1 2000-10-02 Allan Rae <rae@lyx.org>
3 * boost/.cvsignore: ignore Makefile as well
5 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
6 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
8 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
9 Left this one out by accident.
11 * src/frontends/xforms/FormBase.h (restore): default to calling
12 update() since that will restore the original/currently-applied values.
13 Any input() triggered error messages will require the derived classes
14 to redefine restore().
16 * src/frontends/xforms/FormDocument.C: initialize a few variables to
17 avoid a segfault. combo_doc_class is the main concern.
19 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
21 * Simplify build-listerrors in view of GUI-less export ability!
23 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
25 * src/lyx_main.C (easyParse): Disable gui when exporting
27 * src/insets/figinset.C:
31 * src/tabular.C: Changes to allow no-gui.
33 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
35 * src/support/utility.hpp: removed file
36 * src/support/block.h: removed file
38 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
41 * src/mathed/formula.C: add support/lyxlib.h
42 * src/mathed/formulamacro.C: ditto
44 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
45 * src/lyxparagraph.h: ditto
47 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
48 * src/frontends/Makefile.am (INCLUDES): ditto
49 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
50 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
51 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
52 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
53 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
54 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
56 * src/BufferView.h: use boost/utility.hpp
59 * src/LyXAction.h: ditto
60 * src/LyXView.h: ditto
61 * src/bufferlist.h: ditto
62 * src/lastfiles.h: ditto
64 * src/lyx_gui.h: ditto
65 * src/lyx_main.h: ditto
68 * src/frontends/ButtonPolicies.h: ditto
69 * src/frontends/Dialogs.h: ditto
70 * src/frontends/xforms/FormBase.h: ditto
71 * src/frontends/xforms/FormGraphics.h: ditto
72 * src/frontends/xforms/FormParagraph.h: ditto
73 * src/frontends/xforms/FormTabular.h: ditto
74 * src/graphics/GraphicsCache.h: ditto
75 * src/graphics/Renderer.h: ditto
76 * src/insets/ExternalTemplate.h: ditto
77 * src/insets/insetcommand.h: ditto
78 * src/support/path.h: ditto
80 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
81 and introduce clause for 2.97.
83 * boost/libs/README: new file
85 * boost/boost/utility.hpp: new file
87 * boost/boost/config.hpp: new file
89 * boost/boost/array.hpp: new file
91 * boost/Makefile.am: new file
93 * boost/.cvsignore: new file
95 * configure.in (AC_OUTPUT): add boost/Makefile
97 * Makefile.am (SUBDIRS): add boost
99 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
101 * src/support/lstrings.C (suffixIs): Fixed.
103 2000-10-01 Allan Rae <rae@lyx.org>
105 * src/PrinterParams.h: moved things around to avoid the "can't
106 inline call" warning.
108 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
109 into doc++ documentation.
111 * src/frontends/xforms/FormCommand.[Ch]: support button policy
113 * src/frontends/xforms/FormRef.C: make use of button controller
114 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
115 cleaned up button controller usage.
116 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
117 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
118 use the button controller
120 * src/frontends/xforms/forms/*.fd: and associated generated files
121 updated to reflect changes to FormBase. Some other FormXxxx files
122 also got minor updates to reflect changes to FormBase.
124 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
125 (hide): made virtual.
126 (input): return a bool. true == valid input
127 (RestoreCB, restore): new
128 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
129 Changes to allow derived dialogs to use a ButtonController and
130 make sense when doing so: OK button calls ok() and so on.
132 * src/frontends/xforms/ButtonController.h (class ButtonController):
133 Switch from template implementation to taking Policy parameter.
134 Allows FormBase to provide a ButtonController for any dialog.
136 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
137 Probably should rename connect and disconnect.
138 (apply): use the radio button groups
139 (form): needed by FormBase
140 (build): setup the radio button groups
142 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
144 * several files: type canges to reduce the number of warnings and
145 to unify type hangling a bit. Still much to do.
147 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
149 * lib/images/*: rename a bunch of icons to match Dekel converter
152 * src/buffer.C (SimpleLinuxDocOnePar): add a const qualifier to
155 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
157 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
159 * sigc++/handle.h: ditto for class Handle.
161 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
163 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
165 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
167 * src/intl.C (InitKeyMapper): Correct the value of n due to the
168 removal of the "default" language.
170 * src/combox.h (getline): Check that sel > 0
172 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
174 * lib/examples/docbook_example.lyx
175 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
177 * lib/layouts/docbook-book.layout: new docbook book layout.
179 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
181 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
183 * src/insets/figinset.C (DocBook):fixed small typo.
185 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
187 * src/insets/insetinclude.h: string include_label doesn't need to be
190 2000-09-29 Allan Rae <rae@lyx.org>
192 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
193 Allow derived type to control connection and disconnection from signals
194 of its choice if desired.
196 2000-09-28 Juergen Vigna <jug@sad.it>
198 * src/insets/insettabular.C (update): fixed cursor setting when
199 the_locking_inset changed.
200 (draw): made this a bit cleaner.
201 (InsetButtonPress): fixed!
203 * various files: added LyXText Parameter to fitCursor call.
205 * src/BufferView.C (fitCursor): added LyXText parameter.
207 * src/insets/insettabular.C (draw): small draw fix.
209 * src/tabular.C: right setting of left/right celllines.
211 * src/tabular.[Ch]: fixed various types in funcions and structures.
212 * src/insets/insettabular.C: ditto
213 * src/frontends/xforms/FormTabular.C: ditto
215 2000-09-28 Allan Rae <rae@lyx.org>
217 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
218 that the #ifdef's had been applied to part of what should have been
219 a complete condition. It's possible there are other tests that
220 were specific to tables that are also wrong now that InsetTabular is
221 being used. Now we need to fix the output of '\n' after a table in a
222 float for the same reason as the original condition:
223 "don't insert this if we would be adding it before or after a table
224 in a float. This little trick is needed in order to allow use of
225 tables in \subfigures or \subtables."
226 Juergen can you check this?
228 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
230 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
231 outputed to the ostream.
233 * several files: fixed types based on warnings from cxx
235 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
237 * src/frontends/kde/Makefile.am: fix rule for
238 formindexdialogdata_moc.C
240 * src/.cvsignore: add ext_l10n.h to ignore
242 * acconfig.h: stop messing with __STRICT_ANSI__
243 * config/gnome.m4: remove option to set -ansi
244 * config/kde.m4: remove option to set -ansi
245 * config/lyxinclude.m4: don't set -ansi
247 2000-09-27 Juergen Vigna <jug@sad.it>
249 * various files: remove "default" language check.
251 * src/insets/insetquotes.C: removed use of current_view.
253 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
254 the one should have red ears by now!
256 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
257 in more then one paragraph. Fixed cursor-movement/selection.
259 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
260 paragraphs inside a text inset.
262 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
263 text-inset if this owner is an inset.
265 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
267 * src/Bullet.h: changed type of font, character and size to int
269 * src/buffer.C (asciiParagraph): remove actcell and fname1.
271 * src/insets/inseturl.[Ch]:
272 * src/insets/insetref.[Ch]:
273 * src/insets/insetlabel.[Ch]: add linelen to Ascii
275 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
277 * src/buffer.C (readFile): block-if statement rearranged to minimise
278 bloat. Patch does not reverse Jean-Marc's change ;-)
280 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
281 Class rewritten to store pointers to hide/update signals directly,
282 rather than Dialogs *. Also defined an enum to ease use. All xforms
283 forms can now be derived from this class.
285 * src/frontends/xforms/FormCommand.[Ch]
286 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
288 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
291 * src/frontends/xforms/forms/form_citation.fd
292 * src/frontends/xforms/forms/form_copyright.fd
293 * src/frontends/xforms/forms/form_error.fd
294 * src/frontends/xforms/forms/form_index.fd
295 * src/frontends/xforms/forms/form_ref.fd
296 * src/frontends/xforms/forms/form_toc.fd
297 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
299 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
301 * src/insets/insetfoot.C: removed redundent using directive.
303 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
305 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
306 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
308 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
309 created in the constructors in different groups. Then set() just
310 have to show the groups as needed. This fixes the redraw problems
311 (and is how the old menu code worked).
313 * src/support/lyxlib.h: declare the methods as static when we do
316 2000-09-26 Juergen Vigna <jug@sad.it>
318 * src/buffer.C (asciiParagraph): new function.
319 (writeFileAscii): new function with parameter ostream.
320 (writeFileAscii): use now asciiParagraph.
322 * various inset files: added the linelen parameter to the Ascii-func.
324 * src/tabular.C (Write): fixed error in writing file introduced by
325 the last changes from Lars.
327 * lib/bind/menus.bind: removed not supported functions.
329 * src/insets/insettext.C (Ascii): implemented this function.
331 * src/insets/lyxinset.h (Ascii): added linelen parameter.
333 * src/tabular.C (write_attribute[int,string,bool]): new functions.
334 (Write): use of the write_attribute functions.
336 * src/bufferlist.C (close): fixed reasking question!
338 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
340 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
341 new files use the everwhere possible.
344 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
345 src/log_form.C src/lyx.C:
348 * src/buffer.C (runLaTeX): remove func
350 * src/PaperLayout.C: removed file
351 * src/ParagraphExtra.C: likewise
352 * src/bullet_forms.C: likewise
353 * src/bullet_forms.h: likewise
354 * src/bullet_forms_cb.C: likewise
356 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
357 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
360 * several files: remove all traces of the old fd_form_paragraph,
361 and functions belonging to that.
363 * several files: remove all traces of the old fd_form_document,
364 and functions belonging to that.
366 * several files: constify local variables were possible.
368 * several files: remove all code that was dead when NEW_EXPORT was
371 * several files: removed string::c_str in as many places as
374 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
375 (e): be a bit more outspoken when patching
376 (updatesrc): only move files if changed.
378 * forms/layout_forms.h.patch: regenerated
380 * forms/layout_forms.fd: remove form_document and form_paragraph
381 and form_quotes and form_paper and form_table_options and
384 * forms/form1.fd: remove form_table
386 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
387 the fdui->... rewrite. Update some comments to xforms 0.88
389 * forms/bullet_forms.C.patch: removed file
390 * forms/bullet_forms.fd: likewise
391 * forms/bullet_forms.h.patch: likewise
393 * development/Code_rules/Rules: added a section on switch
394 statements. Updated some comment to xforms 0.88.
396 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
398 * src/buffer.C (readFile): make sure that the whole version number
399 is read after \lyxformat (even when it contains a comma)
401 * lib/ui/default.ui: change shortcut of math menu to M-a.
403 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
405 * src/vspace.C (nextToken): use isStrDbl() to check for proper
408 * src/LyXView.C (updateWindowTitle): show the full files name in
409 window title, limited to 30 characters.
411 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
412 When a number of characters has been given, we should not assume
413 that the string is 0-terminated.
415 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
416 calls (fixes some memory leaks)
418 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
419 trans member on exit.
421 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
423 * src/converter.C (GetReachable): fix typo.
425 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
426 understand ',' instead of '.'.
427 (GetInteger): rewrite to use strToInt().
429 2000-09-26 Juergen Vigna <jug@sad.it>
431 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
432 better visibility and error-message on wrong VSpace input.
434 * src/language.C (initL): added english again.
436 2000-09-25 Juergen Vigna <jug@sad.it>
438 * src/frontends/kde/Dialogs.C (Dialogs):
439 * src/frontends/gnome/Dialogs.C (Dialogs):
440 * src/frontends/kde/Makefile.am:
441 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
443 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
445 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
447 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
449 * src/frontends/xforms/FormParagraph.C:
450 * src/frontends/xforms/FormParagraph.h:
451 * src/frontends/xforms/form_paragraph.C:
452 * src/frontends/xforms/form_paragraph.h:
453 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
456 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
458 * src/tabular.C (OldFormatRead): forgot to delete the temporary
459 Paragraph-Data after use.
461 * src/insets/insettext.C (LocalDispatch): don't set the layout on
462 non breakable paragraphs.
464 2000-09-25 Garst R. Reese <reese@isn.net>
466 * src/language.C (initL): added missing language_country codes.
468 2000-09-25 Juergen Vigna <jug@sad.it>
470 * src/insets/insettext.C (InsetText):
471 (deleteLyXText): remove the not released LyXText structure!
473 2000-09-24 Marko Vendelin <markov@ioc.ee>
475 * src/frontends/gnome/mainapp.C
476 * src/frontends/gnome/mainapp.h: added support for keyboard
479 * src/frontends/gnome/FormCitation.C
480 * src/frontends/gnome/FormCitation.h
481 * src/frontends/gnome/Makefile.am
482 * src/frontends/gnome/pixbutton.h: completed the rewrite of
483 FormCitation to use "action area" in mainapp window
485 * src/frontends/gnome/Menubar_pimpl.C
486 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
489 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
491 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
492 width/descent/ascent values if name is empty.
493 (mathed_string_height): Use std::max.
495 2000-09-25 Allan Rae <rae@lyx.org>
497 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
498 segfault. This will be completely redesigned soon.
500 * sigc++: updated libsigc++. Fixes struct timespec bug.
502 * development/tools/makeLyXsigc.sh: .cvsignore addition
504 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
506 * several files: removed almost all traces of the old table
509 * src/TableLayout.C: removed file
511 2000-09-22 Juergen Vigna <jug@sad.it>
513 * src/frontends/kde/Dialogs.C: added credits forms.
515 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
517 * src/frontends/gnome/Dialogs.C: added some forms.
519 * src/spellchecker.C (init_spell_checker): set language in pspell code
520 (RunSpellChecker): some modifications for setting language string.
522 * src/language.[Ch]: added language_country code.
524 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
526 * src/frontends/Dialogs.h: added new signal showError.
527 Rearranged existing signals in some sort of alphabetical order.
529 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
530 FormError.[Ch], form_error.[Ch]
531 * src/frontends/xforms/forms/makefile: added new file form_error.fd
532 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
534 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
535 dialogs. I think that this can be used as the base to all these
538 * src/frontends/xforms/FormError.[Ch]
539 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
540 implementation of InsetError dialog.
542 * src/insets/inseterror.[Ch]: rendered GUI-independent.
544 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
545 * src/frontends/kde/Makefile.am: ditto
547 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
549 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
550 macrobf. This fixes a bug of invisible text.
552 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
554 * lib/doc/LaTeXConfig.lyx.in: updated.
556 * src/language.C (initL): remove language "francais" and change a
557 bit the names of the two other french variations.
559 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
560 string that may not be 0-terminated.
562 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
564 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
566 2000-09-20 Marko Vendelin <markov@ioc.ee>
568 * src/frontends/gnome/FormCitation.C
569 * src/frontends/gnome/FormIndex.C
570 * src/frontends/gnome/FormToc.C
571 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
572 the variable initialization to shut up the warnings
574 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
576 * src/table.[Ch]: deleted files
578 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
581 2000-09-18 Juergen Vigna <jug@sad.it>
583 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
584 problems with selection. Inserted new LFUN_PASTESELECTION.
585 (InsetButtonPress): inserted handling of middle mouse-button paste.
587 * src/spellchecker.C: changed word to word.c_str().
589 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
591 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
592 included in the ``make dist'' tarball.
594 2000-09-15 Juergen Vigna <jug@sad.it>
596 * src/CutAndPaste.C (cutSelection): small fix return the right
597 end position after cut inside one paragraph only.
599 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
600 we are locked as otherwise we don't have a valid cursor position!
602 * src/insets/figinset.C (draw): small bugfix but why is this needed???
604 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
606 * src/frontends/kde/FormRef.C: added using directive.
607 * src/frontends/kde/FormToc.C: ditto
609 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
611 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
613 2000-09-19 Marko Vendelin <markov@ioc.ee>
615 * src/frontends/gnome/Menubar_pimpl.C
616 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
617 Toc, ViewFormats, UpdateFormats, and ExportFormats.
619 * src/frontends/gnome/mainapp.C
620 * src/frontends/gnome/mainapp.h: support for menu update used
623 * src/frontends/gnome/mainapp.C
624 * src/frontends/gnome/mainapp.h: support for "action" area in the
625 main window. This area is used by small simple dialogs, such as
628 * src/frontends/gnome/FormIndex.C
629 * src/frontends/gnome/FormIndex.h
630 * src/frontends/gnome/FormUrl.C
631 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
634 * src/frontends/gnome/FormCitation.C
635 * src/frontends/gnome/FormCitation.h: rewrite to use main window
636 action area. Only "Insert new citation" is implemented.
638 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
640 * src/buffer.C (Dispatch): fix call to Dispatch
641 * src/insets/insetref.C (Edit): likewise
642 * src/insets/insetparent.C (Edit): likewise
643 * src/insets/insetinclude.C (include_cb): likewise
644 * src/frontends/xforms/FormUrl.C (apply): likewise
645 * src/frontends/xforms/FormToc.C (apply): likewise
646 * src/frontends/xforms/FormRef.C (apply): likewise
647 * src/frontends/xforms/FormIndex.C (apply): likewise
648 * src/frontends/xforms/FormCitation.C (apply): likewise
649 * src/lyxserver.C (callback): likewise
650 * src/lyxfunc.C (processKeySym): likewise
653 * src/lyx_cb.C (LayoutsCB): likewise
655 * Makefile.am (sourcedoc): small change
657 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
659 * src/main.C (main): Don't make an empty GUIRunTime object. all
660 methods are static. constify a bit remove unneded using + headers.
662 * src/tabular.C: some more const to local vars move some loop vars
664 * src/spellchecker.C: added some c_str after some word for pspell
666 * src/frontends/GUIRunTime.h: add new static method setDefaults
667 * src/frontends/xforms/GUIRunTime.C (setDefaults):
668 * src/frontends/kde/GUIRunTime.C (setDefaults):
669 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
671 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
672 with strnew in arg, use correct emptystring when calling SetName.
674 * several files: remove all commented code with relation to
675 HAVE_SSTREAM beeing false. We now only support stringstream and
678 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
680 * src/lyxfunc.C: construct correctly the automatic new file
683 * src/text2.C (IsStringInText): change type of variable i to shut
686 * src/support/sstream.h: do not use namespaces if the compiler
687 does not support them.
689 2000-09-15 Marko Vendelin <markov@ioc.ee>
690 * src/frontends/gnome/FormCitation.C
691 * src/frontends/gnome/FormCitation.h
692 * src/frontends/gnome/diainsertcitation_interface.c
693 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
694 regexp support to FormCitation [Gnome].
696 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
699 * configure.in: remove unused KDE/GTKGUI define
701 * src/frontends/kde/FormRef.C
702 * src/frontends/kde/FormRef.h
703 * src/frontends/kde/formrefdialog.C
704 * src/frontends/kde/formrefdialog.h: double click will
705 go to reference, now it is possible to change a cross-ref
708 * src/frontends/kde/FormToc.C
709 * src/frontends/kde/FormToc.h
710 * src/frontends/kde/formtocdialog.C
711 * src/frontends/kde/formtocdialog.h: add a depth
714 * src/frontends/kde/Makefile.am: add QtLyXView.h
717 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
719 * src/frontends/kde/FormCitation.h: added some using directives.
721 * src/frontends/kde/FormToc.h: corrected definition of doTree.
723 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
726 * src/mathed/math_defs.h: redefine SetAlign to use string rather
729 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
731 * src/buffer.C (pop_tag): revert for the second time a change by
732 Lars, who seems to really hate having non-local loop variables :)
734 * src/Lsstream.h: add "using" statements.
736 * src/support/copy.C (copy): add a bunch of std:: qualifiers
737 * src/buffer.C (writeFile): ditto
739 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
741 * src/buffer.C (writeFile): try to fix the locale modified format
742 number to always be as we want it.
744 * src/WorkArea.C (work_area_handler): try to workaround the bugs
745 in XForms 0.89. C-space is now working again.
747 * src/Lsstream.h src/support/sstream.h: new files.
749 * also commented out all cases where strstream were used.
751 * src/Bullet.h (c_str): remove method.
753 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
755 * a lot of files: get rid of "char const *" and "char *" is as
756 many places as possible. We only want to use them in interaction
757 with system of other libraries, not inside lyx.
759 * a lot of files: return const object is not of pod type. This
760 helps ensure that temporary objects is not modified. And fits well
761 with "programming by contract".
763 * configure.in: check for the locale header too
765 * Makefile.am (sourcedoc): new tag for generation of doc++
768 2000-09-14 Juergen Vigna <jug@sad.it>
770 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
771 callback to check which combo called it and do the right action.
773 * src/combox.C (combo_cb): added combo * to the callbacks.
774 (Hide): moved call of callback after Ungrab of the pointer.
776 * src/intl.h: removed LCombo2 function.
778 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
779 function as this can now be handled in one function.
781 * src/combox.h: added Combox * to callback prototype.
783 * src/frontends/xforms/Toolbar_pimpl.C:
784 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
786 2000-09-14 Garst Reese <reese@isn.net>
788 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
789 moved usepackage{xxx}'s to beginning of file. Changed left margin
790 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
791 underlining from title. Thanks to John Culleton for useful suggestions.
793 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
795 * src/lyxlex_pimpl.C (setFile): change error message to debug
798 2000-09-13 Juergen Vigna <jug@sad.it>
800 * src/frontends/xforms/FormDocument.C: implemented choice_class
801 as combox and give callback to combo_language so OK/Apply is activated
804 * src/bufferlist.C (newFile): small fix so already named files
805 (via an open call) are not requested to be named again on the
808 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
810 * src/frontends/kde/Makefile.am
811 * src/frontends/kde/FormRef.C
812 * src/frontends/kde/FormRef.h
813 * src/frontends/kde/formrefdialog.C
814 * src/frontends/kde/formrefdialog.h: implement
817 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
819 * src/frontends/kde/formtocdialog.C
820 * src/frontends/kde/formtocdialog.h
821 * src/frontends/kde/FormToc.C
822 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
824 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
826 * src/frontends/kde/FormCitation.C: fix thinko
827 where we didn't always display the reference text
830 * src/frontends/kde/formurldialog.C
831 * src/frontends/kde/formurldialog.h
832 * src/frontends/kde/FormUrl.C
833 * src/frontends/kde/FormUrl.h: minor cleanups
835 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
837 * src/frontends/kde/Makefile.am
838 * src/frontends/kde/FormToc.C
839 * src/frontends/kde/FormToc.h
840 * src/frontends/kde/FormCitation.C
841 * src/frontends/kde/FormCitation.h
842 * src/frontends/kde/FormIndex.C
843 * src/frontends/kde/FormIndex.h
844 * src/frontends/kde/formtocdialog.C
845 * src/frontends/kde/formtocdialog.h
846 * src/frontends/kde/formcitationdialog.C
847 * src/frontends/kde/formcitationdialog.h
848 * src/frontends/kde/formindexdialog.C
849 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
851 2000-09-12 Juergen Vigna <jug@sad.it>
853 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
856 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
858 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
861 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
863 * src/converter.C (Add, Convert): Added support for converter flags:
864 needaux, resultdir, resultfile.
865 (Convert): Added new parameter view_file.
866 (dvips_options): Fixed letter paper option.
868 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
869 (Export, GetExportableFormats, GetViewableFormats): Added support
872 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
874 (easyParse): Fixed to work with new export code.
876 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
879 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
881 * lib/bind/*.bind: Replaced
882 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
883 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
885 2000-09-11 Juergen Vigna <jug@sad.it>
887 * src/lyx_gui.C (runTime): uses global guiruntime variable.
889 * src/main.C (main): now GUII defines global guiruntime!
891 * src/frontends/gnome/GUIRunTime.C (initApplication):
892 * src/frontends/kde/GUIRunTime.C (initApplication):
893 * src/frontends/xforms/GUIRunTime.C (initApplication):
894 * src/frontends/GUIRunTime.h: added new function initApplication.
896 * src/spellchecker.C (sc_accept_word): change to add_to_session.
898 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
900 2000-09-08 Juergen Vigna <jug@sad.it>
902 * src/lyx_gui.C (create_forms): don't display the "default" entry as
903 we have already "Reset".
905 * src/language.C (initL): inserted "default" language and made this
906 THE default language (and not american!)
908 * src/paragraph.C: inserted handling of "default" language!
910 * src/lyxfont.C: ditto
914 * src/paragraph.C: output the \\par only if we have a following
915 paragraph otherwise it's not needed.
917 2000-09-05 Juergen Vigna <jug@sad.it>
919 * config/pspell.m4: added entry to lyx-flags
921 * src/spellchecker.C: modified version from Kevin for using pspell
923 2000-09-01 Marko Vendelin <markov@ioc.ee>
924 * src/frontends/gnome/Makefile.am
925 * src/frontends/gnome/FormCitation.C
926 * src/frontends/gnome/FormCitation.h
927 * src/frontends/gnome/diainsertcitation_callbacks.c
928 * src/frontends/gnome/diainsertcitation_callbacks.h
929 * src/frontends/gnome/diainsertcitation_interface.c
930 * src/frontends/gnome/diainsertcitation_interface.h
931 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
932 dialog for Gnome frontend
934 * src/main.C: Gnome libraries require keeping application name
935 and its version as strings
937 * src/frontends/gnome/mainapp.C: Change the name of the main window
938 from GnomeLyX to PACKAGE
940 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
942 * src/frontends/Liason.C: add "using: declaration.
944 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
946 * src/mathed/math_macro.C (Metrics): Set the size of the template
948 * src/mathed/formulamacro.C (Latex): Fixed the returned value
950 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
952 * src/converter.C (add_options): New function.
953 (SetViewer): Change $$FName into '$$FName'.
954 (View): Add options when running xdvi
955 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
956 (Convert): The 3rd parameter is now the desired filename. Converts
957 calls to lyx::rename if necessary.
958 Add options when running dvips.
959 (dvi_papersize,dvips_options): New methods.
961 * src/exporter.C (Export): Use getLatexName() instead of fileName().
963 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
964 using a call to Converter::dvips_options.
965 Fixed to work with nex export code.
968 * src/support/rename.C: New files
970 * src/support/syscall.h
971 * src/support/syscall.C: Added Starttype SystemDontWait.
973 * lib/ui/default.ui: Changed to work with new export code
975 * lib/configure.m4: Changed to work with new export code
977 * src/encoding.C: Changed latex name for iso8859_7 encoding.
979 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
981 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
982 so that code compiles with DEC cxx.
984 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
985 to work correctly! Also now supports the additional elements
988 2000-09-01 Allan Rae <rae@lyx.org>
990 * src/frontends/ButtonPolicies.C: renamed all the references to
991 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
993 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
994 since it's a const not a type.
996 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
998 2000-08-31 Juergen Vigna <jug@sad.it>
1000 * src/insets/figinset.C: Various changes to look if the filename has
1001 an extension and if not add it for inline previewing.
1003 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1005 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1006 make buttonStatus and isReadOnly be const methods. (also reflect
1007 this in derived classes.)
1009 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1010 (nextState): change to be static inline, pass the StateMachine as
1012 (PreferencesPolicy): remove casts
1013 (OkCancelPolicy): remvoe casts
1014 (OkCancelReadOnlyPolicy): remove casts
1015 (NoRepeatedApplyReadOnlyPolicy): remove casts
1016 (OkApplyCancelReadOnlyPolicy): remove casts
1017 (OkApplyCancelPolicy): remove casts
1018 (NoRepeatedApplyPolicy): remove casts
1020 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1022 * src/converter.C: added some using directives
1024 * src/frontends/ButtonPolicies.C: changes to overcome
1025 "need lvalue" error with DEC c++
1027 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1028 to WMHideCB for DEC c++
1030 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1032 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1033 to BulletBMTableCB for DEC c++
1035 2000-08-31 Allan Rae <rae@lyx.org>
1037 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1038 character dialog separately from old document dialogs combo_language.
1041 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1043 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1044 Removed LFUN_REF_CREATE.
1046 * src/MenuBackend.C: Added new tags: toc and references
1048 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1049 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1051 (add_toc, add_references): New methods.
1052 (create_submenu): Handle correctly the case when there is a
1053 seperator after optional menu items.
1055 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1056 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1057 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1059 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1061 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1063 * src/converter.[Ch]: New file for converting between different
1066 * src/export.[Ch]: New file for exporting a LyX file to different
1069 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1070 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1071 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1072 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1073 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1074 RunDocBook, MenuExport.
1076 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1077 Exporter::Preview methods if NEW_EXPORT is defined.
1079 * src/buffer.C (Dispatch): Use Exporter::Export.
1081 * src/lyxrc.C: Added new tags: \converter and \viewer.
1084 * src/LyXAction.C: Define new lyx-function: buffer-update.
1085 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1086 when NEW_EXPORT is defined.
1088 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1090 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1092 * lib/ui/default.ui: Added submenus "view" and "update" to the
1095 * src/filetools.C (GetExtension): New function.
1097 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1099 2000-08-29 Allan Rae <rae@lyx.org>
1101 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1103 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1104 (EnableDocumentLayout): removed
1105 (DisableDocumentLayout): removed
1106 (build): make use of ButtonController's read-only handling to
1107 de/activate various objects. Replaces both of the above functions.
1109 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1110 (readOnly): was read_only
1111 (refresh): fixed dumb mistakes with read_only_ handling
1113 * src/frontends/xforms/forms/form_document.fd:
1114 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1115 tabbed dialogs so the tabs look more like tabs and so its easier to
1116 work out which is the current tab.
1118 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1119 segfault with form_table
1121 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1123 2000-08-28 Juergen Vigna <jug@sad.it>
1125 * acconfig.h: added USE_PSPELL.
1127 * src/config.h.in: added USE_PSPELL.
1129 * autogen.sh: added pspell.m4
1131 * config/pspell.m4: new file.
1133 * src/spellchecker.C: implemented support for pspell libary.
1135 2000-08-25 Juergen Vigna <jug@sad.it>
1137 * src/LyXAction.C (init): renamed LFUN_TABLE to
1138 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1140 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1142 * src/lyxscreen.h: add force_clear variable and fuction to force
1143 a clear area when redrawing in LyXText.
1145 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1147 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1149 * some whitespace and comment changes.
1151 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1153 * src/buffer.C: up te LYX_FORMAT to 2.17
1155 2000-08-23 Juergen Vigna <jug@sad.it>
1157 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1160 * src/insets/insettabular.C (pasteSelection): delete the insets
1161 LyXText as it is not valid anymore.
1162 (copySelection): new function.
1163 (pasteSelection): new function.
1164 (cutSelection): new function.
1165 (LocalDispatch): implemented cut/copy/paste of cell selections.
1167 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1168 don't have a LyXText.
1170 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1172 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1175 2000-08-22 Juergen Vigna <jug@sad.it>
1177 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1178 ifdef form_table out if NEW_TABULAR.
1180 2000-08-21 Juergen Vigna <jug@sad.it>
1182 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1183 (draw): fixed draw position so that the cursor is positioned in the
1185 (InsetMotionNotify): hide/show cursor so the position is updated.
1186 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1187 using cellstart() function where it should be used.
1189 * src/insets/insettext.C (draw): ditto.
1191 * src/tabular.C: fixed initialization of some missing variables and
1192 made BoxType into an enum.
1194 2000-08-22 Marko Vendelin <markov@ioc.ee>
1195 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1196 stock menu item using action numerical value, not its string
1200 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1202 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1203 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1205 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1207 * src/frontends/xforms/GUIRunTime.C: new file
1209 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1210 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1212 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1214 * src/frontends/kde/GUIRunTime.C: new file
1216 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1217 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1219 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1221 * src/frontends/gnome/GUIRunTime.C: new file
1223 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1226 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1227 small change to documetentation.
1229 * src/frontends/GUIRunTime.C: removed file
1231 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1233 * src/lyxparagraph.h: enable NEW_TABULAR as default
1235 * src/lyxfunc.C (processKeySym): remove some commented code
1237 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1238 NEW_TABULAR around the fd_form_table_options.
1240 * src/lyx_gui.C (runTime): call the static member function as
1241 GUIRunTime::runTime().
1243 2000-08-21 Allan Rae <rae@lyx.org>
1245 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1248 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1250 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1252 2000-08-21 Allan Rae <rae@lyx.org>
1254 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1255 keep Garst happy ;-)
1256 * src/frontends/xforms/FormPreferences.C (build): use setOK
1257 * src/frontends/xforms/FormDocument.C (build): use setOK
1258 (FormDocument): use the appropriate policy.
1260 2000-08-21 Allan Rae <rae@lyx.org>
1262 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1263 automatic [de]activation of arbitrary objects when in a read-only state.
1265 * src/frontends/ButtonPolicies.h: More documentation
1266 (isReadOnly): added to support the above.
1268 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1270 2000-08-18 Juergen Vigna <jug@sad.it>
1272 * src/insets/insettabular.C (getStatus): changed to return func_status.
1274 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1275 display toggle menu entries if they are.
1277 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1278 new document layout now.
1280 * src/lyxfunc.C: ditto
1282 * src/lyx_gui_misc.C: ditto
1284 * src/lyx_gui.C: ditto
1286 * lib/ui/default.ui: removed paper and quotes layout as they are now
1287 all in the document layout tabbed folder.
1289 * src/frontends/xforms/forms/form_document.fd: added Restore
1290 button and callbacks for all inputs for Allan's ButtonPolicy.
1292 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1293 (CheckChoiceClass): added missing params setting on class change.
1294 (UpdateLayoutDocument): added for updating the layout on params.
1295 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1296 (FormDocument): Implemented Allan's ButtonPolicy with the
1299 2000-08-17 Allan Rae <rae@lyx.org>
1301 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1302 so we can at least see the credits again.
1304 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1305 controller calls for the appropriate callbacks. Note that since Ok
1306 calls apply followed by cancel, and apply isn't a valid input for the
1307 APPLIED state, the bc_ calls have to be made in the static callback not
1308 within each of the real callbacks.
1310 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1311 (setOk): renamed from setOkay()
1313 2000-08-17 Juergen Vigna <jug@sad.it>
1315 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1316 in the implementation part.
1317 (composeUIInfo): don't show optional menu-items.
1319 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1321 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1323 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1324 text-state when in a text-inset.
1326 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1328 2000-08-17 Marko Vendelin <markov@ioc.ee>
1329 * src/frontends/gnome/FormIndex.C
1330 * src/frontends/gnome/FormIndex.h
1331 * src/frontends/gnome/FormToc.C
1332 * src/frontends/gnome/FormToc.h
1333 * src/frontends/gnome/dialogs
1334 * src/frontends/gnome/diatoc_callbacks.c
1335 * src/frontends/gnome/diatoc_callbacks.h
1336 * src/frontends/gnome/diainsertindex_callbacks.h
1337 * src/frontends/gnome/diainsertindex_callbacks.c
1338 * src/frontends/gnome/diainsertindex_interface.c
1339 * src/frontends/gnome/diainsertindex_interface.h
1340 * src/frontends/gnome/diatoc_interface.h
1341 * src/frontends/gnome/diatoc_interface.c
1342 * src/frontends/gnome/Makefile.am: Table of Contents and
1343 Insert Index dialogs implementation for Gnome frontend
1345 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1347 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1349 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1352 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1354 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1355 destructor. Don't definde if you don't need it
1356 (processEvents): made static, non-blocking events processing for
1358 (runTime): static method. event loop for xforms
1359 * similar as above for kde and gnome.
1361 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1362 new Pimpl is correct
1363 (runTime): new method calss the real frontends runtime func.
1365 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1367 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1369 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1371 2000-08-16 Juergen Vigna <jug@sad.it>
1373 * src/lyx_gui.C (runTime): added GUII RunTime support.
1375 * src/frontends/Makefile.am:
1376 * src/frontends/GUIRunTime.[Ch]:
1377 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1378 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1379 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1381 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1383 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1384 as this is already set in ${FRONTEND_INCLUDE} if needed.
1386 * configure.in (CPPFLAGS): setting the include dir for the frontend
1387 directory and don't set FRONTEND=xforms for now as this is executed
1390 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1392 * src/frontends/kde/Makefile.am:
1393 * src/frontends/kde/FormUrl.C:
1394 * src/frontends/kde/FormUrl.h:
1395 * src/frontends/kde/formurldialog.h:
1396 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1398 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1400 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1402 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1404 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1407 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1409 * src/WorkArea.C (work_area_handler): more work to get te
1410 FL_KEYBOARD to work with xforms 0.88 too, please test.
1412 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1414 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1416 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1419 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1421 * src/Timeout.h: remove Qt::emit hack.
1423 * several files: changes to allo doc++ compilation
1425 * src/lyxfunc.C (processKeySym): new method
1426 (processKeyEvent): comment out if FL_REVISION < 89
1428 * src/WorkArea.C: change some debugging levels.
1429 (WorkArea): set wantkey to FL_KEY_ALL
1430 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1431 clearer code and the use of compose with XForms 0.89. Change to
1432 use signals instead of calling methods in bufferview directly.
1434 * src/Painter.C: change some debugging levels.
1436 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1439 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1440 (workAreaKeyPress): new method
1442 2000-08-14 Juergen Vigna <jug@sad.it>
1444 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1446 * config/kde.m4: addes some features
1448 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1449 include missing xforms dialogs.
1451 * src/Timeout.h: a hack to be able to compile with qt/kde.
1453 * sigc++/.cvsignore: added acinclude.m4
1455 * lib/.cvsignore: added listerros
1457 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1458 xforms tree as objects are needed for other frontends.
1460 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1461 linking with not yet implemented xforms objects.
1463 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1465 2000-08-14 Baruch Even <baruch.even@writeme.com>
1467 * src/frontends/xforms/FormGraphics.h:
1468 * src/frontends/xforms/FormGraphics.C:
1469 * src/frontends/xforms/RadioButtonGroup.h:
1470 * src/frontends/xforms/RadioButtonGroup.C:
1471 * src/insets/insetgraphics.h:
1472 * src/insets/insetgraphics.C:
1473 * src/insets/insetgraphicsParams.h:
1474 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1475 instead of spaces, and various other indentation issues to make the
1476 sources more consistent.
1478 2000-08-14 Marko Vendelin <markov@ioc.ee>
1480 * src/frontends/gnome/dialogs/diaprint.glade
1481 * src/frontends/gnome/FormPrint.C
1482 * src/frontends/gnome/FormPrint.h
1483 * src/frontends/gnome/diaprint_callbacks.c
1484 * src/frontends/gnome/diaprint_callbacks.h
1485 * src/frontends/gnome/diaprint_interface.c
1486 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1489 * src/frontends/gnome/dialogs/diainserturl.glade
1490 * src/frontends/gnome/FormUrl.C
1491 * src/frontends/gnome/FormUrl.h
1492 * src/frontends/gnome/diainserturl_callbacks.c
1493 * src/frontends/gnome/diainserturl_callbacks.h
1494 * src/frontends/gnome/diainserturl_interface.c
1495 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1496 Gnome implementation
1498 * src/frontends/gnome/Dialogs.C
1499 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1500 all other dialogs. Copy all unimplemented dialogs from Xforms
1503 * src/frontends/gnome/support.c
1504 * src/frontends/gnome/support.h: support files generated by Glade
1508 * config/gnome.m4: Gnome configuration scripts
1510 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1511 configure --help message
1513 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1514 only if there are no events pendling in Gnome/Gtk. This enhances
1515 the performance of menus.
1518 2000-08-14 Allan Rae <rae@lyx.org>
1520 * lib/Makefile.am: listerrors cleaning
1522 * lib/listerrors: removed -- generated file
1523 * acinclude.m4: ditto
1524 * sigc++/acinclude.m4: ditto
1526 * src/frontends/xforms/forms/form_citation.fd:
1527 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1530 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1531 `updatesrc` and now we have a `test` target that does what `updatesrc`
1532 used to do. I didn't like having an install target that wasn't related
1535 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1536 on all except FormGraphics. This may yet happen. Followed by a major
1537 cleanup including using FL_TRANSIENT for most of the dialogs. More
1538 changes to come when the ButtonController below is introduced.
1540 * src/frontends/xforms/ButtonController.h: New file for managing up to
1541 four buttons on a dialog according to an externally defined policy.
1542 * src/frontends/xforms/Makefile.am: added above
1544 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1545 Apply and Cancel/Close buttons and everything in between and beyond.
1546 * src/frontends/Makefile.am: added above.
1548 * src/frontends/xforms/forms/form_preferences.fd:
1549 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1550 and removed variable 'status' as a result. Fixed the set_minsize thing.
1551 Use the new screen-font-update after checking screen fonts were changed
1552 Added a "Restore" button to restore the original lyxrc values while
1553 editing. This restores everything not just the last input changed.
1554 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1556 * src/LyXAction.C: screen-font-update added for updating buffers after
1557 screen font settings have been changed.
1558 * src/commandtags.h: ditto
1559 * src/lyxfunc.C: ditto
1561 * forms/lyx.fd: removed screen fonts dialog.
1562 * src/lyx_gui.C: ditto
1563 * src/menus.[Ch]: ditto
1564 * src/lyx.[Ch]: ditto
1565 * src/lyx_cb.C: ditto + code from here moved to make
1566 screen-font-update. And people wonder why progress on GUII is
1567 slow. Look at how scattered this stuff was! It takes forever
1570 * forms/fdfix.sh: Fixup the spacing after commas.
1571 * forms/makefile: Remove date from generated files. Fewer clashes now.
1572 * forms/bullet_forms.C.patch: included someones handwritten changes
1574 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1575 once I've discovered why LyXRC was made noncopyable.
1576 * src/lyx_main.C: ditto
1578 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1580 * src/frontends/xforms/forms/fdfix.sh:
1581 * src/frontends/xforms/forms/fdfixh.sed:
1582 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1583 * src/frontends/xforms/Form*.[hC]:
1584 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1585 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1586 provide a destructor for the struct FD_form_xxxx. Another version of
1587 the set_[max|min]size workaround and a few other cleanups. Actually,
1588 Angus' patch from 20000809.
1590 2000-08-13 Baruch Even <baruch.even@writeme.com>
1592 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1595 2000-08-11 Juergen Vigna <jug@sad.it>
1597 * src/insets/insetgraphics.C (InsetGraphics): changing init
1598 order because of warnings.
1600 * src/frontends/xforms/forms/makefile: adding patching .C with
1603 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1604 from .C.patch to .c.patch
1606 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1607 order because of warning.
1609 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1611 * src/frontends/Liason.C (setMinibuffer): new helper function
1613 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1615 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1617 * lib/ui/default.ui: commented out PaperLayout entry
1619 * src/frontends/xforms/form_document.[Ch]: new added files
1621 * src/frontends/xforms/FormDocument.[Ch]: ditto
1623 * src/frontends/xforms/forms/form_document.fd: ditto
1625 * src/frontends/xforms/forms/form_document.C.patch: ditto
1627 2000-08-10 Juergen Vigna <jug@sad.it>
1629 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1630 (InsetGraphics): initialized cacheHandle to 0.
1631 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1633 2000-08-10 Baruch Even <baruch.even@writeme.com>
1635 * src/graphics/GraphicsCache.h:
1636 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1637 correctly as a cache.
1639 * src/graphics/GraphicsCacheItem.h:
1640 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1643 * src/graphics/GraphicsCacheItem_pimpl.h:
1644 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1647 * src/insets/insetgraphics.h:
1648 * src/insets/insetgraphics.C: Changed from using a signal notification
1649 to polling when image is not loaded.
1651 2000-08-10 Allan Rae <rae@lyx.org>
1653 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1654 that there are two functions that have to been taken out of line by
1655 hand and aren't taken care of in the script. (Just a reminder note)
1657 * sigc++/macros/*.h.m4: Updated as above.
1659 2000-08-09 Juergen Vigna <jug@sad.it>
1661 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1663 * src/insets/insettabular.C: make drawing of single cell smarter.
1665 2000-08-09 Marko Vendelin <markov@ioc.ee>
1666 * src/frontends/gnome/Menubar_pimpl.C
1667 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1668 implementation: new files
1670 * src/frontends/gnome/mainapp.C
1671 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1674 * src/main.C: create Gnome main window
1676 * src/frontends/xforms/Menubar_pimpl.h
1677 * src/frontends/Menubar.C
1678 * src/frontends/Menubar.h: added method Menubar::update that calls
1679 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1681 * src/LyXView.C: calls Menubar::update to update the state
1684 * src/frontends/gnome/Makefile.am: added new files
1686 * src/frontends/Makefile.am: added frontend compiler options
1688 2000-08-08 Juergen Vigna <jug@sad.it>
1690 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1692 * src/bufferlist.C (close):
1693 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1694 documents if exiting without saving.
1696 * src/buffer.C (save): use removeAutosaveFile()
1698 * src/support/filetools.C (removeAutosaveFile): new function.
1700 * src/lyx_cb.C (MenuWrite): returns a bool now.
1701 (MenuWriteAs): check if file could really be saved and revert to the
1703 (MenuWriteAs): removing old autosavefile if existant.
1705 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1706 before Goto toggle declaration, because of compiler warning.
1708 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1710 * src/lyxfunc.C (MenuNew): small fix.
1712 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1714 * src/bufferlist.C (newFile):
1715 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1717 * src/lyxrc.C: added new_ask_filename tag
1719 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1721 * src/lyx.fd: removed code pertaining to form_ref
1722 * src/lyx.[Ch]: ditto
1723 * src/lyx_cb.C: ditto
1724 * src/lyx_gui.C: ditto
1725 * src/lyx_gui_misc.C: ditto
1727 * src/BufferView_pimpl.C (restorePosition): update buffer only
1730 * src/commandtags.h (LFUN_REFTOGGLE): removed
1731 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1732 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1733 (LFUN_REFBACK): renamed LFUN_REF_BACK
1735 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1736 * src/menus.C: ditto
1737 * src/lyxfunc.C (Dispatch): ditto.
1738 InsertRef dialog is now GUI-independent.
1740 * src/texrow.C: added using std::endl;
1742 * src/insets/insetref.[Ch]: strip out large amounts of code.
1743 The inset is now a container and this functionality is now
1744 managed by a new FormRef dialog
1746 * src/frontends/Dialogs.h (showRef, createRef): new signals
1748 * src/frontends/xforms/FormIndex.[Ch],
1749 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1750 when setting dialog's min/max size
1751 * src/frontends/xforms/FormIndex.[Ch]: ditto
1753 * src/frontends/xforms/FormRef.[Ch],
1754 src/frontends/xforms/forms/form_ref.fd: new xforms
1755 implementation of an InsetRef dialog
1757 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1760 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1761 ios::nocreate is not part of the standard. Removed.
1763 2000-08-07 Baruch Even <baruch.even@writeme.com>
1765 * src/graphics/Renderer.h:
1766 * src/graphics/Renderer.C: Added base class for rendering of different
1767 image formats into Pixmaps.
1769 * src/graphics/XPM_Renderer.h:
1770 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1771 in a different class.
1773 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1774 easily add support for other formats.
1776 * src/insets/figinset.C: plugged a leak of an X resource.
1778 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1780 * src/CutAndPaste.[Ch]: make all metods static.
1782 * development/Code_rules/Rules: more work, added section on
1783 Exceptions, and a References section.
1785 * a lot of header files: work to make doc++ able to generate the
1786 source documentation, some workarounds of doc++ problems. Doc++ is
1787 now able to generate the documentation.
1789 2000-08-07 Juergen Vigna <jug@sad.it>
1791 * src/insets/insettabular.C (recomputeTextInsets): removed function
1793 * src/tabular.C (SetWidthOfMulticolCell):
1795 (calculate_width_of_column_NMC): fixed return value so that it really
1796 only returns true if the column-width has changed (there where
1797 problems with muliticolumn-cells in this column).
1799 2000-08-04 Juergen Vigna <jug@sad.it>
1801 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1802 also on the scrollstatus of the inset.
1803 (workAreaMotionNotify): ditto.
1805 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1807 2000-08-01 Juergen Vigna <jug@sad.it>
1809 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1811 * src/commandtags.h:
1812 * src/LyXAction.C (init):
1813 * src/insets/inset.C (LocalDispatch): added support for
1816 * src/insets/inset.C (scroll): new functions.
1818 * src/insets/insettext.C (removeNewlines): new function.
1819 (SetAutoBreakRows): removes forced newlines in the text of the
1820 paragraph if autoBreakRows is set to false.
1822 * src/tabular.C (Latex): generates a parbox around the cell contents
1825 * src/frontends/xforms/FormTabular.C (local_update): removed
1826 the radio_useparbox button.
1828 * src/tabular.C (UseParbox): new function
1830 2000-08-06 Baruch Even <baruch.even@writeme.com>
1832 * src/graphics/GraphicsCache.h:
1833 * src/graphics/GraphicsCache.C:
1834 * src/graphics/GraphicsCacheItem.h:
1835 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1838 * src/insets/insetgraphics.h:
1839 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1840 drawing of the inline image.
1842 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1843 into the wrong position.
1845 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1848 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1850 * src/support/translator.h: move all typedefs to public section
1852 * src/support/filetools.C (MakeLatexName): return string const
1854 (TmpFileName): ditto
1855 (FileOpenSearch): ditto
1857 (LibFileSearch): ditto
1858 (i18nLibFileSearch): ditto
1861 (CreateTmpDir): ditto
1862 (CreateBufferTmpDir): ditto
1863 (CreateLyXTmpDir): ditto
1866 (MakeAbsPath): ditto
1868 (OnlyFilename): ditto
1870 (NormalizePath): ditto
1871 (CleanupPath): ditto
1872 (GetFileContents): ditto
1873 (ReplaceEnvironmentPath): ditto
1874 (MakeRelPath): ditto
1876 (ChangeExtension): ditto
1877 (MakeDisplayPath): ditto
1878 (do_popen): return cmdret const
1879 (findtexfile): return string const
1881 * src/support/DebugStream.h: add some /// to please doc++
1883 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1885 * src/texrow.C (same_rownumber): functor to use with find_if
1886 (getIdFromRow): rewritten to use find_if and to not update the
1887 positions. return true if row is found
1888 (increasePos): new method, use to update positions
1890 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1892 * src/lyxlex_pimpl.C (verifyTable): new method
1895 (GetString): return string const
1896 (pushTable): rewrite to use std::stack
1898 (setFile): better check
1901 * src/lyxlex.h: make LyXLex noncopyable
1903 * src/lyxlex.C (text): return char const * const
1904 (GetString): return string const
1905 (getLongString): return string const
1907 * src/lyx_gui_misc.C (askForText): return pair<...> const
1909 * src/lastfiles.[Ch] (operator): return string const
1911 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1912 istringstream not char const *.
1913 move token.end() out of loop.
1914 (readFile): move initializaton of token
1916 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1917 getIdFromRow is successful.
1919 * lib/bind/emacs.bind: don't include menus bind
1921 * development/Code_rules/Rules: the beginnings of making this
1922 better and covering more of the unwritten rules that we have.
1924 * development/Code_rules/Recommendations: a couple of wording
1927 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1929 * src/support/strerror.c: remove C++ comment.
1931 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1933 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1934 LFUN_INDEX_INSERT_LAST
1936 * src/texrow.C (getIdFromRow): changed from const_iterator to
1937 iterator, allowing code to compile with DEC cxx
1939 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1940 stores part of the class, as suggested by Allan. Will allow
1942 (apply): test to apply uses InsetCommandParams operator!=
1944 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1945 (apply): test to apply uses InsetCommandParams operator!=
1947 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1948 stores part of the class.
1949 (update): removed limits on min/max size.
1951 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1952 (apply): test to apply uses InsetCommandParams operator!=
1954 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1955 (Read, Write, scanCommand, getCommand): moved functionality
1956 into InsetCommandParams.
1958 (getScreenLabel): made pure virtual
1959 new InsetCommandParams operators== and !=
1961 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1962 c-tors based on InsetCommandParams. Removed others.
1963 * src/insets/insetinclude.[Ch]: ditto
1964 * src/insets/insetlabel.[Ch]: ditto
1965 * src/insets/insetparent.[Ch]: ditto
1966 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1968 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1969 insets derived from InsetCommand created using similar c-tors
1970 based on InsetCommandParams
1971 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1972 * src/menus.C (ShowRefsMenu): ditto
1973 * src/paragraph.C (Clone): ditto
1974 * src/text2.C (SetCounter): ditto
1975 * src/lyxfunc.C (Dispatch) ditto
1976 Also recreated old InsetIndex behaviour exactly. Can now
1977 index-insert at the start of a paragraph and index-insert-last
1978 without launching the pop-up.
1980 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1982 * lib/lyxrc.example: mark te pdf options as non functional.
1984 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1985 (isStrDbl): move tmpstr.end() out of loop.
1986 (strToDbl): move intialization of tmpstr
1987 (lowercase): return string const and move tmp.end() out of loop.
1988 (uppercase): return string const and move tmp.edn() out of loop.
1989 (prefixIs): add assertion
1994 (containsOnly): ditto
1995 (containsOnly): ditto
1996 (containsOnly): ditto
1997 (countChar): make last arg char not char const
1998 (token): return string const
1999 (subst): return string const, move tmp.end() out of loop.
2000 (subst): return string const, add assertion
2001 (strip): return string const
2002 (frontStrip): return string const, add assertion
2003 (frontStrip): return string const
2008 * src/support/lstrings.C: add inclde "LAssert.h"
2009 (isStrInt): move tmpstr.end() out of loop.
2011 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2012 toollist.end() out of loop.
2013 (deactivate): move toollist.end() out of loop.
2014 (update): move toollist.end() out of loop.
2015 (updateLayoutList): move tc.end() out of loop.
2016 (add): move toollist.end() out of loop.
2018 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2019 md.end() out of loop.
2021 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2023 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2026 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2027 (Erase): move insetlist.end() out of loop.
2029 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2030 ref to const string as first arg. Move initialization of some
2031 variables, whitespace changes.
2033 * src/kbmap.C (defkey): move table.end() out of loop.
2034 (kb_keymap): move table.end() out of loop.
2035 (findbinding): move table.end() out of loop.
2037 * src/MenuBackend.C (hasMenu): move end() out of loop.
2038 (getMenu): move end() out of loop.
2039 (getMenu): move menulist_.end() out of loop.
2041 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2043 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2046 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2047 (getFromLyXName): move infotab.end() out of loop.
2049 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2050 -fvtable-thunks -ffunction-sections -fdata-sections
2052 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2054 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2057 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2059 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2061 * src/frontends/xforms/FormCitation.[Ch],
2062 src/frontends/xforms/FormIndex.[Ch],
2063 src/frontends/xforms/FormToc.[Ch],
2064 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2066 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2068 * src/commandtags.h: renamed, created some flags for citation
2071 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2073 * src/lyxfunc.C (dispatch): use signals to insert index entry
2075 * src/frontends/Dialogs.h: new signal createIndex
2077 * src/frontends/xforms/FormCommand.[Ch],
2078 src/frontends/xforms/FormCitation.[Ch],
2079 src/frontends/xforms/FormToc.[Ch],
2080 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2082 * src/insets/insetindex.[Ch]: GUI-independent
2084 * src/frontends/xforms/FormIndex.[Ch],
2085 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2088 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2090 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2091 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2093 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2095 * src/insets/insetref.C (Latex): rewrite so that there is now
2096 question that a initialization is requested.
2098 * src/insets/insetcommand.h: reenable the hide signal
2100 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2102 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2103 fix handling of shortcuts (many bugs :)
2104 (add_lastfiles): ditto.
2106 * lib/ui/default.ui: fix a few shortcuts.
2108 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2110 * Makefile.am: Fix ``rpmdist'' target to return the exit
2111 status of the ``rpm'' command, instead of the last command in
2112 the chain (the ``rm lyx.xpm'' command, which always returns
2115 2000-08-02 Allan Rae <rae@lyx.org>
2117 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2118 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2119 * src/frontends/xforms/FormToc.C (FormToc): ditto
2121 * src/frontends/xforms/Makefile.am: A few forgotten files
2123 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2124 Signals-not-copyable-problem Lars' started commenting out.
2126 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2128 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2130 * src/insets/insetcommand.h: Signals is not copyable so anoter
2131 scheme for automatic hiding of forms must be used.
2133 * src/frontends/xforms/FormCitation.h: don't inerit from
2134 noncopyable, FormCommand already does that.
2135 * src/frontends/xforms/FormToc.h: ditto
2136 * src/frontends/xforms/FormUrl.h: ditto
2138 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2140 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2142 * src/insets/insetcommand.h (hide): new SigC::Signal0
2143 (d-tor) new virtual destructor emits hide signal
2145 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2146 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2148 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2149 LOF and LOT. Inset is now GUI-independent
2151 * src/insets/insetloa.[Ch]: redundant
2152 * src/insets/insetlof.[Ch]: ditto
2153 * src/insets/insetlot.[Ch]: ditto
2155 * src/frontends/xforms/forms/form_url.fd: tweaked!
2156 * src/frontends/xforms/forms/form_citation.fd: ditto
2158 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2159 dialogs dealing with InsetCommand insets
2161 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2162 FormCommand base class
2163 * src/frontends/xforms/FormUrl.[Ch]: ditto
2165 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2167 * src/frontends/xforms/FormToc.[Ch]: ditto
2169 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2170 passed a generic InsetCommand pointer
2171 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2173 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2174 and modified InsetTOC class
2175 * src/buffer.C: ditto
2177 * forms/lyx.fd: strip out old FD_form_toc code
2178 * src/lyx_gui_misc.C: ditto
2179 * src/lyx_gui.C: ditto
2180 * src/lyx_cb.C: ditto
2181 * src/lyx.[Ch]: ditto
2183 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2185 * src/support/utility.hpp: tr -d '\r'
2187 2000-08-01 Juergen Vigna <jug@sad.it>
2189 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2191 * src/commandtags.h:
2192 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2193 LFUN_TABULAR_FEATURES.
2195 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2196 LFUN_LAYOUT_TABULAR.
2198 * src/insets/insettabular.C (getStatus): implemented helper function.
2200 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2202 2000-07-31 Juergen Vigna <jug@sad.it>
2204 * src/text.C (draw): fixed screen update problem for text-insets.
2206 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2207 something changed probably this has to be added in various other
2210 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2212 2000-07-31 Baruch Even <baruch.even@writeme.com>
2214 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2215 templates to satisfy compaq cxx.
2218 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2220 * src/support/translator.h (equal_1st_in_pair::operator()): take
2221 const ref pair_type as arg.
2222 (equal_2nd_in_pair::operator()): ditto
2223 (Translator::~Translator): remove empty d-tor.
2225 * src/graphics/GraphicsCache.C: move include config.h to top, also
2226 put initialization of GraphicsCache::singleton here.
2227 (~GraphicsCache): move here
2228 (addFile): take const ref as arg
2231 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2233 * src/BufferView2.C (insertLyXFile): change te with/without header
2236 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2238 * src/frontends/xforms/FormGraphics.C (apply): add some
2239 static_cast. Not very nice, but required by compaq cxx.
2241 * src/frontends/xforms/RadioButtonGroup.h: include header
2242 <utility> instead of <pair.h>
2244 * src/insets/insetgraphicsParams.C: add using directive.
2245 (readResize): change return type to void.
2246 (readOrigin): ditto.
2248 * src/lyxfunc.C (getStatus): add missing break for build-program
2249 function; add test for Literate for export functions.
2251 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2252 entries in Options menu.
2254 2000-07-31 Baruch Even <baruch.even@writeme.com>
2256 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2257 protect against auto-allocation; release icon when needed.
2259 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2261 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2262 on usual typewriter.
2264 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2265 earlier czech.kmap), useful only for programming.
2267 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2269 * src/frontends/xforms/FormCitation.h: fix conditioning around
2272 2000-07-31 Juergen Vigna <jug@sad.it>
2274 * src/frontends/xforms/FormTabular.C (local_update): changed
2275 radio_linebreaks to radio_useparbox and added radio_useminipage.
2277 * src/tabular.C: made support for using minipages/parboxes.
2279 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2281 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2283 (descent): so the cursor is in the middle.
2284 (width): bit smaller box.
2286 * src/insets/insetgraphics.h: added display() function.
2288 2000-07-31 Baruch Even <baruch.even@writeme.com>
2290 * src/frontends/Dialogs.h: Added showGraphics signals.
2292 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2293 xforms form definition of the graphics dialog.
2295 * src/frontends/xforms/FormGraphics.h:
2296 * src/frontends/xforms/FormGraphics.C: Added files, the
2297 GUIndependent code of InsetGraphics
2299 * src/insets/insetgraphics.h:
2300 * src/insets/insetgraphics.C: Major writing to make it work.
2302 * src/insets/insetgraphicsParams.h:
2303 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2304 struct between InsetGraphics and GUI.
2306 * src/LaTeXFeatures.h:
2307 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2308 support for graphicx package.
2310 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2311 for the graphics inset.
2313 * src/support/translator.h: Added file, used in
2314 InsetGraphicsParams. this is a template to translate between two
2317 * src/frontends/xforms/RadioButtonGroup.h:
2318 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2319 way to easily control a radio button group.
2321 2000-07-28 Juergen Vigna <jug@sad.it>
2323 * src/insets/insettabular.C (LocalDispatch):
2324 (TabularFeatures): added support for lyx-functions of tabular features.
2325 (cellstart): refixed this function after someone wrongly changed it.
2327 * src/commandtags.h:
2328 * src/LyXAction.C (init): added support for tabular-features
2330 2000-07-28 Allan Rae <rae@lyx.org>
2332 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2333 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2334 triggers the callback for input checking. As a result we sometimes get
2335 "LyX: This shouldn't happen..." printed to cerr.
2336 (input): Started using status variable since I only free() on
2337 destruction. Some input checking for paths and font sizes.
2339 * src/frontends/xforms/FormPreferences.h: Use status to control
2340 activation of Ok and Apply
2342 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2343 callback. Also resized to stop segfaults with 0.88. The problem is
2344 that xforms-0.88 requires the folder to be wide enough to fit all the
2345 tabs. If it isn't it causes all sorts of problems.
2347 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2349 * src/frontends/xforms/forms/README: Reflect reality.
2351 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2352 * src/frontends/xforms/forms/makefile: ditto.
2354 * src/commandtags.h: Get access to new Preferences dialog
2355 * src/LyXAction.C: ditto
2356 * src/lyxfunc.C: ditto
2357 * lib/ui/default.ui: ditto
2359 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2361 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2363 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2366 * src/frontends/xforms/form_url.[Ch]: added.
2368 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2370 * src/insets/insetbib.h: fixed bug in previous commit
2372 * src/frontends/xforms/FormUrl.h: ditto
2374 * src/frontends/xforms/FormPrint.h: ditto
2376 * src/frontends/xforms/FormPreferences.h: ditto
2378 * src/frontends/xforms/FormCopyright.h: ditto
2380 * src/frontends/xforms/FormCitation.C: ditto
2382 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2383 private copyconstructor and private default contructor
2385 * src/support/Makefile.am: add utility.hpp
2387 * src/support/utility.hpp: new file from boost
2389 * src/insets/insetbib.h: set owner in clone
2391 * src/frontends/xforms/FormCitation.C: added missing include
2394 * src/insets/form_url.[Ch]: removed
2396 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2398 * development/lyx.spec.in
2399 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2400 file/directory re-organization.
2402 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2404 * src/insets/insetcommand.[Ch]: moved the string data and
2405 associated manipulation methods into a new stand-alone class
2406 InsetCommandParams. This class has two additional methods
2407 getAsString() and setFromString() allowing the contents to be
2408 moved around as a single string.
2409 (addContents) method removed.
2410 (setContents) method no longer virtual.
2412 * src/buffer.C (readInset): made use of new InsetCitation,
2413 InsetUrl constructors based on InsetCommandParams.
2415 * src/commandtags.h: add LFUN_INSERT_URL
2417 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2418 independent InsetUrl and use InsetCommandParams to extract
2419 string info and create new Insets.
2421 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2423 * src/frontends/xforms/FormCitation.C (apply): uses
2426 * src/frontends/xforms/form_url.C
2427 * src/frontends/xforms/form_url.h
2428 * src/frontends/xforms/FormUrl.h
2429 * src/frontends/xforms/FormUrl.C
2430 * src/frontends/xforms/forms/form_url.fd: new files
2432 * src/insets/insetcite.[Ch]: removed unused constructors.
2434 * src/insets/insetinclude.[Ch]: no longer store filename
2436 * src/insets/inseturl.[Ch]: GUI-independent.
2438 2000-07-26 Juergen Vigna <jug@sad.it>
2439 * renamed frontend from gtk to gnome as it is that what is realized
2440 and did the necessary changes in the files.
2442 2000-07-26 Marko Vendelin <markov@ioc.ee>
2444 * configure.in: cleaning up gnome configuration scripts
2446 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2448 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2449 shortcuts syndrom by redrawing them explicitely (a better solution
2450 would be appreciated).
2452 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2454 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2457 * src/lyx_cb.C (MenuExport): change html export to do the right
2458 thing depending of the document type (instead of having
2459 html-linuxdoc and html-docbook).
2460 * src/lyxfunc.C (getStatus): update for html
2461 * lib/ui/default.ui: simplify due to the above change.
2462 * src/menus.C (ShowFileMenu): update too (in case we need it).
2464 * src/MenuBackend.C (read): if a menu is defined twice, add the
2465 new entries to the exiting one.
2467 2000-07-26 Juergen Vigna <jug@sad.it>
2469 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2471 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2472 and return a bool if it did actual save the file.
2473 (AutoSave): don't autosave a unnamed doc.
2475 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2476 check if this is an UNNAMED new file and react to it.
2477 (newFile): set buffer to unnamed and change to not mark a new
2478 buffer dirty if I didn't do anything with it.
2480 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2482 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2484 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2485 friend as per Angus's patch posted to lyx-devel.
2487 * src/ext_l10n.h: updated
2489 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2490 gettext on the style string right before inserting them into the
2493 * autogen.sh: add code to extract style strings form layout files,
2494 not good enough yet.
2496 * src/frontends/gtk/.cvsignore: add MAKEFILE
2498 * src/MenuBackend.C (read): run the label strings through gettext
2499 before storing them in the containers.
2501 * src/ext_l10n.h: new file
2503 * autogen.sh : generate the ext_l10n.h file here
2505 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2507 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2510 * lib/ui/default.ui: fix a couple of typos.
2512 * config/gnome/gtk.m4: added (and added to the list of files in
2515 * src/insets/insetinclude.C (unique_id): fix when we are using
2516 lyxstring instead of basic_string<>.
2517 * src/insets/insettext.C (LocalDispatch): ditto.
2518 * src/support/filetools.C: ditto.
2520 * lib/configure.m4: create the ui/ directory if necessary.
2522 * src/LyXView.[Ch] (updateToolbar): new method.
2524 * src/BufferView_pimpl.C (buffer): update the toolbar when
2525 opening/closing buffer.
2527 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2529 * src/LyXAction.C (getActionName): enhance to return also the name
2530 and options of pseudo-actions.
2531 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2533 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2534 as an example of what is possible). Used in File->Build too (more
2535 useful) and in the import/export menus (to mimick the complicated
2536 handling of linuxdoc and friends). Try to update all the entries.
2538 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2541 * src/MenuBackend.C (read): Parse the new OptItem tag.
2543 * src/MenuBackend.h: Add a new optional_ data member (used if the
2544 entry should be omitted when the lyxfunc is disabled).
2546 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2547 function, used as a shortcut.
2548 (create_submenu): align correctly the shortcuts on the widest
2551 * src/MenuBackend.h: MenuItem.label() only returns the label of
2552 the menu without shortcut; new method shortcut().
2554 2000-07-14 Marko Vendelin <markov@ioc.ee>
2556 * src/frontends/gtk/Dialogs.C:
2557 * src/frontends/gtk/FormCopyright.C:
2558 * src/frontends/gtk/FormCopyright.h:
2559 * src/frontends/gtk/Makefile.am: added these source-files for the
2560 Gtk/Gnome support of the Copyright-Dialog.
2562 * src/main.C: added Gnome::Main initialization if using
2563 Gtk/Gnome frontend-GUI.
2565 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2567 * config/gnome/aclocal-include.m4
2568 * config/gnome/compiler-flags.m4
2569 * config/gnome/curses.m4
2570 * config/gnome/gnome--.m4
2571 * config/gnome/gnome-bonobo-check.m4
2572 * config/gnome/gnome-common.m4
2573 * config/gnome/gnome-fileutils.m4
2574 * config/gnome/gnome-ghttp-check.m4
2575 * config/gnome/gnome-gnorba-check.m4
2576 * config/gnome/gnome-guile-checks.m4
2577 * config/gnome/gnome-libgtop-check.m4
2578 * config/gnome/gnome-objc-checks.m4
2579 * config/gnome/gnome-orbit-check.m4
2580 * config/gnome/gnome-print-check.m4
2581 * config/gnome/gnome-pthread-check.m4
2582 * config/gnome/gnome-support.m4
2583 * config/gnome/gnome-undelfs.m4
2584 * config/gnome/gnome-vfs.m4
2585 * config/gnome/gnome-x-checks.m4
2586 * config/gnome/gnome-xml-check.m4
2587 * config/gnome/gnome.m4
2588 * config/gnome/gperf-check.m4
2589 * config/gnome/gtk--.m4
2590 * config/gnome/linger.m4
2591 * config/gnome/need-declaration.m4: added configuration scripts
2592 for Gtk/Gnome frontend-GUI
2594 * configure.in: added support for the --with-frontend=gtk option
2596 * autogen.sh: added config/gnome/* to list of config-files
2598 * acconfig.h: added define for GTKGUI-support
2600 * config/lyxinclude.m4: added --with-frontend[=value] option value
2601 for Gtk/Gnome frontend-GUI support.
2603 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2605 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2609 * src/paragraph.C (GetChar): remove non-const version
2611 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2612 (search_kw): use it.
2614 * src/lyx_main.C (init): if "preferences" exist, read that instead
2616 (ReadRcFile): return bool if the file could be read ok.
2617 (ReadUIFile): add a check to see if lex file is set ok.
2619 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2620 bastring can be used instead of lyxstring (still uses the old code
2621 if std::string is good enough or if lyxstring is used.)
2623 * src/encoding.C: make the arrays static, move ininle functions
2625 * src/encoding.h: from here.
2627 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2628 (parseSingleLyXformat2Token): move inset parsing to separate method
2629 (readInset): new private method
2631 * src/Variables.h: remove virtual from get().
2633 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2634 access to NEW_INSETS and NEW_TABULAR
2636 * src/MenuBackend.h: remove superfluous forward declaration of
2637 MenuItem. Add documentations tags "///", remove empty MenuItem
2638 destructor, remove private default contructor.
2640 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2642 (read): more string mlabel and mname to where they are used
2643 (read): remove unused variables mlabel and mname
2644 (defaults): unconditional clear, make menusetup take advantage of
2645 add returning Menu &.
2647 * src/LyXView.h: define NEW_MENUBAR as default
2649 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2650 to NEW_INSETS and NEW_TABULAR.
2651 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2652 defined. Change some of the "xxxx-inset-insert" functions names to
2655 * several files: more enahncements to NEW_INSETS and the resulting
2658 * lib/lyxrc.example (\date_insert_format): move to misc section
2660 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2661 bastring and use AC_CACHE_CHECK.
2662 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2663 the system have the newest methods. uses AC_CACHE_CHECK
2664 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2665 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2666 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2668 * configure.in: add LYX_CXX_GOOD_STD_STRING
2670 * acinclude.m4: recreated
2672 2000-07-24 Amir Karger
2674 * README: add Hebrew, Arabic kmaps
2677 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2679 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2682 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2684 * Lot of files: add pragma interface/implementation.
2686 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2688 * lib/ui/default.ui: new file (ans new directory). Contains the
2689 default menu and toolbar.
2691 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2692 global space. Toolbars are now read (as menus) in ui files.
2694 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2696 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2697 is disabled because the document is read-only. We want to have the
2698 toggle state of the function anyway.
2699 (getStatus): add code for LFUN_VC* functions (mimicking what is
2700 done in old-style menus)
2702 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2703 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2705 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2706 * src/BufferView_pimpl.C: ditto.
2707 * src/lyxfunc.C: ditto.
2709 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2710 default). This replaces old-style menus by new ones.
2712 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2713 MenuItem. Contain the data structure of a menu.
2715 * src/insets/insettext.C: use LyXView::setLayout instead of
2716 accessing directly the toolbar combox.
2717 * src/lyxfunc.C (Dispatch): ditto.
2719 * src/LyXView.C (setLayout): new method, which just calls
2720 Toolbar::setLayout().
2721 (updateLayoutChoice): move part of this method in Toolbar.
2723 * src/toolbar.[Ch]: removed.
2725 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2726 implementation the toolbar.
2728 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2729 the toolbar. It might make sense to merge it with ToolbarDefaults
2731 (setLayout): new function.
2732 (updateLayoutList): ditto.
2733 (openLayoutList): ditto.
2735 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2736 xforms implementation of the toolbar.
2737 (get_toolbar_func): comment out, since I do not
2738 know what it is good for.
2740 * src/ToolbarDefaults.h: Add the ItemType enum.
2742 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2743 for a list of allocated C strings. Used in Menubar xforms
2744 implementation to avoid memory leaks.
2746 * src/support/lstrings.[Ch] (uppercase): new version taking and
2750 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2751 * lib/bind/emacs.bind: ditto.
2753 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2755 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2756 forward decl of LyXView.
2758 * src/toolbar.C (toolbarItem): moved from toolbar.h
2759 (toolbarItem::clean): ditto
2760 (toolbarItem::~toolbarItem): ditto
2761 (toolbarItem::operator): ditto
2763 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2765 * src/paragraph.h: control the NEW_TABULAR define from here
2767 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2768 USE_TABULAR_INSETS to NEW_TABULAR
2770 * src/ToolbarDefaults.C: add include "lyxlex.h"
2772 * files using the old table/tabular: use NEW_TABULAR to control
2773 compilation of old tabular stuff.
2775 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2778 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2779 planemet in reading of old style floats, fix the \end_deeper
2780 problem when reading old style floats.
2782 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2784 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2786 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2788 * lib/bind/sciword.bind: updated.
2790 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2792 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2793 layout write problem
2795 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2797 * src/Makefile.am (INCLUDES): remove image directory from include
2800 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2801 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2803 * src/LyXView.C (create_form_form_main): read the application icon
2806 * lib/images/*.xpm: change the icons to use transparent color for
2809 * src/toolbar.C (update): change the color of the button when it
2812 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2814 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2815 setting explicitely the minibuffer.
2816 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2818 * src/LyXView.C (showState): new function. Shows font information
2819 in minibuffer and update toolbar state.
2820 (LyXView): call Toolbar::update after creating the
2823 * src/toolbar.C: change toollist to be a vector instead of a
2825 (BubbleTimerCB): get help string directly from the callback
2826 argument of the corresponding icon (which is the action)
2827 (set): remove unnecessary ugliness.
2828 (update): new function. update the icons (depressed, disabled)
2829 depending of the status of the corresponding action.
2831 * src/toolbar.h: remove help in toolbarItem
2833 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2835 * src/Painter.C (text): Added code for using symbol glyphs from
2836 iso10646 fonts. Currently diabled.
2838 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2841 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2842 magyar,turkish and usorbian.
2844 * src/paragraph.C (isMultiLingual): Made more efficient.
2846 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2849 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2850 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2851 Also changed the prototype to "bool math_insert_greek(char)".
2853 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2855 * lots of files: apply the NEW_INSETS on all code that will not be
2856 needed when we move to use the new insets. Enable the define in
2857 lyxparagrah.h to try it.
2859 * src/insets/insettabular.C (cellstart): change to be a static
2861 (InsetTabular): initialize buffer in the initializer list.
2863 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2865 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2866 form_print.h out of the header file. Replaced with forward
2867 declarations of the relevant struct.
2869 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2872 * src/commandtags.h: do not include "debug.h" which does not
2873 belong there. #include it in some other places because of this
2876 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2878 * src/insets/insetcaption.C: add a couple "using" directives.
2880 * src/toolbar.C (add): get the help text directly from lyxaction.
2882 (setPixmap): new function. Loads from disk and sets a pixmap on a
2883 botton; the name of the pixmap file is derived from the command
2886 * src/toolbar.h: remove members isBitmap and pixmap from
2889 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2890 * lib/images/: move many files from images/banner.xpm.
2892 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2894 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2895 * src/toolbar.C: ditto.
2896 * configure.in: ditto.
2897 * INSTALL: document.
2899 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2900 the spellchecker popup is closed from the WM.
2902 2000-07-19 Juergen Vigna <jug@sad.it>
2904 * src/insets/insetfloat.C (Write): small fix because we use the
2905 insetname for the type now!
2907 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2909 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2912 * src/frontends/Dialogs.h: removed hideCitation signal
2914 * src/insets/insetcite.h: added hide signal
2916 * src/insets/insetcite.C (~InsetCitation): emits new signal
2917 (getScreenLabel): "intelligent" label should now fit on the screen!
2919 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2921 * src/frontends/xforms/FormCitation.C (showInset): connects
2922 hide() to the inset's hide signal
2923 (show): modified to use fl_set_object_position rather than
2924 fl_set_object_geometry wherever possible
2926 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2928 * src/insets/lyxinset.h: add caption code
2930 * src/insets/insetfloat.C (type): new method
2932 * src/insets/insetcaption.C (Write): new method
2934 (LyxCode): new method
2936 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2937 to get it right together with using the FloatList.
2939 * src/commandtags.h: add LFUN_INSET_CAPTION
2940 * src/lyxfunc.C (Dispatch): handle it
2942 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2945 * src/Variables.[Ch]: make expand take a const reference, remove
2946 the destructor, some whitespace changes.
2948 * src/LyXAction.C (init): add caption-inset-insert
2950 * src/FloatList.C (FloatList): update the default floats a bit.
2952 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2954 * src/Variables.[Ch]: new files. Intended to be used for language
2955 specific strings (like \chaptername) and filename substitution in
2958 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2960 * lib/kbd/american.kmap: update
2962 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2964 * src/bufferparams.[Ch]: remove member allowAccents.
2966 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2968 * src/LaTeXLog.C: use the log_form.h header.
2969 * src/lyx_gui.C: ditto.
2970 * src/lyx_gui_misc.C: ditto.
2971 * src/lyxvc.h: ditto.
2973 * forms/log_form.fd: new file, created from latexoptions.fd. I
2974 kept the log popup and nuked the options form.
2976 * src/{la,}texoptions.[Ch]: removed.
2977 * src/lyx_cb.C (LaTeXOptions): ditto
2979 * src/lyx_gui.C (create_forms): do not handle the
2980 fd_latex_options form.
2982 2000-07-18 Juergen Vigna <jug@sad.it>
2984 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2985 name of the inset so that it can be requested outside (text2.C).
2987 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2990 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2992 * src/mathed/formula.h (ConvertFont): constify
2994 * src/mathed/formula.C (Read): add warning if \end_inset is not
2995 found on expected place.
2997 * src/insets/lyxinset.h (ConvertFont): consify
2999 * src/insets/insetquotes.C (ConvertFont): constify
3000 * src/insets/insetquotes.h: ditto
3002 * src/insets/insetinfo.h: add labelfont
3004 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3005 (ascent): use labelfont
3009 (Write): make .lyx file a bit nicer
3011 * src/insets/insetfloat.C (Write): simplify somewhat...
3012 (Read): add warning if arg is not found
3014 * src/insets/insetcollapsable.C: add using std::max
3015 (Read): move string token and add warning in arg is not found
3016 (draw): use std::max to get the right ty
3017 (getMaxWidth): simplify by using std::max
3019 * src/insets/insetsection.h: new file
3020 * src/insets/insetsection.C: new file
3021 * src/insets/insetcaption.h: new file
3022 * src/insets/insetcaption.C: new file
3024 * src/insets/inset.C (ConvertFont): constify signature
3026 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3027 insetcaption.[Ch] and insetsection.[Ch]
3029 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3030 uses to use LABEL_COUNTER_CHAPTER instead.
3031 * src/text2.C (SetCounter): here
3033 * src/counters.h: new file
3034 * src/counters.C: new file
3035 * src/Sectioning.h: new file
3036 * src/Sectioning.C: new file
3038 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3040 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3042 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3045 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3048 2000-07-17 Juergen Vigna <jug@sad.it>
3050 * src/tabular.C (Validate): check if array-package is needed.
3051 (SetVAlignment): added support for vertical alignment.
3052 (SetLTFoot): better support for longtable header/footers
3053 (Latex): modified to support added features.
3055 * src/LaTeXFeatures.[Ch]: added array-package.
3057 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3059 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3062 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3064 * configure.in: do not forget to put a space after -isystem.
3066 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3068 * lib/kbd/arabic.kmap: a few fixes.
3070 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3072 * some whitespace chagnes to a number of files.
3074 * src/support/DebugStream.h: change to make it easier for
3075 doc++ to parse correctly.
3076 * src/support/lyxstring.h: ditto
3078 * src/mathed/math_utils.C (compara): change to have only one
3080 (MathedLookupBOP): change because of the above.
3082 * src/mathed/math_delim.C (math_deco_compare): change to have only
3084 (search_deco): change becasue of the above.
3086 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3087 instead of manually coded one.
3089 * src/insets/insetquotes.C (Read): read the \end_inset too
3091 * src/insets/insetlatex.h: remove file
3092 * src/insets/insetlatex.C: remove file
3094 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3096 (InsetPrintIndex): remove destructor
3098 * src/insets/insetinclude.h: remove default constructor
3100 * src/insets/insetfloat.C: work to make it work better
3102 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3104 * src/insets/insetcite.h (InsetCitation): remove default constructor
3106 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3108 * src/text.C (GetColumnNearX): comment out some currently unused code.
3110 * src/paragraph.C (writeFile): move some initializations closer to
3112 (CutIntoMinibuffer): small change to use new matchIT operator
3116 (InsertInset): ditto
3119 (InsetIterator): ditto
3120 (Erase): small change to use new matchFT operator
3122 (GetFontSettings): ditto
3123 (HighestFontInRange): ditto
3126 * src/lyxparagraph.h: some chars changed to value_type
3127 (matchIT): because of some stronger checking (perhaps too strong)
3128 in SGI STL, the two operator() unified to one.
3131 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3133 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3134 the last inset read added
3135 (parseSingleLyXformat2Token): some more (future) compability code added
3136 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3137 (parseSingleLyXformat2Token): set last_inset_read
3138 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3139 (parseSingleLyXformat2Token): don't double intializw string next_token
3141 * src/TextCache.C (text_fits::operator()): add const's to the signature
3142 (has_buffer::operator()): ditto
3144 * src/Floating.h: add some comments on the class
3146 * src/FloatList.[Ch] (typeExist): new method
3149 * src/BackStack.h: added default constructor, wanted by Gcc.
3151 2000-07-14 Juergen Vigna <jug@sad.it>
3153 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3155 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3157 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3158 do a redraw when the window is resized!
3159 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3161 * src/insets/insettext.C (resizeLyXText): added function to correctly
3162 being able to resize the LyXWindow.
3164 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3166 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3168 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3169 crashes when closing dialog to a deleted inset.
3171 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3172 method! Now similar to other insets.
3174 2000-07-13 Juergen Vigna <jug@sad.it>
3176 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3178 * lib/examples/Literate.lyx: small patch!
3180 * src/insets/insetbib.C (Read): added this function because of wrong
3181 Write (without [begin|end]_inset).
3183 2000-07-11 Juergen Vigna <jug@sad.it>
3185 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3186 as the insertInset could not be good!
3188 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3189 the bool param should not be last.
3191 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3193 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3194 did submit that to Karl).
3196 * configure.in: use -isystem instead of -I for X headers. This
3197 fixes a problem on solaris with a recent gcc;
3198 put the front-end code after the X detection code;
3199 configure in sigc++ before lib/
3201 * src/lyx_main.C (commandLineHelp): remove -display from command
3204 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3206 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3207 Also put in Makefile rules for building the ``listerrors''
3208 program for parsing errors from literate programs written in LyX.
3210 * lib/build-listerrors: Added small shell script as part of compile
3211 process. This builds a working ``listerrors'' binary if noweb is
3212 installed and either 1) the VNC X server is installed on the machine,
3213 or 2) the user is compiling from within a GUI. The existence of a GUI
3214 is necessary to use the ``lyx --export'' feature for now. This
3215 hack can be removed once ``lyx --export'' no longer requires a GUI to
3218 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3220 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3221 now passed back correctly from gcc and placed "under" error
3222 buttons in a Literate LyX source.
3224 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3226 * src/text.C (GetColumnNearX): Better behavior when a RTL
3227 paragraph is ended by LTR text.
3229 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3232 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3234 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3235 true when clipboard is empty.
3237 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3239 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3240 row of the paragraph.
3241 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3242 to prevent calculation of bidi tables
3244 2000-07-07 Juergen Vigna <jug@sad.it>
3246 * src/screen.C (ToggleSelection): added y_offset and x_offset
3249 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3252 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3254 * src/insets/insettext.C: fixed Layout-Display!
3256 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3258 * configure.in: add check for strings.h header.
3260 * src/spellchecker.C: include <strings.h> in order to have a
3261 definition for bzero().
3263 2000-07-07 Juergen Vigna <jug@sad.it>
3265 * src/insets/insettext.C (draw): set the status of the bv->text to
3266 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3268 * src/screen.C (DrawOneRow):
3269 (DrawFromTo): redraw the actual row if something has changed in it
3272 * src/text.C (draw): call an update of the toplevel-inset if something
3273 has changed inside while drawing.
3275 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3277 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3279 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3280 processing inside class.
3282 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3283 processing inside class.
3285 * src/insets/insetindex.h new struct Holder, consistent with other
3288 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3289 citation dialog from main code and placed it in src/frontends/xforms.
3290 Dialog launched through signals instead of callbacks
3292 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3294 * lyx.man: update the options description.
3296 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3298 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3299 handle neg values, set min width to 590, add doc about -display
3301 2000-07-05 Juergen Vigna <jug@sad.it>
3303 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3304 calls to BufferView *.
3306 * src/insets/insettext.C (checkAndActivateInset): small fix non
3307 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3309 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3310 their \end_inset token!
3312 2000-07-04 edscott <edscott@imp.mx>
3314 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3315 lib/lyxrc.example: added option \wheel_jump
3317 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3319 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3320 remove support for -width,-height,-xpos and -ypos.
3322 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3324 * src/encoding.[Ch]: New files.
3326 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3327 (text): Call to the underline() method only when needed.
3329 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3331 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3332 encoding(s) for the document.
3334 * src/bufferparams.C (BufferParams): Changed default value of
3337 * src/language.C (newLang): Removed.
3338 (items[]): Added encoding information for all defined languages.
3340 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3341 encoding choice button.
3343 * src/lyxrc.h (font_norm_type): New member variable.
3344 (set_font_norm_type): New method.
3346 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3347 paragraphs with different encodings.
3349 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3350 (TransformChar): Changed to work correctly with Arabic points.
3351 (draw): Added support for drawing Arabic points.
3352 (draw): Removed code for drawing underbars (this is done by
3355 * src/support/textutils.h (IsPrintableNonspace): New function.
3357 * src/BufferView_pimpl.h: Added "using SigC::Object".
3358 * src/LyXView.h: ditto.
3360 * src/insets/insetinclude.h (include_label): Changed to mutable.
3362 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3364 * src/mathed/math_iter.h: remove empty destructor
3366 * src/mathed/math_cursor.h: remove empty destructor
3368 * src/insets/lyxinset.h: add THEOREM_CODE
3370 * src/insets/insettheorem.[Ch]: new files
3372 * src/insets/insetminipage.C: (InsertInset): remove
3374 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3376 (InsertInset): remove
3378 * src/insets/insetlist.C: (InsertList): remove
3380 * src/insets/insetfootlike.[Ch]: new files
3382 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3385 (InsertInset): ditto
3387 * src/insets/insetert.C: remove include Painter.h, reindent
3388 (InsertInset): move to header
3390 * src/insets/insetcollapsable.h: remove explicit from default
3391 contructor, remove empty destructor, add InsertInset
3393 * src/insets/insetcollapsable.C (InsertInset): new func
3395 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3397 * src/vspace.h: add explicit to constructor
3399 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3400 \textcompwordmark, please test this.
3402 * src/lyxrc.C: set ascii_linelen to 65 by default
3404 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3406 * src/commandtags.h: add LFUN_INSET_THEOREM
3408 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3409 (makeLinuxDocFile): remove _some_ of the nice logic
3410 (makeDocBookFile): ditto
3412 * src/Painter.[Ch]: (~Painter): removed
3414 * src/LyXAction.C (init): entry for insettheorem added
3416 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3418 (deplog): code to detect files generated by LaTeX, needs testing
3421 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3423 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3425 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3427 * src/LaTeX.C (deplog): Add a check for files that are going to be
3428 created by the first latex run, part of the project to remove the
3431 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3432 contents to the extension list.
3434 2000-07-04 Juergen Vigna <jug@sad.it>
3436 * src/text.C (NextBreakPoint): added support for needFullRow()
3438 * src/insets/lyxinset.h: added needFullRow()
3440 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3443 * src/insets/insettext.C: lots of changes for update!
3445 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3447 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3449 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3451 * src/insets/insetinclude.C (InsetInclude): fixed
3452 initialization of include_label.
3453 (unique_id): now returns a string.
3455 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3457 * src/LaTeXFeatures.h: new member IncludedFiles, for
3458 a map of key, included file name.
3460 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3461 with the included files for inclusion in SGML preamble,
3462 i. e., linuxdoc and docbook.
3465 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3466 nice (is the generated linuxdoc code to be exported?), that
3467 allows to remove column, and only_body that will be true for
3468 slave documents. Insets are allowed inside SGML font type.
3469 New handling of the SGML preamble for included files.
3470 (makeDocBookFile): the same for docbook.
3472 * src/insets/insetinclude.h:
3473 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3475 (DocBook): new export methods.
3477 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3478 and makeDocBookFile.
3480 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3481 formats to export with command line argument -x.
3483 2000-06-29 Juergen Vigna <jug@sad.it>
3485 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3486 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3488 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3489 region could already been cleared by an inset!
3491 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3493 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3496 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3498 (cursorToggle): remove special handling of lyx focus.
3500 2000-06-28 Juergen Vigna <jug@sad.it>
3502 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3505 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3507 * src/insets/insetindex.C (Edit): add a callback when popup is
3510 * src/insets/insettext.C (LocalDispatch):
3511 * src/insets/insetmarginal.h:
3512 * src/insets/insetlist.h:
3513 * src/insets/insetfoot.h:
3514 * src/insets/insetfloat.h:
3515 * src/insets/insetert.h: add a missing std:: qualifier.
3517 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3519 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3522 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3524 * src/insets/insettext.C (Read): remove tmptok unused variable
3525 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3526 (InsertInset): change for new InsetInset code
3528 * src/insets/insettext.h: add TEXT inline method
3530 * src/insets/insettext.C: remove TEXT macro
3532 * src/insets/insetmarginal.C (Write): new method
3533 (Latex): change output slightly
3535 * src/insets/insetfoot.C (Write): new method
3536 (Latex): change output slightly (don't use endl when no need)
3538 * src/insets/insetert.C (Write): new method
3540 * src/insets/insetcollapsable.h: make button_length, button_top_y
3541 and button_bottm_y protected.
3543 * src/insets/insetcollapsable.C (Write): simplify code by using
3544 tostr. Also do not output the float name, the children class
3545 should to that to get control over own arguments
3547 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3548 src/insets/insetminipage.[Ch]:
3551 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3553 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3555 * src/Makefile.am (lyx_SOURCES): add the new files
3557 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3558 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3559 * src/commandtags.h: ditto
3561 * src/LaTeXFeatures.h: add a std::set of used floattypes
3563 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3565 * src/FloatList.[Ch] src/Floating.h: new files
3567 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3569 * src/lyx_cb.C (TableApplyCB): ditto
3571 * src/text2.C: ditto
3572 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3573 (parseSingleLyXformat2Token): ditto + add code for
3574 backwards compability for old float styles + add code for new insets
3576 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3578 (InsertInset(size_type, Inset *, LyXFont)): new method
3579 (InsetChar(size_type, char)): changed to use the other InsetChar
3580 with a LyXFont(ALL_INHERIT).
3581 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3582 insert the META_INSET.
3584 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3586 * sigc++/thread.h (Threads): from here
3588 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3589 definition out of line
3590 * sigc++/scope.h: from here
3592 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3594 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3595 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3597 * Makefile.am (bindist): new target.
3599 * INSTALL: add instructions for doing a binary distribution.
3601 * development/tools/README.bin.example: update a bit.
3603 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3606 * lib/lyxrc.example: new lyxrc tag \set_color.
3608 * src/lyxfunc.C (Dispatch):
3609 * src/commandtags.h:
3610 * src/LyXAction.C: new lyxfunc "set-color".
3612 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3613 and an x11name given as strings.
3615 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3616 cache when a color is changed.
3618 2000-06-26 Juergen Vigna <jug@sad.it>
3620 * src/lyxrow.C (width): added this functions and variable.
3622 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3625 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3627 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3629 * images/undo_bw.xpm: new icon.
3630 * images/redo_bw.xpm: ditto.
3632 * configure.in (INSTALL_SCRIPT): change value to
3633 ${INSTALL} to avoid failures of install-script target.
3634 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3636 * src/BufferView.h: add a magic "friend" declaration to please
3639 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3641 * forms/cite.fd: modified to allow resizing without messing
3644 * src/insetcite.C: Uses code from cite.fd almost without
3646 User can now resize dialog in the x-direction.
3647 Resizing the dialog in the y-direction is prevented, as the
3648 code does this intelligently already.
3650 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3652 * INSTALL: remove obsolete entry in "problems" section.
3654 * lib/examples/sl_*.lyx: update of the slovenian examples.
3656 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3658 2000-06-23 Juergen Vigna <jug@sad.it>
3660 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3662 * src/buffer.C (resize): delete the LyXText of textinsets.
3664 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3666 * src/insets/lyxinset.h: added another parameter 'cleared' to
3667 the draw() function.
3669 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3670 unlocking inset in inset.
3672 2000-06-22 Juergen Vigna <jug@sad.it>
3674 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3675 of insets and moved first to LyXText.
3677 * src/mathed/formulamacro.[Ch]:
3678 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3680 2000-06-21 Juergen Vigna <jug@sad.it>
3682 * src/text.C (GetVisibleRow): look if I should clear the area or not
3683 using Inset::doClearArea() function.
3685 * src/insets/lyxinset.h: added doClearArea() function and
3686 modified draw(Painter &, ...) to draw(BufferView *, ...)
3688 * src/text2.C (UpdateInset): return bool insted of int
3690 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3692 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3693 combox in the character popup
3695 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3696 BufferParams const & params
3698 2000-06-20 Juergen Vigna <jug@sad.it>
3700 * src/insets/insettext.C (SetParagraphData): set insetowner on
3703 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3705 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3706 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3708 (form_main_): remove
3710 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3711 (create_form_form_main): remove FD_form_main stuff, connect to
3712 autosave_timeout signal
3714 * src/LyXView.[Ch] (getMainForm): remove
3715 (UpdateTimerCB): remove
3716 * src/BufferView_pimpl.h: inherit from SigC::Object
3718 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3719 signal instead of callback
3721 * src/BufferView.[Ch] (cursorToggleCB): remove
3723 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3725 * src/BufferView_pimpl.C: changes because of the one below
3727 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3728 instead of storing a pointer to a LyXText.
3730 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3732 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3734 * src/lyxparagraph.h
3736 * src/paragraph.C: Changed fontlist to a sorted vector.
3738 2000-06-19 Juergen Vigna <jug@sad.it>
3740 * src/BufferView.h: added screen() function.
3742 * src/insets/insettext.C (LocalDispatch): some selection code
3745 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3747 * src/insets/insettext.C (SetParagraphData):
3749 (InsetText): fixes for multiple paragraphs.
3751 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3753 * development/lyx.spec.in: Call configure with ``--without-warnings''
3754 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3755 This should be fine, however, since we generally don't want to be
3756 verbose when making an RPM.
3758 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3760 * lib/scripts/fig2pstex.py: New file
3762 2000-06-16 Juergen Vigna <jug@sad.it>
3764 * src/insets/insettabular.C (UpdateLocal):
3765 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3766 (LocalDispatch): Changed all functions to use LyXText.
3768 2000-06-15 Juergen Vigna <jug@sad.it>
3770 * src/text.C (SetHeightOfRow): call inset::update before requesting
3773 * src/insets/insettext.C (update):
3774 * src/insets/insettabular.C (update): added implementation
3776 * src/insets/lyxinset.h: added update function
3778 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3780 * src/text.C (SelectNextWord): protect against null pointers with
3781 old-style string streams. (fix from Paul Theo Gonciari
3784 * src/cite.[Ch]: remove erroneous files.
3786 * lib/configure.m4: update the list of created directories.
3788 * src/lyxrow.C: include <config.h>
3789 * src/lyxcursor.C: ditto.
3791 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3793 * lib/examples/decimal.lyx: new example file from Mike.
3795 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3796 to find template definitions (from Dekel)
3798 * src/frontends/.cvsignore: add a few things.
3800 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3802 * src/Timeout.C (TimeOut): remove default argument.
3804 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3807 * src/insets/ExternalTemplate.C: add a "using" directive.
3809 * src/lyx_main.h: remove the act_ struct, which seems unused
3812 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3814 * LyX Developers Meeting: All files changed, due to random C++ (by
3815 coincidence) code generator script.
3817 - external inset (cool!)
3818 - initial online editing of preferences
3819 - insettabular breaks insettext(s contents)
3821 - some DocBook fixes
3822 - example files update
3823 - other cool stuff, create a diff and look for yourself.
3825 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3827 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3828 -1 this is a non-line-breaking textinset.
3830 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3831 if there is no width set.
3833 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3835 * Lots of files: Merged the dialogbase branch.
3837 2000-06-09 Allan Rae <rae@lyx.org>
3839 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3840 and the Dispatch methods that used it.
3842 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3843 access to functions formerly kept in Dispatch.
3845 2000-05-19 Allan Rae <rae@lyx.org>
3847 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3848 made to_page and count_copies integers again. from_page remains a
3849 string however because I want to allow entry of a print range like
3850 "1,4,22-25" using this field.
3852 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3853 and printer-params-get. These aren't useful from the minibuffer but
3854 could be used by a script/LyXServer app provided it passes a suitable
3855 auto_mem_buffer. I guess I should take a look at how the LyXServer
3856 works and make it support xtl buffers.
3858 * sigc++/: updated to libsigc++-1.0.1
3860 * src/xtl/: updated to xtl-1.3.pl.11
3862 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3863 those changes done to the files in src/ are actually recreated when
3864 they get regenerated. Please don't ever accept a patch that changes a
3865 dialog unless that patch includes the changes to the corresponding *.fd
3868 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3869 stringOnlyContains, renamed it and generalised it.
3871 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3872 branch. Removed the remaining old form_print code.
3874 2000-04-26 Allan Rae <rae@lyx.org>
3876 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3877 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3879 2000-04-25 Allan Rae <rae@lyx.org>
3881 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3882 against a base of xtl-1.3.pl.4
3884 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3885 filter the Id: entries so they still show the xtl version number
3888 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3889 into the src/xtl code. Patch still pending with José (XTL)
3891 2000-04-24 Allan Rae <rae@lyx.org>
3893 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3894 both more generic and much safer. Use the new template functions.
3895 * src/buffer.[Ch] (Dispatch): ditto.
3897 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3898 and mem buffer more intelligently. Also a little general cleanup.
3901 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3902 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3903 * src/xtl/Makefile.am: ditto.
3904 * src/xtl/.cvsignore: ditto.
3905 * src/Makefile.am: ditto.
3907 * src/PrinterParams.h: Removed the macros member functions. Added a
3908 testInvariant member function. A bit of tidying up and commenting.
3909 Included Angus's idea for fixing operation with egcs-1.1.2.
3911 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3912 cool expansion of XTL's mem_buffer to support automatic memory
3913 management within the buffer itself. Removed the various macros and
3914 replaced them with template functions that use either auto_mem_buffer
3915 or mem_buffer depending on a #define. The mem_buffer support will
3916 disappear as soon as the auto_mem_buffer is confirmed to be good on
3917 other platforms/compilers. That is, it's there so you've got something
3920 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3921 effectively forked XTL. However I expect José will include my code
3922 into the next major release. Also fixed a memory leak.
3923 * src/xtl/text.h: ditto.
3924 * src/xtl/xdr.h: ditto.
3925 * src/xtl/giop.h: ditto.
3927 2000-04-16 Allan Rae <rae@lyx.org>
3929 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3930 by autogen.sh and removed by maintainer-clean anyway.
3931 * .cvsignore, sigc++/.cvsignore: Support the above.
3933 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3935 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3937 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3938 macros, renamed static callback-target member functions to suit new
3939 scheme and made them public.
3940 * src/frontends/xforms/forms/form_print.fd: ditto.
3941 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3943 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3946 * src/xtl/: New directory containing a minimal distribution of XTL.
3947 This is XTL-1.3.pl.4.
3949 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3951 2000-04-15 Allan Rae <rae@lyx.org>
3953 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3955 * sigc++/: Updated to libsigc++-1.0.0
3957 2000-04-14 Allan Rae <rae@lyx.org>
3959 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3960 use the generic ones in future. I'll modify my conversion script.
3962 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3964 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3965 (CloseAllBufferRelatedDialogs): Renamed.
3966 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3968 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3969 of the generic ones. These are the same ones my conversion script
3972 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3973 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3974 * src/buffer.C (Dispatch): ditto
3976 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3977 functions for updating and hiding buffer dependent dialogs.
3978 * src/BufferView.C (buffer): ditto
3979 * src/buffer.C (setReadonly): ditto
3980 * src/lyxfunc.C (CloseBuffer): ditto
3982 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3983 Dialogs.h, and hence all the SigC stuff, into every file that includes
3984 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3986 * src/BufferView2.C: reduce the number of headers included by buffer.h
3988 2000-04-11 Allan Rae <rae@lyx.org>
3990 * src/frontends/xforms/xform_macros.h: A small collection of macros
3991 for building C callbacks.
3993 * src/frontends/xforms/Makefile.am: Added above file.
3995 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3996 scheme again. This time it should work for JMarc. If this is
3997 successful I'll revise my conversion script to automate some of this.
3998 The static member functions in the class also have to be public for
3999 this scheme will work. If the scheme works (it's almost identical to
4000 the way BufferView::cursorToggleCB is handled so it should work) then
4001 FormCopyright and FormPrint will be ready for inclusion into the main
4002 trunk immediately after 1.1.5 is released -- provided we're prepared
4003 for complaints about lame compilers not handling XTL.
4005 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4007 2000-04-07 Allan Rae <rae@lyx.org>
4009 * config/lyxinclude.m4: A bit more tidying up (Angus)
4011 * src/LString.h: JMarc's <string> header fix
4013 * src/PrinterParams.h: Used string for most data to remove some
4014 ugly code in the Print dialog and avoid even uglier code when
4015 appending the ints to a string for output.
4017 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4018 and moved "default:" back to the end of switch statement. Cleaned
4019 up the printing so it uses the right function calls and so the
4020 "print to file" option actually puts the file in the right directory.
4022 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4024 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4025 and Ok+Apply button control into a separate method: input (Angus).
4026 (input) Cleaned it up and improved it to be very thorough now.
4027 (All CB) static_cast used instead of C style cast (Angus). This will
4028 probably change again once we've worked out how to keep gcc-2.8.1 happy
4029 with real C callbacks.
4030 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4031 ignore some of the bool settings and has random numbers instead. Needs
4032 some more investigation. Added other input length checks and checking
4033 of file and printer names.
4035 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4036 would link (Angus). Seems the old code doesn't compile with the pragma
4037 statement either. Separated callback entries from internal methods.
4039 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4041 2000-03-17 Allan Rae <rae@lyx.org>
4043 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4044 need it? Maybe it could go in Dialogs instead? I could make it a
4045 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4046 values to get the bool return value.
4047 (Dispatch): New overloaded method for xtl support.
4049 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4050 extern "C" callback instead of static member functions. Hopefully,
4051 JMarc will be able to compile this. I haven't changed
4052 forms/form_copyright.fd yet. Breaking one of my own rules already.
4054 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4055 because they aren't useful from the minibuffer. Maybe a LyXServer
4056 might want a help message though?
4058 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4060 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4061 xtl which needs both rtti and exceptions.
4063 * src/support/Makefile.am:
4064 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4066 * src/frontends/xforms/input_validators.[ch]: input filters and
4067 validators. These conrol what keys are valid in input boxes.
4068 Use them and write some more. Much better idea than waiting till
4069 after the user has pressed Ok to say that the input fields don't make
4072 * src/frontends/xforms/Makefile.am:
4073 * src/frontends/xforms/forms/form_print.fd:
4074 * src/frontends/xforms/forms/makefile:
4075 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4076 new scheme. Still have to make sure I haven't missed anything from
4077 the current implementation.
4079 * src/Makefile.am, src/PrinterParams.h: New data store.
4081 * other files: Added a couple of copyright notices.
4083 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4085 * src/insets/insetbib.h: move Holder struct in public space.
4087 * src/frontends/include/DialogBase.h: use SigC:: only when
4088 SIGC_CXX_NAMESPACES is defined.
4089 * src/frontends/include/Dialogs.h: ditto.
4091 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4093 * src/frontends/xforms/FormCopyright.[Ch]: do not
4094 mention SigC:: explicitely.
4096 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4098 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4099 deals with testing KDE in main configure.in
4100 * configure.in: ditto.
4102 2000-02-22 Allan Rae <rae@lyx.org>
4104 * Lots of files: Merged from HEAD
4106 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4107 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4109 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4111 * sigc++/: new minidist.
4113 2000-02-14 Allan Rae <rae@lyx.org>
4115 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4117 2000-02-08 Juergen Vigna <jug@sad.it>
4119 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4120 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4122 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4123 for this port and so it is much easier for other people to port
4124 dialogs in a common development environment.
4126 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4127 the QT/KDE implementation.
4129 * src/frontends/kde/Dialogs.C:
4130 * src/frontends/kde/FormCopyright.C:
4131 * src/frontends/kde/FormCopyright.h:
4132 * src/frontends/kde/Makefile.am:
4133 * src/frontends/kde/formcopyrightdialog.C:
4134 * src/frontends/kde/formcopyrightdialog.h:
4135 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4136 for the kde support of the Copyright-Dialog.
4138 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4139 subdir-substitution instead of hardcoded 'xforms' as we now have also
4142 * src/frontends/include/DialogBase.h (Object): just commented the
4143 label after #endif (nasty warning and I don't like warnings ;)
4145 * src/main.C (main): added KApplication initialization if using
4148 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4149 For now only the KDE event-loop is added if frontend==kde.
4151 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4153 * configure.in: added support for the --with-frontend[=value] option
4155 * autogen.sh: added kde.m4 file to list of config-files
4157 * acconfig.h: added define for KDEGUI-support
4159 * config/kde.m4: added configuration functions for KDE-port
4161 * config/lyxinclude.m4: added --with-frontend[=value] option with
4162 support for xforms and KDE.
4164 2000-02-08 Allan Rae <rae@lyx.org>
4166 * all Makefile.am: Fixed up so the make targets dist, distclean,
4167 install and uninstall all work even if builddir != srcdir. Still
4168 have a new sigc++ minidist update to come.
4170 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4172 2000-02-01 Allan Rae <rae@lyx.org>
4174 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4175 Many mods to get builddir != srcdir working.
4177 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4178 for building on NT and so we can do the builddir != srcdir stuff.
4180 2000-01-30 Allan Rae <rae@lyx.org>
4182 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4183 This will stay in "rae" branch. We probably don't really need it in
4184 the main trunk as anyone who wants to help programming it should get
4185 a full library installed also. So they can check both included and
4186 system supplied library compilation.
4188 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4189 Added a 'mini' distribution of libsigc++. If you feel the urge to
4190 change something in these directories - Resist it. If you can't
4191 resist the urge then you should modify the following script and rebuild
4192 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4193 all happen. Still uses a hacked version of libsigc++'s configure.in.
4194 I'm quite happy with the results. I'm not sure the extra work to turn
4195 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4196 worth the trouble and would probably lead to extra maintenance
4198 I haven't tested the following important make targets: install, dist.
4199 Not ready for prime time but very close. Maybe 1.1.5.
4201 * development/tools/makeLyXsigc.sh: A shell script to automatically
4202 generate our mini-dist of libsigc++. It can only be used with a CVS
4203 checkout of libsigc++ not a tarball distribution. It's well commented.
4204 This will end up as part of the libsigc++ distribution so other apps
4205 can easily have an included mini-dist. If someone makes mods to the
4206 sigc++ subpackage without modifying this script to generate those
4207 changes I'll be very upset!
4209 * src/frontends/: Started the gui/system indep structure.
4211 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4212 to access the gui-indep dialogs are in this class. Much improved
4213 design compared to previous revision. Lars, please refrain from
4214 moving this header into src/ like you did with Popups.h last time.
4216 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4218 * src/frontends/xforms/: Started the gui-indep system with a single
4219 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4222 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4223 Here you'll find a very useful makefile and automated fdfix.sh that
4224 makes updating dailogs a no-brainer -- provided you follow the rules
4225 set out in the README. I'm thinking about adding another script to
4226 automatically generate skeleton code for a new dialog given just the
4229 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4230 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4231 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4233 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4235 * src/support/LSubstring.C (operator): simplify
4237 * src/lyxtext.h: removed bparams, use buffer_->params instead
4239 * src/lyxrow.h: make Row a real class, move all variables to
4240 private and use accessors.
4242 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4244 (isRightToLeftPar): ditto
4245 (ChangeLanguage): ditto
4246 (isMultiLingual): ditto
4249 (SimpleTeXOnePar): ditto
4250 (TeXEnvironment): ditto
4251 (GetEndLabel): ditto
4253 (SetOnlyLayout): ditto
4254 (BreakParagraph): ditto
4255 (BreakParagraphConservative): ditto
4256 (GetFontSettings): ditto
4258 (CopyIntoMinibuffer): ditto
4259 (CutIntoMinibuffer): ditto
4260 (PasteParagraph): ditto
4261 (SetPExtraType): ditto
4262 (UnsetPExtraType): ditto
4263 (DocBookContTableRows): ditto
4264 (SimpleDocBookOneTablePar): ditto
4266 (TeXFootnote): ditto
4267 (SimpleTeXOneTablePar): ditto
4268 (TeXContTableRows): ditto
4269 (SimpleTeXSpecialChars): ditto
4272 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4273 to private and use accessors.
4275 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4276 this, we did not use it anymore and has not been for ages. Just a
4277 waste of cpu cycles.
4279 * src/language.h: make Language a real class, move all variables
4280 to private and use accessors.
4282 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4283 (create_view): remove
4284 (update): some changes for new timer
4285 (cursorToggle): use new timer
4286 (beforeChange): change for new timer
4288 * src/BufferView.h (cursorToggleCB): removed last paramter because
4291 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4292 (cursorToggleCB): change because of new timer code
4294 * lib/CREDITS: updated own mailaddress
4296 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4298 * src/support/filetools.C (PutEnv): fix the code in case neither
4299 putenv() nor setenv() have been found.
4301 * INSTALL: mention the install-strip Makefile target.
4303 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4304 read-only documents.
4306 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4308 * lib/reLyX/configure.in (VERSION): avoid using a previously
4309 generated reLyX wrapper to find out $prefix.
4311 * lib/examples/eu_adibide_lyx-atua.lyx:
4312 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4313 translation of the Tutorial (Dooteo)
4315 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4317 * forms/cite.fd: new citation dialog
4319 * src/insetcite.[Ch]: the new citation dialog is moved into
4322 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4325 * src/insets/insetcommand.h: data members made private.
4327 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4329 * LyX 1.1.5 released
4331 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4333 * src/version.h (LYX_RELEASE): to 1.1.5
4335 * src/spellchecker.C (RunSpellChecker): return false if the
4336 spellchecker dies upon creation.
4338 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4340 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4341 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4345 * lib/CREDITS: update entry for Martin Vermeer.
4347 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4349 * src/text.C (draw): Draw foreign language bars at the bottom of
4350 the row instead of at the baseline.
4352 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4354 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4356 * lib/bind/de_menus.bind: updated
4358 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4360 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4362 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4364 * src/menus.C (Limit_string_length): New function
4365 (ShowTocMenu): Limit the number of items/length of items in the
4368 * src/paragraph.C (String): Correct result for a paragraph inside
4371 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4373 * src/bufferlist.C (close): test of buf->getuser() == NULL
4375 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4377 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4378 Do not call to SetCursor when the paragraph is a closed footnote!
4380 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4382 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4385 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4387 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4390 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4391 reference popup, that activates the reference-back action
4393 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4395 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4396 the menus. Also fixed a bug.
4398 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4399 the math panels when switching buffers (unless new buffer is readonly).
4401 * src/BufferView.C (NoSavedPositions)
4402 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4404 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4406 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4407 less of dvi dirty or not.
4409 * src/trans_mgr.[Ch] (insert): change first parameter to string
4412 * src/chset.[Ch] (encodeString): add const to first parameter
4414 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4416 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4420 * src/LaTeX.C (deplog): better searching for dependency files in
4421 the latex log. Uses now regexps.
4423 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4424 instead of the box hack or \hfill.
4426 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4428 * src/lyxfunc.C (doImportHelper): do not create the file before
4429 doing the actual import.
4430 (doImportASCIIasLines): create a new file before doing the insert.
4431 (doImportASCIIasParagraphs): ditto.
4433 * lib/lyxrc.example: remove mention of non-existing commands
4435 * lyx.man: remove mention of color-related switches.
4437 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4439 * src/lyx_gui.C: remove all the color-related ressources, which
4440 are not used anymore.
4442 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4445 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4447 * src/lyxrc.C (read): Add a missing break in the switch
4449 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4451 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4453 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4456 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4458 * src/text.C (draw): draw bars under foreign language words.
4460 * src/LColor.[Ch]: add LColor::language
4462 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4464 * src/lyxcursor.h (boundary): New member variable
4466 * src/text.C (IsBoundary): New methods
4468 * src/text.C: Use the above for currect cursor movement when there
4469 is both RTL & LTR text.
4471 * src/text2.C: ditto
4473 * src/bufferview_funcs.C (ToggleAndShow): ditto
4475 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4477 * src/text.C (DeleteLineForward): set selection to true to avoid
4478 that DeleteEmptyParagraphMechanism does some magic. This is how it
4479 is done in all other functions, and seems reasonable.
4480 (DeleteWordForward): do not jump over non-word stuff, since
4481 CursorRightOneWord() already does it.
4483 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4484 DeleteWordBackward, since they seem safe to me (since selection is
4485 set to "true") DeleteEmptyParagraphMechanism does nothing.
4487 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4489 * src/lyx_main.C (easyParse): simplify the code by factoring the
4490 part that removes parameters from the command line.
4491 (LyX): check wether wrong command line options have been given.
4493 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4495 * src/lyx_main.C : add support for specifying user LyX
4496 directory via command line option -userdir.
4498 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4500 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4501 the number of items per popup.
4502 (Add_to_refs_menu): Ditto.
4504 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4506 * src/lyxparagraph.h: renamed ClearParagraph() to
4507 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4508 textclass as parameter, and do nothing if free_spacing is
4509 true. This fixes part of the line-delete-forward problems.
4511 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4512 (pasteSelection): ditto.
4513 (SwitchLayoutsBetweenClasses): more translatable strings.
4515 * src/text2.C (CutSelection): use StripLeadingSpaces.
4516 (PasteSelection): ditto.
4517 (DeleteEmptyParagraphMechanism): ditto.
4519 2000-05-26 Juergen Vigna <jug@sad.it>
4521 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4522 is not needed in tabular insets.
4524 * src/insets/insettabular.C (TabularFeatures): added missing features.
4526 * src/tabular.C (DeleteColumn):
4528 (AppendRow): implemented this functions
4529 (cellsturct::operator=): clone the inset too;
4531 2000-05-23 Juergen Vigna <jug@sad.it>
4533 * src/insets/insettabular.C (LocalDispatch): better selection support
4534 when having multicolumn-cells.
4536 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4538 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4540 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4542 * src/ColorHandler.C (getGCForeground): put more test into _()
4544 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4547 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4550 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4552 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4553 there are no labels, or when buffer is readonly.
4555 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4556 there are no labels, buffer is SGML, or when buffer is readonly.
4558 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4560 * src/LColor.C (LColor): change a couple of grey40 to grey60
4561 (LColor): rewore initalization to make compiles go some magnitude
4563 (getGUIName): don't use gettext until we need the string.
4565 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4567 * src/Bullet.[Ch]: Fixed a small bug.
4569 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4571 * src/paragraph.C (String): Several fixes/improvements
4573 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4575 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4577 * src/paragraph.C (String): give more correct output.
4579 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4581 * src/lyxfont.C (stateText) Do not output the language if it is
4582 eqaul to the language of the document.
4584 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4585 between two paragraphs with the same language.
4587 * src/paragraph.C (getParLanguage) Return a correct answer for an
4588 empty dummy paragraph.
4590 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4593 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4596 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4597 the menus/popup, if requested fonts are unavailable.
4599 2000-05-22 Juergen Vigna <jug@sad.it>
4601 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4602 movement support (Up/Down/Tab/Shift-Tab).
4603 (LocalDispatch): added also preliminari cursor-selection.
4605 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4607 * src/paragraph.C (PasteParagraph): Hopefully now right!
4609 2000-05-22 Garst R. Reese <reese@isn.net>
4611 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4612 of list, change all references to Environment to Command
4613 * tex/hollywood.cls : rewrite environments as commands, add
4614 \uppercase to interiorshot and exteriorshot to force uppecase.
4615 * tex/broadway.cls : rewrite environments as commands. Tweak
4618 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4620 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4621 size of items: use a constant intead of the hardcoded 40, and more
4622 importantly do not remove the %m and %x tags added at the end.
4623 (Add_to_refs_menu): use vector::size_type instead of
4624 unsigned int as basic types for the variables. _Please_ do not
4625 assume that size_t is equal to unsigned int. On an alpha, this is
4626 unsigned long, which is _not_ the same.
4628 * src/language.C (initL): remove language "hungarian", since it
4629 seems that "magyar" is better.
4631 2000-05-22 Juergen Vigna <jug@sad.it>
4633 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4635 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4638 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4639 next was deleted but not set to 0.
4641 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4643 * src/language.C (initL): change the initialization of languages
4644 so that compiles goes _fast_.
4646 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4649 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4651 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4655 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4657 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4659 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4663 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4666 * src/insets/insetlo*.[Ch]: Made editable
4668 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4670 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4671 the current selection.
4673 * src/BufferView_pimpl.C (stuffClipboard): new method
4675 * src/BufferView.C (stuffClipboard): new method
4677 * src/paragraph.C (String): new method
4679 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4680 LColor::ignore when lyxname is not found.
4682 * src/BufferView.C (pasteSelection): new method
4684 * src/BufferView_pimpl.C (pasteSelection): new method
4686 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4688 * src/WorkArea.C (request_clipboard_cb): new static function
4689 (getClipboard): new method
4690 (putClipboard): new method
4692 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4694 * LyX 1.1.5pre2 released
4696 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4698 * src/vspace.C (operator=): removed
4699 (operator=): removed
4701 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4703 * src/layout.C (NumberOfClass): manually set the type in make_pair
4704 (NumberOfLayout): ditto
4706 * src/language.C: use the Language constructor for ignore_lang
4708 * src/language.h: add constructors to struct Language
4710 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4712 * src/text2.C (SetCursorIntern): comment out #warning
4714 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4716 * src/mathed/math_iter.h: initialize sx and sw to 0
4718 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4720 * forms/lyx.fd: Redesign of form_ref
4722 * src/LaTeXFeatures.[Ch]
4726 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4729 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4730 and Buffer::inset_iterator.
4732 * src/menus.C: Added new menus: TOC and Refs.
4734 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4736 * src/buffer.C (getTocList): New method.
4738 * src/BufferView2.C (ChangeRefs): New method.
4740 * src/buffer.C (getLabelList): New method. It replaces the old
4741 getReferenceList. The return type is vector<string> instead of
4744 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4745 the old getLabel() and GetNumberOfLabels() methods.
4746 * src/insets/insetlabel.C (getLabelList): ditto
4747 * src/mathed/formula.C (getLabelList): ditto
4749 * src/paragraph.C (String): New method.
4751 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4752 Uses the new getTocList() method.
4753 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4754 which automatically updates the contents of the browser.
4755 (RefUpdateCB): Use the new getLabelList method.
4757 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4759 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4761 * src/spellchecker.C: Added using std::reverse;
4763 2000-05-19 Juergen Vigna <jug@sad.it>
4765 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4767 * src/insets/insettext.C (computeTextRows): small fix for display of
4768 1 character after a newline.
4770 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4773 2000-05-18 Juergen Vigna <jug@sad.it>
4775 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4776 when changing width of column.
4778 * src/tabular.C (set_row_column_number_info): setting of
4779 autobreak rows if necessary.
4781 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4783 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4785 * src/vc-backend.*: renamed stat() to status() and vcstat to
4786 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4787 compilation broke. The new name seems more relevant, anyway.
4789 2000-05-17 Juergen Vigna <jug@sad.it>
4791 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4792 which was wrong if the removing caused removing of rows!
4794 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4795 (pushToken): new function.
4797 * src/text2.C (CutSelection): fix problem discovered with purify
4799 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4801 * src/debug.C (showTags): enlarge the first column, now that we
4802 have 6-digits debug codes.
4804 * lib/layouts/hollywood.layout:
4805 * lib/tex/hollywood.cls:
4806 * lib/tex/brodway.cls:
4807 * lib/layouts/brodway.layout: more commands and fewer
4808 environments. Preambles moved in the .cls files. Broadway now has
4809 more options on scene numbering and less whitespace (from Garst)
4811 * src/insets/insetbib.C (getKeys): make sure that we are in the
4812 document directory, in case the bib file is there.
4814 * src/insets/insetbib.C (Latex): revert bogus change.
4816 2000-05-16 Juergen Vigna <jug@sad.it>
4818 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4819 the TabularLayout on cursor move.
4821 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4823 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4826 (draw): fixed cursor position and drawing so that the cursor is
4827 visible when before the tabular-inset.
4829 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4830 when creating from old insettext.
4832 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4834 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4836 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4837 * lib/tex/brodway.cls: ditto
4839 * lib/layouts/brodway.layout: change alignment of parenthical
4842 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4844 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4845 versions 0.88 and 0.89 are supported.
4847 2000-05-15 Juergen Vigna <jug@sad.it>
4849 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4852 * src/insets/insettext.C (computeTextRows): redone completely this
4853 function in a much cleaner way, because of problems when having a
4855 (draw): added a frame border when the inset is locked.
4856 (SetDrawLockedFrame): this sets if we draw the border or not.
4857 (SetFrameColor): this sets the frame color (default=insetframe).
4859 * src/insets/lyxinset.h: added x() and y() functions which return
4860 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4861 function which is needed to see if we have a locking inset of some
4862 type in this inset (needed for now in insettabular).
4864 * src/vspace.C (inPixels): the same function also without a BufferView
4865 parameter as so it is easier to use it in some ocasions.
4867 * src/lyxfunc.C: changed all places where insertInset was used so
4868 that now if it couldn't be inserted it is deleted!
4870 * src/TabularLayout.C:
4871 * src/TableLayout.C: added support for new tabular-inset!
4873 * src/BufferView2.C (insertInset): this now returns a bool if the
4874 inset was really inserted!!!
4876 * src/tabular.C (GetLastCellInRow):
4877 (GetFirstCellInRow): new helper functions.
4878 (Latex): implemented for new tabular class.
4882 (TeXTopHLine): new Latex() helper functions.
4884 2000-05-12 Juergen Vigna <jug@sad.it>
4886 * src/mathed/formulamacro.C (Read):
4887 * src/mathed/formula.C (Read): read also the \end_inset here!
4889 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4891 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4892 crush when saving formulae with unbalanced parenthesis.
4894 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4896 * src/layout.C: Add new keyword "endlabelstring" to layout file
4898 * src/text.C (GetVisibleRow): Draw endlabel string.
4900 * lib/layouts/broadway.layout
4901 * lib/layouts/hollywood.layout: Added endlabel for the
4902 Parenthetical layout.
4904 * lib/layouts/heb-article.layout: Do not use slanted font shape
4905 for Theorem like environments.
4907 * src/buffer.C (makeLaTeXFile): Always add "american" to
4908 the UsedLanguages list if document language is RTL.
4910 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4912 * add addendum to README.OS2 and small patch (from SMiyata)
4914 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4916 * many files: correct the calls to ChangeExtension().
4918 * src/support/filetools.C (ChangeExtension): remove the no_path
4919 argument, which does not belong there. Use OnlyFileName() instead.
4921 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4922 files when LaTeXing a non-nice latex file.
4924 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4925 a chain of "if". Return false when deadkeys are not handled.
4927 * src/lyx_main.C (LyX): adapted the code for default bindings.
4929 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4930 bindings for basic functionality (except deadkeys).
4931 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4933 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4934 several methods: handle override_x_deadkeys.
4936 * src/lyxrc.h: remove the "bindings" map, which did not make much
4937 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4939 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4941 * src/lyxfont.C (stateText): use a saner method to determine
4942 whether the font is "default". Seems to fix the crash with DEC
4945 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4947 2000-05-08 Juergen Vigna <jug@sad.it>
4949 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4950 TabularLayoutMenu with mouse-button-3
4951 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4953 * src/TabularLayout.C: added this file for having a Layout for
4956 2000-05-05 Juergen Vigna <jug@sad.it>
4958 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4959 recalculating inset-widths.
4960 (TabularFeatures): activated this function so that I can change
4961 tabular-features via menu.
4963 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4964 that I can test some functions with the Table menu.
4966 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4968 * src/lyxfont.C (stateText): guard against stupid c++libs.
4970 * src/tabular.C: add using std::vector
4971 some whitespace changes, + removed som autogenerated code.
4973 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4975 2000-05-05 Juergen Vigna <jug@sad.it>
4977 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4978 row, columns and cellstructures.
4980 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4982 * lib/lyxrc.example: remove obsolete entries.
4984 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4985 reading of protected_separator for free_spacing.
4987 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4989 * src/text.C (draw): do not display an exclamation mark in the
4990 margin for margin notes. This is confusing, ugly and
4993 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4994 AMS math' is checked.
4996 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4997 name to see whether including the amsmath package is needed.
4999 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5001 * src/paragraph.C (validate): Compute UsedLanguages correctly
5002 (don't insert the american language if it doesn't appear in the
5005 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5006 The argument of \thanks{} command is considered moving argument
5008 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5011 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5013 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5014 for appendix/minipage/depth. The lines can be now both in the footnote
5015 frame, and outside the frame.
5017 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5020 2000-05-05 Juergen Vigna <jug@sad.it>
5022 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5023 neede only in tabular.[Ch].
5025 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5027 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5029 (Write): write '~' for PROTECTED_SEPARATOR
5031 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5033 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5036 * src/mathed/formula.C (drawStr): rename size to siz.
5038 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5039 possibly fix a bug by not changing the pflags = flags to piflags =
5042 2000-05-05 Juergen Vigna <jug@sad.it>
5044 * src/insets/insetbib.C: moved using directive
5046 * src/ImportNoweb.C: small fix for being able to compile (missing
5049 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5051 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5052 to use clear, since we don't depend on this in the code. Add test
5055 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5057 * (various *.C files): add using std::foo directives to please dec
5060 * replace calls to string::clear() to string::erase() (Angus)
5062 * src/cheaders/cmath: modified to provide std::abs.
5064 2000-05-04 Juergen Vigna <jug@sad.it>
5066 * src/insets/insettext.C: Prepared all for inserting of multiple
5067 paragraphs. Still display stuff to do (alignment and other things),
5068 but I would like to use LyXText to do this when we cleaned out the
5069 table-support stuff.
5071 * src/insets/insettabular.C: Changed lot of stuff and added lots
5072 of functionality still a lot to do.
5074 * src/tabular.C: Various functions changed name and moved to be
5075 const functions. Added new Read and Write functions and changed
5076 lots of things so it works good with tabular-insets (also removed
5077 some stuff which is not needed anymore * hacks *).
5079 * src/lyxcursor.h: added operators == and != which just look if
5080 par and pos are (not) equal.
5082 * src/buffer.C (latexParagraphs): inserted this function to latex
5083 all paragraphs form par to endpar as then I can use this too for
5086 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5087 so that I can call this to from text insets with their own cursor.
5089 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5090 output off all paragraphs (because of the fix below)!
5092 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5093 the very last paragraph (this could be also the last paragraph of an
5096 * src/texrow.h: added rows() call which returns the count-variable.
5098 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5100 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5102 * lib/configure.m4: better autodetection of DocBook tools.
5104 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5106 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5108 * src/lyx_cb.C: add using std::reverse;
5110 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5113 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5114 selected files. Should fix repeated errors from generated files.
5116 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5118 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5120 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5121 the spellchecker popup.
5123 * lib/lyxrc.example: Removed the \number_inset section
5125 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5127 * src/insets/figinset.C (various): Use IsFileReadable() to make
5128 sure that the file actually exist. Relying on ghostscripts errors
5129 is a bad idea since they can lead to X server crashes.
5131 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5133 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5136 * lib/lyxrc.example: smallish typo in description of
5137 \view_dvi_paper_option
5139 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5142 * src/lyxfunc.C: doImportHelper to factor out common code of the
5143 various import methods. New functions doImportASCIIasLines,
5144 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5145 doImportLinuxDoc for the format specific parts.
5148 * buffer.C: Dispatch returns now a bool to indicate success
5151 * lyx_gui.C: Add getLyXView() for member access
5153 * lyx_main.C: Change logic for batch commands: First try
5154 Buffer::Dispatch (possibly without GUI), if that fails, use
5157 * lyx_main.C: Add support for --import command line switch.
5158 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5159 Available Formats: Everything accepted by 'buffer-import <format>'
5161 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5163 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5166 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5167 documents will be reformatted upon reentry.
5169 2000-04-27 Juergen Vigna <jug@sad.it>
5171 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5172 correctly only last pos this was a bug.
5174 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5176 * release of lyx-1.1.5pre1
5178 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5180 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5182 * src/menus.C: revert the change of naming (Figure->Graphic...)
5183 from 2000-04-11. It was incomplete and bad.
5185 * src/LColor.[Ch]: add LColor::depthbar.
5186 * src/text.C (GetVisibleRow): use it.
5188 * README: update the languages list.
5190 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5192 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5195 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5197 * README: remove sections that were just wrong.
5199 * src/text2.C (GetRowNearY): remove currentrow code
5201 * src/text.C (GetRow): remove currentrow code
5203 * src/screen.C (Update): rewritten a bit.
5204 (SmallUpdate): removed func
5206 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5208 (FullRebreak): return bool
5209 (currentrow): remove var
5210 (currentrow_y): ditto
5212 * src/lyxscreen.h (Draw): change arg to unsigned long
5213 (FitCursor): return bool
5214 (FitManualCursor): ditto
5215 (Smallpdate): remove func
5216 (first): change to unsigned long
5217 (DrawOneRow): change second arg to long (from long &)
5218 (screen_refresh_y): remove var
5219 (scree_refresh_row): ditto
5221 * src/lyxrow.h: change baseline to usigned int from unsigned
5222 short, this brings some implicit/unsigned issues out in the open.
5224 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5226 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5227 instead of smallUpdate.
5229 * src/lyxcursor.h: change y to unsigned long
5231 * src/buffer.h: don't call updateScrollbar after fitcursor
5233 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5234 where they are used. Removed "\\direction", this was not present
5235 in 1.1.4 and is already obsolete. Commented out some code that I
5236 believe to never be called.
5237 (runLiterate): don't call updateScrollbar after fitCursor
5239 (buildProgram): ditto
5242 * src/WorkArea.h (workWidth): change return val to unsigned
5245 (redraw): remove the button redraws
5246 (setScrollbarValue): change for scrollbar
5247 (getScrollbarValue): change for scrollbar
5248 (getScrollbarBounds): change for scrollbar
5250 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5251 (C_WorkArea_down_cb): removed func
5252 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5253 (resize): change for scrollbar
5254 (setScrollbar): ditto
5255 (setScrollbarBounds): ditto
5256 (setScrollbarIncrements): ditto
5257 (up_cb): removed func
5258 (down_cb): removed func
5259 (scroll_cb): change for scrollbar
5260 (work_area_handler): ditto
5262 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5263 when FitCursor did something.
5264 (updateScrollbar): some unsigned changes
5265 (downCB): removed func
5266 (scrollUpOnePage): removed func
5267 (scrollDownOnePage): remvoed func
5268 (workAreaMotionNotify): don't call screen->FitCursor but use
5269 fitCursor instead. and bool return val
5270 (workAreaButtonPress): ditto
5271 (workAreaButtonRelease): some unsigned changes
5272 (checkInsetHit): ditto
5273 (workAreaExpose): ditto
5274 (update): parts rewritten, comments about the signed char arg added
5275 (smallUpdate): removed func
5276 (cursorPrevious): call needed updateScrollbar
5279 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5282 * src/BufferView.[Ch] (upCB): removed func
5283 (downCB): removed func
5284 (smallUpdate): removed func
5286 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5288 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5289 currentrow, currentrow_y optimization. This did not help a lot and
5290 if we want to do this kind of optimization we should rather use
5291 cursor.row instead of the currentrow.
5293 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5294 buffer spacing and klyx spacing support.
5296 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5298 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5301 2000-04-26 Juergen Vigna <jug@sad.it>
5303 * src/insets/figinset.C: fixes to Lars sstream changes!
5305 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5307 * A lot of files: Added Ascii(ostream &) methods to all inset
5308 classes. Used when exporting to ASCII.
5310 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5311 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5314 * src/text2.C (ToggleFree): Disabled implicit word selection when
5315 there is a change in the language
5317 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5318 no output was generated for end-of-sentence inset.
5320 * src/insets/lyxinset.h
5323 * src/paragraph.C: Removed the insetnumber code
5325 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5327 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5329 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5330 no_babel and no_epsfig completely from the file.
5331 (parseSingleLyXformat2Token): add handling for per-paragraph
5332 spacing as written by klyx.
5334 * src/insets/figinset.C: applied patch by Andre. Made it work with
5337 2000-04-20 Juergen Vigna <jug@sad.it>
5339 * src/insets/insettext.C (cutSelection):
5340 (copySelection): Fixed with selection from right to left.
5341 (draw): now the rows are not recalculated at every draw.
5342 (computeTextRows): for now reset the inset-owner here (this is
5343 important for an undo or copy where the inset-owner is not set
5346 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5347 motion to the_locking_inset screen->first was forgotten, this was
5348 not important till we got multiline insets.
5350 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5352 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5353 code seems to be alright (it is code changed by Dekel, and the
5354 intent is indeed that all macros should be defined \protect'ed)
5356 * NEWS: a bit of reorganisation of the new user-visible features.
5358 2000-04-19 Juergen Vigna <jug@sad.it>
5360 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5361 position. Set the inset_owner of the used paragraph so that it knows
5362 that it is inside an inset. Fixed cursor handling with mouse and
5363 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5364 and cleanups to make TextInsets work better.
5366 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5367 Changed parameters of various functions and added LockInsetInInset().
5369 * src/insets/insettext.C:
5371 * src/insets/insetcollapsable.h:
5372 * src/insets/insetcollapsable.C:
5373 * src/insets/insetfoot.h:
5374 * src/insets/insetfoot.C:
5375 * src/insets/insetert.h:
5376 * src/insets/insetert.C: cleaned up the code so that it works now
5377 correctly with insettext.
5379 * src/insets/inset.C:
5380 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5381 that insets in insets are supported right.
5384 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5386 * src/paragraph.C: some small fixes
5388 * src/debug.h: inserted INSETS debug info
5390 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5391 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5393 * src/commandtags.h:
5394 * src/LyXAction.C: insert code for InsetTabular.
5396 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5397 not Button1MotionMask.
5398 (workAreaButtonRelease): send always a InsetButtonRelease event to
5400 (checkInsetHit): some setCursor fixes (always with insets).
5402 * src/BufferView2.C (lockInset): returns a bool now and extended for
5403 locking insets inside insets.
5404 (showLockedInsetCursor): it is important to have the cursor always
5405 before the locked inset.
5406 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5408 * src/BufferView.h: made lockInset return a bool.
5410 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5412 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5413 that is used also internally but can be called as public to have back
5414 a cursor pos which is not set internally.
5415 (SetCursorIntern): Changed to use above function.
5417 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5419 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5424 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5425 patches for things that should be in or should be changed.
5427 * src/* [insetfiles]: change "usigned char fragile" to bool
5428 fragile. There was only one point that could that be questioned
5429 and that is commented in formulamacro.C. Grep for "CHECK".
5431 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5432 (DeleteBuffer): take it out of CutAndPaste and make it static.
5434 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5436 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5437 output the spacing envir commands. Also the new commands used in
5438 the LaTeX output makes the result better.
5440 * src/Spacing.C (writeEnvirBegin): new method
5441 (writeEnvirEnd): new method
5443 2000-04-18 Juergen Vigna <jug@sad.it>
5445 * src/CutAndPaste.C: made textclass a static member of the class
5446 as otherwise it is not accesed right!!!
5448 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5450 * forms/layout_forms.fd
5451 * src/layout_forms.h
5452 * src/layout_forms.C (create_form_form_character)
5453 * src/lyx_cb.C (UserFreeFont)
5454 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5455 documents (in the layout->character popup).
5457 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5459 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5460 \spell_command was in fact not honored (from Kevin Atkinson).
5462 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5465 * src/lyx_gui.h: make lyxViews private (Angus)
5467 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5469 * src/mathed/math_write.C
5470 (MathMatrixInset::Write) Put \protect before \begin{array} and
5471 \end{array} if fragile
5472 (MathParInset::Write): Put \protect before \\ if fragile
5474 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5476 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5477 initialization if the LyXColorHandler must be done after the
5478 connections to the XServer has been established.
5480 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5481 get the background pixel from the lyxColorhandler so that the
5482 figures are rendered with the correct background color.
5483 (NextToken): removed functions.
5484 (GetPSSizes): use ifs >> string instead of NextToken.
5486 * src/Painter.[Ch]: the color cache moved out of this file.
5488 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5491 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5493 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5494 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5496 * src/BufferView.C (enterView): new func
5497 (leaveView): new func
5499 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5501 (leaveView): new func, undefines xterm cursor when approp.
5503 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5504 (AllowInput): delete the Workarea cursor handling from this func.
5506 * src/Painter.C (underline): draw a slimer underline in most cases.
5508 * src/lyx_main.C (error_handler): use extern "C"
5510 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5512 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5513 sent directly to me.
5515 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5516 to the list by Dekel.
5518 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5521 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5522 methods from lyx_cb.here.
5524 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5527 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5529 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5530 instead of using current_view directly.
5532 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5534 * src/LyXAction.C (init): add the paragraph-spacing command.
5536 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5538 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5540 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5541 different from the documents.
5543 * src/text.C (SetHeightOfRow): take paragraph spacing into
5544 account, paragraph spacing takes precedence over buffer spacing
5545 (GetVisibleRow): ditto
5547 * src/paragraph.C (writeFile): output the spacing parameter too.
5548 (validate): set the correct features if spacing is used in the
5550 (Clear): set spacing to default
5551 (MakeSameLayout): spacing too
5552 (HasSameLayout): spacing too
5553 (SetLayout): spacing too
5554 (TeXOnePar): output the spacing commands
5556 * src/lyxparagraph.h: added a spacing variable for use with
5557 per-paragraph spacing.
5559 * src/Spacing.h: add a Default spacing and a method to check if
5560 the current spacing is default. also added an operator==
5562 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5565 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5567 * src/lyxserver.C (callback): fix dispatch of functions
5569 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5570 printf() into lyxerr call.
5572 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5575 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5576 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5577 the "Float" from each of the subitems.
5578 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5580 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5581 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5582 documented the change so that the workaround can be nuked later.
5584 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5587 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5589 * src/buffer.C (getLatexName): ditto
5590 (setReadonly): ditto
5592 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5594 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5595 avoid some uses of current_view. Added also a bufferParams()
5596 method to get at this.
5598 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5600 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5602 * src/lyxparagraph.[Ch]: removed
5603 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5604 with operators used by lower_bound and
5605 upper_bound in InsetTable's
5606 Make struct InsetTable private again. Used matchpos.
5608 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5610 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5611 document, the language of existing text is changed (unless the
5612 document is multi-lingual)
5614 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5616 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5618 * A lot of files: A rewrite of the Right-to-Left support.
5620 2000-04-10 Juergen Vigna <jug@sad.it>
5622 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5623 misplaced cursor when inset in inset is locked.
5625 * src/insets/insettext.C (LocalDispatch): small fix so that a
5626 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5628 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5629 footnote font should be decreased in size twice when displaying.
5631 * src/insets/insettext.C (GetDrawFont): inserted this function as
5632 the drawing-font may differ from the real paragraph font.
5634 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5635 insets (inset in inset!).
5637 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5638 function here because we don't want footnotes inside footnotes.
5640 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5642 (init): now set the inset_owner in paragraph.C
5643 (LocalDispatch): added some resetPos() in the right position
5646 (pasteSelection): changed to use the new CutAndPaste-Class.
5648 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5649 which tells if it is allowed to insert another inset inside this one.
5651 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5652 SwitchLayoutsBetweenClasses.
5654 * src/text2.C (InsertInset): checking of the new paragraph-function
5656 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5657 is not needed anymore here!
5660 (PasteSelection): redone (also with #ifdef) so that now this uses
5661 the CutAndPaste-Class.
5662 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5665 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5666 from/to text/insets.
5668 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5669 so that the paragraph knows if it is inside an (text)-inset.
5670 (InsertFromMinibuffer): changed return-value to bool as now it
5671 may happen that an inset is not inserted in the paragraph.
5672 (InsertInsetAllowed): this checks if it is allowed to insert an
5673 inset in this paragraph.
5675 (BreakParagraphConservative):
5676 (BreakParagraph) : small change for the above change of the return
5677 value of InsertFromMinibuffer.
5679 * src/lyxparagraph.h: added inset_owner and the functions to handle
5680 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5682 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5684 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5685 functions from BufferView to BufferView::Pimpl to ease maintence.
5687 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5688 correctly. Also use SetCursorIntern instead of SetCursor.
5690 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5693 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5695 * src/WorkArea.C (belowMouse): manually implement below mouse.
5697 * src/*: Add "explicit" on several constructors, I added probably
5698 some unneeded ones. A couple of changes to code because of this.
5700 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5701 implementation and private parts from the users of BufferView. Not
5704 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5705 implementation and private parts from the users of LyXLex. Not
5708 * src/BufferView_pimpl.[Ch]: new files
5710 * src/lyxlex_pimpl.[Ch]: new files
5712 * src/LyXView.[Ch]: some inline functions move out-of-line
5714 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5716 * src/lyxparagraph.h: make struct InsetTable public.
5718 * src/support/lyxstring.h: change lyxstring::difference_type to be
5719 ptrdiff_t. Add std:: modifiers to streams.
5721 * src/font.C: include the <cctype> header, for islower() and
5724 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5726 * src/font.[Ch]: new files. Contains the metric functions for
5727 fonts, takes a LyXFont as parameter. Better separation of concepts.
5729 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5730 changes because of this.
5732 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5734 * src/*: compile with -Winline and move functions that don't
5737 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5740 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5742 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5743 (various files changed because of this)
5745 * src/Painter.C (text): fixed the drawing of smallcaps.
5747 * src/lyxfont.[Ch] (drawText): removed unused member func.
5750 * src/*.C: added needed "using" statements and "std::" qualifiers.
5752 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5754 * src/*.h: removed all use of "using" from header files use
5755 qualifier std:: instead.
5757 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5759 * src/text.C (Backspace): some additional cleanups (we already
5760 know whether cursor.pos is 0 or not).
5762 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5763 automake does not provide one).
5765 * src/bmtable.h: replace C++ comments with C comments.
5767 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5769 * src/screen.C (ShowCursor): Change the shape of the cursor if
5770 the current language is not equal to the language of the document.
5771 (If the cursor change its shape unexpectedly, then you've found a bug)
5773 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5776 * src/insets/insetnumber.[Ch]: New files.
5778 * src/LyXAction.C (init)
5779 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5782 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5784 * src/lyxparagraph.h
5785 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5786 (the vector is kept sorted).
5788 * src/text.C (GetVisibleRow): Draw selection correctly when there
5789 is both LTR and RTL text.
5791 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5792 which is much faster.
5794 * src/text.C (GetVisibleRow and other): Do not draw the last space
5795 in a row if the direction of the last letter is not equal to the
5796 direction of the paragraph.
5798 * src/lyxfont.C (latexWriteStartChanges):
5799 Check that font language is not equal to basefont language.
5800 (latexWriteEndChanges): ditto
5802 * src/lyx_cb.C (StyleReset): Don't change the language while using
5803 the font-default command.
5805 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5806 empty paragraph before a footnote.
5808 * src/insets/insetcommand.C (draw): Increase x correctly.
5810 * src/screen.C (ShowCursor): Change cursor shape if
5811 current language != document language.
5813 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5815 2000-03-31 Juergen Vigna <jug@sad.it>
5817 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5818 (Clone): changed mode how the paragraph-data is copied to the
5819 new clone-paragraph.
5821 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5822 GetInset(pos) with no inset anymore there (in inset UNDO)
5824 * src/insets/insetcommand.C (draw): small fix as here x is
5825 incremented not as much as width() returns (2 before, 2 behind = 4)
5827 2000-03-30 Juergen Vigna <jug@sad.it>
5829 * src/insets/insettext.C (InsetText): small fix in initialize
5830 widthOffset (should not be done in the init() function)
5832 2000-03-29 Amir Karger <karger@lyx.org>
5834 * lib/examples/it_ItemizeBullets.lyx: translation by
5837 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5839 2000-03-29 Juergen Vigna <jug@sad.it>
5841 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5843 * src/insets/insetfoot.C (Clone): small change as for the below
5844 new init function in the text-inset
5846 * src/insets/insettext.C (init): new function as I've seen that
5847 clone did not copy the Paragraph-Data!
5848 (LocalDispatch): Added code so that now we have some sort of Undo
5849 functionality (well actually we HAVE Undo ;)
5851 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5853 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5855 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5858 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5860 * src/main.C: added a runtime check that verifies that the xforms
5861 header used when building LyX and the library used when running
5862 LyX match. Exit with a message if they don't match. This is a
5863 version number check only.
5865 * src/buffer.C (save): Don't allocate memory on the heap for
5866 struct utimbuf times.
5868 * *: some using changes, use iosfwd instead of the real headers.
5870 * src/lyxfont.C use char const * instead of string for the static
5871 strings. Rewrite some functions to use sstream.
5873 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5875 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5878 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5880 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5881 of Geodesy (from Martin Vermeer)
5883 * lib/layouts/svjour.inc: include file for the Springer svjour
5884 class. It can be used to support journals other than JoG.
5886 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5887 Miskiewicz <misiek@pld.org.pl>)
5888 * lib/reLyX/Makefile.am: ditto.
5890 2000-03-27 Juergen Vigna <jug@sad.it>
5892 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5893 also some modifications with operations on selected text.
5895 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5896 problems with clicking on insets (last famous words ;)
5898 * src/insets/insetcommand.C (draw):
5899 (width): Changed to have a bit of space before and after the inset so
5900 that the blinking cursor can be seen (otherwise it was hidden)
5902 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5904 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5905 would not be added to the link list when an installed gettext (not
5906 part of libc) is found.
5908 2000-03-24 Juergen Vigna <jug@sad.it>
5910 * src/insets/insetcollapsable.C (Edit):
5911 * src/mathed/formula.C (InsetButtonRelease):
5912 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5915 * src/BufferView.C (workAreaButtonPress):
5916 (workAreaButtonRelease):
5917 (checkInsetHit): Finally fixed the clicking on insets be handled
5920 * src/insets/insetert.C (Edit): inserted this call so that ERT
5921 insets work always with LaTeX-font
5923 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5925 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5926 caused lyx to startup with no GUI in place, causing in a crash
5927 upon startup when called with arguments.
5929 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5931 * src/FontLoader.C: better initialization of dummyXFontStruct.
5933 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5935 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5936 for linuxdoc and docbook import and export format options.
5938 * lib/lyxrc.example Example of default values for the previous flags.
5940 * src/lyx_cb.C Use those flags instead of the hardwired values for
5941 linuxdoc and docbook export.
5943 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5946 * src/menus.C Added menus entries for the new import/exports formats.
5948 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5950 * src/lyxrc.*: Added support for running without Gui
5953 * src/FontLoader.C: sensible defaults if no fonts are needed
5955 * src/lyx_cb.C: New function ShowMessage (writes either to the
5956 minibuffer or cout in case of no gui
5957 New function AskOverwrite for common stuff
5958 Consequently various changes to call these functions
5960 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5961 wild guess at sensible screen resolution when having no gui
5963 * src/lyxfont.C: no gui, no fonts... set some defaults
5965 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5967 * src/LColor.C: made the command inset background a bit lighter.
5969 2000-03-20 Hartmut Goebel <goebel@noris.net>
5971 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5972 stdstruct.inc. Koma-Script added some title elements which
5973 otherwise have been listed below "bibliography". This split allows
5974 adding title elements to where they belong.
5976 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5977 define the additional tilte elements and then include
5980 * many other layout files: changed to include stdtitle.inc just
5981 before stdstruct.inc.
5983 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5985 * src/buffer.C: (save) Added the option to store all backup files
5986 in a single directory
5988 * src/lyxrc.[Ch]: Added variable \backupdir_path
5990 * lib/lyxrc.example: Added descriptions of recently added variables
5992 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5993 bibtex inset, not closing the bibtex popup when deleting the inset)
5995 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5997 * src/lyx_cb.C: add a couple using directives.
5999 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6000 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6001 import based on the filename.
6003 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6004 file would be imported at start, if the filename where of a sgml file.
6006 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6008 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6010 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6011 * src/lyxfont.h Replaced the member variable bits.direction by the
6012 member variable lang. Made many changes in other files.
6013 This allows having a multi-lingual document
6015 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6016 that change the current language to <l>.
6017 Removed the command "font-rtl"
6019 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6020 format for Hebrew documents)
6022 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6023 When auto_mathmode is "true", pressing a digit key in normal mode
6024 will cause entering into mathmode.
6025 If auto_mathmode is "rtl" then this behavior will be active only
6026 when writing right-to-left text.
6028 * src/text2.C (InsertStringA) The string is inserted using the
6031 * src/paragraph.C (GetEndLabel) Gives a correct result for
6032 footnote paragraphs.
6034 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6036 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6038 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6039 front of PasteParagraph. Never insert a ' '. This should at least
6040 fix some cause for the segfaults that we have been experiencing,
6041 it also fixes backspace behaviour slightly. (Phu!)
6043 * src/support/lstrings.C (compare_no_case): some change to make it
6044 compile with gcc 2.95.2 and stdlibc++-v3
6046 * src/text2.C (MeltFootnoteEnvironment): change type o
6047 first_footnote_par_is_not_empty to bool.
6049 * src/lyxparagraph.h: make text private. Changes in other files
6051 (fitToSize): new function
6052 (setContentsFromPar): new function
6053 (clearContents): new function
6054 (SetChar): new function
6056 * src/paragraph.C (readSimpleWholeFile): deleted.
6058 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6059 the file, just use a simple string instead. Also read the file in
6060 a more maintainable manner.
6062 * src/text2.C (InsertStringA): deleted.
6063 (InsertStringB): deleted.
6065 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6067 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6068 RedoParagraphs from the doublespace handling part, just set status
6069 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6070 done, but perhaps not like this.)
6072 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6074 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6075 character when inserting an inset.
6077 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6079 * src/bufferparams.C (readLanguage): now takes "default" into
6082 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6083 also initialize the toplevel_keymap with the default bindings from
6086 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6088 * all files using lyxrc: have lyxrc as a real variable and not a
6089 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6092 * src/lyxrc.C: remove double call to defaultKeyBindings
6094 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6095 toolbar defauls using lyxlex. Remove enums, structs, functions
6098 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6099 toolbar defaults. Also store default keybindings in a map.
6101 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6102 storing the toolbar defaults without any xforms dependencies.
6104 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6105 applied. Changed to use iterators.
6107 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6109 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6110 systems that don't have LINGUAS set to begin with.
6112 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6114 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6115 the list by Dekel Tsur.
6117 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6119 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6120 * src/insets/form_graphics.C: ditto.
6122 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6124 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6126 * src/bufferparams.C (readLanguage): use the new language map
6128 * src/intl.C (InitKeyMapper): use the new language map
6130 * src/lyx_gui.C (create_forms): use the new language map
6132 * src/language.[Ch]: New files. Used for holding the information
6133 about each language. Now! Use this new language map enhance it and
6134 make it really usable for our needs.
6136 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6138 * screen.C (ShowCursor): Removed duplicate code.
6139 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6140 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6142 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6145 * src/text.C Added TransformChar method. Used for rendering Arabic
6146 text correctly (change the glyphs of the letter according to the
6147 position in the word)
6152 * src/lyxrc.C Added lyxrc command {language_command_begin,
6153 language_command_end,language_command_ltr,language_command_rtl,
6154 language_package} which allows the use of either arabtex or Omega
6157 * src/lyx_gui.C (init)
6159 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6160 to use encoding for menu fonts which is different than the encoding
6163 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6164 do not load the babel package.
6165 To write an English document with Hebrew/Arabic, change the document
6166 language to "english".
6168 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6169 (alphaCounter): changed to return char
6170 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6172 * lib/lyxrc.example Added examples for Hebrew/Arabic
6175 * src/layout.C Added layout command endlabeltype
6177 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6179 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6181 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6183 * src/mathed/math_delim.C (search_deco): return a
6184 math_deco_struct* instead of index.
6186 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6188 * All files with a USE_OSTREAM_ONLY within: removed all code that
6189 was unused when USE_OSTREAM_ONLY is defined.
6191 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6192 of any less. Removed header and using.
6194 * src/text.C (GetVisibleRow): draw the string "Page Break
6195 (top/bottom)" on screen when drawing a pagebreak line.
6197 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6199 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6201 * src/mathed/math_macro.C (draw): do some cast magic.
6204 * src/mathed/math_defs.h: change byte* argument to byte const*.
6206 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6208 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6209 know it is right to return InsetFoot* too, but cxx does not like
6212 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6214 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6216 * src/mathed/math_delim.C: change == to proper assignment.
6218 2000-03-09 Juergen Vigna <jug@sad.it>
6220 * src/insets/insettext.C (setPos): fixed various cursor positioning
6221 problems (via mouse and cursor-keys)
6222 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6223 inset (still a small display problem but it works ;)
6225 * src/insets/insetcollapsable.C (draw): added button_top_y and
6226 button_bottom_y to have correct values for clicking on the inset.
6228 * src/support/lyxalgo.h: commented out 'using std::less'
6230 2000-03-08 Juergen Vigna <jug@sad.it>
6232 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6233 Button-Release event closes as it is alos the Release-Event
6236 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6238 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6240 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6241 can add multiple spaces in Scrap (literate programming) styles...
6242 which, by the way, is how I got hooked on LyX to begin with.
6244 * src/mathed/formula.C (Write): Added dummy variable to an
6245 inset::Latex() call.
6246 (Latex): Add free_spacing boolean to inset::Latex()
6248 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6250 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6251 virtual function to include the free_spacing boolean from
6252 the containing paragraph's style.
6254 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6255 Added free_spacing boolean arg to match inset.h
6257 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6258 Added free_spacing boolean arg to match inset.h
6260 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6261 Added free_spacing boolean and made sure that if in a free_spacing
6262 paragraph, that we output normal space if there is a protected space.
6264 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6265 Added free_spacing boolean arg to match inset.h
6267 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6268 Added free_spacing boolean arg to match inset.h
6270 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6271 Added free_spacing boolean arg to match inset.h
6273 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6274 Added free_spacing boolean arg to match inset.h
6276 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6277 Added free_spacing boolean arg to match inset.h
6279 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6280 free_spacing boolean arg to match inset.h
6282 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6283 Added free_spacing boolean arg to match inset.h
6285 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6286 Added free_spacing boolean arg to match inset.h
6288 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6289 Added free_spacing boolean arg to match inset.h
6291 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6292 Added free_spacing boolean arg to match inset.h
6294 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6295 Added free_spacing boolean arg to match inset.h
6297 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6298 free_spacing boolean arg to match inset.h
6300 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6301 free_spacing boolean arg to match inset.h
6303 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6304 ignore free_spacing paragraphs. The user's spaces are left
6307 * src/text.C (InsertChar): Fixed the free_spacing layout
6308 attribute behavior. Now, if free_spacing is set, you can
6309 add multiple spaces in a paragraph with impunity (and they
6310 get output verbatim).
6311 (SelectSelectedWord): Added dummy argument to inset::Latex()
6314 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6317 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6318 paragraph layouts now only input a simple space instead.
6319 Special character insets don't make any sense in free-spacing
6322 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6323 hard-spaces in the *input* file to simple spaces if the layout
6324 is free-spacing. This converts old files which had to have
6325 hard-spaces in free-spacing layouts where a simple space was
6327 (writeFileAscii): Added free_spacing check to pass to the newly
6328 reworked inset::Latex(...) methods. The inset::Latex() code
6329 ensures that hard-spaces in free-spacing paragraphs get output
6330 as spaces (rather than "~").
6332 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6334 * src/mathed/math_delim.C (draw): draw the empty placeholder
6335 delims with a onoffdash line.
6336 (struct math_deco_compare): struct that holds the "functors" used
6337 for the sort and the binary search in math_deco_table.
6338 (class init_deco_table): class used for initial sort of the
6340 (search_deco): use lower_bound to do a binary search in the
6343 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6345 * src/lyxrc.C: a small secret thingie...
6347 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6348 and to not flush the stream as often as it used to.
6350 * src/support/lyxalgo.h: new file
6351 (sorted): template function used for checking if a sequence is
6352 sorted or not. Two versions with and without user supplied
6353 compare. Uses same compare as std::sort.
6355 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6356 it and give warning on lyxerr.
6358 (struct compare_tags): struct with function operators used for
6359 checking if sorted, sorting and lower_bound.
6360 (search_kw): use lower_bound instead of manually implemented
6363 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6365 * src/insets/insetcollapsable.h: fix Clone() declaration.
6366 * src/insets/insetfoot.h: ditto.
6368 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6370 2000-03-08 Juergen Vigna <jug@sad.it>
6372 * src/insets/lyxinset.h: added owner call which tells us if
6373 this inset is inside another inset. Changed also the return-type
6374 of Editable to an enum so it tells clearer what the return-value is.
6376 * src/insets/insettext.C (computeTextRows): fixed computing of
6377 textinsets which split automatically on more rows.
6379 * src/insets/insetert.[Ch]: changed this to be of BaseType
6382 * src/insets/insetfoot.[Ch]: added footnote inset
6384 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6385 collapsable insets (like footnote, ert, ...)
6387 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6389 * src/lyxdraw.h: remvoe file
6391 * src/lyxdraw.C: remove file
6393 * src/insets/insettext.C: added <algorithm>.
6395 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6397 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6398 (matrix_cb): case MM_OK use string stream
6400 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6403 * src/mathed/math_macro.C (draw): use string stream
6404 (Metrics): use string stream
6406 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6407 directly to the ostream.
6409 * src/vspace.C (asString): use string stream.
6410 (asString): use string stream
6411 (asLatexString): use string stream
6413 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6414 setting Spacing::Other.
6416 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6417 sprintf when creating the stretch vale.
6419 * src/text2.C (alphaCounter): changed to return a string and to
6420 not use a static variable internally. Also fixed a one-off bug.
6421 (SetCounter): changed the drawing of the labels to use string
6422 streams instead of sprintf.
6424 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6425 manipulator to use a scheme that does not require library support.
6426 This is also the way it is done in the new GNU libstdc++. Should
6427 work with DEC cxx now.
6429 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6431 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6432 end. This fixes a bug.
6434 * src/mathed (all files concerned with file writing): apply the
6435 USE_OSTREAM_ONLY changes to mathed too.
6437 * src/support/DebugStream.h: make the constructor explicit.
6439 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6440 count and ostream squashed.
6442 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6444 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6446 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6447 ostringstream uses STL strings, and we might not.
6449 * src/insets/insetspecialchar.C: add using directive.
6450 * src/insets/insettext.C: ditto.
6452 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6454 * lib/layouts/seminar.layout: feeble attempt at a layout for
6455 seminar.cls, far from completet and could really use some looking
6456 at from people used to write layout files.
6458 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6459 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6460 a lot nicer and works nicely with ostreams.
6462 * src/mathed/formula.C (draw): a slightly different solution that
6463 the one posted to the list, but I think this one works too. (font
6464 size wrong in headers.)
6466 * src/insets/insettext.C (computeTextRows): some fiddling on
6467 Jürgens turf, added some comments that he should read.
6469 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6470 used and it gave compiler warnings.
6471 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6474 * src/lyx_gui.C (create_forms): do the right thing when
6475 show_banner is true/false.
6477 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6478 show_banner is false.
6480 * most file writing files: Now use iostreams to do almost all of
6481 the writing. Also instead of passing string &, we now use
6482 stringstreams. mathed output is still not adapted to iostreams.
6483 This change can be turned off by commenting out all the occurences
6484 of the "#define USE_OSTREAM_ONLY 1" lines.
6486 * src/WorkArea.C (createPixmap): don't output debug messages.
6487 (WorkArea): don't output debug messages.
6489 * lib/lyxrc.example: added a comment about the new variable
6492 * development/Code_rules/Rules: Added some more commente about how
6493 to build class interfaces and on how better encapsulation can be
6496 2000-03-03 Juergen Vigna <jug@sad.it>
6498 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6499 automatically with the width of the LyX-Window
6501 * src/insets/insettext.C (computeTextRows): fixed update bug in
6502 displaying text-insets (scrollvalues where not initialized!)
6504 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6506 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6507 id in the check of the result from lower_bound is not enough since
6508 lower_bound can return last too, and then res->id will not be a
6511 * all insets and some code that use them: I have conditionalized
6512 removed the Latex(string & out, ...) this means that only the
6513 Latex(ostream &, ...) will be used. This is a work in progress to
6514 move towards using streams for all output of files.
6516 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6519 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6521 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6522 routine (this fixes bug where greek letters were surrounded by too
6525 * src/support/filetools.C (findtexfile): change a bit the search
6526 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6527 no longer passed to kpsewhich, we may have to change that later.
6529 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6530 warning options to avoid problems with X header files (from Angus
6532 * acinclude.m4: regenerated.
6534 2000-03-02 Juergen Vigna <jug@sad.it>
6536 * src/insets/insettext.C (WriteParagraphData): Using the
6537 par->writeFile() function for writing paragraph-data.
6538 (Read): Using buffer->parseSingleLyXformat2Token()-function
6539 for parsing paragraph data!
6541 * src/buffer.C (readLyXformat2): removed all parse data and using
6542 the new parseSingleLyXformat2Token()-function.
6543 (parseSingleLyXformat2Token): added this function to parse (read)
6544 lyx-file-format (this is called also from text-insets now!)
6546 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6548 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6551 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6552 directly instead of going through a func. One very bad thing: a
6553 static LyXFindReplace, but I don't know where to place it.
6555 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6556 string instead of char[]. Also changed to static.
6557 (GetSelectionOrWordAtCursor): changed to static inline
6558 (SetSelectionOverLenChars): ditto.
6560 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6561 current_view and global variables. both classes has changed names
6562 and LyXFindReplace is not inherited from SearchForm.
6564 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6565 fl_form_search form.
6567 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6569 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6571 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6572 bound (from Kayvan).
6574 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6576 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6578 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6580 * some things that I should comment but the local pub says head to
6583 * comment out all code that belongs to the Roff code for Ascii
6584 export of tables. (this is unused)
6586 * src/LyXView.C: use correct type for global variable
6587 current_layout. (LyXTextClass::size_type)
6589 * some code to get the new insetgraphics closer to working I'd be
6590 grateful for any help.
6592 * src/BufferView2.C (insertInset): use the return type of
6593 NumberOfLayout properly. (also changes in other files)
6595 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6596 this as a test. I want to know what breaks because of this.
6598 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6600 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6602 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6603 to use a \makebox in the label, this allows proper justification
6604 with out using protected spaces or multiple hfills. Now it is
6605 "label" for left justified, "\hfill label\hfill" for center, and
6606 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6607 should be changed accordingly.
6609 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6611 * src/lyxtext.h: change SetLayout() to take a
6612 LyXTextClass::size_type instead of a char (when there is more than
6613 127 layouts in a class); also change type of copylayouttype.
6614 * src/text2.C (SetLayout): ditto.
6615 * src/LyXView.C (updateLayoutChoice): ditto.
6617 * src/LaTeX.C (scanLogFile): errors where the line number was not
6618 given just after the '!'-line were ignored (from Dekel Tsur).
6620 * lib/lyxrc.example: fix description of \date_insert_format
6622 * lib/layouts/llncs.layout: new layout, contributed by Martin
6625 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6627 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6628 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6629 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6630 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6631 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6632 paragraph.C, text.C, text2.C)
6634 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6636 * src/insets/insettext.C (LocalDispatch): remove extra break
6639 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6640 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6642 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6643 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6645 * src/insets/insetbib.h: move InsetBibkey::Holder and
6646 InsetCitation::Holder in public space.
6648 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6650 * src/insets/insettext.h: small change to get the new files from
6651 Juergen to compile (use "string", not "class string").
6653 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6654 const & as parameter to LocalDispatch, use LyXFont const & as
6655 paramter to some other func. This also had impacto on lyxinsets.h
6656 and the two mathed insets.
6658 2000-02-24 Juergen Vigna <jug@sad.it>
6661 * src/commandtags.h:
6663 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6667 * src/BufferView2.C: added/updated code for various inset-functions
6669 * src/insets/insetert.[Ch]: added implementation of InsetERT
6671 * src/insets/insettext.[Ch]: added implementation of InsetText
6673 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6674 (draw): added preliminary code for inset scrolling not finshed yet
6676 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6677 as it is in lyxfunc.C now
6679 * src/insets/lyxinset.h: Added functions for text-insets
6681 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6683 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6684 BufferView and reimplement the list as a queue put inside its own
6687 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6689 * several files: use the new interface to the "updateinsetlist"
6691 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6693 (work_area_handler): call BufferView::trippleClick on trippleclick.
6695 * src/BufferView.C (doubleClick): new function, selects word on
6697 (trippleClick): new function, selects line on trippleclick.
6699 2000-02-22 Allan Rae <rae@lyx.org>
6701 * lib/bind/xemacs.bind: buffer-previous not supported
6703 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6705 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6708 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6710 * src/bufferlist.C: get rid of current_view from this file
6712 * src/spellchecker.C: get rid of current_view from this file
6714 * src/vspace.C: get rid of current_view from this file
6715 (inPixels): added BufferView parameter for this func
6716 (asLatexCommand): added a BufferParams for this func
6718 * src/text.C src/text2.C: get rid of current_view from these
6721 * src/lyxfont.C (getFontDirection): move this function here from
6724 * src/bufferparams.C (getDocumentDirection): move this function
6727 * src/paragraph.C (getParDirection): move this function here from
6729 (getLetterDirection): ditto
6731 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6733 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6734 resize due to wrong pixmap beeing used. Also took the opurtunity
6735 to make the LyXScreen stateless on regard to WorkArea and some
6736 general cleanup in the same files.
6738 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6740 * src/Makefile.am: add missing direction.h
6742 * src/PainterBase.h: made the width functions const.
6744 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6747 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6749 * src/insets/insetlatexaccent.C (draw): make the accents draw
6750 better, at present this will only work well with iso8859-1.
6752 * several files: remove the old drawing code, now we use the new
6755 * several files: remove support for mono_video, reverse_video and
6758 2000-02-17 Juergen Vigna <jug@sad.it>
6760 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6761 int ** as we have to return the pointer, otherwise we have only
6762 NULL pointers in the returning function.
6764 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6766 * src/LaTeX.C (operator()): quote file name when running latex.
6768 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6770 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6771 (bubble tip), this removes our special handling of this.
6773 * Remove all code that is unused now that we have the new
6774 workarea. (Code that are not active when NEW_WA is defined.)
6776 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6778 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6780 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6781 nonexisting layout; correctly redirect obsoleted layouts.
6783 * lib/lyxrc.example: document \view_dvi_paper_option
6785 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6788 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6789 (PreviewDVI): handle the view_dvi_paper_option variable.
6790 [Both from Roland Krause]
6792 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6794 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6795 char const *, int, LyXFont)
6796 (text(int, int, string, LyXFont)): ditto
6798 * src/text.C (InsertCharInTable): attempt to fix the double-space
6799 feature in tables too.
6800 (BackspaceInTable): ditto.
6801 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6803 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6805 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6807 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6808 newly found text in textcache to this.
6809 (buffer): set the owner of the text put into the textcache to 0
6811 * src/insets/figinset.C (draw): fixed the drawing of figures with
6814 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6815 drawing of mathframe, hfills, protected space, table lines. I have
6816 now no outstanding drawing problems with the new Painter code.
6818 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6820 * src/PainterBase.C (ellipse, circle): do not specify the default
6823 * src/LColor.h: add using directive.
6825 * src/Painter.[Ch]: change return type of methods from Painter& to
6826 PainterBase&. Add a using directive.
6828 * src/WorkArea.C: wrap xforms callbacks in C functions
6831 * lib/layouts/foils.layout: font fix and simplifications from Carl
6834 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6836 * a lot of files: The Painter, LColor and WorkArea from the old
6837 devel branch has been ported to lyx-devel. Some new files and a
6838 lot of #ifdeffed code. The new workarea is enabled by default, but
6839 if you want to test the new Painter and LColor you have to compile
6840 with USE_PAINTER defined (do this in config.h f.ex.) There are
6841 still some rought edges, and I'd like some help to clear those
6842 out. It looks stable (loads and displays the Userguide very well).
6845 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6847 * src/buffer.C (pop_tag): revert to the previous implementation
6848 (use a global variable for both loops).
6850 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6852 * src/lyxrc.C (LyXRC): change slightly default date format.
6854 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6855 there is an English text with a footnote that starts with a Hebrew
6856 paragraph, or vice versa.
6857 (TeXFootnote): ditto.
6859 * src/text.C (LeftMargin): allow for negative values for
6860 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6863 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6864 for input encoding (cyrillic)
6866 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6868 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6871 * src/toolbar.C (set): ditto
6872 * src/insets/insetbib.C (create_form_citation_form): ditto
6874 * lib/CREDITS: added Dekel Tsur.
6876 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6877 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6878 hebrew supports files from Dekel Tsur.
6880 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6881 <tzafrir@technion.ac.il>
6883 * src/lyxrc.C: put \date_insert_format at the right place.
6885 * src/buffer.C (makeLaTeXFile): fix the handling of
6886 BufferParams::sides when writing out latex files.
6888 * src/BufferView2.C: add a "using" directive.
6890 * src/support/lyxsum.C (sum): when we use lyxstring,
6891 ostringstream::str needs an additional .c_str().
6893 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6895 * src/support/filetools.C (ChangeExtension): patch from Etienne
6898 * src/TextCache.C (show): remove const_cast and make second
6899 parameter non-const LyXText *.
6901 * src/TextCache.h: use non const LyXText in show.
6903 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6906 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6908 * src/support/lyxsum.C: rework to be more flexible.
6910 * several places: don't check if a pointer is 0 if you are going
6913 * src/text.C: remove some dead code.
6915 * src/insets/figinset.C: remove some dead code
6917 * src/buffer.C: move the BufferView funcs to BufferView2.C
6918 remove all support for insetlatexdel
6919 remove support for oldpapersize stuff
6920 made some member funcs const
6922 * src/kbmap.C: use a std::list to store the bindings in.
6924 * src/BufferView2.C: new file
6926 * src/kbsequence.[Ch]: new files
6928 * src/LyXAction.C + others: remove all trace of buffer-previous
6930 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6931 only have one copy in the binary of this table.
6933 * hebrew patch: moved some functions from LyXText to more
6934 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6936 * several files: remove support for XForms older than 0.88
6938 remove some #if 0 #endif code
6940 * src/TextCache.[Ch]: new file. Holds the textcache.
6942 * src/BufferView.C: changes to use the new TextCache interface.
6943 (waitForX): remove the now unused code.
6945 * src/BackStack.h: remove some commented code
6947 * lib/bind/emacs.bind: remove binding for buffer-previous
6949 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6951 * applied the hebrew patch.
6953 * src/lyxrow.h: make sure that all Row variables are initialized.
6955 * src/text2.C (TextHandleUndo): comment out a delete, this might
6956 introduce a memory leak, but should also help us to not try to
6957 read freed memory. We need to look at this one.
6959 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6960 (LyXParagraph): initalize footnotekind.
6962 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6963 forgot this when applying the patch. Please heed the warnings.
6965 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6966 (aka. reformat problem)
6968 * src/bufferlist.C (exists): made const, and use const_iterator
6969 (isLoaded): new func.
6970 (release): use std::find to find the correct buffer.
6972 * src/bufferlist.h: made getState a const func.
6973 made empty a const func.
6974 made exists a const func.
6977 2000-02-01 Juergen Vigna <jug@sad.it>
6979 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6981 * po/it.po: updated a bit the italian po file and also changed the
6982 'file nuovo' for newfile to 'filenuovo' without a space, this did
6985 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6986 for the new insert_date command.
6988 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6989 from jdblair, to insert a date into the current text conforming to
6990 a strftime format (for now only considering the locale-set and not
6991 the document-language).
6993 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6995 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6996 Bounds Read error seen by purify. The problem was that islower is
6997 a macros which takes an unsigned char and uses it as an index for
6998 in array of characters properties (and is thus subject to the
7002 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7003 correctly the paper sides radio buttons.
7004 (UpdateDocumentButtons): ditto.
7006 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7008 * src/kbmap.C (getsym + others): change to return unsigned int,
7009 returning a long can give problems on 64 bit systems. (I assume
7010 that int is 32bit on 64bit systems)
7012 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7014 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7015 LyXLookupString to be zero-terminated. Really fixes problems seen
7018 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7020 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7021 write a (char*)0 to the lyxerr stream.
7023 * src/lastfiles.C: move algorithm before the using statemets.
7025 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7027 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7028 complains otherwise).
7029 * src/table.C: ditto
7031 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7034 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7035 that I removed earlier... It is really needed.
7037 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7039 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7041 * INSTALL: update xforms home page URL.
7043 * lib/configure.m4: fix a bug with unreadable layout files.
7045 * src/table.C (calculate_width_of_column): add "using std::max"
7048 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7050 * several files: marked several lines with "DEL LINE", this is
7051 lines that can be deleted without changing anything.
7052 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7053 checks this anyway */
7056 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7058 * src/DepTable.C (update): add a "+" at the end when the checksum
7059 is different. (debugging string only)
7061 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7062 the next inset to not be displayed. This should also fix the list
7063 of labels in the "Insert Crossreference" dialog.
7065 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7067 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7068 when regex was not found.
7070 * src/support/lstrings.C (lowercase): use handcoded transform always.
7073 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7074 old_cursor.par->prev could be 0.
7076 * several files: changed post inc/dec to pre inc/dec
7078 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7079 write the lastfiles to file.
7081 * src/BufferView.C (buffer): only show TextCache info when debugging
7083 (resizeCurrentBuffer): ditto
7084 (workAreaExpose): ditto
7086 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7088 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7090 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7091 a bit better by removing the special case for \i and \j.
7093 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7095 * src/lyx_main.C (easyParse): remove test for bad comand line
7096 options, since this broke all xforms-related parsing.
7098 * src/kbmap.C (getsym): set return type to unsigned long, as
7099 declared in header. On an alpha, long is _not_ the same as int.
7101 * src/support/LOstream.h: add a "using std::flush;"
7103 * src/insets/figinset.C: ditto.
7105 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7107 * src/bufferlist.C (write): use blinding fast file copy instead of
7108 "a char at a time", now we are doing it the C++ way.
7110 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7111 std::list<int> instead.
7112 (addpidwait): reflect move to std::list<int>
7113 (sigchldchecker): ditto
7115 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7118 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7119 that obviously was wrong...
7121 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7122 c, this avoids warnings with purify and islower.
7124 * src/insets/figinset.C: rename struct queue to struct
7125 queue_element and rewrite to use a std::queue. gsqueue is now a
7126 std::queue<queue_element>
7127 (runqueue): reflect move to std::queue
7130 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7131 we would get "1" "0" instead of "true" "false. Also make the tostr
7134 2000-01-21 Juergen Vigna <jug@sad.it>
7136 * src/buffer.C (writeFileAscii): Disabled code for special groff
7137 handling of tabulars till I fix this in table.C
7139 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7141 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7143 * src/support/lyxlib.h: ditto.
7145 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7147 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7148 and 'j' look better. This might fix the "macron" bug that has been
7151 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7152 functions as one template function. Delete the old versions.
7154 * src/support/lyxsum.C: move using std::ifstream inside
7157 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7160 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7162 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7164 * src/insets/figinset.C (InitFigures): use new instead of malloc
7165 to allocate memory for figures and bitmaps.
7166 (DoneFigures): use delete[] instead of free to deallocate memory
7167 for figures and bitmaps.
7168 (runqueue): use new to allocate
7169 (getfigdata): use new/delete[] instead of malloc/free
7170 (RegisterFigure): ditto
7172 * some files: moved some declarations closer to first use, small
7173 whitespace changes use preincrement instead of postincrement where
7174 it does not make a difference.
7176 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7177 step on the way to use stl::containers for key maps.
7179 * src/bufferlist.h: add a typedef for const_iterator and const
7180 versions of begin and end.
7182 * src/bufferlist.[Ch]: change name of member variable _state to
7183 state_. (avoid reserved names)
7185 (getFileNames): returns the filenames of the buffers in a vector.
7187 * configure.in (ALL_LINGUAS): added ro
7189 * src/support/putenv.C: new file
7191 * src/support/mkdir.C: new file
7193 2000-01-20 Allan Rae <rae@lyx.org>
7195 * lib/layouts/IEEEtran.layout: Added several theorem environments
7197 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7198 couple of minor additions.
7200 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7201 (except for those in footnotes of course)
7203 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7205 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7207 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7208 std::sort and std::lower_bound instead of qsort and handwritten
7210 (struct compara): struct that holds the functors used by std::sort
7211 and std::lower_bound in MathedLookupBOP.
7213 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7215 * src/support/LAssert.h: do not do partial specialization. We do
7218 * src/support/lyxlib.h: note that lyx::getUserName() and
7219 lyx::date() are not in use right now. Should these be suppressed?
7221 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7222 (makeLinuxDocFile): do not put date and user name in linuxdoc
7225 * src/support/lyxlib.h (kill): change first argument to long int,
7226 since that's what solaris uses.
7228 * src/support/kill.C (kill): fix declaration to match prototype.
7230 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7231 actually check whether namespaces are supported. This is not what
7234 * src/support/lyxsum.C: add a using directive.
7236 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7238 * src/support/kill.C: if we have namespace support we don't have
7239 to include lyxlib.h.
7241 * src/support/lyxlib.h: use namespace lyx if supported.
7243 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7245 * src/support/date.C: new file
7247 * src/support/chdir.C: new file
7249 * src/support/getUserName.C: new file
7251 * src/support/getcwd.C: new file
7253 * src/support/abort.C: new file
7255 * src/support/kill.C: new file
7257 * src/support/lyxlib.h: moved all the functions in this file
7258 insede struct lyx. Added also kill and abort to this struct. This
7259 is a way to avoid the "kill is not defined in <csignal>", we make
7260 C++ wrappers for functions that are not ANSI C or ANSI C++.
7262 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7263 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7264 lyx it has been renamed to sum.
7266 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7268 * src/text.C: add using directives for std::min and std::max.
7270 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7272 * src/texrow.C (getIdFromRow): actually return something useful in
7273 id and pos. Hopefully fixes the bug with positionning of errorbox
7276 * src/lyx_main.C (easyParse): output an error and exit if an
7277 incorrect command line option has been given.
7279 * src/spellchecker.C (ispell_check_word): document a memory leak.
7281 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7282 where a "struct utimbuf" is allocated with "new" and deleted with
7285 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7287 * src/text2.C (CutSelection): don't delete double spaces.
7288 (PasteSelection): ditto
7289 (CopySelection): ditto
7291 * src/text.C (Backspace): don't delete double spaces.
7293 * src/lyxlex.C (next): fix a bug that were only present with
7294 conformant std::istream::get to read comment lines, use
7295 std::istream::getline instead. This seems to fix the problem.
7297 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7299 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7300 allowed to insert space before space" editing problem. Please read
7301 commends at the beginning of the function. Comments about usage
7304 * src/text.C (InsertChar): fix for the "not allowed to insert
7305 space before space" editing problem.
7307 * src/text2.C (DeleteEmptyParagraphMechanism): when
7308 IsEmptyTableRow can only return false this last "else if" will
7309 always be a no-op. Commented out.
7311 * src/text.C (RedoParagraph): As far as I can understand tmp
7312 cursor is not really needed.
7314 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7315 present it could only return false anyway.
7316 (several functions): Did something not so smart...added a const
7317 specifier on a lot of methods.
7319 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7320 and add a tmp->text.resize. The LyXParagraph constructor does the
7322 (BreakParagraphConservative): ditto
7324 * src/support/path.h (Path): add a define so that the wrong usage
7325 "Path("/tmp") will be flagged as a compilation error:
7326 "`unnamed_Path' undeclared (first use this function)"
7328 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7330 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7331 which was bogus for several reasons.
7333 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7337 * autogen.sh: do not use "type -path" (what's that anyway?).
7339 * src/support/filetools.C (findtexfile): remove extraneous space
7340 which caused a kpsewhich warning (at least with kpathsea version
7343 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7345 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7347 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7349 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7351 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7353 * src/paragraph.C (BreakParagraph): do not reserve space on text
7354 if we don't need to (otherwise, if pos_end < pos, we end up
7355 reserving huge amounts of memory due to bad unsigned karma).
7356 (BreakParagraphConservative): ditto, although I have not seen
7357 evidence the bug can happen here.
7359 * src/lyxparagraph.h: add a using std::list.
7361 2000-01-11 Juergen Vigna <jug@sad.it>
7363 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7366 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7368 * src/vc-backend.C (doVCCommand): change to be static and take one
7369 more parameter: the path to chdir too be fore executing the command.
7370 (retrive): new function equiv to "co -r"
7372 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7373 file_not_found_hook is true.
7375 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7377 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7378 if a file is readwrite,readonly...anything else.
7380 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7382 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7383 (CreatePostscript): name change from MenuRunDVIPS (or something)
7384 (PreviewPostscript): name change from MenuPreviewPS
7385 (PreviewDVI): name change from MenuPreviewDVI
7387 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7388 \view_pdf_command., \pdf_to_ps_command
7390 * lib/configure.m4: added search for PDF viewer, and search for
7391 PDF to PS converter.
7392 (lyxrc.defaults output): add \pdflatex_command,
7393 \view_pdf_command and \pdf_to_ps_command.
7395 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7397 * src/bufferlist.C (write): we don't use blocksize for anything so
7400 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7402 * src/support/block.h: disable operator T* (), since it causes
7403 problems with both compilers I tried. See comments in the file.
7405 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7408 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7409 variable LYX_DIR_10x to LYX_DIR_11x.
7411 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7413 * INSTALL: document --with-lyxname.
7416 * configure.in: new configure flag --with-lyxname which allows to
7417 choose the name under which lyx is installed. Default is "lyx", of
7418 course. It used to be possible to do this with --program-suffix,
7419 but the later has in fact a different meaning for autoconf.
7421 * src/support/lstrings.h (lstrchr): reformat a bit.
7423 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7424 * src/mathed/math_defs.h: ditto.
7426 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7428 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7429 true, decides if we create a backup file or not when saving. New
7430 tag and variable \pdf_mode, defaults to false. New tag and
7431 variable \pdflatex_command, defaults to pdflatex. New tag and
7432 variable \view_pdf_command, defaults to xpdf. New tag and variable
7433 \pdf_to_ps_command, defaults to pdf2ps.
7435 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7437 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7438 does not have a BufferView.
7439 (unlockInset): ditto + don't access the_locking_inset if the
7440 buffer does not have a BufferView.
7442 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7443 certain circumstances so that we don't continue a keyboard
7444 operation long after the key was released. Try f.ex. to load a
7445 large document, press PageDown for some seconds and then release
7446 it. Before this change the document would contine to scroll for
7447 some time, with this change it stops imidiatly.
7449 * src/support/block.h: don't allocate more space than needed. As
7450 long as we don't try to write to the arr[x] in a array_type arr[x]
7451 it is perfectly ok. (if you write to it you might segfault).
7452 added operator value_type*() so that is possible to pass the array
7453 to functions expecting a C-pointer.
7455 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7458 * intl/*: updated to gettext 0.10.35, tried to add our own
7459 required modifications. Please verify.
7461 * po/*: updated to gettext 0.10.35, tried to add our own required
7462 modifications. Please verify.
7464 * src/support/lstrings.C (tostr): go at fixing the problem with
7465 cxx and stringstream. When stringstream is used return
7466 oss.str().c_str() so that problems with lyxstring and basic_string
7467 are avoided. Note that the best solution would be for cxx to use
7468 basic_string all the way, but it is not conformant yet. (it seems)
7470 * src/lyx_cb.C + other files: moved several global functions to
7471 class BufferView, some have been moved to BufferView.[Ch] others
7472 are still located in lyx_cb.C. Code changes because of this. (part
7473 of "get rid of current_view project".)
7475 * src/buffer.C + other files: moved several Buffer functions to
7476 class BufferView, the functions are still present in buffer.C.
7477 Code changes because of this.
7479 * config/lcmessage.m4: updated to most recent. used when creating
7482 * config/progtest.m4: updated to most recent. used when creating
7485 * config/gettext.m4: updated to most recent. applied patch for
7488 * config/gettext.m4.patch: new file that shows what changes we
7489 have done to the local copy of gettext.m4.
7491 * config/libtool.m4: new file, used in creation of acinclude.m4
7493 * config/lyxinclude.m4: new file, this is the lyx created m4
7494 macros, used in making acinclude.m4.
7496 * autogen.sh: GNU m4 discovered as a separate task not as part of
7497 the lib/configure creation.
7498 Generate acinlucde from files in config. Actually cat
7499 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7500 easier to upgrade .m4 files that really are external.
7502 * src/Spacing.h: moved using std::istringstream to right after
7503 <sstream>. This should fix the problem seen with some compilers.
7505 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7507 * src/lyx_cb.C: began some work to remove the dependency a lot of
7508 functions have on BufferView::text, even if not really needed.
7509 (GetCurrentTextClass): removed this func, it only hid the
7512 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7513 forgot this in last commit.
7515 * src/Bullet.C (bulletEntry): use static char const *[] for the
7516 tables, becuase of this the return arg had to change to string.
7518 (~Bullet): removed unneeded destructor
7520 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7521 (insetSleep): moved from Buffer
7522 (insetWakeup): moved from Buffer
7523 (insetUnlock): moved from Buffer
7525 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7526 from Buffer to BufferView.
7528 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7530 * config/ltmain.sh: updated to version 1.3.4 of libtool
7532 * config/ltconfig: updated to version 1.3.4 of libtool
7534 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7537 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7538 Did I get that right?
7540 * src/lyxlex.h: add a "using" directive or two.
7541 * src/Spacing.h: ditto.
7542 * src/insets/figinset.C: ditto.
7543 * src/support/filetools.C: ditto.
7544 * src/support/lstrings.C: ditto.
7545 * src/BufferView.C: ditto.
7546 * src/bufferlist.C: ditto.
7547 * src/lyx_cb.C: ditto.
7548 * src/lyxlex.C: ditto.
7550 * NEWS: add some changes for 1.1.4.
7552 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7554 * src/BufferView.C: first go at a TextCache to speed up switching
7557 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7559 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7560 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7561 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7562 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7565 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7566 members of the struct are correctly initialized to 0 (detected by
7568 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7569 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7571 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7572 pidwait, since it was allocated with "new". This was potentially
7573 very bad. Thanks to Michael Schmitt for running purify for us.
7576 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7578 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7580 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7582 1999-12-30 Allan Rae <rae@lyx.org>
7584 * lib/templates/IEEEtran.lyx: minor change
7586 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7587 src/mathed/formula.C (LocalDispatch): askForText changes
7589 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7590 know when a user has cancelled input. Fixes annoying problems with
7591 inserting labels and version control.
7593 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7595 * src/support/lstrings.C (tostr): rewritten to use strstream and
7598 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7600 * src/support/filetools.C (IsFileWriteable): use fstream to check
7601 (IsDirWriteable): use fileinfo to check
7603 * src/support/filetools.h (FilePtr): whole class deleted
7605 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7607 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7609 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7611 * src/bufferlist.C (write): use ifstream and ofstream instead of
7614 * src/Spacing.h: use istrstream instead of sscanf
7616 * src/mathed/math_defs.h: change first arg to istream from FILE*
7618 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7620 * src/mathed/math_parser.C: have yyis to be an istream
7621 (LexGetArg): use istream (yyis)
7623 (mathed_parse): ditto
7624 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7626 * src/mathed/formula.C (Read): rewritten to use istream
7628 * src/mathed/formulamacro.C (Read): rewritten to use istream
7630 * src/lyxlex.h (~LyXLex): deleted desturctor
7631 (getStream): new function, returns an istream
7632 (getFile): deleted funtion
7633 (IsOK): return is.good();
7635 * src/lyxlex.C (LyXLex): delete file and owns_file
7636 (setFile): open an filebuf and assign that to a istream instead of
7638 (setStream): new function, takes an istream as arg.
7639 (setFile): deleted function
7640 (EatLine): rewritten us use istream instead of FILE*
7644 * src/table.C (LyXTable): use istream instead of FILE*
7645 (Read): rewritten to take an istream instead of FILE*
7647 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7649 * src/buffer.C (Dispatch): remove an extraneous break statement.
7651 * src/support/filetools.C (QuoteName): change to do simple
7652 'quoting'. More work is necessary. Also changed to do nothing
7653 under emx (needs fix too).
7654 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7656 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7657 config.h.in to the AC_DEFINE_UNQUOTED() call.
7658 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7659 needs char * as argument (because Solaris 7 declares it like
7662 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7663 remove definition of BZERO.
7665 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7667 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7668 defined, "lyxregex.h" if not.
7670 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7672 (REGEX): new variable that is set to regex.c lyxregex.h when
7673 AM_CONDITIONAL USE_REGEX is set.
7674 (libsupport_la_SOURCES): add $(REGEX)
7676 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7679 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7682 * configure.in: add call to LYX_REGEX
7684 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7685 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7687 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7689 * lib/bind/fi_menus.bind: new file, from
7690 pauli.virtanen@saunalahti.fi.
7692 * src/buffer.C (getBibkeyList): pass the parameter delim to
7693 InsetInclude::getKeys and InsetBibtex::getKeys.
7695 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7696 is passed to Buffer::getBibkeyList
7698 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7699 instead of the hardcoded comma.
7701 * src/insets/insetbib.C (getKeys): make sure that there are not
7702 leading blanks in bibtex keys. Normal latex does not care, but
7703 harvard.sty seems to dislike blanks at the beginning of citation
7704 keys. In particular, the retturn value of the function is
7706 * INSTALL: make it clear that libstdc++ is needed and that gcc
7707 2.7.x probably does not work.
7709 * src/support/filetools.C (findtexfile): make debug message go to
7711 * src/insets/insetbib.C (getKeys): ditto
7713 * src/debug.C (showTags): make sure that the output is correctly
7716 * configure.in: add a comment for TWO_COLOR_ICON define.
7718 * acconfig.h: remove all the entries that already defined in
7719 configure.in or acinclude.m4.
7721 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7722 to avoid user name, date and copyright.
7724 1999-12-21 Juergen Vigna <jug@sad.it>
7726 * src/table.C (Read): Now read bogus row format informations
7727 if the format is < 5 so that afterwards the table can
7728 be read by lyx but without any format-info. Fixed the
7729 crash we experienced when not doing this.
7731 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7733 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7734 (RedoDrawingOfParagraph): ditto
7735 (RedoParagraphs): ditto
7736 (RemoveTableRow): ditto
7738 * src/text.C (Fill): rename arg paperwidth -> paper_width
7740 * src/buffer.C (insertLyXFile): rename var filename -> fname
7741 (writeFile): rename arg filename -> fname
7742 (writeFileAscii): ditto
7743 (makeLaTeXFile): ditto
7744 (makeLinuxDocFile): ditto
7745 (makeDocBookFile): ditto
7747 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7750 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7752 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7755 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7756 compiled by a C compiler not C++.
7758 * src/layout.h (LyXTextClass): added typedef for const_iterator
7759 (LyXTextClassList): added typedef for const_iterator + member
7760 functions begin and end.
7762 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7763 iterators to fill the choice_class.
7764 (updateLayoutChoice): rewritten to use iterators to fill the
7765 layoutlist in the toolbar.
7767 * src/BufferView.h (BufferView::work_area_width): removed unused
7770 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7772 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7773 (sgmlCloseTag): ditto
7775 * src/support/lstrings.h: return type of countChar changed to
7778 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7779 what version of this func to use. Also made to return unsigned int.
7781 * configure.in: call LYX_STD_COUNT
7783 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7784 conforming std::count.
7786 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7788 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7789 and a subscript would give bad display (patch from Dekel Tsur
7790 <dekel@math.tau.ac.il>).
7792 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7794 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7797 * src/chset.h: add a few 'using' directives
7799 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7800 triggered when no buffer is active
7802 * src/layout.C: removed `break' after `return' in switch(), since
7805 * src/lyx_main.C (init): make sure LyX can be ran in place even
7806 when libtool has done its magic with shared libraries. Fix the
7807 test for the case when the system directory has not been found.
7809 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7810 name for the latex file.
7811 (MenuMakeHTML): ditto
7813 * src/buffer.h: add an optional boolean argument, which is passed
7816 1999-12-20 Allan Rae <rae@lyx.org>
7818 * lib/templates/IEEEtran.lyx: small correction and update.
7820 * configure.in: Attempted to use LYX_PATH_HEADER
7822 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7824 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7825 input from JMarc. Now use preprocessor to find the header.
7826 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7827 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7828 LYX_STL_STRING_FWD. See comments in file.
7830 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7832 * The global MiniBuffer * minibuffer variable is dead.
7834 * The global FD_form_main * fd_form_main variable is dead.
7836 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7838 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7840 * src/table.h: add the LOstream.h header
7841 * src/debug.h: ditto
7843 * src/LyXAction.h: change the explaination of the ReadOnly
7844 attribute: is indicates that the function _can_ be used.
7846 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7849 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7851 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7857 * src/paragraph.C (GetWord): assert on pos>=0
7860 * src/support/lyxstring.C: condition the use of an invariant on
7862 * src/support/lyxstring.h: ditto
7864 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7865 Use LAssert.h instead of plain assert().
7867 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7869 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7870 * src/support/filetools.C: ditto
7872 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7875 * INSTALL: document the new configure flags
7877 * configure.in: suppress --with-debug; add --enable-assertions
7879 * acinclude.m4: various changes in alignment of help strings.
7881 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7883 * src/kbmap.C: commented out the use of the hash map in kb_map,
7884 beginning of movement to a stl::container.
7886 * several files: removed code that was not in effect when
7887 MOVE_TEXT was defined.
7889 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7890 for escaping should not be used. We can discuss if the string
7891 should be enclosed in f.ex. [] instead of "".
7893 * src/trans_mgr.C (insert): use the new returned value from
7894 encodeString to get deadkeys and keymaps done correctly.
7896 * src/chset.C (encodeString): changed to return a pair, to tell
7897 what to use if we know the string.
7899 * src/lyxscreen.h (fillArc): new function.
7901 * src/FontInfo.C (resize): rewritten to use more std::string like
7902 structore, especially string::replace.
7904 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7907 * configure.in (chmod +x some scripts): remove config/gcc-hack
7909 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7911 * src/buffer.C (writeFile): change once again the top comment in a
7912 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7913 instead of an hardcoded version number.
7914 (makeDocBookFile): ditto
7916 * src/version.h: add new define LYX_DOCVERSION
7918 * po/de.po: update from Pit Sütterlin
7919 * lib/bind/de_menus.bind: ditto.
7921 * src/lyxfunc.C (Dispatch): call MenuExport()
7922 * src/buffer.C (Dispatch): ditto
7924 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7925 LyXFunc::Dispatch().
7926 (MenuExport): new function, moved from
7927 LyXFunc::Dispatch().
7929 * src/trans_mgr.C (insert): small cleanup
7930 * src/chset.C (loadFile): ditto
7932 * lib/kbd/iso8859-1.cdef: add missing backslashes
7934 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7936 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7937 help with placing the manually drawn accents better.
7939 (Draw): x2 and hg changed to float to minimize rounding errors and
7940 help place the accents better.
7942 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7943 unsigned short to char is just wrong...cast the char to unsigned
7944 char instead so that the two values can compare sanely. This
7945 should also make the display of insetlatexaccents better and
7946 perhaps also some other insets.
7948 (lbearing): new function
7951 1999-12-15 Allan Rae <rae@lyx.org>
7953 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7954 header that provides a wrapper around the very annoying SGI STL header
7957 * src/support/lyxstring.C, src/LString.h:
7958 removed old SGI-STL-compatability attempts.
7960 * configure.in: Use LYX_STL_STRING_FWD.
7962 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7963 stl_string_fwd.h is around and try to determine it's location.
7964 Major improvement over previous SGI STL 3.2 compatability.
7965 Three small problems remain with this function due to my zero
7966 knowledge of autoconf. JMarc and lgb see the comments in the code.
7968 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7970 * src/broken_const.h, config/hack-gcc, config/README: removed
7972 * configure.in: remove --with-gcc-hack option; do not call
7975 * INSTALL: remove documentation of --with-broken-const and
7978 * acconfig.h: remove all trace of BROKEN_CONST define
7980 * src/buffer.C (makeDocBookFile): update version number in output
7982 (SimpleDocBookOnePar): fix an assert when trying to a character
7983 access beyond string length
7986 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7988 * po/de.po: fix the Export menu
7990 * lyx.man: update the description of -dbg
7992 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7993 (commandLineHelp): updated
7994 (easyParse): show list of available debug levels if -dbg is passed
7997 * src/Makefile.am: add debug.C
7999 * src/debug.h: moved some code to debug.C
8001 * src/debug.C: new file. Contains code to set and show debug
8004 * src/layout.C: remove 'break' after 'continue' in switch
8005 statements, since these cannot be reached.
8007 1999-12-13 Allan Rae <rae@lyx.org>
8009 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8010 (in_word_set): hash() -> math_hash()
8012 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8014 * acconfig.h: Added a test for whether we are using exceptions in the
8015 current compilation run. If so USING_EXCEPTIONS is defined.
8017 * config.in: Check for existance of stl_string_fwd.h
8018 * src/LString.h: If compiling --with-included-string and SGI's
8019 STL version 3.2 is present (see above test) we need to block their
8020 forward declaration of string and supply a __get_c_string().
8021 However, it turns out this is only necessary if compiling with
8022 exceptions enabled so I've a bit more to add yet.
8024 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8025 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8026 src/support/LRegex.h, src/undo.h:
8027 Shuffle the order of the included files a little to ensure that
8028 LString.h gets included before anything that includes stl_string_fwd.h
8030 * src/support/lyxstring.C: We need to #include LString.h instead of
8031 lyxstring.h to get the necessary definition of __get_c_string.
8032 (__get_c_string): New function. This is defined static just like SGI's
8033 although why they need to do this I'm not sure. Perhaps it should be
8034 in lstrings.C instead.
8036 * lib/templates/IEEEtran.lyx: New template file.
8038 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8040 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8041 * intl/Makefile.in (MKINSTALLDIRS): ditto
8043 * src/LyXAction.C (init): changed to hold the LFUN data in a
8044 automatic array in stead of in callso to newFunc, this speeds up
8045 compilation a lot. Also all the memory used by the array is
8046 returned when the init is completed.
8048 * a lot of files: compiled with -Wold-style-cast, changed most of
8049 the reported offenders to C++ style casts. Did not change the
8050 offenders in C files.
8052 * src/trans.h (Match): change argument type to unsigned int.
8054 * src/support/DebugStream.C: fix some types on the streambufs so
8055 that it works on a conforming implementation.
8057 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8059 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8061 * src/support/lyxstring.C: remove the inline added earlier since
8062 they cause a bunch of unsatisfied symbols when linking with dec
8063 cxx. Cxx likes to have the body of inlines at the place where they
8066 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8067 accessing negative bounds in array. This fixes the crash when
8068 inserting accented characters.
8069 * src/trans.h (Match): ditto
8071 * src/buffer.C (Dispatch): since this is a void, it should not try
8072 to return anything...
8074 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8076 * src/buffer.h: removed the two friends from Buffer. Some changes
8077 because of this. Buffer::getFileName and Buffer::setFileName
8078 renamed to Buffer::fileName() and Buffer::fileName(...).
8080 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8082 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8083 and Buffer::update(short) to BufferView. This move is currently
8084 controlled by a define MOVE_TEXT, this will be removed when all
8085 shows to be ok. This move paves the way for better separation
8086 between buffer contents and buffer view. One side effect is that
8087 the BufferView needs a rebreak when swiching buffers, if we want
8088 to avoid this we can add a cache that holds pointers to LyXText's
8089 that is not currently in use.
8091 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8094 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8096 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8098 * lyx_main.C: new command line option -x (or --execute) and
8099 -e (or --export). Now direct conversion from .lyx to .tex
8100 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8101 Unfortunately, X is still needed and the GUI pops up during the
8104 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8106 * src/Spacing.C: add a using directive to bring stream stuff into
8108 * src/paragraph.C: ditto
8109 * src/buffer.C: ditto
8111 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8112 from Lars' announcement).
8114 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8115 example files from Tino Meinen.
8117 1999-12-06 Allan Rae <rae@lyx.org>
8119 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8121 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8123 * src/support/lyxstring.C: added a lot of inline for no good
8126 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8127 latexWriteEndChanges, they were not used.
8129 * src/layout.h (operator<<): output operator for PageSides
8131 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8133 * some example files: loaded in LyX 1.0.4 and saved again to update
8134 certain constructs (table format)
8136 * a lot of files: did the change to use fstream/iostream for all
8137 writing of files. Done with a close look at Andre Poenitz's patch.
8139 * some files: whitespace changes.
8141 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8143 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8144 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8145 architecture, we provide our own. It is used unconditionnally, but
8146 I do not think this is a performance problem. Thanks to Angus
8147 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8148 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8150 (GetInset): use my_memcpy.
8154 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8155 it is easier to understand, but it uses less TeX-only constructs now.
8157 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8158 elements contain spaces
8160 * lib/configure: regenerated
8162 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8163 elements contain spaces; display the list of programs that are
8166 * autogen.sh: make sure lib/configure is executable
8168 * lib/examples/*: rename the tutorial examples to begin with the
8169 two-letters language code.
8171 * src/lyxfunc.C (getStatus): do not query current font if no
8174 * src/lyx_cb.C (RunScript): use QuoteName
8175 (MenuRunDvips): ditto
8176 (PrintApplyCB): ditto
8178 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8179 around argument, so that it works well with the current shell.
8180 Does not work properly with OS/2 shells currently.
8182 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8183 * src/LyXSendto.C (SendtoApplyCB): ditto
8184 * src/lyxfunc.C (Dispatch): ditto
8185 * src/buffer.C (runLaTeX): ditto
8186 (runLiterate): ditto
8187 (buildProgram): ditto
8189 * src/lyx_cb.C (RunScript): ditto
8190 (MenuMakeLaTeX): ditto
8192 * src/buffer.h (getLatexName): new method
8194 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8196 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8198 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8199 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8200 (create_math_panel): ditto
8202 * src/lyxfunc.C (getStatus): re-activate the code which gets
8203 current font and cursor; add test for export to html.
8205 * src/lyxrc.C (read): remove unreachable break statements; add a
8208 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8210 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8212 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8213 introduced by faulty regex.
8214 * src/buffer.C: ditto
8215 * src/lastfiles.C: ditto
8216 * src/paragraph.C: ditto
8217 * src/table.C: ditto
8218 * src/vspace.C: ditto
8219 * src/insets/figinset.C: ditto
8220 Note: most of these is absolutely harmless, except the one in
8221 src/mathed formula.C.
8223 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8225 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8226 operation, yielding correct results for the reLyX command.
8228 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8230 * src/support/filetools.C (ExpandPath): removed an over eager
8232 (ReplaceEnvironmentPath): ditto
8234 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8235 shows that we are doing something fishy in our code...
8239 * src/lyxrc.C (read): use a double switch trick to get more help
8240 from the compiler. (the same trick is used in layout.C)
8241 (write): new function. opens a ofstream and pass that to output
8242 (output): new function, takes a ostream and writes the lyxrc
8243 elemts to it. uses a dummy switch to make sure no elements are
8246 * src/lyxlex.h: added a struct pushpophelper for use in functions
8247 with more than one exit point.
8249 * src/lyxlex.[Ch] (GetInteger): made it const
8253 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8255 * src/layout.[hC] : LayoutTags splitted into several enums, new
8256 methods created, better error handling cleaner use of lyxlex. Read
8259 * src/bmtable.[Ch]: change some member prototypes because of the
8260 image const changes.
8262 * commandtags.h, src/LyXAction.C (init): new function:
8263 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8264 This file is not read automatically but you can add \input
8265 preferences to your lyxrc if you want to. We need to discuss how
8268 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8269 in .aux, also remove .bib and .bst files from dependencies when
8272 * src/BufferView.C, src/LyXView.C: add const_cast several places
8273 because of changes to images.
8275 * lib/images/*: same change as for images/*
8277 * lib/lyxrc.example: Default for accept_compound is false not no.
8279 * images/*: changed to be const, however I have som misgivings
8280 about this change so it might be changed back.
8282 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8284 * lib/configure, po/POTFILES.in: regenerated
8286 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8288 * config/lib_configure.m4: removed
8290 * lib/configure.m4: new file (was config/lib_configure.m4)
8292 * configure.in: do not test for rtti, since we do not use it.
8294 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8296 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8297 doubling of allocated space scheme. This makes it faster for large
8298 strings end to use less memory for small strings. xtra rememoved.
8300 * src/insets/figinset.C (waitalarm): commented out.
8301 (GhostscriptMsg): use static_cast
8302 (GhostscriptMsg): use new instead of malloc to allocate memory for
8303 cmap. also delete the memory after use.
8305 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8307 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8308 for changes in bibtex database or style.
8309 (runBibTeX): remove all .bib and .bst files from dep before we
8311 (run): use scanAuc in when dep file already exist.
8313 * src/DepTable.C (remove_files_with_extension): new method
8316 * src/DepTable.[Ch]: made many of the methods const.
8318 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8320 * src/bufferparams.C: make sure that the default textclass is
8321 "article". It used to be the first one by description order, but
8322 now the first one is "docbook".
8324 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8325 string; call Debug::value.
8326 (easyParse): pass complete argument to setDebuggingLevel().
8328 * src/debug.h (value): fix the code that parses debug levels.
8330 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8333 * src/LyXAction.C: use Debug::ACTION as debug channel.
8335 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8337 * NEWS: updated for the future 1.1.3 release.
8339 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8340 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8341 it should. This is of course a controversial change (since many
8342 people will find that their lyx workscreen is suddenly full of
8343 red), but done for the sake of correctness.
8345 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8346 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8348 * src/insets/inseterror.h, src/insets/inseturl.h,
8349 src/insets/insetinfo.h, src/insets/figinset.h,
8350 src/mathed/formulamacro.h, src/mathed/math_macro.h
8351 (EditMessage): add a missing const and add _() to make sure that
8354 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8355 src/insets/insetbib.C, src/support/filetools.C: add `using'
8358 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8359 doing 'Insert index of last word' at the beginning of a paragraph.
8361 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8363 * several files: white-space changes.
8365 * src/mathed/formula.C: removed IsAlpha and IsDigit
8367 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8368 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8371 * src/insets/figinset.C (GetPSSizes): don't break when
8372 "EndComments" is seen. But break when a boundingbox is read.
8374 * all classes inherited from Inset: return value of Clone
8375 changed back to Inset *.
8377 * all classes inherited form MathInset: return value of Clone
8378 changed back to MathedInset *.
8380 * src/insets/figinset.C (runqueue): use a ofstream to output the
8381 gs/ps file. Might need some setpresicion or setw. However I can
8382 see no problem with the current code.
8383 (runqueue): use sleep instead of the alarm/signal code. I just
8384 can't see the difference.
8386 * src/paragraph.C (LyXParagraph): reserve space in the new
8387 paragraph and resize the inserted paragraph to just fit.
8389 * src/lyxfunc.h (operator|=): added operator for func_status.
8391 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8392 check for readable file.
8394 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8395 check for readable file.
8396 (MenuMakeLinuxDoc): ditto
8397 (MenuMakeDocBook): ditto
8398 (MenuMakeAscii): ditto
8399 (InsertAsciiFile): split the test for openable and readable
8401 * src/bmtable.C (draw_bitmaptable): use
8402 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8404 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8405 findtexfile from LaTeX to filetools.
8407 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8408 instead of FilePtr. Needs to be verified by a literate user.
8410 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8412 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8413 (EditMessage): likewise.
8415 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8416 respectively as \textasciitilde and \textasciicircum.
8418 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8420 * src/support/lyxstring.h: made the methods that take iterators
8423 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8424 (regexMatch): made is use the real regex class.
8426 * src/support/Makefile.am: changed to use libtool
8428 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8430 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8432 (MathIsInset ++): changed several macros to be inline functions
8435 * src/mathed/Makefile.am: changed to use libtool
8437 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8439 * src/insets/inset* : Clone changed to const and return type is
8440 the true insettype not just Inset*.
8442 * src/insets/Makefile.am: changed to use libtool
8444 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8446 * src/undo.[Ch] : added empty() and changed some of the method
8449 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8451 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8452 setID use block<> for the bullets array, added const several places.
8454 * src/lyxfunc.C (getStatus): new function
8456 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8457 LyXAction, added const to several funtions.
8459 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8460 a std::map, and to store the dir items in a vector.
8462 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8465 * src/LyXView.[Ch] + other files : changed currentView to view.
8467 * src/LyXAction.[Ch] : ported from the old devel branch.
8469 * src/.cvsignore: added .libs and a.out
8471 * configure.in : changes to use libtool.
8473 * acinclude.m4 : inserted libtool.m4
8475 * .cvsignore: added libtool
8477 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8479 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8480 file name in insets and mathed directories (otherwise the
8481 dependency is not taken in account under cygwin).
8483 * src/text2.C (InsertString[AB]): make sure that we do not try to
8484 read characters past the string length.
8486 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8488 * lib/doc/LaTeXConfig.lyx.in,
8489 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8491 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8492 file saying who created them and when this heppened; this is
8493 useless and annoys tools like cvs.
8495 * lib/layouts/g-brief-{en,de}.layout,
8496 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8497 from Thomas Hartkens <thomas@hartkens.de>.
8499 * src/{insets,mathed}/Makefile.am: do not declare an empty
8500 LDFLAGS, so that it can be set at configure time (useful on Irix
8503 * lib/reLyX/configure.in: make sure that the prefix is set
8504 correctly in LYX_DIR.
8506 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8508 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8509 be used by 'command-sequence' this allows to bind a key to a
8510 sequence of LyX-commands
8511 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8513 * src/LyXAction.C: add "command-sequence"
8515 * src/LyXFunction.C: handling of "command-sequence"
8517 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8518 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8520 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8522 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8524 * src/buffer.C (writeFile): Do not output a comment giving user
8525 and date at the beginning of a .lyx file. This is useless and
8526 annoys cvs anyway; update version number to 1.1.
8528 * src/Makefile.am (LYX_DIR): add this definition, so that a
8529 default path is hardcoded in LyX.
8531 * configure.in: Use LYX_GNU_GETTEXT.
8533 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8534 AM_GNU_GETTEXT with a bug fixed.
8536 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8538 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8540 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8541 which is used to point to LyX data is now LYX_DIR_11x.
8543 * lyx.man: convert to a unix text file; small updates.
8545 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8547 * src/support/LSubstring.[Ch]: made the second arg of most of the
8548 constructors be a const reference.
8550 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8553 * src/support/lyxstring.[Ch] (swap): added missing member function
8554 and specialization of swap(str, str);
8556 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8558 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8559 trace of the old one.
8561 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8562 put the member definitions in undo.C.
8564 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8565 NEW_TEXT and have now only code that was included when this was
8568 * src/intl.C (LCombo): use static_cast
8570 (DispatchCallback): ditto
8572 * src/definitions.h: removed whole file
8574 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8576 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8577 parsing and stores in a std:map. a regex defines the file format.
8578 removed unneeded members.
8580 * src/bufferparams.h: added several enums from definitions.h here.
8581 Removed unsused destructor. Changed some types to use proper enum
8582 types. use block to have the temp_bullets and user_defined_bullets
8583 and to make the whole class assignable.
8585 * src/bufferparams.C (Copy): removed this functions, use a default
8588 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8591 * src/buffer.C (readLyXformat2): commend out all that have with
8592 oldpapersize to do. also comment out all that hve to do with
8593 insetlatex and insetlatexdel.
8594 (setOldPaperStuff): commented out
8596 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8598 * src/LyXAction.C: remove use of inset-latex-insert
8600 * src/mathed/math_panel.C (button_cb): use static_cast
8602 * src/insets/Makefile.am (insets_o_SOURCES): removed
8605 * src/support/lyxstring.C (helper): use the unsigned long
8606 specifier, UL, instead of a static_cast.
8608 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8610 * src/support/block.h: new file. to be used as a c-style array in
8611 classes, so that the class can be assignable.
8613 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8615 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8616 NULL, make sure to return an empty string (it is not possible to
8617 set a string to NULL).
8619 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8621 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8623 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8625 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8626 link line, so that Irix users (for example) can set it explicitely to
8629 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8630 it can be overidden at make time (static or dynamic link, for
8633 * src/vc-backend.C, src/LaTeXFeatures.h,
8634 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8635 statements to bring templates to global namespace.
8637 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8639 * src/support/lyxstring.C (operator[] const): make it standard
8642 * src/minibuffer.C (Init): changed to reflect that more
8643 information is given from the lyxvc and need not be provided here.
8645 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8647 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8649 * src/LyXView.C (UpdateTimerCB): use static_cast
8650 (KeyPressMask_raw_callback): ditto
8652 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8653 buffer_, a lot of changes because of this. currentBuffer() ->
8654 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8655 also changes to other files because of this.
8657 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8659 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8660 have no support for RCS and partial support for CVS, will be
8663 * src/insets/ several files: changes because of function name
8664 changes in Bufferview and LyXView.
8666 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8668 * src/support/LSubstring.[Ch]: new files. These implement a
8669 Substring that can be very convenient to use. i.e. is this
8671 string a = "Mary had a little sheep";
8672 Substring(a, "sheep") = "lamb";
8673 a is now "Mary has a little lamb".
8675 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8676 out patterns and subpatterns of strings. It is used by LSubstring
8677 and also by vc-backend.C
8679 * src/support/lyxstring.C: went over all the assertions used and
8680 tried to correct the wrong ones and flag which of them is required
8681 by the standard. some bugs found because of this. Also removed a
8682 couple of assertions.
8684 * src/support/Makefile.am (libsupport_a_SOURCES): added
8685 LSubstring.[Ch] and LRegex.[Ch]
8687 * src/support/FileInfo.h: have struct stat buf as an object and
8688 not a pointer to one, some changes because of this.
8690 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8691 information in layout when adding the layouts preamble to the
8694 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8697 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8698 because of bug in OS/2.
8700 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8702 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8703 \verbatim@font instead of \ttfamily, so that it can be redefined.
8705 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8706 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8707 src/layout.h, src/text2.C: add 'using' directive to bring the
8708 STL templates we need from the std:: namespace to the global one.
8709 Needed by DEC cxx in strict ansi mode.
8711 * src/support/LIstream.h,src/support/LOstream.h,
8712 src/support/lyxstring.h,src/table.h,
8713 src/lyxlookup.h: do not include <config.h> in header
8714 files. This should be done in the .C files only.
8716 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8720 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8722 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8723 from Kayvan to fix the tth invokation.
8725 * development/lyx.spec.in: updates from Kayvan to reflect the
8726 changes of file names.
8728 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8730 * src/text2.C (InsertStringB): use std::copy
8731 (InsertStringA): use std::copy
8733 * src/bufferlist.C: use a vector to store the buffers in. This is
8734 an internal change and should not affect any other thing.
8736 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8739 * src/text.C (Fill): fix potential bug, one off bug.
8741 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8743 * src/Makefile.am (lyx_main.o): add more files it depends on.
8745 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8747 * src/support/lyxstring.C: use size_t for the reference count,
8748 size, reserved memory and xtra.
8749 (internal_compare): new private member function. Now the compare
8750 functions should work for std::strings that have embedded '\0'
8752 (compare): all compare functions rewritten to use
8755 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8757 * src/support/lyxstring.C (compare): pass c_str()
8758 (compare): pass c_str
8759 (compare): pass c_str
8761 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8763 * src/support/DebugStream.C: <config.h> was not included correctly.
8765 * lib/configure: forgot to re-generate it :( I'll make this file
8766 auto generated soon.
8768 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8770 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8773 * src/support/lyxstring.C: some changes from length() to rep->sz.
8774 avoids a function call.
8776 * src/support/filetools.C (SpaceLess): yet another version of the
8777 algorithm...now per Jean-Marc's suggestions.
8779 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8781 * src/layout.C (less_textclass_desc): functor for use in sorting
8783 (LyXTextClass::Read): sort the textclasses after reading.
8785 * src/support/filetools.C (SpaceLess): new version of the
8786 SpaceLess functions. What problems does this one give? Please
8789 * images/banner_bw.xbm: made the arrays unsigned char *
8791 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8793 * src/support/lyxstring.C (find): remove bogus assertion in the
8794 two versions of find where this has not been done yet.
8796 * src/support/lyxlib.h: add missing int return type to
8799 * src/menus.C (ShowFileMenu): disable exporting to html if no
8800 html export command is present.
8802 * config/lib_configure.m4: add a test for an HTML converter. The
8803 programs checked for are, in this order: tth, latex2html and
8806 * lib/configure: generated from config/lib_configure.m4.
8808 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8809 html converter. The parameters are now passed through $$FName and
8810 $$OutName, instead of standard input/output.
8812 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8814 * lib/lyxrc.example: update description of \html_command.
8815 add "quotes" around \screen_font_xxx font setting examples to help
8816 people who use fonts with spaces in their names.
8818 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8820 * Distribution files: updates for v1.1.2
8822 * src/support/lyxstring.C (find): remove bogus assert and return
8823 npos for the same condition.
8825 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8827 * added patch for OS/2 from SMiyata.
8829 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8831 * src/text2.C (CutSelection): make space_wrapped a bool
8832 (CutSelection): dont declare int i until we have to.
8833 (alphaCounter): return a char const *.
8835 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8837 * src/support/syscall.C (Systemcalls::kill):
8838 src/support/filetools.C (PutEnv, PutEnvPath):
8839 src/lyx_cb.C (addNewlineAndDepth):
8840 src/FontInfo.C (FontInfo::resize): condition some #warning
8841 directives with WITH_WARNINGS.
8844 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8846 * src/layout.[Ch] + several files: access to class variables
8847 limited and made accessor functions instead a lot of code changed
8848 becuase of this. Also instead of returning pointers often a const
8849 reference is returned instead.
8851 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8853 * src/Makefile.am (dist-hook): added used to remove the CVS from
8854 cheaders upon creating a dist
8855 (EXTRA_DIST): added cheaders
8857 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8858 a character not as a small integer.
8860 * src/support/lyxstring.C (find): removed Assert and added i >=
8861 rep->sz to the first if.
8863 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8865 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8866 src/LyXView.C src/buffer.C src/bufferparams.C
8867 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8868 src/text2.C src/insets/insetinclude.C:
8869 lyxlayout renamed to textclasslist.
8871 * src/layout.C: some lyxerr changes.
8873 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8874 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8875 (LyXLayoutList): removed all traces of this class.
8876 (LyXTextClass::Read): rewrote LT_STYLE
8877 (LyXTextClass::hasLayout): new function
8878 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8879 both const and nonconst version.
8880 (LyXTextClass::delete_layout): new function.
8881 (LyXTextClassList::Style): bug fix. do the right thing if layout
8883 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8884 (LyXTextClassList::NameOfLayout): ditto
8885 (LyXTextClassList::Load): ditto
8887 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8889 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8891 * src/LyXAction.C (LookupFunc): added a workaround for sun
8892 compiler, on the other hand...we don't know if the current code
8893 compiles on sun at all...
8895 * src/support/filetools.C (CleanupPath): subst fix
8897 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8900 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8901 complained about this one?
8903 * src/insets/insetinclude.C (Latex): subst fix
8905 * src/insets/insetbib.C (getKeys): subst fix
8907 * src/LyXSendto.C (SendtoApplyCB): subst fix
8909 * src/lyx_main.C (init): subst fix
8911 * src/layout.C (Read): subst fix
8913 * src/lyx_sendfax_main.C (button_send): subst fix
8915 * src/buffer.C (RoffAsciiTable): subst fix
8917 * src/lyx_cb.C (MenuFax): subst fix
8918 (PrintApplyCB): subst fix
8920 1999-10-26 Juergen Vigna <jug@sad.it>
8922 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8924 (Read): Cleaned up this code so now we read only format vestion >= 5
8926 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8928 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8929 come nobody has complained about this one?
8931 * src/insets/insetinclude.C (Latex): subst fix
8933 * src/insets/insetbib.C (getKeys): subst fix
8935 * src/lyx_main.C (init): subst fix
8937 * src/layout.C (Read): subst fix
8939 * src/buffer.C (RoffAsciiTable): subst fix
8941 * src/lyx_cb.C (MenuFax): subst fix.
8943 * src/layout.[hC] + some other files: rewrote to use
8944 std::container to store textclasses and layouts in.
8945 Simplified, removed a lot of code. Make all classes
8946 assignable. Further simplifications and review of type
8947 use still to be one.
8949 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8950 lastfiles to create the lastfiles partr of the menu.
8952 * src/lastfiles.[Ch]: rewritten to use deque to store the
8953 lastfiles in. Uses fstream for reading and writing. Simplifies
8956 * src/support/syscall.C: remove explicit cast.
8958 * src/BufferView.C (CursorToggleCB): removed code snippets that
8960 use explicat C++ style casts instead of C style casts. also use
8961 u_vdata instea of passing pointers in longs.
8963 * src/PaperLayout.C: removed code snippets that were commented out.
8965 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8967 * src/lyx_main.C: removed code snippets that wer commented out.
8969 * src/paragraph.C: removed code snippets that were commented out.
8971 * src/lyxvc.C (logClose): use static_cast
8973 (viewLog): remove explicit cast to void*
8974 (showLog): removed old commented code
8976 * src/menus.C: use static_cast instead of C style casts. use
8977 u_vdata instead of u_ldata. remove explicit cast to (long) for
8978 pointers. Removed old code that was commented out.
8980 * src/insets/inset.C: removed old commented func
8982 * src/insets/insetref.C (InsetRef): removed old code that had been
8983 commented out for a long time.
8985 (escape): removed C style cast
8987 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8989 * src/insets/insetlatex.C (Draw): removed old commented code
8990 (Read): rewritten to use string
8992 * src/insets/insetlabel.C (escape): removed C style cast
8994 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8996 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8999 * src/insets/insetinclude.h: removed a couple of stupid bools
9001 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9002 (Clone): remove C style cast
9003 (getKeys): changed list to lst because of std::list
9005 * src/insets/inseterror.C (Draw): removed som old commented code.
9007 * src/insets/insetcommand.C (Draw): removed some old commented code.
9009 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9010 commented out forever.
9011 (bibitem_cb): use static_cast instead of C style cast
9012 use of vdata changed to u_vdata.
9014 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9016 (CloseUrlCB): use static_cast instead of C style cast.
9017 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9019 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9020 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9021 (CloseInfoCB): static_cast from ob->u_vdata instead.
9022 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9025 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9026 (C_InsetError_CloseErrorCB): forward the ob parameter
9027 (CloseErrorCB): static_cast from ob->u_vdata instead.
9029 * src/vspace.h: include LString.h since we use string in this class.
9031 * src/vspace.C (lyx_advance): changed name from advance because of
9032 nameclash with stl. And since we cannot use namespaces yet...I
9033 used a lyx_ prefix instead. Expect this to change when we begin
9036 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9038 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9039 and removed now defunct constructor and deconstructor.
9041 * src/BufferView.h: have backstack as a object not as a pointer.
9042 removed initialization from constructor. added include for BackStack
9044 * development/lyx.spec.in (%build): add CFLAGS also.
9046 * src/screen.C (drawFrame): removed another warning.
9048 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9050 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9051 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9052 README and ANNOUNCE a bit for the next release. More work is
9055 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9056 unbreakable if we are in freespacing mode (LyX-Code), but not in
9059 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9061 * src/BackStack.h: fixed initialization order in constructor
9063 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9065 * acinclude.m4 (VERSION): new rules for when a version is
9066 development, added also a variable for prerelease.
9067 (warnings): we set with_warnings=yes for prereleases
9068 (lyx_opt): prereleases compile with same optimization as development
9069 (CXXFLAGS): only use pedantic if we are a development version
9071 * src/BufferView.C (restorePosition): don't do anything if the
9074 * src/BackStack.h: added member empty, use this to test if there
9075 is anything to pop...
9077 1999-10-25 Juergen Vigna <jug@sad.it>
9080 * forms/layout_forms.fd +
9081 * forms/latexoptions.fd +
9082 * lyx.fd: changed for various form resize issues
9084 * src/mathed/math_panel.C +
9085 * src/insets/inseterror.C +
9086 * src/insets/insetinfo.C +
9087 * src/insets/inseturl.C +
9088 * src/insets/inseturl.h +
9091 * src/PaperLayout.C +
9092 * src/ParagraphExtra.C +
9093 * src/TableLayout.C +
9095 * src/layout_forms.C +
9102 * src/menus.C: fixed various resize issues. So now forms can be
9103 resized savely or not be resized at all.
9105 * forms/form_url.fd +
9106 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9109 * src/insets/Makefile.am: added files form_url.[Ch]
9111 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9113 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9114 (and presumably 6.2).
9116 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9117 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9118 remaining static member callbacks.
9120 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9123 * src/support/lyxstring.h: declare struct Srep as friend of
9124 lyxstring, since DEC cxx complains otherwise.
9126 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9128 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9130 * src/LaTeX.C (run): made run_bibtex also depend on files with
9132 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9133 are put into the dependency file.
9135 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9136 the code has shown itself to work
9137 (create_ispell_pipe): removed another warning, added a comment
9140 * src/minibuffer.C (ExecutingCB): removed code that has been
9141 commented out a long time
9143 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9144 out code + a warning.
9146 * src/support/lyxstring.h: comment out the three private
9147 operators, when compiling with string ansi conforming compilers
9150 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9152 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9153 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9156 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9159 * src/mathed/math_panel.C (create_math_panel): remove explicit
9162 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9165 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9166 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9167 to XCreatePixmapFromBitmapData
9168 (fl_set_bmtable_data): change the last argument to be unsigned
9170 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9171 and bh to be unsigned int, remove explicit casts in call to
9172 XReadBitmapFileData.
9174 * images/arrows.xbm: made the arrays unsigned char *
9175 * images/varsz.xbm: ditto
9176 * images/misc.xbm: ditto
9177 * images/greek.xbm: ditto
9178 * images/dots.xbm: ditto
9179 * images/brel.xbm: ditto
9180 * images/bop.xbm: ditto
9182 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9184 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9185 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9186 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9188 (LYX_CXX_CHEADERS): added <clocale> to the test.
9190 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9192 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9194 * src/support/lyxstring.C (append): fixed something that must be a
9195 bug, rep->assign was used instead of rep->append.
9197 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9200 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9201 lyx insert double chars. Fix spotted by Kayvan.
9203 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9205 * Fixed the tth support. I messed up with the Emacs patch apply feature
9206 and omitted the changes in lyxrc.C.
9208 1999-10-22 Juergen Vigna <jug@sad.it>
9210 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9212 * src/lyx_cb.C (MenuInsertRef) +
9213 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9214 the form cannot be resized under it limits (fixes a segfault)
9216 * src/lyx.C (create_form_form_ref) +
9217 * forms/lyx.fd: Changed Gravity on name input field so that it is
9220 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9222 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9223 <ostream> and <istream>.
9225 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9226 whether <fstream> provides the latest standard features, or if we
9227 have an oldstyle library (like in egcs).
9228 (LYX_CXX_STL_STRING): fix the test.
9230 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9231 code on MODERN_STL_STREAM.
9233 * src/support/lyxstring.h: use L{I,O}stream.h.
9235 * src/support/L{I,O}stream.h: new files, designed to setup
9236 correctly streams for our use
9237 - includes the right header depending on STL capabilities
9238 - puts std::ostream and std::endl (for LOStream.h) or
9239 std::istream (LIStream.h) in toplevel namespace.
9241 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9243 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9244 was a bib file that had been changed we ensure that bibtex is run.
9245 (runBibTeX): enhanced to extract the names of the bib files and
9246 getting their absolute path and enter them into the dep file.
9247 (findtexfile): static func that is used to look for tex-files,
9248 checks for absolute patchs and tries also with kpsewhich.
9249 Alternative ways of finding the correct files are wanted. Will
9251 (do_popen): function that runs a command using popen and returns
9252 the whole output of that command in a string. Should be moved to
9255 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9256 file with extension ext has changed.
9258 * src/insets/figinset.C: added ifdef guards around the fl_free
9259 code that jug commented out. Now it is commented out when
9260 compiling with XForms == 0.89.
9262 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9263 to lyxstring.C, and only keep a forward declaration in
9264 lyxstring.h. Simplifies the header file a bit and should help a
9265 bit on compile time too. Also changes to Srep will not mandate a
9266 recompile of code just using string.
9267 (~lyxstring): definition moved here since it uses srep.
9268 (size): definition moved here since it uses srep.
9270 * src/support/lyxstring.h: removed a couple of "inline" that should
9273 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9275 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9278 1999-10-21 Juergen Vigna <jug@sad.it>
9280 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9281 set to left if I just remove the width entry (or it is empty).
9283 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9284 paragraph when having dummy paragraphs.
9286 1999-10-20 Juergen Vigna <jug@sad.it>
9288 * src/insets/figinset.C: just commented some fl_free_form calls
9289 and added warnings so that this calls should be activated later
9290 again. This avoids for now a segfault, but we have a memory leak!
9292 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9293 'const char * argument' to 'string argument', this should
9294 fix some Asserts() in lyxstring.C.
9296 * src/lyxfunc.h: Removed the function argAsString(const char *)
9297 as it is not used anymore.
9299 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9301 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9304 * src/Literate.h: some funcs moved from public to private to make
9305 interface clearer. Unneeded args removed.
9307 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9309 (scanBuildLogFile): ditto
9311 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9312 normal TeX Error. Still room for improvement.
9314 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9316 * src/buffer.C (insertErrors): changes to make the error
9317 desctription show properly.
9319 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9322 * src/support/lyxstring.C (helper): changed to use
9323 sizeof(object->rep->ref).
9324 (operator>>): changed to use a pointer instead.
9326 * src/support/lyxstring.h: changed const reference & to value_type
9327 const & lets see if that helps.
9329 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9331 * Makefile.am (rpmdist): fixed to have non static package and
9334 * src/support/lyxstring.C: removed the compilation guards
9336 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9339 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9340 conditional compile of lyxstring.Ch
9342 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9343 stupid check, but it is a lot better than the bastring hack.
9344 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9346 * several files: changed string::erase into string::clear. Not
9349 * src/chset.C (encodeString): use a char temporary instead
9351 * src/table.C (TexEndOfCell): added tostr around
9352 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9353 (TexEndOfCell): ditto
9354 (TexEndOfCell): ditto
9355 (TexEndOfCell): ditto
9356 (DocBookEndOfCell): ditto
9357 (DocBookEndOfCell): ditto
9358 (DocBookEndOfCell): ditto
9359 (DocBookEndOfCell): ditto
9361 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9363 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9365 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9366 (MenuBuildProg): added tostr around ret
9367 (MenuRunChktex): added tostr around ret
9368 (DocumentApplyCB): added tostr around ret
9370 * src/chset.C (encodeString): added tostr around t->ic
9372 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9373 (makeLaTeXFile): added tostr around tocdepth
9374 (makeLaTeXFile): added tostr around ftcound - 1
9376 * src/insets/insetbib.C (setCounter): added tostr around counter.
9378 * src/support/lyxstring.h: added an operator+=(int) to catch more
9381 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9382 (lyxstring): We DON'T allow NULL pointers.
9384 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9386 * src/mathed/math_macro.C (MathMacroArgument::Write,
9387 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9388 when writing them out.
9390 * src/LString.C: remove, since it is not used anymore.
9392 * src/support/lyxstring.C: condition the content to
9393 USE_INCLUDED_STRING macro.
9395 * src/mathed/math_symbols.C, src/support/lstrings.C,
9396 src/support/lyxstring.C: add `using' directive to specify what
9397 we need in <algorithm>. I do not think that we need to
9398 conditionalize this, but any thought is appreciated.
9400 * many files: change all callback functions to "C" linkage
9401 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9402 strict_ansi. Those who were static are now global.
9403 The case of callbacks which are static class members is
9404 trickier, since we have to make C wrappers around them (see
9405 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9406 did not finish this yet, since it defeats the purpose of
9407 encapsulation, and I am not sure what the best route is.
9409 1999-10-19 Juergen Vigna <jug@sad.it>
9411 * src/support/lyxstring.C (lyxstring): we permit to have a null
9412 pointer as assignment value and just don't assign it.
9414 * src/vspace.C (nextToken): corrected this function substituting
9415 find_first(_not)_of with find_last_of.
9417 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9418 (TableOptCloseCB) (TableSpeCloseCB):
9419 inserted fl_set_focus call for problem with fl_hide_form() in
9422 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9424 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9427 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9429 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9430 LyXLex::next() and not eatline() to get its argument.
9432 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9434 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9435 instead, use fstreams for io of the depfile, removed unneeded
9436 functions and variables.
9438 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9439 vector instead, removed all functions and variables that is not in
9442 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9444 * src/buffer.C (insertErrors): use new interface to TeXError
9446 * Makefile.am (rpmdist): added a rpmdist target
9448 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9449 per Kayvan's instructions.
9451 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9453 * src/Makefile.am: add a definition for localedir, so that locales
9454 are found after installation (Kayvan)
9456 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9458 * development/.cvsignore: new file.
9460 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9462 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9463 C++ compiler provides wrappers for C headers and use our alternate
9466 * configure.in: use LYX_CXX_CHEADERS.
9468 * src/cheader/: new directory, populated with cname headers from
9469 libstdc++-2.8.1. They are a bit old, but probably good enough for
9470 what we want (support compilers who lack them).
9472 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9473 from includes. It turns out is was stupid.
9475 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9477 * lib/Makefile.am (install-data-local): forgot a ';'
9478 (install-data-local): forgot a '\'
9479 (libinstalldirs): needed after all. reintroduced.
9481 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9483 * configure.in (AC_OUTPUT): added lyx.spec
9485 * development/lyx.spec: removed file
9487 * development/lyx.spec.in: new file
9489 * po/*.po: merged with lyx.pot becuase of make distcheck
9491 * lib/Makefile.am (dist-hook): added dist-hook so that
9492 documentation files will be included when doing a make
9493 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9494 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9496 more: tried to make install do the right thing, exclude CVS dirs
9499 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9500 Path would fit in more nicely.
9502 * all files that used to use pathstack: uses now Path instead.
9503 This change was a lot easier than expected.
9505 * src/support/path.h: new file
9507 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9509 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9511 * src/support/lyxstring.C (getline): Default arg was given for
9514 * Configure.cmd: removed file
9516 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9518 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9519 streams classes and types, add the proper 'using' statements when
9520 MODERN_STL is defined.
9522 * src/debug.h: move the << operator definition after the inclusion
9525 * src/support/filetools.C: include "LAssert.h", which is needed
9528 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9531 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9532 include "debug.h" to define a proper ostream.
9534 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9536 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9537 method to the SystemCall class which can kill a process, but it's
9538 not fully implemented yet.
9540 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9542 * src/support/FileInfo.h: Better documentation
9544 * src/lyxfunc.C: Added support for buffer-export html
9546 * src/menus.C: Added Export->As HTML...
9548 * lib/bind/*.bind: Added short-cut for buffer-export html
9550 * src/lyxrc.*: Added support for new \tth_command
9552 * lib/lyxrc.example: Added stuff for new \tth_command
9554 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9556 * lib/Makefile.am (IMAGES): removed images/README
9557 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9558 installes in correct place. Check permisions is installed
9561 * src/LaTeX.C: some no-op changes moved declaration of some
9564 * src/LaTeX.h (LATEX_H): changed include guard name
9566 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9568 * lib/reLyX/Makefile.am: install noweb2lyx.
9570 * lib/Makefile.am: install configure.
9572 * lib/reLyX/configure.in: declare a config aux dir; set package
9573 name to lyx (not sure what the best solution is); generate noweb2lyx.
9575 * lib/layouts/egs.layout: fix the bibliography layout.
9577 1999-10-08 Jürgen Vigna <jug@sad.it>
9579 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9580 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9581 it returned without continuing to search the path.
9583 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9585 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9586 also fixes a bug. It is not allowed to do tricks with std::strings
9587 like: string a("hei"); &a[e]; this will not give what you
9588 think... Any reason for the complexity in this func?
9590 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9592 * Updated README and INSTALL a bit, mostly to check that my
9593 CVS rights are correctly set up.
9595 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9597 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9598 does not allow '\0' chars but lyxstring and std::string does.
9600 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9602 * autogen.sh (AUTOCONF): let the autogen script create the
9603 POTFILES.in file too. POTFILES.in should perhaps now not be
9604 included in the cvs module.
9606 * some more files changed to use C++ includes instead of C ones.
9608 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9610 (Reread): added tostr to nlink. buggy output otherwise.
9611 (Reread): added a string() around szMode when assigning to Buffer,
9612 without this I got a log of garbled info strings.
9614 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9617 * I have added several ostream & operator<<(ostream &, some_type)
9618 functions. This has been done to avoid casting and warnings when
9619 outputting enums to lyxerr. This as thus eliminated a lot of
9620 explicit casts and has made the code clearer. Among the enums
9621 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9622 mathed enums, some font enum the Debug::type enum.
9624 * src/support/lyxstring.h (clear): missing method. equivalent of
9627 * all files that contained "stderr": rewrote constructs that used
9628 stderr to use lyxerr instead. (except bmtable)
9630 * src/support/DebugStream.h (level): and the passed t with
9631 Debug::ANY to avoid spurious bits set.
9633 * src/debug.h (Debug::type value): made it accept strings of the
9636 * configure.in (Check for programs): Added a check for kpsewhich,
9637 the latex generation will use this later to better the dicovery of
9640 * src/BufferView.C (create_view): we don't need to cast this to
9641 (void*) that is done automatically.
9642 (WorkAreaButtonPress): removed some dead code.
9644 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9646 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9647 is not overwritten when translated (David Sua'rez de Lis).
9649 * lib/CREDITS: Added David Sua'rez de Lis
9651 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9653 * src/bufferparams.C (BufferParams): default input encoding is now
9656 * acinclude.m4 (cross_compiling): comment out macro
9657 LYX_GXX_STRENGTH_REDUCE.
9659 * acconfig.h: make sure that const is not defined (to empty) when
9660 we are compiling C++. Remove commented out code using SIZEOF_xx
9663 * configure.in : move the test for const and inline as late as
9664 possible so that these C tests do not interefere with C++ ones.
9665 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9666 has not been proven.
9668 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9670 * src/table.C (getDocBookAlign): remove bad default value for
9673 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9675 (ShowFileMenu2): ditto.
9677 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9680 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9682 * Most files: finished the change from the old error code to use
9683 DebugStream for all lyxerr debugging. Only minor changes remain
9684 (e.g. the setting of debug levels using strings instead of number)
9686 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9688 * src/layout.C (Add): Changed to use compare_no_case instead of
9691 * src/FontInfo.C: changed loop variable type too string::size_type.
9693 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9695 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9696 set ETAGS_ARGS to --c++
9698 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9700 * src/table.C (DocBookEndOfCell): commented out two unused variables
9702 * src/paragraph.C: commented out four unused variables.
9704 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9705 insed a if clause with type string::size_type.
9707 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9710 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9712 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9713 variable, also changed loop to go from 0 to lenght + 1, instead of
9714 -1 to length. This should be correct.
9716 * src/LaTeX.C (scanError): use string::size_type as loop variable
9719 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9720 (l.896) since y_tmp and row was not used anyway.
9722 * src/insets/insetref.C (escape): use string::size_type as loop
9725 * src/insets/insetquotes.C (Width): use string::size_type as loop
9727 (Draw): use string::size_type as loop variable type.
9729 * src/insets/insetlatexaccent.C (checkContents): use
9730 string::size_type as loop variable type.
9732 * src/insets/insetlabel.C (escape): use string::size_type as loop
9735 * src/insets/insetinfo.C: added an extern for current_view.
9737 * src/insets/insetcommand.C (scanCommand): use string::size_type
9738 as loop variable type.
9740 * most files: removed the RCS tags. With them we had to recompile
9741 a lot of files after a simple cvs commit. Also we have never used
9742 them for anything meaningful.
9744 * most files: tags-query-replace NULL 0. As adviced several plases
9745 we now use "0" instead of "NULL" in our code.
9747 * src/support/filetools.C (SpaceLess): use string::size_type as
9750 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9752 * src/paragraph.C: fixed up some more string stuff.
9754 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9756 * src/support/filetools.h: make modestr a std::string.
9758 * src/filetools.C (GetEnv): made ch really const.
9760 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9761 made code that used these use max/min from <algorithm> instead.
9763 * changed several c library include files to their equivalent c++
9764 library include files. All is not changed yet.
9766 * created a support subdir in src, put lyxstring and lstrings
9767 there + the extra files atexit, fileblock, strerror. Created
9768 Makefile.am. edited configure.in and src/Makefile.am to use this
9769 new subdir. More files moved to support.
9771 * imported som of the functions from repository lyx, filetools
9773 * ran tags-query-replace on LString -> string, corrected the bogus
9774 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9775 is still some errors in there. This is errors where too much or
9776 too litle get deleted from strings (string::erase, string::substr,
9777 string::replace), there can also be some off by one errors, or
9778 just plain wrong use of functions from lstrings. Viewing of quotes
9781 * LyX is now running fairly well with string, but there are
9782 certainly some bugs yet (see above) also string is quite different
9783 from LString among others in that it does not allow null pointers
9784 passed in and will abort if it gets any.
9786 * Added the revtex4 files I forgot when setting up the repository.
9788 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9790 * All over: Tried to clean everything up so that only the files
9791 that we really need are included in the cvs repository.
9792 * Switched to use automake.
9793 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9794 * Install has not been checked.
9796 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9798 * po/pt.po: Three errors:
9799 l.533 and l.538 format specification error
9800 l. 402 duplicate entry, I just deleted it.