1 2000-10-30 Rob Lahaye <lahaye@postech.edu>
5 2000-10-29 Marko Vendelin <markov@ioc.ee>
6 * src/frontends/gnome/FormCitation.C
7 * src/frontends/gnome/FormCitation.h
8 * src/frontends/gnome/FormCopyright.C
9 * src/frontends/gnome/FormCopyright.h
10 * src/frontends/gnome/FormError.C
11 * src/frontends/gnome/FormError.h
12 * src/frontends/gnome/FormIndex.C
13 * src/frontends/gnome/FormIndex.h
14 * src/frontends/gnome/FormPrint.C
15 * src/frontends/gnome/FormPrint.h
16 * src/frontends/gnome/FormRef.C
17 * src/frontends/gnome/FormRef.h
18 * src/frontends/gnome/FormToc.C
19 * src/frontends/gnome/FormToc.h
20 * src/frontends/gnome/FormUrl.C
21 * src/frontends/gnome/FormUrl.h
22 * src/frontends/gnome/Menubar_pimpl.C
23 * src/frontends/gnome/mainapp.C
24 * src/frontends/gnome/mainapp.h
25 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
26 changing update() to updateSlot() where appropriate
28 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
30 * src/frontends/xforms/FormPreferences.[Ch]:
31 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
34 2000-10-28 Juergen Vigna <jug@sad.it>
36 * src/insets/insettabular.C (draw): fixed drawing bug.
38 * src/insets/insettext.C (clear):
40 (SetParagraphData): clearing the TEXT buffers when deleting the
41 paragraphs used by it.
43 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
45 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
47 2000-10-27 Juergen Vigna <jug@sad.it>
49 * src/tabular.C (~LyXTabular): removed not needed anymore.
51 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
54 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
56 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
59 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
62 * src/frontends/xforms/FormPreferences.[Ch]:
63 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
64 Reorganised as modules based on tabs. Much easier to follow the
65 flow and to add new tabs. Added warning and feedback messages.
68 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
70 * src/tabular.h (DocBook): add std:: qualifier.
72 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
74 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
75 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
78 * insettabular.C (DocBook): uses the tabular methods to export
81 * src/insets/insettext.h
82 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
84 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
86 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
89 * src/lyxfunc.C (MenuNew): lessen the scope of fname
90 moved misplaced AllowInput two lines up.
92 * src/buffer.C (readFile): compare float with float, not with int
94 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
96 * src/minibuffer.C: add "using SigC::slot" statement.
98 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
100 * src/frontends/xforms/forms/README: updated section about make.
102 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
103 Tidied some forms up, made two of form_tabular's tabs more
104 self-consistent, fixed Jean-Marc's size problem in form_preferences,
105 fixed translation problem with "Column".
107 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
109 * src/minibuffer.h: use Timeout instead of the xforms timer
111 (setTimer) rewrite for the Timeout, change to unsigned arg
112 (set): change to unsigned timer arg
115 * src/minibuffer.C (TimerCB): removed func
116 (C_MiniBuffer_TimerCB): removed func
117 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
118 (peek_event): use a switch statement
119 (add): don't use fl_add_timer.
120 (Set): rewrite to use the Timeout
123 * src/Timeout.[Ch] (setType): return a Timeout &
124 (setTimeout): ditto, change to unsigned arg for timeout
126 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
128 * src/mathed/formula.C (mathed_string_width): Use string instead
129 of a constant size char array.
131 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
133 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
134 the two recently added operator<< for SMInput and State.
136 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
138 (OkCancelPolicy): ditto
139 (OkCancelReadOnlyPolicy): ditto
140 (NoRepeatedApplyReadOnlyPolicy): ditto
141 (OkApplyCancelReadOnlyPolicy): ditto
142 (OkApplyCancelPolicy): ditto
143 (NoRepeatedApplyPolicy): ditto
145 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
147 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
148 add the usual std:: qualifiers.
150 2000-10-25 Juergen Vigna <jug@sad.it>
152 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
154 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
156 * src/support/filetools.C (MakeRelPath): change some types to
159 * src/frontends/ButtonPolicies.h (operator<<): new operator for
160 ButtonPolicy::SMInput and ButtonPolicy::State.
162 * src/FontLoader.C (reset): small cleanup
163 (unload): small cleanup
165 * src/FontInfo.C (getFontname): initialize error to 10000.0
167 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
169 * src/frontends/xforms/FormPreferences.[Ch]:
170 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
171 TeX encoding and default paper size sections.
173 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
175 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
178 * src/frontends/xforms/FormError.C (disconnect): use erase() to
179 make the message_ empty.
180 (FormError): don't initialize message_ in initializer list.
182 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
184 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
186 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
188 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
190 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
192 * src/frontends/kde/*data.[Ch]: _("") is not
195 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
197 * src/buffer.C: removed redundant using directive.
199 * src/frontends/DialogBase.h: revert to original definition of
202 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
203 stuff into two classes, one for each dialog, requires a new
204 element in the dialogs vector, FormTabularCreate.
206 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
209 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
210 method. Continues Allan's idea, but means that derived classes
211 don't need to worry about "update or hide?".
213 * src/frontends/xforms/FormError.C (showInset): add connection
216 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
217 one for each dialog. FormTabular now contains main tabular dialog
220 * src/frontends/xforms/FormTabularCreate.[Ch]:
221 * src/frontends/xforms/forms/form_tabular_create.fd: the create
224 * src/frontends/xforms/FormGraphics.[Ch]:
225 * src/frontends/xforms/forms/form_graphics.fd
226 * src/frontends/xforms/FormTabular.[Ch]:
227 * src/frontends/xforms/forms/form_tabular.fd: made daughter
228 classes of FormInset.
230 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
231 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
233 * src/frontends/xforms/Makefile.am:
234 * src/frontends/xforms/forms/makefile: added new files.
236 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
237 variable. added Signal0 hide signal, in keeping with other GUI-I
240 * src/support/lstrings.h: removed redundant std:: qualifier as
241 it's already declared in Lsstream.h.
243 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
245 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
249 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
251 * src/tabular.C (Ascii): minimize scope of cell.
253 * src/BufferView2.C (nextWord): return string() instead of 0;
255 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
257 * src/converter.h: add a std:: qualifier
259 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
261 * src/importer.[Ch]: New files. Used for importing files into LyX.
263 * src/lyxfunc.C (doImport): Use the new Importer class.
265 * src/converter.h: Add shortcut member to the Format class.
266 Used for holding the menu shortcut.
268 * src/converter.C and other files: Made a distinction between
269 format name and format extension. New formats can be defined using
270 the \format lyxrc tag.
271 Added two new converter flags: latex and disable.
273 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
275 * src/support/lyxlib.h: unify namespace/struct implementation.
276 Remove extra declarations.
278 * src/support/chdir.C (chdir): remove version taking char const *
280 * src/support/rename.C: ditto.
281 * src/support/lyxsum.C: ditto.
283 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
285 * src/frontends/xforms/FormBase.[Ch]:
286 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
287 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
288 work only for the next call to fl_show_form(). The correct place to set
289 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
290 done. FormBase also stores minw_, minh_ itself. All dialogs derived
291 from FormBase have the minimum size set; no more stupid crashes with
294 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
296 * lib/ui/default.ui: fix shortcut for Insert->Include File.
298 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
300 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
302 * src/support/lyxlib.h: changed second argument of mkdir to
303 unsigned long int (unsigned int would probably have been enough,
304 but...). Removed <sys/types.h> header.
305 * src/support/mkdir.C (mkdir): ditto.
309 2000-10-19 Juergen Vigna <jug@sad.it>
311 * src/lyxfunc.C (MenuNew): small fix (form John)
313 * src/screen.C (Update): removed unneeded code.
315 * src/tabular.C (Ascii): refixed int != uint bug!
317 * src/support/lyxlib.h: added sys/types.h include for now permits
318 compiling, but I don't like this!
320 2000-10-18 Juergen Vigna <jug@sad.it>
322 * src/text2.C (ClearSelection): if we clear the selection we need
323 more refresh so set the status apropriately
325 * src/insets/insettext.C (draw): hopefully finally fixed draw
328 2000-10-12 Juergen Vigna <jug@sad.it>
330 * src/insets/insettext.C (draw): another small fix and make a block
331 so that variables are localized.
333 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
335 * src/support/lstrings.C (lowercase, uppercase):
336 use explicit casts to remove compiler warnings.
338 * src/support/LRegex.C (Impl):
339 * src/support/StrPool.C (add):
340 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
341 (AddPath, MakeDisplayPath):
342 * src/support/lstrings.C (prefixIs, subst):
343 use correct type to remove compiler warnings.
345 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
347 * src/support/lyxlib.h:
348 * src/support/mkdir.C (mkdir): change parameter to mode_t for
349 portability and to remove compiler warning with DEC cxx.
351 * src/support/FileInfo.[Ch] (flagRWX): ditto.
353 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
355 * src/minibuffer.C (peek_event): retun 1 when there has been a
356 mouseclick in the minibuffer.
360 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
362 * src/frontends/xforms/FormParagraph.C: more space above/below
365 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
367 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
368 a char only if real_current_font was changed.
370 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
372 * NEWS: update somewhat for 1.1.6
374 * lib/ui/default.ui: clean up.
376 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
378 * lib/CREDITS: clean up
380 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
382 * src/combox.[Ch] (select): changed argument back to int
383 * src/combox.C (peek_event): removed num_bytes as it is declared but
386 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
387 modified calls to Combox::select() to remove warnings about type
390 * src/insets/insetbutton.C (width): explicit cast to remove warning
391 about type conversion.
393 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
396 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
397 sel_pos_end, refering to cursor position are changed to
398 LyXParagraph::size_type.
400 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
401 consistent with LyXCursor::pos().
402 (inset_pos): changed to LyXParagraph::size_type for same reason.
404 * src/insets/insettext.C (resizeLyXText): changed some temporary
405 variables refing to cursor position to LyXParagraph::size_type.
407 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
409 * src/frontends/kde/<various>: The Great Renaming,
412 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
414 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
416 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
418 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
419 0 when there are no arguments.
421 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
423 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
424 to segfaults when pressing Ok in InsetBibtex dialog.
426 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
428 * forms/layout_forms.fd:
429 * src/layout_forms.C (create_form_form_character): small change to use
430 labelframe rather than engraved frame + text
432 * src/lyx_gui.C (create_forms): initialise choice_language with some
433 arbitrary value to prevent segfault when dialog is shown.
435 2000-10-16 Baruch Even <baruch.even@writeme.com>
437 * src/converter.C (runLaTeX, scanLog): Added a warning when there
438 is no resulting file. This pertains only to LaTeX output.
440 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
442 * src/text.C (Backspace): Make sure that the row of the cursor is
445 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
448 * src/lyx_gui.C (init): Prevent a crash when only one font from
449 menu/popup fonts is not found.
451 * lib/lyxrc.example: Add an example for binding a key for language
454 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
456 * src/converter.C (GetReachable): Changed the returned type to
458 (IsReachable): New method
460 * src/MenuBackend.C (expand): Handle formats that appear more
463 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
465 * src/frontends/support/Makefile.am
466 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
469 * lib/CREDITS: add Garst Reese.
471 * src/support/snprintf.h: add extern "C" {} around the definitions.
473 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
475 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
478 * src/frontends/xforms/FormDocument.C:
479 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
480 compile without "conversion to integral type of smaller size"
483 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
485 * src/text.C (GetColumnNearX): Fixed disabled code.
487 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
489 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
492 * src/support/snprintf.[ch]: new files
494 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
496 * src/frontends/kde/formprintdialog.C: add
497 file browser for selecting postscript output
499 * src/frontends/kde/formprintdialogdata.C:
500 * src/frontends/kde/formprintdialogdata.h: re-generate
503 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
505 * src/frontends/gnome/Makefile.am:
506 * src/frontends/kde/Makefile.am: FormCommand.C
507 disappeared from xforms
509 * src/frontends/kde/FormCitation.C:
510 * src/frontends/kde/FormIndex.C: read-only
513 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
515 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
518 * src/bufferlist.C: add using directive.
520 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
522 * src/support/lyxfunctional.h: version of class_fun for void
523 returns added, const versions of back_inseter_fun and compare_fun
526 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
528 * src/frontends/xforms/FormInset.C (showInset): fix typo.
530 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
532 * ChangeLog: cleanup.
534 * lib/CREDITS: update to add all the contributors we've forgotten.
535 I have obviously missed some, so tell me whether there were
538 2000-10-13 Marko Vendelin <markov@ioc.ee>
540 * src/frontends/gnome/FormCitation.C
541 * src/frontends/gnome/FormCitation.h
542 * src/frontends/gnome/FormError.C
543 * src/frontends/gnome/FormIndex.C
544 * src/frontends/gnome/FormRef.C
545 * src/frontends/gnome/FormRef.h
546 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
548 * src/frontends/gnome/FormCitation.C
549 * src/frontends/gnome/FormCopyright.C
550 * src/frontends/gnome/FormError.C
551 * src/frontends/gnome/FormIndex.C
552 * src/frontends/gnome/FormRef.C
553 * src/frontends/gnome/FormToc.C
554 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
557 * src/frontends/gnome/Menubar_pimpl.C
558 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
561 2000-10-11 Baruch Even <baruch.even@writeme.com>
564 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
565 to convey its real action.
567 * src/minibuffer.C (peek_event): Added action when mouse clicks to
568 clear the minibuffer and prepare to enter a command.
570 * src/mathed/formula.C (LocalDispatch): Changed to conform with
571 the rename from ExecCommand to PrepareForCommand.
572 * src/lyxfunc.C (Dispatch): ditto.
574 2000-10-11 Baruch Even <baruch.even@writeme.com>
576 * src/buffer.C (writeFile): Added test for errors on writing, this
577 catches all errors and not only file system full errors as intended.
579 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
581 * src/lyx_gui.C (create_forms): better fix for crash with
582 translated interface.
584 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
586 * src/frontends/kde/Makefile.am:
587 * src/frontends/kde/FormCopyright.C:
588 * src/frontends/kde/formcopyrightdialog.C:
589 * src/frontends/kde/formcopyrightdialog.h:
590 * src/frontends/kde/formcopyrightdialogdata.C:
591 * src/frontends/kde/formcopyrightdialogdata.h:
592 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
593 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
594 copyright to use qtarch
596 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
598 * src/encoding.C (read): Fixed bug that caused an error message at
601 * po/Makefile.in.in: Fixed rule for ext_l10n.h
603 * lib/lyxrc.example: Fixed hebrew example.
605 2000-10-13 Allan Rae <rae@lyx.org>
607 * src/frontends/xforms/FormPreferences.C (input): reworking the
609 (build, update, apply): New inputs in various tabfolders
611 * src/frontends/xforms/FormToc.C: use new button policy.
612 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
613 dialogs that either can't use any existing policy or where it just
616 * src/frontends/xforms/FormTabular.h: removed copyright notice that
619 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
620 added a bool parameter which is ignored.
622 * src/buffer.C (setReadonly):
623 * src/BufferView_pimpl.C (buffer):
624 * src/frontends/kde/FormCopyright.h (update):
625 * src/frontends/kde/FormCitation.[Ch] (update):
626 * src/frontends/kde/FormIndex.[Ch] (update):
627 * src/frontends/kde/FormPrint.[Ch] (update):
628 * src/frontends/kde/FormRef.[Ch] (update):
629 * src/frontends/kde/FormToc.[Ch] (update):
630 * src/frontends/kde/FormUrl.[Ch] (update):
631 * src/frontends/gnome/FormCopyright.h (update):
632 * src/frontends/gnome/FormCitation.[Ch] (update):
633 * src/frontends/gnome/FormError.[Ch] (update):
634 * src/frontends/gnome/FormIndex.[Ch] (update):
635 * src/frontends/gnome/FormPrint.[Ch] (update):
636 * src/frontends/gnome/FormRef.h (update):
637 * src/frontends/gnome/FormToc.[Ch] (update):
638 * src/frontends/gnome/FormUrl.[Ch] (update):
639 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
640 to updateBufferDependent and DialogBase
642 * src/frontends/xforms/FormCitation.[hC]:
643 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
644 * src/frontends/xforms/FormError.[Ch]:
645 * src/frontends/xforms/FormGraphics.[Ch]:
646 * src/frontends/xforms/FormIndex.[Ch]:
647 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
648 and fixed readOnly handling.
649 * src/frontends/xforms/FormPrint.[Ch]:
650 * src/frontends/xforms/FormRef.[Ch]:
651 * src/frontends/xforms/FormTabular.[Ch]:
652 * src/frontends/xforms/FormToc.[Ch]:
653 * src/frontends/xforms/FormUrl.[Ch]:
654 * src/frontends/xforms/FormInset.[Ch]:
655 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
656 form of updateBufferDependent.
658 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
659 if form()->visible just in case someone does stuff to the form in a
662 * src/frontends/DialogBase.h (enum): removed enum since we can now use
663 the buttoncontroller for everything the enum used to be used for.
664 (update) It would seem we need to force all dialogs to use a bool
665 parameter or have two update functions. I chose to go with one.
666 I did try removing update() from here and FormBase and defining the
667 appropriate update signatures in FormBaseB[DI] but then ran into the
668 problem of the update() call in FormBase::show(). Whatever I did
669 to get around that would require another function and that just
670 got more confusing. Hence the decision to make everyone have an
671 update(bool). An alternative might have been to override show() in
672 FormBaseB[DI] and that would allow the different and appropriate
675 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
676 true == buffer change occurred. I decided against using a default
677 template parameter since not all compilers support that at present.
679 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
681 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
682 army knife" by removing functionality.
683 (clearStore): removed. All such housekeeping on hide()ing the dialog
684 is to be carried out by overloaded disconnect() methods.
685 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
686 superceded by Baruch's neat test (FormGraphics) to update an existing
687 dialog if a new signal is recieved rather than block all new signals
689 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
690 only to Inset dialogs.
691 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
692 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
694 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
696 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
697 as a base class to all inset dialogs. Used solely to connect/disconnect
698 the Inset::hide signal and to define what action to take on receipt of
699 a UpdateBufferDependent signal.
700 (FormCommand): now derived from FormInset.
702 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
705 * src/frontends/xforms/FormCopyright.[Ch]:
706 * src/frontends/xforms/FormPreferences.[Ch]:
707 now derived from FormBaseBI.
709 * src/frontends/xforms/FormDocument.[Ch]:
710 * src/frontends/xforms/FormParagraph.[Ch]:
711 * src/frontends/xforms/FormPrint.[Ch]:
712 now derived from FormBaseBD.
714 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
716 * src/frontends/xforms/FormCitation.[Ch]:
717 * src/frontends/xforms/FormError.[Ch]:
718 * src/frontends/xforms/FormRef.[Ch]:
719 * src/frontends/xforms/FormToc.[Ch]:
720 (clearStore): reworked as disconnect().
722 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
725 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
727 * src/converter.C (runLaTeX): constify buffer argument
730 * src/frontends/support/Makefile.am (INCLUDES): fix.
732 * src/buffer.h: add std:: qualifier
733 * src/insets/figinset.C (addpidwait): ditto
734 * src/MenuBackend.C: ditto
735 * src/buffer.C: ditto
736 * src/bufferlist.C: ditto
737 * src/layout.C: ditto
738 * src/lyxfunc.C: ditto
740 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
742 * src/lyxtext.h (bidi_level): change return type to
743 LyXParagraph::size_type.
745 * src/lyxparagraph.h: change size_type to
746 TextContainer::difference_type. This should really be
747 TextContainer::size_type, but we need currently to support signed
750 2000-10-11 Marko Vendelin <markov@ioc.ee>
751 * src/frontends/gnome/FormError.h
752 * src/frontends/gnome/FormRef.C
753 * src/frontends/gnome/FormRef.h
754 * src/frontends/gnome/FormError.C
755 * src/frontends/gnome/Makefile.am
756 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
757 to Gnome frontend. Both dialogs use "action" area.
759 2000-10-12 Baruch Even <baruch.even@writeme.com>
761 * src/graphics/GraphicsCacheItem_pimpl.C:
762 * src/graphics/Renderer.C:
763 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
766 2000-10-12 Juergen Vigna <jug@sad.it>
768 * src/insets/insettext.C (draw): fixed drawing bug (specifically
769 visible when selecting).
771 * development/Code_rules/Rules: fixed some typos.
773 2000-10-09 Baruch Even <baruch.even@writeme.com>
775 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
776 compiling on egcs 1.1.2 possible.
778 * src/filedlg.C (comp_direntry::operator() ): ditto.
780 2000-08-31 Baruch Even <baruch.even@writeme.com>
782 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
785 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
786 transient it now only gets freed when the object is destructed.
788 2000-08-24 Baruch Even <baruch.even@writeme.com>
790 * src/frontends/FormGraphics.h:
791 * src/frontends/FormGraphics.C: Changed to use ButtonController and
794 2000-08-20 Baruch Even <baruch.even@writeme.com>
796 * src/insets/insetgraphics.C:
797 (draw): Added messages to the drawn rectangle to report status.
798 (updateInset): Disabled the use of the inline graphics,
801 2000-08-17 Baruch Even <baruch.even@writeme.com>
803 * src/frontends/support: Directory added for the support of GUII LyX.
805 * src/frontends/support/LyXImage.h:
806 * src/frontends/support/LyXImage.C: Base class for GUII holding of
809 * src/frontends/support/LyXImage_X.h:
810 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
811 version of LyXImage, this uses the Xlib Pixmap.
816 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
817 replacement to Pixmap.
819 * src/insets/insetgraphics.h:
820 * src/insets/insetgraphics.C:
821 * src/graphics/GraphicsCacheItem.h:
822 * src/graphics/GraphicsCacheItem.C:
823 * src/graphics/GraphicsCacheItem_pimpl.h:
824 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
827 * src/graphics/GraphicsCacheItem.h:
828 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
829 another copy of the object.
831 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
832 of cacheHandle, this fixed a bug that sent LyX crashing.
834 * src/graphics/XPM_Renderer.h:
835 * src/graphics/XPM_Renderer.C:
836 * src/graphics/EPS_Renderer.h:
837 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
839 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
841 * src/lyxfunc.C (processKeySym): only handle the
842 lockinginset/inset stuff if we have a buffer and text loaded...
844 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
846 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
848 * src/support/lyxfunctional.h: add operator= that takes a reference
850 * src/lyxserver.C (mkfifo): make first arg const
852 * src/layout.h: renamed name(...) to setName(...) to work around
855 * src/buffer.C (setFileName): had to change name of function to
856 work around bugs in egcs. (renamed from fileName)
858 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
860 * src/support/translator.h: move helper template classes to
861 lyxfunctional.h, include "support/lyxfunctional.h"
863 * src/support/lyxmanip.h: add delaration of fmt
865 * src/support/lyxfunctional.h: new file
866 (class_fun_t): new template class
867 (class_fun): helper template function
868 (back_insert_fun_iterator): new template class
869 (back_inserter_fun): helper template function
870 (compare_memfun_t): new template class
871 (compare_memfun): helper template function
872 (equal_1st_in_pair): moved here from translator
873 (equal_2nd_in_pair): moved here from translator
875 * src/support/fmt.C: new file
876 (fmt): new func, can be used for a printf substitute when still
877 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
879 * src/support/StrPool.C: add some comments
881 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
884 * src/insets/figinset.C (addpidwait): use std::copy with
885 ostream_iterator to fill the pidwaitlist
887 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
889 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
892 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
895 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
897 * src/frontends/xforms/FormDocument.C (build): remove c_str()
898 (class_update): ditto
900 (CheckChoiceClass): move initialization of tc and tct
902 * src/tabular.C: remove current_view
903 (OldFormatRead): similar to right below [istream::ignore]
905 * src/lyxlex_pimpl.C (next): add code for faster skipping of
906 chars, unfortunately this is buggy on gcc 2.95.2, so currently
907 unused [istream::ignore]
909 * src/lyxfunc.C: include "support/lyxfunctional.h"
910 (getInsetByCode): use std::find_if and compare_memfun
912 * src/lyxfont.C (stateText): remove c_str()
914 * src/lyx_main.C (setDebuggingLevel): make static
915 (commandLineHelp): make static
917 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
918 Screen* together with fl_get_display() and fl_screen
920 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
921 togheter with fl_get_display() and fl_screen
922 (create_forms): remove c_str()
924 * src/layout.C: include "support/lyxfunctional.h"
925 (hasLayout): use std::find_if and compare_memfun
926 (GetLayout): use std::find_if and comapre_memfun
927 (delete_layout): use std::remove_if and compare_memfun
928 (NumberOfClass): use std:.find_if and compare_memfun
930 * src/gettext.h: change for the new functions
932 * src/gettext.C: new file, make _(char const * str) and _(string
933 const & str) real functions.
935 * src/font.C (width): rewrite slightly to avoid one extra variable
937 * src/debug.C: initialize Debug::ANY here
939 * src/commandtags.h: update number comments
941 * src/combox.h (get): make const func
943 (getline): make const
945 * src/combox.C (input_cb): handle case where fl_get_input can
948 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
949 "support/lyxfunctional.h", remove current_view variable.
950 (resize): use std::for_each with std::mem_fun
951 (getFileNames): use std::copy with back_inserter_fun
952 (getBuffer): change arg type to unsigned int
953 (emergencyWriteAll): call emergencyWrite with std::for_each and
955 (emergencyWrite): new method, the for loop in emergencyWriteAll
957 (exists): use std::find_if with compare_memfun
958 (getBuffer): use std::find_if and compare_memfun
960 * src/buffer.h: add typedefs for iterator_category, value_type
961 difference_type, pointer and reference for inset_iterator
962 add postfix ++ for inset_iterator
963 make inset_iterator::getPos() const
965 * src/buffer.C: added support/lyxmanip.h
966 (readFile): use lyxerr << fmt instead of printf
967 (makeLaTeXFile): use std::copy to write out encodings
969 * src/Painter.C (text): rewrite slightly to avoid extra font variable
971 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
972 free and the char * temp.
973 (hasMenu): use std::find_if and compare_memfun
976 * src/Makefile.am (lyx_SOURCES): added gettext.C
978 * src/LyXAction.C (retrieveActionArg): clear the arg, use
979 string::insert small change to avoid temporary
981 * src/LColor.C (getGUIName): remove c_str()
983 * several files: change all occurrences of fl_display to
986 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
987 that -pedantic is not used for gcc 2.97 (cvs gcc)
989 * boost/Makefile.am: begin slowly to prepare for a real boost lib
991 2000-10-11 Allan Rae <rae@lyx.org>
993 * src/frontends/xforms/FormPreferences.C (input): template path must be
994 a readable directory. It doesn't need to be writeable.
995 (build, delete, update, apply): New inputs in the various tabfolders
997 * src/frontends/xforms/forms/form_preferences.fd:
998 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
999 several new entries to existing folders. Shuffled some existing stuff
1002 * src/frontends/xforms/forms/form_print.fd:
1003 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1004 Should probably rework PrinterParams as well. Note that the switch to
1005 collated is effectively the same as !unsorted so changing PrinterParams
1006 will require a lot of fiddly changes to reverse the existing logic.
1008 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1010 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1012 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1014 2000-10-10 Allan Rae <rae@lyx.org>
1017 * src/lyxfunc.C (Dispatch):
1019 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1022 * src/lyxrc.C (output): Only write the differences between system lyxrc
1023 and the users settings.
1026 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1028 I'll rewrite this later, after 1.1.6 probably, to keep a single
1029 LyXRC but two instances of a LyXRCStruct.
1031 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1033 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1035 * src/tabular.h: add a few std:: qualifiers.
1037 * src/encoding.C: add using directive.
1038 * src/language.C: ditto.
1040 * src/insets/insetquotes.C (Validate): use languages->lang()
1041 instead of only language.
1043 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1045 * lib/languages: New file.
1047 * lib/encodings: New file.
1049 * src/language.C (Languages): New class.
1050 (read): New method. Reads the languages from the 'languages' file.
1052 * src/encoding.C (Encodings): New class.
1053 (read): New method. Reads the encodings from the 'encodings' file.
1055 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1058 * src/bufferparams.h and a lot of files: Deleted the member language,
1059 and renamed language_info to language
1061 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1062 * src/lyxfont.C (latexWriteStartChanges): ditto.
1063 * src/paragraph.C (validate,TeXOnePar): ditto.
1065 * src/lyxfont.C (update): Restored deleted code.
1067 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1069 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1071 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1073 * src/insets/figinset.[Ch]:
1074 * src/insets/insetinclude.[Ch]:
1075 * src/insets/insetinclude.[Ch]:
1076 * src/insets/insetparent.[Ch]:
1077 * src/insets/insetref.[Ch]:
1078 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1080 * src/insets/*.[Ch]:
1081 * src/mathed/formula.[Ch]:
1082 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1084 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1085 * src/lyx_cb.C (FigureApplyCB):
1086 * src/lyxfunc.C (getStatus, Dispatch):
1087 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1090 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1092 * src/converter.[Ch] (Formats::View):
1093 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1095 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1096 *current_view->buffer(). This will change later, but this patch is way
1099 2000-10-09 Juergen Vigna <jug@sad.it>
1101 * src/text.C (GetRow): small fix.
1103 * src/BufferView_pimpl.C (cursorPrevious):
1104 (cursorNext): added LyXText parameter to function.
1106 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1107 keypress depending on cursor position.
1109 2000-10-06 Juergen Vigna <jug@sad.it>
1111 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1112 (copySelection): redone this function and also copy ascii representa-
1115 * src/tabular.C (Ascii):
1119 (print_n_chars): new functions to realize the ascii export of tabulars.
1121 2000-10-05 Juergen Vigna <jug@sad.it>
1123 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1124 if we don't have a buffer.
1126 2000-10-10 Allan Rae <rae@lyx.org>
1128 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1129 with closing dialog. It seems that nested tabfolders require hiding
1130 of inner tabfolders before hiding the dialog itself. Actually all I
1131 did was hide the active outer folder.
1133 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1134 unless there really is a buffer. hideBufferDependent is called
1137 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1138 POTFILES.in stays in $(srcdir).
1140 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1142 * lib/lyxrc.example: Few changes.
1144 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1146 * src/BufferView_pimpl.C (buffer): only need one the
1147 updateBufferDependent signal to be emitted once! Moved to the end of
1148 the method to allow bv_->text to be updated first.
1150 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1151 and hSignal_ with Dialogs * and BufferDependency variables.
1152 New Buffer * parent_, initialised when the dialog is launched. Used to
1153 check whether to update() or hide() dialog in the new, private
1154 updateOrHide() method that is connected to the updateBufferDependent
1155 signal. Daughter classes dictate what to do using the
1156 ChangedBufferAction enum, passed to the c-tor.
1158 * src/frontends/xforms/FormCitation.C:
1159 * src/frontends/xforms/FormCommand.C:
1160 * src/frontends/xforms/FormCopyright.C:
1161 * src/frontends/xforms/FormDocument.C:
1162 * src/frontends/xforms/FormError.C:
1163 * src/frontends/xforms/FormIndex.C:
1164 * src/frontends/xforms/FormPreferences.C:
1165 * src/frontends/xforms/FormPrint.C:
1166 * src/frontends/xforms/FormRef.C:
1167 * src/frontends/xforms/FormToc.C:
1168 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1171 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1172 ChangedBufferAction enum.
1174 * src/frontends/xforms/FormParagraph.[Ch]
1175 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1178 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1180 * lib/bind/cua.bind: fix a bit.
1181 * lib/bind/emacs.bind: ditto.
1183 * lib/bind/menus.bind: remove real menu entries from there.
1185 * src/spellchecker.C: make sure we only include strings.h when
1188 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1190 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1191 function. It enlarges the maximum number of pup when needed.
1192 (add_toc2): Open a new menu if maximum number of items per menu has
1195 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1197 * src/frontends/kde/FormPrint.C: fix error reporting
1199 * src/frontends/xforms/FormDocument.C: fix compiler
1202 * lib/.cvsignore: add Literate.nw
1204 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1207 * bufferview_funcs.[Ch]
1210 * text2.C: Add support for numbers in RTL text.
1212 2000-10-06 Allan Rae <rae@lyx.org>
1214 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1215 to be gettext.m4 friendly again. ext_l10n.h is now
1216 generated into $top_srcdir instead of $top_builddir
1217 so that lyx.pot will be built correctly -- without
1218 duplicate parsing of ext_l10n.h.
1220 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1222 * src/frontends/kde/FormCitation.C: make the dialog
1223 behave more sensibly
1225 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1227 * config/kde.m4: fix consecutive ./configure runs,
1228 look for qtarch, fix library order
1230 * src/frontends/kde/Makefile.am: tidy up,
1231 add Print dialog, add .dlg dependencies
1233 * src/frontends/kde/FormPrint.C:
1234 * src/frontends/kde/FormPrint.h:
1235 * src/frontends/kde/formprintdialog.C:
1236 * src/frontends/kde/formprintdialog.h:
1237 * src/frontends/kde/formprintdialogdata.C:
1238 * src/frontends/kde/formprintdialogdata.h:
1239 * src/frontends/kde/dlg/formprintdialog.dlg: add
1242 * src/frontends/kde/dlg/README: Added explanatory readme
1244 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1245 script to double-check qtarch's output
1247 * src/frontends/kde/formindexdialog.C:
1248 * src/frontends/kde/formindexdialogdata.C:
1249 * src/frontends/kde/formindexdialogdata.h:
1250 * src/frontends/kde/dlg/formindexdialog.dlg: update
1251 for qtarch, minor fixes
1253 2000-10-05 Allan Rae <rae@lyx.org>
1255 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1256 dialogs when switching buffers update them instead. It's up to each
1257 dialog to decide if it should still be visible or not.
1258 update() should return a bool to control visiblity within show().
1259 Or perhaps better to set a member variable and use that to control
1262 * lib/build-listerrors: create an empty "listerrors" file just to stop
1263 make trying to regenerate it all the time if you don't have noweb
1266 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1268 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1269 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1270 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1271 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1272 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1274 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1276 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1278 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1279 deleting buffer. Closes all buffer-dependent dialogs.
1281 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1283 * src/frontends/xforms/FormCitation.[Ch]:
1284 * src/frontends/xforms/FormPreferences.[Ch]:
1285 * src/frontends/xforms/FormPrint.[Ch]:
1286 * src/frontends/xforms/FormRef.[Ch]:
1287 * src/frontends/xforms/FormUrl.[Ch]: ditto
1289 * src/frontends/xforms/FormDocument.[Ch]:
1290 * src/frontends/xforms/forms/form_document.C.patch:
1291 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1292 pass through a single input() function.
1294 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1296 * lib/build-listerrors: return status as OK
1298 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1300 * lib/lyxrc.example: Updated to new export code
1302 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1304 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1307 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1310 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1311 LyX-Code is defined.
1312 * lib/layouts/amsbook.layout: ditto.
1314 * boost/Makefile.am: fix typo.
1316 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1318 (add_lastfiles): removed.
1319 (add_documents): removed.
1320 (add_formats): removed.
1322 * src/frontends/Menubar.C: remove useless "using" directive.
1324 * src/MenuBackend.h: add a new MenuItem constructor.
1326 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1329 2000-10-04 Allan Rae <rae@lyx.org>
1331 * lib/Makefile.am (listerrors):
1332 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1333 I haven't got notangle installed so Kayvan please test. The output
1334 should end up in $builddir. This also allows people who don't have
1335 noweb installed to complete the make process without error.
1337 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1338 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1339 by JMarc's picky compiler.
1341 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1344 * src/insets/insettabular.C (setPos): change for loop to not use
1345 sequencing operator. Please check this Jürgen.
1347 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1349 * src/insets/insetcite.C (getScreenLabel): ditto
1350 * src/support/filetools.C (QuoteName): ditto
1351 (ChangeExtension): ditto
1353 * src/BufferView_pimpl.C (scrollCB): make heigt int
1355 * src/BufferView2.C (insertInset): comment out unused arg
1357 * boost/Makefile.am (EXTRADIST): new variable
1359 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1361 * src/exporter.C (IsExportable): Fixed
1363 * lib/configure.m4: Small fix
1365 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1367 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1368 * src/insets/insetbib.C (bibitemWidest): ditto.
1369 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1371 2000-10-03 Juergen Vigna <jug@sad.it>
1373 * src/BufferView2.C (theLockingInset): removed const because of
1374 Agnus's compile problems.
1376 * src/insets/insettext.C (LocalDispatch): set the language of the
1377 surronding paragraph on inserting the first character.
1379 * various files: changed use of BufferView::the_locking_inset.
1381 * src/BufferView2.C (theLockingInset):
1382 (theLockingInset): new functions.
1384 * src/BufferView.h: removed the_locking_inset.
1386 * src/lyxtext.h: added the_locking_inset
1388 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1390 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1392 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1394 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1395 * src/mathed/math_cursor.C (IsAlpha): ditto.
1396 * src/mathed/math_inset.C (strnew): ditto.
1397 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1398 (IMetrics): cxp set but never used; removed.
1399 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1400 that the variable in question has been removed also!
1403 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1404 using the Buffer * passed to Latex(), using the BufferView * passed to
1405 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1407 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1408 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1410 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1411 * src/buffer.C (readInset): used new InsetBibtex c-tor
1412 * (getBibkeyList): used new InsetBibtex::getKeys
1414 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1417 * lib/build-listerrors
1419 * src/exporter.C: Add literate programming support to the export code
1422 * src/lyx_cb.C: Remove old literate code.
1424 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1427 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1428 * src/converter.C (View, Convert): Use QuoteName.
1430 * src/insets/figinset.C (Preview): Use Formats::View.
1432 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1434 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1436 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1437 the top of the function, because compaq cxx complains that the
1438 "goto exit_with_message" when the function is disabled bypasses
1440 (MenuNew): try a better fix for the generation of new file names.
1441 This time, I used AddName() instead of AddPath(), hoping Juergen
1444 2000-10-03 Allan Rae <rae@lyx.org>
1446 * src/frontends/xforms/forms/form_preferences.fd:
1447 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1448 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1449 "Look and Feel"->"General" but will need to be split up further into
1450 general output and general input tabs. Current plan is for four outer
1451 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1452 stuff; "Inputs" for input and import configuration; "Outputs" for
1453 output and export configuration; and one more whatever is left over
1454 called "General". The leftovers at present look like being which
1455 viewers to use, spellchecker, language support and might be better
1456 named "Support". I've put "Paths" in "Inputs" for the moment as this
1457 seems reasonable for now at least.
1458 One problem remains: X error kills LyX when you close Preferences.
1460 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1462 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1463 qualifier from form()
1464 * src/frontends/xforms/FormCitation.[Ch]:
1465 * src/frontends/xforms/FormCopyright.[Ch]:
1466 * src/frontends/xforms/FormDocument.[Ch]:
1467 * src/frontends/xforms/FormError.[Ch]:
1468 * src/frontends/xforms/FormIndex.[Ch]:
1469 * src/frontends/xforms/FormPreferences.[Ch]:
1470 * src/frontends/xforms/FormPrint.[Ch]:
1471 * src/frontends/xforms/FormRef.[Ch]:
1472 * src/frontends/xforms/FormToc.[Ch]:
1473 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1475 * src/frontends/xforms/FormCitation.[Ch]:
1476 * src/frontends/xforms/FormIndex.[Ch]:
1477 * src/frontends/xforms/FormRef.[Ch]:
1478 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1479 with Allan's naming policy
1481 * src/frontends/xforms/FormCitation.C: some static casts to remove
1484 2000-10-02 Juergen Vigna <jug@sad.it>
1486 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1487 now you can type or do stuff inside the table-cell also when in dummy
1488 position, fixed visible cursor.
1490 * src/insets/insettext.C (Edit): fixing cursor-view position.
1492 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1493 be used for equal functions in lyxfunc and insettext.
1495 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1497 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1499 * src/frontends/gnome/FormCitation.h:
1500 * src/frontends/gnome/FormCopyright.h:
1501 * src/frontends/gnome/FormIndex.h:
1502 * src/frontends/gnome/FormPrint.h:
1503 * src/frontends/gnome/FormToc.h:
1504 * src/frontends/gnome/FormUrl.h:
1505 * src/frontends/kde/FormCitation.h:
1506 * src/frontends/kde/FormCopyright.h:
1507 * src/frontends/kde/FormIndex.h:
1508 * src/frontends/kde/FormRef.h:
1509 * src/frontends/kde/FormToc.h:
1510 * src/frontends/kde/FormUrl.h: fix remaining users of
1513 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1515 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1516 from depth argument.
1517 (DocBookHandleCaption): ditto.
1518 (DocBookHandleFootnote): ditto.
1519 (SimpleDocBookOnePar): ditto.
1521 * src/frontends/xforms/FormDocument.h (form): remove extra
1522 FormDocument:: qualifier.
1524 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1526 * sigc++/handle.h: ditto.
1528 * src/lyx_gui_misc.C: add "using" directive.
1530 * src/cheaders/cstddef: new file, needed by the boost library (for
1533 2000-10-02 Juergen Vigna <jug@sad.it>
1535 * src/insets/insettext.C (SetFont): better support.
1537 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1539 * src/screen.C (DrawOneRow): some uint refixes!
1541 2000-10-02 Allan Rae <rae@lyx.org>
1543 * boost/.cvsignore: ignore Makefile as well
1545 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1546 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1548 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1549 Left this one out by accident.
1551 * src/frontends/xforms/FormBase.h (restore): default to calling
1552 update() since that will restore the original/currently-applied values.
1553 Any input() triggered error messages will require the derived classes
1554 to redefine restore().
1556 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1557 avoid a segfault. combo_doc_class is the main concern.
1559 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1561 * Simplify build-listerrors in view of GUI-less export ability!
1563 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1565 * src/lyx_main.C (easyParse): Disable gui when exporting
1567 * src/insets/figinset.C:
1570 * src/lyx_gui_misc.C
1571 * src/tabular.C: Changes to allow no-gui.
1573 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1575 * src/support/utility.hpp: removed file
1576 * src/support/block.h: removed file
1578 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1581 * src/mathed/formula.C: add support/lyxlib.h
1582 * src/mathed/formulamacro.C: ditto
1584 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1585 * src/lyxparagraph.h: ditto
1587 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1588 * src/frontends/Makefile.am (INCLUDES): ditto
1589 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1590 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1591 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1592 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1593 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1594 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1596 * src/BufferView.h: use boost/utility.hpp
1597 * src/LColor.h: ditto
1598 * src/LaTeX.h: ditto
1599 * src/LyXAction.h: ditto
1600 * src/LyXView.h: ditto
1601 * src/bufferlist.h: ditto
1602 * src/lastfiles.h: ditto
1603 * src/layout.h: ditto
1604 * src/lyx_gui.h: ditto
1605 * src/lyx_main.h: ditto
1606 * src/lyxlex.h: ditto
1607 * src/lyxrc.h: ditto
1608 * src/frontends/ButtonPolicies.h: ditto
1609 * src/frontends/Dialogs.h: ditto
1610 * src/frontends/xforms/FormBase.h: ditto
1611 * src/frontends/xforms/FormGraphics.h: ditto
1612 * src/frontends/xforms/FormParagraph.h: ditto
1613 * src/frontends/xforms/FormTabular.h: ditto
1614 * src/graphics/GraphicsCache.h: ditto
1615 * src/graphics/Renderer.h: ditto
1616 * src/insets/ExternalTemplate.h: ditto
1617 * src/insets/insetcommand.h: ditto
1618 * src/support/path.h: ditto
1620 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1621 and introduce clause for 2.97.
1623 * boost/libs/README: new file
1625 * boost/boost/utility.hpp: new file
1627 * boost/boost/config.hpp: new file
1629 * boost/boost/array.hpp: new file
1631 * boost/Makefile.am: new file
1633 * boost/.cvsignore: new file
1635 * configure.in (AC_OUTPUT): add boost/Makefile
1637 * Makefile.am (SUBDIRS): add boost
1639 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1641 * src/support/lstrings.C (suffixIs): Fixed.
1643 2000-10-01 Allan Rae <rae@lyx.org>
1645 * src/PrinterParams.h: moved things around to avoid the "can't
1646 inline call" warning.
1648 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1649 into doc++ documentation.
1651 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1653 * src/frontends/xforms/FormRef.C: make use of button controller
1654 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1655 cleaned up button controller usage.
1656 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1657 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1658 use the button controller
1660 * src/frontends/xforms/forms/*.fd: and associated generated files
1661 updated to reflect changes to FormBase. Some other FormXxxx files
1662 also got minor updates to reflect changes to FormBase.
1664 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1665 (hide): made virtual.
1666 (input): return a bool. true == valid input
1667 (RestoreCB, restore): new
1668 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1669 Changes to allow derived dialogs to use a ButtonController and
1670 make sense when doing so: OK button calls ok() and so on.
1672 * src/frontends/xforms/ButtonController.h (class ButtonController):
1673 Switch from template implementation to taking Policy parameter.
1674 Allows FormBase to provide a ButtonController for any dialog.
1676 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1677 Probably should rename connect and disconnect.
1678 (apply): use the radio button groups
1679 (form): needed by FormBase
1680 (build): setup the radio button groups
1682 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1684 * several files: type changes to reduce the number of warnings and
1685 to unify type hangling a bit. Still much to do.
1687 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1689 * lib/images/*: rename a bunch of icons to match Dekel converter
1692 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1695 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1697 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1699 * sigc++/handle.h: ditto for class Handle.
1701 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1703 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1705 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1707 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1708 removal of the "default" language.
1710 * src/combox.h (getline): Check that sel > 0
1712 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1714 * lib/examples/docbook_example.lyx
1715 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1717 * lib/layouts/docbook-book.layout: new docbook book layout.
1719 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1721 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1723 * src/insets/figinset.C (DocBook):fixed small typo.
1725 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1727 * src/insets/insetinclude.h: string include_label doesn't need to be
1730 2000-09-29 Allan Rae <rae@lyx.org>
1732 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1733 Allow derived type to control connection and disconnection from signals
1734 of its choice if desired.
1736 2000-09-28 Juergen Vigna <jug@sad.it>
1738 * src/insets/insettabular.C (update): fixed cursor setting when
1739 the_locking_inset changed.
1740 (draw): made this a bit cleaner.
1741 (InsetButtonPress): fixed!
1743 * various files: added LyXText Parameter to fitCursor call.
1745 * src/BufferView.C (fitCursor): added LyXText parameter.
1747 * src/insets/insettabular.C (draw): small draw fix.
1749 * src/tabular.C: right setting of left/right celllines.
1751 * src/tabular.[Ch]: fixed various types in funcions and structures.
1752 * src/insets/insettabular.C: ditto
1753 * src/frontends/xforms/FormTabular.C: ditto
1755 2000-09-28 Allan Rae <rae@lyx.org>
1757 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1758 that the #ifdef's had been applied to part of what should have been
1759 a complete condition. It's possible there are other tests that
1760 were specific to tables that are also wrong now that InsetTabular is
1761 being used. Now we need to fix the output of '\n' after a table in a
1762 float for the same reason as the original condition:
1763 "don't insert this if we would be adding it before or after a table
1764 in a float. This little trick is needed in order to allow use of
1765 tables in \subfigures or \subtables."
1766 Juergen can you check this?
1768 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1770 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1771 output to the ostream.
1773 * several files: fixed types based on warnings from cxx
1775 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1777 * src/frontends/kde/Makefile.am: fix rule for
1778 formindexdialogdata_moc.C
1780 * src/.cvsignore: add ext_l10n.h to ignore
1782 * acconfig.h: stop messing with __STRICT_ANSI__
1783 * config/gnome.m4: remove option to set -ansi
1784 * config/kde.m4: remove option to set -ansi
1785 * config/lyxinclude.m4: don't set -ansi
1787 2000-09-27 Juergen Vigna <jug@sad.it>
1789 * various files: remove "default" language check.
1791 * src/insets/insetquotes.C: removed use of current_view.
1793 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1794 the one should have red ears by now!
1796 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1797 in more then one paragraph. Fixed cursor-movement/selection.
1799 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1800 paragraphs inside a text inset.
1802 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1803 text-inset if this owner is an inset.
1805 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1807 * src/Bullet.h: changed type of font, character and size to int
1809 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1811 * src/insets/inseturl.[Ch]:
1812 * src/insets/insetref.[Ch]:
1813 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1815 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1817 * src/buffer.C (readFile): block-if statement rearranged to minimise
1818 bloat. Patch does not reverse Jean-Marc's change ;-)
1820 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1821 Class rewritten to store pointers to hide/update signals directly,
1822 rather than Dialogs *. Also defined an enum to ease use. All xforms
1823 forms can now be derived from this class.
1825 * src/frontends/xforms/FormCommand.[Ch]
1826 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1828 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1831 * src/frontends/xforms/forms/form_citation.fd
1832 * src/frontends/xforms/forms/form_copyright.fd
1833 * src/frontends/xforms/forms/form_error.fd
1834 * src/frontends/xforms/forms/form_index.fd
1835 * src/frontends/xforms/forms/form_ref.fd
1836 * src/frontends/xforms/forms/form_toc.fd
1837 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1839 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1841 * src/insets/insetfoot.C: removed redundent using directive.
1843 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1845 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1846 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1848 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1849 created in the constructors in different groups. Then set() just
1850 have to show the groups as needed. This fixes the redraw problems
1851 (and is how the old menu code worked).
1853 * src/support/lyxlib.h: declare the methods as static when we do
1854 not have namespaces.
1856 2000-09-26 Juergen Vigna <jug@sad.it>
1858 * src/buffer.C (asciiParagraph): new function.
1859 (writeFileAscii): new function with parameter ostream.
1860 (writeFileAscii): use now asciiParagraph.
1862 * various inset files: added the linelen parameter to the Ascii-func.
1864 * src/tabular.C (Write): fixed error in writing file introduced by
1865 the last changes from Lars.
1867 * lib/bind/menus.bind: removed not supported functions.
1869 * src/insets/insettext.C (Ascii): implemented this function.
1871 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1873 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1874 (Write): use of the write_attribute functions.
1876 * src/bufferlist.C (close): fixed reasking question!
1878 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1880 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1881 new files use the everwhere possible.
1884 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1885 src/log_form.C src/lyx.C:
1888 * src/buffer.C (runLaTeX): remove func
1890 * src/PaperLayout.C: removed file
1891 * src/ParagraphExtra.C: likewise
1892 * src/bullet_forms.C: likewise
1893 * src/bullet_forms.h: likewise
1894 * src/bullet_forms_cb.C: likewise
1896 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1897 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1900 * several files: remove all traces of the old fd_form_paragraph,
1901 and functions belonging to that.
1903 * several files: remove all traces of the old fd_form_document,
1904 and functions belonging to that.
1906 * several files: constify local variables were possible.
1908 * several files: remove all code that was dead when NEW_EXPORT was
1911 * several files: removed string::c_str in as many places as
1914 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1915 (e): be a bit more outspoken when patching
1916 (updatesrc): only move files if changed.
1918 * forms/layout_forms.h.patch: regenerated
1920 * forms/layout_forms.fd: remove form_document and form_paragraph
1921 and form_quotes and form_paper and form_table_options and
1922 form_paragraph_extra
1924 * forms/form1.fd: remove form_table
1926 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1927 the fdui->... rewrite. Update some comments to xforms 0.88
1929 * forms/bullet_forms.C.patch: removed file
1930 * forms/bullet_forms.fd: likewise
1931 * forms/bullet_forms.h.patch: likewise
1933 * development/Code_rules/Rules: added a section on switch
1934 statements. Updated some comment to xforms 0.88.
1936 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1938 * src/buffer.C (readFile): make sure that the whole version number
1939 is read after \lyxformat (even when it contains a comma)
1941 * lib/ui/default.ui: change shortcut of math menu to M-a.
1943 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1945 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1948 * src/LyXView.C (updateWindowTitle): show the full files name in
1949 window title, limited to 30 characters.
1951 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1952 When a number of characters has been given, we should not assume
1953 that the string is 0-terminated.
1955 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1956 calls (fixes some memory leaks)
1958 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1959 trans member on exit.
1961 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1963 * src/converter.C (GetReachable): fix typo.
1965 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1966 understand ',' instead of '.'.
1967 (GetInteger): rewrite to use strToInt().
1969 2000-09-26 Juergen Vigna <jug@sad.it>
1971 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1972 better visibility and error-message on wrong VSpace input.
1974 * src/language.C (initL): added english again.
1976 2000-09-25 Juergen Vigna <jug@sad.it>
1978 * src/frontends/kde/Dialogs.C (Dialogs):
1979 * src/frontends/gnome/Dialogs.C (Dialogs):
1980 * src/frontends/kde/Makefile.am:
1981 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1983 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1985 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1987 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1989 * src/frontends/xforms/FormParagraph.C:
1990 * src/frontends/xforms/FormParagraph.h:
1991 * src/frontends/xforms/form_paragraph.C:
1992 * src/frontends/xforms/form_paragraph.h:
1993 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1996 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1998 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1999 Paragraph-Data after use.
2001 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2002 non breakable paragraphs.
2004 2000-09-25 Garst R. Reese <reese@isn.net>
2006 * src/language.C (initL): added missing language_country codes.
2008 2000-09-25 Juergen Vigna <jug@sad.it>
2010 * src/insets/insettext.C (InsetText):
2011 (deleteLyXText): remove the not released LyXText structure!
2013 2000-09-24 Marko Vendelin <markov@ioc.ee>
2015 * src/frontends/gnome/mainapp.C
2016 * src/frontends/gnome/mainapp.h: added support for keyboard
2019 * src/frontends/gnome/FormCitation.C
2020 * src/frontends/gnome/FormCitation.h
2021 * src/frontends/gnome/Makefile.am
2022 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2023 FormCitation to use "action area" in mainapp window
2025 * src/frontends/gnome/Menubar_pimpl.C
2026 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2029 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2031 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2032 width/descent/ascent values if name is empty.
2033 (mathed_string_height): Use std::max.
2035 2000-09-25 Allan Rae <rae@lyx.org>
2037 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2038 segfault. This will be completely redesigned soon.
2040 * sigc++: updated libsigc++. Fixes struct timespec bug.
2042 * development/tools/makeLyXsigc.sh: .cvsignore addition
2044 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2046 * several files: removed almost all traces of the old table
2049 * src/TableLayout.C: removed file
2051 2000-09-22 Juergen Vigna <jug@sad.it>
2053 * src/frontends/kde/Dialogs.C: added credits forms.
2055 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2057 * src/frontends/gnome/Dialogs.C: added some forms.
2059 * src/spellchecker.C (init_spell_checker): set language in pspell code
2060 (RunSpellChecker): some modifications for setting language string.
2062 * src/language.[Ch]: added language_country code.
2064 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2066 * src/frontends/Dialogs.h: added new signal showError.
2067 Rearranged existing signals in some sort of alphabetical order.
2069 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2070 FormError.[Ch], form_error.[Ch]
2071 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2072 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2074 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2075 dialogs. I think that this can be used as the base to all these
2078 * src/frontends/xforms/FormError.[Ch]
2079 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2080 implementation of InsetError dialog.
2082 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2084 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2085 * src/frontends/kde/Makefile.am: ditto
2087 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2089 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2090 macrobf. This fixes a bug of invisible text.
2092 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2094 * lib/doc/LaTeXConfig.lyx.in: updated.
2096 * src/language.C (initL): remove language "francais" and change a
2097 bit the names of the two other french variations.
2099 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2100 string that may not be 0-terminated.
2102 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2104 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2106 2000-09-20 Marko Vendelin <markov@ioc.ee>
2108 * src/frontends/gnome/FormCitation.C
2109 * src/frontends/gnome/FormIndex.C
2110 * src/frontends/gnome/FormToc.C
2111 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2112 the variable initialization to shut up the warnings
2114 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2116 * src/table.[Ch]: deleted files
2118 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2121 2000-09-18 Juergen Vigna <jug@sad.it>
2123 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2124 problems with selection. Inserted new LFUN_PASTESELECTION.
2125 (InsetButtonPress): inserted handling of middle mouse-button paste.
2127 * src/spellchecker.C: changed word to word.c_str().
2129 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2131 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2132 included in the ``make dist'' tarball.
2134 2000-09-15 Juergen Vigna <jug@sad.it>
2136 * src/CutAndPaste.C (cutSelection): small fix return the right
2137 end position after cut inside one paragraph only.
2139 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2140 we are locked as otherwise we don't have a valid cursor position!
2142 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2144 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2146 * src/frontends/kde/FormRef.C: added using directive.
2147 * src/frontends/kde/FormToc.C: ditto
2149 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2151 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2153 2000-09-19 Marko Vendelin <markov@ioc.ee>
2155 * src/frontends/gnome/Menubar_pimpl.C
2156 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2157 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2159 * src/frontends/gnome/mainapp.C
2160 * src/frontends/gnome/mainapp.h: support for menu update used
2163 * src/frontends/gnome/mainapp.C
2164 * src/frontends/gnome/mainapp.h: support for "action" area in the
2165 main window. This area is used by small simple dialogs, such as
2168 * src/frontends/gnome/FormIndex.C
2169 * src/frontends/gnome/FormIndex.h
2170 * src/frontends/gnome/FormUrl.C
2171 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2174 * src/frontends/gnome/FormCitation.C
2175 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2176 action area. Only "Insert new citation" is implemented.
2178 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2180 * src/buffer.C (Dispatch): fix call to Dispatch
2181 * src/insets/insetref.C (Edit): likewise
2182 * src/insets/insetparent.C (Edit): likewise
2183 * src/insets/insetinclude.C (include_cb): likewise
2184 * src/frontends/xforms/FormUrl.C (apply): likewise
2185 * src/frontends/xforms/FormToc.C (apply): likewise
2186 * src/frontends/xforms/FormRef.C (apply): likewise
2187 * src/frontends/xforms/FormIndex.C (apply): likewise
2188 * src/frontends/xforms/FormCitation.C (apply): likewise
2189 * src/lyxserver.C (callback): likewise
2190 * src/lyxfunc.C (processKeySym): likewise
2191 (Dispatch): likewise
2192 (Dispatch): likewise
2193 * src/lyx_cb.C (LayoutsCB): likewise
2195 * Makefile.am (sourcedoc): small change
2197 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2199 * src/main.C (main): Don't make an empty GUIRunTime object. all
2200 methods are static. constify a bit remove unneded using + headers.
2202 * src/tabular.C: some more const to local vars move some loop vars
2204 * src/spellchecker.C: added some c_str after some word for pspell
2206 * src/frontends/GUIRunTime.h: add new static method setDefaults
2207 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2208 * src/frontends/kde/GUIRunTime.C (setDefaults):
2209 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2211 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2212 with strnew in arg, use correct emptystring when calling SetName.
2214 * several files: remove all commented code with relation to
2215 HAVE_SSTREAM beeing false. We now only support stringstream and
2218 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2220 * src/lyxfunc.C: construct correctly the automatic new file
2223 * src/text2.C (IsStringInText): change type of variable i to shut
2226 * src/support/sstream.h: do not use namespaces if the compiler
2227 does not support them.
2229 2000-09-15 Marko Vendelin <markov@ioc.ee>
2230 * src/frontends/gnome/FormCitation.C
2231 * src/frontends/gnome/FormCitation.h
2232 * src/frontends/gnome/diainsertcitation_interface.c
2233 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2234 regexp support to FormCitation [Gnome].
2236 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2239 * configure.in: remove unused KDE/GTKGUI define
2241 * src/frontends/kde/FormRef.C
2242 * src/frontends/kde/FormRef.h
2243 * src/frontends/kde/formrefdialog.C
2244 * src/frontends/kde/formrefdialog.h: double click will
2245 go to reference, now it is possible to change a cross-ref
2248 * src/frontends/kde/FormToc.C
2249 * src/frontends/kde/FormToc.h
2250 * src/frontends/kde/formtocdialog.C
2251 * src/frontends/kde/formtocdialog.h: add a depth
2254 * src/frontends/kde/Makefile.am: add QtLyXView.h
2257 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2259 * src/frontends/kde/FormCitation.h: added some using directives.
2261 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2263 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2266 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2269 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2271 * src/buffer.C (pop_tag): revert for the second time a change by
2272 Lars, who seems to really hate having non-local loop variables :)
2274 * src/Lsstream.h: add "using" statements.
2276 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2277 * src/buffer.C (writeFile): ditto
2279 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2281 * src/buffer.C (writeFile): try to fix the locale modified format
2282 number to always be as we want it.
2284 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2285 in XForms 0.89. C-space is now working again.
2287 * src/Lsstream.h src/support/sstream.h: new files.
2289 * also commented out all cases where strstream were used.
2291 * src/Bullet.h (c_str): remove method.
2293 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2295 * a lot of files: get rid of "char const *" and "char *" is as
2296 many places as possible. We only want to use them in interaction
2297 with system of other libraries, not inside lyx.
2299 * a lot of files: return const object is not of pod type. This
2300 helps ensure that temporary objects is not modified. And fits well
2301 with "programming by contract".
2303 * configure.in: check for the locale header too
2305 * Makefile.am (sourcedoc): new tag for generation of doc++
2308 2000-09-14 Juergen Vigna <jug@sad.it>
2310 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2311 callback to check which combo called it and do the right action.
2313 * src/combox.C (combo_cb): added combo * to the callbacks.
2314 (Hide): moved call of callback after Ungrab of the pointer.
2316 * src/intl.h: removed LCombo2 function.
2318 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2319 function as this can now be handled in one function.
2321 * src/combox.h: added Combox * to callback prototype.
2323 * src/frontends/xforms/Toolbar_pimpl.C:
2324 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2326 2000-09-14 Garst Reese <reese@isn.net>
2328 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2329 moved usepackage{xxx}'s to beginning of file. Changed left margin
2330 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2331 underlining from title. Thanks to John Culleton for useful suggestions.
2333 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2335 * src/lyxlex_pimpl.C (setFile): change error message to debug
2338 2000-09-13 Juergen Vigna <jug@sad.it>
2340 * src/frontends/xforms/FormDocument.C: implemented choice_class
2341 as combox and give callback to combo_language so OK/Apply is activated
2344 * src/bufferlist.C (newFile): small fix so already named files
2345 (via an open call) are not requested to be named again on the
2348 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2350 * src/frontends/kde/Makefile.am
2351 * src/frontends/kde/FormRef.C
2352 * src/frontends/kde/FormRef.h
2353 * src/frontends/kde/formrefdialog.C
2354 * src/frontends/kde/formrefdialog.h: implement
2357 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2359 * src/frontends/kde/formtocdialog.C
2360 * src/frontends/kde/formtocdialog.h
2361 * src/frontends/kde/FormToc.C
2362 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2364 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2366 * src/frontends/kde/FormCitation.C: fix thinko
2367 where we didn't always display the reference text
2370 * src/frontends/kde/formurldialog.C
2371 * src/frontends/kde/formurldialog.h
2372 * src/frontends/kde/FormUrl.C
2373 * src/frontends/kde/FormUrl.h: minor cleanups
2375 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2377 * src/frontends/kde/Makefile.am
2378 * src/frontends/kde/FormToc.C
2379 * src/frontends/kde/FormToc.h
2380 * src/frontends/kde/FormCitation.C
2381 * src/frontends/kde/FormCitation.h
2382 * src/frontends/kde/FormIndex.C
2383 * src/frontends/kde/FormIndex.h
2384 * src/frontends/kde/formtocdialog.C
2385 * src/frontends/kde/formtocdialog.h
2386 * src/frontends/kde/formcitationdialog.C
2387 * src/frontends/kde/formcitationdialog.h
2388 * src/frontends/kde/formindexdialog.C
2389 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2391 2000-09-12 Juergen Vigna <jug@sad.it>
2393 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2396 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2398 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2401 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2403 * src/converter.C (Add, Convert): Added support for converter flags:
2404 needaux, resultdir, resultfile.
2405 (Convert): Added new parameter view_file.
2406 (dvips_options): Fixed letter paper option.
2408 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2409 (Export, GetExportableFormats, GetViewableFormats): Added support
2412 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2414 (easyParse): Fixed to work with new export code.
2416 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2419 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2421 * lib/bind/*.bind: Replaced
2422 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2423 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2425 2000-09-11 Juergen Vigna <jug@sad.it>
2427 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2429 * src/main.C (main): now GUII defines global guiruntime!
2431 * src/frontends/gnome/GUIRunTime.C (initApplication):
2432 * src/frontends/kde/GUIRunTime.C (initApplication):
2433 * src/frontends/xforms/GUIRunTime.C (initApplication):
2434 * src/frontends/GUIRunTime.h: added new function initApplication.
2436 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2438 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2440 2000-09-08 Juergen Vigna <jug@sad.it>
2442 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2443 we have already "Reset".
2445 * src/language.C (initL): inserted "default" language and made this
2446 THE default language (and not american!)
2448 * src/paragraph.C: inserted handling of "default" language!
2450 * src/lyxfont.C: ditto
2454 * src/paragraph.C: output the \\par only if we have a following
2455 paragraph otherwise it's not needed.
2457 2000-09-05 Juergen Vigna <jug@sad.it>
2459 * config/pspell.m4: added entry to lyx-flags
2461 * src/spellchecker.C: modified version from Kevin for using pspell
2463 2000-09-01 Marko Vendelin <markov@ioc.ee>
2464 * src/frontends/gnome/Makefile.am
2465 * src/frontends/gnome/FormCitation.C
2466 * src/frontends/gnome/FormCitation.h
2467 * src/frontends/gnome/diainsertcitation_callbacks.c
2468 * src/frontends/gnome/diainsertcitation_callbacks.h
2469 * src/frontends/gnome/diainsertcitation_interface.c
2470 * src/frontends/gnome/diainsertcitation_interface.h
2471 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2472 dialog for Gnome frontend
2474 * src/main.C: Gnome libraries require keeping application name
2475 and its version as strings
2477 * src/frontends/gnome/mainapp.C: Change the name of the main window
2478 from GnomeLyX to PACKAGE
2480 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2482 * src/frontends/Liason.C: add "using: declaration.
2484 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2486 * src/mathed/math_macro.C (Metrics): Set the size of the template
2488 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2490 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2492 * src/converter.C (add_options): New function.
2493 (SetViewer): Change $$FName into '$$FName'.
2494 (View): Add options when running xdvi
2495 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2496 (Convert): The 3rd parameter is now the desired filename. Converts
2497 calls to lyx::rename if necessary.
2498 Add options when running dvips.
2499 (dvi_papersize,dvips_options): New methods.
2501 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2503 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2504 using a call to Converter::dvips_options.
2505 Fixed to work with nex export code.
2507 * src/support/copy.C
2508 * src/support/rename.C: New files
2510 * src/support/syscall.h
2511 * src/support/syscall.C: Added Starttype SystemDontWait.
2513 * lib/ui/default.ui: Changed to work with new export code
2515 * lib/configure.m4: Changed to work with new export code
2517 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2519 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2521 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2522 so that code compiles with DEC cxx.
2524 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2525 to work correctly! Also now supports the additional elements
2528 2000-09-01 Allan Rae <rae@lyx.org>
2530 * src/frontends/ButtonPolicies.C: renamed all the references to
2531 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2533 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2534 since it's a const not a type.
2536 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2538 2000-08-31 Juergen Vigna <jug@sad.it>
2540 * src/insets/figinset.C: Various changes to look if the filename has
2541 an extension and if not add it for inline previewing.
2543 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2545 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2546 make buttonStatus and isReadOnly be const methods. (also reflect
2547 this in derived classes.)
2549 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2550 (nextState): change to be static inline, pass the StateMachine as
2552 (PreferencesPolicy): remove casts
2553 (OkCancelPolicy): remvoe casts
2554 (OkCancelReadOnlyPolicy): remove casts
2555 (NoRepeatedApplyReadOnlyPolicy): remove casts
2556 (OkApplyCancelReadOnlyPolicy): remove casts
2557 (OkApplyCancelPolicy): remove casts
2558 (NoRepeatedApplyPolicy): remove casts
2560 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2562 * src/converter.C: added some using directives
2564 * src/frontends/ButtonPolicies.C: changes to overcome
2565 "need lvalue" error with DEC c++
2567 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2568 to WMHideCB for DEC c++
2570 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2572 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2573 to BulletBMTableCB for DEC c++
2575 2000-08-31 Allan Rae <rae@lyx.org>
2577 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2578 character dialog separately from old document dialogs combo_language.
2581 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2583 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2584 Removed LFUN_REF_CREATE.
2586 * src/MenuBackend.C: Added new tags: toc and references
2588 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2589 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2591 (add_toc, add_references): New methods.
2592 (create_submenu): Handle correctly the case when there is a
2593 seperator after optional menu items.
2595 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2596 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2597 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2599 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2601 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2603 * src/converter.[Ch]: New file for converting between different
2606 * src/export.[Ch]: New file for exporting a LyX file to different
2609 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2610 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2611 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2612 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2613 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2614 RunDocBook, MenuExport.
2616 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2617 Exporter::Preview methods if NEW_EXPORT is defined.
2619 * src/buffer.C (Dispatch): Use Exporter::Export.
2621 * src/lyxrc.C: Added new tags: \converter and \viewer.
2624 * src/LyXAction.C: Define new lyx-function: buffer-update.
2625 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2626 when NEW_EXPORT is defined.
2628 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2630 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2632 * lib/ui/default.ui: Added submenus "view" and "update" to the
2635 * src/filetools.C (GetExtension): New function.
2637 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2639 2000-08-29 Allan Rae <rae@lyx.org>
2641 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2643 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2644 (EnableDocumentLayout): removed
2645 (DisableDocumentLayout): removed
2646 (build): make use of ButtonController's read-only handling to
2647 de/activate various objects. Replaces both of the above functions.
2649 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2650 (readOnly): was read_only
2651 (refresh): fixed dumb mistakes with read_only_ handling
2653 * src/frontends/xforms/forms/form_document.fd:
2654 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2655 tabbed dialogs so the tabs look more like tabs and so its easier to
2656 work out which is the current tab.
2658 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2659 segfault with form_table
2661 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2663 2000-08-28 Juergen Vigna <jug@sad.it>
2665 * acconfig.h: added USE_PSPELL.
2667 * src/config.h.in: added USE_PSPELL.
2669 * autogen.sh: added pspell.m4
2671 * config/pspell.m4: new file.
2673 * src/spellchecker.C: implemented support for pspell libary.
2675 2000-08-25 Juergen Vigna <jug@sad.it>
2677 * src/LyXAction.C (init): renamed LFUN_TABLE to
2678 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2680 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2682 * src/lyxscreen.h: add force_clear variable and fuction to force
2683 a clear area when redrawing in LyXText.
2685 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2687 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2689 * some whitespace and comment changes.
2691 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2693 * src/buffer.C: up te LYX_FORMAT to 2.17
2695 2000-08-23 Juergen Vigna <jug@sad.it>
2697 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2700 * src/insets/insettabular.C (pasteSelection): delete the insets
2701 LyXText as it is not valid anymore.
2702 (copySelection): new function.
2703 (pasteSelection): new function.
2704 (cutSelection): new function.
2705 (LocalDispatch): implemented cut/copy/paste of cell selections.
2707 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2708 don't have a LyXText.
2710 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2712 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2715 2000-08-22 Juergen Vigna <jug@sad.it>
2717 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2718 ifdef form_table out if NEW_TABULAR.
2720 2000-08-21 Juergen Vigna <jug@sad.it>
2722 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2723 (draw): fixed draw position so that the cursor is positioned in the
2725 (InsetMotionNotify): hide/show cursor so the position is updated.
2726 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2727 using cellstart() function where it should be used.
2729 * src/insets/insettext.C (draw): ditto.
2731 * src/tabular.C: fixed initialization of some missing variables and
2732 made BoxType into an enum.
2734 2000-08-22 Marko Vendelin <markov@ioc.ee>
2735 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2736 stock menu item using action numerical value, not its string
2740 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2742 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2743 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2745 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2747 * src/frontends/xforms/GUIRunTime.C: new file
2749 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2750 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2752 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2754 * src/frontends/kde/GUIRunTime.C: new file
2756 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2757 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2759 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2761 * src/frontends/gnome/GUIRunTime.C: new file
2763 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2766 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2767 small change to documetentation.
2769 * src/frontends/GUIRunTime.C: removed file
2771 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2773 * src/lyxparagraph.h: enable NEW_TABULAR as default
2775 * src/lyxfunc.C (processKeySym): remove some commented code
2777 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2778 NEW_TABULAR around the fd_form_table_options.
2780 * src/lyx_gui.C (runTime): call the static member function as
2781 GUIRunTime::runTime().
2783 2000-08-21 Allan Rae <rae@lyx.org>
2785 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2788 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2790 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2792 2000-08-21 Allan Rae <rae@lyx.org>
2794 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2795 keep Garst happy ;-)
2796 * src/frontends/xforms/FormPreferences.C (build): use setOK
2797 * src/frontends/xforms/FormDocument.C (build): use setOK
2798 (FormDocument): use the appropriate policy.
2800 2000-08-21 Allan Rae <rae@lyx.org>
2802 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2803 automatic [de]activation of arbitrary objects when in a read-only state.
2805 * src/frontends/ButtonPolicies.h: More documentation
2806 (isReadOnly): added to support the above.
2808 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2810 2000-08-18 Juergen Vigna <jug@sad.it>
2812 * src/insets/insettabular.C (getStatus): changed to return func_status.
2814 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2815 display toggle menu entries if they are.
2817 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2818 new document layout now.
2820 * src/lyxfunc.C: ditto
2822 * src/lyx_gui_misc.C: ditto
2824 * src/lyx_gui.C: ditto
2826 * lib/ui/default.ui: removed paper and quotes layout as they are now
2827 all in the document layout tabbed folder.
2829 * src/frontends/xforms/forms/form_document.fd: added Restore
2830 button and callbacks for all inputs for Allan's ButtonPolicy.
2832 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2833 (CheckChoiceClass): added missing params setting on class change.
2834 (UpdateLayoutDocument): added for updating the layout on params.
2835 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2836 (FormDocument): Implemented Allan's ButtonPolicy with the
2839 2000-08-17 Allan Rae <rae@lyx.org>
2841 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2842 so we can at least see the credits again.
2844 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2845 controller calls for the appropriate callbacks. Note that since Ok
2846 calls apply followed by cancel, and apply isn't a valid input for the
2847 APPLIED state, the bc_ calls have to be made in the static callback not
2848 within each of the real callbacks.
2850 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2851 (setOk): renamed from setOkay()
2853 2000-08-17 Juergen Vigna <jug@sad.it>
2855 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2856 in the implementation part.
2857 (composeUIInfo): don't show optional menu-items.
2859 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2861 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2863 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2864 text-state when in a text-inset.
2866 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2868 2000-08-17 Marko Vendelin <markov@ioc.ee>
2869 * src/frontends/gnome/FormIndex.C
2870 * src/frontends/gnome/FormIndex.h
2871 * src/frontends/gnome/FormToc.C
2872 * src/frontends/gnome/FormToc.h
2873 * src/frontends/gnome/dialogs
2874 * src/frontends/gnome/diatoc_callbacks.c
2875 * src/frontends/gnome/diatoc_callbacks.h
2876 * src/frontends/gnome/diainsertindex_callbacks.h
2877 * src/frontends/gnome/diainsertindex_callbacks.c
2878 * src/frontends/gnome/diainsertindex_interface.c
2879 * src/frontends/gnome/diainsertindex_interface.h
2880 * src/frontends/gnome/diatoc_interface.h
2881 * src/frontends/gnome/diatoc_interface.c
2882 * src/frontends/gnome/Makefile.am: Table of Contents and
2883 Insert Index dialogs implementation for Gnome frontend
2885 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2887 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2889 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2892 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2894 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2895 destructor. Don't definde if you don't need it
2896 (processEvents): made static, non-blocking events processing for
2898 (runTime): static method. event loop for xforms
2899 * similar as above for kde and gnome.
2901 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2902 new Pimpl is correct
2903 (runTime): new method calss the real frontends runtime func.
2905 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2907 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2909 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2911 2000-08-16 Juergen Vigna <jug@sad.it>
2913 * src/lyx_gui.C (runTime): added GUII RunTime support.
2915 * src/frontends/Makefile.am:
2916 * src/frontends/GUIRunTime.[Ch]:
2917 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2918 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2919 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2921 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2923 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2924 as this is already set in ${FRONTEND_INCLUDE} if needed.
2926 * configure.in (CPPFLAGS): setting the include dir for the frontend
2927 directory and don't set FRONTEND=xforms for now as this is executed
2930 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2932 * src/frontends/kde/Makefile.am:
2933 * src/frontends/kde/FormUrl.C:
2934 * src/frontends/kde/FormUrl.h:
2935 * src/frontends/kde/formurldialog.h:
2936 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2938 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2940 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2942 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2944 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2947 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2949 * src/WorkArea.C (work_area_handler): more work to get te
2950 FL_KEYBOARD to work with xforms 0.88 too, please test.
2952 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2954 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2956 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2959 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2961 * src/Timeout.h: remove Qt::emit hack.
2963 * several files: changes to allo doc++ compilation
2965 * src/lyxfunc.C (processKeySym): new method
2966 (processKeyEvent): comment out if FL_REVISION < 89
2968 * src/WorkArea.C: change some debugging levels.
2969 (WorkArea): set wantkey to FL_KEY_ALL
2970 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2971 clearer code and the use of compose with XForms 0.89. Change to
2972 use signals instead of calling methods in bufferview directly.
2974 * src/Painter.C: change some debugging levels.
2976 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2979 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2980 (workAreaKeyPress): new method
2982 2000-08-14 Juergen Vigna <jug@sad.it>
2984 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2986 * config/kde.m4: addes some features
2988 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2989 include missing xforms dialogs.
2991 * src/Timeout.h: a hack to be able to compile with qt/kde.
2993 * sigc++/.cvsignore: added acinclude.m4
2995 * lib/.cvsignore: added listerros
2997 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2998 xforms tree as objects are needed for other frontends.
3000 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3001 linking with not yet implemented xforms objects.
3003 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3005 2000-08-14 Baruch Even <baruch.even@writeme.com>
3007 * src/frontends/xforms/FormGraphics.h:
3008 * src/frontends/xforms/FormGraphics.C:
3009 * src/frontends/xforms/RadioButtonGroup.h:
3010 * src/frontends/xforms/RadioButtonGroup.C:
3011 * src/insets/insetgraphics.h:
3012 * src/insets/insetgraphics.C:
3013 * src/insets/insetgraphicsParams.h:
3014 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3015 instead of spaces, and various other indentation issues to make the
3016 sources more consistent.
3018 2000-08-14 Marko Vendelin <markov@ioc.ee>
3020 * src/frontends/gnome/dialogs/diaprint.glade
3021 * src/frontends/gnome/FormPrint.C
3022 * src/frontends/gnome/FormPrint.h
3023 * src/frontends/gnome/diaprint_callbacks.c
3024 * src/frontends/gnome/diaprint_callbacks.h
3025 * src/frontends/gnome/diaprint_interface.c
3026 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3029 * src/frontends/gnome/dialogs/diainserturl.glade
3030 * src/frontends/gnome/FormUrl.C
3031 * src/frontends/gnome/FormUrl.h
3032 * src/frontends/gnome/diainserturl_callbacks.c
3033 * src/frontends/gnome/diainserturl_callbacks.h
3034 * src/frontends/gnome/diainserturl_interface.c
3035 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3036 Gnome implementation
3038 * src/frontends/gnome/Dialogs.C
3039 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3040 all other dialogs. Copy all unimplemented dialogs from Xforms
3043 * src/frontends/gnome/support.c
3044 * src/frontends/gnome/support.h: support files generated by Glade
3048 * config/gnome.m4: Gnome configuration scripts
3050 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3051 configure --help message
3053 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3054 only if there are no events pendling in Gnome/Gtk. This enhances
3055 the performance of menus.
3058 2000-08-14 Allan Rae <rae@lyx.org>
3060 * lib/Makefile.am: listerrors cleaning
3062 * lib/listerrors: removed -- generated file
3063 * acinclude.m4: ditto
3064 * sigc++/acinclude.m4: ditto
3066 * src/frontends/xforms/forms/form_citation.fd:
3067 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3070 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3071 `updatesrc` and now we have a `test` target that does what `updatesrc`
3072 used to do. I didn't like having an install target that wasn't related
3075 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3076 on all except FormGraphics. This may yet happen. Followed by a major
3077 cleanup including using FL_TRANSIENT for most of the dialogs. More
3078 changes to come when the ButtonController below is introduced.
3080 * src/frontends/xforms/ButtonController.h: New file for managing up to
3081 four buttons on a dialog according to an externally defined policy.
3082 * src/frontends/xforms/Makefile.am: added above
3084 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3085 Apply and Cancel/Close buttons and everything in between and beyond.
3086 * src/frontends/Makefile.am: added above.
3088 * src/frontends/xforms/forms/form_preferences.fd:
3089 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3090 and removed variable 'status' as a result. Fixed the set_minsize thing.
3091 Use the new screen-font-update after checking screen fonts were changed
3092 Added a "Restore" button to restore the original lyxrc values while
3093 editing. This restores everything not just the last input changed.
3094 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3096 * src/LyXAction.C: screen-font-update added for updating buffers after
3097 screen font settings have been changed.
3098 * src/commandtags.h: ditto
3099 * src/lyxfunc.C: ditto
3101 * forms/lyx.fd: removed screen fonts dialog.
3102 * src/lyx_gui.C: ditto
3103 * src/menus.[Ch]: ditto
3104 * src/lyx.[Ch]: ditto
3105 * src/lyx_cb.C: ditto + code from here moved to make
3106 screen-font-update. And people wonder why progress on GUII is
3107 slow. Look at how scattered this stuff was! It takes forever
3110 * forms/fdfix.sh: Fixup the spacing after commas.
3111 * forms/makefile: Remove date from generated files. Fewer clashes now.
3112 * forms/bullet_forms.C.patch: included someones handwritten changes
3114 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3115 once I've discovered why LyXRC was made noncopyable.
3116 * src/lyx_main.C: ditto
3118 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3120 * src/frontends/xforms/forms/fdfix.sh:
3121 * src/frontends/xforms/forms/fdfixh.sed:
3122 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3123 * src/frontends/xforms/Form*.[hC]:
3124 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3125 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3126 provide a destructor for the struct FD_form_xxxx. Another version of
3127 the set_[max|min]size workaround and a few other cleanups. Actually,
3128 Angus' patch from 20000809.
3130 2000-08-13 Baruch Even <baruch.even@writeme.com>
3132 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3135 2000-08-11 Juergen Vigna <jug@sad.it>
3137 * src/insets/insetgraphics.C (InsetGraphics): changing init
3138 order because of warnings.
3140 * src/frontends/xforms/forms/makefile: adding patching .C with
3143 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3144 from .C.patch to .c.patch
3146 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3147 order because of warning.
3149 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3151 * src/frontends/Liason.C (setMinibuffer): new helper function
3153 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3155 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3157 * lib/ui/default.ui: commented out PaperLayout entry
3159 * src/frontends/xforms/form_document.[Ch]: new added files
3161 * src/frontends/xforms/FormDocument.[Ch]: ditto
3163 * src/frontends/xforms/forms/form_document.fd: ditto
3165 * src/frontends/xforms/forms/form_document.C.patch: ditto
3167 2000-08-10 Juergen Vigna <jug@sad.it>
3169 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3170 (InsetGraphics): initialized cacheHandle to 0.
3171 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3173 2000-08-10 Baruch Even <baruch.even@writeme.com>
3175 * src/graphics/GraphicsCache.h:
3176 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3177 correctly as a cache.
3179 * src/graphics/GraphicsCacheItem.h:
3180 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3183 * src/graphics/GraphicsCacheItem_pimpl.h:
3184 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3187 * src/insets/insetgraphics.h:
3188 * src/insets/insetgraphics.C: Changed from using a signal notification
3189 to polling when image is not loaded.
3191 2000-08-10 Allan Rae <rae@lyx.org>
3193 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3194 that there are two functions that have to been taken out of line by
3195 hand and aren't taken care of in the script. (Just a reminder note)
3197 * sigc++/macros/*.h.m4: Updated as above.
3199 2000-08-09 Juergen Vigna <jug@sad.it>
3201 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3203 * src/insets/insettabular.C: make drawing of single cell smarter.
3205 2000-08-09 Marko Vendelin <markov@ioc.ee>
3206 * src/frontends/gnome/Menubar_pimpl.C
3207 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3208 implementation: new files
3210 * src/frontends/gnome/mainapp.C
3211 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3214 * src/main.C: create Gnome main window
3216 * src/frontends/xforms/Menubar_pimpl.h
3217 * src/frontends/Menubar.C
3218 * src/frontends/Menubar.h: added method Menubar::update that calls
3219 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3221 * src/LyXView.C: calls Menubar::update to update the state
3224 * src/frontends/gnome/Makefile.am: added new files
3226 * src/frontends/Makefile.am: added frontend compiler options
3228 2000-08-08 Juergen Vigna <jug@sad.it>
3230 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3232 * src/bufferlist.C (close):
3233 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3234 documents if exiting without saving.
3236 * src/buffer.C (save): use removeAutosaveFile()
3238 * src/support/filetools.C (removeAutosaveFile): new function.
3240 * src/lyx_cb.C (MenuWrite): returns a bool now.
3241 (MenuWriteAs): check if file could really be saved and revert to the
3243 (MenuWriteAs): removing old autosavefile if existant.
3245 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3246 before Goto toggle declaration, because of compiler warning.
3248 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3250 * src/lyxfunc.C (MenuNew): small fix.
3252 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3254 * src/bufferlist.C (newFile):
3255 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3257 * src/lyxrc.C: added new_ask_filename tag
3259 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3261 * src/lyx.fd: removed code pertaining to form_ref
3262 * src/lyx.[Ch]: ditto
3263 * src/lyx_cb.C: ditto
3264 * src/lyx_gui.C: ditto
3265 * src/lyx_gui_misc.C: ditto
3267 * src/BufferView_pimpl.C (restorePosition): update buffer only
3270 * src/commandtags.h (LFUN_REFTOGGLE): removed
3271 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3272 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3273 (LFUN_REFBACK): renamed LFUN_REF_BACK
3275 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3276 * src/menus.C: ditto
3277 * src/lyxfunc.C (Dispatch): ditto.
3278 InsertRef dialog is now GUI-independent.
3280 * src/texrow.C: added using std::endl;
3282 * src/insets/insetref.[Ch]: strip out large amounts of code.
3283 The inset is now a container and this functionality is now
3284 managed by a new FormRef dialog
3286 * src/frontends/Dialogs.h (showRef, createRef): new signals
3288 * src/frontends/xforms/FormIndex.[Ch],
3289 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3290 when setting dialog's min/max size
3291 * src/frontends/xforms/FormIndex.[Ch]: ditto
3293 * src/frontends/xforms/FormRef.[Ch],
3294 src/frontends/xforms/forms/form_ref.fd: new xforms
3295 implementation of an InsetRef dialog
3297 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3300 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3301 ios::nocreate is not part of the standard. Removed.
3303 2000-08-07 Baruch Even <baruch.even@writeme.com>
3305 * src/graphics/Renderer.h:
3306 * src/graphics/Renderer.C: Added base class for rendering of different
3307 image formats into Pixmaps.
3309 * src/graphics/XPM_Renderer.h:
3310 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3311 in a different class.
3313 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3314 easily add support for other formats.
3316 * src/insets/figinset.C: plugged a leak of an X resource.
3318 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3320 * src/CutAndPaste.[Ch]: make all metods static.
3322 * development/Code_rules/Rules: more work, added section on
3323 Exceptions, and a References section.
3325 * a lot of header files: work to make doc++ able to generate the
3326 source documentation, some workarounds of doc++ problems. Doc++ is
3327 now able to generate the documentation.
3329 2000-08-07 Juergen Vigna <jug@sad.it>
3331 * src/insets/insettabular.C (recomputeTextInsets): removed function
3333 * src/tabular.C (SetWidthOfMulticolCell):
3335 (calculate_width_of_column_NMC): fixed return value so that it really
3336 only returns true if the column-width has changed (there where
3337 problems with muliticolumn-cells in this column).
3339 2000-08-04 Juergen Vigna <jug@sad.it>
3341 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3342 also on the scrollstatus of the inset.
3343 (workAreaMotionNotify): ditto.
3345 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3347 2000-08-01 Juergen Vigna <jug@sad.it>
3349 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3351 * src/commandtags.h:
3352 * src/LyXAction.C (init):
3353 * src/insets/inset.C (LocalDispatch): added support for
3356 * src/insets/inset.C (scroll): new functions.
3358 * src/insets/insettext.C (removeNewlines): new function.
3359 (SetAutoBreakRows): removes forced newlines in the text of the
3360 paragraph if autoBreakRows is set to false.
3362 * src/tabular.C (Latex): generates a parbox around the cell contents
3365 * src/frontends/xforms/FormTabular.C (local_update): removed
3366 the radio_useparbox button.
3368 * src/tabular.C (UseParbox): new function
3370 2000-08-06 Baruch Even <baruch.even@writeme.com>
3372 * src/graphics/GraphicsCache.h:
3373 * src/graphics/GraphicsCache.C:
3374 * src/graphics/GraphicsCacheItem.h:
3375 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3378 * src/insets/insetgraphics.h:
3379 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3380 and the drawing of the inline image.
3382 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3383 loaded into the wrong position.
3385 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3388 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3390 * src/support/translator.h: move all typedefs to public section
3392 * src/support/filetools.C (MakeLatexName): return string const
3394 (TmpFileName): ditto
3395 (FileOpenSearch): ditto
3397 (LibFileSearch): ditto
3398 (i18nLibFileSearch): ditto
3401 (CreateTmpDir): ditto
3402 (CreateBufferTmpDir): ditto
3403 (CreateLyXTmpDir): ditto
3406 (MakeAbsPath): ditto
3408 (OnlyFilename): ditto
3410 (NormalizePath): ditto
3411 (CleanupPath): ditto
3412 (GetFileContents): ditto
3413 (ReplaceEnvironmentPath): ditto
3414 (MakeRelPath): ditto
3416 (ChangeExtension): ditto
3417 (MakeDisplayPath): ditto
3418 (do_popen): return cmdret const
3419 (findtexfile): return string const
3421 * src/support/DebugStream.h: add some /// to please doc++
3423 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3425 * src/texrow.C (same_rownumber): functor to use with find_if
3426 (getIdFromRow): rewritten to use find_if and to not update the
3427 positions. return true if row is found
3428 (increasePos): new method, use to update positions
3430 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3432 * src/lyxlex_pimpl.C (verifyTable): new method
3435 (GetString): return string const
3436 (pushTable): rewrite to use std::stack
3438 (setFile): better check
3441 * src/lyxlex.h: make LyXLex noncopyable
3443 * src/lyxlex.C (text): return char const * const
3444 (GetString): return string const
3445 (getLongString): return string const
3447 * src/lyx_gui_misc.C (askForText): return pair<...> const
3449 * src/lastfiles.[Ch] (operator): return string const
3451 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3452 istringstream not char const *.
3453 move token.end() out of loop.
3454 (readFile): move initializaton of token
3456 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3457 getIdFromRow is successful.
3459 * lib/bind/emacs.bind: don't include menus bind
3461 * development/Code_rules/Rules: the beginnings of making this
3462 better and covering more of the unwritten rules that we have.
3464 * development/Code_rules/Recommendations: a couple of wording
3467 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3469 * src/support/strerror.c: remove C++ comment.
3471 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3473 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3474 LFUN_INDEX_INSERT_LAST
3476 * src/texrow.C (getIdFromRow): changed from const_iterator to
3477 iterator, allowing code to compile with DEC cxx
3479 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3480 stores part of the class, as suggested by Allan. Will allow
3482 (apply): test to apply uses InsetCommandParams operator!=
3484 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3485 (apply): test to apply uses InsetCommandParams operator!=
3487 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3488 stores part of the class.
3489 (update): removed limits on min/max size.
3491 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3492 (apply): test to apply uses InsetCommandParams operator!=
3494 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3495 (Read, Write, scanCommand, getCommand): moved functionality
3496 into InsetCommandParams.
3498 (getScreenLabel): made pure virtual
3499 new InsetCommandParams operators== and !=
3501 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3502 c-tors based on InsetCommandParams. Removed others.
3503 * src/insets/insetinclude.[Ch]: ditto
3504 * src/insets/insetlabel.[Ch]: ditto
3505 * src/insets/insetparent.[Ch]: ditto
3506 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3508 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3509 insets derived from InsetCommand created using similar c-tors
3510 based on InsetCommandParams
3511 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3512 * src/menus.C (ShowRefsMenu): ditto
3513 * src/paragraph.C (Clone): ditto
3514 * src/text2.C (SetCounter): ditto
3515 * src/lyxfunc.C (Dispatch) ditto
3516 Also recreated old InsetIndex behaviour exactly. Can now
3517 index-insert at the start of a paragraph and index-insert-last
3518 without launching the pop-up.
3520 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3522 * lib/lyxrc.example: mark te pdf options as non functional.
3524 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3525 (isStrDbl): move tmpstr.end() out of loop.
3526 (strToDbl): move intialization of tmpstr
3527 (lowercase): return string const and move tmp.end() out of loop.
3528 (uppercase): return string const and move tmp.edn() out of loop.
3529 (prefixIs): add assertion
3534 (containsOnly): ditto
3535 (containsOnly): ditto
3536 (containsOnly): ditto
3537 (countChar): make last arg char not char const
3538 (token): return string const
3539 (subst): return string const, move tmp.end() out of loop.
3540 (subst): return string const, add assertion
3541 (strip): return string const
3542 (frontStrip): return string const, add assertion
3543 (frontStrip): return string const
3548 * src/support/lstrings.C: add inclde "LAssert.h"
3549 (isStrInt): move tmpstr.end() out of loop.
3551 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3552 toollist.end() out of loop.
3553 (deactivate): move toollist.end() out of loop.
3554 (update): move toollist.end() out of loop.
3555 (updateLayoutList): move tc.end() out of loop.
3556 (add): move toollist.end() out of loop.
3558 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3559 md.end() out of loop.
3561 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3563 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3566 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3567 (Erase): move insetlist.end() out of loop.
3569 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3570 ref to const string as first arg. Move initialization of some
3571 variables, whitespace changes.
3573 * src/kbmap.C (defkey): move table.end() out of loop.
3574 (kb_keymap): move table.end() out of loop.
3575 (findbinding): move table.end() out of loop.
3577 * src/MenuBackend.C (hasMenu): move end() out of loop.
3578 (getMenu): move end() out of loop.
3579 (getMenu): move menulist_.end() out of loop.
3581 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3583 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3586 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3587 (getFromLyXName): move infotab.end() out of loop.
3589 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3590 -fvtable-thunks -ffunction-sections -fdata-sections
3592 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3594 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3597 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3599 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3601 * src/frontends/xforms/FormCitation.[Ch],
3602 src/frontends/xforms/FormIndex.[Ch],
3603 src/frontends/xforms/FormToc.[Ch],
3604 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3606 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3608 * src/commandtags.h: renamed, created some flags for citation
3611 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3613 * src/lyxfunc.C (dispatch): use signals to insert index entry
3615 * src/frontends/Dialogs.h: new signal createIndex
3617 * src/frontends/xforms/FormCommand.[Ch],
3618 src/frontends/xforms/FormCitation.[Ch],
3619 src/frontends/xforms/FormToc.[Ch],
3620 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3622 * src/insets/insetindex.[Ch]: GUI-independent
3624 * src/frontends/xforms/FormIndex.[Ch],
3625 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3628 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3630 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3631 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3633 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3635 * src/insets/insetref.C (Latex): rewrite so that there is now
3636 question that a initialization is requested.
3638 * src/insets/insetcommand.h: reenable the hide signal
3640 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3642 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3643 fix handling of shortcuts (many bugs :)
3644 (add_lastfiles): ditto.
3646 * lib/ui/default.ui: fix a few shortcuts.
3648 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3650 * Makefile.am: Fix ``rpmdist'' target to return the exit
3651 status of the ``rpm'' command, instead of the last command in
3652 the chain (the ``rm lyx.xpm'' command, which always returns
3655 2000-08-02 Allan Rae <rae@lyx.org>
3657 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3658 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3659 * src/frontends/xforms/FormToc.C (FormToc): ditto
3661 * src/frontends/xforms/Makefile.am: A few forgotten files
3663 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3664 Signals-not-copyable-problem Lars' started commenting out.
3666 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3668 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3670 * src/insets/insetcommand.h: Signals is not copyable so anoter
3671 scheme for automatic hiding of forms must be used.
3673 * src/frontends/xforms/FormCitation.h: don't inerit from
3674 noncopyable, FormCommand already does that.
3675 * src/frontends/xforms/FormToc.h: ditto
3676 * src/frontends/xforms/FormUrl.h: ditto
3678 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3680 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3682 * src/insets/insetcommand.h (hide): new SigC::Signal0
3683 (d-tor) new virtual destructor emits hide signal
3685 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3686 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3688 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3689 LOF and LOT. Inset is now GUI-independent
3691 * src/insets/insetloa.[Ch]: redundant
3692 * src/insets/insetlof.[Ch]: ditto
3693 * src/insets/insetlot.[Ch]: ditto
3695 * src/frontends/xforms/forms/form_url.fd: tweaked!
3696 * src/frontends/xforms/forms/form_citation.fd: ditto
3698 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3699 dialogs dealing with InsetCommand insets
3701 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3702 FormCommand base class
3703 * src/frontends/xforms/FormUrl.[Ch]: ditto
3705 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3707 * src/frontends/xforms/FormToc.[Ch]: ditto
3709 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3710 passed a generic InsetCommand pointer
3711 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3713 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3714 and modified InsetTOC class
3715 * src/buffer.C: ditto
3717 * forms/lyx.fd: strip out old FD_form_toc code
3718 * src/lyx_gui_misc.C: ditto
3719 * src/lyx_gui.C: ditto
3720 * src/lyx_cb.C: ditto
3721 * src/lyx.[Ch]: ditto
3723 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3725 * src/support/utility.hpp: tr -d '\r'
3727 2000-08-01 Juergen Vigna <jug@sad.it>
3729 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3731 * src/commandtags.h:
3732 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3733 LFUN_TABULAR_FEATURES.
3735 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3736 LFUN_LAYOUT_TABULAR.
3738 * src/insets/insettabular.C (getStatus): implemented helper function.
3740 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3742 2000-07-31 Juergen Vigna <jug@sad.it>
3744 * src/text.C (draw): fixed screen update problem for text-insets.
3746 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3747 something changed probably this has to be added in various other
3750 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3752 2000-07-31 Baruch Even <baruch.even@writeme.com>
3754 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3755 templates to satisfy compaq cxx.
3758 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3760 * src/support/translator.h (equal_1st_in_pair::operator()): take
3761 const ref pair_type as arg.
3762 (equal_2nd_in_pair::operator()): ditto
3763 (Translator::~Translator): remove empty d-tor.
3765 * src/graphics/GraphicsCache.C: move include config.h to top, also
3766 put initialization of GraphicsCache::singleton here.
3767 (~GraphicsCache): move here
3768 (addFile): take const ref as arg
3771 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3773 * src/BufferView2.C (insertLyXFile): change te with/without header
3776 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3778 * src/frontends/xforms/FormGraphics.C (apply): add some
3779 static_cast. Not very nice, but required by compaq cxx.
3781 * src/frontends/xforms/RadioButtonGroup.h: include header
3782 <utility> instead of <pair.h>
3784 * src/insets/insetgraphicsParams.C: add using directive.
3785 (readResize): change return type to void.
3786 (readOrigin): ditto.
3788 * src/lyxfunc.C (getStatus): add missing break for build-program
3789 function; add test for Literate for export functions.
3791 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3792 entries in Options menu.
3794 2000-07-31 Baruch Even <baruch.even@writeme.com>
3796 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3797 protect against auto-allocation; release icon when needed.
3799 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3801 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3802 on usual typewriter.
3804 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3805 earlier czech.kmap), useful only for programming.
3807 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3809 * src/frontends/xforms/FormCitation.h: fix conditioning around
3812 2000-07-31 Juergen Vigna <jug@sad.it>
3814 * src/frontends/xforms/FormTabular.C (local_update): changed
3815 radio_linebreaks to radio_useparbox and added radio_useminipage.
3817 * src/tabular.C: made support for using minipages/parboxes.
3819 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3821 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3823 (descent): so the cursor is in the middle.
3824 (width): bit smaller box.
3826 * src/insets/insetgraphics.h: added display() function.
3828 2000-07-31 Baruch Even <baruch.even@writeme.com>
3830 * src/frontends/Dialogs.h: Added showGraphics signals.
3832 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3833 xforms form definition of the graphics dialog.
3835 * src/frontends/xforms/FormGraphics.h:
3836 * src/frontends/xforms/FormGraphics.C: Added files, the
3837 GUIndependent code of InsetGraphics
3839 * src/insets/insetgraphics.h:
3840 * src/insets/insetgraphics.C: Major writing to make it work.
3842 * src/insets/insetgraphicsParams.h:
3843 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3844 struct between InsetGraphics and GUI.
3846 * src/LaTeXFeatures.h:
3847 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3848 support for graphicx package.
3850 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3851 for the graphics inset.
3853 * src/support/translator.h: Added file, used in
3854 InsetGraphicsParams. this is a template to translate between two
3857 * src/frontends/xforms/RadioButtonGroup.h:
3858 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3859 way to easily control a radio button group.
3861 2000-07-28 Juergen Vigna <jug@sad.it>
3863 * src/insets/insettabular.C (LocalDispatch):
3864 (TabularFeatures): added support for lyx-functions of tabular features.
3865 (cellstart): refixed this function after someone wrongly changed it.
3867 * src/commandtags.h:
3868 * src/LyXAction.C (init): added support for tabular-features
3870 2000-07-28 Allan Rae <rae@lyx.org>
3872 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3873 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3874 triggers the callback for input checking. As a result we sometimes get
3875 "LyX: This shouldn't happen..." printed to cerr.
3876 (input): Started using status variable since I only free() on
3877 destruction. Some input checking for paths and font sizes.
3879 * src/frontends/xforms/FormPreferences.h: Use status to control
3880 activation of Ok and Apply
3882 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3883 callback. Also resized to stop segfaults with 0.88. The problem is
3884 that xforms-0.88 requires the folder to be wide enough to fit all the
3885 tabs. If it isn't it causes all sorts of problems.
3887 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3889 * src/frontends/xforms/forms/README: Reflect reality.
3891 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3892 * src/frontends/xforms/forms/makefile: ditto.
3894 * src/commandtags.h: Get access to new Preferences dialog
3895 * src/LyXAction.C: ditto
3896 * src/lyxfunc.C: ditto
3897 * lib/ui/default.ui: ditto
3899 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3901 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3903 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3906 * src/frontends/xforms/form_url.[Ch]: added.
3908 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3910 * src/insets/insetbib.h: fixed bug in previous commit
3912 * src/frontends/xforms/FormUrl.h: ditto
3914 * src/frontends/xforms/FormPrint.h: ditto
3916 * src/frontends/xforms/FormPreferences.h: ditto
3918 * src/frontends/xforms/FormCopyright.h: ditto
3920 * src/frontends/xforms/FormCitation.C: ditto
3922 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3923 private copyconstructor and private default contructor
3925 * src/support/Makefile.am: add utility.hpp
3927 * src/support/utility.hpp: new file from boost
3929 * src/insets/insetbib.h: set owner in clone
3931 * src/frontends/xforms/FormCitation.C: added missing include
3934 * src/insets/form_url.[Ch]: removed
3936 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3938 * development/lyx.spec.in
3939 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3940 file/directory re-organization.
3942 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3944 * src/insets/insetcommand.[Ch]: moved the string data and
3945 associated manipulation methods into a new stand-alone class
3946 InsetCommandParams. This class has two additional methods
3947 getAsString() and setFromString() allowing the contents to be
3948 moved around as a single string.
3949 (addContents) method removed.
3950 (setContents) method no longer virtual.
3952 * src/buffer.C (readInset): made use of new InsetCitation,
3953 InsetUrl constructors based on InsetCommandParams.
3955 * src/commandtags.h: add LFUN_INSERT_URL
3957 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3958 independent InsetUrl and use InsetCommandParams to extract
3959 string info and create new Insets.
3961 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3963 * src/frontends/xforms/FormCitation.C (apply): uses
3966 * src/frontends/xforms/form_url.C
3967 * src/frontends/xforms/form_url.h
3968 * src/frontends/xforms/FormUrl.h
3969 * src/frontends/xforms/FormUrl.C
3970 * src/frontends/xforms/forms/form_url.fd: new files
3972 * src/insets/insetcite.[Ch]: removed unused constructors.
3974 * src/insets/insetinclude.[Ch]: no longer store filename
3976 * src/insets/inseturl.[Ch]: GUI-independent.
3978 2000-07-26 Juergen Vigna <jug@sad.it>
3979 * renamed frontend from gtk to gnome as it is that what is realized
3980 and did the necessary changes in the files.
3982 2000-07-26 Marko Vendelin <markov@ioc.ee>
3984 * configure.in: cleaning up gnome configuration scripts
3986 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3988 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3989 shortcuts syndrom by redrawing them explicitely (a better solution
3990 would be appreciated).
3992 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3994 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3997 * src/lyx_cb.C (MenuExport): change html export to do the right
3998 thing depending of the document type (instead of having
3999 html-linuxdoc and html-docbook).
4000 * src/lyxfunc.C (getStatus): update for html
4001 * lib/ui/default.ui: simplify due to the above change.
4002 * src/menus.C (ShowFileMenu): update too (in case we need it).
4004 * src/MenuBackend.C (read): if a menu is defined twice, add the
4005 new entries to the exiting one.
4007 2000-07-26 Juergen Vigna <jug@sad.it>
4009 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4011 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4012 and return a bool if it did actual save the file.
4013 (AutoSave): don't autosave a unnamed doc.
4015 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4016 check if this is an UNNAMED new file and react to it.
4017 (newFile): set buffer to unnamed and change to not mark a new
4018 buffer dirty if I didn't do anything with it.
4020 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4022 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4024 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4025 friend as per Angus's patch posted to lyx-devel.
4027 * src/ext_l10n.h: updated
4029 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4030 gettext on the style string right before inserting them into the
4033 * autogen.sh: add code to extract style strings form layout files,
4034 not good enough yet.
4036 * src/frontends/gtk/.cvsignore: add MAKEFILE
4038 * src/MenuBackend.C (read): run the label strings through gettext
4039 before storing them in the containers.
4041 * src/ext_l10n.h: new file
4043 * autogen.sh : generate the ext_l10n.h file here
4045 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4047 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4050 * lib/ui/default.ui: fix a couple of typos.
4052 * config/gnome/gtk.m4: added (and added to the list of files in
4055 * src/insets/insetinclude.C (unique_id): fix when we are using
4056 lyxstring instead of basic_string<>.
4057 * src/insets/insettext.C (LocalDispatch): ditto.
4058 * src/support/filetools.C: ditto.
4060 * lib/configure.m4: create the ui/ directory if necessary.
4062 * src/LyXView.[Ch] (updateToolbar): new method.
4064 * src/BufferView_pimpl.C (buffer): update the toolbar when
4065 opening/closing buffer.
4067 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4069 * src/LyXAction.C (getActionName): enhance to return also the name
4070 and options of pseudo-actions.
4071 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4073 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4074 as an example of what is possible). Used in File->Build too (more
4075 useful) and in the import/export menus (to mimick the complicated
4076 handling of linuxdoc and friends). Try to update all the entries.
4078 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4081 * src/MenuBackend.C (read): Parse the new OptItem tag.
4083 * src/MenuBackend.h: Add a new optional_ data member (used if the
4084 entry should be omitted when the lyxfunc is disabled).
4086 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4087 function, used as a shortcut.
4088 (create_submenu): align correctly the shortcuts on the widest
4091 * src/MenuBackend.h: MenuItem.label() only returns the label of
4092 the menu without shortcut; new method shortcut().
4094 2000-07-14 Marko Vendelin <markov@ioc.ee>
4096 * src/frontends/gtk/Dialogs.C:
4097 * src/frontends/gtk/FormCopyright.C:
4098 * src/frontends/gtk/FormCopyright.h:
4099 * src/frontends/gtk/Makefile.am: added these source-files for the
4100 Gtk/Gnome support of the Copyright-Dialog.
4102 * src/main.C: added Gnome::Main initialization if using
4103 Gtk/Gnome frontend-GUI.
4105 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4107 * config/gnome/aclocal-include.m4
4108 * config/gnome/compiler-flags.m4
4109 * config/gnome/curses.m4
4110 * config/gnome/gnome--.m4
4111 * config/gnome/gnome-bonobo-check.m4
4112 * config/gnome/gnome-common.m4
4113 * config/gnome/gnome-fileutils.m4
4114 * config/gnome/gnome-ghttp-check.m4
4115 * config/gnome/gnome-gnorba-check.m4
4116 * config/gnome/gnome-guile-checks.m4
4117 * config/gnome/gnome-libgtop-check.m4
4118 * config/gnome/gnome-objc-checks.m4
4119 * config/gnome/gnome-orbit-check.m4
4120 * config/gnome/gnome-print-check.m4
4121 * config/gnome/gnome-pthread-check.m4
4122 * config/gnome/gnome-support.m4
4123 * config/gnome/gnome-undelfs.m4
4124 * config/gnome/gnome-vfs.m4
4125 * config/gnome/gnome-x-checks.m4
4126 * config/gnome/gnome-xml-check.m4
4127 * config/gnome/gnome.m4
4128 * config/gnome/gperf-check.m4
4129 * config/gnome/gtk--.m4
4130 * config/gnome/linger.m4
4131 * config/gnome/need-declaration.m4: added configuration scripts
4132 for Gtk/Gnome frontend-GUI
4134 * configure.in: added support for the --with-frontend=gtk option
4136 * autogen.sh: added config/gnome/* to list of config-files
4138 * acconfig.h: added define for GTKGUI-support
4140 * config/lyxinclude.m4: added --with-frontend[=value] option value
4141 for Gtk/Gnome frontend-GUI support.
4143 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4145 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4149 * src/paragraph.C (GetChar): remove non-const version
4151 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4152 (search_kw): use it.
4154 * src/lyx_main.C (init): if "preferences" exist, read that instead
4156 (ReadRcFile): return bool if the file could be read ok.
4157 (ReadUIFile): add a check to see if lex file is set ok.
4159 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4160 bastring can be used instead of lyxstring (still uses the old code
4161 if std::string is good enough or if lyxstring is used.)
4163 * src/encoding.C: make the arrays static, move ininle functions
4165 * src/encoding.h: from here.
4167 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4168 (parseSingleLyXformat2Token): move inset parsing to separate method
4169 (readInset): new private method
4171 * src/Variables.h: remove virtual from get().
4173 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4174 access to NEW_INSETS and NEW_TABULAR
4176 * src/MenuBackend.h: remove superfluous forward declaration of
4177 MenuItem. Add documentations tags "///", remove empty MenuItem
4178 destructor, remove private default contructor.
4180 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4182 (read): more string mlabel and mname to where they are used
4183 (read): remove unused variables mlabel and mname
4184 (defaults): unconditional clear, make menusetup take advantage of
4185 add returning Menu &.
4187 * src/LyXView.h: define NEW_MENUBAR as default
4189 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4190 to NEW_INSETS and NEW_TABULAR.
4191 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4192 defined. Change some of the "xxxx-inset-insert" functions names to
4195 * several files: more enahncements to NEW_INSETS and the resulting
4198 * lib/lyxrc.example (\date_insert_format): move to misc section
4200 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4201 bastring and use AC_CACHE_CHECK.
4202 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4203 the system have the newest methods. uses AC_CACHE_CHECK
4204 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4205 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4206 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4208 * configure.in: add LYX_CXX_GOOD_STD_STRING
4210 * acinclude.m4: recreated
4212 2000-07-24 Amir Karger <karger@lyx.org>
4214 * README: add Hebrew, Arabic kmaps
4217 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4219 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4222 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4224 * Lot of files: add pragma interface/implementation.
4226 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4228 * lib/ui/default.ui: new file (ans new directory). Contains the
4229 default menu and toolbar.
4231 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4232 global space. Toolbars are now read (as menus) in ui files.
4234 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4236 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4237 is disabled because the document is read-only. We want to have the
4238 toggle state of the function anyway.
4239 (getStatus): add code for LFUN_VC* functions (mimicking what is
4240 done in old-style menus)
4242 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4243 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4245 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4246 * src/BufferView_pimpl.C: ditto.
4247 * src/lyxfunc.C: ditto.
4249 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4250 default). This replaces old-style menus by new ones.
4252 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4253 MenuItem. Contain the data structure of a menu.
4255 * src/insets/insettext.C: use LyXView::setLayout instead of
4256 accessing directly the toolbar combox.
4257 * src/lyxfunc.C (Dispatch): ditto.
4259 * src/LyXView.C (setLayout): new method, which just calls
4260 Toolbar::setLayout().
4261 (updateLayoutChoice): move part of this method in Toolbar.
4263 * src/toolbar.[Ch]: removed.
4265 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4266 implementation the toolbar.
4268 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4269 the toolbar. It might make sense to merge it with ToolbarDefaults
4271 (setLayout): new function.
4272 (updateLayoutList): ditto.
4273 (openLayoutList): ditto.
4275 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4276 xforms implementation of the toolbar.
4277 (get_toolbar_func): comment out, since I do not
4278 know what it is good for.
4280 * src/ToolbarDefaults.h: Add the ItemType enum.
4282 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4283 for a list of allocated C strings. Used in Menubar xforms
4284 implementation to avoid memory leaks.
4286 * src/support/lstrings.[Ch] (uppercase): new version taking and
4290 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4291 * lib/bind/emacs.bind: ditto.
4293 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4295 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4296 forward decl of LyXView.
4298 * src/toolbar.C (toolbarItem): moved from toolbar.h
4299 (toolbarItem::clean): ditto
4300 (toolbarItem::~toolbarItem): ditto
4301 (toolbarItem::operator): ditto
4303 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4305 * src/paragraph.h: control the NEW_TABULAR define from here
4307 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4308 USE_TABULAR_INSETS to NEW_TABULAR
4310 * src/ToolbarDefaults.C: add include "lyxlex.h"
4312 * files using the old table/tabular: use NEW_TABULAR to control
4313 compilation of old tabular stuff.
4315 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4318 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4319 planemet in reading of old style floats, fix the \end_deeper
4320 problem when reading old style floats.
4322 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4324 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4326 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4328 * lib/bind/sciword.bind: updated.
4330 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4332 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4333 layout write problem
4335 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4337 * src/Makefile.am (INCLUDES): remove image directory from include
4340 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4341 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4343 * src/LyXView.C (create_form_form_main): read the application icon
4346 * lib/images/*.xpm: change the icons to use transparent color for
4349 * src/toolbar.C (update): change the color of the button when it
4352 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4354 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4355 setting explicitely the minibuffer.
4356 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4358 * src/LyXView.C (showState): new function. Shows font information
4359 in minibuffer and update toolbar state.
4360 (LyXView): call Toolbar::update after creating the
4363 * src/toolbar.C: change toollist to be a vector instead of a
4365 (BubbleTimerCB): get help string directly from the callback
4366 argument of the corresponding icon (which is the action)
4367 (set): remove unnecessary ugliness.
4368 (update): new function. update the icons (depressed, disabled)
4369 depending of the status of the corresponding action.
4371 * src/toolbar.h: remove help in toolbarItem
4373 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4375 * src/Painter.C (text): Added code for using symbol glyphs from
4376 iso10646 fonts. Currently diabled.
4378 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4381 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4382 magyar,turkish and usorbian.
4384 * src/paragraph.C (isMultiLingual): Made more efficient.
4386 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4389 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4390 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4391 Also changed the prototype to "bool math_insert_greek(char)".
4393 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4395 * lots of files: apply the NEW_INSETS on all code that will not be
4396 needed when we move to use the new insets. Enable the define in
4397 lyxparagrah.h to try it.
4399 * src/insets/insettabular.C (cellstart): change to be a static
4401 (InsetTabular): initialize buffer in the initializer list.
4403 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4405 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4406 form_print.h out of the header file. Replaced with forward
4407 declarations of the relevant struct.
4409 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4412 * src/commandtags.h: do not include "debug.h" which does not
4413 belong there. #include it in some other places because of this
4416 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4418 * src/insets/insetcaption.C: add a couple "using" directives.
4420 * src/toolbar.C (add): get the help text directly from lyxaction.
4422 (setPixmap): new function. Loads from disk and sets a pixmap on a
4423 botton; the name of the pixmap file is derived from the command
4426 * src/toolbar.h: remove members isBitmap and pixmap from
4429 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4430 * lib/images/: move many files from images/banner.xpm.
4432 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4434 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4435 * src/toolbar.C: ditto.
4436 * configure.in: ditto.
4437 * INSTALL: document.
4439 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4440 the spellchecker popup is closed from the WM.
4442 2000-07-19 Juergen Vigna <jug@sad.it>
4444 * src/insets/insetfloat.C (Write): small fix because we use the
4445 insetname for the type now!
4447 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4449 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4452 * src/frontends/Dialogs.h: removed hideCitation signal
4454 * src/insets/insetcite.h: added hide signal
4456 * src/insets/insetcite.C (~InsetCitation): emits new signal
4457 (getScreenLabel): "intelligent" label should now fit on the screen!
4459 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4461 * src/frontends/xforms/FormCitation.C (showInset): connects
4462 hide() to the inset's hide signal
4463 (show): modified to use fl_set_object_position rather than
4464 fl_set_object_geometry wherever possible
4466 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4468 * src/insets/lyxinset.h: add caption code
4470 * src/insets/insetfloat.C (type): new method
4472 * src/insets/insetcaption.C (Write): new method
4474 (LyxCode): new method
4476 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4477 to get it right together with using the FloatList.
4479 * src/commandtags.h: add LFUN_INSET_CAPTION
4480 * src/lyxfunc.C (Dispatch): handle it
4482 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4485 * src/Variables.[Ch]: make expand take a const reference, remove
4486 the destructor, some whitespace changes.
4488 * src/LyXAction.C (init): add caption-inset-insert
4490 * src/FloatList.C (FloatList): update the default floats a bit.
4492 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4494 * src/Variables.[Ch]: new files. Intended to be used for language
4495 specific strings (like \chaptername) and filename substitution in
4498 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4500 * lib/kbd/american.kmap: update
4502 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4504 * src/bufferparams.[Ch]: remove member allowAccents.
4506 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4508 * src/LaTeXLog.C: use the log_form.h header.
4509 * src/lyx_gui.C: ditto.
4510 * src/lyx_gui_misc.C: ditto.
4511 * src/lyxvc.h: ditto.
4513 * forms/log_form.fd: new file, created from latexoptions.fd. I
4514 kept the log popup and nuked the options form.
4516 * src/{la,}texoptions.[Ch]: removed.
4517 * src/lyx_cb.C (LaTeXOptions): ditto
4519 * src/lyx_gui.C (create_forms): do not handle the
4520 fd_latex_options form.
4522 2000-07-18 Juergen Vigna <jug@sad.it>
4524 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4525 name of the inset so that it can be requested outside (text2.C).
4527 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4530 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4532 * src/mathed/formula.h (ConvertFont): constify
4534 * src/mathed/formula.C (Read): add warning if \end_inset is not
4535 found on expected place.
4537 * src/insets/lyxinset.h (ConvertFont): consify
4539 * src/insets/insetquotes.C (ConvertFont): constify
4540 * src/insets/insetquotes.h: ditto
4542 * src/insets/insetinfo.h: add labelfont
4544 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4545 (ascent): use labelfont
4549 (Write): make .lyx file a bit nicer
4551 * src/insets/insetfloat.C (Write): simplify somewhat...
4552 (Read): add warning if arg is not found
4554 * src/insets/insetcollapsable.C: add using std::max
4555 (Read): move string token and add warning in arg is not found
4556 (draw): use std::max to get the right ty
4557 (getMaxWidth): simplify by using std::max
4559 * src/insets/insetsection.h: new file
4560 * src/insets/insetsection.C: new file
4561 * src/insets/insetcaption.h: new file
4562 * src/insets/insetcaption.C: new file
4564 * src/insets/inset.C (ConvertFont): constify signature
4566 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4567 insetcaption.[Ch] and insetsection.[Ch]
4569 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4570 uses to use LABEL_COUNTER_CHAPTER instead.
4571 * src/text2.C (SetCounter): here
4573 * src/counters.h: new file
4574 * src/counters.C: new file
4575 * src/Sectioning.h: new file
4576 * src/Sectioning.C: new file
4578 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4580 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4582 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4585 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4588 2000-07-17 Juergen Vigna <jug@sad.it>
4590 * src/tabular.C (Validate): check if array-package is needed.
4591 (SetVAlignment): added support for vertical alignment.
4592 (SetLTFoot): better support for longtable header/footers
4593 (Latex): modified to support added features.
4595 * src/LaTeXFeatures.[Ch]: added array-package.
4597 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4599 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4602 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4604 * configure.in: do not forget to put a space after -isystem.
4606 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4608 * lib/kbd/arabic.kmap: a few fixes.
4610 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4612 * some whitespace chagnes to a number of files.
4614 * src/support/DebugStream.h: change to make it easier for
4615 doc++ to parse correctly.
4616 * src/support/lyxstring.h: ditto
4618 * src/mathed/math_utils.C (compara): change to have only one
4620 (MathedLookupBOP): change because of the above.
4622 * src/mathed/math_delim.C (math_deco_compare): change to have only
4624 (search_deco): change becasue of the above.
4626 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4627 instead of manually coded one.
4629 * src/insets/insetquotes.C (Read): read the \end_inset too
4631 * src/insets/insetlatex.h: remove file
4632 * src/insets/insetlatex.C: remove file
4634 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4636 (InsetPrintIndex): remove destructor
4638 * src/insets/insetinclude.h: remove default constructor
4640 * src/insets/insetfloat.C: work to make it work better
4642 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4644 * src/insets/insetcite.h (InsetCitation): remove default constructor
4646 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4648 * src/text.C (GetColumnNearX): comment out some currently unused code.
4650 * src/paragraph.C (writeFile): move some initializations closer to
4652 (CutIntoMinibuffer): small change to use new matchIT operator
4656 (InsertInset): ditto
4659 (InsetIterator): ditto
4660 (Erase): small change to use new matchFT operator
4662 (GetFontSettings): ditto
4663 (HighestFontInRange): ditto
4666 * src/lyxparagraph.h: some chars changed to value_type
4667 (matchIT): because of some stronger checking (perhaps too strong)
4668 in SGI STL, the two operator() unified to one.
4671 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4673 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4674 the last inset read added
4675 (parseSingleLyXformat2Token): some more (future) compability code added
4676 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4677 (parseSingleLyXformat2Token): set last_inset_read
4678 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4679 (parseSingleLyXformat2Token): don't double intializw string next_token
4681 * src/TextCache.C (text_fits::operator()): add const's to the signature
4682 (has_buffer::operator()): ditto
4684 * src/Floating.h: add some comments on the class
4686 * src/FloatList.[Ch] (typeExist): new method
4689 * src/BackStack.h: added default constructor, wanted by Gcc.
4691 2000-07-14 Juergen Vigna <jug@sad.it>
4693 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4695 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4697 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4698 do a redraw when the window is resized!
4699 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4701 * src/insets/insettext.C (resizeLyXText): added function to correctly
4702 being able to resize the LyXWindow.
4704 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4706 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4708 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4709 crashes when closing dialog to a deleted inset.
4711 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4712 method! Now similar to other insets.
4714 2000-07-13 Juergen Vigna <jug@sad.it>
4716 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4718 * lib/examples/Literate.lyx: small patch!
4720 * src/insets/insetbib.C (Read): added this function because of wrong
4721 Write (without [begin|end]_inset).
4723 2000-07-11 Juergen Vigna <jug@sad.it>
4725 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4726 as the insertInset could not be good!
4728 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4729 the bool param should not be last.
4731 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4733 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4734 did submit that to Karl).
4736 * configure.in: use -isystem instead of -I for X headers. This
4737 fixes a problem on solaris with a recent gcc;
4738 put the front-end code after the X detection code;
4739 configure in sigc++ before lib/
4741 * src/lyx_main.C (commandLineHelp): remove -display from command
4744 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4746 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4747 Also put in Makefile rules for building the ``listerrors''
4748 program for parsing errors from literate programs written in LyX.
4750 * lib/build-listerrors: Added small shell script as part of compile
4751 process. This builds a working ``listerrors'' binary if noweb is
4752 installed and either 1) the VNC X server is installed on the machine,
4753 or 2) the user is compiling from within a GUI. The existence of a GUI
4754 is necessary to use the ``lyx --export'' feature for now. This
4755 hack can be removed once ``lyx --export'' no longer requires a GUI to
4758 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4760 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4761 now passed back correctly from gcc and placed "under" error
4762 buttons in a Literate LyX source.
4764 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4766 * src/text.C (GetColumnNearX): Better behavior when a RTL
4767 paragraph is ended by LTR text.
4769 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4772 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4774 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4775 true when clipboard is empty.
4777 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4779 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4780 row of the paragraph.
4781 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4782 to prevent calculation of bidi tables
4784 2000-07-07 Juergen Vigna <jug@sad.it>
4786 * src/screen.C (ToggleSelection): added y_offset and x_offset
4789 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4792 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4794 * src/insets/insettext.C: fixed Layout-Display!
4796 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4798 * configure.in: add check for strings.h header.
4800 * src/spellchecker.C: include <strings.h> in order to have a
4801 definition for bzero().
4803 2000-07-07 Juergen Vigna <jug@sad.it>
4805 * src/insets/insettext.C (draw): set the status of the bv->text to
4806 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4808 * src/screen.C (DrawOneRow):
4809 (DrawFromTo): redraw the actual row if something has changed in it
4812 * src/text.C (draw): call an update of the toplevel-inset if something
4813 has changed inside while drawing.
4815 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4817 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4819 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4820 processing inside class.
4822 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4823 processing inside class.
4825 * src/insets/insetindex.h new struct Holder, consistent with other
4828 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4829 citation dialog from main code and placed it in src/frontends/xforms.
4830 Dialog launched through signals instead of callbacks
4832 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4834 * lyx.man: update the options description.
4836 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4838 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4839 handle neg values, set min width to 590, add doc about -display
4841 2000-07-05 Juergen Vigna <jug@sad.it>
4843 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4844 calls to BufferView *.
4846 * src/insets/insettext.C (checkAndActivateInset): small fix non
4847 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4849 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4850 their \end_inset token!
4852 2000-07-04 edscott <edscott@imp.mx>
4854 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4855 lib/lyxrc.example: added option \wheel_jump
4857 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4859 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4860 remove support for -width,-height,-xpos and -ypos.
4862 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4864 * src/encoding.[Ch]: New files.
4866 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4867 (text): Call to the underline() method only when needed.
4869 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4871 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4872 encoding(s) for the document.
4874 * src/bufferparams.C (BufferParams): Changed default value of
4877 * src/language.C (newLang): Removed.
4878 (items[]): Added encoding information for all defined languages.
4880 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4881 encoding choice button.
4883 * src/lyxrc.h (font_norm_type): New member variable.
4884 (set_font_norm_type): New method.
4886 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4887 paragraphs with different encodings.
4889 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4890 (TransformChar): Changed to work correctly with Arabic points.
4891 (draw): Added support for drawing Arabic points.
4892 (draw): Removed code for drawing underbars (this is done by
4895 * src/support/textutils.h (IsPrintableNonspace): New function.
4897 * src/BufferView_pimpl.h: Added "using SigC::Object".
4898 * src/LyXView.h: ditto.
4900 * src/insets/insetinclude.h (include_label): Changed to mutable.
4902 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4904 * src/mathed/math_iter.h: remove empty destructor
4906 * src/mathed/math_cursor.h: remove empty destructor
4908 * src/insets/lyxinset.h: add THEOREM_CODE
4910 * src/insets/insettheorem.[Ch]: new files
4912 * src/insets/insetminipage.C: (InsertInset): remove
4914 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4916 (InsertInset): remove
4918 * src/insets/insetlist.C: (InsertList): remove
4920 * src/insets/insetfootlike.[Ch]: new files
4922 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4925 (InsertInset): ditto
4927 * src/insets/insetert.C: remove include Painter.h, reindent
4928 (InsertInset): move to header
4930 * src/insets/insetcollapsable.h: remove explicit from default
4931 contructor, remove empty destructor, add InsertInset
4933 * src/insets/insetcollapsable.C (InsertInset): new func
4935 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4937 * src/vspace.h: add explicit to constructor
4939 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4940 \textcompwordmark, please test this.
4942 * src/lyxrc.C: set ascii_linelen to 65 by default
4944 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4946 * src/commandtags.h: add LFUN_INSET_THEOREM
4948 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4949 (makeLinuxDocFile): remove _some_ of the nice logic
4950 (makeDocBookFile): ditto
4952 * src/Painter.[Ch]: (~Painter): removed
4954 * src/LyXAction.C (init): entry for insettheorem added
4956 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4958 (deplog): code to detect files generated by LaTeX, needs testing
4961 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4963 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4965 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4967 * src/LaTeX.C (deplog): Add a check for files that are going to be
4968 created by the first latex run, part of the project to remove the
4971 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4972 contents to the extension list.
4974 2000-07-04 Juergen Vigna <jug@sad.it>
4976 * src/text.C (NextBreakPoint): added support for needFullRow()
4978 * src/insets/lyxinset.h: added needFullRow()
4980 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4983 * src/insets/insettext.C: lots of changes for update!
4985 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4987 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4989 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4991 * src/insets/insetinclude.C (InsetInclude): fixed
4992 initialization of include_label.
4993 (unique_id): now returns a string.
4995 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4997 * src/LaTeXFeatures.h: new member IncludedFiles, for
4998 a map of key, included file name.
5000 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5001 with the included files for inclusion in SGML preamble,
5002 i. e., linuxdoc and docbook.
5005 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5006 nice (is the generated linuxdoc code to be exported?), that
5007 allows to remove column, and only_body that will be true for
5008 slave documents. Insets are allowed inside SGML font type.
5009 New handling of the SGML preamble for included files.
5010 (makeDocBookFile): the same for docbook.
5012 * src/insets/insetinclude.h:
5013 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5015 (DocBook): new export methods.
5017 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5018 and makeDocBookFile.
5020 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5021 formats to export with command line argument -x.
5023 2000-06-29 Juergen Vigna <jug@sad.it>
5025 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5026 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5028 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5029 region could already been cleared by an inset!
5031 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5033 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5036 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5038 (cursorToggle): remove special handling of lyx focus.
5040 2000-06-28 Juergen Vigna <jug@sad.it>
5042 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5045 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5047 * src/insets/insetindex.C (Edit): add a callback when popup is
5050 * src/insets/insettext.C (LocalDispatch):
5051 * src/insets/insetmarginal.h:
5052 * src/insets/insetlist.h:
5053 * src/insets/insetfoot.h:
5054 * src/insets/insetfloat.h:
5055 * src/insets/insetert.h: add a missing std:: qualifier.
5057 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5059 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5062 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5064 * src/insets/insettext.C (Read): remove tmptok unused variable
5065 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5066 (InsertInset): change for new InsetInset code
5068 * src/insets/insettext.h: add TEXT inline method
5070 * src/insets/insettext.C: remove TEXT macro
5072 * src/insets/insetmarginal.C (Write): new method
5073 (Latex): change output slightly
5075 * src/insets/insetfoot.C (Write): new method
5076 (Latex): change output slightly (don't use endl when no need)
5078 * src/insets/insetert.C (Write): new method
5080 * src/insets/insetcollapsable.h: make button_length, button_top_y
5081 and button_bottm_y protected.
5083 * src/insets/insetcollapsable.C (Write): simplify code by using
5084 tostr. Also do not output the float name, the children class
5085 should to that to get control over own arguments
5087 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5088 src/insets/insetminipage.[Ch]:
5091 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5093 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5095 * src/Makefile.am (lyx_SOURCES): add the new files
5097 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5098 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5099 * src/commandtags.h: ditto
5101 * src/LaTeXFeatures.h: add a std::set of used floattypes
5103 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5105 * src/FloatList.[Ch] src/Floating.h: new files
5107 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5109 * src/lyx_cb.C (TableApplyCB): ditto
5111 * src/text2.C: ditto
5112 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5113 (parseSingleLyXformat2Token): ditto + add code for
5114 backwards compability for old float styles + add code for new insets
5116 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5118 (InsertInset(size_type, Inset *, LyXFont)): new method
5119 (InsetChar(size_type, char)): changed to use the other InsetChar
5120 with a LyXFont(ALL_INHERIT).
5121 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5122 insert the META_INSET.
5124 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5126 * sigc++/thread.h (Threads): from here
5128 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5129 definition out of line
5130 * sigc++/scope.h: from here
5132 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5134 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5135 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5137 * Makefile.am (bindist): new target.
5139 * INSTALL: add instructions for doing a binary distribution.
5141 * development/tools/README.bin.example: update a bit.
5143 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5146 * lib/lyxrc.example: new lyxrc tag \set_color.
5148 * src/lyxfunc.C (Dispatch):
5149 * src/commandtags.h:
5150 * src/LyXAction.C: new lyxfunc "set-color".
5152 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5153 and an x11name given as strings.
5155 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5156 cache when a color is changed.
5158 2000-06-26 Juergen Vigna <jug@sad.it>
5160 * src/lyxrow.C (width): added this functions and variable.
5162 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5165 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5167 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5169 * images/undo_bw.xpm: new icon.
5170 * images/redo_bw.xpm: ditto.
5172 * configure.in (INSTALL_SCRIPT): change value to
5173 ${INSTALL} to avoid failures of install-script target.
5174 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5176 * src/BufferView.h: add a magic "friend" declaration to please
5179 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5181 * forms/cite.fd: modified to allow resizing without messing
5184 * src/insetcite.C: Uses code from cite.fd almost without
5186 User can now resize dialog in the x-direction.
5187 Resizing the dialog in the y-direction is prevented, as the
5188 code does this intelligently already.
5190 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5192 * INSTALL: remove obsolete entry in "problems" section.
5194 * lib/examples/sl_*.lyx: update of the slovenian examples.
5196 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5198 2000-06-23 Juergen Vigna <jug@sad.it>
5200 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5202 * src/buffer.C (resize): delete the LyXText of textinsets.
5204 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5206 * src/insets/lyxinset.h: added another parameter 'cleared' to
5207 the draw() function.
5209 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5210 unlocking inset in inset.
5212 2000-06-22 Juergen Vigna <jug@sad.it>
5214 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5215 of insets and moved first to LyXText.
5217 * src/mathed/formulamacro.[Ch]:
5218 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5220 2000-06-21 Juergen Vigna <jug@sad.it>
5222 * src/text.C (GetVisibleRow): look if I should clear the area or not
5223 using Inset::doClearArea() function.
5225 * src/insets/lyxinset.h: added doClearArea() function and
5226 modified draw(Painter &, ...) to draw(BufferView *, ...)
5228 * src/text2.C (UpdateInset): return bool insted of int
5230 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5232 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5233 combox in the character popup
5235 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5236 BufferParams const & params
5238 2000-06-20 Juergen Vigna <jug@sad.it>
5240 * src/insets/insettext.C (SetParagraphData): set insetowner on
5243 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5245 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5246 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5248 (form_main_): remove
5250 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5251 (create_form_form_main): remove FD_form_main stuff, connect to
5252 autosave_timeout signal
5254 * src/LyXView.[Ch] (getMainForm): remove
5255 (UpdateTimerCB): remove
5256 * src/BufferView_pimpl.h: inherit from SigC::Object
5258 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5259 signal instead of callback
5261 * src/BufferView.[Ch] (cursorToggleCB): remove
5263 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5265 * src/BufferView_pimpl.C: changes because of the one below
5267 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5268 instead of storing a pointer to a LyXText.
5270 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5272 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5274 * src/lyxparagraph.h
5276 * src/paragraph.C: Changed fontlist to a sorted vector.
5278 2000-06-19 Juergen Vigna <jug@sad.it>
5280 * src/BufferView.h: added screen() function.
5282 * src/insets/insettext.C (LocalDispatch): some selection code
5285 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5287 * src/insets/insettext.C (SetParagraphData):
5289 (InsetText): fixes for multiple paragraphs.
5291 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5293 * development/lyx.spec.in: Call configure with ``--without-warnings''
5294 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5295 This should be fine, however, since we generally don't want to be
5296 verbose when making an RPM.
5298 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5300 * lib/scripts/fig2pstex.py: New file
5302 2000-06-16 Juergen Vigna <jug@sad.it>
5304 * src/insets/insettabular.C (UpdateLocal):
5305 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5306 (LocalDispatch): Changed all functions to use LyXText.
5308 2000-06-15 Juergen Vigna <jug@sad.it>
5310 * src/text.C (SetHeightOfRow): call inset::update before requesting
5313 * src/insets/insettext.C (update):
5314 * src/insets/insettabular.C (update): added implementation
5316 * src/insets/lyxinset.h: added update function
5318 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5320 * src/text.C (SelectNextWord): protect against null pointers with
5321 old-style string streams. (fix from Paul Theo Gonciari
5324 * src/cite.[Ch]: remove erroneous files.
5326 * lib/configure.m4: update the list of created directories.
5328 * src/lyxrow.C: include <config.h>
5329 * src/lyxcursor.C: ditto.
5331 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5333 * lib/examples/decimal.lyx: new example file from Mike.
5335 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5336 to find template definitions (from Dekel)
5338 * src/frontends/.cvsignore: add a few things.
5340 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5342 * src/Timeout.C (TimeOut): remove default argument.
5344 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5347 * src/insets/ExternalTemplate.C: add a "using" directive.
5349 * src/lyx_main.h: remove the act_ struct, which seems unused
5352 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5354 * LyX Developers Meeting: All files changed, due to random C++ (by
5355 coincidence) code generator script.
5357 - external inset (cool!)
5358 - initial online editing of preferences
5359 - insettabular breaks insettext(s contents)
5361 - some DocBook fixes
5362 - example files update
5363 - other cool stuff, create a diff and look for yourself.
5365 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5367 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5368 -1 this is a non-line-breaking textinset.
5370 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5371 if there is no width set.
5373 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5375 * Lots of files: Merged the dialogbase branch.
5377 2000-06-09 Allan Rae <rae@lyx.org>
5379 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5380 and the Dispatch methods that used it.
5382 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5383 access to functions formerly kept in Dispatch.
5385 2000-05-19 Allan Rae <rae@lyx.org>
5387 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5388 made to_page and count_copies integers again. from_page remains a
5389 string however because I want to allow entry of a print range like
5390 "1,4,22-25" using this field.
5392 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5393 and printer-params-get. These aren't useful from the minibuffer but
5394 could be used by a script/LyXServer app provided it passes a suitable
5395 auto_mem_buffer. I guess I should take a look at how the LyXServer
5396 works and make it support xtl buffers.
5398 * sigc++/: updated to libsigc++-1.0.1
5400 * src/xtl/: updated to xtl-1.3.pl.11
5402 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5403 those changes done to the files in src/ are actually recreated when
5404 they get regenerated. Please don't ever accept a patch that changes a
5405 dialog unless that patch includes the changes to the corresponding *.fd
5408 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5409 stringOnlyContains, renamed it and generalised it.
5411 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5412 branch. Removed the remaining old form_print code.
5414 2000-04-26 Allan Rae <rae@lyx.org>
5416 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5417 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5419 2000-04-25 Allan Rae <rae@lyx.org>
5421 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5422 against a base of xtl-1.3.pl.4
5424 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5425 filter the Id: entries so they still show the xtl version number
5428 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5429 into the src/xtl code. Patch still pending with José (XTL)
5431 2000-04-24 Allan Rae <rae@lyx.org>
5433 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5434 both more generic and much safer. Use the new template functions.
5435 * src/buffer.[Ch] (Dispatch): ditto.
5437 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5438 and mem buffer more intelligently. Also a little general cleanup.
5441 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5442 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5443 * src/xtl/Makefile.am: ditto.
5444 * src/xtl/.cvsignore: ditto.
5445 * src/Makefile.am: ditto.
5447 * src/PrinterParams.h: Removed the macros member functions. Added a
5448 testInvariant member function. A bit of tidying up and commenting.
5449 Included Angus's idea for fixing operation with egcs-1.1.2.
5451 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5452 cool expansion of XTL's mem_buffer to support automatic memory
5453 management within the buffer itself. Removed the various macros and
5454 replaced them with template functions that use either auto_mem_buffer
5455 or mem_buffer depending on a #define. The mem_buffer support will
5456 disappear as soon as the auto_mem_buffer is confirmed to be good on
5457 other platforms/compilers. That is, it's there so you've got something
5460 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5461 effectively forked XTL. However I expect José will include my code
5462 into the next major release. Also fixed a memory leak.
5463 * src/xtl/text.h: ditto.
5464 * src/xtl/xdr.h: ditto.
5465 * src/xtl/giop.h: ditto.
5467 2000-04-16 Allan Rae <rae@lyx.org>
5469 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5470 by autogen.sh and removed by maintainer-clean anyway.
5471 * .cvsignore, sigc++/.cvsignore: Support the above.
5473 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5475 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5477 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5478 macros, renamed static callback-target member functions to suit new
5479 scheme and made them public.
5480 * src/frontends/xforms/forms/form_print.fd: ditto.
5481 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5483 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5486 * src/xtl/: New directory containing a minimal distribution of XTL.
5487 This is XTL-1.3.pl.4.
5489 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5491 2000-04-15 Allan Rae <rae@lyx.org>
5493 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5495 * sigc++/: Updated to libsigc++-1.0.0
5497 2000-04-14 Allan Rae <rae@lyx.org>
5499 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5500 use the generic ones in future. I'll modify my conversion script.
5502 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5504 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5505 (CloseAllBufferRelatedDialogs): Renamed.
5506 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5508 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5509 of the generic ones. These are the same ones my conversion script
5512 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5513 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5514 * src/buffer.C (Dispatch): ditto
5516 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5517 functions for updating and hiding buffer dependent dialogs.
5518 * src/BufferView.C (buffer): ditto
5519 * src/buffer.C (setReadonly): ditto
5520 * src/lyxfunc.C (CloseBuffer): ditto
5522 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5523 Dialogs.h, and hence all the SigC stuff, into every file that includes
5524 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5526 * src/BufferView2.C: reduce the number of headers included by buffer.h
5528 2000-04-11 Allan Rae <rae@lyx.org>
5530 * src/frontends/xforms/xform_macros.h: A small collection of macros
5531 for building C callbacks.
5533 * src/frontends/xforms/Makefile.am: Added above file.
5535 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5536 scheme again. This time it should work for JMarc. If this is
5537 successful I'll revise my conversion script to automate some of this.
5538 The static member functions in the class also have to be public for
5539 this scheme will work. If the scheme works (it's almost identical to
5540 the way BufferView::cursorToggleCB is handled so it should work) then
5541 FormCopyright and FormPrint will be ready for inclusion into the main
5542 trunk immediately after 1.1.5 is released -- provided we're prepared
5543 for complaints about lame compilers not handling XTL.
5545 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5547 2000-04-07 Allan Rae <rae@lyx.org>
5549 * config/lyxinclude.m4: A bit more tidying up (Angus)
5551 * src/LString.h: JMarc's <string> header fix
5553 * src/PrinterParams.h: Used string for most data to remove some
5554 ugly code in the Print dialog and avoid even uglier code when
5555 appending the ints to a string for output.
5557 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5558 and moved "default:" back to the end of switch statement. Cleaned
5559 up the printing so it uses the right function calls and so the
5560 "print to file" option actually puts the file in the right directory.
5562 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5564 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5565 and Ok+Apply button control into a separate method: input (Angus).
5566 (input) Cleaned it up and improved it to be very thorough now.
5567 (All CB) static_cast used instead of C style cast (Angus). This will
5568 probably change again once we've worked out how to keep gcc-2.8.1 happy
5569 with real C callbacks.
5570 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5571 ignore some of the bool settings and has random numbers instead. Needs
5572 some more investigation. Added other input length checks and checking
5573 of file and printer names.
5575 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5576 would link (Angus). Seems the old code doesn't compile with the pragma
5577 statement either. Separated callback entries from internal methods.
5579 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5581 2000-03-17 Allan Rae <rae@lyx.org>
5583 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5584 need it? Maybe it could go in Dialogs instead? I could make it a
5585 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5586 values to get the bool return value.
5587 (Dispatch): New overloaded method for xtl support.
5589 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5590 extern "C" callback instead of static member functions. Hopefully,
5591 JMarc will be able to compile this. I haven't changed
5592 forms/form_copyright.fd yet. Breaking one of my own rules already.
5594 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5595 because they aren't useful from the minibuffer. Maybe a LyXServer
5596 might want a help message though?
5598 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5600 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5601 xtl which needs both rtti and exceptions.
5603 * src/support/Makefile.am:
5604 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5606 * src/frontends/xforms/input_validators.[ch]: input filters and
5607 validators. These conrol what keys are valid in input boxes.
5608 Use them and write some more. Much better idea than waiting till
5609 after the user has pressed Ok to say that the input fields don't make
5612 * src/frontends/xforms/Makefile.am:
5613 * src/frontends/xforms/forms/form_print.fd:
5614 * src/frontends/xforms/forms/makefile:
5615 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5616 new scheme. Still have to make sure I haven't missed anything from
5617 the current implementation.
5619 * src/Makefile.am, src/PrinterParams.h: New data store.
5621 * other files: Added a couple of copyright notices.
5623 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5625 * src/insets/insetbib.h: move Holder struct in public space.
5627 * src/frontends/include/DialogBase.h: use SigC:: only when
5628 SIGC_CXX_NAMESPACES is defined.
5629 * src/frontends/include/Dialogs.h: ditto.
5631 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5633 * src/frontends/xforms/FormCopyright.[Ch]: do not
5634 mention SigC:: explicitely.
5636 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5638 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5639 deals with testing KDE in main configure.in
5640 * configure.in: ditto.
5642 2000-02-22 Allan Rae <rae@lyx.org>
5644 * Lots of files: Merged from HEAD
5646 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5647 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5649 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5651 * sigc++/: new minidist.
5653 2000-02-14 Allan Rae <rae@lyx.org>
5655 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5657 2000-02-08 Juergen Vigna <jug@sad.it>
5659 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5660 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5662 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5663 for this port and so it is much easier for other people to port
5664 dialogs in a common development environment.
5666 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5667 the QT/KDE implementation.
5669 * src/frontends/kde/Dialogs.C:
5670 * src/frontends/kde/FormCopyright.C:
5671 * src/frontends/kde/FormCopyright.h:
5672 * src/frontends/kde/Makefile.am:
5673 * src/frontends/kde/formcopyrightdialog.C:
5674 * src/frontends/kde/formcopyrightdialog.h:
5675 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5676 for the kde support of the Copyright-Dialog.
5678 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5679 subdir-substitution instead of hardcoded 'xforms' as we now have also
5682 * src/frontends/include/DialogBase.h (Object): just commented the
5683 label after #endif (nasty warning and I don't like warnings ;)
5685 * src/main.C (main): added KApplication initialization if using
5688 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5689 For now only the KDE event-loop is added if frontend==kde.
5691 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5693 * configure.in: added support for the --with-frontend[=value] option
5695 * autogen.sh: added kde.m4 file to list of config-files
5697 * acconfig.h: added define for KDEGUI-support
5699 * config/kde.m4: added configuration functions for KDE-port
5701 * config/lyxinclude.m4: added --with-frontend[=value] option with
5702 support for xforms and KDE.
5704 2000-02-08 Allan Rae <rae@lyx.org>
5706 * all Makefile.am: Fixed up so the make targets dist, distclean,
5707 install and uninstall all work even if builddir != srcdir. Still
5708 have a new sigc++ minidist update to come.
5710 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5712 2000-02-01 Allan Rae <rae@lyx.org>
5714 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5715 Many mods to get builddir != srcdir working.
5717 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5718 for building on NT and so we can do the builddir != srcdir stuff.
5720 2000-01-30 Allan Rae <rae@lyx.org>
5722 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5723 This will stay in "rae" branch. We probably don't really need it in
5724 the main trunk as anyone who wants to help programming it should get
5725 a full library installed also. So they can check both included and
5726 system supplied library compilation.
5728 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5729 Added a 'mini' distribution of libsigc++. If you feel the urge to
5730 change something in these directories - Resist it. If you can't
5731 resist the urge then you should modify the following script and rebuild
5732 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5733 all happen. Still uses a hacked version of libsigc++'s configure.in.
5734 I'm quite happy with the results. I'm not sure the extra work to turn
5735 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5736 worth the trouble and would probably lead to extra maintenance
5738 I haven't tested the following important make targets: install, dist.
5739 Not ready for prime time but very close. Maybe 1.1.5.
5741 * development/tools/makeLyXsigc.sh: A shell script to automatically
5742 generate our mini-dist of libsigc++. It can only be used with a CVS
5743 checkout of libsigc++ not a tarball distribution. It's well commented.
5744 This will end up as part of the libsigc++ distribution so other apps
5745 can easily have an included mini-dist. If someone makes mods to the
5746 sigc++ subpackage without modifying this script to generate those
5747 changes I'll be very upset!
5749 * src/frontends/: Started the gui/system indep structure.
5751 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5752 to access the gui-indep dialogs are in this class. Much improved
5753 design compared to previous revision. Lars, please refrain from
5754 moving this header into src/ like you did with Popups.h last time.
5756 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5758 * src/frontends/xforms/: Started the gui-indep system with a single
5759 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5762 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5763 Here you'll find a very useful makefile and automated fdfix.sh that
5764 makes updating dailogs a no-brainer -- provided you follow the rules
5765 set out in the README. I'm thinking about adding another script to
5766 automatically generate skeleton code for a new dialog given just the
5769 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5770 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5771 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5773 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5775 * src/support/LSubstring.C (operator): simplify
5777 * src/lyxtext.h: removed bparams, use buffer_->params instead
5779 * src/lyxrow.h: make Row a real class, move all variables to
5780 private and use accessors.
5782 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5784 (isRightToLeftPar): ditto
5785 (ChangeLanguage): ditto
5786 (isMultiLingual): ditto
5789 (SimpleTeXOnePar): ditto
5790 (TeXEnvironment): ditto
5791 (GetEndLabel): ditto
5793 (SetOnlyLayout): ditto
5794 (BreakParagraph): ditto
5795 (BreakParagraphConservative): ditto
5796 (GetFontSettings): ditto
5798 (CopyIntoMinibuffer): ditto
5799 (CutIntoMinibuffer): ditto
5800 (PasteParagraph): ditto
5801 (SetPExtraType): ditto
5802 (UnsetPExtraType): ditto
5803 (DocBookContTableRows): ditto
5804 (SimpleDocBookOneTablePar): ditto
5806 (TeXFootnote): ditto
5807 (SimpleTeXOneTablePar): ditto
5808 (TeXContTableRows): ditto
5809 (SimpleTeXSpecialChars): ditto
5812 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5813 to private and use accessors.
5815 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5816 this, we did not use it anymore and has not been for ages. Just a
5817 waste of cpu cycles.
5819 * src/language.h: make Language a real class, move all variables
5820 to private and use accessors.
5822 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5823 (create_view): remove
5824 (update): some changes for new timer
5825 (cursorToggle): use new timer
5826 (beforeChange): change for new timer
5828 * src/BufferView.h (cursorToggleCB): removed last paramter because
5831 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5832 (cursorToggleCB): change because of new timer code
5834 * lib/CREDITS: updated own mailaddress
5836 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5838 * src/support/filetools.C (PutEnv): fix the code in case neither
5839 putenv() nor setenv() have been found.
5841 * INSTALL: mention the install-strip Makefile target.
5843 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5844 read-only documents.
5846 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5848 * lib/reLyX/configure.in (VERSION): avoid using a previously
5849 generated reLyX wrapper to find out $prefix.
5851 * lib/examples/eu_adibide_lyx-atua.lyx:
5852 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5853 translation of the Tutorial (Dooteo)
5855 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5857 * forms/cite.fd: new citation dialog
5859 * src/insetcite.[Ch]: the new citation dialog is moved into
5862 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5865 * src/insets/insetcommand.h: data members made private.
5867 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5869 * LyX 1.1.5 released
5871 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5873 * src/version.h (LYX_RELEASE): to 1.1.5
5875 * src/spellchecker.C (RunSpellChecker): return false if the
5876 spellchecker dies upon creation.
5878 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5880 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5881 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5885 * lib/CREDITS: update entry for Martin Vermeer.
5887 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5889 * src/text.C (draw): Draw foreign language bars at the bottom of
5890 the row instead of at the baseline.
5892 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5894 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5896 * lib/bind/de_menus.bind: updated
5898 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5900 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5902 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5904 * src/menus.C (Limit_string_length): New function
5905 (ShowTocMenu): Limit the number of items/length of items in the
5908 * src/paragraph.C (String): Correct result for a paragraph inside
5911 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5913 * src/bufferlist.C (close): test of buf->getuser() == NULL
5915 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5917 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5918 Do not call to SetCursor when the paragraph is a closed footnote!
5920 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5922 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5925 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5927 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5930 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5931 reference popup, that activates the reference-back action
5933 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5935 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5936 the menus. Also fixed a bug.
5938 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5939 the math panels when switching buffers (unless new buffer is readonly).
5941 * src/BufferView.C (NoSavedPositions)
5942 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5944 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5946 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5947 less of dvi dirty or not.
5949 * src/trans_mgr.[Ch] (insert): change first parameter to string
5952 * src/chset.[Ch] (encodeString): add const to first parameter
5954 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5956 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5960 * src/LaTeX.C (deplog): better searching for dependency files in
5961 the latex log. Uses now regexps.
5963 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5964 instead of the box hack or \hfill.
5966 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5968 * src/lyxfunc.C (doImportHelper): do not create the file before
5969 doing the actual import.
5970 (doImportASCIIasLines): create a new file before doing the insert.
5971 (doImportASCIIasParagraphs): ditto.
5973 * lib/lyxrc.example: remove mention of non-existing commands
5975 * lyx.man: remove mention of color-related switches.
5977 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5979 * src/lyx_gui.C: remove all the color-related ressources, which
5980 are not used anymore.
5982 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5985 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5987 * src/lyxrc.C (read): Add a missing break in the switch
5989 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5991 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5993 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5996 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5998 * src/text.C (draw): draw bars under foreign language words.
6000 * src/LColor.[Ch]: add LColor::language
6002 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6004 * src/lyxcursor.h (boundary): New member variable
6006 * src/text.C (IsBoundary): New methods
6008 * src/text.C: Use the above for currect cursor movement when there
6009 is both RTL & LTR text.
6011 * src/text2.C: ditto
6013 * src/bufferview_funcs.C (ToggleAndShow): ditto
6015 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6017 * src/text.C (DeleteLineForward): set selection to true to avoid
6018 that DeleteEmptyParagraphMechanism does some magic. This is how it
6019 is done in all other functions, and seems reasonable.
6020 (DeleteWordForward): do not jump over non-word stuff, since
6021 CursorRightOneWord() already does it.
6023 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6024 DeleteWordBackward, since they seem safe to me (since selection is
6025 set to "true") DeleteEmptyParagraphMechanism does nothing.
6027 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6029 * src/lyx_main.C (easyParse): simplify the code by factoring the
6030 part that removes parameters from the command line.
6031 (LyX): check wether wrong command line options have been given.
6033 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6035 * src/lyx_main.C : add support for specifying user LyX
6036 directory via command line option -userdir.
6038 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6040 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6041 the number of items per popup.
6042 (Add_to_refs_menu): Ditto.
6044 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6046 * src/lyxparagraph.h: renamed ClearParagraph() to
6047 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6048 textclass as parameter, and do nothing if free_spacing is
6049 true. This fixes part of the line-delete-forward problems.
6051 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6052 (pasteSelection): ditto.
6053 (SwitchLayoutsBetweenClasses): more translatable strings.
6055 * src/text2.C (CutSelection): use StripLeadingSpaces.
6056 (PasteSelection): ditto.
6057 (DeleteEmptyParagraphMechanism): ditto.
6059 2000-05-26 Juergen Vigna <jug@sad.it>
6061 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6062 is not needed in tabular insets.
6064 * src/insets/insettabular.C (TabularFeatures): added missing features.
6066 * src/tabular.C (DeleteColumn):
6068 (AppendRow): implemented this functions
6069 (cellsturct::operator=): clone the inset too;
6071 2000-05-23 Juergen Vigna <jug@sad.it>
6073 * src/insets/insettabular.C (LocalDispatch): better selection support
6074 when having multicolumn-cells.
6076 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6078 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6080 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6082 * src/ColorHandler.C (getGCForeground): put more test into _()
6084 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6087 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6090 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6092 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6093 there are no labels, or when buffer is readonly.
6095 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6096 there are no labels, buffer is SGML, or when buffer is readonly.
6098 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6100 * src/LColor.C (LColor): change a couple of grey40 to grey60
6101 (LColor): rewore initalization to make compiles go some magnitude
6103 (getGUIName): don't use gettext until we need the string.
6105 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6107 * src/Bullet.[Ch]: Fixed a small bug.
6109 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6111 * src/paragraph.C (String): Several fixes/improvements
6113 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6115 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6117 * src/paragraph.C (String): give more correct output.
6119 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6121 * src/lyxfont.C (stateText) Do not output the language if it is
6122 eqaul to the language of the document.
6124 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6125 between two paragraphs with the same language.
6127 * src/paragraph.C (getParLanguage) Return a correct answer for an
6128 empty dummy paragraph.
6130 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6133 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6136 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6137 the menus/popup, if requested fonts are unavailable.
6139 2000-05-22 Juergen Vigna <jug@sad.it>
6141 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6142 movement support (Up/Down/Tab/Shift-Tab).
6143 (LocalDispatch): added also preliminari cursor-selection.
6145 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6147 * src/paragraph.C (PasteParagraph): Hopefully now right!
6149 2000-05-22 Garst R. Reese <reese@isn.net>
6151 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6152 of list, change all references to Environment to Command
6153 * tex/hollywood.cls : rewrite environments as commands, add
6154 \uppercase to interiorshot and exteriorshot to force uppecase.
6155 * tex/broadway.cls : rewrite environments as commands. Tweak
6158 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6160 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6161 size of items: use a constant intead of the hardcoded 40, and more
6162 importantly do not remove the %m and %x tags added at the end.
6163 (Add_to_refs_menu): use vector::size_type instead of
6164 unsigned int as basic types for the variables. _Please_ do not
6165 assume that size_t is equal to unsigned int. On an alpha, this is
6166 unsigned long, which is _not_ the same.
6168 * src/language.C (initL): remove language "hungarian", since it
6169 seems that "magyar" is better.
6171 2000-05-22 Juergen Vigna <jug@sad.it>
6173 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6175 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6178 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6179 next was deleted but not set to 0.
6181 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6183 * src/language.C (initL): change the initialization of languages
6184 so that compiles goes _fast_.
6186 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6189 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6191 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6195 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6197 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6199 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6203 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6206 * src/insets/insetlo*.[Ch]: Made editable
6208 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6210 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6211 the current selection.
6213 * src/BufferView_pimpl.C (stuffClipboard): new method
6215 * src/BufferView.C (stuffClipboard): new method
6217 * src/paragraph.C (String): new method
6219 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6220 LColor::ignore when lyxname is not found.
6222 * src/BufferView.C (pasteSelection): new method
6224 * src/BufferView_pimpl.C (pasteSelection): new method
6226 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6228 * src/WorkArea.C (request_clipboard_cb): new static function
6229 (getClipboard): new method
6230 (putClipboard): new method
6232 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6234 * LyX 1.1.5pre2 released
6236 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6238 * src/vspace.C (operator=): removed
6239 (operator=): removed
6241 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6243 * src/layout.C (NumberOfClass): manually set the type in make_pair
6244 (NumberOfLayout): ditto
6246 * src/language.C: use the Language constructor for ignore_lang
6248 * src/language.h: add constructors to struct Language
6250 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6252 * src/text2.C (SetCursorIntern): comment out #warning
6254 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6256 * src/mathed/math_iter.h: initialize sx and sw to 0
6258 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6260 * forms/lyx.fd: Redesign of form_ref
6262 * src/LaTeXFeatures.[Ch]
6266 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6269 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6270 and Buffer::inset_iterator.
6272 * src/menus.C: Added new menus: TOC and Refs.
6274 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6276 * src/buffer.C (getTocList): New method.
6278 * src/BufferView2.C (ChangeRefs): New method.
6280 * src/buffer.C (getLabelList): New method. It replaces the old
6281 getReferenceList. The return type is vector<string> instead of
6284 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6285 the old getLabel() and GetNumberOfLabels() methods.
6286 * src/insets/insetlabel.C (getLabelList): ditto
6287 * src/mathed/formula.C (getLabelList): ditto
6289 * src/paragraph.C (String): New method.
6291 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6292 Uses the new getTocList() method.
6293 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6294 which automatically updates the contents of the browser.
6295 (RefUpdateCB): Use the new getLabelList method.
6297 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6299 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6301 * src/spellchecker.C: Added using std::reverse;
6303 2000-05-19 Juergen Vigna <jug@sad.it>
6305 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6307 * src/insets/insettext.C (computeTextRows): small fix for display of
6308 1 character after a newline.
6310 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6313 2000-05-18 Juergen Vigna <jug@sad.it>
6315 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6316 when changing width of column.
6318 * src/tabular.C (set_row_column_number_info): setting of
6319 autobreak rows if necessary.
6321 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6323 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6325 * src/vc-backend.*: renamed stat() to status() and vcstat to
6326 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6327 compilation broke. The new name seems more relevant, anyway.
6329 2000-05-17 Juergen Vigna <jug@sad.it>
6331 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6332 which was wrong if the removing caused removing of rows!
6334 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6335 (pushToken): new function.
6337 * src/text2.C (CutSelection): fix problem discovered with purify
6339 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6341 * src/debug.C (showTags): enlarge the first column, now that we
6342 have 6-digits debug codes.
6344 * lib/layouts/hollywood.layout:
6345 * lib/tex/hollywood.cls:
6346 * lib/tex/brodway.cls:
6347 * lib/layouts/brodway.layout: more commands and fewer
6348 environments. Preambles moved in the .cls files. Broadway now has
6349 more options on scene numbering and less whitespace (from Garst)
6351 * src/insets/insetbib.C (getKeys): make sure that we are in the
6352 document directory, in case the bib file is there.
6354 * src/insets/insetbib.C (Latex): revert bogus change.
6356 2000-05-16 Juergen Vigna <jug@sad.it>
6358 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6359 the TabularLayout on cursor move.
6361 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6363 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6366 (draw): fixed cursor position and drawing so that the cursor is
6367 visible when before the tabular-inset.
6369 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6370 when creating from old insettext.
6372 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6374 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6376 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6377 * lib/tex/brodway.cls: ditto
6379 * lib/layouts/brodway.layout: change alignment of parenthical
6382 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6384 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6385 versions 0.88 and 0.89 are supported.
6387 2000-05-15 Juergen Vigna <jug@sad.it>
6389 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6392 * src/insets/insettext.C (computeTextRows): redone completely this
6393 function in a much cleaner way, because of problems when having a
6395 (draw): added a frame border when the inset is locked.
6396 (SetDrawLockedFrame): this sets if we draw the border or not.
6397 (SetFrameColor): this sets the frame color (default=insetframe).
6399 * src/insets/lyxinset.h: added x() and y() functions which return
6400 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6401 function which is needed to see if we have a locking inset of some
6402 type in this inset (needed for now in insettabular).
6404 * src/vspace.C (inPixels): the same function also without a BufferView
6405 parameter as so it is easier to use it in some ocasions.
6407 * src/lyxfunc.C: changed all places where insertInset was used so
6408 that now if it couldn't be inserted it is deleted!
6410 * src/TabularLayout.C:
6411 * src/TableLayout.C: added support for new tabular-inset!
6413 * src/BufferView2.C (insertInset): this now returns a bool if the
6414 inset was really inserted!!!
6416 * src/tabular.C (GetLastCellInRow):
6417 (GetFirstCellInRow): new helper functions.
6418 (Latex): implemented for new tabular class.
6422 (TeXTopHLine): new Latex() helper functions.
6424 2000-05-12 Juergen Vigna <jug@sad.it>
6426 * src/mathed/formulamacro.C (Read):
6427 * src/mathed/formula.C (Read): read also the \end_inset here!
6429 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6431 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6432 crush when saving formulae with unbalanced parenthesis.
6434 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6436 * src/layout.C: Add new keyword "endlabelstring" to layout file
6438 * src/text.C (GetVisibleRow): Draw endlabel string.
6440 * lib/layouts/broadway.layout
6441 * lib/layouts/hollywood.layout: Added endlabel for the
6442 Parenthetical layout.
6444 * lib/layouts/heb-article.layout: Do not use slanted font shape
6445 for Theorem like environments.
6447 * src/buffer.C (makeLaTeXFile): Always add "american" to
6448 the UsedLanguages list if document language is RTL.
6450 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6452 * add addendum to README.OS2 and small patch (from SMiyata)
6454 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6456 * many files: correct the calls to ChangeExtension().
6458 * src/support/filetools.C (ChangeExtension): remove the no_path
6459 argument, which does not belong there. Use OnlyFileName() instead.
6461 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6462 files when LaTeXing a non-nice latex file.
6464 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6465 a chain of "if". Return false when deadkeys are not handled.
6467 * src/lyx_main.C (LyX): adapted the code for default bindings.
6469 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6470 bindings for basic functionality (except deadkeys).
6471 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6473 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6474 several methods: handle override_x_deadkeys.
6476 * src/lyxrc.h: remove the "bindings" map, which did not make much
6477 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6479 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6481 * src/lyxfont.C (stateText): use a saner method to determine
6482 whether the font is "default". Seems to fix the crash with DEC
6485 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6487 2000-05-08 Juergen Vigna <jug@sad.it>
6489 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6490 TabularLayoutMenu with mouse-button-3
6491 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6493 * src/TabularLayout.C: added this file for having a Layout for
6496 2000-05-05 Juergen Vigna <jug@sad.it>
6498 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6499 recalculating inset-widths.
6500 (TabularFeatures): activated this function so that I can change
6501 tabular-features via menu.
6503 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6504 that I can test some functions with the Table menu.
6506 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6508 * src/lyxfont.C (stateText): guard against stupid c++libs.
6510 * src/tabular.C: add using std::vector
6511 some whitespace changes, + removed som autogenerated code.
6513 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6515 2000-05-05 Juergen Vigna <jug@sad.it>
6517 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6518 row, columns and cellstructures.
6520 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6522 * lib/lyxrc.example: remove obsolete entries.
6524 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6525 reading of protected_separator for free_spacing.
6527 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6529 * src/text.C (draw): do not display an exclamation mark in the
6530 margin for margin notes. This is confusing, ugly and
6533 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6534 AMS math' is checked.
6536 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6537 name to see whether including the amsmath package is needed.
6539 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6541 * src/paragraph.C (validate): Compute UsedLanguages correctly
6542 (don't insert the american language if it doesn't appear in the
6545 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6546 The argument of \thanks{} command is considered moving argument
6548 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6551 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6553 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6554 for appendix/minipage/depth. The lines can be now both in the footnote
6555 frame, and outside the frame.
6557 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6560 2000-05-05 Juergen Vigna <jug@sad.it>
6562 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6563 neede only in tabular.[Ch].
6565 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6567 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6569 (Write): write '~' for PROTECTED_SEPARATOR
6571 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6573 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6576 * src/mathed/formula.C (drawStr): rename size to siz.
6578 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6579 possibly fix a bug by not changing the pflags = flags to piflags =
6582 2000-05-05 Juergen Vigna <jug@sad.it>
6584 * src/insets/insetbib.C: moved using directive
6586 * src/ImportNoweb.C: small fix for being able to compile (missing
6589 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6591 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6592 to use clear, since we don't depend on this in the code. Add test
6595 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6597 * (various *.C files): add using std::foo directives to please dec
6600 * replace calls to string::clear() to string::erase() (Angus)
6602 * src/cheaders/cmath: modified to provide std::abs.
6604 2000-05-04 Juergen Vigna <jug@sad.it>
6606 * src/insets/insettext.C: Prepared all for inserting of multiple
6607 paragraphs. Still display stuff to do (alignment and other things),
6608 but I would like to use LyXText to do this when we cleaned out the
6609 table-support stuff.
6611 * src/insets/insettabular.C: Changed lot of stuff and added lots
6612 of functionality still a lot to do.
6614 * src/tabular.C: Various functions changed name and moved to be
6615 const functions. Added new Read and Write functions and changed
6616 lots of things so it works good with tabular-insets (also removed
6617 some stuff which is not needed anymore * hacks *).
6619 * src/lyxcursor.h: added operators == and != which just look if
6620 par and pos are (not) equal.
6622 * src/buffer.C (latexParagraphs): inserted this function to latex
6623 all paragraphs form par to endpar as then I can use this too for
6626 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6627 so that I can call this to from text insets with their own cursor.
6629 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6630 output off all paragraphs (because of the fix below)!
6632 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6633 the very last paragraph (this could be also the last paragraph of an
6636 * src/texrow.h: added rows() call which returns the count-variable.
6638 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6640 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6642 * lib/configure.m4: better autodetection of DocBook tools.
6644 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6646 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6648 * src/lyx_cb.C: add using std::reverse;
6650 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6653 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6654 selected files. Should fix repeated errors from generated files.
6656 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6658 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6660 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6661 the spellchecker popup.
6663 * lib/lyxrc.example: Removed the \number_inset section
6665 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6667 * src/insets/figinset.C (various): Use IsFileReadable() to make
6668 sure that the file actually exist. Relying on ghostscripts errors
6669 is a bad idea since they can lead to X server crashes.
6671 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6673 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6676 * lib/lyxrc.example: smallish typo in description of
6677 \view_dvi_paper_option
6679 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6682 * src/lyxfunc.C: doImportHelper to factor out common code of the
6683 various import methods. New functions doImportASCIIasLines,
6684 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6685 doImportLinuxDoc for the format specific parts.
6688 * buffer.C: Dispatch returns now a bool to indicate success
6691 * lyx_gui.C: Add getLyXView() for member access
6693 * lyx_main.C: Change logic for batch commands: First try
6694 Buffer::Dispatch (possibly without GUI), if that fails, use
6697 * lyx_main.C: Add support for --import command line switch.
6698 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6699 Available Formats: Everything accepted by 'buffer-import <format>'
6701 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6703 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6706 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6707 documents will be reformatted upon reentry.
6709 2000-04-27 Juergen Vigna <jug@sad.it>
6711 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6712 correctly only last pos this was a bug.
6714 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6716 * release of lyx-1.1.5pre1
6718 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6720 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6722 * src/menus.C: revert the change of naming (Figure->Graphic...)
6723 from 2000-04-11. It was incomplete and bad.
6725 * src/LColor.[Ch]: add LColor::depthbar.
6726 * src/text.C (GetVisibleRow): use it.
6728 * README: update the languages list.
6730 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6732 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6735 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6737 * README: remove sections that were just wrong.
6739 * src/text2.C (GetRowNearY): remove currentrow code
6741 * src/text.C (GetRow): remove currentrow code
6743 * src/screen.C (Update): rewritten a bit.
6744 (SmallUpdate): removed func
6746 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6748 (FullRebreak): return bool
6749 (currentrow): remove var
6750 (currentrow_y): ditto
6752 * src/lyxscreen.h (Draw): change arg to unsigned long
6753 (FitCursor): return bool
6754 (FitManualCursor): ditto
6755 (Smallpdate): remove func
6756 (first): change to unsigned long
6757 (DrawOneRow): change second arg to long (from long &)
6758 (screen_refresh_y): remove var
6759 (scree_refresh_row): ditto
6761 * src/lyxrow.h: change baseline to usigned int from unsigned
6762 short, this brings some implicit/unsigned issues out in the open.
6764 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6766 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6767 instead of smallUpdate.
6769 * src/lyxcursor.h: change y to unsigned long
6771 * src/buffer.h: don't call updateScrollbar after fitcursor
6773 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6774 where they are used. Removed "\\direction", this was not present
6775 in 1.1.4 and is already obsolete. Commented out some code that I
6776 believe to never be called.
6777 (runLiterate): don't call updateScrollbar after fitCursor
6779 (buildProgram): ditto
6782 * src/WorkArea.h (workWidth): change return val to unsigned
6785 (redraw): remove the button redraws
6786 (setScrollbarValue): change for scrollbar
6787 (getScrollbarValue): change for scrollbar
6788 (getScrollbarBounds): change for scrollbar
6790 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6791 (C_WorkArea_down_cb): removed func
6792 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6793 (resize): change for scrollbar
6794 (setScrollbar): ditto
6795 (setScrollbarBounds): ditto
6796 (setScrollbarIncrements): ditto
6797 (up_cb): removed func
6798 (down_cb): removed func
6799 (scroll_cb): change for scrollbar
6800 (work_area_handler): ditto
6802 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6803 when FitCursor did something.
6804 (updateScrollbar): some unsigned changes
6805 (downCB): removed func
6806 (scrollUpOnePage): removed func
6807 (scrollDownOnePage): remvoed func
6808 (workAreaMotionNotify): don't call screen->FitCursor but use
6809 fitCursor instead. and bool return val
6810 (workAreaButtonPress): ditto
6811 (workAreaButtonRelease): some unsigned changes
6812 (checkInsetHit): ditto
6813 (workAreaExpose): ditto
6814 (update): parts rewritten, comments about the signed char arg added
6815 (smallUpdate): removed func
6816 (cursorPrevious): call needed updateScrollbar
6819 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6822 * src/BufferView.[Ch] (upCB): removed func
6823 (downCB): removed func
6824 (smallUpdate): removed func
6826 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6828 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6829 currentrow, currentrow_y optimization. This did not help a lot and
6830 if we want to do this kind of optimization we should rather use
6831 cursor.row instead of the currentrow.
6833 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6834 buffer spacing and klyx spacing support.
6836 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6838 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6841 2000-04-26 Juergen Vigna <jug@sad.it>
6843 * src/insets/figinset.C: fixes to Lars sstream changes!
6845 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6847 * A lot of files: Added Ascii(ostream &) methods to all inset
6848 classes. Used when exporting to ASCII.
6850 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6851 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6854 * src/text2.C (ToggleFree): Disabled implicit word selection when
6855 there is a change in the language
6857 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6858 no output was generated for end-of-sentence inset.
6860 * src/insets/lyxinset.h
6863 * src/paragraph.C: Removed the insetnumber code
6865 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6867 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6869 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6870 no_babel and no_epsfig completely from the file.
6871 (parseSingleLyXformat2Token): add handling for per-paragraph
6872 spacing as written by klyx.
6874 * src/insets/figinset.C: applied patch by Andre. Made it work with
6877 2000-04-20 Juergen Vigna <jug@sad.it>
6879 * src/insets/insettext.C (cutSelection):
6880 (copySelection): Fixed with selection from right to left.
6881 (draw): now the rows are not recalculated at every draw.
6882 (computeTextRows): for now reset the inset-owner here (this is
6883 important for an undo or copy where the inset-owner is not set
6886 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6887 motion to the_locking_inset screen->first was forgotten, this was
6888 not important till we got multiline insets.
6890 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6892 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6893 code seems to be alright (it is code changed by Dekel, and the
6894 intent is indeed that all macros should be defined \protect'ed)
6896 * NEWS: a bit of reorganisation of the new user-visible features.
6898 2000-04-19 Juergen Vigna <jug@sad.it>
6900 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6901 position. Set the inset_owner of the used paragraph so that it knows
6902 that it is inside an inset. Fixed cursor handling with mouse and
6903 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6904 and cleanups to make TextInsets work better.
6906 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6907 Changed parameters of various functions and added LockInsetInInset().
6909 * src/insets/insettext.C:
6911 * src/insets/insetcollapsable.h:
6912 * src/insets/insetcollapsable.C:
6913 * src/insets/insetfoot.h:
6914 * src/insets/insetfoot.C:
6915 * src/insets/insetert.h:
6916 * src/insets/insetert.C: cleaned up the code so that it works now
6917 correctly with insettext.
6919 * src/insets/inset.C:
6920 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6921 that insets in insets are supported right.
6924 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6926 * src/paragraph.C: some small fixes
6928 * src/debug.h: inserted INSETS debug info
6930 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6931 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6933 * src/commandtags.h:
6934 * src/LyXAction.C: insert code for InsetTabular.
6936 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6937 not Button1MotionMask.
6938 (workAreaButtonRelease): send always a InsetButtonRelease event to
6940 (checkInsetHit): some setCursor fixes (always with insets).
6942 * src/BufferView2.C (lockInset): returns a bool now and extended for
6943 locking insets inside insets.
6944 (showLockedInsetCursor): it is important to have the cursor always
6945 before the locked inset.
6946 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6948 * src/BufferView.h: made lockInset return a bool.
6950 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6952 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6953 that is used also internally but can be called as public to have back
6954 a cursor pos which is not set internally.
6955 (SetCursorIntern): Changed to use above function.
6957 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6959 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6964 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6965 patches for things that should be in or should be changed.
6967 * src/* [insetfiles]: change "usigned char fragile" to bool
6968 fragile. There was only one point that could that be questioned
6969 and that is commented in formulamacro.C. Grep for "CHECK".
6971 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6972 (DeleteBuffer): take it out of CutAndPaste and make it static.
6974 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6976 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6977 output the spacing envir commands. Also the new commands used in
6978 the LaTeX output makes the result better.
6980 * src/Spacing.C (writeEnvirBegin): new method
6981 (writeEnvirEnd): new method
6983 2000-04-18 Juergen Vigna <jug@sad.it>
6985 * src/CutAndPaste.C: made textclass a static member of the class
6986 as otherwise it is not accesed right!!!
6988 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6990 * forms/layout_forms.fd
6991 * src/layout_forms.h
6992 * src/layout_forms.C (create_form_form_character)
6993 * src/lyx_cb.C (UserFreeFont)
6994 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6995 documents (in the layout->character popup).
6997 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6999 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7000 \spell_command was in fact not honored (from Kevin Atkinson).
7002 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7005 * src/lyx_gui.h: make lyxViews private (Angus)
7007 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7009 * src/mathed/math_write.C
7010 (MathMatrixInset::Write) Put \protect before \begin{array} and
7011 \end{array} if fragile
7012 (MathParInset::Write): Put \protect before \\ if fragile
7014 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7016 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7017 initialization if the LyXColorHandler must be done after the
7018 connections to the XServer has been established.
7020 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7021 get the background pixel from the lyxColorhandler so that the
7022 figures are rendered with the correct background color.
7023 (NextToken): removed functions.
7024 (GetPSSizes): use ifs >> string instead of NextToken.
7026 * src/Painter.[Ch]: the color cache moved out of this file.
7028 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7031 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7033 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7034 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7036 * src/BufferView.C (enterView): new func
7037 (leaveView): new func
7039 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7041 (leaveView): new func, undefines xterm cursor when approp.
7043 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7044 (AllowInput): delete the Workarea cursor handling from this func.
7046 * src/Painter.C (underline): draw a slimer underline in most cases.
7048 * src/lyx_main.C (error_handler): use extern "C"
7050 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7052 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7053 sent directly to me.
7055 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7056 to the list by Dekel.
7058 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7061 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7062 methods from lyx_cb.here.
7064 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7067 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7069 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7070 instead of using current_view directly.
7072 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7074 * src/LyXAction.C (init): add the paragraph-spacing command.
7076 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7078 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7080 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7081 different from the documents.
7083 * src/text.C (SetHeightOfRow): take paragraph spacing into
7084 account, paragraph spacing takes precedence over buffer spacing
7085 (GetVisibleRow): ditto
7087 * src/paragraph.C (writeFile): output the spacing parameter too.
7088 (validate): set the correct features if spacing is used in the
7090 (Clear): set spacing to default
7091 (MakeSameLayout): spacing too
7092 (HasSameLayout): spacing too
7093 (SetLayout): spacing too
7094 (TeXOnePar): output the spacing commands
7096 * src/lyxparagraph.h: added a spacing variable for use with
7097 per-paragraph spacing.
7099 * src/Spacing.h: add a Default spacing and a method to check if
7100 the current spacing is default. also added an operator==
7102 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7105 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7107 * src/lyxserver.C (callback): fix dispatch of functions
7109 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7110 printf() into lyxerr call.
7112 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7115 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7116 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7117 the "Float" from each of the subitems.
7118 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7120 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7121 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7122 documented the change so that the workaround can be nuked later.
7124 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7127 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7129 * src/buffer.C (getLatexName): ditto
7130 (setReadonly): ditto
7132 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7134 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7135 avoid some uses of current_view. Added also a bufferParams()
7136 method to get at this.
7138 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7140 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7142 * src/lyxparagraph.[Ch]: removed
7143 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7144 with operators used by lower_bound and
7145 upper_bound in InsetTable's
7146 Make struct InsetTable private again. Used matchpos.
7148 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7150 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7151 document, the language of existing text is changed (unless the
7152 document is multi-lingual)
7154 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7156 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7158 * A lot of files: A rewrite of the Right-to-Left support.
7160 2000-04-10 Juergen Vigna <jug@sad.it>
7162 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7163 misplaced cursor when inset in inset is locked.
7165 * src/insets/insettext.C (LocalDispatch): small fix so that a
7166 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7168 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7169 footnote font should be decreased in size twice when displaying.
7171 * src/insets/insettext.C (GetDrawFont): inserted this function as
7172 the drawing-font may differ from the real paragraph font.
7174 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7175 insets (inset in inset!).
7177 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7178 function here because we don't want footnotes inside footnotes.
7180 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7182 (init): now set the inset_owner in paragraph.C
7183 (LocalDispatch): added some resetPos() in the right position
7186 (pasteSelection): changed to use the new CutAndPaste-Class.
7188 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7189 which tells if it is allowed to insert another inset inside this one.
7191 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7192 SwitchLayoutsBetweenClasses.
7194 * src/text2.C (InsertInset): checking of the new paragraph-function
7196 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7197 is not needed anymore here!
7200 (PasteSelection): redone (also with #ifdef) so that now this uses
7201 the CutAndPaste-Class.
7202 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7205 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7206 from/to text/insets.
7208 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7209 so that the paragraph knows if it is inside an (text)-inset.
7210 (InsertFromMinibuffer): changed return-value to bool as now it
7211 may happen that an inset is not inserted in the paragraph.
7212 (InsertInsetAllowed): this checks if it is allowed to insert an
7213 inset in this paragraph.
7215 (BreakParagraphConservative):
7216 (BreakParagraph) : small change for the above change of the return
7217 value of InsertFromMinibuffer.
7219 * src/lyxparagraph.h: added inset_owner and the functions to handle
7220 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7222 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7224 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7225 functions from BufferView to BufferView::Pimpl to ease maintence.
7227 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7228 correctly. Also use SetCursorIntern instead of SetCursor.
7230 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7233 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7235 * src/WorkArea.C (belowMouse): manually implement below mouse.
7237 * src/*: Add "explicit" on several constructors, I added probably
7238 some unneeded ones. A couple of changes to code because of this.
7240 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7241 implementation and private parts from the users of BufferView. Not
7244 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7245 implementation and private parts from the users of LyXLex. Not
7248 * src/BufferView_pimpl.[Ch]: new files
7250 * src/lyxlex_pimpl.[Ch]: new files
7252 * src/LyXView.[Ch]: some inline functions move out-of-line
7254 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7256 * src/lyxparagraph.h: make struct InsetTable public.
7258 * src/support/lyxstring.h: change lyxstring::difference_type to be
7259 ptrdiff_t. Add std:: modifiers to streams.
7261 * src/font.C: include the <cctype> header, for islower() and
7264 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7266 * src/font.[Ch]: new files. Contains the metric functions for
7267 fonts, takes a LyXFont as parameter. Better separation of concepts.
7269 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7270 changes because of this.
7272 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7274 * src/*: compile with -Winline and move functions that don't
7277 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7280 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7282 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7283 (various files changed because of this)
7285 * src/Painter.C (text): fixed the drawing of smallcaps.
7287 * src/lyxfont.[Ch] (drawText): removed unused member func.
7290 * src/*.C: added needed "using" statements and "std::" qualifiers.
7292 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7294 * src/*.h: removed all use of "using" from header files use
7295 qualifier std:: instead.
7297 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7299 * src/text.C (Backspace): some additional cleanups (we already
7300 know whether cursor.pos is 0 or not).
7302 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7303 automake does not provide one).
7305 * src/bmtable.h: replace C++ comments with C comments.
7307 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7309 * src/screen.C (ShowCursor): Change the shape of the cursor if
7310 the current language is not equal to the language of the document.
7311 (If the cursor change its shape unexpectedly, then you've found a bug)
7313 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7316 * src/insets/insetnumber.[Ch]: New files.
7318 * src/LyXAction.C (init)
7319 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7322 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7324 * src/lyxparagraph.h
7325 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7326 (the vector is kept sorted).
7328 * src/text.C (GetVisibleRow): Draw selection correctly when there
7329 is both LTR and RTL text.
7331 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7332 which is much faster.
7334 * src/text.C (GetVisibleRow and other): Do not draw the last space
7335 in a row if the direction of the last letter is not equal to the
7336 direction of the paragraph.
7338 * src/lyxfont.C (latexWriteStartChanges):
7339 Check that font language is not equal to basefont language.
7340 (latexWriteEndChanges): ditto
7342 * src/lyx_cb.C (StyleReset): Don't change the language while using
7343 the font-default command.
7345 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7346 empty paragraph before a footnote.
7348 * src/insets/insetcommand.C (draw): Increase x correctly.
7350 * src/screen.C (ShowCursor): Change cursor shape if
7351 current language != document language.
7353 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7355 2000-03-31 Juergen Vigna <jug@sad.it>
7357 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7358 (Clone): changed mode how the paragraph-data is copied to the
7359 new clone-paragraph.
7361 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7362 GetInset(pos) with no inset anymore there (in inset UNDO)
7364 * src/insets/insetcommand.C (draw): small fix as here x is
7365 incremented not as much as width() returns (2 before, 2 behind = 4)
7367 2000-03-30 Juergen Vigna <jug@sad.it>
7369 * src/insets/insettext.C (InsetText): small fix in initialize
7370 widthOffset (should not be done in the init() function)
7372 2000-03-29 Amir Karger <karger@lyx.org>
7374 * lib/examples/it_ItemizeBullets.lyx: translation by
7377 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7379 2000-03-29 Juergen Vigna <jug@sad.it>
7381 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7383 * src/insets/insetfoot.C (Clone): small change as for the below
7384 new init function in the text-inset
7386 * src/insets/insettext.C (init): new function as I've seen that
7387 clone did not copy the Paragraph-Data!
7388 (LocalDispatch): Added code so that now we have some sort of Undo
7389 functionality (well actually we HAVE Undo ;)
7391 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7393 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7395 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7398 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7400 * src/main.C: added a runtime check that verifies that the xforms
7401 header used when building LyX and the library used when running
7402 LyX match. Exit with a message if they don't match. This is a
7403 version number check only.
7405 * src/buffer.C (save): Don't allocate memory on the heap for
7406 struct utimbuf times.
7408 * *: some using changes, use iosfwd instead of the real headers.
7410 * src/lyxfont.C use char const * instead of string for the static
7411 strings. Rewrite some functions to use sstream.
7413 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7415 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7418 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7420 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7421 of Geodesy (from Martin Vermeer)
7423 * lib/layouts/svjour.inc: include file for the Springer svjour
7424 class. It can be used to support journals other than JoG.
7426 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7427 Miskiewicz <misiek@pld.org.pl>)
7428 * lib/reLyX/Makefile.am: ditto.
7430 2000-03-27 Juergen Vigna <jug@sad.it>
7432 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7433 also some modifications with operations on selected text.
7435 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7436 problems with clicking on insets (last famous words ;)
7438 * src/insets/insetcommand.C (draw):
7439 (width): Changed to have a bit of space before and after the inset so
7440 that the blinking cursor can be seen (otherwise it was hidden)
7442 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7444 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7445 would not be added to the link list when an installed gettext (not
7446 part of libc) is found.
7448 2000-03-24 Juergen Vigna <jug@sad.it>
7450 * src/insets/insetcollapsable.C (Edit):
7451 * src/mathed/formula.C (InsetButtonRelease):
7452 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7455 * src/BufferView.C (workAreaButtonPress):
7456 (workAreaButtonRelease):
7457 (checkInsetHit): Finally fixed the clicking on insets be handled
7460 * src/insets/insetert.C (Edit): inserted this call so that ERT
7461 insets work always with LaTeX-font
7463 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7465 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7466 caused lyx to startup with no GUI in place, causing in a crash
7467 upon startup when called with arguments.
7469 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7471 * src/FontLoader.C: better initialization of dummyXFontStruct.
7473 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7475 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7476 for linuxdoc and docbook import and export format options.
7478 * lib/lyxrc.example Example of default values for the previous flags.
7480 * src/lyx_cb.C Use those flags instead of the hardwired values for
7481 linuxdoc and docbook export.
7483 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7486 * src/menus.C Added menus entries for the new import/exports formats.
7488 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7490 * src/lyxrc.*: Added support for running without Gui
7493 * src/FontLoader.C: sensible defaults if no fonts are needed
7495 * src/lyx_cb.C: New function ShowMessage (writes either to the
7496 minibuffer or cout in case of no gui
7497 New function AskOverwrite for common stuff
7498 Consequently various changes to call these functions
7500 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7501 wild guess at sensible screen resolution when having no gui
7503 * src/lyxfont.C: no gui, no fonts... set some defaults
7505 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7507 * src/LColor.C: made the command inset background a bit lighter.
7509 2000-03-20 Hartmut Goebel <goebel@noris.net>
7511 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7512 stdstruct.inc. Koma-Script added some title elements which
7513 otherwise have been listed below "bibliography". This split allows
7514 adding title elements to where they belong.
7516 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7517 define the additional title elements and then include
7520 * many other layout files: changed to include stdtitle.inc just
7521 before stdstruct.inc.
7523 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7525 * src/buffer.C: (save) Added the option to store all backup files
7526 in a single directory
7528 * src/lyxrc.[Ch]: Added variable \backupdir_path
7530 * lib/lyxrc.example: Added descriptions of recently added variables
7532 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7533 bibtex inset, not closing the bibtex popup when deleting the inset)
7535 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7537 * src/lyx_cb.C: add a couple using directives.
7539 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7540 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7541 import based on the filename.
7543 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7544 file would be imported at start, if the filename where of a sgml file.
7546 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7548 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7550 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7551 * src/lyxfont.h Replaced the member variable bits.direction by the
7552 member variable lang. Made many changes in other files.
7553 This allows having a multi-lingual document
7555 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7556 that change the current language to <l>.
7557 Removed the command "font-rtl"
7559 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7560 format for Hebrew documents)
7562 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7563 When auto_mathmode is "true", pressing a digit key in normal mode
7564 will cause entering into mathmode.
7565 If auto_mathmode is "rtl" then this behavior will be active only
7566 when writing right-to-left text.
7568 * src/text2.C (InsertStringA) The string is inserted using the
7571 * src/paragraph.C (GetEndLabel) Gives a correct result for
7572 footnote paragraphs.
7574 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7576 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7578 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7579 front of PasteParagraph. Never insert a ' '. This should at least
7580 fix some cause for the segfaults that we have been experiencing,
7581 it also fixes backspace behaviour slightly. (Phu!)
7583 * src/support/lstrings.C (compare_no_case): some change to make it
7584 compile with gcc 2.95.2 and stdlibc++-v3
7586 * src/text2.C (MeltFootnoteEnvironment): change type o
7587 first_footnote_par_is_not_empty to bool.
7589 * src/lyxparagraph.h: make text private. Changes in other files
7591 (fitToSize): new function
7592 (setContentsFromPar): new function
7593 (clearContents): new function
7594 (SetChar): new function
7596 * src/paragraph.C (readSimpleWholeFile): deleted.
7598 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7599 the file, just use a simple string instead. Also read the file in
7600 a more maintainable manner.
7602 * src/text2.C (InsertStringA): deleted.
7603 (InsertStringB): deleted.
7605 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7607 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7608 RedoParagraphs from the doublespace handling part, just set status
7609 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7610 done, but perhaps not like this.)
7612 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7614 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7615 character when inserting an inset.
7617 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7619 * src/bufferparams.C (readLanguage): now takes "default" into
7622 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7623 also initialize the toplevel_keymap with the default bindings from
7626 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7628 * all files using lyxrc: have lyxrc as a real variable and not a
7629 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7632 * src/lyxrc.C: remove double call to defaultKeyBindings
7634 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7635 toolbar defauls using lyxlex. Remove enums, structs, functions
7638 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7639 toolbar defaults. Also store default keybindings in a map.
7641 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7642 storing the toolbar defaults without any xforms dependencies.
7644 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7645 applied. Changed to use iterators.
7647 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7649 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7650 systems that don't have LINGUAS set to begin with.
7652 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7654 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7655 the list by Dekel Tsur.
7657 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7659 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7660 * src/insets/form_graphics.C: ditto.
7662 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7664 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7666 * src/bufferparams.C (readLanguage): use the new language map
7668 * src/intl.C (InitKeyMapper): use the new language map
7670 * src/lyx_gui.C (create_forms): use the new language map
7672 * src/language.[Ch]: New files. Used for holding the information
7673 about each language. Now! Use this new language map enhance it and
7674 make it really usable for our needs.
7676 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7678 * screen.C (ShowCursor): Removed duplicate code.
7679 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7680 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7682 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7685 * src/text.C Added TransformChar method. Used for rendering Arabic
7686 text correctly (change the glyphs of the letter according to the
7687 position in the word)
7692 * src/lyxrc.C Added lyxrc command {language_command_begin,
7693 language_command_end,language_command_ltr,language_command_rtl,
7694 language_package} which allows the use of either arabtex or Omega
7697 * src/lyx_gui.C (init)
7699 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7700 to use encoding for menu fonts which is different than the encoding
7703 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7704 do not load the babel package.
7705 To write an English document with Hebrew/Arabic, change the document
7706 language to "english".
7708 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7709 (alphaCounter): changed to return char
7710 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7712 * lib/lyxrc.example Added examples for Hebrew/Arabic
7715 * src/layout.C Added layout command endlabeltype
7717 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7719 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7721 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7723 * src/mathed/math_delim.C (search_deco): return a
7724 math_deco_struct* instead of index.
7726 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7728 * All files with a USE_OSTREAM_ONLY within: removed all code that
7729 was unused when USE_OSTREAM_ONLY is defined.
7731 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7732 of any less. Removed header and using.
7734 * src/text.C (GetVisibleRow): draw the string "Page Break
7735 (top/bottom)" on screen when drawing a pagebreak line.
7737 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7739 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7741 * src/mathed/math_macro.C (draw): do some cast magic.
7744 * src/mathed/math_defs.h: change byte* argument to byte const*.
7746 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7748 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7749 know it is right to return InsetFoot* too, but cxx does not like
7752 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7754 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7756 * src/mathed/math_delim.C: change == to proper assignment.
7758 2000-03-09 Juergen Vigna <jug@sad.it>
7760 * src/insets/insettext.C (setPos): fixed various cursor positioning
7761 problems (via mouse and cursor-keys)
7762 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7763 inset (still a small display problem but it works ;)
7765 * src/insets/insetcollapsable.C (draw): added button_top_y and
7766 button_bottom_y to have correct values for clicking on the inset.
7768 * src/support/lyxalgo.h: commented out 'using std::less'
7770 2000-03-08 Juergen Vigna <jug@sad.it>
7772 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7773 Button-Release event closes as it is alos the Release-Event
7776 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7778 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7780 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7781 can add multiple spaces in Scrap (literate programming) styles...
7782 which, by the way, is how I got hooked on LyX to begin with.
7784 * src/mathed/formula.C (Write): Added dummy variable to an
7785 inset::Latex() call.
7786 (Latex): Add free_spacing boolean to inset::Latex()
7788 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7790 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7791 virtual function to include the free_spacing boolean from
7792 the containing paragraph's style.
7794 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7795 Added free_spacing boolean arg to match inset.h
7797 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7798 Added free_spacing boolean arg to match inset.h
7800 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7801 Added free_spacing boolean and made sure that if in a free_spacing
7802 paragraph, that we output normal space if there is a protected space.
7804 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7805 Added free_spacing boolean arg to match inset.h
7807 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7808 Added free_spacing boolean arg to match inset.h
7810 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7811 Added free_spacing boolean arg to match inset.h
7813 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7814 Added free_spacing boolean arg to match inset.h
7816 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7817 Added free_spacing boolean arg to match inset.h
7819 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7820 free_spacing boolean arg to match inset.h
7822 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7823 Added free_spacing boolean arg to match inset.h
7825 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7826 Added free_spacing boolean arg to match inset.h
7828 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7829 Added free_spacing boolean arg to match inset.h
7831 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7832 Added free_spacing boolean arg to match inset.h
7834 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7835 Added free_spacing boolean arg to match inset.h
7837 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7838 free_spacing boolean arg to match inset.h
7840 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7841 free_spacing boolean arg to match inset.h
7843 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7844 ignore free_spacing paragraphs. The user's spaces are left
7847 * src/text.C (InsertChar): Fixed the free_spacing layout
7848 attribute behavior. Now, if free_spacing is set, you can
7849 add multiple spaces in a paragraph with impunity (and they
7850 get output verbatim).
7851 (SelectSelectedWord): Added dummy argument to inset::Latex()
7854 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7857 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7858 paragraph layouts now only input a simple space instead.
7859 Special character insets don't make any sense in free-spacing
7862 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7863 hard-spaces in the *input* file to simple spaces if the layout
7864 is free-spacing. This converts old files which had to have
7865 hard-spaces in free-spacing layouts where a simple space was
7867 (writeFileAscii): Added free_spacing check to pass to the newly
7868 reworked inset::Latex(...) methods. The inset::Latex() code
7869 ensures that hard-spaces in free-spacing paragraphs get output
7870 as spaces (rather than "~").
7872 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7874 * src/mathed/math_delim.C (draw): draw the empty placeholder
7875 delims with a onoffdash line.
7876 (struct math_deco_compare): struct that holds the "functors" used
7877 for the sort and the binary search in math_deco_table.
7878 (class init_deco_table): class used for initial sort of the
7880 (search_deco): use lower_bound to do a binary search in the
7883 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7885 * src/lyxrc.C: a small secret thingie...
7887 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7888 and to not flush the stream as often as it used to.
7890 * src/support/lyxalgo.h: new file
7891 (sorted): template function used for checking if a sequence is
7892 sorted or not. Two versions with and without user supplied
7893 compare. Uses same compare as std::sort.
7895 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7896 it and give warning on lyxerr.
7898 (struct compare_tags): struct with function operators used for
7899 checking if sorted, sorting and lower_bound.
7900 (search_kw): use lower_bound instead of manually implemented
7903 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7905 * src/insets/insetcollapsable.h: fix Clone() declaration.
7906 * src/insets/insetfoot.h: ditto.
7908 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7910 2000-03-08 Juergen Vigna <jug@sad.it>
7912 * src/insets/lyxinset.h: added owner call which tells us if
7913 this inset is inside another inset. Changed also the return-type
7914 of Editable to an enum so it tells clearer what the return-value is.
7916 * src/insets/insettext.C (computeTextRows): fixed computing of
7917 textinsets which split automatically on more rows.
7919 * src/insets/insetert.[Ch]: changed this to be of BaseType
7922 * src/insets/insetfoot.[Ch]: added footnote inset
7924 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7925 collapsable insets (like footnote, ert, ...)
7927 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7929 * src/lyxdraw.h: remvoe file
7931 * src/lyxdraw.C: remove file
7933 * src/insets/insettext.C: added <algorithm>.
7935 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7937 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7938 (matrix_cb): case MM_OK use string stream
7940 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7943 * src/mathed/math_macro.C (draw): use string stream
7944 (Metrics): use string stream
7946 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7947 directly to the ostream.
7949 * src/vspace.C (asString): use string stream.
7950 (asString): use string stream
7951 (asLatexString): use string stream
7953 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7954 setting Spacing::Other.
7956 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7957 sprintf when creating the stretch vale.
7959 * src/text2.C (alphaCounter): changed to return a string and to
7960 not use a static variable internally. Also fixed a one-off bug.
7961 (SetCounter): changed the drawing of the labels to use string
7962 streams instead of sprintf.
7964 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7965 manipulator to use a scheme that does not require library support.
7966 This is also the way it is done in the new GNU libstdc++. Should
7967 work with DEC cxx now.
7969 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7971 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7972 end. This fixes a bug.
7974 * src/mathed (all files concerned with file writing): apply the
7975 USE_OSTREAM_ONLY changes to mathed too.
7977 * src/support/DebugStream.h: make the constructor explicit.
7979 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7980 count and ostream squashed.
7982 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7984 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7986 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7987 ostringstream uses STL strings, and we might not.
7989 * src/insets/insetspecialchar.C: add using directive.
7990 * src/insets/insettext.C: ditto.
7992 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7994 * lib/layouts/seminar.layout: feeble attempt at a layout for
7995 seminar.cls, far from completet and could really use some looking
7996 at from people used to write layout files.
7998 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7999 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8000 a lot nicer and works nicely with ostreams.
8002 * src/mathed/formula.C (draw): a slightly different solution that
8003 the one posted to the list, but I think this one works too. (font
8004 size wrong in headers.)
8006 * src/insets/insettext.C (computeTextRows): some fiddling on
8007 Jürgens turf, added some comments that he should read.
8009 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8010 used and it gave compiler warnings.
8011 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8014 * src/lyx_gui.C (create_forms): do the right thing when
8015 show_banner is true/false.
8017 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8018 show_banner is false.
8020 * most file writing files: Now use iostreams to do almost all of
8021 the writing. Also instead of passing string &, we now use
8022 stringstreams. mathed output is still not adapted to iostreams.
8023 This change can be turned off by commenting out all the occurences
8024 of the "#define USE_OSTREAM_ONLY 1" lines.
8026 * src/WorkArea.C (createPixmap): don't output debug messages.
8027 (WorkArea): don't output debug messages.
8029 * lib/lyxrc.example: added a comment about the new variable
8032 * development/Code_rules/Rules: Added some more commente about how
8033 to build class interfaces and on how better encapsulation can be
8036 2000-03-03 Juergen Vigna <jug@sad.it>
8038 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8039 automatically with the width of the LyX-Window
8041 * src/insets/insettext.C (computeTextRows): fixed update bug in
8042 displaying text-insets (scrollvalues where not initialized!)
8044 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8046 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8047 id in the check of the result from lower_bound is not enough since
8048 lower_bound can return last too, and then res->id will not be a
8051 * all insets and some code that use them: I have conditionalized
8052 removed the Latex(string & out, ...) this means that only the
8053 Latex(ostream &, ...) will be used. This is a work in progress to
8054 move towards using streams for all output of files.
8056 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8059 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8061 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8062 routine (this fixes bug where greek letters were surrounded by too
8065 * src/support/filetools.C (findtexfile): change a bit the search
8066 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8067 no longer passed to kpsewhich, we may have to change that later.
8069 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8070 warning options to avoid problems with X header files (from Angus
8072 * acinclude.m4: regenerated.
8074 2000-03-02 Juergen Vigna <jug@sad.it>
8076 * src/insets/insettext.C (WriteParagraphData): Using the
8077 par->writeFile() function for writing paragraph-data.
8078 (Read): Using buffer->parseSingleLyXformat2Token()-function
8079 for parsing paragraph data!
8081 * src/buffer.C (readLyXformat2): removed all parse data and using
8082 the new parseSingleLyXformat2Token()-function.
8083 (parseSingleLyXformat2Token): added this function to parse (read)
8084 lyx-file-format (this is called also from text-insets now!)
8086 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8088 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8091 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8092 directly instead of going through a func. One very bad thing: a
8093 static LyXFindReplace, but I don't know where to place it.
8095 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8096 string instead of char[]. Also changed to static.
8097 (GetSelectionOrWordAtCursor): changed to static inline
8098 (SetSelectionOverLenChars): ditto.
8100 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8101 current_view and global variables. both classes has changed names
8102 and LyXFindReplace is not inherited from SearchForm.
8104 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8105 fl_form_search form.
8107 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8109 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8111 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8112 bound (from Kayvan).
8114 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8116 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8118 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8120 * some things that I should comment but the local pub says head to
8123 * comment out all code that belongs to the Roff code for Ascii
8124 export of tables. (this is unused)
8126 * src/LyXView.C: use correct type for global variable
8127 current_layout. (LyXTextClass::size_type)
8129 * some code to get the new insetgraphics closer to working I'd be
8130 grateful for any help.
8132 * src/BufferView2.C (insertInset): use the return type of
8133 NumberOfLayout properly. (also changes in other files)
8135 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8136 this as a test. I want to know what breaks because of this.
8138 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8140 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8142 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8143 to use a \makebox in the label, this allows proper justification
8144 with out using protected spaces or multiple hfills. Now it is
8145 "label" for left justified, "\hfill label\hfill" for center, and
8146 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8147 should be changed accordingly.
8149 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8151 * src/lyxtext.h: change SetLayout() to take a
8152 LyXTextClass::size_type instead of a char (when there is more than
8153 127 layouts in a class); also change type of copylayouttype.
8154 * src/text2.C (SetLayout): ditto.
8155 * src/LyXView.C (updateLayoutChoice): ditto.
8157 * src/LaTeX.C (scanLogFile): errors where the line number was not
8158 given just after the '!'-line were ignored (from Dekel Tsur).
8160 * lib/lyxrc.example: fix description of \date_insert_format
8162 * lib/layouts/llncs.layout: new layout, contributed by Martin
8165 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8167 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8168 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8169 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8170 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8171 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8172 paragraph.C, text.C, text2.C)
8174 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8176 * src/insets/insettext.C (LocalDispatch): remove extra break
8179 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8180 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8182 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8183 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8185 * src/insets/insetbib.h: move InsetBibkey::Holder and
8186 InsetCitation::Holder in public space.
8188 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8190 * src/insets/insettext.h: small change to get the new files from
8191 Juergen to compile (use "string", not "class string").
8193 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8194 const & as parameter to LocalDispatch, use LyXFont const & as
8195 paramter to some other func. This also had impacto on lyxinsets.h
8196 and the two mathed insets.
8198 2000-02-24 Juergen Vigna <jug@sad.it>
8201 * src/commandtags.h:
8203 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8207 * src/BufferView2.C: added/updated code for various inset-functions
8209 * src/insets/insetert.[Ch]: added implementation of InsetERT
8211 * src/insets/insettext.[Ch]: added implementation of InsetText
8213 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8214 (draw): added preliminary code for inset scrolling not finshed yet
8216 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8217 as it is in lyxfunc.C now
8219 * src/insets/lyxinset.h: Added functions for text-insets
8221 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8223 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8224 BufferView and reimplement the list as a queue put inside its own
8227 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8229 * several files: use the new interface to the "updateinsetlist"
8231 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8233 (work_area_handler): call BufferView::trippleClick on trippleclick.
8235 * src/BufferView.C (doubleClick): new function, selects word on
8237 (trippleClick): new function, selects line on trippleclick.
8239 2000-02-22 Allan Rae <rae@lyx.org>
8241 * lib/bind/xemacs.bind: buffer-previous not supported
8243 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8245 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8248 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8250 * src/bufferlist.C: get rid of current_view from this file
8252 * src/spellchecker.C: get rid of current_view from this file
8254 * src/vspace.C: get rid of current_view from this file
8255 (inPixels): added BufferView parameter for this func
8256 (asLatexCommand): added a BufferParams for this func
8258 * src/text.C src/text2.C: get rid of current_view from these
8261 * src/lyxfont.C (getFontDirection): move this function here from
8264 * src/bufferparams.C (getDocumentDirection): move this function
8267 * src/paragraph.C (getParDirection): move this function here from
8269 (getLetterDirection): ditto
8271 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8273 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8274 resize due to wrong pixmap beeing used. Also took the opurtunity
8275 to make the LyXScreen stateless on regard to WorkArea and some
8276 general cleanup in the same files.
8278 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8280 * src/Makefile.am: add missing direction.h
8282 * src/PainterBase.h: made the width functions const.
8284 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8287 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8289 * src/insets/insetlatexaccent.C (draw): make the accents draw
8290 better, at present this will only work well with iso8859-1.
8292 * several files: remove the old drawing code, now we use the new
8295 * several files: remove support for mono_video, reverse_video and
8298 2000-02-17 Juergen Vigna <jug@sad.it>
8300 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8301 int ** as we have to return the pointer, otherwise we have only
8302 NULL pointers in the returning function.
8304 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8306 * src/LaTeX.C (operator()): quote file name when running latex.
8308 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8310 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8311 (bubble tip), this removes our special handling of this.
8313 * Remove all code that is unused now that we have the new
8314 workarea. (Code that are not active when NEW_WA is defined.)
8316 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8318 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8320 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8321 nonexisting layout; correctly redirect obsoleted layouts.
8323 * lib/lyxrc.example: document \view_dvi_paper_option
8325 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8328 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8329 (PreviewDVI): handle the view_dvi_paper_option variable.
8330 [Both from Roland Krause]
8332 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8334 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8335 char const *, int, LyXFont)
8336 (text(int, int, string, LyXFont)): ditto
8338 * src/text.C (InsertCharInTable): attempt to fix the double-space
8339 feature in tables too.
8340 (BackspaceInTable): ditto.
8341 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8343 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8345 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8347 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8348 newly found text in textcache to this.
8349 (buffer): set the owner of the text put into the textcache to 0
8351 * src/insets/figinset.C (draw): fixed the drawing of figures with
8354 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8355 drawing of mathframe, hfills, protected space, table lines. I have
8356 now no outstanding drawing problems with the new Painter code.
8358 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8360 * src/PainterBase.C (ellipse, circle): do not specify the default
8363 * src/LColor.h: add using directive.
8365 * src/Painter.[Ch]: change return type of methods from Painter& to
8366 PainterBase&. Add a using directive.
8368 * src/WorkArea.C: wrap xforms callbacks in C functions
8371 * lib/layouts/foils.layout: font fix and simplifications from Carl
8374 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8376 * a lot of files: The Painter, LColor and WorkArea from the old
8377 devel branch has been ported to lyx-devel. Some new files and a
8378 lot of #ifdeffed code. The new workarea is enabled by default, but
8379 if you want to test the new Painter and LColor you have to compile
8380 with USE_PAINTER defined (do this in config.h f.ex.) There are
8381 still some rought edges, and I'd like some help to clear those
8382 out. It looks stable (loads and displays the Userguide very well).
8385 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8387 * src/buffer.C (pop_tag): revert to the previous implementation
8388 (use a global variable for both loops).
8390 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8392 * src/lyxrc.C (LyXRC): change slightly default date format.
8394 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8395 there is an English text with a footnote that starts with a Hebrew
8396 paragraph, or vice versa.
8397 (TeXFootnote): ditto.
8399 * src/text.C (LeftMargin): allow for negative values for
8400 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8403 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8404 for input encoding (cyrillic)
8406 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8408 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8411 * src/toolbar.C (set): ditto
8412 * src/insets/insetbib.C (create_form_citation_form): ditto
8414 * lib/CREDITS: added Dekel Tsur.
8416 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8417 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8418 hebrew supports files from Dekel Tsur.
8420 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8421 <tzafrir@technion.ac.il>
8423 * src/lyxrc.C: put \date_insert_format at the right place.
8425 * src/buffer.C (makeLaTeXFile): fix the handling of
8426 BufferParams::sides when writing out latex files.
8428 * src/BufferView2.C: add a "using" directive.
8430 * src/support/lyxsum.C (sum): when we use lyxstring,
8431 ostringstream::str needs an additional .c_str().
8433 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8435 * src/support/filetools.C (ChangeExtension): patch from Etienne
8438 * src/TextCache.C (show): remove const_cast and make second
8439 parameter non-const LyXText *.
8441 * src/TextCache.h: use non const LyXText in show.
8443 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8446 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8448 * src/support/lyxsum.C: rework to be more flexible.
8450 * several places: don't check if a pointer is 0 if you are going
8453 * src/text.C: remove some dead code.
8455 * src/insets/figinset.C: remove some dead code
8457 * src/buffer.C: move the BufferView funcs to BufferView2.C
8458 remove all support for insetlatexdel
8459 remove support for oldpapersize stuff
8460 made some member funcs const
8462 * src/kbmap.C: use a std::list to store the bindings in.
8464 * src/BufferView2.C: new file
8466 * src/kbsequence.[Ch]: new files
8468 * src/LyXAction.C + others: remove all trace of buffer-previous
8470 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8471 only have one copy in the binary of this table.
8473 * hebrew patch: moved some functions from LyXText to more
8474 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8476 * several files: remove support for XForms older than 0.88
8478 remove some #if 0 #endif code
8480 * src/TextCache.[Ch]: new file. Holds the textcache.
8482 * src/BufferView.C: changes to use the new TextCache interface.
8483 (waitForX): remove the now unused code.
8485 * src/BackStack.h: remove some commented code
8487 * lib/bind/emacs.bind: remove binding for buffer-previous
8489 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8491 * applied the hebrew patch.
8493 * src/lyxrow.h: make sure that all Row variables are initialized.
8495 * src/text2.C (TextHandleUndo): comment out a delete, this might
8496 introduce a memory leak, but should also help us to not try to
8497 read freed memory. We need to look at this one.
8499 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8500 (LyXParagraph): initalize footnotekind.
8502 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8503 forgot this when applying the patch. Please heed the warnings.
8505 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8506 (aka. reformat problem)
8508 * src/bufferlist.C (exists): made const, and use const_iterator
8509 (isLoaded): new func.
8510 (release): use std::find to find the correct buffer.
8512 * src/bufferlist.h: made getState a const func.
8513 made empty a const func.
8514 made exists a const func.
8517 2000-02-01 Juergen Vigna <jug@sad.it>
8519 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8521 * po/it.po: updated a bit the italian po file and also changed the
8522 'file nuovo' for newfile to 'filenuovo' without a space, this did
8525 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8526 for the new insert_date command.
8528 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8529 from jdblair, to insert a date into the current text conforming to
8530 a strftime format (for now only considering the locale-set and not
8531 the document-language).
8533 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8535 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8536 Bounds Read error seen by purify. The problem was that islower is
8537 a macros which takes an unsigned char and uses it as an index for
8538 in array of characters properties (and is thus subject to the
8542 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8543 correctly the paper sides radio buttons.
8544 (UpdateDocumentButtons): ditto.
8546 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8548 * src/kbmap.C (getsym + others): change to return unsigned int,
8549 returning a long can give problems on 64 bit systems. (I assume
8550 that int is 32bit on 64bit systems)
8552 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8554 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8555 LyXLookupString to be zero-terminated. Really fixes problems seen
8558 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8560 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8561 write a (char*)0 to the lyxerr stream.
8563 * src/lastfiles.C: move algorithm before the using statemets.
8565 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8567 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8568 complains otherwise).
8569 * src/table.C: ditto
8571 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8574 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8575 that I removed earlier... It is really needed.
8577 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8579 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8581 * INSTALL: update xforms home page URL.
8583 * lib/configure.m4: fix a bug with unreadable layout files.
8585 * src/table.C (calculate_width_of_column): add "using std::max"
8588 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8590 * several files: marked several lines with "DEL LINE", this is
8591 lines that can be deleted without changing anything.
8592 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8593 checks this anyway */
8596 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8598 * src/DepTable.C (update): add a "+" at the end when the checksum
8599 is different. (debugging string only)
8601 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8602 the next inset to not be displayed. This should also fix the list
8603 of labels in the "Insert Crossreference" dialog.
8605 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8607 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8608 when regex was not found.
8610 * src/support/lstrings.C (lowercase): use handcoded transform always.
8613 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8614 old_cursor.par->prev could be 0.
8616 * several files: changed post inc/dec to pre inc/dec
8618 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8619 write the lastfiles to file.
8621 * src/BufferView.C (buffer): only show TextCache info when debugging
8623 (resizeCurrentBuffer): ditto
8624 (workAreaExpose): ditto
8626 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8628 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8630 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8631 a bit better by removing the special case for \i and \j.
8633 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8635 * src/lyx_main.C (easyParse): remove test for bad comand line
8636 options, since this broke all xforms-related parsing.
8638 * src/kbmap.C (getsym): set return type to unsigned long, as
8639 declared in header. On an alpha, long is _not_ the same as int.
8641 * src/support/LOstream.h: add a "using std::flush;"
8643 * src/insets/figinset.C: ditto.
8645 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8647 * src/bufferlist.C (write): use blinding fast file copy instead of
8648 "a char at a time", now we are doing it the C++ way.
8650 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8651 std::list<int> instead.
8652 (addpidwait): reflect move to std::list<int>
8653 (sigchldchecker): ditto
8655 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8658 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8659 that obviously was wrong...
8661 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8662 c, this avoids warnings with purify and islower.
8664 * src/insets/figinset.C: rename struct queue to struct
8665 queue_element and rewrite to use a std::queue. gsqueue is now a
8666 std::queue<queue_element>
8667 (runqueue): reflect move to std::queue
8670 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8671 we would get "1" "0" instead of "true" "false. Also make the tostr
8674 2000-01-21 Juergen Vigna <jug@sad.it>
8676 * src/buffer.C (writeFileAscii): Disabled code for special groff
8677 handling of tabulars till I fix this in table.C
8679 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8681 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8683 * src/support/lyxlib.h: ditto.
8685 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8687 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8688 and 'j' look better. This might fix the "macron" bug that has been
8691 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8692 functions as one template function. Delete the old versions.
8694 * src/support/lyxsum.C: move using std::ifstream inside
8697 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8700 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8702 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8704 * src/insets/figinset.C (InitFigures): use new instead of malloc
8705 to allocate memory for figures and bitmaps.
8706 (DoneFigures): use delete[] instead of free to deallocate memory
8707 for figures and bitmaps.
8708 (runqueue): use new to allocate
8709 (getfigdata): use new/delete[] instead of malloc/free
8710 (RegisterFigure): ditto
8712 * some files: moved some declarations closer to first use, small
8713 whitespace changes use preincrement instead of postincrement where
8714 it does not make a difference.
8716 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8717 step on the way to use stl::containers for key maps.
8719 * src/bufferlist.h: add a typedef for const_iterator and const
8720 versions of begin and end.
8722 * src/bufferlist.[Ch]: change name of member variable _state to
8723 state_. (avoid reserved names)
8725 (getFileNames): returns the filenames of the buffers in a vector.
8727 * configure.in (ALL_LINGUAS): added ro
8729 * src/support/putenv.C: new file
8731 * src/support/mkdir.C: new file
8733 2000-01-20 Allan Rae <rae@lyx.org>
8735 * lib/layouts/IEEEtran.layout: Added several theorem environments
8737 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8738 couple of minor additions.
8740 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8741 (except for those in footnotes of course)
8743 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8745 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8747 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8748 std::sort and std::lower_bound instead of qsort and handwritten
8750 (struct compara): struct that holds the functors used by std::sort
8751 and std::lower_bound in MathedLookupBOP.
8753 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8755 * src/support/LAssert.h: do not do partial specialization. We do
8758 * src/support/lyxlib.h: note that lyx::getUserName() and
8759 lyx::date() are not in use right now. Should these be suppressed?
8761 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8762 (makeLinuxDocFile): do not put date and user name in linuxdoc
8765 * src/support/lyxlib.h (kill): change first argument to long int,
8766 since that's what solaris uses.
8768 * src/support/kill.C (kill): fix declaration to match prototype.
8770 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8771 actually check whether namespaces are supported. This is not what
8774 * src/support/lyxsum.C: add a using directive.
8776 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8778 * src/support/kill.C: if we have namespace support we don't have
8779 to include lyxlib.h.
8781 * src/support/lyxlib.h: use namespace lyx if supported.
8783 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8785 * src/support/date.C: new file
8787 * src/support/chdir.C: new file
8789 * src/support/getUserName.C: new file
8791 * src/support/getcwd.C: new file
8793 * src/support/abort.C: new file
8795 * src/support/kill.C: new file
8797 * src/support/lyxlib.h: moved all the functions in this file
8798 insede struct lyx. Added also kill and abort to this struct. This
8799 is a way to avoid the "kill is not defined in <csignal>", we make
8800 C++ wrappers for functions that are not ANSI C or ANSI C++.
8802 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8803 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8804 lyx it has been renamed to sum.
8806 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8808 * src/text.C: add using directives for std::min and std::max.
8810 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8812 * src/texrow.C (getIdFromRow): actually return something useful in
8813 id and pos. Hopefully fixes the bug with positionning of errorbox
8816 * src/lyx_main.C (easyParse): output an error and exit if an
8817 incorrect command line option has been given.
8819 * src/spellchecker.C (ispell_check_word): document a memory leak.
8821 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8822 where a "struct utimbuf" is allocated with "new" and deleted with
8825 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8827 * src/text2.C (CutSelection): don't delete double spaces.
8828 (PasteSelection): ditto
8829 (CopySelection): ditto
8831 * src/text.C (Backspace): don't delete double spaces.
8833 * src/lyxlex.C (next): fix a bug that were only present with
8834 conformant std::istream::get to read comment lines, use
8835 std::istream::getline instead. This seems to fix the problem.
8837 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8839 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8840 allowed to insert space before space" editing problem. Please read
8841 commends at the beginning of the function. Comments about usage
8844 * src/text.C (InsertChar): fix for the "not allowed to insert
8845 space before space" editing problem.
8847 * src/text2.C (DeleteEmptyParagraphMechanism): when
8848 IsEmptyTableRow can only return false this last "else if" will
8849 always be a no-op. Commented out.
8851 * src/text.C (RedoParagraph): As far as I can understand tmp
8852 cursor is not really needed.
8854 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8855 present it could only return false anyway.
8856 (several functions): Did something not so smart...added a const
8857 specifier on a lot of methods.
8859 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8860 and add a tmp->text.resize. The LyXParagraph constructor does the
8862 (BreakParagraphConservative): ditto
8864 * src/support/path.h (Path): add a define so that the wrong usage
8865 "Path("/tmp") will be flagged as a compilation error:
8866 "`unnamed_Path' undeclared (first use this function)"
8868 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8870 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8871 which was bogus for several reasons.
8873 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8877 * autogen.sh: do not use "type -path" (what's that anyway?).
8879 * src/support/filetools.C (findtexfile): remove extraneous space
8880 which caused a kpsewhich warning (at least with kpathsea version
8883 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8885 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8887 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8889 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8891 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8893 * src/paragraph.C (BreakParagraph): do not reserve space on text
8894 if we don't need to (otherwise, if pos_end < pos, we end up
8895 reserving huge amounts of memory due to bad unsigned karma).
8896 (BreakParagraphConservative): ditto, although I have not seen
8897 evidence the bug can happen here.
8899 * src/lyxparagraph.h: add a using std::list.
8901 2000-01-11 Juergen Vigna <jug@sad.it>
8903 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8906 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8908 * src/vc-backend.C (doVCCommand): change to be static and take one
8909 more parameter: the path to chdir too be fore executing the command.
8910 (retrive): new function equiv to "co -r"
8912 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8913 file_not_found_hook is true.
8915 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8917 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8918 if a file is readwrite,readonly...anything else.
8920 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8922 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8923 (CreatePostscript): name change from MenuRunDVIPS (or something)
8924 (PreviewPostscript): name change from MenuPreviewPS
8925 (PreviewDVI): name change from MenuPreviewDVI
8927 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8928 \view_pdf_command., \pdf_to_ps_command
8930 * lib/configure.m4: added search for PDF viewer, and search for
8931 PDF to PS converter.
8932 (lyxrc.defaults output): add \pdflatex_command,
8933 \view_pdf_command and \pdf_to_ps_command.
8935 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8937 * src/bufferlist.C (write): we don't use blocksize for anything so
8940 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8942 * src/support/block.h: disable operator T* (), since it causes
8943 problems with both compilers I tried. See comments in the file.
8945 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8948 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8949 variable LYX_DIR_10x to LYX_DIR_11x.
8951 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8953 * INSTALL: document --with-lyxname.
8956 * configure.in: new configure flag --with-lyxname which allows to
8957 choose the name under which lyx is installed. Default is "lyx", of
8958 course. It used to be possible to do this with --program-suffix,
8959 but the later has in fact a different meaning for autoconf.
8961 * src/support/lstrings.h (lstrchr): reformat a bit.
8963 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8964 * src/mathed/math_defs.h: ditto.
8966 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8968 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8969 true, decides if we create a backup file or not when saving. New
8970 tag and variable \pdf_mode, defaults to false. New tag and
8971 variable \pdflatex_command, defaults to pdflatex. New tag and
8972 variable \view_pdf_command, defaults to xpdf. New tag and variable
8973 \pdf_to_ps_command, defaults to pdf2ps.
8975 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8977 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8978 does not have a BufferView.
8979 (unlockInset): ditto + don't access the_locking_inset if the
8980 buffer does not have a BufferView.
8982 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8983 certain circumstances so that we don't continue a keyboard
8984 operation long after the key was released. Try f.ex. to load a
8985 large document, press PageDown for some seconds and then release
8986 it. Before this change the document would contine to scroll for
8987 some time, with this change it stops imidiatly.
8989 * src/support/block.h: don't allocate more space than needed. As
8990 long as we don't try to write to the arr[x] in a array_type arr[x]
8991 it is perfectly ok. (if you write to it you might segfault).
8992 added operator value_type*() so that is possible to pass the array
8993 to functions expecting a C-pointer.
8995 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8998 * intl/*: updated to gettext 0.10.35, tried to add our own
8999 required modifications. Please verify.
9001 * po/*: updated to gettext 0.10.35, tried to add our own required
9002 modifications. Please verify.
9004 * src/support/lstrings.C (tostr): go at fixing the problem with
9005 cxx and stringstream. When stringstream is used return
9006 oss.str().c_str() so that problems with lyxstring and basic_string
9007 are avoided. Note that the best solution would be for cxx to use
9008 basic_string all the way, but it is not conformant yet. (it seems)
9010 * src/lyx_cb.C + other files: moved several global functions to
9011 class BufferView, some have been moved to BufferView.[Ch] others
9012 are still located in lyx_cb.C. Code changes because of this. (part
9013 of "get rid of current_view project".)
9015 * src/buffer.C + other files: moved several Buffer functions to
9016 class BufferView, the functions are still present in buffer.C.
9017 Code changes because of this.
9019 * config/lcmessage.m4: updated to most recent. used when creating
9022 * config/progtest.m4: updated to most recent. used when creating
9025 * config/gettext.m4: updated to most recent. applied patch for
9028 * config/gettext.m4.patch: new file that shows what changes we
9029 have done to the local copy of gettext.m4.
9031 * config/libtool.m4: new file, used in creation of acinclude.m4
9033 * config/lyxinclude.m4: new file, this is the lyx created m4
9034 macros, used in making acinclude.m4.
9036 * autogen.sh: GNU m4 discovered as a separate task not as part of
9037 the lib/configure creation.
9038 Generate acinlucde from files in config. Actually cat
9039 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9040 easier to upgrade .m4 files that really are external.
9042 * src/Spacing.h: moved using std::istringstream to right after
9043 <sstream>. This should fix the problem seen with some compilers.
9045 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9047 * src/lyx_cb.C: began some work to remove the dependency a lot of
9048 functions have on BufferView::text, even if not really needed.
9049 (GetCurrentTextClass): removed this func, it only hid the
9052 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9053 forgot this in last commit.
9055 * src/Bullet.C (bulletEntry): use static char const *[] for the
9056 tables, becuase of this the return arg had to change to string.
9058 (~Bullet): removed unneeded destructor
9060 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9061 (insetSleep): moved from Buffer
9062 (insetWakeup): moved from Buffer
9063 (insetUnlock): moved from Buffer
9065 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9066 from Buffer to BufferView.
9068 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9070 * config/ltmain.sh: updated to version 1.3.4 of libtool
9072 * config/ltconfig: updated to version 1.3.4 of libtool
9074 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9077 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9078 Did I get that right?
9080 * src/lyxlex.h: add a "using" directive or two.
9081 * src/Spacing.h: ditto.
9082 * src/insets/figinset.C: ditto.
9083 * src/support/filetools.C: ditto.
9084 * src/support/lstrings.C: ditto.
9085 * src/BufferView.C: ditto.
9086 * src/bufferlist.C: ditto.
9087 * src/lyx_cb.C: ditto.
9088 * src/lyxlex.C: ditto.
9090 * NEWS: add some changes for 1.1.4.
9092 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9094 * src/BufferView.C: first go at a TextCache to speed up switching
9097 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9099 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9100 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9101 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9102 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9105 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9106 members of the struct are correctly initialized to 0 (detected by
9108 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9109 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9111 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9112 pidwait, since it was allocated with "new". This was potentially
9113 very bad. Thanks to Michael Schmitt for running purify for us.
9116 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9118 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9120 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9122 1999-12-30 Allan Rae <rae@lyx.org>
9124 * lib/templates/IEEEtran.lyx: minor change
9126 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9127 src/mathed/formula.C (LocalDispatch): askForText changes
9129 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9130 know when a user has cancelled input. Fixes annoying problems with
9131 inserting labels and version control.
9133 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9135 * src/support/lstrings.C (tostr): rewritten to use strstream and
9138 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9140 * src/support/filetools.C (IsFileWriteable): use fstream to check
9141 (IsDirWriteable): use fileinfo to check
9143 * src/support/filetools.h (FilePtr): whole class deleted
9145 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9147 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9149 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9151 * src/bufferlist.C (write): use ifstream and ofstream instead of
9154 * src/Spacing.h: use istrstream instead of sscanf
9156 * src/mathed/math_defs.h: change first arg to istream from FILE*
9158 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9160 * src/mathed/math_parser.C: have yyis to be an istream
9161 (LexGetArg): use istream (yyis)
9163 (mathed_parse): ditto
9164 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9166 * src/mathed/formula.C (Read): rewritten to use istream
9168 * src/mathed/formulamacro.C (Read): rewritten to use istream
9170 * src/lyxlex.h (~LyXLex): deleted desturctor
9171 (getStream): new function, returns an istream
9172 (getFile): deleted funtion
9173 (IsOK): return is.good();
9175 * src/lyxlex.C (LyXLex): delete file and owns_file
9176 (setFile): open an filebuf and assign that to a istream instead of
9178 (setStream): new function, takes an istream as arg.
9179 (setFile): deleted function
9180 (EatLine): rewritten us use istream instead of FILE*
9184 * src/table.C (LyXTable): use istream instead of FILE*
9185 (Read): rewritten to take an istream instead of FILE*
9187 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9189 * src/buffer.C (Dispatch): remove an extraneous break statement.
9191 * src/support/filetools.C (QuoteName): change to do simple
9192 'quoting'. More work is necessary. Also changed to do nothing
9193 under emx (needs fix too).
9194 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9196 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9197 config.h.in to the AC_DEFINE_UNQUOTED() call.
9198 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9199 needs char * as argument (because Solaris 7 declares it like
9202 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9203 remove definition of BZERO.
9205 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9207 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9208 defined, "lyxregex.h" if not.
9210 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9212 (REGEX): new variable that is set to regex.c lyxregex.h when
9213 AM_CONDITIONAL USE_REGEX is set.
9214 (libsupport_la_SOURCES): add $(REGEX)
9216 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9219 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9222 * configure.in: add call to LYX_REGEX
9224 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9225 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9227 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9229 * lib/bind/fi_menus.bind: new file, from
9230 pauli.virtanen@saunalahti.fi.
9232 * src/buffer.C (getBibkeyList): pass the parameter delim to
9233 InsetInclude::getKeys and InsetBibtex::getKeys.
9235 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9236 is passed to Buffer::getBibkeyList
9238 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9239 instead of the hardcoded comma.
9241 * src/insets/insetbib.C (getKeys): make sure that there are not
9242 leading blanks in bibtex keys. Normal latex does not care, but
9243 harvard.sty seems to dislike blanks at the beginning of citation
9244 keys. In particular, the retturn value of the function is
9246 * INSTALL: make it clear that libstdc++ is needed and that gcc
9247 2.7.x probably does not work.
9249 * src/support/filetools.C (findtexfile): make debug message go to
9251 * src/insets/insetbib.C (getKeys): ditto
9253 * src/debug.C (showTags): make sure that the output is correctly
9256 * configure.in: add a comment for TWO_COLOR_ICON define.
9258 * acconfig.h: remove all the entries that already defined in
9259 configure.in or acinclude.m4.
9261 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9262 to avoid user name, date and copyright.
9264 1999-12-21 Juergen Vigna <jug@sad.it>
9266 * src/table.C (Read): Now read bogus row format informations
9267 if the format is < 5 so that afterwards the table can
9268 be read by lyx but without any format-info. Fixed the
9269 crash we experienced when not doing this.
9271 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9273 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9274 (RedoDrawingOfParagraph): ditto
9275 (RedoParagraphs): ditto
9276 (RemoveTableRow): ditto
9278 * src/text.C (Fill): rename arg paperwidth -> paper_width
9280 * src/buffer.C (insertLyXFile): rename var filename -> fname
9281 (writeFile): rename arg filename -> fname
9282 (writeFileAscii): ditto
9283 (makeLaTeXFile): ditto
9284 (makeLinuxDocFile): ditto
9285 (makeDocBookFile): ditto
9287 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9290 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9292 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9295 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9296 compiled by a C compiler not C++.
9298 * src/layout.h (LyXTextClass): added typedef for const_iterator
9299 (LyXTextClassList): added typedef for const_iterator + member
9300 functions begin and end.
9302 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9303 iterators to fill the choice_class.
9304 (updateLayoutChoice): rewritten to use iterators to fill the
9305 layoutlist in the toolbar.
9307 * src/BufferView.h (BufferView::work_area_width): removed unused
9310 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9312 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9313 (sgmlCloseTag): ditto
9315 * src/support/lstrings.h: return type of countChar changed to
9318 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9319 what version of this func to use. Also made to return unsigned int.
9321 * configure.in: call LYX_STD_COUNT
9323 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9324 conforming std::count.
9326 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9328 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9329 and a subscript would give bad display (patch from Dekel Tsur
9330 <dekel@math.tau.ac.il>).
9332 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9334 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9337 * src/chset.h: add a few 'using' directives
9339 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9340 triggered when no buffer is active
9342 * src/layout.C: removed `break' after `return' in switch(), since
9345 * src/lyx_main.C (init): make sure LyX can be ran in place even
9346 when libtool has done its magic with shared libraries. Fix the
9347 test for the case when the system directory has not been found.
9349 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9350 name for the latex file.
9351 (MenuMakeHTML): ditto
9353 * src/buffer.h: add an optional boolean argument, which is passed
9356 1999-12-20 Allan Rae <rae@lyx.org>
9358 * lib/templates/IEEEtran.lyx: small correction and update.
9360 * configure.in: Attempted to use LYX_PATH_HEADER
9362 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9364 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9365 input from JMarc. Now use preprocessor to find the header.
9366 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9367 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9368 LYX_STL_STRING_FWD. See comments in file.
9370 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9372 * The global MiniBuffer * minibuffer variable is dead.
9374 * The global FD_form_main * fd_form_main variable is dead.
9376 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9378 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9380 * src/table.h: add the LOstream.h header
9381 * src/debug.h: ditto
9383 * src/LyXAction.h: change the explaination of the ReadOnly
9384 attribute: is indicates that the function _can_ be used.
9386 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9389 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9391 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9397 * src/paragraph.C (GetWord): assert on pos>=0
9400 * src/support/lyxstring.C: condition the use of an invariant on
9402 * src/support/lyxstring.h: ditto
9404 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9405 Use LAssert.h instead of plain assert().
9407 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9409 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9410 * src/support/filetools.C: ditto
9412 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9415 * INSTALL: document the new configure flags
9417 * configure.in: suppress --with-debug; add --enable-assertions
9419 * acinclude.m4: various changes in alignment of help strings.
9421 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9423 * src/kbmap.C: commented out the use of the hash map in kb_map,
9424 beginning of movement to a stl::container.
9426 * several files: removed code that was not in effect when
9427 MOVE_TEXT was defined.
9429 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9430 for escaping should not be used. We can discuss if the string
9431 should be enclosed in f.ex. [] instead of "".
9433 * src/trans_mgr.C (insert): use the new returned value from
9434 encodeString to get deadkeys and keymaps done correctly.
9436 * src/chset.C (encodeString): changed to return a pair, to tell
9437 what to use if we know the string.
9439 * src/lyxscreen.h (fillArc): new function.
9441 * src/FontInfo.C (resize): rewritten to use more std::string like
9442 structore, especially string::replace.
9444 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9447 * configure.in (chmod +x some scripts): remove config/gcc-hack
9449 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9451 * src/buffer.C (writeFile): change once again the top comment in a
9452 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9453 instead of an hardcoded version number.
9454 (makeDocBookFile): ditto
9456 * src/version.h: add new define LYX_DOCVERSION
9458 * po/de.po: update from Pit Sütterlin
9459 * lib/bind/de_menus.bind: ditto.
9461 * src/lyxfunc.C (Dispatch): call MenuExport()
9462 * src/buffer.C (Dispatch): ditto
9464 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9465 LyXFunc::Dispatch().
9466 (MenuExport): new function, moved from
9467 LyXFunc::Dispatch().
9469 * src/trans_mgr.C (insert): small cleanup
9470 * src/chset.C (loadFile): ditto
9472 * lib/kbd/iso8859-1.cdef: add missing backslashes
9474 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9476 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9477 help with placing the manually drawn accents better.
9479 (Draw): x2 and hg changed to float to minimize rounding errors and
9480 help place the accents better.
9482 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9483 unsigned short to char is just wrong...cast the char to unsigned
9484 char instead so that the two values can compare sanely. This
9485 should also make the display of insetlatexaccents better and
9486 perhaps also some other insets.
9488 (lbearing): new function
9491 1999-12-15 Allan Rae <rae@lyx.org>
9493 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9494 header that provides a wrapper around the very annoying SGI STL header
9497 * src/support/lyxstring.C, src/LString.h:
9498 removed old SGI-STL-compatability attempts.
9500 * configure.in: Use LYX_STL_STRING_FWD.
9502 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9503 stl_string_fwd.h is around and try to determine it's location.
9504 Major improvement over previous SGI STL 3.2 compatability.
9505 Three small problems remain with this function due to my zero
9506 knowledge of autoconf. JMarc and lgb see the comments in the code.
9508 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9510 * src/broken_const.h, config/hack-gcc, config/README: removed
9512 * configure.in: remove --with-gcc-hack option; do not call
9515 * INSTALL: remove documentation of --with-broken-const and
9518 * acconfig.h: remove all trace of BROKEN_CONST define
9520 * src/buffer.C (makeDocBookFile): update version number in output
9522 (SimpleDocBookOnePar): fix an assert when trying to a character
9523 access beyond string length
9526 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9528 * po/de.po: fix the Export menu
9530 * lyx.man: update the description of -dbg
9532 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9533 (commandLineHelp): updated
9534 (easyParse): show list of available debug levels if -dbg is passed
9537 * src/Makefile.am: add debug.C
9539 * src/debug.h: moved some code to debug.C
9541 * src/debug.C: new file. Contains code to set and show debug
9544 * src/layout.C: remove 'break' after 'continue' in switch
9545 statements, since these cannot be reached.
9547 1999-12-13 Allan Rae <rae@lyx.org>
9549 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9550 (in_word_set): hash() -> math_hash()
9552 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9554 * acconfig.h: Added a test for whether we are using exceptions in the
9555 current compilation run. If so USING_EXCEPTIONS is defined.
9557 * config.in: Check for existance of stl_string_fwd.h
9558 * src/LString.h: If compiling --with-included-string and SGI's
9559 STL version 3.2 is present (see above test) we need to block their
9560 forward declaration of string and supply a __get_c_string().
9561 However, it turns out this is only necessary if compiling with
9562 exceptions enabled so I've a bit more to add yet.
9564 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9565 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9566 src/support/LRegex.h, src/undo.h:
9567 Shuffle the order of the included files a little to ensure that
9568 LString.h gets included before anything that includes stl_string_fwd.h
9570 * src/support/lyxstring.C: We need to #include LString.h instead of
9571 lyxstring.h to get the necessary definition of __get_c_string.
9572 (__get_c_string): New function. This is defined static just like SGI's
9573 although why they need to do this I'm not sure. Perhaps it should be
9574 in lstrings.C instead.
9576 * lib/templates/IEEEtran.lyx: New template file.
9578 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9580 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9581 * intl/Makefile.in (MKINSTALLDIRS): ditto
9583 * src/LyXAction.C (init): changed to hold the LFUN data in a
9584 automatic array in stead of in callso to newFunc, this speeds up
9585 compilation a lot. Also all the memory used by the array is
9586 returned when the init is completed.
9588 * a lot of files: compiled with -Wold-style-cast, changed most of
9589 the reported offenders to C++ style casts. Did not change the
9590 offenders in C files.
9592 * src/trans.h (Match): change argument type to unsigned int.
9594 * src/support/DebugStream.C: fix some types on the streambufs so
9595 that it works on a conforming implementation.
9597 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9599 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9601 * src/support/lyxstring.C: remove the inline added earlier since
9602 they cause a bunch of unsatisfied symbols when linking with dec
9603 cxx. Cxx likes to have the body of inlines at the place where they
9606 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9607 accessing negative bounds in array. This fixes the crash when
9608 inserting accented characters.
9609 * src/trans.h (Match): ditto
9611 * src/buffer.C (Dispatch): since this is a void, it should not try
9612 to return anything...
9614 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9616 * src/buffer.h: removed the two friends from Buffer. Some changes
9617 because of this. Buffer::getFileName and Buffer::setFileName
9618 renamed to Buffer::fileName() and Buffer::fileName(...).
9620 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9622 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9623 and Buffer::update(short) to BufferView. This move is currently
9624 controlled by a define MOVE_TEXT, this will be removed when all
9625 shows to be ok. This move paves the way for better separation
9626 between buffer contents and buffer view. One side effect is that
9627 the BufferView needs a rebreak when swiching buffers, if we want
9628 to avoid this we can add a cache that holds pointers to LyXText's
9629 that is not currently in use.
9631 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9634 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9636 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9638 * lyx_main.C: new command line option -x (or --execute) and
9639 -e (or --export). Now direct conversion from .lyx to .tex
9640 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9641 Unfortunately, X is still needed and the GUI pops up during the
9644 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9646 * src/Spacing.C: add a using directive to bring stream stuff into
9648 * src/paragraph.C: ditto
9649 * src/buffer.C: ditto
9651 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9652 from Lars' announcement).
9654 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9655 example files from Tino Meinen.
9657 1999-12-06 Allan Rae <rae@lyx.org>
9659 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9661 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9663 * src/support/lyxstring.C: added a lot of inline for no good
9666 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9667 latexWriteEndChanges, they were not used.
9669 * src/layout.h (operator<<): output operator for PageSides
9671 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9673 * some example files: loaded in LyX 1.0.4 and saved again to update
9674 certain constructs (table format)
9676 * a lot of files: did the change to use fstream/iostream for all
9677 writing of files. Done with a close look at Andre Poenitz's patch.
9679 * some files: whitespace changes.
9681 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9683 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9684 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9685 architecture, we provide our own. It is used unconditionnally, but
9686 I do not think this is a performance problem. Thanks to Angus
9687 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9688 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9690 (GetInset): use my_memcpy.
9694 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9695 it is easier to understand, but it uses less TeX-only constructs now.
9697 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9698 elements contain spaces
9700 * lib/configure: regenerated
9702 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9703 elements contain spaces; display the list of programs that are
9706 * autogen.sh: make sure lib/configure is executable
9708 * lib/examples/*: rename the tutorial examples to begin with the
9709 two-letters language code.
9711 * src/lyxfunc.C (getStatus): do not query current font if no
9714 * src/lyx_cb.C (RunScript): use QuoteName
9715 (MenuRunDvips): ditto
9716 (PrintApplyCB): ditto
9718 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9719 around argument, so that it works well with the current shell.
9720 Does not work properly with OS/2 shells currently.
9722 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9723 * src/LyXSendto.C (SendtoApplyCB): ditto
9724 * src/lyxfunc.C (Dispatch): ditto
9725 * src/buffer.C (runLaTeX): ditto
9726 (runLiterate): ditto
9727 (buildProgram): ditto
9729 * src/lyx_cb.C (RunScript): ditto
9730 (MenuMakeLaTeX): ditto
9732 * src/buffer.h (getLatexName): new method
9734 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9736 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9738 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9739 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9740 (create_math_panel): ditto
9742 * src/lyxfunc.C (getStatus): re-activate the code which gets
9743 current font and cursor; add test for export to html.
9745 * src/lyxrc.C (read): remove unreachable break statements; add a
9748 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9750 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9752 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9753 introduced by faulty regex.
9754 * src/buffer.C: ditto
9755 * src/lastfiles.C: ditto
9756 * src/paragraph.C: ditto
9757 * src/table.C: ditto
9758 * src/vspace.C: ditto
9759 * src/insets/figinset.C: ditto
9760 Note: most of these is absolutely harmless, except the one in
9761 src/mathed formula.C.
9763 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9765 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9766 operation, yielding correct results for the reLyX command.
9768 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9770 * src/support/filetools.C (ExpandPath): removed an over eager
9772 (ReplaceEnvironmentPath): ditto
9774 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9775 shows that we are doing something fishy in our code...
9779 * src/lyxrc.C (read): use a double switch trick to get more help
9780 from the compiler. (the same trick is used in layout.C)
9781 (write): new function. opens a ofstream and pass that to output
9782 (output): new function, takes a ostream and writes the lyxrc
9783 elemts to it. uses a dummy switch to make sure no elements are
9786 * src/lyxlex.h: added a struct pushpophelper for use in functions
9787 with more than one exit point.
9789 * src/lyxlex.[Ch] (GetInteger): made it const
9793 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9795 * src/layout.[hC] : LayoutTags splitted into several enums, new
9796 methods created, better error handling cleaner use of lyxlex. Read
9799 * src/bmtable.[Ch]: change some member prototypes because of the
9800 image const changes.
9802 * commandtags.h, src/LyXAction.C (init): new function:
9803 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9804 This file is not read automatically but you can add \input
9805 preferences to your lyxrc if you want to. We need to discuss how
9808 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9809 in .aux, also remove .bib and .bst files from dependencies when
9812 * src/BufferView.C, src/LyXView.C: add const_cast several places
9813 because of changes to images.
9815 * lib/images/*: same change as for images/*
9817 * lib/lyxrc.example: Default for accept_compound is false not no.
9819 * images/*: changed to be const, however I have som misgivings
9820 about this change so it might be changed back.
9822 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9824 * lib/configure, po/POTFILES.in: regenerated
9826 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9828 * config/lib_configure.m4: removed
9830 * lib/configure.m4: new file (was config/lib_configure.m4)
9832 * configure.in: do not test for rtti, since we do not use it.
9834 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9836 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9837 doubling of allocated space scheme. This makes it faster for large
9838 strings end to use less memory for small strings. xtra rememoved.
9840 * src/insets/figinset.C (waitalarm): commented out.
9841 (GhostscriptMsg): use static_cast
9842 (GhostscriptMsg): use new instead of malloc to allocate memory for
9843 cmap. also delete the memory after use.
9845 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9847 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9848 for changes in bibtex database or style.
9849 (runBibTeX): remove all .bib and .bst files from dep before we
9851 (run): use scanAuc in when dep file already exist.
9853 * src/DepTable.C (remove_files_with_extension): new method
9856 * src/DepTable.[Ch]: made many of the methods const.
9858 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9860 * src/bufferparams.C: make sure that the default textclass is
9861 "article". It used to be the first one by description order, but
9862 now the first one is "docbook".
9864 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9865 string; call Debug::value.
9866 (easyParse): pass complete argument to setDebuggingLevel().
9868 * src/debug.h (value): fix the code that parses debug levels.
9870 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9873 * src/LyXAction.C: use Debug::ACTION as debug channel.
9875 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9877 * NEWS: updated for the future 1.1.3 release.
9879 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9880 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9881 it should. This is of course a controversial change (since many
9882 people will find that their lyx workscreen is suddenly full of
9883 red), but done for the sake of correctness.
9885 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9886 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9888 * src/insets/inseterror.h, src/insets/inseturl.h,
9889 src/insets/insetinfo.h, src/insets/figinset.h,
9890 src/mathed/formulamacro.h, src/mathed/math_macro.h
9891 (EditMessage): add a missing const and add _() to make sure that
9894 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9895 src/insets/insetbib.C, src/support/filetools.C: add `using'
9898 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9899 doing 'Insert index of last word' at the beginning of a paragraph.
9901 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9903 * several files: white-space changes.
9905 * src/mathed/formula.C: removed IsAlpha and IsDigit
9907 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9908 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9911 * src/insets/figinset.C (GetPSSizes): don't break when
9912 "EndComments" is seen. But break when a boundingbox is read.
9914 * all classes inherited from Inset: return value of Clone
9915 changed back to Inset *.
9917 * all classes inherited form MathInset: return value of Clone
9918 changed back to MathedInset *.
9920 * src/insets/figinset.C (runqueue): use a ofstream to output the
9921 gs/ps file. Might need some setpresicion or setw. However I can
9922 see no problem with the current code.
9923 (runqueue): use sleep instead of the alarm/signal code. I just
9924 can't see the difference.
9926 * src/paragraph.C (LyXParagraph): reserve space in the new
9927 paragraph and resize the inserted paragraph to just fit.
9929 * src/lyxfunc.h (operator|=): added operator for func_status.
9931 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9932 check for readable file.
9934 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9935 check for readable file.
9936 (MenuMakeLinuxDoc): ditto
9937 (MenuMakeDocBook): ditto
9938 (MenuMakeAscii): ditto
9939 (InsertAsciiFile): split the test for openable and readable
9941 * src/bmtable.C (draw_bitmaptable): use
9942 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9944 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9945 findtexfile from LaTeX to filetools.
9947 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9948 instead of FilePtr. Needs to be verified by a literate user.
9950 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9952 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9953 (EditMessage): likewise.
9955 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9956 respectively as \textasciitilde and \textasciicircum.
9958 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9960 * src/support/lyxstring.h: made the methods that take iterators
9963 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9964 (regexMatch): made is use the real regex class.
9966 * src/support/Makefile.am: changed to use libtool
9968 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9970 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9972 (MathIsInset ++): changed several macros to be inline functions
9975 * src/mathed/Makefile.am: changed to use libtool
9977 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9979 * src/insets/inset* : Clone changed to const and return type is
9980 the true insettype not just Inset*.
9982 * src/insets/Makefile.am: changed to use libtool
9984 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9986 * src/undo.[Ch] : added empty() and changed some of the method
9989 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9991 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9992 setID use block<> for the bullets array, added const several places.
9994 * src/lyxfunc.C (getStatus): new function
9996 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9997 LyXAction, added const to several funtions.
9999 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10000 a std::map, and to store the dir items in a vector.
10002 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10005 * src/LyXView.[Ch] + other files : changed currentView to view.
10007 * src/LyXAction.[Ch] : ported from the old devel branch.
10009 * src/.cvsignore: added .libs and a.out
10011 * configure.in : changes to use libtool.
10013 * acinclude.m4 : inserted libtool.m4
10015 * .cvsignore: added libtool
10017 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10019 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10020 file name in insets and mathed directories (otherwise the
10021 dependency is not taken in account under cygwin).
10023 * src/text2.C (InsertString[AB]): make sure that we do not try to
10024 read characters past the string length.
10026 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10028 * lib/doc/LaTeXConfig.lyx.in,
10029 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10031 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10032 file saying who created them and when this heppened; this is
10033 useless and annoys tools like cvs.
10035 * lib/layouts/g-brief-{en,de}.layout,
10036 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10037 from Thomas Hartkens <thomas@hartkens.de>.
10039 * src/{insets,mathed}/Makefile.am: do not declare an empty
10040 LDFLAGS, so that it can be set at configure time (useful on Irix
10043 * lib/reLyX/configure.in: make sure that the prefix is set
10044 correctly in LYX_DIR.
10046 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10048 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10049 be used by 'command-sequence' this allows to bind a key to a
10050 sequence of LyX-commands
10051 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10053 * src/LyXAction.C: add "command-sequence"
10055 * src/LyXFunction.C: handling of "command-sequence"
10057 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10058 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10060 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10062 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10064 * src/buffer.C (writeFile): Do not output a comment giving user
10065 and date at the beginning of a .lyx file. This is useless and
10066 annoys cvs anyway; update version number to 1.1.
10068 * src/Makefile.am (LYX_DIR): add this definition, so that a
10069 default path is hardcoded in LyX.
10071 * configure.in: Use LYX_GNU_GETTEXT.
10073 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10074 AM_GNU_GETTEXT with a bug fixed.
10076 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10078 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10080 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10081 which is used to point to LyX data is now LYX_DIR_11x.
10083 * lyx.man: convert to a unix text file; small updates.
10085 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10087 * src/support/LSubstring.[Ch]: made the second arg of most of the
10088 constructors be a const reference.
10090 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10093 * src/support/lyxstring.[Ch] (swap): added missing member function
10094 and specialization of swap(str, str);
10096 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10098 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10099 trace of the old one.
10101 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10102 put the member definitions in undo.C.
10104 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10105 NEW_TEXT and have now only code that was included when this was
10108 * src/intl.C (LCombo): use static_cast
10110 (DispatchCallback): ditto
10112 * src/definitions.h: removed whole file
10114 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10116 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10117 parsing and stores in a std:map. a regex defines the file format.
10118 removed unneeded members.
10120 * src/bufferparams.h: added several enums from definitions.h here.
10121 Removed unsused destructor. Changed some types to use proper enum
10122 types. use block to have the temp_bullets and user_defined_bullets
10123 and to make the whole class assignable.
10125 * src/bufferparams.C (Copy): removed this functions, use a default
10126 assignment instead.
10128 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10131 * src/buffer.C (readLyXformat2): commend out all that have with
10132 oldpapersize to do. also comment out all that hve to do with
10133 insetlatex and insetlatexdel.
10134 (setOldPaperStuff): commented out
10136 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10138 * src/LyXAction.C: remove use of inset-latex-insert
10140 * src/mathed/math_panel.C (button_cb): use static_cast
10142 * src/insets/Makefile.am (insets_o_SOURCES): removed
10145 * src/support/lyxstring.C (helper): use the unsigned long
10146 specifier, UL, instead of a static_cast.
10148 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10150 * src/support/block.h: new file. to be used as a c-style array in
10151 classes, so that the class can be assignable.
10153 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10155 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10156 NULL, make sure to return an empty string (it is not possible to
10157 set a string to NULL).
10159 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10161 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10163 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10165 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10166 link line, so that Irix users (for example) can set it explicitely to
10169 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10170 it can be overidden at make time (static or dynamic link, for
10173 * src/vc-backend.C, src/LaTeXFeatures.h,
10174 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10175 statements to bring templates to global namespace.
10177 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10179 * src/support/lyxstring.C (operator[] const): make it standard
10182 * src/minibuffer.C (Init): changed to reflect that more
10183 information is given from the lyxvc and need not be provided here.
10185 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10187 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10189 * src/LyXView.C (UpdateTimerCB): use static_cast
10190 (KeyPressMask_raw_callback): ditto
10192 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10193 buffer_, a lot of changes because of this. currentBuffer() ->
10194 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10195 also changes to other files because of this.
10197 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10199 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10200 have no support for RCS and partial support for CVS, will be
10203 * src/insets/ several files: changes because of function name
10204 changes in Bufferview and LyXView.
10206 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10208 * src/support/LSubstring.[Ch]: new files. These implement a
10209 Substring that can be very convenient to use. i.e. is this
10211 string a = "Mary had a little sheep";
10212 Substring(a, "sheep") = "lamb";
10213 a is now "Mary has a little lamb".
10215 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10216 out patterns and subpatterns of strings. It is used by LSubstring
10217 and also by vc-backend.C
10219 * src/support/lyxstring.C: went over all the assertions used and
10220 tried to correct the wrong ones and flag which of them is required
10221 by the standard. some bugs found because of this. Also removed a
10222 couple of assertions.
10224 * src/support/Makefile.am (libsupport_a_SOURCES): added
10225 LSubstring.[Ch] and LRegex.[Ch]
10227 * src/support/FileInfo.h: have struct stat buf as an object and
10228 not a pointer to one, some changes because of this.
10230 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10231 information in layout when adding the layouts preamble to the
10232 textclass preamble.
10234 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10237 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10238 because of bug in OS/2.
10240 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10242 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10243 \verbatim@font instead of \ttfamily, so that it can be redefined.
10245 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10246 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10247 src/layout.h, src/text2.C: add 'using' directive to bring the
10248 STL templates we need from the std:: namespace to the global one.
10249 Needed by DEC cxx in strict ansi mode.
10251 * src/support/LIstream.h,src/support/LOstream.h,
10252 src/support/lyxstring.h,src/table.h,
10253 src/lyxlookup.h: do not include <config.h> in header
10254 files. This should be done in the .C files only.
10256 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10260 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10262 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10263 from Kayvan to fix the tth invokation.
10265 * development/lyx.spec.in: updates from Kayvan to reflect the
10266 changes of file names.
10268 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10270 * src/text2.C (InsertStringB): use std::copy
10271 (InsertStringA): use std::copy
10273 * src/bufferlist.C: use a vector to store the buffers in. This is
10274 an internal change and should not affect any other thing.
10276 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10279 * src/text.C (Fill): fix potential bug, one off bug.
10281 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10283 * src/Makefile.am (lyx_main.o): add more files it depends on.
10285 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10287 * src/support/lyxstring.C: use size_t for the reference count,
10288 size, reserved memory and xtra.
10289 (internal_compare): new private member function. Now the compare
10290 functions should work for std::strings that have embedded '\0'
10292 (compare): all compare functions rewritten to use
10295 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10297 * src/support/lyxstring.C (compare): pass c_str()
10298 (compare): pass c_str
10299 (compare): pass c_str
10301 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10303 * src/support/DebugStream.C: <config.h> was not included correctly.
10305 * lib/configure: forgot to re-generate it :( I'll make this file
10306 auto generated soon.
10308 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10310 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10313 * src/support/lyxstring.C: some changes from length() to rep->sz.
10314 avoids a function call.
10316 * src/support/filetools.C (SpaceLess): yet another version of the
10317 algorithm...now per Jean-Marc's suggestions.
10319 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10321 * src/layout.C (less_textclass_desc): functor for use in sorting
10323 (LyXTextClass::Read): sort the textclasses after reading.
10325 * src/support/filetools.C (SpaceLess): new version of the
10326 SpaceLess functions. What problems does this one give? Please
10329 * images/banner_bw.xbm: made the arrays unsigned char *
10331 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10333 * src/support/lyxstring.C (find): remove bogus assertion in the
10334 two versions of find where this has not been done yet.
10336 * src/support/lyxlib.h: add missing int return type to
10339 * src/menus.C (ShowFileMenu): disable exporting to html if no
10340 html export command is present.
10342 * config/lib_configure.m4: add a test for an HTML converter. The
10343 programs checked for are, in this order: tth, latex2html and
10346 * lib/configure: generated from config/lib_configure.m4.
10348 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10349 html converter. The parameters are now passed through $$FName and
10350 $$OutName, instead of standard input/output.
10352 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10354 * lib/lyxrc.example: update description of \html_command.
10355 add "quotes" around \screen_font_xxx font setting examples to help
10356 people who use fonts with spaces in their names.
10358 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10360 * Distribution files: updates for v1.1.2
10362 * src/support/lyxstring.C (find): remove bogus assert and return
10363 npos for the same condition.
10365 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10367 * added patch for OS/2 from SMiyata.
10369 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10371 * src/text2.C (CutSelection): make space_wrapped a bool
10372 (CutSelection): dont declare int i until we have to.
10373 (alphaCounter): return a char const *.
10375 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10377 * src/support/syscall.C (Systemcalls::kill):
10378 src/support/filetools.C (PutEnv, PutEnvPath):
10379 src/lyx_cb.C (addNewlineAndDepth):
10380 src/FontInfo.C (FontInfo::resize): condition some #warning
10381 directives with WITH_WARNINGS.
10384 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10386 * src/layout.[Ch] + several files: access to class variables
10387 limited and made accessor functions instead a lot of code changed
10388 becuase of this. Also instead of returning pointers often a const
10389 reference is returned instead.
10391 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10393 * src/Makefile.am (dist-hook): added used to remove the CVS from
10394 cheaders upon creating a dist
10395 (EXTRA_DIST): added cheaders
10397 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10398 a character not as a small integer.
10400 * src/support/lyxstring.C (find): removed Assert and added i >=
10401 rep->sz to the first if.
10403 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10405 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10406 src/LyXView.C src/buffer.C src/bufferparams.C
10407 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10408 src/text2.C src/insets/insetinclude.C:
10409 lyxlayout renamed to textclasslist.
10411 * src/layout.C: some lyxerr changes.
10413 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10414 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10415 (LyXLayoutList): removed all traces of this class.
10416 (LyXTextClass::Read): rewrote LT_STYLE
10417 (LyXTextClass::hasLayout): new function
10418 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10419 both const and nonconst version.
10420 (LyXTextClass::delete_layout): new function.
10421 (LyXTextClassList::Style): bug fix. do the right thing if layout
10423 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10424 (LyXTextClassList::NameOfLayout): ditto
10425 (LyXTextClassList::Load): ditto
10427 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10429 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10431 * src/LyXAction.C (LookupFunc): added a workaround for sun
10432 compiler, on the other hand...we don't know if the current code
10433 compiles on sun at all...
10435 * src/support/filetools.C (CleanupPath): subst fix
10437 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10440 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10441 complained about this one?
10443 * src/insets/insetinclude.C (Latex): subst fix
10445 * src/insets/insetbib.C (getKeys): subst fix
10447 * src/LyXSendto.C (SendtoApplyCB): subst fix
10449 * src/lyx_main.C (init): subst fix
10451 * src/layout.C (Read): subst fix
10453 * src/lyx_sendfax_main.C (button_send): subst fix
10455 * src/buffer.C (RoffAsciiTable): subst fix
10457 * src/lyx_cb.C (MenuFax): subst fix
10458 (PrintApplyCB): subst fix
10460 1999-10-26 Juergen Vigna <jug@sad.it>
10462 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10464 (Read): Cleaned up this code so now we read only format vestion >= 5
10466 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10468 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10469 come nobody has complained about this one?
10471 * src/insets/insetinclude.C (Latex): subst fix
10473 * src/insets/insetbib.C (getKeys): subst fix
10475 * src/lyx_main.C (init): subst fix
10477 * src/layout.C (Read): subst fix
10479 * src/buffer.C (RoffAsciiTable): subst fix
10481 * src/lyx_cb.C (MenuFax): subst fix.
10483 * src/layout.[hC] + some other files: rewrote to use
10484 std::container to store textclasses and layouts in.
10485 Simplified, removed a lot of code. Make all classes
10486 assignable. Further simplifications and review of type
10487 use still to be one.
10489 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10490 lastfiles to create the lastfiles partr of the menu.
10492 * src/lastfiles.[Ch]: rewritten to use deque to store the
10493 lastfiles in. Uses fstream for reading and writing. Simplifies
10496 * src/support/syscall.C: remove explicit cast.
10498 * src/BufferView.C (CursorToggleCB): removed code snippets that
10499 were commented out.
10500 use explicat C++ style casts instead of C style casts. also use
10501 u_vdata instea of passing pointers in longs.
10503 * src/PaperLayout.C: removed code snippets that were commented out.
10505 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10507 * src/lyx_main.C: removed code snippets that wer commented out.
10509 * src/paragraph.C: removed code snippets that were commented out.
10511 * src/lyxvc.C (logClose): use static_cast
10513 (viewLog): remove explicit cast to void*
10514 (showLog): removed old commented code
10516 * src/menus.C: use static_cast instead of C style casts. use
10517 u_vdata instead of u_ldata. remove explicit cast to (long) for
10518 pointers. Removed old code that was commented out.
10520 * src/insets/inset.C: removed old commented func
10522 * src/insets/insetref.C (InsetRef): removed old code that had been
10523 commented out for a long time.
10525 (escape): removed C style cast
10527 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10529 * src/insets/insetlatex.C (Draw): removed old commented code
10530 (Read): rewritten to use string
10532 * src/insets/insetlabel.C (escape): removed C style cast
10534 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10536 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10537 old commented code.
10539 * src/insets/insetinclude.h: removed a couple of stupid bools
10541 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10542 (Clone): remove C style cast
10543 (getKeys): changed list to lst because of std::list
10545 * src/insets/inseterror.C (Draw): removed som old commented code.
10547 * src/insets/insetcommand.C (Draw): removed some old commented code.
10549 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10550 commented out forever.
10551 (bibitem_cb): use static_cast instead of C style cast
10552 use of vdata changed to u_vdata.
10554 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10556 (CloseUrlCB): use static_cast instead of C style cast.
10557 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10559 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10560 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10561 (CloseInfoCB): static_cast from ob->u_vdata instead.
10562 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10565 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10566 (C_InsetError_CloseErrorCB): forward the ob parameter
10567 (CloseErrorCB): static_cast from ob->u_vdata instead.
10569 * src/vspace.h: include LString.h since we use string in this class.
10571 * src/vspace.C (lyx_advance): changed name from advance because of
10572 nameclash with stl. And since we cannot use namespaces yet...I
10573 used a lyx_ prefix instead. Expect this to change when we begin
10576 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10578 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10579 and removed now defunct constructor and deconstructor.
10581 * src/BufferView.h: have backstack as a object not as a pointer.
10582 removed initialization from constructor. added include for BackStack
10584 * development/lyx.spec.in (%build): add CFLAGS also.
10586 * src/screen.C (drawFrame): removed another warning.
10588 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10590 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10591 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10592 README and ANNOUNCE a bit for the next release. More work is
10595 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10596 unbreakable if we are in freespacing mode (LyX-Code), but not in
10599 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10601 * src/BackStack.h: fixed initialization order in constructor
10603 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10605 * acinclude.m4 (VERSION): new rules for when a version is
10606 development, added also a variable for prerelease.
10607 (warnings): we set with_warnings=yes for prereleases
10608 (lyx_opt): prereleases compile with same optimization as development
10609 (CXXFLAGS): only use pedantic if we are a development version
10611 * src/BufferView.C (restorePosition): don't do anything if the
10612 backstack is empty.
10614 * src/BackStack.h: added member empty, use this to test if there
10615 is anything to pop...
10617 1999-10-25 Juergen Vigna <jug@sad.it>
10620 * forms/layout_forms.fd +
10621 * forms/latexoptions.fd +
10622 * lyx.fd: changed for various form resize issues
10624 * src/mathed/math_panel.C +
10625 * src/insets/inseterror.C +
10626 * src/insets/insetinfo.C +
10627 * src/insets/inseturl.C +
10628 * src/insets/inseturl.h +
10630 * src/LyXSendto.C +
10631 * src/PaperLayout.C +
10632 * src/ParagraphExtra.C +
10633 * src/TableLayout.C +
10635 * src/layout_forms.C +
10642 * src/menus.C: fixed various resize issues. So now forms can be
10643 resized savely or not be resized at all.
10645 * forms/form_url.fd +
10646 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10649 * src/insets/Makefile.am: added files form_url.[Ch]
10651 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10653 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10654 (and presumably 6.2).
10656 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10657 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10658 remaining static member callbacks.
10660 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10663 * src/support/lyxstring.h: declare struct Srep as friend of
10664 lyxstring, since DEC cxx complains otherwise.
10666 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10668 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10670 * src/LaTeX.C (run): made run_bibtex also depend on files with
10672 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10673 are put into the dependency file.
10675 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10676 the code has shown itself to work
10677 (create_ispell_pipe): removed another warning, added a comment
10680 * src/minibuffer.C (ExecutingCB): removed code that has been
10681 commented out a long time
10683 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10684 out code + a warning.
10686 * src/support/lyxstring.h: comment out the three private
10687 operators, when compiling with string ansi conforming compilers
10688 they make problems.
10690 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10692 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10693 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10696 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10699 * src/mathed/math_panel.C (create_math_panel): remove explicit
10702 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10705 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10706 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10707 to XCreatePixmapFromBitmapData
10708 (fl_set_bmtable_data): change the last argument to be unsigned
10710 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10711 and bh to be unsigned int, remove explicit casts in call to
10712 XReadBitmapFileData.
10714 * images/arrows.xbm: made the arrays unsigned char *
10715 * images/varsz.xbm: ditto
10716 * images/misc.xbm: ditto
10717 * images/greek.xbm: ditto
10718 * images/dots.xbm: ditto
10719 * images/brel.xbm: ditto
10720 * images/bop.xbm: ditto
10722 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10724 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10725 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10726 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10728 (LYX_CXX_CHEADERS): added <clocale> to the test.
10730 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10732 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10734 * src/support/lyxstring.C (append): fixed something that must be a
10735 bug, rep->assign was used instead of rep->append.
10737 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10740 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10741 lyx insert double chars. Fix spotted by Kayvan.
10743 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10745 * Fixed the tth support. I messed up with the Emacs patch apply feature
10746 and omitted the changes in lyxrc.C.
10748 1999-10-22 Juergen Vigna <jug@sad.it>
10750 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10752 * src/lyx_cb.C (MenuInsertRef) +
10753 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10754 the form cannot be resized under it limits (fixes a segfault)
10756 * src/lyx.C (create_form_form_ref) +
10757 * forms/lyx.fd: Changed Gravity on name input field so that it is
10760 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10762 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10763 <ostream> and <istream>.
10765 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10766 whether <fstream> provides the latest standard features, or if we
10767 have an oldstyle library (like in egcs).
10768 (LYX_CXX_STL_STRING): fix the test.
10770 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10771 code on MODERN_STL_STREAM.
10773 * src/support/lyxstring.h: use L{I,O}stream.h.
10775 * src/support/L{I,O}stream.h: new files, designed to setup
10776 correctly streams for our use
10777 - includes the right header depending on STL capabilities
10778 - puts std::ostream and std::endl (for LOStream.h) or
10779 std::istream (LIStream.h) in toplevel namespace.
10781 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10783 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10784 was a bib file that had been changed we ensure that bibtex is run.
10785 (runBibTeX): enhanced to extract the names of the bib files and
10786 getting their absolute path and enter them into the dep file.
10787 (findtexfile): static func that is used to look for tex-files,
10788 checks for absolute patchs and tries also with kpsewhich.
10789 Alternative ways of finding the correct files are wanted. Will
10791 (do_popen): function that runs a command using popen and returns
10792 the whole output of that command in a string. Should be moved to
10795 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10796 file with extension ext has changed.
10798 * src/insets/figinset.C: added ifdef guards around the fl_free
10799 code that jug commented out. Now it is commented out when
10800 compiling with XForms == 0.89.
10802 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10803 to lyxstring.C, and only keep a forward declaration in
10804 lyxstring.h. Simplifies the header file a bit and should help a
10805 bit on compile time too. Also changes to Srep will not mandate a
10806 recompile of code just using string.
10807 (~lyxstring): definition moved here since it uses srep.
10808 (size): definition moved here since it uses srep.
10810 * src/support/lyxstring.h: removed a couple of "inline" that should
10813 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10815 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10818 1999-10-21 Juergen Vigna <jug@sad.it>
10820 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10821 set to left if I just remove the width entry (or it is empty).
10823 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10824 paragraph when having dummy paragraphs.
10826 1999-10-20 Juergen Vigna <jug@sad.it>
10828 * src/insets/figinset.C: just commented some fl_free_form calls
10829 and added warnings so that this calls should be activated later
10830 again. This avoids for now a segfault, but we have a memory leak!
10832 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10833 'const char * argument' to 'string argument', this should
10834 fix some Asserts() in lyxstring.C.
10836 * src/lyxfunc.h: Removed the function argAsString(const char *)
10837 as it is not used anymore.
10839 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10841 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10844 * src/Literate.h: some funcs moved from public to private to make
10845 interface clearer. Unneeded args removed.
10847 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10849 (scanBuildLogFile): ditto
10851 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10852 normal TeX Error. Still room for improvement.
10854 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10856 * src/buffer.C (insertErrors): changes to make the error
10857 desctription show properly.
10859 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10862 * src/support/lyxstring.C (helper): changed to use
10863 sizeof(object->rep->ref).
10864 (operator>>): changed to use a pointer instead.
10866 * src/support/lyxstring.h: changed const reference & to value_type
10867 const & lets see if that helps.
10869 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10871 * Makefile.am (rpmdist): fixed to have non static package and
10874 * src/support/lyxstring.C: removed the compilation guards
10876 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10879 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10880 conditional compile of lyxstring.Ch
10882 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10883 stupid check, but it is a lot better than the bastring hack.
10884 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10886 * several files: changed string::erase into string::clear. Not
10889 * src/chset.C (encodeString): use a char temporary instead
10891 * src/table.C (TexEndOfCell): added tostr around
10892 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10893 (TexEndOfCell): ditto
10894 (TexEndOfCell): ditto
10895 (TexEndOfCell): ditto
10896 (DocBookEndOfCell): ditto
10897 (DocBookEndOfCell): ditto
10898 (DocBookEndOfCell): ditto
10899 (DocBookEndOfCell): ditto
10901 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10903 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10905 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10906 (MenuBuildProg): added tostr around ret
10907 (MenuRunChktex): added tostr around ret
10908 (DocumentApplyCB): added tostr around ret
10910 * src/chset.C (encodeString): added tostr around t->ic
10912 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10913 (makeLaTeXFile): added tostr around tocdepth
10914 (makeLaTeXFile): added tostr around ftcound - 1
10916 * src/insets/insetbib.C (setCounter): added tostr around counter.
10918 * src/support/lyxstring.h: added an operator+=(int) to catch more
10921 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10922 (lyxstring): We DON'T allow NULL pointers.
10924 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10926 * src/mathed/math_macro.C (MathMacroArgument::Write,
10927 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10928 when writing them out.
10930 * src/LString.C: remove, since it is not used anymore.
10932 * src/support/lyxstring.C: condition the content to
10933 USE_INCLUDED_STRING macro.
10935 * src/mathed/math_symbols.C, src/support/lstrings.C,
10936 src/support/lyxstring.C: add `using' directive to specify what
10937 we need in <algorithm>. I do not think that we need to
10938 conditionalize this, but any thought is appreciated.
10940 * many files: change all callback functions to "C" linkage
10941 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10942 strict_ansi. Those who were static are now global.
10943 The case of callbacks which are static class members is
10944 trickier, since we have to make C wrappers around them (see
10945 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10946 did not finish this yet, since it defeats the purpose of
10947 encapsulation, and I am not sure what the best route is.
10949 1999-10-19 Juergen Vigna <jug@sad.it>
10951 * src/support/lyxstring.C (lyxstring): we permit to have a null
10952 pointer as assignment value and just don't assign it.
10954 * src/vspace.C (nextToken): corrected this function substituting
10955 find_first(_not)_of with find_last_of.
10957 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10958 (TableOptCloseCB) (TableSpeCloseCB):
10959 inserted fl_set_focus call for problem with fl_hide_form() in
10962 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10964 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10967 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10969 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10970 LyXLex::next() and not eatline() to get its argument.
10972 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10974 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10975 instead, use fstreams for io of the depfile, removed unneeded
10976 functions and variables.
10978 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10979 vector instead, removed all functions and variables that is not in
10982 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10984 * src/buffer.C (insertErrors): use new interface to TeXError
10986 * Makefile.am (rpmdist): added a rpmdist target
10988 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10989 per Kayvan's instructions.
10991 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10993 * src/Makefile.am: add a definition for localedir, so that locales
10994 are found after installation (Kayvan)
10996 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10998 * development/.cvsignore: new file.
11000 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11002 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11003 C++ compiler provides wrappers for C headers and use our alternate
11006 * configure.in: use LYX_CXX_CHEADERS.
11008 * src/cheader/: new directory, populated with cname headers from
11009 libstdc++-2.8.1. They are a bit old, but probably good enough for
11010 what we want (support compilers who lack them).
11012 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11013 from includes. It turns out is was stupid.
11015 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11017 * lib/Makefile.am (install-data-local): forgot a ';'
11018 (install-data-local): forgot a '\'
11019 (libinstalldirs): needed after all. reintroduced.
11021 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11023 * configure.in (AC_OUTPUT): added lyx.spec
11025 * development/lyx.spec: removed file
11027 * development/lyx.spec.in: new file
11029 * po/*.po: merged with lyx.pot becuase of make distcheck
11031 * lib/Makefile.am (dist-hook): added dist-hook so that
11032 documentation files will be included when doing a make
11033 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11034 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11036 more: tried to make install do the right thing, exclude CVS dirs
11039 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11040 Path would fit in more nicely.
11042 * all files that used to use pathstack: uses now Path instead.
11043 This change was a lot easier than expected.
11045 * src/support/path.h: new file
11047 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11049 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11051 * src/support/lyxstring.C (getline): Default arg was given for
11054 * Configure.cmd: removed file
11056 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11058 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11059 streams classes and types, add the proper 'using' statements when
11060 MODERN_STL is defined.
11062 * src/debug.h: move the << operator definition after the inclusion
11065 * src/support/filetools.C: include "LAssert.h", which is needed
11068 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11071 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11072 include "debug.h" to define a proper ostream.
11074 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11076 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11077 method to the SystemCall class which can kill a process, but it's
11078 not fully implemented yet.
11080 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11082 * src/support/FileInfo.h: Better documentation
11084 * src/lyxfunc.C: Added support for buffer-export html
11086 * src/menus.C: Added Export->As HTML...
11088 * lib/bind/*.bind: Added short-cut for buffer-export html
11090 * src/lyxrc.*: Added support for new \tth_command
11092 * lib/lyxrc.example: Added stuff for new \tth_command
11094 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11096 * lib/Makefile.am (IMAGES): removed images/README
11097 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11098 installes in correct place. Check permisions is installed
11101 * src/LaTeX.C: some no-op changes moved declaration of some
11104 * src/LaTeX.h (LATEX_H): changed include guard name
11106 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11108 * lib/reLyX/Makefile.am: install noweb2lyx.
11110 * lib/Makefile.am: install configure.
11112 * lib/reLyX/configure.in: declare a config aux dir; set package
11113 name to lyx (not sure what the best solution is); generate noweb2lyx.
11115 * lib/layouts/egs.layout: fix the bibliography layout.
11117 1999-10-08 Jürgen Vigna <jug@sad.it>
11119 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11120 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11121 it returned without continuing to search the path.
11123 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11125 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11126 also fixes a bug. It is not allowed to do tricks with std::strings
11127 like: string a("hei"); &a[e]; this will not give what you
11128 think... Any reason for the complexity in this func?
11130 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11132 * Updated README and INSTALL a bit, mostly to check that my
11133 CVS rights are correctly set up.
11135 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11137 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11138 does not allow '\0' chars but lyxstring and std::string does.
11140 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11142 * autogen.sh (AUTOCONF): let the autogen script create the
11143 POTFILES.in file too. POTFILES.in should perhaps now not be
11144 included in the cvs module.
11146 * some more files changed to use C++ includes instead of C ones.
11148 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11150 (Reread): added tostr to nlink. buggy output otherwise.
11151 (Reread): added a string() around szMode when assigning to Buffer,
11152 without this I got a log of garbled info strings.
11154 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11157 * I have added several ostream & operator<<(ostream &, some_type)
11158 functions. This has been done to avoid casting and warnings when
11159 outputting enums to lyxerr. This as thus eliminated a lot of
11160 explicit casts and has made the code clearer. Among the enums
11161 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11162 mathed enums, some font enum the Debug::type enum.
11164 * src/support/lyxstring.h (clear): missing method. equivalent of
11167 * all files that contained "stderr": rewrote constructs that used
11168 stderr to use lyxerr instead. (except bmtable)
11170 * src/support/DebugStream.h (level): and the passed t with
11171 Debug::ANY to avoid spurious bits set.
11173 * src/debug.h (Debug::type value): made it accept strings of the
11174 type INFO,INIT,KEY.
11176 * configure.in (Check for programs): Added a check for kpsewhich,
11177 the latex generation will use this later to better the dicovery of
11180 * src/BufferView.C (create_view): we don't need to cast this to
11181 (void*) that is done automatically.
11182 (WorkAreaButtonPress): removed some dead code.
11184 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11186 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11187 is not overwritten when translated (David Sua'rez de Lis).
11189 * lib/CREDITS: Added David Sua'rez de Lis
11191 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11193 * src/bufferparams.C (BufferParams): default input encoding is now
11196 * acinclude.m4 (cross_compiling): comment out macro
11197 LYX_GXX_STRENGTH_REDUCE.
11199 * acconfig.h: make sure that const is not defined (to empty) when
11200 we are compiling C++. Remove commented out code using SIZEOF_xx
11203 * configure.in : move the test for const and inline as late as
11204 possible so that these C tests do not interefere with C++ ones.
11205 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11206 has not been proven.
11208 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11210 * src/table.C (getDocBookAlign): remove bad default value for
11211 isColumn parameter.
11213 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11215 (ShowFileMenu2): ditto.
11217 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11218 of files to ignore.
11220 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11222 * Most files: finished the change from the old error code to use
11223 DebugStream for all lyxerr debugging. Only minor changes remain
11224 (e.g. the setting of debug levels using strings instead of number)
11226 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11228 * src/layout.C (Add): Changed to use compare_no_case instead of
11231 * src/FontInfo.C: changed loop variable type too string::size_type.
11233 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11235 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11236 set ETAGS_ARGS to --c++
11238 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11240 * src/table.C (DocBookEndOfCell): commented out two unused variables
11242 * src/paragraph.C: commented out four unused variables.
11244 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11245 insed a if clause with type string::size_type.
11247 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11250 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11252 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11253 variable, also changed loop to go from 0 to lenght + 1, instead of
11254 -1 to length. This should be correct.
11256 * src/LaTeX.C (scanError): use string::size_type as loop variable
11259 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11260 (l.896) since y_tmp and row was not used anyway.
11262 * src/insets/insetref.C (escape): use string::size_type as loop
11265 * src/insets/insetquotes.C (Width): use string::size_type as loop
11267 (Draw): use string::size_type as loop variable type.
11269 * src/insets/insetlatexaccent.C (checkContents): use
11270 string::size_type as loop variable type.
11272 * src/insets/insetlabel.C (escape): use string::size_type as loop
11275 * src/insets/insetinfo.C: added an extern for current_view.
11277 * src/insets/insetcommand.C (scanCommand): use string::size_type
11278 as loop variable type.
11280 * most files: removed the RCS tags. With them we had to recompile
11281 a lot of files after a simple cvs commit. Also we have never used
11282 them for anything meaningful.
11284 * most files: tags-query-replace NULL 0. As adviced several plases
11285 we now use "0" instead of "NULL" in our code.
11287 * src/support/filetools.C (SpaceLess): use string::size_type as
11288 loop variable type.
11290 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11292 * src/paragraph.C: fixed up some more string stuff.
11294 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11296 * src/support/filetools.h: make modestr a std::string.
11298 * src/filetools.C (GetEnv): made ch really const.
11300 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11301 made code that used these use max/min from <algorithm> instead.
11303 * changed several c library include files to their equivalent c++
11304 library include files. All is not changed yet.
11306 * created a support subdir in src, put lyxstring and lstrings
11307 there + the extra files atexit, fileblock, strerror. Created
11308 Makefile.am. edited configure.in and src/Makefile.am to use this
11309 new subdir. More files moved to support.
11311 * imported som of the functions from repository lyx, filetools
11313 * ran tags-query-replace on LString -> string, corrected the bogus
11314 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11315 is still some errors in there. This is errors where too much or
11316 too litle get deleted from strings (string::erase, string::substr,
11317 string::replace), there can also be some off by one errors, or
11318 just plain wrong use of functions from lstrings. Viewing of quotes
11321 * LyX is now running fairly well with string, but there are
11322 certainly some bugs yet (see above) also string is quite different
11323 from LString among others in that it does not allow null pointers
11324 passed in and will abort if it gets any.
11326 * Added the revtex4 files I forgot when setting up the repository.
11328 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11330 * All over: Tried to clean everything up so that only the files
11331 that we really need are included in the cvs repository.
11332 * Switched to use automake.
11333 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11334 * Install has not been checked.
11336 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11338 * po/pt.po: Three errors:
11339 l.533 and l.538 format specification error
11340 l. 402 duplicate entry, I just deleted it.