1 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4 make buttonStatus and isReadOnly be const methods. (also reflect
5 this in derived classes.)
7 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
8 (nextState): change to be static inline, pass the StateMachine as
10 (PreferencesPolicy): remove casts
11 (OkCancelPolicy): remvoe casts
12 (OkCancelReadOnlyPolicy): remove casts
13 (NoRepeatedApplyReadOnlyPolicy): remove casts
14 (OkApplyCancelReadOnlyPolicy): remove casts
15 (OkApplyCancelPolicy): remove casts
16 (NoRepeatedApplyPolicy): remove casts
18 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
20 * src/converter.C: added some using directives
22 * src/frontends/ButtonPolicies.C: changes to overcome
23 "need lvalue" error with DEC c++
25 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
26 to WMHideCB for DEC c++
28 * src/frontends/xforms/Menubar_pimpl.C: added using directive
30 * src/frontends/xforms/forms/form_document.C.patch: use C callback
31 to BulletBMTableCB for DEC c++
33 2000-08-31 Allan Rae <rae@lyx.org>
35 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
36 character dialog separately from old document dialogs combo_language.
39 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
41 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
42 Removed LFUN_REF_CREATE.
44 * src/MenuBackend.C: Added new tags: toc and references
46 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
47 (add_lastfiles, add_documents, add_formats): Removed the unused smn
49 (add_toc, add_references): New methods.
50 (create_submenu): Handle correctly the case when there is a
51 seperator after optional menu items.
53 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
54 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
55 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
57 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
59 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
61 * src/converter.[Ch]: New file for converting between different
64 * src/export.[Ch]: New file for exporting a LyX file to different
67 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
68 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
69 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
70 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
71 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
72 RunDocBook, MenuExport.
74 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
75 Exporter::Preview methods if NEW_EXPORT is defined.
77 * src/buffer.C (Dispatch): Use Exporter::Export.
79 * src/lyxrc.C: Added new tags: \converter and \viewer.
82 * src/LyXAction.C: Define new lyx-function: buffer-update.
83 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
84 when NEW_EXPORT is defined.
86 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
88 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
90 * lib/ui/default.ui: Added submenus "view" and "update" to the
93 * src/filetools.C (GetExtension): New function.
95 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
97 2000-08-29 Allan Rae <rae@lyx.org>
99 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
101 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
102 (EnableDocumentLayout): removed
103 (DisableDocumentLayout): removed
104 (build): make use of ButtonController's read-only handling to
105 de/activate various objects. Replaces both of the above functions.
107 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
108 (readOnly): was read_only
109 (refresh): fixed dumb mistakes with read_only_ handling
111 * src/frontends/xforms/forms/form_document.fd:
112 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
113 tabbed dialogs so the tabs look more like tabs and so its easier to
114 work out which is the current tab.
116 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
117 segfault with form_table
119 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
121 2000-08-28 Juergen Vigna <jug@sad.it>
123 * acconfig.h: added USE_PSPELL.
125 * src/config.h.in: added USE_PSPELL.
127 * autogen.sh: added pspell.m4
129 * config/pspell.m4: new file.
131 * src/spellchecker.C: implemented support for pspell libary.
133 2000-08-25 Juergen Vigna <jug@sad.it>
135 * src/LyXAction.C (init): renamed LFUN_TABLE to
136 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
138 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
140 * src/lyxscreen.h: add force_clear variable and fuction to force
141 a clear area when redrawing in LyXText.
143 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
145 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
147 * some whitespace and comment changes.
149 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
151 * src/buffer.C: up te LYX_FORMAT to 2.17
153 2000-08-23 Juergen Vigna <jug@sad.it>
155 * src/BufferView_pimpl.C (tripleClick): disable this when in a
158 * src/insets/insettabular.C (pasteSelection): delete the insets
159 LyXText as it is not valid anymore.
160 (copySelection): new function.
161 (pasteSelection): new function.
162 (cutSelection): new function.
163 (LocalDispatch): implemented cut/copy/paste of cell selections.
165 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
166 don't have a LyXText.
168 * src/LyXAction.C (init): a NEW_TABULAR define too much.
170 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
173 2000-08-22 Juergen Vigna <jug@sad.it>
175 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
176 ifdef form_table out if NEW_TABULAR.
178 2000-08-21 Juergen Vigna <jug@sad.it>
180 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
181 (draw): fixed draw position so that the cursor is positioned in the
183 (InsetMotionNotify): hide/show cursor so the position is updated.
184 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
185 using cellstart() function where it should be used.
187 * src/insets/insettext.C (draw): ditto.
189 * src/tabular.C: fixed initialization of some missing variables and
190 made BoxType into an enum.
192 2000-08-22 Marko Vendelin <markov@ioc.ee>
193 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
194 stock menu item using action numerical value, not its string
198 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
200 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
201 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
203 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
205 * src/frontends/xforms/GUIRunTime.C: new file
207 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
208 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
210 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
212 * src/frontends/kde/GUIRunTime.C: new file
214 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
215 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
217 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
219 * src/frontends/gnome/GUIRunTime.C: new file
221 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
224 * src/frontends/GUIRunTime.h: removed constructor and destructor,
225 small change to documetentation.
227 * src/frontends/GUIRunTime.C: removed file
229 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
231 * src/lyxparagraph.h: enable NEW_TABULAR as default
233 * src/lyxfunc.C (processKeySym): remove some commented code
235 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
236 NEW_TABULAR around the fd_form_table_options.
238 * src/lyx_gui.C (runTime): call the static member function as
239 GUIRunTime::runTime().
241 2000-08-21 Allan Rae <rae@lyx.org>
243 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
246 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
248 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
250 2000-08-21 Allan Rae <rae@lyx.org>
252 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
254 * src/frontends/xforms/FormPreferences.C (build): use setOK
255 * src/frontends/xforms/FormDocument.C (build): use setOK
256 (FormDocument): use the appropriate policy.
258 2000-08-21 Allan Rae <rae@lyx.org>
260 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
261 automatic [de]activation of arbitrary objects when in a read-only state.
263 * src/frontends/ButtonPolicies.h: More documentation
264 (isReadOnly): added to support the above.
266 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
268 2000-08-18 Juergen Vigna <jug@sad.it>
270 * src/insets/insettabular.C (getStatus): changed to return func_status.
272 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
273 display toggle menu entries if they are.
275 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
276 new document layout now.
278 * src/lyxfunc.C: ditto
280 * src/lyx_gui_misc.C: ditto
282 * src/lyx_gui.C: ditto
284 * lib/ui/default.ui: removed paper and quotes layout as they are now
285 all in the document layout tabbed folder.
287 * src/frontends/xforms/forms/form_document.fd: added Restore
288 button and callbacks for all inputs for Allan's ButtonPolicy.
290 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
291 (CheckChoiceClass): added missing params setting on class change.
292 (UpdateLayoutDocument): added for updating the layout on params.
293 (build): forgot to RETURN_ALWAYS input_doc_spacing.
294 (FormDocument): Implemented Allan's ButtonPolicy with the
297 2000-08-17 Allan Rae <rae@lyx.org>
299 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
300 so we can at least see the credits again.
302 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
303 controller calls for the appropriate callbacks. Note that since Ok
304 calls apply followed by cancel, and apply isn't a valid input for the
305 APPLIED state, the bc_ calls have to be made in the static callback not
306 within each of the real callbacks.
308 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
309 (setOk): renamed from setOkay()
311 2000-08-17 Juergen Vigna <jug@sad.it>
313 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
314 in the implementation part.
315 (composeUIInfo): don't show optional menu-items.
317 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
319 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
321 * src/bufferview_funcs.C (CurrentState): fixed to show also the
322 text-state when in a text-inset.
324 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
326 2000-08-17 Marko Vendelin <markov@ioc.ee>
327 * src/frontends/gnome/FormIndex.C
328 * src/frontends/gnome/FormIndex.h
329 * src/frontends/gnome/FormToc.C
330 * src/frontends/gnome/FormToc.h
331 * src/frontends/gnome/dialogs
332 * src/frontends/gnome/diatoc_callbacks.c
333 * src/frontends/gnome/diatoc_callbacks.h
334 * src/frontends/gnome/diainsertindex_callbacks.h
335 * src/frontends/gnome/diainsertindex_callbacks.c
336 * src/frontends/gnome/diainsertindex_interface.c
337 * src/frontends/gnome/diainsertindex_interface.h
338 * src/frontends/gnome/diatoc_interface.h
339 * src/frontends/gnome/diatoc_interface.c
340 * src/frontends/gnome/Makefile.am: Table of Contents and
341 Insert Index dialogs implementation for Gnome frontend
343 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
345 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
347 * src/frontends/gnome/diainserturl_interface.c: make the dialog
350 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
352 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
353 destructor. Don't definde if you don't need it
354 (processEvents): made static, non-blocking events processing for
356 (runTime): static method. event loop for xforms
357 * similar as above for kde and gnome.
359 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
361 (runTime): new method calss the real frontends runtime func.
363 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
365 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
367 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
369 2000-08-16 Juergen Vigna <jug@sad.it>
371 * src/lyx_gui.C (runTime): added GUII RunTime support.
373 * src/frontends/Makefile.am:
374 * src/frontends/GUIRunTime.[Ch]:
375 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
376 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
377 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
379 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
381 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
382 as this is already set in ${FRONTEND_INCLUDE} if needed.
384 * configure.in (CPPFLAGS): setting the include dir for the frontend
385 directory and don't set FRONTEND=xforms for now as this is executed
388 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
390 * src/frontends/kde/Makefile.am:
391 * src/frontends/kde/FormUrl.C:
392 * src/frontends/kde/FormUrl.h:
393 * src/frontends/kde/formurldialog.h:
394 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
396 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
398 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
400 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
402 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
405 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
407 * src/WorkArea.C (work_area_handler): more work to get te
408 FL_KEYBOARD to work with xforms 0.88 too, please test.
410 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
412 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
414 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
417 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
419 * src/Timeout.h: remove Qt::emit hack.
421 * several files: changes to allo doc++ compilation
423 * src/lyxfunc.C (processKeySym): new method
424 (processKeyEvent): comment out if FL_REVISION < 89
426 * src/WorkArea.C: change some debugging levels.
427 (WorkArea): set wantkey to FL_KEY_ALL
428 (work_area_handler): enable the FL_KEYBOARD clause, this enables
429 clearer code and the use of compose with XForms 0.89. Change to
430 use signals instead of calling methods in bufferview directly.
432 * src/Painter.C: change some debugging levels.
434 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
437 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
438 (workAreaKeyPress): new method
440 2000-08-14 Juergen Vigna <jug@sad.it>
442 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
444 * config/kde.m4: addes some features
446 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
447 include missing xforms dialogs.
449 * src/Timeout.h: a hack to be able to compile with qt/kde.
451 * sigc++/.cvsignore: added acinclude.m4
453 * lib/.cvsignore: added listerros
455 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
456 xforms tree as objects are needed for other frontends.
458 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
459 linking with not yet implemented xforms objects.
461 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
463 2000-08-14 Baruch Even <baruch.even@writeme.com>
465 * src/frontends/xforms/FormGraphics.h:
466 * src/frontends/xforms/FormGraphics.C:
467 * src/frontends/xforms/RadioButtonGroup.h:
468 * src/frontends/xforms/RadioButtonGroup.C:
469 * src/insets/insetgraphics.h:
470 * src/insets/insetgraphics.C:
471 * src/insets/insetgraphicsParams.h:
472 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
473 instead of spaces, and various other indentation issues to make the
474 sources more consistent.
476 2000-08-14 Marko Vendelin <markov@ioc.ee>
478 * src/frontends/gnome/dialogs/diaprint.glade
479 * src/frontends/gnome/FormPrint.C
480 * src/frontends/gnome/FormPrint.h
481 * src/frontends/gnome/diaprint_callbacks.c
482 * src/frontends/gnome/diaprint_callbacks.h
483 * src/frontends/gnome/diaprint_interface.c
484 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
487 * src/frontends/gnome/dialogs/diainserturl.glade
488 * src/frontends/gnome/FormUrl.C
489 * src/frontends/gnome/FormUrl.h
490 * src/frontends/gnome/diainserturl_callbacks.c
491 * src/frontends/gnome/diainserturl_callbacks.h
492 * src/frontends/gnome/diainserturl_interface.c
493 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
496 * src/frontends/gnome/Dialogs.C
497 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
498 all other dialogs. Copy all unimplemented dialogs from Xforms
501 * src/frontends/gnome/support.c
502 * src/frontends/gnome/support.h: support files generated by Glade
506 * config/gnome.m4: Gnome configuration scripts
508 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
509 configure --help message
511 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
512 only if there are no events pendling in Gnome/Gtk. This enhances
513 the performance of menus.
516 2000-08-14 Allan Rae <rae@lyx.org>
518 * lib/Makefile.am: listerrors cleaning
520 * lib/listerrors: removed -- generated file
521 * acinclude.m4: ditto
522 * sigc++/acinclude.m4: ditto
524 * src/frontends/xforms/forms/form_citation.fd:
525 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
528 * src/frontends/xforms/forms/makefile: I renamed the `install` target
529 `updatesrc` and now we have a `test` target that does what `updatesrc`
530 used to do. I didn't like having an install target that wasn't related
533 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
534 on all except FormGraphics. This may yet happen. Followed by a major
535 cleanup including using FL_TRANSIENT for most of the dialogs. More
536 changes to come when the ButtonController below is introduced.
538 * src/frontends/xforms/ButtonController.h: New file for managing up to
539 four buttons on a dialog according to an externally defined policy.
540 * src/frontends/xforms/Makefile.am: added above
542 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
543 Apply and Cancel/Close buttons and everything in between and beyond.
544 * src/frontends/Makefile.am: added above.
546 * src/frontends/xforms/forms/form_preferences.fd:
547 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
548 and removed variable 'status' as a result. Fixed the set_minsize thing.
549 Use the new screen-font-update after checking screen fonts were changed
550 Added a "Restore" button to restore the original lyxrc values while
551 editing. This restores everything not just the last input changed.
552 That's still a tricky one. As is the "LyX: this shouldn't happen..."
554 * src/LyXAction.C: screen-font-update added for updating buffers after
555 screen font settings have been changed.
556 * src/commandtags.h: ditto
557 * src/lyxfunc.C: ditto
559 * forms/lyx.fd: removed screen fonts dialog.
560 * src/lyx_gui.C: ditto
561 * src/menus.[Ch]: ditto
562 * src/lyx.[Ch]: ditto
563 * src/lyx_cb.C: ditto + code from here moved to make
564 screen-font-update. And people wonder why progress on GUII is
565 slow. Look at how scattered this stuff was! It takes forever
568 * forms/fdfix.sh: Fixup the spacing after commas.
569 * forms/makefile: Remove date from generated files. Fewer clashes now.
570 * forms/bullet_forms.C.patch: included someones handwritten changes
572 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
573 once I've discovered why LyXRC was made noncopyable.
574 * src/lyx_main.C: ditto
576 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
578 * src/frontends/xforms/forms/fdfix.sh:
579 * src/frontends/xforms/forms/fdfixh.sed:
580 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
581 * src/frontends/xforms/Form*.[hC]:
582 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
583 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
584 provide a destructor for the struct FD_form_xxxx. Another version of
585 the set_[max|min]size workaround and a few other cleanups. Actually,
586 Angus' patch from 20000809.
588 2000-08-13 Baruch Even <baruch.even@writeme.com>
590 * src/insets/insetgraphics.C (Clone): Added several fields that needed
593 2000-08-11 Juergen Vigna <jug@sad.it>
595 * src/insets/insetgraphics.C (InsetGraphics): changing init
596 order because of warnings.
598 * src/frontends/xforms/forms/makefile: adding patching .C with
601 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
602 from .C.patch to .c.patch
604 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
605 order because of warning.
607 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
609 * src/frontends/Liason.C (setMinibuffer): new helper function
611 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
613 * src/lyxfunc.C (Dispatch): calling new Document-Layout
615 * lib/ui/default.ui: commented out PaperLayout entry
617 * src/frontends/xforms/form_document.[Ch]: new added files
619 * src/frontends/xforms/FormDocument.[Ch]: ditto
621 * src/frontends/xforms/forms/form_document.fd: ditto
623 * src/frontends/xforms/forms/form_document.C.patch: ditto
625 2000-08-10 Juergen Vigna <jug@sad.it>
627 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
628 (InsetGraphics): initialized cacheHandle to 0.
629 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
631 2000-08-10 Baruch Even <baruch.even@writeme.com>
633 * src/graphics/GraphicsCache.h:
634 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
635 correctly as a cache.
637 * src/graphics/GraphicsCacheItem.h:
638 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
641 * src/graphics/GraphicsCacheItem_pimpl.h:
642 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
645 * src/insets/insetgraphics.h:
646 * src/insets/insetgraphics.C: Changed from using a signal notification
647 to polling when image is not loaded.
649 2000-08-10 Allan Rae <rae@lyx.org>
651 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
652 that there are two functions that have to been taken out of line by
653 hand and aren't taken care of in the script. (Just a reminder note)
655 * sigc++/macros/*.h.m4: Updated as above.
657 2000-08-09 Juergen Vigna <jug@sad.it>
659 * src/insets/insettext.C (draw): small fix for clearing rectangle.
661 * src/insets/insettabular.C: make drawing of single cell smarter.
663 2000-08-09 Marko Vendelin <markov@ioc.ee>
664 * src/frontends/gnome/Menubar_pimpl.C
665 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
666 implementation: new files
668 * src/frontends/gnome/mainapp.C
669 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
672 * src/main.C: create Gnome main window
674 * src/frontends/xforms/Menubar_pimpl.h
675 * src/frontends/Menubar.C
676 * src/frontends/Menubar.h: added method Menubar::update that calls
677 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
679 * src/LyXView.C: calls Menubar::update to update the state
682 * src/frontends/gnome/Makefile.am: added new files
684 * src/frontends/Makefile.am: added frontend compiler options
686 2000-08-08 Juergen Vigna <jug@sad.it>
688 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
690 * src/bufferlist.C (close):
691 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
692 documents if exiting without saving.
694 * src/buffer.C (save): use removeAutosaveFile()
696 * src/support/filetools.C (removeAutosaveFile): new function.
698 * src/lyx_cb.C (MenuWrite): returns a bool now.
699 (MenuWriteAs): check if file could really be saved and revert to the
701 (MenuWriteAs): removing old autosavefile if existant.
703 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
704 before Goto toggle declaration, because of compiler warning.
706 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
708 * src/lyxfunc.C (MenuNew): small fix.
710 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
712 * src/bufferlist.C (newFile):
713 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
715 * src/lyxrc.C: added new_ask_filename tag
717 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
719 * src/lyx.fd: removed code pertaining to form_ref
720 * src/lyx.[Ch]: ditto
721 * src/lyx_cb.C: ditto
722 * src/lyx_gui.C: ditto
723 * src/lyx_gui_misc.C: ditto
725 * src/BufferView_pimpl.C (restorePosition): update buffer only
728 * src/commandtags.h (LFUN_REFTOGGLE): removed
729 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
730 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
731 (LFUN_REFBACK): renamed LFUN_REF_BACK
733 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
735 * src/lyxfunc.C (Dispatch): ditto.
736 InsertRef dialog is now GUI-independent.
738 * src/texrow.C: added using std::endl;
740 * src/insets/insetref.[Ch]: strip out large amounts of code.
741 The inset is now a container and this functionality is now
742 managed by a new FormRef dialog
744 * src/frontends/Dialogs.h (showRef, createRef): new signals
746 * src/frontends/xforms/FormIndex.[Ch],
747 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
748 when setting dialog's min/max size
749 * src/frontends/xforms/FormIndex.[Ch]: ditto
751 * src/frontends/xforms/FormRef.[Ch],
752 src/frontends/xforms/forms/form_ref.fd: new xforms
753 implementation of an InsetRef dialog
755 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
758 * src/graphics/XPM_Renderer.C (isImageFormatOK):
759 ios::nocreate is not part of the standard. Removed.
761 2000-08-07 Baruch Even <baruch.even@writeme.com>
763 * src/graphics/Renderer.h:
764 * src/graphics/Renderer.C: Added base class for rendering of different
765 image formats into Pixmaps.
767 * src/graphics/XPM_Renderer.h:
768 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
769 in a different class.
771 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
772 easily add support for other formats.
774 * src/insets/figinset.C: plugged a leak of an X resource.
776 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
778 * src/CutAndPaste.[Ch]: make all metods static.
780 * development/Code_rules/Rules: more work, added section on
781 Exceptions, and a References section.
783 * a lot of header files: work to make doc++ able to generate the
784 source documentation, some workarounds of doc++ problems. Doc++ is
785 now able to generate the documentation.
787 2000-08-07 Juergen Vigna <jug@sad.it>
789 * src/insets/insettabular.C (recomputeTextInsets): removed function
791 * src/tabular.C (SetWidthOfMulticolCell):
793 (calculate_width_of_column_NMC): fixed return value so that it really
794 only returns true if the column-width has changed (there where
795 problems with muliticolumn-cells in this column).
797 2000-08-04 Juergen Vigna <jug@sad.it>
799 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
800 also on the scrollstatus of the inset.
801 (workAreaMotionNotify): ditto.
803 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
805 2000-08-01 Juergen Vigna <jug@sad.it>
807 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
810 * src/LyXAction.C (init):
811 * src/insets/inset.C (LocalDispatch): added support for
814 * src/insets/inset.C (scroll): new functions.
816 * src/insets/insettext.C (removeNewlines): new function.
817 (SetAutoBreakRows): removes forced newlines in the text of the
818 paragraph if autoBreakRows is set to false.
820 * src/tabular.C (Latex): generates a parbox around the cell contents
823 * src/frontends/xforms/FormTabular.C (local_update): removed
824 the radio_useparbox button.
826 * src/tabular.C (UseParbox): new function
828 2000-08-06 Baruch Even <baruch.even@writeme.com>
830 * src/graphics/GraphicsCache.h:
831 * src/graphics/GraphicsCache.C:
832 * src/graphics/GraphicsCacheItem.h:
833 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
836 * src/insets/insetgraphics.h:
837 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
838 drawing of the inline image.
840 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
841 into the wrong position.
843 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
846 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
848 * src/support/translator.h: move all typedefs to public section
850 * src/support/filetools.C (MakeLatexName): return string const
853 (FileOpenSearch): ditto
855 (LibFileSearch): ditto
856 (i18nLibFileSearch): ditto
859 (CreateTmpDir): ditto
860 (CreateBufferTmpDir): ditto
861 (CreateLyXTmpDir): ditto
866 (OnlyFilename): ditto
868 (NormalizePath): ditto
870 (GetFileContents): ditto
871 (ReplaceEnvironmentPath): ditto
874 (ChangeExtension): ditto
875 (MakeDisplayPath): ditto
876 (do_popen): return cmdret const
877 (findtexfile): return string const
879 * src/support/DebugStream.h: add some /// to please doc++
881 * src/frontends/DialogBase.h (endif): add some /// to please doc++
883 * src/texrow.C (same_rownumber): functor to use with find_if
884 (getIdFromRow): rewritten to use find_if and to not update the
885 positions. return true if row is found
886 (increasePos): new method, use to update positions
888 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
890 * src/lyxlex_pimpl.C (verifyTable): new method
893 (GetString): return string const
894 (pushTable): rewrite to use std::stack
896 (setFile): better check
899 * src/lyxlex.h: make LyXLex noncopyable
901 * src/lyxlex.C (text): return char const * const
902 (GetString): return string const
903 (getLongString): return string const
905 * src/lyx_gui_misc.C (askForText): return pair<...> const
907 * src/lastfiles.[Ch] (operator): return string const
909 * src/buffer.C (parseSingleLyXformat2Token): pass string to
910 istringstream not char const *.
911 move token.end() out of loop.
912 (readFile): move initializaton of token
914 * src/BufferView2.C (insertErrors): run texrow.increasePos if
915 getIdFromRow is successful.
917 * lib/bind/emacs.bind: don't include menus bind
919 * development/Code_rules/Rules: the beginnings of making this
920 better and covering more of the unwritten rules that we have.
922 * development/Code_rules/Recommendations: a couple of wording
925 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
927 * src/support/strerror.c: remove C++ comment.
929 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
931 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
932 LFUN_INDEX_INSERT_LAST
934 * src/texrow.C (getIdFromRow): changed from const_iterator to
935 iterator, allowing code to compile with DEC cxx
937 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
938 stores part of the class, as suggested by Allan. Will allow
940 (apply): test to apply uses InsetCommandParams operator!=
942 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
943 (apply): test to apply uses InsetCommandParams operator!=
945 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
946 stores part of the class.
947 (update): removed limits on min/max size.
949 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
950 (apply): test to apply uses InsetCommandParams operator!=
952 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
953 (Read, Write, scanCommand, getCommand): moved functionality
954 into InsetCommandParams.
956 (getScreenLabel): made pure virtual
957 new InsetCommandParams operators== and !=
959 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
960 c-tors based on InsetCommandParams. Removed others.
961 * src/insets/insetinclude.[Ch]: ditto
962 * src/insets/insetlabel.[Ch]: ditto
963 * src/insets/insetparent.[Ch]: ditto
964 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
966 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
967 insets derived from InsetCommand created using similar c-tors
968 based on InsetCommandParams
969 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
970 * src/menus.C (ShowRefsMenu): ditto
971 * src/paragraph.C (Clone): ditto
972 * src/text2.C (SetCounter): ditto
973 * src/lyxfunc.C (Dispatch) ditto
974 Also recreated old InsetIndex behaviour exactly. Can now
975 index-insert at the start of a paragraph and index-insert-last
976 without launching the pop-up.
978 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
980 * lib/lyxrc.example: mark te pdf options as non functional.
982 * src/support/lstrings.C (strToInt): move initalization of tmpstr
983 (isStrDbl): move tmpstr.end() out of loop.
984 (strToDbl): move intialization of tmpstr
985 (lowercase): return string const and move tmp.end() out of loop.
986 (uppercase): return string const and move tmp.edn() out of loop.
987 (prefixIs): add assertion
992 (containsOnly): ditto
993 (containsOnly): ditto
994 (containsOnly): ditto
995 (countChar): make last arg char not char const
996 (token): return string const
997 (subst): return string const, move tmp.end() out of loop.
998 (subst): return string const, add assertion
999 (strip): return string const
1000 (frontStrip): return string const, add assertion
1001 (frontStrip): return string const
1006 * src/support/lstrings.C: add inclde "LAssert.h"
1007 (isStrInt): move tmpstr.end() out of loop.
1009 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1010 toollist.end() out of loop.
1011 (deactivate): move toollist.end() out of loop.
1012 (update): move toollist.end() out of loop.
1013 (updateLayoutList): move tc.end() out of loop.
1014 (add): move toollist.end() out of loop.
1016 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1017 md.end() out of loop.
1019 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1021 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1024 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1025 (Erase): move insetlist.end() out of loop.
1027 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1028 ref to const string as first arg. Move initialization of some
1029 variables, whitespace changes.
1031 * src/kbmap.C (defkey): move table.end() out of loop.
1032 (kb_keymap): move table.end() out of loop.
1033 (findbinding): move table.end() out of loop.
1035 * src/MenuBackend.C (hasMenu): move end() out of loop.
1036 (getMenu): move end() out of loop.
1037 (getMenu): move menulist_.end() out of loop.
1039 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1041 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1044 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1045 (getFromLyXName): move infotab.end() out of loop.
1047 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1048 -fvtable-thunks -ffunction-sections -fdata-sections
1050 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1052 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1055 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1057 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1059 * src/frontends/xforms/FormCitation.[Ch],
1060 src/frontends/xforms/FormIndex.[Ch],
1061 src/frontends/xforms/FormToc.[Ch],
1062 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1064 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1066 * src/commandtags.h: renamed, created some flags for citation
1069 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1071 * src/lyxfunc.C (dispatch): use signals to insert index entry
1073 * src/frontends/Dialogs.h: new signal createIndex
1075 * src/frontends/xforms/FormCommand.[Ch],
1076 src/frontends/xforms/FormCitation.[Ch],
1077 src/frontends/xforms/FormToc.[Ch],
1078 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1080 * src/insets/insetindex.[Ch]: GUI-independent
1082 * src/frontends/xforms/FormIndex.[Ch],
1083 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1086 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1088 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1089 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1091 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1093 * src/insets/insetref.C (Latex): rewrite so that there is now
1094 question that a initialization is requested.
1096 * src/insets/insetcommand.h: reenable the hide signal
1098 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1100 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1101 fix handling of shortcuts (many bugs :)
1102 (add_lastfiles): ditto.
1104 * lib/ui/default.ui: fix a few shortcuts.
1106 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1108 * Makefile.am: Fix ``rpmdist'' target to return the exit
1109 status of the ``rpm'' command, instead of the last command in
1110 the chain (the ``rm lyx.xpm'' command, which always returns
1113 2000-08-02 Allan Rae <rae@lyx.org>
1115 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1116 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1117 * src/frontends/xforms/FormToc.C (FormToc): ditto
1119 * src/frontends/xforms/Makefile.am: A few forgotten files
1121 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1122 Signals-not-copyable-problem Lars' started commenting out.
1124 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1126 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1128 * src/insets/insetcommand.h: Signals is not copyable so anoter
1129 scheme for automatic hiding of forms must be used.
1131 * src/frontends/xforms/FormCitation.h: don't inerit from
1132 noncopyable, FormCommand already does that.
1133 * src/frontends/xforms/FormToc.h: ditto
1134 * src/frontends/xforms/FormUrl.h: ditto
1136 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1138 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1140 * src/insets/insetcommand.h (hide): new SigC::Signal0
1141 (d-tor) new virtual destructor emits hide signal
1143 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1144 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1146 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1147 LOF and LOT. Inset is now GUI-independent
1149 * src/insets/insetloa.[Ch]: redundant
1150 * src/insets/insetlof.[Ch]: ditto
1151 * src/insets/insetlot.[Ch]: ditto
1153 * src/frontends/xforms/forms/form_url.fd: tweaked!
1154 * src/frontends/xforms/forms/form_citation.fd: ditto
1156 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1157 dialogs dealing with InsetCommand insets
1159 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1160 FormCommand base class
1161 * src/frontends/xforms/FormUrl.[Ch]: ditto
1163 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1165 * src/frontends/xforms/FormToc.[Ch]: ditto
1167 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1168 passed a generic InsetCommand pointer
1169 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1171 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1172 and modified InsetTOC class
1173 * src/buffer.C: ditto
1175 * forms/lyx.fd: strip out old FD_form_toc code
1176 * src/lyx_gui_misc.C: ditto
1177 * src/lyx_gui.C: ditto
1178 * src/lyx_cb.C: ditto
1179 * src/lyx.[Ch]: ditto
1181 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1183 * src/support/utility.hpp: tr -d '\r'
1185 2000-08-01 Juergen Vigna <jug@sad.it>
1187 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1189 * src/commandtags.h:
1190 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1191 LFUN_TABULAR_FEATURES.
1193 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1194 LFUN_LAYOUT_TABULAR.
1196 * src/insets/insettabular.C (getStatus): implemented helper function.
1198 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1200 2000-07-31 Juergen Vigna <jug@sad.it>
1202 * src/text.C (draw): fixed screen update problem for text-insets.
1204 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1205 something changed probably this has to be added in various other
1208 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1210 2000-07-31 Baruch Even <baruch.even@writeme.com>
1212 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1213 templates to satisfy compaq cxx.
1216 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1218 * src/support/translator.h (equal_1st_in_pair::operator()): take
1219 const ref pair_type as arg.
1220 (equal_2nd_in_pair::operator()): ditto
1221 (Translator::~Translator): remove empty d-tor.
1223 * src/graphics/GraphicsCache.C: move include config.h to top, also
1224 put initialization of GraphicsCache::singleton here.
1225 (~GraphicsCache): move here
1226 (addFile): take const ref as arg
1229 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1231 * src/BufferView2.C (insertLyXFile): change te with/without header
1234 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1236 * src/frontends/xforms/FormGraphics.C (apply): add some
1237 static_cast. Not very nice, but required by compaq cxx.
1239 * src/frontends/xforms/RadioButtonGroup.h: include header
1240 <utility> instead of <pair.h>
1242 * src/insets/insetgraphicsParams.C: add using directive.
1243 (readResize): change return type to void.
1244 (readOrigin): ditto.
1246 * src/lyxfunc.C (getStatus): add missing break for build-program
1247 function; add test for Literate for export functions.
1249 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1250 entries in Options menu.
1252 2000-07-31 Baruch Even <baruch.even@writeme.com>
1254 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1255 protect against auto-allocation; release icon when needed.
1257 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1259 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1260 on usual typewriter.
1262 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1263 earlier czech.kmap), useful only for programming.
1265 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1267 * src/frontends/xforms/FormCitation.h: fix conditioning around
1270 2000-07-31 Juergen Vigna <jug@sad.it>
1272 * src/frontends/xforms/FormTabular.C (local_update): changed
1273 radio_linebreaks to radio_useparbox and added radio_useminipage.
1275 * src/tabular.C: made support for using minipages/parboxes.
1277 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1279 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1281 (descent): so the cursor is in the middle.
1282 (width): bit smaller box.
1284 * src/insets/insetgraphics.h: added display() function.
1286 2000-07-31 Baruch Even <baruch.even@writeme.com>
1288 * src/frontends/Dialogs.h: Added showGraphics signals.
1290 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1291 xforms form definition of the graphics dialog.
1293 * src/frontends/xforms/FormGraphics.h:
1294 * src/frontends/xforms/FormGraphics.C: Added files, the
1295 GUIndependent code of InsetGraphics
1297 * src/insets/insetgraphics.h:
1298 * src/insets/insetgraphics.C: Major writing to make it work.
1300 * src/insets/insetgraphicsParams.h:
1301 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1302 struct between InsetGraphics and GUI.
1304 * src/LaTeXFeatures.h:
1305 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1306 support for graphicx package.
1308 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1309 for the graphics inset.
1311 * src/support/translator.h: Added file, used in
1312 InsetGraphicsParams. this is a template to translate between two
1315 * src/frontends/xforms/RadioButtonGroup.h:
1316 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1317 way to easily control a radio button group.
1319 2000-07-28 Juergen Vigna <jug@sad.it>
1321 * src/insets/insettabular.C (LocalDispatch):
1322 (TabularFeatures): added support for lyx-functions of tabular features.
1323 (cellstart): refixed this function after someone wrongly changed it.
1325 * src/commandtags.h:
1326 * src/LyXAction.C (init): added support for tabular-features
1328 2000-07-28 Allan Rae <rae@lyx.org>
1330 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1331 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1332 triggers the callback for input checking. As a result we sometimes get
1333 "LyX: This shouldn't happen..." printed to cerr.
1334 (input): Started using status variable since I only free() on
1335 destruction. Some input checking for paths and font sizes.
1337 * src/frontends/xforms/FormPreferences.h: Use status to control
1338 activation of Ok and Apply
1340 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1341 callback. Also resized to stop segfaults with 0.88. The problem is
1342 that xforms-0.88 requires the folder to be wide enough to fit all the
1343 tabs. If it isn't it causes all sorts of problems.
1345 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1347 * src/frontends/xforms/forms/README: Reflect reality.
1349 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1350 * src/frontends/xforms/forms/makefile: ditto.
1352 * src/commandtags.h: Get access to new Preferences dialog
1353 * src/LyXAction.C: ditto
1354 * src/lyxfunc.C: ditto
1355 * lib/ui/default.ui: ditto
1357 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1359 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1361 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1364 * src/frontends/xforms/form_url.[Ch]: added.
1366 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1368 * src/insets/insetbib.h: fixed bug in previous commit
1370 * src/frontends/xforms/FormUrl.h: ditto
1372 * src/frontends/xforms/FormPrint.h: ditto
1374 * src/frontends/xforms/FormPreferences.h: ditto
1376 * src/frontends/xforms/FormCopyright.h: ditto
1378 * src/frontends/xforms/FormCitation.C: ditto
1380 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1381 private copyconstructor and private default contructor
1383 * src/support/Makefile.am: add utility.hpp
1385 * src/support/utility.hpp: new file from boost
1387 * src/insets/insetbib.h: set owner in clone
1389 * src/frontends/xforms/FormCitation.C: added missing include
1392 * src/insets/form_url.[Ch]: removed
1394 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1396 * development/lyx.spec.in
1397 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1398 file/directory re-organization.
1400 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1402 * src/insets/insetcommand.[Ch]: moved the string data and
1403 associated manipulation methods into a new stand-alone class
1404 InsetCommandParams. This class has two additional methods
1405 getAsString() and setFromString() allowing the contents to be
1406 moved around as a single string.
1407 (addContents) method removed.
1408 (setContents) method no longer virtual.
1410 * src/buffer.C (readInset): made use of new InsetCitation,
1411 InsetUrl constructors based on InsetCommandParams.
1413 * src/commandtags.h: add LFUN_INSERT_URL
1415 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1416 independent InsetUrl and use InsetCommandParams to extract
1417 string info and create new Insets.
1419 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1421 * src/frontends/xforms/FormCitation.C (apply): uses
1424 * src/frontends/xforms/form_url.C
1425 * src/frontends/xforms/form_url.h
1426 * src/frontends/xforms/FormUrl.h
1427 * src/frontends/xforms/FormUrl.C
1428 * src/frontends/xforms/forms/form_url.fd: new files
1430 * src/insets/insetcite.[Ch]: removed unused constructors.
1432 * src/insets/insetinclude.[Ch]: no longer store filename
1434 * src/insets/inseturl.[Ch]: GUI-independent.
1436 2000-07-26 Juergen Vigna <jug@sad.it>
1437 * renamed frontend from gtk to gnome as it is that what is realized
1438 and did the necessary changes in the files.
1440 2000-07-26 Marko Vendelin <markov@ioc.ee>
1442 * configure.in: cleaning up gnome configuration scripts
1444 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1446 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1447 shortcuts syndrom by redrawing them explicitely (a better solution
1448 would be appreciated).
1450 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1452 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1455 * src/lyx_cb.C (MenuExport): change html export to do the right
1456 thing depending of the document type (instead of having
1457 html-linuxdoc and html-docbook).
1458 * src/lyxfunc.C (getStatus): update for html
1459 * lib/ui/default.ui: simplify due to the above change.
1460 * src/menus.C (ShowFileMenu): update too (in case we need it).
1462 * src/MenuBackend.C (read): if a menu is defined twice, add the
1463 new entries to the exiting one.
1465 2000-07-26 Juergen Vigna <jug@sad.it>
1467 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1469 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1470 and return a bool if it did actual save the file.
1471 (AutoSave): don't autosave a unnamed doc.
1473 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1474 check if this is an UNNAMED new file and react to it.
1475 (newFile): set buffer to unnamed and change to not mark a new
1476 buffer dirty if I didn't do anything with it.
1478 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1480 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1482 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1483 friend as per Angus's patch posted to lyx-devel.
1485 * src/ext_l10n.h: updated
1487 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1488 gettext on the style string right before inserting them into the
1491 * autogen.sh: add code to extract style strings form layout files,
1492 not good enough yet.
1494 * src/frontends/gtk/.cvsignore: add MAKEFILE
1496 * src/MenuBackend.C (read): run the label strings through gettext
1497 before storing them in the containers.
1499 * src/ext_l10n.h: new file
1501 * autogen.sh : generate the ext_l10n.h file here
1503 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1505 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1508 * lib/ui/default.ui: fix a couple of typos.
1510 * config/gnome/gtk.m4: added (and added to the list of files in
1513 * src/insets/insetinclude.C (unique_id): fix when we are using
1514 lyxstring instead of basic_string<>.
1515 * src/insets/insettext.C (LocalDispatch): ditto.
1516 * src/support/filetools.C: ditto.
1518 * lib/configure.m4: create the ui/ directory if necessary.
1520 * src/LyXView.[Ch] (updateToolbar): new method.
1522 * src/BufferView_pimpl.C (buffer): update the toolbar when
1523 opening/closing buffer.
1525 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1527 * src/LyXAction.C (getActionName): enhance to return also the name
1528 and options of pseudo-actions.
1529 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1531 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1532 as an example of what is possible). Used in File->Build too (more
1533 useful) and in the import/export menus (to mimick the complicated
1534 handling of linuxdoc and friends). Try to update all the entries.
1536 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1539 * src/MenuBackend.C (read): Parse the new OptItem tag.
1541 * src/MenuBackend.h: Add a new optional_ data member (used if the
1542 entry should be omitted when the lyxfunc is disabled).
1544 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1545 function, used as a shortcut.
1546 (create_submenu): align correctly the shortcuts on the widest
1549 * src/MenuBackend.h: MenuItem.label() only returns the label of
1550 the menu without shortcut; new method shortcut().
1552 2000-07-14 Marko Vendelin <markov@ioc.ee>
1554 * src/frontends/gtk/Dialogs.C:
1555 * src/frontends/gtk/FormCopyright.C:
1556 * src/frontends/gtk/FormCopyright.h:
1557 * src/frontends/gtk/Makefile.am: added these source-files for the
1558 Gtk/Gnome support of the Copyright-Dialog.
1560 * src/main.C: added Gnome::Main initialization if using
1561 Gtk/Gnome frontend-GUI.
1563 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1565 * config/gnome/aclocal-include.m4
1566 * config/gnome/compiler-flags.m4
1567 * config/gnome/curses.m4
1568 * config/gnome/gnome--.m4
1569 * config/gnome/gnome-bonobo-check.m4
1570 * config/gnome/gnome-common.m4
1571 * config/gnome/gnome-fileutils.m4
1572 * config/gnome/gnome-ghttp-check.m4
1573 * config/gnome/gnome-gnorba-check.m4
1574 * config/gnome/gnome-guile-checks.m4
1575 * config/gnome/gnome-libgtop-check.m4
1576 * config/gnome/gnome-objc-checks.m4
1577 * config/gnome/gnome-orbit-check.m4
1578 * config/gnome/gnome-print-check.m4
1579 * config/gnome/gnome-pthread-check.m4
1580 * config/gnome/gnome-support.m4
1581 * config/gnome/gnome-undelfs.m4
1582 * config/gnome/gnome-vfs.m4
1583 * config/gnome/gnome-x-checks.m4
1584 * config/gnome/gnome-xml-check.m4
1585 * config/gnome/gnome.m4
1586 * config/gnome/gperf-check.m4
1587 * config/gnome/gtk--.m4
1588 * config/gnome/linger.m4
1589 * config/gnome/need-declaration.m4: added configuration scripts
1590 for Gtk/Gnome frontend-GUI
1592 * configure.in: added support for the --with-frontend=gtk option
1594 * autogen.sh: added config/gnome/* to list of config-files
1596 * acconfig.h: added define for GTKGUI-support
1598 * config/lyxinclude.m4: added --with-frontend[=value] option value
1599 for Gtk/Gnome frontend-GUI support.
1601 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1603 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1607 * src/paragraph.C (GetChar): remove non-const version
1609 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1610 (search_kw): use it.
1612 * src/lyx_main.C (init): if "preferences" exist, read that instead
1614 (ReadRcFile): return bool if the file could be read ok.
1615 (ReadUIFile): add a check to see if lex file is set ok.
1617 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1618 bastring can be used instead of lyxstring (still uses the old code
1619 if std::string is good enough or if lyxstring is used.)
1621 * src/encoding.C: make the arrays static, move ininle functions
1623 * src/encoding.h: from here.
1625 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1626 (parseSingleLyXformat2Token): move inset parsing to separate method
1627 (readInset): new private method
1629 * src/Variables.h: remove virtual from get().
1631 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1632 access to NEW_INSETS and NEW_TABULAR
1634 * src/MenuBackend.h: remove superfluous forward declaration of
1635 MenuItem. Add documentations tags "///", remove empty MenuItem
1636 destructor, remove private default contructor.
1638 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1640 (read): more string mlabel and mname to where they are used
1641 (read): remove unused variables mlabel and mname
1642 (defaults): unconditional clear, make menusetup take advantage of
1643 add returning Menu &.
1645 * src/LyXView.h: define NEW_MENUBAR as default
1647 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1648 to NEW_INSETS and NEW_TABULAR.
1649 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1650 defined. Change some of the "xxxx-inset-insert" functions names to
1653 * several files: more enahncements to NEW_INSETS and the resulting
1656 * lib/lyxrc.example (\date_insert_format): move to misc section
1658 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1659 bastring and use AC_CACHE_CHECK.
1660 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1661 the system have the newest methods. uses AC_CACHE_CHECK
1662 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1663 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1664 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1666 * configure.in: add LYX_CXX_GOOD_STD_STRING
1668 * acinclude.m4: recreated
1670 2000-07-24 Amir Karger
1672 * README: add Hebrew, Arabic kmaps
1675 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1677 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1680 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1682 * Lot of files: add pragma interface/implementation.
1684 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1686 * lib/ui/default.ui: new file (ans new directory). Contains the
1687 default menu and toolbar.
1689 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1690 global space. Toolbars are now read (as menus) in ui files.
1692 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1694 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1695 is disabled because the document is read-only. We want to have the
1696 toggle state of the function anyway.
1697 (getStatus): add code for LFUN_VC* functions (mimicking what is
1698 done in old-style menus)
1700 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1701 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1703 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1704 * src/BufferView_pimpl.C: ditto.
1705 * src/lyxfunc.C: ditto.
1707 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1708 default). This replaces old-style menus by new ones.
1710 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1711 MenuItem. Contain the data structure of a menu.
1713 * src/insets/insettext.C: use LyXView::setLayout instead of
1714 accessing directly the toolbar combox.
1715 * src/lyxfunc.C (Dispatch): ditto.
1717 * src/LyXView.C (setLayout): new method, which just calls
1718 Toolbar::setLayout().
1719 (updateLayoutChoice): move part of this method in Toolbar.
1721 * src/toolbar.[Ch]: removed.
1723 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1724 implementation the toolbar.
1726 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1727 the toolbar. It might make sense to merge it with ToolbarDefaults
1729 (setLayout): new function.
1730 (updateLayoutList): ditto.
1731 (openLayoutList): ditto.
1733 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1734 xforms implementation of the toolbar.
1735 (get_toolbar_func): comment out, since I do not
1736 know what it is good for.
1738 * src/ToolbarDefaults.h: Add the ItemType enum.
1740 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1741 for a list of allocated C strings. Used in Menubar xforms
1742 implementation to avoid memory leaks.
1744 * src/support/lstrings.[Ch] (uppercase): new version taking and
1748 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1749 * lib/bind/emacs.bind: ditto.
1751 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1753 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1754 forward decl of LyXView.
1756 * src/toolbar.C (toolbarItem): moved from toolbar.h
1757 (toolbarItem::clean): ditto
1758 (toolbarItem::~toolbarItem): ditto
1759 (toolbarItem::operator): ditto
1761 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1763 * src/paragraph.h: control the NEW_TABULAR define from here
1765 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1766 USE_TABULAR_INSETS to NEW_TABULAR
1768 * src/ToolbarDefaults.C: add include "lyxlex.h"
1770 * files using the old table/tabular: use NEW_TABULAR to control
1771 compilation of old tabular stuff.
1773 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1776 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1777 planemet in reading of old style floats, fix the \end_deeper
1778 problem when reading old style floats.
1780 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1782 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1784 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1786 * lib/bind/sciword.bind: updated.
1788 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1790 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1791 layout write problem
1793 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1795 * src/Makefile.am (INCLUDES): remove image directory from include
1798 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1799 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1801 * src/LyXView.C (create_form_form_main): read the application icon
1804 * lib/images/*.xpm: change the icons to use transparent color for
1807 * src/toolbar.C (update): change the color of the button when it
1810 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1812 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1813 setting explicitely the minibuffer.
1814 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1816 * src/LyXView.C (showState): new function. Shows font information
1817 in minibuffer and update toolbar state.
1818 (LyXView): call Toolbar::update after creating the
1821 * src/toolbar.C: change toollist to be a vector instead of a
1823 (BubbleTimerCB): get help string directly from the callback
1824 argument of the corresponding icon (which is the action)
1825 (set): remove unnecessary ugliness.
1826 (update): new function. update the icons (depressed, disabled)
1827 depending of the status of the corresponding action.
1829 * src/toolbar.h: remove help in toolbarItem
1831 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1833 * src/Painter.C (text): Added code for using symbol glyphs from
1834 iso10646 fonts. Currently diabled.
1836 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1839 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1840 magyar,turkish and usorbian.
1842 * src/paragraph.C (isMultiLingual): Made more efficient.
1844 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1847 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1848 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1849 Also changed the prototype to "bool math_insert_greek(char)".
1851 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1853 * lots of files: apply the NEW_INSETS on all code that will not be
1854 needed when we move to use the new insets. Enable the define in
1855 lyxparagrah.h to try it.
1857 * src/insets/insettabular.C (cellstart): change to be a static
1859 (InsetTabular): initialize buffer in the initializer list.
1861 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1863 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1864 form_print.h out of the header file. Replaced with forward
1865 declarations of the relevant struct.
1867 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1870 * src/commandtags.h: do not include "debug.h" which does not
1871 belong there. #include it in some other places because of this
1874 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1876 * src/insets/insetcaption.C: add a couple "using" directives.
1878 * src/toolbar.C (add): get the help text directly from lyxaction.
1880 (setPixmap): new function. Loads from disk and sets a pixmap on a
1881 botton; the name of the pixmap file is derived from the command
1884 * src/toolbar.h: remove members isBitmap and pixmap from
1887 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1888 * lib/images/: move many files from images/banner.xpm.
1890 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1892 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1893 * src/toolbar.C: ditto.
1894 * configure.in: ditto.
1895 * INSTALL: document.
1897 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1898 the spellchecker popup is closed from the WM.
1900 2000-07-19 Juergen Vigna <jug@sad.it>
1902 * src/insets/insetfloat.C (Write): small fix because we use the
1903 insetname for the type now!
1905 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1907 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1910 * src/frontends/Dialogs.h: removed hideCitation signal
1912 * src/insets/insetcite.h: added hide signal
1914 * src/insets/insetcite.C (~InsetCitation): emits new signal
1915 (getScreenLabel): "intelligent" label should now fit on the screen!
1917 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1919 * src/frontends/xforms/FormCitation.C (showInset): connects
1920 hide() to the inset's hide signal
1921 (show): modified to use fl_set_object_position rather than
1922 fl_set_object_geometry wherever possible
1924 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1926 * src/insets/lyxinset.h: add caption code
1928 * src/insets/insetfloat.C (type): new method
1930 * src/insets/insetcaption.C (Write): new method
1932 (LyxCode): new method
1934 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1935 to get it right together with using the FloatList.
1937 * src/commandtags.h: add LFUN_INSET_CAPTION
1938 * src/lyxfunc.C (Dispatch): handle it
1940 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1943 * src/Variables.[Ch]: make expand take a const reference, remove
1944 the destructor, some whitespace changes.
1946 * src/LyXAction.C (init): add caption-inset-insert
1948 * src/FloatList.C (FloatList): update the default floats a bit.
1950 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1952 * src/Variables.[Ch]: new files. Intended to be used for language
1953 specific strings (like \chaptername) and filename substitution in
1956 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1958 * lib/kbd/american.kmap: update
1960 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1962 * src/bufferparams.[Ch]: remove member allowAccents.
1964 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1966 * src/LaTeXLog.C: use the log_form.h header.
1967 * src/lyx_gui.C: ditto.
1968 * src/lyx_gui_misc.C: ditto.
1969 * src/lyxvc.h: ditto.
1971 * forms/log_form.fd: new file, created from latexoptions.fd. I
1972 kept the log popup and nuked the options form.
1974 * src/{la,}texoptions.[Ch]: removed.
1975 * src/lyx_cb.C (LaTeXOptions): ditto
1977 * src/lyx_gui.C (create_forms): do not handle the
1978 fd_latex_options form.
1980 2000-07-18 Juergen Vigna <jug@sad.it>
1982 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1983 name of the inset so that it can be requested outside (text2.C).
1985 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1988 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1990 * src/mathed/formula.h (ConvertFont): constify
1992 * src/mathed/formula.C (Read): add warning if \end_inset is not
1993 found on expected place.
1995 * src/insets/lyxinset.h (ConvertFont): consify
1997 * src/insets/insetquotes.C (ConvertFont): constify
1998 * src/insets/insetquotes.h: ditto
2000 * src/insets/insetinfo.h: add labelfont
2002 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2003 (ascent): use labelfont
2007 (Write): make .lyx file a bit nicer
2009 * src/insets/insetfloat.C (Write): simplify somewhat...
2010 (Read): add warning if arg is not found
2012 * src/insets/insetcollapsable.C: add using std::max
2013 (Read): move string token and add warning in arg is not found
2014 (draw): use std::max to get the right ty
2015 (getMaxWidth): simplify by using std::max
2017 * src/insets/insetsection.h: new file
2018 * src/insets/insetsection.C: new file
2019 * src/insets/insetcaption.h: new file
2020 * src/insets/insetcaption.C: new file
2022 * src/insets/inset.C (ConvertFont): constify signature
2024 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2025 insetcaption.[Ch] and insetsection.[Ch]
2027 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2028 uses to use LABEL_COUNTER_CHAPTER instead.
2029 * src/text2.C (SetCounter): here
2031 * src/counters.h: new file
2032 * src/counters.C: new file
2033 * src/Sectioning.h: new file
2034 * src/Sectioning.C: new file
2036 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2038 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2040 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2043 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2046 2000-07-17 Juergen Vigna <jug@sad.it>
2048 * src/tabular.C (Validate): check if array-package is needed.
2049 (SetVAlignment): added support for vertical alignment.
2050 (SetLTFoot): better support for longtable header/footers
2051 (Latex): modified to support added features.
2053 * src/LaTeXFeatures.[Ch]: added array-package.
2055 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2057 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2060 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2062 * configure.in: do not forget to put a space after -isystem.
2064 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2066 * lib/kbd/arabic.kmap: a few fixes.
2068 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2070 * some whitespace chagnes to a number of files.
2072 * src/support/DebugStream.h: change to make it easier for
2073 doc++ to parse correctly.
2074 * src/support/lyxstring.h: ditto
2076 * src/mathed/math_utils.C (compara): change to have only one
2078 (MathedLookupBOP): change because of the above.
2080 * src/mathed/math_delim.C (math_deco_compare): change to have only
2082 (search_deco): change becasue of the above.
2084 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2085 instead of manually coded one.
2087 * src/insets/insetquotes.C (Read): read the \end_inset too
2089 * src/insets/insetlatex.h: remove file
2090 * src/insets/insetlatex.C: remove file
2092 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2094 (InsetPrintIndex): remove destructor
2096 * src/insets/insetinclude.h: remove default constructor
2098 * src/insets/insetfloat.C: work to make it work better
2100 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2102 * src/insets/insetcite.h (InsetCitation): remove default constructor
2104 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2106 * src/text.C (GetColumnNearX): comment out some currently unused code.
2108 * src/paragraph.C (writeFile): move some initializations closer to
2110 (CutIntoMinibuffer): small change to use new matchIT operator
2114 (InsertInset): ditto
2117 (InsetIterator): ditto
2118 (Erase): small change to use new matchFT operator
2120 (GetFontSettings): ditto
2121 (HighestFontInRange): ditto
2124 * src/lyxparagraph.h: some chars changed to value_type
2125 (matchIT): because of some stronger checking (perhaps too strong)
2126 in SGI STL, the two operator() unified to one.
2129 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2131 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2132 the last inset read added
2133 (parseSingleLyXformat2Token): some more (future) compability code added
2134 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2135 (parseSingleLyXformat2Token): set last_inset_read
2136 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2137 (parseSingleLyXformat2Token): don't double intializw string next_token
2139 * src/TextCache.C (text_fits::operator()): add const's to the signature
2140 (has_buffer::operator()): ditto
2142 * src/Floating.h: add some comments on the class
2144 * src/FloatList.[Ch] (typeExist): new method
2147 * src/BackStack.h: added default constructor, wanted by Gcc.
2149 2000-07-14 Juergen Vigna <jug@sad.it>
2151 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2153 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2155 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2156 do a redraw when the window is resized!
2157 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2159 * src/insets/insettext.C (resizeLyXText): added function to correctly
2160 being able to resize the LyXWindow.
2162 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2164 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2166 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2167 crashes when closing dialog to a deleted inset.
2169 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2170 method! Now similar to other insets.
2172 2000-07-13 Juergen Vigna <jug@sad.it>
2174 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2176 * lib/examples/Literate.lyx: small patch!
2178 * src/insets/insetbib.C (Read): added this function because of wrong
2179 Write (without [begin|end]_inset).
2181 2000-07-11 Juergen Vigna <jug@sad.it>
2183 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2184 as the insertInset could not be good!
2186 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2187 the bool param should not be last.
2189 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2191 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2192 did submit that to Karl).
2194 * configure.in: use -isystem instead of -I for X headers. This
2195 fixes a problem on solaris with a recent gcc;
2196 put the front-end code after the X detection code;
2197 configure in sigc++ before lib/
2199 * src/lyx_main.C (commandLineHelp): remove -display from command
2202 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2204 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2205 Also put in Makefile rules for building the ``listerrors''
2206 program for parsing errors from literate programs written in LyX.
2208 * lib/build-listerrors: Added small shell script as part of compile
2209 process. This builds a working ``listerrors'' binary if noweb is
2210 installed and either 1) the VNC X server is installed on the machine,
2211 or 2) the user is compiling from within a GUI. The existence of a GUI
2212 is necessary to use the ``lyx --export'' feature for now. This
2213 hack can be removed once ``lyx --export'' no longer requires a GUI to
2216 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2218 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2219 now passed back correctly from gcc and placed "under" error
2220 buttons in a Literate LyX source.
2222 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2224 * src/text.C (GetColumnNearX): Better behavior when a RTL
2225 paragraph is ended by LTR text.
2227 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2230 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2232 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2233 true when clipboard is empty.
2235 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2237 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2238 row of the paragraph.
2239 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2240 to prevent calculation of bidi tables
2242 2000-07-07 Juergen Vigna <jug@sad.it>
2244 * src/screen.C (ToggleSelection): added y_offset and x_offset
2247 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2250 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2252 * src/insets/insettext.C: fixed Layout-Display!
2254 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2256 * configure.in: add check for strings.h header.
2258 * src/spellchecker.C: include <strings.h> in order to have a
2259 definition for bzero().
2261 2000-07-07 Juergen Vigna <jug@sad.it>
2263 * src/insets/insettext.C (draw): set the status of the bv->text to
2264 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2266 * src/screen.C (DrawOneRow):
2267 (DrawFromTo): redraw the actual row if something has changed in it
2270 * src/text.C (draw): call an update of the toplevel-inset if something
2271 has changed inside while drawing.
2273 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2275 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2277 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2278 processing inside class.
2280 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2281 processing inside class.
2283 * src/insets/insetindex.h new struct Holder, consistent with other
2286 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2287 citation dialog from main code and placed it in src/frontends/xforms.
2288 Dialog launched through signals instead of callbacks
2290 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2292 * lyx.man: update the options description.
2294 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2296 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2297 handle neg values, set min width to 590, add doc about -display
2299 2000-07-05 Juergen Vigna <jug@sad.it>
2301 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2302 calls to BufferView *.
2304 * src/insets/insettext.C (checkAndActivateInset): small fix non
2305 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2307 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2308 their \end_inset token!
2310 2000-07-04 edscott <edscott@imp.mx>
2312 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2313 lib/lyxrc.example: added option \wheel_jump
2315 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2317 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2318 remove support for -width,-height,-xpos and -ypos.
2320 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2322 * src/encoding.[Ch]: New files.
2324 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2325 (text): Call to the underline() method only when needed.
2327 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2329 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2330 encoding(s) for the document.
2332 * src/bufferparams.C (BufferParams): Changed default value of
2335 * src/language.C (newLang): Removed.
2336 (items[]): Added encoding information for all defined languages.
2338 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2339 encoding choice button.
2341 * src/lyxrc.h (font_norm_type): New member variable.
2342 (set_font_norm_type): New method.
2344 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2345 paragraphs with different encodings.
2347 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2348 (TransformChar): Changed to work correctly with Arabic points.
2349 (draw): Added support for drawing Arabic points.
2350 (draw): Removed code for drawing underbars (this is done by
2353 * src/support/textutils.h (IsPrintableNonspace): New function.
2355 * src/BufferView_pimpl.h: Added "using SigC::Object".
2356 * src/LyXView.h: ditto.
2358 * src/insets/insetinclude.h (include_label): Changed to mutable.
2360 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2362 * src/mathed/math_iter.h: remove empty destructor
2364 * src/mathed/math_cursor.h: remove empty destructor
2366 * src/insets/lyxinset.h: add THEOREM_CODE
2368 * src/insets/insettheorem.[Ch]: new files
2370 * src/insets/insetminipage.C: (InsertInset): remove
2372 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2374 (InsertInset): remove
2376 * src/insets/insetlist.C: (InsertList): remove
2378 * src/insets/insetfootlike.[Ch]: new files
2380 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2383 (InsertInset): ditto
2385 * src/insets/insetert.C: remove include Painter.h, reindent
2386 (InsertInset): move to header
2388 * src/insets/insetcollapsable.h: remove explicit from default
2389 contructor, remove empty destructor, add InsertInset
2391 * src/insets/insetcollapsable.C (InsertInset): new func
2393 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2395 * src/vspace.h: add explicit to constructor
2397 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2398 \textcompwordmark, please test this.
2400 * src/lyxrc.C: set ascii_linelen to 65 by default
2402 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2404 * src/commandtags.h: add LFUN_INSET_THEOREM
2406 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2407 (makeLinuxDocFile): remove _some_ of the nice logic
2408 (makeDocBookFile): ditto
2410 * src/Painter.[Ch]: (~Painter): removed
2412 * src/LyXAction.C (init): entry for insettheorem added
2414 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2416 (deplog): code to detect files generated by LaTeX, needs testing
2419 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2421 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2423 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2425 * src/LaTeX.C (deplog): Add a check for files that are going to be
2426 created by the first latex run, part of the project to remove the
2429 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2430 contents to the extension list.
2432 2000-07-04 Juergen Vigna <jug@sad.it>
2434 * src/text.C (NextBreakPoint): added support for needFullRow()
2436 * src/insets/lyxinset.h: added needFullRow()
2438 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2441 * src/insets/insettext.C: lots of changes for update!
2443 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2445 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2447 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2449 * src/insets/insetinclude.C (InsetInclude): fixed
2450 initialization of include_label.
2451 (unique_id): now returns a string.
2453 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2455 * src/LaTeXFeatures.h: new member IncludedFiles, for
2456 a map of key, included file name.
2458 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2459 with the included files for inclusion in SGML preamble,
2460 i. e., linuxdoc and docbook.
2463 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2464 nice (is the generated linuxdoc code to be exported?), that
2465 allows to remove column, and only_body that will be true for
2466 slave documents. Insets are allowed inside SGML font type.
2467 New handling of the SGML preamble for included files.
2468 (makeDocBookFile): the same for docbook.
2470 * src/insets/insetinclude.h:
2471 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2473 (DocBook): new export methods.
2475 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2476 and makeDocBookFile.
2478 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2479 formats to export with command line argument -x.
2481 2000-06-29 Juergen Vigna <jug@sad.it>
2483 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2484 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2486 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2487 region could already been cleared by an inset!
2489 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2491 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2494 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2496 (cursorToggle): remove special handling of lyx focus.
2498 2000-06-28 Juergen Vigna <jug@sad.it>
2500 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2503 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2505 * src/insets/insetindex.C (Edit): add a callback when popup is
2508 * src/insets/insettext.C (LocalDispatch):
2509 * src/insets/insetmarginal.h:
2510 * src/insets/insetlist.h:
2511 * src/insets/insetfoot.h:
2512 * src/insets/insetfloat.h:
2513 * src/insets/insetert.h: add a missing std:: qualifier.
2515 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2517 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2520 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2522 * src/insets/insettext.C (Read): remove tmptok unused variable
2523 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2524 (InsertInset): change for new InsetInset code
2526 * src/insets/insettext.h: add TEXT inline method
2528 * src/insets/insettext.C: remove TEXT macro
2530 * src/insets/insetmarginal.C (Write): new method
2531 (Latex): change output slightly
2533 * src/insets/insetfoot.C (Write): new method
2534 (Latex): change output slightly (don't use endl when no need)
2536 * src/insets/insetert.C (Write): new method
2538 * src/insets/insetcollapsable.h: make button_length, button_top_y
2539 and button_bottm_y protected.
2541 * src/insets/insetcollapsable.C (Write): simplify code by using
2542 tostr. Also do not output the float name, the children class
2543 should to that to get control over own arguments
2545 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2546 src/insets/insetminipage.[Ch]:
2549 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2551 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2553 * src/Makefile.am (lyx_SOURCES): add the new files
2555 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2556 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2557 * src/commandtags.h: ditto
2559 * src/LaTeXFeatures.h: add a std::set of used floattypes
2561 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2563 * src/FloatList.[Ch] src/Floating.h: new files
2565 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2567 * src/lyx_cb.C (TableApplyCB): ditto
2569 * src/text2.C: ditto
2570 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2571 (parseSingleLyXformat2Token): ditto + add code for
2572 backwards compability for old float styles + add code for new insets
2574 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2576 (InsertInset(size_type, Inset *, LyXFont)): new method
2577 (InsetChar(size_type, char)): changed to use the other InsetChar
2578 with a LyXFont(ALL_INHERIT).
2579 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2580 insert the META_INSET.
2582 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2584 * sigc++/thread.h (Threads): from here
2586 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2587 definition out of line
2588 * sigc++/scope.h: from here
2590 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2592 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2593 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2595 * Makefile.am (bindist): new target.
2597 * INSTALL: add instructions for doing a binary distribution.
2599 * development/tools/README.bin.example: update a bit.
2601 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2604 * lib/lyxrc.example: new lyxrc tag \set_color.
2606 * src/lyxfunc.C (Dispatch):
2607 * src/commandtags.h:
2608 * src/LyXAction.C: new lyxfunc "set-color".
2610 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2611 and an x11name given as strings.
2613 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2614 cache when a color is changed.
2616 2000-06-26 Juergen Vigna <jug@sad.it>
2618 * src/lyxrow.C (width): added this functions and variable.
2620 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2623 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2625 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2627 * images/undo_bw.xpm: new icon.
2628 * images/redo_bw.xpm: ditto.
2630 * configure.in (INSTALL_SCRIPT): change value to
2631 ${INSTALL} to avoid failures of install-script target.
2632 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2634 * src/BufferView.h: add a magic "friend" declaration to please
2637 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2639 * forms/cite.fd: modified to allow resizing without messing
2642 * src/insetcite.C: Uses code from cite.fd almost without
2644 User can now resize dialog in the x-direction.
2645 Resizing the dialog in the y-direction is prevented, as the
2646 code does this intelligently already.
2648 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2650 * INSTALL: remove obsolete entry in "problems" section.
2652 * lib/examples/sl_*.lyx: update of the slovenian examples.
2654 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2656 2000-06-23 Juergen Vigna <jug@sad.it>
2658 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2660 * src/buffer.C (resize): delete the LyXText of textinsets.
2662 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2664 * src/insets/lyxinset.h: added another parameter 'cleared' to
2665 the draw() function.
2667 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2668 unlocking inset in inset.
2670 2000-06-22 Juergen Vigna <jug@sad.it>
2672 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2673 of insets and moved first to LyXText.
2675 * src/mathed/formulamacro.[Ch]:
2676 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2678 2000-06-21 Juergen Vigna <jug@sad.it>
2680 * src/text.C (GetVisibleRow): look if I should clear the area or not
2681 using Inset::doClearArea() function.
2683 * src/insets/lyxinset.h: added doClearArea() function and
2684 modified draw(Painter &, ...) to draw(BufferView *, ...)
2686 * src/text2.C (UpdateInset): return bool insted of int
2688 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2690 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2691 combox in the character popup
2693 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2694 BufferParams const & params
2696 2000-06-20 Juergen Vigna <jug@sad.it>
2698 * src/insets/insettext.C (SetParagraphData): set insetowner on
2701 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2703 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2704 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2706 (form_main_): remove
2708 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2709 (create_form_form_main): remove FD_form_main stuff, connect to
2710 autosave_timeout signal
2712 * src/LyXView.[Ch] (getMainForm): remove
2713 (UpdateTimerCB): remove
2714 * src/BufferView_pimpl.h: inherit from SigC::Object
2716 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2717 signal instead of callback
2719 * src/BufferView.[Ch] (cursorToggleCB): remove
2721 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2723 * src/BufferView_pimpl.C: changes because of the one below
2725 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2726 instead of storing a pointer to a LyXText.
2728 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2730 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2732 * src/lyxparagraph.h
2734 * src/paragraph.C: Changed fontlist to a sorted vector.
2736 2000-06-19 Juergen Vigna <jug@sad.it>
2738 * src/BufferView.h: added screen() function.
2740 * src/insets/insettext.C (LocalDispatch): some selection code
2743 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2745 * src/insets/insettext.C (SetParagraphData):
2747 (InsetText): fixes for multiple paragraphs.
2749 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2751 * development/lyx.spec.in: Call configure with ``--without-warnings''
2752 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2753 This should be fine, however, since we generally don't want to be
2754 verbose when making an RPM.
2756 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2758 * lib/scripts/fig2pstex.py: New file
2760 2000-06-16 Juergen Vigna <jug@sad.it>
2762 * src/insets/insettabular.C (UpdateLocal):
2763 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2764 (LocalDispatch): Changed all functions to use LyXText.
2766 2000-06-15 Juergen Vigna <jug@sad.it>
2768 * src/text.C (SetHeightOfRow): call inset::update before requesting
2771 * src/insets/insettext.C (update):
2772 * src/insets/insettabular.C (update): added implementation
2774 * src/insets/lyxinset.h: added update function
2776 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2778 * src/text.C (SelectNextWord): protect against null pointers with
2779 old-style string streams. (fix from Paul Theo Gonciari
2782 * src/cite.[Ch]: remove erroneous files.
2784 * lib/configure.m4: update the list of created directories.
2786 * src/lyxrow.C: include <config.h>
2787 * src/lyxcursor.C: ditto.
2789 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2791 * lib/examples/decimal.lyx: new example file from Mike.
2793 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2794 to find template definitions (from Dekel)
2796 * src/frontends/.cvsignore: add a few things.
2798 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2800 * src/Timeout.C (TimeOut): remove default argument.
2802 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2805 * src/insets/ExternalTemplate.C: add a "using" directive.
2807 * src/lyx_main.h: remove the act_ struct, which seems unused
2810 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2812 * LyX Developers Meeting: All files changed, due to random C++ (by
2813 coincidence) code generator script.
2815 - external inset (cool!)
2816 - initial online editing of preferences
2817 - insettabular breaks insettext(s contents)
2819 - some DocBook fixes
2820 - example files update
2821 - other cool stuff, create a diff and look for yourself.
2823 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2825 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2826 -1 this is a non-line-breaking textinset.
2828 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2829 if there is no width set.
2831 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2833 * Lots of files: Merged the dialogbase branch.
2835 2000-06-09 Allan Rae <rae@lyx.org>
2837 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2838 and the Dispatch methods that used it.
2840 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2841 access to functions formerly kept in Dispatch.
2843 2000-05-19 Allan Rae <rae@lyx.org>
2845 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2846 made to_page and count_copies integers again. from_page remains a
2847 string however because I want to allow entry of a print range like
2848 "1,4,22-25" using this field.
2850 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2851 and printer-params-get. These aren't useful from the minibuffer but
2852 could be used by a script/LyXServer app provided it passes a suitable
2853 auto_mem_buffer. I guess I should take a look at how the LyXServer
2854 works and make it support xtl buffers.
2856 * sigc++/: updated to libsigc++-1.0.1
2858 * src/xtl/: updated to xtl-1.3.pl.11
2860 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2861 those changes done to the files in src/ are actually recreated when
2862 they get regenerated. Please don't ever accept a patch that changes a
2863 dialog unless that patch includes the changes to the corresponding *.fd
2866 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2867 stringOnlyContains, renamed it and generalised it.
2869 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2870 branch. Removed the remaining old form_print code.
2872 2000-04-26 Allan Rae <rae@lyx.org>
2874 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2875 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2877 2000-04-25 Allan Rae <rae@lyx.org>
2879 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2880 against a base of xtl-1.3.pl.4
2882 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2883 filter the Id: entries so they still show the xtl version number
2886 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2887 into the src/xtl code. Patch still pending with José (XTL)
2889 2000-04-24 Allan Rae <rae@lyx.org>
2891 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2892 both more generic and much safer. Use the new template functions.
2893 * src/buffer.[Ch] (Dispatch): ditto.
2895 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2896 and mem buffer more intelligently. Also a little general cleanup.
2899 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2900 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2901 * src/xtl/Makefile.am: ditto.
2902 * src/xtl/.cvsignore: ditto.
2903 * src/Makefile.am: ditto.
2905 * src/PrinterParams.h: Removed the macros member functions. Added a
2906 testInvariant member function. A bit of tidying up and commenting.
2907 Included Angus's idea for fixing operation with egcs-1.1.2.
2909 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2910 cool expansion of XTL's mem_buffer to support automatic memory
2911 management within the buffer itself. Removed the various macros and
2912 replaced them with template functions that use either auto_mem_buffer
2913 or mem_buffer depending on a #define. The mem_buffer support will
2914 disappear as soon as the auto_mem_buffer is confirmed to be good on
2915 other platforms/compilers. That is, it's there so you've got something
2918 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2919 effectively forked XTL. However I expect José will include my code
2920 into the next major release. Also fixed a memory leak.
2921 * src/xtl/text.h: ditto.
2922 * src/xtl/xdr.h: ditto.
2923 * src/xtl/giop.h: ditto.
2925 2000-04-16 Allan Rae <rae@lyx.org>
2927 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2928 by autogen.sh and removed by maintainer-clean anyway.
2929 * .cvsignore, sigc++/.cvsignore: Support the above.
2931 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2933 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2935 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2936 macros, renamed static callback-target member functions to suit new
2937 scheme and made them public.
2938 * src/frontends/xforms/forms/form_print.fd: ditto.
2939 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2941 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2944 * src/xtl/: New directory containing a minimal distribution of XTL.
2945 This is XTL-1.3.pl.4.
2947 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2949 2000-04-15 Allan Rae <rae@lyx.org>
2951 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2953 * sigc++/: Updated to libsigc++-1.0.0
2955 2000-04-14 Allan Rae <rae@lyx.org>
2957 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2958 use the generic ones in future. I'll modify my conversion script.
2960 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2962 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2963 (CloseAllBufferRelatedDialogs): Renamed.
2964 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2966 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2967 of the generic ones. These are the same ones my conversion script
2970 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2971 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2972 * src/buffer.C (Dispatch): ditto
2974 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2975 functions for updating and hiding buffer dependent dialogs.
2976 * src/BufferView.C (buffer): ditto
2977 * src/buffer.C (setReadonly): ditto
2978 * src/lyxfunc.C (CloseBuffer): ditto
2980 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2981 Dialogs.h, and hence all the SigC stuff, into every file that includes
2982 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2984 * src/BufferView2.C: reduce the number of headers included by buffer.h
2986 2000-04-11 Allan Rae <rae@lyx.org>
2988 * src/frontends/xforms/xform_macros.h: A small collection of macros
2989 for building C callbacks.
2991 * src/frontends/xforms/Makefile.am: Added above file.
2993 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2994 scheme again. This time it should work for JMarc. If this is
2995 successful I'll revise my conversion script to automate some of this.
2996 The static member functions in the class also have to be public for
2997 this scheme will work. If the scheme works (it's almost identical to
2998 the way BufferView::cursorToggleCB is handled so it should work) then
2999 FormCopyright and FormPrint will be ready for inclusion into the main
3000 trunk immediately after 1.1.5 is released -- provided we're prepared
3001 for complaints about lame compilers not handling XTL.
3003 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3005 2000-04-07 Allan Rae <rae@lyx.org>
3007 * config/lyxinclude.m4: A bit more tidying up (Angus)
3009 * src/LString.h: JMarc's <string> header fix
3011 * src/PrinterParams.h: Used string for most data to remove some
3012 ugly code in the Print dialog and avoid even uglier code when
3013 appending the ints to a string for output.
3015 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3016 and moved "default:" back to the end of switch statement. Cleaned
3017 up the printing so it uses the right function calls and so the
3018 "print to file" option actually puts the file in the right directory.
3020 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3022 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3023 and Ok+Apply button control into a separate method: input (Angus).
3024 (input) Cleaned it up and improved it to be very thorough now.
3025 (All CB) static_cast used instead of C style cast (Angus). This will
3026 probably change again once we've worked out how to keep gcc-2.8.1 happy
3027 with real C callbacks.
3028 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3029 ignore some of the bool settings and has random numbers instead. Needs
3030 some more investigation. Added other input length checks and checking
3031 of file and printer names.
3033 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3034 would link (Angus). Seems the old code doesn't compile with the pragma
3035 statement either. Separated callback entries from internal methods.
3037 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3039 2000-03-17 Allan Rae <rae@lyx.org>
3041 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3042 need it? Maybe it could go in Dialogs instead? I could make it a
3043 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3044 values to get the bool return value.
3045 (Dispatch): New overloaded method for xtl support.
3047 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3048 extern "C" callback instead of static member functions. Hopefully,
3049 JMarc will be able to compile this. I haven't changed
3050 forms/form_copyright.fd yet. Breaking one of my own rules already.
3052 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3053 because they aren't useful from the minibuffer. Maybe a LyXServer
3054 might want a help message though?
3056 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3058 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3059 xtl which needs both rtti and exceptions.
3061 * src/support/Makefile.am:
3062 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3064 * src/frontends/xforms/input_validators.[ch]: input filters and
3065 validators. These conrol what keys are valid in input boxes.
3066 Use them and write some more. Much better idea than waiting till
3067 after the user has pressed Ok to say that the input fields don't make
3070 * src/frontends/xforms/Makefile.am:
3071 * src/frontends/xforms/forms/form_print.fd:
3072 * src/frontends/xforms/forms/makefile:
3073 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3074 new scheme. Still have to make sure I haven't missed anything from
3075 the current implementation.
3077 * src/Makefile.am, src/PrinterParams.h: New data store.
3079 * other files: Added a couple of copyright notices.
3081 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3083 * src/insets/insetbib.h: move Holder struct in public space.
3085 * src/frontends/include/DialogBase.h: use SigC:: only when
3086 SIGC_CXX_NAMESPACES is defined.
3087 * src/frontends/include/Dialogs.h: ditto.
3089 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3091 * src/frontends/xforms/FormCopyright.[Ch]: do not
3092 mention SigC:: explicitely.
3094 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3096 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3097 deals with testing KDE in main configure.in
3098 * configure.in: ditto.
3100 2000-02-22 Allan Rae <rae@lyx.org>
3102 * Lots of files: Merged from HEAD
3104 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3105 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3107 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3109 * sigc++/: new minidist.
3111 2000-02-14 Allan Rae <rae@lyx.org>
3113 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3115 2000-02-08 Juergen Vigna <jug@sad.it>
3117 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3118 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3120 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3121 for this port and so it is much easier for other people to port
3122 dialogs in a common development environment.
3124 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3125 the QT/KDE implementation.
3127 * src/frontends/kde/Dialogs.C:
3128 * src/frontends/kde/FormCopyright.C:
3129 * src/frontends/kde/FormCopyright.h:
3130 * src/frontends/kde/Makefile.am:
3131 * src/frontends/kde/formcopyrightdialog.C:
3132 * src/frontends/kde/formcopyrightdialog.h:
3133 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3134 for the kde support of the Copyright-Dialog.
3136 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3137 subdir-substitution instead of hardcoded 'xforms' as we now have also
3140 * src/frontends/include/DialogBase.h (Object): just commented the
3141 label after #endif (nasty warning and I don't like warnings ;)
3143 * src/main.C (main): added KApplication initialization if using
3146 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3147 For now only the KDE event-loop is added if frontend==kde.
3149 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3151 * configure.in: added support for the --with-frontend[=value] option
3153 * autogen.sh: added kde.m4 file to list of config-files
3155 * acconfig.h: added define for KDEGUI-support
3157 * config/kde.m4: added configuration functions for KDE-port
3159 * config/lyxinclude.m4: added --with-frontend[=value] option with
3160 support for xforms and KDE.
3162 2000-02-08 Allan Rae <rae@lyx.org>
3164 * all Makefile.am: Fixed up so the make targets dist, distclean,
3165 install and uninstall all work even if builddir != srcdir. Still
3166 have a new sigc++ minidist update to come.
3168 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3170 2000-02-01 Allan Rae <rae@lyx.org>
3172 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3173 Many mods to get builddir != srcdir working.
3175 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3176 for building on NT and so we can do the builddir != srcdir stuff.
3178 2000-01-30 Allan Rae <rae@lyx.org>
3180 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3181 This will stay in "rae" branch. We probably don't really need it in
3182 the main trunk as anyone who wants to help programming it should get
3183 a full library installed also. So they can check both included and
3184 system supplied library compilation.
3186 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3187 Added a 'mini' distribution of libsigc++. If you feel the urge to
3188 change something in these directories - Resist it. If you can't
3189 resist the urge then you should modify the following script and rebuild
3190 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3191 all happen. Still uses a hacked version of libsigc++'s configure.in.
3192 I'm quite happy with the results. I'm not sure the extra work to turn
3193 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3194 worth the trouble and would probably lead to extra maintenance
3196 I haven't tested the following important make targets: install, dist.
3197 Not ready for prime time but very close. Maybe 1.1.5.
3199 * development/tools/makeLyXsigc.sh: A shell script to automatically
3200 generate our mini-dist of libsigc++. It can only be used with a CVS
3201 checkout of libsigc++ not a tarball distribution. It's well commented.
3202 This will end up as part of the libsigc++ distribution so other apps
3203 can easily have an included mini-dist. If someone makes mods to the
3204 sigc++ subpackage without modifying this script to generate those
3205 changes I'll be very upset!
3207 * src/frontends/: Started the gui/system indep structure.
3209 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3210 to access the gui-indep dialogs are in this class. Much improved
3211 design compared to previous revision. Lars, please refrain from
3212 moving this header into src/ like you did with Popups.h last time.
3214 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3216 * src/frontends/xforms/: Started the gui-indep system with a single
3217 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3220 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3221 Here you'll find a very useful makefile and automated fdfix.sh that
3222 makes updating dailogs a no-brainer -- provided you follow the rules
3223 set out in the README. I'm thinking about adding another script to
3224 automatically generate skeleton code for a new dialog given just the
3227 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3228 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3229 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3231 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3233 * src/support/LSubstring.C (operator): simplify
3235 * src/lyxtext.h: removed bparams, use buffer_->params instead
3237 * src/lyxrow.h: make Row a real class, move all variables to
3238 private and use accessors.
3240 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3242 (isRightToLeftPar): ditto
3243 (ChangeLanguage): ditto
3244 (isMultiLingual): ditto
3247 (SimpleTeXOnePar): ditto
3248 (TeXEnvironment): ditto
3249 (GetEndLabel): ditto
3251 (SetOnlyLayout): ditto
3252 (BreakParagraph): ditto
3253 (BreakParagraphConservative): ditto
3254 (GetFontSettings): ditto
3256 (CopyIntoMinibuffer): ditto
3257 (CutIntoMinibuffer): ditto
3258 (PasteParagraph): ditto
3259 (SetPExtraType): ditto
3260 (UnsetPExtraType): ditto
3261 (DocBookContTableRows): ditto
3262 (SimpleDocBookOneTablePar): ditto
3264 (TeXFootnote): ditto
3265 (SimpleTeXOneTablePar): ditto
3266 (TeXContTableRows): ditto
3267 (SimpleTeXSpecialChars): ditto
3270 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3271 to private and use accessors.
3273 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3274 this, we did not use it anymore and has not been for ages. Just a
3275 waste of cpu cycles.
3277 * src/language.h: make Language a real class, move all variables
3278 to private and use accessors.
3280 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3281 (create_view): remove
3282 (update): some changes for new timer
3283 (cursorToggle): use new timer
3284 (beforeChange): change for new timer
3286 * src/BufferView.h (cursorToggleCB): removed last paramter because
3289 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3290 (cursorToggleCB): change because of new timer code
3292 * lib/CREDITS: updated own mailaddress
3294 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3296 * src/support/filetools.C (PutEnv): fix the code in case neither
3297 putenv() nor setenv() have been found.
3299 * INSTALL: mention the install-strip Makefile target.
3301 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3302 read-only documents.
3304 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3306 * lib/reLyX/configure.in (VERSION): avoid using a previously
3307 generated reLyX wrapper to find out $prefix.
3309 * lib/examples/eu_adibide_lyx-atua.lyx:
3310 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3311 translation of the Tutorial (Dooteo)
3313 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3315 * forms/cite.fd: new citation dialog
3317 * src/insetcite.[Ch]: the new citation dialog is moved into
3320 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3323 * src/insets/insetcommand.h: data members made private.
3325 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3327 * LyX 1.1.5 released
3329 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3331 * src/version.h (LYX_RELEASE): to 1.1.5
3333 * src/spellchecker.C (RunSpellChecker): return false if the
3334 spellchecker dies upon creation.
3336 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3338 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3339 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3343 * lib/CREDITS: update entry for Martin Vermeer.
3345 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3347 * src/text.C (draw): Draw foreign language bars at the bottom of
3348 the row instead of at the baseline.
3350 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3352 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3354 * lib/bind/de_menus.bind: updated
3356 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3358 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3360 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3362 * src/menus.C (Limit_string_length): New function
3363 (ShowTocMenu): Limit the number of items/length of items in the
3366 * src/paragraph.C (String): Correct result for a paragraph inside
3369 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3371 * src/bufferlist.C (close): test of buf->getuser() == NULL
3373 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3375 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3376 Do not call to SetCursor when the paragraph is a closed footnote!
3378 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3380 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3383 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3385 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3388 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3389 reference popup, that activates the reference-back action
3391 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3393 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3394 the menus. Also fixed a bug.
3396 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3397 the math panels when switching buffers (unless new buffer is readonly).
3399 * src/BufferView.C (NoSavedPositions)
3400 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3402 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3404 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3405 less of dvi dirty or not.
3407 * src/trans_mgr.[Ch] (insert): change first parameter to string
3410 * src/chset.[Ch] (encodeString): add const to first parameter
3412 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3414 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3418 * src/LaTeX.C (deplog): better searching for dependency files in
3419 the latex log. Uses now regexps.
3421 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3422 instead of the box hack or \hfill.
3424 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3426 * src/lyxfunc.C (doImportHelper): do not create the file before
3427 doing the actual import.
3428 (doImportASCIIasLines): create a new file before doing the insert.
3429 (doImportASCIIasParagraphs): ditto.
3431 * lib/lyxrc.example: remove mention of non-existing commands
3433 * lyx.man: remove mention of color-related switches.
3435 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3437 * src/lyx_gui.C: remove all the color-related ressources, which
3438 are not used anymore.
3440 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3443 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3445 * src/lyxrc.C (read): Add a missing break in the switch
3447 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3449 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3451 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3454 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3456 * src/text.C (draw): draw bars under foreign language words.
3458 * src/LColor.[Ch]: add LColor::language
3460 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3462 * src/lyxcursor.h (boundary): New member variable
3464 * src/text.C (IsBoundary): New methods
3466 * src/text.C: Use the above for currect cursor movement when there
3467 is both RTL & LTR text.
3469 * src/text2.C: ditto
3471 * src/bufferview_funcs.C (ToggleAndShow): ditto
3473 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3475 * src/text.C (DeleteLineForward): set selection to true to avoid
3476 that DeleteEmptyParagraphMechanism does some magic. This is how it
3477 is done in all other functions, and seems reasonable.
3478 (DeleteWordForward): do not jump over non-word stuff, since
3479 CursorRightOneWord() already does it.
3481 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3482 DeleteWordBackward, since they seem safe to me (since selection is
3483 set to "true") DeleteEmptyParagraphMechanism does nothing.
3485 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3487 * src/lyx_main.C (easyParse): simplify the code by factoring the
3488 part that removes parameters from the command line.
3489 (LyX): check wether wrong command line options have been given.
3491 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3493 * src/lyx_main.C : add support for specifying user LyX
3494 directory via command line option -userdir.
3496 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3498 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3499 the number of items per popup.
3500 (Add_to_refs_menu): Ditto.
3502 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3504 * src/lyxparagraph.h: renamed ClearParagraph() to
3505 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3506 textclass as parameter, and do nothing if free_spacing is
3507 true. This fixes part of the line-delete-forward problems.
3509 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3510 (pasteSelection): ditto.
3511 (SwitchLayoutsBetweenClasses): more translatable strings.
3513 * src/text2.C (CutSelection): use StripLeadingSpaces.
3514 (PasteSelection): ditto.
3515 (DeleteEmptyParagraphMechanism): ditto.
3517 2000-05-26 Juergen Vigna <jug@sad.it>
3519 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3520 is not needed in tabular insets.
3522 * src/insets/insettabular.C (TabularFeatures): added missing features.
3524 * src/tabular.C (DeleteColumn):
3526 (AppendRow): implemented this functions
3527 (cellsturct::operator=): clone the inset too;
3529 2000-05-23 Juergen Vigna <jug@sad.it>
3531 * src/insets/insettabular.C (LocalDispatch): better selection support
3532 when having multicolumn-cells.
3534 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3536 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3538 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3540 * src/ColorHandler.C (getGCForeground): put more test into _()
3542 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3545 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3548 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3550 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3551 there are no labels, or when buffer is readonly.
3553 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3554 there are no labels, buffer is SGML, or when buffer is readonly.
3556 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3558 * src/LColor.C (LColor): change a couple of grey40 to grey60
3559 (LColor): rewore initalization to make compiles go some magnitude
3561 (getGUIName): don't use gettext until we need the string.
3563 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3565 * src/Bullet.[Ch]: Fixed a small bug.
3567 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3569 * src/paragraph.C (String): Several fixes/improvements
3571 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3573 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3575 * src/paragraph.C (String): give more correct output.
3577 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3579 * src/lyxfont.C (stateText) Do not output the language if it is
3580 eqaul to the language of the document.
3582 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3583 between two paragraphs with the same language.
3585 * src/paragraph.C (getParLanguage) Return a correct answer for an
3586 empty dummy paragraph.
3588 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3591 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3594 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3595 the menus/popup, if requested fonts are unavailable.
3597 2000-05-22 Juergen Vigna <jug@sad.it>
3599 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3600 movement support (Up/Down/Tab/Shift-Tab).
3601 (LocalDispatch): added also preliminari cursor-selection.
3603 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3605 * src/paragraph.C (PasteParagraph): Hopefully now right!
3607 2000-05-22 Garst R. Reese <reese@isn.net>
3609 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3610 of list, change all references to Environment to Command
3611 * tex/hollywood.cls : rewrite environments as commands, add
3612 \uppercase to interiorshot and exteriorshot to force uppecase.
3613 * tex/broadway.cls : rewrite environments as commands. Tweak
3616 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3618 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3619 size of items: use a constant intead of the hardcoded 40, and more
3620 importantly do not remove the %m and %x tags added at the end.
3621 (Add_to_refs_menu): use vector::size_type instead of
3622 unsigned int as basic types for the variables. _Please_ do not
3623 assume that size_t is equal to unsigned int. On an alpha, this is
3624 unsigned long, which is _not_ the same.
3626 * src/language.C (initL): remove language "hungarian", since it
3627 seems that "magyar" is better.
3629 2000-05-22 Juergen Vigna <jug@sad.it>
3631 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3633 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3636 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3637 next was deleted but not set to 0.
3639 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3641 * src/language.C (initL): change the initialization of languages
3642 so that compiles goes _fast_.
3644 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3647 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3649 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3653 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3655 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3657 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3661 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3664 * src/insets/insetlo*.[Ch]: Made editable
3666 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3668 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3669 the current selection.
3671 * src/BufferView_pimpl.C (stuffClipboard): new method
3673 * src/BufferView.C (stuffClipboard): new method
3675 * src/paragraph.C (String): new method
3677 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3678 LColor::ignore when lyxname is not found.
3680 * src/BufferView.C (pasteSelection): new method
3682 * src/BufferView_pimpl.C (pasteSelection): new method
3684 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3686 * src/WorkArea.C (request_clipboard_cb): new static function
3687 (getClipboard): new method
3688 (putClipboard): new method
3690 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3692 * LyX 1.1.5pre2 released
3694 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3696 * src/vspace.C (operator=): removed
3697 (operator=): removed
3699 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3701 * src/layout.C (NumberOfClass): manually set the type in make_pair
3702 (NumberOfLayout): ditto
3704 * src/language.C: use the Language constructor for ignore_lang
3706 * src/language.h: add constructors to struct Language
3708 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3710 * src/text2.C (SetCursorIntern): comment out #warning
3712 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3714 * src/mathed/math_iter.h: initialize sx and sw to 0
3716 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3718 * forms/lyx.fd: Redesign of form_ref
3720 * src/LaTeXFeatures.[Ch]
3724 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3727 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3728 and Buffer::inset_iterator.
3730 * src/menus.C: Added new menus: TOC and Refs.
3732 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3734 * src/buffer.C (getTocList): New method.
3736 * src/BufferView2.C (ChangeRefs): New method.
3738 * src/buffer.C (getLabelList): New method. It replaces the old
3739 getReferenceList. The return type is vector<string> instead of
3742 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3743 the old getLabel() and GetNumberOfLabels() methods.
3744 * src/insets/insetlabel.C (getLabelList): ditto
3745 * src/mathed/formula.C (getLabelList): ditto
3747 * src/paragraph.C (String): New method.
3749 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3750 Uses the new getTocList() method.
3751 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3752 which automatically updates the contents of the browser.
3753 (RefUpdateCB): Use the new getLabelList method.
3755 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3757 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3759 * src/spellchecker.C: Added using std::reverse;
3761 2000-05-19 Juergen Vigna <jug@sad.it>
3763 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3765 * src/insets/insettext.C (computeTextRows): small fix for display of
3766 1 character after a newline.
3768 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3771 2000-05-18 Juergen Vigna <jug@sad.it>
3773 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3774 when changing width of column.
3776 * src/tabular.C (set_row_column_number_info): setting of
3777 autobreak rows if necessary.
3779 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3781 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3783 * src/vc-backend.*: renamed stat() to status() and vcstat to
3784 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3785 compilation broke. The new name seems more relevant, anyway.
3787 2000-05-17 Juergen Vigna <jug@sad.it>
3789 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3790 which was wrong if the removing caused removing of rows!
3792 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3793 (pushToken): new function.
3795 * src/text2.C (CutSelection): fix problem discovered with purify
3797 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3799 * src/debug.C (showTags): enlarge the first column, now that we
3800 have 6-digits debug codes.
3802 * lib/layouts/hollywood.layout:
3803 * lib/tex/hollywood.cls:
3804 * lib/tex/brodway.cls:
3805 * lib/layouts/brodway.layout: more commands and fewer
3806 environments. Preambles moved in the .cls files. Broadway now has
3807 more options on scene numbering and less whitespace (from Garst)
3809 * src/insets/insetbib.C (getKeys): make sure that we are in the
3810 document directory, in case the bib file is there.
3812 * src/insets/insetbib.C (Latex): revert bogus change.
3814 2000-05-16 Juergen Vigna <jug@sad.it>
3816 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3817 the TabularLayout on cursor move.
3819 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3821 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3824 (draw): fixed cursor position and drawing so that the cursor is
3825 visible when before the tabular-inset.
3827 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3828 when creating from old insettext.
3830 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3832 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3834 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3835 * lib/tex/brodway.cls: ditto
3837 * lib/layouts/brodway.layout: change alignment of parenthical
3840 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3842 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3843 versions 0.88 and 0.89 are supported.
3845 2000-05-15 Juergen Vigna <jug@sad.it>
3847 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3850 * src/insets/insettext.C (computeTextRows): redone completely this
3851 function in a much cleaner way, because of problems when having a
3853 (draw): added a frame border when the inset is locked.
3854 (SetDrawLockedFrame): this sets if we draw the border or not.
3855 (SetFrameColor): this sets the frame color (default=insetframe).
3857 * src/insets/lyxinset.h: added x() and y() functions which return
3858 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3859 function which is needed to see if we have a locking inset of some
3860 type in this inset (needed for now in insettabular).
3862 * src/vspace.C (inPixels): the same function also without a BufferView
3863 parameter as so it is easier to use it in some ocasions.
3865 * src/lyxfunc.C: changed all places where insertInset was used so
3866 that now if it couldn't be inserted it is deleted!
3868 * src/TabularLayout.C:
3869 * src/TableLayout.C: added support for new tabular-inset!
3871 * src/BufferView2.C (insertInset): this now returns a bool if the
3872 inset was really inserted!!!
3874 * src/tabular.C (GetLastCellInRow):
3875 (GetFirstCellInRow): new helper functions.
3876 (Latex): implemented for new tabular class.
3880 (TeXTopHLine): new Latex() helper functions.
3882 2000-05-12 Juergen Vigna <jug@sad.it>
3884 * src/mathed/formulamacro.C (Read):
3885 * src/mathed/formula.C (Read): read also the \end_inset here!
3887 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3889 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3890 crush when saving formulae with unbalanced parenthesis.
3892 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3894 * src/layout.C: Add new keyword "endlabelstring" to layout file
3896 * src/text.C (GetVisibleRow): Draw endlabel string.
3898 * lib/layouts/broadway.layout
3899 * lib/layouts/hollywood.layout: Added endlabel for the
3900 Parenthetical layout.
3902 * lib/layouts/heb-article.layout: Do not use slanted font shape
3903 for Theorem like environments.
3905 * src/buffer.C (makeLaTeXFile): Always add "american" to
3906 the UsedLanguages list if document language is RTL.
3908 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3910 * add addendum to README.OS2 and small patch (from SMiyata)
3912 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3914 * many files: correct the calls to ChangeExtension().
3916 * src/support/filetools.C (ChangeExtension): remove the no_path
3917 argument, which does not belong there. Use OnlyFileName() instead.
3919 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3920 files when LaTeXing a non-nice latex file.
3922 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3923 a chain of "if". Return false when deadkeys are not handled.
3925 * src/lyx_main.C (LyX): adapted the code for default bindings.
3927 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3928 bindings for basic functionality (except deadkeys).
3929 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3931 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3932 several methods: handle override_x_deadkeys.
3934 * src/lyxrc.h: remove the "bindings" map, which did not make much
3935 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3937 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3939 * src/lyxfont.C (stateText): use a saner method to determine
3940 whether the font is "default". Seems to fix the crash with DEC
3943 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3945 2000-05-08 Juergen Vigna <jug@sad.it>
3947 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3948 TabularLayoutMenu with mouse-button-3
3949 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3951 * src/TabularLayout.C: added this file for having a Layout for
3954 2000-05-05 Juergen Vigna <jug@sad.it>
3956 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3957 recalculating inset-widths.
3958 (TabularFeatures): activated this function so that I can change
3959 tabular-features via menu.
3961 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3962 that I can test some functions with the Table menu.
3964 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3966 * src/lyxfont.C (stateText): guard against stupid c++libs.
3968 * src/tabular.C: add using std::vector
3969 some whitespace changes, + removed som autogenerated code.
3971 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3973 2000-05-05 Juergen Vigna <jug@sad.it>
3975 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3976 row, columns and cellstructures.
3978 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3980 * lib/lyxrc.example: remove obsolete entries.
3982 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3983 reading of protected_separator for free_spacing.
3985 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3987 * src/text.C (draw): do not display an exclamation mark in the
3988 margin for margin notes. This is confusing, ugly and
3991 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3992 AMS math' is checked.
3994 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3995 name to see whether including the amsmath package is needed.
3997 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3999 * src/paragraph.C (validate): Compute UsedLanguages correctly
4000 (don't insert the american language if it doesn't appear in the
4003 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4004 The argument of \thanks{} command is considered moving argument
4006 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4009 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4011 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4012 for appendix/minipage/depth. The lines can be now both in the footnote
4013 frame, and outside the frame.
4015 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4018 2000-05-05 Juergen Vigna <jug@sad.it>
4020 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4021 neede only in tabular.[Ch].
4023 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4025 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4027 (Write): write '~' for PROTECTED_SEPARATOR
4029 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4031 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4034 * src/mathed/formula.C (drawStr): rename size to siz.
4036 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4037 possibly fix a bug by not changing the pflags = flags to piflags =
4040 2000-05-05 Juergen Vigna <jug@sad.it>
4042 * src/insets/insetbib.C: moved using directive
4044 * src/ImportNoweb.C: small fix for being able to compile (missing
4047 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4049 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4050 to use clear, since we don't depend on this in the code. Add test
4053 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4055 * (various *.C files): add using std::foo directives to please dec
4058 * replace calls to string::clear() to string::erase() (Angus)
4060 * src/cheaders/cmath: modified to provide std::abs.
4062 2000-05-04 Juergen Vigna <jug@sad.it>
4064 * src/insets/insettext.C: Prepared all for inserting of multiple
4065 paragraphs. Still display stuff to do (alignment and other things),
4066 but I would like to use LyXText to do this when we cleaned out the
4067 table-support stuff.
4069 * src/insets/insettabular.C: Changed lot of stuff and added lots
4070 of functionality still a lot to do.
4072 * src/tabular.C: Various functions changed name and moved to be
4073 const functions. Added new Read and Write functions and changed
4074 lots of things so it works good with tabular-insets (also removed
4075 some stuff which is not needed anymore * hacks *).
4077 * src/lyxcursor.h: added operators == and != which just look if
4078 par and pos are (not) equal.
4080 * src/buffer.C (latexParagraphs): inserted this function to latex
4081 all paragraphs form par to endpar as then I can use this too for
4084 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4085 so that I can call this to from text insets with their own cursor.
4087 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4088 output off all paragraphs (because of the fix below)!
4090 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4091 the very last paragraph (this could be also the last paragraph of an
4094 * src/texrow.h: added rows() call which returns the count-variable.
4096 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4098 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4100 * lib/configure.m4: better autodetection of DocBook tools.
4102 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4104 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4106 * src/lyx_cb.C: add using std::reverse;
4108 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4111 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4112 selected files. Should fix repeated errors from generated files.
4114 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4116 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4118 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4119 the spellchecker popup.
4121 * lib/lyxrc.example: Removed the \number_inset section
4123 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4125 * src/insets/figinset.C (various): Use IsFileReadable() to make
4126 sure that the file actually exist. Relying on ghostscripts errors
4127 is a bad idea since they can lead to X server crashes.
4129 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4131 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4134 * lib/lyxrc.example: smallish typo in description of
4135 \view_dvi_paper_option
4137 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4140 * src/lyxfunc.C: doImportHelper to factor out common code of the
4141 various import methods. New functions doImportASCIIasLines,
4142 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4143 doImportLinuxDoc for the format specific parts.
4146 * buffer.C: Dispatch returns now a bool to indicate success
4149 * lyx_gui.C: Add getLyXView() for member access
4151 * lyx_main.C: Change logic for batch commands: First try
4152 Buffer::Dispatch (possibly without GUI), if that fails, use
4155 * lyx_main.C: Add support for --import command line switch.
4156 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4157 Available Formats: Everything accepted by 'buffer-import <format>'
4159 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4161 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4164 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4165 documents will be reformatted upon reentry.
4167 2000-04-27 Juergen Vigna <jug@sad.it>
4169 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4170 correctly only last pos this was a bug.
4172 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4174 * release of lyx-1.1.5pre1
4176 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4178 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4180 * src/menus.C: revert the change of naming (Figure->Graphic...)
4181 from 2000-04-11. It was incomplete and bad.
4183 * src/LColor.[Ch]: add LColor::depthbar.
4184 * src/text.C (GetVisibleRow): use it.
4186 * README: update the languages list.
4188 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4190 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4193 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4195 * README: remove sections that were just wrong.
4197 * src/text2.C (GetRowNearY): remove currentrow code
4199 * src/text.C (GetRow): remove currentrow code
4201 * src/screen.C (Update): rewritten a bit.
4202 (SmallUpdate): removed func
4204 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4206 (FullRebreak): return bool
4207 (currentrow): remove var
4208 (currentrow_y): ditto
4210 * src/lyxscreen.h (Draw): change arg to unsigned long
4211 (FitCursor): return bool
4212 (FitManualCursor): ditto
4213 (Smallpdate): remove func
4214 (first): change to unsigned long
4215 (DrawOneRow): change second arg to long (from long &)
4216 (screen_refresh_y): remove var
4217 (scree_refresh_row): ditto
4219 * src/lyxrow.h: change baseline to usigned int from unsigned
4220 short, this brings some implicit/unsigned issues out in the open.
4222 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4224 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4225 instead of smallUpdate.
4227 * src/lyxcursor.h: change y to unsigned long
4229 * src/buffer.h: don't call updateScrollbar after fitcursor
4231 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4232 where they are used. Removed "\\direction", this was not present
4233 in 1.1.4 and is already obsolete. Commented out some code that I
4234 believe to never be called.
4235 (runLiterate): don't call updateScrollbar after fitCursor
4237 (buildProgram): ditto
4240 * src/WorkArea.h (workWidth): change return val to unsigned
4243 (redraw): remove the button redraws
4244 (setScrollbarValue): change for scrollbar
4245 (getScrollbarValue): change for scrollbar
4246 (getScrollbarBounds): change for scrollbar
4248 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4249 (C_WorkArea_down_cb): removed func
4250 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4251 (resize): change for scrollbar
4252 (setScrollbar): ditto
4253 (setScrollbarBounds): ditto
4254 (setScrollbarIncrements): ditto
4255 (up_cb): removed func
4256 (down_cb): removed func
4257 (scroll_cb): change for scrollbar
4258 (work_area_handler): ditto
4260 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4261 when FitCursor did something.
4262 (updateScrollbar): some unsigned changes
4263 (downCB): removed func
4264 (scrollUpOnePage): removed func
4265 (scrollDownOnePage): remvoed func
4266 (workAreaMotionNotify): don't call screen->FitCursor but use
4267 fitCursor instead. and bool return val
4268 (workAreaButtonPress): ditto
4269 (workAreaButtonRelease): some unsigned changes
4270 (checkInsetHit): ditto
4271 (workAreaExpose): ditto
4272 (update): parts rewritten, comments about the signed char arg added
4273 (smallUpdate): removed func
4274 (cursorPrevious): call needed updateScrollbar
4277 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4280 * src/BufferView.[Ch] (upCB): removed func
4281 (downCB): removed func
4282 (smallUpdate): removed func
4284 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4286 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4287 currentrow, currentrow_y optimization. This did not help a lot and
4288 if we want to do this kind of optimization we should rather use
4289 cursor.row instead of the currentrow.
4291 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4292 buffer spacing and klyx spacing support.
4294 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4296 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4299 2000-04-26 Juergen Vigna <jug@sad.it>
4301 * src/insets/figinset.C: fixes to Lars sstream changes!
4303 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4305 * A lot of files: Added Ascii(ostream &) methods to all inset
4306 classes. Used when exporting to ASCII.
4308 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4309 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4312 * src/text2.C (ToggleFree): Disabled implicit word selection when
4313 there is a change in the language
4315 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4316 no output was generated for end-of-sentence inset.
4318 * src/insets/lyxinset.h
4321 * src/paragraph.C: Removed the insetnumber code
4323 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4325 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4327 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4328 no_babel and no_epsfig completely from the file.
4329 (parseSingleLyXformat2Token): add handling for per-paragraph
4330 spacing as written by klyx.
4332 * src/insets/figinset.C: applied patch by Andre. Made it work with
4335 2000-04-20 Juergen Vigna <jug@sad.it>
4337 * src/insets/insettext.C (cutSelection):
4338 (copySelection): Fixed with selection from right to left.
4339 (draw): now the rows are not recalculated at every draw.
4340 (computeTextRows): for now reset the inset-owner here (this is
4341 important for an undo or copy where the inset-owner is not set
4344 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4345 motion to the_locking_inset screen->first was forgotten, this was
4346 not important till we got multiline insets.
4348 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4350 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4351 code seems to be alright (it is code changed by Dekel, and the
4352 intent is indeed that all macros should be defined \protect'ed)
4354 * NEWS: a bit of reorganisation of the new user-visible features.
4356 2000-04-19 Juergen Vigna <jug@sad.it>
4358 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4359 position. Set the inset_owner of the used paragraph so that it knows
4360 that it is inside an inset. Fixed cursor handling with mouse and
4361 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4362 and cleanups to make TextInsets work better.
4364 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4365 Changed parameters of various functions and added LockInsetInInset().
4367 * src/insets/insettext.C:
4369 * src/insets/insetcollapsable.h:
4370 * src/insets/insetcollapsable.C:
4371 * src/insets/insetfoot.h:
4372 * src/insets/insetfoot.C:
4373 * src/insets/insetert.h:
4374 * src/insets/insetert.C: cleaned up the code so that it works now
4375 correctly with insettext.
4377 * src/insets/inset.C:
4378 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4379 that insets in insets are supported right.
4382 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4384 * src/paragraph.C: some small fixes
4386 * src/debug.h: inserted INSETS debug info
4388 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4389 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4391 * src/commandtags.h:
4392 * src/LyXAction.C: insert code for InsetTabular.
4394 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4395 not Button1MotionMask.
4396 (workAreaButtonRelease): send always a InsetButtonRelease event to
4398 (checkInsetHit): some setCursor fixes (always with insets).
4400 * src/BufferView2.C (lockInset): returns a bool now and extended for
4401 locking insets inside insets.
4402 (showLockedInsetCursor): it is important to have the cursor always
4403 before the locked inset.
4404 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4406 * src/BufferView.h: made lockInset return a bool.
4408 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4410 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4411 that is used also internally but can be called as public to have back
4412 a cursor pos which is not set internally.
4413 (SetCursorIntern): Changed to use above function.
4415 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4417 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4422 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4423 patches for things that should be in or should be changed.
4425 * src/* [insetfiles]: change "usigned char fragile" to bool
4426 fragile. There was only one point that could that be questioned
4427 and that is commented in formulamacro.C. Grep for "CHECK".
4429 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4430 (DeleteBuffer): take it out of CutAndPaste and make it static.
4432 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4434 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4435 output the spacing envir commands. Also the new commands used in
4436 the LaTeX output makes the result better.
4438 * src/Spacing.C (writeEnvirBegin): new method
4439 (writeEnvirEnd): new method
4441 2000-04-18 Juergen Vigna <jug@sad.it>
4443 * src/CutAndPaste.C: made textclass a static member of the class
4444 as otherwise it is not accesed right!!!
4446 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4448 * forms/layout_forms.fd
4449 * src/layout_forms.h
4450 * src/layout_forms.C (create_form_form_character)
4451 * src/lyx_cb.C (UserFreeFont)
4452 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4453 documents (in the layout->character popup).
4455 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4457 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4458 \spell_command was in fact not honored (from Kevin Atkinson).
4460 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4463 * src/lyx_gui.h: make lyxViews private (Angus)
4465 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4467 * src/mathed/math_write.C
4468 (MathMatrixInset::Write) Put \protect before \begin{array} and
4469 \end{array} if fragile
4470 (MathParInset::Write): Put \protect before \\ if fragile
4472 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4474 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4475 initialization if the LyXColorHandler must be done after the
4476 connections to the XServer has been established.
4478 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4479 get the background pixel from the lyxColorhandler so that the
4480 figures are rendered with the correct background color.
4481 (NextToken): removed functions.
4482 (GetPSSizes): use ifs >> string instead of NextToken.
4484 * src/Painter.[Ch]: the color cache moved out of this file.
4486 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4489 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4491 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4492 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4494 * src/BufferView.C (enterView): new func
4495 (leaveView): new func
4497 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4499 (leaveView): new func, undefines xterm cursor when approp.
4501 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4502 (AllowInput): delete the Workarea cursor handling from this func.
4504 * src/Painter.C (underline): draw a slimer underline in most cases.
4506 * src/lyx_main.C (error_handler): use extern "C"
4508 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4510 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4511 sent directly to me.
4513 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4514 to the list by Dekel.
4516 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4519 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4520 methods from lyx_cb.here.
4522 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4525 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4527 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4528 instead of using current_view directly.
4530 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4532 * src/LyXAction.C (init): add the paragraph-spacing command.
4534 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4536 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4538 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4539 different from the documents.
4541 * src/text.C (SetHeightOfRow): take paragraph spacing into
4542 account, paragraph spacing takes precedence over buffer spacing
4543 (GetVisibleRow): ditto
4545 * src/paragraph.C (writeFile): output the spacing parameter too.
4546 (validate): set the correct features if spacing is used in the
4548 (Clear): set spacing to default
4549 (MakeSameLayout): spacing too
4550 (HasSameLayout): spacing too
4551 (SetLayout): spacing too
4552 (TeXOnePar): output the spacing commands
4554 * src/lyxparagraph.h: added a spacing variable for use with
4555 per-paragraph spacing.
4557 * src/Spacing.h: add a Default spacing and a method to check if
4558 the current spacing is default. also added an operator==
4560 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4563 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4565 * src/lyxserver.C (callback): fix dispatch of functions
4567 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4568 printf() into lyxerr call.
4570 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4573 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4574 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4575 the "Float" from each of the subitems.
4576 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4578 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4579 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4580 documented the change so that the workaround can be nuked later.
4582 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4585 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4587 * src/buffer.C (getLatexName): ditto
4588 (setReadonly): ditto
4590 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4592 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4593 avoid some uses of current_view. Added also a bufferParams()
4594 method to get at this.
4596 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4598 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4600 * src/lyxparagraph.[Ch]: removed
4601 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4602 with operators used by lower_bound and
4603 upper_bound in InsetTable's
4604 Make struct InsetTable private again. Used matchpos.
4606 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4608 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4609 document, the language of existing text is changed (unless the
4610 document is multi-lingual)
4612 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4614 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4616 * A lot of files: A rewrite of the Right-to-Left support.
4618 2000-04-10 Juergen Vigna <jug@sad.it>
4620 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4621 misplaced cursor when inset in inset is locked.
4623 * src/insets/insettext.C (LocalDispatch): small fix so that a
4624 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4626 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4627 footnote font should be decreased in size twice when displaying.
4629 * src/insets/insettext.C (GetDrawFont): inserted this function as
4630 the drawing-font may differ from the real paragraph font.
4632 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4633 insets (inset in inset!).
4635 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4636 function here because we don't want footnotes inside footnotes.
4638 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4640 (init): now set the inset_owner in paragraph.C
4641 (LocalDispatch): added some resetPos() in the right position
4644 (pasteSelection): changed to use the new CutAndPaste-Class.
4646 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4647 which tells if it is allowed to insert another inset inside this one.
4649 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4650 SwitchLayoutsBetweenClasses.
4652 * src/text2.C (InsertInset): checking of the new paragraph-function
4654 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4655 is not needed anymore here!
4658 (PasteSelection): redone (also with #ifdef) so that now this uses
4659 the CutAndPaste-Class.
4660 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4663 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4664 from/to text/insets.
4666 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4667 so that the paragraph knows if it is inside an (text)-inset.
4668 (InsertFromMinibuffer): changed return-value to bool as now it
4669 may happen that an inset is not inserted in the paragraph.
4670 (InsertInsetAllowed): this checks if it is allowed to insert an
4671 inset in this paragraph.
4673 (BreakParagraphConservative):
4674 (BreakParagraph) : small change for the above change of the return
4675 value of InsertFromMinibuffer.
4677 * src/lyxparagraph.h: added inset_owner and the functions to handle
4678 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4680 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4682 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4683 functions from BufferView to BufferView::Pimpl to ease maintence.
4685 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4686 correctly. Also use SetCursorIntern instead of SetCursor.
4688 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4691 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4693 * src/WorkArea.C (belowMouse): manually implement below mouse.
4695 * src/*: Add "explicit" on several constructors, I added probably
4696 some unneeded ones. A couple of changes to code because of this.
4698 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4699 implementation and private parts from the users of BufferView. Not
4702 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4703 implementation and private parts from the users of LyXLex. Not
4706 * src/BufferView_pimpl.[Ch]: new files
4708 * src/lyxlex_pimpl.[Ch]: new files
4710 * src/LyXView.[Ch]: some inline functions move out-of-line
4712 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4714 * src/lyxparagraph.h: make struct InsetTable public.
4716 * src/support/lyxstring.h: change lyxstring::difference_type to be
4717 ptrdiff_t. Add std:: modifiers to streams.
4719 * src/font.C: include the <cctype> header, for islower() and
4722 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4724 * src/font.[Ch]: new files. Contains the metric functions for
4725 fonts, takes a LyXFont as parameter. Better separation of concepts.
4727 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4728 changes because of this.
4730 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4732 * src/*: compile with -Winline and move functions that don't
4735 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4738 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4740 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4741 (various files changed because of this)
4743 * src/Painter.C (text): fixed the drawing of smallcaps.
4745 * src/lyxfont.[Ch] (drawText): removed unused member func.
4748 * src/*.C: added needed "using" statements and "std::" qualifiers.
4750 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4752 * src/*.h: removed all use of "using" from header files use
4753 qualifier std:: instead.
4755 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4757 * src/text.C (Backspace): some additional cleanups (we already
4758 know whether cursor.pos is 0 or not).
4760 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4761 automake does not provide one).
4763 * src/bmtable.h: replace C++ comments with C comments.
4765 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4767 * src/screen.C (ShowCursor): Change the shape of the cursor if
4768 the current language is not equal to the language of the document.
4769 (If the cursor change its shape unexpectedly, then you've found a bug)
4771 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4774 * src/insets/insetnumber.[Ch]: New files.
4776 * src/LyXAction.C (init)
4777 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4780 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4782 * src/lyxparagraph.h
4783 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4784 (the vector is kept sorted).
4786 * src/text.C (GetVisibleRow): Draw selection correctly when there
4787 is both LTR and RTL text.
4789 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4790 which is much faster.
4792 * src/text.C (GetVisibleRow and other): Do not draw the last space
4793 in a row if the direction of the last letter is not equal to the
4794 direction of the paragraph.
4796 * src/lyxfont.C (latexWriteStartChanges):
4797 Check that font language is not equal to basefont language.
4798 (latexWriteEndChanges): ditto
4800 * src/lyx_cb.C (StyleReset): Don't change the language while using
4801 the font-default command.
4803 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4804 empty paragraph before a footnote.
4806 * src/insets/insetcommand.C (draw): Increase x correctly.
4808 * src/screen.C (ShowCursor): Change cursor shape if
4809 current language != document language.
4811 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4813 2000-03-31 Juergen Vigna <jug@sad.it>
4815 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4816 (Clone): changed mode how the paragraph-data is copied to the
4817 new clone-paragraph.
4819 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4820 GetInset(pos) with no inset anymore there (in inset UNDO)
4822 * src/insets/insetcommand.C (draw): small fix as here x is
4823 incremented not as much as width() returns (2 before, 2 behind = 4)
4825 2000-03-30 Juergen Vigna <jug@sad.it>
4827 * src/insets/insettext.C (InsetText): small fix in initialize
4828 widthOffset (should not be done in the init() function)
4830 2000-03-29 Amir Karger <karger@lyx.org>
4832 * lib/examples/it_ItemizeBullets.lyx: translation by
4835 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4837 2000-03-29 Juergen Vigna <jug@sad.it>
4839 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4841 * src/insets/insetfoot.C (Clone): small change as for the below
4842 new init function in the text-inset
4844 * src/insets/insettext.C (init): new function as I've seen that
4845 clone did not copy the Paragraph-Data!
4846 (LocalDispatch): Added code so that now we have some sort of Undo
4847 functionality (well actually we HAVE Undo ;)
4849 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4851 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4853 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4856 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4858 * src/main.C: added a runtime check that verifies that the xforms
4859 header used when building LyX and the library used when running
4860 LyX match. Exit with a message if they don't match. This is a
4861 version number check only.
4863 * src/buffer.C (save): Don't allocate memory on the heap for
4864 struct utimbuf times.
4866 * *: some using changes, use iosfwd instead of the real headers.
4868 * src/lyxfont.C use char const * instead of string for the static
4869 strings. Rewrite some functions to use sstream.
4871 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4873 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4876 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4878 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4879 of Geodesy (from Martin Vermeer)
4881 * lib/layouts/svjour.inc: include file for the Springer svjour
4882 class. It can be used to support journals other than JoG.
4884 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4885 Miskiewicz <misiek@pld.org.pl>)
4886 * lib/reLyX/Makefile.am: ditto.
4888 2000-03-27 Juergen Vigna <jug@sad.it>
4890 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4891 also some modifications with operations on selected text.
4893 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4894 problems with clicking on insets (last famous words ;)
4896 * src/insets/insetcommand.C (draw):
4897 (width): Changed to have a bit of space before and after the inset so
4898 that the blinking cursor can be seen (otherwise it was hidden)
4900 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4902 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4903 would not be added to the link list when an installed gettext (not
4904 part of libc) is found.
4906 2000-03-24 Juergen Vigna <jug@sad.it>
4908 * src/insets/insetcollapsable.C (Edit):
4909 * src/mathed/formula.C (InsetButtonRelease):
4910 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4913 * src/BufferView.C (workAreaButtonPress):
4914 (workAreaButtonRelease):
4915 (checkInsetHit): Finally fixed the clicking on insets be handled
4918 * src/insets/insetert.C (Edit): inserted this call so that ERT
4919 insets work always with LaTeX-font
4921 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4923 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4924 caused lyx to startup with no GUI in place, causing in a crash
4925 upon startup when called with arguments.
4927 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4929 * src/FontLoader.C: better initialization of dummyXFontStruct.
4931 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4933 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4934 for linuxdoc and docbook import and export format options.
4936 * lib/lyxrc.example Example of default values for the previous flags.
4938 * src/lyx_cb.C Use those flags instead of the hardwired values for
4939 linuxdoc and docbook export.
4941 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4944 * src/menus.C Added menus entries for the new import/exports formats.
4946 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4948 * src/lyxrc.*: Added support for running without Gui
4951 * src/FontLoader.C: sensible defaults if no fonts are needed
4953 * src/lyx_cb.C: New function ShowMessage (writes either to the
4954 minibuffer or cout in case of no gui
4955 New function AskOverwrite for common stuff
4956 Consequently various changes to call these functions
4958 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4959 wild guess at sensible screen resolution when having no gui
4961 * src/lyxfont.C: no gui, no fonts... set some defaults
4963 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4965 * src/LColor.C: made the command inset background a bit lighter.
4967 2000-03-20 Hartmut Goebel <goebel@noris.net>
4969 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4970 stdstruct.inc. Koma-Script added some title elements which
4971 otherwise have been listed below "bibliography". This split allows
4972 adding title elements to where they belong.
4974 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4975 define the additional tilte elements and then include
4978 * many other layout files: changed to include stdtitle.inc just
4979 before stdstruct.inc.
4981 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4983 * src/buffer.C: (save) Added the option to store all backup files
4984 in a single directory
4986 * src/lyxrc.[Ch]: Added variable \backupdir_path
4988 * lib/lyxrc.example: Added descriptions of recently added variables
4990 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4991 bibtex inset, not closing the bibtex popup when deleting the inset)
4993 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4995 * src/lyx_cb.C: add a couple using directives.
4997 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4998 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4999 import based on the filename.
5001 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5002 file would be imported at start, if the filename where of a sgml file.
5004 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5006 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5008 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5009 * src/lyxfont.h Replaced the member variable bits.direction by the
5010 member variable lang. Made many changes in other files.
5011 This allows having a multi-lingual document
5013 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5014 that change the current language to <l>.
5015 Removed the command "font-rtl"
5017 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5018 format for Hebrew documents)
5020 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5021 When auto_mathmode is "true", pressing a digit key in normal mode
5022 will cause entering into mathmode.
5023 If auto_mathmode is "rtl" then this behavior will be active only
5024 when writing right-to-left text.
5026 * src/text2.C (InsertStringA) The string is inserted using the
5029 * src/paragraph.C (GetEndLabel) Gives a correct result for
5030 footnote paragraphs.
5032 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5034 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5036 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5037 front of PasteParagraph. Never insert a ' '. This should at least
5038 fix some cause for the segfaults that we have been experiencing,
5039 it also fixes backspace behaviour slightly. (Phu!)
5041 * src/support/lstrings.C (compare_no_case): some change to make it
5042 compile with gcc 2.95.2 and stdlibc++-v3
5044 * src/text2.C (MeltFootnoteEnvironment): change type o
5045 first_footnote_par_is_not_empty to bool.
5047 * src/lyxparagraph.h: make text private. Changes in other files
5049 (fitToSize): new function
5050 (setContentsFromPar): new function
5051 (clearContents): new function
5052 (SetChar): new function
5054 * src/paragraph.C (readSimpleWholeFile): deleted.
5056 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5057 the file, just use a simple string instead. Also read the file in
5058 a more maintainable manner.
5060 * src/text2.C (InsertStringA): deleted.
5061 (InsertStringB): deleted.
5063 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5065 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5066 RedoParagraphs from the doublespace handling part, just set status
5067 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5068 done, but perhaps not like this.)
5070 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5072 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5073 character when inserting an inset.
5075 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5077 * src/bufferparams.C (readLanguage): now takes "default" into
5080 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5081 also initialize the toplevel_keymap with the default bindings from
5084 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5086 * all files using lyxrc: have lyxrc as a real variable and not a
5087 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5090 * src/lyxrc.C: remove double call to defaultKeyBindings
5092 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5093 toolbar defauls using lyxlex. Remove enums, structs, functions
5096 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5097 toolbar defaults. Also store default keybindings in a map.
5099 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5100 storing the toolbar defaults without any xforms dependencies.
5102 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5103 applied. Changed to use iterators.
5105 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5107 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5108 systems that don't have LINGUAS set to begin with.
5110 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5112 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5113 the list by Dekel Tsur.
5115 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5117 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5118 * src/insets/form_graphics.C: ditto.
5120 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5122 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5124 * src/bufferparams.C (readLanguage): use the new language map
5126 * src/intl.C (InitKeyMapper): use the new language map
5128 * src/lyx_gui.C (create_forms): use the new language map
5130 * src/language.[Ch]: New files. Used for holding the information
5131 about each language. Now! Use this new language map enhance it and
5132 make it really usable for our needs.
5134 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5136 * screen.C (ShowCursor): Removed duplicate code.
5137 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5138 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5140 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5143 * src/text.C Added TransformChar method. Used for rendering Arabic
5144 text correctly (change the glyphs of the letter according to the
5145 position in the word)
5150 * src/lyxrc.C Added lyxrc command {language_command_begin,
5151 language_command_end,language_command_ltr,language_command_rtl,
5152 language_package} which allows the use of either arabtex or Omega
5155 * src/lyx_gui.C (init)
5157 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5158 to use encoding for menu fonts which is different than the encoding
5161 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5162 do not load the babel package.
5163 To write an English document with Hebrew/Arabic, change the document
5164 language to "english".
5166 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5167 (alphaCounter): changed to return char
5168 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5170 * lib/lyxrc.example Added examples for Hebrew/Arabic
5173 * src/layout.C Added layout command endlabeltype
5175 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5177 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5179 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5181 * src/mathed/math_delim.C (search_deco): return a
5182 math_deco_struct* instead of index.
5184 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5186 * All files with a USE_OSTREAM_ONLY within: removed all code that
5187 was unused when USE_OSTREAM_ONLY is defined.
5189 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5190 of any less. Removed header and using.
5192 * src/text.C (GetVisibleRow): draw the string "Page Break
5193 (top/bottom)" on screen when drawing a pagebreak line.
5195 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5197 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5199 * src/mathed/math_macro.C (draw): do some cast magic.
5202 * src/mathed/math_defs.h: change byte* argument to byte const*.
5204 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5206 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5207 know it is right to return InsetFoot* too, but cxx does not like
5210 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5212 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5214 * src/mathed/math_delim.C: change == to proper assignment.
5216 2000-03-09 Juergen Vigna <jug@sad.it>
5218 * src/insets/insettext.C (setPos): fixed various cursor positioning
5219 problems (via mouse and cursor-keys)
5220 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5221 inset (still a small display problem but it works ;)
5223 * src/insets/insetcollapsable.C (draw): added button_top_y and
5224 button_bottom_y to have correct values for clicking on the inset.
5226 * src/support/lyxalgo.h: commented out 'using std::less'
5228 2000-03-08 Juergen Vigna <jug@sad.it>
5230 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5231 Button-Release event closes as it is alos the Release-Event
5234 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5236 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5238 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5239 can add multiple spaces in Scrap (literate programming) styles...
5240 which, by the way, is how I got hooked on LyX to begin with.
5242 * src/mathed/formula.C (Write): Added dummy variable to an
5243 inset::Latex() call.
5244 (Latex): Add free_spacing boolean to inset::Latex()
5246 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5248 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5249 virtual function to include the free_spacing boolean from
5250 the containing paragraph's style.
5252 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5253 Added free_spacing boolean arg to match inset.h
5255 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5256 Added free_spacing boolean arg to match inset.h
5258 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5259 Added free_spacing boolean and made sure that if in a free_spacing
5260 paragraph, that we output normal space if there is a protected space.
5262 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5263 Added free_spacing boolean arg to match inset.h
5265 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5266 Added free_spacing boolean arg to match inset.h
5268 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5269 Added free_spacing boolean arg to match inset.h
5271 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5272 Added free_spacing boolean arg to match inset.h
5274 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5275 Added free_spacing boolean arg to match inset.h
5277 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5278 free_spacing boolean arg to match inset.h
5280 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5281 Added free_spacing boolean arg to match inset.h
5283 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5284 Added free_spacing boolean arg to match inset.h
5286 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5287 Added free_spacing boolean arg to match inset.h
5289 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5290 Added free_spacing boolean arg to match inset.h
5292 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5293 Added free_spacing boolean arg to match inset.h
5295 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5296 free_spacing boolean arg to match inset.h
5298 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5299 free_spacing boolean arg to match inset.h
5301 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5302 ignore free_spacing paragraphs. The user's spaces are left
5305 * src/text.C (InsertChar): Fixed the free_spacing layout
5306 attribute behavior. Now, if free_spacing is set, you can
5307 add multiple spaces in a paragraph with impunity (and they
5308 get output verbatim).
5309 (SelectSelectedWord): Added dummy argument to inset::Latex()
5312 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5315 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5316 paragraph layouts now only input a simple space instead.
5317 Special character insets don't make any sense in free-spacing
5320 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5321 hard-spaces in the *input* file to simple spaces if the layout
5322 is free-spacing. This converts old files which had to have
5323 hard-spaces in free-spacing layouts where a simple space was
5325 (writeFileAscii): Added free_spacing check to pass to the newly
5326 reworked inset::Latex(...) methods. The inset::Latex() code
5327 ensures that hard-spaces in free-spacing paragraphs get output
5328 as spaces (rather than "~").
5330 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5332 * src/mathed/math_delim.C (draw): draw the empty placeholder
5333 delims with a onoffdash line.
5334 (struct math_deco_compare): struct that holds the "functors" used
5335 for the sort and the binary search in math_deco_table.
5336 (class init_deco_table): class used for initial sort of the
5338 (search_deco): use lower_bound to do a binary search in the
5341 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5343 * src/lyxrc.C: a small secret thingie...
5345 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5346 and to not flush the stream as often as it used to.
5348 * src/support/lyxalgo.h: new file
5349 (sorted): template function used for checking if a sequence is
5350 sorted or not. Two versions with and without user supplied
5351 compare. Uses same compare as std::sort.
5353 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5354 it and give warning on lyxerr.
5356 (struct compare_tags): struct with function operators used for
5357 checking if sorted, sorting and lower_bound.
5358 (search_kw): use lower_bound instead of manually implemented
5361 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5363 * src/insets/insetcollapsable.h: fix Clone() declaration.
5364 * src/insets/insetfoot.h: ditto.
5366 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5368 2000-03-08 Juergen Vigna <jug@sad.it>
5370 * src/insets/lyxinset.h: added owner call which tells us if
5371 this inset is inside another inset. Changed also the return-type
5372 of Editable to an enum so it tells clearer what the return-value is.
5374 * src/insets/insettext.C (computeTextRows): fixed computing of
5375 textinsets which split automatically on more rows.
5377 * src/insets/insetert.[Ch]: changed this to be of BaseType
5380 * src/insets/insetfoot.[Ch]: added footnote inset
5382 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5383 collapsable insets (like footnote, ert, ...)
5385 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5387 * src/lyxdraw.h: remvoe file
5389 * src/lyxdraw.C: remove file
5391 * src/insets/insettext.C: added <algorithm>.
5393 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5395 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5396 (matrix_cb): case MM_OK use string stream
5398 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5401 * src/mathed/math_macro.C (draw): use string stream
5402 (Metrics): use string stream
5404 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5405 directly to the ostream.
5407 * src/vspace.C (asString): use string stream.
5408 (asString): use string stream
5409 (asLatexString): use string stream
5411 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5412 setting Spacing::Other.
5414 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5415 sprintf when creating the stretch vale.
5417 * src/text2.C (alphaCounter): changed to return a string and to
5418 not use a static variable internally. Also fixed a one-off bug.
5419 (SetCounter): changed the drawing of the labels to use string
5420 streams instead of sprintf.
5422 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5423 manipulator to use a scheme that does not require library support.
5424 This is also the way it is done in the new GNU libstdc++. Should
5425 work with DEC cxx now.
5427 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5429 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5430 end. This fixes a bug.
5432 * src/mathed (all files concerned with file writing): apply the
5433 USE_OSTREAM_ONLY changes to mathed too.
5435 * src/support/DebugStream.h: make the constructor explicit.
5437 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5438 count and ostream squashed.
5440 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5442 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5444 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5445 ostringstream uses STL strings, and we might not.
5447 * src/insets/insetspecialchar.C: add using directive.
5448 * src/insets/insettext.C: ditto.
5450 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5452 * lib/layouts/seminar.layout: feeble attempt at a layout for
5453 seminar.cls, far from completet and could really use some looking
5454 at from people used to write layout files.
5456 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5457 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5458 a lot nicer and works nicely with ostreams.
5460 * src/mathed/formula.C (draw): a slightly different solution that
5461 the one posted to the list, but I think this one works too. (font
5462 size wrong in headers.)
5464 * src/insets/insettext.C (computeTextRows): some fiddling on
5465 Jürgens turf, added some comments that he should read.
5467 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5468 used and it gave compiler warnings.
5469 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5472 * src/lyx_gui.C (create_forms): do the right thing when
5473 show_banner is true/false.
5475 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5476 show_banner is false.
5478 * most file writing files: Now use iostreams to do almost all of
5479 the writing. Also instead of passing string &, we now use
5480 stringstreams. mathed output is still not adapted to iostreams.
5481 This change can be turned off by commenting out all the occurences
5482 of the "#define USE_OSTREAM_ONLY 1" lines.
5484 * src/WorkArea.C (createPixmap): don't output debug messages.
5485 (WorkArea): don't output debug messages.
5487 * lib/lyxrc.example: added a comment about the new variable
5490 * development/Code_rules/Rules: Added some more commente about how
5491 to build class interfaces and on how better encapsulation can be
5494 2000-03-03 Juergen Vigna <jug@sad.it>
5496 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5497 automatically with the width of the LyX-Window
5499 * src/insets/insettext.C (computeTextRows): fixed update bug in
5500 displaying text-insets (scrollvalues where not initialized!)
5502 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5504 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5505 id in the check of the result from lower_bound is not enough since
5506 lower_bound can return last too, and then res->id will not be a
5509 * all insets and some code that use them: I have conditionalized
5510 removed the Latex(string & out, ...) this means that only the
5511 Latex(ostream &, ...) will be used. This is a work in progress to
5512 move towards using streams for all output of files.
5514 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5517 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5519 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5520 routine (this fixes bug where greek letters were surrounded by too
5523 * src/support/filetools.C (findtexfile): change a bit the search
5524 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5525 no longer passed to kpsewhich, we may have to change that later.
5527 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5528 warning options to avoid problems with X header files (from Angus
5530 * acinclude.m4: regenerated.
5532 2000-03-02 Juergen Vigna <jug@sad.it>
5534 * src/insets/insettext.C (WriteParagraphData): Using the
5535 par->writeFile() function for writing paragraph-data.
5536 (Read): Using buffer->parseSingleLyXformat2Token()-function
5537 for parsing paragraph data!
5539 * src/buffer.C (readLyXformat2): removed all parse data and using
5540 the new parseSingleLyXformat2Token()-function.
5541 (parseSingleLyXformat2Token): added this function to parse (read)
5542 lyx-file-format (this is called also from text-insets now!)
5544 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5546 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5549 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5550 directly instead of going through a func. One very bad thing: a
5551 static LyXFindReplace, but I don't know where to place it.
5553 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5554 string instead of char[]. Also changed to static.
5555 (GetSelectionOrWordAtCursor): changed to static inline
5556 (SetSelectionOverLenChars): ditto.
5558 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5559 current_view and global variables. both classes has changed names
5560 and LyXFindReplace is not inherited from SearchForm.
5562 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5563 fl_form_search form.
5565 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5567 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5569 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5570 bound (from Kayvan).
5572 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5574 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5576 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5578 * some things that I should comment but the local pub says head to
5581 * comment out all code that belongs to the Roff code for Ascii
5582 export of tables. (this is unused)
5584 * src/LyXView.C: use correct type for global variable
5585 current_layout. (LyXTextClass::size_type)
5587 * some code to get the new insetgraphics closer to working I'd be
5588 grateful for any help.
5590 * src/BufferView2.C (insertInset): use the return type of
5591 NumberOfLayout properly. (also changes in other files)
5593 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5594 this as a test. I want to know what breaks because of this.
5596 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5598 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5600 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5601 to use a \makebox in the label, this allows proper justification
5602 with out using protected spaces or multiple hfills. Now it is
5603 "label" for left justified, "\hfill label\hfill" for center, and
5604 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5605 should be changed accordingly.
5607 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5609 * src/lyxtext.h: change SetLayout() to take a
5610 LyXTextClass::size_type instead of a char (when there is more than
5611 127 layouts in a class); also change type of copylayouttype.
5612 * src/text2.C (SetLayout): ditto.
5613 * src/LyXView.C (updateLayoutChoice): ditto.
5615 * src/LaTeX.C (scanLogFile): errors where the line number was not
5616 given just after the '!'-line were ignored (from Dekel Tsur).
5618 * lib/lyxrc.example: fix description of \date_insert_format
5620 * lib/layouts/llncs.layout: new layout, contributed by Martin
5623 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5625 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5626 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5627 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5628 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5629 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5630 paragraph.C, text.C, text2.C)
5632 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5634 * src/insets/insettext.C (LocalDispatch): remove extra break
5637 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5638 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5640 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5641 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5643 * src/insets/insetbib.h: move InsetBibkey::Holder and
5644 InsetCitation::Holder in public space.
5646 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5648 * src/insets/insettext.h: small change to get the new files from
5649 Juergen to compile (use "string", not "class string").
5651 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5652 const & as parameter to LocalDispatch, use LyXFont const & as
5653 paramter to some other func. This also had impacto on lyxinsets.h
5654 and the two mathed insets.
5656 2000-02-24 Juergen Vigna <jug@sad.it>
5659 * src/commandtags.h:
5661 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5665 * src/BufferView2.C: added/updated code for various inset-functions
5667 * src/insets/insetert.[Ch]: added implementation of InsetERT
5669 * src/insets/insettext.[Ch]: added implementation of InsetText
5671 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5672 (draw): added preliminary code for inset scrolling not finshed yet
5674 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5675 as it is in lyxfunc.C now
5677 * src/insets/lyxinset.h: Added functions for text-insets
5679 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5681 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5682 BufferView and reimplement the list as a queue put inside its own
5685 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5687 * several files: use the new interface to the "updateinsetlist"
5689 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5691 (work_area_handler): call BufferView::trippleClick on trippleclick.
5693 * src/BufferView.C (doubleClick): new function, selects word on
5695 (trippleClick): new function, selects line on trippleclick.
5697 2000-02-22 Allan Rae <rae@lyx.org>
5699 * lib/bind/xemacs.bind: buffer-previous not supported
5701 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5703 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5706 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5708 * src/bufferlist.C: get rid of current_view from this file
5710 * src/spellchecker.C: get rid of current_view from this file
5712 * src/vspace.C: get rid of current_view from this file
5713 (inPixels): added BufferView parameter for this func
5714 (asLatexCommand): added a BufferParams for this func
5716 * src/text.C src/text2.C: get rid of current_view from these
5719 * src/lyxfont.C (getFontDirection): move this function here from
5722 * src/bufferparams.C (getDocumentDirection): move this function
5725 * src/paragraph.C (getParDirection): move this function here from
5727 (getLetterDirection): ditto
5729 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5731 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5732 resize due to wrong pixmap beeing used. Also took the opurtunity
5733 to make the LyXScreen stateless on regard to WorkArea and some
5734 general cleanup in the same files.
5736 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5738 * src/Makefile.am: add missing direction.h
5740 * src/PainterBase.h: made the width functions const.
5742 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5745 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5747 * src/insets/insetlatexaccent.C (draw): make the accents draw
5748 better, at present this will only work well with iso8859-1.
5750 * several files: remove the old drawing code, now we use the new
5753 * several files: remove support for mono_video, reverse_video and
5756 2000-02-17 Juergen Vigna <jug@sad.it>
5758 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5759 int ** as we have to return the pointer, otherwise we have only
5760 NULL pointers in the returning function.
5762 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5764 * src/LaTeX.C (operator()): quote file name when running latex.
5766 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5768 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5769 (bubble tip), this removes our special handling of this.
5771 * Remove all code that is unused now that we have the new
5772 workarea. (Code that are not active when NEW_WA is defined.)
5774 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5776 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5778 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5779 nonexisting layout; correctly redirect obsoleted layouts.
5781 * lib/lyxrc.example: document \view_dvi_paper_option
5783 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5786 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5787 (PreviewDVI): handle the view_dvi_paper_option variable.
5788 [Both from Roland Krause]
5790 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5792 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5793 char const *, int, LyXFont)
5794 (text(int, int, string, LyXFont)): ditto
5796 * src/text.C (InsertCharInTable): attempt to fix the double-space
5797 feature in tables too.
5798 (BackspaceInTable): ditto.
5799 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5801 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5803 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5805 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5806 newly found text in textcache to this.
5807 (buffer): set the owner of the text put into the textcache to 0
5809 * src/insets/figinset.C (draw): fixed the drawing of figures with
5812 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5813 drawing of mathframe, hfills, protected space, table lines. I have
5814 now no outstanding drawing problems with the new Painter code.
5816 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5818 * src/PainterBase.C (ellipse, circle): do not specify the default
5821 * src/LColor.h: add using directive.
5823 * src/Painter.[Ch]: change return type of methods from Painter& to
5824 PainterBase&. Add a using directive.
5826 * src/WorkArea.C: wrap xforms callbacks in C functions
5829 * lib/layouts/foils.layout: font fix and simplifications from Carl
5832 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5834 * a lot of files: The Painter, LColor and WorkArea from the old
5835 devel branch has been ported to lyx-devel. Some new files and a
5836 lot of #ifdeffed code. The new workarea is enabled by default, but
5837 if you want to test the new Painter and LColor you have to compile
5838 with USE_PAINTER defined (do this in config.h f.ex.) There are
5839 still some rought edges, and I'd like some help to clear those
5840 out. It looks stable (loads and displays the Userguide very well).
5843 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5845 * src/buffer.C (pop_tag): revert to the previous implementation
5846 (use a global variable for both loops).
5848 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5850 * src/lyxrc.C (LyXRC): change slightly default date format.
5852 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5853 there is an English text with a footnote that starts with a Hebrew
5854 paragraph, or vice versa.
5855 (TeXFootnote): ditto.
5857 * src/text.C (LeftMargin): allow for negative values for
5858 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5861 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5862 for input encoding (cyrillic)
5864 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5866 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5869 * src/toolbar.C (set): ditto
5870 * src/insets/insetbib.C (create_form_citation_form): ditto
5872 * lib/CREDITS: added Dekel Tsur.
5874 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5875 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5876 hebrew supports files from Dekel Tsur.
5878 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5879 <tzafrir@technion.ac.il>
5881 * src/lyxrc.C: put \date_insert_format at the right place.
5883 * src/buffer.C (makeLaTeXFile): fix the handling of
5884 BufferParams::sides when writing out latex files.
5886 * src/BufferView2.C: add a "using" directive.
5888 * src/support/lyxsum.C (sum): when we use lyxstring,
5889 ostringstream::str needs an additional .c_str().
5891 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5893 * src/support/filetools.C (ChangeExtension): patch from Etienne
5896 * src/TextCache.C (show): remove const_cast and make second
5897 parameter non-const LyXText *.
5899 * src/TextCache.h: use non const LyXText in show.
5901 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5904 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5906 * src/support/lyxsum.C: rework to be more flexible.
5908 * several places: don't check if a pointer is 0 if you are going
5911 * src/text.C: remove some dead code.
5913 * src/insets/figinset.C: remove some dead code
5915 * src/buffer.C: move the BufferView funcs to BufferView2.C
5916 remove all support for insetlatexdel
5917 remove support for oldpapersize stuff
5918 made some member funcs const
5920 * src/kbmap.C: use a std::list to store the bindings in.
5922 * src/BufferView2.C: new file
5924 * src/kbsequence.[Ch]: new files
5926 * src/LyXAction.C + others: remove all trace of buffer-previous
5928 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5929 only have one copy in the binary of this table.
5931 * hebrew patch: moved some functions from LyXText to more
5932 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5934 * several files: remove support for XForms older than 0.88
5936 remove some #if 0 #endif code
5938 * src/TextCache.[Ch]: new file. Holds the textcache.
5940 * src/BufferView.C: changes to use the new TextCache interface.
5941 (waitForX): remove the now unused code.
5943 * src/BackStack.h: remove some commented code
5945 * lib/bind/emacs.bind: remove binding for buffer-previous
5947 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5949 * applied the hebrew patch.
5951 * src/lyxrow.h: make sure that all Row variables are initialized.
5953 * src/text2.C (TextHandleUndo): comment out a delete, this might
5954 introduce a memory leak, but should also help us to not try to
5955 read freed memory. We need to look at this one.
5957 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5958 (LyXParagraph): initalize footnotekind.
5960 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5961 forgot this when applying the patch. Please heed the warnings.
5963 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5964 (aka. reformat problem)
5966 * src/bufferlist.C (exists): made const, and use const_iterator
5967 (isLoaded): new func.
5968 (release): use std::find to find the correct buffer.
5970 * src/bufferlist.h: made getState a const func.
5971 made empty a const func.
5972 made exists a const func.
5975 2000-02-01 Juergen Vigna <jug@sad.it>
5977 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5979 * po/it.po: updated a bit the italian po file and also changed the
5980 'file nuovo' for newfile to 'filenuovo' without a space, this did
5983 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5984 for the new insert_date command.
5986 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5987 from jdblair, to insert a date into the current text conforming to
5988 a strftime format (for now only considering the locale-set and not
5989 the document-language).
5991 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5993 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5994 Bounds Read error seen by purify. The problem was that islower is
5995 a macros which takes an unsigned char and uses it as an index for
5996 in array of characters properties (and is thus subject to the
6000 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6001 correctly the paper sides radio buttons.
6002 (UpdateDocumentButtons): ditto.
6004 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6006 * src/kbmap.C (getsym + others): change to return unsigned int,
6007 returning a long can give problems on 64 bit systems. (I assume
6008 that int is 32bit on 64bit systems)
6010 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6012 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6013 LyXLookupString to be zero-terminated. Really fixes problems seen
6016 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6018 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6019 write a (char*)0 to the lyxerr stream.
6021 * src/lastfiles.C: move algorithm before the using statemets.
6023 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6025 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6026 complains otherwise).
6027 * src/table.C: ditto
6029 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6032 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6033 that I removed earlier... It is really needed.
6035 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6037 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6039 * INSTALL: update xforms home page URL.
6041 * lib/configure.m4: fix a bug with unreadable layout files.
6043 * src/table.C (calculate_width_of_column): add "using std::max"
6046 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6048 * several files: marked several lines with "DEL LINE", this is
6049 lines that can be deleted without changing anything.
6050 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6051 checks this anyway */
6054 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6056 * src/DepTable.C (update): add a "+" at the end when the checksum
6057 is different. (debugging string only)
6059 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6060 the next inset to not be displayed. This should also fix the list
6061 of labels in the "Insert Crossreference" dialog.
6063 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6065 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6066 when regex was not found.
6068 * src/support/lstrings.C (lowercase): use handcoded transform always.
6071 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6072 old_cursor.par->prev could be 0.
6074 * several files: changed post inc/dec to pre inc/dec
6076 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6077 write the lastfiles to file.
6079 * src/BufferView.C (buffer): only show TextCache info when debugging
6081 (resizeCurrentBuffer): ditto
6082 (workAreaExpose): ditto
6084 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6086 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6088 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6089 a bit better by removing the special case for \i and \j.
6091 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6093 * src/lyx_main.C (easyParse): remove test for bad comand line
6094 options, since this broke all xforms-related parsing.
6096 * src/kbmap.C (getsym): set return type to unsigned long, as
6097 declared in header. On an alpha, long is _not_ the same as int.
6099 * src/support/LOstream.h: add a "using std::flush;"
6101 * src/insets/figinset.C: ditto.
6103 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6105 * src/bufferlist.C (write): use blinding fast file copy instead of
6106 "a char at a time", now we are doing it the C++ way.
6108 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6109 std::list<int> instead.
6110 (addpidwait): reflect move to std::list<int>
6111 (sigchldchecker): ditto
6113 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6116 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6117 that obviously was wrong...
6119 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6120 c, this avoids warnings with purify and islower.
6122 * src/insets/figinset.C: rename struct queue to struct
6123 queue_element and rewrite to use a std::queue. gsqueue is now a
6124 std::queue<queue_element>
6125 (runqueue): reflect move to std::queue
6128 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6129 we would get "1" "0" instead of "true" "false. Also make the tostr
6132 2000-01-21 Juergen Vigna <jug@sad.it>
6134 * src/buffer.C (writeFileAscii): Disabled code for special groff
6135 handling of tabulars till I fix this in table.C
6137 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6139 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6141 * src/support/lyxlib.h: ditto.
6143 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6145 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6146 and 'j' look better. This might fix the "macron" bug that has been
6149 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6150 functions as one template function. Delete the old versions.
6152 * src/support/lyxsum.C: move using std::ifstream inside
6155 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6158 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6160 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6162 * src/insets/figinset.C (InitFigures): use new instead of malloc
6163 to allocate memory for figures and bitmaps.
6164 (DoneFigures): use delete[] instead of free to deallocate memory
6165 for figures and bitmaps.
6166 (runqueue): use new to allocate
6167 (getfigdata): use new/delete[] instead of malloc/free
6168 (RegisterFigure): ditto
6170 * some files: moved some declarations closer to first use, small
6171 whitespace changes use preincrement instead of postincrement where
6172 it does not make a difference.
6174 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6175 step on the way to use stl::containers for key maps.
6177 * src/bufferlist.h: add a typedef for const_iterator and const
6178 versions of begin and end.
6180 * src/bufferlist.[Ch]: change name of member variable _state to
6181 state_. (avoid reserved names)
6183 (getFileNames): returns the filenames of the buffers in a vector.
6185 * configure.in (ALL_LINGUAS): added ro
6187 * src/support/putenv.C: new file
6189 * src/support/mkdir.C: new file
6191 2000-01-20 Allan Rae <rae@lyx.org>
6193 * lib/layouts/IEEEtran.layout: Added several theorem environments
6195 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6196 couple of minor additions.
6198 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6199 (except for those in footnotes of course)
6201 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6203 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6205 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6206 std::sort and std::lower_bound instead of qsort and handwritten
6208 (struct compara): struct that holds the functors used by std::sort
6209 and std::lower_bound in MathedLookupBOP.
6211 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6213 * src/support/LAssert.h: do not do partial specialization. We do
6216 * src/support/lyxlib.h: note that lyx::getUserName() and
6217 lyx::date() are not in use right now. Should these be suppressed?
6219 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6220 (makeLinuxDocFile): do not put date and user name in linuxdoc
6223 * src/support/lyxlib.h (kill): change first argument to long int,
6224 since that's what solaris uses.
6226 * src/support/kill.C (kill): fix declaration to match prototype.
6228 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6229 actually check whether namespaces are supported. This is not what
6232 * src/support/lyxsum.C: add a using directive.
6234 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6236 * src/support/kill.C: if we have namespace support we don't have
6237 to include lyxlib.h.
6239 * src/support/lyxlib.h: use namespace lyx if supported.
6241 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6243 * src/support/date.C: new file
6245 * src/support/chdir.C: new file
6247 * src/support/getUserName.C: new file
6249 * src/support/getcwd.C: new file
6251 * src/support/abort.C: new file
6253 * src/support/kill.C: new file
6255 * src/support/lyxlib.h: moved all the functions in this file
6256 insede struct lyx. Added also kill and abort to this struct. This
6257 is a way to avoid the "kill is not defined in <csignal>", we make
6258 C++ wrappers for functions that are not ANSI C or ANSI C++.
6260 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6261 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6262 lyx it has been renamed to sum.
6264 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6266 * src/text.C: add using directives for std::min and std::max.
6268 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6270 * src/texrow.C (getIdFromRow): actually return something useful in
6271 id and pos. Hopefully fixes the bug with positionning of errorbox
6274 * src/lyx_main.C (easyParse): output an error and exit if an
6275 incorrect command line option has been given.
6277 * src/spellchecker.C (ispell_check_word): document a memory leak.
6279 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6280 where a "struct utimbuf" is allocated with "new" and deleted with
6283 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6285 * src/text2.C (CutSelection): don't delete double spaces.
6286 (PasteSelection): ditto
6287 (CopySelection): ditto
6289 * src/text.C (Backspace): don't delete double spaces.
6291 * src/lyxlex.C (next): fix a bug that were only present with
6292 conformant std::istream::get to read comment lines, use
6293 std::istream::getline instead. This seems to fix the problem.
6295 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6297 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6298 allowed to insert space before space" editing problem. Please read
6299 commends at the beginning of the function. Comments about usage
6302 * src/text.C (InsertChar): fix for the "not allowed to insert
6303 space before space" editing problem.
6305 * src/text2.C (DeleteEmptyParagraphMechanism): when
6306 IsEmptyTableRow can only return false this last "else if" will
6307 always be a no-op. Commented out.
6309 * src/text.C (RedoParagraph): As far as I can understand tmp
6310 cursor is not really needed.
6312 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6313 present it could only return false anyway.
6314 (several functions): Did something not so smart...added a const
6315 specifier on a lot of methods.
6317 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6318 and add a tmp->text.resize. The LyXParagraph constructor does the
6320 (BreakParagraphConservative): ditto
6322 * src/support/path.h (Path): add a define so that the wrong usage
6323 "Path("/tmp") will be flagged as a compilation error:
6324 "`unnamed_Path' undeclared (first use this function)"
6326 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6328 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6329 which was bogus for several reasons.
6331 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6335 * autogen.sh: do not use "type -path" (what's that anyway?).
6337 * src/support/filetools.C (findtexfile): remove extraneous space
6338 which caused a kpsewhich warning (at least with kpathsea version
6341 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6343 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6345 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6347 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6349 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6351 * src/paragraph.C (BreakParagraph): do not reserve space on text
6352 if we don't need to (otherwise, if pos_end < pos, we end up
6353 reserving huge amounts of memory due to bad unsigned karma).
6354 (BreakParagraphConservative): ditto, although I have not seen
6355 evidence the bug can happen here.
6357 * src/lyxparagraph.h: add a using std::list.
6359 2000-01-11 Juergen Vigna <jug@sad.it>
6361 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6364 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6366 * src/vc-backend.C (doVCCommand): change to be static and take one
6367 more parameter: the path to chdir too be fore executing the command.
6368 (retrive): new function equiv to "co -r"
6370 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6371 file_not_found_hook is true.
6373 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6375 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6376 if a file is readwrite,readonly...anything else.
6378 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6380 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6381 (CreatePostscript): name change from MenuRunDVIPS (or something)
6382 (PreviewPostscript): name change from MenuPreviewPS
6383 (PreviewDVI): name change from MenuPreviewDVI
6385 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6386 \view_pdf_command., \pdf_to_ps_command
6388 * lib/configure.m4: added search for PDF viewer, and search for
6389 PDF to PS converter.
6390 (lyxrc.defaults output): add \pdflatex_command,
6391 \view_pdf_command and \pdf_to_ps_command.
6393 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6395 * src/bufferlist.C (write): we don't use blocksize for anything so
6398 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6400 * src/support/block.h: disable operator T* (), since it causes
6401 problems with both compilers I tried. See comments in the file.
6403 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6406 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6407 variable LYX_DIR_10x to LYX_DIR_11x.
6409 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6411 * INSTALL: document --with-lyxname.
6414 * configure.in: new configure flag --with-lyxname which allows to
6415 choose the name under which lyx is installed. Default is "lyx", of
6416 course. It used to be possible to do this with --program-suffix,
6417 but the later has in fact a different meaning for autoconf.
6419 * src/support/lstrings.h (lstrchr): reformat a bit.
6421 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6422 * src/mathed/math_defs.h: ditto.
6424 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6426 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6427 true, decides if we create a backup file or not when saving. New
6428 tag and variable \pdf_mode, defaults to false. New tag and
6429 variable \pdflatex_command, defaults to pdflatex. New tag and
6430 variable \view_pdf_command, defaults to xpdf. New tag and variable
6431 \pdf_to_ps_command, defaults to pdf2ps.
6433 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6435 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6436 does not have a BufferView.
6437 (unlockInset): ditto + don't access the_locking_inset if the
6438 buffer does not have a BufferView.
6440 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6441 certain circumstances so that we don't continue a keyboard
6442 operation long after the key was released. Try f.ex. to load a
6443 large document, press PageDown for some seconds and then release
6444 it. Before this change the document would contine to scroll for
6445 some time, with this change it stops imidiatly.
6447 * src/support/block.h: don't allocate more space than needed. As
6448 long as we don't try to write to the arr[x] in a array_type arr[x]
6449 it is perfectly ok. (if you write to it you might segfault).
6450 added operator value_type*() so that is possible to pass the array
6451 to functions expecting a C-pointer.
6453 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6456 * intl/*: updated to gettext 0.10.35, tried to add our own
6457 required modifications. Please verify.
6459 * po/*: updated to gettext 0.10.35, tried to add our own required
6460 modifications. Please verify.
6462 * src/support/lstrings.C (tostr): go at fixing the problem with
6463 cxx and stringstream. When stringstream is used return
6464 oss.str().c_str() so that problems with lyxstring and basic_string
6465 are avoided. Note that the best solution would be for cxx to use
6466 basic_string all the way, but it is not conformant yet. (it seems)
6468 * src/lyx_cb.C + other files: moved several global functions to
6469 class BufferView, some have been moved to BufferView.[Ch] others
6470 are still located in lyx_cb.C. Code changes because of this. (part
6471 of "get rid of current_view project".)
6473 * src/buffer.C + other files: moved several Buffer functions to
6474 class BufferView, the functions are still present in buffer.C.
6475 Code changes because of this.
6477 * config/lcmessage.m4: updated to most recent. used when creating
6480 * config/progtest.m4: updated to most recent. used when creating
6483 * config/gettext.m4: updated to most recent. applied patch for
6486 * config/gettext.m4.patch: new file that shows what changes we
6487 have done to the local copy of gettext.m4.
6489 * config/libtool.m4: new file, used in creation of acinclude.m4
6491 * config/lyxinclude.m4: new file, this is the lyx created m4
6492 macros, used in making acinclude.m4.
6494 * autogen.sh: GNU m4 discovered as a separate task not as part of
6495 the lib/configure creation.
6496 Generate acinlucde from files in config. Actually cat
6497 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6498 easier to upgrade .m4 files that really are external.
6500 * src/Spacing.h: moved using std::istringstream to right after
6501 <sstream>. This should fix the problem seen with some compilers.
6503 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6505 * src/lyx_cb.C: began some work to remove the dependency a lot of
6506 functions have on BufferView::text, even if not really needed.
6507 (GetCurrentTextClass): removed this func, it only hid the
6510 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6511 forgot this in last commit.
6513 * src/Bullet.C (bulletEntry): use static char const *[] for the
6514 tables, becuase of this the return arg had to change to string.
6516 (~Bullet): removed unneeded destructor
6518 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6519 (insetSleep): moved from Buffer
6520 (insetWakeup): moved from Buffer
6521 (insetUnlock): moved from Buffer
6523 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6524 from Buffer to BufferView.
6526 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6528 * config/ltmain.sh: updated to version 1.3.4 of libtool
6530 * config/ltconfig: updated to version 1.3.4 of libtool
6532 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6535 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6536 Did I get that right?
6538 * src/lyxlex.h: add a "using" directive or two.
6539 * src/Spacing.h: ditto.
6540 * src/insets/figinset.C: ditto.
6541 * src/support/filetools.C: ditto.
6542 * src/support/lstrings.C: ditto.
6543 * src/BufferView.C: ditto.
6544 * src/bufferlist.C: ditto.
6545 * src/lyx_cb.C: ditto.
6546 * src/lyxlex.C: ditto.
6548 * NEWS: add some changes for 1.1.4.
6550 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6552 * src/BufferView.C: first go at a TextCache to speed up switching
6555 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6557 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6558 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6559 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6560 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6563 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6564 members of the struct are correctly initialized to 0 (detected by
6566 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6567 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6569 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6570 pidwait, since it was allocated with "new". This was potentially
6571 very bad. Thanks to Michael Schmitt for running purify for us.
6574 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6576 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6578 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6580 1999-12-30 Allan Rae <rae@lyx.org>
6582 * lib/templates/IEEEtran.lyx: minor change
6584 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6585 src/mathed/formula.C (LocalDispatch): askForText changes
6587 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6588 know when a user has cancelled input. Fixes annoying problems with
6589 inserting labels and version control.
6591 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6593 * src/support/lstrings.C (tostr): rewritten to use strstream and
6596 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6598 * src/support/filetools.C (IsFileWriteable): use fstream to check
6599 (IsDirWriteable): use fileinfo to check
6601 * src/support/filetools.h (FilePtr): whole class deleted
6603 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6605 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6607 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6609 * src/bufferlist.C (write): use ifstream and ofstream instead of
6612 * src/Spacing.h: use istrstream instead of sscanf
6614 * src/mathed/math_defs.h: change first arg to istream from FILE*
6616 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6618 * src/mathed/math_parser.C: have yyis to be an istream
6619 (LexGetArg): use istream (yyis)
6621 (mathed_parse): ditto
6622 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6624 * src/mathed/formula.C (Read): rewritten to use istream
6626 * src/mathed/formulamacro.C (Read): rewritten to use istream
6628 * src/lyxlex.h (~LyXLex): deleted desturctor
6629 (getStream): new function, returns an istream
6630 (getFile): deleted funtion
6631 (IsOK): return is.good();
6633 * src/lyxlex.C (LyXLex): delete file and owns_file
6634 (setFile): open an filebuf and assign that to a istream instead of
6636 (setStream): new function, takes an istream as arg.
6637 (setFile): deleted function
6638 (EatLine): rewritten us use istream instead of FILE*
6642 * src/table.C (LyXTable): use istream instead of FILE*
6643 (Read): rewritten to take an istream instead of FILE*
6645 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6647 * src/buffer.C (Dispatch): remove an extraneous break statement.
6649 * src/support/filetools.C (QuoteName): change to do simple
6650 'quoting'. More work is necessary. Also changed to do nothing
6651 under emx (needs fix too).
6652 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6654 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6655 config.h.in to the AC_DEFINE_UNQUOTED() call.
6656 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6657 needs char * as argument (because Solaris 7 declares it like
6660 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6661 remove definition of BZERO.
6663 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6665 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6666 defined, "lyxregex.h" if not.
6668 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6670 (REGEX): new variable that is set to regex.c lyxregex.h when
6671 AM_CONDITIONAL USE_REGEX is set.
6672 (libsupport_la_SOURCES): add $(REGEX)
6674 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6677 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6680 * configure.in: add call to LYX_REGEX
6682 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6683 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6685 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6687 * lib/bind/fi_menus.bind: new file, from
6688 pauli.virtanen@saunalahti.fi.
6690 * src/buffer.C (getBibkeyList): pass the parameter delim to
6691 InsetInclude::getKeys and InsetBibtex::getKeys.
6693 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6694 is passed to Buffer::getBibkeyList
6696 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6697 instead of the hardcoded comma.
6699 * src/insets/insetbib.C (getKeys): make sure that there are not
6700 leading blanks in bibtex keys. Normal latex does not care, but
6701 harvard.sty seems to dislike blanks at the beginning of citation
6702 keys. In particular, the retturn value of the function is
6704 * INSTALL: make it clear that libstdc++ is needed and that gcc
6705 2.7.x probably does not work.
6707 * src/support/filetools.C (findtexfile): make debug message go to
6709 * src/insets/insetbib.C (getKeys): ditto
6711 * src/debug.C (showTags): make sure that the output is correctly
6714 * configure.in: add a comment for TWO_COLOR_ICON define.
6716 * acconfig.h: remove all the entries that already defined in
6717 configure.in or acinclude.m4.
6719 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6720 to avoid user name, date and copyright.
6722 1999-12-21 Juergen Vigna <jug@sad.it>
6724 * src/table.C (Read): Now read bogus row format informations
6725 if the format is < 5 so that afterwards the table can
6726 be read by lyx but without any format-info. Fixed the
6727 crash we experienced when not doing this.
6729 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6731 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6732 (RedoDrawingOfParagraph): ditto
6733 (RedoParagraphs): ditto
6734 (RemoveTableRow): ditto
6736 * src/text.C (Fill): rename arg paperwidth -> paper_width
6738 * src/buffer.C (insertLyXFile): rename var filename -> fname
6739 (writeFile): rename arg filename -> fname
6740 (writeFileAscii): ditto
6741 (makeLaTeXFile): ditto
6742 (makeLinuxDocFile): ditto
6743 (makeDocBookFile): ditto
6745 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6748 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6750 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6753 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6754 compiled by a C compiler not C++.
6756 * src/layout.h (LyXTextClass): added typedef for const_iterator
6757 (LyXTextClassList): added typedef for const_iterator + member
6758 functions begin and end.
6760 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6761 iterators to fill the choice_class.
6762 (updateLayoutChoice): rewritten to use iterators to fill the
6763 layoutlist in the toolbar.
6765 * src/BufferView.h (BufferView::work_area_width): removed unused
6768 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6770 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6771 (sgmlCloseTag): ditto
6773 * src/support/lstrings.h: return type of countChar changed to
6776 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6777 what version of this func to use. Also made to return unsigned int.
6779 * configure.in: call LYX_STD_COUNT
6781 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6782 conforming std::count.
6784 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6786 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6787 and a subscript would give bad display (patch from Dekel Tsur
6788 <dekel@math.tau.ac.il>).
6790 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6792 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6795 * src/chset.h: add a few 'using' directives
6797 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6798 triggered when no buffer is active
6800 * src/layout.C: removed `break' after `return' in switch(), since
6803 * src/lyx_main.C (init): make sure LyX can be ran in place even
6804 when libtool has done its magic with shared libraries. Fix the
6805 test for the case when the system directory has not been found.
6807 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6808 name for the latex file.
6809 (MenuMakeHTML): ditto
6811 * src/buffer.h: add an optional boolean argument, which is passed
6814 1999-12-20 Allan Rae <rae@lyx.org>
6816 * lib/templates/IEEEtran.lyx: small correction and update.
6818 * configure.in: Attempted to use LYX_PATH_HEADER
6820 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6822 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6823 input from JMarc. Now use preprocessor to find the header.
6824 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6825 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6826 LYX_STL_STRING_FWD. See comments in file.
6828 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6830 * The global MiniBuffer * minibuffer variable is dead.
6832 * The global FD_form_main * fd_form_main variable is dead.
6834 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6836 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6838 * src/table.h: add the LOstream.h header
6839 * src/debug.h: ditto
6841 * src/LyXAction.h: change the explaination of the ReadOnly
6842 attribute: is indicates that the function _can_ be used.
6844 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6847 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6849 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6855 * src/paragraph.C (GetWord): assert on pos>=0
6858 * src/support/lyxstring.C: condition the use of an invariant on
6860 * src/support/lyxstring.h: ditto
6862 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6863 Use LAssert.h instead of plain assert().
6865 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6867 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6868 * src/support/filetools.C: ditto
6870 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6873 * INSTALL: document the new configure flags
6875 * configure.in: suppress --with-debug; add --enable-assertions
6877 * acinclude.m4: various changes in alignment of help strings.
6879 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6881 * src/kbmap.C: commented out the use of the hash map in kb_map,
6882 beginning of movement to a stl::container.
6884 * several files: removed code that was not in effect when
6885 MOVE_TEXT was defined.
6887 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6888 for escaping should not be used. We can discuss if the string
6889 should be enclosed in f.ex. [] instead of "".
6891 * src/trans_mgr.C (insert): use the new returned value from
6892 encodeString to get deadkeys and keymaps done correctly.
6894 * src/chset.C (encodeString): changed to return a pair, to tell
6895 what to use if we know the string.
6897 * src/lyxscreen.h (fillArc): new function.
6899 * src/FontInfo.C (resize): rewritten to use more std::string like
6900 structore, especially string::replace.
6902 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6905 * configure.in (chmod +x some scripts): remove config/gcc-hack
6907 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6909 * src/buffer.C (writeFile): change once again the top comment in a
6910 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6911 instead of an hardcoded version number.
6912 (makeDocBookFile): ditto
6914 * src/version.h: add new define LYX_DOCVERSION
6916 * po/de.po: update from Pit Sütterlin
6917 * lib/bind/de_menus.bind: ditto.
6919 * src/lyxfunc.C (Dispatch): call MenuExport()
6920 * src/buffer.C (Dispatch): ditto
6922 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6923 LyXFunc::Dispatch().
6924 (MenuExport): new function, moved from
6925 LyXFunc::Dispatch().
6927 * src/trans_mgr.C (insert): small cleanup
6928 * src/chset.C (loadFile): ditto
6930 * lib/kbd/iso8859-1.cdef: add missing backslashes
6932 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6934 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6935 help with placing the manually drawn accents better.
6937 (Draw): x2 and hg changed to float to minimize rounding errors and
6938 help place the accents better.
6940 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6941 unsigned short to char is just wrong...cast the char to unsigned
6942 char instead so that the two values can compare sanely. This
6943 should also make the display of insetlatexaccents better and
6944 perhaps also some other insets.
6946 (lbearing): new function
6949 1999-12-15 Allan Rae <rae@lyx.org>
6951 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6952 header that provides a wrapper around the very annoying SGI STL header
6955 * src/support/lyxstring.C, src/LString.h:
6956 removed old SGI-STL-compatability attempts.
6958 * configure.in: Use LYX_STL_STRING_FWD.
6960 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6961 stl_string_fwd.h is around and try to determine it's location.
6962 Major improvement over previous SGI STL 3.2 compatability.
6963 Three small problems remain with this function due to my zero
6964 knowledge of autoconf. JMarc and lgb see the comments in the code.
6966 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6968 * src/broken_const.h, config/hack-gcc, config/README: removed
6970 * configure.in: remove --with-gcc-hack option; do not call
6973 * INSTALL: remove documentation of --with-broken-const and
6976 * acconfig.h: remove all trace of BROKEN_CONST define
6978 * src/buffer.C (makeDocBookFile): update version number in output
6980 (SimpleDocBookOnePar): fix an assert when trying to a character
6981 access beyond string length
6984 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6986 * po/de.po: fix the Export menu
6988 * lyx.man: update the description of -dbg
6990 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6991 (commandLineHelp): updated
6992 (easyParse): show list of available debug levels if -dbg is passed
6995 * src/Makefile.am: add debug.C
6997 * src/debug.h: moved some code to debug.C
6999 * src/debug.C: new file. Contains code to set and show debug
7002 * src/layout.C: remove 'break' after 'continue' in switch
7003 statements, since these cannot be reached.
7005 1999-12-13 Allan Rae <rae@lyx.org>
7007 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7008 (in_word_set): hash() -> math_hash()
7010 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7012 * acconfig.h: Added a test for whether we are using exceptions in the
7013 current compilation run. If so USING_EXCEPTIONS is defined.
7015 * config.in: Check for existance of stl_string_fwd.h
7016 * src/LString.h: If compiling --with-included-string and SGI's
7017 STL version 3.2 is present (see above test) we need to block their
7018 forward declaration of string and supply a __get_c_string().
7019 However, it turns out this is only necessary if compiling with
7020 exceptions enabled so I've a bit more to add yet.
7022 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7023 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7024 src/support/LRegex.h, src/undo.h:
7025 Shuffle the order of the included files a little to ensure that
7026 LString.h gets included before anything that includes stl_string_fwd.h
7028 * src/support/lyxstring.C: We need to #include LString.h instead of
7029 lyxstring.h to get the necessary definition of __get_c_string.
7030 (__get_c_string): New function. This is defined static just like SGI's
7031 although why they need to do this I'm not sure. Perhaps it should be
7032 in lstrings.C instead.
7034 * lib/templates/IEEEtran.lyx: New template file.
7036 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7038 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7039 * intl/Makefile.in (MKINSTALLDIRS): ditto
7041 * src/LyXAction.C (init): changed to hold the LFUN data in a
7042 automatic array in stead of in callso to newFunc, this speeds up
7043 compilation a lot. Also all the memory used by the array is
7044 returned when the init is completed.
7046 * a lot of files: compiled with -Wold-style-cast, changed most of
7047 the reported offenders to C++ style casts. Did not change the
7048 offenders in C files.
7050 * src/trans.h (Match): change argument type to unsigned int.
7052 * src/support/DebugStream.C: fix some types on the streambufs so
7053 that it works on a conforming implementation.
7055 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7057 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7059 * src/support/lyxstring.C: remove the inline added earlier since
7060 they cause a bunch of unsatisfied symbols when linking with dec
7061 cxx. Cxx likes to have the body of inlines at the place where they
7064 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7065 accessing negative bounds in array. This fixes the crash when
7066 inserting accented characters.
7067 * src/trans.h (Match): ditto
7069 * src/buffer.C (Dispatch): since this is a void, it should not try
7070 to return anything...
7072 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7074 * src/buffer.h: removed the two friends from Buffer. Some changes
7075 because of this. Buffer::getFileName and Buffer::setFileName
7076 renamed to Buffer::fileName() and Buffer::fileName(...).
7078 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7080 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7081 and Buffer::update(short) to BufferView. This move is currently
7082 controlled by a define MOVE_TEXT, this will be removed when all
7083 shows to be ok. This move paves the way for better separation
7084 between buffer contents and buffer view. One side effect is that
7085 the BufferView needs a rebreak when swiching buffers, if we want
7086 to avoid this we can add a cache that holds pointers to LyXText's
7087 that is not currently in use.
7089 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7092 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7094 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7096 * lyx_main.C: new command line option -x (or --execute) and
7097 -e (or --export). Now direct conversion from .lyx to .tex
7098 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7099 Unfortunately, X is still needed and the GUI pops up during the
7102 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7104 * src/Spacing.C: add a using directive to bring stream stuff into
7106 * src/paragraph.C: ditto
7107 * src/buffer.C: ditto
7109 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7110 from Lars' announcement).
7112 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7113 example files from Tino Meinen.
7115 1999-12-06 Allan Rae <rae@lyx.org>
7117 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7119 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7121 * src/support/lyxstring.C: added a lot of inline for no good
7124 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7125 latexWriteEndChanges, they were not used.
7127 * src/layout.h (operator<<): output operator for PageSides
7129 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7131 * some example files: loaded in LyX 1.0.4 and saved again to update
7132 certain constructs (table format)
7134 * a lot of files: did the change to use fstream/iostream for all
7135 writing of files. Done with a close look at Andre Poenitz's patch.
7137 * some files: whitespace changes.
7139 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7141 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7142 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7143 architecture, we provide our own. It is used unconditionnally, but
7144 I do not think this is a performance problem. Thanks to Angus
7145 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7146 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7148 (GetInset): use my_memcpy.
7152 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7153 it is easier to understand, but it uses less TeX-only constructs now.
7155 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7156 elements contain spaces
7158 * lib/configure: regenerated
7160 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7161 elements contain spaces; display the list of programs that are
7164 * autogen.sh: make sure lib/configure is executable
7166 * lib/examples/*: rename the tutorial examples to begin with the
7167 two-letters language code.
7169 * src/lyxfunc.C (getStatus): do not query current font if no
7172 * src/lyx_cb.C (RunScript): use QuoteName
7173 (MenuRunDvips): ditto
7174 (PrintApplyCB): ditto
7176 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7177 around argument, so that it works well with the current shell.
7178 Does not work properly with OS/2 shells currently.
7180 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7181 * src/LyXSendto.C (SendtoApplyCB): ditto
7182 * src/lyxfunc.C (Dispatch): ditto
7183 * src/buffer.C (runLaTeX): ditto
7184 (runLiterate): ditto
7185 (buildProgram): ditto
7187 * src/lyx_cb.C (RunScript): ditto
7188 (MenuMakeLaTeX): ditto
7190 * src/buffer.h (getLatexName): new method
7192 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7194 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7196 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7197 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7198 (create_math_panel): ditto
7200 * src/lyxfunc.C (getStatus): re-activate the code which gets
7201 current font and cursor; add test for export to html.
7203 * src/lyxrc.C (read): remove unreachable break statements; add a
7206 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7208 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7210 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7211 introduced by faulty regex.
7212 * src/buffer.C: ditto
7213 * src/lastfiles.C: ditto
7214 * src/paragraph.C: ditto
7215 * src/table.C: ditto
7216 * src/vspace.C: ditto
7217 * src/insets/figinset.C: ditto
7218 Note: most of these is absolutely harmless, except the one in
7219 src/mathed formula.C.
7221 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7223 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7224 operation, yielding correct results for the reLyX command.
7226 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7228 * src/support/filetools.C (ExpandPath): removed an over eager
7230 (ReplaceEnvironmentPath): ditto
7232 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7233 shows that we are doing something fishy in our code...
7237 * src/lyxrc.C (read): use a double switch trick to get more help
7238 from the compiler. (the same trick is used in layout.C)
7239 (write): new function. opens a ofstream and pass that to output
7240 (output): new function, takes a ostream and writes the lyxrc
7241 elemts to it. uses a dummy switch to make sure no elements are
7244 * src/lyxlex.h: added a struct pushpophelper for use in functions
7245 with more than one exit point.
7247 * src/lyxlex.[Ch] (GetInteger): made it const
7251 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7253 * src/layout.[hC] : LayoutTags splitted into several enums, new
7254 methods created, better error handling cleaner use of lyxlex. Read
7257 * src/bmtable.[Ch]: change some member prototypes because of the
7258 image const changes.
7260 * commandtags.h, src/LyXAction.C (init): new function:
7261 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7262 This file is not read automatically but you can add \input
7263 preferences to your lyxrc if you want to. We need to discuss how
7266 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7267 in .aux, also remove .bib and .bst files from dependencies when
7270 * src/BufferView.C, src/LyXView.C: add const_cast several places
7271 because of changes to images.
7273 * lib/images/*: same change as for images/*
7275 * lib/lyxrc.example: Default for accept_compound is false not no.
7277 * images/*: changed to be const, however I have som misgivings
7278 about this change so it might be changed back.
7280 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7282 * lib/configure, po/POTFILES.in: regenerated
7284 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7286 * config/lib_configure.m4: removed
7288 * lib/configure.m4: new file (was config/lib_configure.m4)
7290 * configure.in: do not test for rtti, since we do not use it.
7292 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7294 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7295 doubling of allocated space scheme. This makes it faster for large
7296 strings end to use less memory for small strings. xtra rememoved.
7298 * src/insets/figinset.C (waitalarm): commented out.
7299 (GhostscriptMsg): use static_cast
7300 (GhostscriptMsg): use new instead of malloc to allocate memory for
7301 cmap. also delete the memory after use.
7303 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7305 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7306 for changes in bibtex database or style.
7307 (runBibTeX): remove all .bib and .bst files from dep before we
7309 (run): use scanAuc in when dep file already exist.
7311 * src/DepTable.C (remove_files_with_extension): new method
7314 * src/DepTable.[Ch]: made many of the methods const.
7316 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7318 * src/bufferparams.C: make sure that the default textclass is
7319 "article". It used to be the first one by description order, but
7320 now the first one is "docbook".
7322 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7323 string; call Debug::value.
7324 (easyParse): pass complete argument to setDebuggingLevel().
7326 * src/debug.h (value): fix the code that parses debug levels.
7328 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7331 * src/LyXAction.C: use Debug::ACTION as debug channel.
7333 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7335 * NEWS: updated for the future 1.1.3 release.
7337 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7338 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7339 it should. This is of course a controversial change (since many
7340 people will find that their lyx workscreen is suddenly full of
7341 red), but done for the sake of correctness.
7343 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7344 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7346 * src/insets/inseterror.h, src/insets/inseturl.h,
7347 src/insets/insetinfo.h, src/insets/figinset.h,
7348 src/mathed/formulamacro.h, src/mathed/math_macro.h
7349 (EditMessage): add a missing const and add _() to make sure that
7352 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7353 src/insets/insetbib.C, src/support/filetools.C: add `using'
7356 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7357 doing 'Insert index of last word' at the beginning of a paragraph.
7359 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7361 * several files: white-space changes.
7363 * src/mathed/formula.C: removed IsAlpha and IsDigit
7365 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7366 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7369 * src/insets/figinset.C (GetPSSizes): don't break when
7370 "EndComments" is seen. But break when a boundingbox is read.
7372 * all classes inherited from Inset: return value of Clone
7373 changed back to Inset *.
7375 * all classes inherited form MathInset: return value of Clone
7376 changed back to MathedInset *.
7378 * src/insets/figinset.C (runqueue): use a ofstream to output the
7379 gs/ps file. Might need some setpresicion or setw. However I can
7380 see no problem with the current code.
7381 (runqueue): use sleep instead of the alarm/signal code. I just
7382 can't see the difference.
7384 * src/paragraph.C (LyXParagraph): reserve space in the new
7385 paragraph and resize the inserted paragraph to just fit.
7387 * src/lyxfunc.h (operator|=): added operator for func_status.
7389 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7390 check for readable file.
7392 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7393 check for readable file.
7394 (MenuMakeLinuxDoc): ditto
7395 (MenuMakeDocBook): ditto
7396 (MenuMakeAscii): ditto
7397 (InsertAsciiFile): split the test for openable and readable
7399 * src/bmtable.C (draw_bitmaptable): use
7400 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7402 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7403 findtexfile from LaTeX to filetools.
7405 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7406 instead of FilePtr. Needs to be verified by a literate user.
7408 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7410 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7411 (EditMessage): likewise.
7413 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7414 respectively as \textasciitilde and \textasciicircum.
7416 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7418 * src/support/lyxstring.h: made the methods that take iterators
7421 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7422 (regexMatch): made is use the real regex class.
7424 * src/support/Makefile.am: changed to use libtool
7426 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7428 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7430 (MathIsInset ++): changed several macros to be inline functions
7433 * src/mathed/Makefile.am: changed to use libtool
7435 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7437 * src/insets/inset* : Clone changed to const and return type is
7438 the true insettype not just Inset*.
7440 * src/insets/Makefile.am: changed to use libtool
7442 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7444 * src/undo.[Ch] : added empty() and changed some of the method
7447 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7449 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7450 setID use block<> for the bullets array, added const several places.
7452 * src/lyxfunc.C (getStatus): new function
7454 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7455 LyXAction, added const to several funtions.
7457 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7458 a std::map, and to store the dir items in a vector.
7460 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7463 * src/LyXView.[Ch] + other files : changed currentView to view.
7465 * src/LyXAction.[Ch] : ported from the old devel branch.
7467 * src/.cvsignore: added .libs and a.out
7469 * configure.in : changes to use libtool.
7471 * acinclude.m4 : inserted libtool.m4
7473 * .cvsignore: added libtool
7475 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7477 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7478 file name in insets and mathed directories (otherwise the
7479 dependency is not taken in account under cygwin).
7481 * src/text2.C (InsertString[AB]): make sure that we do not try to
7482 read characters past the string length.
7484 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7486 * lib/doc/LaTeXConfig.lyx.in,
7487 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7489 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7490 file saying who created them and when this heppened; this is
7491 useless and annoys tools like cvs.
7493 * lib/layouts/g-brief-{en,de}.layout,
7494 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7495 from Thomas Hartkens <thomas@hartkens.de>.
7497 * src/{insets,mathed}/Makefile.am: do not declare an empty
7498 LDFLAGS, so that it can be set at configure time (useful on Irix
7501 * lib/reLyX/configure.in: make sure that the prefix is set
7502 correctly in LYX_DIR.
7504 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7506 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7507 be used by 'command-sequence' this allows to bind a key to a
7508 sequence of LyX-commands
7509 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7511 * src/LyXAction.C: add "command-sequence"
7513 * src/LyXFunction.C: handling of "command-sequence"
7515 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7516 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7518 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7520 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7522 * src/buffer.C (writeFile): Do not output a comment giving user
7523 and date at the beginning of a .lyx file. This is useless and
7524 annoys cvs anyway; update version number to 1.1.
7526 * src/Makefile.am (LYX_DIR): add this definition, so that a
7527 default path is hardcoded in LyX.
7529 * configure.in: Use LYX_GNU_GETTEXT.
7531 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7532 AM_GNU_GETTEXT with a bug fixed.
7534 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7536 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7538 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7539 which is used to point to LyX data is now LYX_DIR_11x.
7541 * lyx.man: convert to a unix text file; small updates.
7543 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7545 * src/support/LSubstring.[Ch]: made the second arg of most of the
7546 constructors be a const reference.
7548 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7551 * src/support/lyxstring.[Ch] (swap): added missing member function
7552 and specialization of swap(str, str);
7554 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7556 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7557 trace of the old one.
7559 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7560 put the member definitions in undo.C.
7562 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7563 NEW_TEXT and have now only code that was included when this was
7566 * src/intl.C (LCombo): use static_cast
7568 (DispatchCallback): ditto
7570 * src/definitions.h: removed whole file
7572 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7574 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7575 parsing and stores in a std:map. a regex defines the file format.
7576 removed unneeded members.
7578 * src/bufferparams.h: added several enums from definitions.h here.
7579 Removed unsused destructor. Changed some types to use proper enum
7580 types. use block to have the temp_bullets and user_defined_bullets
7581 and to make the whole class assignable.
7583 * src/bufferparams.C (Copy): removed this functions, use a default
7586 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7589 * src/buffer.C (readLyXformat2): commend out all that have with
7590 oldpapersize to do. also comment out all that hve to do with
7591 insetlatex and insetlatexdel.
7592 (setOldPaperStuff): commented out
7594 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7596 * src/LyXAction.C: remove use of inset-latex-insert
7598 * src/mathed/math_panel.C (button_cb): use static_cast
7600 * src/insets/Makefile.am (insets_o_SOURCES): removed
7603 * src/support/lyxstring.C (helper): use the unsigned long
7604 specifier, UL, instead of a static_cast.
7606 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7608 * src/support/block.h: new file. to be used as a c-style array in
7609 classes, so that the class can be assignable.
7611 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7613 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7614 NULL, make sure to return an empty string (it is not possible to
7615 set a string to NULL).
7617 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7619 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7621 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7623 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7624 link line, so that Irix users (for example) can set it explicitely to
7627 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7628 it can be overidden at make time (static or dynamic link, for
7631 * src/vc-backend.C, src/LaTeXFeatures.h,
7632 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7633 statements to bring templates to global namespace.
7635 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7637 * src/support/lyxstring.C (operator[] const): make it standard
7640 * src/minibuffer.C (Init): changed to reflect that more
7641 information is given from the lyxvc and need not be provided here.
7643 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7645 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7647 * src/LyXView.C (UpdateTimerCB): use static_cast
7648 (KeyPressMask_raw_callback): ditto
7650 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7651 buffer_, a lot of changes because of this. currentBuffer() ->
7652 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7653 also changes to other files because of this.
7655 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7657 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7658 have no support for RCS and partial support for CVS, will be
7661 * src/insets/ several files: changes because of function name
7662 changes in Bufferview and LyXView.
7664 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7666 * src/support/LSubstring.[Ch]: new files. These implement a
7667 Substring that can be very convenient to use. i.e. is this
7669 string a = "Mary had a little sheep";
7670 Substring(a, "sheep") = "lamb";
7671 a is now "Mary has a little lamb".
7673 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7674 out patterns and subpatterns of strings. It is used by LSubstring
7675 and also by vc-backend.C
7677 * src/support/lyxstring.C: went over all the assertions used and
7678 tried to correct the wrong ones and flag which of them is required
7679 by the standard. some bugs found because of this. Also removed a
7680 couple of assertions.
7682 * src/support/Makefile.am (libsupport_a_SOURCES): added
7683 LSubstring.[Ch] and LRegex.[Ch]
7685 * src/support/FileInfo.h: have struct stat buf as an object and
7686 not a pointer to one, some changes because of this.
7688 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7689 information in layout when adding the layouts preamble to the
7692 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7695 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7696 because of bug in OS/2.
7698 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7700 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7701 \verbatim@font instead of \ttfamily, so that it can be redefined.
7703 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7704 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7705 src/layout.h, src/text2.C: add 'using' directive to bring the
7706 STL templates we need from the std:: namespace to the global one.
7707 Needed by DEC cxx in strict ansi mode.
7709 * src/support/LIstream.h,src/support/LOstream.h,
7710 src/support/lyxstring.h,src/table.h,
7711 src/lyxlookup.h: do not include <config.h> in header
7712 files. This should be done in the .C files only.
7714 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7718 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7720 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7721 from Kayvan to fix the tth invokation.
7723 * development/lyx.spec.in: updates from Kayvan to reflect the
7724 changes of file names.
7726 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7728 * src/text2.C (InsertStringB): use std::copy
7729 (InsertStringA): use std::copy
7731 * src/bufferlist.C: use a vector to store the buffers in. This is
7732 an internal change and should not affect any other thing.
7734 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7737 * src/text.C (Fill): fix potential bug, one off bug.
7739 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7741 * src/Makefile.am (lyx_main.o): add more files it depends on.
7743 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7745 * src/support/lyxstring.C: use size_t for the reference count,
7746 size, reserved memory and xtra.
7747 (internal_compare): new private member function. Now the compare
7748 functions should work for std::strings that have embedded '\0'
7750 (compare): all compare functions rewritten to use
7753 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7755 * src/support/lyxstring.C (compare): pass c_str()
7756 (compare): pass c_str
7757 (compare): pass c_str
7759 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7761 * src/support/DebugStream.C: <config.h> was not included correctly.
7763 * lib/configure: forgot to re-generate it :( I'll make this file
7764 auto generated soon.
7766 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7768 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7771 * src/support/lyxstring.C: some changes from length() to rep->sz.
7772 avoids a function call.
7774 * src/support/filetools.C (SpaceLess): yet another version of the
7775 algorithm...now per Jean-Marc's suggestions.
7777 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7779 * src/layout.C (less_textclass_desc): functor for use in sorting
7781 (LyXTextClass::Read): sort the textclasses after reading.
7783 * src/support/filetools.C (SpaceLess): new version of the
7784 SpaceLess functions. What problems does this one give? Please
7787 * images/banner_bw.xbm: made the arrays unsigned char *
7789 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7791 * src/support/lyxstring.C (find): remove bogus assertion in the
7792 two versions of find where this has not been done yet.
7794 * src/support/lyxlib.h: add missing int return type to
7797 * src/menus.C (ShowFileMenu): disable exporting to html if no
7798 html export command is present.
7800 * config/lib_configure.m4: add a test for an HTML converter. The
7801 programs checked for are, in this order: tth, latex2html and
7804 * lib/configure: generated from config/lib_configure.m4.
7806 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7807 html converter. The parameters are now passed through $$FName and
7808 $$OutName, instead of standard input/output.
7810 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7812 * lib/lyxrc.example: update description of \html_command.
7813 add "quotes" around \screen_font_xxx font setting examples to help
7814 people who use fonts with spaces in their names.
7816 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7818 * Distribution files: updates for v1.1.2
7820 * src/support/lyxstring.C (find): remove bogus assert and return
7821 npos for the same condition.
7823 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7825 * added patch for OS/2 from SMiyata.
7827 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7829 * src/text2.C (CutSelection): make space_wrapped a bool
7830 (CutSelection): dont declare int i until we have to.
7831 (alphaCounter): return a char const *.
7833 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7835 * src/support/syscall.C (Systemcalls::kill):
7836 src/support/filetools.C (PutEnv, PutEnvPath):
7837 src/lyx_cb.C (addNewlineAndDepth):
7838 src/FontInfo.C (FontInfo::resize): condition some #warning
7839 directives with WITH_WARNINGS.
7842 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7844 * src/layout.[Ch] + several files: access to class variables
7845 limited and made accessor functions instead a lot of code changed
7846 becuase of this. Also instead of returning pointers often a const
7847 reference is returned instead.
7849 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7851 * src/Makefile.am (dist-hook): added used to remove the CVS from
7852 cheaders upon creating a dist
7853 (EXTRA_DIST): added cheaders
7855 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7856 a character not as a small integer.
7858 * src/support/lyxstring.C (find): removed Assert and added i >=
7859 rep->sz to the first if.
7861 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7863 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7864 src/LyXView.C src/buffer.C src/bufferparams.C
7865 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7866 src/text2.C src/insets/insetinclude.C:
7867 lyxlayout renamed to textclasslist.
7869 * src/layout.C: some lyxerr changes.
7871 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7872 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7873 (LyXLayoutList): removed all traces of this class.
7874 (LyXTextClass::Read): rewrote LT_STYLE
7875 (LyXTextClass::hasLayout): new function
7876 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7877 both const and nonconst version.
7878 (LyXTextClass::delete_layout): new function.
7879 (LyXTextClassList::Style): bug fix. do the right thing if layout
7881 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7882 (LyXTextClassList::NameOfLayout): ditto
7883 (LyXTextClassList::Load): ditto
7885 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7887 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7889 * src/LyXAction.C (LookupFunc): added a workaround for sun
7890 compiler, on the other hand...we don't know if the current code
7891 compiles on sun at all...
7893 * src/support/filetools.C (CleanupPath): subst fix
7895 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7898 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7899 complained about this one?
7901 * src/insets/insetinclude.C (Latex): subst fix
7903 * src/insets/insetbib.C (getKeys): subst fix
7905 * src/LyXSendto.C (SendtoApplyCB): subst fix
7907 * src/lyx_main.C (init): subst fix
7909 * src/layout.C (Read): subst fix
7911 * src/lyx_sendfax_main.C (button_send): subst fix
7913 * src/buffer.C (RoffAsciiTable): subst fix
7915 * src/lyx_cb.C (MenuFax): subst fix
7916 (PrintApplyCB): subst fix
7918 1999-10-26 Juergen Vigna <jug@sad.it>
7920 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7922 (Read): Cleaned up this code so now we read only format vestion >= 5
7924 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7926 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7927 come nobody has complained about this one?
7929 * src/insets/insetinclude.C (Latex): subst fix
7931 * src/insets/insetbib.C (getKeys): subst fix
7933 * src/lyx_main.C (init): subst fix
7935 * src/layout.C (Read): subst fix
7937 * src/buffer.C (RoffAsciiTable): subst fix
7939 * src/lyx_cb.C (MenuFax): subst fix.
7941 * src/layout.[hC] + some other files: rewrote to use
7942 std::container to store textclasses and layouts in.
7943 Simplified, removed a lot of code. Make all classes
7944 assignable. Further simplifications and review of type
7945 use still to be one.
7947 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7948 lastfiles to create the lastfiles partr of the menu.
7950 * src/lastfiles.[Ch]: rewritten to use deque to store the
7951 lastfiles in. Uses fstream for reading and writing. Simplifies
7954 * src/support/syscall.C: remove explicit cast.
7956 * src/BufferView.C (CursorToggleCB): removed code snippets that
7958 use explicat C++ style casts instead of C style casts. also use
7959 u_vdata instea of passing pointers in longs.
7961 * src/PaperLayout.C: removed code snippets that were commented out.
7963 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7965 * src/lyx_main.C: removed code snippets that wer commented out.
7967 * src/paragraph.C: removed code snippets that were commented out.
7969 * src/lyxvc.C (logClose): use static_cast
7971 (viewLog): remove explicit cast to void*
7972 (showLog): removed old commented code
7974 * src/menus.C: use static_cast instead of C style casts. use
7975 u_vdata instead of u_ldata. remove explicit cast to (long) for
7976 pointers. Removed old code that was commented out.
7978 * src/insets/inset.C: removed old commented func
7980 * src/insets/insetref.C (InsetRef): removed old code that had been
7981 commented out for a long time.
7983 (escape): removed C style cast
7985 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7987 * src/insets/insetlatex.C (Draw): removed old commented code
7988 (Read): rewritten to use string
7990 * src/insets/insetlabel.C (escape): removed C style cast
7992 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7994 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7997 * src/insets/insetinclude.h: removed a couple of stupid bools
7999 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8000 (Clone): remove C style cast
8001 (getKeys): changed list to lst because of std::list
8003 * src/insets/inseterror.C (Draw): removed som old commented code.
8005 * src/insets/insetcommand.C (Draw): removed some old commented code.
8007 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8008 commented out forever.
8009 (bibitem_cb): use static_cast instead of C style cast
8010 use of vdata changed to u_vdata.
8012 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8014 (CloseUrlCB): use static_cast instead of C style cast.
8015 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8017 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8018 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8019 (CloseInfoCB): static_cast from ob->u_vdata instead.
8020 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8023 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8024 (C_InsetError_CloseErrorCB): forward the ob parameter
8025 (CloseErrorCB): static_cast from ob->u_vdata instead.
8027 * src/vspace.h: include LString.h since we use string in this class.
8029 * src/vspace.C (lyx_advance): changed name from advance because of
8030 nameclash with stl. And since we cannot use namespaces yet...I
8031 used a lyx_ prefix instead. Expect this to change when we begin
8034 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8036 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8037 and removed now defunct constructor and deconstructor.
8039 * src/BufferView.h: have backstack as a object not as a pointer.
8040 removed initialization from constructor. added include for BackStack
8042 * development/lyx.spec.in (%build): add CFLAGS also.
8044 * src/screen.C (drawFrame): removed another warning.
8046 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8048 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8049 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8050 README and ANNOUNCE a bit for the next release. More work is
8053 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8054 unbreakable if we are in freespacing mode (LyX-Code), but not in
8057 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8059 * src/BackStack.h: fixed initialization order in constructor
8061 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8063 * acinclude.m4 (VERSION): new rules for when a version is
8064 development, added also a variable for prerelease.
8065 (warnings): we set with_warnings=yes for prereleases
8066 (lyx_opt): prereleases compile with same optimization as development
8067 (CXXFLAGS): only use pedantic if we are a development version
8069 * src/BufferView.C (restorePosition): don't do anything if the
8072 * src/BackStack.h: added member empty, use this to test if there
8073 is anything to pop...
8075 1999-10-25 Juergen Vigna <jug@sad.it>
8078 * forms/layout_forms.fd +
8079 * forms/latexoptions.fd +
8080 * lyx.fd: changed for various form resize issues
8082 * src/mathed/math_panel.C +
8083 * src/insets/inseterror.C +
8084 * src/insets/insetinfo.C +
8085 * src/insets/inseturl.C +
8086 * src/insets/inseturl.h +
8089 * src/PaperLayout.C +
8090 * src/ParagraphExtra.C +
8091 * src/TableLayout.C +
8093 * src/layout_forms.C +
8100 * src/menus.C: fixed various resize issues. So now forms can be
8101 resized savely or not be resized at all.
8103 * forms/form_url.fd +
8104 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8107 * src/insets/Makefile.am: added files form_url.[Ch]
8109 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8111 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8112 (and presumably 6.2).
8114 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8115 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8116 remaining static member callbacks.
8118 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8121 * src/support/lyxstring.h: declare struct Srep as friend of
8122 lyxstring, since DEC cxx complains otherwise.
8124 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8126 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8128 * src/LaTeX.C (run): made run_bibtex also depend on files with
8130 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8131 are put into the dependency file.
8133 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8134 the code has shown itself to work
8135 (create_ispell_pipe): removed another warning, added a comment
8138 * src/minibuffer.C (ExecutingCB): removed code that has been
8139 commented out a long time
8141 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8142 out code + a warning.
8144 * src/support/lyxstring.h: comment out the three private
8145 operators, when compiling with string ansi conforming compilers
8148 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8150 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8151 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8154 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8157 * src/mathed/math_panel.C (create_math_panel): remove explicit
8160 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8163 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8164 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8165 to XCreatePixmapFromBitmapData
8166 (fl_set_bmtable_data): change the last argument to be unsigned
8168 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8169 and bh to be unsigned int, remove explicit casts in call to
8170 XReadBitmapFileData.
8172 * images/arrows.xbm: made the arrays unsigned char *
8173 * images/varsz.xbm: ditto
8174 * images/misc.xbm: ditto
8175 * images/greek.xbm: ditto
8176 * images/dots.xbm: ditto
8177 * images/brel.xbm: ditto
8178 * images/bop.xbm: ditto
8180 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8182 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8183 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8184 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8186 (LYX_CXX_CHEADERS): added <clocale> to the test.
8188 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8190 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8192 * src/support/lyxstring.C (append): fixed something that must be a
8193 bug, rep->assign was used instead of rep->append.
8195 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8198 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8199 lyx insert double chars. Fix spotted by Kayvan.
8201 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8203 * Fixed the tth support. I messed up with the Emacs patch apply feature
8204 and omitted the changes in lyxrc.C.
8206 1999-10-22 Juergen Vigna <jug@sad.it>
8208 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8210 * src/lyx_cb.C (MenuInsertRef) +
8211 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8212 the form cannot be resized under it limits (fixes a segfault)
8214 * src/lyx.C (create_form_form_ref) +
8215 * forms/lyx.fd: Changed Gravity on name input field so that it is
8218 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8220 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8221 <ostream> and <istream>.
8223 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8224 whether <fstream> provides the latest standard features, or if we
8225 have an oldstyle library (like in egcs).
8226 (LYX_CXX_STL_STRING): fix the test.
8228 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8229 code on MODERN_STL_STREAM.
8231 * src/support/lyxstring.h: use L{I,O}stream.h.
8233 * src/support/L{I,O}stream.h: new files, designed to setup
8234 correctly streams for our use
8235 - includes the right header depending on STL capabilities
8236 - puts std::ostream and std::endl (for LOStream.h) or
8237 std::istream (LIStream.h) in toplevel namespace.
8239 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8241 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8242 was a bib file that had been changed we ensure that bibtex is run.
8243 (runBibTeX): enhanced to extract the names of the bib files and
8244 getting their absolute path and enter them into the dep file.
8245 (findtexfile): static func that is used to look for tex-files,
8246 checks for absolute patchs and tries also with kpsewhich.
8247 Alternative ways of finding the correct files are wanted. Will
8249 (do_popen): function that runs a command using popen and returns
8250 the whole output of that command in a string. Should be moved to
8253 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8254 file with extension ext has changed.
8256 * src/insets/figinset.C: added ifdef guards around the fl_free
8257 code that jug commented out. Now it is commented out when
8258 compiling with XForms == 0.89.
8260 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8261 to lyxstring.C, and only keep a forward declaration in
8262 lyxstring.h. Simplifies the header file a bit and should help a
8263 bit on compile time too. Also changes to Srep will not mandate a
8264 recompile of code just using string.
8265 (~lyxstring): definition moved here since it uses srep.
8266 (size): definition moved here since it uses srep.
8268 * src/support/lyxstring.h: removed a couple of "inline" that should
8271 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8273 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8276 1999-10-21 Juergen Vigna <jug@sad.it>
8278 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8279 set to left if I just remove the width entry (or it is empty).
8281 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8282 paragraph when having dummy paragraphs.
8284 1999-10-20 Juergen Vigna <jug@sad.it>
8286 * src/insets/figinset.C: just commented some fl_free_form calls
8287 and added warnings so that this calls should be activated later
8288 again. This avoids for now a segfault, but we have a memory leak!
8290 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8291 'const char * argument' to 'string argument', this should
8292 fix some Asserts() in lyxstring.C.
8294 * src/lyxfunc.h: Removed the function argAsString(const char *)
8295 as it is not used anymore.
8297 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8299 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8302 * src/Literate.h: some funcs moved from public to private to make
8303 interface clearer. Unneeded args removed.
8305 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8307 (scanBuildLogFile): ditto
8309 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8310 normal TeX Error. Still room for improvement.
8312 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8314 * src/buffer.C (insertErrors): changes to make the error
8315 desctription show properly.
8317 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8320 * src/support/lyxstring.C (helper): changed to use
8321 sizeof(object->rep->ref).
8322 (operator>>): changed to use a pointer instead.
8324 * src/support/lyxstring.h: changed const reference & to value_type
8325 const & lets see if that helps.
8327 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8329 * Makefile.am (rpmdist): fixed to have non static package and
8332 * src/support/lyxstring.C: removed the compilation guards
8334 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8337 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8338 conditional compile of lyxstring.Ch
8340 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8341 stupid check, but it is a lot better than the bastring hack.
8342 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8344 * several files: changed string::erase into string::clear. Not
8347 * src/chset.C (encodeString): use a char temporary instead
8349 * src/table.C (TexEndOfCell): added tostr around
8350 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8351 (TexEndOfCell): ditto
8352 (TexEndOfCell): ditto
8353 (TexEndOfCell): ditto
8354 (DocBookEndOfCell): ditto
8355 (DocBookEndOfCell): ditto
8356 (DocBookEndOfCell): ditto
8357 (DocBookEndOfCell): ditto
8359 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8361 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8363 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8364 (MenuBuildProg): added tostr around ret
8365 (MenuRunChktex): added tostr around ret
8366 (DocumentApplyCB): added tostr around ret
8368 * src/chset.C (encodeString): added tostr around t->ic
8370 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8371 (makeLaTeXFile): added tostr around tocdepth
8372 (makeLaTeXFile): added tostr around ftcound - 1
8374 * src/insets/insetbib.C (setCounter): added tostr around counter.
8376 * src/support/lyxstring.h: added an operator+=(int) to catch more
8379 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8380 (lyxstring): We DON'T allow NULL pointers.
8382 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8384 * src/mathed/math_macro.C (MathMacroArgument::Write,
8385 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8386 when writing them out.
8388 * src/LString.C: remove, since it is not used anymore.
8390 * src/support/lyxstring.C: condition the content to
8391 USE_INCLUDED_STRING macro.
8393 * src/mathed/math_symbols.C, src/support/lstrings.C,
8394 src/support/lyxstring.C: add `using' directive to specify what
8395 we need in <algorithm>. I do not think that we need to
8396 conditionalize this, but any thought is appreciated.
8398 * many files: change all callback functions to "C" linkage
8399 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8400 strict_ansi. Those who were static are now global.
8401 The case of callbacks which are static class members is
8402 trickier, since we have to make C wrappers around them (see
8403 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8404 did not finish this yet, since it defeats the purpose of
8405 encapsulation, and I am not sure what the best route is.
8407 1999-10-19 Juergen Vigna <jug@sad.it>
8409 * src/support/lyxstring.C (lyxstring): we permit to have a null
8410 pointer as assignment value and just don't assign it.
8412 * src/vspace.C (nextToken): corrected this function substituting
8413 find_first(_not)_of with find_last_of.
8415 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8416 (TableOptCloseCB) (TableSpeCloseCB):
8417 inserted fl_set_focus call for problem with fl_hide_form() in
8420 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8422 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8425 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8427 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8428 LyXLex::next() and not eatline() to get its argument.
8430 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8432 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8433 instead, use fstreams for io of the depfile, removed unneeded
8434 functions and variables.
8436 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8437 vector instead, removed all functions and variables that is not in
8440 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8442 * src/buffer.C (insertErrors): use new interface to TeXError
8444 * Makefile.am (rpmdist): added a rpmdist target
8446 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8447 per Kayvan's instructions.
8449 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8451 * src/Makefile.am: add a definition for localedir, so that locales
8452 are found after installation (Kayvan)
8454 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8456 * development/.cvsignore: new file.
8458 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8460 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8461 C++ compiler provides wrappers for C headers and use our alternate
8464 * configure.in: use LYX_CXX_CHEADERS.
8466 * src/cheader/: new directory, populated with cname headers from
8467 libstdc++-2.8.1. They are a bit old, but probably good enough for
8468 what we want (support compilers who lack them).
8470 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8471 from includes. It turns out is was stupid.
8473 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8475 * lib/Makefile.am (install-data-local): forgot a ';'
8476 (install-data-local): forgot a '\'
8477 (libinstalldirs): needed after all. reintroduced.
8479 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8481 * configure.in (AC_OUTPUT): added lyx.spec
8483 * development/lyx.spec: removed file
8485 * development/lyx.spec.in: new file
8487 * po/*.po: merged with lyx.pot becuase of make distcheck
8489 * lib/Makefile.am (dist-hook): added dist-hook so that
8490 documentation files will be included when doing a make
8491 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8492 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8494 more: tried to make install do the right thing, exclude CVS dirs
8497 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8498 Path would fit in more nicely.
8500 * all files that used to use pathstack: uses now Path instead.
8501 This change was a lot easier than expected.
8503 * src/support/path.h: new file
8505 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8507 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8509 * src/support/lyxstring.C (getline): Default arg was given for
8512 * Configure.cmd: removed file
8514 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8516 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8517 streams classes and types, add the proper 'using' statements when
8518 MODERN_STL is defined.
8520 * src/debug.h: move the << operator definition after the inclusion
8523 * src/support/filetools.C: include "LAssert.h", which is needed
8526 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8529 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8530 include "debug.h" to define a proper ostream.
8532 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8534 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8535 method to the SystemCall class which can kill a process, but it's
8536 not fully implemented yet.
8538 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8540 * src/support/FileInfo.h: Better documentation
8542 * src/lyxfunc.C: Added support for buffer-export html
8544 * src/menus.C: Added Export->As HTML...
8546 * lib/bind/*.bind: Added short-cut for buffer-export html
8548 * src/lyxrc.*: Added support for new \tth_command
8550 * lib/lyxrc.example: Added stuff for new \tth_command
8552 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8554 * lib/Makefile.am (IMAGES): removed images/README
8555 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8556 installes in correct place. Check permisions is installed
8559 * src/LaTeX.C: some no-op changes moved declaration of some
8562 * src/LaTeX.h (LATEX_H): changed include guard name
8564 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8566 * lib/reLyX/Makefile.am: install noweb2lyx.
8568 * lib/Makefile.am: install configure.
8570 * lib/reLyX/configure.in: declare a config aux dir; set package
8571 name to lyx (not sure what the best solution is); generate noweb2lyx.
8573 * lib/layouts/egs.layout: fix the bibliography layout.
8575 1999-10-08 Jürgen Vigna <jug@sad.it>
8577 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8578 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8579 it returned without continuing to search the path.
8581 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8583 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8584 also fixes a bug. It is not allowed to do tricks with std::strings
8585 like: string a("hei"); &a[e]; this will not give what you
8586 think... Any reason for the complexity in this func?
8588 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8590 * Updated README and INSTALL a bit, mostly to check that my
8591 CVS rights are correctly set up.
8593 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8595 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8596 does not allow '\0' chars but lyxstring and std::string does.
8598 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8600 * autogen.sh (AUTOCONF): let the autogen script create the
8601 POTFILES.in file too. POTFILES.in should perhaps now not be
8602 included in the cvs module.
8604 * some more files changed to use C++ includes instead of C ones.
8606 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8608 (Reread): added tostr to nlink. buggy output otherwise.
8609 (Reread): added a string() around szMode when assigning to Buffer,
8610 without this I got a log of garbled info strings.
8612 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8615 * I have added several ostream & operator<<(ostream &, some_type)
8616 functions. This has been done to avoid casting and warnings when
8617 outputting enums to lyxerr. This as thus eliminated a lot of
8618 explicit casts and has made the code clearer. Among the enums
8619 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8620 mathed enums, some font enum the Debug::type enum.
8622 * src/support/lyxstring.h (clear): missing method. equivalent of
8625 * all files that contained "stderr": rewrote constructs that used
8626 stderr to use lyxerr instead. (except bmtable)
8628 * src/support/DebugStream.h (level): and the passed t with
8629 Debug::ANY to avoid spurious bits set.
8631 * src/debug.h (Debug::type value): made it accept strings of the
8634 * configure.in (Check for programs): Added a check for kpsewhich,
8635 the latex generation will use this later to better the dicovery of
8638 * src/BufferView.C (create_view): we don't need to cast this to
8639 (void*) that is done automatically.
8640 (WorkAreaButtonPress): removed some dead code.
8642 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8644 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8645 is not overwritten when translated (David Sua'rez de Lis).
8647 * lib/CREDITS: Added David Sua'rez de Lis
8649 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8651 * src/bufferparams.C (BufferParams): default input encoding is now
8654 * acinclude.m4 (cross_compiling): comment out macro
8655 LYX_GXX_STRENGTH_REDUCE.
8657 * acconfig.h: make sure that const is not defined (to empty) when
8658 we are compiling C++. Remove commented out code using SIZEOF_xx
8661 * configure.in : move the test for const and inline as late as
8662 possible so that these C tests do not interefere with C++ ones.
8663 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8664 has not been proven.
8666 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8668 * src/table.C (getDocBookAlign): remove bad default value for
8671 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8673 (ShowFileMenu2): ditto.
8675 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8678 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8680 * Most files: finished the change from the old error code to use
8681 DebugStream for all lyxerr debugging. Only minor changes remain
8682 (e.g. the setting of debug levels using strings instead of number)
8684 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8686 * src/layout.C (Add): Changed to use compare_no_case instead of
8689 * src/FontInfo.C: changed loop variable type too string::size_type.
8691 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8693 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8694 set ETAGS_ARGS to --c++
8696 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8698 * src/table.C (DocBookEndOfCell): commented out two unused variables
8700 * src/paragraph.C: commented out four unused variables.
8702 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8703 insed a if clause with type string::size_type.
8705 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8708 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8710 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8711 variable, also changed loop to go from 0 to lenght + 1, instead of
8712 -1 to length. This should be correct.
8714 * src/LaTeX.C (scanError): use string::size_type as loop variable
8717 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8718 (l.896) since y_tmp and row was not used anyway.
8720 * src/insets/insetref.C (escape): use string::size_type as loop
8723 * src/insets/insetquotes.C (Width): use string::size_type as loop
8725 (Draw): use string::size_type as loop variable type.
8727 * src/insets/insetlatexaccent.C (checkContents): use
8728 string::size_type as loop variable type.
8730 * src/insets/insetlabel.C (escape): use string::size_type as loop
8733 * src/insets/insetinfo.C: added an extern for current_view.
8735 * src/insets/insetcommand.C (scanCommand): use string::size_type
8736 as loop variable type.
8738 * most files: removed the RCS tags. With them we had to recompile
8739 a lot of files after a simple cvs commit. Also we have never used
8740 them for anything meaningful.
8742 * most files: tags-query-replace NULL 0. As adviced several plases
8743 we now use "0" instead of "NULL" in our code.
8745 * src/support/filetools.C (SpaceLess): use string::size_type as
8748 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8750 * src/paragraph.C: fixed up some more string stuff.
8752 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8754 * src/support/filetools.h: make modestr a std::string.
8756 * src/filetools.C (GetEnv): made ch really const.
8758 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8759 made code that used these use max/min from <algorithm> instead.
8761 * changed several c library include files to their equivalent c++
8762 library include files. All is not changed yet.
8764 * created a support subdir in src, put lyxstring and lstrings
8765 there + the extra files atexit, fileblock, strerror. Created
8766 Makefile.am. edited configure.in and src/Makefile.am to use this
8767 new subdir. More files moved to support.
8769 * imported som of the functions from repository lyx, filetools
8771 * ran tags-query-replace on LString -> string, corrected the bogus
8772 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8773 is still some errors in there. This is errors where too much or
8774 too litle get deleted from strings (string::erase, string::substr,
8775 string::replace), there can also be some off by one errors, or
8776 just plain wrong use of functions from lstrings. Viewing of quotes
8779 * LyX is now running fairly well with string, but there are
8780 certainly some bugs yet (see above) also string is quite different
8781 from LString among others in that it does not allow null pointers
8782 passed in and will abort if it gets any.
8784 * Added the revtex4 files I forgot when setting up the repository.
8786 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8788 * All over: Tried to clean everything up so that only the files
8789 that we really need are included in the cvs repository.
8790 * Switched to use automake.
8791 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8792 * Install has not been checked.
8794 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8796 * po/pt.po: Three errors:
8797 l.533 and l.538 format specification error
8798 l. 402 duplicate entry, I just deleted it.