1 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
3 * src/frontends/xforms/FormRef.C (updateBrowser):
4 * src/frontends/xforms/forms/form_ref.fd: try clicking on
5 different insets with the sort key active. Now apply this patch!
7 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
9 * src/frontends/xforms/FormPrint.C: set to valid()
10 when we update from the passed parameters.
12 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
14 * src/LColor.C (getFromGUIName): internationalise the comparison.
16 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
17 FormPreferences choice.
19 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
22 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
24 * src/lyx_rc.C: more detail for the printer program config
27 * src/LColor.C: ert->latex text. LColor needs a big revamp
28 but will have to wait till after 1.1.6
30 * src/buffer.C: bring up a dialog if we load a document
31 with an un-installed text class, rather than just complain
34 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
36 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
37 the browser form for a combox in a tabbed folder. Bug fix courtesy of
38 Steve Lamont <spl@ncmir.ucsd.edu>.
40 * src/frontends/xforms/FormDocument.C (build):
41 * src/frontends/xforms/FormPreferences.C (Language::build):
42 pass tabfolders to Combox::add() in order to use this work around.
44 * src/frontends/xforms/FormCitation.C (connect): remove max size
46 (update): sort list of bibliography keys.
48 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
50 No max size limitation. Same popup for new and existing insets. Fixes
51 bugs reported by Rob Lahaye.
53 * src/frontends/xforms/FormCitation.C (c-tor):
54 * src/frontends/xforms/FormCopyright.C (c-tor):
55 * src/frontends/xforms/FormError.C (c-tor):
56 * src/frontends/xforms/FormGraphics.C (c-tor):
57 * src/frontends/xforms/FormIndex.C (c-tor):
58 * src/frontends/xforms/FormRef.C (c-tor):
59 * src/frontends/xforms/FormToc.C (c-tor):
60 * src/frontends/xforms/FormUrl.C (c-tor):
61 use correct policy for ButtonController.
63 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
65 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
68 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
70 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
71 Some resizing changes.
73 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
75 * configure.in: fix typo
77 * lib/languages: add ukraninian and change no to no_NO
79 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
81 * src/bufferview_funcs.C (FontSize): use setLyXSize
83 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
85 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
86 to check for systems where mkstemp() is available but not declared
87 in headers. The new autoconf macro lyx_CHECK_DECL can be used
88 to check for declarations in headers.
90 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
92 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
94 * forms/makefile: added bibforms.fd, include_form.fd.
95 Removed lyx_sendfax.fd.
97 * src/LaTeXLog.C (ShowLatexLog):
98 * src/LyXAction.C (init):
99 * src/bufferparams.C (readLanguage): altered messages as suggested by
102 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
105 * src/credits.C: made fd_form_credits non-static, so that it can be
106 redrawn should the xforms colors be re-mapped.
107 * src/spellchecker.C ditto fd_form_spell_options.
109 * src/filedlg.[Ch] (redraw):
110 * src/intl.[Ch] (redraw):
111 * src/lyxfr0.[Ch] (redraw):
112 * src/insets/figinset.[Ch] (redraw):
113 * src/insets/insetexternal.[Ch] (redraw):
114 new methods, connected to Dialogs::redrawGUI.
116 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
117 to be connected to Dialogs::redrawGUI.
119 * src/frontends/xforms/FormCitation.C (build):
120 * src/frontends/xforms/FormCopyright.C (build):
121 * src/frontends/xforms/FormError.C (build):
122 * src/frontends/xforms/FormGraphics.C (build):
123 * src/frontends/xforms/FormIndex.C (build):
124 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
125 * src/frontends/xforms/FormToc.C (build):
126 * src/frontends/xforms/FormUrl.C (build):
127 use the ButtonController correctly.
129 * src/frontends/xforms/FormCopyright.C (build):
130 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
131 the .fd file and into build().
133 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
135 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
137 * src/frontends/xforms/forms/form_citation.fd:
138 * src/frontends/xforms/forms/form_copyright.fd:
139 * src/frontends/xforms/forms/form_error.fd:
140 * src/frontends/xforms/forms/form_graphics.fd:
141 * src/frontends/xforms/forms/form_index.fd:
142 * src/frontends/xforms/forms/form_toc.fd:
143 * src/frontends/xforms/forms/form_url.fd:
144 renamed some of the objects. Named others explicitly for the first time.
145 Added Restore and Apply buttons where appropriate.
147 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
150 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
152 * src/version.h: try the pre2 again
154 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
156 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
158 * src/frontends/kde/FormParagraph.C: added using directive.
160 * src/frontends/kde/paradlg.C: added config.h and using directive.
162 * src/frontends/kde/paradlg.h: added std::qualifier.
164 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
166 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
168 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
170 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
172 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
174 * src/version.h: set back to 1.1.6cvs
176 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
178 * src/version.h: set to 1.1.6pre2
180 2000-11-20 Marko Vendelin <markov@ioc.ee>
182 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
184 * src/frontends/gnome/Makefile.am: updated list of XForms object files
186 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
188 * src/LColor.C (init):
189 * src/lyxrc.C (getDescription): changed some comments as suggested by
192 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
193 disconnect the redrawGUI signal in best-practice fashion.
195 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
196 long_opts_tab to reflect the change in name of this tabfolder, as
197 suggested by John Levon.
198 (connect, disconnect): new methods. Don't do much at present other than
199 ensuring that we can't resize the dialog. This just makes xforms go
201 (lots of methods in Colors): made void rather than bool. The idea is
202 to have an isOk() function that keeps track of whether any input is
203 genuinely invalid and should therefore block Save, Apply.
204 Easier to manipulate the counters rapidly.
205 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
206 compiler will like this code. Much cleaner way of doing things.
208 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
210 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
211 rather than simple counters, following suggestion by John Levon.
213 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
214 than engraved frame + text.
216 * src/frontends/xforms/forms/makefile: removed spurious command.
218 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
220 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
222 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
225 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
227 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
228 see what Lars has changed and what is just white space!
229 Now used X directly to ascertain the RGB color associated with the
231 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
233 Added some sort capability.
234 The X11 color name database input is only displayed if the database
235 isn't found in the standard place.
236 Got rid of struct compare_converter; it wasn't used.
237 Probably some other stuff that I've forgotten.
239 * src/frontends/xforms/FormPreferences.h: changed the names of some
240 methods in the Colors struct. Added a couple of structs to help sort
241 colors by name and by RGBColor.
243 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
244 functions into a new class RWInfo.
246 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
247 The dialog is now almost navigable using the keyboard. Unfortunately,
248 the cursor has to be inside a browser for it to be activated. There is
249 no visual feedback for the key shortcuts to the arrow keys (use
250 Alt-appropriate arrow key, Alt-x).
252 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
255 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
256 xform_helpers.[Ch]. See above.
258 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
260 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
262 * src/screen.C (setCursorColor): new method. Sets the color of the
264 (ShowManualCursor): call it.
265 Constify some local variables.
267 * src/LColor.[Ch] (LColor): add entry for cursor
268 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
271 2000-11-19 Juergen Vigna <jug@sad.it>
273 * src/insets/insettabular.C (draw): fixed text border redraw problem.
274 (calculate_dimensions_of_cells): try to boost up when inserting chars.
276 2000-11-15 Rob Lahaye <lahaye@postech.edu>
278 * lib/ui/default.ui: OptItem used for Fax entry
280 2000-11-17 Matej Cepl <cepl@bigfoot.com>
282 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
284 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
286 * src/vspace.C (nextToken): fix so it can handle length phrases like
287 "10mm+-20mm", "40inplus16mmminus10cm" etc.
289 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
291 * src/frontends/xforms/FormPreferences.C: constify several variables
292 (BrowserLyX): rewrite to not need the choice variable
293 (Modify): rewrite to not need the choide variable
294 (compare_converter): make operator const
296 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
297 correct the writing of \set_color
298 (getDescription): return a const string
300 * src/kbsequence.[Ch] (addkey): remove dead code
302 * src/Painter.C (text): remove some commented code
304 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
306 * src/ColorHandler.[Ch]: removed some header files from .h file.
307 Included LColor.h in .C file.
309 * src/LColor.[Ch]: made class copyable so that I could create a
310 system_lcolor instance.
312 * src/Painter.h: removed LColor.h.
314 * src/lyx_gui.C (create_forms): used AddName.
316 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
317 of user preferences/lyxrc file.
319 * src/lyxrc.C (output): output changes to lcolor.
321 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
323 Moved class xformColor to files xform_helpers.[Ch]. These files,
324 Color.[Ch], could now be moved into src if they would be useful to
327 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
328 Also moved FormPreferences::browseFile here as it can be used by any
329 xform dialog with a "Browse" button. FormGraphics is a perfect example.
331 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
332 ReadableFile): changed the FormPreferences methods a little and moved
333 them here as they'll be useful elsewhere also.
335 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
336 Removed some header files and used forward declarations instead.
338 Removed some methods as they'll be useful elsewhere (see above).
340 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
341 Can also now modify the LyX LColors. However, for reasons that I don't
342 yet understand, it appears that we can use
343 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
344 present. The problem appears to lie in ColorHandler, because I can
345 change the color using LColor.SetColor(). Similarly, when reading in a
346 preferences file with some set_color instances, I'll get a warning
347 like: Color sea green is undefined or may not be redefined
348 Bad lyxrc set_color for sea green
350 Once the buffer is loaded, however, I can happily change to this color.
352 Finally, it appears that I have to set the color of "inset frame"
353 explicitly, or it oscillates from "black" to "indian red" with each
356 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
358 * ANNOUNCE: corrected a spelling mistake.
360 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
363 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
365 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
367 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
370 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
371 match the requirements from the standard better. This is required
372 to work with gnu libstdc++-v3
374 * src/frontends/xforms/FormPreferences.C: add explict pair
375 arguments to browse calls. include support/lyxmanip.h remvoe
376 extern fmt. whitespace changes. reorder variables in
377 FormPreferences.h, to match initalizaton order.
379 * several files: constify more local variables.
381 * src/buffer.C: remove some commented functions.
383 * src/DepTable.C (remove_files_with_extension): temporary
384 work around for gcc 2.97
385 * src/filedlg.C (find): ditto
386 * src/Variables.C (set): ditto
387 * src/LyXAction.C (searchActionArg): ditto
388 (retrieveActionArg): ditto
390 * configure.in: check for mktemp too
392 * UPGRADING: prepare for 1.1.6
394 * Makefile.am (lgbtags): add backup tags for when etags are
395 different than usual.
397 * ANNOUNCE: prepare for 1.1.6
399 * src/support/tempname.C (make_tempfile): new function, wrapper
400 around mkstemp and mktemp. Only mkstemp has been tested.
403 2000-11-14 Rob Lahaye <lahaye@postech.edu>
405 * default.ui: capitalized some menu items to improve shortcuts.
407 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
409 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
411 * src/frontends/xforms/Dialogs.C: add "using" directive.
413 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
415 * src/filedlg.C (Select): highlight suggested file in browser, if
418 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
419 each tab folder is encapsulated in its own class.
420 The Language keymaps are now chosen using a text input and a
421 browser button, rather than a Combox.
422 All the browser buttons are now functional, although LyXFileDlg
423 still needs to be modified to make it straighhtforward to return a
424 directory if that is what is desired.
426 * src/frontends/xforms/forms/form_preferences.fd: use text input
427 and browse button to input the Language keymaps. Add a few
428 callbacks for the browse buttons.
430 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
432 * src/support/tempname.C (tempName): small changes to make it
433 safer. remove the '.' before XXXXXX
435 * src/support/filetools.C (TmpFileName): remove func
438 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
439 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
440 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
441 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
443 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
446 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
449 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
450 for bp (this fixes a reproducible hard crash)
452 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
455 * src/frontends/xforms/FormBase.h: make bp_ private
456 (FormBaseBI): remove default for bp
459 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
462 * src/frontends/xforms/Color.C (RGBColor): made several vars
463 const, changed initialization of j to allow it to be const
466 * several files: added const to local variables.
468 * src/lyx_cb.C: removed several function prototypes and moved them
472 (UpdateLayoutPreamble):
474 (MenuInsertLabel): add BufferView as arguemnt
475 (LayoutsCB): make tmp const
477 * src/layout_forms.h: regenerated
479 * src/debug.C: add Debug::FILES
480 (showLevel) (showTags): translate the desc
482 * src/debug.h: add FILES as debug target
484 * src/bufferlist.C: use current_view as an interim measure becuase
485 of added arguments to MenuWrite and MenuWriteAs
487 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
489 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
491 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
492 libstdc++ is compiled with.
494 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
496 * lib/layouts/docbook-book.layout
497 * lib/layouts/docbook.layout
498 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
499 those paragraphs are expresse as SGML comments <!-- -->.
501 * src/LaTeXFeatures.h
502 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
503 parameter, this allows to express all the include files as relative
504 paths to the master buffer. The verbatim insert works as the other
507 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
509 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
511 (MakeDocBookFile): top_element is always written. Some clean up, as
512 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
514 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
515 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
516 a reference is written instead of the name.
517 (Validate): use the relative path for the filename.
519 * src/insets/insetlabel.C (DocBook): write end tag, for XML
522 * src/support/filetools.h
523 * src/support/filetools.C (IsSGMLFilename): added.
526 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
528 * development/OS2/quick_fix.patch:
530 * README.OS2: quick update to the OS/2 port.
532 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
534 * src/converter.C: add "using" directive.
536 * src/frontends/xforms/FormPreferences.C: add "using" directive.
537 (compare_converter): add "int" as return type.
539 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
542 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
544 * src/lyx_gui.C (create_forms): map the xform colours, should a
545 mapping exist. Ie, call XformColor::read().
547 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
548 and struct HSV as HSVColor.
549 (XformColor::read, XformColor::write) : new methods that
550 input/output any changes to the cform GUI colors.
552 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
555 * src/frontends/xforms/FormPreferences.C Lots of little changes
556 associated with the changed name of the RGB and HSV structs. Can
557 now save changes to xforms GUI to file. Commented out
558 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
559 used currently anyway.
561 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
563 * src/converter.C: A lot of changes:
564 - It is no longer possible to choose between two or more ways to
565 export to some format (the new code uses only the shortest path).
566 However, it is still possible to choose between pdflatex/ps2pdf
567 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
568 - Added several methods that makes the FormPreferences code simpler.
569 - Changed the tokens $$FName and $$OutName to $$i and $$o.
571 * src/exporter.C (Export): lyxrc.use_pdf is set before
572 makeLaTeXFile is called. This works but not very nice.
574 * src/frontends/xforms/FormPreferences.C: The formats/converters
575 tabs are now fully functional.
577 * src/buffer.C (getTocList): Add numbers to the captions.
579 * lib/lyxrc.example: Removed fax section
581 * src/support/rename.C (rename): Delete the old file if lyx::copy
584 2000-11-13 Rob Lahaye <lahaye@postech.edu>
586 * lib/ui/default.ui: minor polishing.
588 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
590 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
593 * lib/Makefile.am (DOCINST): do not install everything in the
594 documentation directory.
596 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
598 * src/bufferlist.C (newFile): set the filename to the constructed
601 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
602 constructed "newfileXX.lyx" name to the dialog
604 * src/frontends/DialogBase.h: make update() non-abstract so
605 KDE doesn't need to implement two update methods for every form
607 * src/frontends/kde/Makefile.am: add missing xforms objects
610 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
612 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
614 * src/frontends/xforms/Color.[Ch]: new files, defining the color
615 structs RGB and HSV. May not be the best place for these files.
616 Perhaps move them into src ?
618 * src/frontends/xforms/Makefile.am: added new files.
620 * src/frontends/xforms/forms/form_preferences.fd:
621 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
622 replaced all instances of "colour" with "color"!
624 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
627 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
628 tab. Can now alter the colors of the xform's GUI on the fly. With
629 the aid of a single static Signal (see below), can "Apply" these
630 changes to all currently open dialogs. (Well, to all of the NEW
631 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
632 subsequently opened dialogs will, of course, also have the new
633 color scheme. Cannot yet save (or load) the choices to file, so
634 they are lost when exiting LyX.
636 * src/frontends/Dialogs.h:
637 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
638 Used to trigger a redraw of any dialogs connected to it because,
639 for example, the GUI colours have been re-mapped.
641 * src/frontends/xforms/FormBase.[Ch]:
642 * src/frontends/xforms/FormDocument.[Ch]:
643 * src/frontends/xforms/FormParagraph.[Ch]:
644 * src/frontends/xforms/FormPreferences.[Ch]:
645 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
646 method, to be connected to Dialogs::redrawGUI. Method must be
647 virtual, because dialogs with tabbed folders need to redraw the
648 forms of each tab folder.
650 * src/LyXView.C (d-tor):
651 * src/frontends/xforms/FormBase.C (d-tor): connected
652 Dialogs::redrawGUI signal to redraw().
654 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
655 removed Assert, because it is identical to that in FormBase.
657 2000-11-10 Rob Lahaye <lahaye@postech.edu>
659 * lib/ui/default.ui: minor polishing.
661 2000-11-10 Juergen Vigna <jug@sad.it>
663 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
664 (deleteLyXText): ditto
666 * src/insets/insettabular.C (InsetButtonPress): don't clear the
667 selection on mouse-button-3.
669 * src/insets/insettabular.h: new function clearSelection(), use this
670 functions inside insettabular.C.
672 * src/insets/insettabular.C (TabularFeatures): clear the selection
673 on remove_row/column.
675 * src/insets/inset.C (scroll): fixed some scroll stuff.
677 * src/insets/insettabular.C (draw): fixed another minor draw problem.
679 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
681 * lib/CREDITS: add Yves Bastide
683 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
685 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
686 check whether C library functions are in the global namespace.
688 * configure.in: calls it.
690 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
693 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
695 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
696 iterators to prevent crash.
698 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
700 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
702 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
703 shortcut for xforms CB to the preemptive or post-handler function.
705 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
706 removed the HIDDEN_TIMER as it's no longer used.
707 Various other small changes.
709 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
710 preemptive handler to obtain feedback, rather than the post-handler.
711 (ColoursLoadBrowser): find "black" and "white" based on RGB values
713 Formats tab is now complete. Converters tab is nearly so.
715 2000-11-09 Juergen Vigna <jug@sad.it>
717 * src/insets/insettext.C (~InsetText):
720 (SetParagraphData): set cache.second to 0 after deleting it!
721 (getLyXText): check if cache.second is not 0 if finding it.
723 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
725 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
726 lyxlex to parse the rgb.txt file.
729 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
730 replace the default '#' comment character.
732 * src/support/tempname.C: add "using" directive
733 * src/frontends/ButtonPolicies.C: ditto.
735 * src/support/filetools.C (DirList): add an explicit cast to avoid
736 a compile error (probably not the right fix)
738 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
740 * src/support/filetools.C (DirList): implement using system functions
742 * src/support/tempname.C: new file
744 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
746 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
748 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
751 * src/frontends/xforms/ButtonController.C: new file
753 * src/os2_defines.h: remove getcwd define
755 * src/lyxvc.C: include support/lyxlib.h
756 (showLog): use lyx::tempName
758 * src/lyx_cb.C: comment out includes that we don't need
759 (AutoSave): use lyx::tempName
761 * src/filedlg.C: include support/lyxlib.h
762 (Reread): use lyx::getcwd
764 * src/converter.C: include support/filetools.h
765 (add_options): change to static inline, make tail const
766 (Add): make old_viewer const
767 (GetAllFormats): make it a const method, use const_iterator
768 (enable): make static inline
769 (SplitFormat): make using_format const
771 * src/LaTeX.C (run): use lyx::getcwd
773 * configure.in: check for mkstemp as well
775 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
777 * src/converter.[Ch] (GetAllCommands): new method.
779 * src/support/filetools.[Ch] (DirList): new method.
781 * src/frontends/xforms/FormPreferences.C: started (just!) adding
782 functionality to the converters tab.
783 The formats tab is now nearly complete.
784 The kbmap choices in Languages tab now display the contents of
785 system_lyxdir/kbd/*.kmap in readable form.
787 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
788 Moved some variables into the class.
790 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
791 inactive tab folder to FL_COL1. Haven't yet worked out how to change
792 colour of active folder to lighter grey instead. Any takers?
793 (form_colours): added an "Apply" button.
794 (form_converters): added a "Flags" input field.
795 (form_formats): added a "Shortcut" input field. Note that we can't use
796 names such as "input_shortcut" as this buggers up the sed script stuff.
798 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
806 * src/lyx_sendfax_main.C:
809 * src/spellchecker.C:
810 * src/insets/figinset.C:
811 * src/insets/insetbib.C:
812 * src/insets/insetexternal.C:
813 * src/insets/insetinclude.C:
814 * src/insets/insetinfo.C:
815 * src/mathed/math_panel.C:
816 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
817 all "daughter" dialogs now have identical "feel".
819 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
821 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
822 used (and was only used in one place prior to this patch. Incorrectly!)
824 * src/frontends/xforms/FormDocument.C: changed some instances of
825 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
826 sense. Also added fl_set_input_return() for class_->input_doc_extra and
827 for options_->input_float_placement. This fixes a bug reported by
830 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
831 functionality into d-tor.
833 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
834 input of numerals also.
836 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
837 fl_set_form_atclose(). Can now close dialog from window manager,
838 fixing a bug reported by Rob Lahaye.
840 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
842 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
843 are no longer dark. Haven't yet worked out how to lighten the colour of
844 the active tabfolder. Any ideas anybody?
845 Adjusted Colours tab a little.
846 Added Shortcut field to converters tab. Note that we can't create an
847 fdesign label like "input_shortcut" as this buggers up the sed-script
850 * src/frontends/xforms/FormPreferences.[Ch]:
851 (feedback): fixed crash due to to ob=0.
852 (LanguagesXXX): the kbmap choices now contain the files
853 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
854 be replaced by an input with a file browse button, but since the browse
855 buttons don'y yet work, this'll do for the moment.
856 (FormatsXXX): think that this is now nearly fully functional.
857 Some points/questions though:
858 1. Does "Apply" remove formats if no longer present?
859 2. I think that the browser should list the GUI names rather than the
861 3. Must ensure that we can't delete Formats used by an existing
864 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
865 if this is the best way to do this.
867 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
869 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
871 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
872 for variable assignment.
874 2000-11-07 Rob Lahaye <lahaye@postech.edu>
876 * src/lib/ui/default.ui: added sub/superscripts to menu as
877 Insert->Special characters and cleaned-up the file a bit
879 2000-11-07 Allan Rae <rae@lyx.org>
881 * src/frontends/xforms/FormPreferences.C (feedback): make sure
882 ob isn't 0 before using it. See comments in function.
884 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
886 * src/frontends/xforms/form_*.C: regenerated
888 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
890 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
892 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
893 compiling with gcc-2.96
895 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
897 * src/support/lyxstring.C: add a couple "using" directives.
899 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
900 a .c_str() here too for good measure.
901 * src/Spacing.C (set): ditto.
902 * src/lyxfunc.C (Dispatch): ditto.
904 * src/insets/insettabular.C (copySelection): change .str() to
905 .str().c_str() to fix problems with lyxstring.
906 * src/support/filetools.C (GetFileContents): ditto.
907 * src/buffer.C (asciiParagraph): ditto.
908 * src/paragraph.C (String): ditto.
910 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
911 * lib/bind/sciword.bind: ditto.
913 * src/LyXAction.C (init): remove "symbol-insert" function, which
914 shared LFUN_INSERT_MATH with "math-insert".
916 * lib/configure.m4: == is not a valid operator for command test.
918 * src/lyxrc.C: add using directive.
920 * src/converter.h: add std:: qualifier.
922 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
924 * src/converter.[Ch] and other files: Change the Format class to a
925 real class, and create two instances: formats and system_format.
927 * src/lyxrc.C (output): Output the difference between formats and
930 * src/frontends/xforms/FormPreferences.C (input): Simplify.
931 (buildFormats): Insert formats into browser.
932 (inputFormats): Made the browser and add button functional.
933 (applyFormats): Update formats from format_vec.
935 * src/converter.C: Changed all (*it). to it->
936 (Format::dummy): New method.
937 (Format::importer): New format flag.
938 (Formats::GetAllFormats): New method.
939 (Formats::Add): Delete format from the map if prettyname is empty.
940 (Converter::Convert): Print an error message if moving the file fails.
941 (Converter::GetReachableTo): New method
943 * src/MenuBackend.[Ch]: Add support for importformats tag.
945 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
947 * lib/configure.m4: Add word->tex and ps->fax converters.
949 * lib/ui/default.ui: Use ImportFormats on file->import menu.
950 Return fax to file menu.
954 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
956 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
959 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
962 * src/lyxfunc.C (processKeyEvent): removed
964 * src/bufferlist.C (emergencyWrite): removed the out commented
965 emergency write code.
967 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
969 * src/LyXView.[Ch]: remove the outcommented raw_callback code
971 * many files: change formatting to be a bit more uniform for
972 if,while,for,switch statements, remove some parantesis not needed.
975 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
977 * config/kde.m4: make config more robust when KDEDIR is set
979 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
981 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
982 not returned a pixmap for "math-insert".
984 * src/LyXAction.C (init): sort the entries a bit.
986 2000-11-03 Juergen Vigna <jug@sad.it>
988 * src/insets/insettabular.h: added fixed number to update codes so
989 that update is only in one direction.
991 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
994 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
995 before call to edit because of redraw.
997 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
999 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1001 * lib/ui/default.ui: Populate "edit_float" menu
1003 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1005 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1006 "floats-operate". The name is ugly (and the func also), but this
1007 is just a band-aid until we switch to new insets.
1009 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1011 * lib/ui/default.ui: update again the menu layout (fix some
1014 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1016 * src/MenuBackend.h (fulllabel): new method.
1018 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1019 the menu shortcuts of a menu are unique and whether they
1020 correspond to a letter of the label.
1021 (expand): call checkShortcuts when debugging.
1023 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1025 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1027 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1029 * lib/examples/*.lyx : '\language default' => '\language english'
1031 * lib/examples/it_splash.lyx : except where it should be italian
1033 * lib/templates/*.lyx : the same
1035 * doc/*.lyx* : the same
1037 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1039 * lib/bind/menus.bind: remove the Layout menu entries, which I
1040 somehow forgot earlier.
1042 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1044 * lib/ui/old-default.ui: keep the old one here for reference (to
1047 * lib/ui/default.ui: update the menu layout
1049 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1051 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1052 Can now Apply to different insets without closing the dialog.
1054 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1055 Can't actually DO anything with them yet, but I'd like a little
1058 * src/frontends/xforms/input_validators.[ch]
1059 (fl_lowercase_filter): new.
1061 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1063 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1064 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1066 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1068 2000-11-02 Juergen Vigna <jug@sad.it>
1070 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1071 on char insertion as it has already be updated by bv->updateInset().
1073 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1074 if an inset inside was updated.
1076 * lib/configure.cmd: commented out fax-search code
1078 2000-11-01 Yves Bastide <stid@acm.org>
1080 * src/tabular.C (OldFormatRead): set tabular language to the
1083 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1085 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1086 class names with non-letter characters (from Yves Bastide).
1088 * lib/ui/default.ui: change Item to OptItem in import menu.
1089 Comment out fax stuff.
1091 * lib/configure.m4: comment out fax-related stuff.
1093 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1095 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1096 useful xforms helper functions. At present contains only formatted().
1097 Input a string and it returns it with line breaks so that in fits
1100 * src/frontends/xforms/Makefile.am: add new files.
1102 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1103 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1106 * src/frontends/xforms/FormPreferences.[Ch]:
1107 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1108 but lots of little clean ups. Removed enum State. Make use of
1109 formatted(). Constify lots of methods. Perhaps best of all: removed
1110 requirement for that horrible reinterpret_cast from pointer to long in
1113 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1115 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1116 conditionalize build on xforms < 0.89
1118 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1120 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1122 * src/LyXAction.C (init): comment out fax
1124 * src/lyxrc.h: comment out the fax enums
1125 comment out the fax variables
1127 * src/commandtags.h: comment out LFUN_FAX
1129 * src/lyxrc.C: disable fax variables.
1130 (read): disable parsing of fax variables
1131 (output): disable writing of fax variables
1132 (getFeedback): now description for fax variables
1134 * src/lyxfunc.C: comment out MenuFax
1135 (Dispatch): disable LFUN_FAX
1137 * src/lyx_cb.C (MenuFax): comment out
1139 * src/WorkArea.C: add <cctype>
1140 (work_area_handler): better key handling, should be ok now.
1141 for accented chars + etc
1143 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1144 lyx_sendfax.h and lyx_sendfax_man.C
1146 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1147 (show): don't call InitLyXLookup when using xforms 0.89
1149 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1151 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1153 * src/support/filetools.C (GetFileContents): close to dummy change
1155 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1157 * src/trans.C (AddDeadkey): workaround stupid compilers.
1159 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1161 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1162 of two-sided document.
1164 2000-10-31 Juergen Vigna <jug@sad.it>
1166 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1168 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1169 xposition to the Edit call.
1171 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1173 * src/trans.C (AddDeadkey): cast explicitly to char.
1175 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1177 * src/tabular.C (AsciiBottomHLine): simplify?
1178 (AsciiTopHLine): simplify?
1179 (print_n_chars): simplify
1180 (DocBook): remove most of the << endl; we should flush the stream
1181 as seldom as possible.
1183 (TeXBottomHLine): ditto
1184 (TeXTopHLine): ditto
1186 (write_attribute): try a templified version.
1187 (set_row_column_number_info): lesson scope of variables
1189 * src/support/lstrings.h (tostr): new specialization of tostr
1191 * src/trans.C (AddDeadkey): slightly cleaner fix.
1193 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1195 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1196 '%%' in Toc menu labels.
1199 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1200 font_norm is iso10646-1.
1202 * src/font.C (ascent): Fixed for 16bit fonts
1203 (descent,lbearing,rbearing): ditto
1205 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1207 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1208 (getFeedback): new static method.
1210 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1211 Now use combox rather than choice to display languages.
1212 Feedback is now output using a new timer callback mechanism, identical
1213 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1215 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1217 * src/minibuffer.C: fix for older compilers
1219 2000-10-30 Juergen Vigna <jug@sad.it>
1221 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1222 has to be Left of the inset otherwise LyXText won't find it!
1224 * src/BufferView2.C (open_new_inset): delete the inset if it can
1227 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1229 * lyx.man: fix typo.
1231 2000-10-29 Marko Vendelin <markov@ioc.ee>
1232 * src/frontends/gnome/FormCitation.C
1233 * src/frontends/gnome/FormCitation.h
1234 * src/frontends/gnome/FormCopyright.C
1235 * src/frontends/gnome/FormCopyright.h
1236 * src/frontends/gnome/FormError.C
1237 * src/frontends/gnome/FormError.h
1238 * src/frontends/gnome/FormIndex.C
1239 * src/frontends/gnome/FormIndex.h
1240 * src/frontends/gnome/FormPrint.C
1241 * src/frontends/gnome/FormPrint.h
1242 * src/frontends/gnome/FormRef.C
1243 * src/frontends/gnome/FormRef.h
1244 * src/frontends/gnome/FormToc.C
1245 * src/frontends/gnome/FormToc.h
1246 * src/frontends/gnome/FormUrl.C
1247 * src/frontends/gnome/FormUrl.h
1248 * src/frontends/gnome/Menubar_pimpl.C
1249 * src/frontends/gnome/mainapp.C
1250 * src/frontends/gnome/mainapp.h
1251 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1252 changing update() to updateSlot() where appropriate
1254 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1256 * src/frontends/xforms/FormPreferences.[Ch]:
1257 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1260 2000-10-28 Juergen Vigna <jug@sad.it>
1262 * src/insets/insettabular.C (draw): fixed drawing bug.
1264 * src/insets/insettext.C (clear):
1266 (SetParagraphData): clearing the TEXT buffers when deleting the
1267 paragraphs used by it.
1269 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1271 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1273 2000-10-27 Juergen Vigna <jug@sad.it>
1275 * src/tabular.C (~LyXTabular): removed not needed anymore.
1277 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1280 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1282 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1285 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1288 * src/frontends/xforms/FormPreferences.[Ch]:
1289 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1290 Reorganised as modules based on tabs. Much easier to follow the
1291 flow and to add new tabs. Added warning and feedback messages.
1294 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1296 * src/tabular.h (DocBook): add std:: qualifier.
1298 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1300 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1301 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1304 * insettabular.C (DocBook): uses the tabular methods to export
1307 * src/insets/insettext.h
1308 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1310 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1312 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1315 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1316 moved misplaced AllowInput two lines up.
1318 * src/buffer.C (readFile): compare float with float, not with int
1320 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1322 * src/minibuffer.C: add "using SigC::slot" statement.
1324 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1326 * src/frontends/xforms/forms/README: updated section about make.
1328 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1329 Tidied some forms up, made two of form_tabular's tabs more
1330 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1331 fixed translation problem with "Column".
1333 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1335 * src/minibuffer.h: use Timeout instead of the xforms timer
1337 (setTimer) rewrite for the Timeout, change to unsigned arg
1338 (set): change to unsigned timer arg
1341 * src/minibuffer.C (TimerCB): removed func
1342 (C_MiniBuffer_TimerCB): removed func
1343 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1344 (peek_event): use a switch statement
1345 (add): don't use fl_add_timer.
1346 (Set): rewrite to use the Timeout
1349 * src/Timeout.[Ch] (setType): return a Timeout &
1350 (setTimeout): ditto, change to unsigned arg for timeout
1352 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1354 * src/mathed/formula.C (mathed_string_width): Use string instead
1355 of a constant size char array.
1357 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1359 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1360 the two recently added operator<< for SMInput and State.
1362 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1364 (OkCancelPolicy): ditto
1365 (OkCancelReadOnlyPolicy): ditto
1366 (NoRepeatedApplyReadOnlyPolicy): ditto
1367 (OkApplyCancelReadOnlyPolicy): ditto
1368 (OkApplyCancelPolicy): ditto
1369 (NoRepeatedApplyPolicy): ditto
1371 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1373 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1374 add the usual std:: qualifiers.
1376 2000-10-25 Juergen Vigna <jug@sad.it>
1378 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1380 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1382 * src/support/filetools.C (MakeRelPath): change some types to
1385 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1386 ButtonPolicy::SMInput and ButtonPolicy::State.
1388 * src/FontLoader.C (reset): small cleanup
1389 (unload): small cleanup
1391 * src/FontInfo.C (getFontname): initialize error to 10000.0
1393 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1395 * src/frontends/xforms/FormPreferences.[Ch]:
1396 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1397 TeX encoding and default paper size sections.
1399 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1401 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1404 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1405 make the message_ empty.
1406 (FormError): don't initialize message_ in initializer list.
1408 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1410 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1412 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1414 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1416 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1418 * src/frontends/kde/*data.[Ch]: _("") is not
1421 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1423 * src/buffer.C: removed redundant using directive.
1425 * src/frontends/DialogBase.h: revert to original definition of
1428 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1429 stuff into two classes, one for each dialog, requires a new
1430 element in the dialogs vector, FormTabularCreate.
1432 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1435 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1436 method. Continues Allan's idea, but means that derived classes
1437 don't need to worry about "update or hide?".
1439 * src/frontends/xforms/FormError.C (showInset): add connection
1442 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1443 one for each dialog. FormTabular now contains main tabular dialog
1446 * src/frontends/xforms/FormTabularCreate.[Ch]:
1447 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1450 * src/frontends/xforms/FormGraphics.[Ch]:
1451 * src/frontends/xforms/forms/form_graphics.fd
1452 * src/frontends/xforms/FormTabular.[Ch]:
1453 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1454 classes of FormInset.
1456 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1457 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1459 * src/frontends/xforms/Makefile.am:
1460 * src/frontends/xforms/forms/makefile: added new files.
1462 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1463 variable. added Signal0 hide signal, in keeping with other GUI-I
1466 * src/support/lstrings.h: removed redundant std:: qualifier as
1467 it's already declared in Lsstream.h.
1469 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1471 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1475 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1477 * src/tabular.C (Ascii): minimize scope of cell.
1479 * src/BufferView2.C (nextWord): return string() instead of 0;
1481 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1483 * src/converter.h: add a std:: qualifier
1485 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1487 * src/importer.[Ch]: New files. Used for importing files into LyX.
1489 * src/lyxfunc.C (doImport): Use the new Importer class.
1491 * src/converter.h: Add shortcut member to the Format class.
1492 Used for holding the menu shortcut.
1494 * src/converter.C and other files: Made a distinction between
1495 format name and format extension. New formats can be defined using
1496 the \format lyxrc tag.
1497 Added two new converter flags: latex and disable.
1499 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1501 * src/support/lyxlib.h: unify namespace/struct implementation.
1502 Remove extra declarations.
1504 * src/support/chdir.C (chdir): remove version taking char const *
1506 * src/support/rename.C: ditto.
1507 * src/support/lyxsum.C: ditto.
1509 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1511 * src/frontends/xforms/FormBase.[Ch]:
1512 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1513 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1514 work only for the next call to fl_show_form(). The correct place to set
1515 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1516 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1517 from FormBase have the minimum size set; no more stupid crashes with
1520 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1522 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1524 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1526 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1528 * src/support/lyxlib.h: changed second argument of mkdir to
1529 unsigned long int (unsigned int would probably have been enough,
1530 but...). Removed <sys/types.h> header.
1531 * src/support/mkdir.C (mkdir): ditto.
1535 2000-10-19 Juergen Vigna <jug@sad.it>
1537 * src/lyxfunc.C (MenuNew): small fix (form John)
1539 * src/screen.C (Update): removed unneeded code.
1541 * src/tabular.C (Ascii): refixed int != uint bug!
1543 * src/support/lyxlib.h: added sys/types.h include for now permits
1544 compiling, but I don't like this!
1546 2000-10-18 Juergen Vigna <jug@sad.it>
1548 * src/text2.C (ClearSelection): if we clear the selection we need
1549 more refresh so set the status apropriately
1551 * src/insets/insettext.C (draw): hopefully finally fixed draw
1554 2000-10-12 Juergen Vigna <jug@sad.it>
1556 * src/insets/insettext.C (draw): another small fix and make a block
1557 so that variables are localized.
1559 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1561 * src/support/lstrings.C (lowercase, uppercase):
1562 use explicit casts to remove compiler warnings.
1564 * src/support/LRegex.C (Impl):
1565 * src/support/StrPool.C (add):
1566 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1567 (AddPath, MakeDisplayPath):
1568 * src/support/lstrings.C (prefixIs, subst):
1569 use correct type to remove compiler warnings.
1571 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1573 * src/support/lyxlib.h:
1574 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1575 portability and to remove compiler warning with DEC cxx.
1577 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1579 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1581 * src/minibuffer.C (peek_event): retun 1 when there has been a
1582 mouseclick in the minibuffer.
1586 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1588 * src/frontends/xforms/FormParagraph.C: more space above/below
1591 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1593 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1594 a char only if real_current_font was changed.
1596 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1598 * NEWS: update somewhat for 1.1.6
1600 * lib/ui/default.ui: clean up.
1602 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1604 * lib/CREDITS: clean up
1606 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1608 * src/combox.[Ch] (select): changed argument back to int
1609 * src/combox.C (peek_event): removed num_bytes as it is declared but
1612 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1613 modified calls to Combox::select() to remove warnings about type
1616 * src/insets/insetbutton.C (width): explicit cast to remove warning
1617 about type conversion.
1619 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1622 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1623 sel_pos_end, refering to cursor position are changed to
1624 LyXParagraph::size_type.
1626 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1627 consistent with LyXCursor::pos().
1628 (inset_pos): changed to LyXParagraph::size_type for same reason.
1630 * src/insets/insettext.C (resizeLyXText): changed some temporary
1631 variables refing to cursor position to LyXParagraph::size_type.
1633 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1635 * src/frontends/kde/<various>: The Great Renaming,
1638 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1640 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1642 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1644 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1645 0 when there are no arguments.
1647 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1649 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1650 to segfaults when pressing Ok in InsetBibtex dialog.
1652 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1654 * forms/layout_forms.fd:
1655 * src/layout_forms.C (create_form_form_character): small change to use
1656 labelframe rather than engraved frame + text
1658 * src/lyx_gui.C (create_forms): initialise choice_language with some
1659 arbitrary value to prevent segfault when dialog is shown.
1661 2000-10-16 Baruch Even <baruch.even@writeme.com>
1663 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1664 is no resulting file. This pertains only to LaTeX output.
1666 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1668 * src/text.C (Backspace): Make sure that the row of the cursor is
1671 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1674 * src/lyx_gui.C (init): Prevent a crash when only one font from
1675 menu/popup fonts is not found.
1677 * lib/lyxrc.example: Add an example for binding a key for language
1680 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1682 * src/converter.C (GetReachable): Changed the returned type to
1684 (IsReachable): New method
1686 * src/MenuBackend.C (expand): Handle formats that appear more
1689 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1691 * src/frontends/support/Makefile.am
1692 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1695 * lib/CREDITS: add Garst Reese.
1697 * src/support/snprintf.h: add extern "C" {} around the definitions.
1699 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1701 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1704 * src/frontends/xforms/FormDocument.C:
1705 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1706 compile without "conversion to integral type of smaller size"
1709 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1711 * src/text.C (GetColumnNearX): Fixed disabled code.
1713 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1715 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1718 * src/support/snprintf.[ch]: new files
1720 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1722 * src/frontends/kde/formprintdialog.C: add
1723 file browser for selecting postscript output
1725 * src/frontends/kde/formprintdialogdata.C:
1726 * src/frontends/kde/formprintdialogdata.h: re-generate
1729 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1731 * src/frontends/gnome/Makefile.am:
1732 * src/frontends/kde/Makefile.am: FormCommand.C
1733 disappeared from xforms
1735 * src/frontends/kde/FormCitation.C:
1736 * src/frontends/kde/FormIndex.C: read-only
1739 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1741 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1744 * src/bufferlist.C: add using directive.
1746 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1748 * src/support/lyxfunctional.h: version of class_fun for void
1749 returns added, const versions of back_inseter_fun and compare_fun
1752 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1754 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1756 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1758 * ChangeLog: cleanup.
1760 * lib/CREDITS: update to add all the contributors we've forgotten.
1761 I have obviously missed some, so tell me whether there were
1764 2000-10-13 Marko Vendelin <markov@ioc.ee>
1766 * src/frontends/gnome/FormCitation.C
1767 * src/frontends/gnome/FormCitation.h
1768 * src/frontends/gnome/FormError.C
1769 * src/frontends/gnome/FormIndex.C
1770 * src/frontends/gnome/FormRef.C
1771 * src/frontends/gnome/FormRef.h
1772 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1774 * src/frontends/gnome/FormCitation.C
1775 * src/frontends/gnome/FormCopyright.C
1776 * src/frontends/gnome/FormError.C
1777 * src/frontends/gnome/FormIndex.C
1778 * src/frontends/gnome/FormRef.C
1779 * src/frontends/gnome/FormToc.C
1780 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1783 * src/frontends/gnome/Menubar_pimpl.C
1784 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1787 2000-10-11 Baruch Even <baruch.even@writeme.com>
1790 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1791 to convey its real action.
1793 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1794 clear the minibuffer and prepare to enter a command.
1796 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1797 the rename from ExecCommand to PrepareForCommand.
1798 * src/lyxfunc.C (Dispatch): ditto.
1800 2000-10-11 Baruch Even <baruch.even@writeme.com>
1802 * src/buffer.C (writeFile): Added test for errors on writing, this
1803 catches all errors and not only file system full errors as intended.
1805 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1807 * src/lyx_gui.C (create_forms): better fix for crash with
1808 translated interface.
1810 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1812 * src/frontends/kde/Makefile.am:
1813 * src/frontends/kde/FormCopyright.C:
1814 * src/frontends/kde/formcopyrightdialog.C:
1815 * src/frontends/kde/formcopyrightdialog.h:
1816 * src/frontends/kde/formcopyrightdialogdata.C:
1817 * src/frontends/kde/formcopyrightdialogdata.h:
1818 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1819 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1820 copyright to use qtarch
1822 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1824 * src/encoding.C (read): Fixed bug that caused an error message at
1825 the end of the file.
1827 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1829 * lib/lyxrc.example: Fixed hebrew example.
1831 2000-10-13 Allan Rae <rae@lyx.org>
1833 * src/frontends/xforms/FormPreferences.C (input): reworking the
1835 (build, update, apply): New inputs in various tabfolders
1837 * src/frontends/xforms/FormToc.C: use new button policy.
1838 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1839 dialogs that either can't use any existing policy or where it just
1842 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1845 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1846 added a bool parameter which is ignored.
1848 * src/buffer.C (setReadonly):
1849 * src/BufferView_pimpl.C (buffer):
1850 * src/frontends/kde/FormCopyright.h (update):
1851 * src/frontends/kde/FormCitation.[Ch] (update):
1852 * src/frontends/kde/FormIndex.[Ch] (update):
1853 * src/frontends/kde/FormPrint.[Ch] (update):
1854 * src/frontends/kde/FormRef.[Ch] (update):
1855 * src/frontends/kde/FormToc.[Ch] (update):
1856 * src/frontends/kde/FormUrl.[Ch] (update):
1857 * src/frontends/gnome/FormCopyright.h (update):
1858 * src/frontends/gnome/FormCitation.[Ch] (update):
1859 * src/frontends/gnome/FormError.[Ch] (update):
1860 * src/frontends/gnome/FormIndex.[Ch] (update):
1861 * src/frontends/gnome/FormPrint.[Ch] (update):
1862 * src/frontends/gnome/FormRef.h (update):
1863 * src/frontends/gnome/FormToc.[Ch] (update):
1864 * src/frontends/gnome/FormUrl.[Ch] (update):
1865 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1866 to updateBufferDependent and DialogBase
1868 * src/frontends/xforms/FormCitation.[hC]:
1869 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1870 * src/frontends/xforms/FormError.[Ch]:
1871 * src/frontends/xforms/FormGraphics.[Ch]:
1872 * src/frontends/xforms/FormIndex.[Ch]:
1873 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1874 and fixed readOnly handling.
1875 * src/frontends/xforms/FormPrint.[Ch]:
1876 * src/frontends/xforms/FormRef.[Ch]:
1877 * src/frontends/xforms/FormTabular.[Ch]:
1878 * src/frontends/xforms/FormToc.[Ch]:
1879 * src/frontends/xforms/FormUrl.[Ch]:
1880 * src/frontends/xforms/FormInset.[Ch]:
1881 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1882 form of updateBufferDependent.
1884 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1885 if form()->visible just in case someone does stuff to the form in a
1888 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1889 the buttoncontroller for everything the enum used to be used for.
1890 (update) It would seem we need to force all dialogs to use a bool
1891 parameter or have two update functions. I chose to go with one.
1892 I did try removing update() from here and FormBase and defining the
1893 appropriate update signatures in FormBaseB[DI] but then ran into the
1894 problem of the update() call in FormBase::show(). Whatever I did
1895 to get around that would require another function and that just
1896 got more confusing. Hence the decision to make everyone have an
1897 update(bool). An alternative might have been to override show() in
1898 FormBaseB[DI] and that would allow the different and appropriate
1901 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1902 true == buffer change occurred. I decided against using a default
1903 template parameter since not all compilers support that at present.
1905 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1907 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1908 army knife" by removing functionality.
1909 (clearStore): removed. All such housekeeping on hide()ing the dialog
1910 is to be carried out by overloaded disconnect() methods.
1911 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1912 superceded by Baruch's neat test (FormGraphics) to update an existing
1913 dialog if a new signal is recieved rather than block all new signals
1915 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1916 only to Inset dialogs.
1917 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1918 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1920 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1922 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1923 as a base class to all inset dialogs. Used solely to connect/disconnect
1924 the Inset::hide signal and to define what action to take on receipt of
1925 a UpdateBufferDependent signal.
1926 (FormCommand): now derived from FormInset.
1928 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1931 * src/frontends/xforms/FormCopyright.[Ch]:
1932 * src/frontends/xforms/FormPreferences.[Ch]:
1933 now derived from FormBaseBI.
1935 * src/frontends/xforms/FormDocument.[Ch]:
1936 * src/frontends/xforms/FormParagraph.[Ch]:
1937 * src/frontends/xforms/FormPrint.[Ch]:
1938 now derived from FormBaseBD.
1940 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1942 * src/frontends/xforms/FormCitation.[Ch]:
1943 * src/frontends/xforms/FormError.[Ch]:
1944 * src/frontends/xforms/FormRef.[Ch]:
1945 * src/frontends/xforms/FormToc.[Ch]:
1946 (clearStore): reworked as disconnect().
1948 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1951 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1953 * src/converter.C (runLaTeX): constify buffer argument
1956 * src/frontends/support/Makefile.am (INCLUDES): fix.
1958 * src/buffer.h: add std:: qualifier
1959 * src/insets/figinset.C (addpidwait): ditto
1960 * src/MenuBackend.C: ditto
1961 * src/buffer.C: ditto
1962 * src/bufferlist.C: ditto
1963 * src/layout.C: ditto
1964 * src/lyxfunc.C: ditto
1966 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1968 * src/lyxtext.h (bidi_level): change return type to
1969 LyXParagraph::size_type.
1971 * src/lyxparagraph.h: change size_type to
1972 TextContainer::difference_type. This should really be
1973 TextContainer::size_type, but we need currently to support signed
1976 2000-10-11 Marko Vendelin <markov@ioc.ee>
1977 * src/frontends/gnome/FormError.h
1978 * src/frontends/gnome/FormRef.C
1979 * src/frontends/gnome/FormRef.h
1980 * src/frontends/gnome/FormError.C
1981 * src/frontends/gnome/Makefile.am
1982 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1983 to Gnome frontend. Both dialogs use "action" area.
1985 2000-10-12 Baruch Even <baruch.even@writeme.com>
1987 * src/graphics/GraphicsCacheItem_pimpl.C:
1988 * src/graphics/Renderer.C:
1989 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1992 2000-10-12 Juergen Vigna <jug@sad.it>
1994 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1995 visible when selecting).
1997 * development/Code_rules/Rules: fixed some typos.
1999 2000-10-09 Baruch Even <baruch.even@writeme.com>
2001 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2002 compiling on egcs 1.1.2 possible.
2004 * src/filedlg.C (comp_direntry::operator() ): ditto.
2006 2000-08-31 Baruch Even <baruch.even@writeme.com>
2008 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2011 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2012 transient it now only gets freed when the object is destructed.
2014 2000-08-24 Baruch Even <baruch.even@writeme.com>
2016 * src/frontends/FormGraphics.h:
2017 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2020 2000-08-20 Baruch Even <baruch.even@writeme.com>
2022 * src/insets/insetgraphics.C:
2023 (draw): Added messages to the drawn rectangle to report status.
2024 (updateInset): Disabled the use of the inline graphics,
2027 2000-08-17 Baruch Even <baruch.even@writeme.com>
2029 * src/frontends/support: Directory added for the support of GUII LyX.
2031 * src/frontends/support/LyXImage.h:
2032 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2035 * src/frontends/support/LyXImage_X.h:
2036 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2037 version of LyXImage, this uses the Xlib Pixmap.
2039 * src/PainterBase.h:
2040 * src/PainterBase.C:
2042 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2043 replacement to Pixmap.
2045 * src/insets/insetgraphics.h:
2046 * src/insets/insetgraphics.C:
2047 * src/graphics/GraphicsCacheItem.h:
2048 * src/graphics/GraphicsCacheItem.C:
2049 * src/graphics/GraphicsCacheItem_pimpl.h:
2050 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2053 * src/graphics/GraphicsCacheItem.h:
2054 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2055 another copy of the object.
2057 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2058 of cacheHandle, this fixed a bug that sent LyX crashing.
2060 * src/graphics/XPM_Renderer.h:
2061 * src/graphics/XPM_Renderer.C:
2062 * src/graphics/EPS_Renderer.h:
2063 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2065 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2067 * src/lyxfunc.C (processKeySym): only handle the
2068 lockinginset/inset stuff if we have a buffer and text loaded...
2070 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2072 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2074 * src/support/lyxfunctional.h: add operator= that takes a reference
2076 * src/lyxserver.C (mkfifo): make first arg const
2078 * src/layout.h: renamed name(...) to setName(...) to work around
2081 * src/buffer.C (setFileName): had to change name of function to
2082 work around bugs in egcs. (renamed from fileName)
2084 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2086 * src/support/translator.h: move helper template classes to
2087 lyxfunctional.h, include "support/lyxfunctional.h"
2089 * src/support/lyxmanip.h: add delaration of fmt
2091 * src/support/lyxfunctional.h: new file
2092 (class_fun_t): new template class
2093 (class_fun): helper template function
2094 (back_insert_fun_iterator): new template class
2095 (back_inserter_fun): helper template function
2096 (compare_memfun_t): new template class
2097 (compare_memfun): helper template function
2098 (equal_1st_in_pair): moved here from translator
2099 (equal_2nd_in_pair): moved here from translator
2101 * src/support/fmt.C: new file
2102 (fmt): new func, can be used for a printf substitute when still
2103 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2105 * src/support/StrPool.C: add some comments
2107 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2110 * src/insets/figinset.C (addpidwait): use std::copy with
2111 ostream_iterator to fill the pidwaitlist
2113 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2115 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2118 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2121 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2123 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2124 (class_update): ditto
2125 (BulletPanel): ditto
2126 (CheckChoiceClass): move initialization of tc and tct
2128 * src/tabular.C: remove current_view
2129 (OldFormatRead): similar to right below [istream::ignore]
2131 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2132 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2133 unused [istream::ignore]
2135 * src/lyxfunc.C: include "support/lyxfunctional.h"
2136 (getInsetByCode): use std::find_if and compare_memfun
2138 * src/lyxfont.C (stateText): remove c_str()
2140 * src/lyx_main.C (setDebuggingLevel): make static
2141 (commandLineHelp): make static
2143 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2144 Screen* together with fl_get_display() and fl_screen
2146 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2147 togheter with fl_get_display() and fl_screen
2148 (create_forms): remove c_str()
2150 * src/layout.C: include "support/lyxfunctional.h"
2151 (hasLayout): use std::find_if and compare_memfun
2152 (GetLayout): use std::find_if and comapre_memfun
2153 (delete_layout): use std::remove_if and compare_memfun
2154 (NumberOfClass): use std:.find_if and compare_memfun
2156 * src/gettext.h: change for the new functions
2158 * src/gettext.C: new file, make _(char const * str) and _(string
2159 const & str) real functions.
2161 * src/font.C (width): rewrite slightly to avoid one extra variable
2163 * src/debug.C: initialize Debug::ANY here
2165 * src/commandtags.h: update number comments
2167 * src/combox.h (get): make const func
2169 (getline): make const
2171 * src/combox.C (input_cb): handle case where fl_get_input can
2174 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2175 "support/lyxfunctional.h", remove current_view variable.
2176 (resize): use std::for_each with std::mem_fun
2177 (getFileNames): use std::copy with back_inserter_fun
2178 (getBuffer): change arg type to unsigned int
2179 (emergencyWriteAll): call emergencyWrite with std::for_each and
2181 (emergencyWrite): new method, the for loop in emergencyWriteAll
2183 (exists): use std::find_if with compare_memfun
2184 (getBuffer): use std::find_if and compare_memfun
2186 * src/buffer.h: add typedefs for iterator_category, value_type
2187 difference_type, pointer and reference for inset_iterator
2188 add postfix ++ for inset_iterator
2189 make inset_iterator::getPos() const
2191 * src/buffer.C: added support/lyxmanip.h
2192 (readFile): use lyxerr << fmt instead of printf
2193 (makeLaTeXFile): use std::copy to write out encodings
2195 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2197 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2198 free and the char * temp.
2199 (hasMenu): use std::find_if and compare_memfun
2202 * src/Makefile.am (lyx_SOURCES): added gettext.C
2204 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2205 string::insert small change to avoid temporary
2207 * src/LColor.C (getGUIName): remove c_str()
2209 * several files: change all occurrences of fl_display to
2212 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2213 that -pedantic is not used for gcc 2.97 (cvs gcc)
2215 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2217 2000-10-11 Allan Rae <rae@lyx.org>
2219 * src/frontends/xforms/FormPreferences.C (input): template path must be
2220 a readable directory. It doesn't need to be writeable.
2221 (build, delete, update, apply): New inputs in the various tabfolders
2223 * src/frontends/xforms/forms/form_preferences.fd:
2224 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2225 several new entries to existing folders. Shuffled some existing stuff
2228 * src/frontends/xforms/forms/form_print.fd:
2229 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2230 Should probably rework PrinterParams as well. Note that the switch to
2231 collated is effectively the same as !unsorted so changing PrinterParams
2232 will require a lot of fiddly changes to reverse the existing logic.
2234 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2236 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2238 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2240 2000-10-10 Allan Rae <rae@lyx.org>
2243 * src/lyxfunc.C (Dispatch):
2245 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2248 * src/lyxrc.C (output): Only write the differences between system lyxrc
2249 and the users settings.
2252 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2254 I'll rewrite this later, after 1.1.6 probably, to keep a single
2255 LyXRC but two instances of a LyXRCStruct.
2257 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2259 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2261 * src/tabular.h: add a few std:: qualifiers.
2263 * src/encoding.C: add using directive.
2264 * src/language.C: ditto.
2266 * src/insets/insetquotes.C (Validate): use languages->lang()
2267 instead of only language.
2269 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2271 * lib/languages: New file.
2273 * lib/encodings: New file.
2275 * src/language.C (Languages): New class.
2276 (read): New method. Reads the languages from the 'languages' file.
2278 * src/encoding.C (Encodings): New class.
2279 (read): New method. Reads the encodings from the 'encodings' file.
2281 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2284 * src/bufferparams.h and a lot of files: Deleted the member language,
2285 and renamed language_info to language
2287 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2288 * src/lyxfont.C (latexWriteStartChanges): ditto.
2289 * src/paragraph.C (validate,TeXOnePar): ditto.
2291 * src/lyxfont.C (update): Restored deleted code.
2293 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2295 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2297 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2299 * src/insets/figinset.[Ch]:
2300 * src/insets/insetinclude.[Ch]:
2301 * src/insets/insetinclude.[Ch]:
2302 * src/insets/insetparent.[Ch]:
2303 * src/insets/insetref.[Ch]:
2304 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2306 * src/insets/*.[Ch]:
2307 * src/mathed/formula.[Ch]:
2308 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2310 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2311 * src/lyx_cb.C (FigureApplyCB):
2312 * src/lyxfunc.C (getStatus, Dispatch):
2313 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2316 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2318 * src/converter.[Ch] (Formats::View):
2319 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2321 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2322 *current_view->buffer(). This will change later, but this patch is way
2325 2000-10-09 Juergen Vigna <jug@sad.it>
2327 * src/text.C (GetRow): small fix.
2329 * src/BufferView_pimpl.C (cursorPrevious):
2330 (cursorNext): added LyXText parameter to function.
2332 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2333 keypress depending on cursor position.
2335 2000-10-06 Juergen Vigna <jug@sad.it>
2337 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2338 (copySelection): redone this function and also copy ascii representa-
2341 * src/tabular.C (Ascii):
2345 (print_n_chars): new functions to realize the ascii export of tabulars.
2347 2000-10-05 Juergen Vigna <jug@sad.it>
2349 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2350 if we don't have a buffer.
2352 2000-10-10 Allan Rae <rae@lyx.org>
2354 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2355 with closing dialog. It seems that nested tabfolders require hiding
2356 of inner tabfolders before hiding the dialog itself. Actually all I
2357 did was hide the active outer folder.
2359 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2360 unless there really is a buffer. hideBufferDependent is called
2363 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2364 POTFILES.in stays in $(srcdir).
2366 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2368 * lib/lyxrc.example: Few changes.
2370 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2372 * src/BufferView_pimpl.C (buffer): only need one the
2373 updateBufferDependent signal to be emitted once! Moved to the end of
2374 the method to allow bv_->text to be updated first.
2376 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2377 and hSignal_ with Dialogs * and BufferDependency variables.
2378 New Buffer * parent_, initialised when the dialog is launched. Used to
2379 check whether to update() or hide() dialog in the new, private
2380 updateOrHide() method that is connected to the updateBufferDependent
2381 signal. Daughter classes dictate what to do using the
2382 ChangedBufferAction enum, passed to the c-tor.
2384 * src/frontends/xforms/FormCitation.C:
2385 * src/frontends/xforms/FormCommand.C:
2386 * src/frontends/xforms/FormCopyright.C:
2387 * src/frontends/xforms/FormDocument.C:
2388 * src/frontends/xforms/FormError.C:
2389 * src/frontends/xforms/FormIndex.C:
2390 * src/frontends/xforms/FormPreferences.C:
2391 * src/frontends/xforms/FormPrint.C:
2392 * src/frontends/xforms/FormRef.C:
2393 * src/frontends/xforms/FormToc.C:
2394 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2397 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2398 ChangedBufferAction enum.
2400 * src/frontends/xforms/FormParagraph.[Ch]
2401 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2404 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2406 * lib/bind/cua.bind: fix a bit.
2407 * lib/bind/emacs.bind: ditto.
2409 * lib/bind/menus.bind: remove real menu entries from there.
2411 * src/spellchecker.C: make sure we only include strings.h when
2414 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2416 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2417 function. It enlarges the maximum number of pup when needed.
2418 (add_toc2): Open a new menu if maximum number of items per menu has
2421 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2423 * src/frontends/kde/FormPrint.C: fix error reporting
2425 * src/frontends/xforms/FormDocument.C: fix compiler
2428 * lib/.cvsignore: add Literate.nw
2430 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2433 * bufferview_funcs.[Ch]
2436 * text2.C: Add support for numbers in RTL text.
2438 2000-10-06 Allan Rae <rae@lyx.org>
2440 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2441 to be gettext.m4 friendly again. ext_l10n.h is now
2442 generated into $top_srcdir instead of $top_builddir
2443 so that lyx.pot will be built correctly -- without
2444 duplicate parsing of ext_l10n.h.
2446 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2448 * src/frontends/kde/FormCitation.C: make the dialog
2449 behave more sensibly
2451 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2453 * config/kde.m4: fix consecutive ./configure runs,
2454 look for qtarch, fix library order
2456 * src/frontends/kde/Makefile.am: tidy up,
2457 add Print dialog, add .dlg dependencies
2459 * src/frontends/kde/FormPrint.C:
2460 * src/frontends/kde/FormPrint.h:
2461 * src/frontends/kde/formprintdialog.C:
2462 * src/frontends/kde/formprintdialog.h:
2463 * src/frontends/kde/formprintdialogdata.C:
2464 * src/frontends/kde/formprintdialogdata.h:
2465 * src/frontends/kde/dlg/formprintdialog.dlg: add
2468 * src/frontends/kde/dlg/README: Added explanatory readme
2470 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2471 script to double-check qtarch's output
2473 * src/frontends/kde/formindexdialog.C:
2474 * src/frontends/kde/formindexdialogdata.C:
2475 * src/frontends/kde/formindexdialogdata.h:
2476 * src/frontends/kde/dlg/formindexdialog.dlg: update
2477 for qtarch, minor fixes
2479 2000-10-05 Allan Rae <rae@lyx.org>
2481 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2482 dialogs when switching buffers update them instead. It's up to each
2483 dialog to decide if it should still be visible or not.
2484 update() should return a bool to control visiblity within show().
2485 Or perhaps better to set a member variable and use that to control
2488 * lib/build-listerrors: create an empty "listerrors" file just to stop
2489 make trying to regenerate it all the time if you don't have noweb
2492 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2494 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2495 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2496 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2497 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2498 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2500 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2502 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2504 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2505 deleting buffer. Closes all buffer-dependent dialogs.
2507 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2509 * src/frontends/xforms/FormCitation.[Ch]:
2510 * src/frontends/xforms/FormPreferences.[Ch]:
2511 * src/frontends/xforms/FormPrint.[Ch]:
2512 * src/frontends/xforms/FormRef.[Ch]:
2513 * src/frontends/xforms/FormUrl.[Ch]: ditto
2515 * src/frontends/xforms/FormDocument.[Ch]:
2516 * src/frontends/xforms/forms/form_document.C.patch:
2517 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2518 pass through a single input() function.
2520 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2522 * lib/build-listerrors: return status as OK
2524 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2526 * lib/lyxrc.example: Updated to new export code
2528 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2530 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2533 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2536 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2537 LyX-Code is defined.
2538 * lib/layouts/amsbook.layout: ditto.
2540 * boost/Makefile.am: fix typo.
2542 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2544 (add_lastfiles): removed.
2545 (add_documents): removed.
2546 (add_formats): removed.
2548 * src/frontends/Menubar.C: remove useless "using" directive.
2550 * src/MenuBackend.h: add a new MenuItem constructor.
2552 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2555 2000-10-04 Allan Rae <rae@lyx.org>
2557 * lib/Makefile.am (listerrors):
2558 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2559 I haven't got notangle installed so Kayvan please test. The output
2560 should end up in $builddir. This also allows people who don't have
2561 noweb installed to complete the make process without error.
2563 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2564 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2565 by JMarc's picky compiler.
2567 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2570 * src/insets/insettabular.C (setPos): change for loop to not use
2571 sequencing operator. Please check this Jürgen.
2573 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2575 * src/insets/insetcite.C (getScreenLabel): ditto
2576 * src/support/filetools.C (QuoteName): ditto
2577 (ChangeExtension): ditto
2579 * src/BufferView_pimpl.C (scrollCB): make heigt int
2581 * src/BufferView2.C (insertInset): comment out unused arg
2583 * boost/Makefile.am (EXTRADIST): new variable
2585 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2587 * src/exporter.C (IsExportable): Fixed
2589 * lib/configure.m4: Small fix
2591 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2593 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2594 * src/insets/insetbib.C (bibitemWidest): ditto.
2595 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2597 2000-10-03 Juergen Vigna <jug@sad.it>
2599 * src/BufferView2.C (theLockingInset): removed const because of
2600 Agnus's compile problems.
2602 * src/insets/insettext.C (LocalDispatch): set the language of the
2603 surronding paragraph on inserting the first character.
2605 * various files: changed use of BufferView::the_locking_inset.
2607 * src/BufferView2.C (theLockingInset):
2608 (theLockingInset): new functions.
2610 * src/BufferView.h: removed the_locking_inset.
2612 * src/lyxtext.h: added the_locking_inset
2614 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2616 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2618 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2620 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2621 * src/mathed/math_cursor.C (IsAlpha): ditto.
2622 * src/mathed/math_inset.C (strnew): ditto.
2623 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2624 (IMetrics): cxp set but never used; removed.
2625 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2626 that the variable in question has been removed also!
2629 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2630 using the Buffer * passed to Latex(), using the BufferView * passed to
2631 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2633 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2634 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2636 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2637 * src/buffer.C (readInset): used new InsetBibtex c-tor
2638 * (getBibkeyList): used new InsetBibtex::getKeys
2640 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2643 * lib/build-listerrors
2645 * src/exporter.C: Add literate programming support to the export code
2648 * src/lyx_cb.C: Remove old literate code.
2650 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2653 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2654 * src/converter.C (View, Convert): Use QuoteName.
2656 * src/insets/figinset.C (Preview): Use Formats::View.
2658 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2660 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2662 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2663 the top of the function, because compaq cxx complains that the
2664 "goto exit_with_message" when the function is disabled bypasses
2666 (MenuNew): try a better fix for the generation of new file names.
2667 This time, I used AddName() instead of AddPath(), hoping Juergen
2670 2000-10-03 Allan Rae <rae@lyx.org>
2672 * src/frontends/xforms/forms/form_preferences.fd:
2673 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2674 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2675 "Look and Feel"->"General" but will need to be split up further into
2676 general output and general input tabs. Current plan is for four outer
2677 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2678 stuff; "Inputs" for input and import configuration; "Outputs" for
2679 output and export configuration; and one more whatever is left over
2680 called "General". The leftovers at present look like being which
2681 viewers to use, spellchecker, language support and might be better
2682 named "Support". I've put "Paths" in "Inputs" for the moment as this
2683 seems reasonable for now at least.
2684 One problem remains: X error kills LyX when you close Preferences.
2686 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2688 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2689 qualifier from form()
2690 * src/frontends/xforms/FormCitation.[Ch]:
2691 * src/frontends/xforms/FormCopyright.[Ch]:
2692 * src/frontends/xforms/FormDocument.[Ch]:
2693 * src/frontends/xforms/FormError.[Ch]:
2694 * src/frontends/xforms/FormIndex.[Ch]:
2695 * src/frontends/xforms/FormPreferences.[Ch]:
2696 * src/frontends/xforms/FormPrint.[Ch]:
2697 * src/frontends/xforms/FormRef.[Ch]:
2698 * src/frontends/xforms/FormToc.[Ch]:
2699 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2701 * src/frontends/xforms/FormCitation.[Ch]:
2702 * src/frontends/xforms/FormIndex.[Ch]:
2703 * src/frontends/xforms/FormRef.[Ch]:
2704 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2705 with Allan's naming policy
2707 * src/frontends/xforms/FormCitation.C: some static casts to remove
2710 2000-10-02 Juergen Vigna <jug@sad.it>
2712 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2713 now you can type or do stuff inside the table-cell also when in dummy
2714 position, fixed visible cursor.
2716 * src/insets/insettext.C (Edit): fixing cursor-view position.
2718 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2719 be used for equal functions in lyxfunc and insettext.
2721 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2723 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2725 * src/frontends/gnome/FormCitation.h:
2726 * src/frontends/gnome/FormCopyright.h:
2727 * src/frontends/gnome/FormIndex.h:
2728 * src/frontends/gnome/FormPrint.h:
2729 * src/frontends/gnome/FormToc.h:
2730 * src/frontends/gnome/FormUrl.h:
2731 * src/frontends/kde/FormCitation.h:
2732 * src/frontends/kde/FormCopyright.h:
2733 * src/frontends/kde/FormIndex.h:
2734 * src/frontends/kde/FormRef.h:
2735 * src/frontends/kde/FormToc.h:
2736 * src/frontends/kde/FormUrl.h: fix remaining users of
2739 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2741 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2742 from depth argument.
2743 (DocBookHandleCaption): ditto.
2744 (DocBookHandleFootnote): ditto.
2745 (SimpleDocBookOnePar): ditto.
2747 * src/frontends/xforms/FormDocument.h (form): remove extra
2748 FormDocument:: qualifier.
2750 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2752 * sigc++/handle.h: ditto.
2754 * src/lyx_gui_misc.C: add "using" directive.
2756 * src/cheaders/cstddef: new file, needed by the boost library (for
2759 2000-10-02 Juergen Vigna <jug@sad.it>
2761 * src/insets/insettext.C (SetFont): better support.
2763 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2765 * src/screen.C (DrawOneRow): some uint refixes!
2767 2000-10-02 Allan Rae <rae@lyx.org>
2769 * boost/.cvsignore: ignore Makefile as well
2771 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2772 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2774 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2775 Left this one out by accident.
2777 * src/frontends/xforms/FormBase.h (restore): default to calling
2778 update() since that will restore the original/currently-applied values.
2779 Any input() triggered error messages will require the derived classes
2780 to redefine restore().
2782 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2783 avoid a segfault. combo_doc_class is the main concern.
2785 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2787 * Simplify build-listerrors in view of GUI-less export ability!
2789 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2791 * src/lyx_main.C (easyParse): Disable gui when exporting
2793 * src/insets/figinset.C:
2796 * src/lyx_gui_misc.C
2797 * src/tabular.C: Changes to allow no-gui.
2799 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2801 * src/support/utility.hpp: removed file
2802 * src/support/block.h: removed file
2804 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2807 * src/mathed/formula.C: add support/lyxlib.h
2808 * src/mathed/formulamacro.C: ditto
2810 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2811 * src/lyxparagraph.h: ditto
2813 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2814 * src/frontends/Makefile.am (INCLUDES): ditto
2815 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2816 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2817 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2818 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2819 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2820 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2822 * src/BufferView.h: use boost/utility.hpp
2823 * src/LColor.h: ditto
2824 * src/LaTeX.h: ditto
2825 * src/LyXAction.h: ditto
2826 * src/LyXView.h: ditto
2827 * src/bufferlist.h: ditto
2828 * src/lastfiles.h: ditto
2829 * src/layout.h: ditto
2830 * src/lyx_gui.h: ditto
2831 * src/lyx_main.h: ditto
2832 * src/lyxlex.h: ditto
2833 * src/lyxrc.h: ditto
2834 * src/frontends/ButtonPolicies.h: ditto
2835 * src/frontends/Dialogs.h: ditto
2836 * src/frontends/xforms/FormBase.h: ditto
2837 * src/frontends/xforms/FormGraphics.h: ditto
2838 * src/frontends/xforms/FormParagraph.h: ditto
2839 * src/frontends/xforms/FormTabular.h: ditto
2840 * src/graphics/GraphicsCache.h: ditto
2841 * src/graphics/Renderer.h: ditto
2842 * src/insets/ExternalTemplate.h: ditto
2843 * src/insets/insetcommand.h: ditto
2844 * src/support/path.h: ditto
2846 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2847 and introduce clause for 2.97.
2849 * boost/libs/README: new file
2851 * boost/boost/utility.hpp: new file
2853 * boost/boost/config.hpp: new file
2855 * boost/boost/array.hpp: new file
2857 * boost/Makefile.am: new file
2859 * boost/.cvsignore: new file
2861 * configure.in (AC_OUTPUT): add boost/Makefile
2863 * Makefile.am (SUBDIRS): add boost
2865 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2867 * src/support/lstrings.C (suffixIs): Fixed.
2869 2000-10-01 Allan Rae <rae@lyx.org>
2871 * src/PrinterParams.h: moved things around to avoid the "can't
2872 inline call" warning.
2874 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2875 into doc++ documentation.
2877 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2879 * src/frontends/xforms/FormRef.C: make use of button controller
2880 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2881 cleaned up button controller usage.
2882 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2883 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2884 use the button controller
2886 * src/frontends/xforms/forms/*.fd: and associated generated files
2887 updated to reflect changes to FormBase. Some other FormXxxx files
2888 also got minor updates to reflect changes to FormBase.
2890 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2891 (hide): made virtual.
2892 (input): return a bool. true == valid input
2893 (RestoreCB, restore): new
2894 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2895 Changes to allow derived dialogs to use a ButtonController and
2896 make sense when doing so: OK button calls ok() and so on.
2898 * src/frontends/xforms/ButtonController.h (class ButtonController):
2899 Switch from template implementation to taking Policy parameter.
2900 Allows FormBase to provide a ButtonController for any dialog.
2902 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2903 Probably should rename connect and disconnect.
2904 (apply): use the radio button groups
2905 (form): needed by FormBase
2906 (build): setup the radio button groups
2908 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2910 * several files: type changes to reduce the number of warnings and
2911 to unify type hangling a bit. Still much to do.
2913 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2915 * lib/images/*: rename a bunch of icons to match Dekel converter
2918 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2921 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2923 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2925 * sigc++/handle.h: ditto for class Handle.
2927 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2929 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2931 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2933 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2934 removal of the "default" language.
2936 * src/combox.h (getline): Check that sel > 0
2938 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2940 * lib/examples/docbook_example.lyx
2941 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2943 * lib/layouts/docbook-book.layout: new docbook book layout.
2945 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2947 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2949 * src/insets/figinset.C (DocBook):fixed small typo.
2951 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2953 * src/insets/insetinclude.h: string include_label doesn't need to be
2956 2000-09-29 Allan Rae <rae@lyx.org>
2958 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2959 Allow derived type to control connection and disconnection from signals
2960 of its choice if desired.
2962 2000-09-28 Juergen Vigna <jug@sad.it>
2964 * src/insets/insettabular.C (update): fixed cursor setting when
2965 the_locking_inset changed.
2966 (draw): made this a bit cleaner.
2967 (InsetButtonPress): fixed!
2969 * various files: added LyXText Parameter to fitCursor call.
2971 * src/BufferView.C (fitCursor): added LyXText parameter.
2973 * src/insets/insettabular.C (draw): small draw fix.
2975 * src/tabular.C: right setting of left/right celllines.
2977 * src/tabular.[Ch]: fixed various types in funcions and structures.
2978 * src/insets/insettabular.C: ditto
2979 * src/frontends/xforms/FormTabular.C: ditto
2981 2000-09-28 Allan Rae <rae@lyx.org>
2983 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2984 that the #ifdef's had been applied to part of what should have been
2985 a complete condition. It's possible there are other tests that
2986 were specific to tables that are also wrong now that InsetTabular is
2987 being used. Now we need to fix the output of '\n' after a table in a
2988 float for the same reason as the original condition:
2989 "don't insert this if we would be adding it before or after a table
2990 in a float. This little trick is needed in order to allow use of
2991 tables in \subfigures or \subtables."
2992 Juergen can you check this?
2994 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2996 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2997 output to the ostream.
2999 * several files: fixed types based on warnings from cxx
3001 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3003 * src/frontends/kde/Makefile.am: fix rule for
3004 formindexdialogdata_moc.C
3006 * src/.cvsignore: add ext_l10n.h to ignore
3008 * acconfig.h: stop messing with __STRICT_ANSI__
3009 * config/gnome.m4: remove option to set -ansi
3010 * config/kde.m4: remove option to set -ansi
3011 * config/lyxinclude.m4: don't set -ansi
3013 2000-09-27 Juergen Vigna <jug@sad.it>
3015 * various files: remove "default" language check.
3017 * src/insets/insetquotes.C: removed use of current_view.
3019 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3020 the one should have red ears by now!
3022 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3023 in more then one paragraph. Fixed cursor-movement/selection.
3025 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3026 paragraphs inside a text inset.
3028 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3029 text-inset if this owner is an inset.
3031 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3033 * src/Bullet.h: changed type of font, character and size to int
3035 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3037 * src/insets/inseturl.[Ch]:
3038 * src/insets/insetref.[Ch]:
3039 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3041 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3043 * src/buffer.C (readFile): block-if statement rearranged to minimise
3044 bloat. Patch does not reverse Jean-Marc's change ;-)
3046 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3047 Class rewritten to store pointers to hide/update signals directly,
3048 rather than Dialogs *. Also defined an enum to ease use. All xforms
3049 forms can now be derived from this class.
3051 * src/frontends/xforms/FormCommand.[Ch]
3052 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3054 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3057 * src/frontends/xforms/forms/form_citation.fd
3058 * src/frontends/xforms/forms/form_copyright.fd
3059 * src/frontends/xforms/forms/form_error.fd
3060 * src/frontends/xforms/forms/form_index.fd
3061 * src/frontends/xforms/forms/form_ref.fd
3062 * src/frontends/xforms/forms/form_toc.fd
3063 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3065 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3067 * src/insets/insetfoot.C: removed redundent using directive.
3069 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3071 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3072 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3074 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3075 created in the constructors in different groups. Then set() just
3076 have to show the groups as needed. This fixes the redraw problems
3077 (and is how the old menu code worked).
3079 * src/support/lyxlib.h: declare the methods as static when we do
3080 not have namespaces.
3082 2000-09-26 Juergen Vigna <jug@sad.it>
3084 * src/buffer.C (asciiParagraph): new function.
3085 (writeFileAscii): new function with parameter ostream.
3086 (writeFileAscii): use now asciiParagraph.
3088 * various inset files: added the linelen parameter to the Ascii-func.
3090 * src/tabular.C (Write): fixed error in writing file introduced by
3091 the last changes from Lars.
3093 * lib/bind/menus.bind: removed not supported functions.
3095 * src/insets/insettext.C (Ascii): implemented this function.
3097 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3099 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3100 (Write): use of the write_attribute functions.
3102 * src/bufferlist.C (close): fixed reasking question!
3104 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3106 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3107 new files use the everwhere possible.
3110 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3111 src/log_form.C src/lyx.C:
3114 * src/buffer.C (runLaTeX): remove func
3116 * src/PaperLayout.C: removed file
3117 * src/ParagraphExtra.C: likewise
3118 * src/bullet_forms.C: likewise
3119 * src/bullet_forms.h: likewise
3120 * src/bullet_forms_cb.C: likewise
3122 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3123 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3126 * several files: remove all traces of the old fd_form_paragraph,
3127 and functions belonging to that.
3129 * several files: remove all traces of the old fd_form_document,
3130 and functions belonging to that.
3132 * several files: constify local variables were possible.
3134 * several files: remove all code that was dead when NEW_EXPORT was
3137 * several files: removed string::c_str in as many places as
3140 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3141 (e): be a bit more outspoken when patching
3142 (updatesrc): only move files if changed.
3144 * forms/layout_forms.h.patch: regenerated
3146 * forms/layout_forms.fd: remove form_document and form_paragraph
3147 and form_quotes and form_paper and form_table_options and
3148 form_paragraph_extra
3150 * forms/form1.fd: remove form_table
3152 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3153 the fdui->... rewrite. Update some comments to xforms 0.88
3155 * forms/bullet_forms.C.patch: removed file
3156 * forms/bullet_forms.fd: likewise
3157 * forms/bullet_forms.h.patch: likewise
3159 * development/Code_rules/Rules: added a section on switch
3160 statements. Updated some comment to xforms 0.88.
3162 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3164 * src/buffer.C (readFile): make sure that the whole version number
3165 is read after \lyxformat (even when it contains a comma)
3167 * lib/ui/default.ui: change shortcut of math menu to M-a.
3169 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3171 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3174 * src/LyXView.C (updateWindowTitle): show the full files name in
3175 window title, limited to 30 characters.
3177 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3178 When a number of characters has been given, we should not assume
3179 that the string is 0-terminated.
3181 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3182 calls (fixes some memory leaks)
3184 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3185 trans member on exit.
3187 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3189 * src/converter.C (GetReachable): fix typo.
3191 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3192 understand ',' instead of '.'.
3193 (GetInteger): rewrite to use strToInt().
3195 2000-09-26 Juergen Vigna <jug@sad.it>
3197 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3198 better visibility and error-message on wrong VSpace input.
3200 * src/language.C (initL): added english again.
3202 2000-09-25 Juergen Vigna <jug@sad.it>
3204 * src/frontends/kde/Dialogs.C (Dialogs):
3205 * src/frontends/gnome/Dialogs.C (Dialogs):
3206 * src/frontends/kde/Makefile.am:
3207 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3209 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3211 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3213 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3215 * src/frontends/xforms/FormParagraph.C:
3216 * src/frontends/xforms/FormParagraph.h:
3217 * src/frontends/xforms/form_paragraph.C:
3218 * src/frontends/xforms/form_paragraph.h:
3219 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3222 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3224 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3225 Paragraph-Data after use.
3227 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3228 non breakable paragraphs.
3230 2000-09-25 Garst R. Reese <reese@isn.net>
3232 * src/language.C (initL): added missing language_country codes.
3234 2000-09-25 Juergen Vigna <jug@sad.it>
3236 * src/insets/insettext.C (InsetText):
3237 (deleteLyXText): remove the not released LyXText structure!
3239 2000-09-24 Marko Vendelin <markov@ioc.ee>
3241 * src/frontends/gnome/mainapp.C
3242 * src/frontends/gnome/mainapp.h: added support for keyboard
3245 * src/frontends/gnome/FormCitation.C
3246 * src/frontends/gnome/FormCitation.h
3247 * src/frontends/gnome/Makefile.am
3248 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3249 FormCitation to use "action area" in mainapp window
3251 * src/frontends/gnome/Menubar_pimpl.C
3252 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3255 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3257 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3258 width/descent/ascent values if name is empty.
3259 (mathed_string_height): Use std::max.
3261 2000-09-25 Allan Rae <rae@lyx.org>
3263 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3264 segfault. This will be completely redesigned soon.
3266 * sigc++: updated libsigc++. Fixes struct timespec bug.
3268 * development/tools/makeLyXsigc.sh: .cvsignore addition
3270 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3272 * several files: removed almost all traces of the old table
3275 * src/TableLayout.C: removed file
3277 2000-09-22 Juergen Vigna <jug@sad.it>
3279 * src/frontends/kde/Dialogs.C: added credits forms.
3281 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3283 * src/frontends/gnome/Dialogs.C: added some forms.
3285 * src/spellchecker.C (init_spell_checker): set language in pspell code
3286 (RunSpellChecker): some modifications for setting language string.
3288 * src/language.[Ch]: added language_country code.
3290 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3292 * src/frontends/Dialogs.h: added new signal showError.
3293 Rearranged existing signals in some sort of alphabetical order.
3295 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3296 FormError.[Ch], form_error.[Ch]
3297 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3298 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3300 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3301 dialogs. I think that this can be used as the base to all these
3304 * src/frontends/xforms/FormError.[Ch]
3305 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3306 implementation of InsetError dialog.
3308 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3310 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3311 * src/frontends/kde/Makefile.am: ditto
3313 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3315 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3316 macrobf. This fixes a bug of invisible text.
3318 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3320 * lib/doc/LaTeXConfig.lyx.in: updated.
3322 * src/language.C (initL): remove language "francais" and change a
3323 bit the names of the two other french variations.
3325 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3326 string that may not be 0-terminated.
3328 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3330 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3332 2000-09-20 Marko Vendelin <markov@ioc.ee>
3334 * src/frontends/gnome/FormCitation.C
3335 * src/frontends/gnome/FormIndex.C
3336 * src/frontends/gnome/FormToc.C
3337 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3338 the variable initialization to shut up the warnings
3340 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3342 * src/table.[Ch]: deleted files
3344 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3347 2000-09-18 Juergen Vigna <jug@sad.it>
3349 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3350 problems with selection. Inserted new LFUN_PASTESELECTION.
3351 (InsetButtonPress): inserted handling of middle mouse-button paste.
3353 * src/spellchecker.C: changed word to word.c_str().
3355 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3357 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3358 included in the ``make dist'' tarball.
3360 2000-09-15 Juergen Vigna <jug@sad.it>
3362 * src/CutAndPaste.C (cutSelection): small fix return the right
3363 end position after cut inside one paragraph only.
3365 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3366 we are locked as otherwise we don't have a valid cursor position!
3368 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3370 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3372 * src/frontends/kde/FormRef.C: added using directive.
3373 * src/frontends/kde/FormToc.C: ditto
3375 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3377 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3379 2000-09-19 Marko Vendelin <markov@ioc.ee>
3381 * src/frontends/gnome/Menubar_pimpl.C
3382 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3383 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3385 * src/frontends/gnome/mainapp.C
3386 * src/frontends/gnome/mainapp.h: support for menu update used
3389 * src/frontends/gnome/mainapp.C
3390 * src/frontends/gnome/mainapp.h: support for "action" area in the
3391 main window. This area is used by small simple dialogs, such as
3394 * src/frontends/gnome/FormIndex.C
3395 * src/frontends/gnome/FormIndex.h
3396 * src/frontends/gnome/FormUrl.C
3397 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3400 * src/frontends/gnome/FormCitation.C
3401 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3402 action area. Only "Insert new citation" is implemented.
3404 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3406 * src/buffer.C (Dispatch): fix call to Dispatch
3407 * src/insets/insetref.C (Edit): likewise
3408 * src/insets/insetparent.C (Edit): likewise
3409 * src/insets/insetinclude.C (include_cb): likewise
3410 * src/frontends/xforms/FormUrl.C (apply): likewise
3411 * src/frontends/xforms/FormToc.C (apply): likewise
3412 * src/frontends/xforms/FormRef.C (apply): likewise
3413 * src/frontends/xforms/FormIndex.C (apply): likewise
3414 * src/frontends/xforms/FormCitation.C (apply): likewise
3415 * src/lyxserver.C (callback): likewise
3416 * src/lyxfunc.C (processKeySym): likewise
3417 (Dispatch): likewise
3418 (Dispatch): likewise
3419 * src/lyx_cb.C (LayoutsCB): likewise
3421 * Makefile.am (sourcedoc): small change
3423 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3425 * src/main.C (main): Don't make an empty GUIRunTime object. all
3426 methods are static. constify a bit remove unneded using + headers.
3428 * src/tabular.C: some more const to local vars move some loop vars
3430 * src/spellchecker.C: added some c_str after some word for pspell
3432 * src/frontends/GUIRunTime.h: add new static method setDefaults
3433 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3434 * src/frontends/kde/GUIRunTime.C (setDefaults):
3435 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3437 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3438 with strnew in arg, use correct emptystring when calling SetName.
3440 * several files: remove all commented code with relation to
3441 HAVE_SSTREAM beeing false. We now only support stringstream and
3444 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3446 * src/lyxfunc.C: construct correctly the automatic new file
3449 * src/text2.C (IsStringInText): change type of variable i to shut
3452 * src/support/sstream.h: do not use namespaces if the compiler
3453 does not support them.
3455 2000-09-15 Marko Vendelin <markov@ioc.ee>
3456 * src/frontends/gnome/FormCitation.C
3457 * src/frontends/gnome/FormCitation.h
3458 * src/frontends/gnome/diainsertcitation_interface.c
3459 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3460 regexp support to FormCitation [Gnome].
3462 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3465 * configure.in: remove unused KDE/GTKGUI define
3467 * src/frontends/kde/FormRef.C
3468 * src/frontends/kde/FormRef.h
3469 * src/frontends/kde/formrefdialog.C
3470 * src/frontends/kde/formrefdialog.h: double click will
3471 go to reference, now it is possible to change a cross-ref
3474 * src/frontends/kde/FormToc.C
3475 * src/frontends/kde/FormToc.h
3476 * src/frontends/kde/formtocdialog.C
3477 * src/frontends/kde/formtocdialog.h: add a depth
3480 * src/frontends/kde/Makefile.am: add QtLyXView.h
3483 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3485 * src/frontends/kde/FormCitation.h: added some using directives.
3487 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3489 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3492 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3495 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3497 * src/buffer.C (pop_tag): revert for the second time a change by
3498 Lars, who seems to really hate having non-local loop variables :)
3500 * src/Lsstream.h: add "using" statements.
3502 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3503 * src/buffer.C (writeFile): ditto
3505 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3507 * src/buffer.C (writeFile): try to fix the locale modified format
3508 number to always be as we want it.
3510 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3511 in XForms 0.89. C-space is now working again.
3513 * src/Lsstream.h src/support/sstream.h: new files.
3515 * also commented out all cases where strstream were used.
3517 * src/Bullet.h (c_str): remove method.
3519 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3521 * a lot of files: get rid of "char const *" and "char *" is as
3522 many places as possible. We only want to use them in interaction
3523 with system of other libraries, not inside lyx.
3525 * a lot of files: return const object is not of pod type. This
3526 helps ensure that temporary objects is not modified. And fits well
3527 with "programming by contract".
3529 * configure.in: check for the locale header too
3531 * Makefile.am (sourcedoc): new tag for generation of doc++
3534 2000-09-14 Juergen Vigna <jug@sad.it>
3536 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3537 callback to check which combo called it and do the right action.
3539 * src/combox.C (combo_cb): added combo * to the callbacks.
3540 (Hide): moved call of callback after Ungrab of the pointer.
3542 * src/intl.h: removed LCombo2 function.
3544 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3545 function as this can now be handled in one function.
3547 * src/combox.h: added Combox * to callback prototype.
3549 * src/frontends/xforms/Toolbar_pimpl.C:
3550 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3552 2000-09-14 Garst Reese <reese@isn.net>
3554 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3555 moved usepackage{xxx}'s to beginning of file. Changed left margin
3556 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3557 underlining from title. Thanks to John Culleton for useful suggestions.
3559 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3561 * src/lyxlex_pimpl.C (setFile): change error message to debug
3564 2000-09-13 Juergen Vigna <jug@sad.it>
3566 * src/frontends/xforms/FormDocument.C: implemented choice_class
3567 as combox and give callback to combo_language so OK/Apply is activated
3570 * src/bufferlist.C (newFile): small fix so already named files
3571 (via an open call) are not requested to be named again on the
3574 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3576 * src/frontends/kde/Makefile.am
3577 * src/frontends/kde/FormRef.C
3578 * src/frontends/kde/FormRef.h
3579 * src/frontends/kde/formrefdialog.C
3580 * src/frontends/kde/formrefdialog.h: implement
3583 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3585 * src/frontends/kde/formtocdialog.C
3586 * src/frontends/kde/formtocdialog.h
3587 * src/frontends/kde/FormToc.C
3588 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3590 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3592 * src/frontends/kde/FormCitation.C: fix thinko
3593 where we didn't always display the reference text
3596 * src/frontends/kde/formurldialog.C
3597 * src/frontends/kde/formurldialog.h
3598 * src/frontends/kde/FormUrl.C
3599 * src/frontends/kde/FormUrl.h: minor cleanups
3601 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3603 * src/frontends/kde/Makefile.am
3604 * src/frontends/kde/FormToc.C
3605 * src/frontends/kde/FormToc.h
3606 * src/frontends/kde/FormCitation.C
3607 * src/frontends/kde/FormCitation.h
3608 * src/frontends/kde/FormIndex.C
3609 * src/frontends/kde/FormIndex.h
3610 * src/frontends/kde/formtocdialog.C
3611 * src/frontends/kde/formtocdialog.h
3612 * src/frontends/kde/formcitationdialog.C
3613 * src/frontends/kde/formcitationdialog.h
3614 * src/frontends/kde/formindexdialog.C
3615 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3617 2000-09-12 Juergen Vigna <jug@sad.it>
3619 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3622 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3624 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3627 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3629 * src/converter.C (Add, Convert): Added support for converter flags:
3630 needaux, resultdir, resultfile.
3631 (Convert): Added new parameter view_file.
3632 (dvips_options): Fixed letter paper option.
3634 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3635 (Export, GetExportableFormats, GetViewableFormats): Added support
3638 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3640 (easyParse): Fixed to work with new export code.
3642 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3645 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3647 * lib/bind/*.bind: Replaced
3648 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3649 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3651 2000-09-11 Juergen Vigna <jug@sad.it>
3653 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3655 * src/main.C (main): now GUII defines global guiruntime!
3657 * src/frontends/gnome/GUIRunTime.C (initApplication):
3658 * src/frontends/kde/GUIRunTime.C (initApplication):
3659 * src/frontends/xforms/GUIRunTime.C (initApplication):
3660 * src/frontends/GUIRunTime.h: added new function initApplication.
3662 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3664 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3666 2000-09-08 Juergen Vigna <jug@sad.it>
3668 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3669 we have already "Reset".
3671 * src/language.C (initL): inserted "default" language and made this
3672 THE default language (and not american!)
3674 * src/paragraph.C: inserted handling of "default" language!
3676 * src/lyxfont.C: ditto
3680 * src/paragraph.C: output the \\par only if we have a following
3681 paragraph otherwise it's not needed.
3683 2000-09-05 Juergen Vigna <jug@sad.it>
3685 * config/pspell.m4: added entry to lyx-flags
3687 * src/spellchecker.C: modified version from Kevin for using pspell
3689 2000-09-01 Marko Vendelin <markov@ioc.ee>
3690 * src/frontends/gnome/Makefile.am
3691 * src/frontends/gnome/FormCitation.C
3692 * src/frontends/gnome/FormCitation.h
3693 * src/frontends/gnome/diainsertcitation_callbacks.c
3694 * src/frontends/gnome/diainsertcitation_callbacks.h
3695 * src/frontends/gnome/diainsertcitation_interface.c
3696 * src/frontends/gnome/diainsertcitation_interface.h
3697 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3698 dialog for Gnome frontend
3700 * src/main.C: Gnome libraries require keeping application name
3701 and its version as strings
3703 * src/frontends/gnome/mainapp.C: Change the name of the main window
3704 from GnomeLyX to PACKAGE
3706 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3708 * src/frontends/Liason.C: add "using: declaration.
3710 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3712 * src/mathed/math_macro.C (Metrics): Set the size of the template
3714 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3716 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3718 * src/converter.C (add_options): New function.
3719 (SetViewer): Change $$FName into '$$FName'.
3720 (View): Add options when running xdvi
3721 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3722 (Convert): The 3rd parameter is now the desired filename. Converts
3723 calls to lyx::rename if necessary.
3724 Add options when running dvips.
3725 (dvi_papersize,dvips_options): New methods.
3727 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3729 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3730 using a call to Converter::dvips_options.
3731 Fixed to work with nex export code.
3733 * src/support/copy.C
3734 * src/support/rename.C: New files
3736 * src/support/syscall.h
3737 * src/support/syscall.C: Added Starttype SystemDontWait.
3739 * lib/ui/default.ui: Changed to work with new export code
3741 * lib/configure.m4: Changed to work with new export code
3743 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3745 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3747 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3748 so that code compiles with DEC cxx.
3750 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3751 to work correctly! Also now supports the additional elements
3754 2000-09-01 Allan Rae <rae@lyx.org>
3756 * src/frontends/ButtonPolicies.C: renamed all the references to
3757 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3759 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3760 since it's a const not a type.
3762 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3764 2000-08-31 Juergen Vigna <jug@sad.it>
3766 * src/insets/figinset.C: Various changes to look if the filename has
3767 an extension and if not add it for inline previewing.
3769 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3771 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3772 make buttonStatus and isReadOnly be const methods. (also reflect
3773 this in derived classes.)
3775 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3776 (nextState): change to be static inline, pass the StateMachine as
3778 (PreferencesPolicy): remove casts
3779 (OkCancelPolicy): remvoe casts
3780 (OkCancelReadOnlyPolicy): remove casts
3781 (NoRepeatedApplyReadOnlyPolicy): remove casts
3782 (OkApplyCancelReadOnlyPolicy): remove casts
3783 (OkApplyCancelPolicy): remove casts
3784 (NoRepeatedApplyPolicy): remove casts
3786 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3788 * src/converter.C: added some using directives
3790 * src/frontends/ButtonPolicies.C: changes to overcome
3791 "need lvalue" error with DEC c++
3793 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3794 to WMHideCB for DEC c++
3796 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3798 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3799 to BulletBMTableCB for DEC c++
3801 2000-08-31 Allan Rae <rae@lyx.org>
3803 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3804 character dialog separately from old document dialogs combo_language.
3807 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3809 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3810 Removed LFUN_REF_CREATE.
3812 * src/MenuBackend.C: Added new tags: toc and references
3814 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3815 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3817 (add_toc, add_references): New methods.
3818 (create_submenu): Handle correctly the case when there is a
3819 seperator after optional menu items.
3821 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3822 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3823 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3825 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3827 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3829 * src/converter.[Ch]: New file for converting between different
3832 * src/export.[Ch]: New file for exporting a LyX file to different
3835 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3836 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3837 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3838 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3839 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3840 RunDocBook, MenuExport.
3842 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3843 Exporter::Preview methods if NEW_EXPORT is defined.
3845 * src/buffer.C (Dispatch): Use Exporter::Export.
3847 * src/lyxrc.C: Added new tags: \converter and \viewer.
3850 * src/LyXAction.C: Define new lyx-function: buffer-update.
3851 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3852 when NEW_EXPORT is defined.
3854 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3856 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3858 * lib/ui/default.ui: Added submenus "view" and "update" to the
3861 * src/filetools.C (GetExtension): New function.
3863 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3865 2000-08-29 Allan Rae <rae@lyx.org>
3867 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3869 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3870 (EnableDocumentLayout): removed
3871 (DisableDocumentLayout): removed
3872 (build): make use of ButtonController's read-only handling to
3873 de/activate various objects. Replaces both of the above functions.
3875 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3876 (readOnly): was read_only
3877 (refresh): fixed dumb mistakes with read_only_ handling
3879 * src/frontends/xforms/forms/form_document.fd:
3880 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3881 tabbed dialogs so the tabs look more like tabs and so its easier to
3882 work out which is the current tab.
3884 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3885 segfault with form_table
3887 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3889 2000-08-28 Juergen Vigna <jug@sad.it>
3891 * acconfig.h: added USE_PSPELL.
3893 * src/config.h.in: added USE_PSPELL.
3895 * autogen.sh: added pspell.m4
3897 * config/pspell.m4: new file.
3899 * src/spellchecker.C: implemented support for pspell libary.
3901 2000-08-25 Juergen Vigna <jug@sad.it>
3903 * src/LyXAction.C (init): renamed LFUN_TABLE to
3904 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3906 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3908 * src/lyxscreen.h: add force_clear variable and fuction to force
3909 a clear area when redrawing in LyXText.
3911 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3913 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3915 * some whitespace and comment changes.
3917 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3919 * src/buffer.C: up te LYX_FORMAT to 2.17
3921 2000-08-23 Juergen Vigna <jug@sad.it>
3923 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3926 * src/insets/insettabular.C (pasteSelection): delete the insets
3927 LyXText as it is not valid anymore.
3928 (copySelection): new function.
3929 (pasteSelection): new function.
3930 (cutSelection): new function.
3931 (LocalDispatch): implemented cut/copy/paste of cell selections.
3933 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3934 don't have a LyXText.
3936 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3938 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3941 2000-08-22 Juergen Vigna <jug@sad.it>
3943 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3944 ifdef form_table out if NEW_TABULAR.
3946 2000-08-21 Juergen Vigna <jug@sad.it>
3948 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3949 (draw): fixed draw position so that the cursor is positioned in the
3951 (InsetMotionNotify): hide/show cursor so the position is updated.
3952 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3953 using cellstart() function where it should be used.
3955 * src/insets/insettext.C (draw): ditto.
3957 * src/tabular.C: fixed initialization of some missing variables and
3958 made BoxType into an enum.
3960 2000-08-22 Marko Vendelin <markov@ioc.ee>
3961 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3962 stock menu item using action numerical value, not its string
3966 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3968 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3969 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3971 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3973 * src/frontends/xforms/GUIRunTime.C: new file
3975 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3976 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3978 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3980 * src/frontends/kde/GUIRunTime.C: new file
3982 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3983 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3985 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3987 * src/frontends/gnome/GUIRunTime.C: new file
3989 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3992 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3993 small change to documetentation.
3995 * src/frontends/GUIRunTime.C: removed file
3997 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3999 * src/lyxparagraph.h: enable NEW_TABULAR as default
4001 * src/lyxfunc.C (processKeySym): remove some commented code
4003 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4004 NEW_TABULAR around the fd_form_table_options.
4006 * src/lyx_gui.C (runTime): call the static member function as
4007 GUIRunTime::runTime().
4009 2000-08-21 Allan Rae <rae@lyx.org>
4011 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4014 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4016 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4018 2000-08-21 Allan Rae <rae@lyx.org>
4020 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4021 keep Garst happy ;-)
4022 * src/frontends/xforms/FormPreferences.C (build): use setOK
4023 * src/frontends/xforms/FormDocument.C (build): use setOK
4024 (FormDocument): use the appropriate policy.
4026 2000-08-21 Allan Rae <rae@lyx.org>
4028 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4029 automatic [de]activation of arbitrary objects when in a read-only state.
4031 * src/frontends/ButtonPolicies.h: More documentation
4032 (isReadOnly): added to support the above.
4034 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4036 2000-08-18 Juergen Vigna <jug@sad.it>
4038 * src/insets/insettabular.C (getStatus): changed to return func_status.
4040 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4041 display toggle menu entries if they are.
4043 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4044 new document layout now.
4046 * src/lyxfunc.C: ditto
4048 * src/lyx_gui_misc.C: ditto
4050 * src/lyx_gui.C: ditto
4052 * lib/ui/default.ui: removed paper and quotes layout as they are now
4053 all in the document layout tabbed folder.
4055 * src/frontends/xforms/forms/form_document.fd: added Restore
4056 button and callbacks for all inputs for Allan's ButtonPolicy.
4058 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4059 (CheckChoiceClass): added missing params setting on class change.
4060 (UpdateLayoutDocument): added for updating the layout on params.
4061 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4062 (FormDocument): Implemented Allan's ButtonPolicy with the
4065 2000-08-17 Allan Rae <rae@lyx.org>
4067 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4068 so we can at least see the credits again.
4070 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4071 controller calls for the appropriate callbacks. Note that since Ok
4072 calls apply followed by cancel, and apply isn't a valid input for the
4073 APPLIED state, the bc_ calls have to be made in the static callback not
4074 within each of the real callbacks.
4076 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4077 (setOk): renamed from setOkay()
4079 2000-08-17 Juergen Vigna <jug@sad.it>
4081 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4082 in the implementation part.
4083 (composeUIInfo): don't show optional menu-items.
4085 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4087 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4089 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4090 text-state when in a text-inset.
4092 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4094 2000-08-17 Marko Vendelin <markov@ioc.ee>
4095 * src/frontends/gnome/FormIndex.C
4096 * src/frontends/gnome/FormIndex.h
4097 * src/frontends/gnome/FormToc.C
4098 * src/frontends/gnome/FormToc.h
4099 * src/frontends/gnome/dialogs
4100 * src/frontends/gnome/diatoc_callbacks.c
4101 * src/frontends/gnome/diatoc_callbacks.h
4102 * src/frontends/gnome/diainsertindex_callbacks.h
4103 * src/frontends/gnome/diainsertindex_callbacks.c
4104 * src/frontends/gnome/diainsertindex_interface.c
4105 * src/frontends/gnome/diainsertindex_interface.h
4106 * src/frontends/gnome/diatoc_interface.h
4107 * src/frontends/gnome/diatoc_interface.c
4108 * src/frontends/gnome/Makefile.am: Table of Contents and
4109 Insert Index dialogs implementation for Gnome frontend
4111 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4113 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4115 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4118 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4120 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4121 destructor. Don't definde if you don't need it
4122 (processEvents): made static, non-blocking events processing for
4124 (runTime): static method. event loop for xforms
4125 * similar as above for kde and gnome.
4127 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4128 new Pimpl is correct
4129 (runTime): new method calss the real frontends runtime func.
4131 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4133 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4135 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4137 2000-08-16 Juergen Vigna <jug@sad.it>
4139 * src/lyx_gui.C (runTime): added GUII RunTime support.
4141 * src/frontends/Makefile.am:
4142 * src/frontends/GUIRunTime.[Ch]:
4143 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4144 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4145 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4147 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4149 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4150 as this is already set in ${FRONTEND_INCLUDE} if needed.
4152 * configure.in (CPPFLAGS): setting the include dir for the frontend
4153 directory and don't set FRONTEND=xforms for now as this is executed
4156 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4158 * src/frontends/kde/Makefile.am:
4159 * src/frontends/kde/FormUrl.C:
4160 * src/frontends/kde/FormUrl.h:
4161 * src/frontends/kde/formurldialog.h:
4162 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4164 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4166 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4168 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4170 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4173 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4175 * src/WorkArea.C (work_area_handler): more work to get te
4176 FL_KEYBOARD to work with xforms 0.88 too, please test.
4178 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4180 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4182 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4185 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4187 * src/Timeout.h: remove Qt::emit hack.
4189 * several files: changes to allo doc++ compilation
4191 * src/lyxfunc.C (processKeySym): new method
4192 (processKeyEvent): comment out if FL_REVISION < 89
4194 * src/WorkArea.C: change some debugging levels.
4195 (WorkArea): set wantkey to FL_KEY_ALL
4196 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4197 clearer code and the use of compose with XForms 0.89. Change to
4198 use signals instead of calling methods in bufferview directly.
4200 * src/Painter.C: change some debugging levels.
4202 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4205 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4206 (workAreaKeyPress): new method
4208 2000-08-14 Juergen Vigna <jug@sad.it>
4210 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4212 * config/kde.m4: addes some features
4214 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4215 include missing xforms dialogs.
4217 * src/Timeout.h: a hack to be able to compile with qt/kde.
4219 * sigc++/.cvsignore: added acinclude.m4
4221 * lib/.cvsignore: added listerros
4223 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4224 xforms tree as objects are needed for other frontends.
4226 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4227 linking with not yet implemented xforms objects.
4229 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4231 2000-08-14 Baruch Even <baruch.even@writeme.com>
4233 * src/frontends/xforms/FormGraphics.h:
4234 * src/frontends/xforms/FormGraphics.C:
4235 * src/frontends/xforms/RadioButtonGroup.h:
4236 * src/frontends/xforms/RadioButtonGroup.C:
4237 * src/insets/insetgraphics.h:
4238 * src/insets/insetgraphics.C:
4239 * src/insets/insetgraphicsParams.h:
4240 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4241 instead of spaces, and various other indentation issues to make the
4242 sources more consistent.
4244 2000-08-14 Marko Vendelin <markov@ioc.ee>
4246 * src/frontends/gnome/dialogs/diaprint.glade
4247 * src/frontends/gnome/FormPrint.C
4248 * src/frontends/gnome/FormPrint.h
4249 * src/frontends/gnome/diaprint_callbacks.c
4250 * src/frontends/gnome/diaprint_callbacks.h
4251 * src/frontends/gnome/diaprint_interface.c
4252 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4255 * src/frontends/gnome/dialogs/diainserturl.glade
4256 * src/frontends/gnome/FormUrl.C
4257 * src/frontends/gnome/FormUrl.h
4258 * src/frontends/gnome/diainserturl_callbacks.c
4259 * src/frontends/gnome/diainserturl_callbacks.h
4260 * src/frontends/gnome/diainserturl_interface.c
4261 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4262 Gnome implementation
4264 * src/frontends/gnome/Dialogs.C
4265 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4266 all other dialogs. Copy all unimplemented dialogs from Xforms
4269 * src/frontends/gnome/support.c
4270 * src/frontends/gnome/support.h: support files generated by Glade
4274 * config/gnome.m4: Gnome configuration scripts
4276 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4277 configure --help message
4279 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4280 only if there are no events pendling in Gnome/Gtk. This enhances
4281 the performance of menus.
4284 2000-08-14 Allan Rae <rae@lyx.org>
4286 * lib/Makefile.am: listerrors cleaning
4288 * lib/listerrors: removed -- generated file
4289 * acinclude.m4: ditto
4290 * sigc++/acinclude.m4: ditto
4292 * src/frontends/xforms/forms/form_citation.fd:
4293 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4296 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4297 `updatesrc` and now we have a `test` target that does what `updatesrc`
4298 used to do. I didn't like having an install target that wasn't related
4301 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4302 on all except FormGraphics. This may yet happen. Followed by a major
4303 cleanup including using FL_TRANSIENT for most of the dialogs. More
4304 changes to come when the ButtonController below is introduced.
4306 * src/frontends/xforms/ButtonController.h: New file for managing up to
4307 four buttons on a dialog according to an externally defined policy.
4308 * src/frontends/xforms/Makefile.am: added above
4310 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4311 Apply and Cancel/Close buttons and everything in between and beyond.
4312 * src/frontends/Makefile.am: added above.
4314 * src/frontends/xforms/forms/form_preferences.fd:
4315 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4316 and removed variable 'status' as a result. Fixed the set_minsize thing.
4317 Use the new screen-font-update after checking screen fonts were changed
4318 Added a "Restore" button to restore the original lyxrc values while
4319 editing. This restores everything not just the last input changed.
4320 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4322 * src/LyXAction.C: screen-font-update added for updating buffers after
4323 screen font settings have been changed.
4324 * src/commandtags.h: ditto
4325 * src/lyxfunc.C: ditto
4327 * forms/lyx.fd: removed screen fonts dialog.
4328 * src/lyx_gui.C: ditto
4329 * src/menus.[Ch]: ditto
4330 * src/lyx.[Ch]: ditto
4331 * src/lyx_cb.C: ditto + code from here moved to make
4332 screen-font-update. And people wonder why progress on GUII is
4333 slow. Look at how scattered this stuff was! It takes forever
4336 * forms/fdfix.sh: Fixup the spacing after commas.
4337 * forms/makefile: Remove date from generated files. Fewer clashes now.
4338 * forms/bullet_forms.C.patch: included someones handwritten changes
4340 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4341 once I've discovered why LyXRC was made noncopyable.
4342 * src/lyx_main.C: ditto
4344 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4346 * src/frontends/xforms/forms/fdfix.sh:
4347 * src/frontends/xforms/forms/fdfixh.sed:
4348 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4349 * src/frontends/xforms/Form*.[hC]:
4350 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4351 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4352 provide a destructor for the struct FD_form_xxxx. Another version of
4353 the set_[max|min]size workaround and a few other cleanups. Actually,
4354 Angus' patch from 20000809.
4356 2000-08-13 Baruch Even <baruch.even@writeme.com>
4358 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4361 2000-08-11 Juergen Vigna <jug@sad.it>
4363 * src/insets/insetgraphics.C (InsetGraphics): changing init
4364 order because of warnings.
4366 * src/frontends/xforms/forms/makefile: adding patching .C with
4369 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4370 from .C.patch to .c.patch
4372 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4373 order because of warning.
4375 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4377 * src/frontends/Liason.C (setMinibuffer): new helper function
4379 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4381 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4383 * lib/ui/default.ui: commented out PaperLayout entry
4385 * src/frontends/xforms/form_document.[Ch]: new added files
4387 * src/frontends/xforms/FormDocument.[Ch]: ditto
4389 * src/frontends/xforms/forms/form_document.fd: ditto
4391 * src/frontends/xforms/forms/form_document.C.patch: ditto
4393 2000-08-10 Juergen Vigna <jug@sad.it>
4395 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4396 (InsetGraphics): initialized cacheHandle to 0.
4397 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4399 2000-08-10 Baruch Even <baruch.even@writeme.com>
4401 * src/graphics/GraphicsCache.h:
4402 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4403 correctly as a cache.
4405 * src/graphics/GraphicsCacheItem.h:
4406 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4409 * src/graphics/GraphicsCacheItem_pimpl.h:
4410 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4413 * src/insets/insetgraphics.h:
4414 * src/insets/insetgraphics.C: Changed from using a signal notification
4415 to polling when image is not loaded.
4417 2000-08-10 Allan Rae <rae@lyx.org>
4419 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4420 that there are two functions that have to been taken out of line by
4421 hand and aren't taken care of in the script. (Just a reminder note)
4423 * sigc++/macros/*.h.m4: Updated as above.
4425 2000-08-09 Juergen Vigna <jug@sad.it>
4427 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4429 * src/insets/insettabular.C: make drawing of single cell smarter.
4431 2000-08-09 Marko Vendelin <markov@ioc.ee>
4432 * src/frontends/gnome/Menubar_pimpl.C
4433 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4434 implementation: new files
4436 * src/frontends/gnome/mainapp.C
4437 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4440 * src/main.C: create Gnome main window
4442 * src/frontends/xforms/Menubar_pimpl.h
4443 * src/frontends/Menubar.C
4444 * src/frontends/Menubar.h: added method Menubar::update that calls
4445 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4447 * src/LyXView.C: calls Menubar::update to update the state
4450 * src/frontends/gnome/Makefile.am: added new files
4452 * src/frontends/Makefile.am: added frontend compiler options
4454 2000-08-08 Juergen Vigna <jug@sad.it>
4456 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4458 * src/bufferlist.C (close):
4459 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4460 documents if exiting without saving.
4462 * src/buffer.C (save): use removeAutosaveFile()
4464 * src/support/filetools.C (removeAutosaveFile): new function.
4466 * src/lyx_cb.C (MenuWrite): returns a bool now.
4467 (MenuWriteAs): check if file could really be saved and revert to the
4469 (MenuWriteAs): removing old autosavefile if existant.
4471 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4472 before Goto toggle declaration, because of compiler warning.
4474 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4476 * src/lyxfunc.C (MenuNew): small fix.
4478 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4480 * src/bufferlist.C (newFile):
4481 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4483 * src/lyxrc.C: added new_ask_filename tag
4485 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4487 * src/lyx.fd: removed code pertaining to form_ref
4488 * src/lyx.[Ch]: ditto
4489 * src/lyx_cb.C: ditto
4490 * src/lyx_gui.C: ditto
4491 * src/lyx_gui_misc.C: ditto
4493 * src/BufferView_pimpl.C (restorePosition): update buffer only
4496 * src/commandtags.h (LFUN_REFTOGGLE): removed
4497 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4498 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4499 (LFUN_REFBACK): renamed LFUN_REF_BACK
4501 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4502 * src/menus.C: ditto
4503 * src/lyxfunc.C (Dispatch): ditto.
4504 InsertRef dialog is now GUI-independent.
4506 * src/texrow.C: added using std::endl;
4508 * src/insets/insetref.[Ch]: strip out large amounts of code.
4509 The inset is now a container and this functionality is now
4510 managed by a new FormRef dialog
4512 * src/frontends/Dialogs.h (showRef, createRef): new signals
4514 * src/frontends/xforms/FormIndex.[Ch],
4515 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4516 when setting dialog's min/max size
4517 * src/frontends/xforms/FormIndex.[Ch]: ditto
4519 * src/frontends/xforms/FormRef.[Ch],
4520 src/frontends/xforms/forms/form_ref.fd: new xforms
4521 implementation of an InsetRef dialog
4523 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4526 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4527 ios::nocreate is not part of the standard. Removed.
4529 2000-08-07 Baruch Even <baruch.even@writeme.com>
4531 * src/graphics/Renderer.h:
4532 * src/graphics/Renderer.C: Added base class for rendering of different
4533 image formats into Pixmaps.
4535 * src/graphics/XPM_Renderer.h:
4536 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4537 in a different class.
4539 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4540 easily add support for other formats.
4542 * src/insets/figinset.C: plugged a leak of an X resource.
4544 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4546 * src/CutAndPaste.[Ch]: make all metods static.
4548 * development/Code_rules/Rules: more work, added section on
4549 Exceptions, and a References section.
4551 * a lot of header files: work to make doc++ able to generate the
4552 source documentation, some workarounds of doc++ problems. Doc++ is
4553 now able to generate the documentation.
4555 2000-08-07 Juergen Vigna <jug@sad.it>
4557 * src/insets/insettabular.C (recomputeTextInsets): removed function
4559 * src/tabular.C (SetWidthOfMulticolCell):
4561 (calculate_width_of_column_NMC): fixed return value so that it really
4562 only returns true if the column-width has changed (there where
4563 problems with muliticolumn-cells in this column).
4565 2000-08-04 Juergen Vigna <jug@sad.it>
4567 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4568 also on the scrollstatus of the inset.
4569 (workAreaMotionNotify): ditto.
4571 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4573 2000-08-01 Juergen Vigna <jug@sad.it>
4575 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4577 * src/commandtags.h:
4578 * src/LyXAction.C (init):
4579 * src/insets/inset.C (LocalDispatch): added support for
4582 * src/insets/inset.C (scroll): new functions.
4584 * src/insets/insettext.C (removeNewlines): new function.
4585 (SetAutoBreakRows): removes forced newlines in the text of the
4586 paragraph if autoBreakRows is set to false.
4588 * src/tabular.C (Latex): generates a parbox around the cell contents
4591 * src/frontends/xforms/FormTabular.C (local_update): removed
4592 the radio_useparbox button.
4594 * src/tabular.C (UseParbox): new function
4596 2000-08-06 Baruch Even <baruch.even@writeme.com>
4598 * src/graphics/GraphicsCache.h:
4599 * src/graphics/GraphicsCache.C:
4600 * src/graphics/GraphicsCacheItem.h:
4601 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4604 * src/insets/insetgraphics.h:
4605 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4606 and the drawing of the inline image.
4608 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4609 loaded into the wrong position.
4611 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4614 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4616 * src/support/translator.h: move all typedefs to public section
4618 * src/support/filetools.C (MakeLatexName): return string const
4620 (TmpFileName): ditto
4621 (FileOpenSearch): ditto
4623 (LibFileSearch): ditto
4624 (i18nLibFileSearch): ditto
4627 (CreateTmpDir): ditto
4628 (CreateBufferTmpDir): ditto
4629 (CreateLyXTmpDir): ditto
4632 (MakeAbsPath): ditto
4634 (OnlyFilename): ditto
4636 (NormalizePath): ditto
4637 (CleanupPath): ditto
4638 (GetFileContents): ditto
4639 (ReplaceEnvironmentPath): ditto
4640 (MakeRelPath): ditto
4642 (ChangeExtension): ditto
4643 (MakeDisplayPath): ditto
4644 (do_popen): return cmdret const
4645 (findtexfile): return string const
4647 * src/support/DebugStream.h: add some /// to please doc++
4649 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4651 * src/texrow.C (same_rownumber): functor to use with find_if
4652 (getIdFromRow): rewritten to use find_if and to not update the
4653 positions. return true if row is found
4654 (increasePos): new method, use to update positions
4656 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4658 * src/lyxlex_pimpl.C (verifyTable): new method
4661 (GetString): return string const
4662 (pushTable): rewrite to use std::stack
4664 (setFile): better check
4667 * src/lyxlex.h: make LyXLex noncopyable
4669 * src/lyxlex.C (text): return char const * const
4670 (GetString): return string const
4671 (getLongString): return string const
4673 * src/lyx_gui_misc.C (askForText): return pair<...> const
4675 * src/lastfiles.[Ch] (operator): return string const
4677 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4678 istringstream not char const *.
4679 move token.end() out of loop.
4680 (readFile): move initializaton of token
4682 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4683 getIdFromRow is successful.
4685 * lib/bind/emacs.bind: don't include menus bind
4687 * development/Code_rules/Rules: the beginnings of making this
4688 better and covering more of the unwritten rules that we have.
4690 * development/Code_rules/Recommendations: a couple of wording
4693 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4695 * src/support/strerror.c: remove C++ comment.
4697 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4699 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4700 LFUN_INDEX_INSERT_LAST
4702 * src/texrow.C (getIdFromRow): changed from const_iterator to
4703 iterator, allowing code to compile with DEC cxx
4705 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4706 stores part of the class, as suggested by Allan. Will allow
4708 (apply): test to apply uses InsetCommandParams operator!=
4710 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4711 (apply): test to apply uses InsetCommandParams operator!=
4713 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4714 stores part of the class.
4715 (update): removed limits on min/max size.
4717 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4718 (apply): test to apply uses InsetCommandParams operator!=
4720 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4721 (Read, Write, scanCommand, getCommand): moved functionality
4722 into InsetCommandParams.
4724 (getScreenLabel): made pure virtual
4725 new InsetCommandParams operators== and !=
4727 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4728 c-tors based on InsetCommandParams. Removed others.
4729 * src/insets/insetinclude.[Ch]: ditto
4730 * src/insets/insetlabel.[Ch]: ditto
4731 * src/insets/insetparent.[Ch]: ditto
4732 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4734 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4735 insets derived from InsetCommand created using similar c-tors
4736 based on InsetCommandParams
4737 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4738 * src/menus.C (ShowRefsMenu): ditto
4739 * src/paragraph.C (Clone): ditto
4740 * src/text2.C (SetCounter): ditto
4741 * src/lyxfunc.C (Dispatch) ditto
4742 Also recreated old InsetIndex behaviour exactly. Can now
4743 index-insert at the start of a paragraph and index-insert-last
4744 without launching the pop-up.
4746 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4748 * lib/lyxrc.example: mark te pdf options as non functional.
4750 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4751 (isStrDbl): move tmpstr.end() out of loop.
4752 (strToDbl): move intialization of tmpstr
4753 (lowercase): return string const and move tmp.end() out of loop.
4754 (uppercase): return string const and move tmp.edn() out of loop.
4755 (prefixIs): add assertion
4760 (containsOnly): ditto
4761 (containsOnly): ditto
4762 (containsOnly): ditto
4763 (countChar): make last arg char not char const
4764 (token): return string const
4765 (subst): return string const, move tmp.end() out of loop.
4766 (subst): return string const, add assertion
4767 (strip): return string const
4768 (frontStrip): return string const, add assertion
4769 (frontStrip): return string const
4774 * src/support/lstrings.C: add inclde "LAssert.h"
4775 (isStrInt): move tmpstr.end() out of loop.
4777 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4778 toollist.end() out of loop.
4779 (deactivate): move toollist.end() out of loop.
4780 (update): move toollist.end() out of loop.
4781 (updateLayoutList): move tc.end() out of loop.
4782 (add): move toollist.end() out of loop.
4784 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4785 md.end() out of loop.
4787 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4789 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4792 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4793 (Erase): move insetlist.end() out of loop.
4795 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4796 ref to const string as first arg. Move initialization of some
4797 variables, whitespace changes.
4799 * src/kbmap.C (defkey): move table.end() out of loop.
4800 (kb_keymap): move table.end() out of loop.
4801 (findbinding): move table.end() out of loop.
4803 * src/MenuBackend.C (hasMenu): move end() out of loop.
4804 (getMenu): move end() out of loop.
4805 (getMenu): move menulist_.end() out of loop.
4807 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4809 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4812 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4813 (getFromLyXName): move infotab.end() out of loop.
4815 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4816 -fvtable-thunks -ffunction-sections -fdata-sections
4818 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4820 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4823 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4825 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4827 * src/frontends/xforms/FormCitation.[Ch],
4828 src/frontends/xforms/FormIndex.[Ch],
4829 src/frontends/xforms/FormToc.[Ch],
4830 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4832 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4834 * src/commandtags.h: renamed, created some flags for citation
4837 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4839 * src/lyxfunc.C (dispatch): use signals to insert index entry
4841 * src/frontends/Dialogs.h: new signal createIndex
4843 * src/frontends/xforms/FormCommand.[Ch],
4844 src/frontends/xforms/FormCitation.[Ch],
4845 src/frontends/xforms/FormToc.[Ch],
4846 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4848 * src/insets/insetindex.[Ch]: GUI-independent
4850 * src/frontends/xforms/FormIndex.[Ch],
4851 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4854 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4856 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4857 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4859 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4861 * src/insets/insetref.C (Latex): rewrite so that there is now
4862 question that a initialization is requested.
4864 * src/insets/insetcommand.h: reenable the hide signal
4866 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4868 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4869 fix handling of shortcuts (many bugs :)
4870 (add_lastfiles): ditto.
4872 * lib/ui/default.ui: fix a few shortcuts.
4874 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4876 * Makefile.am: Fix ``rpmdist'' target to return the exit
4877 status of the ``rpm'' command, instead of the last command in
4878 the chain (the ``rm lyx.xpm'' command, which always returns
4881 2000-08-02 Allan Rae <rae@lyx.org>
4883 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4884 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4885 * src/frontends/xforms/FormToc.C (FormToc): ditto
4887 * src/frontends/xforms/Makefile.am: A few forgotten files
4889 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4890 Signals-not-copyable-problem Lars' started commenting out.
4892 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4894 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4896 * src/insets/insetcommand.h: Signals is not copyable so anoter
4897 scheme for automatic hiding of forms must be used.
4899 * src/frontends/xforms/FormCitation.h: don't inerit from
4900 noncopyable, FormCommand already does that.
4901 * src/frontends/xforms/FormToc.h: ditto
4902 * src/frontends/xforms/FormUrl.h: ditto
4904 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4906 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4908 * src/insets/insetcommand.h (hide): new SigC::Signal0
4909 (d-tor) new virtual destructor emits hide signal
4911 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4912 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4914 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4915 LOF and LOT. Inset is now GUI-independent
4917 * src/insets/insetloa.[Ch]: redundant
4918 * src/insets/insetlof.[Ch]: ditto
4919 * src/insets/insetlot.[Ch]: ditto
4921 * src/frontends/xforms/forms/form_url.fd: tweaked!
4922 * src/frontends/xforms/forms/form_citation.fd: ditto
4924 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4925 dialogs dealing with InsetCommand insets
4927 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4928 FormCommand base class
4929 * src/frontends/xforms/FormUrl.[Ch]: ditto
4931 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4933 * src/frontends/xforms/FormToc.[Ch]: ditto
4935 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4936 passed a generic InsetCommand pointer
4937 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4939 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4940 and modified InsetTOC class
4941 * src/buffer.C: ditto
4943 * forms/lyx.fd: strip out old FD_form_toc code
4944 * src/lyx_gui_misc.C: ditto
4945 * src/lyx_gui.C: ditto
4946 * src/lyx_cb.C: ditto
4947 * src/lyx.[Ch]: ditto
4949 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4951 * src/support/utility.hpp: tr -d '\r'
4953 2000-08-01 Juergen Vigna <jug@sad.it>
4955 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4957 * src/commandtags.h:
4958 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4959 LFUN_TABULAR_FEATURES.
4961 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4962 LFUN_LAYOUT_TABULAR.
4964 * src/insets/insettabular.C (getStatus): implemented helper function.
4966 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4968 2000-07-31 Juergen Vigna <jug@sad.it>
4970 * src/text.C (draw): fixed screen update problem for text-insets.
4972 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4973 something changed probably this has to be added in various other
4976 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4978 2000-07-31 Baruch Even <baruch.even@writeme.com>
4980 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4981 templates to satisfy compaq cxx.
4984 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4986 * src/support/translator.h (equal_1st_in_pair::operator()): take
4987 const ref pair_type as arg.
4988 (equal_2nd_in_pair::operator()): ditto
4989 (Translator::~Translator): remove empty d-tor.
4991 * src/graphics/GraphicsCache.C: move include config.h to top, also
4992 put initialization of GraphicsCache::singleton here.
4993 (~GraphicsCache): move here
4994 (addFile): take const ref as arg
4997 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4999 * src/BufferView2.C (insertLyXFile): change te with/without header
5002 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5004 * src/frontends/xforms/FormGraphics.C (apply): add some
5005 static_cast. Not very nice, but required by compaq cxx.
5007 * src/frontends/xforms/RadioButtonGroup.h: include header
5008 <utility> instead of <pair.h>
5010 * src/insets/insetgraphicsParams.C: add using directive.
5011 (readResize): change return type to void.
5012 (readOrigin): ditto.
5014 * src/lyxfunc.C (getStatus): add missing break for build-program
5015 function; add test for Literate for export functions.
5017 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5018 entries in Options menu.
5020 2000-07-31 Baruch Even <baruch.even@writeme.com>
5022 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5023 protect against auto-allocation; release icon when needed.
5025 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5027 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5028 on usual typewriter.
5030 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5031 earlier czech.kmap), useful only for programming.
5033 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5035 * src/frontends/xforms/FormCitation.h: fix conditioning around
5038 2000-07-31 Juergen Vigna <jug@sad.it>
5040 * src/frontends/xforms/FormTabular.C (local_update): changed
5041 radio_linebreaks to radio_useparbox and added radio_useminipage.
5043 * src/tabular.C: made support for using minipages/parboxes.
5045 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5047 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5049 (descent): so the cursor is in the middle.
5050 (width): bit smaller box.
5052 * src/insets/insetgraphics.h: added display() function.
5054 2000-07-31 Baruch Even <baruch.even@writeme.com>
5056 * src/frontends/Dialogs.h: Added showGraphics signals.
5058 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5059 xforms form definition of the graphics dialog.
5061 * src/frontends/xforms/FormGraphics.h:
5062 * src/frontends/xforms/FormGraphics.C: Added files, the
5063 GUIndependent code of InsetGraphics
5065 * src/insets/insetgraphics.h:
5066 * src/insets/insetgraphics.C: Major writing to make it work.
5068 * src/insets/insetgraphicsParams.h:
5069 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5070 struct between InsetGraphics and GUI.
5072 * src/LaTeXFeatures.h:
5073 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5074 support for graphicx package.
5076 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5077 for the graphics inset.
5079 * src/support/translator.h: Added file, used in
5080 InsetGraphicsParams. this is a template to translate between two
5083 * src/frontends/xforms/RadioButtonGroup.h:
5084 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5085 way to easily control a radio button group.
5087 2000-07-28 Juergen Vigna <jug@sad.it>
5089 * src/insets/insettabular.C (LocalDispatch):
5090 (TabularFeatures): added support for lyx-functions of tabular features.
5091 (cellstart): refixed this function after someone wrongly changed it.
5093 * src/commandtags.h:
5094 * src/LyXAction.C (init): added support for tabular-features
5096 2000-07-28 Allan Rae <rae@lyx.org>
5098 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5099 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5100 triggers the callback for input checking. As a result we sometimes get
5101 "LyX: This shouldn't happen..." printed to cerr.
5102 (input): Started using status variable since I only free() on
5103 destruction. Some input checking for paths and font sizes.
5105 * src/frontends/xforms/FormPreferences.h: Use status to control
5106 activation of Ok and Apply
5108 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5109 callback. Also resized to stop segfaults with 0.88. The problem is
5110 that xforms-0.88 requires the folder to be wide enough to fit all the
5111 tabs. If it isn't it causes all sorts of problems.
5113 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5115 * src/frontends/xforms/forms/README: Reflect reality.
5117 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5118 * src/frontends/xforms/forms/makefile: ditto.
5120 * src/commandtags.h: Get access to new Preferences dialog
5121 * src/LyXAction.C: ditto
5122 * src/lyxfunc.C: ditto
5123 * lib/ui/default.ui: ditto
5125 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5127 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5129 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5132 * src/frontends/xforms/form_url.[Ch]: added.
5134 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5136 * src/insets/insetbib.h: fixed bug in previous commit
5138 * src/frontends/xforms/FormUrl.h: ditto
5140 * src/frontends/xforms/FormPrint.h: ditto
5142 * src/frontends/xforms/FormPreferences.h: ditto
5144 * src/frontends/xforms/FormCopyright.h: ditto
5146 * src/frontends/xforms/FormCitation.C: ditto
5148 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5149 private copyconstructor and private default contructor
5151 * src/support/Makefile.am: add utility.hpp
5153 * src/support/utility.hpp: new file from boost
5155 * src/insets/insetbib.h: set owner in clone
5157 * src/frontends/xforms/FormCitation.C: added missing include
5160 * src/insets/form_url.[Ch]: removed
5162 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5164 * development/lyx.spec.in
5165 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5166 file/directory re-organization.
5168 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5170 * src/insets/insetcommand.[Ch]: moved the string data and
5171 associated manipulation methods into a new stand-alone class
5172 InsetCommandParams. This class has two additional methods
5173 getAsString() and setFromString() allowing the contents to be
5174 moved around as a single string.
5175 (addContents) method removed.
5176 (setContents) method no longer virtual.
5178 * src/buffer.C (readInset): made use of new InsetCitation,
5179 InsetUrl constructors based on InsetCommandParams.
5181 * src/commandtags.h: add LFUN_INSERT_URL
5183 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5184 independent InsetUrl and use InsetCommandParams to extract
5185 string info and create new Insets.
5187 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5189 * src/frontends/xforms/FormCitation.C (apply): uses
5192 * src/frontends/xforms/form_url.C
5193 * src/frontends/xforms/form_url.h
5194 * src/frontends/xforms/FormUrl.h
5195 * src/frontends/xforms/FormUrl.C
5196 * src/frontends/xforms/forms/form_url.fd: new files
5198 * src/insets/insetcite.[Ch]: removed unused constructors.
5200 * src/insets/insetinclude.[Ch]: no longer store filename
5202 * src/insets/inseturl.[Ch]: GUI-independent.
5204 2000-07-26 Juergen Vigna <jug@sad.it>
5205 * renamed frontend from gtk to gnome as it is that what is realized
5206 and did the necessary changes in the files.
5208 2000-07-26 Marko Vendelin <markov@ioc.ee>
5210 * configure.in: cleaning up gnome configuration scripts
5212 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5214 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5215 shortcuts syndrom by redrawing them explicitely (a better solution
5216 would be appreciated).
5218 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5220 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5223 * src/lyx_cb.C (MenuExport): change html export to do the right
5224 thing depending of the document type (instead of having
5225 html-linuxdoc and html-docbook).
5226 * src/lyxfunc.C (getStatus): update for html
5227 * lib/ui/default.ui: simplify due to the above change.
5228 * src/menus.C (ShowFileMenu): update too (in case we need it).
5230 * src/MenuBackend.C (read): if a menu is defined twice, add the
5231 new entries to the exiting one.
5233 2000-07-26 Juergen Vigna <jug@sad.it>
5235 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5237 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5238 and return a bool if it did actual save the file.
5239 (AutoSave): don't autosave a unnamed doc.
5241 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5242 check if this is an UNNAMED new file and react to it.
5243 (newFile): set buffer to unnamed and change to not mark a new
5244 buffer dirty if I didn't do anything with it.
5246 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5248 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5250 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5251 friend as per Angus's patch posted to lyx-devel.
5253 * src/ext_l10n.h: updated
5255 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5256 gettext on the style string right before inserting them into the
5259 * autogen.sh: add code to extract style strings form layout files,
5260 not good enough yet.
5262 * src/frontends/gtk/.cvsignore: add MAKEFILE
5264 * src/MenuBackend.C (read): run the label strings through gettext
5265 before storing them in the containers.
5267 * src/ext_l10n.h: new file
5269 * autogen.sh : generate the ext_l10n.h file here
5271 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5273 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5276 * lib/ui/default.ui: fix a couple of typos.
5278 * config/gnome/gtk.m4: added (and added to the list of files in
5281 * src/insets/insetinclude.C (unique_id): fix when we are using
5282 lyxstring instead of basic_string<>.
5283 * src/insets/insettext.C (LocalDispatch): ditto.
5284 * src/support/filetools.C: ditto.
5286 * lib/configure.m4: create the ui/ directory if necessary.
5288 * src/LyXView.[Ch] (updateToolbar): new method.
5290 * src/BufferView_pimpl.C (buffer): update the toolbar when
5291 opening/closing buffer.
5293 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5295 * src/LyXAction.C (getActionName): enhance to return also the name
5296 and options of pseudo-actions.
5297 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5299 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5300 as an example of what is possible). Used in File->Build too (more
5301 useful) and in the import/export menus (to mimick the complicated
5302 handling of linuxdoc and friends). Try to update all the entries.
5304 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5307 * src/MenuBackend.C (read): Parse the new OptItem tag.
5309 * src/MenuBackend.h: Add a new optional_ data member (used if the
5310 entry should be omitted when the lyxfunc is disabled).
5312 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5313 function, used as a shortcut.
5314 (create_submenu): align correctly the shortcuts on the widest
5317 * src/MenuBackend.h: MenuItem.label() only returns the label of
5318 the menu without shortcut; new method shortcut().
5320 2000-07-14 Marko Vendelin <markov@ioc.ee>
5322 * src/frontends/gtk/Dialogs.C:
5323 * src/frontends/gtk/FormCopyright.C:
5324 * src/frontends/gtk/FormCopyright.h:
5325 * src/frontends/gtk/Makefile.am: added these source-files for the
5326 Gtk/Gnome support of the Copyright-Dialog.
5328 * src/main.C: added Gnome::Main initialization if using
5329 Gtk/Gnome frontend-GUI.
5331 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5333 * config/gnome/aclocal-include.m4
5334 * config/gnome/compiler-flags.m4
5335 * config/gnome/curses.m4
5336 * config/gnome/gnome--.m4
5337 * config/gnome/gnome-bonobo-check.m4
5338 * config/gnome/gnome-common.m4
5339 * config/gnome/gnome-fileutils.m4
5340 * config/gnome/gnome-ghttp-check.m4
5341 * config/gnome/gnome-gnorba-check.m4
5342 * config/gnome/gnome-guile-checks.m4
5343 * config/gnome/gnome-libgtop-check.m4
5344 * config/gnome/gnome-objc-checks.m4
5345 * config/gnome/gnome-orbit-check.m4
5346 * config/gnome/gnome-print-check.m4
5347 * config/gnome/gnome-pthread-check.m4
5348 * config/gnome/gnome-support.m4
5349 * config/gnome/gnome-undelfs.m4
5350 * config/gnome/gnome-vfs.m4
5351 * config/gnome/gnome-x-checks.m4
5352 * config/gnome/gnome-xml-check.m4
5353 * config/gnome/gnome.m4
5354 * config/gnome/gperf-check.m4
5355 * config/gnome/gtk--.m4
5356 * config/gnome/linger.m4
5357 * config/gnome/need-declaration.m4: added configuration scripts
5358 for Gtk/Gnome frontend-GUI
5360 * configure.in: added support for the --with-frontend=gtk option
5362 * autogen.sh: added config/gnome/* to list of config-files
5364 * acconfig.h: added define for GTKGUI-support
5366 * config/lyxinclude.m4: added --with-frontend[=value] option value
5367 for Gtk/Gnome frontend-GUI support.
5369 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5371 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5375 * src/paragraph.C (GetChar): remove non-const version
5377 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5378 (search_kw): use it.
5380 * src/lyx_main.C (init): if "preferences" exist, read that instead
5382 (ReadRcFile): return bool if the file could be read ok.
5383 (ReadUIFile): add a check to see if lex file is set ok.
5385 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5386 bastring can be used instead of lyxstring (still uses the old code
5387 if std::string is good enough or if lyxstring is used.)
5389 * src/encoding.C: make the arrays static, move ininle functions
5391 * src/encoding.h: from here.
5393 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5394 (parseSingleLyXformat2Token): move inset parsing to separate method
5395 (readInset): new private method
5397 * src/Variables.h: remove virtual from get().
5399 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5400 access to NEW_INSETS and NEW_TABULAR
5402 * src/MenuBackend.h: remove superfluous forward declaration of
5403 MenuItem. Add documentations tags "///", remove empty MenuItem
5404 destructor, remove private default contructor.
5406 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5408 (read): more string mlabel and mname to where they are used
5409 (read): remove unused variables mlabel and mname
5410 (defaults): unconditional clear, make menusetup take advantage of
5411 add returning Menu &.
5413 * src/LyXView.h: define NEW_MENUBAR as default
5415 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5416 to NEW_INSETS and NEW_TABULAR.
5417 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5418 defined. Change some of the "xxxx-inset-insert" functions names to
5421 * several files: more enahncements to NEW_INSETS and the resulting
5424 * lib/lyxrc.example (\date_insert_format): move to misc section
5426 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5427 bastring and use AC_CACHE_CHECK.
5428 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5429 the system have the newest methods. uses AC_CACHE_CHECK
5430 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5431 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5432 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5434 * configure.in: add LYX_CXX_GOOD_STD_STRING
5436 * acinclude.m4: recreated
5438 2000-07-24 Amir Karger <karger@lyx.org>
5440 * README: add Hebrew, Arabic kmaps
5443 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5445 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5448 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5450 * Lot of files: add pragma interface/implementation.
5452 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5454 * lib/ui/default.ui: new file (ans new directory). Contains the
5455 default menu and toolbar.
5457 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5458 global space. Toolbars are now read (as menus) in ui files.
5460 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5462 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5463 is disabled because the document is read-only. We want to have the
5464 toggle state of the function anyway.
5465 (getStatus): add code for LFUN_VC* functions (mimicking what is
5466 done in old-style menus)
5468 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5469 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5471 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5472 * src/BufferView_pimpl.C: ditto.
5473 * src/lyxfunc.C: ditto.
5475 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5476 default). This replaces old-style menus by new ones.
5478 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5479 MenuItem. Contain the data structure of a menu.
5481 * src/insets/insettext.C: use LyXView::setLayout instead of
5482 accessing directly the toolbar combox.
5483 * src/lyxfunc.C (Dispatch): ditto.
5485 * src/LyXView.C (setLayout): new method, which just calls
5486 Toolbar::setLayout().
5487 (updateLayoutChoice): move part of this method in Toolbar.
5489 * src/toolbar.[Ch]: removed.
5491 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5492 implementation the toolbar.
5494 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5495 the toolbar. It might make sense to merge it with ToolbarDefaults
5497 (setLayout): new function.
5498 (updateLayoutList): ditto.
5499 (openLayoutList): ditto.
5501 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5502 xforms implementation of the toolbar.
5503 (get_toolbar_func): comment out, since I do not
5504 know what it is good for.
5506 * src/ToolbarDefaults.h: Add the ItemType enum.
5508 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5509 for a list of allocated C strings. Used in Menubar xforms
5510 implementation to avoid memory leaks.
5512 * src/support/lstrings.[Ch] (uppercase): new version taking and
5516 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5517 * lib/bind/emacs.bind: ditto.
5519 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5521 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5522 forward decl of LyXView.
5524 * src/toolbar.C (toolbarItem): moved from toolbar.h
5525 (toolbarItem::clean): ditto
5526 (toolbarItem::~toolbarItem): ditto
5527 (toolbarItem::operator): ditto
5529 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5531 * src/paragraph.h: control the NEW_TABULAR define from here
5533 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5534 USE_TABULAR_INSETS to NEW_TABULAR
5536 * src/ToolbarDefaults.C: add include "lyxlex.h"
5538 * files using the old table/tabular: use NEW_TABULAR to control
5539 compilation of old tabular stuff.
5541 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5544 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5545 planemet in reading of old style floats, fix the \end_deeper
5546 problem when reading old style floats.
5548 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5550 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5552 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5554 * lib/bind/sciword.bind: updated.
5556 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5558 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5559 layout write problem
5561 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5563 * src/Makefile.am (INCLUDES): remove image directory from include
5566 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5567 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5569 * src/LyXView.C (create_form_form_main): read the application icon
5572 * lib/images/*.xpm: change the icons to use transparent color for
5575 * src/toolbar.C (update): change the color of the button when it
5578 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5580 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5581 setting explicitely the minibuffer.
5582 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5584 * src/LyXView.C (showState): new function. Shows font information
5585 in minibuffer and update toolbar state.
5586 (LyXView): call Toolbar::update after creating the
5589 * src/toolbar.C: change toollist to be a vector instead of a
5591 (BubbleTimerCB): get help string directly from the callback
5592 argument of the corresponding icon (which is the action)
5593 (set): remove unnecessary ugliness.
5594 (update): new function. update the icons (depressed, disabled)
5595 depending of the status of the corresponding action.
5597 * src/toolbar.h: remove help in toolbarItem
5599 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5601 * src/Painter.C (text): Added code for using symbol glyphs from
5602 iso10646 fonts. Currently diabled.
5604 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5607 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5608 magyar,turkish and usorbian.
5610 * src/paragraph.C (isMultiLingual): Made more efficient.
5612 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5615 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5616 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5617 Also changed the prototype to "bool math_insert_greek(char)".
5619 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5621 * lots of files: apply the NEW_INSETS on all code that will not be
5622 needed when we move to use the new insets. Enable the define in
5623 lyxparagrah.h to try it.
5625 * src/insets/insettabular.C (cellstart): change to be a static
5627 (InsetTabular): initialize buffer in the initializer list.
5629 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5631 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5632 form_print.h out of the header file. Replaced with forward
5633 declarations of the relevant struct.
5635 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5638 * src/commandtags.h: do not include "debug.h" which does not
5639 belong there. #include it in some other places because of this
5642 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5644 * src/insets/insetcaption.C: add a couple "using" directives.
5646 * src/toolbar.C (add): get the help text directly from lyxaction.
5648 (setPixmap): new function. Loads from disk and sets a pixmap on a
5649 botton; the name of the pixmap file is derived from the command
5652 * src/toolbar.h: remove members isBitmap and pixmap from
5655 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5656 * lib/images/: move many files from images/banner.xpm.
5658 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5660 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5661 * src/toolbar.C: ditto.
5662 * configure.in: ditto.
5663 * INSTALL: document.
5665 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5666 the spellchecker popup is closed from the WM.
5668 2000-07-19 Juergen Vigna <jug@sad.it>
5670 * src/insets/insetfloat.C (Write): small fix because we use the
5671 insetname for the type now!
5673 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5675 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5678 * src/frontends/Dialogs.h: removed hideCitation signal
5680 * src/insets/insetcite.h: added hide signal
5682 * src/insets/insetcite.C (~InsetCitation): emits new signal
5683 (getScreenLabel): "intelligent" label should now fit on the screen!
5685 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5687 * src/frontends/xforms/FormCitation.C (showInset): connects
5688 hide() to the inset's hide signal
5689 (show): modified to use fl_set_object_position rather than
5690 fl_set_object_geometry wherever possible
5692 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5694 * src/insets/lyxinset.h: add caption code
5696 * src/insets/insetfloat.C (type): new method
5698 * src/insets/insetcaption.C (Write): new method
5700 (LyxCode): new method
5702 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5703 to get it right together with using the FloatList.
5705 * src/commandtags.h: add LFUN_INSET_CAPTION
5706 * src/lyxfunc.C (Dispatch): handle it
5708 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5711 * src/Variables.[Ch]: make expand take a const reference, remove
5712 the destructor, some whitespace changes.
5714 * src/LyXAction.C (init): add caption-inset-insert
5716 * src/FloatList.C (FloatList): update the default floats a bit.
5718 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5720 * src/Variables.[Ch]: new files. Intended to be used for language
5721 specific strings (like \chaptername) and filename substitution in
5724 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5726 * lib/kbd/american.kmap: update
5728 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5730 * src/bufferparams.[Ch]: remove member allowAccents.
5732 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5734 * src/LaTeXLog.C: use the log_form.h header.
5735 * src/lyx_gui.C: ditto.
5736 * src/lyx_gui_misc.C: ditto.
5737 * src/lyxvc.h: ditto.
5739 * forms/log_form.fd: new file, created from latexoptions.fd. I
5740 kept the log popup and nuked the options form.
5742 * src/{la,}texoptions.[Ch]: removed.
5743 * src/lyx_cb.C (LaTeXOptions): ditto
5745 * src/lyx_gui.C (create_forms): do not handle the
5746 fd_latex_options form.
5748 2000-07-18 Juergen Vigna <jug@sad.it>
5750 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5751 name of the inset so that it can be requested outside (text2.C).
5753 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5756 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5758 * src/mathed/formula.h (ConvertFont): constify
5760 * src/mathed/formula.C (Read): add warning if \end_inset is not
5761 found on expected place.
5763 * src/insets/lyxinset.h (ConvertFont): consify
5765 * src/insets/insetquotes.C (ConvertFont): constify
5766 * src/insets/insetquotes.h: ditto
5768 * src/insets/insetinfo.h: add labelfont
5770 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5771 (ascent): use labelfont
5775 (Write): make .lyx file a bit nicer
5777 * src/insets/insetfloat.C (Write): simplify somewhat...
5778 (Read): add warning if arg is not found
5780 * src/insets/insetcollapsable.C: add using std::max
5781 (Read): move string token and add warning in arg is not found
5782 (draw): use std::max to get the right ty
5783 (getMaxWidth): simplify by using std::max
5785 * src/insets/insetsection.h: new file
5786 * src/insets/insetsection.C: new file
5787 * src/insets/insetcaption.h: new file
5788 * src/insets/insetcaption.C: new file
5790 * src/insets/inset.C (ConvertFont): constify signature
5792 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5793 insetcaption.[Ch] and insetsection.[Ch]
5795 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5796 uses to use LABEL_COUNTER_CHAPTER instead.
5797 * src/text2.C (SetCounter): here
5799 * src/counters.h: new file
5800 * src/counters.C: new file
5801 * src/Sectioning.h: new file
5802 * src/Sectioning.C: new file
5804 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5806 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5808 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5811 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5814 2000-07-17 Juergen Vigna <jug@sad.it>
5816 * src/tabular.C (Validate): check if array-package is needed.
5817 (SetVAlignment): added support for vertical alignment.
5818 (SetLTFoot): better support for longtable header/footers
5819 (Latex): modified to support added features.
5821 * src/LaTeXFeatures.[Ch]: added array-package.
5823 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5825 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5828 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5830 * configure.in: do not forget to put a space after -isystem.
5832 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5834 * lib/kbd/arabic.kmap: a few fixes.
5836 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5838 * some whitespace chagnes to a number of files.
5840 * src/support/DebugStream.h: change to make it easier for
5841 doc++ to parse correctly.
5842 * src/support/lyxstring.h: ditto
5844 * src/mathed/math_utils.C (compara): change to have only one
5846 (MathedLookupBOP): change because of the above.
5848 * src/mathed/math_delim.C (math_deco_compare): change to have only
5850 (search_deco): change becasue of the above.
5852 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5853 instead of manually coded one.
5855 * src/insets/insetquotes.C (Read): read the \end_inset too
5857 * src/insets/insetlatex.h: remove file
5858 * src/insets/insetlatex.C: remove file
5860 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5862 (InsetPrintIndex): remove destructor
5864 * src/insets/insetinclude.h: remove default constructor
5866 * src/insets/insetfloat.C: work to make it work better
5868 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5870 * src/insets/insetcite.h (InsetCitation): remove default constructor
5872 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5874 * src/text.C (GetColumnNearX): comment out some currently unused code.
5876 * src/paragraph.C (writeFile): move some initializations closer to
5878 (CutIntoMinibuffer): small change to use new matchIT operator
5882 (InsertInset): ditto
5885 (InsetIterator): ditto
5886 (Erase): small change to use new matchFT operator
5888 (GetFontSettings): ditto
5889 (HighestFontInRange): ditto
5892 * src/lyxparagraph.h: some chars changed to value_type
5893 (matchIT): because of some stronger checking (perhaps too strong)
5894 in SGI STL, the two operator() unified to one.
5897 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5899 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5900 the last inset read added
5901 (parseSingleLyXformat2Token): some more (future) compability code added
5902 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5903 (parseSingleLyXformat2Token): set last_inset_read
5904 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5905 (parseSingleLyXformat2Token): don't double intializw string next_token
5907 * src/TextCache.C (text_fits::operator()): add const's to the signature
5908 (has_buffer::operator()): ditto
5910 * src/Floating.h: add some comments on the class
5912 * src/FloatList.[Ch] (typeExist): new method
5915 * src/BackStack.h: added default constructor, wanted by Gcc.
5917 2000-07-14 Juergen Vigna <jug@sad.it>
5919 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5921 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5923 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5924 do a redraw when the window is resized!
5925 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5927 * src/insets/insettext.C (resizeLyXText): added function to correctly
5928 being able to resize the LyXWindow.
5930 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5932 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5934 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5935 crashes when closing dialog to a deleted inset.
5937 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5938 method! Now similar to other insets.
5940 2000-07-13 Juergen Vigna <jug@sad.it>
5942 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5944 * lib/examples/Literate.lyx: small patch!
5946 * src/insets/insetbib.C (Read): added this function because of wrong
5947 Write (without [begin|end]_inset).
5949 2000-07-11 Juergen Vigna <jug@sad.it>
5951 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5952 as the insertInset could not be good!
5954 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5955 the bool param should not be last.
5957 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5959 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5960 did submit that to Karl).
5962 * configure.in: use -isystem instead of -I for X headers. This
5963 fixes a problem on solaris with a recent gcc;
5964 put the front-end code after the X detection code;
5965 configure in sigc++ before lib/
5967 * src/lyx_main.C (commandLineHelp): remove -display from command
5970 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5972 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5973 Also put in Makefile rules for building the ``listerrors''
5974 program for parsing errors from literate programs written in LyX.
5976 * lib/build-listerrors: Added small shell script as part of compile
5977 process. This builds a working ``listerrors'' binary if noweb is
5978 installed and either 1) the VNC X server is installed on the machine,
5979 or 2) the user is compiling from within a GUI. The existence of a GUI
5980 is necessary to use the ``lyx --export'' feature for now. This
5981 hack can be removed once ``lyx --export'' no longer requires a GUI to
5984 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5986 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5987 now passed back correctly from gcc and placed "under" error
5988 buttons in a Literate LyX source.
5990 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5992 * src/text.C (GetColumnNearX): Better behavior when a RTL
5993 paragraph is ended by LTR text.
5995 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5998 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6000 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6001 true when clipboard is empty.
6003 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6005 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6006 row of the paragraph.
6007 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6008 to prevent calculation of bidi tables
6010 2000-07-07 Juergen Vigna <jug@sad.it>
6012 * src/screen.C (ToggleSelection): added y_offset and x_offset
6015 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6018 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6020 * src/insets/insettext.C: fixed Layout-Display!
6022 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6024 * configure.in: add check for strings.h header.
6026 * src/spellchecker.C: include <strings.h> in order to have a
6027 definition for bzero().
6029 2000-07-07 Juergen Vigna <jug@sad.it>
6031 * src/insets/insettext.C (draw): set the status of the bv->text to
6032 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6034 * src/screen.C (DrawOneRow):
6035 (DrawFromTo): redraw the actual row if something has changed in it
6038 * src/text.C (draw): call an update of the toplevel-inset if something
6039 has changed inside while drawing.
6041 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6043 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6045 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6046 processing inside class.
6048 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6049 processing inside class.
6051 * src/insets/insetindex.h new struct Holder, consistent with other
6054 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6055 citation dialog from main code and placed it in src/frontends/xforms.
6056 Dialog launched through signals instead of callbacks
6058 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6060 * lyx.man: update the options description.
6062 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6064 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6065 handle neg values, set min width to 590, add doc about -display
6067 2000-07-05 Juergen Vigna <jug@sad.it>
6069 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6070 calls to BufferView *.
6072 * src/insets/insettext.C (checkAndActivateInset): small fix non
6073 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6075 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6076 their \end_inset token!
6078 2000-07-04 edscott <edscott@imp.mx>
6080 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6081 lib/lyxrc.example: added option \wheel_jump
6083 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6085 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6086 remove support for -width,-height,-xpos and -ypos.
6088 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6090 * src/encoding.[Ch]: New files.
6092 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6093 (text): Call to the underline() method only when needed.
6095 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6097 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6098 encoding(s) for the document.
6100 * src/bufferparams.C (BufferParams): Changed default value of
6103 * src/language.C (newLang): Removed.
6104 (items[]): Added encoding information for all defined languages.
6106 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6107 encoding choice button.
6109 * src/lyxrc.h (font_norm_type): New member variable.
6110 (set_font_norm_type): New method.
6112 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6113 paragraphs with different encodings.
6115 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6116 (TransformChar): Changed to work correctly with Arabic points.
6117 (draw): Added support for drawing Arabic points.
6118 (draw): Removed code for drawing underbars (this is done by
6121 * src/support/textutils.h (IsPrintableNonspace): New function.
6123 * src/BufferView_pimpl.h: Added "using SigC::Object".
6124 * src/LyXView.h: ditto.
6126 * src/insets/insetinclude.h (include_label): Changed to mutable.
6128 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6130 * src/mathed/math_iter.h: remove empty destructor
6132 * src/mathed/math_cursor.h: remove empty destructor
6134 * src/insets/lyxinset.h: add THEOREM_CODE
6136 * src/insets/insettheorem.[Ch]: new files
6138 * src/insets/insetminipage.C: (InsertInset): remove
6140 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6142 (InsertInset): remove
6144 * src/insets/insetlist.C: (InsertList): remove
6146 * src/insets/insetfootlike.[Ch]: new files
6148 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6151 (InsertInset): ditto
6153 * src/insets/insetert.C: remove include Painter.h, reindent
6154 (InsertInset): move to header
6156 * src/insets/insetcollapsable.h: remove explicit from default
6157 contructor, remove empty destructor, add InsertInset
6159 * src/insets/insetcollapsable.C (InsertInset): new func
6161 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6163 * src/vspace.h: add explicit to constructor
6165 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6166 \textcompwordmark, please test this.
6168 * src/lyxrc.C: set ascii_linelen to 65 by default
6170 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6172 * src/commandtags.h: add LFUN_INSET_THEOREM
6174 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6175 (makeLinuxDocFile): remove _some_ of the nice logic
6176 (makeDocBookFile): ditto
6178 * src/Painter.[Ch]: (~Painter): removed
6180 * src/LyXAction.C (init): entry for insettheorem added
6182 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6184 (deplog): code to detect files generated by LaTeX, needs testing
6187 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6189 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6191 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6193 * src/LaTeX.C (deplog): Add a check for files that are going to be
6194 created by the first latex run, part of the project to remove the
6197 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6198 contents to the extension list.
6200 2000-07-04 Juergen Vigna <jug@sad.it>
6202 * src/text.C (NextBreakPoint): added support for needFullRow()
6204 * src/insets/lyxinset.h: added needFullRow()
6206 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6209 * src/insets/insettext.C: lots of changes for update!
6211 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6213 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6215 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6217 * src/insets/insetinclude.C (InsetInclude): fixed
6218 initialization of include_label.
6219 (unique_id): now returns a string.
6221 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6223 * src/LaTeXFeatures.h: new member IncludedFiles, for
6224 a map of key, included file name.
6226 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6227 with the included files for inclusion in SGML preamble,
6228 i. e., linuxdoc and docbook.
6231 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6232 nice (is the generated linuxdoc code to be exported?), that
6233 allows to remove column, and only_body that will be true for
6234 slave documents. Insets are allowed inside SGML font type.
6235 New handling of the SGML preamble for included files.
6236 (makeDocBookFile): the same for docbook.
6238 * src/insets/insetinclude.h:
6239 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6241 (DocBook): new export methods.
6243 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6244 and makeDocBookFile.
6246 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6247 formats to export with command line argument -x.
6249 2000-06-29 Juergen Vigna <jug@sad.it>
6251 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6252 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6254 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6255 region could already been cleared by an inset!
6257 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6259 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6262 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6264 (cursorToggle): remove special handling of lyx focus.
6266 2000-06-28 Juergen Vigna <jug@sad.it>
6268 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6271 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6273 * src/insets/insetindex.C (Edit): add a callback when popup is
6276 * src/insets/insettext.C (LocalDispatch):
6277 * src/insets/insetmarginal.h:
6278 * src/insets/insetlist.h:
6279 * src/insets/insetfoot.h:
6280 * src/insets/insetfloat.h:
6281 * src/insets/insetert.h: add a missing std:: qualifier.
6283 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6285 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6288 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6290 * src/insets/insettext.C (Read): remove tmptok unused variable
6291 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6292 (InsertInset): change for new InsetInset code
6294 * src/insets/insettext.h: add TEXT inline method
6296 * src/insets/insettext.C: remove TEXT macro
6298 * src/insets/insetmarginal.C (Write): new method
6299 (Latex): change output slightly
6301 * src/insets/insetfoot.C (Write): new method
6302 (Latex): change output slightly (don't use endl when no need)
6304 * src/insets/insetert.C (Write): new method
6306 * src/insets/insetcollapsable.h: make button_length, button_top_y
6307 and button_bottm_y protected.
6309 * src/insets/insetcollapsable.C (Write): simplify code by using
6310 tostr. Also do not output the float name, the children class
6311 should to that to get control over own arguments
6313 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6314 src/insets/insetminipage.[Ch]:
6317 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6319 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6321 * src/Makefile.am (lyx_SOURCES): add the new files
6323 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6324 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6325 * src/commandtags.h: ditto
6327 * src/LaTeXFeatures.h: add a std::set of used floattypes
6329 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6331 * src/FloatList.[Ch] src/Floating.h: new files
6333 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6335 * src/lyx_cb.C (TableApplyCB): ditto
6337 * src/text2.C: ditto
6338 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6339 (parseSingleLyXformat2Token): ditto + add code for
6340 backwards compability for old float styles + add code for new insets
6342 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6344 (InsertInset(size_type, Inset *, LyXFont)): new method
6345 (InsetChar(size_type, char)): changed to use the other InsetChar
6346 with a LyXFont(ALL_INHERIT).
6347 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6348 insert the META_INSET.
6350 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6352 * sigc++/thread.h (Threads): from here
6354 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6355 definition out of line
6356 * sigc++/scope.h: from here
6358 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6360 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6361 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6363 * Makefile.am (bindist): new target.
6365 * INSTALL: add instructions for doing a binary distribution.
6367 * development/tools/README.bin.example: update a bit.
6369 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6372 * lib/lyxrc.example: new lyxrc tag \set_color.
6374 * src/lyxfunc.C (Dispatch):
6375 * src/commandtags.h:
6376 * src/LyXAction.C: new lyxfunc "set-color".
6378 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6379 and an x11name given as strings.
6381 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6382 cache when a color is changed.
6384 2000-06-26 Juergen Vigna <jug@sad.it>
6386 * src/lyxrow.C (width): added this functions and variable.
6388 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6391 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6393 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6395 * images/undo_bw.xpm: new icon.
6396 * images/redo_bw.xpm: ditto.
6398 * configure.in (INSTALL_SCRIPT): change value to
6399 ${INSTALL} to avoid failures of install-script target.
6400 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6402 * src/BufferView.h: add a magic "friend" declaration to please
6405 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6407 * forms/cite.fd: modified to allow resizing without messing
6410 * src/insetcite.C: Uses code from cite.fd almost without
6412 User can now resize dialog in the x-direction.
6413 Resizing the dialog in the y-direction is prevented, as the
6414 code does this intelligently already.
6416 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6418 * INSTALL: remove obsolete entry in "problems" section.
6420 * lib/examples/sl_*.lyx: update of the slovenian examples.
6422 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6424 2000-06-23 Juergen Vigna <jug@sad.it>
6426 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6428 * src/buffer.C (resize): delete the LyXText of textinsets.
6430 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6432 * src/insets/lyxinset.h: added another parameter 'cleared' to
6433 the draw() function.
6435 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6436 unlocking inset in inset.
6438 2000-06-22 Juergen Vigna <jug@sad.it>
6440 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6441 of insets and moved first to LyXText.
6443 * src/mathed/formulamacro.[Ch]:
6444 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6446 2000-06-21 Juergen Vigna <jug@sad.it>
6448 * src/text.C (GetVisibleRow): look if I should clear the area or not
6449 using Inset::doClearArea() function.
6451 * src/insets/lyxinset.h: added doClearArea() function and
6452 modified draw(Painter &, ...) to draw(BufferView *, ...)
6454 * src/text2.C (UpdateInset): return bool insted of int
6456 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6458 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6459 combox in the character popup
6461 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6462 BufferParams const & params
6464 2000-06-20 Juergen Vigna <jug@sad.it>
6466 * src/insets/insettext.C (SetParagraphData): set insetowner on
6469 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6471 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6472 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6474 (form_main_): remove
6476 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6477 (create_form_form_main): remove FD_form_main stuff, connect to
6478 autosave_timeout signal
6480 * src/LyXView.[Ch] (getMainForm): remove
6481 (UpdateTimerCB): remove
6482 * src/BufferView_pimpl.h: inherit from SigC::Object
6484 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6485 signal instead of callback
6487 * src/BufferView.[Ch] (cursorToggleCB): remove
6489 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6491 * src/BufferView_pimpl.C: changes because of the one below
6493 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6494 instead of storing a pointer to a LyXText.
6496 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6498 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6500 * src/lyxparagraph.h
6502 * src/paragraph.C: Changed fontlist to a sorted vector.
6504 2000-06-19 Juergen Vigna <jug@sad.it>
6506 * src/BufferView.h: added screen() function.
6508 * src/insets/insettext.C (LocalDispatch): some selection code
6511 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6513 * src/insets/insettext.C (SetParagraphData):
6515 (InsetText): fixes for multiple paragraphs.
6517 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6519 * development/lyx.spec.in: Call configure with ``--without-warnings''
6520 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6521 This should be fine, however, since we generally don't want to be
6522 verbose when making an RPM.
6524 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6526 * lib/scripts/fig2pstex.py: New file
6528 2000-06-16 Juergen Vigna <jug@sad.it>
6530 * src/insets/insettabular.C (UpdateLocal):
6531 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6532 (LocalDispatch): Changed all functions to use LyXText.
6534 2000-06-15 Juergen Vigna <jug@sad.it>
6536 * src/text.C (SetHeightOfRow): call inset::update before requesting
6539 * src/insets/insettext.C (update):
6540 * src/insets/insettabular.C (update): added implementation
6542 * src/insets/lyxinset.h: added update function
6544 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6546 * src/text.C (SelectNextWord): protect against null pointers with
6547 old-style string streams. (fix from Paul Theo Gonciari
6550 * src/cite.[Ch]: remove erroneous files.
6552 * lib/configure.m4: update the list of created directories.
6554 * src/lyxrow.C: include <config.h>
6555 * src/lyxcursor.C: ditto.
6557 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6559 * lib/examples/decimal.lyx: new example file from Mike.
6561 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6562 to find template definitions (from Dekel)
6564 * src/frontends/.cvsignore: add a few things.
6566 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6568 * src/Timeout.C (TimeOut): remove default argument.
6570 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6573 * src/insets/ExternalTemplate.C: add a "using" directive.
6575 * src/lyx_main.h: remove the act_ struct, which seems unused
6578 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6580 * LyX Developers Meeting: All files changed, due to random C++ (by
6581 coincidence) code generator script.
6583 - external inset (cool!)
6584 - initial online editing of preferences
6585 - insettabular breaks insettext(s contents)
6587 - some DocBook fixes
6588 - example files update
6589 - other cool stuff, create a diff and look for yourself.
6591 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6593 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6594 -1 this is a non-line-breaking textinset.
6596 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6597 if there is no width set.
6599 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6601 * Lots of files: Merged the dialogbase branch.
6603 2000-06-09 Allan Rae <rae@lyx.org>
6605 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6606 and the Dispatch methods that used it.
6608 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6609 access to functions formerly kept in Dispatch.
6611 2000-05-19 Allan Rae <rae@lyx.org>
6613 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6614 made to_page and count_copies integers again. from_page remains a
6615 string however because I want to allow entry of a print range like
6616 "1,4,22-25" using this field.
6618 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6619 and printer-params-get. These aren't useful from the minibuffer but
6620 could be used by a script/LyXServer app provided it passes a suitable
6621 auto_mem_buffer. I guess I should take a look at how the LyXServer
6622 works and make it support xtl buffers.
6624 * sigc++/: updated to libsigc++-1.0.1
6626 * src/xtl/: updated to xtl-1.3.pl.11
6628 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6629 those changes done to the files in src/ are actually recreated when
6630 they get regenerated. Please don't ever accept a patch that changes a
6631 dialog unless that patch includes the changes to the corresponding *.fd
6634 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6635 stringOnlyContains, renamed it and generalised it.
6637 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6638 branch. Removed the remaining old form_print code.
6640 2000-04-26 Allan Rae <rae@lyx.org>
6642 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6643 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6645 2000-04-25 Allan Rae <rae@lyx.org>
6647 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6648 against a base of xtl-1.3.pl.4
6650 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6651 filter the Id: entries so they still show the xtl version number
6654 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6655 into the src/xtl code. Patch still pending with José (XTL)
6657 2000-04-24 Allan Rae <rae@lyx.org>
6659 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6660 both more generic and much safer. Use the new template functions.
6661 * src/buffer.[Ch] (Dispatch): ditto.
6663 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6664 and mem buffer more intelligently. Also a little general cleanup.
6667 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6668 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6669 * src/xtl/Makefile.am: ditto.
6670 * src/xtl/.cvsignore: ditto.
6671 * src/Makefile.am: ditto.
6673 * src/PrinterParams.h: Removed the macros member functions. Added a
6674 testInvariant member function. A bit of tidying up and commenting.
6675 Included Angus's idea for fixing operation with egcs-1.1.2.
6677 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6678 cool expansion of XTL's mem_buffer to support automatic memory
6679 management within the buffer itself. Removed the various macros and
6680 replaced them with template functions that use either auto_mem_buffer
6681 or mem_buffer depending on a #define. The mem_buffer support will
6682 disappear as soon as the auto_mem_buffer is confirmed to be good on
6683 other platforms/compilers. That is, it's there so you've got something
6686 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6687 effectively forked XTL. However I expect José will include my code
6688 into the next major release. Also fixed a memory leak.
6689 * src/xtl/text.h: ditto.
6690 * src/xtl/xdr.h: ditto.
6691 * src/xtl/giop.h: ditto.
6693 2000-04-16 Allan Rae <rae@lyx.org>
6695 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6696 by autogen.sh and removed by maintainer-clean anyway.
6697 * .cvsignore, sigc++/.cvsignore: Support the above.
6699 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6701 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6703 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6704 macros, renamed static callback-target member functions to suit new
6705 scheme and made them public.
6706 * src/frontends/xforms/forms/form_print.fd: ditto.
6707 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6709 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6712 * src/xtl/: New directory containing a minimal distribution of XTL.
6713 This is XTL-1.3.pl.4.
6715 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6717 2000-04-15 Allan Rae <rae@lyx.org>
6719 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6721 * sigc++/: Updated to libsigc++-1.0.0
6723 2000-04-14 Allan Rae <rae@lyx.org>
6725 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6726 use the generic ones in future. I'll modify my conversion script.
6728 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6730 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6731 (CloseAllBufferRelatedDialogs): Renamed.
6732 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6734 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6735 of the generic ones. These are the same ones my conversion script
6738 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6739 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6740 * src/buffer.C (Dispatch): ditto
6742 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6743 functions for updating and hiding buffer dependent dialogs.
6744 * src/BufferView.C (buffer): ditto
6745 * src/buffer.C (setReadonly): ditto
6746 * src/lyxfunc.C (CloseBuffer): ditto
6748 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6749 Dialogs.h, and hence all the SigC stuff, into every file that includes
6750 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6752 * src/BufferView2.C: reduce the number of headers included by buffer.h
6754 2000-04-11 Allan Rae <rae@lyx.org>
6756 * src/frontends/xforms/xform_macros.h: A small collection of macros
6757 for building C callbacks.
6759 * src/frontends/xforms/Makefile.am: Added above file.
6761 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6762 scheme again. This time it should work for JMarc. If this is
6763 successful I'll revise my conversion script to automate some of this.
6764 The static member functions in the class also have to be public for
6765 this scheme will work. If the scheme works (it's almost identical to
6766 the way BufferView::cursorToggleCB is handled so it should work) then
6767 FormCopyright and FormPrint will be ready for inclusion into the main
6768 trunk immediately after 1.1.5 is released -- provided we're prepared
6769 for complaints about lame compilers not handling XTL.
6771 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6773 2000-04-07 Allan Rae <rae@lyx.org>
6775 * config/lyxinclude.m4: A bit more tidying up (Angus)
6777 * src/LString.h: JMarc's <string> header fix
6779 * src/PrinterParams.h: Used string for most data to remove some
6780 ugly code in the Print dialog and avoid even uglier code when
6781 appending the ints to a string for output.
6783 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6784 and moved "default:" back to the end of switch statement. Cleaned
6785 up the printing so it uses the right function calls and so the
6786 "print to file" option actually puts the file in the right directory.
6788 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6790 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6791 and Ok+Apply button control into a separate method: input (Angus).
6792 (input) Cleaned it up and improved it to be very thorough now.
6793 (All CB) static_cast used instead of C style cast (Angus). This will
6794 probably change again once we've worked out how to keep gcc-2.8.1 happy
6795 with real C callbacks.
6796 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6797 ignore some of the bool settings and has random numbers instead. Needs
6798 some more investigation. Added other input length checks and checking
6799 of file and printer names.
6801 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6802 would link (Angus). Seems the old code doesn't compile with the pragma
6803 statement either. Separated callback entries from internal methods.
6805 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6807 2000-03-17 Allan Rae <rae@lyx.org>
6809 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6810 need it? Maybe it could go in Dialogs instead? I could make it a
6811 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6812 values to get the bool return value.
6813 (Dispatch): New overloaded method for xtl support.
6815 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6816 extern "C" callback instead of static member functions. Hopefully,
6817 JMarc will be able to compile this. I haven't changed
6818 forms/form_copyright.fd yet. Breaking one of my own rules already.
6820 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6821 because they aren't useful from the minibuffer. Maybe a LyXServer
6822 might want a help message though?
6824 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6826 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6827 xtl which needs both rtti and exceptions.
6829 * src/support/Makefile.am:
6830 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6832 * src/frontends/xforms/input_validators.[ch]: input filters and
6833 validators. These conrol what keys are valid in input boxes.
6834 Use them and write some more. Much better idea than waiting till
6835 after the user has pressed Ok to say that the input fields don't make
6838 * src/frontends/xforms/Makefile.am:
6839 * src/frontends/xforms/forms/form_print.fd:
6840 * src/frontends/xforms/forms/makefile:
6841 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6842 new scheme. Still have to make sure I haven't missed anything from
6843 the current implementation.
6845 * src/Makefile.am, src/PrinterParams.h: New data store.
6847 * other files: Added a couple of copyright notices.
6849 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6851 * src/insets/insetbib.h: move Holder struct in public space.
6853 * src/frontends/include/DialogBase.h: use SigC:: only when
6854 SIGC_CXX_NAMESPACES is defined.
6855 * src/frontends/include/Dialogs.h: ditto.
6857 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6859 * src/frontends/xforms/FormCopyright.[Ch]: do not
6860 mention SigC:: explicitely.
6862 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6864 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6865 deals with testing KDE in main configure.in
6866 * configure.in: ditto.
6868 2000-02-22 Allan Rae <rae@lyx.org>
6870 * Lots of files: Merged from HEAD
6872 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6873 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6875 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6877 * sigc++/: new minidist.
6879 2000-02-14 Allan Rae <rae@lyx.org>
6881 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6883 2000-02-08 Juergen Vigna <jug@sad.it>
6885 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6886 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6888 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6889 for this port and so it is much easier for other people to port
6890 dialogs in a common development environment.
6892 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6893 the QT/KDE implementation.
6895 * src/frontends/kde/Dialogs.C:
6896 * src/frontends/kde/FormCopyright.C:
6897 * src/frontends/kde/FormCopyright.h:
6898 * src/frontends/kde/Makefile.am:
6899 * src/frontends/kde/formcopyrightdialog.C:
6900 * src/frontends/kde/formcopyrightdialog.h:
6901 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6902 for the kde support of the Copyright-Dialog.
6904 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6905 subdir-substitution instead of hardcoded 'xforms' as we now have also
6908 * src/frontends/include/DialogBase.h (Object): just commented the
6909 label after #endif (nasty warning and I don't like warnings ;)
6911 * src/main.C (main): added KApplication initialization if using
6914 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6915 For now only the KDE event-loop is added if frontend==kde.
6917 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6919 * configure.in: added support for the --with-frontend[=value] option
6921 * autogen.sh: added kde.m4 file to list of config-files
6923 * acconfig.h: added define for KDEGUI-support
6925 * config/kde.m4: added configuration functions for KDE-port
6927 * config/lyxinclude.m4: added --with-frontend[=value] option with
6928 support for xforms and KDE.
6930 2000-02-08 Allan Rae <rae@lyx.org>
6932 * all Makefile.am: Fixed up so the make targets dist, distclean,
6933 install and uninstall all work even if builddir != srcdir. Still
6934 have a new sigc++ minidist update to come.
6936 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6938 2000-02-01 Allan Rae <rae@lyx.org>
6940 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6941 Many mods to get builddir != srcdir working.
6943 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6944 for building on NT and so we can do the builddir != srcdir stuff.
6946 2000-01-30 Allan Rae <rae@lyx.org>
6948 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6949 This will stay in "rae" branch. We probably don't really need it in
6950 the main trunk as anyone who wants to help programming it should get
6951 a full library installed also. So they can check both included and
6952 system supplied library compilation.
6954 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6955 Added a 'mini' distribution of libsigc++. If you feel the urge to
6956 change something in these directories - Resist it. If you can't
6957 resist the urge then you should modify the following script and rebuild
6958 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6959 all happen. Still uses a hacked version of libsigc++'s configure.in.
6960 I'm quite happy with the results. I'm not sure the extra work to turn
6961 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6962 worth the trouble and would probably lead to extra maintenance
6964 I haven't tested the following important make targets: install, dist.
6965 Not ready for prime time but very close. Maybe 1.1.5.
6967 * development/tools/makeLyXsigc.sh: A shell script to automatically
6968 generate our mini-dist of libsigc++. It can only be used with a CVS
6969 checkout of libsigc++ not a tarball distribution. It's well commented.
6970 This will end up as part of the libsigc++ distribution so other apps
6971 can easily have an included mini-dist. If someone makes mods to the
6972 sigc++ subpackage without modifying this script to generate those
6973 changes I'll be very upset!
6975 * src/frontends/: Started the gui/system indep structure.
6977 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6978 to access the gui-indep dialogs are in this class. Much improved
6979 design compared to previous revision. Lars, please refrain from
6980 moving this header into src/ like you did with Popups.h last time.
6982 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6984 * src/frontends/xforms/: Started the gui-indep system with a single
6985 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6988 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6989 Here you'll find a very useful makefile and automated fdfix.sh that
6990 makes updating dailogs a no-brainer -- provided you follow the rules
6991 set out in the README. I'm thinking about adding another script to
6992 automatically generate skeleton code for a new dialog given just the
6995 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6996 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6997 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6999 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7001 * src/support/LSubstring.C (operator): simplify
7003 * src/lyxtext.h: removed bparams, use buffer_->params instead
7005 * src/lyxrow.h: make Row a real class, move all variables to
7006 private and use accessors.
7008 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7010 (isRightToLeftPar): ditto
7011 (ChangeLanguage): ditto
7012 (isMultiLingual): ditto
7015 (SimpleTeXOnePar): ditto
7016 (TeXEnvironment): ditto
7017 (GetEndLabel): ditto
7019 (SetOnlyLayout): ditto
7020 (BreakParagraph): ditto
7021 (BreakParagraphConservative): ditto
7022 (GetFontSettings): ditto
7024 (CopyIntoMinibuffer): ditto
7025 (CutIntoMinibuffer): ditto
7026 (PasteParagraph): ditto
7027 (SetPExtraType): ditto
7028 (UnsetPExtraType): ditto
7029 (DocBookContTableRows): ditto
7030 (SimpleDocBookOneTablePar): ditto
7032 (TeXFootnote): ditto
7033 (SimpleTeXOneTablePar): ditto
7034 (TeXContTableRows): ditto
7035 (SimpleTeXSpecialChars): ditto
7038 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7039 to private and use accessors.
7041 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7042 this, we did not use it anymore and has not been for ages. Just a
7043 waste of cpu cycles.
7045 * src/language.h: make Language a real class, move all variables
7046 to private and use accessors.
7048 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7049 (create_view): remove
7050 (update): some changes for new timer
7051 (cursorToggle): use new timer
7052 (beforeChange): change for new timer
7054 * src/BufferView.h (cursorToggleCB): removed last paramter because
7057 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7058 (cursorToggleCB): change because of new timer code
7060 * lib/CREDITS: updated own mailaddress
7062 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7064 * src/support/filetools.C (PutEnv): fix the code in case neither
7065 putenv() nor setenv() have been found.
7067 * INSTALL: mention the install-strip Makefile target.
7069 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7070 read-only documents.
7072 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7074 * lib/reLyX/configure.in (VERSION): avoid using a previously
7075 generated reLyX wrapper to find out $prefix.
7077 * lib/examples/eu_adibide_lyx-atua.lyx:
7078 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7079 translation of the Tutorial (Dooteo)
7081 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7083 * forms/cite.fd: new citation dialog
7085 * src/insetcite.[Ch]: the new citation dialog is moved into
7088 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7091 * src/insets/insetcommand.h: data members made private.
7093 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7095 * LyX 1.1.5 released
7097 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7099 * src/version.h (LYX_RELEASE): to 1.1.5
7101 * src/spellchecker.C (RunSpellChecker): return false if the
7102 spellchecker dies upon creation.
7104 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7106 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7107 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7111 * lib/CREDITS: update entry for Martin Vermeer.
7113 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7115 * src/text.C (draw): Draw foreign language bars at the bottom of
7116 the row instead of at the baseline.
7118 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7120 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7122 * lib/bind/de_menus.bind: updated
7124 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7126 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7128 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7130 * src/menus.C (Limit_string_length): New function
7131 (ShowTocMenu): Limit the number of items/length of items in the
7134 * src/paragraph.C (String): Correct result for a paragraph inside
7137 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7139 * src/bufferlist.C (close): test of buf->getuser() == NULL
7141 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7143 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7144 Do not call to SetCursor when the paragraph is a closed footnote!
7146 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7148 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7151 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7153 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7156 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7157 reference popup, that activates the reference-back action
7159 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7161 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7162 the menus. Also fixed a bug.
7164 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7165 the math panels when switching buffers (unless new buffer is readonly).
7167 * src/BufferView.C (NoSavedPositions)
7168 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7170 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7172 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7173 less of dvi dirty or not.
7175 * src/trans_mgr.[Ch] (insert): change first parameter to string
7178 * src/chset.[Ch] (encodeString): add const to first parameter
7180 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7182 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7186 * src/LaTeX.C (deplog): better searching for dependency files in
7187 the latex log. Uses now regexps.
7189 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7190 instead of the box hack or \hfill.
7192 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7194 * src/lyxfunc.C (doImportHelper): do not create the file before
7195 doing the actual import.
7196 (doImportASCIIasLines): create a new file before doing the insert.
7197 (doImportASCIIasParagraphs): ditto.
7199 * lib/lyxrc.example: remove mention of non-existing commands
7201 * lyx.man: remove mention of color-related switches.
7203 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7205 * src/lyx_gui.C: remove all the color-related ressources, which
7206 are not used anymore.
7208 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7211 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7213 * src/lyxrc.C (read): Add a missing break in the switch
7215 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7217 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7219 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7222 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7224 * src/text.C (draw): draw bars under foreign language words.
7226 * src/LColor.[Ch]: add LColor::language
7228 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7230 * src/lyxcursor.h (boundary): New member variable
7232 * src/text.C (IsBoundary): New methods
7234 * src/text.C: Use the above for currect cursor movement when there
7235 is both RTL & LTR text.
7237 * src/text2.C: ditto
7239 * src/bufferview_funcs.C (ToggleAndShow): ditto
7241 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7243 * src/text.C (DeleteLineForward): set selection to true to avoid
7244 that DeleteEmptyParagraphMechanism does some magic. This is how it
7245 is done in all other functions, and seems reasonable.
7246 (DeleteWordForward): do not jump over non-word stuff, since
7247 CursorRightOneWord() already does it.
7249 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7250 DeleteWordBackward, since they seem safe to me (since selection is
7251 set to "true") DeleteEmptyParagraphMechanism does nothing.
7253 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7255 * src/lyx_main.C (easyParse): simplify the code by factoring the
7256 part that removes parameters from the command line.
7257 (LyX): check wether wrong command line options have been given.
7259 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7261 * src/lyx_main.C : add support for specifying user LyX
7262 directory via command line option -userdir.
7264 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7266 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7267 the number of items per popup.
7268 (Add_to_refs_menu): Ditto.
7270 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7272 * src/lyxparagraph.h: renamed ClearParagraph() to
7273 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7274 textclass as parameter, and do nothing if free_spacing is
7275 true. This fixes part of the line-delete-forward problems.
7277 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7278 (pasteSelection): ditto.
7279 (SwitchLayoutsBetweenClasses): more translatable strings.
7281 * src/text2.C (CutSelection): use StripLeadingSpaces.
7282 (PasteSelection): ditto.
7283 (DeleteEmptyParagraphMechanism): ditto.
7285 2000-05-26 Juergen Vigna <jug@sad.it>
7287 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7288 is not needed in tabular insets.
7290 * src/insets/insettabular.C (TabularFeatures): added missing features.
7292 * src/tabular.C (DeleteColumn):
7294 (AppendRow): implemented this functions
7295 (cellsturct::operator=): clone the inset too;
7297 2000-05-23 Juergen Vigna <jug@sad.it>
7299 * src/insets/insettabular.C (LocalDispatch): better selection support
7300 when having multicolumn-cells.
7302 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7304 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7306 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7308 * src/ColorHandler.C (getGCForeground): put more test into _()
7310 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7313 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7316 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7318 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7319 there are no labels, or when buffer is readonly.
7321 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7322 there are no labels, buffer is SGML, or when buffer is readonly.
7324 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7326 * src/LColor.C (LColor): change a couple of grey40 to grey60
7327 (LColor): rewore initalization to make compiles go some magnitude
7329 (getGUIName): don't use gettext until we need the string.
7331 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7333 * src/Bullet.[Ch]: Fixed a small bug.
7335 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7337 * src/paragraph.C (String): Several fixes/improvements
7339 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7341 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7343 * src/paragraph.C (String): give more correct output.
7345 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7347 * src/lyxfont.C (stateText) Do not output the language if it is
7348 eqaul to the language of the document.
7350 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7351 between two paragraphs with the same language.
7353 * src/paragraph.C (getParLanguage) Return a correct answer for an
7354 empty dummy paragraph.
7356 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7359 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7362 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7363 the menus/popup, if requested fonts are unavailable.
7365 2000-05-22 Juergen Vigna <jug@sad.it>
7367 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7368 movement support (Up/Down/Tab/Shift-Tab).
7369 (LocalDispatch): added also preliminari cursor-selection.
7371 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7373 * src/paragraph.C (PasteParagraph): Hopefully now right!
7375 2000-05-22 Garst R. Reese <reese@isn.net>
7377 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7378 of list, change all references to Environment to Command
7379 * tex/hollywood.cls : rewrite environments as commands, add
7380 \uppercase to interiorshot and exteriorshot to force uppecase.
7381 * tex/broadway.cls : rewrite environments as commands. Tweak
7384 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7386 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7387 size of items: use a constant intead of the hardcoded 40, and more
7388 importantly do not remove the %m and %x tags added at the end.
7389 (Add_to_refs_menu): use vector::size_type instead of
7390 unsigned int as basic types for the variables. _Please_ do not
7391 assume that size_t is equal to unsigned int. On an alpha, this is
7392 unsigned long, which is _not_ the same.
7394 * src/language.C (initL): remove language "hungarian", since it
7395 seems that "magyar" is better.
7397 2000-05-22 Juergen Vigna <jug@sad.it>
7399 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7401 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7404 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7405 next was deleted but not set to 0.
7407 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7409 * src/language.C (initL): change the initialization of languages
7410 so that compiles goes _fast_.
7412 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7415 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7417 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7421 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7423 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7425 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7429 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7432 * src/insets/insetlo*.[Ch]: Made editable
7434 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7436 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7437 the current selection.
7439 * src/BufferView_pimpl.C (stuffClipboard): new method
7441 * src/BufferView.C (stuffClipboard): new method
7443 * src/paragraph.C (String): new method
7445 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7446 LColor::ignore when lyxname is not found.
7448 * src/BufferView.C (pasteSelection): new method
7450 * src/BufferView_pimpl.C (pasteSelection): new method
7452 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7454 * src/WorkArea.C (request_clipboard_cb): new static function
7455 (getClipboard): new method
7456 (putClipboard): new method
7458 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7460 * LyX 1.1.5pre2 released
7462 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7464 * src/vspace.C (operator=): removed
7465 (operator=): removed
7467 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7469 * src/layout.C (NumberOfClass): manually set the type in make_pair
7470 (NumberOfLayout): ditto
7472 * src/language.C: use the Language constructor for ignore_lang
7474 * src/language.h: add constructors to struct Language
7476 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7478 * src/text2.C (SetCursorIntern): comment out #warning
7480 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7482 * src/mathed/math_iter.h: initialize sx and sw to 0
7484 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7486 * forms/lyx.fd: Redesign of form_ref
7488 * src/LaTeXFeatures.[Ch]
7492 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7495 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7496 and Buffer::inset_iterator.
7498 * src/menus.C: Added new menus: TOC and Refs.
7500 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7502 * src/buffer.C (getTocList): New method.
7504 * src/BufferView2.C (ChangeRefs): New method.
7506 * src/buffer.C (getLabelList): New method. It replaces the old
7507 getReferenceList. The return type is vector<string> instead of
7510 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7511 the old getLabel() and GetNumberOfLabels() methods.
7512 * src/insets/insetlabel.C (getLabelList): ditto
7513 * src/mathed/formula.C (getLabelList): ditto
7515 * src/paragraph.C (String): New method.
7517 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7518 Uses the new getTocList() method.
7519 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7520 which automatically updates the contents of the browser.
7521 (RefUpdateCB): Use the new getLabelList method.
7523 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7525 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7527 * src/spellchecker.C: Added using std::reverse;
7529 2000-05-19 Juergen Vigna <jug@sad.it>
7531 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7533 * src/insets/insettext.C (computeTextRows): small fix for display of
7534 1 character after a newline.
7536 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7539 2000-05-18 Juergen Vigna <jug@sad.it>
7541 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7542 when changing width of column.
7544 * src/tabular.C (set_row_column_number_info): setting of
7545 autobreak rows if necessary.
7547 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7549 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7551 * src/vc-backend.*: renamed stat() to status() and vcstat to
7552 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7553 compilation broke. The new name seems more relevant, anyway.
7555 2000-05-17 Juergen Vigna <jug@sad.it>
7557 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7558 which was wrong if the removing caused removing of rows!
7560 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7561 (pushToken): new function.
7563 * src/text2.C (CutSelection): fix problem discovered with purify
7565 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7567 * src/debug.C (showTags): enlarge the first column, now that we
7568 have 6-digits debug codes.
7570 * lib/layouts/hollywood.layout:
7571 * lib/tex/hollywood.cls:
7572 * lib/tex/brodway.cls:
7573 * lib/layouts/brodway.layout: more commands and fewer
7574 environments. Preambles moved in the .cls files. Broadway now has
7575 more options on scene numbering and less whitespace (from Garst)
7577 * src/insets/insetbib.C (getKeys): make sure that we are in the
7578 document directory, in case the bib file is there.
7580 * src/insets/insetbib.C (Latex): revert bogus change.
7582 2000-05-16 Juergen Vigna <jug@sad.it>
7584 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7585 the TabularLayout on cursor move.
7587 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7589 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7592 (draw): fixed cursor position and drawing so that the cursor is
7593 visible when before the tabular-inset.
7595 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7596 when creating from old insettext.
7598 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7600 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7602 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7603 * lib/tex/brodway.cls: ditto
7605 * lib/layouts/brodway.layout: change alignment of parenthical
7608 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7610 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7611 versions 0.88 and 0.89 are supported.
7613 2000-05-15 Juergen Vigna <jug@sad.it>
7615 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7618 * src/insets/insettext.C (computeTextRows): redone completely this
7619 function in a much cleaner way, because of problems when having a
7621 (draw): added a frame border when the inset is locked.
7622 (SetDrawLockedFrame): this sets if we draw the border or not.
7623 (SetFrameColor): this sets the frame color (default=insetframe).
7625 * src/insets/lyxinset.h: added x() and y() functions which return
7626 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7627 function which is needed to see if we have a locking inset of some
7628 type in this inset (needed for now in insettabular).
7630 * src/vspace.C (inPixels): the same function also without a BufferView
7631 parameter as so it is easier to use it in some ocasions.
7633 * src/lyxfunc.C: changed all places where insertInset was used so
7634 that now if it couldn't be inserted it is deleted!
7636 * src/TabularLayout.C:
7637 * src/TableLayout.C: added support for new tabular-inset!
7639 * src/BufferView2.C (insertInset): this now returns a bool if the
7640 inset was really inserted!!!
7642 * src/tabular.C (GetLastCellInRow):
7643 (GetFirstCellInRow): new helper functions.
7644 (Latex): implemented for new tabular class.
7648 (TeXTopHLine): new Latex() helper functions.
7650 2000-05-12 Juergen Vigna <jug@sad.it>
7652 * src/mathed/formulamacro.C (Read):
7653 * src/mathed/formula.C (Read): read also the \end_inset here!
7655 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7657 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7658 crush when saving formulae with unbalanced parenthesis.
7660 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7662 * src/layout.C: Add new keyword "endlabelstring" to layout file
7664 * src/text.C (GetVisibleRow): Draw endlabel string.
7666 * lib/layouts/broadway.layout
7667 * lib/layouts/hollywood.layout: Added endlabel for the
7668 Parenthetical layout.
7670 * lib/layouts/heb-article.layout: Do not use slanted font shape
7671 for Theorem like environments.
7673 * src/buffer.C (makeLaTeXFile): Always add "american" to
7674 the UsedLanguages list if document language is RTL.
7676 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7678 * add addendum to README.OS2 and small patch (from SMiyata)
7680 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7682 * many files: correct the calls to ChangeExtension().
7684 * src/support/filetools.C (ChangeExtension): remove the no_path
7685 argument, which does not belong there. Use OnlyFileName() instead.
7687 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7688 files when LaTeXing a non-nice latex file.
7690 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7691 a chain of "if". Return false when deadkeys are not handled.
7693 * src/lyx_main.C (LyX): adapted the code for default bindings.
7695 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7696 bindings for basic functionality (except deadkeys).
7697 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7699 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7700 several methods: handle override_x_deadkeys.
7702 * src/lyxrc.h: remove the "bindings" map, which did not make much
7703 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7705 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7707 * src/lyxfont.C (stateText): use a saner method to determine
7708 whether the font is "default". Seems to fix the crash with DEC
7711 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7713 2000-05-08 Juergen Vigna <jug@sad.it>
7715 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7716 TabularLayoutMenu with mouse-button-3
7717 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7719 * src/TabularLayout.C: added this file for having a Layout for
7722 2000-05-05 Juergen Vigna <jug@sad.it>
7724 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7725 recalculating inset-widths.
7726 (TabularFeatures): activated this function so that I can change
7727 tabular-features via menu.
7729 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7730 that I can test some functions with the Table menu.
7732 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7734 * src/lyxfont.C (stateText): guard against stupid c++libs.
7736 * src/tabular.C: add using std::vector
7737 some whitespace changes, + removed som autogenerated code.
7739 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7741 2000-05-05 Juergen Vigna <jug@sad.it>
7743 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7744 row, columns and cellstructures.
7746 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7748 * lib/lyxrc.example: remove obsolete entries.
7750 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7751 reading of protected_separator for free_spacing.
7753 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7755 * src/text.C (draw): do not display an exclamation mark in the
7756 margin for margin notes. This is confusing, ugly and
7759 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7760 AMS math' is checked.
7762 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7763 name to see whether including the amsmath package is needed.
7765 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7767 * src/paragraph.C (validate): Compute UsedLanguages correctly
7768 (don't insert the american language if it doesn't appear in the
7771 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7772 The argument of \thanks{} command is considered moving argument
7774 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7777 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7779 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7780 for appendix/minipage/depth. The lines can be now both in the footnote
7781 frame, and outside the frame.
7783 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7786 2000-05-05 Juergen Vigna <jug@sad.it>
7788 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7789 neede only in tabular.[Ch].
7791 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7793 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7795 (Write): write '~' for PROTECTED_SEPARATOR
7797 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7799 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7802 * src/mathed/formula.C (drawStr): rename size to siz.
7804 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7805 possibly fix a bug by not changing the pflags = flags to piflags =
7808 2000-05-05 Juergen Vigna <jug@sad.it>
7810 * src/insets/insetbib.C: moved using directive
7812 * src/ImportNoweb.C: small fix for being able to compile (missing
7815 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7817 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7818 to use clear, since we don't depend on this in the code. Add test
7821 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7823 * (various *.C files): add using std::foo directives to please dec
7826 * replace calls to string::clear() to string::erase() (Angus)
7828 * src/cheaders/cmath: modified to provide std::abs.
7830 2000-05-04 Juergen Vigna <jug@sad.it>
7832 * src/insets/insettext.C: Prepared all for inserting of multiple
7833 paragraphs. Still display stuff to do (alignment and other things),
7834 but I would like to use LyXText to do this when we cleaned out the
7835 table-support stuff.
7837 * src/insets/insettabular.C: Changed lot of stuff and added lots
7838 of functionality still a lot to do.
7840 * src/tabular.C: Various functions changed name and moved to be
7841 const functions. Added new Read and Write functions and changed
7842 lots of things so it works good with tabular-insets (also removed
7843 some stuff which is not needed anymore * hacks *).
7845 * src/lyxcursor.h: added operators == and != which just look if
7846 par and pos are (not) equal.
7848 * src/buffer.C (latexParagraphs): inserted this function to latex
7849 all paragraphs form par to endpar as then I can use this too for
7852 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7853 so that I can call this to from text insets with their own cursor.
7855 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7856 output off all paragraphs (because of the fix below)!
7858 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7859 the very last paragraph (this could be also the last paragraph of an
7862 * src/texrow.h: added rows() call which returns the count-variable.
7864 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7866 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7868 * lib/configure.m4: better autodetection of DocBook tools.
7870 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7872 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7874 * src/lyx_cb.C: add using std::reverse;
7876 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7879 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7880 selected files. Should fix repeated errors from generated files.
7882 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7884 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7886 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7887 the spellchecker popup.
7889 * lib/lyxrc.example: Removed the \number_inset section
7891 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7893 * src/insets/figinset.C (various): Use IsFileReadable() to make
7894 sure that the file actually exist. Relying on ghostscripts errors
7895 is a bad idea since they can lead to X server crashes.
7897 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7899 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7902 * lib/lyxrc.example: smallish typo in description of
7903 \view_dvi_paper_option
7905 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7908 * src/lyxfunc.C: doImportHelper to factor out common code of the
7909 various import methods. New functions doImportASCIIasLines,
7910 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7911 doImportLinuxDoc for the format specific parts.
7914 * buffer.C: Dispatch returns now a bool to indicate success
7917 * lyx_gui.C: Add getLyXView() for member access
7919 * lyx_main.C: Change logic for batch commands: First try
7920 Buffer::Dispatch (possibly without GUI), if that fails, use
7923 * lyx_main.C: Add support for --import command line switch.
7924 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7925 Available Formats: Everything accepted by 'buffer-import <format>'
7927 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7929 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7932 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7933 documents will be reformatted upon reentry.
7935 2000-04-27 Juergen Vigna <jug@sad.it>
7937 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7938 correctly only last pos this was a bug.
7940 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7942 * release of lyx-1.1.5pre1
7944 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7946 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7948 * src/menus.C: revert the change of naming (Figure->Graphic...)
7949 from 2000-04-11. It was incomplete and bad.
7951 * src/LColor.[Ch]: add LColor::depthbar.
7952 * src/text.C (GetVisibleRow): use it.
7954 * README: update the languages list.
7956 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7958 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7961 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7963 * README: remove sections that were just wrong.
7965 * src/text2.C (GetRowNearY): remove currentrow code
7967 * src/text.C (GetRow): remove currentrow code
7969 * src/screen.C (Update): rewritten a bit.
7970 (SmallUpdate): removed func
7972 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7974 (FullRebreak): return bool
7975 (currentrow): remove var
7976 (currentrow_y): ditto
7978 * src/lyxscreen.h (Draw): change arg to unsigned long
7979 (FitCursor): return bool
7980 (FitManualCursor): ditto
7981 (Smallpdate): remove func
7982 (first): change to unsigned long
7983 (DrawOneRow): change second arg to long (from long &)
7984 (screen_refresh_y): remove var
7985 (scree_refresh_row): ditto
7987 * src/lyxrow.h: change baseline to usigned int from unsigned
7988 short, this brings some implicit/unsigned issues out in the open.
7990 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7992 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7993 instead of smallUpdate.
7995 * src/lyxcursor.h: change y to unsigned long
7997 * src/buffer.h: don't call updateScrollbar after fitcursor
7999 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8000 where they are used. Removed "\\direction", this was not present
8001 in 1.1.4 and is already obsolete. Commented out some code that I
8002 believe to never be called.
8003 (runLiterate): don't call updateScrollbar after fitCursor
8005 (buildProgram): ditto
8008 * src/WorkArea.h (workWidth): change return val to unsigned
8011 (redraw): remove the button redraws
8012 (setScrollbarValue): change for scrollbar
8013 (getScrollbarValue): change for scrollbar
8014 (getScrollbarBounds): change for scrollbar
8016 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8017 (C_WorkArea_down_cb): removed func
8018 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8019 (resize): change for scrollbar
8020 (setScrollbar): ditto
8021 (setScrollbarBounds): ditto
8022 (setScrollbarIncrements): ditto
8023 (up_cb): removed func
8024 (down_cb): removed func
8025 (scroll_cb): change for scrollbar
8026 (work_area_handler): ditto
8028 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8029 when FitCursor did something.
8030 (updateScrollbar): some unsigned changes
8031 (downCB): removed func
8032 (scrollUpOnePage): removed func
8033 (scrollDownOnePage): remvoed func
8034 (workAreaMotionNotify): don't call screen->FitCursor but use
8035 fitCursor instead. and bool return val
8036 (workAreaButtonPress): ditto
8037 (workAreaButtonRelease): some unsigned changes
8038 (checkInsetHit): ditto
8039 (workAreaExpose): ditto
8040 (update): parts rewritten, comments about the signed char arg added
8041 (smallUpdate): removed func
8042 (cursorPrevious): call needed updateScrollbar
8045 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8048 * src/BufferView.[Ch] (upCB): removed func
8049 (downCB): removed func
8050 (smallUpdate): removed func
8052 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8054 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8055 currentrow, currentrow_y optimization. This did not help a lot and
8056 if we want to do this kind of optimization we should rather use
8057 cursor.row instead of the currentrow.
8059 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8060 buffer spacing and klyx spacing support.
8062 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8064 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8067 2000-04-26 Juergen Vigna <jug@sad.it>
8069 * src/insets/figinset.C: fixes to Lars sstream changes!
8071 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8073 * A lot of files: Added Ascii(ostream &) methods to all inset
8074 classes. Used when exporting to ASCII.
8076 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8077 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8080 * src/text2.C (ToggleFree): Disabled implicit word selection when
8081 there is a change in the language
8083 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8084 no output was generated for end-of-sentence inset.
8086 * src/insets/lyxinset.h
8089 * src/paragraph.C: Removed the insetnumber code
8091 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8093 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8095 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8096 no_babel and no_epsfig completely from the file.
8097 (parseSingleLyXformat2Token): add handling for per-paragraph
8098 spacing as written by klyx.
8100 * src/insets/figinset.C: applied patch by Andre. Made it work with
8103 2000-04-20 Juergen Vigna <jug@sad.it>
8105 * src/insets/insettext.C (cutSelection):
8106 (copySelection): Fixed with selection from right to left.
8107 (draw): now the rows are not recalculated at every draw.
8108 (computeTextRows): for now reset the inset-owner here (this is
8109 important for an undo or copy where the inset-owner is not set
8112 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8113 motion to the_locking_inset screen->first was forgotten, this was
8114 not important till we got multiline insets.
8116 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8118 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8119 code seems to be alright (it is code changed by Dekel, and the
8120 intent is indeed that all macros should be defined \protect'ed)
8122 * NEWS: a bit of reorganisation of the new user-visible features.
8124 2000-04-19 Juergen Vigna <jug@sad.it>
8126 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8127 position. Set the inset_owner of the used paragraph so that it knows
8128 that it is inside an inset. Fixed cursor handling with mouse and
8129 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8130 and cleanups to make TextInsets work better.
8132 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8133 Changed parameters of various functions and added LockInsetInInset().
8135 * src/insets/insettext.C:
8137 * src/insets/insetcollapsable.h:
8138 * src/insets/insetcollapsable.C:
8139 * src/insets/insetfoot.h:
8140 * src/insets/insetfoot.C:
8141 * src/insets/insetert.h:
8142 * src/insets/insetert.C: cleaned up the code so that it works now
8143 correctly with insettext.
8145 * src/insets/inset.C:
8146 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8147 that insets in insets are supported right.
8150 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8152 * src/paragraph.C: some small fixes
8154 * src/debug.h: inserted INSETS debug info
8156 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8157 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8159 * src/commandtags.h:
8160 * src/LyXAction.C: insert code for InsetTabular.
8162 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8163 not Button1MotionMask.
8164 (workAreaButtonRelease): send always a InsetButtonRelease event to
8166 (checkInsetHit): some setCursor fixes (always with insets).
8168 * src/BufferView2.C (lockInset): returns a bool now and extended for
8169 locking insets inside insets.
8170 (showLockedInsetCursor): it is important to have the cursor always
8171 before the locked inset.
8172 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8174 * src/BufferView.h: made lockInset return a bool.
8176 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8178 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8179 that is used also internally but can be called as public to have back
8180 a cursor pos which is not set internally.
8181 (SetCursorIntern): Changed to use above function.
8183 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8185 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8190 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8191 patches for things that should be in or should be changed.
8193 * src/* [insetfiles]: change "usigned char fragile" to bool
8194 fragile. There was only one point that could that be questioned
8195 and that is commented in formulamacro.C. Grep for "CHECK".
8197 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8198 (DeleteBuffer): take it out of CutAndPaste and make it static.
8200 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8202 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8203 output the spacing envir commands. Also the new commands used in
8204 the LaTeX output makes the result better.
8206 * src/Spacing.C (writeEnvirBegin): new method
8207 (writeEnvirEnd): new method
8209 2000-04-18 Juergen Vigna <jug@sad.it>
8211 * src/CutAndPaste.C: made textclass a static member of the class
8212 as otherwise it is not accesed right!!!
8214 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8216 * forms/layout_forms.fd
8217 * src/layout_forms.h
8218 * src/layout_forms.C (create_form_form_character)
8219 * src/lyx_cb.C (UserFreeFont)
8220 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8221 documents (in the layout->character popup).
8223 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8225 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8226 \spell_command was in fact not honored (from Kevin Atkinson).
8228 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8231 * src/lyx_gui.h: make lyxViews private (Angus)
8233 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8235 * src/mathed/math_write.C
8236 (MathMatrixInset::Write) Put \protect before \begin{array} and
8237 \end{array} if fragile
8238 (MathParInset::Write): Put \protect before \\ if fragile
8240 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8242 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8243 initialization if the LyXColorHandler must be done after the
8244 connections to the XServer has been established.
8246 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8247 get the background pixel from the lyxColorhandler so that the
8248 figures are rendered with the correct background color.
8249 (NextToken): removed functions.
8250 (GetPSSizes): use ifs >> string instead of NextToken.
8252 * src/Painter.[Ch]: the color cache moved out of this file.
8254 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8257 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8259 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8260 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8262 * src/BufferView.C (enterView): new func
8263 (leaveView): new func
8265 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8267 (leaveView): new func, undefines xterm cursor when approp.
8269 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8270 (AllowInput): delete the Workarea cursor handling from this func.
8272 * src/Painter.C (underline): draw a slimer underline in most cases.
8274 * src/lyx_main.C (error_handler): use extern "C"
8276 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8278 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8279 sent directly to me.
8281 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8282 to the list by Dekel.
8284 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8287 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8288 methods from lyx_cb.here.
8290 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8293 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8295 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8296 instead of using current_view directly.
8298 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8300 * src/LyXAction.C (init): add the paragraph-spacing command.
8302 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8304 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8306 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8307 different from the documents.
8309 * src/text.C (SetHeightOfRow): take paragraph spacing into
8310 account, paragraph spacing takes precedence over buffer spacing
8311 (GetVisibleRow): ditto
8313 * src/paragraph.C (writeFile): output the spacing parameter too.
8314 (validate): set the correct features if spacing is used in the
8316 (Clear): set spacing to default
8317 (MakeSameLayout): spacing too
8318 (HasSameLayout): spacing too
8319 (SetLayout): spacing too
8320 (TeXOnePar): output the spacing commands
8322 * src/lyxparagraph.h: added a spacing variable for use with
8323 per-paragraph spacing.
8325 * src/Spacing.h: add a Default spacing and a method to check if
8326 the current spacing is default. also added an operator==
8328 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8331 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8333 * src/lyxserver.C (callback): fix dispatch of functions
8335 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8336 printf() into lyxerr call.
8338 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8341 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8342 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8343 the "Float" from each of the subitems.
8344 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8346 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8347 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8348 documented the change so that the workaround can be nuked later.
8350 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8353 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8355 * src/buffer.C (getLatexName): ditto
8356 (setReadonly): ditto
8358 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8360 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8361 avoid some uses of current_view. Added also a bufferParams()
8362 method to get at this.
8364 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8366 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8368 * src/lyxparagraph.[Ch]: removed
8369 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8370 with operators used by lower_bound and
8371 upper_bound in InsetTable's
8372 Make struct InsetTable private again. Used matchpos.
8374 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8376 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8377 document, the language of existing text is changed (unless the
8378 document is multi-lingual)
8380 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8382 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8384 * A lot of files: A rewrite of the Right-to-Left support.
8386 2000-04-10 Juergen Vigna <jug@sad.it>
8388 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8389 misplaced cursor when inset in inset is locked.
8391 * src/insets/insettext.C (LocalDispatch): small fix so that a
8392 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8394 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8395 footnote font should be decreased in size twice when displaying.
8397 * src/insets/insettext.C (GetDrawFont): inserted this function as
8398 the drawing-font may differ from the real paragraph font.
8400 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8401 insets (inset in inset!).
8403 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8404 function here because we don't want footnotes inside footnotes.
8406 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8408 (init): now set the inset_owner in paragraph.C
8409 (LocalDispatch): added some resetPos() in the right position
8412 (pasteSelection): changed to use the new CutAndPaste-Class.
8414 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8415 which tells if it is allowed to insert another inset inside this one.
8417 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8418 SwitchLayoutsBetweenClasses.
8420 * src/text2.C (InsertInset): checking of the new paragraph-function
8422 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8423 is not needed anymore here!
8426 (PasteSelection): redone (also with #ifdef) so that now this uses
8427 the CutAndPaste-Class.
8428 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8431 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8432 from/to text/insets.
8434 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8435 so that the paragraph knows if it is inside an (text)-inset.
8436 (InsertFromMinibuffer): changed return-value to bool as now it
8437 may happen that an inset is not inserted in the paragraph.
8438 (InsertInsetAllowed): this checks if it is allowed to insert an
8439 inset in this paragraph.
8441 (BreakParagraphConservative):
8442 (BreakParagraph) : small change for the above change of the return
8443 value of InsertFromMinibuffer.
8445 * src/lyxparagraph.h: added inset_owner and the functions to handle
8446 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8448 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8450 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8451 functions from BufferView to BufferView::Pimpl to ease maintence.
8453 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8454 correctly. Also use SetCursorIntern instead of SetCursor.
8456 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8459 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8461 * src/WorkArea.C (belowMouse): manually implement below mouse.
8463 * src/*: Add "explicit" on several constructors, I added probably
8464 some unneeded ones. A couple of changes to code because of this.
8466 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8467 implementation and private parts from the users of BufferView. Not
8470 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8471 implementation and private parts from the users of LyXLex. Not
8474 * src/BufferView_pimpl.[Ch]: new files
8476 * src/lyxlex_pimpl.[Ch]: new files
8478 * src/LyXView.[Ch]: some inline functions move out-of-line
8480 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8482 * src/lyxparagraph.h: make struct InsetTable public.
8484 * src/support/lyxstring.h: change lyxstring::difference_type to be
8485 ptrdiff_t. Add std:: modifiers to streams.
8487 * src/font.C: include the <cctype> header, for islower() and
8490 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8492 * src/font.[Ch]: new files. Contains the metric functions for
8493 fonts, takes a LyXFont as parameter. Better separation of concepts.
8495 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8496 changes because of this.
8498 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8500 * src/*: compile with -Winline and move functions that don't
8503 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8506 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8508 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8509 (various files changed because of this)
8511 * src/Painter.C (text): fixed the drawing of smallcaps.
8513 * src/lyxfont.[Ch] (drawText): removed unused member func.
8516 * src/*.C: added needed "using" statements and "std::" qualifiers.
8518 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8520 * src/*.h: removed all use of "using" from header files use
8521 qualifier std:: instead.
8523 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8525 * src/text.C (Backspace): some additional cleanups (we already
8526 know whether cursor.pos is 0 or not).
8528 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8529 automake does not provide one).
8531 * src/bmtable.h: replace C++ comments with C comments.
8533 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8535 * src/screen.C (ShowCursor): Change the shape of the cursor if
8536 the current language is not equal to the language of the document.
8537 (If the cursor change its shape unexpectedly, then you've found a bug)
8539 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8542 * src/insets/insetnumber.[Ch]: New files.
8544 * src/LyXAction.C (init)
8545 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8548 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8550 * src/lyxparagraph.h
8551 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8552 (the vector is kept sorted).
8554 * src/text.C (GetVisibleRow): Draw selection correctly when there
8555 is both LTR and RTL text.
8557 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8558 which is much faster.
8560 * src/text.C (GetVisibleRow and other): Do not draw the last space
8561 in a row if the direction of the last letter is not equal to the
8562 direction of the paragraph.
8564 * src/lyxfont.C (latexWriteStartChanges):
8565 Check that font language is not equal to basefont language.
8566 (latexWriteEndChanges): ditto
8568 * src/lyx_cb.C (StyleReset): Don't change the language while using
8569 the font-default command.
8571 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8572 empty paragraph before a footnote.
8574 * src/insets/insetcommand.C (draw): Increase x correctly.
8576 * src/screen.C (ShowCursor): Change cursor shape if
8577 current language != document language.
8579 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8581 2000-03-31 Juergen Vigna <jug@sad.it>
8583 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8584 (Clone): changed mode how the paragraph-data is copied to the
8585 new clone-paragraph.
8587 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8588 GetInset(pos) with no inset anymore there (in inset UNDO)
8590 * src/insets/insetcommand.C (draw): small fix as here x is
8591 incremented not as much as width() returns (2 before, 2 behind = 4)
8593 2000-03-30 Juergen Vigna <jug@sad.it>
8595 * src/insets/insettext.C (InsetText): small fix in initialize
8596 widthOffset (should not be done in the init() function)
8598 2000-03-29 Amir Karger <karger@lyx.org>
8600 * lib/examples/it_ItemizeBullets.lyx: translation by
8603 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8605 2000-03-29 Juergen Vigna <jug@sad.it>
8607 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8609 * src/insets/insetfoot.C (Clone): small change as for the below
8610 new init function in the text-inset
8612 * src/insets/insettext.C (init): new function as I've seen that
8613 clone did not copy the Paragraph-Data!
8614 (LocalDispatch): Added code so that now we have some sort of Undo
8615 functionality (well actually we HAVE Undo ;)
8617 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8619 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8621 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8624 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8626 * src/main.C: added a runtime check that verifies that the xforms
8627 header used when building LyX and the library used when running
8628 LyX match. Exit with a message if they don't match. This is a
8629 version number check only.
8631 * src/buffer.C (save): Don't allocate memory on the heap for
8632 struct utimbuf times.
8634 * *: some using changes, use iosfwd instead of the real headers.
8636 * src/lyxfont.C use char const * instead of string for the static
8637 strings. Rewrite some functions to use sstream.
8639 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8641 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8644 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8646 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8647 of Geodesy (from Martin Vermeer)
8649 * lib/layouts/svjour.inc: include file for the Springer svjour
8650 class. It can be used to support journals other than JoG.
8652 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8653 Miskiewicz <misiek@pld.org.pl>)
8654 * lib/reLyX/Makefile.am: ditto.
8656 2000-03-27 Juergen Vigna <jug@sad.it>
8658 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8659 also some modifications with operations on selected text.
8661 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8662 problems with clicking on insets (last famous words ;)
8664 * src/insets/insetcommand.C (draw):
8665 (width): Changed to have a bit of space before and after the inset so
8666 that the blinking cursor can be seen (otherwise it was hidden)
8668 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8670 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8671 would not be added to the link list when an installed gettext (not
8672 part of libc) is found.
8674 2000-03-24 Juergen Vigna <jug@sad.it>
8676 * src/insets/insetcollapsable.C (Edit):
8677 * src/mathed/formula.C (InsetButtonRelease):
8678 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8681 * src/BufferView.C (workAreaButtonPress):
8682 (workAreaButtonRelease):
8683 (checkInsetHit): Finally fixed the clicking on insets be handled
8686 * src/insets/insetert.C (Edit): inserted this call so that ERT
8687 insets work always with LaTeX-font
8689 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8691 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8692 caused lyx to startup with no GUI in place, causing in a crash
8693 upon startup when called with arguments.
8695 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8697 * src/FontLoader.C: better initialization of dummyXFontStruct.
8699 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8701 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8702 for linuxdoc and docbook import and export format options.
8704 * lib/lyxrc.example Example of default values for the previous flags.
8706 * src/lyx_cb.C Use those flags instead of the hardwired values for
8707 linuxdoc and docbook export.
8709 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8712 * src/menus.C Added menus entries for the new import/exports formats.
8714 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8716 * src/lyxrc.*: Added support for running without Gui
8719 * src/FontLoader.C: sensible defaults if no fonts are needed
8721 * src/lyx_cb.C: New function ShowMessage (writes either to the
8722 minibuffer or cout in case of no gui
8723 New function AskOverwrite for common stuff
8724 Consequently various changes to call these functions
8726 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8727 wild guess at sensible screen resolution when having no gui
8729 * src/lyxfont.C: no gui, no fonts... set some defaults
8731 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8733 * src/LColor.C: made the command inset background a bit lighter.
8735 2000-03-20 Hartmut Goebel <goebel@noris.net>
8737 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8738 stdstruct.inc. Koma-Script added some title elements which
8739 otherwise have been listed below "bibliography". This split allows
8740 adding title elements to where they belong.
8742 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8743 define the additional title elements and then include
8746 * many other layout files: changed to include stdtitle.inc just
8747 before stdstruct.inc.
8749 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8751 * src/buffer.C: (save) Added the option to store all backup files
8752 in a single directory
8754 * src/lyxrc.[Ch]: Added variable \backupdir_path
8756 * lib/lyxrc.example: Added descriptions of recently added variables
8758 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8759 bibtex inset, not closing the bibtex popup when deleting the inset)
8761 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8763 * src/lyx_cb.C: add a couple using directives.
8765 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8766 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8767 import based on the filename.
8769 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8770 file would be imported at start, if the filename where of a sgml file.
8772 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8774 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8776 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8777 * src/lyxfont.h Replaced the member variable bits.direction by the
8778 member variable lang. Made many changes in other files.
8779 This allows having a multi-lingual document
8781 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8782 that change the current language to <l>.
8783 Removed the command "font-rtl"
8785 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8786 format for Hebrew documents)
8788 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8789 When auto_mathmode is "true", pressing a digit key in normal mode
8790 will cause entering into mathmode.
8791 If auto_mathmode is "rtl" then this behavior will be active only
8792 when writing right-to-left text.
8794 * src/text2.C (InsertStringA) The string is inserted using the
8797 * src/paragraph.C (GetEndLabel) Gives a correct result for
8798 footnote paragraphs.
8800 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8802 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8804 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8805 front of PasteParagraph. Never insert a ' '. This should at least
8806 fix some cause for the segfaults that we have been experiencing,
8807 it also fixes backspace behaviour slightly. (Phu!)
8809 * src/support/lstrings.C (compare_no_case): some change to make it
8810 compile with gcc 2.95.2 and stdlibc++-v3
8812 * src/text2.C (MeltFootnoteEnvironment): change type o
8813 first_footnote_par_is_not_empty to bool.
8815 * src/lyxparagraph.h: make text private. Changes in other files
8817 (fitToSize): new function
8818 (setContentsFromPar): new function
8819 (clearContents): new function
8820 (SetChar): new function
8822 * src/paragraph.C (readSimpleWholeFile): deleted.
8824 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8825 the file, just use a simple string instead. Also read the file in
8826 a more maintainable manner.
8828 * src/text2.C (InsertStringA): deleted.
8829 (InsertStringB): deleted.
8831 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8833 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8834 RedoParagraphs from the doublespace handling part, just set status
8835 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8836 done, but perhaps not like this.)
8838 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8840 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8841 character when inserting an inset.
8843 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8845 * src/bufferparams.C (readLanguage): now takes "default" into
8848 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8849 also initialize the toplevel_keymap with the default bindings from
8852 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8854 * all files using lyxrc: have lyxrc as a real variable and not a
8855 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8858 * src/lyxrc.C: remove double call to defaultKeyBindings
8860 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8861 toolbar defauls using lyxlex. Remove enums, structs, functions
8864 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8865 toolbar defaults. Also store default keybindings in a map.
8867 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8868 storing the toolbar defaults without any xforms dependencies.
8870 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8871 applied. Changed to use iterators.
8873 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8875 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8876 systems that don't have LINGUAS set to begin with.
8878 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8880 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8881 the list by Dekel Tsur.
8883 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8885 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8886 * src/insets/form_graphics.C: ditto.
8888 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8890 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8892 * src/bufferparams.C (readLanguage): use the new language map
8894 * src/intl.C (InitKeyMapper): use the new language map
8896 * src/lyx_gui.C (create_forms): use the new language map
8898 * src/language.[Ch]: New files. Used for holding the information
8899 about each language. Now! Use this new language map enhance it and
8900 make it really usable for our needs.
8902 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8904 * screen.C (ShowCursor): Removed duplicate code.
8905 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8906 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8908 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8911 * src/text.C Added TransformChar method. Used for rendering Arabic
8912 text correctly (change the glyphs of the letter according to the
8913 position in the word)
8918 * src/lyxrc.C Added lyxrc command {language_command_begin,
8919 language_command_end,language_command_ltr,language_command_rtl,
8920 language_package} which allows the use of either arabtex or Omega
8923 * src/lyx_gui.C (init)
8925 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8926 to use encoding for menu fonts which is different than the encoding
8929 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8930 do not load the babel package.
8931 To write an English document with Hebrew/Arabic, change the document
8932 language to "english".
8934 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8935 (alphaCounter): changed to return char
8936 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8938 * lib/lyxrc.example Added examples for Hebrew/Arabic
8941 * src/layout.C Added layout command endlabeltype
8943 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8945 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8947 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8949 * src/mathed/math_delim.C (search_deco): return a
8950 math_deco_struct* instead of index.
8952 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8954 * All files with a USE_OSTREAM_ONLY within: removed all code that
8955 was unused when USE_OSTREAM_ONLY is defined.
8957 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8958 of any less. Removed header and using.
8960 * src/text.C (GetVisibleRow): draw the string "Page Break
8961 (top/bottom)" on screen when drawing a pagebreak line.
8963 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8965 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8967 * src/mathed/math_macro.C (draw): do some cast magic.
8970 * src/mathed/math_defs.h: change byte* argument to byte const*.
8972 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8974 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8975 know it is right to return InsetFoot* too, but cxx does not like
8978 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8980 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8982 * src/mathed/math_delim.C: change == to proper assignment.
8984 2000-03-09 Juergen Vigna <jug@sad.it>
8986 * src/insets/insettext.C (setPos): fixed various cursor positioning
8987 problems (via mouse and cursor-keys)
8988 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8989 inset (still a small display problem but it works ;)
8991 * src/insets/insetcollapsable.C (draw): added button_top_y and
8992 button_bottom_y to have correct values for clicking on the inset.
8994 * src/support/lyxalgo.h: commented out 'using std::less'
8996 2000-03-08 Juergen Vigna <jug@sad.it>
8998 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8999 Button-Release event closes as it is alos the Release-Event
9002 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9004 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9006 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9007 can add multiple spaces in Scrap (literate programming) styles...
9008 which, by the way, is how I got hooked on LyX to begin with.
9010 * src/mathed/formula.C (Write): Added dummy variable to an
9011 inset::Latex() call.
9012 (Latex): Add free_spacing boolean to inset::Latex()
9014 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9016 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9017 virtual function to include the free_spacing boolean from
9018 the containing paragraph's style.
9020 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9021 Added free_spacing boolean arg to match inset.h
9023 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9024 Added free_spacing boolean arg to match inset.h
9026 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9027 Added free_spacing boolean and made sure that if in a free_spacing
9028 paragraph, that we output normal space if there is a protected space.
9030 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9031 Added free_spacing boolean arg to match inset.h
9033 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9034 Added free_spacing boolean arg to match inset.h
9036 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9037 Added free_spacing boolean arg to match inset.h
9039 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9040 Added free_spacing boolean arg to match inset.h
9042 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9043 Added free_spacing boolean arg to match inset.h
9045 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9046 free_spacing boolean arg to match inset.h
9048 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9049 Added free_spacing boolean arg to match inset.h
9051 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9052 Added free_spacing boolean arg to match inset.h
9054 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9055 Added free_spacing boolean arg to match inset.h
9057 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9058 Added free_spacing boolean arg to match inset.h
9060 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9061 Added free_spacing boolean arg to match inset.h
9063 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9064 free_spacing boolean arg to match inset.h
9066 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9067 free_spacing boolean arg to match inset.h
9069 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9070 ignore free_spacing paragraphs. The user's spaces are left
9073 * src/text.C (InsertChar): Fixed the free_spacing layout
9074 attribute behavior. Now, if free_spacing is set, you can
9075 add multiple spaces in a paragraph with impunity (and they
9076 get output verbatim).
9077 (SelectSelectedWord): Added dummy argument to inset::Latex()
9080 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9083 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9084 paragraph layouts now only input a simple space instead.
9085 Special character insets don't make any sense in free-spacing
9088 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9089 hard-spaces in the *input* file to simple spaces if the layout
9090 is free-spacing. This converts old files which had to have
9091 hard-spaces in free-spacing layouts where a simple space was
9093 (writeFileAscii): Added free_spacing check to pass to the newly
9094 reworked inset::Latex(...) methods. The inset::Latex() code
9095 ensures that hard-spaces in free-spacing paragraphs get output
9096 as spaces (rather than "~").
9098 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9100 * src/mathed/math_delim.C (draw): draw the empty placeholder
9101 delims with a onoffdash line.
9102 (struct math_deco_compare): struct that holds the "functors" used
9103 for the sort and the binary search in math_deco_table.
9104 (class init_deco_table): class used for initial sort of the
9106 (search_deco): use lower_bound to do a binary search in the
9109 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9111 * src/lyxrc.C: a small secret thingie...
9113 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9114 and to not flush the stream as often as it used to.
9116 * src/support/lyxalgo.h: new file
9117 (sorted): template function used for checking if a sequence is
9118 sorted or not. Two versions with and without user supplied
9119 compare. Uses same compare as std::sort.
9121 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9122 it and give warning on lyxerr.
9124 (struct compare_tags): struct with function operators used for
9125 checking if sorted, sorting and lower_bound.
9126 (search_kw): use lower_bound instead of manually implemented
9129 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9131 * src/insets/insetcollapsable.h: fix Clone() declaration.
9132 * src/insets/insetfoot.h: ditto.
9134 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9136 2000-03-08 Juergen Vigna <jug@sad.it>
9138 * src/insets/lyxinset.h: added owner call which tells us if
9139 this inset is inside another inset. Changed also the return-type
9140 of Editable to an enum so it tells clearer what the return-value is.
9142 * src/insets/insettext.C (computeTextRows): fixed computing of
9143 textinsets which split automatically on more rows.
9145 * src/insets/insetert.[Ch]: changed this to be of BaseType
9148 * src/insets/insetfoot.[Ch]: added footnote inset
9150 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9151 collapsable insets (like footnote, ert, ...)
9153 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9155 * src/lyxdraw.h: remvoe file
9157 * src/lyxdraw.C: remove file
9159 * src/insets/insettext.C: added <algorithm>.
9161 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9163 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9164 (matrix_cb): case MM_OK use string stream
9166 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9169 * src/mathed/math_macro.C (draw): use string stream
9170 (Metrics): use string stream
9172 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9173 directly to the ostream.
9175 * src/vspace.C (asString): use string stream.
9176 (asString): use string stream
9177 (asLatexString): use string stream
9179 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9180 setting Spacing::Other.
9182 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9183 sprintf when creating the stretch vale.
9185 * src/text2.C (alphaCounter): changed to return a string and to
9186 not use a static variable internally. Also fixed a one-off bug.
9187 (SetCounter): changed the drawing of the labels to use string
9188 streams instead of sprintf.
9190 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9191 manipulator to use a scheme that does not require library support.
9192 This is also the way it is done in the new GNU libstdc++. Should
9193 work with DEC cxx now.
9195 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9197 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9198 end. This fixes a bug.
9200 * src/mathed (all files concerned with file writing): apply the
9201 USE_OSTREAM_ONLY changes to mathed too.
9203 * src/support/DebugStream.h: make the constructor explicit.
9205 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9206 count and ostream squashed.
9208 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9210 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9212 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9213 ostringstream uses STL strings, and we might not.
9215 * src/insets/insetspecialchar.C: add using directive.
9216 * src/insets/insettext.C: ditto.
9218 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9220 * lib/layouts/seminar.layout: feeble attempt at a layout for
9221 seminar.cls, far from completet and could really use some looking
9222 at from people used to write layout files.
9224 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9225 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9226 a lot nicer and works nicely with ostreams.
9228 * src/mathed/formula.C (draw): a slightly different solution that
9229 the one posted to the list, but I think this one works too. (font
9230 size wrong in headers.)
9232 * src/insets/insettext.C (computeTextRows): some fiddling on
9233 Jürgens turf, added some comments that he should read.
9235 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9236 used and it gave compiler warnings.
9237 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9240 * src/lyx_gui.C (create_forms): do the right thing when
9241 show_banner is true/false.
9243 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9244 show_banner is false.
9246 * most file writing files: Now use iostreams to do almost all of
9247 the writing. Also instead of passing string &, we now use
9248 stringstreams. mathed output is still not adapted to iostreams.
9249 This change can be turned off by commenting out all the occurences
9250 of the "#define USE_OSTREAM_ONLY 1" lines.
9252 * src/WorkArea.C (createPixmap): don't output debug messages.
9253 (WorkArea): don't output debug messages.
9255 * lib/lyxrc.example: added a comment about the new variable
9258 * development/Code_rules/Rules: Added some more commente about how
9259 to build class interfaces and on how better encapsulation can be
9262 2000-03-03 Juergen Vigna <jug@sad.it>
9264 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9265 automatically with the width of the LyX-Window
9267 * src/insets/insettext.C (computeTextRows): fixed update bug in
9268 displaying text-insets (scrollvalues where not initialized!)
9270 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9272 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9273 id in the check of the result from lower_bound is not enough since
9274 lower_bound can return last too, and then res->id will not be a
9277 * all insets and some code that use them: I have conditionalized
9278 removed the Latex(string & out, ...) this means that only the
9279 Latex(ostream &, ...) will be used. This is a work in progress to
9280 move towards using streams for all output of files.
9282 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9285 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9287 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9288 routine (this fixes bug where greek letters were surrounded by too
9291 * src/support/filetools.C (findtexfile): change a bit the search
9292 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9293 no longer passed to kpsewhich, we may have to change that later.
9295 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9296 warning options to avoid problems with X header files (from Angus
9298 * acinclude.m4: regenerated.
9300 2000-03-02 Juergen Vigna <jug@sad.it>
9302 * src/insets/insettext.C (WriteParagraphData): Using the
9303 par->writeFile() function for writing paragraph-data.
9304 (Read): Using buffer->parseSingleLyXformat2Token()-function
9305 for parsing paragraph data!
9307 * src/buffer.C (readLyXformat2): removed all parse data and using
9308 the new parseSingleLyXformat2Token()-function.
9309 (parseSingleLyXformat2Token): added this function to parse (read)
9310 lyx-file-format (this is called also from text-insets now!)
9312 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9314 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9317 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9318 directly instead of going through a func. One very bad thing: a
9319 static LyXFindReplace, but I don't know where to place it.
9321 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9322 string instead of char[]. Also changed to static.
9323 (GetSelectionOrWordAtCursor): changed to static inline
9324 (SetSelectionOverLenChars): ditto.
9326 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9327 current_view and global variables. both classes has changed names
9328 and LyXFindReplace is not inherited from SearchForm.
9330 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9331 fl_form_search form.
9333 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9335 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9337 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9338 bound (from Kayvan).
9340 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9342 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9344 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9346 * some things that I should comment but the local pub says head to
9349 * comment out all code that belongs to the Roff code for Ascii
9350 export of tables. (this is unused)
9352 * src/LyXView.C: use correct type for global variable
9353 current_layout. (LyXTextClass::size_type)
9355 * some code to get the new insetgraphics closer to working I'd be
9356 grateful for any help.
9358 * src/BufferView2.C (insertInset): use the return type of
9359 NumberOfLayout properly. (also changes in other files)
9361 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9362 this as a test. I want to know what breaks because of this.
9364 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9366 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9368 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9369 to use a \makebox in the label, this allows proper justification
9370 with out using protected spaces or multiple hfills. Now it is
9371 "label" for left justified, "\hfill label\hfill" for center, and
9372 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9373 should be changed accordingly.
9375 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9377 * src/lyxtext.h: change SetLayout() to take a
9378 LyXTextClass::size_type instead of a char (when there is more than
9379 127 layouts in a class); also change type of copylayouttype.
9380 * src/text2.C (SetLayout): ditto.
9381 * src/LyXView.C (updateLayoutChoice): ditto.
9383 * src/LaTeX.C (scanLogFile): errors where the line number was not
9384 given just after the '!'-line were ignored (from Dekel Tsur).
9386 * lib/lyxrc.example: fix description of \date_insert_format
9388 * lib/layouts/llncs.layout: new layout, contributed by Martin
9391 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9393 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9394 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9395 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9396 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9397 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9398 paragraph.C, text.C, text2.C)
9400 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9402 * src/insets/insettext.C (LocalDispatch): remove extra break
9405 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9406 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9408 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9409 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9411 * src/insets/insetbib.h: move InsetBibkey::Holder and
9412 InsetCitation::Holder in public space.
9414 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9416 * src/insets/insettext.h: small change to get the new files from
9417 Juergen to compile (use "string", not "class string").
9419 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9420 const & as parameter to LocalDispatch, use LyXFont const & as
9421 paramter to some other func. This also had impacto on lyxinsets.h
9422 and the two mathed insets.
9424 2000-02-24 Juergen Vigna <jug@sad.it>
9427 * src/commandtags.h:
9429 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9433 * src/BufferView2.C: added/updated code for various inset-functions
9435 * src/insets/insetert.[Ch]: added implementation of InsetERT
9437 * src/insets/insettext.[Ch]: added implementation of InsetText
9439 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9440 (draw): added preliminary code for inset scrolling not finshed yet
9442 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9443 as it is in lyxfunc.C now
9445 * src/insets/lyxinset.h: Added functions for text-insets
9447 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9449 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9450 BufferView and reimplement the list as a queue put inside its own
9453 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9455 * several files: use the new interface to the "updateinsetlist"
9457 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9459 (work_area_handler): call BufferView::trippleClick on trippleclick.
9461 * src/BufferView.C (doubleClick): new function, selects word on
9463 (trippleClick): new function, selects line on trippleclick.
9465 2000-02-22 Allan Rae <rae@lyx.org>
9467 * lib/bind/xemacs.bind: buffer-previous not supported
9469 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9471 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9474 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9476 * src/bufferlist.C: get rid of current_view from this file
9478 * src/spellchecker.C: get rid of current_view from this file
9480 * src/vspace.C: get rid of current_view from this file
9481 (inPixels): added BufferView parameter for this func
9482 (asLatexCommand): added a BufferParams for this func
9484 * src/text.C src/text2.C: get rid of current_view from these
9487 * src/lyxfont.C (getFontDirection): move this function here from
9490 * src/bufferparams.C (getDocumentDirection): move this function
9493 * src/paragraph.C (getParDirection): move this function here from
9495 (getLetterDirection): ditto
9497 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9499 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9500 resize due to wrong pixmap beeing used. Also took the opurtunity
9501 to make the LyXScreen stateless on regard to WorkArea and some
9502 general cleanup in the same files.
9504 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9506 * src/Makefile.am: add missing direction.h
9508 * src/PainterBase.h: made the width functions const.
9510 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9513 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9515 * src/insets/insetlatexaccent.C (draw): make the accents draw
9516 better, at present this will only work well with iso8859-1.
9518 * several files: remove the old drawing code, now we use the new
9521 * several files: remove support for mono_video, reverse_video and
9524 2000-02-17 Juergen Vigna <jug@sad.it>
9526 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9527 int ** as we have to return the pointer, otherwise we have only
9528 NULL pointers in the returning function.
9530 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9532 * src/LaTeX.C (operator()): quote file name when running latex.
9534 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9536 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9537 (bubble tip), this removes our special handling of this.
9539 * Remove all code that is unused now that we have the new
9540 workarea. (Code that are not active when NEW_WA is defined.)
9542 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9544 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9546 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9547 nonexisting layout; correctly redirect obsoleted layouts.
9549 * lib/lyxrc.example: document \view_dvi_paper_option
9551 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9554 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9555 (PreviewDVI): handle the view_dvi_paper_option variable.
9556 [Both from Roland Krause]
9558 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9560 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9561 char const *, int, LyXFont)
9562 (text(int, int, string, LyXFont)): ditto
9564 * src/text.C (InsertCharInTable): attempt to fix the double-space
9565 feature in tables too.
9566 (BackspaceInTable): ditto.
9567 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9569 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9571 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9573 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9574 newly found text in textcache to this.
9575 (buffer): set the owner of the text put into the textcache to 0
9577 * src/insets/figinset.C (draw): fixed the drawing of figures with
9580 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9581 drawing of mathframe, hfills, protected space, table lines. I have
9582 now no outstanding drawing problems with the new Painter code.
9584 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9586 * src/PainterBase.C (ellipse, circle): do not specify the default
9589 * src/LColor.h: add using directive.
9591 * src/Painter.[Ch]: change return type of methods from Painter& to
9592 PainterBase&. Add a using directive.
9594 * src/WorkArea.C: wrap xforms callbacks in C functions
9597 * lib/layouts/foils.layout: font fix and simplifications from Carl
9600 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9602 * a lot of files: The Painter, LColor and WorkArea from the old
9603 devel branch has been ported to lyx-devel. Some new files and a
9604 lot of #ifdeffed code. The new workarea is enabled by default, but
9605 if you want to test the new Painter and LColor you have to compile
9606 with USE_PAINTER defined (do this in config.h f.ex.) There are
9607 still some rought edges, and I'd like some help to clear those
9608 out. It looks stable (loads and displays the Userguide very well).
9611 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9613 * src/buffer.C (pop_tag): revert to the previous implementation
9614 (use a global variable for both loops).
9616 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9618 * src/lyxrc.C (LyXRC): change slightly default date format.
9620 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9621 there is an English text with a footnote that starts with a Hebrew
9622 paragraph, or vice versa.
9623 (TeXFootnote): ditto.
9625 * src/text.C (LeftMargin): allow for negative values for
9626 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9629 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9630 for input encoding (cyrillic)
9632 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9634 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9637 * src/toolbar.C (set): ditto
9638 * src/insets/insetbib.C (create_form_citation_form): ditto
9640 * lib/CREDITS: added Dekel Tsur.
9642 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9643 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9644 hebrew supports files from Dekel Tsur.
9646 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9647 <tzafrir@technion.ac.il>
9649 * src/lyxrc.C: put \date_insert_format at the right place.
9651 * src/buffer.C (makeLaTeXFile): fix the handling of
9652 BufferParams::sides when writing out latex files.
9654 * src/BufferView2.C: add a "using" directive.
9656 * src/support/lyxsum.C (sum): when we use lyxstring,
9657 ostringstream::str needs an additional .c_str().
9659 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9661 * src/support/filetools.C (ChangeExtension): patch from Etienne
9664 * src/TextCache.C (show): remove const_cast and make second
9665 parameter non-const LyXText *.
9667 * src/TextCache.h: use non const LyXText in show.
9669 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9672 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9674 * src/support/lyxsum.C: rework to be more flexible.
9676 * several places: don't check if a pointer is 0 if you are going
9679 * src/text.C: remove some dead code.
9681 * src/insets/figinset.C: remove some dead code
9683 * src/buffer.C: move the BufferView funcs to BufferView2.C
9684 remove all support for insetlatexdel
9685 remove support for oldpapersize stuff
9686 made some member funcs const
9688 * src/kbmap.C: use a std::list to store the bindings in.
9690 * src/BufferView2.C: new file
9692 * src/kbsequence.[Ch]: new files
9694 * src/LyXAction.C + others: remove all trace of buffer-previous
9696 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9697 only have one copy in the binary of this table.
9699 * hebrew patch: moved some functions from LyXText to more
9700 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9702 * several files: remove support for XForms older than 0.88
9704 remove some #if 0 #endif code
9706 * src/TextCache.[Ch]: new file. Holds the textcache.
9708 * src/BufferView.C: changes to use the new TextCache interface.
9709 (waitForX): remove the now unused code.
9711 * src/BackStack.h: remove some commented code
9713 * lib/bind/emacs.bind: remove binding for buffer-previous
9715 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9717 * applied the hebrew patch.
9719 * src/lyxrow.h: make sure that all Row variables are initialized.
9721 * src/text2.C (TextHandleUndo): comment out a delete, this might
9722 introduce a memory leak, but should also help us to not try to
9723 read freed memory. We need to look at this one.
9725 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9726 (LyXParagraph): initalize footnotekind.
9728 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9729 forgot this when applying the patch. Please heed the warnings.
9731 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9732 (aka. reformat problem)
9734 * src/bufferlist.C (exists): made const, and use const_iterator
9735 (isLoaded): new func.
9736 (release): use std::find to find the correct buffer.
9738 * src/bufferlist.h: made getState a const func.
9739 made empty a const func.
9740 made exists a const func.
9743 2000-02-01 Juergen Vigna <jug@sad.it>
9745 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9747 * po/it.po: updated a bit the italian po file and also changed the
9748 'file nuovo' for newfile to 'filenuovo' without a space, this did
9751 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9752 for the new insert_date command.
9754 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9755 from jdblair, to insert a date into the current text conforming to
9756 a strftime format (for now only considering the locale-set and not
9757 the document-language).
9759 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9761 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9762 Bounds Read error seen by purify. The problem was that islower is
9763 a macros which takes an unsigned char and uses it as an index for
9764 in array of characters properties (and is thus subject to the
9768 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9769 correctly the paper sides radio buttons.
9770 (UpdateDocumentButtons): ditto.
9772 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9774 * src/kbmap.C (getsym + others): change to return unsigned int,
9775 returning a long can give problems on 64 bit systems. (I assume
9776 that int is 32bit on 64bit systems)
9778 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9780 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9781 LyXLookupString to be zero-terminated. Really fixes problems seen
9784 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9786 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9787 write a (char*)0 to the lyxerr stream.
9789 * src/lastfiles.C: move algorithm before the using statemets.
9791 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9793 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9794 complains otherwise).
9795 * src/table.C: ditto
9797 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9800 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9801 that I removed earlier... It is really needed.
9803 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9805 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9807 * INSTALL: update xforms home page URL.
9809 * lib/configure.m4: fix a bug with unreadable layout files.
9811 * src/table.C (calculate_width_of_column): add "using std::max"
9814 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9816 * several files: marked several lines with "DEL LINE", this is
9817 lines that can be deleted without changing anything.
9818 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9819 checks this anyway */
9822 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9824 * src/DepTable.C (update): add a "+" at the end when the checksum
9825 is different. (debugging string only)
9827 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9828 the next inset to not be displayed. This should also fix the list
9829 of labels in the "Insert Crossreference" dialog.
9831 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9833 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9834 when regex was not found.
9836 * src/support/lstrings.C (lowercase): use handcoded transform always.
9839 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9840 old_cursor.par->prev could be 0.
9842 * several files: changed post inc/dec to pre inc/dec
9844 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9845 write the lastfiles to file.
9847 * src/BufferView.C (buffer): only show TextCache info when debugging
9849 (resizeCurrentBuffer): ditto
9850 (workAreaExpose): ditto
9852 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9854 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9856 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9857 a bit better by removing the special case for \i and \j.
9859 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9861 * src/lyx_main.C (easyParse): remove test for bad comand line
9862 options, since this broke all xforms-related parsing.
9864 * src/kbmap.C (getsym): set return type to unsigned long, as
9865 declared in header. On an alpha, long is _not_ the same as int.
9867 * src/support/LOstream.h: add a "using std::flush;"
9869 * src/insets/figinset.C: ditto.
9871 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9873 * src/bufferlist.C (write): use blinding fast file copy instead of
9874 "a char at a time", now we are doing it the C++ way.
9876 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9877 std::list<int> instead.
9878 (addpidwait): reflect move to std::list<int>
9879 (sigchldchecker): ditto
9881 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9884 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9885 that obviously was wrong...
9887 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9888 c, this avoids warnings with purify and islower.
9890 * src/insets/figinset.C: rename struct queue to struct
9891 queue_element and rewrite to use a std::queue. gsqueue is now a
9892 std::queue<queue_element>
9893 (runqueue): reflect move to std::queue
9896 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9897 we would get "1" "0" instead of "true" "false. Also make the tostr
9900 2000-01-21 Juergen Vigna <jug@sad.it>
9902 * src/buffer.C (writeFileAscii): Disabled code for special groff
9903 handling of tabulars till I fix this in table.C
9905 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9907 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9909 * src/support/lyxlib.h: ditto.
9911 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9913 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9914 and 'j' look better. This might fix the "macron" bug that has been
9917 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9918 functions as one template function. Delete the old versions.
9920 * src/support/lyxsum.C: move using std::ifstream inside
9923 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9926 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9928 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9930 * src/insets/figinset.C (InitFigures): use new instead of malloc
9931 to allocate memory for figures and bitmaps.
9932 (DoneFigures): use delete[] instead of free to deallocate memory
9933 for figures and bitmaps.
9934 (runqueue): use new to allocate
9935 (getfigdata): use new/delete[] instead of malloc/free
9936 (RegisterFigure): ditto
9938 * some files: moved some declarations closer to first use, small
9939 whitespace changes use preincrement instead of postincrement where
9940 it does not make a difference.
9942 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9943 step on the way to use stl::containers for key maps.
9945 * src/bufferlist.h: add a typedef for const_iterator and const
9946 versions of begin and end.
9948 * src/bufferlist.[Ch]: change name of member variable _state to
9949 state_. (avoid reserved names)
9951 (getFileNames): returns the filenames of the buffers in a vector.
9953 * configure.in (ALL_LINGUAS): added ro
9955 * src/support/putenv.C: new file
9957 * src/support/mkdir.C: new file
9959 2000-01-20 Allan Rae <rae@lyx.org>
9961 * lib/layouts/IEEEtran.layout: Added several theorem environments
9963 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9964 couple of minor additions.
9966 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9967 (except for those in footnotes of course)
9969 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9971 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9973 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9974 std::sort and std::lower_bound instead of qsort and handwritten
9976 (struct compara): struct that holds the functors used by std::sort
9977 and std::lower_bound in MathedLookupBOP.
9979 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9981 * src/support/LAssert.h: do not do partial specialization. We do
9984 * src/support/lyxlib.h: note that lyx::getUserName() and
9985 lyx::date() are not in use right now. Should these be suppressed?
9987 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9988 (makeLinuxDocFile): do not put date and user name in linuxdoc
9991 * src/support/lyxlib.h (kill): change first argument to long int,
9992 since that's what solaris uses.
9994 * src/support/kill.C (kill): fix declaration to match prototype.
9996 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9997 actually check whether namespaces are supported. This is not what
10000 * src/support/lyxsum.C: add a using directive.
10002 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10004 * src/support/kill.C: if we have namespace support we don't have
10005 to include lyxlib.h.
10007 * src/support/lyxlib.h: use namespace lyx if supported.
10009 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10011 * src/support/date.C: new file
10013 * src/support/chdir.C: new file
10015 * src/support/getUserName.C: new file
10017 * src/support/getcwd.C: new file
10019 * src/support/abort.C: new file
10021 * src/support/kill.C: new file
10023 * src/support/lyxlib.h: moved all the functions in this file
10024 insede struct lyx. Added also kill and abort to this struct. This
10025 is a way to avoid the "kill is not defined in <csignal>", we make
10026 C++ wrappers for functions that are not ANSI C or ANSI C++.
10028 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10029 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10030 lyx it has been renamed to sum.
10032 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10034 * src/text.C: add using directives for std::min and std::max.
10036 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10038 * src/texrow.C (getIdFromRow): actually return something useful in
10039 id and pos. Hopefully fixes the bug with positionning of errorbox
10042 * src/lyx_main.C (easyParse): output an error and exit if an
10043 incorrect command line option has been given.
10045 * src/spellchecker.C (ispell_check_word): document a memory leak.
10047 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10048 where a "struct utimbuf" is allocated with "new" and deleted with
10051 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10053 * src/text2.C (CutSelection): don't delete double spaces.
10054 (PasteSelection): ditto
10055 (CopySelection): ditto
10057 * src/text.C (Backspace): don't delete double spaces.
10059 * src/lyxlex.C (next): fix a bug that were only present with
10060 conformant std::istream::get to read comment lines, use
10061 std::istream::getline instead. This seems to fix the problem.
10063 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10065 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10066 allowed to insert space before space" editing problem. Please read
10067 commends at the beginning of the function. Comments about usage
10070 * src/text.C (InsertChar): fix for the "not allowed to insert
10071 space before space" editing problem.
10073 * src/text2.C (DeleteEmptyParagraphMechanism): when
10074 IsEmptyTableRow can only return false this last "else if" will
10075 always be a no-op. Commented out.
10077 * src/text.C (RedoParagraph): As far as I can understand tmp
10078 cursor is not really needed.
10080 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10081 present it could only return false anyway.
10082 (several functions): Did something not so smart...added a const
10083 specifier on a lot of methods.
10085 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10086 and add a tmp->text.resize. The LyXParagraph constructor does the
10088 (BreakParagraphConservative): ditto
10090 * src/support/path.h (Path): add a define so that the wrong usage
10091 "Path("/tmp") will be flagged as a compilation error:
10092 "`unnamed_Path' undeclared (first use this function)"
10094 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10096 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10097 which was bogus for several reasons.
10099 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10101 (runBibTeX): ditto.
10103 * autogen.sh: do not use "type -path" (what's that anyway?).
10105 * src/support/filetools.C (findtexfile): remove extraneous space
10106 which caused a kpsewhich warning (at least with kpathsea version
10109 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10111 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10113 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10115 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10117 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10119 * src/paragraph.C (BreakParagraph): do not reserve space on text
10120 if we don't need to (otherwise, if pos_end < pos, we end up
10121 reserving huge amounts of memory due to bad unsigned karma).
10122 (BreakParagraphConservative): ditto, although I have not seen
10123 evidence the bug can happen here.
10125 * src/lyxparagraph.h: add a using std::list.
10127 2000-01-11 Juergen Vigna <jug@sad.it>
10129 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10130 could not be found.
10132 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10134 * src/vc-backend.C (doVCCommand): change to be static and take one
10135 more parameter: the path to chdir too be fore executing the command.
10136 (retrive): new function equiv to "co -r"
10138 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10139 file_not_found_hook is true.
10141 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10143 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10144 if a file is readwrite,readonly...anything else.
10146 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10148 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10149 (CreatePostscript): name change from MenuRunDVIPS (or something)
10150 (PreviewPostscript): name change from MenuPreviewPS
10151 (PreviewDVI): name change from MenuPreviewDVI
10153 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10154 \view_pdf_command., \pdf_to_ps_command
10156 * lib/configure.m4: added search for PDF viewer, and search for
10157 PDF to PS converter.
10158 (lyxrc.defaults output): add \pdflatex_command,
10159 \view_pdf_command and \pdf_to_ps_command.
10161 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10163 * src/bufferlist.C (write): we don't use blocksize for anything so
10166 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10168 * src/support/block.h: disable operator T* (), since it causes
10169 problems with both compilers I tried. See comments in the file.
10171 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10174 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10175 variable LYX_DIR_10x to LYX_DIR_11x.
10177 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10179 * INSTALL: document --with-lyxname.
10182 * configure.in: new configure flag --with-lyxname which allows to
10183 choose the name under which lyx is installed. Default is "lyx", of
10184 course. It used to be possible to do this with --program-suffix,
10185 but the later has in fact a different meaning for autoconf.
10187 * src/support/lstrings.h (lstrchr): reformat a bit.
10189 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10190 * src/mathed/math_defs.h: ditto.
10192 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10194 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10195 true, decides if we create a backup file or not when saving. New
10196 tag and variable \pdf_mode, defaults to false. New tag and
10197 variable \pdflatex_command, defaults to pdflatex. New tag and
10198 variable \view_pdf_command, defaults to xpdf. New tag and variable
10199 \pdf_to_ps_command, defaults to pdf2ps.
10201 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10203 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10204 does not have a BufferView.
10205 (unlockInset): ditto + don't access the_locking_inset if the
10206 buffer does not have a BufferView.
10208 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10209 certain circumstances so that we don't continue a keyboard
10210 operation long after the key was released. Try f.ex. to load a
10211 large document, press PageDown for some seconds and then release
10212 it. Before this change the document would contine to scroll for
10213 some time, with this change it stops imidiatly.
10215 * src/support/block.h: don't allocate more space than needed. As
10216 long as we don't try to write to the arr[x] in a array_type arr[x]
10217 it is perfectly ok. (if you write to it you might segfault).
10218 added operator value_type*() so that is possible to pass the array
10219 to functions expecting a C-pointer.
10221 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10224 * intl/*: updated to gettext 0.10.35, tried to add our own
10225 required modifications. Please verify.
10227 * po/*: updated to gettext 0.10.35, tried to add our own required
10228 modifications. Please verify.
10230 * src/support/lstrings.C (tostr): go at fixing the problem with
10231 cxx and stringstream. When stringstream is used return
10232 oss.str().c_str() so that problems with lyxstring and basic_string
10233 are avoided. Note that the best solution would be for cxx to use
10234 basic_string all the way, but it is not conformant yet. (it seems)
10236 * src/lyx_cb.C + other files: moved several global functions to
10237 class BufferView, some have been moved to BufferView.[Ch] others
10238 are still located in lyx_cb.C. Code changes because of this. (part
10239 of "get rid of current_view project".)
10241 * src/buffer.C + other files: moved several Buffer functions to
10242 class BufferView, the functions are still present in buffer.C.
10243 Code changes because of this.
10245 * config/lcmessage.m4: updated to most recent. used when creating
10248 * config/progtest.m4: updated to most recent. used when creating
10251 * config/gettext.m4: updated to most recent. applied patch for
10254 * config/gettext.m4.patch: new file that shows what changes we
10255 have done to the local copy of gettext.m4.
10257 * config/libtool.m4: new file, used in creation of acinclude.m4
10259 * config/lyxinclude.m4: new file, this is the lyx created m4
10260 macros, used in making acinclude.m4.
10262 * autogen.sh: GNU m4 discovered as a separate task not as part of
10263 the lib/configure creation.
10264 Generate acinlucde from files in config. Actually cat
10265 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10266 easier to upgrade .m4 files that really are external.
10268 * src/Spacing.h: moved using std::istringstream to right after
10269 <sstream>. This should fix the problem seen with some compilers.
10271 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10273 * src/lyx_cb.C: began some work to remove the dependency a lot of
10274 functions have on BufferView::text, even if not really needed.
10275 (GetCurrentTextClass): removed this func, it only hid the
10278 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10279 forgot this in last commit.
10281 * src/Bullet.C (bulletEntry): use static char const *[] for the
10282 tables, becuase of this the return arg had to change to string.
10283 (bulletSize): ditto
10284 (~Bullet): removed unneeded destructor
10286 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10287 (insetSleep): moved from Buffer
10288 (insetWakeup): moved from Buffer
10289 (insetUnlock): moved from Buffer
10291 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10292 from Buffer to BufferView.
10294 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10296 * config/ltmain.sh: updated to version 1.3.4 of libtool
10298 * config/ltconfig: updated to version 1.3.4 of libtool
10300 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10303 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10304 Did I get that right?
10306 * src/lyxlex.h: add a "using" directive or two.
10307 * src/Spacing.h: ditto.
10308 * src/insets/figinset.C: ditto.
10309 * src/support/filetools.C: ditto.
10310 * src/support/lstrings.C: ditto.
10311 * src/BufferView.C: ditto.
10312 * src/bufferlist.C: ditto.
10313 * src/lyx_cb.C: ditto.
10314 * src/lyxlex.C: ditto.
10316 * NEWS: add some changes for 1.1.4.
10318 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10320 * src/BufferView.C: first go at a TextCache to speed up switching
10323 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10325 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10326 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10327 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10328 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10331 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10332 members of the struct are correctly initialized to 0 (detected by
10334 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10335 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10337 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10338 pidwait, since it was allocated with "new". This was potentially
10339 very bad. Thanks to Michael Schmitt for running purify for us.
10342 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10344 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10346 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10348 1999-12-30 Allan Rae <rae@lyx.org>
10350 * lib/templates/IEEEtran.lyx: minor change
10352 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10353 src/mathed/formula.C (LocalDispatch): askForText changes
10355 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10356 know when a user has cancelled input. Fixes annoying problems with
10357 inserting labels and version control.
10359 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10361 * src/support/lstrings.C (tostr): rewritten to use strstream and
10364 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10366 * src/support/filetools.C (IsFileWriteable): use fstream to check
10367 (IsDirWriteable): use fileinfo to check
10369 * src/support/filetools.h (FilePtr): whole class deleted
10371 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10373 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10375 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10377 * src/bufferlist.C (write): use ifstream and ofstream instead of
10380 * src/Spacing.h: use istrstream instead of sscanf
10382 * src/mathed/math_defs.h: change first arg to istream from FILE*
10384 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10386 * src/mathed/math_parser.C: have yyis to be an istream
10387 (LexGetArg): use istream (yyis)
10389 (mathed_parse): ditto
10390 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10392 * src/mathed/formula.C (Read): rewritten to use istream
10394 * src/mathed/formulamacro.C (Read): rewritten to use istream
10396 * src/lyxlex.h (~LyXLex): deleted desturctor
10397 (getStream): new function, returns an istream
10398 (getFile): deleted funtion
10399 (IsOK): return is.good();
10401 * src/lyxlex.C (LyXLex): delete file and owns_file
10402 (setFile): open an filebuf and assign that to a istream instead of
10404 (setStream): new function, takes an istream as arg.
10405 (setFile): deleted function
10406 (EatLine): rewritten us use istream instead of FILE*
10410 * src/table.C (LyXTable): use istream instead of FILE*
10411 (Read): rewritten to take an istream instead of FILE*
10413 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10415 * src/buffer.C (Dispatch): remove an extraneous break statement.
10417 * src/support/filetools.C (QuoteName): change to do simple
10418 'quoting'. More work is necessary. Also changed to do nothing
10419 under emx (needs fix too).
10420 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10422 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10423 config.h.in to the AC_DEFINE_UNQUOTED() call.
10424 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10425 needs char * as argument (because Solaris 7 declares it like
10428 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10429 remove definition of BZERO.
10431 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10433 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10434 defined, "lyxregex.h" if not.
10436 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10438 (REGEX): new variable that is set to regex.c lyxregex.h when
10439 AM_CONDITIONAL USE_REGEX is set.
10440 (libsupport_la_SOURCES): add $(REGEX)
10442 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10445 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10448 * configure.in: add call to LYX_REGEX
10450 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10451 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10453 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10455 * lib/bind/fi_menus.bind: new file, from
10456 pauli.virtanen@saunalahti.fi.
10458 * src/buffer.C (getBibkeyList): pass the parameter delim to
10459 InsetInclude::getKeys and InsetBibtex::getKeys.
10461 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10462 is passed to Buffer::getBibkeyList
10464 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10465 instead of the hardcoded comma.
10467 * src/insets/insetbib.C (getKeys): make sure that there are not
10468 leading blanks in bibtex keys. Normal latex does not care, but
10469 harvard.sty seems to dislike blanks at the beginning of citation
10470 keys. In particular, the retturn value of the function is
10472 * INSTALL: make it clear that libstdc++ is needed and that gcc
10473 2.7.x probably does not work.
10475 * src/support/filetools.C (findtexfile): make debug message go to
10477 * src/insets/insetbib.C (getKeys): ditto
10479 * src/debug.C (showTags): make sure that the output is correctly
10482 * configure.in: add a comment for TWO_COLOR_ICON define.
10484 * acconfig.h: remove all the entries that already defined in
10485 configure.in or acinclude.m4.
10487 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10488 to avoid user name, date and copyright.
10490 1999-12-21 Juergen Vigna <jug@sad.it>
10492 * src/table.C (Read): Now read bogus row format informations
10493 if the format is < 5 so that afterwards the table can
10494 be read by lyx but without any format-info. Fixed the
10495 crash we experienced when not doing this.
10497 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10499 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10500 (RedoDrawingOfParagraph): ditto
10501 (RedoParagraphs): ditto
10502 (RemoveTableRow): ditto
10504 * src/text.C (Fill): rename arg paperwidth -> paper_width
10506 * src/buffer.C (insertLyXFile): rename var filename -> fname
10507 (writeFile): rename arg filename -> fname
10508 (writeFileAscii): ditto
10509 (makeLaTeXFile): ditto
10510 (makeLinuxDocFile): ditto
10511 (makeDocBookFile): ditto
10513 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10516 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10518 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10521 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10522 compiled by a C compiler not C++.
10524 * src/layout.h (LyXTextClass): added typedef for const_iterator
10525 (LyXTextClassList): added typedef for const_iterator + member
10526 functions begin and end.
10528 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10529 iterators to fill the choice_class.
10530 (updateLayoutChoice): rewritten to use iterators to fill the
10531 layoutlist in the toolbar.
10533 * src/BufferView.h (BufferView::work_area_width): removed unused
10536 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10538 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10539 (sgmlCloseTag): ditto
10541 * src/support/lstrings.h: return type of countChar changed to
10544 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10545 what version of this func to use. Also made to return unsigned int.
10547 * configure.in: call LYX_STD_COUNT
10549 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10550 conforming std::count.
10552 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10554 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10555 and a subscript would give bad display (patch from Dekel Tsur
10556 <dekel@math.tau.ac.il>).
10558 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10560 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10563 * src/chset.h: add a few 'using' directives
10565 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10566 triggered when no buffer is active
10568 * src/layout.C: removed `break' after `return' in switch(), since
10571 * src/lyx_main.C (init): make sure LyX can be ran in place even
10572 when libtool has done its magic with shared libraries. Fix the
10573 test for the case when the system directory has not been found.
10575 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10576 name for the latex file.
10577 (MenuMakeHTML): ditto
10579 * src/buffer.h: add an optional boolean argument, which is passed
10580 to ChangeExtension.
10582 1999-12-20 Allan Rae <rae@lyx.org>
10584 * lib/templates/IEEEtran.lyx: small correction and update.
10586 * configure.in: Attempted to use LYX_PATH_HEADER
10588 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10590 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10591 input from JMarc. Now use preprocessor to find the header.
10592 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10593 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10594 LYX_STL_STRING_FWD. See comments in file.
10596 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10598 * The global MiniBuffer * minibuffer variable is dead.
10600 * The global FD_form_main * fd_form_main variable is dead.
10602 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10604 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10606 * src/table.h: add the LOstream.h header
10607 * src/debug.h: ditto
10609 * src/LyXAction.h: change the explaination of the ReadOnly
10610 attribute: is indicates that the function _can_ be used.
10612 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10615 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10617 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10623 * src/paragraph.C (GetWord): assert on pos>=0
10626 * src/support/lyxstring.C: condition the use of an invariant on
10628 * src/support/lyxstring.h: ditto
10630 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10631 Use LAssert.h instead of plain assert().
10633 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10635 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10636 * src/support/filetools.C: ditto
10638 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10641 * INSTALL: document the new configure flags
10643 * configure.in: suppress --with-debug; add --enable-assertions
10645 * acinclude.m4: various changes in alignment of help strings.
10647 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10649 * src/kbmap.C: commented out the use of the hash map in kb_map,
10650 beginning of movement to a stl::container.
10652 * several files: removed code that was not in effect when
10653 MOVE_TEXT was defined.
10655 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10656 for escaping should not be used. We can discuss if the string
10657 should be enclosed in f.ex. [] instead of "".
10659 * src/trans_mgr.C (insert): use the new returned value from
10660 encodeString to get deadkeys and keymaps done correctly.
10662 * src/chset.C (encodeString): changed to return a pair, to tell
10663 what to use if we know the string.
10665 * src/lyxscreen.h (fillArc): new function.
10667 * src/FontInfo.C (resize): rewritten to use more std::string like
10668 structore, especially string::replace.
10670 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10673 * configure.in (chmod +x some scripts): remove config/gcc-hack
10675 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10677 * src/buffer.C (writeFile): change once again the top comment in a
10678 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10679 instead of an hardcoded version number.
10680 (makeDocBookFile): ditto
10682 * src/version.h: add new define LYX_DOCVERSION
10684 * po/de.po: update from Pit Sütterlin
10685 * lib/bind/de_menus.bind: ditto.
10687 * src/lyxfunc.C (Dispatch): call MenuExport()
10688 * src/buffer.C (Dispatch): ditto
10690 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10691 LyXFunc::Dispatch().
10692 (MenuExport): new function, moved from
10693 LyXFunc::Dispatch().
10695 * src/trans_mgr.C (insert): small cleanup
10696 * src/chset.C (loadFile): ditto
10698 * lib/kbd/iso8859-1.cdef: add missing backslashes
10700 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10702 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10703 help with placing the manually drawn accents better.
10705 (Draw): x2 and hg changed to float to minimize rounding errors and
10706 help place the accents better.
10708 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10709 unsigned short to char is just wrong...cast the char to unsigned
10710 char instead so that the two values can compare sanely. This
10711 should also make the display of insetlatexaccents better and
10712 perhaps also some other insets.
10714 (lbearing): new function
10717 1999-12-15 Allan Rae <rae@lyx.org>
10719 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10720 header that provides a wrapper around the very annoying SGI STL header
10723 * src/support/lyxstring.C, src/LString.h:
10724 removed old SGI-STL-compatability attempts.
10726 * configure.in: Use LYX_STL_STRING_FWD.
10728 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10729 stl_string_fwd.h is around and try to determine it's location.
10730 Major improvement over previous SGI STL 3.2 compatability.
10731 Three small problems remain with this function due to my zero
10732 knowledge of autoconf. JMarc and lgb see the comments in the code.
10734 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10736 * src/broken_const.h, config/hack-gcc, config/README: removed
10738 * configure.in: remove --with-gcc-hack option; do not call
10741 * INSTALL: remove documentation of --with-broken-const and
10744 * acconfig.h: remove all trace of BROKEN_CONST define
10746 * src/buffer.C (makeDocBookFile): update version number in output
10748 (SimpleDocBookOnePar): fix an assert when trying to a character
10749 access beyond string length
10752 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10754 * po/de.po: fix the Export menu
10756 * lyx.man: update the description of -dbg
10758 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10759 (commandLineHelp): updated
10760 (easyParse): show list of available debug levels if -dbg is passed
10763 * src/Makefile.am: add debug.C
10765 * src/debug.h: moved some code to debug.C
10767 * src/debug.C: new file. Contains code to set and show debug
10770 * src/layout.C: remove 'break' after 'continue' in switch
10771 statements, since these cannot be reached.
10773 1999-12-13 Allan Rae <rae@lyx.org>
10775 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10776 (in_word_set): hash() -> math_hash()
10778 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10780 * acconfig.h: Added a test for whether we are using exceptions in the
10781 current compilation run. If so USING_EXCEPTIONS is defined.
10783 * config.in: Check for existance of stl_string_fwd.h
10784 * src/LString.h: If compiling --with-included-string and SGI's
10785 STL version 3.2 is present (see above test) we need to block their
10786 forward declaration of string and supply a __get_c_string().
10787 However, it turns out this is only necessary if compiling with
10788 exceptions enabled so I've a bit more to add yet.
10790 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10791 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10792 src/support/LRegex.h, src/undo.h:
10793 Shuffle the order of the included files a little to ensure that
10794 LString.h gets included before anything that includes stl_string_fwd.h
10796 * src/support/lyxstring.C: We need to #include LString.h instead of
10797 lyxstring.h to get the necessary definition of __get_c_string.
10798 (__get_c_string): New function. This is defined static just like SGI's
10799 although why they need to do this I'm not sure. Perhaps it should be
10800 in lstrings.C instead.
10802 * lib/templates/IEEEtran.lyx: New template file.
10804 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10806 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10807 * intl/Makefile.in (MKINSTALLDIRS): ditto
10809 * src/LyXAction.C (init): changed to hold the LFUN data in a
10810 automatic array in stead of in callso to newFunc, this speeds up
10811 compilation a lot. Also all the memory used by the array is
10812 returned when the init is completed.
10814 * a lot of files: compiled with -Wold-style-cast, changed most of
10815 the reported offenders to C++ style casts. Did not change the
10816 offenders in C files.
10818 * src/trans.h (Match): change argument type to unsigned int.
10820 * src/support/DebugStream.C: fix some types on the streambufs so
10821 that it works on a conforming implementation.
10823 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10825 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10827 * src/support/lyxstring.C: remove the inline added earlier since
10828 they cause a bunch of unsatisfied symbols when linking with dec
10829 cxx. Cxx likes to have the body of inlines at the place where they
10832 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10833 accessing negative bounds in array. This fixes the crash when
10834 inserting accented characters.
10835 * src/trans.h (Match): ditto
10837 * src/buffer.C (Dispatch): since this is a void, it should not try
10838 to return anything...
10840 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10842 * src/buffer.h: removed the two friends from Buffer. Some changes
10843 because of this. Buffer::getFileName and Buffer::setFileName
10844 renamed to Buffer::fileName() and Buffer::fileName(...).
10846 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10848 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10849 and Buffer::update(short) to BufferView. This move is currently
10850 controlled by a define MOVE_TEXT, this will be removed when all
10851 shows to be ok. This move paves the way for better separation
10852 between buffer contents and buffer view. One side effect is that
10853 the BufferView needs a rebreak when swiching buffers, if we want
10854 to avoid this we can add a cache that holds pointers to LyXText's
10855 that is not currently in use.
10857 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10860 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10862 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10864 * lyx_main.C: new command line option -x (or --execute) and
10865 -e (or --export). Now direct conversion from .lyx to .tex
10866 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10867 Unfortunately, X is still needed and the GUI pops up during the
10870 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10872 * src/Spacing.C: add a using directive to bring stream stuff into
10874 * src/paragraph.C: ditto
10875 * src/buffer.C: ditto
10877 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10878 from Lars' announcement).
10880 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10881 example files from Tino Meinen.
10883 1999-12-06 Allan Rae <rae@lyx.org>
10885 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10887 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10889 * src/support/lyxstring.C: added a lot of inline for no good
10892 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10893 latexWriteEndChanges, they were not used.
10895 * src/layout.h (operator<<): output operator for PageSides
10897 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10899 * some example files: loaded in LyX 1.0.4 and saved again to update
10900 certain constructs (table format)
10902 * a lot of files: did the change to use fstream/iostream for all
10903 writing of files. Done with a close look at Andre Poenitz's patch.
10905 * some files: whitespace changes.
10907 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10909 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10910 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10911 architecture, we provide our own. It is used unconditionnally, but
10912 I do not think this is a performance problem. Thanks to Angus
10913 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10914 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10916 (GetInset): use my_memcpy.
10920 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10921 it is easier to understand, but it uses less TeX-only constructs now.
10923 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10924 elements contain spaces
10926 * lib/configure: regenerated
10928 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10929 elements contain spaces; display the list of programs that are
10932 * autogen.sh: make sure lib/configure is executable
10934 * lib/examples/*: rename the tutorial examples to begin with the
10935 two-letters language code.
10937 * src/lyxfunc.C (getStatus): do not query current font if no
10940 * src/lyx_cb.C (RunScript): use QuoteName
10941 (MenuRunDvips): ditto
10942 (PrintApplyCB): ditto
10944 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10945 around argument, so that it works well with the current shell.
10946 Does not work properly with OS/2 shells currently.
10948 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10949 * src/LyXSendto.C (SendtoApplyCB): ditto
10950 * src/lyxfunc.C (Dispatch): ditto
10951 * src/buffer.C (runLaTeX): ditto
10952 (runLiterate): ditto
10953 (buildProgram): ditto
10955 * src/lyx_cb.C (RunScript): ditto
10956 (MenuMakeLaTeX): ditto
10958 * src/buffer.h (getLatexName): new method
10960 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10962 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10964 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10965 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10966 (create_math_panel): ditto
10968 * src/lyxfunc.C (getStatus): re-activate the code which gets
10969 current font and cursor; add test for export to html.
10971 * src/lyxrc.C (read): remove unreachable break statements; add a
10974 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10976 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10978 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10979 introduced by faulty regex.
10980 * src/buffer.C: ditto
10981 * src/lastfiles.C: ditto
10982 * src/paragraph.C: ditto
10983 * src/table.C: ditto
10984 * src/vspace.C: ditto
10985 * src/insets/figinset.C: ditto
10986 Note: most of these is absolutely harmless, except the one in
10987 src/mathed formula.C.
10989 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10991 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10992 operation, yielding correct results for the reLyX command.
10994 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10996 * src/support/filetools.C (ExpandPath): removed an over eager
10998 (ReplaceEnvironmentPath): ditto
11000 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11001 shows that we are doing something fishy in our code...
11002 (BubblePost): ditto
11005 * src/lyxrc.C (read): use a double switch trick to get more help
11006 from the compiler. (the same trick is used in layout.C)
11007 (write): new function. opens a ofstream and pass that to output
11008 (output): new function, takes a ostream and writes the lyxrc
11009 elemts to it. uses a dummy switch to make sure no elements are
11012 * src/lyxlex.h: added a struct pushpophelper for use in functions
11013 with more than one exit point.
11015 * src/lyxlex.[Ch] (GetInteger): made it const
11019 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11021 * src/layout.[hC] : LayoutTags splitted into several enums, new
11022 methods created, better error handling cleaner use of lyxlex. Read
11025 * src/bmtable.[Ch]: change some member prototypes because of the
11026 image const changes.
11028 * commandtags.h, src/LyXAction.C (init): new function:
11029 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11030 This file is not read automatically but you can add \input
11031 preferences to your lyxrc if you want to. We need to discuss how
11034 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11035 in .aux, also remove .bib and .bst files from dependencies when
11038 * src/BufferView.C, src/LyXView.C: add const_cast several places
11039 because of changes to images.
11041 * lib/images/*: same change as for images/*
11043 * lib/lyxrc.example: Default for accept_compound is false not no.
11045 * images/*: changed to be const, however I have som misgivings
11046 about this change so it might be changed back.
11048 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11050 * lib/configure, po/POTFILES.in: regenerated
11052 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11054 * config/lib_configure.m4: removed
11056 * lib/configure.m4: new file (was config/lib_configure.m4)
11058 * configure.in: do not test for rtti, since we do not use it.
11060 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11062 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11063 doubling of allocated space scheme. This makes it faster for large
11064 strings end to use less memory for small strings. xtra rememoved.
11066 * src/insets/figinset.C (waitalarm): commented out.
11067 (GhostscriptMsg): use static_cast
11068 (GhostscriptMsg): use new instead of malloc to allocate memory for
11069 cmap. also delete the memory after use.
11071 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11073 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11074 for changes in bibtex database or style.
11075 (runBibTeX): remove all .bib and .bst files from dep before we
11077 (run): use scanAuc in when dep file already exist.
11079 * src/DepTable.C (remove_files_with_extension): new method
11080 (exist): new method
11082 * src/DepTable.[Ch]: made many of the methods const.
11084 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11086 * src/bufferparams.C: make sure that the default textclass is
11087 "article". It used to be the first one by description order, but
11088 now the first one is "docbook".
11090 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11091 string; call Debug::value.
11092 (easyParse): pass complete argument to setDebuggingLevel().
11094 * src/debug.h (value): fix the code that parses debug levels.
11096 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11099 * src/LyXAction.C: use Debug::ACTION as debug channel.
11101 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11103 * NEWS: updated for the future 1.1.3 release.
11105 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11106 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11107 it should. This is of course a controversial change (since many
11108 people will find that their lyx workscreen is suddenly full of
11109 red), but done for the sake of correctness.
11111 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11112 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11114 * src/insets/inseterror.h, src/insets/inseturl.h,
11115 src/insets/insetinfo.h, src/insets/figinset.h,
11116 src/mathed/formulamacro.h, src/mathed/math_macro.h
11117 (EditMessage): add a missing const and add _() to make sure that
11118 translation happens
11120 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11121 src/insets/insetbib.C, src/support/filetools.C: add `using'
11122 directives for cxx.
11124 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11125 doing 'Insert index of last word' at the beginning of a paragraph.
11127 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11129 * several files: white-space changes.
11131 * src/mathed/formula.C: removed IsAlpha and IsDigit
11133 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11134 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11137 * src/insets/figinset.C (GetPSSizes): don't break when
11138 "EndComments" is seen. But break when a boundingbox is read.
11140 * all classes inherited from Inset: return value of Clone
11141 changed back to Inset *.
11143 * all classes inherited form MathInset: return value of Clone
11144 changed back to MathedInset *.
11146 * src/insets/figinset.C (runqueue): use a ofstream to output the
11147 gs/ps file. Might need some setpresicion or setw. However I can
11148 see no problem with the current code.
11149 (runqueue): use sleep instead of the alarm/signal code. I just
11150 can't see the difference.
11152 * src/paragraph.C (LyXParagraph): reserve space in the new
11153 paragraph and resize the inserted paragraph to just fit.
11155 * src/lyxfunc.h (operator|=): added operator for func_status.
11157 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11158 check for readable file.
11160 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11161 check for readable file.
11162 (MenuMakeLinuxDoc): ditto
11163 (MenuMakeDocBook): ditto
11164 (MenuMakeAscii): ditto
11165 (InsertAsciiFile): split the test for openable and readable
11167 * src/bmtable.C (draw_bitmaptable): use
11168 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11170 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11171 findtexfile from LaTeX to filetools.
11173 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11174 instead of FilePtr. Needs to be verified by a literate user.
11176 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11178 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11179 (EditMessage): likewise.
11181 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11182 respectively as \textasciitilde and \textasciicircum.
11184 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11186 * src/support/lyxstring.h: made the methods that take iterators
11187 use const_iterator.
11189 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11190 (regexMatch): made is use the real regex class.
11192 * src/support/Makefile.am: changed to use libtool
11194 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11196 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11198 (MathIsInset ++): changed several macros to be inline functions
11201 * src/mathed/Makefile.am: changed to use libtool
11203 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11205 * src/insets/inset* : Clone changed to const and return type is
11206 the true insettype not just Inset*.
11208 * src/insets/Makefile.am: changed to use libtool
11210 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11212 * src/undo.[Ch] : added empty() and changed some of the method
11215 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11217 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11218 setID use block<> for the bullets array, added const several places.
11220 * src/lyxfunc.C (getStatus): new function
11222 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11223 LyXAction, added const to several funtions.
11225 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11226 a std::map, and to store the dir items in a vector.
11228 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11231 * src/LyXView.[Ch] + other files : changed currentView to view.
11233 * src/LyXAction.[Ch] : ported from the old devel branch.
11235 * src/.cvsignore: added .libs and a.out
11237 * configure.in : changes to use libtool.
11239 * acinclude.m4 : inserted libtool.m4
11241 * .cvsignore: added libtool
11243 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11245 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11246 file name in insets and mathed directories (otherwise the
11247 dependency is not taken in account under cygwin).
11249 * src/text2.C (InsertString[AB]): make sure that we do not try to
11250 read characters past the string length.
11252 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11254 * lib/doc/LaTeXConfig.lyx.in,
11255 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11257 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11258 file saying who created them and when this heppened; this is
11259 useless and annoys tools like cvs.
11261 * lib/layouts/g-brief-{en,de}.layout,
11262 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11263 from Thomas Hartkens <thomas@hartkens.de>.
11265 * src/{insets,mathed}/Makefile.am: do not declare an empty
11266 LDFLAGS, so that it can be set at configure time (useful on Irix
11269 * lib/reLyX/configure.in: make sure that the prefix is set
11270 correctly in LYX_DIR.
11272 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11274 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11275 be used by 'command-sequence' this allows to bind a key to a
11276 sequence of LyX-commands
11277 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11279 * src/LyXAction.C: add "command-sequence"
11281 * src/LyXFunction.C: handling of "command-sequence"
11283 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11284 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11286 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11288 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11290 * src/buffer.C (writeFile): Do not output a comment giving user
11291 and date at the beginning of a .lyx file. This is useless and
11292 annoys cvs anyway; update version number to 1.1.
11294 * src/Makefile.am (LYX_DIR): add this definition, so that a
11295 default path is hardcoded in LyX.
11297 * configure.in: Use LYX_GNU_GETTEXT.
11299 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11300 AM_GNU_GETTEXT with a bug fixed.
11302 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11304 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11306 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11307 which is used to point to LyX data is now LYX_DIR_11x.
11309 * lyx.man: convert to a unix text file; small updates.
11311 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11313 * src/support/LSubstring.[Ch]: made the second arg of most of the
11314 constructors be a const reference.
11316 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11319 * src/support/lyxstring.[Ch] (swap): added missing member function
11320 and specialization of swap(str, str);
11322 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11324 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11325 trace of the old one.
11327 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11328 put the member definitions in undo.C.
11330 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11331 NEW_TEXT and have now only code that was included when this was
11334 * src/intl.C (LCombo): use static_cast
11336 (DispatchCallback): ditto
11338 * src/definitions.h: removed whole file
11340 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11342 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11343 parsing and stores in a std:map. a regex defines the file format.
11344 removed unneeded members.
11346 * src/bufferparams.h: added several enums from definitions.h here.
11347 Removed unsused destructor. Changed some types to use proper enum
11348 types. use block to have the temp_bullets and user_defined_bullets
11349 and to make the whole class assignable.
11351 * src/bufferparams.C (Copy): removed this functions, use a default
11352 assignment instead.
11354 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11357 * src/buffer.C (readLyXformat2): commend out all that have with
11358 oldpapersize to do. also comment out all that hve to do with
11359 insetlatex and insetlatexdel.
11360 (setOldPaperStuff): commented out
11362 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11364 * src/LyXAction.C: remove use of inset-latex-insert
11366 * src/mathed/math_panel.C (button_cb): use static_cast
11368 * src/insets/Makefile.am (insets_o_SOURCES): removed
11371 * src/support/lyxstring.C (helper): use the unsigned long
11372 specifier, UL, instead of a static_cast.
11374 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11376 * src/support/block.h: new file. to be used as a c-style array in
11377 classes, so that the class can be assignable.
11379 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11381 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11382 NULL, make sure to return an empty string (it is not possible to
11383 set a string to NULL).
11385 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11387 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11389 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11391 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11392 link line, so that Irix users (for example) can set it explicitely to
11395 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11396 it can be overidden at make time (static or dynamic link, for
11399 * src/vc-backend.C, src/LaTeXFeatures.h,
11400 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11401 statements to bring templates to global namespace.
11403 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11405 * src/support/lyxstring.C (operator[] const): make it standard
11408 * src/minibuffer.C (Init): changed to reflect that more
11409 information is given from the lyxvc and need not be provided here.
11411 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11413 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11415 * src/LyXView.C (UpdateTimerCB): use static_cast
11416 (KeyPressMask_raw_callback): ditto
11418 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11419 buffer_, a lot of changes because of this. currentBuffer() ->
11420 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11421 also changes to other files because of this.
11423 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11425 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11426 have no support for RCS and partial support for CVS, will be
11429 * src/insets/ several files: changes because of function name
11430 changes in Bufferview and LyXView.
11432 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11434 * src/support/LSubstring.[Ch]: new files. These implement a
11435 Substring that can be very convenient to use. i.e. is this
11437 string a = "Mary had a little sheep";
11438 Substring(a, "sheep") = "lamb";
11439 a is now "Mary has a little lamb".
11441 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11442 out patterns and subpatterns of strings. It is used by LSubstring
11443 and also by vc-backend.C
11445 * src/support/lyxstring.C: went over all the assertions used and
11446 tried to correct the wrong ones and flag which of them is required
11447 by the standard. some bugs found because of this. Also removed a
11448 couple of assertions.
11450 * src/support/Makefile.am (libsupport_a_SOURCES): added
11451 LSubstring.[Ch] and LRegex.[Ch]
11453 * src/support/FileInfo.h: have struct stat buf as an object and
11454 not a pointer to one, some changes because of this.
11456 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11457 information in layout when adding the layouts preamble to the
11458 textclass preamble.
11460 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11463 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11464 because of bug in OS/2.
11466 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11468 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11469 \verbatim@font instead of \ttfamily, so that it can be redefined.
11471 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11472 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11473 src/layout.h, src/text2.C: add 'using' directive to bring the
11474 STL templates we need from the std:: namespace to the global one.
11475 Needed by DEC cxx in strict ansi mode.
11477 * src/support/LIstream.h,src/support/LOstream.h,
11478 src/support/lyxstring.h,src/table.h,
11479 src/lyxlookup.h: do not include <config.h> in header
11480 files. This should be done in the .C files only.
11482 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11486 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11488 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11489 from Kayvan to fix the tth invokation.
11491 * development/lyx.spec.in: updates from Kayvan to reflect the
11492 changes of file names.
11494 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11496 * src/text2.C (InsertStringB): use std::copy
11497 (InsertStringA): use std::copy
11499 * src/bufferlist.C: use a vector to store the buffers in. This is
11500 an internal change and should not affect any other thing.
11502 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11505 * src/text.C (Fill): fix potential bug, one off bug.
11507 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11509 * src/Makefile.am (lyx_main.o): add more files it depends on.
11511 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11513 * src/support/lyxstring.C: use size_t for the reference count,
11514 size, reserved memory and xtra.
11515 (internal_compare): new private member function. Now the compare
11516 functions should work for std::strings that have embedded '\0'
11518 (compare): all compare functions rewritten to use
11521 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11523 * src/support/lyxstring.C (compare): pass c_str()
11524 (compare): pass c_str
11525 (compare): pass c_str
11527 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11529 * src/support/DebugStream.C: <config.h> was not included correctly.
11531 * lib/configure: forgot to re-generate it :( I'll make this file
11532 auto generated soon.
11534 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11536 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11539 * src/support/lyxstring.C: some changes from length() to rep->sz.
11540 avoids a function call.
11542 * src/support/filetools.C (SpaceLess): yet another version of the
11543 algorithm...now per Jean-Marc's suggestions.
11545 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11547 * src/layout.C (less_textclass_desc): functor for use in sorting
11549 (LyXTextClass::Read): sort the textclasses after reading.
11551 * src/support/filetools.C (SpaceLess): new version of the
11552 SpaceLess functions. What problems does this one give? Please
11555 * images/banner_bw.xbm: made the arrays unsigned char *
11557 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11559 * src/support/lyxstring.C (find): remove bogus assertion in the
11560 two versions of find where this has not been done yet.
11562 * src/support/lyxlib.h: add missing int return type to
11565 * src/menus.C (ShowFileMenu): disable exporting to html if no
11566 html export command is present.
11568 * config/lib_configure.m4: add a test for an HTML converter. The
11569 programs checked for are, in this order: tth, latex2html and
11572 * lib/configure: generated from config/lib_configure.m4.
11574 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11575 html converter. The parameters are now passed through $$FName and
11576 $$OutName, instead of standard input/output.
11578 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11580 * lib/lyxrc.example: update description of \html_command.
11581 add "quotes" around \screen_font_xxx font setting examples to help
11582 people who use fonts with spaces in their names.
11584 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11586 * Distribution files: updates for v1.1.2
11588 * src/support/lyxstring.C (find): remove bogus assert and return
11589 npos for the same condition.
11591 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11593 * added patch for OS/2 from SMiyata.
11595 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11597 * src/text2.C (CutSelection): make space_wrapped a bool
11598 (CutSelection): dont declare int i until we have to.
11599 (alphaCounter): return a char const *.
11601 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11603 * src/support/syscall.C (Systemcalls::kill):
11604 src/support/filetools.C (PutEnv, PutEnvPath):
11605 src/lyx_cb.C (addNewlineAndDepth):
11606 src/FontInfo.C (FontInfo::resize): condition some #warning
11607 directives with WITH_WARNINGS.
11610 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11612 * src/layout.[Ch] + several files: access to class variables
11613 limited and made accessor functions instead a lot of code changed
11614 becuase of this. Also instead of returning pointers often a const
11615 reference is returned instead.
11617 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11619 * src/Makefile.am (dist-hook): added used to remove the CVS from
11620 cheaders upon creating a dist
11621 (EXTRA_DIST): added cheaders
11623 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11624 a character not as a small integer.
11626 * src/support/lyxstring.C (find): removed Assert and added i >=
11627 rep->sz to the first if.
11629 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11631 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11632 src/LyXView.C src/buffer.C src/bufferparams.C
11633 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11634 src/text2.C src/insets/insetinclude.C:
11635 lyxlayout renamed to textclasslist.
11637 * src/layout.C: some lyxerr changes.
11639 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11640 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11641 (LyXLayoutList): removed all traces of this class.
11642 (LyXTextClass::Read): rewrote LT_STYLE
11643 (LyXTextClass::hasLayout): new function
11644 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11645 both const and nonconst version.
11646 (LyXTextClass::delete_layout): new function.
11647 (LyXTextClassList::Style): bug fix. do the right thing if layout
11649 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11650 (LyXTextClassList::NameOfLayout): ditto
11651 (LyXTextClassList::Load): ditto
11653 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11655 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11657 * src/LyXAction.C (LookupFunc): added a workaround for sun
11658 compiler, on the other hand...we don't know if the current code
11659 compiles on sun at all...
11661 * src/support/filetools.C (CleanupPath): subst fix
11663 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11666 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11667 complained about this one?
11669 * src/insets/insetinclude.C (Latex): subst fix
11671 * src/insets/insetbib.C (getKeys): subst fix
11673 * src/LyXSendto.C (SendtoApplyCB): subst fix
11675 * src/lyx_main.C (init): subst fix
11677 * src/layout.C (Read): subst fix
11679 * src/lyx_sendfax_main.C (button_send): subst fix
11681 * src/buffer.C (RoffAsciiTable): subst fix
11683 * src/lyx_cb.C (MenuFax): subst fix
11684 (PrintApplyCB): subst fix
11686 1999-10-26 Juergen Vigna <jug@sad.it>
11688 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11690 (Read): Cleaned up this code so now we read only format vestion >= 5
11692 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11694 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11695 come nobody has complained about this one?
11697 * src/insets/insetinclude.C (Latex): subst fix
11699 * src/insets/insetbib.C (getKeys): subst fix
11701 * src/lyx_main.C (init): subst fix
11703 * src/layout.C (Read): subst fix
11705 * src/buffer.C (RoffAsciiTable): subst fix
11707 * src/lyx_cb.C (MenuFax): subst fix.
11709 * src/layout.[hC] + some other files: rewrote to use
11710 std::container to store textclasses and layouts in.
11711 Simplified, removed a lot of code. Make all classes
11712 assignable. Further simplifications and review of type
11713 use still to be one.
11715 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11716 lastfiles to create the lastfiles partr of the menu.
11718 * src/lastfiles.[Ch]: rewritten to use deque to store the
11719 lastfiles in. Uses fstream for reading and writing. Simplifies
11722 * src/support/syscall.C: remove explicit cast.
11724 * src/BufferView.C (CursorToggleCB): removed code snippets that
11725 were commented out.
11726 use explicat C++ style casts instead of C style casts. also use
11727 u_vdata instea of passing pointers in longs.
11729 * src/PaperLayout.C: removed code snippets that were commented out.
11731 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11733 * src/lyx_main.C: removed code snippets that wer commented out.
11735 * src/paragraph.C: removed code snippets that were commented out.
11737 * src/lyxvc.C (logClose): use static_cast
11739 (viewLog): remove explicit cast to void*
11740 (showLog): removed old commented code
11742 * src/menus.C: use static_cast instead of C style casts. use
11743 u_vdata instead of u_ldata. remove explicit cast to (long) for
11744 pointers. Removed old code that was commented out.
11746 * src/insets/inset.C: removed old commented func
11748 * src/insets/insetref.C (InsetRef): removed old code that had been
11749 commented out for a long time.
11751 (escape): removed C style cast
11753 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11755 * src/insets/insetlatex.C (Draw): removed old commented code
11756 (Read): rewritten to use string
11758 * src/insets/insetlabel.C (escape): removed C style cast
11760 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11762 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11763 old commented code.
11765 * src/insets/insetinclude.h: removed a couple of stupid bools
11767 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11768 (Clone): remove C style cast
11769 (getKeys): changed list to lst because of std::list
11771 * src/insets/inseterror.C (Draw): removed som old commented code.
11773 * src/insets/insetcommand.C (Draw): removed some old commented code.
11775 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11776 commented out forever.
11777 (bibitem_cb): use static_cast instead of C style cast
11778 use of vdata changed to u_vdata.
11780 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11782 (CloseUrlCB): use static_cast instead of C style cast.
11783 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11785 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11786 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11787 (CloseInfoCB): static_cast from ob->u_vdata instead.
11788 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11791 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11792 (C_InsetError_CloseErrorCB): forward the ob parameter
11793 (CloseErrorCB): static_cast from ob->u_vdata instead.
11795 * src/vspace.h: include LString.h since we use string in this class.
11797 * src/vspace.C (lyx_advance): changed name from advance because of
11798 nameclash with stl. And since we cannot use namespaces yet...I
11799 used a lyx_ prefix instead. Expect this to change when we begin
11802 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11804 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11805 and removed now defunct constructor and deconstructor.
11807 * src/BufferView.h: have backstack as a object not as a pointer.
11808 removed initialization from constructor. added include for BackStack
11810 * development/lyx.spec.in (%build): add CFLAGS also.
11812 * src/screen.C (drawFrame): removed another warning.
11814 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11816 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11817 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11818 README and ANNOUNCE a bit for the next release. More work is
11821 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11822 unbreakable if we are in freespacing mode (LyX-Code), but not in
11825 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11827 * src/BackStack.h: fixed initialization order in constructor
11829 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11831 * acinclude.m4 (VERSION): new rules for when a version is
11832 development, added also a variable for prerelease.
11833 (warnings): we set with_warnings=yes for prereleases
11834 (lyx_opt): prereleases compile with same optimization as development
11835 (CXXFLAGS): only use pedantic if we are a development version
11837 * src/BufferView.C (restorePosition): don't do anything if the
11838 backstack is empty.
11840 * src/BackStack.h: added member empty, use this to test if there
11841 is anything to pop...
11843 1999-10-25 Juergen Vigna <jug@sad.it>
11846 * forms/layout_forms.fd +
11847 * forms/latexoptions.fd +
11848 * lyx.fd: changed for various form resize issues
11850 * src/mathed/math_panel.C +
11851 * src/insets/inseterror.C +
11852 * src/insets/insetinfo.C +
11853 * src/insets/inseturl.C +
11854 * src/insets/inseturl.h +
11856 * src/LyXSendto.C +
11857 * src/PaperLayout.C +
11858 * src/ParagraphExtra.C +
11859 * src/TableLayout.C +
11861 * src/layout_forms.C +
11868 * src/menus.C: fixed various resize issues. So now forms can be
11869 resized savely or not be resized at all.
11871 * forms/form_url.fd +
11872 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11875 * src/insets/Makefile.am: added files form_url.[Ch]
11877 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11879 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11880 (and presumably 6.2).
11882 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11883 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11884 remaining static member callbacks.
11886 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11889 * src/support/lyxstring.h: declare struct Srep as friend of
11890 lyxstring, since DEC cxx complains otherwise.
11892 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11894 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11896 * src/LaTeX.C (run): made run_bibtex also depend on files with
11898 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11899 are put into the dependency file.
11901 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11902 the code has shown itself to work
11903 (create_ispell_pipe): removed another warning, added a comment
11906 * src/minibuffer.C (ExecutingCB): removed code that has been
11907 commented out a long time
11909 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11910 out code + a warning.
11912 * src/support/lyxstring.h: comment out the three private
11913 operators, when compiling with string ansi conforming compilers
11914 they make problems.
11916 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11918 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11919 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11922 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11925 * src/mathed/math_panel.C (create_math_panel): remove explicit
11928 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11931 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11932 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11933 to XCreatePixmapFromBitmapData
11934 (fl_set_bmtable_data): change the last argument to be unsigned
11936 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11937 and bh to be unsigned int, remove explicit casts in call to
11938 XReadBitmapFileData.
11940 * images/arrows.xbm: made the arrays unsigned char *
11941 * images/varsz.xbm: ditto
11942 * images/misc.xbm: ditto
11943 * images/greek.xbm: ditto
11944 * images/dots.xbm: ditto
11945 * images/brel.xbm: ditto
11946 * images/bop.xbm: ditto
11948 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11950 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11951 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11952 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11954 (LYX_CXX_CHEADERS): added <clocale> to the test.
11956 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11958 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11960 * src/support/lyxstring.C (append): fixed something that must be a
11961 bug, rep->assign was used instead of rep->append.
11963 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11966 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11967 lyx insert double chars. Fix spotted by Kayvan.
11969 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11971 * Fixed the tth support. I messed up with the Emacs patch apply feature
11972 and omitted the changes in lyxrc.C.
11974 1999-10-22 Juergen Vigna <jug@sad.it>
11976 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11978 * src/lyx_cb.C (MenuInsertRef) +
11979 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11980 the form cannot be resized under it limits (fixes a segfault)
11982 * src/lyx.C (create_form_form_ref) +
11983 * forms/lyx.fd: Changed Gravity on name input field so that it is
11986 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11988 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11989 <ostream> and <istream>.
11991 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11992 whether <fstream> provides the latest standard features, or if we
11993 have an oldstyle library (like in egcs).
11994 (LYX_CXX_STL_STRING): fix the test.
11996 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11997 code on MODERN_STL_STREAM.
11999 * src/support/lyxstring.h: use L{I,O}stream.h.
12001 * src/support/L{I,O}stream.h: new files, designed to setup
12002 correctly streams for our use
12003 - includes the right header depending on STL capabilities
12004 - puts std::ostream and std::endl (for LOStream.h) or
12005 std::istream (LIStream.h) in toplevel namespace.
12007 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12009 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12010 was a bib file that had been changed we ensure that bibtex is run.
12011 (runBibTeX): enhanced to extract the names of the bib files and
12012 getting their absolute path and enter them into the dep file.
12013 (findtexfile): static func that is used to look for tex-files,
12014 checks for absolute patchs and tries also with kpsewhich.
12015 Alternative ways of finding the correct files are wanted. Will
12017 (do_popen): function that runs a command using popen and returns
12018 the whole output of that command in a string. Should be moved to
12021 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12022 file with extension ext has changed.
12024 * src/insets/figinset.C: added ifdef guards around the fl_free
12025 code that jug commented out. Now it is commented out when
12026 compiling with XForms == 0.89.
12028 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12029 to lyxstring.C, and only keep a forward declaration in
12030 lyxstring.h. Simplifies the header file a bit and should help a
12031 bit on compile time too. Also changes to Srep will not mandate a
12032 recompile of code just using string.
12033 (~lyxstring): definition moved here since it uses srep.
12034 (size): definition moved here since it uses srep.
12036 * src/support/lyxstring.h: removed a couple of "inline" that should
12039 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12041 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12044 1999-10-21 Juergen Vigna <jug@sad.it>
12046 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12047 set to left if I just remove the width entry (or it is empty).
12049 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12050 paragraph when having dummy paragraphs.
12052 1999-10-20 Juergen Vigna <jug@sad.it>
12054 * src/insets/figinset.C: just commented some fl_free_form calls
12055 and added warnings so that this calls should be activated later
12056 again. This avoids for now a segfault, but we have a memory leak!
12058 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12059 'const char * argument' to 'string argument', this should
12060 fix some Asserts() in lyxstring.C.
12062 * src/lyxfunc.h: Removed the function argAsString(const char *)
12063 as it is not used anymore.
12065 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12067 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12070 * src/Literate.h: some funcs moved from public to private to make
12071 interface clearer. Unneeded args removed.
12073 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12075 (scanBuildLogFile): ditto
12077 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12078 normal TeX Error. Still room for improvement.
12080 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12082 * src/buffer.C (insertErrors): changes to make the error
12083 desctription show properly.
12085 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12088 * src/support/lyxstring.C (helper): changed to use
12089 sizeof(object->rep->ref).
12090 (operator>>): changed to use a pointer instead.
12092 * src/support/lyxstring.h: changed const reference & to value_type
12093 const & lets see if that helps.
12095 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12097 * Makefile.am (rpmdist): fixed to have non static package and
12100 * src/support/lyxstring.C: removed the compilation guards
12102 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12105 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12106 conditional compile of lyxstring.Ch
12108 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12109 stupid check, but it is a lot better than the bastring hack.
12110 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12112 * several files: changed string::erase into string::clear. Not
12115 * src/chset.C (encodeString): use a char temporary instead
12117 * src/table.C (TexEndOfCell): added tostr around
12118 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12119 (TexEndOfCell): ditto
12120 (TexEndOfCell): ditto
12121 (TexEndOfCell): ditto
12122 (DocBookEndOfCell): ditto
12123 (DocBookEndOfCell): ditto
12124 (DocBookEndOfCell): ditto
12125 (DocBookEndOfCell): ditto
12127 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12129 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12131 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12132 (MenuBuildProg): added tostr around ret
12133 (MenuRunChktex): added tostr around ret
12134 (DocumentApplyCB): added tostr around ret
12136 * src/chset.C (encodeString): added tostr around t->ic
12138 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12139 (makeLaTeXFile): added tostr around tocdepth
12140 (makeLaTeXFile): added tostr around ftcound - 1
12142 * src/insets/insetbib.C (setCounter): added tostr around counter.
12144 * src/support/lyxstring.h: added an operator+=(int) to catch more
12147 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12148 (lyxstring): We DON'T allow NULL pointers.
12150 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12152 * src/mathed/math_macro.C (MathMacroArgument::Write,
12153 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12154 when writing them out.
12156 * src/LString.C: remove, since it is not used anymore.
12158 * src/support/lyxstring.C: condition the content to
12159 USE_INCLUDED_STRING macro.
12161 * src/mathed/math_symbols.C, src/support/lstrings.C,
12162 src/support/lyxstring.C: add `using' directive to specify what
12163 we need in <algorithm>. I do not think that we need to
12164 conditionalize this, but any thought is appreciated.
12166 * many files: change all callback functions to "C" linkage
12167 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12168 strict_ansi. Those who were static are now global.
12169 The case of callbacks which are static class members is
12170 trickier, since we have to make C wrappers around them (see
12171 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12172 did not finish this yet, since it defeats the purpose of
12173 encapsulation, and I am not sure what the best route is.
12175 1999-10-19 Juergen Vigna <jug@sad.it>
12177 * src/support/lyxstring.C (lyxstring): we permit to have a null
12178 pointer as assignment value and just don't assign it.
12180 * src/vspace.C (nextToken): corrected this function substituting
12181 find_first(_not)_of with find_last_of.
12183 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12184 (TableOptCloseCB) (TableSpeCloseCB):
12185 inserted fl_set_focus call for problem with fl_hide_form() in
12188 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12190 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12193 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12195 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12196 LyXLex::next() and not eatline() to get its argument.
12198 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12200 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12201 instead, use fstreams for io of the depfile, removed unneeded
12202 functions and variables.
12204 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12205 vector instead, removed all functions and variables that is not in
12208 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12210 * src/buffer.C (insertErrors): use new interface to TeXError
12212 * Makefile.am (rpmdist): added a rpmdist target
12214 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12215 per Kayvan's instructions.
12217 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12219 * src/Makefile.am: add a definition for localedir, so that locales
12220 are found after installation (Kayvan)
12222 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12224 * development/.cvsignore: new file.
12226 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12228 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12229 C++ compiler provides wrappers for C headers and use our alternate
12232 * configure.in: use LYX_CXX_CHEADERS.
12234 * src/cheader/: new directory, populated with cname headers from
12235 libstdc++-2.8.1. They are a bit old, but probably good enough for
12236 what we want (support compilers who lack them).
12238 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12239 from includes. It turns out is was stupid.
12241 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12243 * lib/Makefile.am (install-data-local): forgot a ';'
12244 (install-data-local): forgot a '\'
12245 (libinstalldirs): needed after all. reintroduced.
12247 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12249 * configure.in (AC_OUTPUT): added lyx.spec
12251 * development/lyx.spec: removed file
12253 * development/lyx.spec.in: new file
12255 * po/*.po: merged with lyx.pot becuase of make distcheck
12257 * lib/Makefile.am (dist-hook): added dist-hook so that
12258 documentation files will be included when doing a make
12259 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12260 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12262 more: tried to make install do the right thing, exclude CVS dirs
12265 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12266 Path would fit in more nicely.
12268 * all files that used to use pathstack: uses now Path instead.
12269 This change was a lot easier than expected.
12271 * src/support/path.h: new file
12273 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12275 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12277 * src/support/lyxstring.C (getline): Default arg was given for
12280 * Configure.cmd: removed file
12282 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12284 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12285 streams classes and types, add the proper 'using' statements when
12286 MODERN_STL is defined.
12288 * src/debug.h: move the << operator definition after the inclusion
12291 * src/support/filetools.C: include "LAssert.h", which is needed
12294 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12297 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12298 include "debug.h" to define a proper ostream.
12300 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12302 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12303 method to the SystemCall class which can kill a process, but it's
12304 not fully implemented yet.
12306 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12308 * src/support/FileInfo.h: Better documentation
12310 * src/lyxfunc.C: Added support for buffer-export html
12312 * src/menus.C: Added Export->As HTML...
12314 * lib/bind/*.bind: Added short-cut for buffer-export html
12316 * src/lyxrc.*: Added support for new \tth_command
12318 * lib/lyxrc.example: Added stuff for new \tth_command
12320 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12322 * lib/Makefile.am (IMAGES): removed images/README
12323 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12324 installes in correct place. Check permisions is installed
12327 * src/LaTeX.C: some no-op changes moved declaration of some
12330 * src/LaTeX.h (LATEX_H): changed include guard name
12332 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12334 * lib/reLyX/Makefile.am: install noweb2lyx.
12336 * lib/Makefile.am: install configure.
12338 * lib/reLyX/configure.in: declare a config aux dir; set package
12339 name to lyx (not sure what the best solution is); generate noweb2lyx.
12341 * lib/layouts/egs.layout: fix the bibliography layout.
12343 1999-10-08 Jürgen Vigna <jug@sad.it>
12345 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12346 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12347 it returned without continuing to search the path.
12349 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12351 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12352 also fixes a bug. It is not allowed to do tricks with std::strings
12353 like: string a("hei"); &a[e]; this will not give what you
12354 think... Any reason for the complexity in this func?
12356 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12358 * Updated README and INSTALL a bit, mostly to check that my
12359 CVS rights are correctly set up.
12361 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12363 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12364 does not allow '\0' chars but lyxstring and std::string does.
12366 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12368 * autogen.sh (AUTOCONF): let the autogen script create the
12369 POTFILES.in file too. POTFILES.in should perhaps now not be
12370 included in the cvs module.
12372 * some more files changed to use C++ includes instead of C ones.
12374 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12376 (Reread): added tostr to nlink. buggy output otherwise.
12377 (Reread): added a string() around szMode when assigning to Buffer,
12378 without this I got a log of garbled info strings.
12380 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12383 * I have added several ostream & operator<<(ostream &, some_type)
12384 functions. This has been done to avoid casting and warnings when
12385 outputting enums to lyxerr. This as thus eliminated a lot of
12386 explicit casts and has made the code clearer. Among the enums
12387 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12388 mathed enums, some font enum the Debug::type enum.
12390 * src/support/lyxstring.h (clear): missing method. equivalent of
12393 * all files that contained "stderr": rewrote constructs that used
12394 stderr to use lyxerr instead. (except bmtable)
12396 * src/support/DebugStream.h (level): and the passed t with
12397 Debug::ANY to avoid spurious bits set.
12399 * src/debug.h (Debug::type value): made it accept strings of the
12400 type INFO,INIT,KEY.
12402 * configure.in (Check for programs): Added a check for kpsewhich,
12403 the latex generation will use this later to better the dicovery of
12406 * src/BufferView.C (create_view): we don't need to cast this to
12407 (void*) that is done automatically.
12408 (WorkAreaButtonPress): removed some dead code.
12410 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12412 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12413 is not overwritten when translated (David Sua'rez de Lis).
12415 * lib/CREDITS: Added David Sua'rez de Lis
12417 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12419 * src/bufferparams.C (BufferParams): default input encoding is now
12422 * acinclude.m4 (cross_compiling): comment out macro
12423 LYX_GXX_STRENGTH_REDUCE.
12425 * acconfig.h: make sure that const is not defined (to empty) when
12426 we are compiling C++. Remove commented out code using SIZEOF_xx
12429 * configure.in : move the test for const and inline as late as
12430 possible so that these C tests do not interefere with C++ ones.
12431 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12432 has not been proven.
12434 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12436 * src/table.C (getDocBookAlign): remove bad default value for
12437 isColumn parameter.
12439 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12441 (ShowFileMenu2): ditto.
12443 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12444 of files to ignore.
12446 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12448 * Most files: finished the change from the old error code to use
12449 DebugStream for all lyxerr debugging. Only minor changes remain
12450 (e.g. the setting of debug levels using strings instead of number)
12452 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12454 * src/layout.C (Add): Changed to use compare_no_case instead of
12457 * src/FontInfo.C: changed loop variable type too string::size_type.
12459 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12461 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12462 set ETAGS_ARGS to --c++
12464 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12466 * src/table.C (DocBookEndOfCell): commented out two unused variables
12468 * src/paragraph.C: commented out four unused variables.
12470 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12471 insed a if clause with type string::size_type.
12473 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12476 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12478 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12479 variable, also changed loop to go from 0 to lenght + 1, instead of
12480 -1 to length. This should be correct.
12482 * src/LaTeX.C (scanError): use string::size_type as loop variable
12485 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12486 (l.896) since y_tmp and row was not used anyway.
12488 * src/insets/insetref.C (escape): use string::size_type as loop
12491 * src/insets/insetquotes.C (Width): use string::size_type as loop
12493 (Draw): use string::size_type as loop variable type.
12495 * src/insets/insetlatexaccent.C (checkContents): use
12496 string::size_type as loop variable type.
12498 * src/insets/insetlabel.C (escape): use string::size_type as loop
12501 * src/insets/insetinfo.C: added an extern for current_view.
12503 * src/insets/insetcommand.C (scanCommand): use string::size_type
12504 as loop variable type.
12506 * most files: removed the RCS tags. With them we had to recompile
12507 a lot of files after a simple cvs commit. Also we have never used
12508 them for anything meaningful.
12510 * most files: tags-query-replace NULL 0. As adviced several plases
12511 we now use "0" instead of "NULL" in our code.
12513 * src/support/filetools.C (SpaceLess): use string::size_type as
12514 loop variable type.
12516 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12518 * src/paragraph.C: fixed up some more string stuff.
12520 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12522 * src/support/filetools.h: make modestr a std::string.
12524 * src/filetools.C (GetEnv): made ch really const.
12526 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12527 made code that used these use max/min from <algorithm> instead.
12529 * changed several c library include files to their equivalent c++
12530 library include files. All is not changed yet.
12532 * created a support subdir in src, put lyxstring and lstrings
12533 there + the extra files atexit, fileblock, strerror. Created
12534 Makefile.am. edited configure.in and src/Makefile.am to use this
12535 new subdir. More files moved to support.
12537 * imported som of the functions from repository lyx, filetools
12539 * ran tags-query-replace on LString -> string, corrected the bogus
12540 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12541 is still some errors in there. This is errors where too much or
12542 too litle get deleted from strings (string::erase, string::substr,
12543 string::replace), there can also be some off by one errors, or
12544 just plain wrong use of functions from lstrings. Viewing of quotes
12547 * LyX is now running fairly well with string, but there are
12548 certainly some bugs yet (see above) also string is quite different
12549 from LString among others in that it does not allow null pointers
12550 passed in and will abort if it gets any.
12552 * Added the revtex4 files I forgot when setting up the repository.
12554 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12556 * All over: Tried to clean everything up so that only the files
12557 that we really need are included in the cvs repository.
12558 * Switched to use automake.
12559 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12560 * Install has not been checked.
12562 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12564 * po/pt.po: Three errors:
12565 l.533 and l.538 format specification error
12566 l. 402 duplicate entry, I just deleted it.