1 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
4 bind file if it has not been done yet.
5 (read): remove local bindFile variable. Try to fix the handling of
6 RC_BIND and RC_BINDFILE.
8 * src/lyx_main.C (init): use readBindFileIfNeeded().
10 * lib/languages: Change description of german to "German (new
13 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
15 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
16 "Apply" buttons if arg is non-zero.
18 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
19 launching the popup if sufficient info is passed to
22 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
24 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
25 labels (disabled in 1.1.6).
27 * src/lyxrc.[Ch]: New variable label_init_length
29 * mathed/formula.C (LocalDispatch): Preserve the label when
30 changing from display math to eqnarray (however, the label
31 do not appear at the first line, as one might expects, but at the
33 (LocalDispatch): When inserting a label to a formula which already
34 have a label, the old label is used as default value.
35 Also, if the label is changed, then all references to the label
38 * src/mathed/math_iter.C (setLabel): Allow to set the label
39 even if it is empty. This is needed to allow deletion of a label
42 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
43 refernces only if the old label appears once in the document.
45 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
47 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
48 <gehlert@Rcs1.urz.tu-dresden.de>
50 * src/frontends/xforms/FormBase.C: comment out debug.h
52 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
53 code in xform_helpers instead.
54 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
56 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
57 Use N_(), rather than _() when creating strings to pass to browseFile()
58 because browseFile calls gettext() itself now.
60 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
61 display the filename correctly.
63 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
65 * src/converter.C (Move): New method. Used to move file or files
66 from temp dir to the output dir. (this fixes the bug that
67 exporting linuxdoc/docbook document to html would not move all
68 html file from temp directory).
70 * src/support/filetools.C (DirList): Fixed.
72 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
74 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
76 * src/converter.C (Add): Remove $$i when setting latex_command.
78 * src/text.C (IsBoundary): Return false when pos = 0.
80 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
82 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
84 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
86 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
87 need to empty the fields to turn off use of the geometry package!
89 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
91 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
92 (Buffer const &), not a (BufferParams const &) and so fix a crash
93 caused by using current_view before it had been initialised. Not
94 the best way to do this, but much easier than changing
95 Inset::Clone(Buffer const &) to Inset::Clone().
98 * src/tabular.C: changed call to CopyIntoMinibuffer().
100 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
102 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
104 * src/lyxfunc.C (getStatus): disable insertion of floats in a
107 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
109 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
110 changed filter for screen fonts input filter from int to float
112 * src/frontends/xforms/input_validators.c: removed.
113 * src/frontends/xforms/input_validators.C: new file. Can now call C++
114 functions from within the filter functions.
116 * src/frontends/xforms/input_validators.[Ch]
117 (fl_unsigned_float_filter): new filter function.
119 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
120 confused now! And if you think I'm going to do this in
121 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
123 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
125 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
127 * src/WorkArea.C (work_area_handler): don't handle button requests
128 if xbutton.button == 0
130 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
132 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
133 It creates a lot of interesting problems.
135 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
137 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
138 the menu exists in the current menubar before opening it.
140 * src/MenuBackend.C (hasSubmenu): new method.
142 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
143 action value by offsetting actions by a large constant (so that
144 bogs choice result will be less than this constant).
146 * lib/bind/fi_menus.bind: more cleanup to menus.
147 * lib/bind/sciword.bind: ditto.
148 * lib/bind/xemacs.bind: ditto.
149 * lib/bind/emacs.bind: ditto.
150 * lib/bind/pt_menus.bind: ditto.
151 * lib/bind/hu_menus.bind: ditto.
153 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
155 * INSTALL: update PROBLEMS section.
157 * src/lyxlookup.h: remove condition on xforms version, since we
158 should not include it if not appropriate.
160 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
162 * src/LColor.C: "latex text" -> "latex inset" (from
165 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
167 * src/frontends/kde/FormTabularCreate.C:
168 * src/frontends/kde/citationdlg.C:
169 * src/frontends/kde/copyrightdlg.C:
170 * src/frontends/kde/paradlg.C:
171 * src/frontends/kde/paraextradlg.C:
172 * src/frontends/kde/parageneraldlg.C:
173 * src/frontends/kde/printdlg.C:
174 * src/frontends/kde/refdlg.C:
175 * src/frontends/kde/tabcreatedlg.C:
176 * src/frontends/kde/tocdlg.C:
177 * src/frontends/kde/urldlg.C: add necessary headers
180 * src/frontends/kde/dlg/emptytable.C:
181 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
182 default parameters (from Angus Leeming)
184 * src/frontends/kde/dlg/moc/.cvsignore:
185 * src/frontends/kde/dlg/.cvsignore:
186 * src/frontends/kde/moc/.cvsignore: fix the library name
189 * src/frontends/kde/paradlg.C:
190 * src/frontends/kde/parageneraldlg.C:
191 * src/frontends/kde/dlg/para.dlg:
192 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
194 * src/frontends/kde/dlg/README: clarified qtarch version
196 * src/frontends/kde/dlg/Makefile.am: removed the
197 dlg rules as they created spontaneous rebuilds
198 (not a good idea as it requires qtarch)
200 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
202 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
203 fixlevel along with xforms version.
205 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
206 xforms version is strictly less than 0.89.5.
207 * src/lyx_gui.C (LyXGUI): ditto.
208 * src/LyXView.C (show): ditto.
210 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
212 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
213 movement in inset in RTL text.
214 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
215 (workAreaButtonRelease): Do not open a float when there is a selection.
217 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
219 * src/spellchecker.C (RunSpellChecker): Open all floats before
222 * src/text.C (InsertChar): Consider "," as a part of a number
223 (for LTR numbers in RTL text code).
224 (IsBoundary): Fixed (and simplified).
225 (InsertChar): Recalculate cursor boundary.
228 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
230 * src/spellchecker.C: fix figures with pspell enabled
232 * src/insets/figinset.C: workaround for gs hang xforms bug
234 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
236 * lib/bind/??_menus.bind: comment out the entries corresponding to
237 real menus. They should be eventually removed, but I'll let the
238 language maintainers do that.
240 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
242 * src/frontends/kde/parageneraldlg.C:
243 * src/frontends/kde/parageneraldlg.h: don't use
244 a derived class for SpaceAbove/Below
246 * src/frontends/kde/dlg/README: add some info
248 * src/frontends/kde/dlg/*: update data files, update
251 * src/frontends/kde/dlg/moc/Makefile.am: add
254 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
256 * configure.in: add new KDE Makefiles
257 * src/vspace.h: return GlueLength not a normal one
258 * src/support/lstrings.h:
259 * src/support/lstrings.C: add isStrUnsignedInt(),
262 * src/frontends/kde/*: big reorganisation, update
263 FormParagraph, add FormTabCreate
265 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
267 * lib/ui/default.ui: small grammatical change.
269 * src/frontends/xforms/xform_macros.h: removed.
271 * src/frontends/xforms/FormBase.C:
272 * src/frontends/xforms/FormPreferences.C:
273 * src/frontends/xforms/Makefile.am: changes associated with removing
274 xform_macros.h. Should make Lars' debugging a little easier.
276 * src/frontends/xforms/FormPreferences.C:
277 * src/frontends/xforms/FormPreferences.h:
278 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
279 longer use X11 color name database. HSV and RGB dials/sliders.
280 Please let this be the end of this!
282 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
284 * Several files: Allow compilation when the compiler doesn't
287 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
290 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
291 command line options.
293 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
295 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
296 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
299 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
301 * src/frontends/xforms/FormRef.C (updateBrowser):
302 * src/frontends/xforms/forms/form_ref.fd: try clicking on
303 different insets with the sort key active. Now apply this patch!
305 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
307 * src/frontends/xforms/FormPrint.C: set to valid()
308 when we update from the passed parameters.
310 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
312 * src/LColor.C (getFromGUIName): internationalise the comparison.
314 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
315 FormPreferences choice.
317 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
320 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
322 * src/lyxrc.C: more detail for the printer program config
325 * src/LColor.C: ert->latex text. LColor needs a big revamp
326 but will have to wait till after 1.1.6
328 * src/buffer.C: bring up a dialog if we load a document
329 with an un-installed text class, rather than just complain
332 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
334 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
335 the browser form for a combox in a tabbed folder. Bug fix courtesy of
336 Steve Lamont <spl@ncmir.ucsd.edu>.
338 * src/frontends/xforms/FormDocument.C (build):
339 * src/frontends/xforms/FormPreferences.C (Language::build):
340 pass tabfolders to Combox::add() in order to use this work around.
342 * src/frontends/xforms/FormCitation.C (connect): remove max size
344 (update): sort list of bibliography keys.
346 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
348 No max size limitation. Same popup for new and existing insets. Fixes
349 bugs reported by Rob Lahaye.
351 * src/frontends/xforms/FormCitation.C (c-tor):
352 * src/frontends/xforms/FormCopyright.C (c-tor):
353 * src/frontends/xforms/FormError.C (c-tor):
354 * src/frontends/xforms/FormGraphics.C (c-tor):
355 * src/frontends/xforms/FormIndex.C (c-tor):
356 * src/frontends/xforms/FormRef.C (c-tor):
357 * src/frontends/xforms/FormToc.C (c-tor):
358 * src/frontends/xforms/FormUrl.C (c-tor):
359 use correct policy for ButtonController.
361 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
363 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
366 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
368 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
369 Some resizing changes.
371 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
373 * configure.in: fix typo
375 * lib/languages: add ukraninian and change no to no_NO
377 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
379 * src/bufferview_funcs.C (FontSize): use setLyXSize
381 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
383 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
384 to check for systems where mkstemp() is available but not declared
385 in headers. The new autoconf macro lyx_CHECK_DECL can be used
386 to check for declarations in headers.
388 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
390 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
392 * forms/makefile: added bibforms.fd, include_form.fd.
393 Removed lyx_sendfax.fd.
395 * src/LaTeXLog.C (ShowLatexLog):
396 * src/LyXAction.C (init):
397 * src/bufferparams.C (readLanguage): altered messages as suggested by
400 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
403 * src/credits.C: made fd_form_credits non-static, so that it can be
404 redrawn should the xforms colors be re-mapped.
405 * src/spellchecker.C ditto fd_form_spell_options.
407 * src/filedlg.[Ch] (redraw):
408 * src/intl.[Ch] (redraw):
409 * src/lyxfr0.[Ch] (redraw):
410 * src/insets/figinset.[Ch] (redraw):
411 * src/insets/insetexternal.[Ch] (redraw):
412 new methods, connected to Dialogs::redrawGUI.
414 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
415 to be connected to Dialogs::redrawGUI.
417 * src/frontends/xforms/FormCitation.C (build):
418 * src/frontends/xforms/FormCopyright.C (build):
419 * src/frontends/xforms/FormError.C (build):
420 * src/frontends/xforms/FormGraphics.C (build):
421 * src/frontends/xforms/FormIndex.C (build):
422 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
423 * src/frontends/xforms/FormToc.C (build):
424 * src/frontends/xforms/FormUrl.C (build):
425 use the ButtonController correctly.
427 * src/frontends/xforms/FormCopyright.C (build):
428 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
429 the .fd file and into build().
431 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
433 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
435 * src/frontends/xforms/forms/form_citation.fd:
436 * src/frontends/xforms/forms/form_copyright.fd:
437 * src/frontends/xforms/forms/form_error.fd:
438 * src/frontends/xforms/forms/form_graphics.fd:
439 * src/frontends/xforms/forms/form_index.fd:
440 * src/frontends/xforms/forms/form_toc.fd:
441 * src/frontends/xforms/forms/form_url.fd:
442 renamed some of the objects. Named others explicitly for the first time.
443 Added Restore and Apply buttons where appropriate.
445 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
448 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
450 * src/version.h: try the pre2 again
452 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
454 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
456 * src/frontends/kde/FormParagraph.C: added using directive.
458 * src/frontends/kde/paradlg.C: added config.h and using directive.
460 * src/frontends/kde/paradlg.h: added std::qualifier.
462 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
464 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
466 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
468 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
470 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
472 * src/version.h: set back to 1.1.6cvs
474 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
476 * src/version.h: set to 1.1.6pre2
478 2000-11-20 Marko Vendelin <markov@ioc.ee>
480 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
482 * src/frontends/gnome/Makefile.am: updated list of XForms object files
484 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
486 * src/LColor.C (init):
487 * src/lyxrc.C (getDescription): changed some comments as suggested by
490 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
491 disconnect the redrawGUI signal in best-practice fashion.
493 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
494 long_opts_tab to reflect the change in name of this tabfolder, as
495 suggested by John Levon.
496 (connect, disconnect): new methods. Don't do much at present other than
497 ensuring that we can't resize the dialog. This just makes xforms go
499 (lots of methods in Colors): made void rather than bool. The idea is
500 to have an isOk() function that keeps track of whether any input is
501 genuinely invalid and should therefore block Save, Apply.
502 Easier to manipulate the counters rapidly.
503 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
504 compiler will like this code. Much cleaner way of doing things.
506 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
508 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
509 rather than simple counters, following suggestion by John Levon.
511 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
512 than engraved frame + text.
514 * src/frontends/xforms/forms/makefile: removed spurious command.
516 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
518 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
520 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
523 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
525 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
526 see what Lars has changed and what is just white space!
527 Now used X directly to ascertain the RGB color associated with the
529 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
531 Added some sort capability.
532 The X11 color name database input is only displayed if the database
533 isn't found in the standard place.
534 Got rid of struct compare_converter; it wasn't used.
535 Probably some other stuff that I've forgotten.
537 * src/frontends/xforms/FormPreferences.h: changed the names of some
538 methods in the Colors struct. Added a couple of structs to help sort
539 colors by name and by RGBColor.
541 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
542 functions into a new class RWInfo.
544 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
545 The dialog is now almost navigable using the keyboard. Unfortunately,
546 the cursor has to be inside a browser for it to be activated. There is
547 no visual feedback for the key shortcuts to the arrow keys (use
548 Alt-appropriate arrow key, Alt-x).
550 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
553 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
554 xform_helpers.[Ch]. See above.
556 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
558 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
560 * src/screen.C (setCursorColor): new method. Sets the color of the
562 (ShowManualCursor): call it.
563 Constify some local variables.
565 * src/LColor.[Ch] (LColor): add entry for cursor
566 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
569 2000-11-19 Juergen Vigna <jug@sad.it>
571 * src/insets/insettabular.C (draw): fixed text border redraw problem.
572 (calculate_dimensions_of_cells): try to boost up when inserting chars.
574 2000-11-15 Rob Lahaye <lahaye@postech.edu>
576 * lib/ui/default.ui: OptItem used for Fax entry
578 2000-11-17 Matej Cepl <cepl@bigfoot.com>
580 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
582 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
584 * src/vspace.C (nextToken): fix so it can handle length phrases like
585 "10mm+-20mm", "40inplus16mmminus10cm" etc.
587 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
589 * src/frontends/xforms/FormPreferences.C: constify several variables
590 (BrowserLyX): rewrite to not need the choice variable
591 (Modify): rewrite to not need the choide variable
592 (compare_converter): make operator const
594 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
595 correct the writing of \set_color
596 (getDescription): return a const string
598 * src/kbsequence.[Ch] (addkey): remove dead code
600 * src/Painter.C (text): remove some commented code
602 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
604 * src/ColorHandler.[Ch]: removed some header files from .h file.
605 Included LColor.h in .C file.
607 * src/LColor.[Ch]: made class copyable so that I could create a
608 system_lcolor instance.
610 * src/Painter.h: removed LColor.h.
612 * src/lyx_gui.C (create_forms): used AddName.
614 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
615 of user preferences/lyxrc file.
617 * src/lyxrc.C (output): output changes to lcolor.
619 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
621 Moved class xformColor to files xform_helpers.[Ch]. These files,
622 Color.[Ch], could now be moved into src if they would be useful to
625 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
626 Also moved FormPreferences::browseFile here as it can be used by any
627 xform dialog with a "Browse" button. FormGraphics is a perfect example.
629 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
630 ReadableFile): changed the FormPreferences methods a little and moved
631 them here as they'll be useful elsewhere also.
633 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
634 Removed some header files and used forward declarations instead.
636 Removed some methods as they'll be useful elsewhere (see above).
638 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
639 Can also now modify the LyX LColors. However, for reasons that I don't
640 yet understand, it appears that we can use
641 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
642 present. The problem appears to lie in ColorHandler, because I can
643 change the color using LColor.SetColor(). Similarly, when reading in a
644 preferences file with some set_color instances, I'll get a warning
645 like: Color sea green is undefined or may not be redefined
646 Bad lyxrc set_color for sea green
648 Once the buffer is loaded, however, I can happily change to this color.
650 Finally, it appears that I have to set the color of "inset frame"
651 explicitly, or it oscillates from "black" to "indian red" with each
654 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
656 * ANNOUNCE: corrected a spelling mistake.
658 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
661 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
663 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
665 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
668 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
669 match the requirements from the standard better. This is required
670 to work with gnu libstdc++-v3
672 * src/frontends/xforms/FormPreferences.C: add explict pair
673 arguments to browse calls. include support/lyxmanip.h remvoe
674 extern fmt. whitespace changes. reorder variables in
675 FormPreferences.h, to match initalizaton order.
677 * several files: constify more local variables.
679 * src/buffer.C: remove some commented functions.
681 * src/DepTable.C (remove_files_with_extension): temporary
682 work around for gcc 2.97
683 * src/filedlg.C (find): ditto
684 * src/Variables.C (set): ditto
685 * src/LyXAction.C (searchActionArg): ditto
686 (retrieveActionArg): ditto
688 * configure.in: check for mktemp too
690 * UPGRADING: prepare for 1.1.6
692 * Makefile.am (lgbtags): add backup tags for when etags are
693 different than usual.
695 * ANNOUNCE: prepare for 1.1.6
697 * src/support/tempname.C (make_tempfile): new function, wrapper
698 around mkstemp and mktemp. Only mkstemp has been tested.
701 2000-11-14 Rob Lahaye <lahaye@postech.edu>
703 * default.ui: capitalized some menu items to improve shortcuts.
705 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
707 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
709 * src/frontends/xforms/Dialogs.C: add "using" directive.
711 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
713 * src/filedlg.C (Select): highlight suggested file in browser, if
716 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
717 each tab folder is encapsulated in its own class.
718 The Language keymaps are now chosen using a text input and a
719 browser button, rather than a Combox.
720 All the browser buttons are now functional, although LyXFileDlg
721 still needs to be modified to make it straighhtforward to return a
722 directory if that is what is desired.
724 * src/frontends/xforms/forms/form_preferences.fd: use text input
725 and browse button to input the Language keymaps. Add a few
726 callbacks for the browse buttons.
728 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
730 * src/support/tempname.C (tempName): small changes to make it
731 safer. remove the '.' before XXXXXX
733 * src/support/filetools.C (TmpFileName): remove func
736 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
737 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
738 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
739 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
741 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
744 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
747 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
748 for bp (this fixes a reproducible hard crash)
750 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
753 * src/frontends/xforms/FormBase.h: make bp_ private
754 (FormBaseBI): remove default for bp
757 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
760 * src/frontends/xforms/Color.C (RGBColor): made several vars
761 const, changed initialization of j to allow it to be const
764 * several files: added const to local variables.
766 * src/lyx_cb.C: removed several function prototypes and moved them
770 (UpdateLayoutPreamble):
772 (MenuInsertLabel): add BufferView as arguemnt
773 (LayoutsCB): make tmp const
775 * src/layout_forms.h: regenerated
777 * src/debug.C: add Debug::FILES
778 (showLevel) (showTags): translate the desc
780 * src/debug.h: add FILES as debug target
782 * src/bufferlist.C: use current_view as an interim measure becuase
783 of added arguments to MenuWrite and MenuWriteAs
785 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
787 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
789 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
790 libstdc++ is compiled with.
792 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
794 * lib/layouts/docbook-book.layout
795 * lib/layouts/docbook.layout
796 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
797 those paragraphs are expresse as SGML comments <!-- -->.
799 * src/LaTeXFeatures.h
800 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
801 parameter, this allows to express all the include files as relative
802 paths to the master buffer. The verbatim insert works as the other
805 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
807 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
809 (MakeDocBookFile): top_element is always written. Some clean up, as
810 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
812 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
813 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
814 a reference is written instead of the name.
815 (Validate): use the relative path for the filename.
817 * src/insets/insetlabel.C (DocBook): write end tag, for XML
820 * src/support/filetools.h
821 * src/support/filetools.C (IsSGMLFilename): added.
824 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
826 * development/OS2/quick_fix.patch:
828 * README.OS2: quick update to the OS/2 port.
830 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
832 * src/converter.C: add "using" directive.
834 * src/frontends/xforms/FormPreferences.C: add "using" directive.
835 (compare_converter): add "int" as return type.
837 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
840 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
842 * src/lyx_gui.C (create_forms): map the xform colours, should a
843 mapping exist. Ie, call XformColor::read().
845 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
846 and struct HSV as HSVColor.
847 (XformColor::read, XformColor::write) : new methods that
848 input/output any changes to the cform GUI colors.
850 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
853 * src/frontends/xforms/FormPreferences.C Lots of little changes
854 associated with the changed name of the RGB and HSV structs. Can
855 now save changes to xforms GUI to file. Commented out
856 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
857 used currently anyway.
859 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
861 * src/converter.C: A lot of changes:
862 - It is no longer possible to choose between two or more ways to
863 export to some format (the new code uses only the shortest path).
864 However, it is still possible to choose between pdflatex/ps2pdf
865 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
866 - Added several methods that makes the FormPreferences code simpler.
867 - Changed the tokens $$FName and $$OutName to $$i and $$o.
869 * src/exporter.C (Export): lyxrc.use_pdf is set before
870 makeLaTeXFile is called. This works but not very nice.
872 * src/frontends/xforms/FormPreferences.C: The formats/converters
873 tabs are now fully functional.
875 * src/buffer.C (getTocList): Add numbers to the captions.
877 * lib/lyxrc.example: Removed fax section
879 * src/support/rename.C (rename): Delete the old file if lyx::copy
882 2000-11-13 Rob Lahaye <lahaye@postech.edu>
884 * lib/ui/default.ui: minor polishing.
886 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
888 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
891 * lib/Makefile.am (DOCINST): do not install everything in the
892 documentation directory.
894 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
896 * src/bufferlist.C (newFile): set the filename to the constructed
899 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
900 constructed "newfileXX.lyx" name to the dialog
902 * src/frontends/DialogBase.h: make update() non-abstract so
903 KDE doesn't need to implement two update methods for every form
905 * src/frontends/kde/Makefile.am: add missing xforms objects
908 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
910 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
912 * src/frontends/xforms/Color.[Ch]: new files, defining the color
913 structs RGB and HSV. May not be the best place for these files.
914 Perhaps move them into src ?
916 * src/frontends/xforms/Makefile.am: added new files.
918 * src/frontends/xforms/forms/form_preferences.fd:
919 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
920 replaced all instances of "colour" with "color"!
922 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
925 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
926 tab. Can now alter the colors of the xform's GUI on the fly. With
927 the aid of a single static Signal (see below), can "Apply" these
928 changes to all currently open dialogs. (Well, to all of the NEW
929 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
930 subsequently opened dialogs will, of course, also have the new
931 color scheme. Cannot yet save (or load) the choices to file, so
932 they are lost when exiting LyX.
934 * src/frontends/Dialogs.h:
935 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
936 Used to trigger a redraw of any dialogs connected to it because,
937 for example, the GUI colours have been re-mapped.
939 * src/frontends/xforms/FormBase.[Ch]:
940 * src/frontends/xforms/FormDocument.[Ch]:
941 * src/frontends/xforms/FormParagraph.[Ch]:
942 * src/frontends/xforms/FormPreferences.[Ch]:
943 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
944 method, to be connected to Dialogs::redrawGUI. Method must be
945 virtual, because dialogs with tabbed folders need to redraw the
946 forms of each tab folder.
948 * src/LyXView.C (d-tor):
949 * src/frontends/xforms/FormBase.C (d-tor): connected
950 Dialogs::redrawGUI signal to redraw().
952 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
953 removed Assert, because it is identical to that in FormBase.
955 2000-11-10 Rob Lahaye <lahaye@postech.edu>
957 * lib/ui/default.ui: minor polishing.
959 2000-11-10 Juergen Vigna <jug@sad.it>
961 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
962 (deleteLyXText): ditto
964 * src/insets/insettabular.C (InsetButtonPress): don't clear the
965 selection on mouse-button-3.
967 * src/insets/insettabular.h: new function clearSelection(), use this
968 functions inside insettabular.C.
970 * src/insets/insettabular.C (TabularFeatures): clear the selection
971 on remove_row/column.
973 * src/insets/inset.C (scroll): fixed some scroll stuff.
975 * src/insets/insettabular.C (draw): fixed another minor draw problem.
977 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
979 * lib/CREDITS: add Yves Bastide
981 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
983 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
984 check whether C library functions are in the global namespace.
986 * configure.in: calls it.
988 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
991 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
993 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
994 iterators to prevent crash.
996 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
998 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1000 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1001 shortcut for xforms CB to the preemptive or post-handler function.
1003 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1004 removed the HIDDEN_TIMER as it's no longer used.
1005 Various other small changes.
1007 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1008 preemptive handler to obtain feedback, rather than the post-handler.
1009 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1011 Formats tab is now complete. Converters tab is nearly so.
1013 2000-11-09 Juergen Vigna <jug@sad.it>
1015 * src/insets/insettext.C (~InsetText):
1018 (SetParagraphData): set cache.second to 0 after deleting it!
1019 (getLyXText): check if cache.second is not 0 if finding it.
1021 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1023 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1024 lyxlex to parse the rgb.txt file.
1027 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1028 replace the default '#' comment character.
1030 * src/support/tempname.C: add "using" directive
1031 * src/frontends/ButtonPolicies.C: ditto.
1033 * src/support/filetools.C (DirList): add an explicit cast to avoid
1034 a compile error (probably not the right fix)
1036 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1038 * src/support/filetools.C (DirList): implement using system functions
1040 * src/support/tempname.C: new file
1042 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1044 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1046 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1049 * src/frontends/xforms/ButtonController.C: new file
1051 * src/os2_defines.h: remove getcwd define
1053 * src/lyxvc.C: include support/lyxlib.h
1054 (showLog): use lyx::tempName
1056 * src/lyx_cb.C: comment out includes that we don't need
1057 (AutoSave): use lyx::tempName
1059 * src/filedlg.C: include support/lyxlib.h
1060 (Reread): use lyx::getcwd
1062 * src/converter.C: include support/filetools.h
1063 (add_options): change to static inline, make tail const
1064 (Add): make old_viewer const
1065 (GetAllFormats): make it a const method, use const_iterator
1066 (enable): make static inline
1067 (SplitFormat): make using_format const
1069 * src/LaTeX.C (run): use lyx::getcwd
1071 * configure.in: check for mkstemp as well
1073 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1075 * src/converter.[Ch] (GetAllCommands): new method.
1077 * src/support/filetools.[Ch] (DirList): new method.
1079 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1080 functionality to the converters tab.
1081 The formats tab is now nearly complete.
1082 The kbmap choices in Languages tab now display the contents of
1083 system_lyxdir/kbd/*.kmap in readable form.
1085 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1086 Moved some variables into the class.
1088 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1089 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1090 colour of active folder to lighter grey instead. Any takers?
1091 (form_colours): added an "Apply" button.
1092 (form_converters): added a "Flags" input field.
1093 (form_formats): added a "Shortcut" input field. Note that we can't use
1094 names such as "input_shortcut" as this buggers up the sed script stuff.
1096 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1104 * src/lyx_sendfax_main.C:
1107 * src/spellchecker.C:
1108 * src/insets/figinset.C:
1109 * src/insets/insetbib.C:
1110 * src/insets/insetexternal.C:
1111 * src/insets/insetinclude.C:
1112 * src/insets/insetinfo.C:
1113 * src/mathed/math_panel.C:
1114 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1115 all "daughter" dialogs now have identical "feel".
1117 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1119 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1120 used (and was only used in one place prior to this patch. Incorrectly!)
1122 * src/frontends/xforms/FormDocument.C: changed some instances of
1123 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1124 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1125 for options_->input_float_placement. This fixes a bug reported by
1128 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1129 functionality into d-tor.
1131 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1132 input of numerals also.
1134 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1135 fl_set_form_atclose(). Can now close dialog from window manager,
1136 fixing a bug reported by Rob Lahaye.
1138 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1140 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1141 are no longer dark. Haven't yet worked out how to lighten the colour of
1142 the active tabfolder. Any ideas anybody?
1143 Adjusted Colours tab a little.
1144 Added Shortcut field to converters tab. Note that we can't create an
1145 fdesign label like "input_shortcut" as this buggers up the sed-script
1148 * src/frontends/xforms/FormPreferences.[Ch]:
1149 (feedback): fixed crash due to to ob=0.
1150 (LanguagesXXX): the kbmap choices now contain the files
1151 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1152 be replaced by an input with a file browse button, but since the browse
1153 buttons don'y yet work, this'll do for the moment.
1154 (FormatsXXX): think that this is now nearly fully functional.
1155 Some points/questions though:
1156 1. Does "Apply" remove formats if no longer present?
1157 2. I think that the browser should list the GUI names rather than the
1159 3. Must ensure that we can't delete Formats used by an existing
1162 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1163 if this is the best way to do this.
1165 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1167 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1169 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1170 for variable assignment.
1172 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1174 * src/lib/ui/default.ui: added sub/superscripts to menu as
1175 Insert->Special characters and cleaned-up the file a bit
1177 2000-11-07 Allan Rae <rae@lyx.org>
1179 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1180 ob isn't 0 before using it. See comments in function.
1182 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1184 * src/frontends/xforms/form_*.C: regenerated
1186 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1188 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1190 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1191 compiling with gcc-2.96
1193 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1195 * src/support/lyxstring.C: add a couple "using" directives.
1197 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1198 a .c_str() here too for good measure.
1199 * src/Spacing.C (set): ditto.
1200 * src/lyxfunc.C (Dispatch): ditto.
1202 * src/insets/insettabular.C (copySelection): change .str() to
1203 .str().c_str() to fix problems with lyxstring.
1204 * src/support/filetools.C (GetFileContents): ditto.
1205 * src/buffer.C (asciiParagraph): ditto.
1206 * src/paragraph.C (String): ditto.
1208 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1209 * lib/bind/sciword.bind: ditto.
1211 * src/LyXAction.C (init): remove "symbol-insert" function, which
1212 shared LFUN_INSERT_MATH with "math-insert".
1214 * lib/configure.m4: == is not a valid operator for command test.
1216 * src/lyxrc.C: add using directive.
1218 * src/converter.h: add std:: qualifier.
1220 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1222 * src/converter.[Ch] and other files: Change the Format class to a
1223 real class, and create two instances: formats and system_format.
1225 * src/lyxrc.C (output): Output the difference between formats and
1228 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1229 (buildFormats): Insert formats into browser.
1230 (inputFormats): Made the browser and add button functional.
1231 (applyFormats): Update formats from format_vec.
1233 * src/converter.C: Changed all (*it). to it->
1234 (Format::dummy): New method.
1235 (Format::importer): New format flag.
1236 (Formats::GetAllFormats): New method.
1237 (Formats::Add): Delete format from the map if prettyname is empty.
1238 (Converter::Convert): Print an error message if moving the file fails.
1239 (Converter::GetReachableTo): New method
1241 * src/MenuBackend.[Ch]: Add support for importformats tag.
1243 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1245 * lib/configure.m4: Add word->tex and ps->fax converters.
1247 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1248 Return fax to file menu.
1252 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1254 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1257 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1260 * src/lyxfunc.C (processKeyEvent): removed
1262 * src/bufferlist.C (emergencyWrite): removed the out commented
1263 emergency write code.
1265 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1267 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1269 * many files: change formatting to be a bit more uniform for
1270 if,while,for,switch statements, remove some parantesis not needed.
1273 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1275 * config/kde.m4: make config more robust when KDEDIR is set
1277 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1279 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1280 not returned a pixmap for "math-insert".
1282 * src/LyXAction.C (init): sort the entries a bit.
1284 2000-11-03 Juergen Vigna <jug@sad.it>
1286 * src/insets/insettabular.h: added fixed number to update codes so
1287 that update is only in one direction.
1289 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1292 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1293 before call to edit because of redraw.
1295 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1297 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1299 * lib/ui/default.ui: Populate "edit_float" menu
1301 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1303 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1304 "floats-operate". The name is ugly (and the func also), but this
1305 is just a band-aid until we switch to new insets.
1307 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1309 * lib/ui/default.ui: update again the menu layout (fix some
1312 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1314 * src/MenuBackend.h (fulllabel): new method.
1316 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1317 the menu shortcuts of a menu are unique and whether they
1318 correspond to a letter of the label.
1319 (expand): call checkShortcuts when debugging.
1321 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1323 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1325 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1327 * lib/examples/*.lyx : '\language default' => '\language english'
1329 * lib/examples/it_splash.lyx : except where it should be italian
1331 * lib/templates/*.lyx : the same
1333 * doc/*.lyx* : the same
1335 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1337 * lib/bind/menus.bind: remove the Layout menu entries, which I
1338 somehow forgot earlier.
1340 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1342 * lib/ui/old-default.ui: keep the old one here for reference (to
1345 * lib/ui/default.ui: update the menu layout
1347 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1349 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1350 Can now Apply to different insets without closing the dialog.
1352 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1353 Can't actually DO anything with them yet, but I'd like a little
1356 * src/frontends/xforms/input_validators.[ch]
1357 (fl_lowercase_filter): new.
1359 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1361 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1362 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1364 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1366 2000-11-02 Juergen Vigna <jug@sad.it>
1368 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1369 on char insertion as it has already be updated by bv->updateInset().
1371 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1372 if an inset inside was updated.
1374 * lib/configure.cmd: commented out fax-search code
1376 2000-11-01 Yves Bastide <stid@acm.org>
1378 * src/tabular.C (OldFormatRead): set tabular language to the
1381 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1383 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1384 class names with non-letter characters (from Yves Bastide).
1386 * lib/ui/default.ui: change Item to OptItem in import menu.
1387 Comment out fax stuff.
1389 * lib/configure.m4: comment out fax-related stuff.
1391 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1393 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1394 useful xforms helper functions. At present contains only formatted().
1395 Input a string and it returns it with line breaks so that in fits
1398 * src/frontends/xforms/Makefile.am: add new files.
1400 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1401 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1404 * src/frontends/xforms/FormPreferences.[Ch]:
1405 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1406 but lots of little clean ups. Removed enum State. Make use of
1407 formatted(). Constify lots of methods. Perhaps best of all: removed
1408 requirement for that horrible reinterpret_cast from pointer to long in
1411 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1413 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1414 conditionalize build on xforms < 0.89
1416 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1418 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1420 * src/LyXAction.C (init): comment out fax
1422 * src/lyxrc.h: comment out the fax enums
1423 comment out the fax variables
1425 * src/commandtags.h: comment out LFUN_FAX
1427 * src/lyxrc.C: disable fax variables.
1428 (read): disable parsing of fax variables
1429 (output): disable writing of fax variables
1430 (getFeedback): now description for fax variables
1432 * src/lyxfunc.C: comment out MenuFax
1433 (Dispatch): disable LFUN_FAX
1435 * src/lyx_cb.C (MenuFax): comment out
1437 * src/WorkArea.C: add <cctype>
1438 (work_area_handler): better key handling, should be ok now.
1439 for accented chars + etc
1441 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1442 lyx_sendfax.h and lyx_sendfax_man.C
1444 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1445 (show): don't call InitLyXLookup when using xforms 0.89
1447 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1449 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1451 * src/support/filetools.C (GetFileContents): close to dummy change
1453 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1455 * src/trans.C (AddDeadkey): workaround stupid compilers.
1457 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1459 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1460 of two-sided document.
1462 2000-10-31 Juergen Vigna <jug@sad.it>
1464 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1466 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1467 xposition to the Edit call.
1469 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1471 * src/trans.C (AddDeadkey): cast explicitly to char.
1473 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1475 * src/tabular.C (AsciiBottomHLine): simplify?
1476 (AsciiTopHLine): simplify?
1477 (print_n_chars): simplify
1478 (DocBook): remove most of the << endl; we should flush the stream
1479 as seldom as possible.
1481 (TeXBottomHLine): ditto
1482 (TeXTopHLine): ditto
1484 (write_attribute): try a templified version.
1485 (set_row_column_number_info): lesson scope of variables
1487 * src/support/lstrings.h (tostr): new specialization of tostr
1489 * src/trans.C (AddDeadkey): slightly cleaner fix.
1491 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1493 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1494 '%%' in Toc menu labels.
1497 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1498 font_norm is iso10646-1.
1500 * src/font.C (ascent): Fixed for 16bit fonts
1501 (descent,lbearing,rbearing): ditto
1503 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1505 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1506 (getFeedback): new static method.
1508 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1509 Now use combox rather than choice to display languages.
1510 Feedback is now output using a new timer callback mechanism, identical
1511 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1513 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1515 * src/minibuffer.C: fix for older compilers
1517 2000-10-30 Juergen Vigna <jug@sad.it>
1519 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1520 has to be Left of the inset otherwise LyXText won't find it!
1522 * src/BufferView2.C (open_new_inset): delete the inset if it can
1525 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1527 * lyx.man: fix typo.
1529 2000-10-29 Marko Vendelin <markov@ioc.ee>
1530 * src/frontends/gnome/FormCitation.C
1531 * src/frontends/gnome/FormCitation.h
1532 * src/frontends/gnome/FormCopyright.C
1533 * src/frontends/gnome/FormCopyright.h
1534 * src/frontends/gnome/FormError.C
1535 * src/frontends/gnome/FormError.h
1536 * src/frontends/gnome/FormIndex.C
1537 * src/frontends/gnome/FormIndex.h
1538 * src/frontends/gnome/FormPrint.C
1539 * src/frontends/gnome/FormPrint.h
1540 * src/frontends/gnome/FormRef.C
1541 * src/frontends/gnome/FormRef.h
1542 * src/frontends/gnome/FormToc.C
1543 * src/frontends/gnome/FormToc.h
1544 * src/frontends/gnome/FormUrl.C
1545 * src/frontends/gnome/FormUrl.h
1546 * src/frontends/gnome/Menubar_pimpl.C
1547 * src/frontends/gnome/mainapp.C
1548 * src/frontends/gnome/mainapp.h
1549 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1550 changing update() to updateSlot() where appropriate
1552 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1554 * src/frontends/xforms/FormPreferences.[Ch]:
1555 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1558 2000-10-28 Juergen Vigna <jug@sad.it>
1560 * src/insets/insettabular.C (draw): fixed drawing bug.
1562 * src/insets/insettext.C (clear):
1564 (SetParagraphData): clearing the TEXT buffers when deleting the
1565 paragraphs used by it.
1567 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1569 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1571 2000-10-27 Juergen Vigna <jug@sad.it>
1573 * src/tabular.C (~LyXTabular): removed not needed anymore.
1575 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1578 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1580 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1583 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1586 * src/frontends/xforms/FormPreferences.[Ch]:
1587 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1588 Reorganised as modules based on tabs. Much easier to follow the
1589 flow and to add new tabs. Added warning and feedback messages.
1592 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1594 * src/tabular.h (DocBook): add std:: qualifier.
1596 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1598 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1599 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1602 * insettabular.C (DocBook): uses the tabular methods to export
1605 * src/insets/insettext.h
1606 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1608 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1610 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1613 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1614 moved misplaced AllowInput two lines up.
1616 * src/buffer.C (readFile): compare float with float, not with int
1618 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1620 * src/minibuffer.C: add "using SigC::slot" statement.
1622 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1624 * src/frontends/xforms/forms/README: updated section about make.
1626 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1627 Tidied some forms up, made two of form_tabular's tabs more
1628 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1629 fixed translation problem with "Column".
1631 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1633 * src/minibuffer.h: use Timeout instead of the xforms timer
1635 (setTimer) rewrite for the Timeout, change to unsigned arg
1636 (set): change to unsigned timer arg
1639 * src/minibuffer.C (TimerCB): removed func
1640 (C_MiniBuffer_TimerCB): removed func
1641 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1642 (peek_event): use a switch statement
1643 (add): don't use fl_add_timer.
1644 (Set): rewrite to use the Timeout
1647 * src/Timeout.[Ch] (setType): return a Timeout &
1648 (setTimeout): ditto, change to unsigned arg for timeout
1650 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1652 * src/mathed/formula.C (mathed_string_width): Use string instead
1653 of a constant size char array.
1655 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1657 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1658 the two recently added operator<< for SMInput and State.
1660 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1662 (OkCancelPolicy): ditto
1663 (OkCancelReadOnlyPolicy): ditto
1664 (NoRepeatedApplyReadOnlyPolicy): ditto
1665 (OkApplyCancelReadOnlyPolicy): ditto
1666 (OkApplyCancelPolicy): ditto
1667 (NoRepeatedApplyPolicy): ditto
1669 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1671 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1672 add the usual std:: qualifiers.
1674 2000-10-25 Juergen Vigna <jug@sad.it>
1676 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1678 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1680 * src/support/filetools.C (MakeRelPath): change some types to
1683 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1684 ButtonPolicy::SMInput and ButtonPolicy::State.
1686 * src/FontLoader.C (reset): small cleanup
1687 (unload): small cleanup
1689 * src/FontInfo.C (getFontname): initialize error to 10000.0
1691 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1693 * src/frontends/xforms/FormPreferences.[Ch]:
1694 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1695 TeX encoding and default paper size sections.
1697 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1699 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1702 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1703 make the message_ empty.
1704 (FormError): don't initialize message_ in initializer list.
1706 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1708 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1710 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1712 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1714 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1716 * src/frontends/kde/*data.[Ch]: _("") is not
1719 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1721 * src/buffer.C: removed redundant using directive.
1723 * src/frontends/DialogBase.h: revert to original definition of
1726 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1727 stuff into two classes, one for each dialog, requires a new
1728 element in the dialogs vector, FormTabularCreate.
1730 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1733 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1734 method. Continues Allan's idea, but means that derived classes
1735 don't need to worry about "update or hide?".
1737 * src/frontends/xforms/FormError.C (showInset): add connection
1740 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1741 one for each dialog. FormTabular now contains main tabular dialog
1744 * src/frontends/xforms/FormTabularCreate.[Ch]:
1745 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1748 * src/frontends/xforms/FormGraphics.[Ch]:
1749 * src/frontends/xforms/forms/form_graphics.fd
1750 * src/frontends/xforms/FormTabular.[Ch]:
1751 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1752 classes of FormInset.
1754 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1755 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1757 * src/frontends/xforms/Makefile.am:
1758 * src/frontends/xforms/forms/makefile: added new files.
1760 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1761 variable. added Signal0 hide signal, in keeping with other GUI-I
1764 * src/support/lstrings.h: removed redundant std:: qualifier as
1765 it's already declared in Lsstream.h.
1767 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1769 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1773 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1775 * src/tabular.C (Ascii): minimize scope of cell.
1777 * src/BufferView2.C (nextWord): return string() instead of 0;
1779 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1781 * src/converter.h: add a std:: qualifier
1783 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1785 * src/importer.[Ch]: New files. Used for importing files into LyX.
1787 * src/lyxfunc.C (doImport): Use the new Importer class.
1789 * src/converter.h: Add shortcut member to the Format class.
1790 Used for holding the menu shortcut.
1792 * src/converter.C and other files: Made a distinction between
1793 format name and format extension. New formats can be defined using
1794 the \format lyxrc tag.
1795 Added two new converter flags: latex and disable.
1797 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1799 * src/support/lyxlib.h: unify namespace/struct implementation.
1800 Remove extra declarations.
1802 * src/support/chdir.C (chdir): remove version taking char const *
1804 * src/support/rename.C: ditto.
1805 * src/support/lyxsum.C: ditto.
1807 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1809 * src/frontends/xforms/FormBase.[Ch]:
1810 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1811 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1812 work only for the next call to fl_show_form(). The correct place to set
1813 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1814 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1815 from FormBase have the minimum size set; no more stupid crashes with
1818 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1820 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1822 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1824 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1826 * src/support/lyxlib.h: changed second argument of mkdir to
1827 unsigned long int (unsigned int would probably have been enough,
1828 but...). Removed <sys/types.h> header.
1829 * src/support/mkdir.C (mkdir): ditto.
1833 2000-10-19 Juergen Vigna <jug@sad.it>
1835 * src/lyxfunc.C (MenuNew): small fix (form John)
1837 * src/screen.C (Update): removed unneeded code.
1839 * src/tabular.C (Ascii): refixed int != uint bug!
1841 * src/support/lyxlib.h: added sys/types.h include for now permits
1842 compiling, but I don't like this!
1844 2000-10-18 Juergen Vigna <jug@sad.it>
1846 * src/text2.C (ClearSelection): if we clear the selection we need
1847 more refresh so set the status apropriately
1849 * src/insets/insettext.C (draw): hopefully finally fixed draw
1852 2000-10-12 Juergen Vigna <jug@sad.it>
1854 * src/insets/insettext.C (draw): another small fix and make a block
1855 so that variables are localized.
1857 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1859 * src/support/lstrings.C (lowercase, uppercase):
1860 use explicit casts to remove compiler warnings.
1862 * src/support/LRegex.C (Impl):
1863 * src/support/StrPool.C (add):
1864 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1865 (AddPath, MakeDisplayPath):
1866 * src/support/lstrings.C (prefixIs, subst):
1867 use correct type to remove compiler warnings.
1869 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1871 * src/support/lyxlib.h:
1872 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1873 portability and to remove compiler warning with DEC cxx.
1875 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1877 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1879 * src/minibuffer.C (peek_event): retun 1 when there has been a
1880 mouseclick in the minibuffer.
1884 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1886 * src/frontends/xforms/FormParagraph.C: more space above/below
1889 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1891 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1892 a char only if real_current_font was changed.
1894 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1896 * NEWS: update somewhat for 1.1.6
1898 * lib/ui/default.ui: clean up.
1900 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1902 * lib/CREDITS: clean up
1904 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1906 * src/combox.[Ch] (select): changed argument back to int
1907 * src/combox.C (peek_event): removed num_bytes as it is declared but
1910 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1911 modified calls to Combox::select() to remove warnings about type
1914 * src/insets/insetbutton.C (width): explicit cast to remove warning
1915 about type conversion.
1917 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1920 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1921 sel_pos_end, refering to cursor position are changed to
1922 LyXParagraph::size_type.
1924 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1925 consistent with LyXCursor::pos().
1926 (inset_pos): changed to LyXParagraph::size_type for same reason.
1928 * src/insets/insettext.C (resizeLyXText): changed some temporary
1929 variables refing to cursor position to LyXParagraph::size_type.
1931 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1933 * src/frontends/kde/<various>: The Great Renaming,
1936 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1938 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1940 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1942 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1943 0 when there are no arguments.
1945 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1947 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1948 to segfaults when pressing Ok in InsetBibtex dialog.
1950 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1952 * forms/layout_forms.fd:
1953 * src/layout_forms.C (create_form_form_character): small change to use
1954 labelframe rather than engraved frame + text
1956 * src/lyx_gui.C (create_forms): initialise choice_language with some
1957 arbitrary value to prevent segfault when dialog is shown.
1959 2000-10-16 Baruch Even <baruch.even@writeme.com>
1961 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1962 is no resulting file. This pertains only to LaTeX output.
1964 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1966 * src/text.C (Backspace): Make sure that the row of the cursor is
1969 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1972 * src/lyx_gui.C (init): Prevent a crash when only one font from
1973 menu/popup fonts is not found.
1975 * lib/lyxrc.example: Add an example for binding a key for language
1978 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1980 * src/converter.C (GetReachable): Changed the returned type to
1982 (IsReachable): New method
1984 * src/MenuBackend.C (expand): Handle formats that appear more
1987 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1989 * src/frontends/support/Makefile.am
1990 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1993 * lib/CREDITS: add Garst Reese.
1995 * src/support/snprintf.h: add extern "C" {} around the definitions.
1997 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1999 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2002 * src/frontends/xforms/FormDocument.C:
2003 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2004 compile without "conversion to integral type of smaller size"
2007 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2009 * src/text.C (GetColumnNearX): Fixed disabled code.
2011 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2013 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2016 * src/support/snprintf.[ch]: new files
2018 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2020 * src/frontends/kde/formprintdialog.C: add
2021 file browser for selecting postscript output
2023 * src/frontends/kde/formprintdialogdata.C:
2024 * src/frontends/kde/formprintdialogdata.h: re-generate
2027 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2029 * src/frontends/gnome/Makefile.am:
2030 * src/frontends/kde/Makefile.am: FormCommand.C
2031 disappeared from xforms
2033 * src/frontends/kde/FormCitation.C:
2034 * src/frontends/kde/FormIndex.C: read-only
2037 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2039 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2042 * src/bufferlist.C: add using directive.
2044 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2046 * src/support/lyxfunctional.h: version of class_fun for void
2047 returns added, const versions of back_inseter_fun and compare_fun
2050 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2052 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2054 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2056 * ChangeLog: cleanup.
2058 * lib/CREDITS: update to add all the contributors we've forgotten.
2059 I have obviously missed some, so tell me whether there were
2062 2000-10-13 Marko Vendelin <markov@ioc.ee>
2064 * src/frontends/gnome/FormCitation.C
2065 * src/frontends/gnome/FormCitation.h
2066 * src/frontends/gnome/FormError.C
2067 * src/frontends/gnome/FormIndex.C
2068 * src/frontends/gnome/FormRef.C
2069 * src/frontends/gnome/FormRef.h
2070 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2072 * src/frontends/gnome/FormCitation.C
2073 * src/frontends/gnome/FormCopyright.C
2074 * src/frontends/gnome/FormError.C
2075 * src/frontends/gnome/FormIndex.C
2076 * src/frontends/gnome/FormRef.C
2077 * src/frontends/gnome/FormToc.C
2078 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2081 * src/frontends/gnome/Menubar_pimpl.C
2082 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2085 2000-10-11 Baruch Even <baruch.even@writeme.com>
2088 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2089 to convey its real action.
2091 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2092 clear the minibuffer and prepare to enter a command.
2094 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2095 the rename from ExecCommand to PrepareForCommand.
2096 * src/lyxfunc.C (Dispatch): ditto.
2098 2000-10-11 Baruch Even <baruch.even@writeme.com>
2100 * src/buffer.C (writeFile): Added test for errors on writing, this
2101 catches all errors and not only file system full errors as intended.
2103 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2105 * src/lyx_gui.C (create_forms): better fix for crash with
2106 translated interface.
2108 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2110 * src/frontends/kde/Makefile.am:
2111 * src/frontends/kde/FormCopyright.C:
2112 * src/frontends/kde/formcopyrightdialog.C:
2113 * src/frontends/kde/formcopyrightdialog.h:
2114 * src/frontends/kde/formcopyrightdialogdata.C:
2115 * src/frontends/kde/formcopyrightdialogdata.h:
2116 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2117 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2118 copyright to use qtarch
2120 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2122 * src/encoding.C (read): Fixed bug that caused an error message at
2123 the end of the file.
2125 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2127 * lib/lyxrc.example: Fixed hebrew example.
2129 2000-10-13 Allan Rae <rae@lyx.org>
2131 * src/frontends/xforms/FormPreferences.C (input): reworking the
2133 (build, update, apply): New inputs in various tabfolders
2135 * src/frontends/xforms/FormToc.C: use new button policy.
2136 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2137 dialogs that either can't use any existing policy or where it just
2140 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2143 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2144 added a bool parameter which is ignored.
2146 * src/buffer.C (setReadonly):
2147 * src/BufferView_pimpl.C (buffer):
2148 * src/frontends/kde/FormCopyright.h (update):
2149 * src/frontends/kde/FormCitation.[Ch] (update):
2150 * src/frontends/kde/FormIndex.[Ch] (update):
2151 * src/frontends/kde/FormPrint.[Ch] (update):
2152 * src/frontends/kde/FormRef.[Ch] (update):
2153 * src/frontends/kde/FormToc.[Ch] (update):
2154 * src/frontends/kde/FormUrl.[Ch] (update):
2155 * src/frontends/gnome/FormCopyright.h (update):
2156 * src/frontends/gnome/FormCitation.[Ch] (update):
2157 * src/frontends/gnome/FormError.[Ch] (update):
2158 * src/frontends/gnome/FormIndex.[Ch] (update):
2159 * src/frontends/gnome/FormPrint.[Ch] (update):
2160 * src/frontends/gnome/FormRef.h (update):
2161 * src/frontends/gnome/FormToc.[Ch] (update):
2162 * src/frontends/gnome/FormUrl.[Ch] (update):
2163 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2164 to updateBufferDependent and DialogBase
2166 * src/frontends/xforms/FormCitation.[hC]:
2167 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2168 * src/frontends/xforms/FormError.[Ch]:
2169 * src/frontends/xforms/FormGraphics.[Ch]:
2170 * src/frontends/xforms/FormIndex.[Ch]:
2171 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2172 and fixed readOnly handling.
2173 * src/frontends/xforms/FormPrint.[Ch]:
2174 * src/frontends/xforms/FormRef.[Ch]:
2175 * src/frontends/xforms/FormTabular.[Ch]:
2176 * src/frontends/xforms/FormToc.[Ch]:
2177 * src/frontends/xforms/FormUrl.[Ch]:
2178 * src/frontends/xforms/FormInset.[Ch]:
2179 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2180 form of updateBufferDependent.
2182 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2183 if form()->visible just in case someone does stuff to the form in a
2186 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2187 the buttoncontroller for everything the enum used to be used for.
2188 (update) It would seem we need to force all dialogs to use a bool
2189 parameter or have two update functions. I chose to go with one.
2190 I did try removing update() from here and FormBase and defining the
2191 appropriate update signatures in FormBaseB[DI] but then ran into the
2192 problem of the update() call in FormBase::show(). Whatever I did
2193 to get around that would require another function and that just
2194 got more confusing. Hence the decision to make everyone have an
2195 update(bool). An alternative might have been to override show() in
2196 FormBaseB[DI] and that would allow the different and appropriate
2199 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2200 true == buffer change occurred. I decided against using a default
2201 template parameter since not all compilers support that at present.
2203 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2205 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2206 army knife" by removing functionality.
2207 (clearStore): removed. All such housekeeping on hide()ing the dialog
2208 is to be carried out by overloaded disconnect() methods.
2209 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2210 superceded by Baruch's neat test (FormGraphics) to update an existing
2211 dialog if a new signal is recieved rather than block all new signals
2213 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2214 only to Inset dialogs.
2215 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2216 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2218 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2220 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2221 as a base class to all inset dialogs. Used solely to connect/disconnect
2222 the Inset::hide signal and to define what action to take on receipt of
2223 a UpdateBufferDependent signal.
2224 (FormCommand): now derived from FormInset.
2226 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2229 * src/frontends/xforms/FormCopyright.[Ch]:
2230 * src/frontends/xforms/FormPreferences.[Ch]:
2231 now derived from FormBaseBI.
2233 * src/frontends/xforms/FormDocument.[Ch]:
2234 * src/frontends/xforms/FormParagraph.[Ch]:
2235 * src/frontends/xforms/FormPrint.[Ch]:
2236 now derived from FormBaseBD.
2238 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2240 * src/frontends/xforms/FormCitation.[Ch]:
2241 * src/frontends/xforms/FormError.[Ch]:
2242 * src/frontends/xforms/FormRef.[Ch]:
2243 * src/frontends/xforms/FormToc.[Ch]:
2244 (clearStore): reworked as disconnect().
2246 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2249 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2251 * src/converter.C (runLaTeX): constify buffer argument
2254 * src/frontends/support/Makefile.am (INCLUDES): fix.
2256 * src/buffer.h: add std:: qualifier
2257 * src/insets/figinset.C (addpidwait): ditto
2258 * src/MenuBackend.C: ditto
2259 * src/buffer.C: ditto
2260 * src/bufferlist.C: ditto
2261 * src/layout.C: ditto
2262 * src/lyxfunc.C: ditto
2264 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2266 * src/lyxtext.h (bidi_level): change return type to
2267 LyXParagraph::size_type.
2269 * src/lyxparagraph.h: change size_type to
2270 TextContainer::difference_type. This should really be
2271 TextContainer::size_type, but we need currently to support signed
2274 2000-10-11 Marko Vendelin <markov@ioc.ee>
2275 * src/frontends/gnome/FormError.h
2276 * src/frontends/gnome/FormRef.C
2277 * src/frontends/gnome/FormRef.h
2278 * src/frontends/gnome/FormError.C
2279 * src/frontends/gnome/Makefile.am
2280 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2281 to Gnome frontend. Both dialogs use "action" area.
2283 2000-10-12 Baruch Even <baruch.even@writeme.com>
2285 * src/graphics/GraphicsCacheItem_pimpl.C:
2286 * src/graphics/Renderer.C:
2287 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2290 2000-10-12 Juergen Vigna <jug@sad.it>
2292 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2293 visible when selecting).
2295 * development/Code_rules/Rules: fixed some typos.
2297 2000-10-09 Baruch Even <baruch.even@writeme.com>
2299 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2300 compiling on egcs 1.1.2 possible.
2302 * src/filedlg.C (comp_direntry::operator() ): ditto.
2304 2000-08-31 Baruch Even <baruch.even@writeme.com>
2306 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2309 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2310 transient it now only gets freed when the object is destructed.
2312 2000-08-24 Baruch Even <baruch.even@writeme.com>
2314 * src/frontends/FormGraphics.h:
2315 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2318 2000-08-20 Baruch Even <baruch.even@writeme.com>
2320 * src/insets/insetgraphics.C:
2321 (draw): Added messages to the drawn rectangle to report status.
2322 (updateInset): Disabled the use of the inline graphics,
2325 2000-08-17 Baruch Even <baruch.even@writeme.com>
2327 * src/frontends/support: Directory added for the support of GUII LyX.
2329 * src/frontends/support/LyXImage.h:
2330 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2333 * src/frontends/support/LyXImage_X.h:
2334 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2335 version of LyXImage, this uses the Xlib Pixmap.
2337 * src/PainterBase.h:
2338 * src/PainterBase.C:
2340 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2341 replacement to Pixmap.
2343 * src/insets/insetgraphics.h:
2344 * src/insets/insetgraphics.C:
2345 * src/graphics/GraphicsCacheItem.h:
2346 * src/graphics/GraphicsCacheItem.C:
2347 * src/graphics/GraphicsCacheItem_pimpl.h:
2348 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2351 * src/graphics/GraphicsCacheItem.h:
2352 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2353 another copy of the object.
2355 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2356 of cacheHandle, this fixed a bug that sent LyX crashing.
2358 * src/graphics/XPM_Renderer.h:
2359 * src/graphics/XPM_Renderer.C:
2360 * src/graphics/EPS_Renderer.h:
2361 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2363 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2365 * src/lyxfunc.C (processKeySym): only handle the
2366 lockinginset/inset stuff if we have a buffer and text loaded...
2368 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2370 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2372 * src/support/lyxfunctional.h: add operator= that takes a reference
2374 * src/lyxserver.C (mkfifo): make first arg const
2376 * src/layout.h: renamed name(...) to setName(...) to work around
2379 * src/buffer.C (setFileName): had to change name of function to
2380 work around bugs in egcs. (renamed from fileName)
2382 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2384 * src/support/translator.h: move helper template classes to
2385 lyxfunctional.h, include "support/lyxfunctional.h"
2387 * src/support/lyxmanip.h: add delaration of fmt
2389 * src/support/lyxfunctional.h: new file
2390 (class_fun_t): new template class
2391 (class_fun): helper template function
2392 (back_insert_fun_iterator): new template class
2393 (back_inserter_fun): helper template function
2394 (compare_memfun_t): new template class
2395 (compare_memfun): helper template function
2396 (equal_1st_in_pair): moved here from translator
2397 (equal_2nd_in_pair): moved here from translator
2399 * src/support/fmt.C: new file
2400 (fmt): new func, can be used for a printf substitute when still
2401 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2403 * src/support/StrPool.C: add some comments
2405 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2408 * src/insets/figinset.C (addpidwait): use std::copy with
2409 ostream_iterator to fill the pidwaitlist
2411 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2413 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2416 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2419 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2421 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2422 (class_update): ditto
2423 (BulletPanel): ditto
2424 (CheckChoiceClass): move initialization of tc and tct
2426 * src/tabular.C: remove current_view
2427 (OldFormatRead): similar to right below [istream::ignore]
2429 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2430 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2431 unused [istream::ignore]
2433 * src/lyxfunc.C: include "support/lyxfunctional.h"
2434 (getInsetByCode): use std::find_if and compare_memfun
2436 * src/lyxfont.C (stateText): remove c_str()
2438 * src/lyx_main.C (setDebuggingLevel): make static
2439 (commandLineHelp): make static
2441 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2442 Screen* together with fl_get_display() and fl_screen
2444 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2445 togheter with fl_get_display() and fl_screen
2446 (create_forms): remove c_str()
2448 * src/layout.C: include "support/lyxfunctional.h"
2449 (hasLayout): use std::find_if and compare_memfun
2450 (GetLayout): use std::find_if and comapre_memfun
2451 (delete_layout): use std::remove_if and compare_memfun
2452 (NumberOfClass): use std:.find_if and compare_memfun
2454 * src/gettext.h: change for the new functions
2456 * src/gettext.C: new file, make _(char const * str) and _(string
2457 const & str) real functions.
2459 * src/font.C (width): rewrite slightly to avoid one extra variable
2461 * src/debug.C: initialize Debug::ANY here
2463 * src/commandtags.h: update number comments
2465 * src/combox.h (get): make const func
2467 (getline): make const
2469 * src/combox.C (input_cb): handle case where fl_get_input can
2472 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2473 "support/lyxfunctional.h", remove current_view variable.
2474 (resize): use std::for_each with std::mem_fun
2475 (getFileNames): use std::copy with back_inserter_fun
2476 (getBuffer): change arg type to unsigned int
2477 (emergencyWriteAll): call emergencyWrite with std::for_each and
2479 (emergencyWrite): new method, the for loop in emergencyWriteAll
2481 (exists): use std::find_if with compare_memfun
2482 (getBuffer): use std::find_if and compare_memfun
2484 * src/buffer.h: add typedefs for iterator_category, value_type
2485 difference_type, pointer and reference for inset_iterator
2486 add postfix ++ for inset_iterator
2487 make inset_iterator::getPos() const
2489 * src/buffer.C: added support/lyxmanip.h
2490 (readFile): use lyxerr << fmt instead of printf
2491 (makeLaTeXFile): use std::copy to write out encodings
2493 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2495 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2496 free and the char * temp.
2497 (hasMenu): use std::find_if and compare_memfun
2500 * src/Makefile.am (lyx_SOURCES): added gettext.C
2502 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2503 string::insert small change to avoid temporary
2505 * src/LColor.C (getGUIName): remove c_str()
2507 * several files: change all occurrences of fl_display to
2510 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2511 that -pedantic is not used for gcc 2.97 (cvs gcc)
2513 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2515 2000-10-11 Allan Rae <rae@lyx.org>
2517 * src/frontends/xforms/FormPreferences.C (input): template path must be
2518 a readable directory. It doesn't need to be writeable.
2519 (build, delete, update, apply): New inputs in the various tabfolders
2521 * src/frontends/xforms/forms/form_preferences.fd:
2522 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2523 several new entries to existing folders. Shuffled some existing stuff
2526 * src/frontends/xforms/forms/form_print.fd:
2527 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2528 Should probably rework PrinterParams as well. Note that the switch to
2529 collated is effectively the same as !unsorted so changing PrinterParams
2530 will require a lot of fiddly changes to reverse the existing logic.
2532 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2534 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2536 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2538 2000-10-10 Allan Rae <rae@lyx.org>
2541 * src/lyxfunc.C (Dispatch):
2543 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2546 * src/lyxrc.C (output): Only write the differences between system lyxrc
2547 and the users settings.
2550 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2552 I'll rewrite this later, after 1.1.6 probably, to keep a single
2553 LyXRC but two instances of a LyXRCStruct.
2555 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2557 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2559 * src/tabular.h: add a few std:: qualifiers.
2561 * src/encoding.C: add using directive.
2562 * src/language.C: ditto.
2564 * src/insets/insetquotes.C (Validate): use languages->lang()
2565 instead of only language.
2567 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2569 * lib/languages: New file.
2571 * lib/encodings: New file.
2573 * src/language.C (Languages): New class.
2574 (read): New method. Reads the languages from the 'languages' file.
2576 * src/encoding.C (Encodings): New class.
2577 (read): New method. Reads the encodings from the 'encodings' file.
2579 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2582 * src/bufferparams.h and a lot of files: Deleted the member language,
2583 and renamed language_info to language
2585 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2586 * src/lyxfont.C (latexWriteStartChanges): ditto.
2587 * src/paragraph.C (validate,TeXOnePar): ditto.
2589 * src/lyxfont.C (update): Restored deleted code.
2591 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2593 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2595 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2597 * src/insets/figinset.[Ch]:
2598 * src/insets/insetinclude.[Ch]:
2599 * src/insets/insetinclude.[Ch]:
2600 * src/insets/insetparent.[Ch]:
2601 * src/insets/insetref.[Ch]:
2602 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2604 * src/insets/*.[Ch]:
2605 * src/mathed/formula.[Ch]:
2606 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2608 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2609 * src/lyx_cb.C (FigureApplyCB):
2610 * src/lyxfunc.C (getStatus, Dispatch):
2611 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2614 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2616 * src/converter.[Ch] (Formats::View):
2617 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2619 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2620 *current_view->buffer(). This will change later, but this patch is way
2623 2000-10-09 Juergen Vigna <jug@sad.it>
2625 * src/text.C (GetRow): small fix.
2627 * src/BufferView_pimpl.C (cursorPrevious):
2628 (cursorNext): added LyXText parameter to function.
2630 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2631 keypress depending on cursor position.
2633 2000-10-06 Juergen Vigna <jug@sad.it>
2635 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2636 (copySelection): redone this function and also copy ascii representa-
2639 * src/tabular.C (Ascii):
2643 (print_n_chars): new functions to realize the ascii export of tabulars.
2645 2000-10-05 Juergen Vigna <jug@sad.it>
2647 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2648 if we don't have a buffer.
2650 2000-10-10 Allan Rae <rae@lyx.org>
2652 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2653 with closing dialog. It seems that nested tabfolders require hiding
2654 of inner tabfolders before hiding the dialog itself. Actually all I
2655 did was hide the active outer folder.
2657 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2658 unless there really is a buffer. hideBufferDependent is called
2661 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2662 POTFILES.in stays in $(srcdir).
2664 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2666 * lib/lyxrc.example: Few changes.
2668 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2670 * src/BufferView_pimpl.C (buffer): only need one the
2671 updateBufferDependent signal to be emitted once! Moved to the end of
2672 the method to allow bv_->text to be updated first.
2674 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2675 and hSignal_ with Dialogs * and BufferDependency variables.
2676 New Buffer * parent_, initialised when the dialog is launched. Used to
2677 check whether to update() or hide() dialog in the new, private
2678 updateOrHide() method that is connected to the updateBufferDependent
2679 signal. Daughter classes dictate what to do using the
2680 ChangedBufferAction enum, passed to the c-tor.
2682 * src/frontends/xforms/FormCitation.C:
2683 * src/frontends/xforms/FormCommand.C:
2684 * src/frontends/xforms/FormCopyright.C:
2685 * src/frontends/xforms/FormDocument.C:
2686 * src/frontends/xforms/FormError.C:
2687 * src/frontends/xforms/FormIndex.C:
2688 * src/frontends/xforms/FormPreferences.C:
2689 * src/frontends/xforms/FormPrint.C:
2690 * src/frontends/xforms/FormRef.C:
2691 * src/frontends/xforms/FormToc.C:
2692 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2695 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2696 ChangedBufferAction enum.
2698 * src/frontends/xforms/FormParagraph.[Ch]
2699 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2702 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2704 * lib/bind/cua.bind: fix a bit.
2705 * lib/bind/emacs.bind: ditto.
2707 * lib/bind/menus.bind: remove real menu entries from there.
2709 * src/spellchecker.C: make sure we only include strings.h when
2712 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2714 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2715 function. It enlarges the maximum number of pup when needed.
2716 (add_toc2): Open a new menu if maximum number of items per menu has
2719 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2721 * src/frontends/kde/FormPrint.C: fix error reporting
2723 * src/frontends/xforms/FormDocument.C: fix compiler
2726 * lib/.cvsignore: add Literate.nw
2728 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2731 * bufferview_funcs.[Ch]
2734 * text2.C: Add support for numbers in RTL text.
2736 2000-10-06 Allan Rae <rae@lyx.org>
2738 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2739 to be gettext.m4 friendly again. ext_l10n.h is now
2740 generated into $top_srcdir instead of $top_builddir
2741 so that lyx.pot will be built correctly -- without
2742 duplicate parsing of ext_l10n.h.
2744 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2746 * src/frontends/kde/FormCitation.C: make the dialog
2747 behave more sensibly
2749 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2751 * config/kde.m4: fix consecutive ./configure runs,
2752 look for qtarch, fix library order
2754 * src/frontends/kde/Makefile.am: tidy up,
2755 add Print dialog, add .dlg dependencies
2757 * src/frontends/kde/FormPrint.C:
2758 * src/frontends/kde/FormPrint.h:
2759 * src/frontends/kde/formprintdialog.C:
2760 * src/frontends/kde/formprintdialog.h:
2761 * src/frontends/kde/formprintdialogdata.C:
2762 * src/frontends/kde/formprintdialogdata.h:
2763 * src/frontends/kde/dlg/formprintdialog.dlg: add
2766 * src/frontends/kde/dlg/README: Added explanatory readme
2768 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2769 script to double-check qtarch's output
2771 * src/frontends/kde/formindexdialog.C:
2772 * src/frontends/kde/formindexdialogdata.C:
2773 * src/frontends/kde/formindexdialogdata.h:
2774 * src/frontends/kde/dlg/formindexdialog.dlg: update
2775 for qtarch, minor fixes
2777 2000-10-05 Allan Rae <rae@lyx.org>
2779 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2780 dialogs when switching buffers update them instead. It's up to each
2781 dialog to decide if it should still be visible or not.
2782 update() should return a bool to control visiblity within show().
2783 Or perhaps better to set a member variable and use that to control
2786 * lib/build-listerrors: create an empty "listerrors" file just to stop
2787 make trying to regenerate it all the time if you don't have noweb
2790 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2792 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2793 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2794 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2795 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2796 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2798 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2800 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2802 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2803 deleting buffer. Closes all buffer-dependent dialogs.
2805 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2807 * src/frontends/xforms/FormCitation.[Ch]:
2808 * src/frontends/xforms/FormPreferences.[Ch]:
2809 * src/frontends/xforms/FormPrint.[Ch]:
2810 * src/frontends/xforms/FormRef.[Ch]:
2811 * src/frontends/xforms/FormUrl.[Ch]: ditto
2813 * src/frontends/xforms/FormDocument.[Ch]:
2814 * src/frontends/xforms/forms/form_document.C.patch:
2815 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2816 pass through a single input() function.
2818 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2820 * lib/build-listerrors: return status as OK
2822 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2824 * lib/lyxrc.example: Updated to new export code
2826 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2828 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2831 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2834 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2835 LyX-Code is defined.
2836 * lib/layouts/amsbook.layout: ditto.
2838 * boost/Makefile.am: fix typo.
2840 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2842 (add_lastfiles): removed.
2843 (add_documents): removed.
2844 (add_formats): removed.
2846 * src/frontends/Menubar.C: remove useless "using" directive.
2848 * src/MenuBackend.h: add a new MenuItem constructor.
2850 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2853 2000-10-04 Allan Rae <rae@lyx.org>
2855 * lib/Makefile.am (listerrors):
2856 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2857 I haven't got notangle installed so Kayvan please test. The output
2858 should end up in $builddir. This also allows people who don't have
2859 noweb installed to complete the make process without error.
2861 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2862 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2863 by JMarc's picky compiler.
2865 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2868 * src/insets/insettabular.C (setPos): change for loop to not use
2869 sequencing operator. Please check this Jürgen.
2871 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2873 * src/insets/insetcite.C (getScreenLabel): ditto
2874 * src/support/filetools.C (QuoteName): ditto
2875 (ChangeExtension): ditto
2877 * src/BufferView_pimpl.C (scrollCB): make heigt int
2879 * src/BufferView2.C (insertInset): comment out unused arg
2881 * boost/Makefile.am (EXTRADIST): new variable
2883 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2885 * src/exporter.C (IsExportable): Fixed
2887 * lib/configure.m4: Small fix
2889 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2891 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2892 * src/insets/insetbib.C (bibitemWidest): ditto.
2893 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2895 2000-10-03 Juergen Vigna <jug@sad.it>
2897 * src/BufferView2.C (theLockingInset): removed const because of
2898 Agnus's compile problems.
2900 * src/insets/insettext.C (LocalDispatch): set the language of the
2901 surronding paragraph on inserting the first character.
2903 * various files: changed use of BufferView::the_locking_inset.
2905 * src/BufferView2.C (theLockingInset):
2906 (theLockingInset): new functions.
2908 * src/BufferView.h: removed the_locking_inset.
2910 * src/lyxtext.h: added the_locking_inset
2912 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2914 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2916 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2918 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2919 * src/mathed/math_cursor.C (IsAlpha): ditto.
2920 * src/mathed/math_inset.C (strnew): ditto.
2921 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2922 (IMetrics): cxp set but never used; removed.
2923 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2924 that the variable in question has been removed also!
2927 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2928 using the Buffer * passed to Latex(), using the BufferView * passed to
2929 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2931 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2932 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2934 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2935 * src/buffer.C (readInset): used new InsetBibtex c-tor
2936 * (getBibkeyList): used new InsetBibtex::getKeys
2938 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2941 * lib/build-listerrors
2943 * src/exporter.C: Add literate programming support to the export code
2946 * src/lyx_cb.C: Remove old literate code.
2948 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2951 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2952 * src/converter.C (View, Convert): Use QuoteName.
2954 * src/insets/figinset.C (Preview): Use Formats::View.
2956 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2958 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2960 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2961 the top of the function, because compaq cxx complains that the
2962 "goto exit_with_message" when the function is disabled bypasses
2964 (MenuNew): try a better fix for the generation of new file names.
2965 This time, I used AddName() instead of AddPath(), hoping Juergen
2968 2000-10-03 Allan Rae <rae@lyx.org>
2970 * src/frontends/xforms/forms/form_preferences.fd:
2971 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2972 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2973 "Look and Feel"->"General" but will need to be split up further into
2974 general output and general input tabs. Current plan is for four outer
2975 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2976 stuff; "Inputs" for input and import configuration; "Outputs" for
2977 output and export configuration; and one more whatever is left over
2978 called "General". The leftovers at present look like being which
2979 viewers to use, spellchecker, language support and might be better
2980 named "Support". I've put "Paths" in "Inputs" for the moment as this
2981 seems reasonable for now at least.
2982 One problem remains: X error kills LyX when you close Preferences.
2984 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2986 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2987 qualifier from form()
2988 * src/frontends/xforms/FormCitation.[Ch]:
2989 * src/frontends/xforms/FormCopyright.[Ch]:
2990 * src/frontends/xforms/FormDocument.[Ch]:
2991 * src/frontends/xforms/FormError.[Ch]:
2992 * src/frontends/xforms/FormIndex.[Ch]:
2993 * src/frontends/xforms/FormPreferences.[Ch]:
2994 * src/frontends/xforms/FormPrint.[Ch]:
2995 * src/frontends/xforms/FormRef.[Ch]:
2996 * src/frontends/xforms/FormToc.[Ch]:
2997 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2999 * src/frontends/xforms/FormCitation.[Ch]:
3000 * src/frontends/xforms/FormIndex.[Ch]:
3001 * src/frontends/xforms/FormRef.[Ch]:
3002 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3003 with Allan's naming policy
3005 * src/frontends/xforms/FormCitation.C: some static casts to remove
3008 2000-10-02 Juergen Vigna <jug@sad.it>
3010 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3011 now you can type or do stuff inside the table-cell also when in dummy
3012 position, fixed visible cursor.
3014 * src/insets/insettext.C (Edit): fixing cursor-view position.
3016 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3017 be used for equal functions in lyxfunc and insettext.
3019 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3021 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3023 * src/frontends/gnome/FormCitation.h:
3024 * src/frontends/gnome/FormCopyright.h:
3025 * src/frontends/gnome/FormIndex.h:
3026 * src/frontends/gnome/FormPrint.h:
3027 * src/frontends/gnome/FormToc.h:
3028 * src/frontends/gnome/FormUrl.h:
3029 * src/frontends/kde/FormCitation.h:
3030 * src/frontends/kde/FormCopyright.h:
3031 * src/frontends/kde/FormIndex.h:
3032 * src/frontends/kde/FormRef.h:
3033 * src/frontends/kde/FormToc.h:
3034 * src/frontends/kde/FormUrl.h: fix remaining users of
3037 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3039 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3040 from depth argument.
3041 (DocBookHandleCaption): ditto.
3042 (DocBookHandleFootnote): ditto.
3043 (SimpleDocBookOnePar): ditto.
3045 * src/frontends/xforms/FormDocument.h (form): remove extra
3046 FormDocument:: qualifier.
3048 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3050 * sigc++/handle.h: ditto.
3052 * src/lyx_gui_misc.C: add "using" directive.
3054 * src/cheaders/cstddef: new file, needed by the boost library (for
3057 2000-10-02 Juergen Vigna <jug@sad.it>
3059 * src/insets/insettext.C (SetFont): better support.
3061 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3063 * src/screen.C (DrawOneRow): some uint refixes!
3065 2000-10-02 Allan Rae <rae@lyx.org>
3067 * boost/.cvsignore: ignore Makefile as well
3069 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3070 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3072 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3073 Left this one out by accident.
3075 * src/frontends/xforms/FormBase.h (restore): default to calling
3076 update() since that will restore the original/currently-applied values.
3077 Any input() triggered error messages will require the derived classes
3078 to redefine restore().
3080 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3081 avoid a segfault. combo_doc_class is the main concern.
3083 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3085 * Simplify build-listerrors in view of GUI-less export ability!
3087 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3089 * src/lyx_main.C (easyParse): Disable gui when exporting
3091 * src/insets/figinset.C:
3094 * src/lyx_gui_misc.C
3095 * src/tabular.C: Changes to allow no-gui.
3097 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3099 * src/support/utility.hpp: removed file
3100 * src/support/block.h: removed file
3102 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3105 * src/mathed/formula.C: add support/lyxlib.h
3106 * src/mathed/formulamacro.C: ditto
3108 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3109 * src/lyxparagraph.h: ditto
3111 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3112 * src/frontends/Makefile.am (INCLUDES): ditto
3113 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3114 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3115 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3116 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3117 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3118 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3120 * src/BufferView.h: use boost/utility.hpp
3121 * src/LColor.h: ditto
3122 * src/LaTeX.h: ditto
3123 * src/LyXAction.h: ditto
3124 * src/LyXView.h: ditto
3125 * src/bufferlist.h: ditto
3126 * src/lastfiles.h: ditto
3127 * src/layout.h: ditto
3128 * src/lyx_gui.h: ditto
3129 * src/lyx_main.h: ditto
3130 * src/lyxlex.h: ditto
3131 * src/lyxrc.h: ditto
3132 * src/frontends/ButtonPolicies.h: ditto
3133 * src/frontends/Dialogs.h: ditto
3134 * src/frontends/xforms/FormBase.h: ditto
3135 * src/frontends/xforms/FormGraphics.h: ditto
3136 * src/frontends/xforms/FormParagraph.h: ditto
3137 * src/frontends/xforms/FormTabular.h: ditto
3138 * src/graphics/GraphicsCache.h: ditto
3139 * src/graphics/Renderer.h: ditto
3140 * src/insets/ExternalTemplate.h: ditto
3141 * src/insets/insetcommand.h: ditto
3142 * src/support/path.h: ditto
3144 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3145 and introduce clause for 2.97.
3147 * boost/libs/README: new file
3149 * boost/boost/utility.hpp: new file
3151 * boost/boost/config.hpp: new file
3153 * boost/boost/array.hpp: new file
3155 * boost/Makefile.am: new file
3157 * boost/.cvsignore: new file
3159 * configure.in (AC_OUTPUT): add boost/Makefile
3161 * Makefile.am (SUBDIRS): add boost
3163 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3165 * src/support/lstrings.C (suffixIs): Fixed.
3167 2000-10-01 Allan Rae <rae@lyx.org>
3169 * src/PrinterParams.h: moved things around to avoid the "can't
3170 inline call" warning.
3172 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3173 into doc++ documentation.
3175 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3177 * src/frontends/xforms/FormRef.C: make use of button controller
3178 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3179 cleaned up button controller usage.
3180 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3181 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3182 use the button controller
3184 * src/frontends/xforms/forms/*.fd: and associated generated files
3185 updated to reflect changes to FormBase. Some other FormXxxx files
3186 also got minor updates to reflect changes to FormBase.
3188 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3189 (hide): made virtual.
3190 (input): return a bool. true == valid input
3191 (RestoreCB, restore): new
3192 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3193 Changes to allow derived dialogs to use a ButtonController and
3194 make sense when doing so: OK button calls ok() and so on.
3196 * src/frontends/xforms/ButtonController.h (class ButtonController):
3197 Switch from template implementation to taking Policy parameter.
3198 Allows FormBase to provide a ButtonController for any dialog.
3200 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3201 Probably should rename connect and disconnect.
3202 (apply): use the radio button groups
3203 (form): needed by FormBase
3204 (build): setup the radio button groups
3206 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3208 * several files: type changes to reduce the number of warnings and
3209 to unify type hangling a bit. Still much to do.
3211 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3213 * lib/images/*: rename a bunch of icons to match Dekel converter
3216 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3219 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3221 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3223 * sigc++/handle.h: ditto for class Handle.
3225 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3227 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3229 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3231 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3232 removal of the "default" language.
3234 * src/combox.h (getline): Check that sel > 0
3236 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3238 * lib/examples/docbook_example.lyx
3239 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3241 * lib/layouts/docbook-book.layout: new docbook book layout.
3243 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3245 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3247 * src/insets/figinset.C (DocBook):fixed small typo.
3249 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3251 * src/insets/insetinclude.h: string include_label doesn't need to be
3254 2000-09-29 Allan Rae <rae@lyx.org>
3256 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3257 Allow derived type to control connection and disconnection from signals
3258 of its choice if desired.
3260 2000-09-28 Juergen Vigna <jug@sad.it>
3262 * src/insets/insettabular.C (update): fixed cursor setting when
3263 the_locking_inset changed.
3264 (draw): made this a bit cleaner.
3265 (InsetButtonPress): fixed!
3267 * various files: added LyXText Parameter to fitCursor call.
3269 * src/BufferView.C (fitCursor): added LyXText parameter.
3271 * src/insets/insettabular.C (draw): small draw fix.
3273 * src/tabular.C: right setting of left/right celllines.
3275 * src/tabular.[Ch]: fixed various types in funcions and structures.
3276 * src/insets/insettabular.C: ditto
3277 * src/frontends/xforms/FormTabular.C: ditto
3279 2000-09-28 Allan Rae <rae@lyx.org>
3281 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3282 that the #ifdef's had been applied to part of what should have been
3283 a complete condition. It's possible there are other tests that
3284 were specific to tables that are also wrong now that InsetTabular is
3285 being used. Now we need to fix the output of '\n' after a table in a
3286 float for the same reason as the original condition:
3287 "don't insert this if we would be adding it before or after a table
3288 in a float. This little trick is needed in order to allow use of
3289 tables in \subfigures or \subtables."
3290 Juergen can you check this?
3292 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3294 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3295 output to the ostream.
3297 * several files: fixed types based on warnings from cxx
3299 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3301 * src/frontends/kde/Makefile.am: fix rule for
3302 formindexdialogdata_moc.C
3304 * src/.cvsignore: add ext_l10n.h to ignore
3306 * acconfig.h: stop messing with __STRICT_ANSI__
3307 * config/gnome.m4: remove option to set -ansi
3308 * config/kde.m4: remove option to set -ansi
3309 * config/lyxinclude.m4: don't set -ansi
3311 2000-09-27 Juergen Vigna <jug@sad.it>
3313 * various files: remove "default" language check.
3315 * src/insets/insetquotes.C: removed use of current_view.
3317 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3318 the one should have red ears by now!
3320 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3321 in more then one paragraph. Fixed cursor-movement/selection.
3323 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3324 paragraphs inside a text inset.
3326 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3327 text-inset if this owner is an inset.
3329 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3331 * src/Bullet.h: changed type of font, character and size to int
3333 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3335 * src/insets/inseturl.[Ch]:
3336 * src/insets/insetref.[Ch]:
3337 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3339 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3341 * src/buffer.C (readFile): block-if statement rearranged to minimise
3342 bloat. Patch does not reverse Jean-Marc's change ;-)
3344 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3345 Class rewritten to store pointers to hide/update signals directly,
3346 rather than Dialogs *. Also defined an enum to ease use. All xforms
3347 forms can now be derived from this class.
3349 * src/frontends/xforms/FormCommand.[Ch]
3350 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3352 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3355 * src/frontends/xforms/forms/form_citation.fd
3356 * src/frontends/xforms/forms/form_copyright.fd
3357 * src/frontends/xforms/forms/form_error.fd
3358 * src/frontends/xforms/forms/form_index.fd
3359 * src/frontends/xforms/forms/form_ref.fd
3360 * src/frontends/xforms/forms/form_toc.fd
3361 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3363 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3365 * src/insets/insetfoot.C: removed redundent using directive.
3367 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3369 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3370 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3372 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3373 created in the constructors in different groups. Then set() just
3374 have to show the groups as needed. This fixes the redraw problems
3375 (and is how the old menu code worked).
3377 * src/support/lyxlib.h: declare the methods as static when we do
3378 not have namespaces.
3380 2000-09-26 Juergen Vigna <jug@sad.it>
3382 * src/buffer.C (asciiParagraph): new function.
3383 (writeFileAscii): new function with parameter ostream.
3384 (writeFileAscii): use now asciiParagraph.
3386 * various inset files: added the linelen parameter to the Ascii-func.
3388 * src/tabular.C (Write): fixed error in writing file introduced by
3389 the last changes from Lars.
3391 * lib/bind/menus.bind: removed not supported functions.
3393 * src/insets/insettext.C (Ascii): implemented this function.
3395 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3397 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3398 (Write): use of the write_attribute functions.
3400 * src/bufferlist.C (close): fixed reasking question!
3402 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3404 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3405 new files use the everwhere possible.
3408 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3409 src/log_form.C src/lyx.C:
3412 * src/buffer.C (runLaTeX): remove func
3414 * src/PaperLayout.C: removed file
3415 * src/ParagraphExtra.C: likewise
3416 * src/bullet_forms.C: likewise
3417 * src/bullet_forms.h: likewise
3418 * src/bullet_forms_cb.C: likewise
3420 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3421 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3424 * several files: remove all traces of the old fd_form_paragraph,
3425 and functions belonging to that.
3427 * several files: remove all traces of the old fd_form_document,
3428 and functions belonging to that.
3430 * several files: constify local variables were possible.
3432 * several files: remove all code that was dead when NEW_EXPORT was
3435 * several files: removed string::c_str in as many places as
3438 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3439 (e): be a bit more outspoken when patching
3440 (updatesrc): only move files if changed.
3442 * forms/layout_forms.h.patch: regenerated
3444 * forms/layout_forms.fd: remove form_document and form_paragraph
3445 and form_quotes and form_paper and form_table_options and
3446 form_paragraph_extra
3448 * forms/form1.fd: remove form_table
3450 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3451 the fdui->... rewrite. Update some comments to xforms 0.88
3453 * forms/bullet_forms.C.patch: removed file
3454 * forms/bullet_forms.fd: likewise
3455 * forms/bullet_forms.h.patch: likewise
3457 * development/Code_rules/Rules: added a section on switch
3458 statements. Updated some comment to xforms 0.88.
3460 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3462 * src/buffer.C (readFile): make sure that the whole version number
3463 is read after \lyxformat (even when it contains a comma)
3465 * lib/ui/default.ui: change shortcut of math menu to M-a.
3467 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3469 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3472 * src/LyXView.C (updateWindowTitle): show the full files name in
3473 window title, limited to 30 characters.
3475 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3476 When a number of characters has been given, we should not assume
3477 that the string is 0-terminated.
3479 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3480 calls (fixes some memory leaks)
3482 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3483 trans member on exit.
3485 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3487 * src/converter.C (GetReachable): fix typo.
3489 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3490 understand ',' instead of '.'.
3491 (GetInteger): rewrite to use strToInt().
3493 2000-09-26 Juergen Vigna <jug@sad.it>
3495 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3496 better visibility and error-message on wrong VSpace input.
3498 * src/language.C (initL): added english again.
3500 2000-09-25 Juergen Vigna <jug@sad.it>
3502 * src/frontends/kde/Dialogs.C (Dialogs):
3503 * src/frontends/gnome/Dialogs.C (Dialogs):
3504 * src/frontends/kde/Makefile.am:
3505 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3507 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3509 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3511 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3513 * src/frontends/xforms/FormParagraph.C:
3514 * src/frontends/xforms/FormParagraph.h:
3515 * src/frontends/xforms/form_paragraph.C:
3516 * src/frontends/xforms/form_paragraph.h:
3517 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3520 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3522 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3523 Paragraph-Data after use.
3525 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3526 non breakable paragraphs.
3528 2000-09-25 Garst R. Reese <reese@isn.net>
3530 * src/language.C (initL): added missing language_country codes.
3532 2000-09-25 Juergen Vigna <jug@sad.it>
3534 * src/insets/insettext.C (InsetText):
3535 (deleteLyXText): remove the not released LyXText structure!
3537 2000-09-24 Marko Vendelin <markov@ioc.ee>
3539 * src/frontends/gnome/mainapp.C
3540 * src/frontends/gnome/mainapp.h: added support for keyboard
3543 * src/frontends/gnome/FormCitation.C
3544 * src/frontends/gnome/FormCitation.h
3545 * src/frontends/gnome/Makefile.am
3546 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3547 FormCitation to use "action area" in mainapp window
3549 * src/frontends/gnome/Menubar_pimpl.C
3550 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3553 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3555 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3556 width/descent/ascent values if name is empty.
3557 (mathed_string_height): Use std::max.
3559 2000-09-25 Allan Rae <rae@lyx.org>
3561 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3562 segfault. This will be completely redesigned soon.
3564 * sigc++: updated libsigc++. Fixes struct timespec bug.
3566 * development/tools/makeLyXsigc.sh: .cvsignore addition
3568 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3570 * several files: removed almost all traces of the old table
3573 * src/TableLayout.C: removed file
3575 2000-09-22 Juergen Vigna <jug@sad.it>
3577 * src/frontends/kde/Dialogs.C: added credits forms.
3579 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3581 * src/frontends/gnome/Dialogs.C: added some forms.
3583 * src/spellchecker.C (init_spell_checker): set language in pspell code
3584 (RunSpellChecker): some modifications for setting language string.
3586 * src/language.[Ch]: added language_country code.
3588 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3590 * src/frontends/Dialogs.h: added new signal showError.
3591 Rearranged existing signals in some sort of alphabetical order.
3593 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3594 FormError.[Ch], form_error.[Ch]
3595 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3596 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3598 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3599 dialogs. I think that this can be used as the base to all these
3602 * src/frontends/xforms/FormError.[Ch]
3603 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3604 implementation of InsetError dialog.
3606 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3608 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3609 * src/frontends/kde/Makefile.am: ditto
3611 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3613 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3614 macrobf. This fixes a bug of invisible text.
3616 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3618 * lib/doc/LaTeXConfig.lyx.in: updated.
3620 * src/language.C (initL): remove language "francais" and change a
3621 bit the names of the two other french variations.
3623 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3624 string that may not be 0-terminated.
3626 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3628 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3630 2000-09-20 Marko Vendelin <markov@ioc.ee>
3632 * src/frontends/gnome/FormCitation.C
3633 * src/frontends/gnome/FormIndex.C
3634 * src/frontends/gnome/FormToc.C
3635 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3636 the variable initialization to shut up the warnings
3638 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3640 * src/table.[Ch]: deleted files
3642 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3645 2000-09-18 Juergen Vigna <jug@sad.it>
3647 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3648 problems with selection. Inserted new LFUN_PASTESELECTION.
3649 (InsetButtonPress): inserted handling of middle mouse-button paste.
3651 * src/spellchecker.C: changed word to word.c_str().
3653 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3655 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3656 included in the ``make dist'' tarball.
3658 2000-09-15 Juergen Vigna <jug@sad.it>
3660 * src/CutAndPaste.C (cutSelection): small fix return the right
3661 end position after cut inside one paragraph only.
3663 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3664 we are locked as otherwise we don't have a valid cursor position!
3666 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3668 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3670 * src/frontends/kde/FormRef.C: added using directive.
3671 * src/frontends/kde/FormToc.C: ditto
3673 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3675 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3677 2000-09-19 Marko Vendelin <markov@ioc.ee>
3679 * src/frontends/gnome/Menubar_pimpl.C
3680 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3681 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3683 * src/frontends/gnome/mainapp.C
3684 * src/frontends/gnome/mainapp.h: support for menu update used
3687 * src/frontends/gnome/mainapp.C
3688 * src/frontends/gnome/mainapp.h: support for "action" area in the
3689 main window. This area is used by small simple dialogs, such as
3692 * src/frontends/gnome/FormIndex.C
3693 * src/frontends/gnome/FormIndex.h
3694 * src/frontends/gnome/FormUrl.C
3695 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3698 * src/frontends/gnome/FormCitation.C
3699 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3700 action area. Only "Insert new citation" is implemented.
3702 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3704 * src/buffer.C (Dispatch): fix call to Dispatch
3705 * src/insets/insetref.C (Edit): likewise
3706 * src/insets/insetparent.C (Edit): likewise
3707 * src/insets/insetinclude.C (include_cb): likewise
3708 * src/frontends/xforms/FormUrl.C (apply): likewise
3709 * src/frontends/xforms/FormToc.C (apply): likewise
3710 * src/frontends/xforms/FormRef.C (apply): likewise
3711 * src/frontends/xforms/FormIndex.C (apply): likewise
3712 * src/frontends/xforms/FormCitation.C (apply): likewise
3713 * src/lyxserver.C (callback): likewise
3714 * src/lyxfunc.C (processKeySym): likewise
3715 (Dispatch): likewise
3716 (Dispatch): likewise
3717 * src/lyx_cb.C (LayoutsCB): likewise
3719 * Makefile.am (sourcedoc): small change
3721 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3723 * src/main.C (main): Don't make an empty GUIRunTime object. all
3724 methods are static. constify a bit remove unneded using + headers.
3726 * src/tabular.C: some more const to local vars move some loop vars
3728 * src/spellchecker.C: added some c_str after some word for pspell
3730 * src/frontends/GUIRunTime.h: add new static method setDefaults
3731 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3732 * src/frontends/kde/GUIRunTime.C (setDefaults):
3733 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3735 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3736 with strnew in arg, use correct emptystring when calling SetName.
3738 * several files: remove all commented code with relation to
3739 HAVE_SSTREAM beeing false. We now only support stringstream and
3742 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3744 * src/lyxfunc.C: construct correctly the automatic new file
3747 * src/text2.C (IsStringInText): change type of variable i to shut
3750 * src/support/sstream.h: do not use namespaces if the compiler
3751 does not support them.
3753 2000-09-15 Marko Vendelin <markov@ioc.ee>
3754 * src/frontends/gnome/FormCitation.C
3755 * src/frontends/gnome/FormCitation.h
3756 * src/frontends/gnome/diainsertcitation_interface.c
3757 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3758 regexp support to FormCitation [Gnome].
3760 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3763 * configure.in: remove unused KDE/GTKGUI define
3765 * src/frontends/kde/FormRef.C
3766 * src/frontends/kde/FormRef.h
3767 * src/frontends/kde/formrefdialog.C
3768 * src/frontends/kde/formrefdialog.h: double click will
3769 go to reference, now it is possible to change a cross-ref
3772 * src/frontends/kde/FormToc.C
3773 * src/frontends/kde/FormToc.h
3774 * src/frontends/kde/formtocdialog.C
3775 * src/frontends/kde/formtocdialog.h: add a depth
3778 * src/frontends/kde/Makefile.am: add QtLyXView.h
3781 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3783 * src/frontends/kde/FormCitation.h: added some using directives.
3785 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3787 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3790 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3793 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3795 * src/buffer.C (pop_tag): revert for the second time a change by
3796 Lars, who seems to really hate having non-local loop variables :)
3798 * src/Lsstream.h: add "using" statements.
3800 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3801 * src/buffer.C (writeFile): ditto
3803 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3805 * src/buffer.C (writeFile): try to fix the locale modified format
3806 number to always be as we want it.
3808 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3809 in XForms 0.89. C-space is now working again.
3811 * src/Lsstream.h src/support/sstream.h: new files.
3813 * also commented out all cases where strstream were used.
3815 * src/Bullet.h (c_str): remove method.
3817 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3819 * a lot of files: get rid of "char const *" and "char *" is as
3820 many places as possible. We only want to use them in interaction
3821 with system of other libraries, not inside lyx.
3823 * a lot of files: return const object is not of pod type. This
3824 helps ensure that temporary objects is not modified. And fits well
3825 with "programming by contract".
3827 * configure.in: check for the locale header too
3829 * Makefile.am (sourcedoc): new tag for generation of doc++
3832 2000-09-14 Juergen Vigna <jug@sad.it>
3834 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3835 callback to check which combo called it and do the right action.
3837 * src/combox.C (combo_cb): added combo * to the callbacks.
3838 (Hide): moved call of callback after Ungrab of the pointer.
3840 * src/intl.h: removed LCombo2 function.
3842 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3843 function as this can now be handled in one function.
3845 * src/combox.h: added Combox * to callback prototype.
3847 * src/frontends/xforms/Toolbar_pimpl.C:
3848 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3850 2000-09-14 Garst Reese <reese@isn.net>
3852 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3853 moved usepackage{xxx}'s to beginning of file. Changed left margin
3854 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3855 underlining from title. Thanks to John Culleton for useful suggestions.
3857 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3859 * src/lyxlex_pimpl.C (setFile): change error message to debug
3862 2000-09-13 Juergen Vigna <jug@sad.it>
3864 * src/frontends/xforms/FormDocument.C: implemented choice_class
3865 as combox and give callback to combo_language so OK/Apply is activated
3868 * src/bufferlist.C (newFile): small fix so already named files
3869 (via an open call) are not requested to be named again on the
3872 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3874 * src/frontends/kde/Makefile.am
3875 * src/frontends/kde/FormRef.C
3876 * src/frontends/kde/FormRef.h
3877 * src/frontends/kde/formrefdialog.C
3878 * src/frontends/kde/formrefdialog.h: implement
3881 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3883 * src/frontends/kde/formtocdialog.C
3884 * src/frontends/kde/formtocdialog.h
3885 * src/frontends/kde/FormToc.C
3886 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3888 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3890 * src/frontends/kde/FormCitation.C: fix thinko
3891 where we didn't always display the reference text
3894 * src/frontends/kde/formurldialog.C
3895 * src/frontends/kde/formurldialog.h
3896 * src/frontends/kde/FormUrl.C
3897 * src/frontends/kde/FormUrl.h: minor cleanups
3899 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3901 * src/frontends/kde/Makefile.am
3902 * src/frontends/kde/FormToc.C
3903 * src/frontends/kde/FormToc.h
3904 * src/frontends/kde/FormCitation.C
3905 * src/frontends/kde/FormCitation.h
3906 * src/frontends/kde/FormIndex.C
3907 * src/frontends/kde/FormIndex.h
3908 * src/frontends/kde/formtocdialog.C
3909 * src/frontends/kde/formtocdialog.h
3910 * src/frontends/kde/formcitationdialog.C
3911 * src/frontends/kde/formcitationdialog.h
3912 * src/frontends/kde/formindexdialog.C
3913 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3915 2000-09-12 Juergen Vigna <jug@sad.it>
3917 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3920 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3922 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3925 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3927 * src/converter.C (Add, Convert): Added support for converter flags:
3928 needaux, resultdir, resultfile.
3929 (Convert): Added new parameter view_file.
3930 (dvips_options): Fixed letter paper option.
3932 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3933 (Export, GetExportableFormats, GetViewableFormats): Added support
3936 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3938 (easyParse): Fixed to work with new export code.
3940 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3943 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3945 * lib/bind/*.bind: Replaced
3946 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3947 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3949 2000-09-11 Juergen Vigna <jug@sad.it>
3951 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3953 * src/main.C (main): now GUII defines global guiruntime!
3955 * src/frontends/gnome/GUIRunTime.C (initApplication):
3956 * src/frontends/kde/GUIRunTime.C (initApplication):
3957 * src/frontends/xforms/GUIRunTime.C (initApplication):
3958 * src/frontends/GUIRunTime.h: added new function initApplication.
3960 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3962 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3964 2000-09-08 Juergen Vigna <jug@sad.it>
3966 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3967 we have already "Reset".
3969 * src/language.C (initL): inserted "default" language and made this
3970 THE default language (and not american!)
3972 * src/paragraph.C: inserted handling of "default" language!
3974 * src/lyxfont.C: ditto
3978 * src/paragraph.C: output the \\par only if we have a following
3979 paragraph otherwise it's not needed.
3981 2000-09-05 Juergen Vigna <jug@sad.it>
3983 * config/pspell.m4: added entry to lyx-flags
3985 * src/spellchecker.C: modified version from Kevin for using pspell
3987 2000-09-01 Marko Vendelin <markov@ioc.ee>
3988 * src/frontends/gnome/Makefile.am
3989 * src/frontends/gnome/FormCitation.C
3990 * src/frontends/gnome/FormCitation.h
3991 * src/frontends/gnome/diainsertcitation_callbacks.c
3992 * src/frontends/gnome/diainsertcitation_callbacks.h
3993 * src/frontends/gnome/diainsertcitation_interface.c
3994 * src/frontends/gnome/diainsertcitation_interface.h
3995 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3996 dialog for Gnome frontend
3998 * src/main.C: Gnome libraries require keeping application name
3999 and its version as strings
4001 * src/frontends/gnome/mainapp.C: Change the name of the main window
4002 from GnomeLyX to PACKAGE
4004 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4006 * src/frontends/Liason.C: add "using: declaration.
4008 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4010 * src/mathed/math_macro.C (Metrics): Set the size of the template
4012 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4014 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4016 * src/converter.C (add_options): New function.
4017 (SetViewer): Change $$FName into '$$FName'.
4018 (View): Add options when running xdvi
4019 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4020 (Convert): The 3rd parameter is now the desired filename. Converts
4021 calls to lyx::rename if necessary.
4022 Add options when running dvips.
4023 (dvi_papersize,dvips_options): New methods.
4025 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4027 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4028 using a call to Converter::dvips_options.
4029 Fixed to work with nex export code.
4031 * src/support/copy.C
4032 * src/support/rename.C: New files
4034 * src/support/syscall.h
4035 * src/support/syscall.C: Added Starttype SystemDontWait.
4037 * lib/ui/default.ui: Changed to work with new export code
4039 * lib/configure.m4: Changed to work with new export code
4041 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4043 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4045 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4046 so that code compiles with DEC cxx.
4048 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4049 to work correctly! Also now supports the additional elements
4052 2000-09-01 Allan Rae <rae@lyx.org>
4054 * src/frontends/ButtonPolicies.C: renamed all the references to
4055 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4057 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4058 since it's a const not a type.
4060 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4062 2000-08-31 Juergen Vigna <jug@sad.it>
4064 * src/insets/figinset.C: Various changes to look if the filename has
4065 an extension and if not add it for inline previewing.
4067 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4069 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4070 make buttonStatus and isReadOnly be const methods. (also reflect
4071 this in derived classes.)
4073 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4074 (nextState): change to be static inline, pass the StateMachine as
4076 (PreferencesPolicy): remove casts
4077 (OkCancelPolicy): remvoe casts
4078 (OkCancelReadOnlyPolicy): remove casts
4079 (NoRepeatedApplyReadOnlyPolicy): remove casts
4080 (OkApplyCancelReadOnlyPolicy): remove casts
4081 (OkApplyCancelPolicy): remove casts
4082 (NoRepeatedApplyPolicy): remove casts
4084 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4086 * src/converter.C: added some using directives
4088 * src/frontends/ButtonPolicies.C: changes to overcome
4089 "need lvalue" error with DEC c++
4091 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4092 to WMHideCB for DEC c++
4094 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4096 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4097 to BulletBMTableCB for DEC c++
4099 2000-08-31 Allan Rae <rae@lyx.org>
4101 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4102 character dialog separately from old document dialogs combo_language.
4105 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4107 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4108 Removed LFUN_REF_CREATE.
4110 * src/MenuBackend.C: Added new tags: toc and references
4112 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4113 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4115 (add_toc, add_references): New methods.
4116 (create_submenu): Handle correctly the case when there is a
4117 seperator after optional menu items.
4119 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4120 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4121 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4123 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4125 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4127 * src/converter.[Ch]: New file for converting between different
4130 * src/export.[Ch]: New file for exporting a LyX file to different
4133 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4134 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4135 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4136 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4137 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4138 RunDocBook, MenuExport.
4140 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4141 Exporter::Preview methods if NEW_EXPORT is defined.
4143 * src/buffer.C (Dispatch): Use Exporter::Export.
4145 * src/lyxrc.C: Added new tags: \converter and \viewer.
4148 * src/LyXAction.C: Define new lyx-function: buffer-update.
4149 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4150 when NEW_EXPORT is defined.
4152 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4154 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4156 * lib/ui/default.ui: Added submenus "view" and "update" to the
4159 * src/filetools.C (GetExtension): New function.
4161 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4163 2000-08-29 Allan Rae <rae@lyx.org>
4165 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4167 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4168 (EnableDocumentLayout): removed
4169 (DisableDocumentLayout): removed
4170 (build): make use of ButtonController's read-only handling to
4171 de/activate various objects. Replaces both of the above functions.
4173 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4174 (readOnly): was read_only
4175 (refresh): fixed dumb mistakes with read_only_ handling
4177 * src/frontends/xforms/forms/form_document.fd:
4178 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4179 tabbed dialogs so the tabs look more like tabs and so its easier to
4180 work out which is the current tab.
4182 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4183 segfault with form_table
4185 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4187 2000-08-28 Juergen Vigna <jug@sad.it>
4189 * acconfig.h: added USE_PSPELL.
4191 * src/config.h.in: added USE_PSPELL.
4193 * autogen.sh: added pspell.m4
4195 * config/pspell.m4: new file.
4197 * src/spellchecker.C: implemented support for pspell libary.
4199 2000-08-25 Juergen Vigna <jug@sad.it>
4201 * src/LyXAction.C (init): renamed LFUN_TABLE to
4202 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4204 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4206 * src/lyxscreen.h: add force_clear variable and fuction to force
4207 a clear area when redrawing in LyXText.
4209 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4211 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4213 * some whitespace and comment changes.
4215 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4217 * src/buffer.C: up te LYX_FORMAT to 2.17
4219 2000-08-23 Juergen Vigna <jug@sad.it>
4221 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4224 * src/insets/insettabular.C (pasteSelection): delete the insets
4225 LyXText as it is not valid anymore.
4226 (copySelection): new function.
4227 (pasteSelection): new function.
4228 (cutSelection): new function.
4229 (LocalDispatch): implemented cut/copy/paste of cell selections.
4231 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4232 don't have a LyXText.
4234 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4236 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4239 2000-08-22 Juergen Vigna <jug@sad.it>
4241 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4242 ifdef form_table out if NEW_TABULAR.
4244 2000-08-21 Juergen Vigna <jug@sad.it>
4246 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4247 (draw): fixed draw position so that the cursor is positioned in the
4249 (InsetMotionNotify): hide/show cursor so the position is updated.
4250 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4251 using cellstart() function where it should be used.
4253 * src/insets/insettext.C (draw): ditto.
4255 * src/tabular.C: fixed initialization of some missing variables and
4256 made BoxType into an enum.
4258 2000-08-22 Marko Vendelin <markov@ioc.ee>
4259 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4260 stock menu item using action numerical value, not its string
4264 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4266 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4267 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4269 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4271 * src/frontends/xforms/GUIRunTime.C: new file
4273 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4274 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4276 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4278 * src/frontends/kde/GUIRunTime.C: new file
4280 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4281 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4283 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4285 * src/frontends/gnome/GUIRunTime.C: new file
4287 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4290 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4291 small change to documetentation.
4293 * src/frontends/GUIRunTime.C: removed file
4295 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4297 * src/lyxparagraph.h: enable NEW_TABULAR as default
4299 * src/lyxfunc.C (processKeySym): remove some commented code
4301 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4302 NEW_TABULAR around the fd_form_table_options.
4304 * src/lyx_gui.C (runTime): call the static member function as
4305 GUIRunTime::runTime().
4307 2000-08-21 Allan Rae <rae@lyx.org>
4309 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4312 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4314 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4316 2000-08-21 Allan Rae <rae@lyx.org>
4318 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4319 keep Garst happy ;-)
4320 * src/frontends/xforms/FormPreferences.C (build): use setOK
4321 * src/frontends/xforms/FormDocument.C (build): use setOK
4322 (FormDocument): use the appropriate policy.
4324 2000-08-21 Allan Rae <rae@lyx.org>
4326 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4327 automatic [de]activation of arbitrary objects when in a read-only state.
4329 * src/frontends/ButtonPolicies.h: More documentation
4330 (isReadOnly): added to support the above.
4332 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4334 2000-08-18 Juergen Vigna <jug@sad.it>
4336 * src/insets/insettabular.C (getStatus): changed to return func_status.
4338 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4339 display toggle menu entries if they are.
4341 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4342 new document layout now.
4344 * src/lyxfunc.C: ditto
4346 * src/lyx_gui_misc.C: ditto
4348 * src/lyx_gui.C: ditto
4350 * lib/ui/default.ui: removed paper and quotes layout as they are now
4351 all in the document layout tabbed folder.
4353 * src/frontends/xforms/forms/form_document.fd: added Restore
4354 button and callbacks for all inputs for Allan's ButtonPolicy.
4356 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4357 (CheckChoiceClass): added missing params setting on class change.
4358 (UpdateLayoutDocument): added for updating the layout on params.
4359 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4360 (FormDocument): Implemented Allan's ButtonPolicy with the
4363 2000-08-17 Allan Rae <rae@lyx.org>
4365 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4366 so we can at least see the credits again.
4368 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4369 controller calls for the appropriate callbacks. Note that since Ok
4370 calls apply followed by cancel, and apply isn't a valid input for the
4371 APPLIED state, the bc_ calls have to be made in the static callback not
4372 within each of the real callbacks.
4374 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4375 (setOk): renamed from setOkay()
4377 2000-08-17 Juergen Vigna <jug@sad.it>
4379 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4380 in the implementation part.
4381 (composeUIInfo): don't show optional menu-items.
4383 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4385 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4387 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4388 text-state when in a text-inset.
4390 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4392 2000-08-17 Marko Vendelin <markov@ioc.ee>
4393 * src/frontends/gnome/FormIndex.C
4394 * src/frontends/gnome/FormIndex.h
4395 * src/frontends/gnome/FormToc.C
4396 * src/frontends/gnome/FormToc.h
4397 * src/frontends/gnome/dialogs
4398 * src/frontends/gnome/diatoc_callbacks.c
4399 * src/frontends/gnome/diatoc_callbacks.h
4400 * src/frontends/gnome/diainsertindex_callbacks.h
4401 * src/frontends/gnome/diainsertindex_callbacks.c
4402 * src/frontends/gnome/diainsertindex_interface.c
4403 * src/frontends/gnome/diainsertindex_interface.h
4404 * src/frontends/gnome/diatoc_interface.h
4405 * src/frontends/gnome/diatoc_interface.c
4406 * src/frontends/gnome/Makefile.am: Table of Contents and
4407 Insert Index dialogs implementation for Gnome frontend
4409 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4411 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4413 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4416 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4418 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4419 destructor. Don't definde if you don't need it
4420 (processEvents): made static, non-blocking events processing for
4422 (runTime): static method. event loop for xforms
4423 * similar as above for kde and gnome.
4425 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4426 new Pimpl is correct
4427 (runTime): new method calss the real frontends runtime func.
4429 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4431 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4433 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4435 2000-08-16 Juergen Vigna <jug@sad.it>
4437 * src/lyx_gui.C (runTime): added GUII RunTime support.
4439 * src/frontends/Makefile.am:
4440 * src/frontends/GUIRunTime.[Ch]:
4441 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4442 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4443 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4445 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4447 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4448 as this is already set in ${FRONTEND_INCLUDE} if needed.
4450 * configure.in (CPPFLAGS): setting the include dir for the frontend
4451 directory and don't set FRONTEND=xforms for now as this is executed
4454 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4456 * src/frontends/kde/Makefile.am:
4457 * src/frontends/kde/FormUrl.C:
4458 * src/frontends/kde/FormUrl.h:
4459 * src/frontends/kde/formurldialog.h:
4460 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4462 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4464 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4466 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4468 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4471 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4473 * src/WorkArea.C (work_area_handler): more work to get te
4474 FL_KEYBOARD to work with xforms 0.88 too, please test.
4476 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4478 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4480 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4483 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4485 * src/Timeout.h: remove Qt::emit hack.
4487 * several files: changes to allo doc++ compilation
4489 * src/lyxfunc.C (processKeySym): new method
4490 (processKeyEvent): comment out if FL_REVISION < 89
4492 * src/WorkArea.C: change some debugging levels.
4493 (WorkArea): set wantkey to FL_KEY_ALL
4494 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4495 clearer code and the use of compose with XForms 0.89. Change to
4496 use signals instead of calling methods in bufferview directly.
4498 * src/Painter.C: change some debugging levels.
4500 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4503 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4504 (workAreaKeyPress): new method
4506 2000-08-14 Juergen Vigna <jug@sad.it>
4508 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4510 * config/kde.m4: addes some features
4512 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4513 include missing xforms dialogs.
4515 * src/Timeout.h: a hack to be able to compile with qt/kde.
4517 * sigc++/.cvsignore: added acinclude.m4
4519 * lib/.cvsignore: added listerros
4521 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4522 xforms tree as objects are needed for other frontends.
4524 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4525 linking with not yet implemented xforms objects.
4527 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4529 2000-08-14 Baruch Even <baruch.even@writeme.com>
4531 * src/frontends/xforms/FormGraphics.h:
4532 * src/frontends/xforms/FormGraphics.C:
4533 * src/frontends/xforms/RadioButtonGroup.h:
4534 * src/frontends/xforms/RadioButtonGroup.C:
4535 * src/insets/insetgraphics.h:
4536 * src/insets/insetgraphics.C:
4537 * src/insets/insetgraphicsParams.h:
4538 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4539 instead of spaces, and various other indentation issues to make the
4540 sources more consistent.
4542 2000-08-14 Marko Vendelin <markov@ioc.ee>
4544 * src/frontends/gnome/dialogs/diaprint.glade
4545 * src/frontends/gnome/FormPrint.C
4546 * src/frontends/gnome/FormPrint.h
4547 * src/frontends/gnome/diaprint_callbacks.c
4548 * src/frontends/gnome/diaprint_callbacks.h
4549 * src/frontends/gnome/diaprint_interface.c
4550 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4553 * src/frontends/gnome/dialogs/diainserturl.glade
4554 * src/frontends/gnome/FormUrl.C
4555 * src/frontends/gnome/FormUrl.h
4556 * src/frontends/gnome/diainserturl_callbacks.c
4557 * src/frontends/gnome/diainserturl_callbacks.h
4558 * src/frontends/gnome/diainserturl_interface.c
4559 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4560 Gnome implementation
4562 * src/frontends/gnome/Dialogs.C
4563 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4564 all other dialogs. Copy all unimplemented dialogs from Xforms
4567 * src/frontends/gnome/support.c
4568 * src/frontends/gnome/support.h: support files generated by Glade
4572 * config/gnome.m4: Gnome configuration scripts
4574 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4575 configure --help message
4577 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4578 only if there are no events pendling in Gnome/Gtk. This enhances
4579 the performance of menus.
4582 2000-08-14 Allan Rae <rae@lyx.org>
4584 * lib/Makefile.am: listerrors cleaning
4586 * lib/listerrors: removed -- generated file
4587 * acinclude.m4: ditto
4588 * sigc++/acinclude.m4: ditto
4590 * src/frontends/xforms/forms/form_citation.fd:
4591 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4594 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4595 `updatesrc` and now we have a `test` target that does what `updatesrc`
4596 used to do. I didn't like having an install target that wasn't related
4599 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4600 on all except FormGraphics. This may yet happen. Followed by a major
4601 cleanup including using FL_TRANSIENT for most of the dialogs. More
4602 changes to come when the ButtonController below is introduced.
4604 * src/frontends/xforms/ButtonController.h: New file for managing up to
4605 four buttons on a dialog according to an externally defined policy.
4606 * src/frontends/xforms/Makefile.am: added above
4608 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4609 Apply and Cancel/Close buttons and everything in between and beyond.
4610 * src/frontends/Makefile.am: added above.
4612 * src/frontends/xforms/forms/form_preferences.fd:
4613 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4614 and removed variable 'status' as a result. Fixed the set_minsize thing.
4615 Use the new screen-font-update after checking screen fonts were changed
4616 Added a "Restore" button to restore the original lyxrc values while
4617 editing. This restores everything not just the last input changed.
4618 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4620 * src/LyXAction.C: screen-font-update added for updating buffers after
4621 screen font settings have been changed.
4622 * src/commandtags.h: ditto
4623 * src/lyxfunc.C: ditto
4625 * forms/lyx.fd: removed screen fonts dialog.
4626 * src/lyx_gui.C: ditto
4627 * src/menus.[Ch]: ditto
4628 * src/lyx.[Ch]: ditto
4629 * src/lyx_cb.C: ditto + code from here moved to make
4630 screen-font-update. And people wonder why progress on GUII is
4631 slow. Look at how scattered this stuff was! It takes forever
4634 * forms/fdfix.sh: Fixup the spacing after commas.
4635 * forms/makefile: Remove date from generated files. Fewer clashes now.
4636 * forms/bullet_forms.C.patch: included someones handwritten changes
4638 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4639 once I've discovered why LyXRC was made noncopyable.
4640 * src/lyx_main.C: ditto
4642 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4644 * src/frontends/xforms/forms/fdfix.sh:
4645 * src/frontends/xforms/forms/fdfixh.sed:
4646 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4647 * src/frontends/xforms/Form*.[hC]:
4648 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4649 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4650 provide a destructor for the struct FD_form_xxxx. Another version of
4651 the set_[max|min]size workaround and a few other cleanups. Actually,
4652 Angus' patch from 20000809.
4654 2000-08-13 Baruch Even <baruch.even@writeme.com>
4656 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4659 2000-08-11 Juergen Vigna <jug@sad.it>
4661 * src/insets/insetgraphics.C (InsetGraphics): changing init
4662 order because of warnings.
4664 * src/frontends/xforms/forms/makefile: adding patching .C with
4667 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4668 from .C.patch to .c.patch
4670 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4671 order because of warning.
4673 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4675 * src/frontends/Liason.C (setMinibuffer): new helper function
4677 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4679 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4681 * lib/ui/default.ui: commented out PaperLayout entry
4683 * src/frontends/xforms/form_document.[Ch]: new added files
4685 * src/frontends/xforms/FormDocument.[Ch]: ditto
4687 * src/frontends/xforms/forms/form_document.fd: ditto
4689 * src/frontends/xforms/forms/form_document.C.patch: ditto
4691 2000-08-10 Juergen Vigna <jug@sad.it>
4693 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4694 (InsetGraphics): initialized cacheHandle to 0.
4695 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4697 2000-08-10 Baruch Even <baruch.even@writeme.com>
4699 * src/graphics/GraphicsCache.h:
4700 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4701 correctly as a cache.
4703 * src/graphics/GraphicsCacheItem.h:
4704 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4707 * src/graphics/GraphicsCacheItem_pimpl.h:
4708 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4711 * src/insets/insetgraphics.h:
4712 * src/insets/insetgraphics.C: Changed from using a signal notification
4713 to polling when image is not loaded.
4715 2000-08-10 Allan Rae <rae@lyx.org>
4717 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4718 that there are two functions that have to been taken out of line by
4719 hand and aren't taken care of in the script. (Just a reminder note)
4721 * sigc++/macros/*.h.m4: Updated as above.
4723 2000-08-09 Juergen Vigna <jug@sad.it>
4725 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4727 * src/insets/insettabular.C: make drawing of single cell smarter.
4729 2000-08-09 Marko Vendelin <markov@ioc.ee>
4730 * src/frontends/gnome/Menubar_pimpl.C
4731 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4732 implementation: new files
4734 * src/frontends/gnome/mainapp.C
4735 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4738 * src/main.C: create Gnome main window
4740 * src/frontends/xforms/Menubar_pimpl.h
4741 * src/frontends/Menubar.C
4742 * src/frontends/Menubar.h: added method Menubar::update that calls
4743 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4745 * src/LyXView.C: calls Menubar::update to update the state
4748 * src/frontends/gnome/Makefile.am: added new files
4750 * src/frontends/Makefile.am: added frontend compiler options
4752 2000-08-08 Juergen Vigna <jug@sad.it>
4754 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4756 * src/bufferlist.C (close):
4757 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4758 documents if exiting without saving.
4760 * src/buffer.C (save): use removeAutosaveFile()
4762 * src/support/filetools.C (removeAutosaveFile): new function.
4764 * src/lyx_cb.C (MenuWrite): returns a bool now.
4765 (MenuWriteAs): check if file could really be saved and revert to the
4767 (MenuWriteAs): removing old autosavefile if existant.
4769 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4770 before Goto toggle declaration, because of compiler warning.
4772 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4774 * src/lyxfunc.C (MenuNew): small fix.
4776 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4778 * src/bufferlist.C (newFile):
4779 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4781 * src/lyxrc.C: added new_ask_filename tag
4783 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4785 * src/lyx.fd: removed code pertaining to form_ref
4786 * src/lyx.[Ch]: ditto
4787 * src/lyx_cb.C: ditto
4788 * src/lyx_gui.C: ditto
4789 * src/lyx_gui_misc.C: ditto
4791 * src/BufferView_pimpl.C (restorePosition): update buffer only
4794 * src/commandtags.h (LFUN_REFTOGGLE): removed
4795 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4796 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4797 (LFUN_REFBACK): renamed LFUN_REF_BACK
4799 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4800 * src/menus.C: ditto
4801 * src/lyxfunc.C (Dispatch): ditto.
4802 InsertRef dialog is now GUI-independent.
4804 * src/texrow.C: added using std::endl;
4806 * src/insets/insetref.[Ch]: strip out large amounts of code.
4807 The inset is now a container and this functionality is now
4808 managed by a new FormRef dialog
4810 * src/frontends/Dialogs.h (showRef, createRef): new signals
4812 * src/frontends/xforms/FormIndex.[Ch],
4813 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4814 when setting dialog's min/max size
4815 * src/frontends/xforms/FormIndex.[Ch]: ditto
4817 * src/frontends/xforms/FormRef.[Ch],
4818 src/frontends/xforms/forms/form_ref.fd: new xforms
4819 implementation of an InsetRef dialog
4821 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4824 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4825 ios::nocreate is not part of the standard. Removed.
4827 2000-08-07 Baruch Even <baruch.even@writeme.com>
4829 * src/graphics/Renderer.h:
4830 * src/graphics/Renderer.C: Added base class for rendering of different
4831 image formats into Pixmaps.
4833 * src/graphics/XPM_Renderer.h:
4834 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4835 in a different class.
4837 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4838 easily add support for other formats.
4840 * src/insets/figinset.C: plugged a leak of an X resource.
4842 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4844 * src/CutAndPaste.[Ch]: make all metods static.
4846 * development/Code_rules/Rules: more work, added section on
4847 Exceptions, and a References section.
4849 * a lot of header files: work to make doc++ able to generate the
4850 source documentation, some workarounds of doc++ problems. Doc++ is
4851 now able to generate the documentation.
4853 2000-08-07 Juergen Vigna <jug@sad.it>
4855 * src/insets/insettabular.C (recomputeTextInsets): removed function
4857 * src/tabular.C (SetWidthOfMulticolCell):
4859 (calculate_width_of_column_NMC): fixed return value so that it really
4860 only returns true if the column-width has changed (there where
4861 problems with muliticolumn-cells in this column).
4863 2000-08-04 Juergen Vigna <jug@sad.it>
4865 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4866 also on the scrollstatus of the inset.
4867 (workAreaMotionNotify): ditto.
4869 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4871 2000-08-01 Juergen Vigna <jug@sad.it>
4873 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4875 * src/commandtags.h:
4876 * src/LyXAction.C (init):
4877 * src/insets/inset.C (LocalDispatch): added support for
4880 * src/insets/inset.C (scroll): new functions.
4882 * src/insets/insettext.C (removeNewlines): new function.
4883 (SetAutoBreakRows): removes forced newlines in the text of the
4884 paragraph if autoBreakRows is set to false.
4886 * src/tabular.C (Latex): generates a parbox around the cell contents
4889 * src/frontends/xforms/FormTabular.C (local_update): removed
4890 the radio_useparbox button.
4892 * src/tabular.C (UseParbox): new function
4894 2000-08-06 Baruch Even <baruch.even@writeme.com>
4896 * src/graphics/GraphicsCache.h:
4897 * src/graphics/GraphicsCache.C:
4898 * src/graphics/GraphicsCacheItem.h:
4899 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4902 * src/insets/insetgraphics.h:
4903 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4904 and the drawing of the inline image.
4906 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4907 loaded into the wrong position.
4909 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4912 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4914 * src/support/translator.h: move all typedefs to public section
4916 * src/support/filetools.C (MakeLatexName): return string const
4918 (TmpFileName): ditto
4919 (FileOpenSearch): ditto
4921 (LibFileSearch): ditto
4922 (i18nLibFileSearch): ditto
4925 (CreateTmpDir): ditto
4926 (CreateBufferTmpDir): ditto
4927 (CreateLyXTmpDir): ditto
4930 (MakeAbsPath): ditto
4932 (OnlyFilename): ditto
4934 (NormalizePath): ditto
4935 (CleanupPath): ditto
4936 (GetFileContents): ditto
4937 (ReplaceEnvironmentPath): ditto
4938 (MakeRelPath): ditto
4940 (ChangeExtension): ditto
4941 (MakeDisplayPath): ditto
4942 (do_popen): return cmdret const
4943 (findtexfile): return string const
4945 * src/support/DebugStream.h: add some /// to please doc++
4947 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4949 * src/texrow.C (same_rownumber): functor to use with find_if
4950 (getIdFromRow): rewritten to use find_if and to not update the
4951 positions. return true if row is found
4952 (increasePos): new method, use to update positions
4954 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4956 * src/lyxlex_pimpl.C (verifyTable): new method
4959 (GetString): return string const
4960 (pushTable): rewrite to use std::stack
4962 (setFile): better check
4965 * src/lyxlex.h: make LyXLex noncopyable
4967 * src/lyxlex.C (text): return char const * const
4968 (GetString): return string const
4969 (getLongString): return string const
4971 * src/lyx_gui_misc.C (askForText): return pair<...> const
4973 * src/lastfiles.[Ch] (operator): return string const
4975 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4976 istringstream not char const *.
4977 move token.end() out of loop.
4978 (readFile): move initializaton of token
4980 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4981 getIdFromRow is successful.
4983 * lib/bind/emacs.bind: don't include menus bind
4985 * development/Code_rules/Rules: the beginnings of making this
4986 better and covering more of the unwritten rules that we have.
4988 * development/Code_rules/Recommendations: a couple of wording
4991 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4993 * src/support/strerror.c: remove C++ comment.
4995 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4997 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4998 LFUN_INDEX_INSERT_LAST
5000 * src/texrow.C (getIdFromRow): changed from const_iterator to
5001 iterator, allowing code to compile with DEC cxx
5003 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5004 stores part of the class, as suggested by Allan. Will allow
5006 (apply): test to apply uses InsetCommandParams operator!=
5008 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5009 (apply): test to apply uses InsetCommandParams operator!=
5011 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5012 stores part of the class.
5013 (update): removed limits on min/max size.
5015 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5016 (apply): test to apply uses InsetCommandParams operator!=
5018 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5019 (Read, Write, scanCommand, getCommand): moved functionality
5020 into InsetCommandParams.
5022 (getScreenLabel): made pure virtual
5023 new InsetCommandParams operators== and !=
5025 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5026 c-tors based on InsetCommandParams. Removed others.
5027 * src/insets/insetinclude.[Ch]: ditto
5028 * src/insets/insetlabel.[Ch]: ditto
5029 * src/insets/insetparent.[Ch]: ditto
5030 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5032 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5033 insets derived from InsetCommand created using similar c-tors
5034 based on InsetCommandParams
5035 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5036 * src/menus.C (ShowRefsMenu): ditto
5037 * src/paragraph.C (Clone): ditto
5038 * src/text2.C (SetCounter): ditto
5039 * src/lyxfunc.C (Dispatch) ditto
5040 Also recreated old InsetIndex behaviour exactly. Can now
5041 index-insert at the start of a paragraph and index-insert-last
5042 without launching the pop-up.
5044 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5046 * lib/lyxrc.example: mark te pdf options as non functional.
5048 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5049 (isStrDbl): move tmpstr.end() out of loop.
5050 (strToDbl): move intialization of tmpstr
5051 (lowercase): return string const and move tmp.end() out of loop.
5052 (uppercase): return string const and move tmp.edn() out of loop.
5053 (prefixIs): add assertion
5058 (containsOnly): ditto
5059 (containsOnly): ditto
5060 (containsOnly): ditto
5061 (countChar): make last arg char not char const
5062 (token): return string const
5063 (subst): return string const, move tmp.end() out of loop.
5064 (subst): return string const, add assertion
5065 (strip): return string const
5066 (frontStrip): return string const, add assertion
5067 (frontStrip): return string const
5072 * src/support/lstrings.C: add inclde "LAssert.h"
5073 (isStrInt): move tmpstr.end() out of loop.
5075 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5076 toollist.end() out of loop.
5077 (deactivate): move toollist.end() out of loop.
5078 (update): move toollist.end() out of loop.
5079 (updateLayoutList): move tc.end() out of loop.
5080 (add): move toollist.end() out of loop.
5082 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5083 md.end() out of loop.
5085 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5087 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5090 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5091 (Erase): move insetlist.end() out of loop.
5093 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5094 ref to const string as first arg. Move initialization of some
5095 variables, whitespace changes.
5097 * src/kbmap.C (defkey): move table.end() out of loop.
5098 (kb_keymap): move table.end() out of loop.
5099 (findbinding): move table.end() out of loop.
5101 * src/MenuBackend.C (hasMenu): move end() out of loop.
5102 (getMenu): move end() out of loop.
5103 (getMenu): move menulist_.end() out of loop.
5105 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5107 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5110 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5111 (getFromLyXName): move infotab.end() out of loop.
5113 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5114 -fvtable-thunks -ffunction-sections -fdata-sections
5116 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5118 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5121 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5123 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5125 * src/frontends/xforms/FormCitation.[Ch],
5126 src/frontends/xforms/FormIndex.[Ch],
5127 src/frontends/xforms/FormToc.[Ch],
5128 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5130 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5132 * src/commandtags.h: renamed, created some flags for citation
5135 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5137 * src/lyxfunc.C (dispatch): use signals to insert index entry
5139 * src/frontends/Dialogs.h: new signal createIndex
5141 * src/frontends/xforms/FormCommand.[Ch],
5142 src/frontends/xforms/FormCitation.[Ch],
5143 src/frontends/xforms/FormToc.[Ch],
5144 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5146 * src/insets/insetindex.[Ch]: GUI-independent
5148 * src/frontends/xforms/FormIndex.[Ch],
5149 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5152 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5154 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5155 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5157 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5159 * src/insets/insetref.C (Latex): rewrite so that there is now
5160 question that a initialization is requested.
5162 * src/insets/insetcommand.h: reenable the hide signal
5164 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5166 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5167 fix handling of shortcuts (many bugs :)
5168 (add_lastfiles): ditto.
5170 * lib/ui/default.ui: fix a few shortcuts.
5172 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5174 * Makefile.am: Fix ``rpmdist'' target to return the exit
5175 status of the ``rpm'' command, instead of the last command in
5176 the chain (the ``rm lyx.xpm'' command, which always returns
5179 2000-08-02 Allan Rae <rae@lyx.org>
5181 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5182 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5183 * src/frontends/xforms/FormToc.C (FormToc): ditto
5185 * src/frontends/xforms/Makefile.am: A few forgotten files
5187 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5188 Signals-not-copyable-problem Lars' started commenting out.
5190 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5192 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5194 * src/insets/insetcommand.h: Signals is not copyable so anoter
5195 scheme for automatic hiding of forms must be used.
5197 * src/frontends/xforms/FormCitation.h: don't inerit from
5198 noncopyable, FormCommand already does that.
5199 * src/frontends/xforms/FormToc.h: ditto
5200 * src/frontends/xforms/FormUrl.h: ditto
5202 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5204 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5206 * src/insets/insetcommand.h (hide): new SigC::Signal0
5207 (d-tor) new virtual destructor emits hide signal
5209 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5210 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5212 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5213 LOF and LOT. Inset is now GUI-independent
5215 * src/insets/insetloa.[Ch]: redundant
5216 * src/insets/insetlof.[Ch]: ditto
5217 * src/insets/insetlot.[Ch]: ditto
5219 * src/frontends/xforms/forms/form_url.fd: tweaked!
5220 * src/frontends/xforms/forms/form_citation.fd: ditto
5222 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5223 dialogs dealing with InsetCommand insets
5225 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5226 FormCommand base class
5227 * src/frontends/xforms/FormUrl.[Ch]: ditto
5229 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5231 * src/frontends/xforms/FormToc.[Ch]: ditto
5233 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5234 passed a generic InsetCommand pointer
5235 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5237 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5238 and modified InsetTOC class
5239 * src/buffer.C: ditto
5241 * forms/lyx.fd: strip out old FD_form_toc code
5242 * src/lyx_gui_misc.C: ditto
5243 * src/lyx_gui.C: ditto
5244 * src/lyx_cb.C: ditto
5245 * src/lyx.[Ch]: ditto
5247 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5249 * src/support/utility.hpp: tr -d '\r'
5251 2000-08-01 Juergen Vigna <jug@sad.it>
5253 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5255 * src/commandtags.h:
5256 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5257 LFUN_TABULAR_FEATURES.
5259 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5260 LFUN_LAYOUT_TABULAR.
5262 * src/insets/insettabular.C (getStatus): implemented helper function.
5264 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5266 2000-07-31 Juergen Vigna <jug@sad.it>
5268 * src/text.C (draw): fixed screen update problem for text-insets.
5270 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5271 something changed probably this has to be added in various other
5274 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5276 2000-07-31 Baruch Even <baruch.even@writeme.com>
5278 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5279 templates to satisfy compaq cxx.
5282 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5284 * src/support/translator.h (equal_1st_in_pair::operator()): take
5285 const ref pair_type as arg.
5286 (equal_2nd_in_pair::operator()): ditto
5287 (Translator::~Translator): remove empty d-tor.
5289 * src/graphics/GraphicsCache.C: move include config.h to top, also
5290 put initialization of GraphicsCache::singleton here.
5291 (~GraphicsCache): move here
5292 (addFile): take const ref as arg
5295 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5297 * src/BufferView2.C (insertLyXFile): change te with/without header
5300 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5302 * src/frontends/xforms/FormGraphics.C (apply): add some
5303 static_cast. Not very nice, but required by compaq cxx.
5305 * src/frontends/xforms/RadioButtonGroup.h: include header
5306 <utility> instead of <pair.h>
5308 * src/insets/insetgraphicsParams.C: add using directive.
5309 (readResize): change return type to void.
5310 (readOrigin): ditto.
5312 * src/lyxfunc.C (getStatus): add missing break for build-program
5313 function; add test for Literate for export functions.
5315 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5316 entries in Options menu.
5318 2000-07-31 Baruch Even <baruch.even@writeme.com>
5320 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5321 protect against auto-allocation; release icon when needed.
5323 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5325 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5326 on usual typewriter.
5328 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5329 earlier czech.kmap), useful only for programming.
5331 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5333 * src/frontends/xforms/FormCitation.h: fix conditioning around
5336 2000-07-31 Juergen Vigna <jug@sad.it>
5338 * src/frontends/xforms/FormTabular.C (local_update): changed
5339 radio_linebreaks to radio_useparbox and added radio_useminipage.
5341 * src/tabular.C: made support for using minipages/parboxes.
5343 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5345 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5347 (descent): so the cursor is in the middle.
5348 (width): bit smaller box.
5350 * src/insets/insetgraphics.h: added display() function.
5352 2000-07-31 Baruch Even <baruch.even@writeme.com>
5354 * src/frontends/Dialogs.h: Added showGraphics signals.
5356 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5357 xforms form definition of the graphics dialog.
5359 * src/frontends/xforms/FormGraphics.h:
5360 * src/frontends/xforms/FormGraphics.C: Added files, the
5361 GUIndependent code of InsetGraphics
5363 * src/insets/insetgraphics.h:
5364 * src/insets/insetgraphics.C: Major writing to make it work.
5366 * src/insets/insetgraphicsParams.h:
5367 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5368 struct between InsetGraphics and GUI.
5370 * src/LaTeXFeatures.h:
5371 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5372 support for graphicx package.
5374 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5375 for the graphics inset.
5377 * src/support/translator.h: Added file, used in
5378 InsetGraphicsParams. this is a template to translate between two
5381 * src/frontends/xforms/RadioButtonGroup.h:
5382 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5383 way to easily control a radio button group.
5385 2000-07-28 Juergen Vigna <jug@sad.it>
5387 * src/insets/insettabular.C (LocalDispatch):
5388 (TabularFeatures): added support for lyx-functions of tabular features.
5389 (cellstart): refixed this function after someone wrongly changed it.
5391 * src/commandtags.h:
5392 * src/LyXAction.C (init): added support for tabular-features
5394 2000-07-28 Allan Rae <rae@lyx.org>
5396 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5397 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5398 triggers the callback for input checking. As a result we sometimes get
5399 "LyX: This shouldn't happen..." printed to cerr.
5400 (input): Started using status variable since I only free() on
5401 destruction. Some input checking for paths and font sizes.
5403 * src/frontends/xforms/FormPreferences.h: Use status to control
5404 activation of Ok and Apply
5406 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5407 callback. Also resized to stop segfaults with 0.88. The problem is
5408 that xforms-0.88 requires the folder to be wide enough to fit all the
5409 tabs. If it isn't it causes all sorts of problems.
5411 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5413 * src/frontends/xforms/forms/README: Reflect reality.
5415 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5416 * src/frontends/xforms/forms/makefile: ditto.
5418 * src/commandtags.h: Get access to new Preferences dialog
5419 * src/LyXAction.C: ditto
5420 * src/lyxfunc.C: ditto
5421 * lib/ui/default.ui: ditto
5423 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5425 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5427 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5430 * src/frontends/xforms/form_url.[Ch]: added.
5432 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5434 * src/insets/insetbib.h: fixed bug in previous commit
5436 * src/frontends/xforms/FormUrl.h: ditto
5438 * src/frontends/xforms/FormPrint.h: ditto
5440 * src/frontends/xforms/FormPreferences.h: ditto
5442 * src/frontends/xforms/FormCopyright.h: ditto
5444 * src/frontends/xforms/FormCitation.C: ditto
5446 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5447 private copyconstructor and private default contructor
5449 * src/support/Makefile.am: add utility.hpp
5451 * src/support/utility.hpp: new file from boost
5453 * src/insets/insetbib.h: set owner in clone
5455 * src/frontends/xforms/FormCitation.C: added missing include
5458 * src/insets/form_url.[Ch]: removed
5460 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5462 * development/lyx.spec.in
5463 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5464 file/directory re-organization.
5466 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5468 * src/insets/insetcommand.[Ch]: moved the string data and
5469 associated manipulation methods into a new stand-alone class
5470 InsetCommandParams. This class has two additional methods
5471 getAsString() and setFromString() allowing the contents to be
5472 moved around as a single string.
5473 (addContents) method removed.
5474 (setContents) method no longer virtual.
5476 * src/buffer.C (readInset): made use of new InsetCitation,
5477 InsetUrl constructors based on InsetCommandParams.
5479 * src/commandtags.h: add LFUN_INSERT_URL
5481 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5482 independent InsetUrl and use InsetCommandParams to extract
5483 string info and create new Insets.
5485 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5487 * src/frontends/xforms/FormCitation.C (apply): uses
5490 * src/frontends/xforms/form_url.C
5491 * src/frontends/xforms/form_url.h
5492 * src/frontends/xforms/FormUrl.h
5493 * src/frontends/xforms/FormUrl.C
5494 * src/frontends/xforms/forms/form_url.fd: new files
5496 * src/insets/insetcite.[Ch]: removed unused constructors.
5498 * src/insets/insetinclude.[Ch]: no longer store filename
5500 * src/insets/inseturl.[Ch]: GUI-independent.
5502 2000-07-26 Juergen Vigna <jug@sad.it>
5503 * renamed frontend from gtk to gnome as it is that what is realized
5504 and did the necessary changes in the files.
5506 2000-07-26 Marko Vendelin <markov@ioc.ee>
5508 * configure.in: cleaning up gnome configuration scripts
5510 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5512 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5513 shortcuts syndrom by redrawing them explicitely (a better solution
5514 would be appreciated).
5516 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5518 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5521 * src/lyx_cb.C (MenuExport): change html export to do the right
5522 thing depending of the document type (instead of having
5523 html-linuxdoc and html-docbook).
5524 * src/lyxfunc.C (getStatus): update for html
5525 * lib/ui/default.ui: simplify due to the above change.
5526 * src/menus.C (ShowFileMenu): update too (in case we need it).
5528 * src/MenuBackend.C (read): if a menu is defined twice, add the
5529 new entries to the exiting one.
5531 2000-07-26 Juergen Vigna <jug@sad.it>
5533 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5535 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5536 and return a bool if it did actual save the file.
5537 (AutoSave): don't autosave a unnamed doc.
5539 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5540 check if this is an UNNAMED new file and react to it.
5541 (newFile): set buffer to unnamed and change to not mark a new
5542 buffer dirty if I didn't do anything with it.
5544 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5546 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5548 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5549 friend as per Angus's patch posted to lyx-devel.
5551 * src/ext_l10n.h: updated
5553 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5554 gettext on the style string right before inserting them into the
5557 * autogen.sh: add code to extract style strings form layout files,
5558 not good enough yet.
5560 * src/frontends/gtk/.cvsignore: add MAKEFILE
5562 * src/MenuBackend.C (read): run the label strings through gettext
5563 before storing them in the containers.
5565 * src/ext_l10n.h: new file
5567 * autogen.sh : generate the ext_l10n.h file here
5569 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5571 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5574 * lib/ui/default.ui: fix a couple of typos.
5576 * config/gnome/gtk.m4: added (and added to the list of files in
5579 * src/insets/insetinclude.C (unique_id): fix when we are using
5580 lyxstring instead of basic_string<>.
5581 * src/insets/insettext.C (LocalDispatch): ditto.
5582 * src/support/filetools.C: ditto.
5584 * lib/configure.m4: create the ui/ directory if necessary.
5586 * src/LyXView.[Ch] (updateToolbar): new method.
5588 * src/BufferView_pimpl.C (buffer): update the toolbar when
5589 opening/closing buffer.
5591 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5593 * src/LyXAction.C (getActionName): enhance to return also the name
5594 and options of pseudo-actions.
5595 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5597 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5598 as an example of what is possible). Used in File->Build too (more
5599 useful) and in the import/export menus (to mimick the complicated
5600 handling of linuxdoc and friends). Try to update all the entries.
5602 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5605 * src/MenuBackend.C (read): Parse the new OptItem tag.
5607 * src/MenuBackend.h: Add a new optional_ data member (used if the
5608 entry should be omitted when the lyxfunc is disabled).
5610 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5611 function, used as a shortcut.
5612 (create_submenu): align correctly the shortcuts on the widest
5615 * src/MenuBackend.h: MenuItem.label() only returns the label of
5616 the menu without shortcut; new method shortcut().
5618 2000-07-14 Marko Vendelin <markov@ioc.ee>
5620 * src/frontends/gtk/Dialogs.C:
5621 * src/frontends/gtk/FormCopyright.C:
5622 * src/frontends/gtk/FormCopyright.h:
5623 * src/frontends/gtk/Makefile.am: added these source-files for the
5624 Gtk/Gnome support of the Copyright-Dialog.
5626 * src/main.C: added Gnome::Main initialization if using
5627 Gtk/Gnome frontend-GUI.
5629 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5631 * config/gnome/aclocal-include.m4
5632 * config/gnome/compiler-flags.m4
5633 * config/gnome/curses.m4
5634 * config/gnome/gnome--.m4
5635 * config/gnome/gnome-bonobo-check.m4
5636 * config/gnome/gnome-common.m4
5637 * config/gnome/gnome-fileutils.m4
5638 * config/gnome/gnome-ghttp-check.m4
5639 * config/gnome/gnome-gnorba-check.m4
5640 * config/gnome/gnome-guile-checks.m4
5641 * config/gnome/gnome-libgtop-check.m4
5642 * config/gnome/gnome-objc-checks.m4
5643 * config/gnome/gnome-orbit-check.m4
5644 * config/gnome/gnome-print-check.m4
5645 * config/gnome/gnome-pthread-check.m4
5646 * config/gnome/gnome-support.m4
5647 * config/gnome/gnome-undelfs.m4
5648 * config/gnome/gnome-vfs.m4
5649 * config/gnome/gnome-x-checks.m4
5650 * config/gnome/gnome-xml-check.m4
5651 * config/gnome/gnome.m4
5652 * config/gnome/gperf-check.m4
5653 * config/gnome/gtk--.m4
5654 * config/gnome/linger.m4
5655 * config/gnome/need-declaration.m4: added configuration scripts
5656 for Gtk/Gnome frontend-GUI
5658 * configure.in: added support for the --with-frontend=gtk option
5660 * autogen.sh: added config/gnome/* to list of config-files
5662 * acconfig.h: added define for GTKGUI-support
5664 * config/lyxinclude.m4: added --with-frontend[=value] option value
5665 for Gtk/Gnome frontend-GUI support.
5667 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5669 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5673 * src/paragraph.C (GetChar): remove non-const version
5675 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5676 (search_kw): use it.
5678 * src/lyx_main.C (init): if "preferences" exist, read that instead
5680 (ReadRcFile): return bool if the file could be read ok.
5681 (ReadUIFile): add a check to see if lex file is set ok.
5683 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5684 bastring can be used instead of lyxstring (still uses the old code
5685 if std::string is good enough or if lyxstring is used.)
5687 * src/encoding.C: make the arrays static, move ininle functions
5689 * src/encoding.h: from here.
5691 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5692 (parseSingleLyXformat2Token): move inset parsing to separate method
5693 (readInset): new private method
5695 * src/Variables.h: remove virtual from get().
5697 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5698 access to NEW_INSETS and NEW_TABULAR
5700 * src/MenuBackend.h: remove superfluous forward declaration of
5701 MenuItem. Add documentations tags "///", remove empty MenuItem
5702 destructor, remove private default contructor.
5704 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5706 (read): more string mlabel and mname to where they are used
5707 (read): remove unused variables mlabel and mname
5708 (defaults): unconditional clear, make menusetup take advantage of
5709 add returning Menu &.
5711 * src/LyXView.h: define NEW_MENUBAR as default
5713 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5714 to NEW_INSETS and NEW_TABULAR.
5715 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5716 defined. Change some of the "xxxx-inset-insert" functions names to
5719 * several files: more enahncements to NEW_INSETS and the resulting
5722 * lib/lyxrc.example (\date_insert_format): move to misc section
5724 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5725 bastring and use AC_CACHE_CHECK.
5726 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5727 the system have the newest methods. uses AC_CACHE_CHECK
5728 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5729 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5730 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5732 * configure.in: add LYX_CXX_GOOD_STD_STRING
5734 * acinclude.m4: recreated
5736 2000-07-24 Amir Karger <karger@lyx.org>
5738 * README: add Hebrew, Arabic kmaps
5741 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5743 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5746 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5748 * Lot of files: add pragma interface/implementation.
5750 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5752 * lib/ui/default.ui: new file (ans new directory). Contains the
5753 default menu and toolbar.
5755 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5756 global space. Toolbars are now read (as menus) in ui files.
5758 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5760 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5761 is disabled because the document is read-only. We want to have the
5762 toggle state of the function anyway.
5763 (getStatus): add code for LFUN_VC* functions (mimicking what is
5764 done in old-style menus)
5766 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5767 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5769 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5770 * src/BufferView_pimpl.C: ditto.
5771 * src/lyxfunc.C: ditto.
5773 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5774 default). This replaces old-style menus by new ones.
5776 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5777 MenuItem. Contain the data structure of a menu.
5779 * src/insets/insettext.C: use LyXView::setLayout instead of
5780 accessing directly the toolbar combox.
5781 * src/lyxfunc.C (Dispatch): ditto.
5783 * src/LyXView.C (setLayout): new method, which just calls
5784 Toolbar::setLayout().
5785 (updateLayoutChoice): move part of this method in Toolbar.
5787 * src/toolbar.[Ch]: removed.
5789 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5790 implementation the toolbar.
5792 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5793 the toolbar. It might make sense to merge it with ToolbarDefaults
5795 (setLayout): new function.
5796 (updateLayoutList): ditto.
5797 (openLayoutList): ditto.
5799 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5800 xforms implementation of the toolbar.
5801 (get_toolbar_func): comment out, since I do not
5802 know what it is good for.
5804 * src/ToolbarDefaults.h: Add the ItemType enum.
5806 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5807 for a list of allocated C strings. Used in Menubar xforms
5808 implementation to avoid memory leaks.
5810 * src/support/lstrings.[Ch] (uppercase): new version taking and
5814 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5815 * lib/bind/emacs.bind: ditto.
5817 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5819 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5820 forward decl of LyXView.
5822 * src/toolbar.C (toolbarItem): moved from toolbar.h
5823 (toolbarItem::clean): ditto
5824 (toolbarItem::~toolbarItem): ditto
5825 (toolbarItem::operator): ditto
5827 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5829 * src/paragraph.h: control the NEW_TABULAR define from here
5831 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5832 USE_TABULAR_INSETS to NEW_TABULAR
5834 * src/ToolbarDefaults.C: add include "lyxlex.h"
5836 * files using the old table/tabular: use NEW_TABULAR to control
5837 compilation of old tabular stuff.
5839 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5842 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5843 planemet in reading of old style floats, fix the \end_deeper
5844 problem when reading old style floats.
5846 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5848 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5850 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5852 * lib/bind/sciword.bind: updated.
5854 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5856 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5857 layout write problem
5859 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5861 * src/Makefile.am (INCLUDES): remove image directory from include
5864 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5865 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5867 * src/LyXView.C (create_form_form_main): read the application icon
5870 * lib/images/*.xpm: change the icons to use transparent color for
5873 * src/toolbar.C (update): change the color of the button when it
5876 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5878 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5879 setting explicitely the minibuffer.
5880 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5882 * src/LyXView.C (showState): new function. Shows font information
5883 in minibuffer and update toolbar state.
5884 (LyXView): call Toolbar::update after creating the
5887 * src/toolbar.C: change toollist to be a vector instead of a
5889 (BubbleTimerCB): get help string directly from the callback
5890 argument of the corresponding icon (which is the action)
5891 (set): remove unnecessary ugliness.
5892 (update): new function. update the icons (depressed, disabled)
5893 depending of the status of the corresponding action.
5895 * src/toolbar.h: remove help in toolbarItem
5897 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5899 * src/Painter.C (text): Added code for using symbol glyphs from
5900 iso10646 fonts. Currently diabled.
5902 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5905 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5906 magyar,turkish and usorbian.
5908 * src/paragraph.C (isMultiLingual): Made more efficient.
5910 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5913 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5914 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5915 Also changed the prototype to "bool math_insert_greek(char)".
5917 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5919 * lots of files: apply the NEW_INSETS on all code that will not be
5920 needed when we move to use the new insets. Enable the define in
5921 lyxparagrah.h to try it.
5923 * src/insets/insettabular.C (cellstart): change to be a static
5925 (InsetTabular): initialize buffer in the initializer list.
5927 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5929 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5930 form_print.h out of the header file. Replaced with forward
5931 declarations of the relevant struct.
5933 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5936 * src/commandtags.h: do not include "debug.h" which does not
5937 belong there. #include it in some other places because of this
5940 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5942 * src/insets/insetcaption.C: add a couple "using" directives.
5944 * src/toolbar.C (add): get the help text directly from lyxaction.
5946 (setPixmap): new function. Loads from disk and sets a pixmap on a
5947 botton; the name of the pixmap file is derived from the command
5950 * src/toolbar.h: remove members isBitmap and pixmap from
5953 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5954 * lib/images/: move many files from images/banner.xpm.
5956 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5958 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5959 * src/toolbar.C: ditto.
5960 * configure.in: ditto.
5961 * INSTALL: document.
5963 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5964 the spellchecker popup is closed from the WM.
5966 2000-07-19 Juergen Vigna <jug@sad.it>
5968 * src/insets/insetfloat.C (Write): small fix because we use the
5969 insetname for the type now!
5971 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5973 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5976 * src/frontends/Dialogs.h: removed hideCitation signal
5978 * src/insets/insetcite.h: added hide signal
5980 * src/insets/insetcite.C (~InsetCitation): emits new signal
5981 (getScreenLabel): "intelligent" label should now fit on the screen!
5983 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5985 * src/frontends/xforms/FormCitation.C (showInset): connects
5986 hide() to the inset's hide signal
5987 (show): modified to use fl_set_object_position rather than
5988 fl_set_object_geometry wherever possible
5990 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5992 * src/insets/lyxinset.h: add caption code
5994 * src/insets/insetfloat.C (type): new method
5996 * src/insets/insetcaption.C (Write): new method
5998 (LyxCode): new method
6000 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6001 to get it right together with using the FloatList.
6003 * src/commandtags.h: add LFUN_INSET_CAPTION
6004 * src/lyxfunc.C (Dispatch): handle it
6006 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6009 * src/Variables.[Ch]: make expand take a const reference, remove
6010 the destructor, some whitespace changes.
6012 * src/LyXAction.C (init): add caption-inset-insert
6014 * src/FloatList.C (FloatList): update the default floats a bit.
6016 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6018 * src/Variables.[Ch]: new files. Intended to be used for language
6019 specific strings (like \chaptername) and filename substitution in
6022 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6024 * lib/kbd/american.kmap: update
6026 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6028 * src/bufferparams.[Ch]: remove member allowAccents.
6030 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6032 * src/LaTeXLog.C: use the log_form.h header.
6033 * src/lyx_gui.C: ditto.
6034 * src/lyx_gui_misc.C: ditto.
6035 * src/lyxvc.h: ditto.
6037 * forms/log_form.fd: new file, created from latexoptions.fd. I
6038 kept the log popup and nuked the options form.
6040 * src/{la,}texoptions.[Ch]: removed.
6041 * src/lyx_cb.C (LaTeXOptions): ditto
6043 * src/lyx_gui.C (create_forms): do not handle the
6044 fd_latex_options form.
6046 2000-07-18 Juergen Vigna <jug@sad.it>
6048 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6049 name of the inset so that it can be requested outside (text2.C).
6051 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6054 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6056 * src/mathed/formula.h (ConvertFont): constify
6058 * src/mathed/formula.C (Read): add warning if \end_inset is not
6059 found on expected place.
6061 * src/insets/lyxinset.h (ConvertFont): consify
6063 * src/insets/insetquotes.C (ConvertFont): constify
6064 * src/insets/insetquotes.h: ditto
6066 * src/insets/insetinfo.h: add labelfont
6068 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6069 (ascent): use labelfont
6073 (Write): make .lyx file a bit nicer
6075 * src/insets/insetfloat.C (Write): simplify somewhat...
6076 (Read): add warning if arg is not found
6078 * src/insets/insetcollapsable.C: add using std::max
6079 (Read): move string token and add warning in arg is not found
6080 (draw): use std::max to get the right ty
6081 (getMaxWidth): simplify by using std::max
6083 * src/insets/insetsection.h: new file
6084 * src/insets/insetsection.C: new file
6085 * src/insets/insetcaption.h: new file
6086 * src/insets/insetcaption.C: new file
6088 * src/insets/inset.C (ConvertFont): constify signature
6090 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6091 insetcaption.[Ch] and insetsection.[Ch]
6093 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6094 uses to use LABEL_COUNTER_CHAPTER instead.
6095 * src/text2.C (SetCounter): here
6097 * src/counters.h: new file
6098 * src/counters.C: new file
6099 * src/Sectioning.h: new file
6100 * src/Sectioning.C: new file
6102 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6104 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6106 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6109 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6112 2000-07-17 Juergen Vigna <jug@sad.it>
6114 * src/tabular.C (Validate): check if array-package is needed.
6115 (SetVAlignment): added support for vertical alignment.
6116 (SetLTFoot): better support for longtable header/footers
6117 (Latex): modified to support added features.
6119 * src/LaTeXFeatures.[Ch]: added array-package.
6121 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6123 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6126 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6128 * configure.in: do not forget to put a space after -isystem.
6130 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6132 * lib/kbd/arabic.kmap: a few fixes.
6134 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6136 * some whitespace chagnes to a number of files.
6138 * src/support/DebugStream.h: change to make it easier for
6139 doc++ to parse correctly.
6140 * src/support/lyxstring.h: ditto
6142 * src/mathed/math_utils.C (compara): change to have only one
6144 (MathedLookupBOP): change because of the above.
6146 * src/mathed/math_delim.C (math_deco_compare): change to have only
6148 (search_deco): change becasue of the above.
6150 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6151 instead of manually coded one.
6153 * src/insets/insetquotes.C (Read): read the \end_inset too
6155 * src/insets/insetlatex.h: remove file
6156 * src/insets/insetlatex.C: remove file
6158 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6160 (InsetPrintIndex): remove destructor
6162 * src/insets/insetinclude.h: remove default constructor
6164 * src/insets/insetfloat.C: work to make it work better
6166 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6168 * src/insets/insetcite.h (InsetCitation): remove default constructor
6170 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6172 * src/text.C (GetColumnNearX): comment out some currently unused code.
6174 * src/paragraph.C (writeFile): move some initializations closer to
6176 (CutIntoMinibuffer): small change to use new matchIT operator
6180 (InsertInset): ditto
6183 (InsetIterator): ditto
6184 (Erase): small change to use new matchFT operator
6186 (GetFontSettings): ditto
6187 (HighestFontInRange): ditto
6190 * src/lyxparagraph.h: some chars changed to value_type
6191 (matchIT): because of some stronger checking (perhaps too strong)
6192 in SGI STL, the two operator() unified to one.
6195 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6197 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6198 the last inset read added
6199 (parseSingleLyXformat2Token): some more (future) compability code added
6200 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6201 (parseSingleLyXformat2Token): set last_inset_read
6202 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6203 (parseSingleLyXformat2Token): don't double intializw string next_token
6205 * src/TextCache.C (text_fits::operator()): add const's to the signature
6206 (has_buffer::operator()): ditto
6208 * src/Floating.h: add some comments on the class
6210 * src/FloatList.[Ch] (typeExist): new method
6213 * src/BackStack.h: added default constructor, wanted by Gcc.
6215 2000-07-14 Juergen Vigna <jug@sad.it>
6217 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6219 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6221 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6222 do a redraw when the window is resized!
6223 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6225 * src/insets/insettext.C (resizeLyXText): added function to correctly
6226 being able to resize the LyXWindow.
6228 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6230 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6232 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6233 crashes when closing dialog to a deleted inset.
6235 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6236 method! Now similar to other insets.
6238 2000-07-13 Juergen Vigna <jug@sad.it>
6240 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6242 * lib/examples/Literate.lyx: small patch!
6244 * src/insets/insetbib.C (Read): added this function because of wrong
6245 Write (without [begin|end]_inset).
6247 2000-07-11 Juergen Vigna <jug@sad.it>
6249 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6250 as the insertInset could not be good!
6252 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6253 the bool param should not be last.
6255 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6257 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6258 did submit that to Karl).
6260 * configure.in: use -isystem instead of -I for X headers. This
6261 fixes a problem on solaris with a recent gcc;
6262 put the front-end code after the X detection code;
6263 configure in sigc++ before lib/
6265 * src/lyx_main.C (commandLineHelp): remove -display from command
6268 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6270 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6271 Also put in Makefile rules for building the ``listerrors''
6272 program for parsing errors from literate programs written in LyX.
6274 * lib/build-listerrors: Added small shell script as part of compile
6275 process. This builds a working ``listerrors'' binary if noweb is
6276 installed and either 1) the VNC X server is installed on the machine,
6277 or 2) the user is compiling from within a GUI. The existence of a GUI
6278 is necessary to use the ``lyx --export'' feature for now. This
6279 hack can be removed once ``lyx --export'' no longer requires a GUI to
6282 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6284 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6285 now passed back correctly from gcc and placed "under" error
6286 buttons in a Literate LyX source.
6288 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6290 * src/text.C (GetColumnNearX): Better behavior when a RTL
6291 paragraph is ended by LTR text.
6293 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6296 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6298 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6299 true when clipboard is empty.
6301 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6303 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6304 row of the paragraph.
6305 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6306 to prevent calculation of bidi tables
6308 2000-07-07 Juergen Vigna <jug@sad.it>
6310 * src/screen.C (ToggleSelection): added y_offset and x_offset
6313 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6316 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6318 * src/insets/insettext.C: fixed Layout-Display!
6320 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6322 * configure.in: add check for strings.h header.
6324 * src/spellchecker.C: include <strings.h> in order to have a
6325 definition for bzero().
6327 2000-07-07 Juergen Vigna <jug@sad.it>
6329 * src/insets/insettext.C (draw): set the status of the bv->text to
6330 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6332 * src/screen.C (DrawOneRow):
6333 (DrawFromTo): redraw the actual row if something has changed in it
6336 * src/text.C (draw): call an update of the toplevel-inset if something
6337 has changed inside while drawing.
6339 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6341 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6343 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6344 processing inside class.
6346 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6347 processing inside class.
6349 * src/insets/insetindex.h new struct Holder, consistent with other
6352 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6353 citation dialog from main code and placed it in src/frontends/xforms.
6354 Dialog launched through signals instead of callbacks
6356 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6358 * lyx.man: update the options description.
6360 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6362 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6363 handle neg values, set min width to 590, add doc about -display
6365 2000-07-05 Juergen Vigna <jug@sad.it>
6367 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6368 calls to BufferView *.
6370 * src/insets/insettext.C (checkAndActivateInset): small fix non
6371 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6373 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6374 their \end_inset token!
6376 2000-07-04 edscott <edscott@imp.mx>
6378 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6379 lib/lyxrc.example: added option \wheel_jump
6381 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6383 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6384 remove support for -width,-height,-xpos and -ypos.
6386 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6388 * src/encoding.[Ch]: New files.
6390 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6391 (text): Call to the underline() method only when needed.
6393 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6395 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6396 encoding(s) for the document.
6398 * src/bufferparams.C (BufferParams): Changed default value of
6401 * src/language.C (newLang): Removed.
6402 (items[]): Added encoding information for all defined languages.
6404 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6405 encoding choice button.
6407 * src/lyxrc.h (font_norm_type): New member variable.
6408 (set_font_norm_type): New method.
6410 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6411 paragraphs with different encodings.
6413 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6414 (TransformChar): Changed to work correctly with Arabic points.
6415 (draw): Added support for drawing Arabic points.
6416 (draw): Removed code for drawing underbars (this is done by
6419 * src/support/textutils.h (IsPrintableNonspace): New function.
6421 * src/BufferView_pimpl.h: Added "using SigC::Object".
6422 * src/LyXView.h: ditto.
6424 * src/insets/insetinclude.h (include_label): Changed to mutable.
6426 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6428 * src/mathed/math_iter.h: remove empty destructor
6430 * src/mathed/math_cursor.h: remove empty destructor
6432 * src/insets/lyxinset.h: add THEOREM_CODE
6434 * src/insets/insettheorem.[Ch]: new files
6436 * src/insets/insetminipage.C: (InsertInset): remove
6438 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6440 (InsertInset): remove
6442 * src/insets/insetlist.C: (InsertList): remove
6444 * src/insets/insetfootlike.[Ch]: new files
6446 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6449 (InsertInset): ditto
6451 * src/insets/insetert.C: remove include Painter.h, reindent
6452 (InsertInset): move to header
6454 * src/insets/insetcollapsable.h: remove explicit from default
6455 contructor, remove empty destructor, add InsertInset
6457 * src/insets/insetcollapsable.C (InsertInset): new func
6459 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6461 * src/vspace.h: add explicit to constructor
6463 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6464 \textcompwordmark, please test this.
6466 * src/lyxrc.C: set ascii_linelen to 65 by default
6468 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6470 * src/commandtags.h: add LFUN_INSET_THEOREM
6472 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6473 (makeLinuxDocFile): remove _some_ of the nice logic
6474 (makeDocBookFile): ditto
6476 * src/Painter.[Ch]: (~Painter): removed
6478 * src/LyXAction.C (init): entry for insettheorem added
6480 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6482 (deplog): code to detect files generated by LaTeX, needs testing
6485 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6487 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6489 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6491 * src/LaTeX.C (deplog): Add a check for files that are going to be
6492 created by the first latex run, part of the project to remove the
6495 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6496 contents to the extension list.
6498 2000-07-04 Juergen Vigna <jug@sad.it>
6500 * src/text.C (NextBreakPoint): added support for needFullRow()
6502 * src/insets/lyxinset.h: added needFullRow()
6504 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6507 * src/insets/insettext.C: lots of changes for update!
6509 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6511 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6513 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6515 * src/insets/insetinclude.C (InsetInclude): fixed
6516 initialization of include_label.
6517 (unique_id): now returns a string.
6519 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6521 * src/LaTeXFeatures.h: new member IncludedFiles, for
6522 a map of key, included file name.
6524 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6525 with the included files for inclusion in SGML preamble,
6526 i. e., linuxdoc and docbook.
6529 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6530 nice (is the generated linuxdoc code to be exported?), that
6531 allows to remove column, and only_body that will be true for
6532 slave documents. Insets are allowed inside SGML font type.
6533 New handling of the SGML preamble for included files.
6534 (makeDocBookFile): the same for docbook.
6536 * src/insets/insetinclude.h:
6537 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6539 (DocBook): new export methods.
6541 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6542 and makeDocBookFile.
6544 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6545 formats to export with command line argument -x.
6547 2000-06-29 Juergen Vigna <jug@sad.it>
6549 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6550 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6552 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6553 region could already been cleared by an inset!
6555 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6557 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6560 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6562 (cursorToggle): remove special handling of lyx focus.
6564 2000-06-28 Juergen Vigna <jug@sad.it>
6566 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6569 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6571 * src/insets/insetindex.C (Edit): add a callback when popup is
6574 * src/insets/insettext.C (LocalDispatch):
6575 * src/insets/insetmarginal.h:
6576 * src/insets/insetlist.h:
6577 * src/insets/insetfoot.h:
6578 * src/insets/insetfloat.h:
6579 * src/insets/insetert.h: add a missing std:: qualifier.
6581 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6583 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6586 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6588 * src/insets/insettext.C (Read): remove tmptok unused variable
6589 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6590 (InsertInset): change for new InsetInset code
6592 * src/insets/insettext.h: add TEXT inline method
6594 * src/insets/insettext.C: remove TEXT macro
6596 * src/insets/insetmarginal.C (Write): new method
6597 (Latex): change output slightly
6599 * src/insets/insetfoot.C (Write): new method
6600 (Latex): change output slightly (don't use endl when no need)
6602 * src/insets/insetert.C (Write): new method
6604 * src/insets/insetcollapsable.h: make button_length, button_top_y
6605 and button_bottm_y protected.
6607 * src/insets/insetcollapsable.C (Write): simplify code by using
6608 tostr. Also do not output the float name, the children class
6609 should to that to get control over own arguments
6611 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6612 src/insets/insetminipage.[Ch]:
6615 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6617 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6619 * src/Makefile.am (lyx_SOURCES): add the new files
6621 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6622 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6623 * src/commandtags.h: ditto
6625 * src/LaTeXFeatures.h: add a std::set of used floattypes
6627 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6629 * src/FloatList.[Ch] src/Floating.h: new files
6631 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6633 * src/lyx_cb.C (TableApplyCB): ditto
6635 * src/text2.C: ditto
6636 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6637 (parseSingleLyXformat2Token): ditto + add code for
6638 backwards compability for old float styles + add code for new insets
6640 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6642 (InsertInset(size_type, Inset *, LyXFont)): new method
6643 (InsetChar(size_type, char)): changed to use the other InsetChar
6644 with a LyXFont(ALL_INHERIT).
6645 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6646 insert the META_INSET.
6648 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6650 * sigc++/thread.h (Threads): from here
6652 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6653 definition out of line
6654 * sigc++/scope.h: from here
6656 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6658 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6659 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6661 * Makefile.am (bindist): new target.
6663 * INSTALL: add instructions for doing a binary distribution.
6665 * development/tools/README.bin.example: update a bit.
6667 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6670 * lib/lyxrc.example: new lyxrc tag \set_color.
6672 * src/lyxfunc.C (Dispatch):
6673 * src/commandtags.h:
6674 * src/LyXAction.C: new lyxfunc "set-color".
6676 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6677 and an x11name given as strings.
6679 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6680 cache when a color is changed.
6682 2000-06-26 Juergen Vigna <jug@sad.it>
6684 * src/lyxrow.C (width): added this functions and variable.
6686 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6689 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6691 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6693 * images/undo_bw.xpm: new icon.
6694 * images/redo_bw.xpm: ditto.
6696 * configure.in (INSTALL_SCRIPT): change value to
6697 ${INSTALL} to avoid failures of install-script target.
6698 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6700 * src/BufferView.h: add a magic "friend" declaration to please
6703 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6705 * forms/cite.fd: modified to allow resizing without messing
6708 * src/insetcite.C: Uses code from cite.fd almost without
6710 User can now resize dialog in the x-direction.
6711 Resizing the dialog in the y-direction is prevented, as the
6712 code does this intelligently already.
6714 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6716 * INSTALL: remove obsolete entry in "problems" section.
6718 * lib/examples/sl_*.lyx: update of the slovenian examples.
6720 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6722 2000-06-23 Juergen Vigna <jug@sad.it>
6724 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6726 * src/buffer.C (resize): delete the LyXText of textinsets.
6728 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6730 * src/insets/lyxinset.h: added another parameter 'cleared' to
6731 the draw() function.
6733 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6734 unlocking inset in inset.
6736 2000-06-22 Juergen Vigna <jug@sad.it>
6738 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6739 of insets and moved first to LyXText.
6741 * src/mathed/formulamacro.[Ch]:
6742 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6744 2000-06-21 Juergen Vigna <jug@sad.it>
6746 * src/text.C (GetVisibleRow): look if I should clear the area or not
6747 using Inset::doClearArea() function.
6749 * src/insets/lyxinset.h: added doClearArea() function and
6750 modified draw(Painter &, ...) to draw(BufferView *, ...)
6752 * src/text2.C (UpdateInset): return bool insted of int
6754 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6756 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6757 combox in the character popup
6759 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6760 BufferParams const & params
6762 2000-06-20 Juergen Vigna <jug@sad.it>
6764 * src/insets/insettext.C (SetParagraphData): set insetowner on
6767 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6769 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6770 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6772 (form_main_): remove
6774 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6775 (create_form_form_main): remove FD_form_main stuff, connect to
6776 autosave_timeout signal
6778 * src/LyXView.[Ch] (getMainForm): remove
6779 (UpdateTimerCB): remove
6780 * src/BufferView_pimpl.h: inherit from SigC::Object
6782 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6783 signal instead of callback
6785 * src/BufferView.[Ch] (cursorToggleCB): remove
6787 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6789 * src/BufferView_pimpl.C: changes because of the one below
6791 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6792 instead of storing a pointer to a LyXText.
6794 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6796 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6798 * src/lyxparagraph.h
6800 * src/paragraph.C: Changed fontlist to a sorted vector.
6802 2000-06-19 Juergen Vigna <jug@sad.it>
6804 * src/BufferView.h: added screen() function.
6806 * src/insets/insettext.C (LocalDispatch): some selection code
6809 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6811 * src/insets/insettext.C (SetParagraphData):
6813 (InsetText): fixes for multiple paragraphs.
6815 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6817 * development/lyx.spec.in: Call configure with ``--without-warnings''
6818 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6819 This should be fine, however, since we generally don't want to be
6820 verbose when making an RPM.
6822 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6824 * lib/scripts/fig2pstex.py: New file
6826 2000-06-16 Juergen Vigna <jug@sad.it>
6828 * src/insets/insettabular.C (UpdateLocal):
6829 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6830 (LocalDispatch): Changed all functions to use LyXText.
6832 2000-06-15 Juergen Vigna <jug@sad.it>
6834 * src/text.C (SetHeightOfRow): call inset::update before requesting
6837 * src/insets/insettext.C (update):
6838 * src/insets/insettabular.C (update): added implementation
6840 * src/insets/lyxinset.h: added update function
6842 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6844 * src/text.C (SelectNextWord): protect against null pointers with
6845 old-style string streams. (fix from Paul Theo Gonciari
6848 * src/cite.[Ch]: remove erroneous files.
6850 * lib/configure.m4: update the list of created directories.
6852 * src/lyxrow.C: include <config.h>
6853 * src/lyxcursor.C: ditto.
6855 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6857 * lib/examples/decimal.lyx: new example file from Mike.
6859 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6860 to find template definitions (from Dekel)
6862 * src/frontends/.cvsignore: add a few things.
6864 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6866 * src/Timeout.C (TimeOut): remove default argument.
6868 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6871 * src/insets/ExternalTemplate.C: add a "using" directive.
6873 * src/lyx_main.h: remove the act_ struct, which seems unused
6876 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6878 * LyX Developers Meeting: All files changed, due to random C++ (by
6879 coincidence) code generator script.
6881 - external inset (cool!)
6882 - initial online editing of preferences
6883 - insettabular breaks insettext(s contents)
6885 - some DocBook fixes
6886 - example files update
6887 - other cool stuff, create a diff and look for yourself.
6889 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6891 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6892 -1 this is a non-line-breaking textinset.
6894 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6895 if there is no width set.
6897 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6899 * Lots of files: Merged the dialogbase branch.
6901 2000-06-09 Allan Rae <rae@lyx.org>
6903 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6904 and the Dispatch methods that used it.
6906 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6907 access to functions formerly kept in Dispatch.
6909 2000-05-19 Allan Rae <rae@lyx.org>
6911 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6912 made to_page and count_copies integers again. from_page remains a
6913 string however because I want to allow entry of a print range like
6914 "1,4,22-25" using this field.
6916 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6917 and printer-params-get. These aren't useful from the minibuffer but
6918 could be used by a script/LyXServer app provided it passes a suitable
6919 auto_mem_buffer. I guess I should take a look at how the LyXServer
6920 works and make it support xtl buffers.
6922 * sigc++/: updated to libsigc++-1.0.1
6924 * src/xtl/: updated to xtl-1.3.pl.11
6926 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6927 those changes done to the files in src/ are actually recreated when
6928 they get regenerated. Please don't ever accept a patch that changes a
6929 dialog unless that patch includes the changes to the corresponding *.fd
6932 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6933 stringOnlyContains, renamed it and generalised it.
6935 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6936 branch. Removed the remaining old form_print code.
6938 2000-04-26 Allan Rae <rae@lyx.org>
6940 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6941 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6943 2000-04-25 Allan Rae <rae@lyx.org>
6945 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6946 against a base of xtl-1.3.pl.4
6948 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6949 filter the Id: entries so they still show the xtl version number
6952 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6953 into the src/xtl code. Patch still pending with José (XTL)
6955 2000-04-24 Allan Rae <rae@lyx.org>
6957 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6958 both more generic and much safer. Use the new template functions.
6959 * src/buffer.[Ch] (Dispatch): ditto.
6961 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6962 and mem buffer more intelligently. Also a little general cleanup.
6965 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6966 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6967 * src/xtl/Makefile.am: ditto.
6968 * src/xtl/.cvsignore: ditto.
6969 * src/Makefile.am: ditto.
6971 * src/PrinterParams.h: Removed the macros member functions. Added a
6972 testInvariant member function. A bit of tidying up and commenting.
6973 Included Angus's idea for fixing operation with egcs-1.1.2.
6975 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6976 cool expansion of XTL's mem_buffer to support automatic memory
6977 management within the buffer itself. Removed the various macros and
6978 replaced them with template functions that use either auto_mem_buffer
6979 or mem_buffer depending on a #define. The mem_buffer support will
6980 disappear as soon as the auto_mem_buffer is confirmed to be good on
6981 other platforms/compilers. That is, it's there so you've got something
6984 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6985 effectively forked XTL. However I expect José will include my code
6986 into the next major release. Also fixed a memory leak.
6987 * src/xtl/text.h: ditto.
6988 * src/xtl/xdr.h: ditto.
6989 * src/xtl/giop.h: ditto.
6991 2000-04-16 Allan Rae <rae@lyx.org>
6993 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6994 by autogen.sh and removed by maintainer-clean anyway.
6995 * .cvsignore, sigc++/.cvsignore: Support the above.
6997 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6999 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7001 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7002 macros, renamed static callback-target member functions to suit new
7003 scheme and made them public.
7004 * src/frontends/xforms/forms/form_print.fd: ditto.
7005 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7007 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7010 * src/xtl/: New directory containing a minimal distribution of XTL.
7011 This is XTL-1.3.pl.4.
7013 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7015 2000-04-15 Allan Rae <rae@lyx.org>
7017 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7019 * sigc++/: Updated to libsigc++-1.0.0
7021 2000-04-14 Allan Rae <rae@lyx.org>
7023 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7024 use the generic ones in future. I'll modify my conversion script.
7026 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7028 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7029 (CloseAllBufferRelatedDialogs): Renamed.
7030 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7032 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7033 of the generic ones. These are the same ones my conversion script
7036 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7037 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7038 * src/buffer.C (Dispatch): ditto
7040 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7041 functions for updating and hiding buffer dependent dialogs.
7042 * src/BufferView.C (buffer): ditto
7043 * src/buffer.C (setReadonly): ditto
7044 * src/lyxfunc.C (CloseBuffer): ditto
7046 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7047 Dialogs.h, and hence all the SigC stuff, into every file that includes
7048 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7050 * src/BufferView2.C: reduce the number of headers included by buffer.h
7052 2000-04-11 Allan Rae <rae@lyx.org>
7054 * src/frontends/xforms/xform_macros.h: A small collection of macros
7055 for building C callbacks.
7057 * src/frontends/xforms/Makefile.am: Added above file.
7059 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7060 scheme again. This time it should work for JMarc. If this is
7061 successful I'll revise my conversion script to automate some of this.
7062 The static member functions in the class also have to be public for
7063 this scheme will work. If the scheme works (it's almost identical to
7064 the way BufferView::cursorToggleCB is handled so it should work) then
7065 FormCopyright and FormPrint will be ready for inclusion into the main
7066 trunk immediately after 1.1.5 is released -- provided we're prepared
7067 for complaints about lame compilers not handling XTL.
7069 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7071 2000-04-07 Allan Rae <rae@lyx.org>
7073 * config/lyxinclude.m4: A bit more tidying up (Angus)
7075 * src/LString.h: JMarc's <string> header fix
7077 * src/PrinterParams.h: Used string for most data to remove some
7078 ugly code in the Print dialog and avoid even uglier code when
7079 appending the ints to a string for output.
7081 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7082 and moved "default:" back to the end of switch statement. Cleaned
7083 up the printing so it uses the right function calls and so the
7084 "print to file" option actually puts the file in the right directory.
7086 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7088 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7089 and Ok+Apply button control into a separate method: input (Angus).
7090 (input) Cleaned it up and improved it to be very thorough now.
7091 (All CB) static_cast used instead of C style cast (Angus). This will
7092 probably change again once we've worked out how to keep gcc-2.8.1 happy
7093 with real C callbacks.
7094 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7095 ignore some of the bool settings and has random numbers instead. Needs
7096 some more investigation. Added other input length checks and checking
7097 of file and printer names.
7099 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7100 would link (Angus). Seems the old code doesn't compile with the pragma
7101 statement either. Separated callback entries from internal methods.
7103 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7105 2000-03-17 Allan Rae <rae@lyx.org>
7107 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7108 need it? Maybe it could go in Dialogs instead? I could make it a
7109 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7110 values to get the bool return value.
7111 (Dispatch): New overloaded method for xtl support.
7113 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7114 extern "C" callback instead of static member functions. Hopefully,
7115 JMarc will be able to compile this. I haven't changed
7116 forms/form_copyright.fd yet. Breaking one of my own rules already.
7118 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7119 because they aren't useful from the minibuffer. Maybe a LyXServer
7120 might want a help message though?
7122 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7124 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7125 xtl which needs both rtti and exceptions.
7127 * src/support/Makefile.am:
7128 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7130 * src/frontends/xforms/input_validators.[ch]: input filters and
7131 validators. These conrol what keys are valid in input boxes.
7132 Use them and write some more. Much better idea than waiting till
7133 after the user has pressed Ok to say that the input fields don't make
7136 * src/frontends/xforms/Makefile.am:
7137 * src/frontends/xforms/forms/form_print.fd:
7138 * src/frontends/xforms/forms/makefile:
7139 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7140 new scheme. Still have to make sure I haven't missed anything from
7141 the current implementation.
7143 * src/Makefile.am, src/PrinterParams.h: New data store.
7145 * other files: Added a couple of copyright notices.
7147 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7149 * src/insets/insetbib.h: move Holder struct in public space.
7151 * src/frontends/include/DialogBase.h: use SigC:: only when
7152 SIGC_CXX_NAMESPACES is defined.
7153 * src/frontends/include/Dialogs.h: ditto.
7155 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7157 * src/frontends/xforms/FormCopyright.[Ch]: do not
7158 mention SigC:: explicitely.
7160 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7162 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7163 deals with testing KDE in main configure.in
7164 * configure.in: ditto.
7166 2000-02-22 Allan Rae <rae@lyx.org>
7168 * Lots of files: Merged from HEAD
7170 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7171 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7173 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7175 * sigc++/: new minidist.
7177 2000-02-14 Allan Rae <rae@lyx.org>
7179 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7181 2000-02-08 Juergen Vigna <jug@sad.it>
7183 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7184 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7186 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7187 for this port and so it is much easier for other people to port
7188 dialogs in a common development environment.
7190 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7191 the QT/KDE implementation.
7193 * src/frontends/kde/Dialogs.C:
7194 * src/frontends/kde/FormCopyright.C:
7195 * src/frontends/kde/FormCopyright.h:
7196 * src/frontends/kde/Makefile.am:
7197 * src/frontends/kde/formcopyrightdialog.C:
7198 * src/frontends/kde/formcopyrightdialog.h:
7199 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7200 for the kde support of the Copyright-Dialog.
7202 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7203 subdir-substitution instead of hardcoded 'xforms' as we now have also
7206 * src/frontends/include/DialogBase.h (Object): just commented the
7207 label after #endif (nasty warning and I don't like warnings ;)
7209 * src/main.C (main): added KApplication initialization if using
7212 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7213 For now only the KDE event-loop is added if frontend==kde.
7215 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7217 * configure.in: added support for the --with-frontend[=value] option
7219 * autogen.sh: added kde.m4 file to list of config-files
7221 * acconfig.h: added define for KDEGUI-support
7223 * config/kde.m4: added configuration functions for KDE-port
7225 * config/lyxinclude.m4: added --with-frontend[=value] option with
7226 support for xforms and KDE.
7228 2000-02-08 Allan Rae <rae@lyx.org>
7230 * all Makefile.am: Fixed up so the make targets dist, distclean,
7231 install and uninstall all work even if builddir != srcdir. Still
7232 have a new sigc++ minidist update to come.
7234 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7236 2000-02-01 Allan Rae <rae@lyx.org>
7238 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7239 Many mods to get builddir != srcdir working.
7241 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7242 for building on NT and so we can do the builddir != srcdir stuff.
7244 2000-01-30 Allan Rae <rae@lyx.org>
7246 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7247 This will stay in "rae" branch. We probably don't really need it in
7248 the main trunk as anyone who wants to help programming it should get
7249 a full library installed also. So they can check both included and
7250 system supplied library compilation.
7252 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7253 Added a 'mini' distribution of libsigc++. If you feel the urge to
7254 change something in these directories - Resist it. If you can't
7255 resist the urge then you should modify the following script and rebuild
7256 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7257 all happen. Still uses a hacked version of libsigc++'s configure.in.
7258 I'm quite happy with the results. I'm not sure the extra work to turn
7259 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7260 worth the trouble and would probably lead to extra maintenance
7262 I haven't tested the following important make targets: install, dist.
7263 Not ready for prime time but very close. Maybe 1.1.5.
7265 * development/tools/makeLyXsigc.sh: A shell script to automatically
7266 generate our mini-dist of libsigc++. It can only be used with a CVS
7267 checkout of libsigc++ not a tarball distribution. It's well commented.
7268 This will end up as part of the libsigc++ distribution so other apps
7269 can easily have an included mini-dist. If someone makes mods to the
7270 sigc++ subpackage without modifying this script to generate those
7271 changes I'll be very upset!
7273 * src/frontends/: Started the gui/system indep structure.
7275 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7276 to access the gui-indep dialogs are in this class. Much improved
7277 design compared to previous revision. Lars, please refrain from
7278 moving this header into src/ like you did with Popups.h last time.
7280 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7282 * src/frontends/xforms/: Started the gui-indep system with a single
7283 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7286 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7287 Here you'll find a very useful makefile and automated fdfix.sh that
7288 makes updating dailogs a no-brainer -- provided you follow the rules
7289 set out in the README. I'm thinking about adding another script to
7290 automatically generate skeleton code for a new dialog given just the
7293 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7294 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7295 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7297 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7299 * src/support/LSubstring.C (operator): simplify
7301 * src/lyxtext.h: removed bparams, use buffer_->params instead
7303 * src/lyxrow.h: make Row a real class, move all variables to
7304 private and use accessors.
7306 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7308 (isRightToLeftPar): ditto
7309 (ChangeLanguage): ditto
7310 (isMultiLingual): ditto
7313 (SimpleTeXOnePar): ditto
7314 (TeXEnvironment): ditto
7315 (GetEndLabel): ditto
7317 (SetOnlyLayout): ditto
7318 (BreakParagraph): ditto
7319 (BreakParagraphConservative): ditto
7320 (GetFontSettings): ditto
7322 (CopyIntoMinibuffer): ditto
7323 (CutIntoMinibuffer): ditto
7324 (PasteParagraph): ditto
7325 (SetPExtraType): ditto
7326 (UnsetPExtraType): ditto
7327 (DocBookContTableRows): ditto
7328 (SimpleDocBookOneTablePar): ditto
7330 (TeXFootnote): ditto
7331 (SimpleTeXOneTablePar): ditto
7332 (TeXContTableRows): ditto
7333 (SimpleTeXSpecialChars): ditto
7336 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7337 to private and use accessors.
7339 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7340 this, we did not use it anymore and has not been for ages. Just a
7341 waste of cpu cycles.
7343 * src/language.h: make Language a real class, move all variables
7344 to private and use accessors.
7346 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7347 (create_view): remove
7348 (update): some changes for new timer
7349 (cursorToggle): use new timer
7350 (beforeChange): change for new timer
7352 * src/BufferView.h (cursorToggleCB): removed last paramter because
7355 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7356 (cursorToggleCB): change because of new timer code
7358 * lib/CREDITS: updated own mailaddress
7360 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7362 * src/support/filetools.C (PutEnv): fix the code in case neither
7363 putenv() nor setenv() have been found.
7365 * INSTALL: mention the install-strip Makefile target.
7367 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7368 read-only documents.
7370 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7372 * lib/reLyX/configure.in (VERSION): avoid using a previously
7373 generated reLyX wrapper to find out $prefix.
7375 * lib/examples/eu_adibide_lyx-atua.lyx:
7376 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7377 translation of the Tutorial (Dooteo)
7379 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7381 * forms/cite.fd: new citation dialog
7383 * src/insetcite.[Ch]: the new citation dialog is moved into
7386 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7389 * src/insets/insetcommand.h: data members made private.
7391 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7393 * LyX 1.1.5 released
7395 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7397 * src/version.h (LYX_RELEASE): to 1.1.5
7399 * src/spellchecker.C (RunSpellChecker): return false if the
7400 spellchecker dies upon creation.
7402 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7404 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7405 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7409 * lib/CREDITS: update entry for Martin Vermeer.
7411 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7413 * src/text.C (draw): Draw foreign language bars at the bottom of
7414 the row instead of at the baseline.
7416 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7418 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7420 * lib/bind/de_menus.bind: updated
7422 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7424 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7426 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7428 * src/menus.C (Limit_string_length): New function
7429 (ShowTocMenu): Limit the number of items/length of items in the
7432 * src/paragraph.C (String): Correct result for a paragraph inside
7435 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7437 * src/bufferlist.C (close): test of buf->getuser() == NULL
7439 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7441 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7442 Do not call to SetCursor when the paragraph is a closed footnote!
7444 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7446 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7449 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7451 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7454 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7455 reference popup, that activates the reference-back action
7457 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7459 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7460 the menus. Also fixed a bug.
7462 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7463 the math panels when switching buffers (unless new buffer is readonly).
7465 * src/BufferView.C (NoSavedPositions)
7466 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7468 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7470 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7471 less of dvi dirty or not.
7473 * src/trans_mgr.[Ch] (insert): change first parameter to string
7476 * src/chset.[Ch] (encodeString): add const to first parameter
7478 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7480 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7484 * src/LaTeX.C (deplog): better searching for dependency files in
7485 the latex log. Uses now regexps.
7487 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7488 instead of the box hack or \hfill.
7490 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7492 * src/lyxfunc.C (doImportHelper): do not create the file before
7493 doing the actual import.
7494 (doImportASCIIasLines): create a new file before doing the insert.
7495 (doImportASCIIasParagraphs): ditto.
7497 * lib/lyxrc.example: remove mention of non-existing commands
7499 * lyx.man: remove mention of color-related switches.
7501 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7503 * src/lyx_gui.C: remove all the color-related ressources, which
7504 are not used anymore.
7506 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7509 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7511 * src/lyxrc.C (read): Add a missing break in the switch
7513 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7515 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7517 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7520 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7522 * src/text.C (draw): draw bars under foreign language words.
7524 * src/LColor.[Ch]: add LColor::language
7526 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7528 * src/lyxcursor.h (boundary): New member variable
7530 * src/text.C (IsBoundary): New methods
7532 * src/text.C: Use the above for currect cursor movement when there
7533 is both RTL & LTR text.
7535 * src/text2.C: ditto
7537 * src/bufferview_funcs.C (ToggleAndShow): ditto
7539 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7541 * src/text.C (DeleteLineForward): set selection to true to avoid
7542 that DeleteEmptyParagraphMechanism does some magic. This is how it
7543 is done in all other functions, and seems reasonable.
7544 (DeleteWordForward): do not jump over non-word stuff, since
7545 CursorRightOneWord() already does it.
7547 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7548 DeleteWordBackward, since they seem safe to me (since selection is
7549 set to "true") DeleteEmptyParagraphMechanism does nothing.
7551 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7553 * src/lyx_main.C (easyParse): simplify the code by factoring the
7554 part that removes parameters from the command line.
7555 (LyX): check wether wrong command line options have been given.
7557 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7559 * src/lyx_main.C : add support for specifying user LyX
7560 directory via command line option -userdir.
7562 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7564 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7565 the number of items per popup.
7566 (Add_to_refs_menu): Ditto.
7568 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7570 * src/lyxparagraph.h: renamed ClearParagraph() to
7571 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7572 textclass as parameter, and do nothing if free_spacing is
7573 true. This fixes part of the line-delete-forward problems.
7575 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7576 (pasteSelection): ditto.
7577 (SwitchLayoutsBetweenClasses): more translatable strings.
7579 * src/text2.C (CutSelection): use StripLeadingSpaces.
7580 (PasteSelection): ditto.
7581 (DeleteEmptyParagraphMechanism): ditto.
7583 2000-05-26 Juergen Vigna <jug@sad.it>
7585 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7586 is not needed in tabular insets.
7588 * src/insets/insettabular.C (TabularFeatures): added missing features.
7590 * src/tabular.C (DeleteColumn):
7592 (AppendRow): implemented this functions
7593 (cellsturct::operator=): clone the inset too;
7595 2000-05-23 Juergen Vigna <jug@sad.it>
7597 * src/insets/insettabular.C (LocalDispatch): better selection support
7598 when having multicolumn-cells.
7600 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7602 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7604 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7606 * src/ColorHandler.C (getGCForeground): put more test into _()
7608 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7611 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7614 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7616 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7617 there are no labels, or when buffer is readonly.
7619 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7620 there are no labels, buffer is SGML, or when buffer is readonly.
7622 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7624 * src/LColor.C (LColor): change a couple of grey40 to grey60
7625 (LColor): rewore initalization to make compiles go some magnitude
7627 (getGUIName): don't use gettext until we need the string.
7629 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7631 * src/Bullet.[Ch]: Fixed a small bug.
7633 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7635 * src/paragraph.C (String): Several fixes/improvements
7637 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7639 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7641 * src/paragraph.C (String): give more correct output.
7643 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7645 * src/lyxfont.C (stateText) Do not output the language if it is
7646 eqaul to the language of the document.
7648 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7649 between two paragraphs with the same language.
7651 * src/paragraph.C (getParLanguage) Return a correct answer for an
7652 empty dummy paragraph.
7654 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7657 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7660 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7661 the menus/popup, if requested fonts are unavailable.
7663 2000-05-22 Juergen Vigna <jug@sad.it>
7665 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7666 movement support (Up/Down/Tab/Shift-Tab).
7667 (LocalDispatch): added also preliminari cursor-selection.
7669 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7671 * src/paragraph.C (PasteParagraph): Hopefully now right!
7673 2000-05-22 Garst R. Reese <reese@isn.net>
7675 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7676 of list, change all references to Environment to Command
7677 * tex/hollywood.cls : rewrite environments as commands, add
7678 \uppercase to interiorshot and exteriorshot to force uppecase.
7679 * tex/broadway.cls : rewrite environments as commands. Tweak
7682 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7684 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7685 size of items: use a constant intead of the hardcoded 40, and more
7686 importantly do not remove the %m and %x tags added at the end.
7687 (Add_to_refs_menu): use vector::size_type instead of
7688 unsigned int as basic types for the variables. _Please_ do not
7689 assume that size_t is equal to unsigned int. On an alpha, this is
7690 unsigned long, which is _not_ the same.
7692 * src/language.C (initL): remove language "hungarian", since it
7693 seems that "magyar" is better.
7695 2000-05-22 Juergen Vigna <jug@sad.it>
7697 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7699 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7702 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7703 next was deleted but not set to 0.
7705 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7707 * src/language.C (initL): change the initialization of languages
7708 so that compiles goes _fast_.
7710 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7713 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7715 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7719 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7721 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7723 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7727 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7730 * src/insets/insetlo*.[Ch]: Made editable
7732 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7734 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7735 the current selection.
7737 * src/BufferView_pimpl.C (stuffClipboard): new method
7739 * src/BufferView.C (stuffClipboard): new method
7741 * src/paragraph.C (String): new method
7743 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7744 LColor::ignore when lyxname is not found.
7746 * src/BufferView.C (pasteSelection): new method
7748 * src/BufferView_pimpl.C (pasteSelection): new method
7750 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7752 * src/WorkArea.C (request_clipboard_cb): new static function
7753 (getClipboard): new method
7754 (putClipboard): new method
7756 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7758 * LyX 1.1.5pre2 released
7760 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7762 * src/vspace.C (operator=): removed
7763 (operator=): removed
7765 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7767 * src/layout.C (NumberOfClass): manually set the type in make_pair
7768 (NumberOfLayout): ditto
7770 * src/language.C: use the Language constructor for ignore_lang
7772 * src/language.h: add constructors to struct Language
7774 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7776 * src/text2.C (SetCursorIntern): comment out #warning
7778 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7780 * src/mathed/math_iter.h: initialize sx and sw to 0
7782 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7784 * forms/lyx.fd: Redesign of form_ref
7786 * src/LaTeXFeatures.[Ch]
7790 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7793 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7794 and Buffer::inset_iterator.
7796 * src/menus.C: Added new menus: TOC and Refs.
7798 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7800 * src/buffer.C (getTocList): New method.
7802 * src/BufferView2.C (ChangeRefs): New method.
7804 * src/buffer.C (getLabelList): New method. It replaces the old
7805 getReferenceList. The return type is vector<string> instead of
7808 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7809 the old getLabel() and GetNumberOfLabels() methods.
7810 * src/insets/insetlabel.C (getLabelList): ditto
7811 * src/mathed/formula.C (getLabelList): ditto
7813 * src/paragraph.C (String): New method.
7815 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7816 Uses the new getTocList() method.
7817 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7818 which automatically updates the contents of the browser.
7819 (RefUpdateCB): Use the new getLabelList method.
7821 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7823 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7825 * src/spellchecker.C: Added using std::reverse;
7827 2000-05-19 Juergen Vigna <jug@sad.it>
7829 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7831 * src/insets/insettext.C (computeTextRows): small fix for display of
7832 1 character after a newline.
7834 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7837 2000-05-18 Juergen Vigna <jug@sad.it>
7839 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7840 when changing width of column.
7842 * src/tabular.C (set_row_column_number_info): setting of
7843 autobreak rows if necessary.
7845 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7847 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7849 * src/vc-backend.*: renamed stat() to status() and vcstat to
7850 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7851 compilation broke. The new name seems more relevant, anyway.
7853 2000-05-17 Juergen Vigna <jug@sad.it>
7855 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7856 which was wrong if the removing caused removing of rows!
7858 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7859 (pushToken): new function.
7861 * src/text2.C (CutSelection): fix problem discovered with purify
7863 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7865 * src/debug.C (showTags): enlarge the first column, now that we
7866 have 6-digits debug codes.
7868 * lib/layouts/hollywood.layout:
7869 * lib/tex/hollywood.cls:
7870 * lib/tex/brodway.cls:
7871 * lib/layouts/brodway.layout: more commands and fewer
7872 environments. Preambles moved in the .cls files. Broadway now has
7873 more options on scene numbering and less whitespace (from Garst)
7875 * src/insets/insetbib.C (getKeys): make sure that we are in the
7876 document directory, in case the bib file is there.
7878 * src/insets/insetbib.C (Latex): revert bogus change.
7880 2000-05-16 Juergen Vigna <jug@sad.it>
7882 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7883 the TabularLayout on cursor move.
7885 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7887 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7890 (draw): fixed cursor position and drawing so that the cursor is
7891 visible when before the tabular-inset.
7893 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7894 when creating from old insettext.
7896 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7898 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7900 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7901 * lib/tex/brodway.cls: ditto
7903 * lib/layouts/brodway.layout: change alignment of parenthical
7906 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7908 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7909 versions 0.88 and 0.89 are supported.
7911 2000-05-15 Juergen Vigna <jug@sad.it>
7913 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7916 * src/insets/insettext.C (computeTextRows): redone completely this
7917 function in a much cleaner way, because of problems when having a
7919 (draw): added a frame border when the inset is locked.
7920 (SetDrawLockedFrame): this sets if we draw the border or not.
7921 (SetFrameColor): this sets the frame color (default=insetframe).
7923 * src/insets/lyxinset.h: added x() and y() functions which return
7924 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7925 function which is needed to see if we have a locking inset of some
7926 type in this inset (needed for now in insettabular).
7928 * src/vspace.C (inPixels): the same function also without a BufferView
7929 parameter as so it is easier to use it in some ocasions.
7931 * src/lyxfunc.C: changed all places where insertInset was used so
7932 that now if it couldn't be inserted it is deleted!
7934 * src/TabularLayout.C:
7935 * src/TableLayout.C: added support for new tabular-inset!
7937 * src/BufferView2.C (insertInset): this now returns a bool if the
7938 inset was really inserted!!!
7940 * src/tabular.C (GetLastCellInRow):
7941 (GetFirstCellInRow): new helper functions.
7942 (Latex): implemented for new tabular class.
7946 (TeXTopHLine): new Latex() helper functions.
7948 2000-05-12 Juergen Vigna <jug@sad.it>
7950 * src/mathed/formulamacro.C (Read):
7951 * src/mathed/formula.C (Read): read also the \end_inset here!
7953 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7955 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7956 crush when saving formulae with unbalanced parenthesis.
7958 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7960 * src/layout.C: Add new keyword "endlabelstring" to layout file
7962 * src/text.C (GetVisibleRow): Draw endlabel string.
7964 * lib/layouts/broadway.layout
7965 * lib/layouts/hollywood.layout: Added endlabel for the
7966 Parenthetical layout.
7968 * lib/layouts/heb-article.layout: Do not use slanted font shape
7969 for Theorem like environments.
7971 * src/buffer.C (makeLaTeXFile): Always add "american" to
7972 the UsedLanguages list if document language is RTL.
7974 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7976 * add addendum to README.OS2 and small patch (from SMiyata)
7978 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7980 * many files: correct the calls to ChangeExtension().
7982 * src/support/filetools.C (ChangeExtension): remove the no_path
7983 argument, which does not belong there. Use OnlyFileName() instead.
7985 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7986 files when LaTeXing a non-nice latex file.
7988 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7989 a chain of "if". Return false when deadkeys are not handled.
7991 * src/lyx_main.C (LyX): adapted the code for default bindings.
7993 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7994 bindings for basic functionality (except deadkeys).
7995 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7997 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7998 several methods: handle override_x_deadkeys.
8000 * src/lyxrc.h: remove the "bindings" map, which did not make much
8001 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8003 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8005 * src/lyxfont.C (stateText): use a saner method to determine
8006 whether the font is "default". Seems to fix the crash with DEC
8009 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8011 2000-05-08 Juergen Vigna <jug@sad.it>
8013 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8014 TabularLayoutMenu with mouse-button-3
8015 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8017 * src/TabularLayout.C: added this file for having a Layout for
8020 2000-05-05 Juergen Vigna <jug@sad.it>
8022 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8023 recalculating inset-widths.
8024 (TabularFeatures): activated this function so that I can change
8025 tabular-features via menu.
8027 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8028 that I can test some functions with the Table menu.
8030 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8032 * src/lyxfont.C (stateText): guard against stupid c++libs.
8034 * src/tabular.C: add using std::vector
8035 some whitespace changes, + removed som autogenerated code.
8037 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8039 2000-05-05 Juergen Vigna <jug@sad.it>
8041 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8042 row, columns and cellstructures.
8044 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8046 * lib/lyxrc.example: remove obsolete entries.
8048 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8049 reading of protected_separator for free_spacing.
8051 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8053 * src/text.C (draw): do not display an exclamation mark in the
8054 margin for margin notes. This is confusing, ugly and
8057 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8058 AMS math' is checked.
8060 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8061 name to see whether including the amsmath package is needed.
8063 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8065 * src/paragraph.C (validate): Compute UsedLanguages correctly
8066 (don't insert the american language if it doesn't appear in the
8069 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8070 The argument of \thanks{} command is considered moving argument
8072 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8075 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8077 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8078 for appendix/minipage/depth. The lines can be now both in the footnote
8079 frame, and outside the frame.
8081 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8084 2000-05-05 Juergen Vigna <jug@sad.it>
8086 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8087 neede only in tabular.[Ch].
8089 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8091 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8093 (Write): write '~' for PROTECTED_SEPARATOR
8095 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8097 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8100 * src/mathed/formula.C (drawStr): rename size to siz.
8102 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8103 possibly fix a bug by not changing the pflags = flags to piflags =
8106 2000-05-05 Juergen Vigna <jug@sad.it>
8108 * src/insets/insetbib.C: moved using directive
8110 * src/ImportNoweb.C: small fix for being able to compile (missing
8113 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8115 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8116 to use clear, since we don't depend on this in the code. Add test
8119 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8121 * (various *.C files): add using std::foo directives to please dec
8124 * replace calls to string::clear() to string::erase() (Angus)
8126 * src/cheaders/cmath: modified to provide std::abs.
8128 2000-05-04 Juergen Vigna <jug@sad.it>
8130 * src/insets/insettext.C: Prepared all for inserting of multiple
8131 paragraphs. Still display stuff to do (alignment and other things),
8132 but I would like to use LyXText to do this when we cleaned out the
8133 table-support stuff.
8135 * src/insets/insettabular.C: Changed lot of stuff and added lots
8136 of functionality still a lot to do.
8138 * src/tabular.C: Various functions changed name and moved to be
8139 const functions. Added new Read and Write functions and changed
8140 lots of things so it works good with tabular-insets (also removed
8141 some stuff which is not needed anymore * hacks *).
8143 * src/lyxcursor.h: added operators == and != which just look if
8144 par and pos are (not) equal.
8146 * src/buffer.C (latexParagraphs): inserted this function to latex
8147 all paragraphs form par to endpar as then I can use this too for
8150 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8151 so that I can call this to from text insets with their own cursor.
8153 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8154 output off all paragraphs (because of the fix below)!
8156 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8157 the very last paragraph (this could be also the last paragraph of an
8160 * src/texrow.h: added rows() call which returns the count-variable.
8162 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8164 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8166 * lib/configure.m4: better autodetection of DocBook tools.
8168 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8170 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8172 * src/lyx_cb.C: add using std::reverse;
8174 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8177 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8178 selected files. Should fix repeated errors from generated files.
8180 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8182 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8184 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8185 the spellchecker popup.
8187 * lib/lyxrc.example: Removed the \number_inset section
8189 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8191 * src/insets/figinset.C (various): Use IsFileReadable() to make
8192 sure that the file actually exist. Relying on ghostscripts errors
8193 is a bad idea since they can lead to X server crashes.
8195 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8197 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8200 * lib/lyxrc.example: smallish typo in description of
8201 \view_dvi_paper_option
8203 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8206 * src/lyxfunc.C: doImportHelper to factor out common code of the
8207 various import methods. New functions doImportASCIIasLines,
8208 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8209 doImportLinuxDoc for the format specific parts.
8212 * buffer.C: Dispatch returns now a bool to indicate success
8215 * lyx_gui.C: Add getLyXView() for member access
8217 * lyx_main.C: Change logic for batch commands: First try
8218 Buffer::Dispatch (possibly without GUI), if that fails, use
8221 * lyx_main.C: Add support for --import command line switch.
8222 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8223 Available Formats: Everything accepted by 'buffer-import <format>'
8225 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8227 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8230 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8231 documents will be reformatted upon reentry.
8233 2000-04-27 Juergen Vigna <jug@sad.it>
8235 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8236 correctly only last pos this was a bug.
8238 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8240 * release of lyx-1.1.5pre1
8242 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8244 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8246 * src/menus.C: revert the change of naming (Figure->Graphic...)
8247 from 2000-04-11. It was incomplete and bad.
8249 * src/LColor.[Ch]: add LColor::depthbar.
8250 * src/text.C (GetVisibleRow): use it.
8252 * README: update the languages list.
8254 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8256 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8259 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8261 * README: remove sections that were just wrong.
8263 * src/text2.C (GetRowNearY): remove currentrow code
8265 * src/text.C (GetRow): remove currentrow code
8267 * src/screen.C (Update): rewritten a bit.
8268 (SmallUpdate): removed func
8270 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8272 (FullRebreak): return bool
8273 (currentrow): remove var
8274 (currentrow_y): ditto
8276 * src/lyxscreen.h (Draw): change arg to unsigned long
8277 (FitCursor): return bool
8278 (FitManualCursor): ditto
8279 (Smallpdate): remove func
8280 (first): change to unsigned long
8281 (DrawOneRow): change second arg to long (from long &)
8282 (screen_refresh_y): remove var
8283 (scree_refresh_row): ditto
8285 * src/lyxrow.h: change baseline to usigned int from unsigned
8286 short, this brings some implicit/unsigned issues out in the open.
8288 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8290 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8291 instead of smallUpdate.
8293 * src/lyxcursor.h: change y to unsigned long
8295 * src/buffer.h: don't call updateScrollbar after fitcursor
8297 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8298 where they are used. Removed "\\direction", this was not present
8299 in 1.1.4 and is already obsolete. Commented out some code that I
8300 believe to never be called.
8301 (runLiterate): don't call updateScrollbar after fitCursor
8303 (buildProgram): ditto
8306 * src/WorkArea.h (workWidth): change return val to unsigned
8309 (redraw): remove the button redraws
8310 (setScrollbarValue): change for scrollbar
8311 (getScrollbarValue): change for scrollbar
8312 (getScrollbarBounds): change for scrollbar
8314 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8315 (C_WorkArea_down_cb): removed func
8316 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8317 (resize): change for scrollbar
8318 (setScrollbar): ditto
8319 (setScrollbarBounds): ditto
8320 (setScrollbarIncrements): ditto
8321 (up_cb): removed func
8322 (down_cb): removed func
8323 (scroll_cb): change for scrollbar
8324 (work_area_handler): ditto
8326 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8327 when FitCursor did something.
8328 (updateScrollbar): some unsigned changes
8329 (downCB): removed func
8330 (scrollUpOnePage): removed func
8331 (scrollDownOnePage): remvoed func
8332 (workAreaMotionNotify): don't call screen->FitCursor but use
8333 fitCursor instead. and bool return val
8334 (workAreaButtonPress): ditto
8335 (workAreaButtonRelease): some unsigned changes
8336 (checkInsetHit): ditto
8337 (workAreaExpose): ditto
8338 (update): parts rewritten, comments about the signed char arg added
8339 (smallUpdate): removed func
8340 (cursorPrevious): call needed updateScrollbar
8343 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8346 * src/BufferView.[Ch] (upCB): removed func
8347 (downCB): removed func
8348 (smallUpdate): removed func
8350 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8352 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8353 currentrow, currentrow_y optimization. This did not help a lot and
8354 if we want to do this kind of optimization we should rather use
8355 cursor.row instead of the currentrow.
8357 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8358 buffer spacing and klyx spacing support.
8360 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8362 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8365 2000-04-26 Juergen Vigna <jug@sad.it>
8367 * src/insets/figinset.C: fixes to Lars sstream changes!
8369 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8371 * A lot of files: Added Ascii(ostream &) methods to all inset
8372 classes. Used when exporting to ASCII.
8374 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8375 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8378 * src/text2.C (ToggleFree): Disabled implicit word selection when
8379 there is a change in the language
8381 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8382 no output was generated for end-of-sentence inset.
8384 * src/insets/lyxinset.h
8387 * src/paragraph.C: Removed the insetnumber code
8389 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8391 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8393 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8394 no_babel and no_epsfig completely from the file.
8395 (parseSingleLyXformat2Token): add handling for per-paragraph
8396 spacing as written by klyx.
8398 * src/insets/figinset.C: applied patch by Andre. Made it work with
8401 2000-04-20 Juergen Vigna <jug@sad.it>
8403 * src/insets/insettext.C (cutSelection):
8404 (copySelection): Fixed with selection from right to left.
8405 (draw): now the rows are not recalculated at every draw.
8406 (computeTextRows): for now reset the inset-owner here (this is
8407 important for an undo or copy where the inset-owner is not set
8410 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8411 motion to the_locking_inset screen->first was forgotten, this was
8412 not important till we got multiline insets.
8414 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8416 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8417 code seems to be alright (it is code changed by Dekel, and the
8418 intent is indeed that all macros should be defined \protect'ed)
8420 * NEWS: a bit of reorganisation of the new user-visible features.
8422 2000-04-19 Juergen Vigna <jug@sad.it>
8424 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8425 position. Set the inset_owner of the used paragraph so that it knows
8426 that it is inside an inset. Fixed cursor handling with mouse and
8427 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8428 and cleanups to make TextInsets work better.
8430 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8431 Changed parameters of various functions and added LockInsetInInset().
8433 * src/insets/insettext.C:
8435 * src/insets/insetcollapsable.h:
8436 * src/insets/insetcollapsable.C:
8437 * src/insets/insetfoot.h:
8438 * src/insets/insetfoot.C:
8439 * src/insets/insetert.h:
8440 * src/insets/insetert.C: cleaned up the code so that it works now
8441 correctly with insettext.
8443 * src/insets/inset.C:
8444 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8445 that insets in insets are supported right.
8448 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8450 * src/paragraph.C: some small fixes
8452 * src/debug.h: inserted INSETS debug info
8454 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8455 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8457 * src/commandtags.h:
8458 * src/LyXAction.C: insert code for InsetTabular.
8460 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8461 not Button1MotionMask.
8462 (workAreaButtonRelease): send always a InsetButtonRelease event to
8464 (checkInsetHit): some setCursor fixes (always with insets).
8466 * src/BufferView2.C (lockInset): returns a bool now and extended for
8467 locking insets inside insets.
8468 (showLockedInsetCursor): it is important to have the cursor always
8469 before the locked inset.
8470 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8472 * src/BufferView.h: made lockInset return a bool.
8474 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8476 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8477 that is used also internally but can be called as public to have back
8478 a cursor pos which is not set internally.
8479 (SetCursorIntern): Changed to use above function.
8481 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8483 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8488 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8489 patches for things that should be in or should be changed.
8491 * src/* [insetfiles]: change "usigned char fragile" to bool
8492 fragile. There was only one point that could that be questioned
8493 and that is commented in formulamacro.C. Grep for "CHECK".
8495 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8496 (DeleteBuffer): take it out of CutAndPaste and make it static.
8498 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8500 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8501 output the spacing envir commands. Also the new commands used in
8502 the LaTeX output makes the result better.
8504 * src/Spacing.C (writeEnvirBegin): new method
8505 (writeEnvirEnd): new method
8507 2000-04-18 Juergen Vigna <jug@sad.it>
8509 * src/CutAndPaste.C: made textclass a static member of the class
8510 as otherwise it is not accesed right!!!
8512 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8514 * forms/layout_forms.fd
8515 * src/layout_forms.h
8516 * src/layout_forms.C (create_form_form_character)
8517 * src/lyx_cb.C (UserFreeFont)
8518 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8519 documents (in the layout->character popup).
8521 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8523 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8524 \spell_command was in fact not honored (from Kevin Atkinson).
8526 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8529 * src/lyx_gui.h: make lyxViews private (Angus)
8531 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8533 * src/mathed/math_write.C
8534 (MathMatrixInset::Write) Put \protect before \begin{array} and
8535 \end{array} if fragile
8536 (MathParInset::Write): Put \protect before \\ if fragile
8538 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8540 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8541 initialization if the LyXColorHandler must be done after the
8542 connections to the XServer has been established.
8544 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8545 get the background pixel from the lyxColorhandler so that the
8546 figures are rendered with the correct background color.
8547 (NextToken): removed functions.
8548 (GetPSSizes): use ifs >> string instead of NextToken.
8550 * src/Painter.[Ch]: the color cache moved out of this file.
8552 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8555 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8557 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8558 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8560 * src/BufferView.C (enterView): new func
8561 (leaveView): new func
8563 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8565 (leaveView): new func, undefines xterm cursor when approp.
8567 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8568 (AllowInput): delete the Workarea cursor handling from this func.
8570 * src/Painter.C (underline): draw a slimer underline in most cases.
8572 * src/lyx_main.C (error_handler): use extern "C"
8574 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8576 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8577 sent directly to me.
8579 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8580 to the list by Dekel.
8582 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8585 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8586 methods from lyx_cb.here.
8588 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8591 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8593 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8594 instead of using current_view directly.
8596 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8598 * src/LyXAction.C (init): add the paragraph-spacing command.
8600 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8602 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8604 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8605 different from the documents.
8607 * src/text.C (SetHeightOfRow): take paragraph spacing into
8608 account, paragraph spacing takes precedence over buffer spacing
8609 (GetVisibleRow): ditto
8611 * src/paragraph.C (writeFile): output the spacing parameter too.
8612 (validate): set the correct features if spacing is used in the
8614 (Clear): set spacing to default
8615 (MakeSameLayout): spacing too
8616 (HasSameLayout): spacing too
8617 (SetLayout): spacing too
8618 (TeXOnePar): output the spacing commands
8620 * src/lyxparagraph.h: added a spacing variable for use with
8621 per-paragraph spacing.
8623 * src/Spacing.h: add a Default spacing and a method to check if
8624 the current spacing is default. also added an operator==
8626 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8629 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8631 * src/lyxserver.C (callback): fix dispatch of functions
8633 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8634 printf() into lyxerr call.
8636 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8639 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8640 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8641 the "Float" from each of the subitems.
8642 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8644 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8645 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8646 documented the change so that the workaround can be nuked later.
8648 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8651 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8653 * src/buffer.C (getLatexName): ditto
8654 (setReadonly): ditto
8656 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8658 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8659 avoid some uses of current_view. Added also a bufferParams()
8660 method to get at this.
8662 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8664 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8666 * src/lyxparagraph.[Ch]: removed
8667 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8668 with operators used by lower_bound and
8669 upper_bound in InsetTable's
8670 Make struct InsetTable private again. Used matchpos.
8672 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8674 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8675 document, the language of existing text is changed (unless the
8676 document is multi-lingual)
8678 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8680 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8682 * A lot of files: A rewrite of the Right-to-Left support.
8684 2000-04-10 Juergen Vigna <jug@sad.it>
8686 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8687 misplaced cursor when inset in inset is locked.
8689 * src/insets/insettext.C (LocalDispatch): small fix so that a
8690 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8692 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8693 footnote font should be decreased in size twice when displaying.
8695 * src/insets/insettext.C (GetDrawFont): inserted this function as
8696 the drawing-font may differ from the real paragraph font.
8698 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8699 insets (inset in inset!).
8701 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8702 function here because we don't want footnotes inside footnotes.
8704 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8706 (init): now set the inset_owner in paragraph.C
8707 (LocalDispatch): added some resetPos() in the right position
8710 (pasteSelection): changed to use the new CutAndPaste-Class.
8712 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8713 which tells if it is allowed to insert another inset inside this one.
8715 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8716 SwitchLayoutsBetweenClasses.
8718 * src/text2.C (InsertInset): checking of the new paragraph-function
8720 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8721 is not needed anymore here!
8724 (PasteSelection): redone (also with #ifdef) so that now this uses
8725 the CutAndPaste-Class.
8726 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8729 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8730 from/to text/insets.
8732 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8733 so that the paragraph knows if it is inside an (text)-inset.
8734 (InsertFromMinibuffer): changed return-value to bool as now it
8735 may happen that an inset is not inserted in the paragraph.
8736 (InsertInsetAllowed): this checks if it is allowed to insert an
8737 inset in this paragraph.
8739 (BreakParagraphConservative):
8740 (BreakParagraph) : small change for the above change of the return
8741 value of InsertFromMinibuffer.
8743 * src/lyxparagraph.h: added inset_owner and the functions to handle
8744 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8746 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8748 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8749 functions from BufferView to BufferView::Pimpl to ease maintence.
8751 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8752 correctly. Also use SetCursorIntern instead of SetCursor.
8754 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8757 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8759 * src/WorkArea.C (belowMouse): manually implement below mouse.
8761 * src/*: Add "explicit" on several constructors, I added probably
8762 some unneeded ones. A couple of changes to code because of this.
8764 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8765 implementation and private parts from the users of BufferView. Not
8768 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8769 implementation and private parts from the users of LyXLex. Not
8772 * src/BufferView_pimpl.[Ch]: new files
8774 * src/lyxlex_pimpl.[Ch]: new files
8776 * src/LyXView.[Ch]: some inline functions move out-of-line
8778 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8780 * src/lyxparagraph.h: make struct InsetTable public.
8782 * src/support/lyxstring.h: change lyxstring::difference_type to be
8783 ptrdiff_t. Add std:: modifiers to streams.
8785 * src/font.C: include the <cctype> header, for islower() and
8788 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8790 * src/font.[Ch]: new files. Contains the metric functions for
8791 fonts, takes a LyXFont as parameter. Better separation of concepts.
8793 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8794 changes because of this.
8796 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8798 * src/*: compile with -Winline and move functions that don't
8801 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8804 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8806 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8807 (various files changed because of this)
8809 * src/Painter.C (text): fixed the drawing of smallcaps.
8811 * src/lyxfont.[Ch] (drawText): removed unused member func.
8814 * src/*.C: added needed "using" statements and "std::" qualifiers.
8816 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8818 * src/*.h: removed all use of "using" from header files use
8819 qualifier std:: instead.
8821 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8823 * src/text.C (Backspace): some additional cleanups (we already
8824 know whether cursor.pos is 0 or not).
8826 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8827 automake does not provide one).
8829 * src/bmtable.h: replace C++ comments with C comments.
8831 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8833 * src/screen.C (ShowCursor): Change the shape of the cursor if
8834 the current language is not equal to the language of the document.
8835 (If the cursor change its shape unexpectedly, then you've found a bug)
8837 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8840 * src/insets/insetnumber.[Ch]: New files.
8842 * src/LyXAction.C (init)
8843 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8846 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8848 * src/lyxparagraph.h
8849 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8850 (the vector is kept sorted).
8852 * src/text.C (GetVisibleRow): Draw selection correctly when there
8853 is both LTR and RTL text.
8855 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8856 which is much faster.
8858 * src/text.C (GetVisibleRow and other): Do not draw the last space
8859 in a row if the direction of the last letter is not equal to the
8860 direction of the paragraph.
8862 * src/lyxfont.C (latexWriteStartChanges):
8863 Check that font language is not equal to basefont language.
8864 (latexWriteEndChanges): ditto
8866 * src/lyx_cb.C (StyleReset): Don't change the language while using
8867 the font-default command.
8869 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8870 empty paragraph before a footnote.
8872 * src/insets/insetcommand.C (draw): Increase x correctly.
8874 * src/screen.C (ShowCursor): Change cursor shape if
8875 current language != document language.
8877 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8879 2000-03-31 Juergen Vigna <jug@sad.it>
8881 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8882 (Clone): changed mode how the paragraph-data is copied to the
8883 new clone-paragraph.
8885 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8886 GetInset(pos) with no inset anymore there (in inset UNDO)
8888 * src/insets/insetcommand.C (draw): small fix as here x is
8889 incremented not as much as width() returns (2 before, 2 behind = 4)
8891 2000-03-30 Juergen Vigna <jug@sad.it>
8893 * src/insets/insettext.C (InsetText): small fix in initialize
8894 widthOffset (should not be done in the init() function)
8896 2000-03-29 Amir Karger <karger@lyx.org>
8898 * lib/examples/it_ItemizeBullets.lyx: translation by
8901 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8903 2000-03-29 Juergen Vigna <jug@sad.it>
8905 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8907 * src/insets/insetfoot.C (Clone): small change as for the below
8908 new init function in the text-inset
8910 * src/insets/insettext.C (init): new function as I've seen that
8911 clone did not copy the Paragraph-Data!
8912 (LocalDispatch): Added code so that now we have some sort of Undo
8913 functionality (well actually we HAVE Undo ;)
8915 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8917 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8919 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8922 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8924 * src/main.C: added a runtime check that verifies that the xforms
8925 header used when building LyX and the library used when running
8926 LyX match. Exit with a message if they don't match. This is a
8927 version number check only.
8929 * src/buffer.C (save): Don't allocate memory on the heap for
8930 struct utimbuf times.
8932 * *: some using changes, use iosfwd instead of the real headers.
8934 * src/lyxfont.C use char const * instead of string for the static
8935 strings. Rewrite some functions to use sstream.
8937 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8939 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8942 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8944 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8945 of Geodesy (from Martin Vermeer)
8947 * lib/layouts/svjour.inc: include file for the Springer svjour
8948 class. It can be used to support journals other than JoG.
8950 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8951 Miskiewicz <misiek@pld.org.pl>)
8952 * lib/reLyX/Makefile.am: ditto.
8954 2000-03-27 Juergen Vigna <jug@sad.it>
8956 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8957 also some modifications with operations on selected text.
8959 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8960 problems with clicking on insets (last famous words ;)
8962 * src/insets/insetcommand.C (draw):
8963 (width): Changed to have a bit of space before and after the inset so
8964 that the blinking cursor can be seen (otherwise it was hidden)
8966 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8968 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8969 would not be added to the link list when an installed gettext (not
8970 part of libc) is found.
8972 2000-03-24 Juergen Vigna <jug@sad.it>
8974 * src/insets/insetcollapsable.C (Edit):
8975 * src/mathed/formula.C (InsetButtonRelease):
8976 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8979 * src/BufferView.C (workAreaButtonPress):
8980 (workAreaButtonRelease):
8981 (checkInsetHit): Finally fixed the clicking on insets be handled
8984 * src/insets/insetert.C (Edit): inserted this call so that ERT
8985 insets work always with LaTeX-font
8987 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8989 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8990 caused lyx to startup with no GUI in place, causing in a crash
8991 upon startup when called with arguments.
8993 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8995 * src/FontLoader.C: better initialization of dummyXFontStruct.
8997 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8999 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9000 for linuxdoc and docbook import and export format options.
9002 * lib/lyxrc.example Example of default values for the previous flags.
9004 * src/lyx_cb.C Use those flags instead of the hardwired values for
9005 linuxdoc and docbook export.
9007 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9010 * src/menus.C Added menus entries for the new import/exports formats.
9012 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9014 * src/lyxrc.*: Added support for running without Gui
9017 * src/FontLoader.C: sensible defaults if no fonts are needed
9019 * src/lyx_cb.C: New function ShowMessage (writes either to the
9020 minibuffer or cout in case of no gui
9021 New function AskOverwrite for common stuff
9022 Consequently various changes to call these functions
9024 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9025 wild guess at sensible screen resolution when having no gui
9027 * src/lyxfont.C: no gui, no fonts... set some defaults
9029 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9031 * src/LColor.C: made the command inset background a bit lighter.
9033 2000-03-20 Hartmut Goebel <goebel@noris.net>
9035 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9036 stdstruct.inc. Koma-Script added some title elements which
9037 otherwise have been listed below "bibliography". This split allows
9038 adding title elements to where they belong.
9040 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9041 define the additional title elements and then include
9044 * many other layout files: changed to include stdtitle.inc just
9045 before stdstruct.inc.
9047 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9049 * src/buffer.C: (save) Added the option to store all backup files
9050 in a single directory
9052 * src/lyxrc.[Ch]: Added variable \backupdir_path
9054 * lib/lyxrc.example: Added descriptions of recently added variables
9056 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9057 bibtex inset, not closing the bibtex popup when deleting the inset)
9059 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9061 * src/lyx_cb.C: add a couple using directives.
9063 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9064 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9065 import based on the filename.
9067 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9068 file would be imported at start, if the filename where of a sgml file.
9070 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9072 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9074 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9075 * src/lyxfont.h Replaced the member variable bits.direction by the
9076 member variable lang. Made many changes in other files.
9077 This allows having a multi-lingual document
9079 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9080 that change the current language to <l>.
9081 Removed the command "font-rtl"
9083 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9084 format for Hebrew documents)
9086 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9087 When auto_mathmode is "true", pressing a digit key in normal mode
9088 will cause entering into mathmode.
9089 If auto_mathmode is "rtl" then this behavior will be active only
9090 when writing right-to-left text.
9092 * src/text2.C (InsertStringA) The string is inserted using the
9095 * src/paragraph.C (GetEndLabel) Gives a correct result for
9096 footnote paragraphs.
9098 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9100 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9102 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9103 front of PasteParagraph. Never insert a ' '. This should at least
9104 fix some cause for the segfaults that we have been experiencing,
9105 it also fixes backspace behaviour slightly. (Phu!)
9107 * src/support/lstrings.C (compare_no_case): some change to make it
9108 compile with gcc 2.95.2 and stdlibc++-v3
9110 * src/text2.C (MeltFootnoteEnvironment): change type o
9111 first_footnote_par_is_not_empty to bool.
9113 * src/lyxparagraph.h: make text private. Changes in other files
9115 (fitToSize): new function
9116 (setContentsFromPar): new function
9117 (clearContents): new function
9118 (SetChar): new function
9120 * src/paragraph.C (readSimpleWholeFile): deleted.
9122 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9123 the file, just use a simple string instead. Also read the file in
9124 a more maintainable manner.
9126 * src/text2.C (InsertStringA): deleted.
9127 (InsertStringB): deleted.
9129 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9131 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9132 RedoParagraphs from the doublespace handling part, just set status
9133 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9134 done, but perhaps not like this.)
9136 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9138 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9139 character when inserting an inset.
9141 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9143 * src/bufferparams.C (readLanguage): now takes "default" into
9146 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9147 also initialize the toplevel_keymap with the default bindings from
9150 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9152 * all files using lyxrc: have lyxrc as a real variable and not a
9153 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9156 * src/lyxrc.C: remove double call to defaultKeyBindings
9158 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9159 toolbar defauls using lyxlex. Remove enums, structs, functions
9162 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9163 toolbar defaults. Also store default keybindings in a map.
9165 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9166 storing the toolbar defaults without any xforms dependencies.
9168 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9169 applied. Changed to use iterators.
9171 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9173 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9174 systems that don't have LINGUAS set to begin with.
9176 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9178 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9179 the list by Dekel Tsur.
9181 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9183 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9184 * src/insets/form_graphics.C: ditto.
9186 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9188 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9190 * src/bufferparams.C (readLanguage): use the new language map
9192 * src/intl.C (InitKeyMapper): use the new language map
9194 * src/lyx_gui.C (create_forms): use the new language map
9196 * src/language.[Ch]: New files. Used for holding the information
9197 about each language. Now! Use this new language map enhance it and
9198 make it really usable for our needs.
9200 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9202 * screen.C (ShowCursor): Removed duplicate code.
9203 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9204 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9206 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9209 * src/text.C Added TransformChar method. Used for rendering Arabic
9210 text correctly (change the glyphs of the letter according to the
9211 position in the word)
9216 * src/lyxrc.C Added lyxrc command {language_command_begin,
9217 language_command_end,language_command_ltr,language_command_rtl,
9218 language_package} which allows the use of either arabtex or Omega
9221 * src/lyx_gui.C (init)
9223 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9224 to use encoding for menu fonts which is different than the encoding
9227 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9228 do not load the babel package.
9229 To write an English document with Hebrew/Arabic, change the document
9230 language to "english".
9232 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9233 (alphaCounter): changed to return char
9234 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9236 * lib/lyxrc.example Added examples for Hebrew/Arabic
9239 * src/layout.C Added layout command endlabeltype
9241 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9243 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9245 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9247 * src/mathed/math_delim.C (search_deco): return a
9248 math_deco_struct* instead of index.
9250 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9252 * All files with a USE_OSTREAM_ONLY within: removed all code that
9253 was unused when USE_OSTREAM_ONLY is defined.
9255 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9256 of any less. Removed header and using.
9258 * src/text.C (GetVisibleRow): draw the string "Page Break
9259 (top/bottom)" on screen when drawing a pagebreak line.
9261 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9263 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9265 * src/mathed/math_macro.C (draw): do some cast magic.
9268 * src/mathed/math_defs.h: change byte* argument to byte const*.
9270 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9272 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9273 know it is right to return InsetFoot* too, but cxx does not like
9276 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9278 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9280 * src/mathed/math_delim.C: change == to proper assignment.
9282 2000-03-09 Juergen Vigna <jug@sad.it>
9284 * src/insets/insettext.C (setPos): fixed various cursor positioning
9285 problems (via mouse and cursor-keys)
9286 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9287 inset (still a small display problem but it works ;)
9289 * src/insets/insetcollapsable.C (draw): added button_top_y and
9290 button_bottom_y to have correct values for clicking on the inset.
9292 * src/support/lyxalgo.h: commented out 'using std::less'
9294 2000-03-08 Juergen Vigna <jug@sad.it>
9296 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9297 Button-Release event closes as it is alos the Release-Event
9300 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9302 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9304 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9305 can add multiple spaces in Scrap (literate programming) styles...
9306 which, by the way, is how I got hooked on LyX to begin with.
9308 * src/mathed/formula.C (Write): Added dummy variable to an
9309 inset::Latex() call.
9310 (Latex): Add free_spacing boolean to inset::Latex()
9312 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9314 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9315 virtual function to include the free_spacing boolean from
9316 the containing paragraph's style.
9318 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9319 Added free_spacing boolean arg to match inset.h
9321 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9322 Added free_spacing boolean arg to match inset.h
9324 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9325 Added free_spacing boolean and made sure that if in a free_spacing
9326 paragraph, that we output normal space if there is a protected space.
9328 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9329 Added free_spacing boolean arg to match inset.h
9331 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9332 Added free_spacing boolean arg to match inset.h
9334 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9335 Added free_spacing boolean arg to match inset.h
9337 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9338 Added free_spacing boolean arg to match inset.h
9340 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9341 Added free_spacing boolean arg to match inset.h
9343 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9344 free_spacing boolean arg to match inset.h
9346 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9347 Added free_spacing boolean arg to match inset.h
9349 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9350 Added free_spacing boolean arg to match inset.h
9352 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9353 Added free_spacing boolean arg to match inset.h
9355 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9356 Added free_spacing boolean arg to match inset.h
9358 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9359 Added free_spacing boolean arg to match inset.h
9361 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9362 free_spacing boolean arg to match inset.h
9364 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9365 free_spacing boolean arg to match inset.h
9367 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9368 ignore free_spacing paragraphs. The user's spaces are left
9371 * src/text.C (InsertChar): Fixed the free_spacing layout
9372 attribute behavior. Now, if free_spacing is set, you can
9373 add multiple spaces in a paragraph with impunity (and they
9374 get output verbatim).
9375 (SelectSelectedWord): Added dummy argument to inset::Latex()
9378 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9381 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9382 paragraph layouts now only input a simple space instead.
9383 Special character insets don't make any sense in free-spacing
9386 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9387 hard-spaces in the *input* file to simple spaces if the layout
9388 is free-spacing. This converts old files which had to have
9389 hard-spaces in free-spacing layouts where a simple space was
9391 (writeFileAscii): Added free_spacing check to pass to the newly
9392 reworked inset::Latex(...) methods. The inset::Latex() code
9393 ensures that hard-spaces in free-spacing paragraphs get output
9394 as spaces (rather than "~").
9396 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9398 * src/mathed/math_delim.C (draw): draw the empty placeholder
9399 delims with a onoffdash line.
9400 (struct math_deco_compare): struct that holds the "functors" used
9401 for the sort and the binary search in math_deco_table.
9402 (class init_deco_table): class used for initial sort of the
9404 (search_deco): use lower_bound to do a binary search in the
9407 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9409 * src/lyxrc.C: a small secret thingie...
9411 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9412 and to not flush the stream as often as it used to.
9414 * src/support/lyxalgo.h: new file
9415 (sorted): template function used for checking if a sequence is
9416 sorted or not. Two versions with and without user supplied
9417 compare. Uses same compare as std::sort.
9419 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9420 it and give warning on lyxerr.
9422 (struct compare_tags): struct with function operators used for
9423 checking if sorted, sorting and lower_bound.
9424 (search_kw): use lower_bound instead of manually implemented
9427 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9429 * src/insets/insetcollapsable.h: fix Clone() declaration.
9430 * src/insets/insetfoot.h: ditto.
9432 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9434 2000-03-08 Juergen Vigna <jug@sad.it>
9436 * src/insets/lyxinset.h: added owner call which tells us if
9437 this inset is inside another inset. Changed also the return-type
9438 of Editable to an enum so it tells clearer what the return-value is.
9440 * src/insets/insettext.C (computeTextRows): fixed computing of
9441 textinsets which split automatically on more rows.
9443 * src/insets/insetert.[Ch]: changed this to be of BaseType
9446 * src/insets/insetfoot.[Ch]: added footnote inset
9448 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9449 collapsable insets (like footnote, ert, ...)
9451 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9453 * src/lyxdraw.h: remvoe file
9455 * src/lyxdraw.C: remove file
9457 * src/insets/insettext.C: added <algorithm>.
9459 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9461 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9462 (matrix_cb): case MM_OK use string stream
9464 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9467 * src/mathed/math_macro.C (draw): use string stream
9468 (Metrics): use string stream
9470 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9471 directly to the ostream.
9473 * src/vspace.C (asString): use string stream.
9474 (asString): use string stream
9475 (asLatexString): use string stream
9477 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9478 setting Spacing::Other.
9480 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9481 sprintf when creating the stretch vale.
9483 * src/text2.C (alphaCounter): changed to return a string and to
9484 not use a static variable internally. Also fixed a one-off bug.
9485 (SetCounter): changed the drawing of the labels to use string
9486 streams instead of sprintf.
9488 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9489 manipulator to use a scheme that does not require library support.
9490 This is also the way it is done in the new GNU libstdc++. Should
9491 work with DEC cxx now.
9493 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9495 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9496 end. This fixes a bug.
9498 * src/mathed (all files concerned with file writing): apply the
9499 USE_OSTREAM_ONLY changes to mathed too.
9501 * src/support/DebugStream.h: make the constructor explicit.
9503 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9504 count and ostream squashed.
9506 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9508 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9510 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9511 ostringstream uses STL strings, and we might not.
9513 * src/insets/insetspecialchar.C: add using directive.
9514 * src/insets/insettext.C: ditto.
9516 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9518 * lib/layouts/seminar.layout: feeble attempt at a layout for
9519 seminar.cls, far from completet and could really use some looking
9520 at from people used to write layout files.
9522 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9523 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9524 a lot nicer and works nicely with ostreams.
9526 * src/mathed/formula.C (draw): a slightly different solution that
9527 the one posted to the list, but I think this one works too. (font
9528 size wrong in headers.)
9530 * src/insets/insettext.C (computeTextRows): some fiddling on
9531 Jürgens turf, added some comments that he should read.
9533 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9534 used and it gave compiler warnings.
9535 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9538 * src/lyx_gui.C (create_forms): do the right thing when
9539 show_banner is true/false.
9541 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9542 show_banner is false.
9544 * most file writing files: Now use iostreams to do almost all of
9545 the writing. Also instead of passing string &, we now use
9546 stringstreams. mathed output is still not adapted to iostreams.
9547 This change can be turned off by commenting out all the occurences
9548 of the "#define USE_OSTREAM_ONLY 1" lines.
9550 * src/WorkArea.C (createPixmap): don't output debug messages.
9551 (WorkArea): don't output debug messages.
9553 * lib/lyxrc.example: added a comment about the new variable
9556 * development/Code_rules/Rules: Added some more commente about how
9557 to build class interfaces and on how better encapsulation can be
9560 2000-03-03 Juergen Vigna <jug@sad.it>
9562 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9563 automatically with the width of the LyX-Window
9565 * src/insets/insettext.C (computeTextRows): fixed update bug in
9566 displaying text-insets (scrollvalues where not initialized!)
9568 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9570 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9571 id in the check of the result from lower_bound is not enough since
9572 lower_bound can return last too, and then res->id will not be a
9575 * all insets and some code that use them: I have conditionalized
9576 removed the Latex(string & out, ...) this means that only the
9577 Latex(ostream &, ...) will be used. This is a work in progress to
9578 move towards using streams for all output of files.
9580 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9583 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9585 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9586 routine (this fixes bug where greek letters were surrounded by too
9589 * src/support/filetools.C (findtexfile): change a bit the search
9590 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9591 no longer passed to kpsewhich, we may have to change that later.
9593 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9594 warning options to avoid problems with X header files (from Angus
9596 * acinclude.m4: regenerated.
9598 2000-03-02 Juergen Vigna <jug@sad.it>
9600 * src/insets/insettext.C (WriteParagraphData): Using the
9601 par->writeFile() function for writing paragraph-data.
9602 (Read): Using buffer->parseSingleLyXformat2Token()-function
9603 for parsing paragraph data!
9605 * src/buffer.C (readLyXformat2): removed all parse data and using
9606 the new parseSingleLyXformat2Token()-function.
9607 (parseSingleLyXformat2Token): added this function to parse (read)
9608 lyx-file-format (this is called also from text-insets now!)
9610 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9612 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9615 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9616 directly instead of going through a func. One very bad thing: a
9617 static LyXFindReplace, but I don't know where to place it.
9619 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9620 string instead of char[]. Also changed to static.
9621 (GetSelectionOrWordAtCursor): changed to static inline
9622 (SetSelectionOverLenChars): ditto.
9624 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9625 current_view and global variables. both classes has changed names
9626 and LyXFindReplace is not inherited from SearchForm.
9628 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9629 fl_form_search form.
9631 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9633 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9635 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9636 bound (from Kayvan).
9638 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9640 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9642 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9644 * some things that I should comment but the local pub says head to
9647 * comment out all code that belongs to the Roff code for Ascii
9648 export of tables. (this is unused)
9650 * src/LyXView.C: use correct type for global variable
9651 current_layout. (LyXTextClass::size_type)
9653 * some code to get the new insetgraphics closer to working I'd be
9654 grateful for any help.
9656 * src/BufferView2.C (insertInset): use the return type of
9657 NumberOfLayout properly. (also changes in other files)
9659 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9660 this as a test. I want to know what breaks because of this.
9662 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9664 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9666 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9667 to use a \makebox in the label, this allows proper justification
9668 with out using protected spaces or multiple hfills. Now it is
9669 "label" for left justified, "\hfill label\hfill" for center, and
9670 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9671 should be changed accordingly.
9673 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9675 * src/lyxtext.h: change SetLayout() to take a
9676 LyXTextClass::size_type instead of a char (when there is more than
9677 127 layouts in a class); also change type of copylayouttype.
9678 * src/text2.C (SetLayout): ditto.
9679 * src/LyXView.C (updateLayoutChoice): ditto.
9681 * src/LaTeX.C (scanLogFile): errors where the line number was not
9682 given just after the '!'-line were ignored (from Dekel Tsur).
9684 * lib/lyxrc.example: fix description of \date_insert_format
9686 * lib/layouts/llncs.layout: new layout, contributed by Martin
9689 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9691 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9692 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9693 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9694 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9695 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9696 paragraph.C, text.C, text2.C)
9698 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9700 * src/insets/insettext.C (LocalDispatch): remove extra break
9703 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9704 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9706 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9707 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9709 * src/insets/insetbib.h: move InsetBibkey::Holder and
9710 InsetCitation::Holder in public space.
9712 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9714 * src/insets/insettext.h: small change to get the new files from
9715 Juergen to compile (use "string", not "class string").
9717 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9718 const & as parameter to LocalDispatch, use LyXFont const & as
9719 paramter to some other func. This also had impacto on lyxinsets.h
9720 and the two mathed insets.
9722 2000-02-24 Juergen Vigna <jug@sad.it>
9725 * src/commandtags.h:
9727 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9731 * src/BufferView2.C: added/updated code for various inset-functions
9733 * src/insets/insetert.[Ch]: added implementation of InsetERT
9735 * src/insets/insettext.[Ch]: added implementation of InsetText
9737 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9738 (draw): added preliminary code for inset scrolling not finshed yet
9740 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9741 as it is in lyxfunc.C now
9743 * src/insets/lyxinset.h: Added functions for text-insets
9745 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9747 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9748 BufferView and reimplement the list as a queue put inside its own
9751 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9753 * several files: use the new interface to the "updateinsetlist"
9755 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9757 (work_area_handler): call BufferView::trippleClick on trippleclick.
9759 * src/BufferView.C (doubleClick): new function, selects word on
9761 (trippleClick): new function, selects line on trippleclick.
9763 2000-02-22 Allan Rae <rae@lyx.org>
9765 * lib/bind/xemacs.bind: buffer-previous not supported
9767 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9769 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9772 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9774 * src/bufferlist.C: get rid of current_view from this file
9776 * src/spellchecker.C: get rid of current_view from this file
9778 * src/vspace.C: get rid of current_view from this file
9779 (inPixels): added BufferView parameter for this func
9780 (asLatexCommand): added a BufferParams for this func
9782 * src/text.C src/text2.C: get rid of current_view from these
9785 * src/lyxfont.C (getFontDirection): move this function here from
9788 * src/bufferparams.C (getDocumentDirection): move this function
9791 * src/paragraph.C (getParDirection): move this function here from
9793 (getLetterDirection): ditto
9795 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9797 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9798 resize due to wrong pixmap beeing used. Also took the opurtunity
9799 to make the LyXScreen stateless on regard to WorkArea and some
9800 general cleanup in the same files.
9802 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9804 * src/Makefile.am: add missing direction.h
9806 * src/PainterBase.h: made the width functions const.
9808 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9811 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9813 * src/insets/insetlatexaccent.C (draw): make the accents draw
9814 better, at present this will only work well with iso8859-1.
9816 * several files: remove the old drawing code, now we use the new
9819 * several files: remove support for mono_video, reverse_video and
9822 2000-02-17 Juergen Vigna <jug@sad.it>
9824 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9825 int ** as we have to return the pointer, otherwise we have only
9826 NULL pointers in the returning function.
9828 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9830 * src/LaTeX.C (operator()): quote file name when running latex.
9832 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9834 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9835 (bubble tip), this removes our special handling of this.
9837 * Remove all code that is unused now that we have the new
9838 workarea. (Code that are not active when NEW_WA is defined.)
9840 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9842 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9844 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9845 nonexisting layout; correctly redirect obsoleted layouts.
9847 * lib/lyxrc.example: document \view_dvi_paper_option
9849 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9852 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9853 (PreviewDVI): handle the view_dvi_paper_option variable.
9854 [Both from Roland Krause]
9856 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9858 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9859 char const *, int, LyXFont)
9860 (text(int, int, string, LyXFont)): ditto
9862 * src/text.C (InsertCharInTable): attempt to fix the double-space
9863 feature in tables too.
9864 (BackspaceInTable): ditto.
9865 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9867 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9869 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9871 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9872 newly found text in textcache to this.
9873 (buffer): set the owner of the text put into the textcache to 0
9875 * src/insets/figinset.C (draw): fixed the drawing of figures with
9878 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9879 drawing of mathframe, hfills, protected space, table lines. I have
9880 now no outstanding drawing problems with the new Painter code.
9882 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9884 * src/PainterBase.C (ellipse, circle): do not specify the default
9887 * src/LColor.h: add using directive.
9889 * src/Painter.[Ch]: change return type of methods from Painter& to
9890 PainterBase&. Add a using directive.
9892 * src/WorkArea.C: wrap xforms callbacks in C functions
9895 * lib/layouts/foils.layout: font fix and simplifications from Carl
9898 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9900 * a lot of files: The Painter, LColor and WorkArea from the old
9901 devel branch has been ported to lyx-devel. Some new files and a
9902 lot of #ifdeffed code. The new workarea is enabled by default, but
9903 if you want to test the new Painter and LColor you have to compile
9904 with USE_PAINTER defined (do this in config.h f.ex.) There are
9905 still some rought edges, and I'd like some help to clear those
9906 out. It looks stable (loads and displays the Userguide very well).
9909 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9911 * src/buffer.C (pop_tag): revert to the previous implementation
9912 (use a global variable for both loops).
9914 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9916 * src/lyxrc.C (LyXRC): change slightly default date format.
9918 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9919 there is an English text with a footnote that starts with a Hebrew
9920 paragraph, or vice versa.
9921 (TeXFootnote): ditto.
9923 * src/text.C (LeftMargin): allow for negative values for
9924 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9927 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9928 for input encoding (cyrillic)
9930 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9932 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9935 * src/toolbar.C (set): ditto
9936 * src/insets/insetbib.C (create_form_citation_form): ditto
9938 * lib/CREDITS: added Dekel Tsur.
9940 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9941 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9942 hebrew supports files from Dekel Tsur.
9944 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9945 <tzafrir@technion.ac.il>
9947 * src/lyxrc.C: put \date_insert_format at the right place.
9949 * src/buffer.C (makeLaTeXFile): fix the handling of
9950 BufferParams::sides when writing out latex files.
9952 * src/BufferView2.C: add a "using" directive.
9954 * src/support/lyxsum.C (sum): when we use lyxstring,
9955 ostringstream::str needs an additional .c_str().
9957 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9959 * src/support/filetools.C (ChangeExtension): patch from Etienne
9962 * src/TextCache.C (show): remove const_cast and make second
9963 parameter non-const LyXText *.
9965 * src/TextCache.h: use non const LyXText in show.
9967 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9970 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9972 * src/support/lyxsum.C: rework to be more flexible.
9974 * several places: don't check if a pointer is 0 if you are going
9977 * src/text.C: remove some dead code.
9979 * src/insets/figinset.C: remove some dead code
9981 * src/buffer.C: move the BufferView funcs to BufferView2.C
9982 remove all support for insetlatexdel
9983 remove support for oldpapersize stuff
9984 made some member funcs const
9986 * src/kbmap.C: use a std::list to store the bindings in.
9988 * src/BufferView2.C: new file
9990 * src/kbsequence.[Ch]: new files
9992 * src/LyXAction.C + others: remove all trace of buffer-previous
9994 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9995 only have one copy in the binary of this table.
9997 * hebrew patch: moved some functions from LyXText to more
9998 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10000 * several files: remove support for XForms older than 0.88
10001 whitespace changes.
10002 remove some #if 0 #endif code
10004 * src/TextCache.[Ch]: new file. Holds the textcache.
10006 * src/BufferView.C: changes to use the new TextCache interface.
10007 (waitForX): remove the now unused code.
10009 * src/BackStack.h: remove some commented code
10011 * lib/bind/emacs.bind: remove binding for buffer-previous
10013 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10015 * applied the hebrew patch.
10017 * src/lyxrow.h: make sure that all Row variables are initialized.
10019 * src/text2.C (TextHandleUndo): comment out a delete, this might
10020 introduce a memory leak, but should also help us to not try to
10021 read freed memory. We need to look at this one.
10023 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10024 (LyXParagraph): initalize footnotekind.
10026 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10027 forgot this when applying the patch. Please heed the warnings.
10029 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10030 (aka. reformat problem)
10032 * src/bufferlist.C (exists): made const, and use const_iterator
10033 (isLoaded): new func.
10034 (release): use std::find to find the correct buffer.
10036 * src/bufferlist.h: made getState a const func.
10037 made empty a const func.
10038 made exists a const func.
10041 2000-02-01 Juergen Vigna <jug@sad.it>
10043 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10045 * po/it.po: updated a bit the italian po file and also changed the
10046 'file nuovo' for newfile to 'filenuovo' without a space, this did
10049 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10050 for the new insert_date command.
10052 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10053 from jdblair, to insert a date into the current text conforming to
10054 a strftime format (for now only considering the locale-set and not
10055 the document-language).
10057 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10059 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10060 Bounds Read error seen by purify. The problem was that islower is
10061 a macros which takes an unsigned char and uses it as an index for
10062 in array of characters properties (and is thus subject to the
10066 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10067 correctly the paper sides radio buttons.
10068 (UpdateDocumentButtons): ditto.
10070 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10072 * src/kbmap.C (getsym + others): change to return unsigned int,
10073 returning a long can give problems on 64 bit systems. (I assume
10074 that int is 32bit on 64bit systems)
10076 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10078 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10079 LyXLookupString to be zero-terminated. Really fixes problems seen
10080 by purify, I think.
10082 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10084 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10085 write a (char*)0 to the lyxerr stream.
10087 * src/lastfiles.C: move algorithm before the using statemets.
10089 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10091 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10092 complains otherwise).
10093 * src/table.C: ditto
10095 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10098 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10099 that I removed earlier... It is really needed.
10101 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10103 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10105 * INSTALL: update xforms home page URL.
10107 * lib/configure.m4: fix a bug with unreadable layout files.
10109 * src/table.C (calculate_width_of_column): add "using std::max"
10112 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10114 * several files: marked several lines with "DEL LINE", this is
10115 lines that can be deleted without changing anything.
10116 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10117 checks this anyway */
10120 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10122 * src/DepTable.C (update): add a "+" at the end when the checksum
10123 is different. (debugging string only)
10125 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10126 the next inset to not be displayed. This should also fix the list
10127 of labels in the "Insert Crossreference" dialog.
10129 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10131 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10132 when regex was not found.
10134 * src/support/lstrings.C (lowercase): use handcoded transform always.
10137 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10138 old_cursor.par->prev could be 0.
10140 * several files: changed post inc/dec to pre inc/dec
10142 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10143 write the lastfiles to file.
10145 * src/BufferView.C (buffer): only show TextCache info when debugging
10147 (resizeCurrentBuffer): ditto
10148 (workAreaExpose): ditto
10150 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10152 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10154 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10155 a bit better by removing the special case for \i and \j.
10157 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10159 * src/lyx_main.C (easyParse): remove test for bad comand line
10160 options, since this broke all xforms-related parsing.
10162 * src/kbmap.C (getsym): set return type to unsigned long, as
10163 declared in header. On an alpha, long is _not_ the same as int.
10165 * src/support/LOstream.h: add a "using std::flush;"
10167 * src/insets/figinset.C: ditto.
10169 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10171 * src/bufferlist.C (write): use blinding fast file copy instead of
10172 "a char at a time", now we are doing it the C++ way.
10174 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10175 std::list<int> instead.
10176 (addpidwait): reflect move to std::list<int>
10177 (sigchldchecker): ditto
10179 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10182 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10183 that obviously was wrong...
10185 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10186 c, this avoids warnings with purify and islower.
10188 * src/insets/figinset.C: rename struct queue to struct
10189 queue_element and rewrite to use a std::queue. gsqueue is now a
10190 std::queue<queue_element>
10191 (runqueue): reflect move to std::queue
10194 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10195 we would get "1" "0" instead of "true" "false. Also make the tostr
10198 2000-01-21 Juergen Vigna <jug@sad.it>
10200 * src/buffer.C (writeFileAscii): Disabled code for special groff
10201 handling of tabulars till I fix this in table.C
10203 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10205 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10207 * src/support/lyxlib.h: ditto.
10209 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10211 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10212 and 'j' look better. This might fix the "macron" bug that has been
10215 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10216 functions as one template function. Delete the old versions.
10218 * src/support/lyxsum.C: move using std::ifstream inside
10221 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10224 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10226 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10228 * src/insets/figinset.C (InitFigures): use new instead of malloc
10229 to allocate memory for figures and bitmaps.
10230 (DoneFigures): use delete[] instead of free to deallocate memory
10231 for figures and bitmaps.
10232 (runqueue): use new to allocate
10233 (getfigdata): use new/delete[] instead of malloc/free
10234 (RegisterFigure): ditto
10236 * some files: moved some declarations closer to first use, small
10237 whitespace changes use preincrement instead of postincrement where
10238 it does not make a difference.
10240 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10241 step on the way to use stl::containers for key maps.
10243 * src/bufferlist.h: add a typedef for const_iterator and const
10244 versions of begin and end.
10246 * src/bufferlist.[Ch]: change name of member variable _state to
10247 state_. (avoid reserved names)
10249 (getFileNames): returns the filenames of the buffers in a vector.
10251 * configure.in (ALL_LINGUAS): added ro
10253 * src/support/putenv.C: new file
10255 * src/support/mkdir.C: new file
10257 2000-01-20 Allan Rae <rae@lyx.org>
10259 * lib/layouts/IEEEtran.layout: Added several theorem environments
10261 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10262 couple of minor additions.
10264 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10265 (except for those in footnotes of course)
10267 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10269 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10271 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10272 std::sort and std::lower_bound instead of qsort and handwritten
10274 (struct compara): struct that holds the functors used by std::sort
10275 and std::lower_bound in MathedLookupBOP.
10277 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10279 * src/support/LAssert.h: do not do partial specialization. We do
10280 not really need it.
10282 * src/support/lyxlib.h: note that lyx::getUserName() and
10283 lyx::date() are not in use right now. Should these be suppressed?
10285 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10286 (makeLinuxDocFile): do not put date and user name in linuxdoc
10289 * src/support/lyxlib.h (kill): change first argument to long int,
10290 since that's what solaris uses.
10292 * src/support/kill.C (kill): fix declaration to match prototype.
10294 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10295 actually check whether namespaces are supported. This is not what
10298 * src/support/lyxsum.C: add a using directive.
10300 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10302 * src/support/kill.C: if we have namespace support we don't have
10303 to include lyxlib.h.
10305 * src/support/lyxlib.h: use namespace lyx if supported.
10307 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10309 * src/support/date.C: new file
10311 * src/support/chdir.C: new file
10313 * src/support/getUserName.C: new file
10315 * src/support/getcwd.C: new file
10317 * src/support/abort.C: new file
10319 * src/support/kill.C: new file
10321 * src/support/lyxlib.h: moved all the functions in this file
10322 insede struct lyx. Added also kill and abort to this struct. This
10323 is a way to avoid the "kill is not defined in <csignal>", we make
10324 C++ wrappers for functions that are not ANSI C or ANSI C++.
10326 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10327 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10328 lyx it has been renamed to sum.
10330 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10332 * src/text.C: add using directives for std::min and std::max.
10334 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10336 * src/texrow.C (getIdFromRow): actually return something useful in
10337 id and pos. Hopefully fixes the bug with positionning of errorbox
10340 * src/lyx_main.C (easyParse): output an error and exit if an
10341 incorrect command line option has been given.
10343 * src/spellchecker.C (ispell_check_word): document a memory leak.
10345 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10346 where a "struct utimbuf" is allocated with "new" and deleted with
10349 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10351 * src/text2.C (CutSelection): don't delete double spaces.
10352 (PasteSelection): ditto
10353 (CopySelection): ditto
10355 * src/text.C (Backspace): don't delete double spaces.
10357 * src/lyxlex.C (next): fix a bug that were only present with
10358 conformant std::istream::get to read comment lines, use
10359 std::istream::getline instead. This seems to fix the problem.
10361 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10363 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10364 allowed to insert space before space" editing problem. Please read
10365 commends at the beginning of the function. Comments about usage
10368 * src/text.C (InsertChar): fix for the "not allowed to insert
10369 space before space" editing problem.
10371 * src/text2.C (DeleteEmptyParagraphMechanism): when
10372 IsEmptyTableRow can only return false this last "else if" will
10373 always be a no-op. Commented out.
10375 * src/text.C (RedoParagraph): As far as I can understand tmp
10376 cursor is not really needed.
10378 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10379 present it could only return false anyway.
10380 (several functions): Did something not so smart...added a const
10381 specifier on a lot of methods.
10383 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10384 and add a tmp->text.resize. The LyXParagraph constructor does the
10386 (BreakParagraphConservative): ditto
10388 * src/support/path.h (Path): add a define so that the wrong usage
10389 "Path("/tmp") will be flagged as a compilation error:
10390 "`unnamed_Path' undeclared (first use this function)"
10392 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10394 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10395 which was bogus for several reasons.
10397 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10399 (runBibTeX): ditto.
10401 * autogen.sh: do not use "type -path" (what's that anyway?).
10403 * src/support/filetools.C (findtexfile): remove extraneous space
10404 which caused a kpsewhich warning (at least with kpathsea version
10407 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10409 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10411 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10413 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10415 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10417 * src/paragraph.C (BreakParagraph): do not reserve space on text
10418 if we don't need to (otherwise, if pos_end < pos, we end up
10419 reserving huge amounts of memory due to bad unsigned karma).
10420 (BreakParagraphConservative): ditto, although I have not seen
10421 evidence the bug can happen here.
10423 * src/lyxparagraph.h: add a using std::list.
10425 2000-01-11 Juergen Vigna <jug@sad.it>
10427 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10428 could not be found.
10430 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10432 * src/vc-backend.C (doVCCommand): change to be static and take one
10433 more parameter: the path to chdir too be fore executing the command.
10434 (retrive): new function equiv to "co -r"
10436 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10437 file_not_found_hook is true.
10439 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10441 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10442 if a file is readwrite,readonly...anything else.
10444 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10446 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10447 (CreatePostscript): name change from MenuRunDVIPS (or something)
10448 (PreviewPostscript): name change from MenuPreviewPS
10449 (PreviewDVI): name change from MenuPreviewDVI
10451 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10452 \view_pdf_command., \pdf_to_ps_command
10454 * lib/configure.m4: added search for PDF viewer, and search for
10455 PDF to PS converter.
10456 (lyxrc.defaults output): add \pdflatex_command,
10457 \view_pdf_command and \pdf_to_ps_command.
10459 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10461 * src/bufferlist.C (write): we don't use blocksize for anything so
10464 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10466 * src/support/block.h: disable operator T* (), since it causes
10467 problems with both compilers I tried. See comments in the file.
10469 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10472 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10473 variable LYX_DIR_10x to LYX_DIR_11x.
10475 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10477 * INSTALL: document --with-lyxname.
10480 * configure.in: new configure flag --with-lyxname which allows to
10481 choose the name under which lyx is installed. Default is "lyx", of
10482 course. It used to be possible to do this with --program-suffix,
10483 but the later has in fact a different meaning for autoconf.
10485 * src/support/lstrings.h (lstrchr): reformat a bit.
10487 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10488 * src/mathed/math_defs.h: ditto.
10490 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10492 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10493 true, decides if we create a backup file or not when saving. New
10494 tag and variable \pdf_mode, defaults to false. New tag and
10495 variable \pdflatex_command, defaults to pdflatex. New tag and
10496 variable \view_pdf_command, defaults to xpdf. New tag and variable
10497 \pdf_to_ps_command, defaults to pdf2ps.
10499 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10501 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10502 does not have a BufferView.
10503 (unlockInset): ditto + don't access the_locking_inset if the
10504 buffer does not have a BufferView.
10506 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10507 certain circumstances so that we don't continue a keyboard
10508 operation long after the key was released. Try f.ex. to load a
10509 large document, press PageDown for some seconds and then release
10510 it. Before this change the document would contine to scroll for
10511 some time, with this change it stops imidiatly.
10513 * src/support/block.h: don't allocate more space than needed. As
10514 long as we don't try to write to the arr[x] in a array_type arr[x]
10515 it is perfectly ok. (if you write to it you might segfault).
10516 added operator value_type*() so that is possible to pass the array
10517 to functions expecting a C-pointer.
10519 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10522 * intl/*: updated to gettext 0.10.35, tried to add our own
10523 required modifications. Please verify.
10525 * po/*: updated to gettext 0.10.35, tried to add our own required
10526 modifications. Please verify.
10528 * src/support/lstrings.C (tostr): go at fixing the problem with
10529 cxx and stringstream. When stringstream is used return
10530 oss.str().c_str() so that problems with lyxstring and basic_string
10531 are avoided. Note that the best solution would be for cxx to use
10532 basic_string all the way, but it is not conformant yet. (it seems)
10534 * src/lyx_cb.C + other files: moved several global functions to
10535 class BufferView, some have been moved to BufferView.[Ch] others
10536 are still located in lyx_cb.C. Code changes because of this. (part
10537 of "get rid of current_view project".)
10539 * src/buffer.C + other files: moved several Buffer functions to
10540 class BufferView, the functions are still present in buffer.C.
10541 Code changes because of this.
10543 * config/lcmessage.m4: updated to most recent. used when creating
10546 * config/progtest.m4: updated to most recent. used when creating
10549 * config/gettext.m4: updated to most recent. applied patch for
10552 * config/gettext.m4.patch: new file that shows what changes we
10553 have done to the local copy of gettext.m4.
10555 * config/libtool.m4: new file, used in creation of acinclude.m4
10557 * config/lyxinclude.m4: new file, this is the lyx created m4
10558 macros, used in making acinclude.m4.
10560 * autogen.sh: GNU m4 discovered as a separate task not as part of
10561 the lib/configure creation.
10562 Generate acinlucde from files in config. Actually cat
10563 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10564 easier to upgrade .m4 files that really are external.
10566 * src/Spacing.h: moved using std::istringstream to right after
10567 <sstream>. This should fix the problem seen with some compilers.
10569 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10571 * src/lyx_cb.C: began some work to remove the dependency a lot of
10572 functions have on BufferView::text, even if not really needed.
10573 (GetCurrentTextClass): removed this func, it only hid the
10576 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10577 forgot this in last commit.
10579 * src/Bullet.C (bulletEntry): use static char const *[] for the
10580 tables, becuase of this the return arg had to change to string.
10581 (bulletSize): ditto
10582 (~Bullet): removed unneeded destructor
10584 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10585 (insetSleep): moved from Buffer
10586 (insetWakeup): moved from Buffer
10587 (insetUnlock): moved from Buffer
10589 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10590 from Buffer to BufferView.
10592 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10594 * config/ltmain.sh: updated to version 1.3.4 of libtool
10596 * config/ltconfig: updated to version 1.3.4 of libtool
10598 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10601 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10602 Did I get that right?
10604 * src/lyxlex.h: add a "using" directive or two.
10605 * src/Spacing.h: ditto.
10606 * src/insets/figinset.C: ditto.
10607 * src/support/filetools.C: ditto.
10608 * src/support/lstrings.C: ditto.
10609 * src/BufferView.C: ditto.
10610 * src/bufferlist.C: ditto.
10611 * src/lyx_cb.C: ditto.
10612 * src/lyxlex.C: ditto.
10614 * NEWS: add some changes for 1.1.4.
10616 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10618 * src/BufferView.C: first go at a TextCache to speed up switching
10621 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10623 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10624 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10625 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10626 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10629 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10630 members of the struct are correctly initialized to 0 (detected by
10632 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10633 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10635 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10636 pidwait, since it was allocated with "new". This was potentially
10637 very bad. Thanks to Michael Schmitt for running purify for us.
10640 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10642 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10644 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10646 1999-12-30 Allan Rae <rae@lyx.org>
10648 * lib/templates/IEEEtran.lyx: minor change
10650 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10651 src/mathed/formula.C (LocalDispatch): askForText changes
10653 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10654 know when a user has cancelled input. Fixes annoying problems with
10655 inserting labels and version control.
10657 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10659 * src/support/lstrings.C (tostr): rewritten to use strstream and
10662 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10664 * src/support/filetools.C (IsFileWriteable): use fstream to check
10665 (IsDirWriteable): use fileinfo to check
10667 * src/support/filetools.h (FilePtr): whole class deleted
10669 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10671 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10673 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10675 * src/bufferlist.C (write): use ifstream and ofstream instead of
10678 * src/Spacing.h: use istrstream instead of sscanf
10680 * src/mathed/math_defs.h: change first arg to istream from FILE*
10682 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10684 * src/mathed/math_parser.C: have yyis to be an istream
10685 (LexGetArg): use istream (yyis)
10687 (mathed_parse): ditto
10688 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10690 * src/mathed/formula.C (Read): rewritten to use istream
10692 * src/mathed/formulamacro.C (Read): rewritten to use istream
10694 * src/lyxlex.h (~LyXLex): deleted desturctor
10695 (getStream): new function, returns an istream
10696 (getFile): deleted funtion
10697 (IsOK): return is.good();
10699 * src/lyxlex.C (LyXLex): delete file and owns_file
10700 (setFile): open an filebuf and assign that to a istream instead of
10702 (setStream): new function, takes an istream as arg.
10703 (setFile): deleted function
10704 (EatLine): rewritten us use istream instead of FILE*
10708 * src/table.C (LyXTable): use istream instead of FILE*
10709 (Read): rewritten to take an istream instead of FILE*
10711 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10713 * src/buffer.C (Dispatch): remove an extraneous break statement.
10715 * src/support/filetools.C (QuoteName): change to do simple
10716 'quoting'. More work is necessary. Also changed to do nothing
10717 under emx (needs fix too).
10718 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10720 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10721 config.h.in to the AC_DEFINE_UNQUOTED() call.
10722 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10723 needs char * as argument (because Solaris 7 declares it like
10726 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10727 remove definition of BZERO.
10729 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10731 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10732 defined, "lyxregex.h" if not.
10734 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10736 (REGEX): new variable that is set to regex.c lyxregex.h when
10737 AM_CONDITIONAL USE_REGEX is set.
10738 (libsupport_la_SOURCES): add $(REGEX)
10740 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10743 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10746 * configure.in: add call to LYX_REGEX
10748 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10749 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10751 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10753 * lib/bind/fi_menus.bind: new file, from
10754 pauli.virtanen@saunalahti.fi.
10756 * src/buffer.C (getBibkeyList): pass the parameter delim to
10757 InsetInclude::getKeys and InsetBibtex::getKeys.
10759 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10760 is passed to Buffer::getBibkeyList
10762 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10763 instead of the hardcoded comma.
10765 * src/insets/insetbib.C (getKeys): make sure that there are not
10766 leading blanks in bibtex keys. Normal latex does not care, but
10767 harvard.sty seems to dislike blanks at the beginning of citation
10768 keys. In particular, the retturn value of the function is
10770 * INSTALL: make it clear that libstdc++ is needed and that gcc
10771 2.7.x probably does not work.
10773 * src/support/filetools.C (findtexfile): make debug message go to
10775 * src/insets/insetbib.C (getKeys): ditto
10777 * src/debug.C (showTags): make sure that the output is correctly
10780 * configure.in: add a comment for TWO_COLOR_ICON define.
10782 * acconfig.h: remove all the entries that already defined in
10783 configure.in or acinclude.m4.
10785 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10786 to avoid user name, date and copyright.
10788 1999-12-21 Juergen Vigna <jug@sad.it>
10790 * src/table.C (Read): Now read bogus row format informations
10791 if the format is < 5 so that afterwards the table can
10792 be read by lyx but without any format-info. Fixed the
10793 crash we experienced when not doing this.
10795 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10797 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10798 (RedoDrawingOfParagraph): ditto
10799 (RedoParagraphs): ditto
10800 (RemoveTableRow): ditto
10802 * src/text.C (Fill): rename arg paperwidth -> paper_width
10804 * src/buffer.C (insertLyXFile): rename var filename -> fname
10805 (writeFile): rename arg filename -> fname
10806 (writeFileAscii): ditto
10807 (makeLaTeXFile): ditto
10808 (makeLinuxDocFile): ditto
10809 (makeDocBookFile): ditto
10811 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10814 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10816 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10819 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10820 compiled by a C compiler not C++.
10822 * src/layout.h (LyXTextClass): added typedef for const_iterator
10823 (LyXTextClassList): added typedef for const_iterator + member
10824 functions begin and end.
10826 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10827 iterators to fill the choice_class.
10828 (updateLayoutChoice): rewritten to use iterators to fill the
10829 layoutlist in the toolbar.
10831 * src/BufferView.h (BufferView::work_area_width): removed unused
10834 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10836 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10837 (sgmlCloseTag): ditto
10839 * src/support/lstrings.h: return type of countChar changed to
10842 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10843 what version of this func to use. Also made to return unsigned int.
10845 * configure.in: call LYX_STD_COUNT
10847 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10848 conforming std::count.
10850 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10852 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10853 and a subscript would give bad display (patch from Dekel Tsur
10854 <dekel@math.tau.ac.il>).
10856 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10858 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10861 * src/chset.h: add a few 'using' directives
10863 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10864 triggered when no buffer is active
10866 * src/layout.C: removed `break' after `return' in switch(), since
10869 * src/lyx_main.C (init): make sure LyX can be ran in place even
10870 when libtool has done its magic with shared libraries. Fix the
10871 test for the case when the system directory has not been found.
10873 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10874 name for the latex file.
10875 (MenuMakeHTML): ditto
10877 * src/buffer.h: add an optional boolean argument, which is passed
10878 to ChangeExtension.
10880 1999-12-20 Allan Rae <rae@lyx.org>
10882 * lib/templates/IEEEtran.lyx: small correction and update.
10884 * configure.in: Attempted to use LYX_PATH_HEADER
10886 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10888 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10889 input from JMarc. Now use preprocessor to find the header.
10890 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10891 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10892 LYX_STL_STRING_FWD. See comments in file.
10894 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10896 * The global MiniBuffer * minibuffer variable is dead.
10898 * The global FD_form_main * fd_form_main variable is dead.
10900 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10902 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10904 * src/table.h: add the LOstream.h header
10905 * src/debug.h: ditto
10907 * src/LyXAction.h: change the explaination of the ReadOnly
10908 attribute: is indicates that the function _can_ be used.
10910 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10913 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10915 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10921 * src/paragraph.C (GetWord): assert on pos>=0
10924 * src/support/lyxstring.C: condition the use of an invariant on
10926 * src/support/lyxstring.h: ditto
10928 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10929 Use LAssert.h instead of plain assert().
10931 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10933 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10934 * src/support/filetools.C: ditto
10936 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10939 * INSTALL: document the new configure flags
10941 * configure.in: suppress --with-debug; add --enable-assertions
10943 * acinclude.m4: various changes in alignment of help strings.
10945 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10947 * src/kbmap.C: commented out the use of the hash map in kb_map,
10948 beginning of movement to a stl::container.
10950 * several files: removed code that was not in effect when
10951 MOVE_TEXT was defined.
10953 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10954 for escaping should not be used. We can discuss if the string
10955 should be enclosed in f.ex. [] instead of "".
10957 * src/trans_mgr.C (insert): use the new returned value from
10958 encodeString to get deadkeys and keymaps done correctly.
10960 * src/chset.C (encodeString): changed to return a pair, to tell
10961 what to use if we know the string.
10963 * src/lyxscreen.h (fillArc): new function.
10965 * src/FontInfo.C (resize): rewritten to use more std::string like
10966 structore, especially string::replace.
10968 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10971 * configure.in (chmod +x some scripts): remove config/gcc-hack
10973 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10975 * src/buffer.C (writeFile): change once again the top comment in a
10976 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10977 instead of an hardcoded version number.
10978 (makeDocBookFile): ditto
10980 * src/version.h: add new define LYX_DOCVERSION
10982 * po/de.po: update from Pit Sütterlin
10983 * lib/bind/de_menus.bind: ditto.
10985 * src/lyxfunc.C (Dispatch): call MenuExport()
10986 * src/buffer.C (Dispatch): ditto
10988 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10989 LyXFunc::Dispatch().
10990 (MenuExport): new function, moved from
10991 LyXFunc::Dispatch().
10993 * src/trans_mgr.C (insert): small cleanup
10994 * src/chset.C (loadFile): ditto
10996 * lib/kbd/iso8859-1.cdef: add missing backslashes
10998 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11000 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11001 help with placing the manually drawn accents better.
11003 (Draw): x2 and hg changed to float to minimize rounding errors and
11004 help place the accents better.
11006 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11007 unsigned short to char is just wrong...cast the char to unsigned
11008 char instead so that the two values can compare sanely. This
11009 should also make the display of insetlatexaccents better and
11010 perhaps also some other insets.
11012 (lbearing): new function
11015 1999-12-15 Allan Rae <rae@lyx.org>
11017 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11018 header that provides a wrapper around the very annoying SGI STL header
11021 * src/support/lyxstring.C, src/LString.h:
11022 removed old SGI-STL-compatability attempts.
11024 * configure.in: Use LYX_STL_STRING_FWD.
11026 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11027 stl_string_fwd.h is around and try to determine it's location.
11028 Major improvement over previous SGI STL 3.2 compatability.
11029 Three small problems remain with this function due to my zero
11030 knowledge of autoconf. JMarc and lgb see the comments in the code.
11032 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11034 * src/broken_const.h, config/hack-gcc, config/README: removed
11036 * configure.in: remove --with-gcc-hack option; do not call
11039 * INSTALL: remove documentation of --with-broken-const and
11042 * acconfig.h: remove all trace of BROKEN_CONST define
11044 * src/buffer.C (makeDocBookFile): update version number in output
11046 (SimpleDocBookOnePar): fix an assert when trying to a character
11047 access beyond string length
11050 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11052 * po/de.po: fix the Export menu
11054 * lyx.man: update the description of -dbg
11056 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11057 (commandLineHelp): updated
11058 (easyParse): show list of available debug levels if -dbg is passed
11061 * src/Makefile.am: add debug.C
11063 * src/debug.h: moved some code to debug.C
11065 * src/debug.C: new file. Contains code to set and show debug
11068 * src/layout.C: remove 'break' after 'continue' in switch
11069 statements, since these cannot be reached.
11071 1999-12-13 Allan Rae <rae@lyx.org>
11073 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11074 (in_word_set): hash() -> math_hash()
11076 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11078 * acconfig.h: Added a test for whether we are using exceptions in the
11079 current compilation run. If so USING_EXCEPTIONS is defined.
11081 * config.in: Check for existance of stl_string_fwd.h
11082 * src/LString.h: If compiling --with-included-string and SGI's
11083 STL version 3.2 is present (see above test) we need to block their
11084 forward declaration of string and supply a __get_c_string().
11085 However, it turns out this is only necessary if compiling with
11086 exceptions enabled so I've a bit more to add yet.
11088 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11089 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11090 src/support/LRegex.h, src/undo.h:
11091 Shuffle the order of the included files a little to ensure that
11092 LString.h gets included before anything that includes stl_string_fwd.h
11094 * src/support/lyxstring.C: We need to #include LString.h instead of
11095 lyxstring.h to get the necessary definition of __get_c_string.
11096 (__get_c_string): New function. This is defined static just like SGI's
11097 although why they need to do this I'm not sure. Perhaps it should be
11098 in lstrings.C instead.
11100 * lib/templates/IEEEtran.lyx: New template file.
11102 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11104 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11105 * intl/Makefile.in (MKINSTALLDIRS): ditto
11107 * src/LyXAction.C (init): changed to hold the LFUN data in a
11108 automatic array in stead of in callso to newFunc, this speeds up
11109 compilation a lot. Also all the memory used by the array is
11110 returned when the init is completed.
11112 * a lot of files: compiled with -Wold-style-cast, changed most of
11113 the reported offenders to C++ style casts. Did not change the
11114 offenders in C files.
11116 * src/trans.h (Match): change argument type to unsigned int.
11118 * src/support/DebugStream.C: fix some types on the streambufs so
11119 that it works on a conforming implementation.
11121 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11123 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11125 * src/support/lyxstring.C: remove the inline added earlier since
11126 they cause a bunch of unsatisfied symbols when linking with dec
11127 cxx. Cxx likes to have the body of inlines at the place where they
11130 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11131 accessing negative bounds in array. This fixes the crash when
11132 inserting accented characters.
11133 * src/trans.h (Match): ditto
11135 * src/buffer.C (Dispatch): since this is a void, it should not try
11136 to return anything...
11138 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11140 * src/buffer.h: removed the two friends from Buffer. Some changes
11141 because of this. Buffer::getFileName and Buffer::setFileName
11142 renamed to Buffer::fileName() and Buffer::fileName(...).
11144 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11146 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11147 and Buffer::update(short) to BufferView. This move is currently
11148 controlled by a define MOVE_TEXT, this will be removed when all
11149 shows to be ok. This move paves the way for better separation
11150 between buffer contents and buffer view. One side effect is that
11151 the BufferView needs a rebreak when swiching buffers, if we want
11152 to avoid this we can add a cache that holds pointers to LyXText's
11153 that is not currently in use.
11155 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11158 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11160 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11162 * lyx_main.C: new command line option -x (or --execute) and
11163 -e (or --export). Now direct conversion from .lyx to .tex
11164 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11165 Unfortunately, X is still needed and the GUI pops up during the
11168 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11170 * src/Spacing.C: add a using directive to bring stream stuff into
11172 * src/paragraph.C: ditto
11173 * src/buffer.C: ditto
11175 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11176 from Lars' announcement).
11178 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11179 example files from Tino Meinen.
11181 1999-12-06 Allan Rae <rae@lyx.org>
11183 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11185 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11187 * src/support/lyxstring.C: added a lot of inline for no good
11190 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11191 latexWriteEndChanges, they were not used.
11193 * src/layout.h (operator<<): output operator for PageSides
11195 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11197 * some example files: loaded in LyX 1.0.4 and saved again to update
11198 certain constructs (table format)
11200 * a lot of files: did the change to use fstream/iostream for all
11201 writing of files. Done with a close look at Andre Poenitz's patch.
11203 * some files: whitespace changes.
11205 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11207 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11208 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11209 architecture, we provide our own. It is used unconditionnally, but
11210 I do not think this is a performance problem. Thanks to Angus
11211 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11212 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11214 (GetInset): use my_memcpy.
11218 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11219 it is easier to understand, but it uses less TeX-only constructs now.
11221 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11222 elements contain spaces
11224 * lib/configure: regenerated
11226 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11227 elements contain spaces; display the list of programs that are
11230 * autogen.sh: make sure lib/configure is executable
11232 * lib/examples/*: rename the tutorial examples to begin with the
11233 two-letters language code.
11235 * src/lyxfunc.C (getStatus): do not query current font if no
11238 * src/lyx_cb.C (RunScript): use QuoteName
11239 (MenuRunDvips): ditto
11240 (PrintApplyCB): ditto
11242 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11243 around argument, so that it works well with the current shell.
11244 Does not work properly with OS/2 shells currently.
11246 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11247 * src/LyXSendto.C (SendtoApplyCB): ditto
11248 * src/lyxfunc.C (Dispatch): ditto
11249 * src/buffer.C (runLaTeX): ditto
11250 (runLiterate): ditto
11251 (buildProgram): ditto
11253 * src/lyx_cb.C (RunScript): ditto
11254 (MenuMakeLaTeX): ditto
11256 * src/buffer.h (getLatexName): new method
11258 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11260 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11262 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11263 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11264 (create_math_panel): ditto
11266 * src/lyxfunc.C (getStatus): re-activate the code which gets
11267 current font and cursor; add test for export to html.
11269 * src/lyxrc.C (read): remove unreachable break statements; add a
11272 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11274 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11276 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11277 introduced by faulty regex.
11278 * src/buffer.C: ditto
11279 * src/lastfiles.C: ditto
11280 * src/paragraph.C: ditto
11281 * src/table.C: ditto
11282 * src/vspace.C: ditto
11283 * src/insets/figinset.C: ditto
11284 Note: most of these is absolutely harmless, except the one in
11285 src/mathed formula.C.
11287 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11289 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11290 operation, yielding correct results for the reLyX command.
11292 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11294 * src/support/filetools.C (ExpandPath): removed an over eager
11296 (ReplaceEnvironmentPath): ditto
11298 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11299 shows that we are doing something fishy in our code...
11300 (BubblePost): ditto
11303 * src/lyxrc.C (read): use a double switch trick to get more help
11304 from the compiler. (the same trick is used in layout.C)
11305 (write): new function. opens a ofstream and pass that to output
11306 (output): new function, takes a ostream and writes the lyxrc
11307 elemts to it. uses a dummy switch to make sure no elements are
11310 * src/lyxlex.h: added a struct pushpophelper for use in functions
11311 with more than one exit point.
11313 * src/lyxlex.[Ch] (GetInteger): made it const
11317 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11319 * src/layout.[hC] : LayoutTags splitted into several enums, new
11320 methods created, better error handling cleaner use of lyxlex. Read
11323 * src/bmtable.[Ch]: change some member prototypes because of the
11324 image const changes.
11326 * commandtags.h, src/LyXAction.C (init): new function:
11327 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11328 This file is not read automatically but you can add \input
11329 preferences to your lyxrc if you want to. We need to discuss how
11332 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11333 in .aux, also remove .bib and .bst files from dependencies when
11336 * src/BufferView.C, src/LyXView.C: add const_cast several places
11337 because of changes to images.
11339 * lib/images/*: same change as for images/*
11341 * lib/lyxrc.example: Default for accept_compound is false not no.
11343 * images/*: changed to be const, however I have som misgivings
11344 about this change so it might be changed back.
11346 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11348 * lib/configure, po/POTFILES.in: regenerated
11350 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11352 * config/lib_configure.m4: removed
11354 * lib/configure.m4: new file (was config/lib_configure.m4)
11356 * configure.in: do not test for rtti, since we do not use it.
11358 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11360 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11361 doubling of allocated space scheme. This makes it faster for large
11362 strings end to use less memory for small strings. xtra rememoved.
11364 * src/insets/figinset.C (waitalarm): commented out.
11365 (GhostscriptMsg): use static_cast
11366 (GhostscriptMsg): use new instead of malloc to allocate memory for
11367 cmap. also delete the memory after use.
11369 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11371 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11372 for changes in bibtex database or style.
11373 (runBibTeX): remove all .bib and .bst files from dep before we
11375 (run): use scanAuc in when dep file already exist.
11377 * src/DepTable.C (remove_files_with_extension): new method
11378 (exist): new method
11380 * src/DepTable.[Ch]: made many of the methods const.
11382 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11384 * src/bufferparams.C: make sure that the default textclass is
11385 "article". It used to be the first one by description order, but
11386 now the first one is "docbook".
11388 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11389 string; call Debug::value.
11390 (easyParse): pass complete argument to setDebuggingLevel().
11392 * src/debug.h (value): fix the code that parses debug levels.
11394 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11397 * src/LyXAction.C: use Debug::ACTION as debug channel.
11399 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11401 * NEWS: updated for the future 1.1.3 release.
11403 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11404 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11405 it should. This is of course a controversial change (since many
11406 people will find that their lyx workscreen is suddenly full of
11407 red), but done for the sake of correctness.
11409 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11410 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11412 * src/insets/inseterror.h, src/insets/inseturl.h,
11413 src/insets/insetinfo.h, src/insets/figinset.h,
11414 src/mathed/formulamacro.h, src/mathed/math_macro.h
11415 (EditMessage): add a missing const and add _() to make sure that
11416 translation happens
11418 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11419 src/insets/insetbib.C, src/support/filetools.C: add `using'
11420 directives for cxx.
11422 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11423 doing 'Insert index of last word' at the beginning of a paragraph.
11425 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11427 * several files: white-space changes.
11429 * src/mathed/formula.C: removed IsAlpha and IsDigit
11431 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11432 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11435 * src/insets/figinset.C (GetPSSizes): don't break when
11436 "EndComments" is seen. But break when a boundingbox is read.
11438 * all classes inherited from Inset: return value of Clone
11439 changed back to Inset *.
11441 * all classes inherited form MathInset: return value of Clone
11442 changed back to MathedInset *.
11444 * src/insets/figinset.C (runqueue): use a ofstream to output the
11445 gs/ps file. Might need some setpresicion or setw. However I can
11446 see no problem with the current code.
11447 (runqueue): use sleep instead of the alarm/signal code. I just
11448 can't see the difference.
11450 * src/paragraph.C (LyXParagraph): reserve space in the new
11451 paragraph and resize the inserted paragraph to just fit.
11453 * src/lyxfunc.h (operator|=): added operator for func_status.
11455 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11456 check for readable file.
11458 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11459 check for readable file.
11460 (MenuMakeLinuxDoc): ditto
11461 (MenuMakeDocBook): ditto
11462 (MenuMakeAscii): ditto
11463 (InsertAsciiFile): split the test for openable and readable
11465 * src/bmtable.C (draw_bitmaptable): use
11466 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11468 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11469 findtexfile from LaTeX to filetools.
11471 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11472 instead of FilePtr. Needs to be verified by a literate user.
11474 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11476 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11477 (EditMessage): likewise.
11479 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11480 respectively as \textasciitilde and \textasciicircum.
11482 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11484 * src/support/lyxstring.h: made the methods that take iterators
11485 use const_iterator.
11487 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11488 (regexMatch): made is use the real regex class.
11490 * src/support/Makefile.am: changed to use libtool
11492 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11494 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11496 (MathIsInset ++): changed several macros to be inline functions
11499 * src/mathed/Makefile.am: changed to use libtool
11501 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11503 * src/insets/inset* : Clone changed to const and return type is
11504 the true insettype not just Inset*.
11506 * src/insets/Makefile.am: changed to use libtool
11508 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11510 * src/undo.[Ch] : added empty() and changed some of the method
11513 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11515 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11516 setID use block<> for the bullets array, added const several places.
11518 * src/lyxfunc.C (getStatus): new function
11520 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11521 LyXAction, added const to several funtions.
11523 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11524 a std::map, and to store the dir items in a vector.
11526 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11529 * src/LyXView.[Ch] + other files : changed currentView to view.
11531 * src/LyXAction.[Ch] : ported from the old devel branch.
11533 * src/.cvsignore: added .libs and a.out
11535 * configure.in : changes to use libtool.
11537 * acinclude.m4 : inserted libtool.m4
11539 * .cvsignore: added libtool
11541 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11543 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11544 file name in insets and mathed directories (otherwise the
11545 dependency is not taken in account under cygwin).
11547 * src/text2.C (InsertString[AB]): make sure that we do not try to
11548 read characters past the string length.
11550 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11552 * lib/doc/LaTeXConfig.lyx.in,
11553 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11555 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11556 file saying who created them and when this heppened; this is
11557 useless and annoys tools like cvs.
11559 * lib/layouts/g-brief-{en,de}.layout,
11560 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11561 from Thomas Hartkens <thomas@hartkens.de>.
11563 * src/{insets,mathed}/Makefile.am: do not declare an empty
11564 LDFLAGS, so that it can be set at configure time (useful on Irix
11567 * lib/reLyX/configure.in: make sure that the prefix is set
11568 correctly in LYX_DIR.
11570 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11572 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11573 be used by 'command-sequence' this allows to bind a key to a
11574 sequence of LyX-commands
11575 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11577 * src/LyXAction.C: add "command-sequence"
11579 * src/LyXFunction.C: handling of "command-sequence"
11581 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11582 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11584 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11586 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11588 * src/buffer.C (writeFile): Do not output a comment giving user
11589 and date at the beginning of a .lyx file. This is useless and
11590 annoys cvs anyway; update version number to 1.1.
11592 * src/Makefile.am (LYX_DIR): add this definition, so that a
11593 default path is hardcoded in LyX.
11595 * configure.in: Use LYX_GNU_GETTEXT.
11597 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11598 AM_GNU_GETTEXT with a bug fixed.
11600 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11602 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11604 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11605 which is used to point to LyX data is now LYX_DIR_11x.
11607 * lyx.man: convert to a unix text file; small updates.
11609 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11611 * src/support/LSubstring.[Ch]: made the second arg of most of the
11612 constructors be a const reference.
11614 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11617 * src/support/lyxstring.[Ch] (swap): added missing member function
11618 and specialization of swap(str, str);
11620 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11622 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11623 trace of the old one.
11625 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11626 put the member definitions in undo.C.
11628 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11629 NEW_TEXT and have now only code that was included when this was
11632 * src/intl.C (LCombo): use static_cast
11634 (DispatchCallback): ditto
11636 * src/definitions.h: removed whole file
11638 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11640 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11641 parsing and stores in a std:map. a regex defines the file format.
11642 removed unneeded members.
11644 * src/bufferparams.h: added several enums from definitions.h here.
11645 Removed unsused destructor. Changed some types to use proper enum
11646 types. use block to have the temp_bullets and user_defined_bullets
11647 and to make the whole class assignable.
11649 * src/bufferparams.C (Copy): removed this functions, use a default
11650 assignment instead.
11652 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11655 * src/buffer.C (readLyXformat2): commend out all that have with
11656 oldpapersize to do. also comment out all that hve to do with
11657 insetlatex and insetlatexdel.
11658 (setOldPaperStuff): commented out
11660 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11662 * src/LyXAction.C: remove use of inset-latex-insert
11664 * src/mathed/math_panel.C (button_cb): use static_cast
11666 * src/insets/Makefile.am (insets_o_SOURCES): removed
11669 * src/support/lyxstring.C (helper): use the unsigned long
11670 specifier, UL, instead of a static_cast.
11672 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11674 * src/support/block.h: new file. to be used as a c-style array in
11675 classes, so that the class can be assignable.
11677 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11679 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11680 NULL, make sure to return an empty string (it is not possible to
11681 set a string to NULL).
11683 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11685 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11687 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11689 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11690 link line, so that Irix users (for example) can set it explicitely to
11693 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11694 it can be overidden at make time (static or dynamic link, for
11697 * src/vc-backend.C, src/LaTeXFeatures.h,
11698 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11699 statements to bring templates to global namespace.
11701 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11703 * src/support/lyxstring.C (operator[] const): make it standard
11706 * src/minibuffer.C (Init): changed to reflect that more
11707 information is given from the lyxvc and need not be provided here.
11709 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11711 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11713 * src/LyXView.C (UpdateTimerCB): use static_cast
11714 (KeyPressMask_raw_callback): ditto
11716 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11717 buffer_, a lot of changes because of this. currentBuffer() ->
11718 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11719 also changes to other files because of this.
11721 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11723 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11724 have no support for RCS and partial support for CVS, will be
11727 * src/insets/ several files: changes because of function name
11728 changes in Bufferview and LyXView.
11730 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11732 * src/support/LSubstring.[Ch]: new files. These implement a
11733 Substring that can be very convenient to use. i.e. is this
11735 string a = "Mary had a little sheep";
11736 Substring(a, "sheep") = "lamb";
11737 a is now "Mary has a little lamb".
11739 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11740 out patterns and subpatterns of strings. It is used by LSubstring
11741 and also by vc-backend.C
11743 * src/support/lyxstring.C: went over all the assertions used and
11744 tried to correct the wrong ones and flag which of them is required
11745 by the standard. some bugs found because of this. Also removed a
11746 couple of assertions.
11748 * src/support/Makefile.am (libsupport_a_SOURCES): added
11749 LSubstring.[Ch] and LRegex.[Ch]
11751 * src/support/FileInfo.h: have struct stat buf as an object and
11752 not a pointer to one, some changes because of this.
11754 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11755 information in layout when adding the layouts preamble to the
11756 textclass preamble.
11758 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11761 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11762 because of bug in OS/2.
11764 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11766 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11767 \verbatim@font instead of \ttfamily, so that it can be redefined.
11769 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11770 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11771 src/layout.h, src/text2.C: add 'using' directive to bring the
11772 STL templates we need from the std:: namespace to the global one.
11773 Needed by DEC cxx in strict ansi mode.
11775 * src/support/LIstream.h,src/support/LOstream.h,
11776 src/support/lyxstring.h,src/table.h,
11777 src/lyxlookup.h: do not include <config.h> in header
11778 files. This should be done in the .C files only.
11780 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11784 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11786 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11787 from Kayvan to fix the tth invokation.
11789 * development/lyx.spec.in: updates from Kayvan to reflect the
11790 changes of file names.
11792 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11794 * src/text2.C (InsertStringB): use std::copy
11795 (InsertStringA): use std::copy
11797 * src/bufferlist.C: use a vector to store the buffers in. This is
11798 an internal change and should not affect any other thing.
11800 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11803 * src/text.C (Fill): fix potential bug, one off bug.
11805 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11807 * src/Makefile.am (lyx_main.o): add more files it depends on.
11809 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11811 * src/support/lyxstring.C: use size_t for the reference count,
11812 size, reserved memory and xtra.
11813 (internal_compare): new private member function. Now the compare
11814 functions should work for std::strings that have embedded '\0'
11816 (compare): all compare functions rewritten to use
11819 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11821 * src/support/lyxstring.C (compare): pass c_str()
11822 (compare): pass c_str
11823 (compare): pass c_str
11825 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11827 * src/support/DebugStream.C: <config.h> was not included correctly.
11829 * lib/configure: forgot to re-generate it :( I'll make this file
11830 auto generated soon.
11832 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11834 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11837 * src/support/lyxstring.C: some changes from length() to rep->sz.
11838 avoids a function call.
11840 * src/support/filetools.C (SpaceLess): yet another version of the
11841 algorithm...now per Jean-Marc's suggestions.
11843 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11845 * src/layout.C (less_textclass_desc): functor for use in sorting
11847 (LyXTextClass::Read): sort the textclasses after reading.
11849 * src/support/filetools.C (SpaceLess): new version of the
11850 SpaceLess functions. What problems does this one give? Please
11853 * images/banner_bw.xbm: made the arrays unsigned char *
11855 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11857 * src/support/lyxstring.C (find): remove bogus assertion in the
11858 two versions of find where this has not been done yet.
11860 * src/support/lyxlib.h: add missing int return type to
11863 * src/menus.C (ShowFileMenu): disable exporting to html if no
11864 html export command is present.
11866 * config/lib_configure.m4: add a test for an HTML converter. The
11867 programs checked for are, in this order: tth, latex2html and
11870 * lib/configure: generated from config/lib_configure.m4.
11872 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11873 html converter. The parameters are now passed through $$FName and
11874 $$OutName, instead of standard input/output.
11876 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11878 * lib/lyxrc.example: update description of \html_command.
11879 add "quotes" around \screen_font_xxx font setting examples to help
11880 people who use fonts with spaces in their names.
11882 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11884 * Distribution files: updates for v1.1.2
11886 * src/support/lyxstring.C (find): remove bogus assert and return
11887 npos for the same condition.
11889 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11891 * added patch for OS/2 from SMiyata.
11893 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11895 * src/text2.C (CutSelection): make space_wrapped a bool
11896 (CutSelection): dont declare int i until we have to.
11897 (alphaCounter): return a char const *.
11899 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11901 * src/support/syscall.C (Systemcalls::kill):
11902 src/support/filetools.C (PutEnv, PutEnvPath):
11903 src/lyx_cb.C (addNewlineAndDepth):
11904 src/FontInfo.C (FontInfo::resize): condition some #warning
11905 directives with WITH_WARNINGS.
11908 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11910 * src/layout.[Ch] + several files: access to class variables
11911 limited and made accessor functions instead a lot of code changed
11912 becuase of this. Also instead of returning pointers often a const
11913 reference is returned instead.
11915 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11917 * src/Makefile.am (dist-hook): added used to remove the CVS from
11918 cheaders upon creating a dist
11919 (EXTRA_DIST): added cheaders
11921 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11922 a character not as a small integer.
11924 * src/support/lyxstring.C (find): removed Assert and added i >=
11925 rep->sz to the first if.
11927 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11929 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11930 src/LyXView.C src/buffer.C src/bufferparams.C
11931 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11932 src/text2.C src/insets/insetinclude.C:
11933 lyxlayout renamed to textclasslist.
11935 * src/layout.C: some lyxerr changes.
11937 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11938 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11939 (LyXLayoutList): removed all traces of this class.
11940 (LyXTextClass::Read): rewrote LT_STYLE
11941 (LyXTextClass::hasLayout): new function
11942 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11943 both const and nonconst version.
11944 (LyXTextClass::delete_layout): new function.
11945 (LyXTextClassList::Style): bug fix. do the right thing if layout
11947 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11948 (LyXTextClassList::NameOfLayout): ditto
11949 (LyXTextClassList::Load): ditto
11951 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11953 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11955 * src/LyXAction.C (LookupFunc): added a workaround for sun
11956 compiler, on the other hand...we don't know if the current code
11957 compiles on sun at all...
11959 * src/support/filetools.C (CleanupPath): subst fix
11961 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11964 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11965 complained about this one?
11967 * src/insets/insetinclude.C (Latex): subst fix
11969 * src/insets/insetbib.C (getKeys): subst fix
11971 * src/LyXSendto.C (SendtoApplyCB): subst fix
11973 * src/lyx_main.C (init): subst fix
11975 * src/layout.C (Read): subst fix
11977 * src/lyx_sendfax_main.C (button_send): subst fix
11979 * src/buffer.C (RoffAsciiTable): subst fix
11981 * src/lyx_cb.C (MenuFax): subst fix
11982 (PrintApplyCB): subst fix
11984 1999-10-26 Juergen Vigna <jug@sad.it>
11986 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11988 (Read): Cleaned up this code so now we read only format vestion >= 5
11990 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11992 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11993 come nobody has complained about this one?
11995 * src/insets/insetinclude.C (Latex): subst fix
11997 * src/insets/insetbib.C (getKeys): subst fix
11999 * src/lyx_main.C (init): subst fix
12001 * src/layout.C (Read): subst fix
12003 * src/buffer.C (RoffAsciiTable): subst fix
12005 * src/lyx_cb.C (MenuFax): subst fix.
12007 * src/layout.[hC] + some other files: rewrote to use
12008 std::container to store textclasses and layouts in.
12009 Simplified, removed a lot of code. Make all classes
12010 assignable. Further simplifications and review of type
12011 use still to be one.
12013 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12014 lastfiles to create the lastfiles partr of the menu.
12016 * src/lastfiles.[Ch]: rewritten to use deque to store the
12017 lastfiles in. Uses fstream for reading and writing. Simplifies
12020 * src/support/syscall.C: remove explicit cast.
12022 * src/BufferView.C (CursorToggleCB): removed code snippets that
12023 were commented out.
12024 use explicat C++ style casts instead of C style casts. also use
12025 u_vdata instea of passing pointers in longs.
12027 * src/PaperLayout.C: removed code snippets that were commented out.
12029 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12031 * src/lyx_main.C: removed code snippets that wer commented out.
12033 * src/paragraph.C: removed code snippets that were commented out.
12035 * src/lyxvc.C (logClose): use static_cast
12037 (viewLog): remove explicit cast to void*
12038 (showLog): removed old commented code
12040 * src/menus.C: use static_cast instead of C style casts. use
12041 u_vdata instead of u_ldata. remove explicit cast to (long) for
12042 pointers. Removed old code that was commented out.
12044 * src/insets/inset.C: removed old commented func
12046 * src/insets/insetref.C (InsetRef): removed old code that had been
12047 commented out for a long time.
12049 (escape): removed C style cast
12051 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12053 * src/insets/insetlatex.C (Draw): removed old commented code
12054 (Read): rewritten to use string
12056 * src/insets/insetlabel.C (escape): removed C style cast
12058 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12060 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12061 old commented code.
12063 * src/insets/insetinclude.h: removed a couple of stupid bools
12065 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12066 (Clone): remove C style cast
12067 (getKeys): changed list to lst because of std::list
12069 * src/insets/inseterror.C (Draw): removed som old commented code.
12071 * src/insets/insetcommand.C (Draw): removed some old commented code.
12073 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12074 commented out forever.
12075 (bibitem_cb): use static_cast instead of C style cast
12076 use of vdata changed to u_vdata.
12078 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12080 (CloseUrlCB): use static_cast instead of C style cast.
12081 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12083 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12084 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12085 (CloseInfoCB): static_cast from ob->u_vdata instead.
12086 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12089 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12090 (C_InsetError_CloseErrorCB): forward the ob parameter
12091 (CloseErrorCB): static_cast from ob->u_vdata instead.
12093 * src/vspace.h: include LString.h since we use string in this class.
12095 * src/vspace.C (lyx_advance): changed name from advance because of
12096 nameclash with stl. And since we cannot use namespaces yet...I
12097 used a lyx_ prefix instead. Expect this to change when we begin
12100 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12102 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12103 and removed now defunct constructor and deconstructor.
12105 * src/BufferView.h: have backstack as a object not as a pointer.
12106 removed initialization from constructor. added include for BackStack
12108 * development/lyx.spec.in (%build): add CFLAGS also.
12110 * src/screen.C (drawFrame): removed another warning.
12112 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12114 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12115 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12116 README and ANNOUNCE a bit for the next release. More work is
12119 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12120 unbreakable if we are in freespacing mode (LyX-Code), but not in
12123 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12125 * src/BackStack.h: fixed initialization order in constructor
12127 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12129 * acinclude.m4 (VERSION): new rules for when a version is
12130 development, added also a variable for prerelease.
12131 (warnings): we set with_warnings=yes for prereleases
12132 (lyx_opt): prereleases compile with same optimization as development
12133 (CXXFLAGS): only use pedantic if we are a development version
12135 * src/BufferView.C (restorePosition): don't do anything if the
12136 backstack is empty.
12138 * src/BackStack.h: added member empty, use this to test if there
12139 is anything to pop...
12141 1999-10-25 Juergen Vigna <jug@sad.it>
12144 * forms/layout_forms.fd +
12145 * forms/latexoptions.fd +
12146 * lyx.fd: changed for various form resize issues
12148 * src/mathed/math_panel.C +
12149 * src/insets/inseterror.C +
12150 * src/insets/insetinfo.C +
12151 * src/insets/inseturl.C +
12152 * src/insets/inseturl.h +
12154 * src/LyXSendto.C +
12155 * src/PaperLayout.C +
12156 * src/ParagraphExtra.C +
12157 * src/TableLayout.C +
12159 * src/layout_forms.C +
12166 * src/menus.C: fixed various resize issues. So now forms can be
12167 resized savely or not be resized at all.
12169 * forms/form_url.fd +
12170 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12173 * src/insets/Makefile.am: added files form_url.[Ch]
12175 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12177 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12178 (and presumably 6.2).
12180 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12181 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12182 remaining static member callbacks.
12184 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12187 * src/support/lyxstring.h: declare struct Srep as friend of
12188 lyxstring, since DEC cxx complains otherwise.
12190 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12192 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12194 * src/LaTeX.C (run): made run_bibtex also depend on files with
12196 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12197 are put into the dependency file.
12199 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12200 the code has shown itself to work
12201 (create_ispell_pipe): removed another warning, added a comment
12204 * src/minibuffer.C (ExecutingCB): removed code that has been
12205 commented out a long time
12207 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12208 out code + a warning.
12210 * src/support/lyxstring.h: comment out the three private
12211 operators, when compiling with string ansi conforming compilers
12212 they make problems.
12214 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12216 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12217 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12220 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12223 * src/mathed/math_panel.C (create_math_panel): remove explicit
12226 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12229 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12230 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12231 to XCreatePixmapFromBitmapData
12232 (fl_set_bmtable_data): change the last argument to be unsigned
12234 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12235 and bh to be unsigned int, remove explicit casts in call to
12236 XReadBitmapFileData.
12238 * images/arrows.xbm: made the arrays unsigned char *
12239 * images/varsz.xbm: ditto
12240 * images/misc.xbm: ditto
12241 * images/greek.xbm: ditto
12242 * images/dots.xbm: ditto
12243 * images/brel.xbm: ditto
12244 * images/bop.xbm: ditto
12246 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12248 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12249 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12250 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12252 (LYX_CXX_CHEADERS): added <clocale> to the test.
12254 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12256 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12258 * src/support/lyxstring.C (append): fixed something that must be a
12259 bug, rep->assign was used instead of rep->append.
12261 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12264 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12265 lyx insert double chars. Fix spotted by Kayvan.
12267 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12269 * Fixed the tth support. I messed up with the Emacs patch apply feature
12270 and omitted the changes in lyxrc.C.
12272 1999-10-22 Juergen Vigna <jug@sad.it>
12274 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12276 * src/lyx_cb.C (MenuInsertRef) +
12277 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12278 the form cannot be resized under it limits (fixes a segfault)
12280 * src/lyx.C (create_form_form_ref) +
12281 * forms/lyx.fd: Changed Gravity on name input field so that it is
12284 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12286 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12287 <ostream> and <istream>.
12289 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12290 whether <fstream> provides the latest standard features, or if we
12291 have an oldstyle library (like in egcs).
12292 (LYX_CXX_STL_STRING): fix the test.
12294 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12295 code on MODERN_STL_STREAM.
12297 * src/support/lyxstring.h: use L{I,O}stream.h.
12299 * src/support/L{I,O}stream.h: new files, designed to setup
12300 correctly streams for our use
12301 - includes the right header depending on STL capabilities
12302 - puts std::ostream and std::endl (for LOStream.h) or
12303 std::istream (LIStream.h) in toplevel namespace.
12305 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12307 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12308 was a bib file that had been changed we ensure that bibtex is run.
12309 (runBibTeX): enhanced to extract the names of the bib files and
12310 getting their absolute path and enter them into the dep file.
12311 (findtexfile): static func that is used to look for tex-files,
12312 checks for absolute patchs and tries also with kpsewhich.
12313 Alternative ways of finding the correct files are wanted. Will
12315 (do_popen): function that runs a command using popen and returns
12316 the whole output of that command in a string. Should be moved to
12319 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12320 file with extension ext has changed.
12322 * src/insets/figinset.C: added ifdef guards around the fl_free
12323 code that jug commented out. Now it is commented out when
12324 compiling with XForms == 0.89.
12326 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12327 to lyxstring.C, and only keep a forward declaration in
12328 lyxstring.h. Simplifies the header file a bit and should help a
12329 bit on compile time too. Also changes to Srep will not mandate a
12330 recompile of code just using string.
12331 (~lyxstring): definition moved here since it uses srep.
12332 (size): definition moved here since it uses srep.
12334 * src/support/lyxstring.h: removed a couple of "inline" that should
12337 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12339 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12342 1999-10-21 Juergen Vigna <jug@sad.it>
12344 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12345 set to left if I just remove the width entry (or it is empty).
12347 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12348 paragraph when having dummy paragraphs.
12350 1999-10-20 Juergen Vigna <jug@sad.it>
12352 * src/insets/figinset.C: just commented some fl_free_form calls
12353 and added warnings so that this calls should be activated later
12354 again. This avoids for now a segfault, but we have a memory leak!
12356 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12357 'const char * argument' to 'string argument', this should
12358 fix some Asserts() in lyxstring.C.
12360 * src/lyxfunc.h: Removed the function argAsString(const char *)
12361 as it is not used anymore.
12363 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12365 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12368 * src/Literate.h: some funcs moved from public to private to make
12369 interface clearer. Unneeded args removed.
12371 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12373 (scanBuildLogFile): ditto
12375 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12376 normal TeX Error. Still room for improvement.
12378 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12380 * src/buffer.C (insertErrors): changes to make the error
12381 desctription show properly.
12383 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12386 * src/support/lyxstring.C (helper): changed to use
12387 sizeof(object->rep->ref).
12388 (operator>>): changed to use a pointer instead.
12390 * src/support/lyxstring.h: changed const reference & to value_type
12391 const & lets see if that helps.
12393 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12395 * Makefile.am (rpmdist): fixed to have non static package and
12398 * src/support/lyxstring.C: removed the compilation guards
12400 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12403 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12404 conditional compile of lyxstring.Ch
12406 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12407 stupid check, but it is a lot better than the bastring hack.
12408 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12410 * several files: changed string::erase into string::clear. Not
12413 * src/chset.C (encodeString): use a char temporary instead
12415 * src/table.C (TexEndOfCell): added tostr around
12416 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12417 (TexEndOfCell): ditto
12418 (TexEndOfCell): ditto
12419 (TexEndOfCell): ditto
12420 (DocBookEndOfCell): ditto
12421 (DocBookEndOfCell): ditto
12422 (DocBookEndOfCell): ditto
12423 (DocBookEndOfCell): ditto
12425 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12427 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12429 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12430 (MenuBuildProg): added tostr around ret
12431 (MenuRunChktex): added tostr around ret
12432 (DocumentApplyCB): added tostr around ret
12434 * src/chset.C (encodeString): added tostr around t->ic
12436 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12437 (makeLaTeXFile): added tostr around tocdepth
12438 (makeLaTeXFile): added tostr around ftcound - 1
12440 * src/insets/insetbib.C (setCounter): added tostr around counter.
12442 * src/support/lyxstring.h: added an operator+=(int) to catch more
12445 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12446 (lyxstring): We DON'T allow NULL pointers.
12448 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12450 * src/mathed/math_macro.C (MathMacroArgument::Write,
12451 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12452 when writing them out.
12454 * src/LString.C: remove, since it is not used anymore.
12456 * src/support/lyxstring.C: condition the content to
12457 USE_INCLUDED_STRING macro.
12459 * src/mathed/math_symbols.C, src/support/lstrings.C,
12460 src/support/lyxstring.C: add `using' directive to specify what
12461 we need in <algorithm>. I do not think that we need to
12462 conditionalize this, but any thought is appreciated.
12464 * many files: change all callback functions to "C" linkage
12465 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12466 strict_ansi. Those who were static are now global.
12467 The case of callbacks which are static class members is
12468 trickier, since we have to make C wrappers around them (see
12469 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12470 did not finish this yet, since it defeats the purpose of
12471 encapsulation, and I am not sure what the best route is.
12473 1999-10-19 Juergen Vigna <jug@sad.it>
12475 * src/support/lyxstring.C (lyxstring): we permit to have a null
12476 pointer as assignment value and just don't assign it.
12478 * src/vspace.C (nextToken): corrected this function substituting
12479 find_first(_not)_of with find_last_of.
12481 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12482 (TableOptCloseCB) (TableSpeCloseCB):
12483 inserted fl_set_focus call for problem with fl_hide_form() in
12486 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12488 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12491 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12493 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12494 LyXLex::next() and not eatline() to get its argument.
12496 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12498 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12499 instead, use fstreams for io of the depfile, removed unneeded
12500 functions and variables.
12502 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12503 vector instead, removed all functions and variables that is not in
12506 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12508 * src/buffer.C (insertErrors): use new interface to TeXError
12510 * Makefile.am (rpmdist): added a rpmdist target
12512 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12513 per Kayvan's instructions.
12515 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12517 * src/Makefile.am: add a definition for localedir, so that locales
12518 are found after installation (Kayvan)
12520 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12522 * development/.cvsignore: new file.
12524 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12526 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12527 C++ compiler provides wrappers for C headers and use our alternate
12530 * configure.in: use LYX_CXX_CHEADERS.
12532 * src/cheader/: new directory, populated with cname headers from
12533 libstdc++-2.8.1. They are a bit old, but probably good enough for
12534 what we want (support compilers who lack them).
12536 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12537 from includes. It turns out is was stupid.
12539 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12541 * lib/Makefile.am (install-data-local): forgot a ';'
12542 (install-data-local): forgot a '\'
12543 (libinstalldirs): needed after all. reintroduced.
12545 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12547 * configure.in (AC_OUTPUT): added lyx.spec
12549 * development/lyx.spec: removed file
12551 * development/lyx.spec.in: new file
12553 * po/*.po: merged with lyx.pot becuase of make distcheck
12555 * lib/Makefile.am (dist-hook): added dist-hook so that
12556 documentation files will be included when doing a make
12557 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12558 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12560 more: tried to make install do the right thing, exclude CVS dirs
12563 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12564 Path would fit in more nicely.
12566 * all files that used to use pathstack: uses now Path instead.
12567 This change was a lot easier than expected.
12569 * src/support/path.h: new file
12571 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12573 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12575 * src/support/lyxstring.C (getline): Default arg was given for
12578 * Configure.cmd: removed file
12580 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12582 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12583 streams classes and types, add the proper 'using' statements when
12584 MODERN_STL is defined.
12586 * src/debug.h: move the << operator definition after the inclusion
12589 * src/support/filetools.C: include "LAssert.h", which is needed
12592 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12595 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12596 include "debug.h" to define a proper ostream.
12598 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12600 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12601 method to the SystemCall class which can kill a process, but it's
12602 not fully implemented yet.
12604 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12606 * src/support/FileInfo.h: Better documentation
12608 * src/lyxfunc.C: Added support for buffer-export html
12610 * src/menus.C: Added Export->As HTML...
12612 * lib/bind/*.bind: Added short-cut for buffer-export html
12614 * src/lyxrc.*: Added support for new \tth_command
12616 * lib/lyxrc.example: Added stuff for new \tth_command
12618 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12620 * lib/Makefile.am (IMAGES): removed images/README
12621 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12622 installes in correct place. Check permisions is installed
12625 * src/LaTeX.C: some no-op changes moved declaration of some
12628 * src/LaTeX.h (LATEX_H): changed include guard name
12630 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12632 * lib/reLyX/Makefile.am: install noweb2lyx.
12634 * lib/Makefile.am: install configure.
12636 * lib/reLyX/configure.in: declare a config aux dir; set package
12637 name to lyx (not sure what the best solution is); generate noweb2lyx.
12639 * lib/layouts/egs.layout: fix the bibliography layout.
12641 1999-10-08 Jürgen Vigna <jug@sad.it>
12643 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12644 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12645 it returned without continuing to search the path.
12647 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12649 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12650 also fixes a bug. It is not allowed to do tricks with std::strings
12651 like: string a("hei"); &a[e]; this will not give what you
12652 think... Any reason for the complexity in this func?
12654 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12656 * Updated README and INSTALL a bit, mostly to check that my
12657 CVS rights are correctly set up.
12659 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12661 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12662 does not allow '\0' chars but lyxstring and std::string does.
12664 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12666 * autogen.sh (AUTOCONF): let the autogen script create the
12667 POTFILES.in file too. POTFILES.in should perhaps now not be
12668 included in the cvs module.
12670 * some more files changed to use C++ includes instead of C ones.
12672 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12674 (Reread): added tostr to nlink. buggy output otherwise.
12675 (Reread): added a string() around szMode when assigning to Buffer,
12676 without this I got a log of garbled info strings.
12678 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12681 * I have added several ostream & operator<<(ostream &, some_type)
12682 functions. This has been done to avoid casting and warnings when
12683 outputting enums to lyxerr. This as thus eliminated a lot of
12684 explicit casts and has made the code clearer. Among the enums
12685 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12686 mathed enums, some font enum the Debug::type enum.
12688 * src/support/lyxstring.h (clear): missing method. equivalent of
12691 * all files that contained "stderr": rewrote constructs that used
12692 stderr to use lyxerr instead. (except bmtable)
12694 * src/support/DebugStream.h (level): and the passed t with
12695 Debug::ANY to avoid spurious bits set.
12697 * src/debug.h (Debug::type value): made it accept strings of the
12698 type INFO,INIT,KEY.
12700 * configure.in (Check for programs): Added a check for kpsewhich,
12701 the latex generation will use this later to better the dicovery of
12704 * src/BufferView.C (create_view): we don't need to cast this to
12705 (void*) that is done automatically.
12706 (WorkAreaButtonPress): removed some dead code.
12708 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12710 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12711 is not overwritten when translated (David Sua'rez de Lis).
12713 * lib/CREDITS: Added David Sua'rez de Lis
12715 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12717 * src/bufferparams.C (BufferParams): default input encoding is now
12720 * acinclude.m4 (cross_compiling): comment out macro
12721 LYX_GXX_STRENGTH_REDUCE.
12723 * acconfig.h: make sure that const is not defined (to empty) when
12724 we are compiling C++. Remove commented out code using SIZEOF_xx
12727 * configure.in : move the test for const and inline as late as
12728 possible so that these C tests do not interefere with C++ ones.
12729 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12730 has not been proven.
12732 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12734 * src/table.C (getDocBookAlign): remove bad default value for
12735 isColumn parameter.
12737 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12739 (ShowFileMenu2): ditto.
12741 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12742 of files to ignore.
12744 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12746 * Most files: finished the change from the old error code to use
12747 DebugStream for all lyxerr debugging. Only minor changes remain
12748 (e.g. the setting of debug levels using strings instead of number)
12750 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12752 * src/layout.C (Add): Changed to use compare_no_case instead of
12755 * src/FontInfo.C: changed loop variable type too string::size_type.
12757 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12759 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12760 set ETAGS_ARGS to --c++
12762 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12764 * src/table.C (DocBookEndOfCell): commented out two unused variables
12766 * src/paragraph.C: commented out four unused variables.
12768 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12769 insed a if clause with type string::size_type.
12771 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12774 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12776 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12777 variable, also changed loop to go from 0 to lenght + 1, instead of
12778 -1 to length. This should be correct.
12780 * src/LaTeX.C (scanError): use string::size_type as loop variable
12783 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12784 (l.896) since y_tmp and row was not used anyway.
12786 * src/insets/insetref.C (escape): use string::size_type as loop
12789 * src/insets/insetquotes.C (Width): use string::size_type as loop
12791 (Draw): use string::size_type as loop variable type.
12793 * src/insets/insetlatexaccent.C (checkContents): use
12794 string::size_type as loop variable type.
12796 * src/insets/insetlabel.C (escape): use string::size_type as loop
12799 * src/insets/insetinfo.C: added an extern for current_view.
12801 * src/insets/insetcommand.C (scanCommand): use string::size_type
12802 as loop variable type.
12804 * most files: removed the RCS tags. With them we had to recompile
12805 a lot of files after a simple cvs commit. Also we have never used
12806 them for anything meaningful.
12808 * most files: tags-query-replace NULL 0. As adviced several plases
12809 we now use "0" instead of "NULL" in our code.
12811 * src/support/filetools.C (SpaceLess): use string::size_type as
12812 loop variable type.
12814 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12816 * src/paragraph.C: fixed up some more string stuff.
12818 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12820 * src/support/filetools.h: make modestr a std::string.
12822 * src/filetools.C (GetEnv): made ch really const.
12824 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12825 made code that used these use max/min from <algorithm> instead.
12827 * changed several c library include files to their equivalent c++
12828 library include files. All is not changed yet.
12830 * created a support subdir in src, put lyxstring and lstrings
12831 there + the extra files atexit, fileblock, strerror. Created
12832 Makefile.am. edited configure.in and src/Makefile.am to use this
12833 new subdir. More files moved to support.
12835 * imported som of the functions from repository lyx, filetools
12837 * ran tags-query-replace on LString -> string, corrected the bogus
12838 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12839 is still some errors in there. This is errors where too much or
12840 too litle get deleted from strings (string::erase, string::substr,
12841 string::replace), there can also be some off by one errors, or
12842 just plain wrong use of functions from lstrings. Viewing of quotes
12845 * LyX is now running fairly well with string, but there are
12846 certainly some bugs yet (see above) also string is quite different
12847 from LString among others in that it does not allow null pointers
12848 passed in and will abort if it gets any.
12850 * Added the revtex4 files I forgot when setting up the repository.
12852 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12854 * All over: Tried to clean everything up so that only the files
12855 that we really need are included in the cvs repository.
12856 * Switched to use automake.
12857 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12858 * Install has not been checked.
12860 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12862 * po/pt.po: Three errors:
12863 l.533 and l.538 format specification error
12864 l. 402 duplicate entry, I just deleted it.