not
7630 mention SigC:: explicitely.
7632 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7634 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7635 deals with testing KDE in main configure.in
7636 * configure.in: ditto.
7638 2000-02-22 Allan Rae <rae@lyx.org>
7640 * Lots of files: Merged from HEAD
7642 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7643 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7645 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7647 * sigc++/: new minidist.
7649 2000-02-14 Allan Rae <rae@lyx.org>
7651 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7653 2000-02-08 Juergen Vigna <jug@sad.it>
7655 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7656 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7658 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7659 for this port and so it is much easier for other people to port
7660 dialogs in a common development environment.
7662 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7663 the QT/KDE implementation.
7665 * src/frontends/kde/Dialogs.C:
7666 * src/frontends/kde/FormCopyright.C:
7667 * src/frontends/kde/FormCopyright.h:
7668 * src/frontends/kde/Makefile.am:
7669 * src/frontends/kde/formcopyrightdialog.C:
7670 * src/frontends/kde/formcopyrightdialog.h:
7671 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7672 for the kde support of the Copyright-Dialog.
7674 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7675 subdir-substitution instead of hardcoded 'xforms' as we now have also
7678 * src/frontends/include/DialogBase.h (Object): just commented the
7679 label after #endif (nasty warning and I don't like warnings ;)
7681 * src/main.C (main): added KApplication initialization if using
7684 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7685 For now only the KDE event-loop is added if frontend==kde.
7687 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7689 * configure.in: added support for the --with-frontend[=value] option
7691 * autogen.sh: added kde.m4 file to list of config-files
7693 * acconfig.h: added define for KDEGUI-support
7695 * config/kde.m4: added configuration functions for KDE-port
7697 * config/lyxinclude.m4: added --with-frontend[=value] option with
7698 support for xforms and KDE.
7700 2000-02-08 Allan Rae <rae@lyx.org>
7702 * all Makefile.am: Fixed up so the make targets dist, distclean,
7703 install and uninstall all work even if builddir != srcdir. Still
7704 have a new sigc++ minidist update to come.
7706 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7708 2000-02-01 Allan Rae <rae@lyx.org>
7710 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7711 Many mods to get builddir != srcdir working.
7713 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7714 for building on NT and so we can do the builddir != srcdir stuff.
7716 2000-01-30 Allan Rae <rae@lyx.org>
7718 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7719 This will stay in "rae" branch. We probably don't really need it in
7720 the main trunk as anyone who wants to help programming it should get
7721 a full library installed also. So they can check both included and
7722 system supplied library compilation.
7724 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7725 Added a 'mini' distribution of libsigc++. If you feel the urge to
7726 change something in these directories - Resist it. If you can't
7727 resist the urge then you should modify the following script and rebuild
7728 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7729 all happen. Still uses a hacked version of libsigc++'s configure.in.
7730 I'm quite happy with the results. I'm not sure the extra work to turn
7731 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7732 worth the trouble and would probably lead to extra maintenance
7734 I haven't tested the following important make targets: install, dist.
7735 Not ready for prime time but very close. Maybe 1.1.5.
7737 * development/tools/makeLyXsigc.sh: A shell script to automatically
7738 generate our mini-dist of libsigc++. It can only be used with a CVS
7739 checkout of libsigc++ not a tarball distribution. It's well commented.
7740 This will end up as part of the libsigc++ distribution so other apps
7741 can easily have an included mini-dist. If someone makes mods to the
7742 sigc++ subpackage without modifying this script to generate those
7743 changes I'll be very upset!
7745 * src/frontends/: Started the gui/system indep structure.
7747 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7748 to access the gui-indep dialogs are in this class. Much improved
7749 design compared to previous revision. Lars, please refrain from
7750 moving this header into src/ like you did with Popups.h last time.
7752 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7754 * src/frontends/xforms/: Started the gui-indep system with a single
7755 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7758 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7759 Here you'll find a very useful makefile and automated fdfix.sh that
7760 makes updating dailogs a no-brainer -- provided you follow the rules
7761 set out in the README. I'm thinking about adding another script to
7762 automatically generate skeleton code for a new dialog given just the
7765 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7766 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7767 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7769 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7771 * src/support/LSubstring.C (operator): simplify
7773 * src/lyxtext.h: removed bparams, use buffer_->params instead
7775 * src/lyxrow.h: make Row a real class, move all variables to
7776 private and use accessors.
7778 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7780 (isRightToLeftPar): ditto
7781 (ChangeLanguage): ditto
7782 (isMultiLingual): ditto
7785 (SimpleTeXOnePar): ditto
7786 (TeXEnvironment): ditto
7787 (GetEndLabel): ditto
7789 (SetOnlyLayout): ditto
7790 (BreakParagraph): ditto
7791 (BreakParagraphConservative): ditto
7792 (GetFontSettings): ditto
7794 (CopyIntoMinibuffer): ditto
7795 (CutIntoMinibuffer): ditto
7796 (PasteParagraph): ditto
7797 (SetPExtraType): ditto
7798 (UnsetPExtraType): ditto
7799 (DocBookContTableRows): ditto
7800 (SimpleDocBookOneTablePar): ditto
7802 (TeXFootnote): ditto
7803 (SimpleTeXOneTablePar): ditto
7804 (TeXContTableRows): ditto
7805 (SimpleTeXSpecialChars): ditto
7808 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7809 to private and use accessors.
7811 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7812 this, we did not use it anymore and has not been for ages. Just a
7813 waste of cpu cycles.
7815 * src/language.h: make Language a real class, move all variables
7816 to private and use accessors.
7818 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7819 (create_view): remove
7820 (update): some changes for new timer
7821 (cursorToggle): use new timer
7822 (beforeChange): change for new timer
7824 * src/BufferView.h (cursorToggleCB): removed last paramter because
7827 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7828 (cursorToggleCB): change because of new timer code
7830 * lib/CREDITS: updated own mailaddress
7832 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7834 * src/support/filetools.C (PutEnv): fix the code in case neither
7835 putenv() nor setenv() have been found.
7837 * INSTALL: mention the install-strip Makefile target.
7839 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7840 read-only documents.
7842 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7844 * lib/reLyX/configure.in (VERSION): avoid using a previously
7845 generated reLyX wrapper to find out $prefix.
7847 * lib/examples/eu_adibide_lyx-atua.lyx:
7848 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7849 translation of the Tutorial (Dooteo)
7851 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7853 * forms/cite.fd: new citation dialog
7855 * src/insetcite.[Ch]: the new citation dialog is moved into
7858 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7861 * src/insets/insetcommand.h: data members made private.
7863 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7865 * LyX 1.1.5 released
7867 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7869 * src/version.h (LYX_RELEASE): to 1.1.5
7871 * src/spellchecker.C (RunSpellChecker): return false if the
7872 spellchecker dies upon creation.
7874 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7876 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7877 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7881 * lib/CREDITS: update entry for Martin Vermeer.
7883 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7885 * src/text.C (draw): Draw foreign language bars at the bottom of
7886 the row instead of at the baseline.
7888 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7890 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7892 * lib/bind/de_menus.bind: updated
7894 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7896 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7898 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7900 * src/menus.C (Limit_string_length): New function
7901 (ShowTocMenu): Limit the number of items/length of items in the
7904 * src/paragraph.C (String): Correct result for a paragraph inside
7907 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7909 * src/bufferlist.C (close): test of buf->getuser() == NULL
7911 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7913 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7914 Do not call to SetCursor when the paragraph is a closed footnote!
7916 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7918 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7921 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7923 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7926 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7927 reference popup, that activates the reference-back action
7929 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7931 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7932 the menus. Also fixed a bug.
7934 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7935 the math panels when switching buffers (unless new buffer is readonly).
7937 * src/BufferView.C (NoSavedPositions)
7938 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7940 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7942 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7943 less of dvi dirty or not.
7945 * src/trans_mgr.[Ch] (insert): change first parameter to string
7948 * src/chset.[Ch] (encodeString): add const to first parameter
7950 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7952 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7956 * src/LaTeX.C (deplog): better searching for dependency files in
7957 the latex log. Uses now regexps.
7959 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7960 instead of the box hack or \hfill.
7962 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7964 * src/lyxfunc.C (doImportHelper): do not create the file before
7965 doing the actual import.
7966 (doImportASCIIasLines): create a new file before doing the insert.
7967 (doImportASCIIasParagraphs): ditto.
7969 * lib/lyxrc.example: remove mention of non-existing commands
7971 * lyx.man: remove mention of color-related switches.
7973 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7975 * src/lyx_gui.C: remove all the color-related ressources, which
7976 are not used anymore.
7978 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7981 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7983 * src/lyxrc.C (read): Add a missing break in the switch
7985 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7987 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7989 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7992 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7994 * src/text.C (draw): draw bars under foreign language words.
7996 * src/LColor.[Ch]: add LColor::language
7998 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
8000 * src/lyxcursor.h (boundary): New member variable
8002 * src/text.C (IsBoundary): New methods
8004 * src/text.C: Use the above for currect cursor movement when there
8005 is both RTL & LTR text.
8007 * src/text2.C: ditto
8009 * src/bufferview_funcs.C (ToggleAndShow): ditto
8011 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8013 * src/text.C (DeleteLineForward): set selection to true to avoid
8014 that DeleteEmptyParagraphMechanism does some magic. This is how it
8015 is done in all other functions, and seems reasonable.
8016 (DeleteWordForward): do not jump over non-word stuff, since
8017 CursorRightOneWord() already does it.
8019 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
8020 DeleteWordBackward, since they seem safe to me (since selection is
8021 set to "true") DeleteEmptyParagraphMechanism does nothing.
8023 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8025 * src/lyx_main.C (easyParse): simplify the code by factoring the
8026 part that removes parameters from the command line.
8027 (LyX): check wether wrong command line options have been given.
8029 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
8031 * src/lyx_main.C : add support for specifying user LyX
8032 directory via command line option -userdir.
8034 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
8036 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
8037 the number of items per popup.
8038 (Add_to_refs_menu): Ditto.
8040 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8042 * src/lyxparagraph.h: renamed ClearParagraph() to
8043 StripLeadingSpaces() and moved it to paragraph.C. We pass the
8044 textclass as parameter, and do nothing if free_spacing is
8045 true. This fixes part of the line-delete-forward problems.
8047 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
8048 (pasteSelection): ditto.
8049 (SwitchLayoutsBetweenClasses): more translatable strings.
8051 * src/text2.C (CutSelection): use StripLeadingSpaces.
8052 (PasteSelection): ditto.
8053 (DeleteEmptyParagraphMechanism): ditto.
8055 2000-05-26 Juergen Vigna <jug@sad.it>
8057 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
8058 is not needed in tabular insets.
8060 * src/insets/insettabular.C (TabularFeatures): added missing features.
8062 * src/tabular.C (DeleteColumn):
8064 (AppendRow): implemented this functions
8065 (cellsturct::operator=): clone the inset too;
8067 2000-05-23 Juergen Vigna <jug@sad.it>
8069 * src/insets/insettabular.C (LocalDispatch): better selection support
8070 when having multicolumn-cells.
8072 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8074 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
8076 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8078 * src/ColorHandler.C (getGCForeground): put more test into _()
8080 * lib/examples/eu_splash.lyx: new file (Basque translation) from
8083 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
8086 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
8088 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
8089 there are no labels, or when buffer is readonly.
8091 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
8092 there are no labels, buffer is SGML, or when buffer is readonly.
8094 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8096 * src/LColor.C (LColor): change a couple of grey40 to grey60
8097 (LColor): rewore initalization to make compiles go some magnitude
8099 (getGUIName): don't use gettext until we need the string.
8101 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
8103 * src/Bullet.[Ch]: Fixed a small bug.
8105 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
8107 * src/paragraph.C (String): Several fixes/improvements
8109 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
8111 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8113 * src/paragraph.C (String): give more correct output.
8115 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
8117 * src/lyxfont.C (stateText) Do not output the language if it is
8118 eqaul to the language of the document.
8120 * src/paragraph.C (TeXOnePar): Do not put language switch commands
8121 between two paragraphs with the same language.
8123 * src/paragraph.C (getParLanguage) Return a correct answer for an
8124 empty dummy paragraph.
8126 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
8129 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
8132 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
8133 the menus/popup, if requested fonts are unavailable.
8135 2000-05-22 Juergen Vigna <jug@sad.it>
8137 * src/insets/insettabular.C (LocalDispatch): added some more cursor
8138 movement support (Up/Down/Tab/Shift-Tab).
8139 (LocalDispatch): added also preliminari cursor-selection.
8141 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
8143 * src/paragraph.C (PasteParagraph): Hopefully now right!
8145 2000-05-22 Garst R. Reese <reese@isn.net>
8147 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
8148 of list, change all references to Environment to Command
8149 * tex/hollywood.cls : rewrite environments as commands, add
8150 \uppercase to interiorshot and exteriorshot to force uppecase.
8151 * tex/broadway.cls : rewrite environments as commands. Tweak
8154 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8156 * src/menus.C (Add_to_toc_menu): fix the code which limits the
8157 size of items: use a constant intead of the hardcoded 40, and more
8158 importantly do not remove the %m and %x tags added at the end.
8159 (Add_to_refs_menu): use vector::size_type instead of
8160 unsigned int as basic types for the variables. _Please_ do not
8161 assume that size_t is equal to unsigned int. On an alpha, this is
8162 unsigned long, which is _not_ the same.
8164 * src/language.C (initL): remove language "hungarian", since it
8165 seems that "magyar" is better.
8167 2000-05-22 Juergen Vigna <jug@sad.it>
8169 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
8171 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
8174 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
8175 next was deleted but not set to 0.
8177 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8179 * src/language.C (initL): change the initialization of languages
8180 so that compiles goes _fast_.
8182 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
8185 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
8187 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8191 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8193 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
8195 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
8199 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
8202 * src/insets/insetlo*.[Ch]: Made editable
8204 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8206 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
8207 the current selection.
8209 * src/BufferView_pimpl.C (stuffClipboard): new method
8211 * src/BufferView.C (stuffClipboard): new method
8213 * src/paragraph.C (String): new method
8215 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
8216 LColor::ignore when lyxname is not found.
8218 * src/BufferView.C (pasteSelection): new method
8220 * src/BufferView_pimpl.C (pasteSelection): new method
8222 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
8224 * src/WorkArea.C (request_clipboard_cb): new static function
8225 (getClipboard): new method
8226 (putClipboard): new method
8228 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8230 * LyX 1.1.5pre2 released
8232 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8234 * src/vspace.C (operator=): removed
8235 (operator=): removed
8237 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
8239 * src/layout.C (NumberOfClass): manually set the type in make_pair
8240 (NumberOfLayout): ditto
8242 * src/language.C: use the Language constructor for ignore_lang
8244 * src/language.h: add constructors to struct Language
8246 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
8248 * src/text2.C (SetCursorIntern): comment out #warning
8250 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
8252 * src/mathed/math_iter.h: initialize sx and sw to 0
8254 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8256 * forms/lyx.fd: Redesign of form_ref
8258 * src/LaTeXFeatures.[Ch]
8262 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
8265 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
8266 and Buffer::inset_iterator.
8268 * src/menus.C: Added new menus: TOC and Refs.
8270 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
8272 * src/buffer.C (getTocList): New method.
8274 * src/BufferView2.C (ChangeRefs): New method.
8276 * src/buffer.C (getLabelList): New method. It replaces the old
8277 getReferenceList. The return type is vector<string> instead of
8280 * src/insets/insetinclude.C (getLabelList): New method. Replaces
8281 the old getLabel() and GetNumberOfLabels() methods.
8282 * src/insets/insetlabel.C (getLabelList): ditto
8283 * src/mathed/formula.C (getLabelList): ditto
8285 * src/paragraph.C (String): New method.
8287 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
8288 Uses the new getTocList() method.
8289 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
8290 which automatically updates the contents of the browser.
8291 (RefUpdateCB): Use the new getLabelList method.
8293 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
8295 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
8297 * src/spellchecker.C: Added using std::reverse;
8299 2000-05-19 Juergen Vigna <jug@sad.it>
8301 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
8303 * src/insets/insettext.C (computeTextRows): small fix for display of
8304 1 character after a newline.
8306 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
8309 2000-05-18 Juergen Vigna <jug@sad.it>
8311 * src/insets/insettabular.C (TabularFeatures): fixed update of display
8312 when changing width of column.
8314 * src/tabular.C (set_row_column_number_info): setting of
8315 autobreak rows if necessary.
8317 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8319 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
8321 * src/vc-backend.*: renamed stat() to status() and vcstat to
8322 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
8323 compilation broke. The new name seems more relevant, anyway.
8325 2000-05-17 Juergen Vigna <jug@sad.it>
8327 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
8328 which was wrong if the removing caused removing of rows!
8330 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
8331 (pushToken): new function.
8333 * src/text2.C (CutSelection): fix problem discovered with purify
8335 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8337 * src/debug.C (showTags): enlarge the first column, now that we
8338 have 6-digits debug codes.
8340 * lib/layouts/hollywood.layout:
8341 * lib/tex/hollywood.cls:
8342 * lib/tex/brodway.cls:
8343 * lib/layouts/brodway.layout: more commands and fewer
8344 environments. Preambles moved in the .cls files. Broadway now has
8345 more options on scene numbering and less whitespace (from Garst)
8347 * src/insets/insetbib.C (getKeys): make sure that we are in the
8348 document directory, in case the bib file is there.
8350 * src/insets/insetbib.C (Latex): revert bogus change.
8352 2000-05-16 Juergen Vigna <jug@sad.it>
8354 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8355 the TabularLayout on cursor move.
8357 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8359 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8362 (draw): fixed cursor position and drawing so that the cursor is
8363 visible when before the tabular-inset.
8365 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8366 when creating from old insettext.
8368 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8370 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8372 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8373 * lib/tex/brodway.cls: ditto
8375 * lib/layouts/brodway.layout: change alignment of parenthical
8378 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8380 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8381 versions 0.88 and 0.89 are supported.
8383 2000-05-15 Juergen Vigna <jug@sad.it>
8385 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8388 * src/insets/insettext.C (computeTextRows): redone completely this
8389 function in a much cleaner way, because of problems when having a
8391 (draw): added a frame border when the inset is locked.
8392 (SetDrawLockedFrame): this sets if we draw the border or not.
8393 (SetFrameColor): this sets the frame color (default=insetframe).
8395 * src/insets/lyxinset.h: added x() and y() functions which return
8396 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8397 function which is needed to see if we have a locking inset of some
8398 type in this inset (needed for now in insettabular).
8400 * src/vspace.C (inPixels): the same function also without a BufferView
8401 parameter as so it is easier to use it in some ocasions.
8403 * src/lyxfunc.C: changed all places where insertInset was used so
8404 that now if it couldn't be inserted it is deleted!
8406 * src/TabularLayout.C:
8407 * src/TableLayout.C: added support for new tabular-inset!
8409 * src/BufferView2.C (insertInset): this now returns a bool if the
8410 inset was really inserted!!!
8412 * src/tabular.C (GetLastCellInRow):
8413 (GetFirstCellInRow): new helper functions.
8414 (Latex): implemented for new tabular class.
8418 (TeXTopHLine): new Latex() helper functions.
8420 2000-05-12 Juergen Vigna <jug@sad.it>
8422 * src/mathed/formulamacro.C (Read):
8423 * src/mathed/formula.C (Read): read also the \end_inset here!
8425 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8427 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8428 crush when saving formulae with unbalanced parenthesis.
8430 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8432 * src/layout.C: Add new keyword "endlabelstring" to layout file
8434 * src/text.C (GetVisibleRow): Draw endlabel string.
8436 * lib/layouts/broadway.layout
8437 * lib/layouts/hollywood.layout: Added endlabel for the
8438 Parenthetical layout.
8440 * lib/layouts/heb-article.layout: Do not use slanted font shape
8441 for Theorem like environments.
8443 * src/buffer.C (makeLaTeXFile): Always add "american" to
8444 the UsedLanguages list if document language is RTL.
8446 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8448 * add addendum to README.OS2 and small patch (from SMiyata)
8450 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8452 * many files: correct the calls to ChangeExtension().
8454 * src/support/filetools.C (ChangeExtension): remove the no_path
8455 argument, which does not belong there. Use OnlyFileName() instead.
8457 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8458 files when LaTeXing a non-nice latex file.
8460 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8461 a chain of "if". Return false when deadkeys are not handled.
8463 * src/lyx_main.C (LyX): adapted the code for default bindings.
8465 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8466 bindings for basic functionality (except deadkeys).
8467 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8469 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8470 several methods: handle override_x_deadkeys.
8472 * src/lyxrc.h: remove the "bindings" map, which did not make much
8473 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8475 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8477 * src/lyxfont.C (stateText): use a saner method to determine
8478 whether the font is "default". Seems to fix the crash with DEC
8481 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8483 2000-05-08 Juergen Vigna <jug@sad.it>
8485 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8486 TabularLayoutMenu with mouse-button-3
8487 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8489 * src/TabularLayout.C: added this file for having a Layout for
8492 2000-05-05 Juergen Vigna <jug@sad.it>
8494 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8495 recalculating inset-widths.
8496 (TabularFeatures): activated this function so that I can change
8497 tabular-features via menu.
8499 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8500 that I can test some functions with the Table menu.
8502 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8504 * src/lyxfont.C (stateText): guard against stupid c++libs.
8506 * src/tabular.C: add using std::vector
8507 some whitespace changes, + removed som autogenerated code.
8509 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8511 2000-05-05 Juergen Vigna <jug@sad.it>
8513 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8514 row, columns and cellstructures.
8516 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8518 * lib/lyxrc.example: remove obsolete entries.
8520 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8521 reading of protected_separator for free_spacing.
8523 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8525 * src/text.C (draw): do not display an exclamation mark in the
8526 margin for margin notes. This is confusing, ugly and
8529 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8530 AMS math' is checked.
8532 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8533 name to see whether including the amsmath package is needed.
8535 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8537 * src/paragraph.C (validate): Compute UsedLanguages correctly
8538 (don't insert the american language if it doesn't appear in the
8541 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8542 The argument of \thanks{} command is considered moving argument
8544 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8547 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8549 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8550 for appendix/minipage/depth. The lines can be now both in the footnote
8551 frame, and outside the frame.
8553 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8556 2000-05-05 Juergen Vigna <jug@sad.it>
8558 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8559 neede only in tabular.[Ch].
8561 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8563 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8565 (Write): write '~' for PROTECTED_SEPARATOR
8567 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8569 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8572 * src/mathed/formula.C (drawStr): rename size to siz.
8574 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8575 possibly fix a bug by not changing the pflags = flags to piflags =
8578 2000-05-05 Juergen Vigna <jug@sad.it>
8580 * src/insets/insetbib.C: moved using directive
8582 * src/ImportNoweb.C: small fix for being able to compile (missing
8585 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8587 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8588 to use clear, since we don't depend on this in the code. Add test
8591 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8593 * (various *.C files): add using std::foo directives to please dec
8596 * replace calls to string::clear() to string::erase() (Angus)
8598 * src/cheaders/cmath: modified to provide std::abs.
8600 2000-05-04 Juergen Vigna <jug@sad.it>
8602 * src/insets/insettext.C: Prepared all for inserting of multiple
8603 paragraphs. Still display stuff to do (alignment and other things),
8604 but I would like to use LyXText to do this when we cleaned out the
8605 table-support stuff.
8607 * src/insets/insettabular.C: Changed lot of stuff and added lots
8608 of functionality still a lot to do.
8610 * src/tabular.C: Various functions changed name and moved to be
8611 const functions. Added new Read and Write functions and changed
8612 lots of things so it works good with tabular-insets (also removed
8613 some stuff which is not needed anymore * hacks *).
8615 * src/lyxcursor.h: added operators == and != which just look if
8616 par and pos are (not) equal.
8618 * src/buffer.C (latexParagraphs): inserted this function to latex
8619 all paragraphs form par to endpar as then I can use this too for
8622 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8623 so that I can call this to from text insets with their own cursor.
8625 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8626 output off all paragraphs (because of the fix below)!
8628 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8629 the very last paragraph (this could be also the last paragraph of an
8632 * src/texrow.h: added rows() call which returns the count-variable.
8634 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8636 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8638 * lib/configure.m4: better autodetection of DocBook tools.
8640 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8642 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8644 * src/lyx_cb.C: add using std::reverse;
8646 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8649 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8650 selected files. Should fix repeated errors from generated files.
8652 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8654 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8656 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8657 the spellchecker popup.
8659 * lib/lyxrc.example: Removed the \number_inset section
8661 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8663 * src/insets/figinset.C (various): Use IsFileReadable() to make
8664 sure that the file actually exist. Relying on ghostscripts errors
8665 is a bad idea since they can lead to X server crashes.
8667 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8669 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8672 * lib/lyxrc.example: smallish typo in description of
8673 \view_dvi_paper_option
8675 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8678 * src/lyxfunc.C: doImportHelper to factor out common code of the
8679 various import methods. New functions doImportASCIIasLines,
8680 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8681 doImportLinuxDoc for the format specific parts.
8684 * buffer.C: Dispatch returns now a bool to indicate success
8687 * lyx_gui.C: Add getLyXView() for member access
8689 * lyx_main.C: Change logic for batch commands: First try
8690 Buffer::Dispatch (possibly without GUI), if that fails, use
8693 * lyx_main.C: Add support for --import command line switch.
8694 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8695 Available Formats: Everything accepted by 'buffer-import <format>'
8697 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8699 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8702 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8703 documents will be reformatted upon reentry.
8705 2000-04-27 Juergen Vigna <jug@sad.it>
8707 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8708 correctly only last pos this was a bug.
8710 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8712 * release of lyx-1.1.5pre1
8714 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8716 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8718 * src/menus.C: revert the change of naming (Figure->Graphic...)
8719 from 2000-04-11. It was incomplete and bad.
8721 * src/LColor.[Ch]: add LColor::depthbar.
8722 * src/text.C (GetVisibleRow): use it.
8724 * README: update the languages list.
8726 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8728 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8731 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8733 * README: remove sections that were just wrong.
8735 * src/text2.C (GetRowNearY): remove currentrow code
8737 * src/text.C (GetRow): remove currentrow code
8739 * src/screen.C (Update): rewritten a bit.
8740 (SmallUpdate): removed func
8742 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8744 (FullRebreak): return bool
8745 (currentrow): remove var
8746 (currentrow_y): ditto
8748 * src/lyxscreen.h (Draw): change arg to unsigned long
8749 (FitCursor): return bool
8750 (FitManualCursor): ditto
8751 (Smallpdate): remove func
8752 (first): change to unsigned long
8753 (DrawOneRow): change second arg to long (from long &)
8754 (screen_refresh_y): remove var
8755 (scree_refresh_row): ditto
8757 * src/lyxrow.h: change baseline to usigned int from unsigned
8758 short, this brings some implicit/unsigned issues out in the open.
8760 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8762 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8763 instead of smallUpdate.
8765 * src/lyxcursor.h: change y to unsigned long
8767 * src/buffer.h: don't call updateScrollbar after fitcursor
8769 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8770 where they are used. Removed "\\direction", this was not present
8771 in 1.1.4 and is already obsolete. Commented out some code that I
8772 believe to never be called.
8773 (runLiterate): don't call updateScrollbar after fitCursor
8775 (buildProgram): ditto
8778 * src/WorkArea.h (workWidth): change return val to unsigned
8781 (redraw): remove the button redraws
8782 (setScrollbarValue): change for scrollbar
8783 (getScrollbarValue): change for scrollbar
8784 (getScrollbarBounds): change for scrollbar
8786 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8787 (C_WorkArea_down_cb): removed func
8788 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8789 (resize): change for scrollbar
8790 (setScrollbar): ditto
8791 (setScrollbarBounds): ditto
8792 (setScrollbarIncrements): ditto
8793 (up_cb): removed func
8794 (down_cb): removed func
8795 (scroll_cb): change for scrollbar
8796 (work_area_handler): ditto
8798 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8799 when FitCursor did something.
8800 (updateScrollbar): some unsigned changes
8801 (downCB): removed func
8802 (scrollUpOnePage): removed func
8803 (scrollDownOnePage): remvoed func
8804 (workAreaMotionNotify): don't call screen->FitCursor but use
8805 fitCursor instead. and bool return val
8806 (workAreaButtonPress): ditto
8807 (workAreaButtonRelease): some unsigned changes
8808 (checkInsetHit): ditto
8809 (workAreaExpose): ditto
8810 (update): parts rewritten, comments about the signed char arg added
8811 (smallUpdate): removed func
8812 (cursorPrevious): call needed updateScrollbar
8815 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8818 * src/BufferView.[Ch] (upCB): removed func
8819 (downCB): removed func
8820 (smallUpdate): removed func
8822 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8824 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8825 currentrow, currentrow_y optimization. This did not help a lot and
8826 if we want to do this kind of optimization we should rather use
8827 cursor.row instead of the currentrow.
8829 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8830 buffer spacing and klyx spacing support.
8832 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8834 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8837 2000-04-26 Juergen Vigna <jug@sad.it>
8839 * src/insets/figinset.C: fixes to Lars sstream changes!
8841 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8843 * A lot of files: Added Ascii(ostream &) methods to all inset
8844 classes. Used when exporting to ASCII.
8846 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8847 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8850 * src/text2.C (ToggleFree): Disabled implicit word selection when
8851 there is a change in the language
8853 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8854 no output was generated for end-of-sentence inset.
8856 * src/insets/lyxinset.h
8859 * src/paragraph.C: Removed the insetnumber code
8861 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8863 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8865 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8866 no_babel and no_epsfig completely from the file.
8867 (parseSingleLyXformat2Token): add handling for per-paragraph
8868 spacing as written by klyx.
8870 * src/insets/figinset.C: applied patch by Andre. Made it work with
8873 2000-04-20 Juergen Vigna <jug@sad.it>
8875 * src/insets/insettext.C (cutSelection):
8876 (copySelection): Fixed with selection from right to left.
8877 (draw): now the rows are not recalculated at every draw.
8878 (computeTextRows): for now reset the inset-owner here (this is
8879 important for an undo or copy where the inset-owner is not set
8882 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8883 motion to the_locking_inset screen->first was forgotten, this was
8884 not important till we got multiline insets.
8886 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8888 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8889 code seems to be alright (it is code changed by Dekel, and the
8890 intent is indeed that all macros should be defined \protect'ed)
8892 * NEWS: a bit of reorganisation of the new user-visible features.
8894 2000-04-19 Juergen Vigna <jug@sad.it>
8896 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8897 position. Set the inset_owner of the used paragraph so that it knows
8898 that it is inside an inset. Fixed cursor handling with mouse and
8899 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8900 and cleanups to make TextInsets work better.
8902 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8903 Changed parameters of various functions and added LockInsetInInset().
8905 * src/insets/insettext.C:
8907 * src/insets/insetcollapsable.h:
8908 * src/insets/insetcollapsable.C:
8909 * src/insets/insetfoot.h:
8910 * src/insets/insetfoot.C:
8911 * src/insets/insetert.h:
8912 * src/insets/insetert.C: cleaned up the code so that it works now
8913 correctly with insettext.
8915 * src/insets/inset.C:
8916 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8917 that insets in insets are supported right.
8920 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8922 * src/paragraph.C: some small fixes
8924 * src/debug.h: inserted INSETS debug info
8926 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8927 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8929 * src/commandtags.h:
8930 * src/LyXAction.C: insert code for InsetTabular.
8932 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8933 not Button1MotionMask.
8934 (workAreaButtonRelease): send always a InsetButtonRelease event to
8936 (checkInsetHit): some setCursor fixes (always with insets).
8938 * src/BufferView2.C (lockInset): returns a bool now and extended for
8939 locking insets inside insets.
8940 (showLockedInsetCursor): it is important to have the cursor always
8941 before the locked inset.
8942 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8944 * src/BufferView.h: made lockInset return a bool.
8946 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8948 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8949 that is used also internally but can be called as public to have back
8950 a cursor pos which is not set internally.
8951 (SetCursorIntern): Changed to use above function.
8953 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8955 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8960 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8961 patches for things that should be in or should be changed.
8963 * src/* [insetfiles]: change "usigned char fragile" to bool
8964 fragile. There was only one point that could that be questioned
8965 and that is commented in formulamacro.C. Grep for "CHECK".
8967 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8968 (DeleteBuffer): take it out of CutAndPaste and make it static.
8970 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8972 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8973 output the spacing envir commands. Also the new commands used in
8974 the LaTeX output makes the result better.
8976 * src/Spacing.C (writeEnvirBegin): new method
8977 (writeEnvirEnd): new method
8979 2000-04-18 Juergen Vigna <jug@sad.it>
8981 * src/CutAndPaste.C: made textclass a static member of the class
8982 as otherwise it is not accesed right!!!
8984 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8986 * forms/layout_forms.fd
8987 * src/layout_forms.h
8988 * src/layout_forms.C (create_form_form_character)
8989 * src/lyx_cb.C (UserFreeFont)
8990 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8991 documents (in the layout->character popup).
8993 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8995 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8996 \spell_command was in fact not honored (from Kevin Atkinson).
8998 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
9001 * src/lyx_gui.h: make lyxViews private (Angus)
9003 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
9005 * src/mathed/math_write.C
9006 (MathMatrixInset::Write) Put \protect before \begin{array} and
9007 \end{array} if fragile
9008 (MathParInset::Write): Put \protect before \\ if fragile
9010 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9012 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
9013 initialization if the LyXColorHandler must be done after the
9014 connections to the XServer has been established.
9016 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
9017 get the background pixel from the lyxColorhandler so that the
9018 figures are rendered with the correct background color.
9019 (NextToken): removed functions.
9020 (GetPSSizes): use ifs >> string instead of NextToken.
9022 * src/Painter.[Ch]: the color cache moved out of this file.
9024 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
9027 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9029 * src/WorkArea.C (work_area_handler): call BufferView::enterView
9030 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
9032 * src/BufferView.C (enterView): new func
9033 (leaveView): new func
9035 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
9037 (leaveView): new func, undefines xterm cursor when approp.
9039 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
9040 (AllowInput): delete the Workarea cursor handling from this func.
9042 * src/Painter.C (underline): draw a slimer underline in most cases.
9044 * src/lyx_main.C (error_handler): use extern "C"
9046 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9048 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
9049 sent directly to me.
9051 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
9052 to the list by Dekel.
9054 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
9057 * src/bufferview_funcs.[Ch]: two new files, moved several of the
9058 methods from lyx_cb.here.
9060 * src/lyx_cb.C: in addition to the above; removed input_prohibited
9063 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9065 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
9066 instead of using current_view directly.
9068 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
9070 * src/LyXAction.C (init): add the paragraph-spacing command.
9072 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
9074 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
9076 * src/lyx_cb.C (CurrentState): output a string when the spacing is
9077 different from the documents.
9079 * src/text.C (SetHeightOfRow): take paragraph spacing into
9080 account, paragraph spacing takes precedence over buffer spacing
9081 (GetVisibleRow): ditto
9083 * src/paragraph.C (writeFile): output the spacing parameter too.
9084 (validate): set the correct features if spacing is used in the
9086 (Clear): set spacing to default
9087 (MakeSameLayout): spacing too
9088 (HasSameLayout): spacing too
9089 (SetLayout): spacing too
9090 (TeXOnePar): output the spacing commands
9092 * src/lyxparagraph.h: added a spacing variable for use with
9093 per-paragraph spacing.
9095 * src/Spacing.h: add a Default spacing and a method to check if
9096 the current spacing is default. also added an operator==
9098 * src/text2.C (DeleteEmptyParagraphMechanism): added a
9101 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9103 * src/lyxserver.C (callback): fix dispatch of functions
9105 * src/insets/insetlatexaccent.C (checkContents): turn bogus
9106 printf() into lyxerr call.
9108 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
9111 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
9112 "Table" to "Table Box", "Float" to "Floating Material"; deletes
9113 the "Float" from each of the subitems.
9114 (ShowHelpMenu): add entry for "FAQ" and "TOC".
9116 * src/support/DebugStream.h: add an #ifdef to work around a gcc
9117 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
9118 documented the change so that the workaround can be nuked later.
9120 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
9123 * src/lyxlex_pimpl.C (next): do not re-declare the default value
9125 * src/buffer.C (getLatexName): ditto
9126 (setReadonly): ditto
9128 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9130 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
9131 avoid some uses of current_view. Added also a bufferParams()
9132 method to get at this.
9134 * src/lyxtext.h: changed params->buffer and paramters->bparams.
9136 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9138 * src/lyxparagraph.[Ch]: removed
9139 operator<(LyXParagraph::InsetTable..., added a struct matchIT
9140 with operators used by lower_bound and
9141 upper_bound in InsetTable's
9142 Make struct InsetTable private again. Used matchpos.
9144 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
9146 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
9147 document, the language of existing text is changed (unless the
9148 document is multi-lingual)
9150 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
9152 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
9154 * A lot of files: A rewrite of the Right-to-Left support.
9156 2000-04-10 Juergen Vigna <jug@sad.it>
9158 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
9159 misplaced cursor when inset in inset is locked.
9161 * src/insets/insettext.C (LocalDispatch): small fix so that a
9162 BREAKLINE is not inserted if we don't permit it with autBreakRows.
9164 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
9165 footnote font should be decreased in size twice when displaying.
9167 * src/insets/insettext.C (GetDrawFont): inserted this function as
9168 the drawing-font may differ from the real paragraph font.
9170 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
9171 insets (inset in inset!).
9173 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
9174 function here because we don't want footnotes inside footnotes.
9176 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
9178 (init): now set the inset_owner in paragraph.C
9179 (LocalDispatch): added some resetPos() in the right position
9182 (pasteSelection): changed to use the new CutAndPaste-Class.
9184 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
9185 which tells if it is allowed to insert another inset inside this one.
9187 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
9188 SwitchLayoutsBetweenClasses.
9190 * src/text2.C (InsertInset): checking of the new paragraph-function
9192 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
9193 is not needed anymore here!
9196 (PasteSelection): redone (also with #ifdef) so that now this uses
9197 the CutAndPaste-Class.
9198 (SwitchLayoutsBetweenClasses): removed here and implemented in the
9201 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
9202 from/to text/insets.
9204 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
9205 so that the paragraph knows if it is inside an (text)-inset.
9206 (InsertFromMinibuffer): changed return-value to bool as now it
9207 may happen that an inset is not inserted in the paragraph.
9208 (InsertInsetAllowed): this checks if it is allowed to insert an
9209 inset in this paragraph.
9211 (BreakParagraphConservative):
9212 (BreakParagraph) : small change for the above change of the return
9213 value of InsertFromMinibuffer.
9215 * src/lyxparagraph.h: added inset_owner and the functions to handle
9216 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
9218 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9220 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
9221 functions from BufferView to BufferView::Pimpl to ease maintence.
9223 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
9224 correctly. Also use SetCursorIntern instead of SetCursor.
9226 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
9229 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9231 * src/WorkArea.C (belowMouse): manually implement below mouse.
9233 * src/*: Add "explicit" on several constructors, I added probably
9234 some unneeded ones. A couple of changes to code because of this.
9236 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
9237 implementation and private parts from the users of BufferView. Not
9240 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
9241 implementation and private parts from the users of LyXLex. Not
9244 * src/BufferView_pimpl.[Ch]: new files
9246 * src/lyxlex_pimpl.[Ch]: new files
9248 * src/LyXView.[Ch]: some inline functions move out-of-line
9250 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9252 * src/lyxparagraph.h: make struct InsetTable public.
9254 * src/support/lyxstring.h: change lyxstring::difference_type to be
9255 ptrdiff_t. Add std:: modifiers to streams.
9257 * src/font.C: include the <cctype> header, for islower() and
9260 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9262 * src/font.[Ch]: new files. Contains the metric functions for
9263 fonts, takes a LyXFont as parameter. Better separation of concepts.
9265 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
9266 changes because of this.
9268 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
9270 * src/*: compile with -Winline and move functions that don't
9273 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
9276 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9278 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
9279 (various files changed because of this)
9281 * src/Painter.C (text): fixed the drawing of smallcaps.
9283 * src/lyxfont.[Ch] (drawText): removed unused member func.
9286 * src/*.C: added needed "using" statements and "std::" qualifiers.
9288 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
9290 * src/*.h: removed all use of "using" from header files use
9291 qualifier std:: instead.
9293 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9295 * src/text.C (Backspace): some additional cleanups (we already
9296 know whether cursor.pos is 0 or not).
9298 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
9299 automake does not provide one).
9301 * src/bmtable.h: replace C++ comments with C comments.
9303 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
9305 * src/screen.C (ShowCursor): Change the shape of the cursor if
9306 the current language is not equal to the language of the document.
9307 (If the cursor change its shape unexpectedly, then you've found a bug)
9309 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
9312 * src/insets/insetnumber.[Ch]: New files.
9314 * src/LyXAction.C (init)
9315 * src/lyxfunc.C (dispatch): Add command number-inset-insert
9318 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
9320 * src/lyxparagraph.h
9321 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
9322 (the vector is kept sorted).
9324 * src/text.C (GetVisibleRow): Draw selection correctly when there
9325 is both LTR and RTL text.
9327 * src/paragraph.C (Clone): Use the assignment operator for cloning,
9328 which is much faster.
9330 * src/text.C (GetVisibleRow and other): Do not draw the last space
9331 in a row if the direction of the last letter is not equal to the
9332 direction of the paragraph.
9334 * src/lyxfont.C (latexWriteStartChanges):
9335 Check that font language is not equal to basefont language.
9336 (latexWriteEndChanges): ditto
9338 * src/lyx_cb.C (StyleReset): Don't change the language while using
9339 the font-default command.
9341 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9342 empty paragraph before a footnote.
9344 * src/insets/insetcommand.C (draw): Increase x correctly.
9346 * src/screen.C (ShowCursor): Change cursor shape if
9347 current language != document language.
9349 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9351 2000-03-31 Juergen Vigna <jug@sad.it>
9353 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9354 (Clone): changed mode how the paragraph-data is copied to the
9355 new clone-paragraph.
9357 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9358 GetInset(pos) with no inset anymore there (in inset UNDO)
9360 * src/insets/insetcommand.C (draw): small fix as here x is
9361 incremented not as much as width() returns (2 before, 2 behind = 4)
9363 2000-03-30 Juergen Vigna <jug@sad.it>
9365 * src/insets/insettext.C (InsetText): small fix in initialize
9366 widthOffset (should not be done in the init() function)
9368 2000-03-29 Amir Karger <karger@lyx.org>
9370 * lib/examples/it_ItemizeBullets.lyx: translation by
9373 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9375 2000-03-29 Juergen Vigna <jug@sad.it>
9377 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9379 * src/insets/insetfoot.C (Clone): small change as for the below
9380 new init function in the text-inset
9382 * src/insets/insettext.C (init): new function as I've seen that
9383 clone did not copy the Paragraph-Data!
9384 (LocalDispatch): Added code so that now we have some sort of Undo
9385 functionality (well actually we HAVE Undo ;)
9387 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9389 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9391 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9394 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9396 * src/main.C: added a runtime check that verifies that the xforms
9397 header used when building LyX and the library used when running
9398 LyX match. Exit with a message if they don't match. This is a
9399 version number check only.
9401 * src/buffer.C (save): Don't allocate memory on the heap for
9402 struct utimbuf times.
9404 * *: some using changes, use iosfwd instead of the real headers.
9406 * src/lyxfont.C use char const * instead of string for the static
9407 strings. Rewrite some functions to use sstream.
9409 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9411 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9414 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9416 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9417 of Geodesy (from Martin Vermeer)
9419 * lib/layouts/svjour.inc: include file for the Springer svjour
9420 class. It can be used to support journals other than JoG.
9422 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9423 Miskiewicz <misiek@pld.org.pl>)
9424 * lib/reLyX/Makefile.am: ditto.
9426 2000-03-27 Juergen Vigna <jug@sad.it>
9428 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9429 also some modifications with operations on selected text.
9431 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9432 problems with clicking on insets (last famous words ;)
9434 * src/insets/insetcommand.C (draw):
9435 (width): Changed to have a bit of space before and after the inset so
9436 that the blinking cursor can be seen (otherwise it was hidden)
9438 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9440 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9441 would not be added to the link list when an installed gettext (not
9442 part of libc) is found.
9444 2000-03-24 Juergen Vigna <jug@sad.it>
9446 * src/insets/insetcollapsable.C (Edit):
9447 * src/mathed/formula.C (InsetButtonRelease):
9448 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9451 * src/BufferView.C (workAreaButtonPress):
9452 (workAreaButtonRelease):
9453 (checkInsetHit): Finally fixed the clicking on insets be handled
9456 * src/insets/insetert.C (Edit): inserted this call so that ERT
9457 insets work always with LaTeX-font
9459 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9461 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9462 caused lyx to startup with no GUI in place, causing in a crash
9463 upon startup when called with arguments.
9465 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9467 * src/FontLoader.C: better initialization of dummyXFontStruct.
9469 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9471 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9472 for linuxdoc and docbook import and export format options.
9474 * lib/lyxrc.example Example of default values for the previous flags.
9476 * src/lyx_cb.C Use those flags instead of the hardwired values for
9477 linuxdoc and docbook export.
9479 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9482 * src/menus.C Added menus entries for the new import/exports formats.
9484 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9486 * src/lyxrc.*: Added support for running without Gui
9489 * src/FontLoader.C: sensible defaults if no fonts are needed
9491 * src/lyx_cb.C: New function ShowMessage (writes either to the
9492 minibuffer or cout in case of no gui
9493 New function AskOverwrite for common stuff
9494 Consequently various changes to call these functions
9496 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9497 wild guess at sensible screen resolution when having no gui
9499 * src/lyxfont.C: no gui, no fonts... set some defaults
9501 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9503 * src/LColor.C: made the command inset background a bit lighter.
9505 2000-03-20 Hartmut Goebel <goebel@noris.net>
9507 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9508 stdstruct.inc. Koma-Script added some title elements which
9509 otherwise have been listed below "bibliography". This split allows
9510 adding title elements to where they belong.
9512 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9513 define the additional title elements and then include
9516 * many other layout files: changed to include stdtitle.inc just
9517 before stdstruct.inc.
9519 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9521 * src/buffer.C: (save) Added the option to store all backup files
9522 in a single directory
9524 * src/lyxrc.[Ch]: Added variable \backupdir_path
9526 * lib/lyxrc.example: Added descriptions of recently added variables
9528 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9529 bibtex inset, not closing the bibtex popup when deleting the inset)
9531 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9533 * src/lyx_cb.C: add a couple using directives.
9535 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9536 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9537 import based on the filename.
9539 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9540 file would be imported at start, if the filename where of a sgml file.
9542 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9544 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9546 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9547 * src/lyxfont.h Replaced the member variable bits.direction by the
9548 member variable lang. Made many changes in other files.
9549 This allows having a multi-lingual document
9551 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9552 that change the current language to <l>.
9553 Removed the command "font-rtl"
9555 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9556 format for Hebrew documents)
9558 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9559 When auto_mathmode is "true", pressing a digit key in normal mode
9560 will cause entering into mathmode.
9561 If auto_mathmode is "rtl" then this behavior will be active only
9562 when writing right-to-left text.
9564 * src/text2.C (InsertStringA) The string is inserted using the
9567 * src/paragraph.C (GetEndLabel) Gives a correct result for
9568 footnote paragraphs.
9570 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9572 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9574 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9575 front of PasteParagraph. Never insert a ' '. This should at least
9576 fix some cause for the segfaults that we have been experiencing,
9577 it also fixes backspace behaviour slightly. (Phu!)
9579 * src/support/lstrings.C (compare_no_case): some change to make it
9580 compile with gcc 2.95.2 and stdlibc++-v3
9582 * src/text2.C (MeltFootnoteEnvironment): change type o
9583 first_footnote_par_is_not_empty to bool.
9585 * src/lyxparagraph.h: make text private. Changes in other files
9587 (fitToSize): new function
9588 (setContentsFromPar): new function
9589 (clearContents): new function
9590 (SetChar): new function
9592 * src/paragraph.C (readSimpleWholeFile): deleted.
9594 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9595 the file, just use a simple string instead. Also read the file in
9596 a more maintainable manner.
9598 * src/text2.C (InsertStringA): deleted.
9599 (InsertStringB): deleted.
9601 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9603 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9604 RedoParagraphs from the doublespace handling part, just set status
9605 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9606 done, but perhaps not like this.)
9608 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9610 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9611 character when inserting an inset.
9613 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9615 * src/bufferparams.C (readLanguage): now takes "default" into
9618 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9619 also initialize the toplevel_keymap with the default bindings from
9622 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9624 * all files using lyxrc: have lyxrc as a real variable and not a
9625 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9628 * src/lyxrc.C: remove double call to defaultKeyBindings
9630 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9631 toolbar defauls using lyxlex. Remove enums, structs, functions
9634 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9635 toolbar defaults. Also store default keybindings in a map.
9637 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9638 storing the toolbar defaults without any xforms dependencies.
9640 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9641 applied. Changed to use iterators.
9643 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9645 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9646 systems that don't have LINGUAS set to begin with.
9648 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9650 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9651 the list by Dekel Tsur.
9653 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9655 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9656 * src/insets/form_graphics.C: ditto.
9658 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9660 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9662 * src/bufferparams.C (readLanguage): use the new language map
9664 * src/intl.C (InitKeyMapper): use the new language map
9666 * src/lyx_gui.C (create_forms): use the new language map
9668 * src/language.[Ch]: New files. Used for holding the information
9669 about each language. Now! Use this new language map enhance it and
9670 make it really usable for our needs.
9672 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9674 * screen.C (ShowCursor): Removed duplicate code.
9675 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9676 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9678 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9681 * src/text.C Added TransformChar method. Used for rendering Arabic
9682 text correctly (change the glyphs of the letter according to the
9683 position in the word)
9688 * src/lyxrc.C Added lyxrc command {language_command_begin,
9689 language_command_end,language_command_ltr,language_command_rtl,
9690 language_package} which allows the use of either arabtex or Omega
9693 * src/lyx_gui.C (init)
9695 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9696 to use encoding for menu fonts which is different than the encoding
9699 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9700 do not load the babel package.
9701 To write an English document with Hebrew/Arabic, change the document
9702 language to "english".
9704 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9705 (alphaCounter): changed to return char
9706 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9708 * lib/lyxrc.example Added examples for Hebrew/Arabic
9711 * src/layout.C Added layout command endlabeltype
9713 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9715 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9717 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9719 * src/mathed/math_delim.C (search_deco): return a
9720 math_deco_struct* instead of index.
9722 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9724 * All files with a USE_OSTREAM_ONLY within: removed all code that
9725 was unused when USE_OSTREAM_ONLY is defined.
9727 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9728 of any less. Removed header and using.
9730 * src/text.C (GetVisibleRow): draw the string "Page Break
9731 (top/bottom)" on screen when drawing a pagebreak line.
9733 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9735 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9737 * src/mathed/math_macro.C (draw): do some cast magic.
9740 * src/mathed/math_defs.h: change byte* argument to byte const*.
9742 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9744 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9745 know it is right to return InsetFoot* too, but cxx does not like
9748 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9750 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9752 * src/mathed/math_delim.C: change == to proper assignment.
9754 2000-03-09 Juergen Vigna <jug@sad.it>
9756 * src/insets/insettext.C (setPos): fixed various cursor positioning
9757 problems (via mouse and cursor-keys)
9758 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9759 inset (still a small display problem but it works ;)
9761 * src/insets/insetcollapsable.C (draw): added button_top_y and
9762 button_bottom_y to have correct values for clicking on the inset.
9764 * src/support/lyxalgo.h: commented out 'using std::less'
9766 2000-03-08 Juergen Vigna <jug@sad.it>
9768 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9769 Button-Release event closes as it is alos the Release-Event
9772 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9774 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9776 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9777 can add multiple spaces in Scrap (literate programming) styles...
9778 which, by the way, is how I got hooked on LyX to begin with.
9780 * src/mathed/formula.C (Write): Added dummy variable to an
9781 inset::Latex() call.
9782 (Latex): Add free_spacing boolean to inset::Latex()
9784 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9786 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9787 virtual function to include the free_spacing boolean from
9788 the containing paragraph's style.
9790 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9791 Added free_spacing boolean arg to match inset.h
9793 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9794 Added free_spacing boolean arg to match inset.h
9796 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9797 Added free_spacing boolean and made sure that if in a free_spacing
9798 paragraph, that we output normal space if there is a protected space.
9800 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9801 Added free_spacing boolean arg to match inset.h
9803 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9804 Added free_spacing boolean arg to match inset.h
9806 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9807 Added free_spacing boolean arg to match inset.h
9809 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9810 Added free_spacing boolean arg to match inset.h
9812 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9813 Added free_spacing boolean arg to match inset.h
9815 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9816 free_spacing boolean arg to match inset.h
9818 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9819 Added free_spacing boolean arg to match inset.h
9821 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9822 Added free_spacing boolean arg to match inset.h
9824 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9825 Added free_spacing boolean arg to match inset.h
9827 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9828 Added free_spacing boolean arg to match inset.h
9830 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9831 Added free_spacing boolean arg to match inset.h
9833 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9834 free_spacing boolean arg to match inset.h
9836 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9837 free_spacing boolean arg to match inset.h
9839 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9840 ignore free_spacing paragraphs. The user's spaces are left
9843 * src/text.C (InsertChar): Fixed the free_spacing layout
9844 attribute behavior. Now, if free_spacing is set, you can
9845 add multiple spaces in a paragraph with impunity (and they
9846 get output verbatim).
9847 (SelectSelectedWord): Added dummy argument to inset::Latex()
9850 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9853 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9854 paragraph layouts now only input a simple space instead.
9855 Special character insets don't make any sense in free-spacing
9858 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9859 hard-spaces in the *input* file to simple spaces if the layout
9860 is free-spacing. This converts old files which had to have
9861 hard-spaces in free-spacing layouts where a simple space was
9863 (writeFileAscii): Added free_spacing check to pass to the newly
9864 reworked inset::Latex(...) methods. The inset::Latex() code
9865 ensures that hard-spaces in free-spacing paragraphs get output
9866 as spaces (rather than "~").
9868 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9870 * src/mathed/math_delim.C (draw): draw the empty placeholder
9871 delims with a onoffdash line.
9872 (struct math_deco_compare): struct that holds the "functors" used
9873 for the sort and the binary search in math_deco_table.
9874 (class init_deco_table): class used for initial sort of the
9876 (search_deco): use lower_bound to do a binary search in the
9879 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9881 * src/lyxrc.C: a small secret thingie...
9883 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9884 and to not flush the stream as often as it used to.
9886 * src/support/lyxalgo.h: new file
9887 (sorted): template function used for checking if a sequence is
9888 sorted or not. Two versions with and without user supplied
9889 compare. Uses same compare as std::sort.
9891 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9892 it and give warning on lyxerr.
9894 (struct compare_tags): struct with function operators used for
9895 checking if sorted, sorting and lower_bound.
9896 (search_kw): use lower_bound instead of manually implemented
9899 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9901 * src/insets/insetcollapsable.h: fix Clone() declaration.
9902 * src/insets/insetfoot.h: ditto.
9904 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9906 2000-03-08 Juergen Vigna <jug@sad.it>
9908 * src/insets/lyxinset.h: added owner call which tells us if
9909 this inset is inside another inset. Changed also the return-type
9910 of Editable to an enum so it tells clearer what the return-value is.
9912 * src/insets/insettext.C (computeTextRows): fixed computing of
9913 textinsets which split automatically on more rows.
9915 * src/insets/insetert.[Ch]: changed this to be of BaseType
9918 * src/insets/insetfoot.[Ch]: added footnote inset
9920 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9921 collapsable insets (like footnote, ert, ...)
9923 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9925 * src/lyxdraw.h: remvoe file
9927 * src/lyxdraw.C: remove file
9929 * src/insets/insettext.C: added <algorithm>.
9931 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9933 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9934 (matrix_cb): case MM_OK use string stream
9936 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9939 * src/mathed/math_macro.C (draw): use string stream
9940 (Metrics): use string stream
9942 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9943 directly to the ostream.
9945 * src/vspace.C (asString): use string stream.
9946 (asString): use string stream
9947 (asLatexString): use string stream
9949 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9950 setting Spacing::Other.
9952 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9953 sprintf when creating the stretch vale.
9955 * src/text2.C (alphaCounter): changed to return a string and to
9956 not use a static variable internally. Also fixed a one-off bug.
9957 (SetCounter): changed the drawing of the labels to use string
9958 streams instead of sprintf.
9960 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9961 manipulator to use a scheme that does not require library support.
9962 This is also the way it is done in the new GNU libstdc++. Should
9963 work with DEC cxx now.
9965 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9967 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9968 end. This fixes a bug.
9970 * src/mathed (all files concerned with file writing): apply the
9971 USE_OSTREAM_ONLY changes to mathed too.
9973 * src/support/DebugStream.h: make the constructor explicit.
9975 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9976 count and ostream squashed.
9978 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9980 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9982 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9983 ostringstream uses STL strings, and we might not.
9985 * src/insets/insetspecialchar.C: add using directive.
9986 * src/insets/insettext.C: ditto.
9988 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9990 * lib/layouts/seminar.layout: feeble attempt at a layout for
9991 seminar.cls, far from completet and could really use some looking
9992 at from people used to write layout files.
9994 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9995 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9996 a lot nicer and works nicely with ostreams.
9998 * src/mathed/formula.C (draw): a slightly different solution that
9999 the one posted to the list, but I think this one works too. (font
10000 size wrong in headers.)
10002 * src/insets/insettext.C (computeTextRows): some fiddling on
10003 Jürgens turf, added some comments that he should read.
10005 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
10006 used and it gave compiler warnings.
10007 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
10010 * src/lyx_gui.C (create_forms): do the right thing when
10011 show_banner is true/false.
10013 * src/lyx_cb.C (TimerCB): no need to close or do anything if
10014 show_banner is false.
10016 * most file writing files: Now use iostreams to do almost all of
10017 the writing. Also instead of passing string &, we now use
10018 stringstreams. mathed output is still not adapted to iostreams.
10019 This change can be turned off by commenting out all the occurences
10020 of the "#define USE_OSTREAM_ONLY 1" lines.
10022 * src/WorkArea.C (createPixmap): don't output debug messages.
10023 (WorkArea): don't output debug messages.
10025 * lib/lyxrc.example: added a comment about the new variable
10028 * development/Code_rules/Rules: Added some more commente about how
10029 to build class interfaces and on how better encapsulation can be
10032 2000-03-03 Juergen Vigna <jug@sad.it>
10034 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
10035 automatically with the width of the LyX-Window
10037 * src/insets/insettext.C (computeTextRows): fixed update bug in
10038 displaying text-insets (scrollvalues where not initialized!)
10040 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10042 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
10043 id in the check of the result from lower_bound is not enough since
10044 lower_bound can return last too, and then res->id will not be a
10047 * all insets and some code that use them: I have conditionalized
10048 removed the Latex(string & out, ...) this means that only the
10049 Latex(ostream &, ...) will be used. This is a work in progress to
10050 move towards using streams for all output of files.
10052 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
10055 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10057 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
10058 routine (this fixes bug where greek letters were surrounded by too
10061 * src/support/filetools.C (findtexfile): change a bit the search
10062 algorithm, to fix bug introduced in 1.1.4. Note that --format is
10063 no longer passed to kpsewhich, we may have to change that later.
10065 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
10066 warning options to avoid problems with X header files (from Angus
10068 * acinclude.m4: regenerated.
10070 2000-03-02 Juergen Vigna <jug@sad.it>
10072 * src/insets/insettext.C (WriteParagraphData): Using the
10073 par->writeFile() function for writing paragraph-data.
10074 (Read): Using buffer->parseSingleLyXformat2Token()-function
10075 for parsing paragraph data!
10077 * src/buffer.C (readLyXformat2): removed all parse data and using
10078 the new parseSingleLyXformat2Token()-function.
10079 (parseSingleLyXformat2Token): added this function to parse (read)
10080 lyx-file-format (this is called also from text-insets now!)
10082 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10084 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
10087 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
10088 directly instead of going through a func. One very bad thing: a
10089 static LyXFindReplace, but I don't know where to place it.
10091 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
10092 string instead of char[]. Also changed to static.
10093 (GetSelectionOrWordAtCursor): changed to static inline
10094 (SetSelectionOverLenChars): ditto.
10096 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
10097 current_view and global variables. both classes has changed names
10098 and LyXFindReplace is not inherited from SearchForm.
10100 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
10101 fl_form_search form.
10103 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
10105 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10107 * lib/bind/*.bind: make sure 'buffer-previous' function is not
10108 bound (from Kayvan).
10110 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
10112 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
10114 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10116 * some things that I should comment but the local pub says head to
10119 * comment out all code that belongs to the Roff code for Ascii
10120 export of tables. (this is unused)
10122 * src/LyXView.C: use correct type for global variable
10123 current_layout. (LyXTextClass::size_type)
10125 * some code to get the new insetgraphics closer to working I'd be
10126 grateful for any help.
10128 * src/BufferView2.C (insertInset): use the return type of
10129 NumberOfLayout properly. (also changes in other files)
10131 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
10132 this as a test. I want to know what breaks because of this.
10134 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
10136 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10138 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
10139 to use a \makebox in the label, this allows proper justification
10140 with out using protected spaces or multiple hfills. Now it is
10141 "label" for left justified, "\hfill label\hfill" for center, and
10142 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
10143 should be changed accordingly.
10145 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10147 * src/lyxtext.h: change SetLayout() to take a
10148 LyXTextClass::size_type instead of a char (when there is more than
10149 127 layouts in a class); also change type of copylayouttype.
10150 * src/text2.C (SetLayout): ditto.
10151 * src/LyXView.C (updateLayoutChoice): ditto.
10153 * src/LaTeX.C (scanLogFile): errors where the line number was not
10154 given just after the '!'-line were ignored (from Dekel Tsur).
10156 * lib/lyxrc.example: fix description of \date_insert_format
10158 * lib/layouts/llncs.layout: new layout, contributed by Martin
10161 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10163 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
10164 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
10165 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
10166 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
10167 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
10168 paragraph.C, text.C, text2.C)
10170 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10172 * src/insets/insettext.C (LocalDispatch): remove extra break
10175 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
10176 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
10178 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
10179 * src/insets/insettext.[Ch] (GetCursorPos): ditto
10181 * src/insets/insetbib.h: move InsetBibkey::Holder and
10182 InsetCitation::Holder in public space.
10184 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10186 * src/insets/insettext.h: small change to get the new files from
10187 Juergen to compile (use "string", not "class string").
10189 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
10190 const & as parameter to LocalDispatch, use LyXFont const & as
10191 paramter to some other func. This also had impacto on lyxinsets.h
10192 and the two mathed insets.
10194 2000-02-24 Juergen Vigna <jug@sad.it>
10197 * src/commandtags.h:
10199 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
10203 * src/BufferView2.C: added/updated code for various inset-functions
10205 * src/insets/insetert.[Ch]: added implementation of InsetERT
10207 * src/insets/insettext.[Ch]: added implementation of InsetText
10209 * src/insets/inset.C (Edit): added "unsigned int button" parameter
10210 (draw): added preliminary code for inset scrolling not finshed yet
10212 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
10213 as it is in lyxfunc.C now
10215 * src/insets/lyxinset.h: Added functions for text-insets
10217 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10219 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
10220 BufferView and reimplement the list as a queue put inside its own
10223 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
10225 * several files: use the new interface to the "updateinsetlist"
10227 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
10229 (work_area_handler): call BufferView::trippleClick on trippleclick.
10231 * src/BufferView.C (doubleClick): new function, selects word on
10233 (trippleClick): new function, selects line on trippleclick.
10235 2000-02-22 Allan Rae <rae@lyx.org>
10237 * lib/bind/xemacs.bind: buffer-previous not supported
10239 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10241 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
10244 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10246 * src/bufferlist.C: get rid of current_view from this file
10248 * src/spellchecker.C: get rid of current_view from this file
10250 * src/vspace.C: get rid of current_view from this file
10251 (inPixels): added BufferView parameter for this func
10252 (asLatexCommand): added a BufferParams for this func
10254 * src/text.C src/text2.C: get rid of current_view from these
10257 * src/lyxfont.C (getFontDirection): move this function here from
10260 * src/bufferparams.C (getDocumentDirection): move this function
10263 * src/paragraph.C (getParDirection): move this function here from
10265 (getLetterDirection): ditto
10267 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
10269 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
10270 resize due to wrong pixmap beeing used. Also took the opurtunity
10271 to make the LyXScreen stateless on regard to WorkArea and some
10272 general cleanup in the same files.
10274 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10276 * src/Makefile.am: add missing direction.h
10278 * src/PainterBase.h: made the width functions const.
10280 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
10283 * src/insets/insetcommand.C (draw): draw Editable as buttons.
10285 * src/insets/insetlatexaccent.C (draw): make the accents draw
10286 better, at present this will only work well with iso8859-1.
10288 * several files: remove the old drawing code, now we use the new
10291 * several files: remove support for mono_video, reverse_video and
10294 2000-02-17 Juergen Vigna <jug@sad.it>
10296 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
10297 int ** as we have to return the pointer, otherwise we have only
10298 NULL pointers in the returning function.
10300 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10302 * src/LaTeX.C (operator()): quote file name when running latex.
10304 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10306 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
10307 (bubble tip), this removes our special handling of this.
10309 * Remove all code that is unused now that we have the new
10310 workarea. (Code that are not active when NEW_WA is defined.)
10312 * Make the uses of XSync not conditionalized on define USE_XSYNC.
10314 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10316 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
10317 nonexisting layout; correctly redirect obsoleted layouts.
10319 * lib/lyxrc.example: document \view_dvi_paper_option
10321 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
10324 * src/lyx_cb.C (RunScript): handle $$FName for command names.
10325 (PreviewDVI): handle the view_dvi_paper_option variable.
10326 [Both from Roland Krause]
10328 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10330 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
10331 char const *, int, LyXFont)
10332 (text(int, int, string, LyXFont)): ditto
10334 * src/text.C (InsertCharInTable): attempt to fix the double-space
10335 feature in tables too.
10336 (BackspaceInTable): ditto.
10337 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10339 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10341 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10343 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10344 newly found text in textcache to this.
10345 (buffer): set the owner of the text put into the textcache to 0
10347 * src/insets/figinset.C (draw): fixed the drawing of figures with
10350 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10351 drawing of mathframe, hfills, protected space, table lines. I have
10352 now no outstanding drawing problems with the new Painter code.
10354 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10356 * src/PainterBase.C (ellipse, circle): do not specify the default
10359 * src/LColor.h: add using directive.
10361 * src/Painter.[Ch]: change return type of methods from Painter& to
10362 PainterBase&. Add a using directive.
10364 * src/WorkArea.C: wrap xforms callbacks in C functions
10367 * lib/layouts/foils.layout: font fix and simplifications from Carl
10370 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10372 * a lot of files: The Painter, LColor and WorkArea from the old
10373 devel branch has been ported to lyx-devel. Some new files and a
10374 lot of #ifdeffed code. The new workarea is enabled by default, but
10375 if you want to test the new Painter and LColor you have to compile
10376 with USE_PAINTER defined (do this in config.h f.ex.) There are
10377 still some rought edges, and I'd like some help to clear those
10378 out. It looks stable (loads and displays the Userguide very well).
10381 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10383 * src/buffer.C (pop_tag): revert to the previous implementation
10384 (use a global variable for both loops).
10386 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10388 * src/lyxrc.C (LyXRC): change slightly default date format.
10390 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10391 there is an English text with a footnote that starts with a Hebrew
10392 paragraph, or vice versa.
10393 (TeXFootnote): ditto.
10395 * src/text.C (LeftMargin): allow for negative values for
10396 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10399 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10400 for input encoding (cyrillic)
10402 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10404 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10407 * src/toolbar.C (set): ditto
10408 * src/insets/insetbib.C (create_form_citation_form): ditto
10410 * lib/CREDITS: added Dekel Tsur.
10412 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10413 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10414 hebrew supports files from Dekel Tsur.
10416 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10417 <tzafrir@technion.ac.il>
10419 * src/lyxrc.C: put \date_insert_format at the right place.
10421 * src/buffer.C (makeLaTeXFile): fix the handling of
10422 BufferParams::sides when writing out latex files.
10424 * src/BufferView2.C: add a "using" directive.
10426 * src/support/lyxsum.C (sum): when we use lyxstring,
10427 ostringstream::str needs an additional .c_str().
10429 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10431 * src/support/filetools.C (ChangeExtension): patch from Etienne
10434 * src/TextCache.C (show): remove const_cast and make second
10435 parameter non-const LyXText *.
10437 * src/TextCache.h: use non const LyXText in show.
10439 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10442 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10444 * src/support/lyxsum.C: rework to be more flexible.
10446 * several places: don't check if a pointer is 0 if you are going
10449 * src/text.C: remove some dead code.
10451 * src/insets/figinset.C: remove some dead code
10453 * src/buffer.C: move the BufferView funcs to BufferView2.C
10454 remove all support for insetlatexdel
10455 remove support for oldpapersize stuff
10456 made some member funcs const
10458 * src/kbmap.C: use a std::list to store the bindings in.
10460 * src/BufferView2.C: new file
10462 * src/kbsequence.[Ch]: new files
10464 * src/LyXAction.C + others: remove all trace of buffer-previous
10466 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10467 only have one copy in the binary of this table.
10469 * hebrew patch: moved some functions from LyXText to more
10470 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10472 * several files: remove support for XForms older than 0.88
10473 whitespace changes.
10474 remove some #if 0 #endif code
10476 * src/TextCache.[Ch]: new file. Holds the textcache.
10478 * src/BufferView.C: changes to use the new TextCache interface.
10479 (waitForX): remove the now unused code.
10481 * src/BackStack.h: remove some commented code
10483 * lib/bind/emacs.bind: remove binding for buffer-previous
10485 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10487 * applied the hebrew patch.
10489 * src/lyxrow.h: make sure that all Row variables are initialized.
10491 * src/text2.C (TextHandleUndo): comment out a delete, this might
10492 introduce a memory leak, but should also help us to not try to
10493 read freed memory. We need to look at this one.
10495 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10496 (LyXParagraph): initalize footnotekind.
10498 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10499 forgot this when applying the patch. Please heed the warnings.
10501 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10502 (aka. reformat problem)
10504 * src/bufferlist.C (exists): made const, and use const_iterator
10505 (isLoaded): new func.
10506 (release): use std::find to find the correct buffer.
10508 * src/bufferlist.h: made getState a const func.
10509 made empty a const func.
10510 made exists a const func.
10513 2000-02-01 Juergen Vigna <jug@sad.it>
10515 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10517 * po/it.po: updated a bit the italian po file and also changed the
10518 'file nuovo' for newfile to 'filenuovo' without a space, this did
10521 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10522 for the new insert_date command.
10524 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10525 from jdblair, to insert a date into the current text conforming to
10526 a strftime format (for now only considering the locale-set and not
10527 the document-language).
10529 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10531 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10532 Bounds Read error seen by purify. The problem was that islower is
10533 a macros which takes an unsigned char and uses it as an index for
10534 in array of characters properties (and is thus subject to the
10538 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10539 correctly the paper sides radio buttons.
10540 (UpdateDocumentButtons): ditto.
10542 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10544 * src/kbmap.C (getsym + others): change to return unsigned int,
10545 returning a long can give problems on 64 bit systems. (I assume
10546 that int is 32bit on 64bit systems)
10548 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10550 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10551 LyXLookupString to be zero-terminated. Really fixes problems seen
10552 by purify, I think.
10554 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10556 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10557 write a (char*)0 to the lyxerr stream.
10559 * src/lastfiles.C: move algorithm before the using statemets.
10561 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10563 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10564 complains otherwise).
10565 * src/table.C: ditto
10567 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10570 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10571 that I removed earlier... It is really needed.
10573 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10575 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10577 * INSTALL: update xforms home page URL.
10579 * lib/configure.m4: fix a bug with unreadable layout files.
10581 * src/table.C (calculate_width_of_column): add "using std::max"
10584 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10586 * several files: marked several lines with "DEL LINE", this is
10587 lines that can be deleted without changing anything.
10588 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10589 checks this anyway */
10592 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10594 * src/DepTable.C (update): add a "+" at the end when the checksum
10595 is different. (debugging string only)
10597 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10598 the next inset to not be displayed. This should also fix the list
10599 of labels in the "Insert Crossreference" dialog.
10601 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10603 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10604 when regex was not found.
10606 * src/support/lstrings.C (lowercase): use handcoded transform always.
10609 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10610 old_cursor.par->prev could be 0.
10612 * several files: changed post inc/dec to pre inc/dec
10614 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10615 write the lastfiles to file.
10617 * src/BufferView.C (buffer): only show TextCache info when debugging
10619 (resizeCurrentBuffer): ditto
10620 (workAreaExpose): ditto
10622 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10624 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10626 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10627 a bit better by removing the special case for \i and \j.
10629 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10631 * src/lyx_main.C (easyParse): remove test for bad comand line
10632 options, since this broke all xforms-related parsing.
10634 * src/kbmap.C (getsym): set return type to unsigned long, as
10635 declared in header. On an alpha, long is _not_ the same as int.
10637 * src/support/LOstream.h: add a "using std::flush;"
10639 * src/insets/figinset.C: ditto.
10641 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10643 * src/bufferlist.C (write): use blinding fast file copy instead of
10644 "a char at a time", now we are doing it the C++ way.
10646 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10647 std::list<int> instead.
10648 (addpidwait): reflect move to std::list<int>
10649 (sigchldchecker): ditto
10651 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10654 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10655 that obviously was wrong...
10657 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10658 c, this avoids warnings with purify and islower.
10660 * src/insets/figinset.C: rename struct queue to struct
10661 queue_element and rewrite to use a std::queue. gsqueue is now a
10662 std::queue<queue_element>
10663 (runqueue): reflect move to std::queue
10666 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10667 we would get "1" "0" instead of "true" "false. Also make the tostr
10670 2000-01-21 Juergen Vigna <jug@sad.it>
10672 * src/buffer.C (writeFileAscii): Disabled code for special groff
10673 handling of tabulars till I fix this in table.C
10675 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10677 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10679 * src/support/lyxlib.h: ditto.
10681 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10683 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10684 and 'j' look better. This might fix the "macron" bug that has been
10687 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10688 functions as one template function. Delete the old versions.
10690 * src/support/lyxsum.C: move using std::ifstream inside
10693 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10696 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10698 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10700 * src/insets/figinset.C (InitFigures): use new instead of malloc
10701 to allocate memory for figures and bitmaps.
10702 (DoneFigures): use delete[] instead of free to deallocate memory
10703 for figures and bitmaps.
10704 (runqueue): use new to allocate
10705 (getfigdata): use new/delete[] instead of malloc/free
10706 (RegisterFigure): ditto
10708 * some files: moved some declarations closer to first use, small
10709 whitespace changes use preincrement instead of postincrement where
10710 it does not make a difference.
10712 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10713 step on the way to use stl::containers for key maps.
10715 * src/bufferlist.h: add a typedef for const_iterator and const
10716 versions of begin and end.
10718 * src/bufferlist.[Ch]: change name of member variable _state to
10719 state_. (avoid reserved names)
10721 (getFileNames): returns the filenames of the buffers in a vector.
10723 * configure.in (ALL_LINGUAS): added ro
10725 * src/support/putenv.C: new file
10727 * src/support/mkdir.C: new file
10729 2000-01-20 Allan Rae <rae@lyx.org>
10731 * lib/layouts/IEEEtran.layout: Added several theorem environments
10733 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10734 couple of minor additions.
10736 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10737 (except for those in footnotes of course)
10739 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10741 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10743 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10744 std::sort and std::lower_bound instead of qsort and handwritten
10746 (struct compara): struct that holds the functors used by std::sort
10747 and std::lower_bound in MathedLookupBOP.
10749 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10751 * src/support/LAssert.h: do not do partial specialization. We do
10752 not really need it.
10754 * src/support/lyxlib.h: note that lyx::getUserName() and
10755 lyx::date() are not in use right now. Should these be suppressed?
10757 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10758 (makeLinuxDocFile): do not put date and user name in linuxdoc
10761 * src/support/lyxlib.h (kill): change first argument to long int,
10762 since that's what solaris uses.
10764 * src/support/kill.C (kill): fix declaration to match prototype.
10766 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10767 actually check whether namespaces are supported. This is not what
10770 * src/support/lyxsum.C: add a using directive.
10772 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10774 * src/support/kill.C: if we have namespace support we don't have
10775 to include lyxlib.h.
10777 * src/support/lyxlib.h: use namespace lyx if supported.
10779 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10781 * src/support/date.C: new file
10783 * src/support/chdir.C: new file
10785 * src/support/getUserName.C: new file
10787 * src/support/getcwd.C: new file
10789 * src/support/abort.C: new file
10791 * src/support/kill.C: new file
10793 * src/support/lyxlib.h: moved all the functions in this file
10794 insede struct lyx. Added also kill and abort to this struct. This
10795 is a way to avoid the "kill is not defined in <csignal>", we make
10796 C++ wrappers for functions that are not ANSI C or ANSI C++.
10798 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10799 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10800 lyx it has been renamed to sum.
10802 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10804 * src/text.C: add using directives for std::min and std::max.
10806 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10808 * src/texrow.C (getIdFromRow): actually return something useful in
10809 id and pos. Hopefully fixes the bug with positionning of errorbox
10812 * src/lyx_main.C (easyParse): output an error and exit if an
10813 incorrect command line option has been given.
10815 * src/spellchecker.C (ispell_check_word): document a memory leak.
10817 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10818 where a "struct utimbuf" is allocated with "new" and deleted with
10821 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10823 * src/text2.C (CutSelection): don't delete double spaces.
10824 (PasteSelection): ditto
10825 (CopySelection): ditto
10827 * src/text.C (Backspace): don't delete double spaces.
10829 * src/lyxlex.C (next): fix a bug that were only present with
10830 conformant std::istream::get to read comment lines, use
10831 std::istream::getline instead. This seems to fix the problem.
10833 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10835 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10836 allowed to insert space before space" editing problem. Please read
10837 commends at the beginning of the function. Comments about usage
10840 * src/text.C (InsertChar): fix for the "not allowed to insert
10841 space before space" editing problem.
10843 * src/text2.C (DeleteEmptyParagraphMechanism): when
10844 IsEmptyTableRow can only return false this last "else if" will
10845 always be a no-op. Commented out.
10847 * src/text.C (RedoParagraph): As far as I can understand tmp
10848 cursor is not really needed.
10850 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10851 present it could only return false anyway.
10852 (several functions): Did something not so smart...added a const
10853 specifier on a lot of methods.
10855 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10856 and add a tmp->text.resize. The LyXParagraph constructor does the
10858 (BreakParagraphConservative): ditto
10860 * src/support/path.h (Path): add a define so that the wrong usage
10861 "Path("/tmp") will be flagged as a compilation error:
10862 "`unnamed_Path' undeclared (first use this function)"
10864 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10866 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10867 which was bogus for several reasons.
10869 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10871 (runBibTeX): ditto.
10873 * autogen.sh: do not use "type -path" (what's that anyway?).
10875 * src/support/filetools.C (findtexfile): remove extraneous space
10876 which caused a kpsewhich warning (at least with kpathsea version
10879 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10881 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10883 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10885 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10887 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10889 * src/paragraph.C (BreakParagraph): do not reserve space on text
10890 if we don't need to (otherwise, if pos_end < pos, we end up
10891 reserving huge amounts of memory due to bad unsigned karma).
10892 (BreakParagraphConservative): ditto, although I have not seen
10893 evidence the bug can happen here.
10895 * src/lyxparagraph.h: add a using std::list.
10897 2000-01-11 Juergen Vigna <jug@sad.it>
10899 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10900 could not be found.
10902 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10904 * src/vc-backend.C (doVCCommand): change to be static and take one
10905 more parameter: the path to chdir too be fore executing the command.
10906 (retrive): new function equiv to "co -r"
10908 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10909 file_not_found_hook is true.
10911 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10913 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10914 if a file is readwrite,readonly...anything else.
10916 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10918 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10919 (CreatePostscript): name change from MenuRunDVIPS (or something)
10920 (PreviewPostscript): name change from MenuPreviewPS
10921 (PreviewDVI): name change from MenuPreviewDVI
10923 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10924 \view_pdf_command., \pdf_to_ps_command
10926 * lib/configure.m4: added search for PDF viewer, and search for
10927 PDF to PS converter.
10928 (lyxrc.defaults output): add \pdflatex_command,
10929 \view_pdf_command and \pdf_to_ps_command.
10931 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10933 * src/bufferlist.C (write): we don't use blocksize for anything so
10936 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10938 * src/support/block.h: disable operator T* (), since it causes
10939 problems with both compilers I tried. See comments in the file.
10941 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10944 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10945 variable LYX_DIR_10x to LYX_DIR_11x.
10947 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10949 * INSTALL: document --with-lyxname.
10952 * configure.in: new configure flag --with-lyxname which allows to
10953 choose the name under which lyx is installed. Default is "lyx", of
10954 course. It used to be possible to do this with --program-suffix,
10955 but the later has in fact a different meaning for autoconf.
10957 * src/support/lstrings.h (lstrchr): reformat a bit.
10959 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10960 * src/mathed/math_defs.h: ditto.
10962 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10964 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10965 true, decides if we create a backup file or not when saving. New
10966 tag and variable \pdf_mode, defaults to false. New tag and
10967 variable \pdflatex_command, defaults to pdflatex. New tag and
10968 variable \view_pdf_command, defaults to xpdf. New tag and variable
10969 \pdf_to_ps_command, defaults to pdf2ps.
10971 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10973 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10974 does not have a BufferView.
10975 (unlockInset): ditto + don't access the_locking_inset if the
10976 buffer does not have a BufferView.
10978 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10979 certain circumstances so that we don't continue a keyboard
10980 operation long after the key was released. Try f.ex. to load a
10981 large document, press PageDown for some seconds and then release
10982 it. Before this change the document would contine to scroll for
10983 some time, with this change it stops imidiatly.
10985 * src/support/block.h: don't allocate more space than needed. As
10986 long as we don't try to write to the arr[x] in a array_type arr[x]
10987 it is perfectly ok. (if you write to it you might segfault).
10988 added operator value_type*() so that is possible to pass the array
10989 to functions expecting a C-pointer.
10991 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10994 * intl/*: updated to gettext 0.10.35, tried to add our own
10995 required modifications. Please verify.
10997 * po/*: updated to gettext 0.10.35, tried to add our own required
10998 modifications. Please verify.
11000 * src/support/lstrings.C (tostr): go at fixing the problem with
11001 cxx and stringstream. When stringstream is used return
11002 oss.str().c_str() so that problems with lyxstring and basic_string
11003 are avoided. Note that the best solution would be for cxx to use
11004 basic_string all the way, but it is not conformant yet. (it seems)
11006 * src/lyx_cb.C + other files: moved several global functions to
11007 class BufferView, some have been moved to BufferView.[Ch] others
11008 are still located in lyx_cb.C. Code changes because of this. (part
11009 of "get rid of current_view project".)
11011 * src/buffer.C + other files: moved several Buffer functions to
11012 class BufferView, the functions are still present in buffer.C.
11013 Code changes because of this.
11015 * config/lcmessage.m4: updated to most recent. used when creating
11018 * config/progtest.m4: updated to most recent. used when creating
11021 * config/gettext.m4: updated to most recent. applied patch for
11024 * config/gettext.m4.patch: new file that shows what changes we
11025 have done to the local copy of gettext.m4.
11027 * config/libtool.m4: new file, used in creation of acinclude.m4
11029 * config/lyxinclude.m4: new file, this is the lyx created m4
11030 macros, used in making acinclude.m4.
11032 * autogen.sh: GNU m4 discovered as a separate task not as part of
11033 the lib/configure creation.
11034 Generate acinlucde from files in config. Actually cat
11035 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
11036 easier to upgrade .m4 files that really are external.
11038 * src/Spacing.h: moved using std::istringstream to right after
11039 <sstream>. This should fix the problem seen with some compilers.
11041 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11043 * src/lyx_cb.C: began some work to remove the dependency a lot of
11044 functions have on BufferView::text, even if not really needed.
11045 (GetCurrentTextClass): removed this func, it only hid the
11048 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
11049 forgot this in last commit.
11051 * src/Bullet.C (bulletEntry): use static char const *[] for the
11052 tables, becuase of this the return arg had to change to string.
11053 (bulletSize): ditto
11054 (~Bullet): removed unneeded destructor
11056 * src/BufferView.C (beforeChange): moved from lyx_cb.C
11057 (insetSleep): moved from Buffer
11058 (insetWakeup): moved from Buffer
11059 (insetUnlock): moved from Buffer
11061 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
11062 from Buffer to BufferView.
11064 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
11066 * config/ltmain.sh: updated to version 1.3.4 of libtool
11068 * config/ltconfig: updated to version 1.3.4 of libtool
11070 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11073 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
11074 Did I get that right?
11076 * src/lyxlex.h: add a "using" directive or two.
11077 * src/Spacing.h: ditto.
11078 * src/insets/figinset.C: ditto.
11079 * src/support/filetools.C: ditto.
11080 * src/support/lstrings.C: ditto.
11081 * src/BufferView.C: ditto.
11082 * src/bufferlist.C: ditto.
11083 * src/lyx_cb.C: ditto.
11084 * src/lyxlex.C: ditto.
11086 * NEWS: add some changes for 1.1.4.
11088 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11090 * src/BufferView.C: first go at a TextCache to speed up switching
11093 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11095 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
11096 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
11097 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
11098 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
11101 * src/mathed/math_defs.h (MathedRowSt): make sure that all
11102 members of the struct are correctly initialized to 0 (detected by
11104 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
11105 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
11107 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
11108 pidwait, since it was allocated with "new". This was potentially
11109 very bad. Thanks to Michael Schmitt for running purify for us.
11112 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11114 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
11116 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
11118 1999-12-30 Allan Rae <rae@lyx.org>
11120 * lib/templates/IEEEtran.lyx: minor change
11122 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
11123 src/mathed/formula.C (LocalDispatch): askForText changes
11125 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
11126 know when a user has cancelled input. Fixes annoying problems with
11127 inserting labels and version control.
11129 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11131 * src/support/lstrings.C (tostr): rewritten to use strstream and
11134 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11136 * src/support/filetools.C (IsFileWriteable): use fstream to check
11137 (IsDirWriteable): use fileinfo to check
11139 * src/support/filetools.h (FilePtr): whole class deleted
11141 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
11143 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
11145 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
11147 * src/bufferlist.C (write): use ifstream and ofstream instead of
11150 * src/Spacing.h: use istrstream instead of sscanf
11152 * src/mathed/math_defs.h: change first arg to istream from FILE*
11154 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
11156 * src/mathed/math_parser.C: have yyis to be an istream
11157 (LexGetArg): use istream (yyis)
11159 (mathed_parse): ditto
11160 (mathed_parser_file): first arg istream instead of FILE*, set yyis
11162 * src/mathed/formula.C (Read): rewritten to use istream
11164 * src/mathed/formulamacro.C (Read): rewritten to use istream
11166 * src/lyxlex.h (~LyXLex): deleted desturctor
11167 (getStream): new function, returns an istream
11168 (getFile): deleted funtion
11169 (IsOK): return is.good();
11171 * src/lyxlex.C (LyXLex): delete file and owns_file
11172 (setFile): open an filebuf and assign that to a istream instead of
11174 (setStream): new function, takes an istream as arg.
11175 (setFile): deleted function
11176 (EatLine): rewritten us use istream instead of FILE*
11180 * src/table.C (LyXTable): use istream instead of FILE*
11181 (Read): rewritten to take an istream instead of FILE*
11183 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11185 * src/buffer.C (Dispatch): remove an extraneous break statement.
11187 * src/support/filetools.C (QuoteName): change to do simple
11188 'quoting'. More work is necessary. Also changed to do nothing
11189 under emx (needs fix too).
11190 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
11192 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
11193 config.h.in to the AC_DEFINE_UNQUOTED() call.
11194 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
11195 needs char * as argument (because Solaris 7 declares it like
11198 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
11199 remove definition of BZERO.
11201 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11203 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
11204 defined, "lyxregex.h" if not.
11206 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
11208 (REGEX): new variable that is set to regex.c lyxregex.h when
11209 AM_CONDITIONAL USE_REGEX is set.
11210 (libsupport_la_SOURCES): add $(REGEX)
11212 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
11215 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
11218 * configure.in: add call to LYX_REGEX
11220 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
11221 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
11223 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11225 * lib/bind/fi_menus.bind: new file, from
11226 pauli.virtanen@saunalahti.fi.
11228 * src/buffer.C (getBibkeyList): pass the parameter delim to
11229 InsetInclude::getKeys and InsetBibtex::getKeys.
11231 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
11232 is passed to Buffer::getBibkeyList
11234 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
11235 instead of the hardcoded comma.
11237 * src/insets/insetbib.C (getKeys): make sure that there are not
11238 leading blanks in bibtex keys. Normal latex does not care, but
11239 harvard.sty seems to dislike blanks at the beginning of citation
11240 keys. In particular, the retturn value of the function is
11242 * INSTALL: make it clear that libstdc++ is needed and that gcc
11243 2.7.x probably does not work.
11245 * src/support/filetools.C (findtexfile): make debug message go to
11247 * src/insets/insetbib.C (getKeys): ditto
11249 * src/debug.C (showTags): make sure that the output is correctly
11252 * configure.in: add a comment for TWO_COLOR_ICON define.
11254 * acconfig.h: remove all the entries that already defined in
11255 configure.in or acinclude.m4.
11257 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
11258 to avoid user name, date and copyright.
11260 1999-12-21 Juergen Vigna <jug@sad.it>
11262 * src/table.C (Read): Now read bogus row format informations
11263 if the format is < 5 so that afterwards the table can
11264 be read by lyx but without any format-info. Fixed the
11265 crash we experienced when not doing this.
11267 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
11269 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
11270 (RedoDrawingOfParagraph): ditto
11271 (RedoParagraphs): ditto
11272 (RemoveTableRow): ditto
11274 * src/text.C (Fill): rename arg paperwidth -> paper_width
11276 * src/buffer.C (insertLyXFile): rename var filename -> fname
11277 (writeFile): rename arg filename -> fname
11278 (writeFileAscii): ditto
11279 (makeLaTeXFile): ditto
11280 (makeLinuxDocFile): ditto
11281 (makeDocBookFile): ditto
11283 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
11286 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
11288 * src/bmtable.h: add extern "C" on this file when __cplusplus is
11291 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
11292 compiled by a C compiler not C++.
11294 * src/layout.h (LyXTextClass): added typedef for const_iterator
11295 (LyXTextClassList): added typedef for const_iterator + member
11296 functions begin and end.
11298 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
11299 iterators to fill the choice_class.
11300 (updateLayoutChoice): rewritten to use iterators to fill the
11301 layoutlist in the toolbar.
11303 * src/BufferView.h (BufferView::work_area_width): removed unused
11306 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
11308 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
11309 (sgmlCloseTag): ditto
11311 * src/support/lstrings.h: return type of countChar changed to
11314 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
11315 what version of this func to use. Also made to return unsigned int.
11317 * configure.in: call LYX_STD_COUNT
11319 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
11320 conforming std::count.
11322 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11324 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
11325 and a subscript would give bad display (patch from Dekel Tsur
11326 <dekel@math.tau.ac.il>).
11328 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
11330 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
11333 * src/chset.h: add a few 'using' directives
11335 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
11336 triggered when no buffer is active
11338 * src/layout.C: removed `break' after `return' in switch(), since
11341 * src/lyx_main.C (init): make sure LyX can be ran in place even
11342 when libtool has done its magic with shared libraries. Fix the
11343 test for the case when the system directory has not been found.
11345 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11346 name for the latex file.
11347 (MenuMakeHTML): ditto
11349 * src/buffer.h: add an optional boolean argument, which is passed
11350 to ChangeExtension.
11352 1999-12-20 Allan Rae <rae@lyx.org>
11354 * lib/templates/IEEEtran.lyx: small correction and update.
11356 * configure.in: Attempted to use LYX_PATH_HEADER
11358 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11360 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11361 input from JMarc. Now use preprocessor to find the header.
11362 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11363 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11364 LYX_STL_STRING_FWD. See comments in file.
11366 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11368 * The global MiniBuffer * minibuffer variable is dead.
11370 * The global FD_form_main * fd_form_main variable is dead.
11372 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11374 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11376 * src/table.h: add the LOstream.h header
11377 * src/debug.h: ditto
11379 * src/LyXAction.h: change the explaination of the ReadOnly
11380 attribute: is indicates that the function _can_ be used.
11382 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11385 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11387 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11393 * src/paragraph.C (GetWord): assert on pos>=0
11396 * src/support/lyxstring.C: condition the use of an invariant on
11398 * src/support/lyxstring.h: ditto
11400 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11401 Use LAssert.h instead of plain assert().
11403 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11405 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11406 * src/support/filetools.C: ditto
11408 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11411 * INSTALL: document the new configure flags
11413 * configure.in: suppress --with-debug; add --enable-assertions
11415 * acinclude.m4: various changes in alignment of help strings.
11417 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11419 * src/kbmap.C: commented out the use of the hash map in kb_map,
11420 beginning of movement to a stl::container.
11422 * several files: removed code that was not in effect when
11423 MOVE_TEXT was defined.
11425 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11426 for escaping should not be used. We can discuss if the string
11427 should be enclosed in f.ex. [] instead of "".
11429 * src/trans_mgr.C (insert): use the new returned value from
11430 encodeString to get deadkeys and keymaps done correctly.
11432 * src/chset.C (encodeString): changed to return a pair, to tell
11433 what to use if we know the string.
11435 * src/lyxscreen.h (fillArc): new function.
11437 * src/FontInfo.C (resize): rewritten to use more std::string like
11438 structore, especially string::replace.
11440 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11443 * configure.in (chmod +x some scripts): remove config/gcc-hack
11445 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11447 * src/buffer.C (writeFile): change once again the top comment in a
11448 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11449 instead of an hardcoded version number.
11450 (makeDocBookFile): ditto
11452 * src/version.h: add new define LYX_DOCVERSION
11454 * po/de.po: update from Pit Sütterlin
11455 * lib/bind/de_menus.bind: ditto.
11457 * src/lyxfunc.C (Dispatch): call MenuExport()
11458 * src/buffer.C (Dispatch): ditto
11460 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11461 LyXFunc::Dispatch().
11462 (MenuExport): new function, moved from
11463 LyXFunc::Dispatch().
11465 * src/trans_mgr.C (insert): small cleanup
11466 * src/chset.C (loadFile): ditto
11468 * lib/kbd/iso8859-1.cdef: add missing backslashes
11470 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11472 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11473 help with placing the manually drawn accents better.
11475 (Draw): x2 and hg changed to float to minimize rounding errors and
11476 help place the accents better.
11478 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11479 unsigned short to char is just wrong...cast the char to unsigned
11480 char instead so that the two values can compare sanely. This
11481 should also make the display of insetlatexaccents better and
11482 perhaps also some other insets.
11484 (lbearing): new function
11487 1999-12-15 Allan Rae <rae@lyx.org>
11489 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11490 header that provides a wrapper around the very annoying SGI STL header
11493 * src/support/lyxstring.C, src/LString.h:
11494 removed old SGI-STL-compatability attempts.
11496 * configure.in: Use LYX_STL_STRING_FWD.
11498 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11499 stl_string_fwd.h is around and try to determine it's location.
11500 Major improvement over previous SGI STL 3.2 compatability.
11501 Three small problems remain with this function due to my zero
11502 knowledge of autoconf. JMarc and lgb see the comments in the code.
11504 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11506 * src/broken_const.h, config/hack-gcc, config/README: removed
11508 * configure.in: remove --with-gcc-hack option; do not call
11511 * INSTALL: remove documentation of --with-broken-const and
11514 * acconfig.h: remove all trace of BROKEN_CONST define
11516 * src/buffer.C (makeDocBookFile): update version number in output
11518 (SimpleDocBookOnePar): fix an assert when trying to a character
11519 access beyond string length
11522 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11524 * po/de.po: fix the Export menu
11526 * lyx.man: update the description of -dbg
11528 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11529 (commandLineHelp): updated
11530 (easyParse): show list of available debug levels if -dbg is passed
11533 * src/Makefile.am: add debug.C
11535 * src/debug.h: moved some code to debug.C
11537 * src/debug.C: new file. Contains code to set and show debug
11540 * src/layout.C: remove 'break' after 'continue' in switch
11541 statements, since these cannot be reached.
11543 1999-12-13 Allan Rae <rae@lyx.org>
11545 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11546 (in_word_set): hash() -> math_hash()
11548 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11550 * acconfig.h: Added a test for whether we are using exceptions in the
11551 current compilation run. If so USING_EXCEPTIONS is defined.
11553 * config.in: Check for existance of stl_string_fwd.h
11554 * src/LString.h: If compiling --with-included-string and SGI's
11555 STL version 3.2 is present (see above test) we need to block their
11556 forward declaration of string and supply a __get_c_string().
11557 However, it turns out this is only necessary if compiling with
11558 exceptions enabled so I've a bit more to add yet.
11560 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11561 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11562 src/support/LRegex.h, src/undo.h:
11563 Shuffle the order of the included files a little to ensure that
11564 LString.h gets included before anything that includes stl_string_fwd.h
11566 * src/support/lyxstring.C: We need to #include LString.h instead of
11567 lyxstring.h to get the necessary definition of __get_c_string.
11568 (__get_c_string): New function. This is defined static just like SGI's
11569 although why they need to do this I'm not sure. Perhaps it should be
11570 in lstrings.C instead.
11572 * lib/templates/IEEEtran.lyx: New template file.
11574 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11576 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11577 * intl/Makefile.in (MKINSTALLDIRS): ditto
11579 * src/LyXAction.C (init): changed to hold the LFUN data in a
11580 automatic array in stead of in callso to newFunc, this speeds up
11581 compilation a lot. Also all the memory used by the array is
11582 returned when the init is completed.
11584 * a lot of files: compiled with -Wold-style-cast, changed most of
11585 the reported offenders to C++ style casts. Did not change the
11586 offenders in C files.
11588 * src/trans.h (Match): change argument type to unsigned int.
11590 * src/support/DebugStream.C: fix some types on the streambufs so
11591 that it works on a conforming implementation.
11593 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11595 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11597 * src/support/lyxstring.C: remove the inline added earlier since
11598 they cause a bunch of unsatisfied symbols when linking with dec
11599 cxx. Cxx likes to have the body of inlines at the place where they
11602 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11603 accessing negative bounds in array. This fixes the crash when
11604 inserting accented characters.
11605 * src/trans.h (Match): ditto
11607 * src/buffer.C (Dispatch): since this is a void, it should not try
11608 to return anything...
11610 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11612 * src/buffer.h: removed the two friends from Buffer. Some changes
11613 because of this. Buffer::getFileName and Buffer::setFileName
11614 renamed to Buffer::fileName() and Buffer::fileName(...).
11616 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11618 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11619 and Buffer::update(short) to BufferView. This move is currently
11620 controlled by a define MOVE_TEXT, this will be removed when all
11621 shows to be ok. This move paves the way for better separation
11622 between buffer contents and buffer view. One side effect is that
11623 the BufferView needs a rebreak when swiching buffers, if we want
11624 to avoid this we can add a cache that holds pointers to LyXText's
11625 that is not currently in use.
11627 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11630 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11632 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11634 * lyx_main.C: new command line option -x (or --execute) and
11635 -e (or --export). Now direct conversion from .lyx to .tex
11636 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11637 Unfortunately, X is still needed and the GUI pops up during the
11640 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11642 * src/Spacing.C: add a using directive to bring stream stuff into
11644 * src/paragraph.C: ditto
11645 * src/buffer.C: ditto
11647 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11648 from Lars' announcement).
11650 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11651 example files from Tino Meinen.
11653 1999-12-06 Allan Rae <rae@lyx.org>
11655 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11657 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11659 * src/support/lyxstring.C: added a lot of inline for no good
11662 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11663 latexWriteEndChanges, they were not used.
11665 * src/layout.h (operator<<): output operator for PageSides
11667 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11669 * some example files: loaded in LyX 1.0.4 and saved again to update
11670 certain constructs (table format)
11672 * a lot of files: did the change to use fstream/iostream for all
11673 writing of files. Done with a close look at Andre Poenitz's patch.
11675 * some files: whitespace changes.
11677 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11679 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11680 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11681 architecture, we provide our own. It is used unconditionnally, but
11682 I do not think this is a performance problem. Thanks to Angus
11683 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11684 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11686 (GetInset): use my_memcpy.
11690 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11691 it is easier to understand, but it uses less TeX-only constructs now.
11693 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11694 elements contain spaces
11696 * lib/configure: regenerated
11698 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11699 elements contain spaces; display the list of programs that are
11702 * autogen.sh: make sure lib/configure is executable
11704 * lib/examples/*: rename the tutorial examples to begin with the
11705 two-letters language code.
11707 * src/lyxfunc.C (getStatus): do not query current font if no
11710 * src/lyx_cb.C (RunScript): use QuoteName
11711 (MenuRunDvips): ditto
11712 (PrintApplyCB): ditto
11714 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11715 around argument, so that it works well with the current shell.
11716 Does not work properly with OS/2 shells currently.
11718 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11719 * src/LyXSendto.C (SendtoApplyCB): ditto
11720 * src/lyxfunc.C (Dispatch): ditto
11721 * src/buffer.C (runLaTeX): ditto
11722 (runLiterate): ditto
11723 (buildProgram): ditto
11725 * src/lyx_cb.C (RunScript): ditto
11726 (MenuMakeLaTeX): ditto
11728 * src/buffer.h (getLatexName): new method
11730 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11732 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11734 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11735 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11736 (create_math_panel): ditto
11738 * src/lyxfunc.C (getStatus): re-activate the code which gets
11739 current font and cursor; add test for export to html.
11741 * src/lyxrc.C (read): remove unreachable break statements; add a
11744 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11746 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11748 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11749 introduced by faulty regex.
11750 * src/buffer.C: ditto
11751 * src/lastfiles.C: ditto
11752 * src/paragraph.C: ditto
11753 * src/table.C: ditto
11754 * src/vspace.C: ditto
11755 * src/insets/figinset.C: ditto
11756 Note: most of these is absolutely harmless, except the one in
11757 src/mathed formula.C.
11759 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11761 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11762 operation, yielding correct results for the reLyX command.
11764 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11766 * src/support/filetools.C (ExpandPath): removed an over eager
11768 (ReplaceEnvironmentPath): ditto
11770 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11771 shows that we are doing something fishy in our code...
11772 (BubblePost): ditto
11775 * src/lyxrc.C (read): use a double switch trick to get more help
11776 from the compiler. (the same trick is used in layout.C)
11777 (write): new function. opens a ofstream and pass that to output
11778 (output): new function, takes a ostream and writes the lyxrc
11779 elemts to it. uses a dummy switch to make sure no elements are
11782 * src/lyxlex.h: added a struct pushpophelper for use in functions
11783 with more than one exit point.
11785 * src/lyxlex.[Ch] (GetInteger): made it const
11789 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11791 * src/layout.[hC] : LayoutTags splitted into several enums, new
11792 methods created, better error handling cleaner use of lyxlex. Read
11795 * src/bmtable.[Ch]: change some member prototypes because of the
11796 image const changes.
11798 * commandtags.h, src/LyXAction.C (init): new function:
11799 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11800 This file is not read automatically but you can add \input
11801 preferences to your lyxrc if you want to. We need to discuss how
11804 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11805 in .aux, also remove .bib and .bst files from dependencies when
11808 * src/BufferView.C, src/LyXView.C: add const_cast several places
11809 because of changes to images.
11811 * lib/images/*: same change as for images/*
11813 * lib/lyxrc.example: Default for accept_compound is false not no.
11815 * images/*: changed to be const, however I have som misgivings
11816 about this change so it might be changed back.
11818 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11820 * lib/configure, po/POTFILES.in: regenerated
11822 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11824 * config/lib_configure.m4: removed
11826 * lib/configure.m4: new file (was config/lib_configure.m4)
11828 * configure.in: do not test for rtti, since we do not use it.
11830 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11832 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11833 doubling of allocated space scheme. This makes it faster for large
11834 strings end to use less memory for small strings. xtra rememoved.
11836 * src/insets/figinset.C (waitalarm): commented out.
11837 (GhostscriptMsg): use static_cast
11838 (GhostscriptMsg): use new instead of malloc to allocate memory for
11839 cmap. also delete the memory after use.
11841 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11843 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11844 for changes in bibtex database or style.
11845 (runBibTeX): remove all .bib and .bst files from dep before we
11847 (run): use scanAuc in when dep file already exist.
11849 * src/DepTable.C (remove_files_with_extension): new method
11850 (exist): new method
11852 * src/DepTable.[Ch]: made many of the methods const.
11854 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11856 * src/bufferparams.C: make sure that the default textclass is
11857 "article". It used to be the first one by description order, but
11858 now the first one is "docbook".
11860 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11861 string; call Debug::value.
11862 (easyParse): pass complete argument to setDebuggingLevel().
11864 * src/debug.h (value): fix the code that parses debug levels.
11866 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11869 * src/LyXAction.C: use Debug::ACTION as debug channel.
11871 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11873 * NEWS: updated for the future 1.1.3 release.
11875 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11876 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11877 it should. This is of course a controversial change (since many
11878 people will find that their lyx workscreen is suddenly full of
11879 red), but done for the sake of correctness.
11881 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11882 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11884 * src/insets/inseterror.h, src/insets/inseturl.h,
11885 src/insets/insetinfo.h, src/insets/figinset.h,
11886 src/mathed/formulamacro.h, src/mathed/math_macro.h
11887 (EditMessage): add a missing const and add _() to make sure that
11888 translation happens
11890 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11891 src/insets/insetbib.C, src/support/filetools.C: add `using'
11892 directives for cxx.
11894 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11895 doing 'Insert index of last word' at the beginning of a paragraph.
11897 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11899 * several files: white-space changes.
11901 * src/mathed/formula.C: removed IsAlpha and IsDigit
11903 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11904 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11907 * src/insets/figinset.C (GetPSSizes): don't break when
11908 "EndComments" is seen. But break when a boundingbox is read.
11910 * all classes inherited from Inset: return value of Clone
11911 changed back to Inset *.
11913 * all classes inherited form MathInset: return value of Clone
11914 changed back to MathedInset *.
11916 * src/insets/figinset.C (runqueue): use a ofstream to output the
11917 gs/ps file. Might need some setpresicion or setw. However I can
11918 see no problem with the current code.
11919 (runqueue): use sleep instead of the alarm/signal code. I just
11920 can't see the difference.
11922 * src/paragraph.C (LyXParagraph): reserve space in the new
11923 paragraph and resize the inserted paragraph to just fit.
11925 * src/lyxfunc.h (operator|=): added operator for func_status.
11927 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11928 check for readable file.
11930 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11931 check for readable file.
11932 (MenuMakeLinuxDoc): ditto
11933 (MenuMakeDocBook): ditto
11934 (MenuMakeAscii): ditto
11935 (InsertAsciiFile): split the test for openable and readable
11937 * src/bmtable.C (draw_bitmaptable): use
11938 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11940 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11941 findtexfile from LaTeX to filetools.
11943 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11944 instead of FilePtr. Needs to be verified by a literate user.
11946 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11948 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11949 (EditMessage): likewise.
11951 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11952 respectively as \textasciitilde and \textasciicircum.
11954 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11956 * src/support/lyxstring.h: made the methods that take iterators
11957 use const_iterator.
11959 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11960 (regexMatch): made is use the real regex class.
11962 * src/support/Makefile.am: changed to use libtool
11964 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11966 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11968 (MathIsInset ++): changed several macros to be inline functions
11971 * src/mathed/Makefile.am: changed to use libtool
11973 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11975 * src/insets/inset* : Clone changed to const and return type is
11976 the true insettype not just Inset*.
11978 * src/insets/Makefile.am: changed to use libtool
11980 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11982 * src/undo.[Ch] : added empty() and changed some of the method
11985 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11987 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11988 setID use block<> for the bullets array, added const several places.
11990 * src/lyxfunc.C (getStatus): new function
11992 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11993 LyXAction, added const to several funtions.
11995 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11996 a std::map, and to store the dir items in a vector.
11998 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
12001 * src/LyXView.[Ch] + other files : changed currentView to view.
12003 * src/LyXAction.[Ch] : ported from the old devel branch.
12005 * src/.cvsignore: added .libs and a.out
12007 * configure.in : changes to use libtool.
12009 * acinclude.m4 : inserted libtool.m4
12011 * .cvsignore: added libtool
12013 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12015 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
12016 file name in insets and mathed directories (otherwise the
12017 dependency is not taken in account under cygwin).
12019 * src/text2.C (InsertString[AB]): make sure that we do not try to
12020 read characters past the string length.
12022 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12024 * lib/doc/LaTeXConfig.lyx.in,
12025 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
12027 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
12028 file saying who created them and when this heppened; this is
12029 useless and annoys tools like cvs.
12031 * lib/layouts/g-brief-{en,de}.layout,
12032 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
12033 from Thomas Hartkens <thomas@hartkens.de>.
12035 * src/{insets,mathed}/Makefile.am: do not declare an empty
12036 LDFLAGS, so that it can be set at configure time (useful on Irix
12039 * lib/reLyX/configure.in: make sure that the prefix is set
12040 correctly in LYX_DIR.
12042 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
12044 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
12045 be used by 'command-sequence' this allows to bind a key to a
12046 sequence of LyX-commands
12047 (Example: 'command-sequence math-insert alpha; math-insert beta;")
12049 * src/LyXAction.C: add "command-sequence"
12051 * src/LyXFunction.C: handling of "command-sequence"
12053 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
12054 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
12056 * src/lyxserver.C, src/minibuffer.C: Use this new interface
12058 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12060 * src/buffer.C (writeFile): Do not output a comment giving user
12061 and date at the beginning of a .lyx file. This is useless and
12062 annoys cvs anyway; update version number to 1.1.
12064 * src/Makefile.am (LYX_DIR): add this definition, so that a
12065 default path is hardcoded in LyX.
12067 * configure.in: Use LYX_GNU_GETTEXT.
12069 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
12070 AM_GNU_GETTEXT with a bug fixed.
12072 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
12074 * src/chset.C: add "using std::ifstream;" to please dec cxx.
12076 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
12077 which is used to point to LyX data is now LYX_DIR_11x.
12079 * lyx.man: convert to a unix text file; small updates.
12081 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
12083 * src/support/LSubstring.[Ch]: made the second arg of most of the
12084 constructors be a const reference.
12086 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
12089 * src/support/lyxstring.[Ch] (swap): added missing member function
12090 and specialization of swap(str, str);
12092 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
12094 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
12095 trace of the old one.
12097 * src/undo.[Ch]: made the undostack use std::list to store undo's in
12098 put the member definitions in undo.C.
12100 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
12101 NEW_TEXT and have now only code that was included when this was
12104 * src/intl.C (LCombo): use static_cast
12106 (DispatchCallback): ditto
12108 * src/definitions.h: removed whole file
12110 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
12112 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
12113 parsing and stores in a std:map. a regex defines the file format.
12114 removed unneeded members.
12116 * src/bufferparams.h: added several enums from definitions.h here.
12117 Removed unsused destructor. Changed some types to use proper enum
12118 types. use block to have the temp_bullets and user_defined_bullets
12119 and to make the whole class assignable.
12121 * src/bufferparams.C (Copy): removed this functions, use a default
12122 assignment instead.
12124 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
12127 * src/buffer.C (readLyXformat2): commend out all that have with
12128 oldpapersize to do. also comment out all that hve to do with
12129 insetlatex and insetlatexdel.
12130 (setOldPaperStuff): commented out
12132 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
12134 * src/LyXAction.C: remove use of inset-latex-insert
12136 * src/mathed/math_panel.C (button_cb): use static_cast
12138 * src/insets/Makefile.am (insets_o_SOURCES): removed
12141 * src/support/lyxstring.C (helper): use the unsigned long
12142 specifier, UL, instead of a static_cast.
12144 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
12146 * src/support/block.h: new file. to be used as a c-style array in
12147 classes, so that the class can be assignable.
12149 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12151 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
12152 NULL, make sure to return an empty string (it is not possible to
12153 set a string to NULL).
12155 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12157 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
12159 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
12161 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
12162 link line, so that Irix users (for example) can set it explicitely to
12165 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
12166 it can be overidden at make time (static or dynamic link, for
12169 * src/vc-backend.C, src/LaTeXFeatures.h,
12170 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
12171 statements to bring templates to global namespace.
12173 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
12175 * src/support/lyxstring.C (operator[] const): make it standard
12178 * src/minibuffer.C (Init): changed to reflect that more
12179 information is given from the lyxvc and need not be provided here.
12181 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
12183 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
12185 * src/LyXView.C (UpdateTimerCB): use static_cast
12186 (KeyPressMask_raw_callback): ditto
12188 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
12189 buffer_, a lot of changes because of this. currentBuffer() ->
12190 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
12191 also changes to other files because of this.
12193 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
12195 * src/vc-backend.[Ch]: new files. The backends for vc handling,
12196 have no support for RCS and partial support for CVS, will be
12199 * src/insets/ several files: changes because of function name
12200 changes in Bufferview and LyXView.
12202 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
12204 * src/support/LSubstring.[Ch]: new files. These implement a
12205 Substring that can be very convenient to use. i.e. is this
12207 string a = "Mary had a little sheep";
12208 Substring(a, "sheep") = "lamb";
12209 a is now "Mary has a little lamb".
12211 * src/support/LRegex.[Ch]: a regex class that can be used to pick
12212 out patterns and subpatterns of strings. It is used by LSubstring
12213 and also by vc-backend.C
12215 * src/support/lyxstring.C: went over all the assertions used and
12216 tried to correct the wrong ones and flag which of them is required
12217 by the standard. some bugs found because of this. Also removed a
12218 couple of assertions.
12220 * src/support/Makefile.am (libsupport_a_SOURCES): added
12221 LSubstring.[Ch] and LRegex.[Ch]
12223 * src/support/FileInfo.h: have struct stat buf as an object and
12224 not a pointer to one, some changes because of this.
12226 * src/LaTeXFeatures.C (getTClassPreamble): also use the
12227 information in layout when adding the layouts preamble to the
12228 textclass preamble.
12230 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
12233 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
12234 because of bug in OS/2.
12236 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12238 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
12239 \verbatim@font instead of \ttfamily, so that it can be redefined.
12241 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
12242 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
12243 src/layout.h, src/text2.C: add 'using' directive to bring the
12244 STL templates we need from the std:: namespace to the global one.
12245 Needed by DEC cxx in strict ansi mode.
12247 * src/support/LIstream.h,src/support/LOstream.h,
12248 src/support/lyxstring.h,src/table.h,
12249 src/lyxlookup.h: do not include <config.h> in header
12250 files. This should be done in the .C files only.
12252 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
12256 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12258 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
12259 from Kayvan to fix the tth invokation.
12261 * development/lyx.spec.in: updates from Kayvan to reflect the
12262 changes of file names.
12264 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12266 * src/text2.C (InsertStringB): use std::copy
12267 (InsertStringA): use std::copy
12269 * src/bufferlist.C: use a vector to store the buffers in. This is
12270 an internal change and should not affect any other thing.
12272 * src/BufferView.C (waitForX): use XSync instead of the lengthy
12275 * src/text.C (Fill): fix potential bug, one off bug.
12277 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12279 * src/Makefile.am (lyx_main.o): add more files it depends on.
12281 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
12283 * src/support/lyxstring.C: use size_t for the reference count,
12284 size, reserved memory and xtra.
12285 (internal_compare): new private member function. Now the compare
12286 functions should work for std::strings that have embedded '\0'
12288 (compare): all compare functions rewritten to use
12291 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12293 * src/support/lyxstring.C (compare): pass c_str()
12294 (compare): pass c_str
12295 (compare): pass c_str
12297 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12299 * src/support/DebugStream.C: <config.h> was not included correctly.
12301 * lib/configure: forgot to re-generate it :( I'll make this file
12302 auto generated soon.
12304 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12306 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
12309 * src/support/lyxstring.C: some changes from length() to rep->sz.
12310 avoids a function call.
12312 * src/support/filetools.C (SpaceLess): yet another version of the
12313 algorithm...now per Jean-Marc's suggestions.
12315 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12317 * src/layout.C (less_textclass_desc): functor for use in sorting
12319 (LyXTextClass::Read): sort the textclasses after reading.
12321 * src/support/filetools.C (SpaceLess): new version of the
12322 SpaceLess functions. What problems does this one give? Please
12325 * images/banner_bw.xbm: made the arrays unsigned char *
12327 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12329 * src/support/lyxstring.C (find): remove bogus assertion in the
12330 two versions of find where this has not been done yet.
12332 * src/support/lyxlib.h: add missing int return type to
12335 * src/menus.C (ShowFileMenu): disable exporting to html if no
12336 html export command is present.
12338 * config/lib_configure.m4: add a test for an HTML converter. The
12339 programs checked for are, in this order: tth, latex2html and
12342 * lib/configure: generated from config/lib_configure.m4.
12344 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12345 html converter. The parameters are now passed through $$FName and
12346 $$OutName, instead of standard input/output.
12348 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12350 * lib/lyxrc.example: update description of \html_command.
12351 add "quotes" around \screen_font_xxx font setting examples to help
12352 people who use fonts with spaces in their names.
12354 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12356 * Distribution files: updates for v1.1.2
12358 * src/support/lyxstring.C (find): remove bogus assert and return
12359 npos for the same condition.
12361 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12363 * added patch for OS/2 from SMiyata.
12365 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12367 * src/text2.C (CutSelection): make space_wrapped a bool
12368 (CutSelection): dont declare int i until we have to.
12369 (alphaCounter): return a char const *.
12371 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12373 * src/support/syscall.C (Systemcalls::kill):
12374 src/support/filetools.C (PutEnv, PutEnvPath):
12375 src/lyx_cb.C (addNewlineAndDepth):
12376 src/FontInfo.C (FontInfo::resize): condition some #warning
12377 directives with WITH_WARNINGS.
12380 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12382 * src/layout.[Ch] + several files: access to class variables
12383 limited and made accessor functions instead a lot of code changed
12384 becuase of this. Also instead of returning pointers often a const
12385 reference is returned instead.
12387 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12389 * src/Makefile.am (dist-hook): added used to remove the CVS from
12390 cheaders upon creating a dist
12391 (EXTRA_DIST): added cheaders
12393 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12394 a character not as a small integer.
12396 * src/support/lyxstring.C (find): removed Assert and added i >=
12397 rep->sz to the first if.
12399 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12401 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12402 src/LyXView.C src/buffer.C src/bufferparams.C
12403 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12404 src/text2.C src/insets/insetinclude.C:
12405 lyxlayout renamed to textclasslist.
12407 * src/layout.C: some lyxerr changes.
12409 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12410 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12411 (LyXLayoutList): removed all traces of this class.
12412 (LyXTextClass::Read): rewrote LT_STYLE
12413 (LyXTextClass::hasLayout): new function
12414 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12415 both const and nonconst version.
12416 (LyXTextClass::delete_layout): new function.
12417 (LyXTextClassList::Style): bug fix. do the right thing if layout
12419 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12420 (LyXTextClassList::NameOfLayout): ditto
12421 (LyXTextClassList::Load): ditto
12423 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12425 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12427 * src/LyXAction.C (LookupFunc): added a workaround for sun
12428 compiler, on the other hand...we don't know if the current code
12429 compiles on sun at all...
12431 * src/support/filetools.C (CleanupPath): subst fix
12433 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12436 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12437 complained about this one?
12439 * src/insets/insetinclude.C (Latex): subst fix
12441 * src/insets/insetbib.C (getKeys): subst fix
12443 * src/LyXSendto.C (SendtoApplyCB): subst fix
12445 * src/lyx_main.C (init): subst fix
12447 * src/layout.C (Read): subst fix
12449 * src/lyx_sendfax_main.C (button_send): subst fix
12451 * src/buffer.C (RoffAsciiTable): subst fix
12453 * src/lyx_cb.C (MenuFax): subst fix
12454 (PrintApplyCB): subst fix
12456 1999-10-26 Juergen Vigna <jug@sad.it>
12458 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12460 (Read): Cleaned up this code so now we read only format vestion >= 5
12462 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12464 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12465 come nobody has complained about this one?
12467 * src/insets/insetinclude.C (Latex): subst fix
12469 * src/insets/insetbib.C (getKeys): subst fix
12471 * src/lyx_main.C (init): subst fix
12473 * src/layout.C (Read): subst fix
12475 * src/buffer.C (RoffAsciiTable): subst fix
12477 * src/lyx_cb.C (MenuFax): subst fix.
12479 * src/layout.[hC] + some other files: rewrote to use
12480 std::container to store textclasses and layouts in.
12481 Simplified, removed a lot of code. Make all classes
12482 assignable. Further simplifications and review of type
12483 use still to be one.
12485 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12486 lastfiles to create the lastfiles partr of the menu.
12488 * src/lastfiles.[Ch]: rewritten to use deque to store the
12489 lastfiles in. Uses fstream for reading and writing. Simplifies
12492 * src/support/syscall.C: remove explicit cast.
12494 * src/BufferView.C (CursorToggleCB): removed code snippets that
12495 were commented out.
12496 use explicat C++ style casts instead of C style casts. also use
12497 u_vdata instea of passing pointers in longs.
12499 * src/PaperLayout.C: removed code snippets that were commented out.
12501 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12503 * src/lyx_main.C: removed code snippets that wer commented out.
12505 * src/paragraph.C: removed code snippets that were commented out.
12507 * src/lyxvc.C (logClose): use static_cast
12509 (viewLog): remove explicit cast to void*
12510 (showLog): removed old commented code
12512 * src/menus.C: use static_cast instead of C style casts. use
12513 u_vdata instead of u_ldata. remove explicit cast to (long) for
12514 pointers. Removed old code that was commented out.
12516 * src/insets/inset.C: removed old commented func
12518 * src/insets/insetref.C (InsetRef): removed old code that had been
12519 commented out for a long time.
12521 (escape): removed C style cast
12523 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12525 * src/insets/insetlatex.C (Draw): removed old commented code
12526 (Read): rewritten to use string
12528 * src/insets/insetlabel.C (escape): removed C style cast
12530 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12532 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12533 old commented code.
12535 * src/insets/insetinclude.h: removed a couple of stupid bools
12537 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12538 (Clone): remove C style cast
12539 (getKeys): changed list to lst because of std::list
12541 * src/insets/inseterror.C (Draw): removed som old commented code.
12543 * src/insets/insetcommand.C (Draw): removed some old commented code.
12545 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12546 commented out forever.
12547 (bibitem_cb): use static_cast instead of C style cast
12548 use of vdata changed to u_vdata.
12550 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12552 (CloseUrlCB): use static_cast instead of C style cast.
12553 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12555 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12556 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12557 (CloseInfoCB): static_cast from ob->u_vdata instead.
12558 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12561 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12562 (C_InsetError_CloseErrorCB): forward the ob parameter
12563 (CloseErrorCB): static_cast from ob->u_vdata instead.
12565 * src/vspace.h: include LString.h since we use string in this class.
12567 * src/vspace.C (lyx_advance): changed name from advance because of
12568 nameclash with stl. And since we cannot use namespaces yet...I
12569 used a lyx_ prefix instead. Expect this to change when we begin
12572 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12574 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12575 and removed now defunct constructor and deconstructor.
12577 * src/BufferView.h: have backstack as a object not as a pointer.
12578 removed initialization from constructor. added include for BackStack
12580 * development/lyx.spec.in (%build): add CFLAGS also.
12582 * src/screen.C (drawFrame): removed another warning.
12584 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12586 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12587 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12588 README and ANNOUNCE a bit for the next release. More work is
12591 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12592 unbreakable if we are in freespacing mode (LyX-Code), but not in
12595 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12597 * src/BackStack.h: fixed initialization order in constructor
12599 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12601 * acinclude.m4 (VERSION): new rules for when a version is
12602 development, added also a variable for prerelease.
12603 (warnings): we set with_warnings=yes for prereleases
12604 (lyx_opt): prereleases compile with same optimization as development
12605 (CXXFLAGS): only use pedantic if we are a development version
12607 * src/BufferView.C (restorePosition): don't do anything if the
12608 backstack is empty.
12610 * src/BackStack.h: added member empty, use this to test if there
12611 is anything to pop...
12613 1999-10-25 Juergen Vigna <jug@sad.it>
12616 * forms/layout_forms.fd +
12617 * forms/latexoptions.fd +
12618 * lyx.fd: changed for various form resize issues
12620 * src/mathed/math_panel.C +
12621 * src/insets/inseterror.C +
12622 * src/insets/insetinfo.C +
12623 * src/insets/inseturl.C +
12624 * src/insets/inseturl.h +
12626 * src/LyXSendto.C +
12627 * src/PaperLayout.C +
12628 * src/ParagraphExtra.C +
12629 * src/TableLayout.C +
12631 * src/layout_forms.C +
12638 * src/menus.C: fixed various resize issues. So now forms can be
12639 resized savely or not be resized at all.
12641 * forms/form_url.fd +
12642 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12645 * src/insets/Makefile.am: added files form_url.[Ch]
12647 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12649 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12650 (and presumably 6.2).
12652 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12653 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12654 remaining static member callbacks.
12656 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12659 * src/support/lyxstring.h: declare struct Srep as friend of
12660 lyxstring, since DEC cxx complains otherwise.
12662 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12664 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12666 * src/LaTeX.C (run): made run_bibtex also depend on files with
12668 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12669 are put into the dependency file.
12671 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12672 the code has shown itself to work
12673 (create_ispell_pipe): removed another warning, added a comment
12676 * src/minibuffer.C (ExecutingCB): removed code that has been
12677 commented out a long time
12679 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12680 out code + a warning.
12682 * src/support/lyxstring.h: comment out the three private
12683 operators, when compiling with string ansi conforming compilers
12684 they make problems.
12686 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12688 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12689 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12692 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12695 * src/mathed/math_panel.C (create_math_panel): remove explicit
12698 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12701 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12702 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12703 to XCreatePixmapFromBitmapData
12704 (fl_set_bmtable_data): change the last argument to be unsigned
12706 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12707 and bh to be unsigned int, remove explicit casts in call to
12708 XReadBitmapFileData.
12710 * images/arrows.xbm: made the arrays unsigned char *
12711 * images/varsz.xbm: ditto
12712 * images/misc.xbm: ditto
12713 * images/greek.xbm: ditto
12714 * images/dots.xbm: ditto
12715 * images/brel.xbm: ditto
12716 * images/bop.xbm: ditto
12718 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12720 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12721 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12722 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12724 (LYX_CXX_CHEADERS): added <clocale> to the test.
12726 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12728 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12730 * src/support/lyxstring.C (append): fixed something that must be a
12731 bug, rep->assign was used instead of rep->append.
12733 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12736 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12737 lyx insert double chars. Fix spotted by Kayvan.
12739 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12741 * Fixed the tth support. I messed up with the Emacs patch apply feature
12742 and omitted the changes in lyxrc.C.
12744 1999-10-22 Juergen Vigna <jug@sad.it>
12746 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12748 * src/lyx_cb.C (MenuInsertRef) +
12749 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12750 the form cannot be resized under it limits (fixes a segfault)
12752 * src/lyx.C (create_form_form_ref) +
12753 * forms/lyx.fd: Changed Gravity on name input field so that it is
12756 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12758 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12759 <ostream> and <istream>.
12761 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12762 whether <fstream> provides the latest standard features, or if we
12763 have an oldstyle library (like in egcs).
12764 (LYX_CXX_STL_STRING): fix the test.
12766 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12767 code on MODERN_STL_STREAM.
12769 * src/support/lyxstring.h: use L{I,O}stream.h.
12771 * src/support/L{I,O}stream.h: new files, designed to setup
12772 correctly streams for our use
12773 - includes the right header depending on STL capabilities
12774 - puts std::ostream and std::endl (for LOStream.h) or
12775 std::istream (LIStream.h) in toplevel namespace.
12777 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12779 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12780 was a bib file that had been changed we ensure that bibtex is run.
12781 (runBibTeX): enhanced to extract the names of the bib files and
12782 getting their absolute path and enter them into the dep file.
12783 (findtexfile): static func that is used to look for tex-files,
12784 checks for absolute patchs and tries also with kpsewhich.
12785 Alternative ways of finding the correct files are wanted. Will
12787 (do_popen): function that runs a command using popen and returns
12788 the whole output of that command in a string. Should be moved to
12791 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12792 file with extension ext has changed.
12794 * src/insets/figinset.C: added ifdef guards around the fl_free
12795 code that jug commented out. Now it is commented out when
12796 compiling with XForms == 0.89.
12798 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12799 to lyxstring.C, and only keep a forward declaration in
12800 lyxstring.h. Simplifies the header file a bit and should help a
12801 bit on compile time too. Also changes to Srep will not mandate a
12802 recompile of code just using string.
12803 (~lyxstring): definition moved here since it uses srep.
12804 (size): definition moved here since it uses srep.
12806 * src/support/lyxstring.h: removed a couple of "inline" that should
12809 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12811 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12814 1999-10-21 Juergen Vigna <jug@sad.it>
12816 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12817 set to left if I just remove the width entry (or it is empty).
12819 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12820 paragraph when having dummy paragraphs.
12822 1999-10-20 Juergen Vigna <jug@sad.it>
12824 * src/insets/figinset.C: just commented some fl_free_form calls
12825 and added warnings so that this calls should be activated later
12826 again. This avoids for now a segfault, but we have a memory leak!
12828 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12829 'const char * argument' to 'string argument', this should
12830 fix some Asserts() in lyxstring.C.
12832 * src/lyxfunc.h: Removed the function argAsString(const char *)
12833 as it is not used anymore.
12835 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12837 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12840 * src/Literate.h: some funcs moved from public to private to make
12841 interface clearer. Unneeded args removed.
12843 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12845 (scanBuildLogFile): ditto
12847 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12848 normal TeX Error. Still room for improvement.
12850 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12852 * src/buffer.C (insertErrors): changes to make the error
12853 desctription show properly.
12855 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12858 * src/support/lyxstring.C (helper): changed to use
12859 sizeof(object->rep->ref).
12860 (operator>>): changed to use a pointer instead.
12862 * src/support/lyxstring.h: changed const reference & to value_type
12863 const & lets see if that helps.
12865 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12867 * Makefile.am (rpmdist): fixed to have non static package and
12870 * src/support/lyxstring.C: removed the compilation guards
12872 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12875 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12876 conditional compile of lyxstring.Ch
12878 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12879 stupid check, but it is a lot better than the bastring hack.
12880 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12882 * several files: changed string::erase into string::clear. Not
12885 * src/chset.C (encodeString): use a char temporary instead
12887 * src/table.C (TexEndOfCell): added tostr around
12888 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12889 (TexEndOfCell): ditto
12890 (TexEndOfCell): ditto
12891 (TexEndOfCell): ditto
12892 (DocBookEndOfCell): ditto
12893 (DocBookEndOfCell): ditto
12894 (DocBookEndOfCell): ditto
12895 (DocBookEndOfCell): ditto
12897 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12899 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12901 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12902 (MenuBuildProg): added tostr around ret
12903 (MenuRunChktex): added tostr around ret
12904 (DocumentApplyCB): added tostr around ret
12906 * src/chset.C (encodeString): added tostr around t->ic
12908 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12909 (makeLaTeXFile): added tostr around tocdepth
12910 (makeLaTeXFile): added tostr around ftcound - 1
12912 * src/insets/insetbib.C (setCounter): added tostr around counter.
12914 * src/support/lyxstring.h: added an operator+=(int) to catch more
12917 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12918 (lyxstring): We DON'T allow NULL pointers.
12920 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12922 * src/mathed/math_macro.C (MathMacroArgument::Write,
12923 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12924 when writing them out.
12926 * src/LString.C: remove, since it is not used anymore.
12928 * src/support/lyxstring.C: condition the content to
12929 USE_INCLUDED_STRING macro.
12931 * src/mathed/math_symbols.C, src/support/lstrings.C,
12932 src/support/lyxstring.C: add `using' directive to specify what
12933 we need in <algorithm>. I do not think that we need to
12934 conditionalize this, but any thought is appreciated.
12936 * many files: change all callback functions to "C" linkage
12937 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12938 strict_ansi. Those who were static are now global.
12939 The case of callbacks which are static class members is
12940 trickier, since we have to make C wrappers around them (see
12941 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12942 did not finish this yet, since it defeats the purpose of
12943 encapsulation, and I am not sure what the best route is.
12945 1999-10-19 Juergen Vigna <jug@sad.it>
12947 * src/support/lyxstring.C (lyxstring): we permit to have a null
12948 pointer as assignment value and just don't assign it.
12950 * src/vspace.C (nextToken): corrected this function substituting
12951 find_first(_not)_of with find_last_of.
12953 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12954 (TableOptCloseCB) (TableSpeCloseCB):
12955 inserted fl_set_focus call for problem with fl_hide_form() in
12958 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12960 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12963 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12965 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12966 LyXLex::next() and not eatline() to get its argument.
12968 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12970 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12971 instead, use fstreams for io of the depfile, removed unneeded
12972 functions and variables.
12974 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12975 vector instead, removed all functions and variables that is not in
12978 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12980 * src/buffer.C (insertErrors): use new interface to TeXError
12982 * Makefile.am (rpmdist): added a rpmdist target
12984 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12985 per Kayvan's instructions.
12987 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12989 * src/Makefile.am: add a definition for localedir, so that locales
12990 are found after installation (Kayvan)
12992 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12994 * development/.cvsignore: new file.
12996 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12998 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12999 C++ compiler provides wrappers for C headers and use our alternate
13002 * configure.in: use LYX_CXX_CHEADERS.
13004 * src/cheader/: new directory, populated with cname headers from
13005 libstdc++-2.8.1. They are a bit old, but probably good enough for
13006 what we want (support compilers who lack them).
13008 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
13009 from includes. It turns out is was stupid.
13011 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
13013 * lib/Makefile.am (install-data-local): forgot a ';'
13014 (install-data-local): forgot a '\'
13015 (libinstalldirs): needed after all. reintroduced.
13017 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
13019 * configure.in (AC_OUTPUT): added lyx.spec
13021 * development/lyx.spec: removed file
13023 * development/lyx.spec.in: new file
13025 * po/*.po: merged with lyx.pot becuase of make distcheck
13027 * lib/Makefile.am (dist-hook): added dist-hook so that
13028 documentation files will be included when doing a make
13029 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
13030 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
13032 more: tried to make install do the right thing, exclude CVS dirs
13035 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
13036 Path would fit in more nicely.
13038 * all files that used to use pathstack: uses now Path instead.
13039 This change was a lot easier than expected.
13041 * src/support/path.h: new file
13043 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
13045 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
13047 * src/support/lyxstring.C (getline): Default arg was given for
13050 * Configure.cmd: removed file
13052 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13054 * src/support/DebugStream.[Ch]: remove the explicit std:: before
13055 streams classes and types, add the proper 'using' statements when
13056 MODERN_STL is defined.
13058 * src/debug.h: move the << operator definition after the inclusion
13061 * src/support/filetools.C: include "LAssert.h", which is needed
13064 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
13067 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
13068 include "debug.h" to define a proper ostream.
13070 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
13072 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
13073 method to the SystemCall class which can kill a process, but it's
13074 not fully implemented yet.
13076 * src/*.C: Changed Systemcalls::Startscript() to startscript()
13078 * src/support/FileInfo.h: Better documentation
13080 * src/lyxfunc.C: Added support for buffer-export html
13082 * src/menus.C: Added Export->As HTML...
13084 * lib/bind/*.bind: Added short-cut for buffer-export html
13086 * src/lyxrc.*: Added support for new \tth_command
13088 * lib/lyxrc.example: Added stuff for new \tth_command
13090 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
13092 * lib/Makefile.am (IMAGES): removed images/README
13093 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
13094 installes in correct place. Check permisions is installed
13097 * src/LaTeX.C: some no-op changes moved declaration of some
13100 * src/LaTeX.h (LATEX_H): changed include guard name
13102 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13104 * lib/reLyX/Makefile.am: install noweb2lyx.
13106 * lib/Makefile.am: install configure.
13108 * lib/reLyX/configure.in: declare a config aux dir; set package
13109 name to lyx (not sure what the best solution is); generate noweb2lyx.
13111 * lib/layouts/egs.layout: fix the bibliography layout.
13113 1999-10-08 Jürgen Vigna <jug@sad.it>
13115 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
13116 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
13117 it returned without continuing to search the path.
13119 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
13121 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
13122 also fixes a bug. It is not allowed to do tricks with std::strings
13123 like: string a("hei"); &a[e]; this will not give what you
13124 think... Any reason for the complexity in this func?
13126 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
13128 * Updated README and INSTALL a bit, mostly to check that my
13129 CVS rights are correctly set up.
13131 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
13133 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
13134 does not allow '\0' chars but lyxstring and std::string does.
13136 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
13138 * autogen.sh (AUTOCONF): let the autogen script create the
13139 POTFILES.in file too. POTFILES.in should perhaps now not be
13140 included in the cvs module.
13142 * some more files changed to use C++ includes instead of C ones.
13144 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
13146 (Reread): added tostr to nlink. buggy output otherwise.
13147 (Reread): added a string() around szMode when assigning to Buffer,
13148 without this I got a log of garbled info strings.
13150 * acconfig.h: commented out the PTR_AS_INT macros. They should not
13153 * I have added several ostream & operator<<(ostream &, some_type)
13154 functions. This has been done to avoid casting and warnings when
13155 outputting enums to lyxerr. This as thus eliminated a lot of
13156 explicit casts and has made the code clearer. Among the enums
13157 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
13158 mathed enums, some font enum the Debug::type enum.
13160 * src/support/lyxstring.h (clear): missing method. equivalent of
13163 * all files that contained "stderr": rewrote constructs that used
13164 stderr to use lyxerr instead. (except bmtable)
13166 * src/support/DebugStream.h (level): and the passed t with
13167 Debug::ANY to avoid spurious bits set.
13169 * src/debug.h (Debug::type value): made it accept strings of the
13170 type INFO,INIT,KEY.
13172 * configure.in (Check for programs): Added a check for kpsewhich,
13173 the latex generation will use this later to better the dicovery of
13176 * src/BufferView.C (create_view): we don't need to cast this to
13177 (void*) that is done automatically.
13178 (WorkAreaButtonPress): removed some dead code.
13180 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13182 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
13183 is not overwritten when translated (David Sua'rez de Lis).
13185 * lib/CREDITS: Added David Sua'rez de Lis
13187 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
13189 * src/bufferparams.C (BufferParams): default input encoding is now
13192 * acinclude.m4 (cross_compiling): comment out macro
13193 LYX_GXX_STRENGTH_REDUCE.
13195 * acconfig.h: make sure that const is not defined (to empty) when
13196 we are compiling C++. Remove commented out code using SIZEOF_xx
13199 * configure.in : move the test for const and inline as late as
13200 possible so that these C tests do not interefere with C++ ones.
13201 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
13202 has not been proven.
13204 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13206 * src/table.C (getDocBookAlign): remove bad default value for
13207 isColumn parameter.
13209 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
13211 (ShowFileMenu2): ditto.
13213 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
13214 of files to ignore.
13216 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
13218 * Most files: finished the change from the old error code to use
13219 DebugStream for all lyxerr debugging. Only minor changes remain
13220 (e.g. the setting of debug levels using strings instead of number)
13222 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
13224 * src/layout.C (Add): Changed to use compare_no_case instead of
13227 * src/FontInfo.C: changed loop variable type too string::size_type.
13229 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
13231 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
13232 set ETAGS_ARGS to --c++
13234 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
13236 * src/table.C (DocBookEndOfCell): commented out two unused variables
13238 * src/paragraph.C: commented out four unused variables.
13240 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
13241 insed a if clause with type string::size_type.
13243 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
13246 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
13248 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
13249 variable, also changed loop to go from 0 to lenght + 1, instead of
13250 -1 to length. This should be correct.
13252 * src/LaTeX.C (scanError): use string::size_type as loop variable
13255 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
13256 (l.896) since y_tmp and row was not used anyway.
13258 * src/insets/insetref.C (escape): use string::size_type as loop
13261 * src/insets/insetquotes.C (Width): use string::size_type as loop
13263 (Draw): use string::size_type as loop variable type.
13265 * src/insets/insetlatexaccent.C (checkContents): use
13266 string::size_type as loop variable type.
13268 * src/insets/insetlabel.C (escape): use string::size_type as loop
13271 * src/insets/insetinfo.C: added an extern for current_view.
13273 * src/insets/insetcommand.C (scanCommand): use string::size_type
13274 as loop variable type.
13276 * most files: removed the RCS tags. With them we had to recompile
13277 a lot of files after a simple cvs commit. Also we have never used
13278 them for anything meaningful.
13280 * most files: tags-query-replace NULL 0. As adviced several plases
13281 we now use "0" instead of "NULL" in our code.
13283 * src/support/filetools.C (SpaceLess): use string::size_type as
13284 loop variable type.
13286 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
13288 * src/paragraph.C: fixed up some more string stuff.
13290 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
13292 * src/support/filetools.h: make modestr a std::string.
13294 * src/filetools.C (GetEnv): made ch really const.
13296 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
13297 made code that used these use max/min from <algorithm> instead.
13299 * changed several c library include files to their equivalent c++
13300 library include files. All is not changed yet.
13302 * created a support subdir in src, put lyxstring and lstrings
13303 there + the extra files atexit, fileblock, strerror. Created
13304 Makefile.am. edited configure.in and src/Makefile.am to use this
13305 new subdir. More files moved to support.
13307 * imported som of the functions from repository lyx, filetools
13309 * ran tags-query-replace on LString -> string, corrected the bogus
13310 cases. Tried to make use of lstrings.[hC], debugged a lot. There
13311 is still some errors in there. This is errors where too much or
13312 too litle get deleted from strings (string::erase, string::substr,
13313 string::replace), there can also be some off by one errors, or
13314 just plain wrong use of functions from lstrings. Viewing of quotes
13317 * LyX is now running fairly well with string, but there are
13318 certainly some bugs yet (see above) also string is quite different
13319 from LString among others in that it does not allow null pointers
13320 passed in and will abort if it gets any.
13322 * Added the revtex4 files I forgot when setting up the repository.
13324 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
13326 * All over: Tried to clean everything up so that only the files
13327 that we really need are included in the cvs repository.
13328 * Switched to use automake.
13329 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
13330 * Install has not been checked.
13332 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
13334 * po/pt.po: Three errors:
13335 l.533 and l.538 format specification error
13336 l. 402 duplicate entry, I just deleted it.