1 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
4 match the requirements from the standard better. This is required
5 to work with gnu libstdc++-v3
7 * src/frontends/xforms/FormPreferences.C: add explict pair
8 arguments to browse calls. include support/lyxmanip.h remvoe
9 extern fmt. whitespace changes. reorder variables in
10 FormPreferences.h, to match initalizaton order.
12 * several files: constify more local variables.
14 * src/buffer.C: remove some commented functions.
16 * src/DepTable.C (remove_files_with_extension): temporary
17 work around for gcc 2.97
18 * src/filedlg.C (find): ditto
19 * src/Variables.C (set): ditto
20 * src/LyXAction.C (searchActionArg): ditto
21 (retrieveActionArg): ditto
23 * configure.in: check for mktemp too
25 * UPGRADING: prepare for 1.1.6
27 * Makefile.am (lgbtags): add backup tags for when etags are
30 * ANNOUNCE: prepare for 1.1.6
32 * src/support/tempname.C (make_tempfile): new function, wrapper
33 around mkstemp and mktemp. Only mkstemp has been tested.
36 2000-11-14 Rob Lahaye <lahaye@postech.edu>
38 * default.ui: capitalized some menu items to improve shortcuts.
40 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
42 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
44 * src/frontends/xforms/Dialogs.C: add "using" directive.
46 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
48 * src/filedlg.C (Select): highlight suggested file in browser, if
51 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
52 each tab folder is encapsulated in its own class.
53 The Language keymaps are now chosen using a text input and a
54 browser button, rather than a Combox.
55 All the browser buttons are now functional, although LyXFileDlg
56 still needs to be modified to make it straighhtforward to return a
57 directory if that is what is desired.
59 * src/frontends/xforms/forms/form_preferences.fd: use text input
60 and browse button to input the Language keymaps. Add a few
61 callbacks for the browse buttons.
63 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
65 * src/support/tempname.C (tempName): small changes to make it
66 safer. remove the '.' before XXXXXX
68 * src/support/filetools.C (TmpFileName): remove func
71 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
72 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
73 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
74 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
76 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
79 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
82 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
83 for bp (this fixes a reproducible hard crash)
85 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
88 * src/frontends/xforms/FormBase.h: make bp_ private
89 (FormBaseBI): remove default for bp
92 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
95 * src/frontends/xforms/Color.C (RGBColor): made several vars
96 const, changed initialization of j to allow it to be const
99 * several files: added const to local variables.
101 * src/lyx_cb.C: removed several function prototypes and moved them
105 (UpdateLayoutPreamble):
107 (MenuInsertLabel): add BufferView as arguemnt
108 (LayoutsCB): make tmp const
110 * src/layout_forms.h: regenerated
112 * src/debug.C: add Debug::FILES
113 (showLevel) (showTags): translate the desc
115 * src/debug.h: add FILES as debug target
117 * src/bufferlist.C: use current_view as an interim measure becuase
118 of added arguments to MenuWrite and MenuWriteAs
120 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
122 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
124 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
125 libstdc++ is compiled with.
127 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
129 * lib/layouts/docbook-book.layout
130 * lib/layouts/docbook.layout
131 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
132 those paragraphs are expresse as SGML comments <!-- -->.
134 * src/LaTeXFeatures.h
135 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
136 parameter, this allows to express all the include files as relative
137 paths to the master buffer. The verbatim insert works as the other
140 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
142 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
144 (MakeDocBookFile): top_element is always written. Some clean up, as
145 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
147 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
148 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
149 a reference is written instead of the name.
150 (Validate): use the relative path for the filename.
152 * src/insets/insetlabel.C (DocBook): write end tag, for XML
155 * src/support/filetools.h
156 * src/support/filetools.C (IsSGMLFilename): added.
159 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
161 * development/OS2/quick_fix.patch:
163 * README.OS2: quick update to the OS/2 port.
165 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
167 * src/converter.C: add "using" directive.
169 * src/frontends/xforms/FormPreferences.C: add "using" directive.
170 (compare_converter): add "int" as return type.
172 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
175 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
177 * src/lyx_gui.C (create_forms): map the xform colours, should a
178 mapping exist. Ie, call XformColor::read().
180 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
181 and struct HSV as HSVColor.
182 (XformColor::read, XformColor::write) : new methods that
183 input/output any changes to the cform GUI colors.
185 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
188 * src/frontends/xforms/FormPreferences.C Lots of little changes
189 associated with the changed name of the RGB and HSV structs. Can
190 now save changes to xforms GUI to file. Commented out
191 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
192 used currently anyway.
194 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
196 * src/converter.C: A lot of changes:
197 - It is no longer possible to choose between two or more ways to
198 export to some format (the new code uses only the shortest path).
199 However, it is still possible to choose between pdflatex/ps2pdf
200 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
201 - Added several methods that makes the FormPreferences code simpler.
202 - Changed the tokens $$FName and $$OutName to $$i and $$o.
204 * src/exporter.C (Export): lyxrc.use_pdf is set before
205 makeLaTeXFile is called. This works but not very nice.
207 * src/frontends/xforms/FormPreferences.C: The formats/converters
208 tabs are now fully functional.
210 * src/buffer.C (getTocList): Add numbers to the captions.
212 * lib/lyxrc.example: Removed fax section
214 * src/support/rename.C (rename): Delete the old file if lyx::copy
217 2000-11-13 Rob Lahaye <lahaye@postech.edu>
219 * lib/ui/default.ui: minor polishing.
221 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
223 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
226 * lib/Makefile.am (DOCINST): do not install everything in the
227 documentation directory.
229 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
231 * src/bufferlist.C (newFile): set the filename to the constructed
234 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
235 constructed "newfileXX.lyx" name to the dialog
237 * src/frontends/DialogBase.h: make update() non-abstract so
238 KDE doesn't need to implement two update methods for every form
240 * src/frontends/kde/Makefile.am: add missing xforms objects
243 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
245 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
247 * src/frontends/xforms/Color.[Ch]: new files, defining the color
248 structs RGB and HSV. May not be the best place for these files.
249 Perhaps move them into src ?
251 * src/frontends/xforms/Makefile.am: added new files.
253 * src/frontends/xforms/forms/form_preferences.fd:
254 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
255 replaced all instances of "colour" with "color"!
257 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
260 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
261 tab. Can now alter the colors of the xform's GUI on the fly. With
262 the aid of a single static Signal (see below), can "Apply" these
263 changes to all currently open dialogs. (Well, to all of the NEW
264 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
265 subsequently opened dialogs will, of course, also have the new
266 color scheme. Cannot yet save (or load) the choices to file, so
267 they are lost when exiting LyX.
269 * src/frontends/Dialogs.h:
270 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
271 Used to trigger a redraw of any dialogs connected to it because,
272 for example, the GUI colours have been re-mapped.
274 * src/frontends/xforms/FormBase.[Ch]:
275 * src/frontends/xforms/FormDocument.[Ch]:
276 * src/frontends/xforms/FormParagraph.[Ch]:
277 * src/frontends/xforms/FormPreferences.[Ch]:
278 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
279 method, to be connected to Dialogs::redrawGUI. Method must be
280 virtual, because dialogs with tabbed folders need to redraw the
281 forms of each tab folder.
283 * src/LyXView.C (d-tor):
284 * src/frontends/xforms/FormBase.C (d-tor): connected
285 Dialogs::redrawGUI signal to redraw().
287 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
288 removed Assert, because it is identical to that in FormBase.
290 2000-11-10 Rob Lahaye <lahaye@postech.edu>
292 * lib/ui/default.ui: minor polishing.
294 2000-11-10 Juergen Vigna <jug@sad.it>
296 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
297 (deleteLyXText): ditto
299 * src/insets/insettabular.C (InsetButtonPress): don't clear the
300 selection on mouse-button-3.
302 * src/insets/insettabular.h: new function clearSelection(), use this
303 functions inside insettabular.C.
305 * src/insets/insettabular.C (TabularFeatures): clear the selection
306 on remove_row/column.
308 * src/insets/inset.C (scroll): fixed some scroll stuff.
310 * src/insets/insettabular.C (draw): fixed another minor draw problem.
312 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
314 * lib/CREDITS: add Yves Bastide
316 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
318 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
319 check whether C library functions are in the global namespace.
321 * configure.in: calls it.
323 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
326 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
328 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
329 iterators to prevent crash.
331 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
333 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
335 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
336 shortcut for xforms CB to the preemptive or post-handler function.
338 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
339 removed the HIDDEN_TIMER as it's no longer used.
340 Various other small changes.
342 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
343 preemptive handler to obtain feedback, rather than the post-handler.
344 (ColoursLoadBrowser): find "black" and "white" based on RGB values
346 Formats tab is now complete. Converters tab is nearly so.
348 2000-11-09 Juergen Vigna <jug@sad.it>
350 * src/insets/insettext.C (~InsetText):
353 (SetParagraphData): set cache.second to 0 after deleting it!
354 (getLyXText): check if cache.second is not 0 if finding it.
356 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
358 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
359 lyxlex to parse the rgb.txt file.
362 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
363 replace the default '#' comment character.
365 * src/support/tempname.C: add "using" directive
366 * src/frontends/ButtonPolicies.C: ditto.
368 * src/support/filetools.C (DirList): add an explicit cast to avoid
369 a compile error (probably not the right fix)
371 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
373 * src/support/filetools.C (DirList): implement using system functions
375 * src/support/tempname.C: new file
377 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
379 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
381 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
384 * src/frontends/xforms/ButtonController.C: new file
386 * src/os2_defines.h: remove getcwd define
388 * src/lyxvc.C: include support/lyxlib.h
389 (showLog): use lyx::tempName
391 * src/lyx_cb.C: comment out includes that we don't need
392 (AutoSave): use lyx::tempName
394 * src/filedlg.C: include support/lyxlib.h
395 (Reread): use lyx::getcwd
397 * src/converter.C: include support/filetools.h
398 (add_options): change to static inline, make tail const
399 (Add): make old_viewer const
400 (GetAllFormats): make it a const method, use const_iterator
401 (enable): make static inline
402 (SplitFormat): make using_format const
404 * src/LaTeX.C (run): use lyx::getcwd
406 * configure.in: check for mkstemp as well
408 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
410 * src/converter.[Ch] (GetAllCommands): new method.
412 * src/support/filetools.[Ch] (DirList): new method.
414 * src/frontends/xforms/FormPreferences.C: started (just!) adding
415 functionality to the converters tab.
416 The formats tab is now nearly complete.
417 The kbmap choices in Languages tab now display the contents of
418 system_lyxdir/kbd/*.kmap in readable form.
420 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
421 Moved some variables into the class.
423 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
424 inactive tab folder to FL_COL1. Haven't yet worked out how to change
425 colour of active folder to lighter grey instead. Any takers?
426 (form_colours): added an "Apply" button.
427 (form_converters): added a "Flags" input field.
428 (form_formats): added a "Shortcut" input field. Note that we can't use
429 names such as "input_shortcut" as this buggers up the sed script stuff.
431 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
439 * src/lyx_sendfax_main.C:
442 * src/spellchecker.C:
443 * src/insets/figinset.C:
444 * src/insets/insetbib.C:
445 * src/insets/insetexternal.C:
446 * src/insets/insetinclude.C:
447 * src/insets/insetinfo.C:
448 * src/mathed/math_panel.C:
449 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
450 all "daughter" dialogs now have identical "feel".
452 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
454 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
455 used (and was only used in one place prior to this patch. Incorrectly!)
457 * src/frontends/xforms/FormDocument.C: changed some instances of
458 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
459 sense. Also added fl_set_input_return() for class_->input_doc_extra and
460 for options_->input_float_placement. This fixes a bug reported by
463 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
464 functionality into d-tor.
466 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
467 input of numerals also.
469 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
470 fl_set_form_atclose(). Can now close dialog from window manager,
471 fixing a bug reported by Rob Lahaye.
473 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
475 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
476 are no longer dark. Haven't yet worked out how to lighten the colour of
477 the active tabfolder. Any ideas anybody?
478 Adjusted Colours tab a little.
479 Added Shortcut field to converters tab. Note that we can't create an
480 fdesign label like "input_shortcut" as this buggers up the sed-script
483 * src/frontends/xforms/FormPreferences.[Ch]:
484 (feedback): fixed crash due to to ob=0.
485 (LanguagesXXX): the kbmap choices now contain the files
486 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
487 be replaced by an input with a file browse button, but since the browse
488 buttons don'y yet work, this'll do for the moment.
489 (FormatsXXX): think that this is now nearly fully functional.
490 Some points/questions though:
491 1. Does "Apply" remove formats if no longer present?
492 2. I think that the browser should list the GUI names rather than the
494 3. Must ensure that we can't delete Formats used by an existing
497 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
498 if this is the best way to do this.
500 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
502 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
504 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
505 for variable assignment.
507 2000-11-07 Rob Lahaye <lahaye@postech.edu>
509 * src/lib/ui/default.ui: added sub/superscripts to menu as
510 Insert->Special characters and cleaned-up the file a bit
512 2000-11-07 Allan Rae <rae@lyx.org>
514 * src/frontends/xforms/FormPreferences.C (feedback): make sure
515 ob isn't 0 before using it. See comments in function.
517 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
519 * src/frontends/xforms/form_*.C: regenerated
521 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
523 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
525 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
526 compiling with gcc-2.96
528 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
530 * src/support/lyxstring.C: add a couple "using" directives.
532 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
533 a .c_str() here too for good measure.
534 * src/Spacing.C (set): ditto.
535 * src/lyxfunc.C (Dispatch): ditto.
537 * src/insets/insettabular.C (copySelection): change .str() to
538 .str().c_str() to fix problems with lyxstring.
539 * src/support/filetools.C (GetFileContents): ditto.
540 * src/buffer.C (asciiParagraph): ditto.
541 * src/paragraph.C (String): ditto.
543 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
544 * lib/bind/sciword.bind: ditto.
546 * src/LyXAction.C (init): remove "symbol-insert" function, which
547 shared LFUN_INSERT_MATH with "math-insert".
549 * lib/configure.m4: == is not a valid operator for command test.
551 * src/lyxrc.C: add using directive.
553 * src/converter.h: add std:: qualifier.
555 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
557 * src/converter.[Ch] and other files: Change the Format class to a
558 real class, and create two instances: formats and system_format.
560 * src/lyxrc.C (output): Output the difference between formats and
563 * src/frontends/xforms/FormPreferences.C (input): Simplify.
564 (buildFormats): Insert formats into browser.
565 (inputFormats): Made the browser and add button functional.
566 (applyFormats): Update formats from format_vec.
568 * src/converter.C: Changed all (*it). to it->
569 (Format::dummy): New method.
570 (Format::importer): New format flag.
571 (Formats::GetAllFormats): New method.
572 (Formats::Add): Delete format from the map if prettyname is empty.
573 (Converter::Convert): Print an error message if moving the file fails.
574 (Converter::GetReachableTo): New method
576 * src/MenuBackend.[Ch]: Add support for importformats tag.
578 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
580 * lib/configure.m4: Add word->tex and ps->fax converters.
582 * lib/ui/default.ui: Use ImportFormats on file->import menu.
583 Return fax to file menu.
587 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
589 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
592 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
595 * src/lyxfunc.C (processKeyEvent): removed
597 * src/bufferlist.C (emergencyWrite): removed the out commented
598 emergency write code.
600 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
602 * src/LyXView.[Ch]: remove the outcommented raw_callback code
604 * many files: change formatting to be a bit more uniform for
605 if,while,for,switch statements, remove some parantesis not needed.
608 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
610 * config/kde.m4: make config more robust when KDEDIR is set
612 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
614 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
615 not returned a pixmap for "math-insert".
617 * src/LyXAction.C (init): sort the entries a bit.
619 2000-11-03 Juergen Vigna <jug@sad.it>
621 * src/insets/insettabular.h: added fixed number to update codes so
622 that update is only in one direction.
624 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
627 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
628 before call to edit because of redraw.
630 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
632 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
634 * lib/ui/default.ui: Populate "edit_float" menu
636 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
638 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
639 "floats-operate". The name is ugly (and the func also), but this
640 is just a band-aid until we switch to new insets.
642 2000-11-03 Rob Lahaye <lahaye@postech.edu>
644 * lib/ui/default.ui: update again the menu layout (fix some
647 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
649 * src/MenuBackend.h (fulllabel): new method.
651 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
652 the menu shortcuts of a menu are unique and whether they
653 correspond to a letter of the label.
654 (expand): call checkShortcuts when debugging.
656 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
658 * src/insets/insettext.C (InsetButtonPress): shut off warning.
660 2000-11-02 Lior Silberman <lior@Princeton.EDU>
662 * lib/examples/*.lyx : '\language default' => '\language english'
664 * lib/examples/it_splash.lyx : except where it should be italian
666 * lib/templates/*.lyx : the same
668 * doc/*.lyx* : the same
670 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
672 * lib/bind/menus.bind: remove the Layout menu entries, which I
673 somehow forgot earlier.
675 2000-11-03 Rob Lahaye <lahaye@postech.edu>
677 * lib/ui/old-default.ui: keep the old one here for reference (to
680 * lib/ui/default.ui: update the menu layout
682 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
684 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
685 Can now Apply to different insets without closing the dialog.
687 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
688 Can't actually DO anything with them yet, but I'd like a little
691 * src/frontends/xforms/input_validators.[ch]
692 (fl_lowercase_filter): new.
694 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
696 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
697 of MATH_CODE. This fixes a bug with math-macros in RTL text.
699 * src/text.C (PrepareToPrint): Show math-macros block aligned.
701 2000-11-02 Juergen Vigna <jug@sad.it>
703 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
704 on char insertion as it has already be updated by bv->updateInset().
706 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
707 if an inset inside was updated.
709 * lib/configure.cmd: commented out fax-search code
711 2000-11-01 Yves Bastide <stid@acm.org>
713 * src/tabular.C (OldFormatRead): set tabular language to the
716 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
718 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
719 class names with non-letter characters (from Yves Bastide).
721 * lib/ui/default.ui: change Item to OptItem in import menu.
722 Comment out fax stuff.
724 * lib/configure.m4: comment out fax-related stuff.
726 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
728 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
729 useful xforms helper functions. At present contains only formatted().
730 Input a string and it returns it with line breaks so that in fits
733 * src/frontends/xforms/Makefile.am: add new files.
735 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
736 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
739 * src/frontends/xforms/FormPreferences.[Ch]:
740 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
741 but lots of little clean ups. Removed enum State. Make use of
742 formatted(). Constify lots of methods. Perhaps best of all: removed
743 requirement for that horrible reinterpret_cast from pointer to long in
746 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
748 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
749 conditionalize build on xforms < 0.89
751 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
753 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
755 * src/LyXAction.C (init): comment out fax
757 * src/lyxrc.h: comment out the fax enums
758 comment out the fax variables
760 * src/commandtags.h: comment out LFUN_FAX
762 * src/lyxrc.C: disable fax variables.
763 (read): disable parsing of fax variables
764 (output): disable writing of fax variables
765 (getFeedback): now description for fax variables
767 * src/lyxfunc.C: comment out MenuFax
768 (Dispatch): disable LFUN_FAX
770 * src/lyx_cb.C (MenuFax): comment out
772 * src/WorkArea.C: add <cctype>
773 (work_area_handler): better key handling, should be ok now.
774 for accented chars + etc
776 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
777 lyx_sendfax.h and lyx_sendfax_man.C
779 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
780 (show): don't call InitLyXLookup when using xforms 0.89
782 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
784 * src/trans.C (AddDeadkey): better fix, the other one could crash...
786 * src/support/filetools.C (GetFileContents): close to dummy change
788 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
790 * src/trans.C (AddDeadkey): workaround stupid compilers.
792 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
794 * src/frontends/xforms/FormDocument.C (class_update): fix setting
795 of two-sided document.
797 2000-10-31 Juergen Vigna <jug@sad.it>
799 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
801 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
802 xposition to the Edit call.
804 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
806 * src/trans.C (AddDeadkey): cast explicitly to char.
808 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
810 * src/tabular.C (AsciiBottomHLine): simplify?
811 (AsciiTopHLine): simplify?
812 (print_n_chars): simplify
813 (DocBook): remove most of the << endl; we should flush the stream
814 as seldom as possible.
816 (TeXBottomHLine): ditto
819 (write_attribute): try a templified version.
820 (set_row_column_number_info): lesson scope of variables
822 * src/support/lstrings.h (tostr): new specialization of tostr
824 * src/trans.C (AddDeadkey): slightly cleaner fix.
826 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
828 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
829 '%%' in Toc menu labels.
832 * src/insets/insetlatexaccent.C (draw): Correct rendering when
833 font_norm is iso10646-1.
835 * src/font.C (ascent): Fixed for 16bit fonts
836 (descent,lbearing,rbearing): ditto
838 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
840 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
841 (getFeedback): new static method.
843 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
844 Now use combox rather than choice to display languages.
845 Feedback is now output using a new timer callback mechanism, identical
846 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
848 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
850 * src/minibuffer.C: fix for older compilers
852 2000-10-30 Juergen Vigna <jug@sad.it>
854 * src/insets/insettext.C (InsertInset): fixed this as the cursor
855 has to be Left of the inset otherwise LyXText won't find it!
857 * src/BufferView2.C (open_new_inset): delete the inset if it can
860 2000-10-30 Rob Lahaye <lahaye@postech.edu>
864 2000-10-29 Marko Vendelin <markov@ioc.ee>
865 * src/frontends/gnome/FormCitation.C
866 * src/frontends/gnome/FormCitation.h
867 * src/frontends/gnome/FormCopyright.C
868 * src/frontends/gnome/FormCopyright.h
869 * src/frontends/gnome/FormError.C
870 * src/frontends/gnome/FormError.h
871 * src/frontends/gnome/FormIndex.C
872 * src/frontends/gnome/FormIndex.h
873 * src/frontends/gnome/FormPrint.C
874 * src/frontends/gnome/FormPrint.h
875 * src/frontends/gnome/FormRef.C
876 * src/frontends/gnome/FormRef.h
877 * src/frontends/gnome/FormToc.C
878 * src/frontends/gnome/FormToc.h
879 * src/frontends/gnome/FormUrl.C
880 * src/frontends/gnome/FormUrl.h
881 * src/frontends/gnome/Menubar_pimpl.C
882 * src/frontends/gnome/mainapp.C
883 * src/frontends/gnome/mainapp.h
884 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
885 changing update() to updateSlot() where appropriate
887 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
889 * src/frontends/xforms/FormPreferences.[Ch]:
890 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
893 2000-10-28 Juergen Vigna <jug@sad.it>
895 * src/insets/insettabular.C (draw): fixed drawing bug.
897 * src/insets/insettext.C (clear):
899 (SetParagraphData): clearing the TEXT buffers when deleting the
900 paragraphs used by it.
902 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
904 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
906 2000-10-27 Juergen Vigna <jug@sad.it>
908 * src/tabular.C (~LyXTabular): removed not needed anymore.
910 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
913 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
915 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
918 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
921 * src/frontends/xforms/FormPreferences.[Ch]:
922 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
923 Reorganised as modules based on tabs. Much easier to follow the
924 flow and to add new tabs. Added warning and feedback messages.
927 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
929 * src/tabular.h (DocBook): add std:: qualifier.
931 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
933 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
934 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
937 * insettabular.C (DocBook): uses the tabular methods to export
940 * src/insets/insettext.h
941 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
943 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
945 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
948 * src/lyxfunc.C (MenuNew): lessen the scope of fname
949 moved misplaced AllowInput two lines up.
951 * src/buffer.C (readFile): compare float with float, not with int
953 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
955 * src/minibuffer.C: add "using SigC::slot" statement.
957 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
959 * src/frontends/xforms/forms/README: updated section about make.
961 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
962 Tidied some forms up, made two of form_tabular's tabs more
963 self-consistent, fixed Jean-Marc's size problem in form_preferences,
964 fixed translation problem with "Column".
966 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
968 * src/minibuffer.h: use Timeout instead of the xforms timer
970 (setTimer) rewrite for the Timeout, change to unsigned arg
971 (set): change to unsigned timer arg
974 * src/minibuffer.C (TimerCB): removed func
975 (C_MiniBuffer_TimerCB): removed func
976 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
977 (peek_event): use a switch statement
978 (add): don't use fl_add_timer.
979 (Set): rewrite to use the Timeout
982 * src/Timeout.[Ch] (setType): return a Timeout &
983 (setTimeout): ditto, change to unsigned arg for timeout
985 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
987 * src/mathed/formula.C (mathed_string_width): Use string instead
988 of a constant size char array.
990 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
992 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
993 the two recently added operator<< for SMInput and State.
995 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
997 (OkCancelPolicy): ditto
998 (OkCancelReadOnlyPolicy): ditto
999 (NoRepeatedApplyReadOnlyPolicy): ditto
1000 (OkApplyCancelReadOnlyPolicy): ditto
1001 (OkApplyCancelPolicy): ditto
1002 (NoRepeatedApplyPolicy): ditto
1004 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1006 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1007 add the usual std:: qualifiers.
1009 2000-10-25 Juergen Vigna <jug@sad.it>
1011 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1013 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1015 * src/support/filetools.C (MakeRelPath): change some types to
1018 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1019 ButtonPolicy::SMInput and ButtonPolicy::State.
1021 * src/FontLoader.C (reset): small cleanup
1022 (unload): small cleanup
1024 * src/FontInfo.C (getFontname): initialize error to 10000.0
1026 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1028 * src/frontends/xforms/FormPreferences.[Ch]:
1029 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1030 TeX encoding and default paper size sections.
1032 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1034 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1037 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1038 make the message_ empty.
1039 (FormError): don't initialize message_ in initializer list.
1041 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1043 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1045 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1047 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1049 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1051 * src/frontends/kde/*data.[Ch]: _("") is not
1054 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1056 * src/buffer.C: removed redundant using directive.
1058 * src/frontends/DialogBase.h: revert to original definition of
1061 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1062 stuff into two classes, one for each dialog, requires a new
1063 element in the dialogs vector, FormTabularCreate.
1065 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1068 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1069 method. Continues Allan's idea, but means that derived classes
1070 don't need to worry about "update or hide?".
1072 * src/frontends/xforms/FormError.C (showInset): add connection
1075 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1076 one for each dialog. FormTabular now contains main tabular dialog
1079 * src/frontends/xforms/FormTabularCreate.[Ch]:
1080 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1083 * src/frontends/xforms/FormGraphics.[Ch]:
1084 * src/frontends/xforms/forms/form_graphics.fd
1085 * src/frontends/xforms/FormTabular.[Ch]:
1086 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1087 classes of FormInset.
1089 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1090 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1092 * src/frontends/xforms/Makefile.am:
1093 * src/frontends/xforms/forms/makefile: added new files.
1095 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1096 variable. added Signal0 hide signal, in keeping with other GUI-I
1099 * src/support/lstrings.h: removed redundant std:: qualifier as
1100 it's already declared in Lsstream.h.
1102 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1104 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1108 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1110 * src/tabular.C (Ascii): minimize scope of cell.
1112 * src/BufferView2.C (nextWord): return string() instead of 0;
1114 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1116 * src/converter.h: add a std:: qualifier
1118 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1120 * src/importer.[Ch]: New files. Used for importing files into LyX.
1122 * src/lyxfunc.C (doImport): Use the new Importer class.
1124 * src/converter.h: Add shortcut member to the Format class.
1125 Used for holding the menu shortcut.
1127 * src/converter.C and other files: Made a distinction between
1128 format name and format extension. New formats can be defined using
1129 the \format lyxrc tag.
1130 Added two new converter flags: latex and disable.
1132 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1134 * src/support/lyxlib.h: unify namespace/struct implementation.
1135 Remove extra declarations.
1137 * src/support/chdir.C (chdir): remove version taking char const *
1139 * src/support/rename.C: ditto.
1140 * src/support/lyxsum.C: ditto.
1142 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1144 * src/frontends/xforms/FormBase.[Ch]:
1145 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1146 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1147 work only for the next call to fl_show_form(). The correct place to set
1148 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1149 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1150 from FormBase have the minimum size set; no more stupid crashes with
1153 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1155 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1157 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1159 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1161 * src/support/lyxlib.h: changed second argument of mkdir to
1162 unsigned long int (unsigned int would probably have been enough,
1163 but...). Removed <sys/types.h> header.
1164 * src/support/mkdir.C (mkdir): ditto.
1168 2000-10-19 Juergen Vigna <jug@sad.it>
1170 * src/lyxfunc.C (MenuNew): small fix (form John)
1172 * src/screen.C (Update): removed unneeded code.
1174 * src/tabular.C (Ascii): refixed int != uint bug!
1176 * src/support/lyxlib.h: added sys/types.h include for now permits
1177 compiling, but I don't like this!
1179 2000-10-18 Juergen Vigna <jug@sad.it>
1181 * src/text2.C (ClearSelection): if we clear the selection we need
1182 more refresh so set the status apropriately
1184 * src/insets/insettext.C (draw): hopefully finally fixed draw
1187 2000-10-12 Juergen Vigna <jug@sad.it>
1189 * src/insets/insettext.C (draw): another small fix and make a block
1190 so that variables are localized.
1192 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1194 * src/support/lstrings.C (lowercase, uppercase):
1195 use explicit casts to remove compiler warnings.
1197 * src/support/LRegex.C (Impl):
1198 * src/support/StrPool.C (add):
1199 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1200 (AddPath, MakeDisplayPath):
1201 * src/support/lstrings.C (prefixIs, subst):
1202 use correct type to remove compiler warnings.
1204 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1206 * src/support/lyxlib.h:
1207 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1208 portability and to remove compiler warning with DEC cxx.
1210 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1212 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1214 * src/minibuffer.C (peek_event): retun 1 when there has been a
1215 mouseclick in the minibuffer.
1219 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1221 * src/frontends/xforms/FormParagraph.C: more space above/below
1224 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1226 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1227 a char only if real_current_font was changed.
1229 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1231 * NEWS: update somewhat for 1.1.6
1233 * lib/ui/default.ui: clean up.
1235 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1237 * lib/CREDITS: clean up
1239 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1241 * src/combox.[Ch] (select): changed argument back to int
1242 * src/combox.C (peek_event): removed num_bytes as it is declared but
1245 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1246 modified calls to Combox::select() to remove warnings about type
1249 * src/insets/insetbutton.C (width): explicit cast to remove warning
1250 about type conversion.
1252 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1255 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1256 sel_pos_end, refering to cursor position are changed to
1257 LyXParagraph::size_type.
1259 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1260 consistent with LyXCursor::pos().
1261 (inset_pos): changed to LyXParagraph::size_type for same reason.
1263 * src/insets/insettext.C (resizeLyXText): changed some temporary
1264 variables refing to cursor position to LyXParagraph::size_type.
1266 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1268 * src/frontends/kde/<various>: The Great Renaming,
1271 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1273 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1275 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1277 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1278 0 when there are no arguments.
1280 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1282 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1283 to segfaults when pressing Ok in InsetBibtex dialog.
1285 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1287 * forms/layout_forms.fd:
1288 * src/layout_forms.C (create_form_form_character): small change to use
1289 labelframe rather than engraved frame + text
1291 * src/lyx_gui.C (create_forms): initialise choice_language with some
1292 arbitrary value to prevent segfault when dialog is shown.
1294 2000-10-16 Baruch Even <baruch.even@writeme.com>
1296 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1297 is no resulting file. This pertains only to LaTeX output.
1299 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1301 * src/text.C (Backspace): Make sure that the row of the cursor is
1304 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1307 * src/lyx_gui.C (init): Prevent a crash when only one font from
1308 menu/popup fonts is not found.
1310 * lib/lyxrc.example: Add an example for binding a key for language
1313 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1315 * src/converter.C (GetReachable): Changed the returned type to
1317 (IsReachable): New method
1319 * src/MenuBackend.C (expand): Handle formats that appear more
1322 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1324 * src/frontends/support/Makefile.am
1325 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1328 * lib/CREDITS: add Garst Reese.
1330 * src/support/snprintf.h: add extern "C" {} around the definitions.
1332 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1334 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1337 * src/frontends/xforms/FormDocument.C:
1338 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1339 compile without "conversion to integral type of smaller size"
1342 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1344 * src/text.C (GetColumnNearX): Fixed disabled code.
1346 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1348 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1351 * src/support/snprintf.[ch]: new files
1353 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1355 * src/frontends/kde/formprintdialog.C: add
1356 file browser for selecting postscript output
1358 * src/frontends/kde/formprintdialogdata.C:
1359 * src/frontends/kde/formprintdialogdata.h: re-generate
1362 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1364 * src/frontends/gnome/Makefile.am:
1365 * src/frontends/kde/Makefile.am: FormCommand.C
1366 disappeared from xforms
1368 * src/frontends/kde/FormCitation.C:
1369 * src/frontends/kde/FormIndex.C: read-only
1372 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1374 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1377 * src/bufferlist.C: add using directive.
1379 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1381 * src/support/lyxfunctional.h: version of class_fun for void
1382 returns added, const versions of back_inseter_fun and compare_fun
1385 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1387 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1389 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1391 * ChangeLog: cleanup.
1393 * lib/CREDITS: update to add all the contributors we've forgotten.
1394 I have obviously missed some, so tell me whether there were
1397 2000-10-13 Marko Vendelin <markov@ioc.ee>
1399 * src/frontends/gnome/FormCitation.C
1400 * src/frontends/gnome/FormCitation.h
1401 * src/frontends/gnome/FormError.C
1402 * src/frontends/gnome/FormIndex.C
1403 * src/frontends/gnome/FormRef.C
1404 * src/frontends/gnome/FormRef.h
1405 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1407 * src/frontends/gnome/FormCitation.C
1408 * src/frontends/gnome/FormCopyright.C
1409 * src/frontends/gnome/FormError.C
1410 * src/frontends/gnome/FormIndex.C
1411 * src/frontends/gnome/FormRef.C
1412 * src/frontends/gnome/FormToc.C
1413 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1416 * src/frontends/gnome/Menubar_pimpl.C
1417 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1420 2000-10-11 Baruch Even <baruch.even@writeme.com>
1423 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1424 to convey its real action.
1426 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1427 clear the minibuffer and prepare to enter a command.
1429 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1430 the rename from ExecCommand to PrepareForCommand.
1431 * src/lyxfunc.C (Dispatch): ditto.
1433 2000-10-11 Baruch Even <baruch.even@writeme.com>
1435 * src/buffer.C (writeFile): Added test for errors on writing, this
1436 catches all errors and not only file system full errors as intended.
1438 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1440 * src/lyx_gui.C (create_forms): better fix for crash with
1441 translated interface.
1443 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1445 * src/frontends/kde/Makefile.am:
1446 * src/frontends/kde/FormCopyright.C:
1447 * src/frontends/kde/formcopyrightdialog.C:
1448 * src/frontends/kde/formcopyrightdialog.h:
1449 * src/frontends/kde/formcopyrightdialogdata.C:
1450 * src/frontends/kde/formcopyrightdialogdata.h:
1451 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1452 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1453 copyright to use qtarch
1455 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1457 * src/encoding.C (read): Fixed bug that caused an error message at
1458 the end of the file.
1460 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1462 * lib/lyxrc.example: Fixed hebrew example.
1464 2000-10-13 Allan Rae <rae@lyx.org>
1466 * src/frontends/xforms/FormPreferences.C (input): reworking the
1468 (build, update, apply): New inputs in various tabfolders
1470 * src/frontends/xforms/FormToc.C: use new button policy.
1471 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1472 dialogs that either can't use any existing policy or where it just
1475 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1478 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1479 added a bool parameter which is ignored.
1481 * src/buffer.C (setReadonly):
1482 * src/BufferView_pimpl.C (buffer):
1483 * src/frontends/kde/FormCopyright.h (update):
1484 * src/frontends/kde/FormCitation.[Ch] (update):
1485 * src/frontends/kde/FormIndex.[Ch] (update):
1486 * src/frontends/kde/FormPrint.[Ch] (update):
1487 * src/frontends/kde/FormRef.[Ch] (update):
1488 * src/frontends/kde/FormToc.[Ch] (update):
1489 * src/frontends/kde/FormUrl.[Ch] (update):
1490 * src/frontends/gnome/FormCopyright.h (update):
1491 * src/frontends/gnome/FormCitation.[Ch] (update):
1492 * src/frontends/gnome/FormError.[Ch] (update):
1493 * src/frontends/gnome/FormIndex.[Ch] (update):
1494 * src/frontends/gnome/FormPrint.[Ch] (update):
1495 * src/frontends/gnome/FormRef.h (update):
1496 * src/frontends/gnome/FormToc.[Ch] (update):
1497 * src/frontends/gnome/FormUrl.[Ch] (update):
1498 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1499 to updateBufferDependent and DialogBase
1501 * src/frontends/xforms/FormCitation.[hC]:
1502 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1503 * src/frontends/xforms/FormError.[Ch]:
1504 * src/frontends/xforms/FormGraphics.[Ch]:
1505 * src/frontends/xforms/FormIndex.[Ch]:
1506 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1507 and fixed readOnly handling.
1508 * src/frontends/xforms/FormPrint.[Ch]:
1509 * src/frontends/xforms/FormRef.[Ch]:
1510 * src/frontends/xforms/FormTabular.[Ch]:
1511 * src/frontends/xforms/FormToc.[Ch]:
1512 * src/frontends/xforms/FormUrl.[Ch]:
1513 * src/frontends/xforms/FormInset.[Ch]:
1514 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1515 form of updateBufferDependent.
1517 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1518 if form()->visible just in case someone does stuff to the form in a
1521 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1522 the buttoncontroller for everything the enum used to be used for.
1523 (update) It would seem we need to force all dialogs to use a bool
1524 parameter or have two update functions. I chose to go with one.
1525 I did try removing update() from here and FormBase and defining the
1526 appropriate update signatures in FormBaseB[DI] but then ran into the
1527 problem of the update() call in FormBase::show(). Whatever I did
1528 to get around that would require another function and that just
1529 got more confusing. Hence the decision to make everyone have an
1530 update(bool). An alternative might have been to override show() in
1531 FormBaseB[DI] and that would allow the different and appropriate
1534 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1535 true == buffer change occurred. I decided against using a default
1536 template parameter since not all compilers support that at present.
1538 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1540 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1541 army knife" by removing functionality.
1542 (clearStore): removed. All such housekeeping on hide()ing the dialog
1543 is to be carried out by overloaded disconnect() methods.
1544 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1545 superceded by Baruch's neat test (FormGraphics) to update an existing
1546 dialog if a new signal is recieved rather than block all new signals
1548 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1549 only to Inset dialogs.
1550 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1551 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1553 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1555 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1556 as a base class to all inset dialogs. Used solely to connect/disconnect
1557 the Inset::hide signal and to define what action to take on receipt of
1558 a UpdateBufferDependent signal.
1559 (FormCommand): now derived from FormInset.
1561 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1564 * src/frontends/xforms/FormCopyright.[Ch]:
1565 * src/frontends/xforms/FormPreferences.[Ch]:
1566 now derived from FormBaseBI.
1568 * src/frontends/xforms/FormDocument.[Ch]:
1569 * src/frontends/xforms/FormParagraph.[Ch]:
1570 * src/frontends/xforms/FormPrint.[Ch]:
1571 now derived from FormBaseBD.
1573 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1575 * src/frontends/xforms/FormCitation.[Ch]:
1576 * src/frontends/xforms/FormError.[Ch]:
1577 * src/frontends/xforms/FormRef.[Ch]:
1578 * src/frontends/xforms/FormToc.[Ch]:
1579 (clearStore): reworked as disconnect().
1581 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1584 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1586 * src/converter.C (runLaTeX): constify buffer argument
1589 * src/frontends/support/Makefile.am (INCLUDES): fix.
1591 * src/buffer.h: add std:: qualifier
1592 * src/insets/figinset.C (addpidwait): ditto
1593 * src/MenuBackend.C: ditto
1594 * src/buffer.C: ditto
1595 * src/bufferlist.C: ditto
1596 * src/layout.C: ditto
1597 * src/lyxfunc.C: ditto
1599 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1601 * src/lyxtext.h (bidi_level): change return type to
1602 LyXParagraph::size_type.
1604 * src/lyxparagraph.h: change size_type to
1605 TextContainer::difference_type. This should really be
1606 TextContainer::size_type, but we need currently to support signed
1609 2000-10-11 Marko Vendelin <markov@ioc.ee>
1610 * src/frontends/gnome/FormError.h
1611 * src/frontends/gnome/FormRef.C
1612 * src/frontends/gnome/FormRef.h
1613 * src/frontends/gnome/FormError.C
1614 * src/frontends/gnome/Makefile.am
1615 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1616 to Gnome frontend. Both dialogs use "action" area.
1618 2000-10-12 Baruch Even <baruch.even@writeme.com>
1620 * src/graphics/GraphicsCacheItem_pimpl.C:
1621 * src/graphics/Renderer.C:
1622 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1625 2000-10-12 Juergen Vigna <jug@sad.it>
1627 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1628 visible when selecting).
1630 * development/Code_rules/Rules: fixed some typos.
1632 2000-10-09 Baruch Even <baruch.even@writeme.com>
1634 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1635 compiling on egcs 1.1.2 possible.
1637 * src/filedlg.C (comp_direntry::operator() ): ditto.
1639 2000-08-31 Baruch Even <baruch.even@writeme.com>
1641 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1644 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1645 transient it now only gets freed when the object is destructed.
1647 2000-08-24 Baruch Even <baruch.even@writeme.com>
1649 * src/frontends/FormGraphics.h:
1650 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1653 2000-08-20 Baruch Even <baruch.even@writeme.com>
1655 * src/insets/insetgraphics.C:
1656 (draw): Added messages to the drawn rectangle to report status.
1657 (updateInset): Disabled the use of the inline graphics,
1660 2000-08-17 Baruch Even <baruch.even@writeme.com>
1662 * src/frontends/support: Directory added for the support of GUII LyX.
1664 * src/frontends/support/LyXImage.h:
1665 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1668 * src/frontends/support/LyXImage_X.h:
1669 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1670 version of LyXImage, this uses the Xlib Pixmap.
1672 * src/PainterBase.h:
1673 * src/PainterBase.C:
1675 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1676 replacement to Pixmap.
1678 * src/insets/insetgraphics.h:
1679 * src/insets/insetgraphics.C:
1680 * src/graphics/GraphicsCacheItem.h:
1681 * src/graphics/GraphicsCacheItem.C:
1682 * src/graphics/GraphicsCacheItem_pimpl.h:
1683 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1686 * src/graphics/GraphicsCacheItem.h:
1687 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1688 another copy of the object.
1690 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1691 of cacheHandle, this fixed a bug that sent LyX crashing.
1693 * src/graphics/XPM_Renderer.h:
1694 * src/graphics/XPM_Renderer.C:
1695 * src/graphics/EPS_Renderer.h:
1696 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1698 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1700 * src/lyxfunc.C (processKeySym): only handle the
1701 lockinginset/inset stuff if we have a buffer and text loaded...
1703 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1705 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1707 * src/support/lyxfunctional.h: add operator= that takes a reference
1709 * src/lyxserver.C (mkfifo): make first arg const
1711 * src/layout.h: renamed name(...) to setName(...) to work around
1714 * src/buffer.C (setFileName): had to change name of function to
1715 work around bugs in egcs. (renamed from fileName)
1717 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1719 * src/support/translator.h: move helper template classes to
1720 lyxfunctional.h, include "support/lyxfunctional.h"
1722 * src/support/lyxmanip.h: add delaration of fmt
1724 * src/support/lyxfunctional.h: new file
1725 (class_fun_t): new template class
1726 (class_fun): helper template function
1727 (back_insert_fun_iterator): new template class
1728 (back_inserter_fun): helper template function
1729 (compare_memfun_t): new template class
1730 (compare_memfun): helper template function
1731 (equal_1st_in_pair): moved here from translator
1732 (equal_2nd_in_pair): moved here from translator
1734 * src/support/fmt.C: new file
1735 (fmt): new func, can be used for a printf substitute when still
1736 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1738 * src/support/StrPool.C: add some comments
1740 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1743 * src/insets/figinset.C (addpidwait): use std::copy with
1744 ostream_iterator to fill the pidwaitlist
1746 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1748 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1751 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1754 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1756 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1757 (class_update): ditto
1758 (BulletPanel): ditto
1759 (CheckChoiceClass): move initialization of tc and tct
1761 * src/tabular.C: remove current_view
1762 (OldFormatRead): similar to right below [istream::ignore]
1764 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1765 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1766 unused [istream::ignore]
1768 * src/lyxfunc.C: include "support/lyxfunctional.h"
1769 (getInsetByCode): use std::find_if and compare_memfun
1771 * src/lyxfont.C (stateText): remove c_str()
1773 * src/lyx_main.C (setDebuggingLevel): make static
1774 (commandLineHelp): make static
1776 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1777 Screen* together with fl_get_display() and fl_screen
1779 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1780 togheter with fl_get_display() and fl_screen
1781 (create_forms): remove c_str()
1783 * src/layout.C: include "support/lyxfunctional.h"
1784 (hasLayout): use std::find_if and compare_memfun
1785 (GetLayout): use std::find_if and comapre_memfun
1786 (delete_layout): use std::remove_if and compare_memfun
1787 (NumberOfClass): use std:.find_if and compare_memfun
1789 * src/gettext.h: change for the new functions
1791 * src/gettext.C: new file, make _(char const * str) and _(string
1792 const & str) real functions.
1794 * src/font.C (width): rewrite slightly to avoid one extra variable
1796 * src/debug.C: initialize Debug::ANY here
1798 * src/commandtags.h: update number comments
1800 * src/combox.h (get): make const func
1802 (getline): make const
1804 * src/combox.C (input_cb): handle case where fl_get_input can
1807 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1808 "support/lyxfunctional.h", remove current_view variable.
1809 (resize): use std::for_each with std::mem_fun
1810 (getFileNames): use std::copy with back_inserter_fun
1811 (getBuffer): change arg type to unsigned int
1812 (emergencyWriteAll): call emergencyWrite with std::for_each and
1814 (emergencyWrite): new method, the for loop in emergencyWriteAll
1816 (exists): use std::find_if with compare_memfun
1817 (getBuffer): use std::find_if and compare_memfun
1819 * src/buffer.h: add typedefs for iterator_category, value_type
1820 difference_type, pointer and reference for inset_iterator
1821 add postfix ++ for inset_iterator
1822 make inset_iterator::getPos() const
1824 * src/buffer.C: added support/lyxmanip.h
1825 (readFile): use lyxerr << fmt instead of printf
1826 (makeLaTeXFile): use std::copy to write out encodings
1828 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1830 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1831 free and the char * temp.
1832 (hasMenu): use std::find_if and compare_memfun
1835 * src/Makefile.am (lyx_SOURCES): added gettext.C
1837 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1838 string::insert small change to avoid temporary
1840 * src/LColor.C (getGUIName): remove c_str()
1842 * several files: change all occurrences of fl_display to
1845 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1846 that -pedantic is not used for gcc 2.97 (cvs gcc)
1848 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1850 2000-10-11 Allan Rae <rae@lyx.org>
1852 * src/frontends/xforms/FormPreferences.C (input): template path must be
1853 a readable directory. It doesn't need to be writeable.
1854 (build, delete, update, apply): New inputs in the various tabfolders
1856 * src/frontends/xforms/forms/form_preferences.fd:
1857 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1858 several new entries to existing folders. Shuffled some existing stuff
1861 * src/frontends/xforms/forms/form_print.fd:
1862 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1863 Should probably rework PrinterParams as well. Note that the switch to
1864 collated is effectively the same as !unsorted so changing PrinterParams
1865 will require a lot of fiddly changes to reverse the existing logic.
1867 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1869 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1871 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1873 2000-10-10 Allan Rae <rae@lyx.org>
1876 * src/lyxfunc.C (Dispatch):
1878 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1881 * src/lyxrc.C (output): Only write the differences between system lyxrc
1882 and the users settings.
1885 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1887 I'll rewrite this later, after 1.1.6 probably, to keep a single
1888 LyXRC but two instances of a LyXRCStruct.
1890 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1892 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1894 * src/tabular.h: add a few std:: qualifiers.
1896 * src/encoding.C: add using directive.
1897 * src/language.C: ditto.
1899 * src/insets/insetquotes.C (Validate): use languages->lang()
1900 instead of only language.
1902 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1904 * lib/languages: New file.
1906 * lib/encodings: New file.
1908 * src/language.C (Languages): New class.
1909 (read): New method. Reads the languages from the 'languages' file.
1911 * src/encoding.C (Encodings): New class.
1912 (read): New method. Reads the encodings from the 'encodings' file.
1914 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1917 * src/bufferparams.h and a lot of files: Deleted the member language,
1918 and renamed language_info to language
1920 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1921 * src/lyxfont.C (latexWriteStartChanges): ditto.
1922 * src/paragraph.C (validate,TeXOnePar): ditto.
1924 * src/lyxfont.C (update): Restored deleted code.
1926 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1928 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1930 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1932 * src/insets/figinset.[Ch]:
1933 * src/insets/insetinclude.[Ch]:
1934 * src/insets/insetinclude.[Ch]:
1935 * src/insets/insetparent.[Ch]:
1936 * src/insets/insetref.[Ch]:
1937 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1939 * src/insets/*.[Ch]:
1940 * src/mathed/formula.[Ch]:
1941 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1943 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1944 * src/lyx_cb.C (FigureApplyCB):
1945 * src/lyxfunc.C (getStatus, Dispatch):
1946 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1949 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1951 * src/converter.[Ch] (Formats::View):
1952 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1954 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1955 *current_view->buffer(). This will change later, but this patch is way
1958 2000-10-09 Juergen Vigna <jug@sad.it>
1960 * src/text.C (GetRow): small fix.
1962 * src/BufferView_pimpl.C (cursorPrevious):
1963 (cursorNext): added LyXText parameter to function.
1965 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1966 keypress depending on cursor position.
1968 2000-10-06 Juergen Vigna <jug@sad.it>
1970 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1971 (copySelection): redone this function and also copy ascii representa-
1974 * src/tabular.C (Ascii):
1978 (print_n_chars): new functions to realize the ascii export of tabulars.
1980 2000-10-05 Juergen Vigna <jug@sad.it>
1982 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1983 if we don't have a buffer.
1985 2000-10-10 Allan Rae <rae@lyx.org>
1987 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1988 with closing dialog. It seems that nested tabfolders require hiding
1989 of inner tabfolders before hiding the dialog itself. Actually all I
1990 did was hide the active outer folder.
1992 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1993 unless there really is a buffer. hideBufferDependent is called
1996 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1997 POTFILES.in stays in $(srcdir).
1999 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2001 * lib/lyxrc.example: Few changes.
2003 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2005 * src/BufferView_pimpl.C (buffer): only need one the
2006 updateBufferDependent signal to be emitted once! Moved to the end of
2007 the method to allow bv_->text to be updated first.
2009 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2010 and hSignal_ with Dialogs * and BufferDependency variables.
2011 New Buffer * parent_, initialised when the dialog is launched. Used to
2012 check whether to update() or hide() dialog in the new, private
2013 updateOrHide() method that is connected to the updateBufferDependent
2014 signal. Daughter classes dictate what to do using the
2015 ChangedBufferAction enum, passed to the c-tor.
2017 * src/frontends/xforms/FormCitation.C:
2018 * src/frontends/xforms/FormCommand.C:
2019 * src/frontends/xforms/FormCopyright.C:
2020 * src/frontends/xforms/FormDocument.C:
2021 * src/frontends/xforms/FormError.C:
2022 * src/frontends/xforms/FormIndex.C:
2023 * src/frontends/xforms/FormPreferences.C:
2024 * src/frontends/xforms/FormPrint.C:
2025 * src/frontends/xforms/FormRef.C:
2026 * src/frontends/xforms/FormToc.C:
2027 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2030 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2031 ChangedBufferAction enum.
2033 * src/frontends/xforms/FormParagraph.[Ch]
2034 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2037 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2039 * lib/bind/cua.bind: fix a bit.
2040 * lib/bind/emacs.bind: ditto.
2042 * lib/bind/menus.bind: remove real menu entries from there.
2044 * src/spellchecker.C: make sure we only include strings.h when
2047 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2049 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2050 function. It enlarges the maximum number of pup when needed.
2051 (add_toc2): Open a new menu if maximum number of items per menu has
2054 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2056 * src/frontends/kde/FormPrint.C: fix error reporting
2058 * src/frontends/xforms/FormDocument.C: fix compiler
2061 * lib/.cvsignore: add Literate.nw
2063 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2066 * bufferview_funcs.[Ch]
2069 * text2.C: Add support for numbers in RTL text.
2071 2000-10-06 Allan Rae <rae@lyx.org>
2073 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2074 to be gettext.m4 friendly again. ext_l10n.h is now
2075 generated into $top_srcdir instead of $top_builddir
2076 so that lyx.pot will be built correctly -- without
2077 duplicate parsing of ext_l10n.h.
2079 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2081 * src/frontends/kde/FormCitation.C: make the dialog
2082 behave more sensibly
2084 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2086 * config/kde.m4: fix consecutive ./configure runs,
2087 look for qtarch, fix library order
2089 * src/frontends/kde/Makefile.am: tidy up,
2090 add Print dialog, add .dlg dependencies
2092 * src/frontends/kde/FormPrint.C:
2093 * src/frontends/kde/FormPrint.h:
2094 * src/frontends/kde/formprintdialog.C:
2095 * src/frontends/kde/formprintdialog.h:
2096 * src/frontends/kde/formprintdialogdata.C:
2097 * src/frontends/kde/formprintdialogdata.h:
2098 * src/frontends/kde/dlg/formprintdialog.dlg: add
2101 * src/frontends/kde/dlg/README: Added explanatory readme
2103 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2104 script to double-check qtarch's output
2106 * src/frontends/kde/formindexdialog.C:
2107 * src/frontends/kde/formindexdialogdata.C:
2108 * src/frontends/kde/formindexdialogdata.h:
2109 * src/frontends/kde/dlg/formindexdialog.dlg: update
2110 for qtarch, minor fixes
2112 2000-10-05 Allan Rae <rae@lyx.org>
2114 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2115 dialogs when switching buffers update them instead. It's up to each
2116 dialog to decide if it should still be visible or not.
2117 update() should return a bool to control visiblity within show().
2118 Or perhaps better to set a member variable and use that to control
2121 * lib/build-listerrors: create an empty "listerrors" file just to stop
2122 make trying to regenerate it all the time if you don't have noweb
2125 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2127 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2128 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2129 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2130 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2131 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2133 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2135 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2137 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2138 deleting buffer. Closes all buffer-dependent dialogs.
2140 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2142 * src/frontends/xforms/FormCitation.[Ch]:
2143 * src/frontends/xforms/FormPreferences.[Ch]:
2144 * src/frontends/xforms/FormPrint.[Ch]:
2145 * src/frontends/xforms/FormRef.[Ch]:
2146 * src/frontends/xforms/FormUrl.[Ch]: ditto
2148 * src/frontends/xforms/FormDocument.[Ch]:
2149 * src/frontends/xforms/forms/form_document.C.patch:
2150 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2151 pass through a single input() function.
2153 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2155 * lib/build-listerrors: return status as OK
2157 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2159 * lib/lyxrc.example: Updated to new export code
2161 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2163 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2166 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2169 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2170 LyX-Code is defined.
2171 * lib/layouts/amsbook.layout: ditto.
2173 * boost/Makefile.am: fix typo.
2175 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2177 (add_lastfiles): removed.
2178 (add_documents): removed.
2179 (add_formats): removed.
2181 * src/frontends/Menubar.C: remove useless "using" directive.
2183 * src/MenuBackend.h: add a new MenuItem constructor.
2185 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2188 2000-10-04 Allan Rae <rae@lyx.org>
2190 * lib/Makefile.am (listerrors):
2191 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2192 I haven't got notangle installed so Kayvan please test. The output
2193 should end up in $builddir. This also allows people who don't have
2194 noweb installed to complete the make process without error.
2196 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2197 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2198 by JMarc's picky compiler.
2200 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2203 * src/insets/insettabular.C (setPos): change for loop to not use
2204 sequencing operator. Please check this Jürgen.
2206 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2208 * src/insets/insetcite.C (getScreenLabel): ditto
2209 * src/support/filetools.C (QuoteName): ditto
2210 (ChangeExtension): ditto
2212 * src/BufferView_pimpl.C (scrollCB): make heigt int
2214 * src/BufferView2.C (insertInset): comment out unused arg
2216 * boost/Makefile.am (EXTRADIST): new variable
2218 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2220 * src/exporter.C (IsExportable): Fixed
2222 * lib/configure.m4: Small fix
2224 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2226 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2227 * src/insets/insetbib.C (bibitemWidest): ditto.
2228 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2230 2000-10-03 Juergen Vigna <jug@sad.it>
2232 * src/BufferView2.C (theLockingInset): removed const because of
2233 Agnus's compile problems.
2235 * src/insets/insettext.C (LocalDispatch): set the language of the
2236 surronding paragraph on inserting the first character.
2238 * various files: changed use of BufferView::the_locking_inset.
2240 * src/BufferView2.C (theLockingInset):
2241 (theLockingInset): new functions.
2243 * src/BufferView.h: removed the_locking_inset.
2245 * src/lyxtext.h: added the_locking_inset
2247 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2249 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2251 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2253 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2254 * src/mathed/math_cursor.C (IsAlpha): ditto.
2255 * src/mathed/math_inset.C (strnew): ditto.
2256 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2257 (IMetrics): cxp set but never used; removed.
2258 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2259 that the variable in question has been removed also!
2262 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2263 using the Buffer * passed to Latex(), using the BufferView * passed to
2264 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2266 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2267 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2269 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2270 * src/buffer.C (readInset): used new InsetBibtex c-tor
2271 * (getBibkeyList): used new InsetBibtex::getKeys
2273 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2276 * lib/build-listerrors
2278 * src/exporter.C: Add literate programming support to the export code
2281 * src/lyx_cb.C: Remove old literate code.
2283 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2286 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2287 * src/converter.C (View, Convert): Use QuoteName.
2289 * src/insets/figinset.C (Preview): Use Formats::View.
2291 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2293 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2295 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2296 the top of the function, because compaq cxx complains that the
2297 "goto exit_with_message" when the function is disabled bypasses
2299 (MenuNew): try a better fix for the generation of new file names.
2300 This time, I used AddName() instead of AddPath(), hoping Juergen
2303 2000-10-03 Allan Rae <rae@lyx.org>
2305 * src/frontends/xforms/forms/form_preferences.fd:
2306 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2307 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2308 "Look and Feel"->"General" but will need to be split up further into
2309 general output and general input tabs. Current plan is for four outer
2310 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2311 stuff; "Inputs" for input and import configuration; "Outputs" for
2312 output and export configuration; and one more whatever is left over
2313 called "General". The leftovers at present look like being which
2314 viewers to use, spellchecker, language support and might be better
2315 named "Support". I've put "Paths" in "Inputs" for the moment as this
2316 seems reasonable for now at least.
2317 One problem remains: X error kills LyX when you close Preferences.
2319 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2321 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2322 qualifier from form()
2323 * src/frontends/xforms/FormCitation.[Ch]:
2324 * src/frontends/xforms/FormCopyright.[Ch]:
2325 * src/frontends/xforms/FormDocument.[Ch]:
2326 * src/frontends/xforms/FormError.[Ch]:
2327 * src/frontends/xforms/FormIndex.[Ch]:
2328 * src/frontends/xforms/FormPreferences.[Ch]:
2329 * src/frontends/xforms/FormPrint.[Ch]:
2330 * src/frontends/xforms/FormRef.[Ch]:
2331 * src/frontends/xforms/FormToc.[Ch]:
2332 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2334 * src/frontends/xforms/FormCitation.[Ch]:
2335 * src/frontends/xforms/FormIndex.[Ch]:
2336 * src/frontends/xforms/FormRef.[Ch]:
2337 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2338 with Allan's naming policy
2340 * src/frontends/xforms/FormCitation.C: some static casts to remove
2343 2000-10-02 Juergen Vigna <jug@sad.it>
2345 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2346 now you can type or do stuff inside the table-cell also when in dummy
2347 position, fixed visible cursor.
2349 * src/insets/insettext.C (Edit): fixing cursor-view position.
2351 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2352 be used for equal functions in lyxfunc and insettext.
2354 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2356 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2358 * src/frontends/gnome/FormCitation.h:
2359 * src/frontends/gnome/FormCopyright.h:
2360 * src/frontends/gnome/FormIndex.h:
2361 * src/frontends/gnome/FormPrint.h:
2362 * src/frontends/gnome/FormToc.h:
2363 * src/frontends/gnome/FormUrl.h:
2364 * src/frontends/kde/FormCitation.h:
2365 * src/frontends/kde/FormCopyright.h:
2366 * src/frontends/kde/FormIndex.h:
2367 * src/frontends/kde/FormRef.h:
2368 * src/frontends/kde/FormToc.h:
2369 * src/frontends/kde/FormUrl.h: fix remaining users of
2372 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2374 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2375 from depth argument.
2376 (DocBookHandleCaption): ditto.
2377 (DocBookHandleFootnote): ditto.
2378 (SimpleDocBookOnePar): ditto.
2380 * src/frontends/xforms/FormDocument.h (form): remove extra
2381 FormDocument:: qualifier.
2383 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2385 * sigc++/handle.h: ditto.
2387 * src/lyx_gui_misc.C: add "using" directive.
2389 * src/cheaders/cstddef: new file, needed by the boost library (for
2392 2000-10-02 Juergen Vigna <jug@sad.it>
2394 * src/insets/insettext.C (SetFont): better support.
2396 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2398 * src/screen.C (DrawOneRow): some uint refixes!
2400 2000-10-02 Allan Rae <rae@lyx.org>
2402 * boost/.cvsignore: ignore Makefile as well
2404 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2405 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2407 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2408 Left this one out by accident.
2410 * src/frontends/xforms/FormBase.h (restore): default to calling
2411 update() since that will restore the original/currently-applied values.
2412 Any input() triggered error messages will require the derived classes
2413 to redefine restore().
2415 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2416 avoid a segfault. combo_doc_class is the main concern.
2418 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2420 * Simplify build-listerrors in view of GUI-less export ability!
2422 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2424 * src/lyx_main.C (easyParse): Disable gui when exporting
2426 * src/insets/figinset.C:
2429 * src/lyx_gui_misc.C
2430 * src/tabular.C: Changes to allow no-gui.
2432 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2434 * src/support/utility.hpp: removed file
2435 * src/support/block.h: removed file
2437 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2440 * src/mathed/formula.C: add support/lyxlib.h
2441 * src/mathed/formulamacro.C: ditto
2443 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2444 * src/lyxparagraph.h: ditto
2446 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2447 * src/frontends/Makefile.am (INCLUDES): ditto
2448 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2449 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2450 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2451 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2452 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2453 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2455 * src/BufferView.h: use boost/utility.hpp
2456 * src/LColor.h: ditto
2457 * src/LaTeX.h: ditto
2458 * src/LyXAction.h: ditto
2459 * src/LyXView.h: ditto
2460 * src/bufferlist.h: ditto
2461 * src/lastfiles.h: ditto
2462 * src/layout.h: ditto
2463 * src/lyx_gui.h: ditto
2464 * src/lyx_main.h: ditto
2465 * src/lyxlex.h: ditto
2466 * src/lyxrc.h: ditto
2467 * src/frontends/ButtonPolicies.h: ditto
2468 * src/frontends/Dialogs.h: ditto
2469 * src/frontends/xforms/FormBase.h: ditto
2470 * src/frontends/xforms/FormGraphics.h: ditto
2471 * src/frontends/xforms/FormParagraph.h: ditto
2472 * src/frontends/xforms/FormTabular.h: ditto
2473 * src/graphics/GraphicsCache.h: ditto
2474 * src/graphics/Renderer.h: ditto
2475 * src/insets/ExternalTemplate.h: ditto
2476 * src/insets/insetcommand.h: ditto
2477 * src/support/path.h: ditto
2479 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2480 and introduce clause for 2.97.
2482 * boost/libs/README: new file
2484 * boost/boost/utility.hpp: new file
2486 * boost/boost/config.hpp: new file
2488 * boost/boost/array.hpp: new file
2490 * boost/Makefile.am: new file
2492 * boost/.cvsignore: new file
2494 * configure.in (AC_OUTPUT): add boost/Makefile
2496 * Makefile.am (SUBDIRS): add boost
2498 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2500 * src/support/lstrings.C (suffixIs): Fixed.
2502 2000-10-01 Allan Rae <rae@lyx.org>
2504 * src/PrinterParams.h: moved things around to avoid the "can't
2505 inline call" warning.
2507 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2508 into doc++ documentation.
2510 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2512 * src/frontends/xforms/FormRef.C: make use of button controller
2513 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2514 cleaned up button controller usage.
2515 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2516 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2517 use the button controller
2519 * src/frontends/xforms/forms/*.fd: and associated generated files
2520 updated to reflect changes to FormBase. Some other FormXxxx files
2521 also got minor updates to reflect changes to FormBase.
2523 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2524 (hide): made virtual.
2525 (input): return a bool. true == valid input
2526 (RestoreCB, restore): new
2527 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2528 Changes to allow derived dialogs to use a ButtonController and
2529 make sense when doing so: OK button calls ok() and so on.
2531 * src/frontends/xforms/ButtonController.h (class ButtonController):
2532 Switch from template implementation to taking Policy parameter.
2533 Allows FormBase to provide a ButtonController for any dialog.
2535 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2536 Probably should rename connect and disconnect.
2537 (apply): use the radio button groups
2538 (form): needed by FormBase
2539 (build): setup the radio button groups
2541 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2543 * several files: type changes to reduce the number of warnings and
2544 to unify type hangling a bit. Still much to do.
2546 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2548 * lib/images/*: rename a bunch of icons to match Dekel converter
2551 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2554 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2556 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2558 * sigc++/handle.h: ditto for class Handle.
2560 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2562 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2564 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2566 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2567 removal of the "default" language.
2569 * src/combox.h (getline): Check that sel > 0
2571 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2573 * lib/examples/docbook_example.lyx
2574 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2576 * lib/layouts/docbook-book.layout: new docbook book layout.
2578 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2580 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2582 * src/insets/figinset.C (DocBook):fixed small typo.
2584 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2586 * src/insets/insetinclude.h: string include_label doesn't need to be
2589 2000-09-29 Allan Rae <rae@lyx.org>
2591 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2592 Allow derived type to control connection and disconnection from signals
2593 of its choice if desired.
2595 2000-09-28 Juergen Vigna <jug@sad.it>
2597 * src/insets/insettabular.C (update): fixed cursor setting when
2598 the_locking_inset changed.
2599 (draw): made this a bit cleaner.
2600 (InsetButtonPress): fixed!
2602 * various files: added LyXText Parameter to fitCursor call.
2604 * src/BufferView.C (fitCursor): added LyXText parameter.
2606 * src/insets/insettabular.C (draw): small draw fix.
2608 * src/tabular.C: right setting of left/right celllines.
2610 * src/tabular.[Ch]: fixed various types in funcions and structures.
2611 * src/insets/insettabular.C: ditto
2612 * src/frontends/xforms/FormTabular.C: ditto
2614 2000-09-28 Allan Rae <rae@lyx.org>
2616 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2617 that the #ifdef's had been applied to part of what should have been
2618 a complete condition. It's possible there are other tests that
2619 were specific to tables that are also wrong now that InsetTabular is
2620 being used. Now we need to fix the output of '\n' after a table in a
2621 float for the same reason as the original condition:
2622 "don't insert this if we would be adding it before or after a table
2623 in a float. This little trick is needed in order to allow use of
2624 tables in \subfigures or \subtables."
2625 Juergen can you check this?
2627 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2629 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2630 output to the ostream.
2632 * several files: fixed types based on warnings from cxx
2634 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2636 * src/frontends/kde/Makefile.am: fix rule for
2637 formindexdialogdata_moc.C
2639 * src/.cvsignore: add ext_l10n.h to ignore
2641 * acconfig.h: stop messing with __STRICT_ANSI__
2642 * config/gnome.m4: remove option to set -ansi
2643 * config/kde.m4: remove option to set -ansi
2644 * config/lyxinclude.m4: don't set -ansi
2646 2000-09-27 Juergen Vigna <jug@sad.it>
2648 * various files: remove "default" language check.
2650 * src/insets/insetquotes.C: removed use of current_view.
2652 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2653 the one should have red ears by now!
2655 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2656 in more then one paragraph. Fixed cursor-movement/selection.
2658 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2659 paragraphs inside a text inset.
2661 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2662 text-inset if this owner is an inset.
2664 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2666 * src/Bullet.h: changed type of font, character and size to int
2668 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2670 * src/insets/inseturl.[Ch]:
2671 * src/insets/insetref.[Ch]:
2672 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2674 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2676 * src/buffer.C (readFile): block-if statement rearranged to minimise
2677 bloat. Patch does not reverse Jean-Marc's change ;-)
2679 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2680 Class rewritten to store pointers to hide/update signals directly,
2681 rather than Dialogs *. Also defined an enum to ease use. All xforms
2682 forms can now be derived from this class.
2684 * src/frontends/xforms/FormCommand.[Ch]
2685 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2687 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2690 * src/frontends/xforms/forms/form_citation.fd
2691 * src/frontends/xforms/forms/form_copyright.fd
2692 * src/frontends/xforms/forms/form_error.fd
2693 * src/frontends/xforms/forms/form_index.fd
2694 * src/frontends/xforms/forms/form_ref.fd
2695 * src/frontends/xforms/forms/form_toc.fd
2696 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2698 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2700 * src/insets/insetfoot.C: removed redundent using directive.
2702 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2704 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2705 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2707 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2708 created in the constructors in different groups. Then set() just
2709 have to show the groups as needed. This fixes the redraw problems
2710 (and is how the old menu code worked).
2712 * src/support/lyxlib.h: declare the methods as static when we do
2713 not have namespaces.
2715 2000-09-26 Juergen Vigna <jug@sad.it>
2717 * src/buffer.C (asciiParagraph): new function.
2718 (writeFileAscii): new function with parameter ostream.
2719 (writeFileAscii): use now asciiParagraph.
2721 * various inset files: added the linelen parameter to the Ascii-func.
2723 * src/tabular.C (Write): fixed error in writing file introduced by
2724 the last changes from Lars.
2726 * lib/bind/menus.bind: removed not supported functions.
2728 * src/insets/insettext.C (Ascii): implemented this function.
2730 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2732 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2733 (Write): use of the write_attribute functions.
2735 * src/bufferlist.C (close): fixed reasking question!
2737 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2739 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2740 new files use the everwhere possible.
2743 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2744 src/log_form.C src/lyx.C:
2747 * src/buffer.C (runLaTeX): remove func
2749 * src/PaperLayout.C: removed file
2750 * src/ParagraphExtra.C: likewise
2751 * src/bullet_forms.C: likewise
2752 * src/bullet_forms.h: likewise
2753 * src/bullet_forms_cb.C: likewise
2755 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2756 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2759 * several files: remove all traces of the old fd_form_paragraph,
2760 and functions belonging to that.
2762 * several files: remove all traces of the old fd_form_document,
2763 and functions belonging to that.
2765 * several files: constify local variables were possible.
2767 * several files: remove all code that was dead when NEW_EXPORT was
2770 * several files: removed string::c_str in as many places as
2773 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2774 (e): be a bit more outspoken when patching
2775 (updatesrc): only move files if changed.
2777 * forms/layout_forms.h.patch: regenerated
2779 * forms/layout_forms.fd: remove form_document and form_paragraph
2780 and form_quotes and form_paper and form_table_options and
2781 form_paragraph_extra
2783 * forms/form1.fd: remove form_table
2785 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2786 the fdui->... rewrite. Update some comments to xforms 0.88
2788 * forms/bullet_forms.C.patch: removed file
2789 * forms/bullet_forms.fd: likewise
2790 * forms/bullet_forms.h.patch: likewise
2792 * development/Code_rules/Rules: added a section on switch
2793 statements. Updated some comment to xforms 0.88.
2795 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2797 * src/buffer.C (readFile): make sure that the whole version number
2798 is read after \lyxformat (even when it contains a comma)
2800 * lib/ui/default.ui: change shortcut of math menu to M-a.
2802 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2804 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2807 * src/LyXView.C (updateWindowTitle): show the full files name in
2808 window title, limited to 30 characters.
2810 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2811 When a number of characters has been given, we should not assume
2812 that the string is 0-terminated.
2814 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2815 calls (fixes some memory leaks)
2817 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2818 trans member on exit.
2820 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2822 * src/converter.C (GetReachable): fix typo.
2824 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2825 understand ',' instead of '.'.
2826 (GetInteger): rewrite to use strToInt().
2828 2000-09-26 Juergen Vigna <jug@sad.it>
2830 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2831 better visibility and error-message on wrong VSpace input.
2833 * src/language.C (initL): added english again.
2835 2000-09-25 Juergen Vigna <jug@sad.it>
2837 * src/frontends/kde/Dialogs.C (Dialogs):
2838 * src/frontends/gnome/Dialogs.C (Dialogs):
2839 * src/frontends/kde/Makefile.am:
2840 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2842 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2844 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2846 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2848 * src/frontends/xforms/FormParagraph.C:
2849 * src/frontends/xforms/FormParagraph.h:
2850 * src/frontends/xforms/form_paragraph.C:
2851 * src/frontends/xforms/form_paragraph.h:
2852 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2855 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2857 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2858 Paragraph-Data after use.
2860 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2861 non breakable paragraphs.
2863 2000-09-25 Garst R. Reese <reese@isn.net>
2865 * src/language.C (initL): added missing language_country codes.
2867 2000-09-25 Juergen Vigna <jug@sad.it>
2869 * src/insets/insettext.C (InsetText):
2870 (deleteLyXText): remove the not released LyXText structure!
2872 2000-09-24 Marko Vendelin <markov@ioc.ee>
2874 * src/frontends/gnome/mainapp.C
2875 * src/frontends/gnome/mainapp.h: added support for keyboard
2878 * src/frontends/gnome/FormCitation.C
2879 * src/frontends/gnome/FormCitation.h
2880 * src/frontends/gnome/Makefile.am
2881 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2882 FormCitation to use "action area" in mainapp window
2884 * src/frontends/gnome/Menubar_pimpl.C
2885 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2888 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2890 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2891 width/descent/ascent values if name is empty.
2892 (mathed_string_height): Use std::max.
2894 2000-09-25 Allan Rae <rae@lyx.org>
2896 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2897 segfault. This will be completely redesigned soon.
2899 * sigc++: updated libsigc++. Fixes struct timespec bug.
2901 * development/tools/makeLyXsigc.sh: .cvsignore addition
2903 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2905 * several files: removed almost all traces of the old table
2908 * src/TableLayout.C: removed file
2910 2000-09-22 Juergen Vigna <jug@sad.it>
2912 * src/frontends/kde/Dialogs.C: added credits forms.
2914 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2916 * src/frontends/gnome/Dialogs.C: added some forms.
2918 * src/spellchecker.C (init_spell_checker): set language in pspell code
2919 (RunSpellChecker): some modifications for setting language string.
2921 * src/language.[Ch]: added language_country code.
2923 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2925 * src/frontends/Dialogs.h: added new signal showError.
2926 Rearranged existing signals in some sort of alphabetical order.
2928 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2929 FormError.[Ch], form_error.[Ch]
2930 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2931 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2933 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2934 dialogs. I think that this can be used as the base to all these
2937 * src/frontends/xforms/FormError.[Ch]
2938 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2939 implementation of InsetError dialog.
2941 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2943 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2944 * src/frontends/kde/Makefile.am: ditto
2946 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2948 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2949 macrobf. This fixes a bug of invisible text.
2951 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2953 * lib/doc/LaTeXConfig.lyx.in: updated.
2955 * src/language.C (initL): remove language "francais" and change a
2956 bit the names of the two other french variations.
2958 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2959 string that may not be 0-terminated.
2961 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2963 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2965 2000-09-20 Marko Vendelin <markov@ioc.ee>
2967 * src/frontends/gnome/FormCitation.C
2968 * src/frontends/gnome/FormIndex.C
2969 * src/frontends/gnome/FormToc.C
2970 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2971 the variable initialization to shut up the warnings
2973 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2975 * src/table.[Ch]: deleted files
2977 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2980 2000-09-18 Juergen Vigna <jug@sad.it>
2982 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2983 problems with selection. Inserted new LFUN_PASTESELECTION.
2984 (InsetButtonPress): inserted handling of middle mouse-button paste.
2986 * src/spellchecker.C: changed word to word.c_str().
2988 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2990 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2991 included in the ``make dist'' tarball.
2993 2000-09-15 Juergen Vigna <jug@sad.it>
2995 * src/CutAndPaste.C (cutSelection): small fix return the right
2996 end position after cut inside one paragraph only.
2998 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2999 we are locked as otherwise we don't have a valid cursor position!
3001 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3003 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3005 * src/frontends/kde/FormRef.C: added using directive.
3006 * src/frontends/kde/FormToc.C: ditto
3008 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3010 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3012 2000-09-19 Marko Vendelin <markov@ioc.ee>
3014 * src/frontends/gnome/Menubar_pimpl.C
3015 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3016 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3018 * src/frontends/gnome/mainapp.C
3019 * src/frontends/gnome/mainapp.h: support for menu update used
3022 * src/frontends/gnome/mainapp.C
3023 * src/frontends/gnome/mainapp.h: support for "action" area in the
3024 main window. This area is used by small simple dialogs, such as
3027 * src/frontends/gnome/FormIndex.C
3028 * src/frontends/gnome/FormIndex.h
3029 * src/frontends/gnome/FormUrl.C
3030 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3033 * src/frontends/gnome/FormCitation.C
3034 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3035 action area. Only "Insert new citation" is implemented.
3037 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3039 * src/buffer.C (Dispatch): fix call to Dispatch
3040 * src/insets/insetref.C (Edit): likewise
3041 * src/insets/insetparent.C (Edit): likewise
3042 * src/insets/insetinclude.C (include_cb): likewise
3043 * src/frontends/xforms/FormUrl.C (apply): likewise
3044 * src/frontends/xforms/FormToc.C (apply): likewise
3045 * src/frontends/xforms/FormRef.C (apply): likewise
3046 * src/frontends/xforms/FormIndex.C (apply): likewise
3047 * src/frontends/xforms/FormCitation.C (apply): likewise
3048 * src/lyxserver.C (callback): likewise
3049 * src/lyxfunc.C (processKeySym): likewise
3050 (Dispatch): likewise
3051 (Dispatch): likewise
3052 * src/lyx_cb.C (LayoutsCB): likewise
3054 * Makefile.am (sourcedoc): small change
3056 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3058 * src/main.C (main): Don't make an empty GUIRunTime object. all
3059 methods are static. constify a bit remove unneded using + headers.
3061 * src/tabular.C: some more const to local vars move some loop vars
3063 * src/spellchecker.C: added some c_str after some word for pspell
3065 * src/frontends/GUIRunTime.h: add new static method setDefaults
3066 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3067 * src/frontends/kde/GUIRunTime.C (setDefaults):
3068 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3070 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3071 with strnew in arg, use correct emptystring when calling SetName.
3073 * several files: remove all commented code with relation to
3074 HAVE_SSTREAM beeing false. We now only support stringstream and
3077 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3079 * src/lyxfunc.C: construct correctly the automatic new file
3082 * src/text2.C (IsStringInText): change type of variable i to shut
3085 * src/support/sstream.h: do not use namespaces if the compiler
3086 does not support them.
3088 2000-09-15 Marko Vendelin <markov@ioc.ee>
3089 * src/frontends/gnome/FormCitation.C
3090 * src/frontends/gnome/FormCitation.h
3091 * src/frontends/gnome/diainsertcitation_interface.c
3092 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3093 regexp support to FormCitation [Gnome].
3095 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3098 * configure.in: remove unused KDE/GTKGUI define
3100 * src/frontends/kde/FormRef.C
3101 * src/frontends/kde/FormRef.h
3102 * src/frontends/kde/formrefdialog.C
3103 * src/frontends/kde/formrefdialog.h: double click will
3104 go to reference, now it is possible to change a cross-ref
3107 * src/frontends/kde/FormToc.C
3108 * src/frontends/kde/FormToc.h
3109 * src/frontends/kde/formtocdialog.C
3110 * src/frontends/kde/formtocdialog.h: add a depth
3113 * src/frontends/kde/Makefile.am: add QtLyXView.h
3116 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3118 * src/frontends/kde/FormCitation.h: added some using directives.
3120 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3122 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3125 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3128 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3130 * src/buffer.C (pop_tag): revert for the second time a change by
3131 Lars, who seems to really hate having non-local loop variables :)
3133 * src/Lsstream.h: add "using" statements.
3135 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3136 * src/buffer.C (writeFile): ditto
3138 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3140 * src/buffer.C (writeFile): try to fix the locale modified format
3141 number to always be as we want it.
3143 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3144 in XForms 0.89. C-space is now working again.
3146 * src/Lsstream.h src/support/sstream.h: new files.
3148 * also commented out all cases where strstream were used.
3150 * src/Bullet.h (c_str): remove method.
3152 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3154 * a lot of files: get rid of "char const *" and "char *" is as
3155 many places as possible. We only want to use them in interaction
3156 with system of other libraries, not inside lyx.
3158 * a lot of files: return const object is not of pod type. This
3159 helps ensure that temporary objects is not modified. And fits well
3160 with "programming by contract".
3162 * configure.in: check for the locale header too
3164 * Makefile.am (sourcedoc): new tag for generation of doc++
3167 2000-09-14 Juergen Vigna <jug@sad.it>
3169 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3170 callback to check which combo called it and do the right action.
3172 * src/combox.C (combo_cb): added combo * to the callbacks.
3173 (Hide): moved call of callback after Ungrab of the pointer.
3175 * src/intl.h: removed LCombo2 function.
3177 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3178 function as this can now be handled in one function.
3180 * src/combox.h: added Combox * to callback prototype.
3182 * src/frontends/xforms/Toolbar_pimpl.C:
3183 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3185 2000-09-14 Garst Reese <reese@isn.net>
3187 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3188 moved usepackage{xxx}'s to beginning of file. Changed left margin
3189 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3190 underlining from title. Thanks to John Culleton for useful suggestions.
3192 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3194 * src/lyxlex_pimpl.C (setFile): change error message to debug
3197 2000-09-13 Juergen Vigna <jug@sad.it>
3199 * src/frontends/xforms/FormDocument.C: implemented choice_class
3200 as combox and give callback to combo_language so OK/Apply is activated
3203 * src/bufferlist.C (newFile): small fix so already named files
3204 (via an open call) are not requested to be named again on the
3207 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3209 * src/frontends/kde/Makefile.am
3210 * src/frontends/kde/FormRef.C
3211 * src/frontends/kde/FormRef.h
3212 * src/frontends/kde/formrefdialog.C
3213 * src/frontends/kde/formrefdialog.h: implement
3216 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3218 * src/frontends/kde/formtocdialog.C
3219 * src/frontends/kde/formtocdialog.h
3220 * src/frontends/kde/FormToc.C
3221 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3223 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3225 * src/frontends/kde/FormCitation.C: fix thinko
3226 where we didn't always display the reference text
3229 * src/frontends/kde/formurldialog.C
3230 * src/frontends/kde/formurldialog.h
3231 * src/frontends/kde/FormUrl.C
3232 * src/frontends/kde/FormUrl.h: minor cleanups
3234 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3236 * src/frontends/kde/Makefile.am
3237 * src/frontends/kde/FormToc.C
3238 * src/frontends/kde/FormToc.h
3239 * src/frontends/kde/FormCitation.C
3240 * src/frontends/kde/FormCitation.h
3241 * src/frontends/kde/FormIndex.C
3242 * src/frontends/kde/FormIndex.h
3243 * src/frontends/kde/formtocdialog.C
3244 * src/frontends/kde/formtocdialog.h
3245 * src/frontends/kde/formcitationdialog.C
3246 * src/frontends/kde/formcitationdialog.h
3247 * src/frontends/kde/formindexdialog.C
3248 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3250 2000-09-12 Juergen Vigna <jug@sad.it>
3252 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3255 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3257 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3260 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3262 * src/converter.C (Add, Convert): Added support for converter flags:
3263 needaux, resultdir, resultfile.
3264 (Convert): Added new parameter view_file.
3265 (dvips_options): Fixed letter paper option.
3267 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3268 (Export, GetExportableFormats, GetViewableFormats): Added support
3271 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3273 (easyParse): Fixed to work with new export code.
3275 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3278 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3280 * lib/bind/*.bind: Replaced
3281 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3282 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3284 2000-09-11 Juergen Vigna <jug@sad.it>
3286 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3288 * src/main.C (main): now GUII defines global guiruntime!
3290 * src/frontends/gnome/GUIRunTime.C (initApplication):
3291 * src/frontends/kde/GUIRunTime.C (initApplication):
3292 * src/frontends/xforms/GUIRunTime.C (initApplication):
3293 * src/frontends/GUIRunTime.h: added new function initApplication.
3295 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3297 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3299 2000-09-08 Juergen Vigna <jug@sad.it>
3301 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3302 we have already "Reset".
3304 * src/language.C (initL): inserted "default" language and made this
3305 THE default language (and not american!)
3307 * src/paragraph.C: inserted handling of "default" language!
3309 * src/lyxfont.C: ditto
3313 * src/paragraph.C: output the \\par only if we have a following
3314 paragraph otherwise it's not needed.
3316 2000-09-05 Juergen Vigna <jug@sad.it>
3318 * config/pspell.m4: added entry to lyx-flags
3320 * src/spellchecker.C: modified version from Kevin for using pspell
3322 2000-09-01 Marko Vendelin <markov@ioc.ee>
3323 * src/frontends/gnome/Makefile.am
3324 * src/frontends/gnome/FormCitation.C
3325 * src/frontends/gnome/FormCitation.h
3326 * src/frontends/gnome/diainsertcitation_callbacks.c
3327 * src/frontends/gnome/diainsertcitation_callbacks.h
3328 * src/frontends/gnome/diainsertcitation_interface.c
3329 * src/frontends/gnome/diainsertcitation_interface.h
3330 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3331 dialog for Gnome frontend
3333 * src/main.C: Gnome libraries require keeping application name
3334 and its version as strings
3336 * src/frontends/gnome/mainapp.C: Change the name of the main window
3337 from GnomeLyX to PACKAGE
3339 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3341 * src/frontends/Liason.C: add "using: declaration.
3343 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3345 * src/mathed/math_macro.C (Metrics): Set the size of the template
3347 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3349 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3351 * src/converter.C (add_options): New function.
3352 (SetViewer): Change $$FName into '$$FName'.
3353 (View): Add options when running xdvi
3354 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3355 (Convert): The 3rd parameter is now the desired filename. Converts
3356 calls to lyx::rename if necessary.
3357 Add options when running dvips.
3358 (dvi_papersize,dvips_options): New methods.
3360 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3362 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3363 using a call to Converter::dvips_options.
3364 Fixed to work with nex export code.
3366 * src/support/copy.C
3367 * src/support/rename.C: New files
3369 * src/support/syscall.h
3370 * src/support/syscall.C: Added Starttype SystemDontWait.
3372 * lib/ui/default.ui: Changed to work with new export code
3374 * lib/configure.m4: Changed to work with new export code
3376 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3378 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3380 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3381 so that code compiles with DEC cxx.
3383 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3384 to work correctly! Also now supports the additional elements
3387 2000-09-01 Allan Rae <rae@lyx.org>
3389 * src/frontends/ButtonPolicies.C: renamed all the references to
3390 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3392 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3393 since it's a const not a type.
3395 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3397 2000-08-31 Juergen Vigna <jug@sad.it>
3399 * src/insets/figinset.C: Various changes to look if the filename has
3400 an extension and if not add it for inline previewing.
3402 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3404 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3405 make buttonStatus and isReadOnly be const methods. (also reflect
3406 this in derived classes.)
3408 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3409 (nextState): change to be static inline, pass the StateMachine as
3411 (PreferencesPolicy): remove casts
3412 (OkCancelPolicy): remvoe casts
3413 (OkCancelReadOnlyPolicy): remove casts
3414 (NoRepeatedApplyReadOnlyPolicy): remove casts
3415 (OkApplyCancelReadOnlyPolicy): remove casts
3416 (OkApplyCancelPolicy): remove casts
3417 (NoRepeatedApplyPolicy): remove casts
3419 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3421 * src/converter.C: added some using directives
3423 * src/frontends/ButtonPolicies.C: changes to overcome
3424 "need lvalue" error with DEC c++
3426 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3427 to WMHideCB for DEC c++
3429 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3431 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3432 to BulletBMTableCB for DEC c++
3434 2000-08-31 Allan Rae <rae@lyx.org>
3436 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3437 character dialog separately from old document dialogs combo_language.
3440 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3442 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3443 Removed LFUN_REF_CREATE.
3445 * src/MenuBackend.C: Added new tags: toc and references
3447 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3448 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3450 (add_toc, add_references): New methods.
3451 (create_submenu): Handle correctly the case when there is a
3452 seperator after optional menu items.
3454 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3455 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3456 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3458 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3460 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3462 * src/converter.[Ch]: New file for converting between different
3465 * src/export.[Ch]: New file for exporting a LyX file to different
3468 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3469 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3470 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3471 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3472 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3473 RunDocBook, MenuExport.
3475 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3476 Exporter::Preview methods if NEW_EXPORT is defined.
3478 * src/buffer.C (Dispatch): Use Exporter::Export.
3480 * src/lyxrc.C: Added new tags: \converter and \viewer.
3483 * src/LyXAction.C: Define new lyx-function: buffer-update.
3484 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3485 when NEW_EXPORT is defined.
3487 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3489 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3491 * lib/ui/default.ui: Added submenus "view" and "update" to the
3494 * src/filetools.C (GetExtension): New function.
3496 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3498 2000-08-29 Allan Rae <rae@lyx.org>
3500 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3502 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3503 (EnableDocumentLayout): removed
3504 (DisableDocumentLayout): removed
3505 (build): make use of ButtonController's read-only handling to
3506 de/activate various objects. Replaces both of the above functions.
3508 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3509 (readOnly): was read_only
3510 (refresh): fixed dumb mistakes with read_only_ handling
3512 * src/frontends/xforms/forms/form_document.fd:
3513 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3514 tabbed dialogs so the tabs look more like tabs and so its easier to
3515 work out which is the current tab.
3517 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3518 segfault with form_table
3520 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3522 2000-08-28 Juergen Vigna <jug@sad.it>
3524 * acconfig.h: added USE_PSPELL.
3526 * src/config.h.in: added USE_PSPELL.
3528 * autogen.sh: added pspell.m4
3530 * config/pspell.m4: new file.
3532 * src/spellchecker.C: implemented support for pspell libary.
3534 2000-08-25 Juergen Vigna <jug@sad.it>
3536 * src/LyXAction.C (init): renamed LFUN_TABLE to
3537 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3539 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3541 * src/lyxscreen.h: add force_clear variable and fuction to force
3542 a clear area when redrawing in LyXText.
3544 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3546 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3548 * some whitespace and comment changes.
3550 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3552 * src/buffer.C: up te LYX_FORMAT to 2.17
3554 2000-08-23 Juergen Vigna <jug@sad.it>
3556 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3559 * src/insets/insettabular.C (pasteSelection): delete the insets
3560 LyXText as it is not valid anymore.
3561 (copySelection): new function.
3562 (pasteSelection): new function.
3563 (cutSelection): new function.
3564 (LocalDispatch): implemented cut/copy/paste of cell selections.
3566 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3567 don't have a LyXText.
3569 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3571 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3574 2000-08-22 Juergen Vigna <jug@sad.it>
3576 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3577 ifdef form_table out if NEW_TABULAR.
3579 2000-08-21 Juergen Vigna <jug@sad.it>
3581 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3582 (draw): fixed draw position so that the cursor is positioned in the
3584 (InsetMotionNotify): hide/show cursor so the position is updated.
3585 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3586 using cellstart() function where it should be used.
3588 * src/insets/insettext.C (draw): ditto.
3590 * src/tabular.C: fixed initialization of some missing variables and
3591 made BoxType into an enum.
3593 2000-08-22 Marko Vendelin <markov@ioc.ee>
3594 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3595 stock menu item using action numerical value, not its string
3599 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3601 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3602 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3604 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3606 * src/frontends/xforms/GUIRunTime.C: new file
3608 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3609 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3611 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3613 * src/frontends/kde/GUIRunTime.C: new file
3615 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3616 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3618 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3620 * src/frontends/gnome/GUIRunTime.C: new file
3622 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3625 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3626 small change to documetentation.
3628 * src/frontends/GUIRunTime.C: removed file
3630 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3632 * src/lyxparagraph.h: enable NEW_TABULAR as default
3634 * src/lyxfunc.C (processKeySym): remove some commented code
3636 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3637 NEW_TABULAR around the fd_form_table_options.
3639 * src/lyx_gui.C (runTime): call the static member function as
3640 GUIRunTime::runTime().
3642 2000-08-21 Allan Rae <rae@lyx.org>
3644 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3647 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3649 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3651 2000-08-21 Allan Rae <rae@lyx.org>
3653 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3654 keep Garst happy ;-)
3655 * src/frontends/xforms/FormPreferences.C (build): use setOK
3656 * src/frontends/xforms/FormDocument.C (build): use setOK
3657 (FormDocument): use the appropriate policy.
3659 2000-08-21 Allan Rae <rae@lyx.org>
3661 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3662 automatic [de]activation of arbitrary objects when in a read-only state.
3664 * src/frontends/ButtonPolicies.h: More documentation
3665 (isReadOnly): added to support the above.
3667 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3669 2000-08-18 Juergen Vigna <jug@sad.it>
3671 * src/insets/insettabular.C (getStatus): changed to return func_status.
3673 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3674 display toggle menu entries if they are.
3676 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3677 new document layout now.
3679 * src/lyxfunc.C: ditto
3681 * src/lyx_gui_misc.C: ditto
3683 * src/lyx_gui.C: ditto
3685 * lib/ui/default.ui: removed paper and quotes layout as they are now
3686 all in the document layout tabbed folder.
3688 * src/frontends/xforms/forms/form_document.fd: added Restore
3689 button and callbacks for all inputs for Allan's ButtonPolicy.
3691 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3692 (CheckChoiceClass): added missing params setting on class change.
3693 (UpdateLayoutDocument): added for updating the layout on params.
3694 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3695 (FormDocument): Implemented Allan's ButtonPolicy with the
3698 2000-08-17 Allan Rae <rae@lyx.org>
3700 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3701 so we can at least see the credits again.
3703 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3704 controller calls for the appropriate callbacks. Note that since Ok
3705 calls apply followed by cancel, and apply isn't a valid input for the
3706 APPLIED state, the bc_ calls have to be made in the static callback not
3707 within each of the real callbacks.
3709 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3710 (setOk): renamed from setOkay()
3712 2000-08-17 Juergen Vigna <jug@sad.it>
3714 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3715 in the implementation part.
3716 (composeUIInfo): don't show optional menu-items.
3718 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3720 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3722 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3723 text-state when in a text-inset.
3725 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3727 2000-08-17 Marko Vendelin <markov@ioc.ee>
3728 * src/frontends/gnome/FormIndex.C
3729 * src/frontends/gnome/FormIndex.h
3730 * src/frontends/gnome/FormToc.C
3731 * src/frontends/gnome/FormToc.h
3732 * src/frontends/gnome/dialogs
3733 * src/frontends/gnome/diatoc_callbacks.c
3734 * src/frontends/gnome/diatoc_callbacks.h
3735 * src/frontends/gnome/diainsertindex_callbacks.h
3736 * src/frontends/gnome/diainsertindex_callbacks.c
3737 * src/frontends/gnome/diainsertindex_interface.c
3738 * src/frontends/gnome/diainsertindex_interface.h
3739 * src/frontends/gnome/diatoc_interface.h
3740 * src/frontends/gnome/diatoc_interface.c
3741 * src/frontends/gnome/Makefile.am: Table of Contents and
3742 Insert Index dialogs implementation for Gnome frontend
3744 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3746 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3748 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3751 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3753 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3754 destructor. Don't definde if you don't need it
3755 (processEvents): made static, non-blocking events processing for
3757 (runTime): static method. event loop for xforms
3758 * similar as above for kde and gnome.
3760 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3761 new Pimpl is correct
3762 (runTime): new method calss the real frontends runtime func.
3764 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3766 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3768 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3770 2000-08-16 Juergen Vigna <jug@sad.it>
3772 * src/lyx_gui.C (runTime): added GUII RunTime support.
3774 * src/frontends/Makefile.am:
3775 * src/frontends/GUIRunTime.[Ch]:
3776 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3777 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3778 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3780 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3782 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3783 as this is already set in ${FRONTEND_INCLUDE} if needed.
3785 * configure.in (CPPFLAGS): setting the include dir for the frontend
3786 directory and don't set FRONTEND=xforms for now as this is executed
3789 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3791 * src/frontends/kde/Makefile.am:
3792 * src/frontends/kde/FormUrl.C:
3793 * src/frontends/kde/FormUrl.h:
3794 * src/frontends/kde/formurldialog.h:
3795 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3797 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3799 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3801 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3803 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3806 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3808 * src/WorkArea.C (work_area_handler): more work to get te
3809 FL_KEYBOARD to work with xforms 0.88 too, please test.
3811 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3813 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3815 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3818 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3820 * src/Timeout.h: remove Qt::emit hack.
3822 * several files: changes to allo doc++ compilation
3824 * src/lyxfunc.C (processKeySym): new method
3825 (processKeyEvent): comment out if FL_REVISION < 89
3827 * src/WorkArea.C: change some debugging levels.
3828 (WorkArea): set wantkey to FL_KEY_ALL
3829 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3830 clearer code and the use of compose with XForms 0.89. Change to
3831 use signals instead of calling methods in bufferview directly.
3833 * src/Painter.C: change some debugging levels.
3835 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3838 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3839 (workAreaKeyPress): new method
3841 2000-08-14 Juergen Vigna <jug@sad.it>
3843 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3845 * config/kde.m4: addes some features
3847 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3848 include missing xforms dialogs.
3850 * src/Timeout.h: a hack to be able to compile with qt/kde.
3852 * sigc++/.cvsignore: added acinclude.m4
3854 * lib/.cvsignore: added listerros
3856 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3857 xforms tree as objects are needed for other frontends.
3859 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3860 linking with not yet implemented xforms objects.
3862 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3864 2000-08-14 Baruch Even <baruch.even@writeme.com>
3866 * src/frontends/xforms/FormGraphics.h:
3867 * src/frontends/xforms/FormGraphics.C:
3868 * src/frontends/xforms/RadioButtonGroup.h:
3869 * src/frontends/xforms/RadioButtonGroup.C:
3870 * src/insets/insetgraphics.h:
3871 * src/insets/insetgraphics.C:
3872 * src/insets/insetgraphicsParams.h:
3873 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3874 instead of spaces, and various other indentation issues to make the
3875 sources more consistent.
3877 2000-08-14 Marko Vendelin <markov@ioc.ee>
3879 * src/frontends/gnome/dialogs/diaprint.glade
3880 * src/frontends/gnome/FormPrint.C
3881 * src/frontends/gnome/FormPrint.h
3882 * src/frontends/gnome/diaprint_callbacks.c
3883 * src/frontends/gnome/diaprint_callbacks.h
3884 * src/frontends/gnome/diaprint_interface.c
3885 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3888 * src/frontends/gnome/dialogs/diainserturl.glade
3889 * src/frontends/gnome/FormUrl.C
3890 * src/frontends/gnome/FormUrl.h
3891 * src/frontends/gnome/diainserturl_callbacks.c
3892 * src/frontends/gnome/diainserturl_callbacks.h
3893 * src/frontends/gnome/diainserturl_interface.c
3894 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3895 Gnome implementation
3897 * src/frontends/gnome/Dialogs.C
3898 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3899 all other dialogs. Copy all unimplemented dialogs from Xforms
3902 * src/frontends/gnome/support.c
3903 * src/frontends/gnome/support.h: support files generated by Glade
3907 * config/gnome.m4: Gnome configuration scripts
3909 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3910 configure --help message
3912 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3913 only if there are no events pendling in Gnome/Gtk. This enhances
3914 the performance of menus.
3917 2000-08-14 Allan Rae <rae@lyx.org>
3919 * lib/Makefile.am: listerrors cleaning
3921 * lib/listerrors: removed -- generated file
3922 * acinclude.m4: ditto
3923 * sigc++/acinclude.m4: ditto
3925 * src/frontends/xforms/forms/form_citation.fd:
3926 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3929 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3930 `updatesrc` and now we have a `test` target that does what `updatesrc`
3931 used to do. I didn't like having an install target that wasn't related
3934 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3935 on all except FormGraphics. This may yet happen. Followed by a major
3936 cleanup including using FL_TRANSIENT for most of the dialogs. More
3937 changes to come when the ButtonController below is introduced.
3939 * src/frontends/xforms/ButtonController.h: New file for managing up to
3940 four buttons on a dialog according to an externally defined policy.
3941 * src/frontends/xforms/Makefile.am: added above
3943 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3944 Apply and Cancel/Close buttons and everything in between and beyond.
3945 * src/frontends/Makefile.am: added above.
3947 * src/frontends/xforms/forms/form_preferences.fd:
3948 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3949 and removed variable 'status' as a result. Fixed the set_minsize thing.
3950 Use the new screen-font-update after checking screen fonts were changed
3951 Added a "Restore" button to restore the original lyxrc values while
3952 editing. This restores everything not just the last input changed.
3953 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3955 * src/LyXAction.C: screen-font-update added for updating buffers after
3956 screen font settings have been changed.
3957 * src/commandtags.h: ditto
3958 * src/lyxfunc.C: ditto
3960 * forms/lyx.fd: removed screen fonts dialog.
3961 * src/lyx_gui.C: ditto
3962 * src/menus.[Ch]: ditto
3963 * src/lyx.[Ch]: ditto
3964 * src/lyx_cb.C: ditto + code from here moved to make
3965 screen-font-update. And people wonder why progress on GUII is
3966 slow. Look at how scattered this stuff was! It takes forever
3969 * forms/fdfix.sh: Fixup the spacing after commas.
3970 * forms/makefile: Remove date from generated files. Fewer clashes now.
3971 * forms/bullet_forms.C.patch: included someones handwritten changes
3973 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3974 once I've discovered why LyXRC was made noncopyable.
3975 * src/lyx_main.C: ditto
3977 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3979 * src/frontends/xforms/forms/fdfix.sh:
3980 * src/frontends/xforms/forms/fdfixh.sed:
3981 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3982 * src/frontends/xforms/Form*.[hC]:
3983 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3984 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3985 provide a destructor for the struct FD_form_xxxx. Another version of
3986 the set_[max|min]size workaround and a few other cleanups. Actually,
3987 Angus' patch from 20000809.
3989 2000-08-13 Baruch Even <baruch.even@writeme.com>
3991 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3994 2000-08-11 Juergen Vigna <jug@sad.it>
3996 * src/insets/insetgraphics.C (InsetGraphics): changing init
3997 order because of warnings.
3999 * src/frontends/xforms/forms/makefile: adding patching .C with
4002 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4003 from .C.patch to .c.patch
4005 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4006 order because of warning.
4008 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4010 * src/frontends/Liason.C (setMinibuffer): new helper function
4012 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4014 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4016 * lib/ui/default.ui: commented out PaperLayout entry
4018 * src/frontends/xforms/form_document.[Ch]: new added files
4020 * src/frontends/xforms/FormDocument.[Ch]: ditto
4022 * src/frontends/xforms/forms/form_document.fd: ditto
4024 * src/frontends/xforms/forms/form_document.C.patch: ditto
4026 2000-08-10 Juergen Vigna <jug@sad.it>
4028 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4029 (InsetGraphics): initialized cacheHandle to 0.
4030 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4032 2000-08-10 Baruch Even <baruch.even@writeme.com>
4034 * src/graphics/GraphicsCache.h:
4035 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4036 correctly as a cache.
4038 * src/graphics/GraphicsCacheItem.h:
4039 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4042 * src/graphics/GraphicsCacheItem_pimpl.h:
4043 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4046 * src/insets/insetgraphics.h:
4047 * src/insets/insetgraphics.C: Changed from using a signal notification
4048 to polling when image is not loaded.
4050 2000-08-10 Allan Rae <rae@lyx.org>
4052 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4053 that there are two functions that have to been taken out of line by
4054 hand and aren't taken care of in the script. (Just a reminder note)
4056 * sigc++/macros/*.h.m4: Updated as above.
4058 2000-08-09 Juergen Vigna <jug@sad.it>
4060 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4062 * src/insets/insettabular.C: make drawing of single cell smarter.
4064 2000-08-09 Marko Vendelin <markov@ioc.ee>
4065 * src/frontends/gnome/Menubar_pimpl.C
4066 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4067 implementation: new files
4069 * src/frontends/gnome/mainapp.C
4070 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4073 * src/main.C: create Gnome main window
4075 * src/frontends/xforms/Menubar_pimpl.h
4076 * src/frontends/Menubar.C
4077 * src/frontends/Menubar.h: added method Menubar::update that calls
4078 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4080 * src/LyXView.C: calls Menubar::update to update the state
4083 * src/frontends/gnome/Makefile.am: added new files
4085 * src/frontends/Makefile.am: added frontend compiler options
4087 2000-08-08 Juergen Vigna <jug@sad.it>
4089 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4091 * src/bufferlist.C (close):
4092 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4093 documents if exiting without saving.
4095 * src/buffer.C (save): use removeAutosaveFile()
4097 * src/support/filetools.C (removeAutosaveFile): new function.
4099 * src/lyx_cb.C (MenuWrite): returns a bool now.
4100 (MenuWriteAs): check if file could really be saved and revert to the
4102 (MenuWriteAs): removing old autosavefile if existant.
4104 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4105 before Goto toggle declaration, because of compiler warning.
4107 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4109 * src/lyxfunc.C (MenuNew): small fix.
4111 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4113 * src/bufferlist.C (newFile):
4114 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4116 * src/lyxrc.C: added new_ask_filename tag
4118 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4120 * src/lyx.fd: removed code pertaining to form_ref
4121 * src/lyx.[Ch]: ditto
4122 * src/lyx_cb.C: ditto
4123 * src/lyx_gui.C: ditto
4124 * src/lyx_gui_misc.C: ditto
4126 * src/BufferView_pimpl.C (restorePosition): update buffer only
4129 * src/commandtags.h (LFUN_REFTOGGLE): removed
4130 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4131 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4132 (LFUN_REFBACK): renamed LFUN_REF_BACK
4134 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4135 * src/menus.C: ditto
4136 * src/lyxfunc.C (Dispatch): ditto.
4137 InsertRef dialog is now GUI-independent.
4139 * src/texrow.C: added using std::endl;
4141 * src/insets/insetref.[Ch]: strip out large amounts of code.
4142 The inset is now a container and this functionality is now
4143 managed by a new FormRef dialog
4145 * src/frontends/Dialogs.h (showRef, createRef): new signals
4147 * src/frontends/xforms/FormIndex.[Ch],
4148 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4149 when setting dialog's min/max size
4150 * src/frontends/xforms/FormIndex.[Ch]: ditto
4152 * src/frontends/xforms/FormRef.[Ch],
4153 src/frontends/xforms/forms/form_ref.fd: new xforms
4154 implementation of an InsetRef dialog
4156 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4159 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4160 ios::nocreate is not part of the standard. Removed.
4162 2000-08-07 Baruch Even <baruch.even@writeme.com>
4164 * src/graphics/Renderer.h:
4165 * src/graphics/Renderer.C: Added base class for rendering of different
4166 image formats into Pixmaps.
4168 * src/graphics/XPM_Renderer.h:
4169 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4170 in a different class.
4172 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4173 easily add support for other formats.
4175 * src/insets/figinset.C: plugged a leak of an X resource.
4177 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4179 * src/CutAndPaste.[Ch]: make all metods static.
4181 * development/Code_rules/Rules: more work, added section on
4182 Exceptions, and a References section.
4184 * a lot of header files: work to make doc++ able to generate the
4185 source documentation, some workarounds of doc++ problems. Doc++ is
4186 now able to generate the documentation.
4188 2000-08-07 Juergen Vigna <jug@sad.it>
4190 * src/insets/insettabular.C (recomputeTextInsets): removed function
4192 * src/tabular.C (SetWidthOfMulticolCell):
4194 (calculate_width_of_column_NMC): fixed return value so that it really
4195 only returns true if the column-width has changed (there where
4196 problems with muliticolumn-cells in this column).
4198 2000-08-04 Juergen Vigna <jug@sad.it>
4200 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4201 also on the scrollstatus of the inset.
4202 (workAreaMotionNotify): ditto.
4204 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4206 2000-08-01 Juergen Vigna <jug@sad.it>
4208 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4210 * src/commandtags.h:
4211 * src/LyXAction.C (init):
4212 * src/insets/inset.C (LocalDispatch): added support for
4215 * src/insets/inset.C (scroll): new functions.
4217 * src/insets/insettext.C (removeNewlines): new function.
4218 (SetAutoBreakRows): removes forced newlines in the text of the
4219 paragraph if autoBreakRows is set to false.
4221 * src/tabular.C (Latex): generates a parbox around the cell contents
4224 * src/frontends/xforms/FormTabular.C (local_update): removed
4225 the radio_useparbox button.
4227 * src/tabular.C (UseParbox): new function
4229 2000-08-06 Baruch Even <baruch.even@writeme.com>
4231 * src/graphics/GraphicsCache.h:
4232 * src/graphics/GraphicsCache.C:
4233 * src/graphics/GraphicsCacheItem.h:
4234 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4237 * src/insets/insetgraphics.h:
4238 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4239 and the drawing of the inline image.
4241 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4242 loaded into the wrong position.
4244 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4247 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4249 * src/support/translator.h: move all typedefs to public section
4251 * src/support/filetools.C (MakeLatexName): return string const
4253 (TmpFileName): ditto
4254 (FileOpenSearch): ditto
4256 (LibFileSearch): ditto
4257 (i18nLibFileSearch): ditto
4260 (CreateTmpDir): ditto
4261 (CreateBufferTmpDir): ditto
4262 (CreateLyXTmpDir): ditto
4265 (MakeAbsPath): ditto
4267 (OnlyFilename): ditto
4269 (NormalizePath): ditto
4270 (CleanupPath): ditto
4271 (GetFileContents): ditto
4272 (ReplaceEnvironmentPath): ditto
4273 (MakeRelPath): ditto
4275 (ChangeExtension): ditto
4276 (MakeDisplayPath): ditto
4277 (do_popen): return cmdret const
4278 (findtexfile): return string const
4280 * src/support/DebugStream.h: add some /// to please doc++
4282 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4284 * src/texrow.C (same_rownumber): functor to use with find_if
4285 (getIdFromRow): rewritten to use find_if and to not update the
4286 positions. return true if row is found
4287 (increasePos): new method, use to update positions
4289 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4291 * src/lyxlex_pimpl.C (verifyTable): new method
4294 (GetString): return string const
4295 (pushTable): rewrite to use std::stack
4297 (setFile): better check
4300 * src/lyxlex.h: make LyXLex noncopyable
4302 * src/lyxlex.C (text): return char const * const
4303 (GetString): return string const
4304 (getLongString): return string const
4306 * src/lyx_gui_misc.C (askForText): return pair<...> const
4308 * src/lastfiles.[Ch] (operator): return string const
4310 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4311 istringstream not char const *.
4312 move token.end() out of loop.
4313 (readFile): move initializaton of token
4315 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4316 getIdFromRow is successful.
4318 * lib/bind/emacs.bind: don't include menus bind
4320 * development/Code_rules/Rules: the beginnings of making this
4321 better and covering more of the unwritten rules that we have.
4323 * development/Code_rules/Recommendations: a couple of wording
4326 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4328 * src/support/strerror.c: remove C++ comment.
4330 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4332 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4333 LFUN_INDEX_INSERT_LAST
4335 * src/texrow.C (getIdFromRow): changed from const_iterator to
4336 iterator, allowing code to compile with DEC cxx
4338 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4339 stores part of the class, as suggested by Allan. Will allow
4341 (apply): test to apply uses InsetCommandParams operator!=
4343 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4344 (apply): test to apply uses InsetCommandParams operator!=
4346 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4347 stores part of the class.
4348 (update): removed limits on min/max size.
4350 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4351 (apply): test to apply uses InsetCommandParams operator!=
4353 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4354 (Read, Write, scanCommand, getCommand): moved functionality
4355 into InsetCommandParams.
4357 (getScreenLabel): made pure virtual
4358 new InsetCommandParams operators== and !=
4360 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4361 c-tors based on InsetCommandParams. Removed others.
4362 * src/insets/insetinclude.[Ch]: ditto
4363 * src/insets/insetlabel.[Ch]: ditto
4364 * src/insets/insetparent.[Ch]: ditto
4365 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4367 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4368 insets derived from InsetCommand created using similar c-tors
4369 based on InsetCommandParams
4370 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4371 * src/menus.C (ShowRefsMenu): ditto
4372 * src/paragraph.C (Clone): ditto
4373 * src/text2.C (SetCounter): ditto
4374 * src/lyxfunc.C (Dispatch) ditto
4375 Also recreated old InsetIndex behaviour exactly. Can now
4376 index-insert at the start of a paragraph and index-insert-last
4377 without launching the pop-up.
4379 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4381 * lib/lyxrc.example: mark te pdf options as non functional.
4383 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4384 (isStrDbl): move tmpstr.end() out of loop.
4385 (strToDbl): move intialization of tmpstr
4386 (lowercase): return string const and move tmp.end() out of loop.
4387 (uppercase): return string const and move tmp.edn() out of loop.
4388 (prefixIs): add assertion
4393 (containsOnly): ditto
4394 (containsOnly): ditto
4395 (containsOnly): ditto
4396 (countChar): make last arg char not char const
4397 (token): return string const
4398 (subst): return string const, move tmp.end() out of loop.
4399 (subst): return string const, add assertion
4400 (strip): return string const
4401 (frontStrip): return string const, add assertion
4402 (frontStrip): return string const
4407 * src/support/lstrings.C: add inclde "LAssert.h"
4408 (isStrInt): move tmpstr.end() out of loop.
4410 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4411 toollist.end() out of loop.
4412 (deactivate): move toollist.end() out of loop.
4413 (update): move toollist.end() out of loop.
4414 (updateLayoutList): move tc.end() out of loop.
4415 (add): move toollist.end() out of loop.
4417 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4418 md.end() out of loop.
4420 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4422 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4425 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4426 (Erase): move insetlist.end() out of loop.
4428 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4429 ref to const string as first arg. Move initialization of some
4430 variables, whitespace changes.
4432 * src/kbmap.C (defkey): move table.end() out of loop.
4433 (kb_keymap): move table.end() out of loop.
4434 (findbinding): move table.end() out of loop.
4436 * src/MenuBackend.C (hasMenu): move end() out of loop.
4437 (getMenu): move end() out of loop.
4438 (getMenu): move menulist_.end() out of loop.
4440 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4442 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4445 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4446 (getFromLyXName): move infotab.end() out of loop.
4448 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4449 -fvtable-thunks -ffunction-sections -fdata-sections
4451 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4453 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4456 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4458 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4460 * src/frontends/xforms/FormCitation.[Ch],
4461 src/frontends/xforms/FormIndex.[Ch],
4462 src/frontends/xforms/FormToc.[Ch],
4463 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4465 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4467 * src/commandtags.h: renamed, created some flags for citation
4470 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4472 * src/lyxfunc.C (dispatch): use signals to insert index entry
4474 * src/frontends/Dialogs.h: new signal createIndex
4476 * src/frontends/xforms/FormCommand.[Ch],
4477 src/frontends/xforms/FormCitation.[Ch],
4478 src/frontends/xforms/FormToc.[Ch],
4479 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4481 * src/insets/insetindex.[Ch]: GUI-independent
4483 * src/frontends/xforms/FormIndex.[Ch],
4484 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4487 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4489 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4490 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4492 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4494 * src/insets/insetref.C (Latex): rewrite so that there is now
4495 question that a initialization is requested.
4497 * src/insets/insetcommand.h: reenable the hide signal
4499 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4501 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4502 fix handling of shortcuts (many bugs :)
4503 (add_lastfiles): ditto.
4505 * lib/ui/default.ui: fix a few shortcuts.
4507 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4509 * Makefile.am: Fix ``rpmdist'' target to return the exit
4510 status of the ``rpm'' command, instead of the last command in
4511 the chain (the ``rm lyx.xpm'' command, which always returns
4514 2000-08-02 Allan Rae <rae@lyx.org>
4516 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4517 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4518 * src/frontends/xforms/FormToc.C (FormToc): ditto
4520 * src/frontends/xforms/Makefile.am: A few forgotten files
4522 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4523 Signals-not-copyable-problem Lars' started commenting out.
4525 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4527 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4529 * src/insets/insetcommand.h: Signals is not copyable so anoter
4530 scheme for automatic hiding of forms must be used.
4532 * src/frontends/xforms/FormCitation.h: don't inerit from
4533 noncopyable, FormCommand already does that.
4534 * src/frontends/xforms/FormToc.h: ditto
4535 * src/frontends/xforms/FormUrl.h: ditto
4537 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4539 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4541 * src/insets/insetcommand.h (hide): new SigC::Signal0
4542 (d-tor) new virtual destructor emits hide signal
4544 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4545 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4547 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4548 LOF and LOT. Inset is now GUI-independent
4550 * src/insets/insetloa.[Ch]: redundant
4551 * src/insets/insetlof.[Ch]: ditto
4552 * src/insets/insetlot.[Ch]: ditto
4554 * src/frontends/xforms/forms/form_url.fd: tweaked!
4555 * src/frontends/xforms/forms/form_citation.fd: ditto
4557 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4558 dialogs dealing with InsetCommand insets
4560 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4561 FormCommand base class
4562 * src/frontends/xforms/FormUrl.[Ch]: ditto
4564 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4566 * src/frontends/xforms/FormToc.[Ch]: ditto
4568 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4569 passed a generic InsetCommand pointer
4570 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4572 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4573 and modified InsetTOC class
4574 * src/buffer.C: ditto
4576 * forms/lyx.fd: strip out old FD_form_toc code
4577 * src/lyx_gui_misc.C: ditto
4578 * src/lyx_gui.C: ditto
4579 * src/lyx_cb.C: ditto
4580 * src/lyx.[Ch]: ditto
4582 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4584 * src/support/utility.hpp: tr -d '\r'
4586 2000-08-01 Juergen Vigna <jug@sad.it>
4588 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4590 * src/commandtags.h:
4591 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4592 LFUN_TABULAR_FEATURES.
4594 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4595 LFUN_LAYOUT_TABULAR.
4597 * src/insets/insettabular.C (getStatus): implemented helper function.
4599 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4601 2000-07-31 Juergen Vigna <jug@sad.it>
4603 * src/text.C (draw): fixed screen update problem for text-insets.
4605 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4606 something changed probably this has to be added in various other
4609 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4611 2000-07-31 Baruch Even <baruch.even@writeme.com>
4613 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4614 templates to satisfy compaq cxx.
4617 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4619 * src/support/translator.h (equal_1st_in_pair::operator()): take
4620 const ref pair_type as arg.
4621 (equal_2nd_in_pair::operator()): ditto
4622 (Translator::~Translator): remove empty d-tor.
4624 * src/graphics/GraphicsCache.C: move include config.h to top, also
4625 put initialization of GraphicsCache::singleton here.
4626 (~GraphicsCache): move here
4627 (addFile): take const ref as arg
4630 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4632 * src/BufferView2.C (insertLyXFile): change te with/without header
4635 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4637 * src/frontends/xforms/FormGraphics.C (apply): add some
4638 static_cast. Not very nice, but required by compaq cxx.
4640 * src/frontends/xforms/RadioButtonGroup.h: include header
4641 <utility> instead of <pair.h>
4643 * src/insets/insetgraphicsParams.C: add using directive.
4644 (readResize): change return type to void.
4645 (readOrigin): ditto.
4647 * src/lyxfunc.C (getStatus): add missing break for build-program
4648 function; add test for Literate for export functions.
4650 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4651 entries in Options menu.
4653 2000-07-31 Baruch Even <baruch.even@writeme.com>
4655 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4656 protect against auto-allocation; release icon when needed.
4658 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4660 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4661 on usual typewriter.
4663 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4664 earlier czech.kmap), useful only for programming.
4666 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4668 * src/frontends/xforms/FormCitation.h: fix conditioning around
4671 2000-07-31 Juergen Vigna <jug@sad.it>
4673 * src/frontends/xforms/FormTabular.C (local_update): changed
4674 radio_linebreaks to radio_useparbox and added radio_useminipage.
4676 * src/tabular.C: made support for using minipages/parboxes.
4678 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4680 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4682 (descent): so the cursor is in the middle.
4683 (width): bit smaller box.
4685 * src/insets/insetgraphics.h: added display() function.
4687 2000-07-31 Baruch Even <baruch.even@writeme.com>
4689 * src/frontends/Dialogs.h: Added showGraphics signals.
4691 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4692 xforms form definition of the graphics dialog.
4694 * src/frontends/xforms/FormGraphics.h:
4695 * src/frontends/xforms/FormGraphics.C: Added files, the
4696 GUIndependent code of InsetGraphics
4698 * src/insets/insetgraphics.h:
4699 * src/insets/insetgraphics.C: Major writing to make it work.
4701 * src/insets/insetgraphicsParams.h:
4702 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4703 struct between InsetGraphics and GUI.
4705 * src/LaTeXFeatures.h:
4706 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4707 support for graphicx package.
4709 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4710 for the graphics inset.
4712 * src/support/translator.h: Added file, used in
4713 InsetGraphicsParams. this is a template to translate between two
4716 * src/frontends/xforms/RadioButtonGroup.h:
4717 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4718 way to easily control a radio button group.
4720 2000-07-28 Juergen Vigna <jug@sad.it>
4722 * src/insets/insettabular.C (LocalDispatch):
4723 (TabularFeatures): added support for lyx-functions of tabular features.
4724 (cellstart): refixed this function after someone wrongly changed it.
4726 * src/commandtags.h:
4727 * src/LyXAction.C (init): added support for tabular-features
4729 2000-07-28 Allan Rae <rae@lyx.org>
4731 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4732 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4733 triggers the callback for input checking. As a result we sometimes get
4734 "LyX: This shouldn't happen..." printed to cerr.
4735 (input): Started using status variable since I only free() on
4736 destruction. Some input checking for paths and font sizes.
4738 * src/frontends/xforms/FormPreferences.h: Use status to control
4739 activation of Ok and Apply
4741 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4742 callback. Also resized to stop segfaults with 0.88. The problem is
4743 that xforms-0.88 requires the folder to be wide enough to fit all the
4744 tabs. If it isn't it causes all sorts of problems.
4746 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4748 * src/frontends/xforms/forms/README: Reflect reality.
4750 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4751 * src/frontends/xforms/forms/makefile: ditto.
4753 * src/commandtags.h: Get access to new Preferences dialog
4754 * src/LyXAction.C: ditto
4755 * src/lyxfunc.C: ditto
4756 * lib/ui/default.ui: ditto
4758 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4760 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4762 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4765 * src/frontends/xforms/form_url.[Ch]: added.
4767 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4769 * src/insets/insetbib.h: fixed bug in previous commit
4771 * src/frontends/xforms/FormUrl.h: ditto
4773 * src/frontends/xforms/FormPrint.h: ditto
4775 * src/frontends/xforms/FormPreferences.h: ditto
4777 * src/frontends/xforms/FormCopyright.h: ditto
4779 * src/frontends/xforms/FormCitation.C: ditto
4781 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4782 private copyconstructor and private default contructor
4784 * src/support/Makefile.am: add utility.hpp
4786 * src/support/utility.hpp: new file from boost
4788 * src/insets/insetbib.h: set owner in clone
4790 * src/frontends/xforms/FormCitation.C: added missing include
4793 * src/insets/form_url.[Ch]: removed
4795 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4797 * development/lyx.spec.in
4798 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4799 file/directory re-organization.
4801 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4803 * src/insets/insetcommand.[Ch]: moved the string data and
4804 associated manipulation methods into a new stand-alone class
4805 InsetCommandParams. This class has two additional methods
4806 getAsString() and setFromString() allowing the contents to be
4807 moved around as a single string.
4808 (addContents) method removed.
4809 (setContents) method no longer virtual.
4811 * src/buffer.C (readInset): made use of new InsetCitation,
4812 InsetUrl constructors based on InsetCommandParams.
4814 * src/commandtags.h: add LFUN_INSERT_URL
4816 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4817 independent InsetUrl and use InsetCommandParams to extract
4818 string info and create new Insets.
4820 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4822 * src/frontends/xforms/FormCitation.C (apply): uses
4825 * src/frontends/xforms/form_url.C
4826 * src/frontends/xforms/form_url.h
4827 * src/frontends/xforms/FormUrl.h
4828 * src/frontends/xforms/FormUrl.C
4829 * src/frontends/xforms/forms/form_url.fd: new files
4831 * src/insets/insetcite.[Ch]: removed unused constructors.
4833 * src/insets/insetinclude.[Ch]: no longer store filename
4835 * src/insets/inseturl.[Ch]: GUI-independent.
4837 2000-07-26 Juergen Vigna <jug@sad.it>
4838 * renamed frontend from gtk to gnome as it is that what is realized
4839 and did the necessary changes in the files.
4841 2000-07-26 Marko Vendelin <markov@ioc.ee>
4843 * configure.in: cleaning up gnome configuration scripts
4845 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4847 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4848 shortcuts syndrom by redrawing them explicitely (a better solution
4849 would be appreciated).
4851 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4853 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4856 * src/lyx_cb.C (MenuExport): change html export to do the right
4857 thing depending of the document type (instead of having
4858 html-linuxdoc and html-docbook).
4859 * src/lyxfunc.C (getStatus): update for html
4860 * lib/ui/default.ui: simplify due to the above change.
4861 * src/menus.C (ShowFileMenu): update too (in case we need it).
4863 * src/MenuBackend.C (read): if a menu is defined twice, add the
4864 new entries to the exiting one.
4866 2000-07-26 Juergen Vigna <jug@sad.it>
4868 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4870 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4871 and return a bool if it did actual save the file.
4872 (AutoSave): don't autosave a unnamed doc.
4874 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4875 check if this is an UNNAMED new file and react to it.
4876 (newFile): set buffer to unnamed and change to not mark a new
4877 buffer dirty if I didn't do anything with it.
4879 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4881 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4883 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4884 friend as per Angus's patch posted to lyx-devel.
4886 * src/ext_l10n.h: updated
4888 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4889 gettext on the style string right before inserting them into the
4892 * autogen.sh: add code to extract style strings form layout files,
4893 not good enough yet.
4895 * src/frontends/gtk/.cvsignore: add MAKEFILE
4897 * src/MenuBackend.C (read): run the label strings through gettext
4898 before storing them in the containers.
4900 * src/ext_l10n.h: new file
4902 * autogen.sh : generate the ext_l10n.h file here
4904 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4906 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4909 * lib/ui/default.ui: fix a couple of typos.
4911 * config/gnome/gtk.m4: added (and added to the list of files in
4914 * src/insets/insetinclude.C (unique_id): fix when we are using
4915 lyxstring instead of basic_string<>.
4916 * src/insets/insettext.C (LocalDispatch): ditto.
4917 * src/support/filetools.C: ditto.
4919 * lib/configure.m4: create the ui/ directory if necessary.
4921 * src/LyXView.[Ch] (updateToolbar): new method.
4923 * src/BufferView_pimpl.C (buffer): update the toolbar when
4924 opening/closing buffer.
4926 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4928 * src/LyXAction.C (getActionName): enhance to return also the name
4929 and options of pseudo-actions.
4930 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4932 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4933 as an example of what is possible). Used in File->Build too (more
4934 useful) and in the import/export menus (to mimick the complicated
4935 handling of linuxdoc and friends). Try to update all the entries.
4937 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4940 * src/MenuBackend.C (read): Parse the new OptItem tag.
4942 * src/MenuBackend.h: Add a new optional_ data member (used if the
4943 entry should be omitted when the lyxfunc is disabled).
4945 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4946 function, used as a shortcut.
4947 (create_submenu): align correctly the shortcuts on the widest
4950 * src/MenuBackend.h: MenuItem.label() only returns the label of
4951 the menu without shortcut; new method shortcut().
4953 2000-07-14 Marko Vendelin <markov@ioc.ee>
4955 * src/frontends/gtk/Dialogs.C:
4956 * src/frontends/gtk/FormCopyright.C:
4957 * src/frontends/gtk/FormCopyright.h:
4958 * src/frontends/gtk/Makefile.am: added these source-files for the
4959 Gtk/Gnome support of the Copyright-Dialog.
4961 * src/main.C: added Gnome::Main initialization if using
4962 Gtk/Gnome frontend-GUI.
4964 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4966 * config/gnome/aclocal-include.m4
4967 * config/gnome/compiler-flags.m4
4968 * config/gnome/curses.m4
4969 * config/gnome/gnome--.m4
4970 * config/gnome/gnome-bonobo-check.m4
4971 * config/gnome/gnome-common.m4
4972 * config/gnome/gnome-fileutils.m4
4973 * config/gnome/gnome-ghttp-check.m4
4974 * config/gnome/gnome-gnorba-check.m4
4975 * config/gnome/gnome-guile-checks.m4
4976 * config/gnome/gnome-libgtop-check.m4
4977 * config/gnome/gnome-objc-checks.m4
4978 * config/gnome/gnome-orbit-check.m4
4979 * config/gnome/gnome-print-check.m4
4980 * config/gnome/gnome-pthread-check.m4
4981 * config/gnome/gnome-support.m4
4982 * config/gnome/gnome-undelfs.m4
4983 * config/gnome/gnome-vfs.m4
4984 * config/gnome/gnome-x-checks.m4
4985 * config/gnome/gnome-xml-check.m4
4986 * config/gnome/gnome.m4
4987 * config/gnome/gperf-check.m4
4988 * config/gnome/gtk--.m4
4989 * config/gnome/linger.m4
4990 * config/gnome/need-declaration.m4: added configuration scripts
4991 for Gtk/Gnome frontend-GUI
4993 * configure.in: added support for the --with-frontend=gtk option
4995 * autogen.sh: added config/gnome/* to list of config-files
4997 * acconfig.h: added define for GTKGUI-support
4999 * config/lyxinclude.m4: added --with-frontend[=value] option value
5000 for Gtk/Gnome frontend-GUI support.
5002 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5004 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5008 * src/paragraph.C (GetChar): remove non-const version
5010 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5011 (search_kw): use it.
5013 * src/lyx_main.C (init): if "preferences" exist, read that instead
5015 (ReadRcFile): return bool if the file could be read ok.
5016 (ReadUIFile): add a check to see if lex file is set ok.
5018 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5019 bastring can be used instead of lyxstring (still uses the old code
5020 if std::string is good enough or if lyxstring is used.)
5022 * src/encoding.C: make the arrays static, move ininle functions
5024 * src/encoding.h: from here.
5026 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5027 (parseSingleLyXformat2Token): move inset parsing to separate method
5028 (readInset): new private method
5030 * src/Variables.h: remove virtual from get().
5032 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5033 access to NEW_INSETS and NEW_TABULAR
5035 * src/MenuBackend.h: remove superfluous forward declaration of
5036 MenuItem. Add documentations tags "///", remove empty MenuItem
5037 destructor, remove private default contructor.
5039 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5041 (read): more string mlabel and mname to where they are used
5042 (read): remove unused variables mlabel and mname
5043 (defaults): unconditional clear, make menusetup take advantage of
5044 add returning Menu &.
5046 * src/LyXView.h: define NEW_MENUBAR as default
5048 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5049 to NEW_INSETS and NEW_TABULAR.
5050 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5051 defined. Change some of the "xxxx-inset-insert" functions names to
5054 * several files: more enahncements to NEW_INSETS and the resulting
5057 * lib/lyxrc.example (\date_insert_format): move to misc section
5059 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5060 bastring and use AC_CACHE_CHECK.
5061 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5062 the system have the newest methods. uses AC_CACHE_CHECK
5063 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5064 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5065 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5067 * configure.in: add LYX_CXX_GOOD_STD_STRING
5069 * acinclude.m4: recreated
5071 2000-07-24 Amir Karger <karger@lyx.org>
5073 * README: add Hebrew, Arabic kmaps
5076 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5078 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5081 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5083 * Lot of files: add pragma interface/implementation.
5085 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5087 * lib/ui/default.ui: new file (ans new directory). Contains the
5088 default menu and toolbar.
5090 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5091 global space. Toolbars are now read (as menus) in ui files.
5093 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5095 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5096 is disabled because the document is read-only. We want to have the
5097 toggle state of the function anyway.
5098 (getStatus): add code for LFUN_VC* functions (mimicking what is
5099 done in old-style menus)
5101 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5102 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5104 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5105 * src/BufferView_pimpl.C: ditto.
5106 * src/lyxfunc.C: ditto.
5108 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5109 default). This replaces old-style menus by new ones.
5111 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5112 MenuItem. Contain the data structure of a menu.
5114 * src/insets/insettext.C: use LyXView::setLayout instead of
5115 accessing directly the toolbar combox.
5116 * src/lyxfunc.C (Dispatch): ditto.
5118 * src/LyXView.C (setLayout): new method, which just calls
5119 Toolbar::setLayout().
5120 (updateLayoutChoice): move part of this method in Toolbar.
5122 * src/toolbar.[Ch]: removed.
5124 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5125 implementation the toolbar.
5127 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5128 the toolbar. It might make sense to merge it with ToolbarDefaults
5130 (setLayout): new function.
5131 (updateLayoutList): ditto.
5132 (openLayoutList): ditto.
5134 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5135 xforms implementation of the toolbar.
5136 (get_toolbar_func): comment out, since I do not
5137 know what it is good for.
5139 * src/ToolbarDefaults.h: Add the ItemType enum.
5141 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5142 for a list of allocated C strings. Used in Menubar xforms
5143 implementation to avoid memory leaks.
5145 * src/support/lstrings.[Ch] (uppercase): new version taking and
5149 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5150 * lib/bind/emacs.bind: ditto.
5152 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5154 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5155 forward decl of LyXView.
5157 * src/toolbar.C (toolbarItem): moved from toolbar.h
5158 (toolbarItem::clean): ditto
5159 (toolbarItem::~toolbarItem): ditto
5160 (toolbarItem::operator): ditto
5162 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5164 * src/paragraph.h: control the NEW_TABULAR define from here
5166 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5167 USE_TABULAR_INSETS to NEW_TABULAR
5169 * src/ToolbarDefaults.C: add include "lyxlex.h"
5171 * files using the old table/tabular: use NEW_TABULAR to control
5172 compilation of old tabular stuff.
5174 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5177 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5178 planemet in reading of old style floats, fix the \end_deeper
5179 problem when reading old style floats.
5181 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5183 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5185 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5187 * lib/bind/sciword.bind: updated.
5189 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5191 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5192 layout write problem
5194 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5196 * src/Makefile.am (INCLUDES): remove image directory from include
5199 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5200 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5202 * src/LyXView.C (create_form_form_main): read the application icon
5205 * lib/images/*.xpm: change the icons to use transparent color for
5208 * src/toolbar.C (update): change the color of the button when it
5211 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5213 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5214 setting explicitely the minibuffer.
5215 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5217 * src/LyXView.C (showState): new function. Shows font information
5218 in minibuffer and update toolbar state.
5219 (LyXView): call Toolbar::update after creating the
5222 * src/toolbar.C: change toollist to be a vector instead of a
5224 (BubbleTimerCB): get help string directly from the callback
5225 argument of the corresponding icon (which is the action)
5226 (set): remove unnecessary ugliness.
5227 (update): new function. update the icons (depressed, disabled)
5228 depending of the status of the corresponding action.
5230 * src/toolbar.h: remove help in toolbarItem
5232 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5234 * src/Painter.C (text): Added code for using symbol glyphs from
5235 iso10646 fonts. Currently diabled.
5237 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5240 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5241 magyar,turkish and usorbian.
5243 * src/paragraph.C (isMultiLingual): Made more efficient.
5245 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5248 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5249 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5250 Also changed the prototype to "bool math_insert_greek(char)".
5252 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5254 * lots of files: apply the NEW_INSETS on all code that will not be
5255 needed when we move to use the new insets. Enable the define in
5256 lyxparagrah.h to try it.
5258 * src/insets/insettabular.C (cellstart): change to be a static
5260 (InsetTabular): initialize buffer in the initializer list.
5262 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5264 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5265 form_print.h out of the header file. Replaced with forward
5266 declarations of the relevant struct.
5268 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5271 * src/commandtags.h: do not include "debug.h" which does not
5272 belong there. #include it in some other places because of this
5275 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5277 * src/insets/insetcaption.C: add a couple "using" directives.
5279 * src/toolbar.C (add): get the help text directly from lyxaction.
5281 (setPixmap): new function. Loads from disk and sets a pixmap on a
5282 botton; the name of the pixmap file is derived from the command
5285 * src/toolbar.h: remove members isBitmap and pixmap from
5288 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5289 * lib/images/: move many files from images/banner.xpm.
5291 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5293 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5294 * src/toolbar.C: ditto.
5295 * configure.in: ditto.
5296 * INSTALL: document.
5298 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5299 the spellchecker popup is closed from the WM.
5301 2000-07-19 Juergen Vigna <jug@sad.it>
5303 * src/insets/insetfloat.C (Write): small fix because we use the
5304 insetname for the type now!
5306 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5308 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5311 * src/frontends/Dialogs.h: removed hideCitation signal
5313 * src/insets/insetcite.h: added hide signal
5315 * src/insets/insetcite.C (~InsetCitation): emits new signal
5316 (getScreenLabel): "intelligent" label should now fit on the screen!
5318 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5320 * src/frontends/xforms/FormCitation.C (showInset): connects
5321 hide() to the inset's hide signal
5322 (show): modified to use fl_set_object_position rather than
5323 fl_set_object_geometry wherever possible
5325 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5327 * src/insets/lyxinset.h: add caption code
5329 * src/insets/insetfloat.C (type): new method
5331 * src/insets/insetcaption.C (Write): new method
5333 (LyxCode): new method
5335 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5336 to get it right together with using the FloatList.
5338 * src/commandtags.h: add LFUN_INSET_CAPTION
5339 * src/lyxfunc.C (Dispatch): handle it
5341 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5344 * src/Variables.[Ch]: make expand take a const reference, remove
5345 the destructor, some whitespace changes.
5347 * src/LyXAction.C (init): add caption-inset-insert
5349 * src/FloatList.C (FloatList): update the default floats a bit.
5351 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5353 * src/Variables.[Ch]: new files. Intended to be used for language
5354 specific strings (like \chaptername) and filename substitution in
5357 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5359 * lib/kbd/american.kmap: update
5361 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5363 * src/bufferparams.[Ch]: remove member allowAccents.
5365 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5367 * src/LaTeXLog.C: use the log_form.h header.
5368 * src/lyx_gui.C: ditto.
5369 * src/lyx_gui_misc.C: ditto.
5370 * src/lyxvc.h: ditto.
5372 * forms/log_form.fd: new file, created from latexoptions.fd. I
5373 kept the log popup and nuked the options form.
5375 * src/{la,}texoptions.[Ch]: removed.
5376 * src/lyx_cb.C (LaTeXOptions): ditto
5378 * src/lyx_gui.C (create_forms): do not handle the
5379 fd_latex_options form.
5381 2000-07-18 Juergen Vigna <jug@sad.it>
5383 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5384 name of the inset so that it can be requested outside (text2.C).
5386 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5389 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5391 * src/mathed/formula.h (ConvertFont): constify
5393 * src/mathed/formula.C (Read): add warning if \end_inset is not
5394 found on expected place.
5396 * src/insets/lyxinset.h (ConvertFont): consify
5398 * src/insets/insetquotes.C (ConvertFont): constify
5399 * src/insets/insetquotes.h: ditto
5401 * src/insets/insetinfo.h: add labelfont
5403 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5404 (ascent): use labelfont
5408 (Write): make .lyx file a bit nicer
5410 * src/insets/insetfloat.C (Write): simplify somewhat...
5411 (Read): add warning if arg is not found
5413 * src/insets/insetcollapsable.C: add using std::max
5414 (Read): move string token and add warning in arg is not found
5415 (draw): use std::max to get the right ty
5416 (getMaxWidth): simplify by using std::max
5418 * src/insets/insetsection.h: new file
5419 * src/insets/insetsection.C: new file
5420 * src/insets/insetcaption.h: new file
5421 * src/insets/insetcaption.C: new file
5423 * src/insets/inset.C (ConvertFont): constify signature
5425 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5426 insetcaption.[Ch] and insetsection.[Ch]
5428 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5429 uses to use LABEL_COUNTER_CHAPTER instead.
5430 * src/text2.C (SetCounter): here
5432 * src/counters.h: new file
5433 * src/counters.C: new file
5434 * src/Sectioning.h: new file
5435 * src/Sectioning.C: new file
5437 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5439 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5441 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5444 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5447 2000-07-17 Juergen Vigna <jug@sad.it>
5449 * src/tabular.C (Validate): check if array-package is needed.
5450 (SetVAlignment): added support for vertical alignment.
5451 (SetLTFoot): better support for longtable header/footers
5452 (Latex): modified to support added features.
5454 * src/LaTeXFeatures.[Ch]: added array-package.
5456 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5458 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5461 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5463 * configure.in: do not forget to put a space after -isystem.
5465 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5467 * lib/kbd/arabic.kmap: a few fixes.
5469 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5471 * some whitespace chagnes to a number of files.
5473 * src/support/DebugStream.h: change to make it easier for
5474 doc++ to parse correctly.
5475 * src/support/lyxstring.h: ditto
5477 * src/mathed/math_utils.C (compara): change to have only one
5479 (MathedLookupBOP): change because of the above.
5481 * src/mathed/math_delim.C (math_deco_compare): change to have only
5483 (search_deco): change becasue of the above.
5485 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5486 instead of manually coded one.
5488 * src/insets/insetquotes.C (Read): read the \end_inset too
5490 * src/insets/insetlatex.h: remove file
5491 * src/insets/insetlatex.C: remove file
5493 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5495 (InsetPrintIndex): remove destructor
5497 * src/insets/insetinclude.h: remove default constructor
5499 * src/insets/insetfloat.C: work to make it work better
5501 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5503 * src/insets/insetcite.h (InsetCitation): remove default constructor
5505 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5507 * src/text.C (GetColumnNearX): comment out some currently unused code.
5509 * src/paragraph.C (writeFile): move some initializations closer to
5511 (CutIntoMinibuffer): small change to use new matchIT operator
5515 (InsertInset): ditto
5518 (InsetIterator): ditto
5519 (Erase): small change to use new matchFT operator
5521 (GetFontSettings): ditto
5522 (HighestFontInRange): ditto
5525 * src/lyxparagraph.h: some chars changed to value_type
5526 (matchIT): because of some stronger checking (perhaps too strong)
5527 in SGI STL, the two operator() unified to one.
5530 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5532 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5533 the last inset read added
5534 (parseSingleLyXformat2Token): some more (future) compability code added
5535 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5536 (parseSingleLyXformat2Token): set last_inset_read
5537 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5538 (parseSingleLyXformat2Token): don't double intializw string next_token
5540 * src/TextCache.C (text_fits::operator()): add const's to the signature
5541 (has_buffer::operator()): ditto
5543 * src/Floating.h: add some comments on the class
5545 * src/FloatList.[Ch] (typeExist): new method
5548 * src/BackStack.h: added default constructor, wanted by Gcc.
5550 2000-07-14 Juergen Vigna <jug@sad.it>
5552 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5554 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5556 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5557 do a redraw when the window is resized!
5558 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5560 * src/insets/insettext.C (resizeLyXText): added function to correctly
5561 being able to resize the LyXWindow.
5563 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5565 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5567 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5568 crashes when closing dialog to a deleted inset.
5570 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5571 method! Now similar to other insets.
5573 2000-07-13 Juergen Vigna <jug@sad.it>
5575 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5577 * lib/examples/Literate.lyx: small patch!
5579 * src/insets/insetbib.C (Read): added this function because of wrong
5580 Write (without [begin|end]_inset).
5582 2000-07-11 Juergen Vigna <jug@sad.it>
5584 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5585 as the insertInset could not be good!
5587 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5588 the bool param should not be last.
5590 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5592 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5593 did submit that to Karl).
5595 * configure.in: use -isystem instead of -I for X headers. This
5596 fixes a problem on solaris with a recent gcc;
5597 put the front-end code after the X detection code;
5598 configure in sigc++ before lib/
5600 * src/lyx_main.C (commandLineHelp): remove -display from command
5603 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5605 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5606 Also put in Makefile rules for building the ``listerrors''
5607 program for parsing errors from literate programs written in LyX.
5609 * lib/build-listerrors: Added small shell script as part of compile
5610 process. This builds a working ``listerrors'' binary if noweb is
5611 installed and either 1) the VNC X server is installed on the machine,
5612 or 2) the user is compiling from within a GUI. The existence of a GUI
5613 is necessary to use the ``lyx --export'' feature for now. This
5614 hack can be removed once ``lyx --export'' no longer requires a GUI to
5617 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5619 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5620 now passed back correctly from gcc and placed "under" error
5621 buttons in a Literate LyX source.
5623 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5625 * src/text.C (GetColumnNearX): Better behavior when a RTL
5626 paragraph is ended by LTR text.
5628 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5631 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5633 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5634 true when clipboard is empty.
5636 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5638 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5639 row of the paragraph.
5640 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5641 to prevent calculation of bidi tables
5643 2000-07-07 Juergen Vigna <jug@sad.it>
5645 * src/screen.C (ToggleSelection): added y_offset and x_offset
5648 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5651 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5653 * src/insets/insettext.C: fixed Layout-Display!
5655 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5657 * configure.in: add check for strings.h header.
5659 * src/spellchecker.C: include <strings.h> in order to have a
5660 definition for bzero().
5662 2000-07-07 Juergen Vigna <jug@sad.it>
5664 * src/insets/insettext.C (draw): set the status of the bv->text to
5665 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5667 * src/screen.C (DrawOneRow):
5668 (DrawFromTo): redraw the actual row if something has changed in it
5671 * src/text.C (draw): call an update of the toplevel-inset if something
5672 has changed inside while drawing.
5674 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5676 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5678 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5679 processing inside class.
5681 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5682 processing inside class.
5684 * src/insets/insetindex.h new struct Holder, consistent with other
5687 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5688 citation dialog from main code and placed it in src/frontends/xforms.
5689 Dialog launched through signals instead of callbacks
5691 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5693 * lyx.man: update the options description.
5695 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5697 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5698 handle neg values, set min width to 590, add doc about -display
5700 2000-07-05 Juergen Vigna <jug@sad.it>
5702 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5703 calls to BufferView *.
5705 * src/insets/insettext.C (checkAndActivateInset): small fix non
5706 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5708 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5709 their \end_inset token!
5711 2000-07-04 edscott <edscott@imp.mx>
5713 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5714 lib/lyxrc.example: added option \wheel_jump
5716 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5718 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5719 remove support for -width,-height,-xpos and -ypos.
5721 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5723 * src/encoding.[Ch]: New files.
5725 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5726 (text): Call to the underline() method only when needed.
5728 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5730 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5731 encoding(s) for the document.
5733 * src/bufferparams.C (BufferParams): Changed default value of
5736 * src/language.C (newLang): Removed.
5737 (items[]): Added encoding information for all defined languages.
5739 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5740 encoding choice button.
5742 * src/lyxrc.h (font_norm_type): New member variable.
5743 (set_font_norm_type): New method.
5745 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5746 paragraphs with different encodings.
5748 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5749 (TransformChar): Changed to work correctly with Arabic points.
5750 (draw): Added support for drawing Arabic points.
5751 (draw): Removed code for drawing underbars (this is done by
5754 * src/support/textutils.h (IsPrintableNonspace): New function.
5756 * src/BufferView_pimpl.h: Added "using SigC::Object".
5757 * src/LyXView.h: ditto.
5759 * src/insets/insetinclude.h (include_label): Changed to mutable.
5761 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5763 * src/mathed/math_iter.h: remove empty destructor
5765 * src/mathed/math_cursor.h: remove empty destructor
5767 * src/insets/lyxinset.h: add THEOREM_CODE
5769 * src/insets/insettheorem.[Ch]: new files
5771 * src/insets/insetminipage.C: (InsertInset): remove
5773 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5775 (InsertInset): remove
5777 * src/insets/insetlist.C: (InsertList): remove
5779 * src/insets/insetfootlike.[Ch]: new files
5781 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5784 (InsertInset): ditto
5786 * src/insets/insetert.C: remove include Painter.h, reindent
5787 (InsertInset): move to header
5789 * src/insets/insetcollapsable.h: remove explicit from default
5790 contructor, remove empty destructor, add InsertInset
5792 * src/insets/insetcollapsable.C (InsertInset): new func
5794 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5796 * src/vspace.h: add explicit to constructor
5798 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5799 \textcompwordmark, please test this.
5801 * src/lyxrc.C: set ascii_linelen to 65 by default
5803 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5805 * src/commandtags.h: add LFUN_INSET_THEOREM
5807 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5808 (makeLinuxDocFile): remove _some_ of the nice logic
5809 (makeDocBookFile): ditto
5811 * src/Painter.[Ch]: (~Painter): removed
5813 * src/LyXAction.C (init): entry for insettheorem added
5815 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5817 (deplog): code to detect files generated by LaTeX, needs testing
5820 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5822 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5824 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5826 * src/LaTeX.C (deplog): Add a check for files that are going to be
5827 created by the first latex run, part of the project to remove the
5830 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5831 contents to the extension list.
5833 2000-07-04 Juergen Vigna <jug@sad.it>
5835 * src/text.C (NextBreakPoint): added support for needFullRow()
5837 * src/insets/lyxinset.h: added needFullRow()
5839 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5842 * src/insets/insettext.C: lots of changes for update!
5844 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5846 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5848 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5850 * src/insets/insetinclude.C (InsetInclude): fixed
5851 initialization of include_label.
5852 (unique_id): now returns a string.
5854 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5856 * src/LaTeXFeatures.h: new member IncludedFiles, for
5857 a map of key, included file name.
5859 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5860 with the included files for inclusion in SGML preamble,
5861 i. e., linuxdoc and docbook.
5864 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5865 nice (is the generated linuxdoc code to be exported?), that
5866 allows to remove column, and only_body that will be true for
5867 slave documents. Insets are allowed inside SGML font type.
5868 New handling of the SGML preamble for included files.
5869 (makeDocBookFile): the same for docbook.
5871 * src/insets/insetinclude.h:
5872 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5874 (DocBook): new export methods.
5876 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5877 and makeDocBookFile.
5879 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5880 formats to export with command line argument -x.
5882 2000-06-29 Juergen Vigna <jug@sad.it>
5884 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5885 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5887 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5888 region could already been cleared by an inset!
5890 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5892 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5895 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5897 (cursorToggle): remove special handling of lyx focus.
5899 2000-06-28 Juergen Vigna <jug@sad.it>
5901 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5904 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5906 * src/insets/insetindex.C (Edit): add a callback when popup is
5909 * src/insets/insettext.C (LocalDispatch):
5910 * src/insets/insetmarginal.h:
5911 * src/insets/insetlist.h:
5912 * src/insets/insetfoot.h:
5913 * src/insets/insetfloat.h:
5914 * src/insets/insetert.h: add a missing std:: qualifier.
5916 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5918 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5921 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5923 * src/insets/insettext.C (Read): remove tmptok unused variable
5924 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5925 (InsertInset): change for new InsetInset code
5927 * src/insets/insettext.h: add TEXT inline method
5929 * src/insets/insettext.C: remove TEXT macro
5931 * src/insets/insetmarginal.C (Write): new method
5932 (Latex): change output slightly
5934 * src/insets/insetfoot.C (Write): new method
5935 (Latex): change output slightly (don't use endl when no need)
5937 * src/insets/insetert.C (Write): new method
5939 * src/insets/insetcollapsable.h: make button_length, button_top_y
5940 and button_bottm_y protected.
5942 * src/insets/insetcollapsable.C (Write): simplify code by using
5943 tostr. Also do not output the float name, the children class
5944 should to that to get control over own arguments
5946 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5947 src/insets/insetminipage.[Ch]:
5950 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5952 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5954 * src/Makefile.am (lyx_SOURCES): add the new files
5956 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5957 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5958 * src/commandtags.h: ditto
5960 * src/LaTeXFeatures.h: add a std::set of used floattypes
5962 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5964 * src/FloatList.[Ch] src/Floating.h: new files
5966 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5968 * src/lyx_cb.C (TableApplyCB): ditto
5970 * src/text2.C: ditto
5971 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5972 (parseSingleLyXformat2Token): ditto + add code for
5973 backwards compability for old float styles + add code for new insets
5975 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5977 (InsertInset(size_type, Inset *, LyXFont)): new method
5978 (InsetChar(size_type, char)): changed to use the other InsetChar
5979 with a LyXFont(ALL_INHERIT).
5980 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5981 insert the META_INSET.
5983 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5985 * sigc++/thread.h (Threads): from here
5987 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5988 definition out of line
5989 * sigc++/scope.h: from here
5991 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5993 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5994 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5996 * Makefile.am (bindist): new target.
5998 * INSTALL: add instructions for doing a binary distribution.
6000 * development/tools/README.bin.example: update a bit.
6002 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6005 * lib/lyxrc.example: new lyxrc tag \set_color.
6007 * src/lyxfunc.C (Dispatch):
6008 * src/commandtags.h:
6009 * src/LyXAction.C: new lyxfunc "set-color".
6011 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6012 and an x11name given as strings.
6014 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6015 cache when a color is changed.
6017 2000-06-26 Juergen Vigna <jug@sad.it>
6019 * src/lyxrow.C (width): added this functions and variable.
6021 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6024 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6026 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6028 * images/undo_bw.xpm: new icon.
6029 * images/redo_bw.xpm: ditto.
6031 * configure.in (INSTALL_SCRIPT): change value to
6032 ${INSTALL} to avoid failures of install-script target.
6033 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6035 * src/BufferView.h: add a magic "friend" declaration to please
6038 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6040 * forms/cite.fd: modified to allow resizing without messing
6043 * src/insetcite.C: Uses code from cite.fd almost without
6045 User can now resize dialog in the x-direction.
6046 Resizing the dialog in the y-direction is prevented, as the
6047 code does this intelligently already.
6049 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6051 * INSTALL: remove obsolete entry in "problems" section.
6053 * lib/examples/sl_*.lyx: update of the slovenian examples.
6055 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6057 2000-06-23 Juergen Vigna <jug@sad.it>
6059 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6061 * src/buffer.C (resize): delete the LyXText of textinsets.
6063 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6065 * src/insets/lyxinset.h: added another parameter 'cleared' to
6066 the draw() function.
6068 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6069 unlocking inset in inset.
6071 2000-06-22 Juergen Vigna <jug@sad.it>
6073 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6074 of insets and moved first to LyXText.
6076 * src/mathed/formulamacro.[Ch]:
6077 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6079 2000-06-21 Juergen Vigna <jug@sad.it>
6081 * src/text.C (GetVisibleRow): look if I should clear the area or not
6082 using Inset::doClearArea() function.
6084 * src/insets/lyxinset.h: added doClearArea() function and
6085 modified draw(Painter &, ...) to draw(BufferView *, ...)
6087 * src/text2.C (UpdateInset): return bool insted of int
6089 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6091 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6092 combox in the character popup
6094 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6095 BufferParams const & params
6097 2000-06-20 Juergen Vigna <jug@sad.it>
6099 * src/insets/insettext.C (SetParagraphData): set insetowner on
6102 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6104 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6105 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6107 (form_main_): remove
6109 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6110 (create_form_form_main): remove FD_form_main stuff, connect to
6111 autosave_timeout signal
6113 * src/LyXView.[Ch] (getMainForm): remove
6114 (UpdateTimerCB): remove
6115 * src/BufferView_pimpl.h: inherit from SigC::Object
6117 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6118 signal instead of callback
6120 * src/BufferView.[Ch] (cursorToggleCB): remove
6122 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6124 * src/BufferView_pimpl.C: changes because of the one below
6126 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6127 instead of storing a pointer to a LyXText.
6129 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6131 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6133 * src/lyxparagraph.h
6135 * src/paragraph.C: Changed fontlist to a sorted vector.
6137 2000-06-19 Juergen Vigna <jug@sad.it>
6139 * src/BufferView.h: added screen() function.
6141 * src/insets/insettext.C (LocalDispatch): some selection code
6144 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6146 * src/insets/insettext.C (SetParagraphData):
6148 (InsetText): fixes for multiple paragraphs.
6150 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6152 * development/lyx.spec.in: Call configure with ``--without-warnings''
6153 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6154 This should be fine, however, since we generally don't want to be
6155 verbose when making an RPM.
6157 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6159 * lib/scripts/fig2pstex.py: New file
6161 2000-06-16 Juergen Vigna <jug@sad.it>
6163 * src/insets/insettabular.C (UpdateLocal):
6164 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6165 (LocalDispatch): Changed all functions to use LyXText.
6167 2000-06-15 Juergen Vigna <jug@sad.it>
6169 * src/text.C (SetHeightOfRow): call inset::update before requesting
6172 * src/insets/insettext.C (update):
6173 * src/insets/insettabular.C (update): added implementation
6175 * src/insets/lyxinset.h: added update function
6177 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6179 * src/text.C (SelectNextWord): protect against null pointers with
6180 old-style string streams. (fix from Paul Theo Gonciari
6183 * src/cite.[Ch]: remove erroneous files.
6185 * lib/configure.m4: update the list of created directories.
6187 * src/lyxrow.C: include <config.h>
6188 * src/lyxcursor.C: ditto.
6190 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6192 * lib/examples/decimal.lyx: new example file from Mike.
6194 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6195 to find template definitions (from Dekel)
6197 * src/frontends/.cvsignore: add a few things.
6199 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6201 * src/Timeout.C (TimeOut): remove default argument.
6203 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6206 * src/insets/ExternalTemplate.C: add a "using" directive.
6208 * src/lyx_main.h: remove the act_ struct, which seems unused
6211 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6213 * LyX Developers Meeting: All files changed, due to random C++ (by
6214 coincidence) code generator script.
6216 - external inset (cool!)
6217 - initial online editing of preferences
6218 - insettabular breaks insettext(s contents)
6220 - some DocBook fixes
6221 - example files update
6222 - other cool stuff, create a diff and look for yourself.
6224 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6226 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6227 -1 this is a non-line-breaking textinset.
6229 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6230 if there is no width set.
6232 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6234 * Lots of files: Merged the dialogbase branch.
6236 2000-06-09 Allan Rae <rae@lyx.org>
6238 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6239 and the Dispatch methods that used it.
6241 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6242 access to functions formerly kept in Dispatch.
6244 2000-05-19 Allan Rae <rae@lyx.org>
6246 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6247 made to_page and count_copies integers again. from_page remains a
6248 string however because I want to allow entry of a print range like
6249 "1,4,22-25" using this field.
6251 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6252 and printer-params-get. These aren't useful from the minibuffer but
6253 could be used by a script/LyXServer app provided it passes a suitable
6254 auto_mem_buffer. I guess I should take a look at how the LyXServer
6255 works and make it support xtl buffers.
6257 * sigc++/: updated to libsigc++-1.0.1
6259 * src/xtl/: updated to xtl-1.3.pl.11
6261 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6262 those changes done to the files in src/ are actually recreated when
6263 they get regenerated. Please don't ever accept a patch that changes a
6264 dialog unless that patch includes the changes to the corresponding *.fd
6267 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6268 stringOnlyContains, renamed it and generalised it.
6270 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6271 branch. Removed the remaining old form_print code.
6273 2000-04-26 Allan Rae <rae@lyx.org>
6275 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6276 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6278 2000-04-25 Allan Rae <rae@lyx.org>
6280 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6281 against a base of xtl-1.3.pl.4
6283 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6284 filter the Id: entries so they still show the xtl version number
6287 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6288 into the src/xtl code. Patch still pending with José (XTL)
6290 2000-04-24 Allan Rae <rae@lyx.org>
6292 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6293 both more generic and much safer. Use the new template functions.
6294 * src/buffer.[Ch] (Dispatch): ditto.
6296 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6297 and mem buffer more intelligently. Also a little general cleanup.
6300 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6301 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6302 * src/xtl/Makefile.am: ditto.
6303 * src/xtl/.cvsignore: ditto.
6304 * src/Makefile.am: ditto.
6306 * src/PrinterParams.h: Removed the macros member functions. Added a
6307 testInvariant member function. A bit of tidying up and commenting.
6308 Included Angus's idea for fixing operation with egcs-1.1.2.
6310 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6311 cool expansion of XTL's mem_buffer to support automatic memory
6312 management within the buffer itself. Removed the various macros and
6313 replaced them with template functions that use either auto_mem_buffer
6314 or mem_buffer depending on a #define. The mem_buffer support will
6315 disappear as soon as the auto_mem_buffer is confirmed to be good on
6316 other platforms/compilers. That is, it's there so you've got something
6319 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6320 effectively forked XTL. However I expect José will include my code
6321 into the next major release. Also fixed a memory leak.
6322 * src/xtl/text.h: ditto.
6323 * src/xtl/xdr.h: ditto.
6324 * src/xtl/giop.h: ditto.
6326 2000-04-16 Allan Rae <rae@lyx.org>
6328 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6329 by autogen.sh and removed by maintainer-clean anyway.
6330 * .cvsignore, sigc++/.cvsignore: Support the above.
6332 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6334 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6336 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6337 macros, renamed static callback-target member functions to suit new
6338 scheme and made them public.
6339 * src/frontends/xforms/forms/form_print.fd: ditto.
6340 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6342 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6345 * src/xtl/: New directory containing a minimal distribution of XTL.
6346 This is XTL-1.3.pl.4.
6348 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6350 2000-04-15 Allan Rae <rae@lyx.org>
6352 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6354 * sigc++/: Updated to libsigc++-1.0.0
6356 2000-04-14 Allan Rae <rae@lyx.org>
6358 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6359 use the generic ones in future. I'll modify my conversion script.
6361 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6363 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6364 (CloseAllBufferRelatedDialogs): Renamed.
6365 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6367 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6368 of the generic ones. These are the same ones my conversion script
6371 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6372 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6373 * src/buffer.C (Dispatch): ditto
6375 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6376 functions for updating and hiding buffer dependent dialogs.
6377 * src/BufferView.C (buffer): ditto
6378 * src/buffer.C (setReadonly): ditto
6379 * src/lyxfunc.C (CloseBuffer): ditto
6381 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6382 Dialogs.h, and hence all the SigC stuff, into every file that includes
6383 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6385 * src/BufferView2.C: reduce the number of headers included by buffer.h
6387 2000-04-11 Allan Rae <rae@lyx.org>
6389 * src/frontends/xforms/xform_macros.h: A small collection of macros
6390 for building C callbacks.
6392 * src/frontends/xforms/Makefile.am: Added above file.
6394 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6395 scheme again. This time it should work for JMarc. If this is
6396 successful I'll revise my conversion script to automate some of this.
6397 The static member functions in the class also have to be public for
6398 this scheme will work. If the scheme works (it's almost identical to
6399 the way BufferView::cursorToggleCB is handled so it should work) then
6400 FormCopyright and FormPrint will be ready for inclusion into the main
6401 trunk immediately after 1.1.5 is released -- provided we're prepared
6402 for complaints about lame compilers not handling XTL.
6404 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6406 2000-04-07 Allan Rae <rae@lyx.org>
6408 * config/lyxinclude.m4: A bit more tidying up (Angus)
6410 * src/LString.h: JMarc's <string> header fix
6412 * src/PrinterParams.h: Used string for most data to remove some
6413 ugly code in the Print dialog and avoid even uglier code when
6414 appending the ints to a string for output.
6416 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6417 and moved "default:" back to the end of switch statement. Cleaned
6418 up the printing so it uses the right function calls and so the
6419 "print to file" option actually puts the file in the right directory.
6421 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6423 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6424 and Ok+Apply button control into a separate method: input (Angus).
6425 (input) Cleaned it up and improved it to be very thorough now.
6426 (All CB) static_cast used instead of C style cast (Angus). This will
6427 probably change again once we've worked out how to keep gcc-2.8.1 happy
6428 with real C callbacks.
6429 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6430 ignore some of the bool settings and has random numbers instead. Needs
6431 some more investigation. Added other input length checks and checking
6432 of file and printer names.
6434 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6435 would link (Angus). Seems the old code doesn't compile with the pragma
6436 statement either. Separated callback entries from internal methods.
6438 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6440 2000-03-17 Allan Rae <rae@lyx.org>
6442 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6443 need it? Maybe it could go in Dialogs instead? I could make it a
6444 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6445 values to get the bool return value.
6446 (Dispatch): New overloaded method for xtl support.
6448 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6449 extern "C" callback instead of static member functions. Hopefully,
6450 JMarc will be able to compile this. I haven't changed
6451 forms/form_copyright.fd yet. Breaking one of my own rules already.
6453 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6454 because they aren't useful from the minibuffer. Maybe a LyXServer
6455 might want a help message though?
6457 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6459 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6460 xtl which needs both rtti and exceptions.
6462 * src/support/Makefile.am:
6463 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6465 * src/frontends/xforms/input_validators.[ch]: input filters and
6466 validators. These conrol what keys are valid in input boxes.
6467 Use them and write some more. Much better idea than waiting till
6468 after the user has pressed Ok to say that the input fields don't make
6471 * src/frontends/xforms/Makefile.am:
6472 * src/frontends/xforms/forms/form_print.fd:
6473 * src/frontends/xforms/forms/makefile:
6474 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6475 new scheme. Still have to make sure I haven't missed anything from
6476 the current implementation.
6478 * src/Makefile.am, src/PrinterParams.h: New data store.
6480 * other files: Added a couple of copyright notices.
6482 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6484 * src/insets/insetbib.h: move Holder struct in public space.
6486 * src/frontends/include/DialogBase.h: use SigC:: only when
6487 SIGC_CXX_NAMESPACES is defined.
6488 * src/frontends/include/Dialogs.h: ditto.
6490 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6492 * src/frontends/xforms/FormCopyright.[Ch]: do not
6493 mention SigC:: explicitely.
6495 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6497 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6498 deals with testing KDE in main configure.in
6499 * configure.in: ditto.
6501 2000-02-22 Allan Rae <rae@lyx.org>
6503 * Lots of files: Merged from HEAD
6505 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6506 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6508 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6510 * sigc++/: new minidist.
6512 2000-02-14 Allan Rae <rae@lyx.org>
6514 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6516 2000-02-08 Juergen Vigna <jug@sad.it>
6518 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6519 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6521 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6522 for this port and so it is much easier for other people to port
6523 dialogs in a common development environment.
6525 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6526 the QT/KDE implementation.
6528 * src/frontends/kde/Dialogs.C:
6529 * src/frontends/kde/FormCopyright.C:
6530 * src/frontends/kde/FormCopyright.h:
6531 * src/frontends/kde/Makefile.am:
6532 * src/frontends/kde/formcopyrightdialog.C:
6533 * src/frontends/kde/formcopyrightdialog.h:
6534 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6535 for the kde support of the Copyright-Dialog.
6537 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6538 subdir-substitution instead of hardcoded 'xforms' as we now have also
6541 * src/frontends/include/DialogBase.h (Object): just commented the
6542 label after #endif (nasty warning and I don't like warnings ;)
6544 * src/main.C (main): added KApplication initialization if using
6547 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6548 For now only the KDE event-loop is added if frontend==kde.
6550 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6552 * configure.in: added support for the --with-frontend[=value] option
6554 * autogen.sh: added kde.m4 file to list of config-files
6556 * acconfig.h: added define for KDEGUI-support
6558 * config/kde.m4: added configuration functions for KDE-port
6560 * config/lyxinclude.m4: added --with-frontend[=value] option with
6561 support for xforms and KDE.
6563 2000-02-08 Allan Rae <rae@lyx.org>
6565 * all Makefile.am: Fixed up so the make targets dist, distclean,
6566 install and uninstall all work even if builddir != srcdir. Still
6567 have a new sigc++ minidist update to come.
6569 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6571 2000-02-01 Allan Rae <rae@lyx.org>
6573 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6574 Many mods to get builddir != srcdir working.
6576 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6577 for building on NT and so we can do the builddir != srcdir stuff.
6579 2000-01-30 Allan Rae <rae@lyx.org>
6581 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6582 This will stay in "rae" branch. We probably don't really need it in
6583 the main trunk as anyone who wants to help programming it should get
6584 a full library installed also. So they can check both included and
6585 system supplied library compilation.
6587 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6588 Added a 'mini' distribution of libsigc++. If you feel the urge to
6589 change something in these directories - Resist it. If you can't
6590 resist the urge then you should modify the following script and rebuild
6591 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6592 all happen. Still uses a hacked version of libsigc++'s configure.in.
6593 I'm quite happy with the results. I'm not sure the extra work to turn
6594 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6595 worth the trouble and would probably lead to extra maintenance
6597 I haven't tested the following important make targets: install, dist.
6598 Not ready for prime time but very close. Maybe 1.1.5.
6600 * development/tools/makeLyXsigc.sh: A shell script to automatically
6601 generate our mini-dist of libsigc++. It can only be used with a CVS
6602 checkout of libsigc++ not a tarball distribution. It's well commented.
6603 This will end up as part of the libsigc++ distribution so other apps
6604 can easily have an included mini-dist. If someone makes mods to the
6605 sigc++ subpackage without modifying this script to generate those
6606 changes I'll be very upset!
6608 * src/frontends/: Started the gui/system indep structure.
6610 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6611 to access the gui-indep dialogs are in this class. Much improved
6612 design compared to previous revision. Lars, please refrain from
6613 moving this header into src/ like you did with Popups.h last time.
6615 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6617 * src/frontends/xforms/: Started the gui-indep system with a single
6618 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6621 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6622 Here you'll find a very useful makefile and automated fdfix.sh that
6623 makes updating dailogs a no-brainer -- provided you follow the rules
6624 set out in the README. I'm thinking about adding another script to
6625 automatically generate skeleton code for a new dialog given just the
6628 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6629 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6630 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6632 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6634 * src/support/LSubstring.C (operator): simplify
6636 * src/lyxtext.h: removed bparams, use buffer_->params instead
6638 * src/lyxrow.h: make Row a real class, move all variables to
6639 private and use accessors.
6641 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6643 (isRightToLeftPar): ditto
6644 (ChangeLanguage): ditto
6645 (isMultiLingual): ditto
6648 (SimpleTeXOnePar): ditto
6649 (TeXEnvironment): ditto
6650 (GetEndLabel): ditto
6652 (SetOnlyLayout): ditto
6653 (BreakParagraph): ditto
6654 (BreakParagraphConservative): ditto
6655 (GetFontSettings): ditto
6657 (CopyIntoMinibuffer): ditto
6658 (CutIntoMinibuffer): ditto
6659 (PasteParagraph): ditto
6660 (SetPExtraType): ditto
6661 (UnsetPExtraType): ditto
6662 (DocBookContTableRows): ditto
6663 (SimpleDocBookOneTablePar): ditto
6665 (TeXFootnote): ditto
6666 (SimpleTeXOneTablePar): ditto
6667 (TeXContTableRows): ditto
6668 (SimpleTeXSpecialChars): ditto
6671 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6672 to private and use accessors.
6674 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6675 this, we did not use it anymore and has not been for ages. Just a
6676 waste of cpu cycles.
6678 * src/language.h: make Language a real class, move all variables
6679 to private and use accessors.
6681 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6682 (create_view): remove
6683 (update): some changes for new timer
6684 (cursorToggle): use new timer
6685 (beforeChange): change for new timer
6687 * src/BufferView.h (cursorToggleCB): removed last paramter because
6690 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6691 (cursorToggleCB): change because of new timer code
6693 * lib/CREDITS: updated own mailaddress
6695 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6697 * src/support/filetools.C (PutEnv): fix the code in case neither
6698 putenv() nor setenv() have been found.
6700 * INSTALL: mention the install-strip Makefile target.
6702 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6703 read-only documents.
6705 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6707 * lib/reLyX/configure.in (VERSION): avoid using a previously
6708 generated reLyX wrapper to find out $prefix.
6710 * lib/examples/eu_adibide_lyx-atua.lyx:
6711 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6712 translation of the Tutorial (Dooteo)
6714 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6716 * forms/cite.fd: new citation dialog
6718 * src/insetcite.[Ch]: the new citation dialog is moved into
6721 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6724 * src/insets/insetcommand.h: data members made private.
6726 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6728 * LyX 1.1.5 released
6730 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6732 * src/version.h (LYX_RELEASE): to 1.1.5
6734 * src/spellchecker.C (RunSpellChecker): return false if the
6735 spellchecker dies upon creation.
6737 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6739 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6740 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6744 * lib/CREDITS: update entry for Martin Vermeer.
6746 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6748 * src/text.C (draw): Draw foreign language bars at the bottom of
6749 the row instead of at the baseline.
6751 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6753 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6755 * lib/bind/de_menus.bind: updated
6757 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6759 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6761 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6763 * src/menus.C (Limit_string_length): New function
6764 (ShowTocMenu): Limit the number of items/length of items in the
6767 * src/paragraph.C (String): Correct result for a paragraph inside
6770 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6772 * src/bufferlist.C (close): test of buf->getuser() == NULL
6774 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6776 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6777 Do not call to SetCursor when the paragraph is a closed footnote!
6779 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6781 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6784 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6786 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6789 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6790 reference popup, that activates the reference-back action
6792 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6794 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6795 the menus. Also fixed a bug.
6797 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6798 the math panels when switching buffers (unless new buffer is readonly).
6800 * src/BufferView.C (NoSavedPositions)
6801 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6803 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6805 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6806 less of dvi dirty or not.
6808 * src/trans_mgr.[Ch] (insert): change first parameter to string
6811 * src/chset.[Ch] (encodeString): add const to first parameter
6813 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6815 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6819 * src/LaTeX.C (deplog): better searching for dependency files in
6820 the latex log. Uses now regexps.
6822 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6823 instead of the box hack or \hfill.
6825 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6827 * src/lyxfunc.C (doImportHelper): do not create the file before
6828 doing the actual import.
6829 (doImportASCIIasLines): create a new file before doing the insert.
6830 (doImportASCIIasParagraphs): ditto.
6832 * lib/lyxrc.example: remove mention of non-existing commands
6834 * lyx.man: remove mention of color-related switches.
6836 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6838 * src/lyx_gui.C: remove all the color-related ressources, which
6839 are not used anymore.
6841 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6844 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6846 * src/lyxrc.C (read): Add a missing break in the switch
6848 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6850 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6852 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6855 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6857 * src/text.C (draw): draw bars under foreign language words.
6859 * src/LColor.[Ch]: add LColor::language
6861 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6863 * src/lyxcursor.h (boundary): New member variable
6865 * src/text.C (IsBoundary): New methods
6867 * src/text.C: Use the above for currect cursor movement when there
6868 is both RTL & LTR text.
6870 * src/text2.C: ditto
6872 * src/bufferview_funcs.C (ToggleAndShow): ditto
6874 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6876 * src/text.C (DeleteLineForward): set selection to true to avoid
6877 that DeleteEmptyParagraphMechanism does some magic. This is how it
6878 is done in all other functions, and seems reasonable.
6879 (DeleteWordForward): do not jump over non-word stuff, since
6880 CursorRightOneWord() already does it.
6882 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6883 DeleteWordBackward, since they seem safe to me (since selection is
6884 set to "true") DeleteEmptyParagraphMechanism does nothing.
6886 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6888 * src/lyx_main.C (easyParse): simplify the code by factoring the
6889 part that removes parameters from the command line.
6890 (LyX): check wether wrong command line options have been given.
6892 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6894 * src/lyx_main.C : add support for specifying user LyX
6895 directory via command line option -userdir.
6897 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6899 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6900 the number of items per popup.
6901 (Add_to_refs_menu): Ditto.
6903 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6905 * src/lyxparagraph.h: renamed ClearParagraph() to
6906 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6907 textclass as parameter, and do nothing if free_spacing is
6908 true. This fixes part of the line-delete-forward problems.
6910 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6911 (pasteSelection): ditto.
6912 (SwitchLayoutsBetweenClasses): more translatable strings.
6914 * src/text2.C (CutSelection): use StripLeadingSpaces.
6915 (PasteSelection): ditto.
6916 (DeleteEmptyParagraphMechanism): ditto.
6918 2000-05-26 Juergen Vigna <jug@sad.it>
6920 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6921 is not needed in tabular insets.
6923 * src/insets/insettabular.C (TabularFeatures): added missing features.
6925 * src/tabular.C (DeleteColumn):
6927 (AppendRow): implemented this functions
6928 (cellsturct::operator=): clone the inset too;
6930 2000-05-23 Juergen Vigna <jug@sad.it>
6932 * src/insets/insettabular.C (LocalDispatch): better selection support
6933 when having multicolumn-cells.
6935 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6937 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6939 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6941 * src/ColorHandler.C (getGCForeground): put more test into _()
6943 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6946 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6949 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6951 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6952 there are no labels, or when buffer is readonly.
6954 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6955 there are no labels, buffer is SGML, or when buffer is readonly.
6957 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6959 * src/LColor.C (LColor): change a couple of grey40 to grey60
6960 (LColor): rewore initalization to make compiles go some magnitude
6962 (getGUIName): don't use gettext until we need the string.
6964 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6966 * src/Bullet.[Ch]: Fixed a small bug.
6968 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6970 * src/paragraph.C (String): Several fixes/improvements
6972 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6974 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6976 * src/paragraph.C (String): give more correct output.
6978 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6980 * src/lyxfont.C (stateText) Do not output the language if it is
6981 eqaul to the language of the document.
6983 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6984 between two paragraphs with the same language.
6986 * src/paragraph.C (getParLanguage) Return a correct answer for an
6987 empty dummy paragraph.
6989 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6992 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6995 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6996 the menus/popup, if requested fonts are unavailable.
6998 2000-05-22 Juergen Vigna <jug@sad.it>
7000 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7001 movement support (Up/Down/Tab/Shift-Tab).
7002 (LocalDispatch): added also preliminari cursor-selection.
7004 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7006 * src/paragraph.C (PasteParagraph): Hopefully now right!
7008 2000-05-22 Garst R. Reese <reese@isn.net>
7010 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7011 of list, change all references to Environment to Command
7012 * tex/hollywood.cls : rewrite environments as commands, add
7013 \uppercase to interiorshot and exteriorshot to force uppecase.
7014 * tex/broadway.cls : rewrite environments as commands. Tweak
7017 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7019 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7020 size of items: use a constant intead of the hardcoded 40, and more
7021 importantly do not remove the %m and %x tags added at the end.
7022 (Add_to_refs_menu): use vector::size_type instead of
7023 unsigned int as basic types for the variables. _Please_ do not
7024 assume that size_t is equal to unsigned int. On an alpha, this is
7025 unsigned long, which is _not_ the same.
7027 * src/language.C (initL): remove language "hungarian", since it
7028 seems that "magyar" is better.
7030 2000-05-22 Juergen Vigna <jug@sad.it>
7032 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7034 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7037 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7038 next was deleted but not set to 0.
7040 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7042 * src/language.C (initL): change the initialization of languages
7043 so that compiles goes _fast_.
7045 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7048 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7050 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7054 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7056 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7058 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7062 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7065 * src/insets/insetlo*.[Ch]: Made editable
7067 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7069 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7070 the current selection.
7072 * src/BufferView_pimpl.C (stuffClipboard): new method
7074 * src/BufferView.C (stuffClipboard): new method
7076 * src/paragraph.C (String): new method
7078 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7079 LColor::ignore when lyxname is not found.
7081 * src/BufferView.C (pasteSelection): new method
7083 * src/BufferView_pimpl.C (pasteSelection): new method
7085 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7087 * src/WorkArea.C (request_clipboard_cb): new static function
7088 (getClipboard): new method
7089 (putClipboard): new method
7091 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7093 * LyX 1.1.5pre2 released
7095 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7097 * src/vspace.C (operator=): removed
7098 (operator=): removed
7100 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7102 * src/layout.C (NumberOfClass): manually set the type in make_pair
7103 (NumberOfLayout): ditto
7105 * src/language.C: use the Language constructor for ignore_lang
7107 * src/language.h: add constructors to struct Language
7109 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7111 * src/text2.C (SetCursorIntern): comment out #warning
7113 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7115 * src/mathed/math_iter.h: initialize sx and sw to 0
7117 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7119 * forms/lyx.fd: Redesign of form_ref
7121 * src/LaTeXFeatures.[Ch]
7125 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7128 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7129 and Buffer::inset_iterator.
7131 * src/menus.C: Added new menus: TOC and Refs.
7133 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7135 * src/buffer.C (getTocList): New method.
7137 * src/BufferView2.C (ChangeRefs): New method.
7139 * src/buffer.C (getLabelList): New method. It replaces the old
7140 getReferenceList. The return type is vector<string> instead of
7143 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7144 the old getLabel() and GetNumberOfLabels() methods.
7145 * src/insets/insetlabel.C (getLabelList): ditto
7146 * src/mathed/formula.C (getLabelList): ditto
7148 * src/paragraph.C (String): New method.
7150 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7151 Uses the new getTocList() method.
7152 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7153 which automatically updates the contents of the browser.
7154 (RefUpdateCB): Use the new getLabelList method.
7156 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7158 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7160 * src/spellchecker.C: Added using std::reverse;
7162 2000-05-19 Juergen Vigna <jug@sad.it>
7164 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7166 * src/insets/insettext.C (computeTextRows): small fix for display of
7167 1 character after a newline.
7169 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7172 2000-05-18 Juergen Vigna <jug@sad.it>
7174 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7175 when changing width of column.
7177 * src/tabular.C (set_row_column_number_info): setting of
7178 autobreak rows if necessary.
7180 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7182 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7184 * src/vc-backend.*: renamed stat() to status() and vcstat to
7185 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7186 compilation broke. The new name seems more relevant, anyway.
7188 2000-05-17 Juergen Vigna <jug@sad.it>
7190 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7191 which was wrong if the removing caused removing of rows!
7193 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7194 (pushToken): new function.
7196 * src/text2.C (CutSelection): fix problem discovered with purify
7198 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7200 * src/debug.C (showTags): enlarge the first column, now that we
7201 have 6-digits debug codes.
7203 * lib/layouts/hollywood.layout:
7204 * lib/tex/hollywood.cls:
7205 * lib/tex/brodway.cls:
7206 * lib/layouts/brodway.layout: more commands and fewer
7207 environments. Preambles moved in the .cls files. Broadway now has
7208 more options on scene numbering and less whitespace (from Garst)
7210 * src/insets/insetbib.C (getKeys): make sure that we are in the
7211 document directory, in case the bib file is there.
7213 * src/insets/insetbib.C (Latex): revert bogus change.
7215 2000-05-16 Juergen Vigna <jug@sad.it>
7217 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7218 the TabularLayout on cursor move.
7220 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7222 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7225 (draw): fixed cursor position and drawing so that the cursor is
7226 visible when before the tabular-inset.
7228 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7229 when creating from old insettext.
7231 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7233 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7235 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7236 * lib/tex/brodway.cls: ditto
7238 * lib/layouts/brodway.layout: change alignment of parenthical
7241 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7243 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7244 versions 0.88 and 0.89 are supported.
7246 2000-05-15 Juergen Vigna <jug@sad.it>
7248 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7251 * src/insets/insettext.C (computeTextRows): redone completely this
7252 function in a much cleaner way, because of problems when having a
7254 (draw): added a frame border when the inset is locked.
7255 (SetDrawLockedFrame): this sets if we draw the border or not.
7256 (SetFrameColor): this sets the frame color (default=insetframe).
7258 * src/insets/lyxinset.h: added x() and y() functions which return
7259 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7260 function which is needed to see if we have a locking inset of some
7261 type in this inset (needed for now in insettabular).
7263 * src/vspace.C (inPixels): the same function also without a BufferView
7264 parameter as so it is easier to use it in some ocasions.
7266 * src/lyxfunc.C: changed all places where insertInset was used so
7267 that now if it couldn't be inserted it is deleted!
7269 * src/TabularLayout.C:
7270 * src/TableLayout.C: added support for new tabular-inset!
7272 * src/BufferView2.C (insertInset): this now returns a bool if the
7273 inset was really inserted!!!
7275 * src/tabular.C (GetLastCellInRow):
7276 (GetFirstCellInRow): new helper functions.
7277 (Latex): implemented for new tabular class.
7281 (TeXTopHLine): new Latex() helper functions.
7283 2000-05-12 Juergen Vigna <jug@sad.it>
7285 * src/mathed/formulamacro.C (Read):
7286 * src/mathed/formula.C (Read): read also the \end_inset here!
7288 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7290 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7291 crush when saving formulae with unbalanced parenthesis.
7293 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7295 * src/layout.C: Add new keyword "endlabelstring" to layout file
7297 * src/text.C (GetVisibleRow): Draw endlabel string.
7299 * lib/layouts/broadway.layout
7300 * lib/layouts/hollywood.layout: Added endlabel for the
7301 Parenthetical layout.
7303 * lib/layouts/heb-article.layout: Do not use slanted font shape
7304 for Theorem like environments.
7306 * src/buffer.C (makeLaTeXFile): Always add "american" to
7307 the UsedLanguages list if document language is RTL.
7309 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7311 * add addendum to README.OS2 and small patch (from SMiyata)
7313 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7315 * many files: correct the calls to ChangeExtension().
7317 * src/support/filetools.C (ChangeExtension): remove the no_path
7318 argument, which does not belong there. Use OnlyFileName() instead.
7320 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7321 files when LaTeXing a non-nice latex file.
7323 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7324 a chain of "if". Return false when deadkeys are not handled.
7326 * src/lyx_main.C (LyX): adapted the code for default bindings.
7328 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7329 bindings for basic functionality (except deadkeys).
7330 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7332 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7333 several methods: handle override_x_deadkeys.
7335 * src/lyxrc.h: remove the "bindings" map, which did not make much
7336 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7338 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7340 * src/lyxfont.C (stateText): use a saner method to determine
7341 whether the font is "default". Seems to fix the crash with DEC
7344 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7346 2000-05-08 Juergen Vigna <jug@sad.it>
7348 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7349 TabularLayoutMenu with mouse-button-3
7350 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7352 * src/TabularLayout.C: added this file for having a Layout for
7355 2000-05-05 Juergen Vigna <jug@sad.it>
7357 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7358 recalculating inset-widths.
7359 (TabularFeatures): activated this function so that I can change
7360 tabular-features via menu.
7362 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7363 that I can test some functions with the Table menu.
7365 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7367 * src/lyxfont.C (stateText): guard against stupid c++libs.
7369 * src/tabular.C: add using std::vector
7370 some whitespace changes, + removed som autogenerated code.
7372 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7374 2000-05-05 Juergen Vigna <jug@sad.it>
7376 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7377 row, columns and cellstructures.
7379 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7381 * lib/lyxrc.example: remove obsolete entries.
7383 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7384 reading of protected_separator for free_spacing.
7386 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7388 * src/text.C (draw): do not display an exclamation mark in the
7389 margin for margin notes. This is confusing, ugly and
7392 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7393 AMS math' is checked.
7395 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7396 name to see whether including the amsmath package is needed.
7398 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7400 * src/paragraph.C (validate): Compute UsedLanguages correctly
7401 (don't insert the american language if it doesn't appear in the
7404 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7405 The argument of \thanks{} command is considered moving argument
7407 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7410 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7412 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7413 for appendix/minipage/depth. The lines can be now both in the footnote
7414 frame, and outside the frame.
7416 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7419 2000-05-05 Juergen Vigna <jug@sad.it>
7421 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7422 neede only in tabular.[Ch].
7424 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7426 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7428 (Write): write '~' for PROTECTED_SEPARATOR
7430 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7432 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7435 * src/mathed/formula.C (drawStr): rename size to siz.
7437 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7438 possibly fix a bug by not changing the pflags = flags to piflags =
7441 2000-05-05 Juergen Vigna <jug@sad.it>
7443 * src/insets/insetbib.C: moved using directive
7445 * src/ImportNoweb.C: small fix for being able to compile (missing
7448 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7450 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7451 to use clear, since we don't depend on this in the code. Add test
7454 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7456 * (various *.C files): add using std::foo directives to please dec
7459 * replace calls to string::clear() to string::erase() (Angus)
7461 * src/cheaders/cmath: modified to provide std::abs.
7463 2000-05-04 Juergen Vigna <jug@sad.it>
7465 * src/insets/insettext.C: Prepared all for inserting of multiple
7466 paragraphs. Still display stuff to do (alignment and other things),
7467 but I would like to use LyXText to do this when we cleaned out the
7468 table-support stuff.
7470 * src/insets/insettabular.C: Changed lot of stuff and added lots
7471 of functionality still a lot to do.
7473 * src/tabular.C: Various functions changed name and moved to be
7474 const functions. Added new Read and Write functions and changed
7475 lots of things so it works good with tabular-insets (also removed
7476 some stuff which is not needed anymore * hacks *).
7478 * src/lyxcursor.h: added operators == and != which just look if
7479 par and pos are (not) equal.
7481 * src/buffer.C (latexParagraphs): inserted this function to latex
7482 all paragraphs form par to endpar as then I can use this too for
7485 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7486 so that I can call this to from text insets with their own cursor.
7488 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7489 output off all paragraphs (because of the fix below)!
7491 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7492 the very last paragraph (this could be also the last paragraph of an
7495 * src/texrow.h: added rows() call which returns the count-variable.
7497 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7499 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7501 * lib/configure.m4: better autodetection of DocBook tools.
7503 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7505 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7507 * src/lyx_cb.C: add using std::reverse;
7509 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7512 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7513 selected files. Should fix repeated errors from generated files.
7515 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7517 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7519 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7520 the spellchecker popup.
7522 * lib/lyxrc.example: Removed the \number_inset section
7524 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7526 * src/insets/figinset.C (various): Use IsFileReadable() to make
7527 sure that the file actually exist. Relying on ghostscripts errors
7528 is a bad idea since they can lead to X server crashes.
7530 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7532 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7535 * lib/lyxrc.example: smallish typo in description of
7536 \view_dvi_paper_option
7538 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7541 * src/lyxfunc.C: doImportHelper to factor out common code of the
7542 various import methods. New functions doImportASCIIasLines,
7543 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7544 doImportLinuxDoc for the format specific parts.
7547 * buffer.C: Dispatch returns now a bool to indicate success
7550 * lyx_gui.C: Add getLyXView() for member access
7552 * lyx_main.C: Change logic for batch commands: First try
7553 Buffer::Dispatch (possibly without GUI), if that fails, use
7556 * lyx_main.C: Add support for --import command line switch.
7557 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7558 Available Formats: Everything accepted by 'buffer-import <format>'
7560 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7562 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7565 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7566 documents will be reformatted upon reentry.
7568 2000-04-27 Juergen Vigna <jug@sad.it>
7570 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7571 correctly only last pos this was a bug.
7573 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7575 * release of lyx-1.1.5pre1
7577 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7579 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7581 * src/menus.C: revert the change of naming (Figure->Graphic...)
7582 from 2000-04-11. It was incomplete and bad.
7584 * src/LColor.[Ch]: add LColor::depthbar.
7585 * src/text.C (GetVisibleRow): use it.
7587 * README: update the languages list.
7589 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7591 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7594 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7596 * README: remove sections that were just wrong.
7598 * src/text2.C (GetRowNearY): remove currentrow code
7600 * src/text.C (GetRow): remove currentrow code
7602 * src/screen.C (Update): rewritten a bit.
7603 (SmallUpdate): removed func
7605 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7607 (FullRebreak): return bool
7608 (currentrow): remove var
7609 (currentrow_y): ditto
7611 * src/lyxscreen.h (Draw): change arg to unsigned long
7612 (FitCursor): return bool
7613 (FitManualCursor): ditto
7614 (Smallpdate): remove func
7615 (first): change to unsigned long
7616 (DrawOneRow): change second arg to long (from long &)
7617 (screen_refresh_y): remove var
7618 (scree_refresh_row): ditto
7620 * src/lyxrow.h: change baseline to usigned int from unsigned
7621 short, this brings some implicit/unsigned issues out in the open.
7623 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7625 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7626 instead of smallUpdate.
7628 * src/lyxcursor.h: change y to unsigned long
7630 * src/buffer.h: don't call updateScrollbar after fitcursor
7632 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7633 where they are used. Removed "\\direction", this was not present
7634 in 1.1.4 and is already obsolete. Commented out some code that I
7635 believe to never be called.
7636 (runLiterate): don't call updateScrollbar after fitCursor
7638 (buildProgram): ditto
7641 * src/WorkArea.h (workWidth): change return val to unsigned
7644 (redraw): remove the button redraws
7645 (setScrollbarValue): change for scrollbar
7646 (getScrollbarValue): change for scrollbar
7647 (getScrollbarBounds): change for scrollbar
7649 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7650 (C_WorkArea_down_cb): removed func
7651 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7652 (resize): change for scrollbar
7653 (setScrollbar): ditto
7654 (setScrollbarBounds): ditto
7655 (setScrollbarIncrements): ditto
7656 (up_cb): removed func
7657 (down_cb): removed func
7658 (scroll_cb): change for scrollbar
7659 (work_area_handler): ditto
7661 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7662 when FitCursor did something.
7663 (updateScrollbar): some unsigned changes
7664 (downCB): removed func
7665 (scrollUpOnePage): removed func
7666 (scrollDownOnePage): remvoed func
7667 (workAreaMotionNotify): don't call screen->FitCursor but use
7668 fitCursor instead. and bool return val
7669 (workAreaButtonPress): ditto
7670 (workAreaButtonRelease): some unsigned changes
7671 (checkInsetHit): ditto
7672 (workAreaExpose): ditto
7673 (update): parts rewritten, comments about the signed char arg added
7674 (smallUpdate): removed func
7675 (cursorPrevious): call needed updateScrollbar
7678 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7681 * src/BufferView.[Ch] (upCB): removed func
7682 (downCB): removed func
7683 (smallUpdate): removed func
7685 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7687 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7688 currentrow, currentrow_y optimization. This did not help a lot and
7689 if we want to do this kind of optimization we should rather use
7690 cursor.row instead of the currentrow.
7692 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7693 buffer spacing and klyx spacing support.
7695 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7697 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7700 2000-04-26 Juergen Vigna <jug@sad.it>
7702 * src/insets/figinset.C: fixes to Lars sstream changes!
7704 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7706 * A lot of files: Added Ascii(ostream &) methods to all inset
7707 classes. Used when exporting to ASCII.
7709 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7710 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7713 * src/text2.C (ToggleFree): Disabled implicit word selection when
7714 there is a change in the language
7716 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7717 no output was generated for end-of-sentence inset.
7719 * src/insets/lyxinset.h
7722 * src/paragraph.C: Removed the insetnumber code
7724 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7726 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7728 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7729 no_babel and no_epsfig completely from the file.
7730 (parseSingleLyXformat2Token): add handling for per-paragraph
7731 spacing as written by klyx.
7733 * src/insets/figinset.C: applied patch by Andre. Made it work with
7736 2000-04-20 Juergen Vigna <jug@sad.it>
7738 * src/insets/insettext.C (cutSelection):
7739 (copySelection): Fixed with selection from right to left.
7740 (draw): now the rows are not recalculated at every draw.
7741 (computeTextRows): for now reset the inset-owner here (this is
7742 important for an undo or copy where the inset-owner is not set
7745 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7746 motion to the_locking_inset screen->first was forgotten, this was
7747 not important till we got multiline insets.
7749 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7751 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7752 code seems to be alright (it is code changed by Dekel, and the
7753 intent is indeed that all macros should be defined \protect'ed)
7755 * NEWS: a bit of reorganisation of the new user-visible features.
7757 2000-04-19 Juergen Vigna <jug@sad.it>
7759 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7760 position. Set the inset_owner of the used paragraph so that it knows
7761 that it is inside an inset. Fixed cursor handling with mouse and
7762 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7763 and cleanups to make TextInsets work better.
7765 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7766 Changed parameters of various functions and added LockInsetInInset().
7768 * src/insets/insettext.C:
7770 * src/insets/insetcollapsable.h:
7771 * src/insets/insetcollapsable.C:
7772 * src/insets/insetfoot.h:
7773 * src/insets/insetfoot.C:
7774 * src/insets/insetert.h:
7775 * src/insets/insetert.C: cleaned up the code so that it works now
7776 correctly with insettext.
7778 * src/insets/inset.C:
7779 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7780 that insets in insets are supported right.
7783 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7785 * src/paragraph.C: some small fixes
7787 * src/debug.h: inserted INSETS debug info
7789 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7790 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7792 * src/commandtags.h:
7793 * src/LyXAction.C: insert code for InsetTabular.
7795 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7796 not Button1MotionMask.
7797 (workAreaButtonRelease): send always a InsetButtonRelease event to
7799 (checkInsetHit): some setCursor fixes (always with insets).
7801 * src/BufferView2.C (lockInset): returns a bool now and extended for
7802 locking insets inside insets.
7803 (showLockedInsetCursor): it is important to have the cursor always
7804 before the locked inset.
7805 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7807 * src/BufferView.h: made lockInset return a bool.
7809 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7811 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7812 that is used also internally but can be called as public to have back
7813 a cursor pos which is not set internally.
7814 (SetCursorIntern): Changed to use above function.
7816 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7818 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7823 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7824 patches for things that should be in or should be changed.
7826 * src/* [insetfiles]: change "usigned char fragile" to bool
7827 fragile. There was only one point that could that be questioned
7828 and that is commented in formulamacro.C. Grep for "CHECK".
7830 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7831 (DeleteBuffer): take it out of CutAndPaste and make it static.
7833 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7835 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7836 output the spacing envir commands. Also the new commands used in
7837 the LaTeX output makes the result better.
7839 * src/Spacing.C (writeEnvirBegin): new method
7840 (writeEnvirEnd): new method
7842 2000-04-18 Juergen Vigna <jug@sad.it>
7844 * src/CutAndPaste.C: made textclass a static member of the class
7845 as otherwise it is not accesed right!!!
7847 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7849 * forms/layout_forms.fd
7850 * src/layout_forms.h
7851 * src/layout_forms.C (create_form_form_character)
7852 * src/lyx_cb.C (UserFreeFont)
7853 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7854 documents (in the layout->character popup).
7856 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7858 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7859 \spell_command was in fact not honored (from Kevin Atkinson).
7861 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7864 * src/lyx_gui.h: make lyxViews private (Angus)
7866 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7868 * src/mathed/math_write.C
7869 (MathMatrixInset::Write) Put \protect before \begin{array} and
7870 \end{array} if fragile
7871 (MathParInset::Write): Put \protect before \\ if fragile
7873 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7875 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7876 initialization if the LyXColorHandler must be done after the
7877 connections to the XServer has been established.
7879 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7880 get the background pixel from the lyxColorhandler so that the
7881 figures are rendered with the correct background color.
7882 (NextToken): removed functions.
7883 (GetPSSizes): use ifs >> string instead of NextToken.
7885 * src/Painter.[Ch]: the color cache moved out of this file.
7887 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7890 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7892 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7893 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7895 * src/BufferView.C (enterView): new func
7896 (leaveView): new func
7898 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7900 (leaveView): new func, undefines xterm cursor when approp.
7902 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7903 (AllowInput): delete the Workarea cursor handling from this func.
7905 * src/Painter.C (underline): draw a slimer underline in most cases.
7907 * src/lyx_main.C (error_handler): use extern "C"
7909 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7911 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7912 sent directly to me.
7914 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7915 to the list by Dekel.
7917 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7920 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7921 methods from lyx_cb.here.
7923 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7926 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7928 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7929 instead of using current_view directly.
7931 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7933 * src/LyXAction.C (init): add the paragraph-spacing command.
7935 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7937 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7939 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7940 different from the documents.
7942 * src/text.C (SetHeightOfRow): take paragraph spacing into
7943 account, paragraph spacing takes precedence over buffer spacing
7944 (GetVisibleRow): ditto
7946 * src/paragraph.C (writeFile): output the spacing parameter too.
7947 (validate): set the correct features if spacing is used in the
7949 (Clear): set spacing to default
7950 (MakeSameLayout): spacing too
7951 (HasSameLayout): spacing too
7952 (SetLayout): spacing too
7953 (TeXOnePar): output the spacing commands
7955 * src/lyxparagraph.h: added a spacing variable for use with
7956 per-paragraph spacing.
7958 * src/Spacing.h: add a Default spacing and a method to check if
7959 the current spacing is default. also added an operator==
7961 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7964 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7966 * src/lyxserver.C (callback): fix dispatch of functions
7968 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7969 printf() into lyxerr call.
7971 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7974 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7975 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7976 the "Float" from each of the subitems.
7977 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7979 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7980 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7981 documented the change so that the workaround can be nuked later.
7983 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7986 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7988 * src/buffer.C (getLatexName): ditto
7989 (setReadonly): ditto
7991 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7993 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7994 avoid some uses of current_view. Added also a bufferParams()
7995 method to get at this.
7997 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7999 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8001 * src/lyxparagraph.[Ch]: removed
8002 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8003 with operators used by lower_bound and
8004 upper_bound in InsetTable's
8005 Make struct InsetTable private again. Used matchpos.
8007 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8009 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8010 document, the language of existing text is changed (unless the
8011 document is multi-lingual)
8013 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8015 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8017 * A lot of files: A rewrite of the Right-to-Left support.
8019 2000-04-10 Juergen Vigna <jug@sad.it>
8021 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8022 misplaced cursor when inset in inset is locked.
8024 * src/insets/insettext.C (LocalDispatch): small fix so that a
8025 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8027 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8028 footnote font should be decreased in size twice when displaying.
8030 * src/insets/insettext.C (GetDrawFont): inserted this function as
8031 the drawing-font may differ from the real paragraph font.
8033 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8034 insets (inset in inset!).
8036 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8037 function here because we don't want footnotes inside footnotes.
8039 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8041 (init): now set the inset_owner in paragraph.C
8042 (LocalDispatch): added some resetPos() in the right position
8045 (pasteSelection): changed to use the new CutAndPaste-Class.
8047 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8048 which tells if it is allowed to insert another inset inside this one.
8050 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8051 SwitchLayoutsBetweenClasses.
8053 * src/text2.C (InsertInset): checking of the new paragraph-function
8055 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8056 is not needed anymore here!
8059 (PasteSelection): redone (also with #ifdef) so that now this uses
8060 the CutAndPaste-Class.
8061 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8064 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8065 from/to text/insets.
8067 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8068 so that the paragraph knows if it is inside an (text)-inset.
8069 (InsertFromMinibuffer): changed return-value to bool as now it
8070 may happen that an inset is not inserted in the paragraph.
8071 (InsertInsetAllowed): this checks if it is allowed to insert an
8072 inset in this paragraph.
8074 (BreakParagraphConservative):
8075 (BreakParagraph) : small change for the above change of the return
8076 value of InsertFromMinibuffer.
8078 * src/lyxparagraph.h: added inset_owner and the functions to handle
8079 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8081 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8083 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8084 functions from BufferView to BufferView::Pimpl to ease maintence.
8086 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8087 correctly. Also use SetCursorIntern instead of SetCursor.
8089 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8092 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8094 * src/WorkArea.C (belowMouse): manually implement below mouse.
8096 * src/*: Add "explicit" on several constructors, I added probably
8097 some unneeded ones. A couple of changes to code because of this.
8099 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8100 implementation and private parts from the users of BufferView. Not
8103 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8104 implementation and private parts from the users of LyXLex. Not
8107 * src/BufferView_pimpl.[Ch]: new files
8109 * src/lyxlex_pimpl.[Ch]: new files
8111 * src/LyXView.[Ch]: some inline functions move out-of-line
8113 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8115 * src/lyxparagraph.h: make struct InsetTable public.
8117 * src/support/lyxstring.h: change lyxstring::difference_type to be
8118 ptrdiff_t. Add std:: modifiers to streams.
8120 * src/font.C: include the <cctype> header, for islower() and
8123 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8125 * src/font.[Ch]: new files. Contains the metric functions for
8126 fonts, takes a LyXFont as parameter. Better separation of concepts.
8128 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8129 changes because of this.
8131 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8133 * src/*: compile with -Winline and move functions that don't
8136 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8139 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8141 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8142 (various files changed because of this)
8144 * src/Painter.C (text): fixed the drawing of smallcaps.
8146 * src/lyxfont.[Ch] (drawText): removed unused member func.
8149 * src/*.C: added needed "using" statements and "std::" qualifiers.
8151 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8153 * src/*.h: removed all use of "using" from header files use
8154 qualifier std:: instead.
8156 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8158 * src/text.C (Backspace): some additional cleanups (we already
8159 know whether cursor.pos is 0 or not).
8161 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8162 automake does not provide one).
8164 * src/bmtable.h: replace C++ comments with C comments.
8166 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8168 * src/screen.C (ShowCursor): Change the shape of the cursor if
8169 the current language is not equal to the language of the document.
8170 (If the cursor change its shape unexpectedly, then you've found a bug)
8172 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8175 * src/insets/insetnumber.[Ch]: New files.
8177 * src/LyXAction.C (init)
8178 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8181 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8183 * src/lyxparagraph.h
8184 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8185 (the vector is kept sorted).
8187 * src/text.C (GetVisibleRow): Draw selection correctly when there
8188 is both LTR and RTL text.
8190 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8191 which is much faster.
8193 * src/text.C (GetVisibleRow and other): Do not draw the last space
8194 in a row if the direction of the last letter is not equal to the
8195 direction of the paragraph.
8197 * src/lyxfont.C (latexWriteStartChanges):
8198 Check that font language is not equal to basefont language.
8199 (latexWriteEndChanges): ditto
8201 * src/lyx_cb.C (StyleReset): Don't change the language while using
8202 the font-default command.
8204 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8205 empty paragraph before a footnote.
8207 * src/insets/insetcommand.C (draw): Increase x correctly.
8209 * src/screen.C (ShowCursor): Change cursor shape if
8210 current language != document language.
8212 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8214 2000-03-31 Juergen Vigna <jug@sad.it>
8216 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8217 (Clone): changed mode how the paragraph-data is copied to the
8218 new clone-paragraph.
8220 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8221 GetInset(pos) with no inset anymore there (in inset UNDO)
8223 * src/insets/insetcommand.C (draw): small fix as here x is
8224 incremented not as much as width() returns (2 before, 2 behind = 4)
8226 2000-03-30 Juergen Vigna <jug@sad.it>
8228 * src/insets/insettext.C (InsetText): small fix in initialize
8229 widthOffset (should not be done in the init() function)
8231 2000-03-29 Amir Karger <karger@lyx.org>
8233 * lib/examples/it_ItemizeBullets.lyx: translation by
8236 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8238 2000-03-29 Juergen Vigna <jug@sad.it>
8240 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8242 * src/insets/insetfoot.C (Clone): small change as for the below
8243 new init function in the text-inset
8245 * src/insets/insettext.C (init): new function as I've seen that
8246 clone did not copy the Paragraph-Data!
8247 (LocalDispatch): Added code so that now we have some sort of Undo
8248 functionality (well actually we HAVE Undo ;)
8250 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8252 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8254 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8257 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8259 * src/main.C: added a runtime check that verifies that the xforms
8260 header used when building LyX and the library used when running
8261 LyX match. Exit with a message if they don't match. This is a
8262 version number check only.
8264 * src/buffer.C (save): Don't allocate memory on the heap for
8265 struct utimbuf times.
8267 * *: some using changes, use iosfwd instead of the real headers.
8269 * src/lyxfont.C use char const * instead of string for the static
8270 strings. Rewrite some functions to use sstream.
8272 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8274 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8277 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8279 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8280 of Geodesy (from Martin Vermeer)
8282 * lib/layouts/svjour.inc: include file for the Springer svjour
8283 class. It can be used to support journals other than JoG.
8285 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8286 Miskiewicz <misiek@pld.org.pl>)
8287 * lib/reLyX/Makefile.am: ditto.
8289 2000-03-27 Juergen Vigna <jug@sad.it>
8291 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8292 also some modifications with operations on selected text.
8294 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8295 problems with clicking on insets (last famous words ;)
8297 * src/insets/insetcommand.C (draw):
8298 (width): Changed to have a bit of space before and after the inset so
8299 that the blinking cursor can be seen (otherwise it was hidden)
8301 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8303 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8304 would not be added to the link list when an installed gettext (not
8305 part of libc) is found.
8307 2000-03-24 Juergen Vigna <jug@sad.it>
8309 * src/insets/insetcollapsable.C (Edit):
8310 * src/mathed/formula.C (InsetButtonRelease):
8311 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8314 * src/BufferView.C (workAreaButtonPress):
8315 (workAreaButtonRelease):
8316 (checkInsetHit): Finally fixed the clicking on insets be handled
8319 * src/insets/insetert.C (Edit): inserted this call so that ERT
8320 insets work always with LaTeX-font
8322 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8324 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8325 caused lyx to startup with no GUI in place, causing in a crash
8326 upon startup when called with arguments.
8328 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8330 * src/FontLoader.C: better initialization of dummyXFontStruct.
8332 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8334 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8335 for linuxdoc and docbook import and export format options.
8337 * lib/lyxrc.example Example of default values for the previous flags.
8339 * src/lyx_cb.C Use those flags instead of the hardwired values for
8340 linuxdoc and docbook export.
8342 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8345 * src/menus.C Added menus entries for the new import/exports formats.
8347 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8349 * src/lyxrc.*: Added support for running without Gui
8352 * src/FontLoader.C: sensible defaults if no fonts are needed
8354 * src/lyx_cb.C: New function ShowMessage (writes either to the
8355 minibuffer or cout in case of no gui
8356 New function AskOverwrite for common stuff
8357 Consequently various changes to call these functions
8359 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8360 wild guess at sensible screen resolution when having no gui
8362 * src/lyxfont.C: no gui, no fonts... set some defaults
8364 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8366 * src/LColor.C: made the command inset background a bit lighter.
8368 2000-03-20 Hartmut Goebel <goebel@noris.net>
8370 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8371 stdstruct.inc. Koma-Script added some title elements which
8372 otherwise have been listed below "bibliography". This split allows
8373 adding title elements to where they belong.
8375 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8376 define the additional title elements and then include
8379 * many other layout files: changed to include stdtitle.inc just
8380 before stdstruct.inc.
8382 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8384 * src/buffer.C: (save) Added the option to store all backup files
8385 in a single directory
8387 * src/lyxrc.[Ch]: Added variable \backupdir_path
8389 * lib/lyxrc.example: Added descriptions of recently added variables
8391 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8392 bibtex inset, not closing the bibtex popup when deleting the inset)
8394 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8396 * src/lyx_cb.C: add a couple using directives.
8398 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8399 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8400 import based on the filename.
8402 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8403 file would be imported at start, if the filename where of a sgml file.
8405 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8407 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8409 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8410 * src/lyxfont.h Replaced the member variable bits.direction by the
8411 member variable lang. Made many changes in other files.
8412 This allows having a multi-lingual document
8414 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8415 that change the current language to <l>.
8416 Removed the command "font-rtl"
8418 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8419 format for Hebrew documents)
8421 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8422 When auto_mathmode is "true", pressing a digit key in normal mode
8423 will cause entering into mathmode.
8424 If auto_mathmode is "rtl" then this behavior will be active only
8425 when writing right-to-left text.
8427 * src/text2.C (InsertStringA) The string is inserted using the
8430 * src/paragraph.C (GetEndLabel) Gives a correct result for
8431 footnote paragraphs.
8433 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8435 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8437 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8438 front of PasteParagraph. Never insert a ' '. This should at least
8439 fix some cause for the segfaults that we have been experiencing,
8440 it also fixes backspace behaviour slightly. (Phu!)
8442 * src/support/lstrings.C (compare_no_case): some change to make it
8443 compile with gcc 2.95.2 and stdlibc++-v3
8445 * src/text2.C (MeltFootnoteEnvironment): change type o
8446 first_footnote_par_is_not_empty to bool.
8448 * src/lyxparagraph.h: make text private. Changes in other files
8450 (fitToSize): new function
8451 (setContentsFromPar): new function
8452 (clearContents): new function
8453 (SetChar): new function
8455 * src/paragraph.C (readSimpleWholeFile): deleted.
8457 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8458 the file, just use a simple string instead. Also read the file in
8459 a more maintainable manner.
8461 * src/text2.C (InsertStringA): deleted.
8462 (InsertStringB): deleted.
8464 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8466 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8467 RedoParagraphs from the doublespace handling part, just set status
8468 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8469 done, but perhaps not like this.)
8471 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8473 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8474 character when inserting an inset.
8476 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8478 * src/bufferparams.C (readLanguage): now takes "default" into
8481 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8482 also initialize the toplevel_keymap with the default bindings from
8485 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8487 * all files using lyxrc: have lyxrc as a real variable and not a
8488 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8491 * src/lyxrc.C: remove double call to defaultKeyBindings
8493 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8494 toolbar defauls using lyxlex. Remove enums, structs, functions
8497 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8498 toolbar defaults. Also store default keybindings in a map.
8500 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8501 storing the toolbar defaults without any xforms dependencies.
8503 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8504 applied. Changed to use iterators.
8506 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8508 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8509 systems that don't have LINGUAS set to begin with.
8511 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8513 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8514 the list by Dekel Tsur.
8516 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8518 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8519 * src/insets/form_graphics.C: ditto.
8521 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8523 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8525 * src/bufferparams.C (readLanguage): use the new language map
8527 * src/intl.C (InitKeyMapper): use the new language map
8529 * src/lyx_gui.C (create_forms): use the new language map
8531 * src/language.[Ch]: New files. Used for holding the information
8532 about each language. Now! Use this new language map enhance it and
8533 make it really usable for our needs.
8535 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8537 * screen.C (ShowCursor): Removed duplicate code.
8538 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8539 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8541 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8544 * src/text.C Added TransformChar method. Used for rendering Arabic
8545 text correctly (change the glyphs of the letter according to the
8546 position in the word)
8551 * src/lyxrc.C Added lyxrc command {language_command_begin,
8552 language_command_end,language_command_ltr,language_command_rtl,
8553 language_package} which allows the use of either arabtex or Omega
8556 * src/lyx_gui.C (init)
8558 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8559 to use encoding for menu fonts which is different than the encoding
8562 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8563 do not load the babel package.
8564 To write an English document with Hebrew/Arabic, change the document
8565 language to "english".
8567 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8568 (alphaCounter): changed to return char
8569 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8571 * lib/lyxrc.example Added examples for Hebrew/Arabic
8574 * src/layout.C Added layout command endlabeltype
8576 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8578 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8580 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8582 * src/mathed/math_delim.C (search_deco): return a
8583 math_deco_struct* instead of index.
8585 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8587 * All files with a USE_OSTREAM_ONLY within: removed all code that
8588 was unused when USE_OSTREAM_ONLY is defined.
8590 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8591 of any less. Removed header and using.
8593 * src/text.C (GetVisibleRow): draw the string "Page Break
8594 (top/bottom)" on screen when drawing a pagebreak line.
8596 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8598 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8600 * src/mathed/math_macro.C (draw): do some cast magic.
8603 * src/mathed/math_defs.h: change byte* argument to byte const*.
8605 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8607 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8608 know it is right to return InsetFoot* too, but cxx does not like
8611 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8613 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8615 * src/mathed/math_delim.C: change == to proper assignment.
8617 2000-03-09 Juergen Vigna <jug@sad.it>
8619 * src/insets/insettext.C (setPos): fixed various cursor positioning
8620 problems (via mouse and cursor-keys)
8621 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8622 inset (still a small display problem but it works ;)
8624 * src/insets/insetcollapsable.C (draw): added button_top_y and
8625 button_bottom_y to have correct values for clicking on the inset.
8627 * src/support/lyxalgo.h: commented out 'using std::less'
8629 2000-03-08 Juergen Vigna <jug@sad.it>
8631 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8632 Button-Release event closes as it is alos the Release-Event
8635 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8637 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8639 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8640 can add multiple spaces in Scrap (literate programming) styles...
8641 which, by the way, is how I got hooked on LyX to begin with.
8643 * src/mathed/formula.C (Write): Added dummy variable to an
8644 inset::Latex() call.
8645 (Latex): Add free_spacing boolean to inset::Latex()
8647 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8649 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8650 virtual function to include the free_spacing boolean from
8651 the containing paragraph's style.
8653 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8654 Added free_spacing boolean arg to match inset.h
8656 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8657 Added free_spacing boolean arg to match inset.h
8659 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8660 Added free_spacing boolean and made sure that if in a free_spacing
8661 paragraph, that we output normal space if there is a protected space.
8663 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8664 Added free_spacing boolean arg to match inset.h
8666 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8667 Added free_spacing boolean arg to match inset.h
8669 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8670 Added free_spacing boolean arg to match inset.h
8672 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8673 Added free_spacing boolean arg to match inset.h
8675 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8676 Added free_spacing boolean arg to match inset.h
8678 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8679 free_spacing boolean arg to match inset.h
8681 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8682 Added free_spacing boolean arg to match inset.h
8684 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8685 Added free_spacing boolean arg to match inset.h
8687 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8688 Added free_spacing boolean arg to match inset.h
8690 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8691 Added free_spacing boolean arg to match inset.h
8693 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8694 Added free_spacing boolean arg to match inset.h
8696 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8697 free_spacing boolean arg to match inset.h
8699 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8700 free_spacing boolean arg to match inset.h
8702 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8703 ignore free_spacing paragraphs. The user's spaces are left
8706 * src/text.C (InsertChar): Fixed the free_spacing layout
8707 attribute behavior. Now, if free_spacing is set, you can
8708 add multiple spaces in a paragraph with impunity (and they
8709 get output verbatim).
8710 (SelectSelectedWord): Added dummy argument to inset::Latex()
8713 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8716 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8717 paragraph layouts now only input a simple space instead.
8718 Special character insets don't make any sense in free-spacing
8721 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8722 hard-spaces in the *input* file to simple spaces if the layout
8723 is free-spacing. This converts old files which had to have
8724 hard-spaces in free-spacing layouts where a simple space was
8726 (writeFileAscii): Added free_spacing check to pass to the newly
8727 reworked inset::Latex(...) methods. The inset::Latex() code
8728 ensures that hard-spaces in free-spacing paragraphs get output
8729 as spaces (rather than "~").
8731 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8733 * src/mathed/math_delim.C (draw): draw the empty placeholder
8734 delims with a onoffdash line.
8735 (struct math_deco_compare): struct that holds the "functors" used
8736 for the sort and the binary search in math_deco_table.
8737 (class init_deco_table): class used for initial sort of the
8739 (search_deco): use lower_bound to do a binary search in the
8742 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8744 * src/lyxrc.C: a small secret thingie...
8746 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8747 and to not flush the stream as often as it used to.
8749 * src/support/lyxalgo.h: new file
8750 (sorted): template function used for checking if a sequence is
8751 sorted or not. Two versions with and without user supplied
8752 compare. Uses same compare as std::sort.
8754 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8755 it and give warning on lyxerr.
8757 (struct compare_tags): struct with function operators used for
8758 checking if sorted, sorting and lower_bound.
8759 (search_kw): use lower_bound instead of manually implemented
8762 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8764 * src/insets/insetcollapsable.h: fix Clone() declaration.
8765 * src/insets/insetfoot.h: ditto.
8767 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8769 2000-03-08 Juergen Vigna <jug@sad.it>
8771 * src/insets/lyxinset.h: added owner call which tells us if
8772 this inset is inside another inset. Changed also the return-type
8773 of Editable to an enum so it tells clearer what the return-value is.
8775 * src/insets/insettext.C (computeTextRows): fixed computing of
8776 textinsets which split automatically on more rows.
8778 * src/insets/insetert.[Ch]: changed this to be of BaseType
8781 * src/insets/insetfoot.[Ch]: added footnote inset
8783 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8784 collapsable insets (like footnote, ert, ...)
8786 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8788 * src/lyxdraw.h: remvoe file
8790 * src/lyxdraw.C: remove file
8792 * src/insets/insettext.C: added <algorithm>.
8794 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8796 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8797 (matrix_cb): case MM_OK use string stream
8799 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8802 * src/mathed/math_macro.C (draw): use string stream
8803 (Metrics): use string stream
8805 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8806 directly to the ostream.
8808 * src/vspace.C (asString): use string stream.
8809 (asString): use string stream
8810 (asLatexString): use string stream
8812 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8813 setting Spacing::Other.
8815 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8816 sprintf when creating the stretch vale.
8818 * src/text2.C (alphaCounter): changed to return a string and to
8819 not use a static variable internally. Also fixed a one-off bug.
8820 (SetCounter): changed the drawing of the labels to use string
8821 streams instead of sprintf.
8823 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8824 manipulator to use a scheme that does not require library support.
8825 This is also the way it is done in the new GNU libstdc++. Should
8826 work with DEC cxx now.
8828 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8830 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8831 end. This fixes a bug.
8833 * src/mathed (all files concerned with file writing): apply the
8834 USE_OSTREAM_ONLY changes to mathed too.
8836 * src/support/DebugStream.h: make the constructor explicit.
8838 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8839 count and ostream squashed.
8841 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8843 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8845 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8846 ostringstream uses STL strings, and we might not.
8848 * src/insets/insetspecialchar.C: add using directive.
8849 * src/insets/insettext.C: ditto.
8851 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8853 * lib/layouts/seminar.layout: feeble attempt at a layout for
8854 seminar.cls, far from completet and could really use some looking
8855 at from people used to write layout files.
8857 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8858 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8859 a lot nicer and works nicely with ostreams.
8861 * src/mathed/formula.C (draw): a slightly different solution that
8862 the one posted to the list, but I think this one works too. (font
8863 size wrong in headers.)
8865 * src/insets/insettext.C (computeTextRows): some fiddling on
8866 Jürgens turf, added some comments that he should read.
8868 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8869 used and it gave compiler warnings.
8870 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8873 * src/lyx_gui.C (create_forms): do the right thing when
8874 show_banner is true/false.
8876 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8877 show_banner is false.
8879 * most file writing files: Now use iostreams to do almost all of
8880 the writing. Also instead of passing string &, we now use
8881 stringstreams. mathed output is still not adapted to iostreams.
8882 This change can be turned off by commenting out all the occurences
8883 of the "#define USE_OSTREAM_ONLY 1" lines.
8885 * src/WorkArea.C (createPixmap): don't output debug messages.
8886 (WorkArea): don't output debug messages.
8888 * lib/lyxrc.example: added a comment about the new variable
8891 * development/Code_rules/Rules: Added some more commente about how
8892 to build class interfaces and on how better encapsulation can be
8895 2000-03-03 Juergen Vigna <jug@sad.it>
8897 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8898 automatically with the width of the LyX-Window
8900 * src/insets/insettext.C (computeTextRows): fixed update bug in
8901 displaying text-insets (scrollvalues where not initialized!)
8903 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8905 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8906 id in the check of the result from lower_bound is not enough since
8907 lower_bound can return last too, and then res->id will not be a
8910 * all insets and some code that use them: I have conditionalized
8911 removed the Latex(string & out, ...) this means that only the
8912 Latex(ostream &, ...) will be used. This is a work in progress to
8913 move towards using streams for all output of files.
8915 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8918 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8920 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8921 routine (this fixes bug where greek letters were surrounded by too
8924 * src/support/filetools.C (findtexfile): change a bit the search
8925 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8926 no longer passed to kpsewhich, we may have to change that later.
8928 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8929 warning options to avoid problems with X header files (from Angus
8931 * acinclude.m4: regenerated.
8933 2000-03-02 Juergen Vigna <jug@sad.it>
8935 * src/insets/insettext.C (WriteParagraphData): Using the
8936 par->writeFile() function for writing paragraph-data.
8937 (Read): Using buffer->parseSingleLyXformat2Token()-function
8938 for parsing paragraph data!
8940 * src/buffer.C (readLyXformat2): removed all parse data and using
8941 the new parseSingleLyXformat2Token()-function.
8942 (parseSingleLyXformat2Token): added this function to parse (read)
8943 lyx-file-format (this is called also from text-insets now!)
8945 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8947 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8950 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8951 directly instead of going through a func. One very bad thing: a
8952 static LyXFindReplace, but I don't know where to place it.
8954 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8955 string instead of char[]. Also changed to static.
8956 (GetSelectionOrWordAtCursor): changed to static inline
8957 (SetSelectionOverLenChars): ditto.
8959 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8960 current_view and global variables. both classes has changed names
8961 and LyXFindReplace is not inherited from SearchForm.
8963 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8964 fl_form_search form.
8966 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8968 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8970 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8971 bound (from Kayvan).
8973 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8975 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8977 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8979 * some things that I should comment but the local pub says head to
8982 * comment out all code that belongs to the Roff code for Ascii
8983 export of tables. (this is unused)
8985 * src/LyXView.C: use correct type for global variable
8986 current_layout. (LyXTextClass::size_type)
8988 * some code to get the new insetgraphics closer to working I'd be
8989 grateful for any help.
8991 * src/BufferView2.C (insertInset): use the return type of
8992 NumberOfLayout properly. (also changes in other files)
8994 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8995 this as a test. I want to know what breaks because of this.
8997 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8999 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9001 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9002 to use a \makebox in the label, this allows proper justification
9003 with out using protected spaces or multiple hfills. Now it is
9004 "label" for left justified, "\hfill label\hfill" for center, and
9005 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9006 should be changed accordingly.
9008 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9010 * src/lyxtext.h: change SetLayout() to take a
9011 LyXTextClass::size_type instead of a char (when there is more than
9012 127 layouts in a class); also change type of copylayouttype.
9013 * src/text2.C (SetLayout): ditto.
9014 * src/LyXView.C (updateLayoutChoice): ditto.
9016 * src/LaTeX.C (scanLogFile): errors where the line number was not
9017 given just after the '!'-line were ignored (from Dekel Tsur).
9019 * lib/lyxrc.example: fix description of \date_insert_format
9021 * lib/layouts/llncs.layout: new layout, contributed by Martin
9024 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9026 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9027 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9028 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9029 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9030 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9031 paragraph.C, text.C, text2.C)
9033 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9035 * src/insets/insettext.C (LocalDispatch): remove extra break
9038 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9039 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9041 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9042 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9044 * src/insets/insetbib.h: move InsetBibkey::Holder and
9045 InsetCitation::Holder in public space.
9047 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9049 * src/insets/insettext.h: small change to get the new files from
9050 Juergen to compile (use "string", not "class string").
9052 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9053 const & as parameter to LocalDispatch, use LyXFont const & as
9054 paramter to some other func. This also had impacto on lyxinsets.h
9055 and the two mathed insets.
9057 2000-02-24 Juergen Vigna <jug@sad.it>
9060 * src/commandtags.h:
9062 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9066 * src/BufferView2.C: added/updated code for various inset-functions
9068 * src/insets/insetert.[Ch]: added implementation of InsetERT
9070 * src/insets/insettext.[Ch]: added implementation of InsetText
9072 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9073 (draw): added preliminary code for inset scrolling not finshed yet
9075 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9076 as it is in lyxfunc.C now
9078 * src/insets/lyxinset.h: Added functions for text-insets
9080 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9082 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9083 BufferView and reimplement the list as a queue put inside its own
9086 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9088 * several files: use the new interface to the "updateinsetlist"
9090 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9092 (work_area_handler): call BufferView::trippleClick on trippleclick.
9094 * src/BufferView.C (doubleClick): new function, selects word on
9096 (trippleClick): new function, selects line on trippleclick.
9098 2000-02-22 Allan Rae <rae@lyx.org>
9100 * lib/bind/xemacs.bind: buffer-previous not supported
9102 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9104 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9107 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9109 * src/bufferlist.C: get rid of current_view from this file
9111 * src/spellchecker.C: get rid of current_view from this file
9113 * src/vspace.C: get rid of current_view from this file
9114 (inPixels): added BufferView parameter for this func
9115 (asLatexCommand): added a BufferParams for this func
9117 * src/text.C src/text2.C: get rid of current_view from these
9120 * src/lyxfont.C (getFontDirection): move this function here from
9123 * src/bufferparams.C (getDocumentDirection): move this function
9126 * src/paragraph.C (getParDirection): move this function here from
9128 (getLetterDirection): ditto
9130 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9132 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9133 resize due to wrong pixmap beeing used. Also took the opurtunity
9134 to make the LyXScreen stateless on regard to WorkArea and some
9135 general cleanup in the same files.
9137 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9139 * src/Makefile.am: add missing direction.h
9141 * src/PainterBase.h: made the width functions const.
9143 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9146 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9148 * src/insets/insetlatexaccent.C (draw): make the accents draw
9149 better, at present this will only work well with iso8859-1.
9151 * several files: remove the old drawing code, now we use the new
9154 * several files: remove support for mono_video, reverse_video and
9157 2000-02-17 Juergen Vigna <jug@sad.it>
9159 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9160 int ** as we have to return the pointer, otherwise we have only
9161 NULL pointers in the returning function.
9163 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9165 * src/LaTeX.C (operator()): quote file name when running latex.
9167 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9169 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9170 (bubble tip), this removes our special handling of this.
9172 * Remove all code that is unused now that we have the new
9173 workarea. (Code that are not active when NEW_WA is defined.)
9175 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9177 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9179 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9180 nonexisting layout; correctly redirect obsoleted layouts.
9182 * lib/lyxrc.example: document \view_dvi_paper_option
9184 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9187 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9188 (PreviewDVI): handle the view_dvi_paper_option variable.
9189 [Both from Roland Krause]
9191 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9193 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9194 char const *, int, LyXFont)
9195 (text(int, int, string, LyXFont)): ditto
9197 * src/text.C (InsertCharInTable): attempt to fix the double-space
9198 feature in tables too.
9199 (BackspaceInTable): ditto.
9200 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9202 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9204 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9206 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9207 newly found text in textcache to this.
9208 (buffer): set the owner of the text put into the textcache to 0
9210 * src/insets/figinset.C (draw): fixed the drawing of figures with
9213 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9214 drawing of mathframe, hfills, protected space, table lines. I have
9215 now no outstanding drawing problems with the new Painter code.
9217 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9219 * src/PainterBase.C (ellipse, circle): do not specify the default
9222 * src/LColor.h: add using directive.
9224 * src/Painter.[Ch]: change return type of methods from Painter& to
9225 PainterBase&. Add a using directive.
9227 * src/WorkArea.C: wrap xforms callbacks in C functions
9230 * lib/layouts/foils.layout: font fix and simplifications from Carl
9233 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9235 * a lot of files: The Painter, LColor and WorkArea from the old
9236 devel branch has been ported to lyx-devel. Some new files and a
9237 lot of #ifdeffed code. The new workarea is enabled by default, but
9238 if you want to test the new Painter and LColor you have to compile
9239 with USE_PAINTER defined (do this in config.h f.ex.) There are
9240 still some rought edges, and I'd like some help to clear those
9241 out. It looks stable (loads and displays the Userguide very well).
9244 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9246 * src/buffer.C (pop_tag): revert to the previous implementation
9247 (use a global variable for both loops).
9249 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9251 * src/lyxrc.C (LyXRC): change slightly default date format.
9253 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9254 there is an English text with a footnote that starts with a Hebrew
9255 paragraph, or vice versa.
9256 (TeXFootnote): ditto.
9258 * src/text.C (LeftMargin): allow for negative values for
9259 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9262 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9263 for input encoding (cyrillic)
9265 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9267 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9270 * src/toolbar.C (set): ditto
9271 * src/insets/insetbib.C (create_form_citation_form): ditto
9273 * lib/CREDITS: added Dekel Tsur.
9275 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9276 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9277 hebrew supports files from Dekel Tsur.
9279 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9280 <tzafrir@technion.ac.il>
9282 * src/lyxrc.C: put \date_insert_format at the right place.
9284 * src/buffer.C (makeLaTeXFile): fix the handling of
9285 BufferParams::sides when writing out latex files.
9287 * src/BufferView2.C: add a "using" directive.
9289 * src/support/lyxsum.C (sum): when we use lyxstring,
9290 ostringstream::str needs an additional .c_str().
9292 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9294 * src/support/filetools.C (ChangeExtension): patch from Etienne
9297 * src/TextCache.C (show): remove const_cast and make second
9298 parameter non-const LyXText *.
9300 * src/TextCache.h: use non const LyXText in show.
9302 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9305 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9307 * src/support/lyxsum.C: rework to be more flexible.
9309 * several places: don't check if a pointer is 0 if you are going
9312 * src/text.C: remove some dead code.
9314 * src/insets/figinset.C: remove some dead code
9316 * src/buffer.C: move the BufferView funcs to BufferView2.C
9317 remove all support for insetlatexdel
9318 remove support for oldpapersize stuff
9319 made some member funcs const
9321 * src/kbmap.C: use a std::list to store the bindings in.
9323 * src/BufferView2.C: new file
9325 * src/kbsequence.[Ch]: new files
9327 * src/LyXAction.C + others: remove all trace of buffer-previous
9329 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9330 only have one copy in the binary of this table.
9332 * hebrew patch: moved some functions from LyXText to more
9333 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9335 * several files: remove support for XForms older than 0.88
9337 remove some #if 0 #endif code
9339 * src/TextCache.[Ch]: new file. Holds the textcache.
9341 * src/BufferView.C: changes to use the new TextCache interface.
9342 (waitForX): remove the now unused code.
9344 * src/BackStack.h: remove some commented code
9346 * lib/bind/emacs.bind: remove binding for buffer-previous
9348 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9350 * applied the hebrew patch.
9352 * src/lyxrow.h: make sure that all Row variables are initialized.
9354 * src/text2.C (TextHandleUndo): comment out a delete, this might
9355 introduce a memory leak, but should also help us to not try to
9356 read freed memory. We need to look at this one.
9358 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9359 (LyXParagraph): initalize footnotekind.
9361 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9362 forgot this when applying the patch. Please heed the warnings.
9364 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9365 (aka. reformat problem)
9367 * src/bufferlist.C (exists): made const, and use const_iterator
9368 (isLoaded): new func.
9369 (release): use std::find to find the correct buffer.
9371 * src/bufferlist.h: made getState a const func.
9372 made empty a const func.
9373 made exists a const func.
9376 2000-02-01 Juergen Vigna <jug@sad.it>
9378 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9380 * po/it.po: updated a bit the italian po file and also changed the
9381 'file nuovo' for newfile to 'filenuovo' without a space, this did
9384 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9385 for the new insert_date command.
9387 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9388 from jdblair, to insert a date into the current text conforming to
9389 a strftime format (for now only considering the locale-set and not
9390 the document-language).
9392 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9394 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9395 Bounds Read error seen by purify. The problem was that islower is
9396 a macros which takes an unsigned char and uses it as an index for
9397 in array of characters properties (and is thus subject to the
9401 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9402 correctly the paper sides radio buttons.
9403 (UpdateDocumentButtons): ditto.
9405 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9407 * src/kbmap.C (getsym + others): change to return unsigned int,
9408 returning a long can give problems on 64 bit systems. (I assume
9409 that int is 32bit on 64bit systems)
9411 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9413 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9414 LyXLookupString to be zero-terminated. Really fixes problems seen
9417 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9419 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9420 write a (char*)0 to the lyxerr stream.
9422 * src/lastfiles.C: move algorithm before the using statemets.
9424 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9426 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9427 complains otherwise).
9428 * src/table.C: ditto
9430 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9433 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9434 that I removed earlier... It is really needed.
9436 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9438 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9440 * INSTALL: update xforms home page URL.
9442 * lib/configure.m4: fix a bug with unreadable layout files.
9444 * src/table.C (calculate_width_of_column): add "using std::max"
9447 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9449 * several files: marked several lines with "DEL LINE", this is
9450 lines that can be deleted without changing anything.
9451 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9452 checks this anyway */
9455 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9457 * src/DepTable.C (update): add a "+" at the end when the checksum
9458 is different. (debugging string only)
9460 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9461 the next inset to not be displayed. This should also fix the list
9462 of labels in the "Insert Crossreference" dialog.
9464 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9466 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9467 when regex was not found.
9469 * src/support/lstrings.C (lowercase): use handcoded transform always.
9472 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9473 old_cursor.par->prev could be 0.
9475 * several files: changed post inc/dec to pre inc/dec
9477 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9478 write the lastfiles to file.
9480 * src/BufferView.C (buffer): only show TextCache info when debugging
9482 (resizeCurrentBuffer): ditto
9483 (workAreaExpose): ditto
9485 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9487 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9489 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9490 a bit better by removing the special case for \i and \j.
9492 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9494 * src/lyx_main.C (easyParse): remove test for bad comand line
9495 options, since this broke all xforms-related parsing.
9497 * src/kbmap.C (getsym): set return type to unsigned long, as
9498 declared in header. On an alpha, long is _not_ the same as int.
9500 * src/support/LOstream.h: add a "using std::flush;"
9502 * src/insets/figinset.C: ditto.
9504 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9506 * src/bufferlist.C (write): use blinding fast file copy instead of
9507 "a char at a time", now we are doing it the C++ way.
9509 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9510 std::list<int> instead.
9511 (addpidwait): reflect move to std::list<int>
9512 (sigchldchecker): ditto
9514 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9517 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9518 that obviously was wrong...
9520 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9521 c, this avoids warnings with purify and islower.
9523 * src/insets/figinset.C: rename struct queue to struct
9524 queue_element and rewrite to use a std::queue. gsqueue is now a
9525 std::queue<queue_element>
9526 (runqueue): reflect move to std::queue
9529 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9530 we would get "1" "0" instead of "true" "false. Also make the tostr
9533 2000-01-21 Juergen Vigna <jug@sad.it>
9535 * src/buffer.C (writeFileAscii): Disabled code for special groff
9536 handling of tabulars till I fix this in table.C
9538 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9540 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9542 * src/support/lyxlib.h: ditto.
9544 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9546 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9547 and 'j' look better. This might fix the "macron" bug that has been
9550 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9551 functions as one template function. Delete the old versions.
9553 * src/support/lyxsum.C: move using std::ifstream inside
9556 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9559 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9561 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9563 * src/insets/figinset.C (InitFigures): use new instead of malloc
9564 to allocate memory for figures and bitmaps.
9565 (DoneFigures): use delete[] instead of free to deallocate memory
9566 for figures and bitmaps.
9567 (runqueue): use new to allocate
9568 (getfigdata): use new/delete[] instead of malloc/free
9569 (RegisterFigure): ditto
9571 * some files: moved some declarations closer to first use, small
9572 whitespace changes use preincrement instead of postincrement where
9573 it does not make a difference.
9575 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9576 step on the way to use stl::containers for key maps.
9578 * src/bufferlist.h: add a typedef for const_iterator and const
9579 versions of begin and end.
9581 * src/bufferlist.[Ch]: change name of member variable _state to
9582 state_. (avoid reserved names)
9584 (getFileNames): returns the filenames of the buffers in a vector.
9586 * configure.in (ALL_LINGUAS): added ro
9588 * src/support/putenv.C: new file
9590 * src/support/mkdir.C: new file
9592 2000-01-20 Allan Rae <rae@lyx.org>
9594 * lib/layouts/IEEEtran.layout: Added several theorem environments
9596 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9597 couple of minor additions.
9599 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9600 (except for those in footnotes of course)
9602 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9604 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9606 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9607 std::sort and std::lower_bound instead of qsort and handwritten
9609 (struct compara): struct that holds the functors used by std::sort
9610 and std::lower_bound in MathedLookupBOP.
9612 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9614 * src/support/LAssert.h: do not do partial specialization. We do
9617 * src/support/lyxlib.h: note that lyx::getUserName() and
9618 lyx::date() are not in use right now. Should these be suppressed?
9620 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9621 (makeLinuxDocFile): do not put date and user name in linuxdoc
9624 * src/support/lyxlib.h (kill): change first argument to long int,
9625 since that's what solaris uses.
9627 * src/support/kill.C (kill): fix declaration to match prototype.
9629 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9630 actually check whether namespaces are supported. This is not what
9633 * src/support/lyxsum.C: add a using directive.
9635 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9637 * src/support/kill.C: if we have namespace support we don't have
9638 to include lyxlib.h.
9640 * src/support/lyxlib.h: use namespace lyx if supported.
9642 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9644 * src/support/date.C: new file
9646 * src/support/chdir.C: new file
9648 * src/support/getUserName.C: new file
9650 * src/support/getcwd.C: new file
9652 * src/support/abort.C: new file
9654 * src/support/kill.C: new file
9656 * src/support/lyxlib.h: moved all the functions in this file
9657 insede struct lyx. Added also kill and abort to this struct. This
9658 is a way to avoid the "kill is not defined in <csignal>", we make
9659 C++ wrappers for functions that are not ANSI C or ANSI C++.
9661 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9662 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9663 lyx it has been renamed to sum.
9665 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9667 * src/text.C: add using directives for std::min and std::max.
9669 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9671 * src/texrow.C (getIdFromRow): actually return something useful in
9672 id and pos. Hopefully fixes the bug with positionning of errorbox
9675 * src/lyx_main.C (easyParse): output an error and exit if an
9676 incorrect command line option has been given.
9678 * src/spellchecker.C (ispell_check_word): document a memory leak.
9680 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9681 where a "struct utimbuf" is allocated with "new" and deleted with
9684 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9686 * src/text2.C (CutSelection): don't delete double spaces.
9687 (PasteSelection): ditto
9688 (CopySelection): ditto
9690 * src/text.C (Backspace): don't delete double spaces.
9692 * src/lyxlex.C (next): fix a bug that were only present with
9693 conformant std::istream::get to read comment lines, use
9694 std::istream::getline instead. This seems to fix the problem.
9696 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9698 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9699 allowed to insert space before space" editing problem. Please read
9700 commends at the beginning of the function. Comments about usage
9703 * src/text.C (InsertChar): fix for the "not allowed to insert
9704 space before space" editing problem.
9706 * src/text2.C (DeleteEmptyParagraphMechanism): when
9707 IsEmptyTableRow can only return false this last "else if" will
9708 always be a no-op. Commented out.
9710 * src/text.C (RedoParagraph): As far as I can understand tmp
9711 cursor is not really needed.
9713 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9714 present it could only return false anyway.
9715 (several functions): Did something not so smart...added a const
9716 specifier on a lot of methods.
9718 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9719 and add a tmp->text.resize. The LyXParagraph constructor does the
9721 (BreakParagraphConservative): ditto
9723 * src/support/path.h (Path): add a define so that the wrong usage
9724 "Path("/tmp") will be flagged as a compilation error:
9725 "`unnamed_Path' undeclared (first use this function)"
9727 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9729 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9730 which was bogus for several reasons.
9732 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9736 * autogen.sh: do not use "type -path" (what's that anyway?).
9738 * src/support/filetools.C (findtexfile): remove extraneous space
9739 which caused a kpsewhich warning (at least with kpathsea version
9742 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9744 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9746 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9748 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9750 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9752 * src/paragraph.C (BreakParagraph): do not reserve space on text
9753 if we don't need to (otherwise, if pos_end < pos, we end up
9754 reserving huge amounts of memory due to bad unsigned karma).
9755 (BreakParagraphConservative): ditto, although I have not seen
9756 evidence the bug can happen here.
9758 * src/lyxparagraph.h: add a using std::list.
9760 2000-01-11 Juergen Vigna <jug@sad.it>
9762 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9765 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9767 * src/vc-backend.C (doVCCommand): change to be static and take one
9768 more parameter: the path to chdir too be fore executing the command.
9769 (retrive): new function equiv to "co -r"
9771 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9772 file_not_found_hook is true.
9774 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9776 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9777 if a file is readwrite,readonly...anything else.
9779 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9781 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9782 (CreatePostscript): name change from MenuRunDVIPS (or something)
9783 (PreviewPostscript): name change from MenuPreviewPS
9784 (PreviewDVI): name change from MenuPreviewDVI
9786 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9787 \view_pdf_command., \pdf_to_ps_command
9789 * lib/configure.m4: added search for PDF viewer, and search for
9790 PDF to PS converter.
9791 (lyxrc.defaults output): add \pdflatex_command,
9792 \view_pdf_command and \pdf_to_ps_command.
9794 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9796 * src/bufferlist.C (write): we don't use blocksize for anything so
9799 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9801 * src/support/block.h: disable operator T* (), since it causes
9802 problems with both compilers I tried. See comments in the file.
9804 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9807 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9808 variable LYX_DIR_10x to LYX_DIR_11x.
9810 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9812 * INSTALL: document --with-lyxname.
9815 * configure.in: new configure flag --with-lyxname which allows to
9816 choose the name under which lyx is installed. Default is "lyx", of
9817 course. It used to be possible to do this with --program-suffix,
9818 but the later has in fact a different meaning for autoconf.
9820 * src/support/lstrings.h (lstrchr): reformat a bit.
9822 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9823 * src/mathed/math_defs.h: ditto.
9825 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9827 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9828 true, decides if we create a backup file or not when saving. New
9829 tag and variable \pdf_mode, defaults to false. New tag and
9830 variable \pdflatex_command, defaults to pdflatex. New tag and
9831 variable \view_pdf_command, defaults to xpdf. New tag and variable
9832 \pdf_to_ps_command, defaults to pdf2ps.
9834 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9836 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9837 does not have a BufferView.
9838 (unlockInset): ditto + don't access the_locking_inset if the
9839 buffer does not have a BufferView.
9841 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9842 certain circumstances so that we don't continue a keyboard
9843 operation long after the key was released. Try f.ex. to load a
9844 large document, press PageDown for some seconds and then release
9845 it. Before this change the document would contine to scroll for
9846 some time, with this change it stops imidiatly.
9848 * src/support/block.h: don't allocate more space than needed. As
9849 long as we don't try to write to the arr[x] in a array_type arr[x]
9850 it is perfectly ok. (if you write to it you might segfault).
9851 added operator value_type*() so that is possible to pass the array
9852 to functions expecting a C-pointer.
9854 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9857 * intl/*: updated to gettext 0.10.35, tried to add our own
9858 required modifications. Please verify.
9860 * po/*: updated to gettext 0.10.35, tried to add our own required
9861 modifications. Please verify.
9863 * src/support/lstrings.C (tostr): go at fixing the problem with
9864 cxx and stringstream. When stringstream is used return
9865 oss.str().c_str() so that problems with lyxstring and basic_string
9866 are avoided. Note that the best solution would be for cxx to use
9867 basic_string all the way, but it is not conformant yet. (it seems)
9869 * src/lyx_cb.C + other files: moved several global functions to
9870 class BufferView, some have been moved to BufferView.[Ch] others
9871 are still located in lyx_cb.C. Code changes because of this. (part
9872 of "get rid of current_view project".)
9874 * src/buffer.C + other files: moved several Buffer functions to
9875 class BufferView, the functions are still present in buffer.C.
9876 Code changes because of this.
9878 * config/lcmessage.m4: updated to most recent. used when creating
9881 * config/progtest.m4: updated to most recent. used when creating
9884 * config/gettext.m4: updated to most recent. applied patch for
9887 * config/gettext.m4.patch: new file that shows what changes we
9888 have done to the local copy of gettext.m4.
9890 * config/libtool.m4: new file, used in creation of acinclude.m4
9892 * config/lyxinclude.m4: new file, this is the lyx created m4
9893 macros, used in making acinclude.m4.
9895 * autogen.sh: GNU m4 discovered as a separate task not as part of
9896 the lib/configure creation.
9897 Generate acinlucde from files in config. Actually cat
9898 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9899 easier to upgrade .m4 files that really are external.
9901 * src/Spacing.h: moved using std::istringstream to right after
9902 <sstream>. This should fix the problem seen with some compilers.
9904 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9906 * src/lyx_cb.C: began some work to remove the dependency a lot of
9907 functions have on BufferView::text, even if not really needed.
9908 (GetCurrentTextClass): removed this func, it only hid the
9911 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9912 forgot this in last commit.
9914 * src/Bullet.C (bulletEntry): use static char const *[] for the
9915 tables, becuase of this the return arg had to change to string.
9917 (~Bullet): removed unneeded destructor
9919 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9920 (insetSleep): moved from Buffer
9921 (insetWakeup): moved from Buffer
9922 (insetUnlock): moved from Buffer
9924 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9925 from Buffer to BufferView.
9927 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9929 * config/ltmain.sh: updated to version 1.3.4 of libtool
9931 * config/ltconfig: updated to version 1.3.4 of libtool
9933 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9936 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9937 Did I get that right?
9939 * src/lyxlex.h: add a "using" directive or two.
9940 * src/Spacing.h: ditto.
9941 * src/insets/figinset.C: ditto.
9942 * src/support/filetools.C: ditto.
9943 * src/support/lstrings.C: ditto.
9944 * src/BufferView.C: ditto.
9945 * src/bufferlist.C: ditto.
9946 * src/lyx_cb.C: ditto.
9947 * src/lyxlex.C: ditto.
9949 * NEWS: add some changes for 1.1.4.
9951 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9953 * src/BufferView.C: first go at a TextCache to speed up switching
9956 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9958 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9959 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9960 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9961 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9964 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9965 members of the struct are correctly initialized to 0 (detected by
9967 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9968 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9970 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9971 pidwait, since it was allocated with "new". This was potentially
9972 very bad. Thanks to Michael Schmitt for running purify for us.
9975 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9977 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9979 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9981 1999-12-30 Allan Rae <rae@lyx.org>
9983 * lib/templates/IEEEtran.lyx: minor change
9985 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9986 src/mathed/formula.C (LocalDispatch): askForText changes
9988 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9989 know when a user has cancelled input. Fixes annoying problems with
9990 inserting labels and version control.
9992 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9994 * src/support/lstrings.C (tostr): rewritten to use strstream and
9997 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9999 * src/support/filetools.C (IsFileWriteable): use fstream to check
10000 (IsDirWriteable): use fileinfo to check
10002 * src/support/filetools.h (FilePtr): whole class deleted
10004 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10006 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10008 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10010 * src/bufferlist.C (write): use ifstream and ofstream instead of
10013 * src/Spacing.h: use istrstream instead of sscanf
10015 * src/mathed/math_defs.h: change first arg to istream from FILE*
10017 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10019 * src/mathed/math_parser.C: have yyis to be an istream
10020 (LexGetArg): use istream (yyis)
10022 (mathed_parse): ditto
10023 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10025 * src/mathed/formula.C (Read): rewritten to use istream
10027 * src/mathed/formulamacro.C (Read): rewritten to use istream
10029 * src/lyxlex.h (~LyXLex): deleted desturctor
10030 (getStream): new function, returns an istream
10031 (getFile): deleted funtion
10032 (IsOK): return is.good();
10034 * src/lyxlex.C (LyXLex): delete file and owns_file
10035 (setFile): open an filebuf and assign that to a istream instead of
10037 (setStream): new function, takes an istream as arg.
10038 (setFile): deleted function
10039 (EatLine): rewritten us use istream instead of FILE*
10043 * src/table.C (LyXTable): use istream instead of FILE*
10044 (Read): rewritten to take an istream instead of FILE*
10046 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10048 * src/buffer.C (Dispatch): remove an extraneous break statement.
10050 * src/support/filetools.C (QuoteName): change to do simple
10051 'quoting'. More work is necessary. Also changed to do nothing
10052 under emx (needs fix too).
10053 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10055 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10056 config.h.in to the AC_DEFINE_UNQUOTED() call.
10057 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10058 needs char * as argument (because Solaris 7 declares it like
10061 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10062 remove definition of BZERO.
10064 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10066 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10067 defined, "lyxregex.h" if not.
10069 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10071 (REGEX): new variable that is set to regex.c lyxregex.h when
10072 AM_CONDITIONAL USE_REGEX is set.
10073 (libsupport_la_SOURCES): add $(REGEX)
10075 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10078 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10081 * configure.in: add call to LYX_REGEX
10083 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10084 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10086 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10088 * lib/bind/fi_menus.bind: new file, from
10089 pauli.virtanen@saunalahti.fi.
10091 * src/buffer.C (getBibkeyList): pass the parameter delim to
10092 InsetInclude::getKeys and InsetBibtex::getKeys.
10094 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10095 is passed to Buffer::getBibkeyList
10097 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10098 instead of the hardcoded comma.
10100 * src/insets/insetbib.C (getKeys): make sure that there are not
10101 leading blanks in bibtex keys. Normal latex does not care, but
10102 harvard.sty seems to dislike blanks at the beginning of citation
10103 keys. In particular, the retturn value of the function is
10105 * INSTALL: make it clear that libstdc++ is needed and that gcc
10106 2.7.x probably does not work.
10108 * src/support/filetools.C (findtexfile): make debug message go to
10110 * src/insets/insetbib.C (getKeys): ditto
10112 * src/debug.C (showTags): make sure that the output is correctly
10115 * configure.in: add a comment for TWO_COLOR_ICON define.
10117 * acconfig.h: remove all the entries that already defined in
10118 configure.in or acinclude.m4.
10120 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10121 to avoid user name, date and copyright.
10123 1999-12-21 Juergen Vigna <jug@sad.it>
10125 * src/table.C (Read): Now read bogus row format informations
10126 if the format is < 5 so that afterwards the table can
10127 be read by lyx but without any format-info. Fixed the
10128 crash we experienced when not doing this.
10130 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10132 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10133 (RedoDrawingOfParagraph): ditto
10134 (RedoParagraphs): ditto
10135 (RemoveTableRow): ditto
10137 * src/text.C (Fill): rename arg paperwidth -> paper_width
10139 * src/buffer.C (insertLyXFile): rename var filename -> fname
10140 (writeFile): rename arg filename -> fname
10141 (writeFileAscii): ditto
10142 (makeLaTeXFile): ditto
10143 (makeLinuxDocFile): ditto
10144 (makeDocBookFile): ditto
10146 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10149 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10151 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10154 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10155 compiled by a C compiler not C++.
10157 * src/layout.h (LyXTextClass): added typedef for const_iterator
10158 (LyXTextClassList): added typedef for const_iterator + member
10159 functions begin and end.
10161 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10162 iterators to fill the choice_class.
10163 (updateLayoutChoice): rewritten to use iterators to fill the
10164 layoutlist in the toolbar.
10166 * src/BufferView.h (BufferView::work_area_width): removed unused
10169 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10171 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10172 (sgmlCloseTag): ditto
10174 * src/support/lstrings.h: return type of countChar changed to
10177 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10178 what version of this func to use. Also made to return unsigned int.
10180 * configure.in: call LYX_STD_COUNT
10182 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10183 conforming std::count.
10185 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10187 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10188 and a subscript would give bad display (patch from Dekel Tsur
10189 <dekel@math.tau.ac.il>).
10191 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10193 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10196 * src/chset.h: add a few 'using' directives
10198 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10199 triggered when no buffer is active
10201 * src/layout.C: removed `break' after `return' in switch(), since
10204 * src/lyx_main.C (init): make sure LyX can be ran in place even
10205 when libtool has done its magic with shared libraries. Fix the
10206 test for the case when the system directory has not been found.
10208 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10209 name for the latex file.
10210 (MenuMakeHTML): ditto
10212 * src/buffer.h: add an optional boolean argument, which is passed
10213 to ChangeExtension.
10215 1999-12-20 Allan Rae <rae@lyx.org>
10217 * lib/templates/IEEEtran.lyx: small correction and update.
10219 * configure.in: Attempted to use LYX_PATH_HEADER
10221 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10223 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10224 input from JMarc. Now use preprocessor to find the header.
10225 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10226 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10227 LYX_STL_STRING_FWD. See comments in file.
10229 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10231 * The global MiniBuffer * minibuffer variable is dead.
10233 * The global FD_form_main * fd_form_main variable is dead.
10235 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10237 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10239 * src/table.h: add the LOstream.h header
10240 * src/debug.h: ditto
10242 * src/LyXAction.h: change the explaination of the ReadOnly
10243 attribute: is indicates that the function _can_ be used.
10245 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10248 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10250 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10256 * src/paragraph.C (GetWord): assert on pos>=0
10259 * src/support/lyxstring.C: condition the use of an invariant on
10261 * src/support/lyxstring.h: ditto
10263 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10264 Use LAssert.h instead of plain assert().
10266 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10268 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10269 * src/support/filetools.C: ditto
10271 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10274 * INSTALL: document the new configure flags
10276 * configure.in: suppress --with-debug; add --enable-assertions
10278 * acinclude.m4: various changes in alignment of help strings.
10280 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10282 * src/kbmap.C: commented out the use of the hash map in kb_map,
10283 beginning of movement to a stl::container.
10285 * several files: removed code that was not in effect when
10286 MOVE_TEXT was defined.
10288 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10289 for escaping should not be used. We can discuss if the string
10290 should be enclosed in f.ex. [] instead of "".
10292 * src/trans_mgr.C (insert): use the new returned value from
10293 encodeString to get deadkeys and keymaps done correctly.
10295 * src/chset.C (encodeString): changed to return a pair, to tell
10296 what to use if we know the string.
10298 * src/lyxscreen.h (fillArc): new function.
10300 * src/FontInfo.C (resize): rewritten to use more std::string like
10301 structore, especially string::replace.
10303 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10306 * configure.in (chmod +x some scripts): remove config/gcc-hack
10308 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10310 * src/buffer.C (writeFile): change once again the top comment in a
10311 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10312 instead of an hardcoded version number.
10313 (makeDocBookFile): ditto
10315 * src/version.h: add new define LYX_DOCVERSION
10317 * po/de.po: update from Pit Sütterlin
10318 * lib/bind/de_menus.bind: ditto.
10320 * src/lyxfunc.C (Dispatch): call MenuExport()
10321 * src/buffer.C (Dispatch): ditto
10323 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10324 LyXFunc::Dispatch().
10325 (MenuExport): new function, moved from
10326 LyXFunc::Dispatch().
10328 * src/trans_mgr.C (insert): small cleanup
10329 * src/chset.C (loadFile): ditto
10331 * lib/kbd/iso8859-1.cdef: add missing backslashes
10333 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10335 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10336 help with placing the manually drawn accents better.
10338 (Draw): x2 and hg changed to float to minimize rounding errors and
10339 help place the accents better.
10341 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10342 unsigned short to char is just wrong...cast the char to unsigned
10343 char instead so that the two values can compare sanely. This
10344 should also make the display of insetlatexaccents better and
10345 perhaps also some other insets.
10347 (lbearing): new function
10350 1999-12-15 Allan Rae <rae@lyx.org>
10352 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10353 header that provides a wrapper around the very annoying SGI STL header
10356 * src/support/lyxstring.C, src/LString.h:
10357 removed old SGI-STL-compatability attempts.
10359 * configure.in: Use LYX_STL_STRING_FWD.
10361 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10362 stl_string_fwd.h is around and try to determine it's location.
10363 Major improvement over previous SGI STL 3.2 compatability.
10364 Three small problems remain with this function due to my zero
10365 knowledge of autoconf. JMarc and lgb see the comments in the code.
10367 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10369 * src/broken_const.h, config/hack-gcc, config/README: removed
10371 * configure.in: remove --with-gcc-hack option; do not call
10374 * INSTALL: remove documentation of --with-broken-const and
10377 * acconfig.h: remove all trace of BROKEN_CONST define
10379 * src/buffer.C (makeDocBookFile): update version number in output
10381 (SimpleDocBookOnePar): fix an assert when trying to a character
10382 access beyond string length
10385 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10387 * po/de.po: fix the Export menu
10389 * lyx.man: update the description of -dbg
10391 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10392 (commandLineHelp): updated
10393 (easyParse): show list of available debug levels if -dbg is passed
10396 * src/Makefile.am: add debug.C
10398 * src/debug.h: moved some code to debug.C
10400 * src/debug.C: new file. Contains code to set and show debug
10403 * src/layout.C: remove 'break' after 'continue' in switch
10404 statements, since these cannot be reached.
10406 1999-12-13 Allan Rae <rae@lyx.org>
10408 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10409 (in_word_set): hash() -> math_hash()
10411 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10413 * acconfig.h: Added a test for whether we are using exceptions in the
10414 current compilation run. If so USING_EXCEPTIONS is defined.
10416 * config.in: Check for existance of stl_string_fwd.h
10417 * src/LString.h: If compiling --with-included-string and SGI's
10418 STL version 3.2 is present (see above test) we need to block their
10419 forward declaration of string and supply a __get_c_string().
10420 However, it turns out this is only necessary if compiling with
10421 exceptions enabled so I've a bit more to add yet.
10423 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10424 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10425 src/support/LRegex.h, src/undo.h:
10426 Shuffle the order of the included files a little to ensure that
10427 LString.h gets included before anything that includes stl_string_fwd.h
10429 * src/support/lyxstring.C: We need to #include LString.h instead of
10430 lyxstring.h to get the necessary definition of __get_c_string.
10431 (__get_c_string): New function. This is defined static just like SGI's
10432 although why they need to do this I'm not sure. Perhaps it should be
10433 in lstrings.C instead.
10435 * lib/templates/IEEEtran.lyx: New template file.
10437 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10439 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10440 * intl/Makefile.in (MKINSTALLDIRS): ditto
10442 * src/LyXAction.C (init): changed to hold the LFUN data in a
10443 automatic array in stead of in callso to newFunc, this speeds up
10444 compilation a lot. Also all the memory used by the array is
10445 returned when the init is completed.
10447 * a lot of files: compiled with -Wold-style-cast, changed most of
10448 the reported offenders to C++ style casts. Did not change the
10449 offenders in C files.
10451 * src/trans.h (Match): change argument type to unsigned int.
10453 * src/support/DebugStream.C: fix some types on the streambufs so
10454 that it works on a conforming implementation.
10456 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10458 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10460 * src/support/lyxstring.C: remove the inline added earlier since
10461 they cause a bunch of unsatisfied symbols when linking with dec
10462 cxx. Cxx likes to have the body of inlines at the place where they
10465 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10466 accessing negative bounds in array. This fixes the crash when
10467 inserting accented characters.
10468 * src/trans.h (Match): ditto
10470 * src/buffer.C (Dispatch): since this is a void, it should not try
10471 to return anything...
10473 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10475 * src/buffer.h: removed the two friends from Buffer. Some changes
10476 because of this. Buffer::getFileName and Buffer::setFileName
10477 renamed to Buffer::fileName() and Buffer::fileName(...).
10479 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10481 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10482 and Buffer::update(short) to BufferView. This move is currently
10483 controlled by a define MOVE_TEXT, this will be removed when all
10484 shows to be ok. This move paves the way for better separation
10485 between buffer contents and buffer view. One side effect is that
10486 the BufferView needs a rebreak when swiching buffers, if we want
10487 to avoid this we can add a cache that holds pointers to LyXText's
10488 that is not currently in use.
10490 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10493 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10495 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10497 * lyx_main.C: new command line option -x (or --execute) and
10498 -e (or --export). Now direct conversion from .lyx to .tex
10499 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10500 Unfortunately, X is still needed and the GUI pops up during the
10503 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10505 * src/Spacing.C: add a using directive to bring stream stuff into
10507 * src/paragraph.C: ditto
10508 * src/buffer.C: ditto
10510 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10511 from Lars' announcement).
10513 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10514 example files from Tino Meinen.
10516 1999-12-06 Allan Rae <rae@lyx.org>
10518 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10520 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10522 * src/support/lyxstring.C: added a lot of inline for no good
10525 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10526 latexWriteEndChanges, they were not used.
10528 * src/layout.h (operator<<): output operator for PageSides
10530 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10532 * some example files: loaded in LyX 1.0.4 and saved again to update
10533 certain constructs (table format)
10535 * a lot of files: did the change to use fstream/iostream for all
10536 writing of files. Done with a close look at Andre Poenitz's patch.
10538 * some files: whitespace changes.
10540 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10542 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10543 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10544 architecture, we provide our own. It is used unconditionnally, but
10545 I do not think this is a performance problem. Thanks to Angus
10546 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10547 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10549 (GetInset): use my_memcpy.
10553 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10554 it is easier to understand, but it uses less TeX-only constructs now.
10556 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10557 elements contain spaces
10559 * lib/configure: regenerated
10561 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10562 elements contain spaces; display the list of programs that are
10565 * autogen.sh: make sure lib/configure is executable
10567 * lib/examples/*: rename the tutorial examples to begin with the
10568 two-letters language code.
10570 * src/lyxfunc.C (getStatus): do not query current font if no
10573 * src/lyx_cb.C (RunScript): use QuoteName
10574 (MenuRunDvips): ditto
10575 (PrintApplyCB): ditto
10577 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10578 around argument, so that it works well with the current shell.
10579 Does not work properly with OS/2 shells currently.
10581 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10582 * src/LyXSendto.C (SendtoApplyCB): ditto
10583 * src/lyxfunc.C (Dispatch): ditto
10584 * src/buffer.C (runLaTeX): ditto
10585 (runLiterate): ditto
10586 (buildProgram): ditto
10588 * src/lyx_cb.C (RunScript): ditto
10589 (MenuMakeLaTeX): ditto
10591 * src/buffer.h (getLatexName): new method
10593 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10595 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10597 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10598 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10599 (create_math_panel): ditto
10601 * src/lyxfunc.C (getStatus): re-activate the code which gets
10602 current font and cursor; add test for export to html.
10604 * src/lyxrc.C (read): remove unreachable break statements; add a
10607 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10609 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10611 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10612 introduced by faulty regex.
10613 * src/buffer.C: ditto
10614 * src/lastfiles.C: ditto
10615 * src/paragraph.C: ditto
10616 * src/table.C: ditto
10617 * src/vspace.C: ditto
10618 * src/insets/figinset.C: ditto
10619 Note: most of these is absolutely harmless, except the one in
10620 src/mathed formula.C.
10622 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10624 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10625 operation, yielding correct results for the reLyX command.
10627 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10629 * src/support/filetools.C (ExpandPath): removed an over eager
10631 (ReplaceEnvironmentPath): ditto
10633 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10634 shows that we are doing something fishy in our code...
10635 (BubblePost): ditto
10638 * src/lyxrc.C (read): use a double switch trick to get more help
10639 from the compiler. (the same trick is used in layout.C)
10640 (write): new function. opens a ofstream and pass that to output
10641 (output): new function, takes a ostream and writes the lyxrc
10642 elemts to it. uses a dummy switch to make sure no elements are
10645 * src/lyxlex.h: added a struct pushpophelper for use in functions
10646 with more than one exit point.
10648 * src/lyxlex.[Ch] (GetInteger): made it const
10652 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10654 * src/layout.[hC] : LayoutTags splitted into several enums, new
10655 methods created, better error handling cleaner use of lyxlex. Read
10658 * src/bmtable.[Ch]: change some member prototypes because of the
10659 image const changes.
10661 * commandtags.h, src/LyXAction.C (init): new function:
10662 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10663 This file is not read automatically but you can add \input
10664 preferences to your lyxrc if you want to. We need to discuss how
10667 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10668 in .aux, also remove .bib and .bst files from dependencies when
10671 * src/BufferView.C, src/LyXView.C: add const_cast several places
10672 because of changes to images.
10674 * lib/images/*: same change as for images/*
10676 * lib/lyxrc.example: Default for accept_compound is false not no.
10678 * images/*: changed to be const, however I have som misgivings
10679 about this change so it might be changed back.
10681 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10683 * lib/configure, po/POTFILES.in: regenerated
10685 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10687 * config/lib_configure.m4: removed
10689 * lib/configure.m4: new file (was config/lib_configure.m4)
10691 * configure.in: do not test for rtti, since we do not use it.
10693 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10695 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10696 doubling of allocated space scheme. This makes it faster for large
10697 strings end to use less memory for small strings. xtra rememoved.
10699 * src/insets/figinset.C (waitalarm): commented out.
10700 (GhostscriptMsg): use static_cast
10701 (GhostscriptMsg): use new instead of malloc to allocate memory for
10702 cmap. also delete the memory after use.
10704 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10706 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10707 for changes in bibtex database or style.
10708 (runBibTeX): remove all .bib and .bst files from dep before we
10710 (run): use scanAuc in when dep file already exist.
10712 * src/DepTable.C (remove_files_with_extension): new method
10713 (exist): new method
10715 * src/DepTable.[Ch]: made many of the methods const.
10717 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10719 * src/bufferparams.C: make sure that the default textclass is
10720 "article". It used to be the first one by description order, but
10721 now the first one is "docbook".
10723 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10724 string; call Debug::value.
10725 (easyParse): pass complete argument to setDebuggingLevel().
10727 * src/debug.h (value): fix the code that parses debug levels.
10729 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10732 * src/LyXAction.C: use Debug::ACTION as debug channel.
10734 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10736 * NEWS: updated for the future 1.1.3 release.
10738 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10739 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10740 it should. This is of course a controversial change (since many
10741 people will find that their lyx workscreen is suddenly full of
10742 red), but done for the sake of correctness.
10744 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10745 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10747 * src/insets/inseterror.h, src/insets/inseturl.h,
10748 src/insets/insetinfo.h, src/insets/figinset.h,
10749 src/mathed/formulamacro.h, src/mathed/math_macro.h
10750 (EditMessage): add a missing const and add _() to make sure that
10751 translation happens
10753 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10754 src/insets/insetbib.C, src/support/filetools.C: add `using'
10755 directives for cxx.
10757 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10758 doing 'Insert index of last word' at the beginning of a paragraph.
10760 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10762 * several files: white-space changes.
10764 * src/mathed/formula.C: removed IsAlpha and IsDigit
10766 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10767 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10770 * src/insets/figinset.C (GetPSSizes): don't break when
10771 "EndComments" is seen. But break when a boundingbox is read.
10773 * all classes inherited from Inset: return value of Clone
10774 changed back to Inset *.
10776 * all classes inherited form MathInset: return value of Clone
10777 changed back to MathedInset *.
10779 * src/insets/figinset.C (runqueue): use a ofstream to output the
10780 gs/ps file. Might need some setpresicion or setw. However I can
10781 see no problem with the current code.
10782 (runqueue): use sleep instead of the alarm/signal code. I just
10783 can't see the difference.
10785 * src/paragraph.C (LyXParagraph): reserve space in the new
10786 paragraph and resize the inserted paragraph to just fit.
10788 * src/lyxfunc.h (operator|=): added operator for func_status.
10790 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10791 check for readable file.
10793 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10794 check for readable file.
10795 (MenuMakeLinuxDoc): ditto
10796 (MenuMakeDocBook): ditto
10797 (MenuMakeAscii): ditto
10798 (InsertAsciiFile): split the test for openable and readable
10800 * src/bmtable.C (draw_bitmaptable): use
10801 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10803 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10804 findtexfile from LaTeX to filetools.
10806 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10807 instead of FilePtr. Needs to be verified by a literate user.
10809 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10811 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10812 (EditMessage): likewise.
10814 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10815 respectively as \textasciitilde and \textasciicircum.
10817 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10819 * src/support/lyxstring.h: made the methods that take iterators
10820 use const_iterator.
10822 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10823 (regexMatch): made is use the real regex class.
10825 * src/support/Makefile.am: changed to use libtool
10827 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10829 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10831 (MathIsInset ++): changed several macros to be inline functions
10834 * src/mathed/Makefile.am: changed to use libtool
10836 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10838 * src/insets/inset* : Clone changed to const and return type is
10839 the true insettype not just Inset*.
10841 * src/insets/Makefile.am: changed to use libtool
10843 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10845 * src/undo.[Ch] : added empty() and changed some of the method
10848 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10850 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10851 setID use block<> for the bullets array, added const several places.
10853 * src/lyxfunc.C (getStatus): new function
10855 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10856 LyXAction, added const to several funtions.
10858 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10859 a std::map, and to store the dir items in a vector.
10861 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10864 * src/LyXView.[Ch] + other files : changed currentView to view.
10866 * src/LyXAction.[Ch] : ported from the old devel branch.
10868 * src/.cvsignore: added .libs and a.out
10870 * configure.in : changes to use libtool.
10872 * acinclude.m4 : inserted libtool.m4
10874 * .cvsignore: added libtool
10876 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10878 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10879 file name in insets and mathed directories (otherwise the
10880 dependency is not taken in account under cygwin).
10882 * src/text2.C (InsertString[AB]): make sure that we do not try to
10883 read characters past the string length.
10885 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10887 * lib/doc/LaTeXConfig.lyx.in,
10888 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10890 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10891 file saying who created them and when this heppened; this is
10892 useless and annoys tools like cvs.
10894 * lib/layouts/g-brief-{en,de}.layout,
10895 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10896 from Thomas Hartkens <thomas@hartkens.de>.
10898 * src/{insets,mathed}/Makefile.am: do not declare an empty
10899 LDFLAGS, so that it can be set at configure time (useful on Irix
10902 * lib/reLyX/configure.in: make sure that the prefix is set
10903 correctly in LYX_DIR.
10905 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10907 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10908 be used by 'command-sequence' this allows to bind a key to a
10909 sequence of LyX-commands
10910 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10912 * src/LyXAction.C: add "command-sequence"
10914 * src/LyXFunction.C: handling of "command-sequence"
10916 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10917 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10919 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10921 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10923 * src/buffer.C (writeFile): Do not output a comment giving user
10924 and date at the beginning of a .lyx file. This is useless and
10925 annoys cvs anyway; update version number to 1.1.
10927 * src/Makefile.am (LYX_DIR): add this definition, so that a
10928 default path is hardcoded in LyX.
10930 * configure.in: Use LYX_GNU_GETTEXT.
10932 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10933 AM_GNU_GETTEXT with a bug fixed.
10935 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10937 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10939 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10940 which is used to point to LyX data is now LYX_DIR_11x.
10942 * lyx.man: convert to a unix text file; small updates.
10944 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10946 * src/support/LSubstring.[Ch]: made the second arg of most of the
10947 constructors be a const reference.
10949 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10952 * src/support/lyxstring.[Ch] (swap): added missing member function
10953 and specialization of swap(str, str);
10955 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10957 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10958 trace of the old one.
10960 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10961 put the member definitions in undo.C.
10963 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10964 NEW_TEXT and have now only code that was included when this was
10967 * src/intl.C (LCombo): use static_cast
10969 (DispatchCallback): ditto
10971 * src/definitions.h: removed whole file
10973 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10975 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10976 parsing and stores in a std:map. a regex defines the file format.
10977 removed unneeded members.
10979 * src/bufferparams.h: added several enums from definitions.h here.
10980 Removed unsused destructor. Changed some types to use proper enum
10981 types. use block to have the temp_bullets and user_defined_bullets
10982 and to make the whole class assignable.
10984 * src/bufferparams.C (Copy): removed this functions, use a default
10985 assignment instead.
10987 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10990 * src/buffer.C (readLyXformat2): commend out all that have with
10991 oldpapersize to do. also comment out all that hve to do with
10992 insetlatex and insetlatexdel.
10993 (setOldPaperStuff): commented out
10995 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10997 * src/LyXAction.C: remove use of inset-latex-insert
10999 * src/mathed/math_panel.C (button_cb): use static_cast
11001 * src/insets/Makefile.am (insets_o_SOURCES): removed
11004 * src/support/lyxstring.C (helper): use the unsigned long
11005 specifier, UL, instead of a static_cast.
11007 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11009 * src/support/block.h: new file. to be used as a c-style array in
11010 classes, so that the class can be assignable.
11012 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11014 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11015 NULL, make sure to return an empty string (it is not possible to
11016 set a string to NULL).
11018 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11020 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11022 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11024 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11025 link line, so that Irix users (for example) can set it explicitely to
11028 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11029 it can be overidden at make time (static or dynamic link, for
11032 * src/vc-backend.C, src/LaTeXFeatures.h,
11033 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11034 statements to bring templates to global namespace.
11036 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11038 * src/support/lyxstring.C (operator[] const): make it standard
11041 * src/minibuffer.C (Init): changed to reflect that more
11042 information is given from the lyxvc and need not be provided here.
11044 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11046 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11048 * src/LyXView.C (UpdateTimerCB): use static_cast
11049 (KeyPressMask_raw_callback): ditto
11051 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11052 buffer_, a lot of changes because of this. currentBuffer() ->
11053 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11054 also changes to other files because of this.
11056 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11058 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11059 have no support for RCS and partial support for CVS, will be
11062 * src/insets/ several files: changes because of function name
11063 changes in Bufferview and LyXView.
11065 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11067 * src/support/LSubstring.[Ch]: new files. These implement a
11068 Substring that can be very convenient to use. i.e. is this
11070 string a = "Mary had a little sheep";
11071 Substring(a, "sheep") = "lamb";
11072 a is now "Mary has a little lamb".
11074 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11075 out patterns and subpatterns of strings. It is used by LSubstring
11076 and also by vc-backend.C
11078 * src/support/lyxstring.C: went over all the assertions used and
11079 tried to correct the wrong ones and flag which of them is required
11080 by the standard. some bugs found because of this. Also removed a
11081 couple of assertions.
11083 * src/support/Makefile.am (libsupport_a_SOURCES): added
11084 LSubstring.[Ch] and LRegex.[Ch]
11086 * src/support/FileInfo.h: have struct stat buf as an object and
11087 not a pointer to one, some changes because of this.
11089 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11090 information in layout when adding the layouts preamble to the
11091 textclass preamble.
11093 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11096 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11097 because of bug in OS/2.
11099 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11101 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11102 \verbatim@font instead of \ttfamily, so that it can be redefined.
11104 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11105 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11106 src/layout.h, src/text2.C: add 'using' directive to bring the
11107 STL templates we need from the std:: namespace to the global one.
11108 Needed by DEC cxx in strict ansi mode.
11110 * src/support/LIstream.h,src/support/LOstream.h,
11111 src/support/lyxstring.h,src/table.h,
11112 src/lyxlookup.h: do not include <config.h> in header
11113 files. This should be done in the .C files only.
11115 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11119 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11121 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11122 from Kayvan to fix the tth invokation.
11124 * development/lyx.spec.in: updates from Kayvan to reflect the
11125 changes of file names.
11127 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11129 * src/text2.C (InsertStringB): use std::copy
11130 (InsertStringA): use std::copy
11132 * src/bufferlist.C: use a vector to store the buffers in. This is
11133 an internal change and should not affect any other thing.
11135 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11138 * src/text.C (Fill): fix potential bug, one off bug.
11140 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11142 * src/Makefile.am (lyx_main.o): add more files it depends on.
11144 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11146 * src/support/lyxstring.C: use size_t for the reference count,
11147 size, reserved memory and xtra.
11148 (internal_compare): new private member function. Now the compare
11149 functions should work for std::strings that have embedded '\0'
11151 (compare): all compare functions rewritten to use
11154 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11156 * src/support/lyxstring.C (compare): pass c_str()
11157 (compare): pass c_str
11158 (compare): pass c_str
11160 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11162 * src/support/DebugStream.C: <config.h> was not included correctly.
11164 * lib/configure: forgot to re-generate it :( I'll make this file
11165 auto generated soon.
11167 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11169 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11172 * src/support/lyxstring.C: some changes from length() to rep->sz.
11173 avoids a function call.
11175 * src/support/filetools.C (SpaceLess): yet another version of the
11176 algorithm...now per Jean-Marc's suggestions.
11178 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11180 * src/layout.C (less_textclass_desc): functor for use in sorting
11182 (LyXTextClass::Read): sort the textclasses after reading.
11184 * src/support/filetools.C (SpaceLess): new version of the
11185 SpaceLess functions. What problems does this one give? Please
11188 * images/banner_bw.xbm: made the arrays unsigned char *
11190 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11192 * src/support/lyxstring.C (find): remove bogus assertion in the
11193 two versions of find where this has not been done yet.
11195 * src/support/lyxlib.h: add missing int return type to
11198 * src/menus.C (ShowFileMenu): disable exporting to html if no
11199 html export command is present.
11201 * config/lib_configure.m4: add a test for an HTML converter. The
11202 programs checked for are, in this order: tth, latex2html and
11205 * lib/configure: generated from config/lib_configure.m4.
11207 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11208 html converter. The parameters are now passed through $$FName and
11209 $$OutName, instead of standard input/output.
11211 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11213 * lib/lyxrc.example: update description of \html_command.
11214 add "quotes" around \screen_font_xxx font setting examples to help
11215 people who use fonts with spaces in their names.
11217 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11219 * Distribution files: updates for v1.1.2
11221 * src/support/lyxstring.C (find): remove bogus assert and return
11222 npos for the same condition.
11224 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11226 * added patch for OS/2 from SMiyata.
11228 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11230 * src/text2.C (CutSelection): make space_wrapped a bool
11231 (CutSelection): dont declare int i until we have to.
11232 (alphaCounter): return a char const *.
11234 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11236 * src/support/syscall.C (Systemcalls::kill):
11237 src/support/filetools.C (PutEnv, PutEnvPath):
11238 src/lyx_cb.C (addNewlineAndDepth):
11239 src/FontInfo.C (FontInfo::resize): condition some #warning
11240 directives with WITH_WARNINGS.
11243 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11245 * src/layout.[Ch] + several files: access to class variables
11246 limited and made accessor functions instead a lot of code changed
11247 becuase of this. Also instead of returning pointers often a const
11248 reference is returned instead.
11250 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11252 * src/Makefile.am (dist-hook): added used to remove the CVS from
11253 cheaders upon creating a dist
11254 (EXTRA_DIST): added cheaders
11256 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11257 a character not as a small integer.
11259 * src/support/lyxstring.C (find): removed Assert and added i >=
11260 rep->sz to the first if.
11262 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11264 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11265 src/LyXView.C src/buffer.C src/bufferparams.C
11266 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11267 src/text2.C src/insets/insetinclude.C:
11268 lyxlayout renamed to textclasslist.
11270 * src/layout.C: some lyxerr changes.
11272 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11273 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11274 (LyXLayoutList): removed all traces of this class.
11275 (LyXTextClass::Read): rewrote LT_STYLE
11276 (LyXTextClass::hasLayout): new function
11277 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11278 both const and nonconst version.
11279 (LyXTextClass::delete_layout): new function.
11280 (LyXTextClassList::Style): bug fix. do the right thing if layout
11282 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11283 (LyXTextClassList::NameOfLayout): ditto
11284 (LyXTextClassList::Load): ditto
11286 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11288 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11290 * src/LyXAction.C (LookupFunc): added a workaround for sun
11291 compiler, on the other hand...we don't know if the current code
11292 compiles on sun at all...
11294 * src/support/filetools.C (CleanupPath): subst fix
11296 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11299 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11300 complained about this one?
11302 * src/insets/insetinclude.C (Latex): subst fix
11304 * src/insets/insetbib.C (getKeys): subst fix
11306 * src/LyXSendto.C (SendtoApplyCB): subst fix
11308 * src/lyx_main.C (init): subst fix
11310 * src/layout.C (Read): subst fix
11312 * src/lyx_sendfax_main.C (button_send): subst fix
11314 * src/buffer.C (RoffAsciiTable): subst fix
11316 * src/lyx_cb.C (MenuFax): subst fix
11317 (PrintApplyCB): subst fix
11319 1999-10-26 Juergen Vigna <jug@sad.it>
11321 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11323 (Read): Cleaned up this code so now we read only format vestion >= 5
11325 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11327 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11328 come nobody has complained about this one?
11330 * src/insets/insetinclude.C (Latex): subst fix
11332 * src/insets/insetbib.C (getKeys): subst fix
11334 * src/lyx_main.C (init): subst fix
11336 * src/layout.C (Read): subst fix
11338 * src/buffer.C (RoffAsciiTable): subst fix
11340 * src/lyx_cb.C (MenuFax): subst fix.
11342 * src/layout.[hC] + some other files: rewrote to use
11343 std::container to store textclasses and layouts in.
11344 Simplified, removed a lot of code. Make all classes
11345 assignable. Further simplifications and review of type
11346 use still to be one.
11348 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11349 lastfiles to create the lastfiles partr of the menu.
11351 * src/lastfiles.[Ch]: rewritten to use deque to store the
11352 lastfiles in. Uses fstream for reading and writing. Simplifies
11355 * src/support/syscall.C: remove explicit cast.
11357 * src/BufferView.C (CursorToggleCB): removed code snippets that
11358 were commented out.
11359 use explicat C++ style casts instead of C style casts. also use
11360 u_vdata instea of passing pointers in longs.
11362 * src/PaperLayout.C: removed code snippets that were commented out.
11364 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11366 * src/lyx_main.C: removed code snippets that wer commented out.
11368 * src/paragraph.C: removed code snippets that were commented out.
11370 * src/lyxvc.C (logClose): use static_cast
11372 (viewLog): remove explicit cast to void*
11373 (showLog): removed old commented code
11375 * src/menus.C: use static_cast instead of C style casts. use
11376 u_vdata instead of u_ldata. remove explicit cast to (long) for
11377 pointers. Removed old code that was commented out.
11379 * src/insets/inset.C: removed old commented func
11381 * src/insets/insetref.C (InsetRef): removed old code that had been
11382 commented out for a long time.
11384 (escape): removed C style cast
11386 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11388 * src/insets/insetlatex.C (Draw): removed old commented code
11389 (Read): rewritten to use string
11391 * src/insets/insetlabel.C (escape): removed C style cast
11393 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11395 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11396 old commented code.
11398 * src/insets/insetinclude.h: removed a couple of stupid bools
11400 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11401 (Clone): remove C style cast
11402 (getKeys): changed list to lst because of std::list
11404 * src/insets/inseterror.C (Draw): removed som old commented code.
11406 * src/insets/insetcommand.C (Draw): removed some old commented code.
11408 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11409 commented out forever.
11410 (bibitem_cb): use static_cast instead of C style cast
11411 use of vdata changed to u_vdata.
11413 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11415 (CloseUrlCB): use static_cast instead of C style cast.
11416 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11418 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11419 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11420 (CloseInfoCB): static_cast from ob->u_vdata instead.
11421 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11424 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11425 (C_InsetError_CloseErrorCB): forward the ob parameter
11426 (CloseErrorCB): static_cast from ob->u_vdata instead.
11428 * src/vspace.h: include LString.h since we use string in this class.
11430 * src/vspace.C (lyx_advance): changed name from advance because of
11431 nameclash with stl. And since we cannot use namespaces yet...I
11432 used a lyx_ prefix instead. Expect this to change when we begin
11435 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11437 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11438 and removed now defunct constructor and deconstructor.
11440 * src/BufferView.h: have backstack as a object not as a pointer.
11441 removed initialization from constructor. added include for BackStack
11443 * development/lyx.spec.in (%build): add CFLAGS also.
11445 * src/screen.C (drawFrame): removed another warning.
11447 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11449 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11450 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11451 README and ANNOUNCE a bit for the next release. More work is
11454 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11455 unbreakable if we are in freespacing mode (LyX-Code), but not in
11458 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11460 * src/BackStack.h: fixed initialization order in constructor
11462 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11464 * acinclude.m4 (VERSION): new rules for when a version is
11465 development, added also a variable for prerelease.
11466 (warnings): we set with_warnings=yes for prereleases
11467 (lyx_opt): prereleases compile with same optimization as development
11468 (CXXFLAGS): only use pedantic if we are a development version
11470 * src/BufferView.C (restorePosition): don't do anything if the
11471 backstack is empty.
11473 * src/BackStack.h: added member empty, use this to test if there
11474 is anything to pop...
11476 1999-10-25 Juergen Vigna <jug@sad.it>
11479 * forms/layout_forms.fd +
11480 * forms/latexoptions.fd +
11481 * lyx.fd: changed for various form resize issues
11483 * src/mathed/math_panel.C +
11484 * src/insets/inseterror.C +
11485 * src/insets/insetinfo.C +
11486 * src/insets/inseturl.C +
11487 * src/insets/inseturl.h +
11489 * src/LyXSendto.C +
11490 * src/PaperLayout.C +
11491 * src/ParagraphExtra.C +
11492 * src/TableLayout.C +
11494 * src/layout_forms.C +
11501 * src/menus.C: fixed various resize issues. So now forms can be
11502 resized savely or not be resized at all.
11504 * forms/form_url.fd +
11505 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11508 * src/insets/Makefile.am: added files form_url.[Ch]
11510 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11512 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11513 (and presumably 6.2).
11515 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11516 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11517 remaining static member callbacks.
11519 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11522 * src/support/lyxstring.h: declare struct Srep as friend of
11523 lyxstring, since DEC cxx complains otherwise.
11525 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11527 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11529 * src/LaTeX.C (run): made run_bibtex also depend on files with
11531 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11532 are put into the dependency file.
11534 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11535 the code has shown itself to work
11536 (create_ispell_pipe): removed another warning, added a comment
11539 * src/minibuffer.C (ExecutingCB): removed code that has been
11540 commented out a long time
11542 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11543 out code + a warning.
11545 * src/support/lyxstring.h: comment out the three private
11546 operators, when compiling with string ansi conforming compilers
11547 they make problems.
11549 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11551 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11552 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11555 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11558 * src/mathed/math_panel.C (create_math_panel): remove explicit
11561 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11564 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11565 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11566 to XCreatePixmapFromBitmapData
11567 (fl_set_bmtable_data): change the last argument to be unsigned
11569 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11570 and bh to be unsigned int, remove explicit casts in call to
11571 XReadBitmapFileData.
11573 * images/arrows.xbm: made the arrays unsigned char *
11574 * images/varsz.xbm: ditto
11575 * images/misc.xbm: ditto
11576 * images/greek.xbm: ditto
11577 * images/dots.xbm: ditto
11578 * images/brel.xbm: ditto
11579 * images/bop.xbm: ditto
11581 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11583 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11584 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11585 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11587 (LYX_CXX_CHEADERS): added <clocale> to the test.
11589 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11591 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11593 * src/support/lyxstring.C (append): fixed something that must be a
11594 bug, rep->assign was used instead of rep->append.
11596 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11599 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11600 lyx insert double chars. Fix spotted by Kayvan.
11602 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11604 * Fixed the tth support. I messed up with the Emacs patch apply feature
11605 and omitted the changes in lyxrc.C.
11607 1999-10-22 Juergen Vigna <jug@sad.it>
11609 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11611 * src/lyx_cb.C (MenuInsertRef) +
11612 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11613 the form cannot be resized under it limits (fixes a segfault)
11615 * src/lyx.C (create_form_form_ref) +
11616 * forms/lyx.fd: Changed Gravity on name input field so that it is
11619 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11621 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11622 <ostream> and <istream>.
11624 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11625 whether <fstream> provides the latest standard features, or if we
11626 have an oldstyle library (like in egcs).
11627 (LYX_CXX_STL_STRING): fix the test.
11629 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11630 code on MODERN_STL_STREAM.
11632 * src/support/lyxstring.h: use L{I,O}stream.h.
11634 * src/support/L{I,O}stream.h: new files, designed to setup
11635 correctly streams for our use
11636 - includes the right header depending on STL capabilities
11637 - puts std::ostream and std::endl (for LOStream.h) or
11638 std::istream (LIStream.h) in toplevel namespace.
11640 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11642 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11643 was a bib file that had been changed we ensure that bibtex is run.
11644 (runBibTeX): enhanced to extract the names of the bib files and
11645 getting their absolute path and enter them into the dep file.
11646 (findtexfile): static func that is used to look for tex-files,
11647 checks for absolute patchs and tries also with kpsewhich.
11648 Alternative ways of finding the correct files are wanted. Will
11650 (do_popen): function that runs a command using popen and returns
11651 the whole output of that command in a string. Should be moved to
11654 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11655 file with extension ext has changed.
11657 * src/insets/figinset.C: added ifdef guards around the fl_free
11658 code that jug commented out. Now it is commented out when
11659 compiling with XForms == 0.89.
11661 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11662 to lyxstring.C, and only keep a forward declaration in
11663 lyxstring.h. Simplifies the header file a bit and should help a
11664 bit on compile time too. Also changes to Srep will not mandate a
11665 recompile of code just using string.
11666 (~lyxstring): definition moved here since it uses srep.
11667 (size): definition moved here since it uses srep.
11669 * src/support/lyxstring.h: removed a couple of "inline" that should
11672 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11674 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11677 1999-10-21 Juergen Vigna <jug@sad.it>
11679 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11680 set to left if I just remove the width entry (or it is empty).
11682 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11683 paragraph when having dummy paragraphs.
11685 1999-10-20 Juergen Vigna <jug@sad.it>
11687 * src/insets/figinset.C: just commented some fl_free_form calls
11688 and added warnings so that this calls should be activated later
11689 again. This avoids for now a segfault, but we have a memory leak!
11691 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11692 'const char * argument' to 'string argument', this should
11693 fix some Asserts() in lyxstring.C.
11695 * src/lyxfunc.h: Removed the function argAsString(const char *)
11696 as it is not used anymore.
11698 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11700 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11703 * src/Literate.h: some funcs moved from public to private to make
11704 interface clearer. Unneeded args removed.
11706 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11708 (scanBuildLogFile): ditto
11710 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11711 normal TeX Error. Still room for improvement.
11713 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11715 * src/buffer.C (insertErrors): changes to make the error
11716 desctription show properly.
11718 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11721 * src/support/lyxstring.C (helper): changed to use
11722 sizeof(object->rep->ref).
11723 (operator>>): changed to use a pointer instead.
11725 * src/support/lyxstring.h: changed const reference & to value_type
11726 const & lets see if that helps.
11728 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11730 * Makefile.am (rpmdist): fixed to have non static package and
11733 * src/support/lyxstring.C: removed the compilation guards
11735 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11738 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11739 conditional compile of lyxstring.Ch
11741 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11742 stupid check, but it is a lot better than the bastring hack.
11743 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11745 * several files: changed string::erase into string::clear. Not
11748 * src/chset.C (encodeString): use a char temporary instead
11750 * src/table.C (TexEndOfCell): added tostr around
11751 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11752 (TexEndOfCell): ditto
11753 (TexEndOfCell): ditto
11754 (TexEndOfCell): ditto
11755 (DocBookEndOfCell): ditto
11756 (DocBookEndOfCell): ditto
11757 (DocBookEndOfCell): ditto
11758 (DocBookEndOfCell): ditto
11760 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11762 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11764 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11765 (MenuBuildProg): added tostr around ret
11766 (MenuRunChktex): added tostr around ret
11767 (DocumentApplyCB): added tostr around ret
11769 * src/chset.C (encodeString): added tostr around t->ic
11771 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11772 (makeLaTeXFile): added tostr around tocdepth
11773 (makeLaTeXFile): added tostr around ftcound - 1
11775 * src/insets/insetbib.C (setCounter): added tostr around counter.
11777 * src/support/lyxstring.h: added an operator+=(int) to catch more
11780 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11781 (lyxstring): We DON'T allow NULL pointers.
11783 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11785 * src/mathed/math_macro.C (MathMacroArgument::Write,
11786 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11787 when writing them out.
11789 * src/LString.C: remove, since it is not used anymore.
11791 * src/support/lyxstring.C: condition the content to
11792 USE_INCLUDED_STRING macro.
11794 * src/mathed/math_symbols.C, src/support/lstrings.C,
11795 src/support/lyxstring.C: add `using' directive to specify what
11796 we need in <algorithm>. I do not think that we need to
11797 conditionalize this, but any thought is appreciated.
11799 * many files: change all callback functions to "C" linkage
11800 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11801 strict_ansi. Those who were static are now global.
11802 The case of callbacks which are static class members is
11803 trickier, since we have to make C wrappers around them (see
11804 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11805 did not finish this yet, since it defeats the purpose of
11806 encapsulation, and I am not sure what the best route is.
11808 1999-10-19 Juergen Vigna <jug@sad.it>
11810 * src/support/lyxstring.C (lyxstring): we permit to have a null
11811 pointer as assignment value and just don't assign it.
11813 * src/vspace.C (nextToken): corrected this function substituting
11814 find_first(_not)_of with find_last_of.
11816 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11817 (TableOptCloseCB) (TableSpeCloseCB):
11818 inserted fl_set_focus call for problem with fl_hide_form() in
11821 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11823 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11826 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11828 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11829 LyXLex::next() and not eatline() to get its argument.
11831 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11833 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11834 instead, use fstreams for io of the depfile, removed unneeded
11835 functions and variables.
11837 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11838 vector instead, removed all functions and variables that is not in
11841 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11843 * src/buffer.C (insertErrors): use new interface to TeXError
11845 * Makefile.am (rpmdist): added a rpmdist target
11847 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11848 per Kayvan's instructions.
11850 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11852 * src/Makefile.am: add a definition for localedir, so that locales
11853 are found after installation (Kayvan)
11855 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11857 * development/.cvsignore: new file.
11859 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11861 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11862 C++ compiler provides wrappers for C headers and use our alternate
11865 * configure.in: use LYX_CXX_CHEADERS.
11867 * src/cheader/: new directory, populated with cname headers from
11868 libstdc++-2.8.1. They are a bit old, but probably good enough for
11869 what we want (support compilers who lack them).
11871 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11872 from includes. It turns out is was stupid.
11874 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11876 * lib/Makefile.am (install-data-local): forgot a ';'
11877 (install-data-local): forgot a '\'
11878 (libinstalldirs): needed after all. reintroduced.
11880 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11882 * configure.in (AC_OUTPUT): added lyx.spec
11884 * development/lyx.spec: removed file
11886 * development/lyx.spec.in: new file
11888 * po/*.po: merged with lyx.pot becuase of make distcheck
11890 * lib/Makefile.am (dist-hook): added dist-hook so that
11891 documentation files will be included when doing a make
11892 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11893 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11895 more: tried to make install do the right thing, exclude CVS dirs
11898 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11899 Path would fit in more nicely.
11901 * all files that used to use pathstack: uses now Path instead.
11902 This change was a lot easier than expected.
11904 * src/support/path.h: new file
11906 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11908 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11910 * src/support/lyxstring.C (getline): Default arg was given for
11913 * Configure.cmd: removed file
11915 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11917 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11918 streams classes and types, add the proper 'using' statements when
11919 MODERN_STL is defined.
11921 * src/debug.h: move the << operator definition after the inclusion
11924 * src/support/filetools.C: include "LAssert.h", which is needed
11927 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11930 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11931 include "debug.h" to define a proper ostream.
11933 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11935 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11936 method to the SystemCall class which can kill a process, but it's
11937 not fully implemented yet.
11939 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11941 * src/support/FileInfo.h: Better documentation
11943 * src/lyxfunc.C: Added support for buffer-export html
11945 * src/menus.C: Added Export->As HTML...
11947 * lib/bind/*.bind: Added short-cut for buffer-export html
11949 * src/lyxrc.*: Added support for new \tth_command
11951 * lib/lyxrc.example: Added stuff for new \tth_command
11953 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11955 * lib/Makefile.am (IMAGES): removed images/README
11956 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11957 installes in correct place. Check permisions is installed
11960 * src/LaTeX.C: some no-op changes moved declaration of some
11963 * src/LaTeX.h (LATEX_H): changed include guard name
11965 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11967 * lib/reLyX/Makefile.am: install noweb2lyx.
11969 * lib/Makefile.am: install configure.
11971 * lib/reLyX/configure.in: declare a config aux dir; set package
11972 name to lyx (not sure what the best solution is); generate noweb2lyx.
11974 * lib/layouts/egs.layout: fix the bibliography layout.
11976 1999-10-08 Jürgen Vigna <jug@sad.it>
11978 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11979 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11980 it returned without continuing to search the path.
11982 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11984 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11985 also fixes a bug. It is not allowed to do tricks with std::strings
11986 like: string a("hei"); &a[e]; this will not give what you
11987 think... Any reason for the complexity in this func?
11989 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11991 * Updated README and INSTALL a bit, mostly to check that my
11992 CVS rights are correctly set up.
11994 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11996 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11997 does not allow '\0' chars but lyxstring and std::string does.
11999 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12001 * autogen.sh (AUTOCONF): let the autogen script create the
12002 POTFILES.in file too. POTFILES.in should perhaps now not be
12003 included in the cvs module.
12005 * some more files changed to use C++ includes instead of C ones.
12007 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12009 (Reread): added tostr to nlink. buggy output otherwise.
12010 (Reread): added a string() around szMode when assigning to Buffer,
12011 without this I got a log of garbled info strings.
12013 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12016 * I have added several ostream & operator<<(ostream &, some_type)
12017 functions. This has been done to avoid casting and warnings when
12018 outputting enums to lyxerr. This as thus eliminated a lot of
12019 explicit casts and has made the code clearer. Among the enums
12020 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12021 mathed enums, some font enum the Debug::type enum.
12023 * src/support/lyxstring.h (clear): missing method. equivalent of
12026 * all files that contained "stderr": rewrote constructs that used
12027 stderr to use lyxerr instead. (except bmtable)
12029 * src/support/DebugStream.h (level): and the passed t with
12030 Debug::ANY to avoid spurious bits set.
12032 * src/debug.h (Debug::type value): made it accept strings of the
12033 type INFO,INIT,KEY.
12035 * configure.in (Check for programs): Added a check for kpsewhich,
12036 the latex generation will use this later to better the dicovery of
12039 * src/BufferView.C (create_view): we don't need to cast this to
12040 (void*) that is done automatically.
12041 (WorkAreaButtonPress): removed some dead code.
12043 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12045 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12046 is not overwritten when translated (David Sua'rez de Lis).
12048 * lib/CREDITS: Added David Sua'rez de Lis
12050 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12052 * src/bufferparams.C (BufferParams): default input encoding is now
12055 * acinclude.m4 (cross_compiling): comment out macro
12056 LYX_GXX_STRENGTH_REDUCE.
12058 * acconfig.h: make sure that const is not defined (to empty) when
12059 we are compiling C++. Remove commented out code using SIZEOF_xx
12062 * configure.in : move the test for const and inline as late as
12063 possible so that these C tests do not interefere with C++ ones.
12064 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12065 has not been proven.
12067 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12069 * src/table.C (getDocBookAlign): remove bad default value for
12070 isColumn parameter.
12072 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12074 (ShowFileMenu2): ditto.
12076 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12077 of files to ignore.
12079 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12081 * Most files: finished the change from the old error code to use
12082 DebugStream for all lyxerr debugging. Only minor changes remain
12083 (e.g. the setting of debug levels using strings instead of number)
12085 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12087 * src/layout.C (Add): Changed to use compare_no_case instead of
12090 * src/FontInfo.C: changed loop variable type too string::size_type.
12092 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12094 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12095 set ETAGS_ARGS to --c++
12097 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12099 * src/table.C (DocBookEndOfCell): commented out two unused variables
12101 * src/paragraph.C: commented out four unused variables.
12103 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12104 insed a if clause with type string::size_type.
12106 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12109 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12111 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12112 variable, also changed loop to go from 0 to lenght + 1, instead of
12113 -1 to length. This should be correct.
12115 * src/LaTeX.C (scanError): use string::size_type as loop variable
12118 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12119 (l.896) since y_tmp and row was not used anyway.
12121 * src/insets/insetref.C (escape): use string::size_type as loop
12124 * src/insets/insetquotes.C (Width): use string::size_type as loop
12126 (Draw): use string::size_type as loop variable type.
12128 * src/insets/insetlatexaccent.C (checkContents): use
12129 string::size_type as loop variable type.
12131 * src/insets/insetlabel.C (escape): use string::size_type as loop
12134 * src/insets/insetinfo.C: added an extern for current_view.
12136 * src/insets/insetcommand.C (scanCommand): use string::size_type
12137 as loop variable type.
12139 * most files: removed the RCS tags. With them we had to recompile
12140 a lot of files after a simple cvs commit. Also we have never used
12141 them for anything meaningful.
12143 * most files: tags-query-replace NULL 0. As adviced several plases
12144 we now use "0" instead of "NULL" in our code.
12146 * src/support/filetools.C (SpaceLess): use string::size_type as
12147 loop variable type.
12149 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12151 * src/paragraph.C: fixed up some more string stuff.
12153 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12155 * src/support/filetools.h: make modestr a std::string.
12157 * src/filetools.C (GetEnv): made ch really const.
12159 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12160 made code that used these use max/min from <algorithm> instead.
12162 * changed several c library include files to their equivalent c++
12163 library include files. All is not changed yet.
12165 * created a support subdir in src, put lyxstring and lstrings
12166 there + the extra files atexit, fileblock, strerror. Created
12167 Makefile.am. edited configure.in and src/Makefile.am to use this
12168 new subdir. More files moved to support.
12170 * imported som of the functions from repository lyx, filetools
12172 * ran tags-query-replace on LString -> string, corrected the bogus
12173 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12174 is still some errors in there. This is errors where too much or
12175 too litle get deleted from strings (string::erase, string::substr,
12176 string::replace), there can also be some off by one errors, or
12177 just plain wrong use of functions from lstrings. Viewing of quotes
12180 * LyX is now running fairly well with string, but there are
12181 certainly some bugs yet (see above) also string is quite different
12182 from LString among others in that it does not allow null pointers
12183 passed in and will abort if it gets any.
12185 * Added the revtex4 files I forgot when setting up the repository.
12187 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12189 * All over: Tried to clean everything up so that only the files
12190 that we really need are included in the cvs repository.
12191 * Switched to use automake.
12192 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12193 * Install has not been checked.
12195 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12197 * po/pt.po: Three errors:
12198 l.533 and l.538 format specification error
12199 l. 402 duplicate entry, I just deleted it.