1 2001-01-04 Juergen Vigna <jug@sad.it>
3 * src/insets/insettabular.C (resetPos): an extra scroll, but we
4 really should redo all this scrolling code!
5 (TabularFeatures): unlock the_locking_inset before add/del rows/colums.
7 * src/text.C (GetVisibleRow): check that y/h values are good otherwise
10 * src/insets/insettabular.C (LocalDispatch): fixes to PASTESELECTION.
11 (pasteSelection): pay attention to multicolumn cells.
12 (calculate_dimensions_of_cells): forgot to reset maxAsc/Desc.
14 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
16 * src/mathed/math_panel.C (deco_cb): check the decoration index is
19 * src/frontends/xforms/FormPreferences.C (feedback): apply
20 formatting to the translated string, not to the original one.
21 (printWarning): ditto.
23 * src/gettext.C (_): translate empty string with empty string.
25 * src/frontends/xforms/FormCopyright.C (build): use _() instead of
30 * UPGRADING: mention that tabular format has been changed.
32 2001-01-03 Juergen Vigna <jug@sad.it>
34 * src/insets/insettabular.C (InsetButtonPress): look for button==2
35 and do Clipboard Paste!
37 * src/insets/insettext.C (SetText): added function.
39 * src/insets/insettabular.C (LocalDispatch): Fixed LFUN_PASTE and
40 new LFUN_PASTESELECTION.
42 * src/insets/insettext.C (draw): don't clear if top_x changes.
44 * src/insets/insettabular.C (draw): clear only if the inset didn't
45 change in the draw routine.
47 * src/insets/insettext.C (width): make the width dependant on the
50 * src/text.C (draw): comment out the UpdateInset call.
52 * src/screen.C (DrawOneRow):
53 (DrawFromTo): check for bv->text->status not text->status.
55 * src/insets/insettabular.C (calculate_dimensions_of_cells): calculate
56 dimensions of ascent-descent for the whole row.
58 * src/insets/insettext.C (draw): check also for need_update == INIT.
60 2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
62 * Makefile.am (EXTRA_DIST): add autogen.sh
64 2001-01-03 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
66 * development/OS2/quick_fix.patch:
67 * lib/configure.cmd: update OS/2 support files.
69 2001-01-02 Juergen Vigna <jug@sad.it>
71 * src/insets/insettabular.C (pasteSelection): rewritten correctly.
73 * src/tabular.C (TeXTopHLine):
74 (TeXBottomHLine): fixed Lars new code.
76 * src/insets/insettext.C (LocalDispatch): added support for math_greek.
78 * src/mathed/math_symbols.C (math_insert_greek): removed current_view
79 from this function and added a BufferView * parameter.
81 * src/mathed/math_symbols.C (math_insert_symbol): ditto
83 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
85 * src/version.h: set to pre3
87 2000-12-31 Lars Gullik Bjønnes <larsbj@lyx.org>
89 * src/Makefile.am (lyx_SOURCES): added Floating.C
91 * src/Floating.h: moved all the inlines to Floating.C
93 * src/Floating.C: new file
95 2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
97 * src/frontends/xforms/FormPreferences.C (feedback): fix
98 description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
100 2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
102 * src/support/FileInfo.h: move unistd.h to after sys/types.h and
105 * src/support/FileInfo.C: don't include sys/types. and sys/stat.h
107 * src/mathed/math_inset.h: move LString.h to be included first
109 * src/insets/insetfloat.C: adjust for change in private variable names
111 * src/frontends/xforms/xform_helpers.h : don't include config.h
113 * src/frontends/xforms/xform_helpers.C: adjust the order of
114 includes, some whitespace changes.
116 * src/trans.C (Load): constify filename and res
118 * src/text2.C (SetCounter): call Floating::name()
120 * src/screen.C: change to not use owner from WorkArea, but from
123 * src/lyxfunc.C: adjust because of changes in Intl.
125 * src/intl.h: make trans a object instead of pointer, inlucd
126 trans_mgr.h in this file.
127 (getTrans): return a reference to TransManager
129 * src/intl.C: don't include trans_mgr.h here
130 modify calls to trans to work on object instead of on pointer
132 * src/WorkArea.h: add using for Signal1
133 comment out forward decl of BufferView.
135 remove class variable owner_ and getter method for this.
137 * src/WorkArea.C: don't include BufferView.h
138 (WorkArea): change to not take a BufferView.h, use signals
140 (scroll_cb): emit signal
142 * src/LaTeXFeatures.C: include Floatlist.h
143 (getPackages): only load float.sty when needed
144 (getMacros): prepare for outputting the correct code to preamble.
146 * src/Floating.h: make all variables private + rename to var_.
147 (Floating): default ctor
148 (Floating): complex ctor to set a complete Floating
154 * src/FloatList.C (FloatList): use Floating's constructor
157 (newFloat): call type()
158 (defaultPlacement): call placement()
159 (operator): new operator
161 * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
162 (scrollUp): call pimpl's scrollCB
164 (pasteClipboard): constify clip
166 * src/BufferView2.C (insertLyXFile): constify fname, fi and c.
167 (insertErrors): constify desctext, errortext, msgtxt and errorrow
168 (open_new_inset): delete some commented code.
170 * src/BufferView.[Ch] (enterView): comment out
173 (workAreaMotionNotify): ditto
174 (workAreaButtonPress): ditto
177 (workAreaButtonRelease): ditto
178 (workAreaExpose): ditto
180 * config/lyxinclude.m4 (cross_compiling): small stuff to be able
181 to compile with cvs gcc (2.97).
183 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
185 * lib/ui/default.ui: menu structure cleanup.
187 * lib/languages: add description of entries.
189 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
191 * src/insets/ExternalTemplate.C (readTemplates): change debug
193 (readTemplate): use lyxlex.printError to report read errors.
196 * src/insets/insetexternal.C (Read): suppress debug message when
199 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
201 * src/insets/insetinclude.C (Ascii): New method. Currently
202 supports only verbatim input.
204 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
206 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
208 2000-12-22 Juergen Vigna <jug@sad.it>
210 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
211 have a selection and button == 3.
212 (UpdateLocal): if what == INIT clear selection if existent!
213 (InsetButtonPress): don't activate the cell inset on button==3
215 (LocalDispatch): move curor up/down if exiting an inset which this
218 2000-12-20 Juergen Vigna <jug@sad.it>
220 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
221 calling for the math-panel (do not unlock the math-inset if locked)!
223 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
224 text-insets (with x-offset).
226 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
227 alignment of multicolumn-cells.
229 2000-12-19 Juergen Vigna <jug@sad.it>
231 * src/lyxfunc.C (Dispatch):
232 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
235 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
237 * src/WorkArea.C (work_area_handler): simplify the key/keysym
238 handling for XForms 0.89, this might have rendered some cases
239 unusable. I have at least deadkeys, accent-xxx and KP_x working.
240 Please report proplems.
242 * src/lyxfunc.C (processKeySym): make the self-insert handling
245 2000-12-18 Baruch Even <baruch.even@writeme.com>
247 * src/LaTeX.C (deplog): fix spelling errors
248 * src/text2.C (CutSelection): ditto
249 * src/lyxfunc.C (Dispatch): ditto
251 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
253 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
255 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
256 and h_align in default init.
257 adjust calls to MathedRowSt
259 * src/mathed/math_iter.C: adjust calls to MathedRowSt
260 * src/mathed/math_iter.h (getAD): ditto
262 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
263 methods setBaseline, ascent, descent
264 (class MathMatrixInset): remove method GetAlign, change h_align
267 * src/lyxfunc.C (processKeySym): discover the correct argument if
268 the action is LFUN_SELFINSERT
270 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
272 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
275 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
277 * src/support/copy.C: don't include filetools.h
279 * lib/images: revert to old banner, drop the cucumber.
281 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
283 * src/converter.C (Formats::View): Change the current directory to
284 the directory of the file.
286 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
288 * src/kbsequence.C (addkey): also clear sequence and modifiers if
291 * src/BufferView2.C (theLockingInset): return 0 if text is 0
293 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
295 * Many files: Fix RTL support for insettext.
297 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
299 * README: add mention of broken ghostscript versions, remove
300 reference to non-existent BUGS file
302 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
304 * src/support/lstrings.C (compare_no_case): small fix. When passed
305 length, should use it in the size comparison.
307 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
309 * src/insets/insetexternal.C (getScreenLabel): Return a default
310 value if the template label is empty.
312 * src/lyxlookup.C: do not condition on FL_REVISION.
315 * src/sp_form.C: fix the font size of some text entries
317 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
318 after TOC when there is no TOC.
320 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
321 bind file if it has not been done yet.
322 (read): remove local bindFile variable. Try to fix the handling of
323 RC_BIND and RC_BINDFILE.
325 * src/lyx_main.C (init): use readBindFileIfNeeded().
327 * lib/languages: Change description of german to "German (new
330 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
332 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
333 "Apply" buttons if arg is non-zero.
335 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
336 launching the popup if sufficient info is passed to
337 LFUN_CITATION_CREATE.
339 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
341 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
342 labels (disabled in 1.1.6).
344 * src/lyxrc.[Ch]: New variable label_init_length
346 * mathed/formula.C (LocalDispatch): Preserve the label when
347 changing from display math to eqnarray (however, the label
348 do not appear at the first line, as one might expects, but at the
350 (LocalDispatch): When inserting a label to a formula which already
351 have a label, the old label is used as default value.
352 Also, if the label is changed, then all references to the label
355 * src/mathed/math_iter.C (setLabel): Allow to set the label
356 even if it is empty. This is needed to allow deletion of a label
359 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
360 refernces only if the old label appears once in the document.
362 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
364 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
365 <gehlert@Rcs1.urz.tu-dresden.de>
367 * src/frontends/xforms/FormBase.C: comment out debug.h
369 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
370 code in xform_helpers instead.
371 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
373 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
374 Use N_(), rather than _() when creating strings to pass to browseFile()
375 because browseFile calls gettext() itself now.
377 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
378 display the filename correctly.
380 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
382 * src/converter.C (Move): New method. Used to move file or files
383 from temp dir to the output dir. (this fixes the bug that
384 exporting linuxdoc/docbook document to html would not move all
385 html file from temp directory).
387 * src/support/filetools.C (DirList): Fixed.
389 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
391 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
393 * src/converter.C (Add): Remove $$i when setting latex_command.
395 * src/text.C (IsBoundary): Return false when pos = 0.
397 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
399 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
401 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
403 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
404 need to empty the fields to turn off use of the geometry package!
406 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
408 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
409 (Buffer const &), not a (BufferParams const &) and so fix a crash
410 caused by using current_view before it had been initialised. Not
411 the best way to do this, but much easier than changing
412 Inset::Clone(Buffer const &) to Inset::Clone().
415 * src/tabular.C: changed call to CopyIntoMinibuffer().
417 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
419 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
421 * src/lyxfunc.C (getStatus): disable insertion of floats in a
424 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
426 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
427 changed filter for screen fonts input filter from int to float
429 * src/frontends/xforms/input_validators.c: removed.
430 * src/frontends/xforms/input_validators.C: new file. Can now call C++
431 functions from within the filter functions.
433 * src/frontends/xforms/input_validators.[Ch]
434 (fl_unsigned_float_filter): new filter function.
436 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
437 confused now! And if you think I'm going to do this in
438 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
440 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
442 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
444 * src/WorkArea.C (work_area_handler): don't handle button requests
445 if xbutton.button == 0
447 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
449 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
450 It creates a lot of interesting problems.
452 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
454 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
455 the menu exists in the current menubar before opening it.
457 * src/MenuBackend.C (hasSubmenu): new method.
459 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
460 action value by offsetting actions by a large constant (so that
461 bogs choice result will be less than this constant).
463 * lib/bind/fi_menus.bind: more cleanup to menus.
464 * lib/bind/sciword.bind: ditto.
465 * lib/bind/xemacs.bind: ditto.
466 * lib/bind/emacs.bind: ditto.
467 * lib/bind/pt_menus.bind: ditto.
468 * lib/bind/hu_menus.bind: ditto.
470 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
472 * INSTALL: update PROBLEMS section.
474 * src/lyxlookup.h: remove condition on xforms version, since we
475 should not include it if not appropriate.
477 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
479 * src/LColor.C: "latex text" -> "latex inset" (from
482 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
484 * src/frontends/kde/FormTabularCreate.C:
485 * src/frontends/kde/citationdlg.C:
486 * src/frontends/kde/copyrightdlg.C:
487 * src/frontends/kde/paradlg.C:
488 * src/frontends/kde/paraextradlg.C:
489 * src/frontends/kde/parageneraldlg.C:
490 * src/frontends/kde/printdlg.C:
491 * src/frontends/kde/refdlg.C:
492 * src/frontends/kde/tabcreatedlg.C:
493 * src/frontends/kde/tocdlg.C:
494 * src/frontends/kde/urldlg.C: add necessary headers
497 * src/frontends/kde/dlg/emptytable.C:
498 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
499 default parameters (from Angus Leeming)
501 * src/frontends/kde/dlg/moc/.cvsignore:
502 * src/frontends/kde/dlg/.cvsignore:
503 * src/frontends/kde/moc/.cvsignore: fix the library name
506 * src/frontends/kde/paradlg.C:
507 * src/frontends/kde/parageneraldlg.C:
508 * src/frontends/kde/dlg/para.dlg:
509 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
511 * src/frontends/kde/dlg/README: clarified qtarch version
513 * src/frontends/kde/dlg/Makefile.am: removed the
514 dlg rules as they created spontaneous rebuilds
515 (not a good idea as it requires qtarch)
517 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
519 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
520 fixlevel along with xforms version.
522 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
523 xforms version is strictly less than 0.89.5.
524 * src/lyx_gui.C (LyXGUI): ditto.
525 * src/LyXView.C (show): ditto.
527 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
529 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
530 movement in inset in RTL text.
531 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
532 (workAreaButtonRelease): Do not open a float when there is a selection.
534 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
536 * src/spellchecker.C (RunSpellChecker): Open all floats before
539 * src/text.C (InsertChar): Consider "," as a part of a number
540 (for LTR numbers in RTL text code).
541 (IsBoundary): Fixed (and simplified).
542 (InsertChar): Recalculate cursor boundary.
545 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
547 * src/spellchecker.C: fix figures with pspell enabled
549 * src/insets/figinset.C: workaround for gs hang xforms bug
551 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
553 * lib/bind/??_menus.bind: comment out the entries corresponding to
554 real menus. They should be eventually removed, but I'll let the
555 language maintainers do that.
557 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
559 * src/frontends/kde/parageneraldlg.C:
560 * src/frontends/kde/parageneraldlg.h: don't use
561 a derived class for SpaceAbove/Below
563 * src/frontends/kde/dlg/README: add some info
565 * src/frontends/kde/dlg/*: update data files, update
568 * src/frontends/kde/dlg/moc/Makefile.am: add
571 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
573 * configure.in: add new KDE Makefiles
574 * src/vspace.h: return GlueLength not a normal one
575 * src/support/lstrings.h:
576 * src/support/lstrings.C: add isStrUnsignedInt(),
579 * src/frontends/kde/*: big reorganisation, update
580 FormParagraph, add FormTabCreate
582 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
584 * lib/ui/default.ui: small grammatical change.
586 * src/frontends/xforms/xform_macros.h: removed.
588 * src/frontends/xforms/FormBase.C:
589 * src/frontends/xforms/FormPreferences.C:
590 * src/frontends/xforms/Makefile.am: changes associated with removing
591 xform_macros.h. Should make Lars' debugging a little easier.
593 * src/frontends/xforms/FormPreferences.C:
594 * src/frontends/xforms/FormPreferences.h:
595 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
596 longer use X11 color name database. HSV and RGB dials/sliders.
597 Please let this be the end of this!
599 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
601 * Several files: Allow compilation when the compiler doesn't
604 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
607 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
608 command line options.
610 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
612 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
613 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
616 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
618 * src/frontends/xforms/FormRef.C (updateBrowser):
619 * src/frontends/xforms/forms/form_ref.fd: try clicking on
620 different insets with the sort key active. Now apply this patch!
622 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
624 * src/frontends/xforms/FormPrint.C: set to valid()
625 when we update from the passed parameters.
627 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
629 * src/LColor.C (getFromGUIName): internationalise the comparison.
631 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
632 FormPreferences choice.
634 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
637 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
639 * src/lyxrc.C: more detail for the printer program config
642 * src/LColor.C: ert->latex text. LColor needs a big revamp
643 but will have to wait till after 1.1.6
645 * src/buffer.C: bring up a dialog if we load a document
646 with an un-installed text class, rather than just complain
649 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
651 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
652 the browser form for a combox in a tabbed folder. Bug fix courtesy of
653 Steve Lamont <spl@ncmir.ucsd.edu>.
655 * src/frontends/xforms/FormDocument.C (build):
656 * src/frontends/xforms/FormPreferences.C (Language::build):
657 pass tabfolders to Combox::add() in order to use this work around.
659 * src/frontends/xforms/FormCitation.C (connect): remove max size
661 (update): sort list of bibliography keys.
663 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
665 No max size limitation. Same popup for new and existing insets. Fixes
666 bugs reported by Rob Lahaye.
668 * src/frontends/xforms/FormCitation.C (c-tor):
669 * src/frontends/xforms/FormCopyright.C (c-tor):
670 * src/frontends/xforms/FormError.C (c-tor):
671 * src/frontends/xforms/FormGraphics.C (c-tor):
672 * src/frontends/xforms/FormIndex.C (c-tor):
673 * src/frontends/xforms/FormRef.C (c-tor):
674 * src/frontends/xforms/FormToc.C (c-tor):
675 * src/frontends/xforms/FormUrl.C (c-tor):
676 use correct policy for ButtonController.
678 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
680 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
683 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
685 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
686 Some resizing changes.
688 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
690 * configure.in: fix typo
692 * lib/languages: add ukraninian and change no to no_NO
694 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
696 * src/bufferview_funcs.C (FontSize): use setLyXSize
698 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
700 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
701 to check for systems where mkstemp() is available but not declared
702 in headers. The new autoconf macro lyx_CHECK_DECL can be used
703 to check for declarations in headers.
705 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
707 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
709 * forms/makefile: added bibforms.fd, include_form.fd.
710 Removed lyx_sendfax.fd.
712 * src/LaTeXLog.C (ShowLatexLog):
713 * src/LyXAction.C (init):
714 * src/bufferparams.C (readLanguage): altered messages as suggested by
717 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
720 * src/credits.C: made fd_form_credits non-static, so that it can be
721 redrawn should the xforms colors be re-mapped.
722 * src/spellchecker.C ditto fd_form_spell_options.
724 * src/filedlg.[Ch] (redraw):
725 * src/intl.[Ch] (redraw):
726 * src/lyxfr0.[Ch] (redraw):
727 * src/insets/figinset.[Ch] (redraw):
728 * src/insets/insetexternal.[Ch] (redraw):
729 new methods, connected to Dialogs::redrawGUI.
731 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
732 to be connected to Dialogs::redrawGUI.
734 * src/frontends/xforms/FormCitation.C (build):
735 * src/frontends/xforms/FormCopyright.C (build):
736 * src/frontends/xforms/FormError.C (build):
737 * src/frontends/xforms/FormGraphics.C (build):
738 * src/frontends/xforms/FormIndex.C (build):
739 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
740 * src/frontends/xforms/FormToc.C (build):
741 * src/frontends/xforms/FormUrl.C (build):
742 use the ButtonController correctly.
744 * src/frontends/xforms/FormCopyright.C (build):
745 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
746 the .fd file and into build().
748 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
750 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
752 * src/frontends/xforms/forms/form_citation.fd:
753 * src/frontends/xforms/forms/form_copyright.fd:
754 * src/frontends/xforms/forms/form_error.fd:
755 * src/frontends/xforms/forms/form_graphics.fd:
756 * src/frontends/xforms/forms/form_index.fd:
757 * src/frontends/xforms/forms/form_toc.fd:
758 * src/frontends/xforms/forms/form_url.fd:
759 renamed some of the objects. Named others explicitly for the first time.
760 Added Restore and Apply buttons where appropriate.
762 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
765 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
767 * src/version.h: try the pre2 again
769 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
771 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
773 * src/frontends/kde/FormParagraph.C: added using directive.
775 * src/frontends/kde/paradlg.C: added config.h and using directive.
777 * src/frontends/kde/paradlg.h: added std::qualifier.
779 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
781 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
783 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
785 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
787 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
789 * src/version.h: set back to 1.1.6cvs
791 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
793 * src/version.h: set to 1.1.6pre2
795 2000-11-20 Marko Vendelin <markov@ioc.ee>
797 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
799 * src/frontends/gnome/Makefile.am: updated list of XForms object files
801 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
803 * src/LColor.C (init):
804 * src/lyxrc.C (getDescription): changed some comments as suggested by
807 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
808 disconnect the redrawGUI signal in best-practice fashion.
810 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
811 long_opts_tab to reflect the change in name of this tabfolder, as
812 suggested by John Levon.
813 (connect, disconnect): new methods. Don't do much at present other than
814 ensuring that we can't resize the dialog. This just makes xforms go
816 (lots of methods in Colors): made void rather than bool. The idea is
817 to have an isOk() function that keeps track of whether any input is
818 genuinely invalid and should therefore block Save, Apply.
819 Easier to manipulate the counters rapidly.
820 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
821 compiler will like this code. Much cleaner way of doing things.
823 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
825 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
826 rather than simple counters, following suggestion by John Levon.
828 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
829 than engraved frame + text.
831 * src/frontends/xforms/forms/makefile: removed spurious command.
833 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
835 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
837 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
840 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
842 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
843 see what Lars has changed and what is just white space!
844 Now used X directly to ascertain the RGB color associated with the
846 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
848 Added some sort capability.
849 The X11 color name database input is only displayed if the database
850 isn't found in the standard place.
851 Got rid of struct compare_converter; it wasn't used.
852 Probably some other stuff that I've forgotten.
854 * src/frontends/xforms/FormPreferences.h: changed the names of some
855 methods in the Colors struct. Added a couple of structs to help sort
856 colors by name and by RGBColor.
858 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
859 functions into a new class RWInfo.
861 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
862 The dialog is now almost navigable using the keyboard. Unfortunately,
863 the cursor has to be inside a browser for it to be activated. There is
864 no visual feedback for the key shortcuts to the arrow keys (use
865 Alt-appropriate arrow key, Alt-x).
867 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
870 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
871 xform_helpers.[Ch]. See above.
873 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
875 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
877 * src/screen.C (setCursorColor): new method. Sets the color of the
879 (ShowManualCursor): call it.
880 Constify some local variables.
882 * src/LColor.[Ch] (LColor): add entry for cursor
883 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
886 2000-11-19 Juergen Vigna <jug@sad.it>
888 * src/insets/insettabular.C (draw): fixed text border redraw problem.
889 (calculate_dimensions_of_cells): try to boost up when inserting chars.
891 2000-11-15 Rob Lahaye <lahaye@postech.edu>
893 * lib/ui/default.ui: OptItem used for Fax entry
895 2000-11-17 Matej Cepl <cepl@bigfoot.com>
897 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
899 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
901 * src/vspace.C (nextToken): fix so it can handle length phrases like
902 "10mm+-20mm", "40inplus16mmminus10cm" etc.
904 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
906 * src/frontends/xforms/FormPreferences.C: constify several variables
907 (BrowserLyX): rewrite to not need the choice variable
908 (Modify): rewrite to not need the choide variable
909 (compare_converter): make operator const
911 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
912 correct the writing of \set_color
913 (getDescription): return a const string
915 * src/kbsequence.[Ch] (addkey): remove dead code
917 * src/Painter.C (text): remove some commented code
919 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
921 * src/ColorHandler.[Ch]: removed some header files from .h file.
922 Included LColor.h in .C file.
924 * src/LColor.[Ch]: made class copyable so that I could create a
925 system_lcolor instance.
927 * src/Painter.h: removed LColor.h.
929 * src/lyx_gui.C (create_forms): used AddName.
931 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
932 of user preferences/lyxrc file.
934 * src/lyxrc.C (output): output changes to lcolor.
936 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
938 Moved class xformColor to files xform_helpers.[Ch]. These files,
939 Color.[Ch], could now be moved into src if they would be useful to
942 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
943 Also moved FormPreferences::browseFile here as it can be used by any
944 xform dialog with a "Browse" button. FormGraphics is a perfect example.
946 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
947 ReadableFile): changed the FormPreferences methods a little and moved
948 them here as they'll be useful elsewhere also.
950 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
951 Removed some header files and used forward declarations instead.
953 Removed some methods as they'll be useful elsewhere (see above).
955 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
956 Can also now modify the LyX LColors. However, for reasons that I don't
957 yet understand, it appears that we can use
958 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
959 present. The problem appears to lie in ColorHandler, because I can
960 change the color using LColor.SetColor(). Similarly, when reading in a
961 preferences file with some set_color instances, I'll get a warning
962 like: Color sea green is undefined or may not be redefined
963 Bad lyxrc set_color for sea green
965 Once the buffer is loaded, however, I can happily change to this color.
967 Finally, it appears that I have to set the color of "inset frame"
968 explicitly, or it oscillates from "black" to "indian red" with each
971 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
973 * ANNOUNCE: corrected a spelling mistake.
975 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
978 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
980 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
982 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
985 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
986 match the requirements from the standard better. This is required
987 to work with gnu libstdc++-v3
989 * src/frontends/xforms/FormPreferences.C: add explict pair
990 arguments to browse calls. include support/lyxmanip.h remvoe
991 extern fmt. whitespace changes. reorder variables in
992 FormPreferences.h, to match initalizaton order.
994 * several files: constify more local variables.
996 * src/buffer.C: remove some commented functions.
998 * src/DepTable.C (remove_files_with_extension): temporary
999 work around for gcc 2.97
1000 * src/filedlg.C (find): ditto
1001 * src/Variables.C (set): ditto
1002 * src/LyXAction.C (searchActionArg): ditto
1003 (retrieveActionArg): ditto
1005 * configure.in: check for mktemp too
1007 * UPGRADING: prepare for 1.1.6
1009 * Makefile.am (lgbtags): add backup tags for when etags are
1010 different than usual.
1012 * ANNOUNCE: prepare for 1.1.6
1014 * src/support/tempname.C (make_tempfile): new function, wrapper
1015 around mkstemp and mktemp. Only mkstemp has been tested.
1016 (tempName): call it.
1018 2000-11-14 Rob Lahaye <lahaye@postech.edu>
1020 * default.ui: capitalized some menu items to improve shortcuts.
1022 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1024 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
1026 * src/frontends/xforms/Dialogs.C: add "using" directive.
1028 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
1030 * src/filedlg.C (Select): highlight suggested file in browser, if
1033 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
1034 each tab folder is encapsulated in its own class.
1035 The Language keymaps are now chosen using a text input and a
1036 browser button, rather than a Combox.
1037 All the browser buttons are now functional, although LyXFileDlg
1038 still needs to be modified to make it straighhtforward to return a
1039 directory if that is what is desired.
1041 * src/frontends/xforms/forms/form_preferences.fd: use text input
1042 and browse button to input the Language keymaps. Add a few
1043 callbacks for the browse buttons.
1045 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1047 * src/support/tempname.C (tempName): small changes to make it
1048 safer. remove the '.' before XXXXXX
1050 * src/support/filetools.C (TmpFileName): remove func
1053 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
1054 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
1055 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
1056 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
1058 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
1059 (FormCommand): ditto
1061 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
1064 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
1065 for bp (this fixes a reproducible hard crash)
1067 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
1070 * src/frontends/xforms/FormBase.h: make bp_ private
1071 (FormBaseBI): remove default for bp
1074 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
1077 * src/frontends/xforms/Color.C (RGBColor): made several vars
1078 const, changed initialization of j to allow it to be const
1081 * several files: added const to local variables.
1083 * src/lyx_cb.C: removed several function prototypes and moved them
1087 (UpdateLayoutPreamble):
1089 (MenuInsertLabel): add BufferView as arguemnt
1090 (LayoutsCB): make tmp const
1092 * src/layout_forms.h: regenerated
1094 * src/debug.C: add Debug::FILES
1095 (showLevel) (showTags): translate the desc
1097 * src/debug.h: add FILES as debug target
1099 * src/bufferlist.C: use current_view as an interim measure becuase
1100 of added arguments to MenuWrite and MenuWriteAs
1102 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
1104 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
1106 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
1107 libstdc++ is compiled with.
1109 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
1111 * lib/layouts/docbook-book.layout
1112 * lib/layouts/docbook.layout
1113 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
1114 those paragraphs are expresse as SGML comments <!-- -->.
1116 * src/LaTeXFeatures.h
1117 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
1118 parameter, this allows to express all the include files as relative
1119 paths to the master buffer. The verbatim insert works as the other
1122 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
1124 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
1126 (MakeDocBookFile): top_element is always written. Some clean up, as
1127 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
1129 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
1130 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
1131 a reference is written instead of the name.
1132 (Validate): use the relative path for the filename.
1134 * src/insets/insetlabel.C (DocBook): write end tag, for XML
1137 * src/support/filetools.h
1138 * src/support/filetools.C (IsSGMLFilename): added.
1141 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
1143 * development/OS2/quick_fix.patch:
1144 * lib/configure.cmd:
1145 * README.OS2: quick update to the OS/2 port.
1147 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1149 * src/converter.C: add "using" directive.
1151 * src/frontends/xforms/FormPreferences.C: add "using" directive.
1152 (compare_converter): add "int" as return type.
1154 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
1157 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
1159 * src/lyx_gui.C (create_forms): map the xform colours, should a
1160 mapping exist. Ie, call XformColor::read().
1162 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
1163 and struct HSV as HSVColor.
1164 (XformColor::read, XformColor::write) : new methods that
1165 input/output any changes to the cform GUI colors.
1167 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
1170 * src/frontends/xforms/FormPreferences.C Lots of little changes
1171 associated with the changed name of the RGB and HSV structs. Can
1172 now save changes to xforms GUI to file. Commented out
1173 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
1174 used currently anyway.
1176 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
1178 * src/converter.C: A lot of changes:
1179 - It is no longer possible to choose between two or more ways to
1180 export to some format (the new code uses only the shortest path).
1181 However, it is still possible to choose between pdflatex/ps2pdf
1182 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1183 - Added several methods that makes the FormPreferences code simpler.
1184 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1186 * src/exporter.C (Export): lyxrc.use_pdf is set before
1187 makeLaTeXFile is called. This works but not very nice.
1189 * src/frontends/xforms/FormPreferences.C: The formats/converters
1190 tabs are now fully functional.
1192 * src/buffer.C (getTocList): Add numbers to the captions.
1194 * lib/lyxrc.example: Removed fax section
1196 * src/support/rename.C (rename): Delete the old file if lyx::copy
1199 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1201 * lib/ui/default.ui: minor polishing.
1203 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1205 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1208 * lib/Makefile.am (DOCINST): do not install everything in the
1209 documentation directory.
1211 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1213 * src/bufferlist.C (newFile): set the filename to the constructed
1216 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1217 constructed "newfileXX.lyx" name to the dialog
1219 * src/frontends/DialogBase.h: make update() non-abstract so
1220 KDE doesn't need to implement two update methods for every form
1222 * src/frontends/kde/Makefile.am: add missing xforms objects
1225 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1227 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1229 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1230 structs RGB and HSV. May not be the best place for these files.
1231 Perhaps move them into src ?
1233 * src/frontends/xforms/Makefile.am: added new files.
1235 * src/frontends/xforms/forms/form_preferences.fd:
1236 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1237 replaced all instances of "colour" with "color"!
1239 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1242 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1243 tab. Can now alter the colors of the xform's GUI on the fly. With
1244 the aid of a single static Signal (see below), can "Apply" these
1245 changes to all currently open dialogs. (Well, to all of the NEW
1246 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1247 subsequently opened dialogs will, of course, also have the new
1248 color scheme. Cannot yet save (or load) the choices to file, so
1249 they are lost when exiting LyX.
1251 * src/frontends/Dialogs.h:
1252 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1253 Used to trigger a redraw of any dialogs connected to it because,
1254 for example, the GUI colours have been re-mapped.
1256 * src/frontends/xforms/FormBase.[Ch]:
1257 * src/frontends/xforms/FormDocument.[Ch]:
1258 * src/frontends/xforms/FormParagraph.[Ch]:
1259 * src/frontends/xforms/FormPreferences.[Ch]:
1260 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1261 method, to be connected to Dialogs::redrawGUI. Method must be
1262 virtual, because dialogs with tabbed folders need to redraw the
1263 forms of each tab folder.
1265 * src/LyXView.C (d-tor):
1266 * src/frontends/xforms/FormBase.C (d-tor): connected
1267 Dialogs::redrawGUI signal to redraw().
1269 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1270 removed Assert, because it is identical to that in FormBase.
1272 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1274 * lib/ui/default.ui: minor polishing.
1276 2000-11-10 Juergen Vigna <jug@sad.it>
1278 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1279 (deleteLyXText): ditto
1281 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1282 selection on mouse-button-3.
1284 * src/insets/insettabular.h: new function clearSelection(), use this
1285 functions inside insettabular.C.
1287 * src/insets/insettabular.C (TabularFeatures): clear the selection
1288 on remove_row/column.
1290 * src/insets/inset.C (scroll): fixed some scroll stuff.
1292 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1294 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1296 * lib/CREDITS: add Yves Bastide
1298 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1300 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1301 check whether C library functions are in the global namespace.
1303 * configure.in: calls it.
1305 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1306 #ifndef __GLIBCPP__.
1308 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1310 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1311 iterators to prevent crash.
1313 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1315 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1317 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1318 shortcut for xforms CB to the preemptive or post-handler function.
1320 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1321 removed the HIDDEN_TIMER as it's no longer used.
1322 Various other small changes.
1324 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1325 preemptive handler to obtain feedback, rather than the post-handler.
1326 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1328 Formats tab is now complete. Converters tab is nearly so.
1330 2000-11-09 Juergen Vigna <jug@sad.it>
1332 * src/insets/insettext.C (~InsetText):
1335 (SetParagraphData): set cache.second to 0 after deleting it!
1336 (getLyXText): check if cache.second is not 0 if finding it.
1338 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1340 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1341 lyxlex to parse the rgb.txt file.
1344 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1345 replace the default '#' comment character.
1347 * src/support/tempname.C: add "using" directive
1348 * src/frontends/ButtonPolicies.C: ditto.
1350 * src/support/filetools.C (DirList): add an explicit cast to avoid
1351 a compile error (probably not the right fix)
1353 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1355 * src/support/filetools.C (DirList): implement using system functions
1357 * src/support/tempname.C: new file
1359 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1361 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1363 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1366 * src/frontends/xforms/ButtonController.C: new file
1368 * src/os2_defines.h: remove getcwd define
1370 * src/lyxvc.C: include support/lyxlib.h
1371 (showLog): use lyx::tempName
1373 * src/lyx_cb.C: comment out includes that we don't need
1374 (AutoSave): use lyx::tempName
1376 * src/filedlg.C: include support/lyxlib.h
1377 (Reread): use lyx::getcwd
1379 * src/converter.C: include support/filetools.h
1380 (add_options): change to static inline, make tail const
1381 (Add): make old_viewer const
1382 (GetAllFormats): make it a const method, use const_iterator
1383 (enable): make static inline
1384 (SplitFormat): make using_format const
1386 * src/LaTeX.C (run): use lyx::getcwd
1388 * configure.in: check for mkstemp as well
1390 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1392 * src/converter.[Ch] (GetAllCommands): new method.
1394 * src/support/filetools.[Ch] (DirList): new method.
1396 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1397 functionality to the converters tab.
1398 The formats tab is now nearly complete.
1399 The kbmap choices in Languages tab now display the contents of
1400 system_lyxdir/kbd/*.kmap in readable form.
1402 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1403 Moved some variables into the class.
1405 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1406 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1407 colour of active folder to lighter grey instead. Any takers?
1408 (form_colours): added an "Apply" button.
1409 (form_converters): added a "Flags" input field.
1410 (form_formats): added a "Shortcut" input field. Note that we can't use
1411 names such as "input_shortcut" as this buggers up the sed script stuff.
1413 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1421 * src/lyx_sendfax_main.C:
1424 * src/spellchecker.C:
1425 * src/insets/figinset.C:
1426 * src/insets/insetbib.C:
1427 * src/insets/insetexternal.C:
1428 * src/insets/insetinclude.C:
1429 * src/insets/insetinfo.C:
1430 * src/mathed/math_panel.C:
1431 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1432 all "daughter" dialogs now have identical "feel".
1434 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1436 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1437 used (and was only used in one place prior to this patch. Incorrectly!)
1439 * src/frontends/xforms/FormDocument.C: changed some instances of
1440 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1441 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1442 for options_->input_float_placement. This fixes a bug reported by
1445 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1446 functionality into d-tor.
1448 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1449 input of numerals also.
1451 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1452 fl_set_form_atclose(). Can now close dialog from window manager,
1453 fixing a bug reported by Rob Lahaye.
1455 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1457 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1458 are no longer dark. Haven't yet worked out how to lighten the colour of
1459 the active tabfolder. Any ideas anybody?
1460 Adjusted Colours tab a little.
1461 Added Shortcut field to converters tab. Note that we can't create an
1462 fdesign label like "input_shortcut" as this buggers up the sed-script
1465 * src/frontends/xforms/FormPreferences.[Ch]:
1466 (feedback): fixed crash due to to ob=0.
1467 (LanguagesXXX): the kbmap choices now contain the files
1468 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1469 be replaced by an input with a file browse button, but since the browse
1470 buttons don'y yet work, this'll do for the moment.
1471 (FormatsXXX): think that this is now nearly fully functional.
1472 Some points/questions though:
1473 1. Does "Apply" remove formats if no longer present?
1474 2. I think that the browser should list the GUI names rather than the
1476 3. Must ensure that we can't delete Formats used by an existing
1479 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1480 if this is the best way to do this.
1482 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1484 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1486 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1487 for variable assignment.
1489 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1491 * src/lib/ui/default.ui: added sub/superscripts to menu as
1492 Insert->Special characters and cleaned-up the file a bit
1494 2000-11-07 Allan Rae <rae@lyx.org>
1496 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1497 ob isn't 0 before using it. See comments in function.
1499 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1501 * src/frontends/xforms/form_*.C: regenerated
1503 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1505 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1507 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1508 compiling with gcc-2.96
1510 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1512 * src/support/lyxstring.C: add a couple "using" directives.
1514 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1515 a .c_str() here too for good measure.
1516 * src/Spacing.C (set): ditto.
1517 * src/lyxfunc.C (Dispatch): ditto.
1519 * src/insets/insettabular.C (copySelection): change .str() to
1520 .str().c_str() to fix problems with lyxstring.
1521 * src/support/filetools.C (GetFileContents): ditto.
1522 * src/buffer.C (asciiParagraph): ditto.
1523 * src/paragraph.C (String): ditto.
1525 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1526 * lib/bind/sciword.bind: ditto.
1528 * src/LyXAction.C (init): remove "symbol-insert" function, which
1529 shared LFUN_INSERT_MATH with "math-insert".
1531 * lib/configure.m4: == is not a valid operator for command test.
1533 * src/lyxrc.C: add using directive.
1535 * src/converter.h: add std:: qualifier.
1537 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1539 * src/converter.[Ch] and other files: Change the Format class to a
1540 real class, and create two instances: formats and system_format.
1542 * src/lyxrc.C (output): Output the difference between formats and
1545 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1546 (buildFormats): Insert formats into browser.
1547 (inputFormats): Made the browser and add button functional.
1548 (applyFormats): Update formats from format_vec.
1550 * src/converter.C: Changed all (*it). to it->
1551 (Format::dummy): New method.
1552 (Format::importer): New format flag.
1553 (Formats::GetAllFormats): New method.
1554 (Formats::Add): Delete format from the map if prettyname is empty.
1555 (Converter::Convert): Print an error message if moving the file fails.
1556 (Converter::GetReachableTo): New method
1558 * src/MenuBackend.[Ch]: Add support for importformats tag.
1560 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1562 * lib/configure.m4: Add word->tex and ps->fax converters.
1564 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1565 Return fax to file menu.
1569 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1571 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1574 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1577 * src/lyxfunc.C (processKeyEvent): removed
1579 * src/bufferlist.C (emergencyWrite): removed the out commented
1580 emergency write code.
1582 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1584 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1586 * many files: change formatting to be a bit more uniform for
1587 if,while,for,switch statements, remove some parantesis not needed.
1590 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1592 * config/kde.m4: make config more robust when KDEDIR is set
1594 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1596 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1597 not returned a pixmap for "math-insert".
1599 * src/LyXAction.C (init): sort the entries a bit.
1601 2000-11-03 Juergen Vigna <jug@sad.it>
1603 * src/insets/insettabular.h: added fixed number to update codes so
1604 that update is only in one direction.
1606 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1609 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1610 before call to edit because of redraw.
1612 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1614 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1616 * lib/ui/default.ui: Populate "edit_float" menu
1618 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1620 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1621 "floats-operate". The name is ugly (and the func also), but this
1622 is just a band-aid until we switch to new insets.
1624 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1626 * lib/ui/default.ui: update again the menu layout (fix some
1629 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1631 * src/MenuBackend.h (fulllabel): new method.
1633 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1634 the menu shortcuts of a menu are unique and whether they
1635 correspond to a letter of the label.
1636 (expand): call checkShortcuts when debugging.
1638 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1640 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1642 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1644 * lib/examples/*.lyx : '\language default' => '\language english'
1646 * lib/examples/it_splash.lyx : except where it should be italian
1648 * lib/templates/*.lyx : the same
1650 * doc/*.lyx* : the same
1652 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1654 * lib/bind/menus.bind: remove the Layout menu entries, which I
1655 somehow forgot earlier.
1657 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1659 * lib/ui/old-default.ui: keep the old one here for reference (to
1662 * lib/ui/default.ui: update the menu layout
1664 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1666 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1667 Can now Apply to different insets without closing the dialog.
1669 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1670 Can't actually DO anything with them yet, but I'd like a little
1673 * src/frontends/xforms/input_validators.[ch]
1674 (fl_lowercase_filter): new.
1676 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1678 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1679 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1681 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1683 2000-11-02 Juergen Vigna <jug@sad.it>
1685 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1686 on char insertion as it has already be updated by bv->updateInset().
1688 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1689 if an inset inside was updated.
1691 * lib/configure.cmd: commented out fax-search code
1693 2000-11-01 Yves Bastide <stid@acm.org>
1695 * src/tabular.C (OldFormatRead): set tabular language to the
1698 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1700 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1701 class names with non-letter characters (from Yves Bastide).
1703 * lib/ui/default.ui: change Item to OptItem in import menu.
1704 Comment out fax stuff.
1706 * lib/configure.m4: comment out fax-related stuff.
1708 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1710 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1711 useful xforms helper functions. At present contains only formatted().
1712 Input a string and it returns it with line breaks so that in fits
1715 * src/frontends/xforms/Makefile.am: add new files.
1717 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1718 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1721 * src/frontends/xforms/FormPreferences.[Ch]:
1722 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1723 but lots of little clean ups. Removed enum State. Make use of
1724 formatted(). Constify lots of methods. Perhaps best of all: removed
1725 requirement for that horrible reinterpret_cast from pointer to long in
1728 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1730 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1731 conditionalize build on xforms < 0.89
1733 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1735 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1737 * src/LyXAction.C (init): comment out fax
1739 * src/lyxrc.h: comment out the fax enums
1740 comment out the fax variables
1742 * src/commandtags.h: comment out LFUN_FAX
1744 * src/lyxrc.C: disable fax variables.
1745 (read): disable parsing of fax variables
1746 (output): disable writing of fax variables
1747 (getFeedback): now description for fax variables
1749 * src/lyxfunc.C: comment out MenuFax
1750 (Dispatch): disable LFUN_FAX
1752 * src/lyx_cb.C (MenuFax): comment out
1754 * src/WorkArea.C: add <cctype>
1755 (work_area_handler): better key handling, should be ok now.
1756 for accented chars + etc
1758 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1759 lyx_sendfax.h and lyx_sendfax_man.C
1761 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1762 (show): don't call InitLyXLookup when using xforms 0.89
1764 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1766 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1768 * src/support/filetools.C (GetFileContents): close to dummy change
1770 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1772 * src/trans.C (AddDeadkey): workaround stupid compilers.
1774 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1776 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1777 of two-sided document.
1779 2000-10-31 Juergen Vigna <jug@sad.it>
1781 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1783 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1784 xposition to the Edit call.
1786 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1788 * src/trans.C (AddDeadkey): cast explicitly to char.
1790 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1792 * src/tabular.C (AsciiBottomHLine): simplify?
1793 (AsciiTopHLine): simplify?
1794 (print_n_chars): simplify
1795 (DocBook): remove most of the << endl; we should flush the stream
1796 as seldom as possible.
1798 (TeXBottomHLine): ditto
1799 (TeXTopHLine): ditto
1801 (write_attribute): try a templified version.
1802 (set_row_column_number_info): lesson scope of variables
1804 * src/support/lstrings.h (tostr): new specialization of tostr
1806 * src/trans.C (AddDeadkey): slightly cleaner fix.
1808 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1810 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1811 '%%' in Toc menu labels.
1814 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1815 font_norm is iso10646-1.
1817 * src/font.C (ascent): Fixed for 16bit fonts
1818 (descent,lbearing,rbearing): ditto
1820 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1822 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1823 (getFeedback): new static method.
1825 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1826 Now use combox rather than choice to display languages.
1827 Feedback is now output using a new timer callback mechanism, identical
1828 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1830 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1832 * src/minibuffer.C: fix for older compilers
1834 2000-10-30 Juergen Vigna <jug@sad.it>
1836 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1837 has to be Left of the inset otherwise LyXText won't find it!
1839 * src/BufferView2.C (open_new_inset): delete the inset if it can
1842 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1844 * lyx.man: fix typo.
1846 2000-10-29 Marko Vendelin <markov@ioc.ee>
1847 * src/frontends/gnome/FormCitation.C
1848 * src/frontends/gnome/FormCitation.h
1849 * src/frontends/gnome/FormCopyright.C
1850 * src/frontends/gnome/FormCopyright.h
1851 * src/frontends/gnome/FormError.C
1852 * src/frontends/gnome/FormError.h
1853 * src/frontends/gnome/FormIndex.C
1854 * src/frontends/gnome/FormIndex.h
1855 * src/frontends/gnome/FormPrint.C
1856 * src/frontends/gnome/FormPrint.h
1857 * src/frontends/gnome/FormRef.C
1858 * src/frontends/gnome/FormRef.h
1859 * src/frontends/gnome/FormToc.C
1860 * src/frontends/gnome/FormToc.h
1861 * src/frontends/gnome/FormUrl.C
1862 * src/frontends/gnome/FormUrl.h
1863 * src/frontends/gnome/Menubar_pimpl.C
1864 * src/frontends/gnome/mainapp.C
1865 * src/frontends/gnome/mainapp.h
1866 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1867 changing update() to updateSlot() where appropriate
1869 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1871 * src/frontends/xforms/FormPreferences.[Ch]:
1872 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1875 2000-10-28 Juergen Vigna <jug@sad.it>
1877 * src/insets/insettabular.C (draw): fixed drawing bug.
1879 * src/insets/insettext.C (clear):
1881 (SetParagraphData): clearing the TEXT buffers when deleting the
1882 paragraphs used by it.
1884 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1886 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1888 2000-10-27 Juergen Vigna <jug@sad.it>
1890 * src/tabular.C (~LyXTabular): removed not needed anymore.
1892 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1895 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1897 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1900 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1903 * src/frontends/xforms/FormPreferences.[Ch]:
1904 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1905 Reorganised as modules based on tabs. Much easier to follow the
1906 flow and to add new tabs. Added warning and feedback messages.
1909 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1911 * src/tabular.h (DocBook): add std:: qualifier.
1913 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1915 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1916 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1919 * insettabular.C (DocBook): uses the tabular methods to export
1922 * src/insets/insettext.h
1923 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1925 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1927 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1930 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1931 moved misplaced AllowInput two lines up.
1933 * src/buffer.C (readFile): compare float with float, not with int
1935 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1937 * src/minibuffer.C: add "using SigC::slot" statement.
1939 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1941 * src/frontends/xforms/forms/README: updated section about make.
1943 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1944 Tidied some forms up, made two of form_tabular's tabs more
1945 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1946 fixed translation problem with "Column".
1948 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1950 * src/minibuffer.h: use Timeout instead of the xforms timer
1952 (setTimer) rewrite for the Timeout, change to unsigned arg
1953 (set): change to unsigned timer arg
1956 * src/minibuffer.C (TimerCB): removed func
1957 (C_MiniBuffer_TimerCB): removed func
1958 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1959 (peek_event): use a switch statement
1960 (add): don't use fl_add_timer.
1961 (Set): rewrite to use the Timeout
1964 * src/Timeout.[Ch] (setType): return a Timeout &
1965 (setTimeout): ditto, change to unsigned arg for timeout
1967 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1969 * src/mathed/formula.C (mathed_string_width): Use string instead
1970 of a constant size char array.
1972 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1974 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1975 the two recently added operator<< for SMInput and State.
1977 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1979 (OkCancelPolicy): ditto
1980 (OkCancelReadOnlyPolicy): ditto
1981 (NoRepeatedApplyReadOnlyPolicy): ditto
1982 (OkApplyCancelReadOnlyPolicy): ditto
1983 (OkApplyCancelPolicy): ditto
1984 (NoRepeatedApplyPolicy): ditto
1986 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1988 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1989 add the usual std:: qualifiers.
1991 2000-10-25 Juergen Vigna <jug@sad.it>
1993 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1995 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1997 * src/support/filetools.C (MakeRelPath): change some types to
2000 * src/frontends/ButtonPolicies.h (operator<<): new operator for
2001 ButtonPolicy::SMInput and ButtonPolicy::State.
2003 * src/FontLoader.C (reset): small cleanup
2004 (unload): small cleanup
2006 * src/FontInfo.C (getFontname): initialize error to 10000.0
2008 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2010 * src/frontends/xforms/FormPreferences.[Ch]:
2011 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
2012 TeX encoding and default paper size sections.
2014 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2016 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
2019 * src/frontends/xforms/FormError.C (disconnect): use erase() to
2020 make the message_ empty.
2021 (FormError): don't initialize message_ in initializer list.
2023 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2025 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
2027 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2029 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
2031 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
2033 * src/frontends/kde/*data.[Ch]: _("") is not
2036 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2038 * src/buffer.C: removed redundant using directive.
2040 * src/frontends/DialogBase.h: revert to original definition of
2043 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
2044 stuff into two classes, one for each dialog, requires a new
2045 element in the dialogs vector, FormTabularCreate.
2047 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
2050 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
2051 method. Continues Allan's idea, but means that derived classes
2052 don't need to worry about "update or hide?".
2054 * src/frontends/xforms/FormError.C (showInset): add connection
2057 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
2058 one for each dialog. FormTabular now contains main tabular dialog
2061 * src/frontends/xforms/FormTabularCreate.[Ch]:
2062 * src/frontends/xforms/forms/form_tabular_create.fd: the create
2065 * src/frontends/xforms/FormGraphics.[Ch]:
2066 * src/frontends/xforms/forms/form_graphics.fd
2067 * src/frontends/xforms/FormTabular.[Ch]:
2068 * src/frontends/xforms/forms/form_tabular.fd: made daughter
2069 classes of FormInset.
2071 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
2072 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
2074 * src/frontends/xforms/Makefile.am:
2075 * src/frontends/xforms/forms/makefile: added new files.
2077 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
2078 variable. added Signal0 hide signal, in keeping with other GUI-I
2081 * src/support/lstrings.h: removed redundant std:: qualifier as
2082 it's already declared in Lsstream.h.
2084 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2086 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
2090 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
2092 * src/tabular.C (Ascii): minimize scope of cell.
2094 * src/BufferView2.C (nextWord): return string() instead of 0;
2096 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2098 * src/converter.h: add a std:: qualifier
2100 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
2102 * src/importer.[Ch]: New files. Used for importing files into LyX.
2104 * src/lyxfunc.C (doImport): Use the new Importer class.
2106 * src/converter.h: Add shortcut member to the Format class.
2107 Used for holding the menu shortcut.
2109 * src/converter.C and other files: Made a distinction between
2110 format name and format extension. New formats can be defined using
2111 the \format lyxrc tag.
2112 Added two new converter flags: latex and disable.
2114 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2116 * src/support/lyxlib.h: unify namespace/struct implementation.
2117 Remove extra declarations.
2119 * src/support/chdir.C (chdir): remove version taking char const *
2121 * src/support/rename.C: ditto.
2122 * src/support/lyxsum.C: ditto.
2124 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
2126 * src/frontends/xforms/FormBase.[Ch]:
2127 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
2128 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
2129 work only for the next call to fl_show_form(). The correct place to set
2130 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
2131 done. FormBase also stores minw_, minh_ itself. All dialogs derived
2132 from FormBase have the minimum size set; no more stupid crashes with
2135 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2137 * lib/ui/default.ui: fix shortcut for Insert->Include File.
2139 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2141 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
2143 * src/support/lyxlib.h: changed second argument of mkdir to
2144 unsigned long int (unsigned int would probably have been enough,
2145 but...). Removed <sys/types.h> header.
2146 * src/support/mkdir.C (mkdir): ditto.
2150 2000-10-19 Juergen Vigna <jug@sad.it>
2152 * src/lyxfunc.C (MenuNew): small fix (form John)
2154 * src/screen.C (Update): removed unneeded code.
2156 * src/tabular.C (Ascii): refixed int != uint bug!
2158 * src/support/lyxlib.h: added sys/types.h include for now permits
2159 compiling, but I don't like this!
2161 2000-10-18 Juergen Vigna <jug@sad.it>
2163 * src/text2.C (ClearSelection): if we clear the selection we need
2164 more refresh so set the status apropriately
2166 * src/insets/insettext.C (draw): hopefully finally fixed draw
2169 2000-10-12 Juergen Vigna <jug@sad.it>
2171 * src/insets/insettext.C (draw): another small fix and make a block
2172 so that variables are localized.
2174 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
2176 * src/support/lstrings.C (lowercase, uppercase):
2177 use explicit casts to remove compiler warnings.
2179 * src/support/LRegex.C (Impl):
2180 * src/support/StrPool.C (add):
2181 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2182 (AddPath, MakeDisplayPath):
2183 * src/support/lstrings.C (prefixIs, subst):
2184 use correct type to remove compiler warnings.
2186 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2188 * src/support/lyxlib.h:
2189 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2190 portability and to remove compiler warning with DEC cxx.
2192 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2194 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2196 * src/minibuffer.C (peek_event): retun 1 when there has been a
2197 mouseclick in the minibuffer.
2201 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2203 * src/frontends/xforms/FormParagraph.C: more space above/below
2206 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2208 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2209 a char only if real_current_font was changed.
2211 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2213 * NEWS: update somewhat for 1.1.6
2215 * lib/ui/default.ui: clean up.
2217 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2219 * lib/CREDITS: clean up
2221 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2223 * src/combox.[Ch] (select): changed argument back to int
2224 * src/combox.C (peek_event): removed num_bytes as it is declared but
2227 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2228 modified calls to Combox::select() to remove warnings about type
2231 * src/insets/insetbutton.C (width): explicit cast to remove warning
2232 about type conversion.
2234 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2237 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2238 sel_pos_end, refering to cursor position are changed to
2239 LyXParagraph::size_type.
2241 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2242 consistent with LyXCursor::pos().
2243 (inset_pos): changed to LyXParagraph::size_type for same reason.
2245 * src/insets/insettext.C (resizeLyXText): changed some temporary
2246 variables refing to cursor position to LyXParagraph::size_type.
2248 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2250 * src/frontends/kde/<various>: The Great Renaming,
2253 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2255 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2257 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2259 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2260 0 when there are no arguments.
2262 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2264 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2265 to segfaults when pressing Ok in InsetBibtex dialog.
2267 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2269 * forms/layout_forms.fd:
2270 * src/layout_forms.C (create_form_form_character): small change to use
2271 labelframe rather than engraved frame + text
2273 * src/lyx_gui.C (create_forms): initialise choice_language with some
2274 arbitrary value to prevent segfault when dialog is shown.
2276 2000-10-16 Baruch Even <baruch.even@writeme.com>
2278 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2279 is no resulting file. This pertains only to LaTeX output.
2281 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2283 * src/text.C (Backspace): Make sure that the row of the cursor is
2286 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2289 * src/lyx_gui.C (init): Prevent a crash when only one font from
2290 menu/popup fonts is not found.
2292 * lib/lyxrc.example: Add an example for binding a key for language
2295 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2297 * src/converter.C (GetReachable): Changed the returned type to
2299 (IsReachable): New method
2301 * src/MenuBackend.C (expand): Handle formats that appear more
2304 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2306 * src/frontends/support/Makefile.am
2307 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2310 * lib/CREDITS: add Garst Reese.
2312 * src/support/snprintf.h: add extern "C" {} around the definitions.
2314 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2316 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2319 * src/frontends/xforms/FormDocument.C:
2320 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2321 compile without "conversion to integral type of smaller size"
2324 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2326 * src/text.C (GetColumnNearX): Fixed disabled code.
2328 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2330 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2333 * src/support/snprintf.[ch]: new files
2335 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2337 * src/frontends/kde/formprintdialog.C: add
2338 file browser for selecting postscript output
2340 * src/frontends/kde/formprintdialogdata.C:
2341 * src/frontends/kde/formprintdialogdata.h: re-generate
2344 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2346 * src/frontends/gnome/Makefile.am:
2347 * src/frontends/kde/Makefile.am: FormCommand.C
2348 disappeared from xforms
2350 * src/frontends/kde/FormCitation.C:
2351 * src/frontends/kde/FormIndex.C: read-only
2354 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2356 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2359 * src/bufferlist.C: add using directive.
2361 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2363 * src/support/lyxfunctional.h: version of class_fun for void
2364 returns added, const versions of back_inseter_fun and compare_fun
2367 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2369 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2371 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2373 * ChangeLog: cleanup.
2375 * lib/CREDITS: update to add all the contributors we've forgotten.
2376 I have obviously missed some, so tell me whether there were
2379 2000-10-13 Marko Vendelin <markov@ioc.ee>
2381 * src/frontends/gnome/FormCitation.C
2382 * src/frontends/gnome/FormCitation.h
2383 * src/frontends/gnome/FormError.C
2384 * src/frontends/gnome/FormIndex.C
2385 * src/frontends/gnome/FormRef.C
2386 * src/frontends/gnome/FormRef.h
2387 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2389 * src/frontends/gnome/FormCitation.C
2390 * src/frontends/gnome/FormCopyright.C
2391 * src/frontends/gnome/FormError.C
2392 * src/frontends/gnome/FormIndex.C
2393 * src/frontends/gnome/FormRef.C
2394 * src/frontends/gnome/FormToc.C
2395 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2398 * src/frontends/gnome/Menubar_pimpl.C
2399 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2402 2000-10-11 Baruch Even <baruch.even@writeme.com>
2405 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2406 to convey its real action.
2408 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2409 clear the minibuffer and prepare to enter a command.
2411 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2412 the rename from ExecCommand to PrepareForCommand.
2413 * src/lyxfunc.C (Dispatch): ditto.
2415 2000-10-11 Baruch Even <baruch.even@writeme.com>
2417 * src/buffer.C (writeFile): Added test for errors on writing, this
2418 catches all errors and not only file system full errors as intended.
2420 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2422 * src/lyx_gui.C (create_forms): better fix for crash with
2423 translated interface.
2425 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2427 * src/frontends/kde/Makefile.am:
2428 * src/frontends/kde/FormCopyright.C:
2429 * src/frontends/kde/formcopyrightdialog.C:
2430 * src/frontends/kde/formcopyrightdialog.h:
2431 * src/frontends/kde/formcopyrightdialogdata.C:
2432 * src/frontends/kde/formcopyrightdialogdata.h:
2433 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2434 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2435 copyright to use qtarch
2437 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2439 * src/encoding.C (read): Fixed bug that caused an error message at
2440 the end of the file.
2442 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2444 * lib/lyxrc.example: Fixed hebrew example.
2446 2000-10-13 Allan Rae <rae@lyx.org>
2448 * src/frontends/xforms/FormPreferences.C (input): reworking the
2450 (build, update, apply): New inputs in various tabfolders
2452 * src/frontends/xforms/FormToc.C: use new button policy.
2453 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2454 dialogs that either can't use any existing policy or where it just
2457 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2460 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2461 added a bool parameter which is ignored.
2463 * src/buffer.C (setReadonly):
2464 * src/BufferView_pimpl.C (buffer):
2465 * src/frontends/kde/FormCopyright.h (update):
2466 * src/frontends/kde/FormCitation.[Ch] (update):
2467 * src/frontends/kde/FormIndex.[Ch] (update):
2468 * src/frontends/kde/FormPrint.[Ch] (update):
2469 * src/frontends/kde/FormRef.[Ch] (update):
2470 * src/frontends/kde/FormToc.[Ch] (update):
2471 * src/frontends/kde/FormUrl.[Ch] (update):
2472 * src/frontends/gnome/FormCopyright.h (update):
2473 * src/frontends/gnome/FormCitation.[Ch] (update):
2474 * src/frontends/gnome/FormError.[Ch] (update):
2475 * src/frontends/gnome/FormIndex.[Ch] (update):
2476 * src/frontends/gnome/FormPrint.[Ch] (update):
2477 * src/frontends/gnome/FormRef.h (update):
2478 * src/frontends/gnome/FormToc.[Ch] (update):
2479 * src/frontends/gnome/FormUrl.[Ch] (update):
2480 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2481 to updateBufferDependent and DialogBase
2483 * src/frontends/xforms/FormCitation.[hC]:
2484 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2485 * src/frontends/xforms/FormError.[Ch]:
2486 * src/frontends/xforms/FormGraphics.[Ch]:
2487 * src/frontends/xforms/FormIndex.[Ch]:
2488 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2489 and fixed readOnly handling.
2490 * src/frontends/xforms/FormPrint.[Ch]:
2491 * src/frontends/xforms/FormRef.[Ch]:
2492 * src/frontends/xforms/FormTabular.[Ch]:
2493 * src/frontends/xforms/FormToc.[Ch]:
2494 * src/frontends/xforms/FormUrl.[Ch]:
2495 * src/frontends/xforms/FormInset.[Ch]:
2496 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2497 form of updateBufferDependent.
2499 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2500 if form()->visible just in case someone does stuff to the form in a
2503 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2504 the buttoncontroller for everything the enum used to be used for.
2505 (update) It would seem we need to force all dialogs to use a bool
2506 parameter or have two update functions. I chose to go with one.
2507 I did try removing update() from here and FormBase and defining the
2508 appropriate update signatures in FormBaseB[DI] but then ran into the
2509 problem of the update() call in FormBase::show(). Whatever I did
2510 to get around that would require another function and that just
2511 got more confusing. Hence the decision to make everyone have an
2512 update(bool). An alternative might have been to override show() in
2513 FormBaseB[DI] and that would allow the different and appropriate
2516 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2517 true == buffer change occurred. I decided against using a default
2518 template parameter since not all compilers support that at present.
2520 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2522 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2523 army knife" by removing functionality.
2524 (clearStore): removed. All such housekeeping on hide()ing the dialog
2525 is to be carried out by overloaded disconnect() methods.
2526 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2527 superceded by Baruch's neat test (FormGraphics) to update an existing
2528 dialog if a new signal is recieved rather than block all new signals
2530 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2531 only to Inset dialogs.
2532 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2533 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2535 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2537 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2538 as a base class to all inset dialogs. Used solely to connect/disconnect
2539 the Inset::hide signal and to define what action to take on receipt of
2540 a UpdateBufferDependent signal.
2541 (FormCommand): now derived from FormInset.
2543 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2546 * src/frontends/xforms/FormCopyright.[Ch]:
2547 * src/frontends/xforms/FormPreferences.[Ch]:
2548 now derived from FormBaseBI.
2550 * src/frontends/xforms/FormDocument.[Ch]:
2551 * src/frontends/xforms/FormParagraph.[Ch]:
2552 * src/frontends/xforms/FormPrint.[Ch]:
2553 now derived from FormBaseBD.
2555 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2557 * src/frontends/xforms/FormCitation.[Ch]:
2558 * src/frontends/xforms/FormError.[Ch]:
2559 * src/frontends/xforms/FormRef.[Ch]:
2560 * src/frontends/xforms/FormToc.[Ch]:
2561 (clearStore): reworked as disconnect().
2563 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2566 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2568 * src/converter.C (runLaTeX): constify buffer argument
2571 * src/frontends/support/Makefile.am (INCLUDES): fix.
2573 * src/buffer.h: add std:: qualifier
2574 * src/insets/figinset.C (addpidwait): ditto
2575 * src/MenuBackend.C: ditto
2576 * src/buffer.C: ditto
2577 * src/bufferlist.C: ditto
2578 * src/layout.C: ditto
2579 * src/lyxfunc.C: ditto
2581 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2583 * src/lyxtext.h (bidi_level): change return type to
2584 LyXParagraph::size_type.
2586 * src/lyxparagraph.h: change size_type to
2587 TextContainer::difference_type. This should really be
2588 TextContainer::size_type, but we need currently to support signed
2591 2000-10-11 Marko Vendelin <markov@ioc.ee>
2592 * src/frontends/gnome/FormError.h
2593 * src/frontends/gnome/FormRef.C
2594 * src/frontends/gnome/FormRef.h
2595 * src/frontends/gnome/FormError.C
2596 * src/frontends/gnome/Makefile.am
2597 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2598 to Gnome frontend. Both dialogs use "action" area.
2600 2000-10-12 Baruch Even <baruch.even@writeme.com>
2602 * src/graphics/GraphicsCacheItem_pimpl.C:
2603 * src/graphics/Renderer.C:
2604 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2607 2000-10-12 Juergen Vigna <jug@sad.it>
2609 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2610 visible when selecting).
2612 * development/Code_rules/Rules: fixed some typos.
2614 2000-10-09 Baruch Even <baruch.even@writeme.com>
2616 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2617 compiling on egcs 1.1.2 possible.
2619 * src/filedlg.C (comp_direntry::operator() ): ditto.
2621 2000-08-31 Baruch Even <baruch.even@writeme.com>
2623 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2626 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2627 transient it now only gets freed when the object is destructed.
2629 2000-08-24 Baruch Even <baruch.even@writeme.com>
2631 * src/frontends/FormGraphics.h:
2632 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2635 2000-08-20 Baruch Even <baruch.even@writeme.com>
2637 * src/insets/insetgraphics.C:
2638 (draw): Added messages to the drawn rectangle to report status.
2639 (updateInset): Disabled the use of the inline graphics,
2642 2000-08-17 Baruch Even <baruch.even@writeme.com>
2644 * src/frontends/support: Directory added for the support of GUII LyX.
2646 * src/frontends/support/LyXImage.h:
2647 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2650 * src/frontends/support/LyXImage_X.h:
2651 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2652 version of LyXImage, this uses the Xlib Pixmap.
2654 * src/PainterBase.h:
2655 * src/PainterBase.C:
2657 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2658 replacement to Pixmap.
2660 * src/insets/insetgraphics.h:
2661 * src/insets/insetgraphics.C:
2662 * src/graphics/GraphicsCacheItem.h:
2663 * src/graphics/GraphicsCacheItem.C:
2664 * src/graphics/GraphicsCacheItem_pimpl.h:
2665 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2668 * src/graphics/GraphicsCacheItem.h:
2669 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2670 another copy of the object.
2672 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2673 of cacheHandle, this fixed a bug that sent LyX crashing.
2675 * src/graphics/XPM_Renderer.h:
2676 * src/graphics/XPM_Renderer.C:
2677 * src/graphics/EPS_Renderer.h:
2678 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2680 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2682 * src/lyxfunc.C (processKeySym): only handle the
2683 lockinginset/inset stuff if we have a buffer and text loaded...
2685 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2687 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2689 * src/support/lyxfunctional.h: add operator= that takes a reference
2691 * src/lyxserver.C (mkfifo): make first arg const
2693 * src/layout.h: renamed name(...) to setName(...) to work around
2696 * src/buffer.C (setFileName): had to change name of function to
2697 work around bugs in egcs. (renamed from fileName)
2699 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2701 * src/support/translator.h: move helper template classes to
2702 lyxfunctional.h, include "support/lyxfunctional.h"
2704 * src/support/lyxmanip.h: add delaration of fmt
2706 * src/support/lyxfunctional.h: new file
2707 (class_fun_t): new template class
2708 (class_fun): helper template function
2709 (back_insert_fun_iterator): new template class
2710 (back_inserter_fun): helper template function
2711 (compare_memfun_t): new template class
2712 (compare_memfun): helper template function
2713 (equal_1st_in_pair): moved here from translator
2714 (equal_2nd_in_pair): moved here from translator
2716 * src/support/fmt.C: new file
2717 (fmt): new func, can be used for a printf substitute when still
2718 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2720 * src/support/StrPool.C: add some comments
2722 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2725 * src/insets/figinset.C (addpidwait): use std::copy with
2726 ostream_iterator to fill the pidwaitlist
2728 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2730 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2733 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2736 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2738 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2739 (class_update): ditto
2740 (BulletPanel): ditto
2741 (CheckChoiceClass): move initialization of tc and tct
2743 * src/tabular.C: remove current_view
2744 (OldFormatRead): similar to right below [istream::ignore]
2746 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2747 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2748 unused [istream::ignore]
2750 * src/lyxfunc.C: include "support/lyxfunctional.h"
2751 (getInsetByCode): use std::find_if and compare_memfun
2753 * src/lyxfont.C (stateText): remove c_str()
2755 * src/lyx_main.C (setDebuggingLevel): make static
2756 (commandLineHelp): make static
2758 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2759 Screen* together with fl_get_display() and fl_screen
2761 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2762 togheter with fl_get_display() and fl_screen
2763 (create_forms): remove c_str()
2765 * src/layout.C: include "support/lyxfunctional.h"
2766 (hasLayout): use std::find_if and compare_memfun
2767 (GetLayout): use std::find_if and comapre_memfun
2768 (delete_layout): use std::remove_if and compare_memfun
2769 (NumberOfClass): use std:.find_if and compare_memfun
2771 * src/gettext.h: change for the new functions
2773 * src/gettext.C: new file, make _(char const * str) and _(string
2774 const & str) real functions.
2776 * src/font.C (width): rewrite slightly to avoid one extra variable
2778 * src/debug.C: initialize Debug::ANY here
2780 * src/commandtags.h: update number comments
2782 * src/combox.h (get): make const func
2784 (getline): make const
2786 * src/combox.C (input_cb): handle case where fl_get_input can
2789 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2790 "support/lyxfunctional.h", remove current_view variable.
2791 (resize): use std::for_each with std::mem_fun
2792 (getFileNames): use std::copy with back_inserter_fun
2793 (getBuffer): change arg type to unsigned int
2794 (emergencyWriteAll): call emergencyWrite with std::for_each and
2796 (emergencyWrite): new method, the for loop in emergencyWriteAll
2798 (exists): use std::find_if with compare_memfun
2799 (getBuffer): use std::find_if and compare_memfun
2801 * src/buffer.h: add typedefs for iterator_category, value_type
2802 difference_type, pointer and reference for inset_iterator
2803 add postfix ++ for inset_iterator
2804 make inset_iterator::getPos() const
2806 * src/buffer.C: added support/lyxmanip.h
2807 (readFile): use lyxerr << fmt instead of printf
2808 (makeLaTeXFile): use std::copy to write out encodings
2810 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2812 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2813 free and the char * temp.
2814 (hasMenu): use std::find_if and compare_memfun
2817 * src/Makefile.am (lyx_SOURCES): added gettext.C
2819 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2820 string::insert small change to avoid temporary
2822 * src/LColor.C (getGUIName): remove c_str()
2824 * several files: change all occurrences of fl_display to
2827 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2828 that -pedantic is not used for gcc 2.97 (cvs gcc)
2830 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2832 2000-10-11 Allan Rae <rae@lyx.org>
2834 * src/frontends/xforms/FormPreferences.C (input): template path must be
2835 a readable directory. It doesn't need to be writeable.
2836 (build, delete, update, apply): New inputs in the various tabfolders
2838 * src/frontends/xforms/forms/form_preferences.fd:
2839 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2840 several new entries to existing folders. Shuffled some existing stuff
2843 * src/frontends/xforms/forms/form_print.fd:
2844 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2845 Should probably rework PrinterParams as well. Note that the switch to
2846 collated is effectively the same as !unsorted so changing PrinterParams
2847 will require a lot of fiddly changes to reverse the existing logic.
2849 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2851 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2853 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2855 2000-10-10 Allan Rae <rae@lyx.org>
2858 * src/lyxfunc.C (Dispatch):
2860 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2863 * src/lyxrc.C (output): Only write the differences between system lyxrc
2864 and the users settings.
2867 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2869 I'll rewrite this later, after 1.1.6 probably, to keep a single
2870 LyXRC but two instances of a LyXRCStruct.
2872 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2874 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2876 * src/tabular.h: add a few std:: qualifiers.
2878 * src/encoding.C: add using directive.
2879 * src/language.C: ditto.
2881 * src/insets/insetquotes.C (Validate): use languages->lang()
2882 instead of only language.
2884 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2886 * lib/languages: New file.
2888 * lib/encodings: New file.
2890 * src/language.C (Languages): New class.
2891 (read): New method. Reads the languages from the 'languages' file.
2893 * src/encoding.C (Encodings): New class.
2894 (read): New method. Reads the encodings from the 'encodings' file.
2896 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2899 * src/bufferparams.h and a lot of files: Deleted the member language,
2900 and renamed language_info to language
2902 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2903 * src/lyxfont.C (latexWriteStartChanges): ditto.
2904 * src/paragraph.C (validate,TeXOnePar): ditto.
2906 * src/lyxfont.C (update): Restored deleted code.
2908 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2910 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2912 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2914 * src/insets/figinset.[Ch]:
2915 * src/insets/insetinclude.[Ch]:
2916 * src/insets/insetinclude.[Ch]:
2917 * src/insets/insetparent.[Ch]:
2918 * src/insets/insetref.[Ch]:
2919 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2921 * src/insets/*.[Ch]:
2922 * src/mathed/formula.[Ch]:
2923 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2925 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2926 * src/lyx_cb.C (FigureApplyCB):
2927 * src/lyxfunc.C (getStatus, Dispatch):
2928 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2931 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2933 * src/converter.[Ch] (Formats::View):
2934 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2936 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2937 *current_view->buffer(). This will change later, but this patch is way
2940 2000-10-09 Juergen Vigna <jug@sad.it>
2942 * src/text.C (GetRow): small fix.
2944 * src/BufferView_pimpl.C (cursorPrevious):
2945 (cursorNext): added LyXText parameter to function.
2947 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2948 keypress depending on cursor position.
2950 2000-10-06 Juergen Vigna <jug@sad.it>
2952 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2953 (copySelection): redone this function and also copy ascii representa-
2956 * src/tabular.C (Ascii):
2960 (print_n_chars): new functions to realize the ascii export of tabulars.
2962 2000-10-05 Juergen Vigna <jug@sad.it>
2964 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2965 if we don't have a buffer.
2967 2000-10-10 Allan Rae <rae@lyx.org>
2969 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2970 with closing dialog. It seems that nested tabfolders require hiding
2971 of inner tabfolders before hiding the dialog itself. Actually all I
2972 did was hide the active outer folder.
2974 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2975 unless there really is a buffer. hideBufferDependent is called
2978 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2979 POTFILES.in stays in $(srcdir).
2981 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2983 * lib/lyxrc.example: Few changes.
2985 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2987 * src/BufferView_pimpl.C (buffer): only need one the
2988 updateBufferDependent signal to be emitted once! Moved to the end of
2989 the method to allow bv_->text to be updated first.
2991 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2992 and hSignal_ with Dialogs * and BufferDependency variables.
2993 New Buffer * parent_, initialised when the dialog is launched. Used to
2994 check whether to update() or hide() dialog in the new, private
2995 updateOrHide() method that is connected to the updateBufferDependent
2996 signal. Daughter classes dictate what to do using the
2997 ChangedBufferAction enum, passed to the c-tor.
2999 * src/frontends/xforms/FormCitation.C:
3000 * src/frontends/xforms/FormCommand.C:
3001 * src/frontends/xforms/FormCopyright.C:
3002 * src/frontends/xforms/FormDocument.C:
3003 * src/frontends/xforms/FormError.C:
3004 * src/frontends/xforms/FormIndex.C:
3005 * src/frontends/xforms/FormPreferences.C:
3006 * src/frontends/xforms/FormPrint.C:
3007 * src/frontends/xforms/FormRef.C:
3008 * src/frontends/xforms/FormToc.C:
3009 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
3012 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
3013 ChangedBufferAction enum.
3015 * src/frontends/xforms/FormParagraph.[Ch]
3016 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
3019 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3021 * lib/bind/cua.bind: fix a bit.
3022 * lib/bind/emacs.bind: ditto.
3024 * lib/bind/menus.bind: remove real menu entries from there.
3026 * src/spellchecker.C: make sure we only include strings.h when
3029 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3031 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
3032 function. It enlarges the maximum number of pup when needed.
3033 (add_toc2): Open a new menu if maximum number of items per menu has
3036 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
3038 * src/frontends/kde/FormPrint.C: fix error reporting
3040 * src/frontends/xforms/FormDocument.C: fix compiler
3043 * lib/.cvsignore: add Literate.nw
3045 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
3048 * bufferview_funcs.[Ch]
3051 * text2.C: Add support for numbers in RTL text.
3053 2000-10-06 Allan Rae <rae@lyx.org>
3055 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
3056 to be gettext.m4 friendly again. ext_l10n.h is now
3057 generated into $top_srcdir instead of $top_builddir
3058 so that lyx.pot will be built correctly -- without
3059 duplicate parsing of ext_l10n.h.
3061 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3063 * src/frontends/kde/FormCitation.C: make the dialog
3064 behave more sensibly
3066 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
3068 * config/kde.m4: fix consecutive ./configure runs,
3069 look for qtarch, fix library order
3071 * src/frontends/kde/Makefile.am: tidy up,
3072 add Print dialog, add .dlg dependencies
3074 * src/frontends/kde/FormPrint.C:
3075 * src/frontends/kde/FormPrint.h:
3076 * src/frontends/kde/formprintdialog.C:
3077 * src/frontends/kde/formprintdialog.h:
3078 * src/frontends/kde/formprintdialogdata.C:
3079 * src/frontends/kde/formprintdialogdata.h:
3080 * src/frontends/kde/dlg/formprintdialog.dlg: add
3083 * src/frontends/kde/dlg/README: Added explanatory readme
3085 * src/frontends/kde/dlg/checkinitorder.pl: small perl
3086 script to double-check qtarch's output
3088 * src/frontends/kde/formindexdialog.C:
3089 * src/frontends/kde/formindexdialogdata.C:
3090 * src/frontends/kde/formindexdialogdata.h:
3091 * src/frontends/kde/dlg/formindexdialog.dlg: update
3092 for qtarch, minor fixes
3094 2000-10-05 Allan Rae <rae@lyx.org>
3096 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
3097 dialogs when switching buffers update them instead. It's up to each
3098 dialog to decide if it should still be visible or not.
3099 update() should return a bool to control visiblity within show().
3100 Or perhaps better to set a member variable and use that to control
3103 * lib/build-listerrors: create an empty "listerrors" file just to stop
3104 make trying to regenerate it all the time if you don't have noweb
3107 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
3109 * po/Makefile.in.in (ext_l10n.h): added a rule to build
3110 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
3111 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
3112 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
3113 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
3115 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
3117 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
3119 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
3120 deleting buffer. Closes all buffer-dependent dialogs.
3122 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
3124 * src/frontends/xforms/FormCitation.[Ch]:
3125 * src/frontends/xforms/FormPreferences.[Ch]:
3126 * src/frontends/xforms/FormPrint.[Ch]:
3127 * src/frontends/xforms/FormRef.[Ch]:
3128 * src/frontends/xforms/FormUrl.[Ch]: ditto
3130 * src/frontends/xforms/FormDocument.[Ch]:
3131 * src/frontends/xforms/forms/form_document.C.patch:
3132 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
3133 pass through a single input() function.
3135 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3137 * lib/build-listerrors: return status as OK
3139 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
3141 * lib/lyxrc.example: Updated to new export code
3143 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3145 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
3148 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
3151 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
3152 LyX-Code is defined.
3153 * lib/layouts/amsbook.layout: ditto.
3155 * boost/Makefile.am: fix typo.
3157 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
3159 (add_lastfiles): removed.
3160 (add_documents): removed.
3161 (add_formats): removed.
3163 * src/frontends/Menubar.C: remove useless "using" directive.
3165 * src/MenuBackend.h: add a new MenuItem constructor.
3167 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
3170 2000-10-04 Allan Rae <rae@lyx.org>
3172 * lib/Makefile.am (listerrors):
3173 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
3174 I haven't got notangle installed so Kayvan please test. The output
3175 should end up in $builddir. This also allows people who don't have
3176 noweb installed to complete the make process without error.
3178 * src/frontends/xforms/FormCommand.[Ch] (showInset):
3179 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
3180 by JMarc's picky compiler.
3182 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3185 * src/insets/insettabular.C (setPos): change for loop to not use
3186 sequencing operator. Please check this Jürgen.
3188 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3190 * src/insets/insetcite.C (getScreenLabel): ditto
3191 * src/support/filetools.C (QuoteName): ditto
3192 (ChangeExtension): ditto
3194 * src/BufferView_pimpl.C (scrollCB): make heigt int
3196 * src/BufferView2.C (insertInset): comment out unused arg
3198 * boost/Makefile.am (EXTRADIST): new variable
3200 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3202 * src/exporter.C (IsExportable): Fixed
3204 * lib/configure.m4: Small fix
3206 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3208 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3209 * src/insets/insetbib.C (bibitemWidest): ditto.
3210 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3212 2000-10-03 Juergen Vigna <jug@sad.it>
3214 * src/BufferView2.C (theLockingInset): removed const because of
3215 Agnus's compile problems.
3217 * src/insets/insettext.C (LocalDispatch): set the language of the
3218 surronding paragraph on inserting the first character.
3220 * various files: changed use of BufferView::the_locking_inset.
3222 * src/BufferView2.C (theLockingInset):
3223 (theLockingInset): new functions.
3225 * src/BufferView.h: removed the_locking_inset.
3227 * src/lyxtext.h: added the_locking_inset
3229 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3231 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3233 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3235 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3236 * src/mathed/math_cursor.C (IsAlpha): ditto.
3237 * src/mathed/math_inset.C (strnew): ditto.
3238 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3239 (IMetrics): cxp set but never used; removed.
3240 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3241 that the variable in question has been removed also!
3244 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3245 using the Buffer * passed to Latex(), using the BufferView * passed to
3246 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3248 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3249 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3251 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3252 * src/buffer.C (readInset): used new InsetBibtex c-tor
3253 * (getBibkeyList): used new InsetBibtex::getKeys
3255 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3258 * lib/build-listerrors
3260 * src/exporter.C: Add literate programming support to the export code
3263 * src/lyx_cb.C: Remove old literate code.
3265 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3268 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3269 * src/converter.C (View, Convert): Use QuoteName.
3271 * src/insets/figinset.C (Preview): Use Formats::View.
3273 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3275 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3277 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3278 the top of the function, because compaq cxx complains that the
3279 "goto exit_with_message" when the function is disabled bypasses
3281 (MenuNew): try a better fix for the generation of new file names.
3282 This time, I used AddName() instead of AddPath(), hoping Juergen
3285 2000-10-03 Allan Rae <rae@lyx.org>
3287 * src/frontends/xforms/forms/form_preferences.fd:
3288 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3289 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3290 "Look and Feel"->"General" but will need to be split up further into
3291 general output and general input tabs. Current plan is for four outer
3292 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3293 stuff; "Inputs" for input and import configuration; "Outputs" for
3294 output and export configuration; and one more whatever is left over
3295 called "General". The leftovers at present look like being which
3296 viewers to use, spellchecker, language support and might be better
3297 named "Support". I've put "Paths" in "Inputs" for the moment as this
3298 seems reasonable for now at least.
3299 One problem remains: X error kills LyX when you close Preferences.
3301 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3303 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3304 qualifier from form()
3305 * src/frontends/xforms/FormCitation.[Ch]:
3306 * src/frontends/xforms/FormCopyright.[Ch]:
3307 * src/frontends/xforms/FormDocument.[Ch]:
3308 * src/frontends/xforms/FormError.[Ch]:
3309 * src/frontends/xforms/FormIndex.[Ch]:
3310 * src/frontends/xforms/FormPreferences.[Ch]:
3311 * src/frontends/xforms/FormPrint.[Ch]:
3312 * src/frontends/xforms/FormRef.[Ch]:
3313 * src/frontends/xforms/FormToc.[Ch]:
3314 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3316 * src/frontends/xforms/FormCitation.[Ch]:
3317 * src/frontends/xforms/FormIndex.[Ch]:
3318 * src/frontends/xforms/FormRef.[Ch]:
3319 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3320 with Allan's naming policy
3322 * src/frontends/xforms/FormCitation.C: some static casts to remove
3325 2000-10-02 Juergen Vigna <jug@sad.it>
3327 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3328 now you can type or do stuff inside the table-cell also when in dummy
3329 position, fixed visible cursor.
3331 * src/insets/insettext.C (Edit): fixing cursor-view position.
3333 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3334 be used for equal functions in lyxfunc and insettext.
3336 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3338 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3340 * src/frontends/gnome/FormCitation.h:
3341 * src/frontends/gnome/FormCopyright.h:
3342 * src/frontends/gnome/FormIndex.h:
3343 * src/frontends/gnome/FormPrint.h:
3344 * src/frontends/gnome/FormToc.h:
3345 * src/frontends/gnome/FormUrl.h:
3346 * src/frontends/kde/FormCitation.h:
3347 * src/frontends/kde/FormCopyright.h:
3348 * src/frontends/kde/FormIndex.h:
3349 * src/frontends/kde/FormRef.h:
3350 * src/frontends/kde/FormToc.h:
3351 * src/frontends/kde/FormUrl.h: fix remaining users of
3354 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3356 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3357 from depth argument.
3358 (DocBookHandleCaption): ditto.
3359 (DocBookHandleFootnote): ditto.
3360 (SimpleDocBookOnePar): ditto.
3362 * src/frontends/xforms/FormDocument.h (form): remove extra
3363 FormDocument:: qualifier.
3365 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3367 * sigc++/handle.h: ditto.
3369 * src/lyx_gui_misc.C: add "using" directive.
3371 * src/cheaders/cstddef: new file, needed by the boost library (for
3374 2000-10-02 Juergen Vigna <jug@sad.it>
3376 * src/insets/insettext.C (SetFont): better support.
3378 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3380 * src/screen.C (DrawOneRow): some uint refixes!
3382 2000-10-02 Allan Rae <rae@lyx.org>
3384 * boost/.cvsignore: ignore Makefile as well
3386 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3387 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3389 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3390 Left this one out by accident.
3392 * src/frontends/xforms/FormBase.h (restore): default to calling
3393 update() since that will restore the original/currently-applied values.
3394 Any input() triggered error messages will require the derived classes
3395 to redefine restore().
3397 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3398 avoid a segfault. combo_doc_class is the main concern.
3400 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3402 * Simplify build-listerrors in view of GUI-less export ability!
3404 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3406 * src/lyx_main.C (easyParse): Disable gui when exporting
3408 * src/insets/figinset.C:
3411 * src/lyx_gui_misc.C
3412 * src/tabular.C: Changes to allow no-gui.
3414 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3416 * src/support/utility.hpp: removed file
3417 * src/support/block.h: removed file
3419 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3422 * src/mathed/formula.C: add support/lyxlib.h
3423 * src/mathed/formulamacro.C: ditto
3425 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3426 * src/lyxparagraph.h: ditto
3428 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3429 * src/frontends/Makefile.am (INCLUDES): ditto
3430 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3431 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3432 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3433 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3434 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3435 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3437 * src/BufferView.h: use boost/utility.hpp
3438 * src/LColor.h: ditto
3439 * src/LaTeX.h: ditto
3440 * src/LyXAction.h: ditto
3441 * src/LyXView.h: ditto
3442 * src/bufferlist.h: ditto
3443 * src/lastfiles.h: ditto
3444 * src/layout.h: ditto
3445 * src/lyx_gui.h: ditto
3446 * src/lyx_main.h: ditto
3447 * src/lyxlex.h: ditto
3448 * src/lyxrc.h: ditto
3449 * src/frontends/ButtonPolicies.h: ditto
3450 * src/frontends/Dialogs.h: ditto
3451 * src/frontends/xforms/FormBase.h: ditto
3452 * src/frontends/xforms/FormGraphics.h: ditto
3453 * src/frontends/xforms/FormParagraph.h: ditto
3454 * src/frontends/xforms/FormTabular.h: ditto
3455 * src/graphics/GraphicsCache.h: ditto
3456 * src/graphics/Renderer.h: ditto
3457 * src/insets/ExternalTemplate.h: ditto
3458 * src/insets/insetcommand.h: ditto
3459 * src/support/path.h: ditto
3461 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3462 and introduce clause for 2.97.
3464 * boost/libs/README: new file
3466 * boost/boost/utility.hpp: new file
3468 * boost/boost/config.hpp: new file
3470 * boost/boost/array.hpp: new file
3472 * boost/Makefile.am: new file
3474 * boost/.cvsignore: new file
3476 * configure.in (AC_OUTPUT): add boost/Makefile
3478 * Makefile.am (SUBDIRS): add boost
3480 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3482 * src/support/lstrings.C (suffixIs): Fixed.
3484 2000-10-01 Allan Rae <rae@lyx.org>
3486 * src/PrinterParams.h: moved things around to avoid the "can't
3487 inline call" warning.
3489 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3490 into doc++ documentation.
3492 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3494 * src/frontends/xforms/FormRef.C: make use of button controller
3495 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3496 cleaned up button controller usage.
3497 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3498 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3499 use the button controller
3501 * src/frontends/xforms/forms/*.fd: and associated generated files
3502 updated to reflect changes to FormBase. Some other FormXxxx files
3503 also got minor updates to reflect changes to FormBase.
3505 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3506 (hide): made virtual.
3507 (input): return a bool. true == valid input
3508 (RestoreCB, restore): new
3509 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3510 Changes to allow derived dialogs to use a ButtonController and
3511 make sense when doing so: OK button calls ok() and so on.
3513 * src/frontends/xforms/ButtonController.h (class ButtonController):
3514 Switch from template implementation to taking Policy parameter.
3515 Allows FormBase to provide a ButtonController for any dialog.
3517 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3518 Probably should rename connect and disconnect.
3519 (apply): use the radio button groups
3520 (form): needed by FormBase
3521 (build): setup the radio button groups
3523 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3525 * several files: type changes to reduce the number of warnings and
3526 to unify type hangling a bit. Still much to do.
3528 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3530 * lib/images/*: rename a bunch of icons to match Dekel converter
3533 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3536 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3538 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3540 * sigc++/handle.h: ditto for class Handle.
3542 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3544 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3546 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3548 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3549 removal of the "default" language.
3551 * src/combox.h (getline): Check that sel > 0
3553 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3555 * lib/examples/docbook_example.lyx
3556 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3558 * lib/layouts/docbook-book.layout: new docbook book layout.
3560 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3562 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3564 * src/insets/figinset.C (DocBook):fixed small typo.
3566 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3568 * src/insets/insetinclude.h: string include_label doesn't need to be
3571 2000-09-29 Allan Rae <rae@lyx.org>
3573 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3574 Allow derived type to control connection and disconnection from signals
3575 of its choice if desired.
3577 2000-09-28 Juergen Vigna <jug@sad.it>
3579 * src/insets/insettabular.C (update): fixed cursor setting when
3580 the_locking_inset changed.
3581 (draw): made this a bit cleaner.
3582 (InsetButtonPress): fixed!
3584 * various files: added LyXText Parameter to fitCursor call.
3586 * src/BufferView.C (fitCursor): added LyXText parameter.
3588 * src/insets/insettabular.C (draw): small draw fix.
3590 * src/tabular.C: right setting of left/right celllines.
3592 * src/tabular.[Ch]: fixed various types in funcions and structures.
3593 * src/insets/insettabular.C: ditto
3594 * src/frontends/xforms/FormTabular.C: ditto
3596 2000-09-28 Allan Rae <rae@lyx.org>
3598 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3599 that the #ifdef's had been applied to part of what should have been
3600 a complete condition. It's possible there are other tests that
3601 were specific to tables that are also wrong now that InsetTabular is
3602 being used. Now we need to fix the output of '\n' after a table in a
3603 float for the same reason as the original condition:
3604 "don't insert this if we would be adding it before or after a table
3605 in a float. This little trick is needed in order to allow use of
3606 tables in \subfigures or \subtables."
3607 Juergen can you check this?
3609 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3611 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3612 output to the ostream.
3614 * several files: fixed types based on warnings from cxx
3616 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3618 * src/frontends/kde/Makefile.am: fix rule for
3619 formindexdialogdata_moc.C
3621 * src/.cvsignore: add ext_l10n.h to ignore
3623 * acconfig.h: stop messing with __STRICT_ANSI__
3624 * config/gnome.m4: remove option to set -ansi
3625 * config/kde.m4: remove option to set -ansi
3626 * config/lyxinclude.m4: don't set -ansi
3628 2000-09-27 Juergen Vigna <jug@sad.it>
3630 * various files: remove "default" language check.
3632 * src/insets/insetquotes.C: removed use of current_view.
3634 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3635 the one should have red ears by now!
3637 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3638 in more then one paragraph. Fixed cursor-movement/selection.
3640 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3641 paragraphs inside a text inset.
3643 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3644 text-inset if this owner is an inset.
3646 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3648 * src/Bullet.h: changed type of font, character and size to int
3650 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3652 * src/insets/inseturl.[Ch]:
3653 * src/insets/insetref.[Ch]:
3654 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3656 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3658 * src/buffer.C (readFile): block-if statement rearranged to minimise
3659 bloat. Patch does not reverse Jean-Marc's change ;-)
3661 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3662 Class rewritten to store pointers to hide/update signals directly,
3663 rather than Dialogs *. Also defined an enum to ease use. All xforms
3664 forms can now be derived from this class.
3666 * src/frontends/xforms/FormCommand.[Ch]
3667 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3669 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3672 * src/frontends/xforms/forms/form_citation.fd
3673 * src/frontends/xforms/forms/form_copyright.fd
3674 * src/frontends/xforms/forms/form_error.fd
3675 * src/frontends/xforms/forms/form_index.fd
3676 * src/frontends/xforms/forms/form_ref.fd
3677 * src/frontends/xforms/forms/form_toc.fd
3678 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3680 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3682 * src/insets/insetfoot.C: removed redundent using directive.
3684 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3686 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3687 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3689 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3690 created in the constructors in different groups. Then set() just
3691 have to show the groups as needed. This fixes the redraw problems
3692 (and is how the old menu code worked).
3694 * src/support/lyxlib.h: declare the methods as static when we do
3695 not have namespaces.
3697 2000-09-26 Juergen Vigna <jug@sad.it>
3699 * src/buffer.C (asciiParagraph): new function.
3700 (writeFileAscii): new function with parameter ostream.
3701 (writeFileAscii): use now asciiParagraph.
3703 * various inset files: added the linelen parameter to the Ascii-func.
3705 * src/tabular.C (Write): fixed error in writing file introduced by
3706 the last changes from Lars.
3708 * lib/bind/menus.bind: removed not supported functions.
3710 * src/insets/insettext.C (Ascii): implemented this function.
3712 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3714 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3715 (Write): use of the write_attribute functions.
3717 * src/bufferlist.C (close): fixed reasking question!
3719 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3721 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3722 new files use the everwhere possible.
3725 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3726 src/log_form.C src/lyx.C:
3729 * src/buffer.C (runLaTeX): remove func
3731 * src/PaperLayout.C: removed file
3732 * src/ParagraphExtra.C: likewise
3733 * src/bullet_forms.C: likewise
3734 * src/bullet_forms.h: likewise
3735 * src/bullet_forms_cb.C: likewise
3737 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3738 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3741 * several files: remove all traces of the old fd_form_paragraph,
3742 and functions belonging to that.
3744 * several files: remove all traces of the old fd_form_document,
3745 and functions belonging to that.
3747 * several files: constify local variables were possible.
3749 * several files: remove all code that was dead when NEW_EXPORT was
3752 * several files: removed string::c_str in as many places as
3755 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3756 (e): be a bit more outspoken when patching
3757 (updatesrc): only move files if changed.
3759 * forms/layout_forms.h.patch: regenerated
3761 * forms/layout_forms.fd: remove form_document and form_paragraph
3762 and form_quotes and form_paper and form_table_options and
3763 form_paragraph_extra
3765 * forms/form1.fd: remove form_table
3767 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3768 the fdui->... rewrite. Update some comments to xforms 0.88
3770 * forms/bullet_forms.C.patch: removed file
3771 * forms/bullet_forms.fd: likewise
3772 * forms/bullet_forms.h.patch: likewise
3774 * development/Code_rules/Rules: added a section on switch
3775 statements. Updated some comment to xforms 0.88.
3777 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3779 * src/buffer.C (readFile): make sure that the whole version number
3780 is read after \lyxformat (even when it contains a comma)
3782 * lib/ui/default.ui: change shortcut of math menu to M-a.
3784 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3786 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3789 * src/LyXView.C (updateWindowTitle): show the full files name in
3790 window title, limited to 30 characters.
3792 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3793 When a number of characters has been given, we should not assume
3794 that the string is 0-terminated.
3796 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3797 calls (fixes some memory leaks)
3799 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3800 trans member on exit.
3802 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3804 * src/converter.C (GetReachable): fix typo.
3806 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3807 understand ',' instead of '.'.
3808 (GetInteger): rewrite to use strToInt().
3810 2000-09-26 Juergen Vigna <jug@sad.it>
3812 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3813 better visibility and error-message on wrong VSpace input.
3815 * src/language.C (initL): added english again.
3817 2000-09-25 Juergen Vigna <jug@sad.it>
3819 * src/frontends/kde/Dialogs.C (Dialogs):
3820 * src/frontends/gnome/Dialogs.C (Dialogs):
3821 * src/frontends/kde/Makefile.am:
3822 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3824 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3826 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3828 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3830 * src/frontends/xforms/FormParagraph.C:
3831 * src/frontends/xforms/FormParagraph.h:
3832 * src/frontends/xforms/form_paragraph.C:
3833 * src/frontends/xforms/form_paragraph.h:
3834 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3837 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3839 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3840 Paragraph-Data after use.
3842 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3843 non breakable paragraphs.
3845 2000-09-25 Garst R. Reese <reese@isn.net>
3847 * src/language.C (initL): added missing language_country codes.
3849 2000-09-25 Juergen Vigna <jug@sad.it>
3851 * src/insets/insettext.C (InsetText):
3852 (deleteLyXText): remove the not released LyXText structure!
3854 2000-09-24 Marko Vendelin <markov@ioc.ee>
3856 * src/frontends/gnome/mainapp.C
3857 * src/frontends/gnome/mainapp.h: added support for keyboard
3860 * src/frontends/gnome/FormCitation.C
3861 * src/frontends/gnome/FormCitation.h
3862 * src/frontends/gnome/Makefile.am
3863 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3864 FormCitation to use "action area" in mainapp window
3866 * src/frontends/gnome/Menubar_pimpl.C
3867 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3870 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3872 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3873 width/descent/ascent values if name is empty.
3874 (mathed_string_height): Use std::max.
3876 2000-09-25 Allan Rae <rae@lyx.org>
3878 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3879 segfault. This will be completely redesigned soon.
3881 * sigc++: updated libsigc++. Fixes struct timespec bug.
3883 * development/tools/makeLyXsigc.sh: .cvsignore addition
3885 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3887 * several files: removed almost all traces of the old table
3890 * src/TableLayout.C: removed file
3892 2000-09-22 Juergen Vigna <jug@sad.it>
3894 * src/frontends/kde/Dialogs.C: added credits forms.
3896 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3898 * src/frontends/gnome/Dialogs.C: added some forms.
3900 * src/spellchecker.C (init_spell_checker): set language in pspell code
3901 (RunSpellChecker): some modifications for setting language string.
3903 * src/language.[Ch]: added language_country code.
3905 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3907 * src/frontends/Dialogs.h: added new signal showError.
3908 Rearranged existing signals in some sort of alphabetical order.
3910 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3911 FormError.[Ch], form_error.[Ch]
3912 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3913 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3915 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3916 dialogs. I think that this can be used as the base to all these
3919 * src/frontends/xforms/FormError.[Ch]
3920 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3921 implementation of InsetError dialog.
3923 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3925 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3926 * src/frontends/kde/Makefile.am: ditto
3928 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3930 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3931 macrobf. This fixes a bug of invisible text.
3933 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3935 * lib/doc/LaTeXConfig.lyx.in: updated.
3937 * src/language.C (initL): remove language "francais" and change a
3938 bit the names of the two other french variations.
3940 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3941 string that may not be 0-terminated.
3943 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3945 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3947 2000-09-20 Marko Vendelin <markov@ioc.ee>
3949 * src/frontends/gnome/FormCitation.C
3950 * src/frontends/gnome/FormIndex.C
3951 * src/frontends/gnome/FormToc.C
3952 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3953 the variable initialization to shut up the warnings
3955 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3957 * src/table.[Ch]: deleted files
3959 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3962 2000-09-18 Juergen Vigna <jug@sad.it>
3964 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3965 problems with selection. Inserted new LFUN_PASTESELECTION.
3966 (InsetButtonPress): inserted handling of middle mouse-button paste.
3968 * src/spellchecker.C: changed word to word.c_str().
3970 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3972 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3973 included in the ``make dist'' tarball.
3975 2000-09-15 Juergen Vigna <jug@sad.it>
3977 * src/CutAndPaste.C (cutSelection): small fix return the right
3978 end position after cut inside one paragraph only.
3980 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3981 we are locked as otherwise we don't have a valid cursor position!
3983 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3985 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3987 * src/frontends/kde/FormRef.C: added using directive.
3988 * src/frontends/kde/FormToc.C: ditto
3990 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3992 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3994 2000-09-19 Marko Vendelin <markov@ioc.ee>
3996 * src/frontends/gnome/Menubar_pimpl.C
3997 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3998 Toc, ViewFormats, UpdateFormats, and ExportFormats.
4000 * src/frontends/gnome/mainapp.C
4001 * src/frontends/gnome/mainapp.h: support for menu update used
4004 * src/frontends/gnome/mainapp.C
4005 * src/frontends/gnome/mainapp.h: support for "action" area in the
4006 main window. This area is used by small simple dialogs, such as
4009 * src/frontends/gnome/FormIndex.C
4010 * src/frontends/gnome/FormIndex.h
4011 * src/frontends/gnome/FormUrl.C
4012 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
4015 * src/frontends/gnome/FormCitation.C
4016 * src/frontends/gnome/FormCitation.h: rewrite to use main window
4017 action area. Only "Insert new citation" is implemented.
4019 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4021 * src/buffer.C (Dispatch): fix call to Dispatch
4022 * src/insets/insetref.C (Edit): likewise
4023 * src/insets/insetparent.C (Edit): likewise
4024 * src/insets/insetinclude.C (include_cb): likewise
4025 * src/frontends/xforms/FormUrl.C (apply): likewise
4026 * src/frontends/xforms/FormToc.C (apply): likewise
4027 * src/frontends/xforms/FormRef.C (apply): likewise
4028 * src/frontends/xforms/FormIndex.C (apply): likewise
4029 * src/frontends/xforms/FormCitation.C (apply): likewise
4030 * src/lyxserver.C (callback): likewise
4031 * src/lyxfunc.C (processKeySym): likewise
4032 (Dispatch): likewise
4033 (Dispatch): likewise
4034 * src/lyx_cb.C (LayoutsCB): likewise
4036 * Makefile.am (sourcedoc): small change
4038 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4040 * src/main.C (main): Don't make an empty GUIRunTime object. all
4041 methods are static. constify a bit remove unneded using + headers.
4043 * src/tabular.C: some more const to local vars move some loop vars
4045 * src/spellchecker.C: added some c_str after some word for pspell
4047 * src/frontends/GUIRunTime.h: add new static method setDefaults
4048 * src/frontends/xforms/GUIRunTime.C (setDefaults):
4049 * src/frontends/kde/GUIRunTime.C (setDefaults):
4050 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
4052 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
4053 with strnew in arg, use correct emptystring when calling SetName.
4055 * several files: remove all commented code with relation to
4056 HAVE_SSTREAM beeing false. We now only support stringstream and
4059 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4061 * src/lyxfunc.C: construct correctly the automatic new file
4064 * src/text2.C (IsStringInText): change type of variable i to shut
4067 * src/support/sstream.h: do not use namespaces if the compiler
4068 does not support them.
4070 2000-09-15 Marko Vendelin <markov@ioc.ee>
4071 * src/frontends/gnome/FormCitation.C
4072 * src/frontends/gnome/FormCitation.h
4073 * src/frontends/gnome/diainsertcitation_interface.c
4074 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
4075 regexp support to FormCitation [Gnome].
4077 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
4080 * configure.in: remove unused KDE/GTKGUI define
4082 * src/frontends/kde/FormRef.C
4083 * src/frontends/kde/FormRef.h
4084 * src/frontends/kde/formrefdialog.C
4085 * src/frontends/kde/formrefdialog.h: double click will
4086 go to reference, now it is possible to change a cross-ref
4089 * src/frontends/kde/FormToc.C
4090 * src/frontends/kde/FormToc.h
4091 * src/frontends/kde/formtocdialog.C
4092 * src/frontends/kde/formtocdialog.h: add a depth
4095 * src/frontends/kde/Makefile.am: add QtLyXView.h
4098 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
4100 * src/frontends/kde/FormCitation.h: added some using directives.
4102 * src/frontends/kde/FormToc.h: corrected definition of doTree.
4104 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
4107 * src/mathed/math_defs.h: redefine SetAlign to use string rather
4110 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4112 * src/buffer.C (pop_tag): revert for the second time a change by
4113 Lars, who seems to really hate having non-local loop variables :)
4115 * src/Lsstream.h: add "using" statements.
4117 * src/support/copy.C (copy): add a bunch of std:: qualifiers
4118 * src/buffer.C (writeFile): ditto
4120 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4122 * src/buffer.C (writeFile): try to fix the locale modified format
4123 number to always be as we want it.
4125 * src/WorkArea.C (work_area_handler): try to workaround the bugs
4126 in XForms 0.89. C-space is now working again.
4128 * src/Lsstream.h src/support/sstream.h: new files.
4130 * also commented out all cases where strstream were used.
4132 * src/Bullet.h (c_str): remove method.
4134 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
4136 * a lot of files: get rid of "char const *" and "char *" is as
4137 many places as possible. We only want to use them in interaction
4138 with system of other libraries, not inside lyx.
4140 * a lot of files: return const object is not of pod type. This
4141 helps ensure that temporary objects is not modified. And fits well
4142 with "programming by contract".
4144 * configure.in: check for the locale header too
4146 * Makefile.am (sourcedoc): new tag for generation of doc++
4149 2000-09-14 Juergen Vigna <jug@sad.it>
4151 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
4152 callback to check which combo called it and do the right action.
4154 * src/combox.C (combo_cb): added combo * to the callbacks.
4155 (Hide): moved call of callback after Ungrab of the pointer.
4157 * src/intl.h: removed LCombo2 function.
4159 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
4160 function as this can now be handled in one function.
4162 * src/combox.h: added Combox * to callback prototype.
4164 * src/frontends/xforms/Toolbar_pimpl.C:
4165 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
4167 2000-09-14 Garst Reese <reese@isn.net>
4169 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
4170 moved usepackage{xxx}'s to beginning of file. Changed left margin
4171 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
4172 underlining from title. Thanks to John Culleton for useful suggestions.
4174 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4176 * src/lyxlex_pimpl.C (setFile): change error message to debug
4179 2000-09-13 Juergen Vigna <jug@sad.it>
4181 * src/frontends/xforms/FormDocument.C: implemented choice_class
4182 as combox and give callback to combo_language so OK/Apply is activated
4185 * src/bufferlist.C (newFile): small fix so already named files
4186 (via an open call) are not requested to be named again on the
4189 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4191 * src/frontends/kde/Makefile.am
4192 * src/frontends/kde/FormRef.C
4193 * src/frontends/kde/FormRef.h
4194 * src/frontends/kde/formrefdialog.C
4195 * src/frontends/kde/formrefdialog.h: implement
4198 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4200 * src/frontends/kde/formtocdialog.C
4201 * src/frontends/kde/formtocdialog.h
4202 * src/frontends/kde/FormToc.C
4203 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4205 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4207 * src/frontends/kde/FormCitation.C: fix thinko
4208 where we didn't always display the reference text
4211 * src/frontends/kde/formurldialog.C
4212 * src/frontends/kde/formurldialog.h
4213 * src/frontends/kde/FormUrl.C
4214 * src/frontends/kde/FormUrl.h: minor cleanups
4216 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4218 * src/frontends/kde/Makefile.am
4219 * src/frontends/kde/FormToc.C
4220 * src/frontends/kde/FormToc.h
4221 * src/frontends/kde/FormCitation.C
4222 * src/frontends/kde/FormCitation.h
4223 * src/frontends/kde/FormIndex.C
4224 * src/frontends/kde/FormIndex.h
4225 * src/frontends/kde/formtocdialog.C
4226 * src/frontends/kde/formtocdialog.h
4227 * src/frontends/kde/formcitationdialog.C
4228 * src/frontends/kde/formcitationdialog.h
4229 * src/frontends/kde/formindexdialog.C
4230 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4232 2000-09-12 Juergen Vigna <jug@sad.it>
4234 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4237 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4239 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4242 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4244 * src/converter.C (Add, Convert): Added support for converter flags:
4245 needaux, resultdir, resultfile.
4246 (Convert): Added new parameter view_file.
4247 (dvips_options): Fixed letter paper option.
4249 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4250 (Export, GetExportableFormats, GetViewableFormats): Added support
4253 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4255 (easyParse): Fixed to work with new export code.
4257 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4260 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4262 * lib/bind/*.bind: Replaced
4263 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4264 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4266 2000-09-11 Juergen Vigna <jug@sad.it>
4268 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4270 * src/main.C (main): now GUII defines global guiruntime!
4272 * src/frontends/gnome/GUIRunTime.C (initApplication):
4273 * src/frontends/kde/GUIRunTime.C (initApplication):
4274 * src/frontends/xforms/GUIRunTime.C (initApplication):
4275 * src/frontends/GUIRunTime.h: added new function initApplication.
4277 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4279 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4281 2000-09-08 Juergen Vigna <jug@sad.it>
4283 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4284 we have already "Reset".
4286 * src/language.C (initL): inserted "default" language and made this
4287 THE default language (and not american!)
4289 * src/paragraph.C: inserted handling of "default" language!
4291 * src/lyxfont.C: ditto
4295 * src/paragraph.C: output the \\par only if we have a following
4296 paragraph otherwise it's not needed.
4298 2000-09-05 Juergen Vigna <jug@sad.it>
4300 * config/pspell.m4: added entry to lyx-flags
4302 * src/spellchecker.C: modified version from Kevin for using pspell
4304 2000-09-01 Marko Vendelin <markov@ioc.ee>
4305 * src/frontends/gnome/Makefile.am
4306 * src/frontends/gnome/FormCitation.C
4307 * src/frontends/gnome/FormCitation.h
4308 * src/frontends/gnome/diainsertcitation_callbacks.c
4309 * src/frontends/gnome/diainsertcitation_callbacks.h
4310 * src/frontends/gnome/diainsertcitation_interface.c
4311 * src/frontends/gnome/diainsertcitation_interface.h
4312 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4313 dialog for Gnome frontend
4315 * src/main.C: Gnome libraries require keeping application name
4316 and its version as strings
4318 * src/frontends/gnome/mainapp.C: Change the name of the main window
4319 from GnomeLyX to PACKAGE
4321 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4323 * src/frontends/Liason.C: add "using: declaration.
4325 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4327 * src/mathed/math_macro.C (Metrics): Set the size of the template
4329 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4331 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4333 * src/converter.C (add_options): New function.
4334 (SetViewer): Change $$FName into '$$FName'.
4335 (View): Add options when running xdvi
4336 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4337 (Convert): The 3rd parameter is now the desired filename. Converts
4338 calls to lyx::rename if necessary.
4339 Add options when running dvips.
4340 (dvi_papersize,dvips_options): New methods.
4342 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4344 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4345 using a call to Converter::dvips_options.
4346 Fixed to work with nex export code.
4348 * src/support/copy.C
4349 * src/support/rename.C: New files
4351 * src/support/syscall.h
4352 * src/support/syscall.C: Added Starttype SystemDontWait.
4354 * lib/ui/default.ui: Changed to work with new export code
4356 * lib/configure.m4: Changed to work with new export code
4358 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4360 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4362 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4363 so that code compiles with DEC cxx.
4365 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4366 to work correctly! Also now supports the additional elements
4369 2000-09-01 Allan Rae <rae@lyx.org>
4371 * src/frontends/ButtonPolicies.C: renamed all the references to
4372 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4374 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4375 since it's a const not a type.
4377 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4379 2000-08-31 Juergen Vigna <jug@sad.it>
4381 * src/insets/figinset.C: Various changes to look if the filename has
4382 an extension and if not add it for inline previewing.
4384 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4386 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4387 make buttonStatus and isReadOnly be const methods. (also reflect
4388 this in derived classes.)
4390 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4391 (nextState): change to be static inline, pass the StateMachine as
4393 (PreferencesPolicy): remove casts
4394 (OkCancelPolicy): remvoe casts
4395 (OkCancelReadOnlyPolicy): remove casts
4396 (NoRepeatedApplyReadOnlyPolicy): remove casts
4397 (OkApplyCancelReadOnlyPolicy): remove casts
4398 (OkApplyCancelPolicy): remove casts
4399 (NoRepeatedApplyPolicy): remove casts
4401 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4403 * src/converter.C: added some using directives
4405 * src/frontends/ButtonPolicies.C: changes to overcome
4406 "need lvalue" error with DEC c++
4408 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4409 to WMHideCB for DEC c++
4411 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4413 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4414 to BulletBMTableCB for DEC c++
4416 2000-08-31 Allan Rae <rae@lyx.org>
4418 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4419 character dialog separately from old document dialogs combo_language.
4422 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4424 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4425 Removed LFUN_REF_CREATE.
4427 * src/MenuBackend.C: Added new tags: toc and references
4429 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4430 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4432 (add_toc, add_references): New methods.
4433 (create_submenu): Handle correctly the case when there is a
4434 seperator after optional menu items.
4436 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4437 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4438 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4440 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4442 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4444 * src/converter.[Ch]: New file for converting between different
4447 * src/export.[Ch]: New file for exporting a LyX file to different
4450 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4451 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4452 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4453 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4454 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4455 RunDocBook, MenuExport.
4457 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4458 Exporter::Preview methods if NEW_EXPORT is defined.
4460 * src/buffer.C (Dispatch): Use Exporter::Export.
4462 * src/lyxrc.C: Added new tags: \converter and \viewer.
4465 * src/LyXAction.C: Define new lyx-function: buffer-update.
4466 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4467 when NEW_EXPORT is defined.
4469 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4471 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4473 * lib/ui/default.ui: Added submenus "view" and "update" to the
4476 * src/filetools.C (GetExtension): New function.
4478 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4480 2000-08-29 Allan Rae <rae@lyx.org>
4482 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4484 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4485 (EnableDocumentLayout): removed
4486 (DisableDocumentLayout): removed
4487 (build): make use of ButtonController's read-only handling to
4488 de/activate various objects. Replaces both of the above functions.
4490 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4491 (readOnly): was read_only
4492 (refresh): fixed dumb mistakes with read_only_ handling
4494 * src/frontends/xforms/forms/form_document.fd:
4495 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4496 tabbed dialogs so the tabs look more like tabs and so its easier to
4497 work out which is the current tab.
4499 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4500 segfault with form_table
4502 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4504 2000-08-28 Juergen Vigna <jug@sad.it>
4506 * acconfig.h: added USE_PSPELL.
4508 * src/config.h.in: added USE_PSPELL.
4510 * autogen.sh: added pspell.m4
4512 * config/pspell.m4: new file.
4514 * src/spellchecker.C: implemented support for pspell libary.
4516 2000-08-25 Juergen Vigna <jug@sad.it>
4518 * src/LyXAction.C (init): renamed LFUN_TABLE to
4519 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4521 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4523 * src/lyxscreen.h: add force_clear variable and fuction to force
4524 a clear area when redrawing in LyXText.
4526 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4528 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4530 * some whitespace and comment changes.
4532 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4534 * src/buffer.C: up te LYX_FORMAT to 2.17
4536 2000-08-23 Juergen Vigna <jug@sad.it>
4538 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4541 * src/insets/insettabular.C (pasteSelection): delete the insets
4542 LyXText as it is not valid anymore.
4543 (copySelection): new function.
4544 (pasteSelection): new function.
4545 (cutSelection): new function.
4546 (LocalDispatch): implemented cut/copy/paste of cell selections.
4548 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4549 don't have a LyXText.
4551 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4553 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4556 2000-08-22 Juergen Vigna <jug@sad.it>
4558 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4559 ifdef form_table out if NEW_TABULAR.
4561 2000-08-21 Juergen Vigna <jug@sad.it>
4563 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4564 (draw): fixed draw position so that the cursor is positioned in the
4566 (InsetMotionNotify): hide/show cursor so the position is updated.
4567 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4568 using cellstart() function where it should be used.
4570 * src/insets/insettext.C (draw): ditto.
4572 * src/tabular.C: fixed initialization of some missing variables and
4573 made BoxType into an enum.
4575 2000-08-22 Marko Vendelin <markov@ioc.ee>
4576 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4577 stock menu item using action numerical value, not its string
4581 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4583 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4584 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4586 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4588 * src/frontends/xforms/GUIRunTime.C: new file
4590 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4591 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4593 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4595 * src/frontends/kde/GUIRunTime.C: new file
4597 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4598 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4600 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4602 * src/frontends/gnome/GUIRunTime.C: new file
4604 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4607 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4608 small change to documetentation.
4610 * src/frontends/GUIRunTime.C: removed file
4612 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4614 * src/lyxparagraph.h: enable NEW_TABULAR as default
4616 * src/lyxfunc.C (processKeySym): remove some commented code
4618 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4619 NEW_TABULAR around the fd_form_table_options.
4621 * src/lyx_gui.C (runTime): call the static member function as
4622 GUIRunTime::runTime().
4624 2000-08-21 Allan Rae <rae@lyx.org>
4626 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4629 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4631 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4633 2000-08-21 Allan Rae <rae@lyx.org>
4635 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4636 keep Garst happy ;-)
4637 * src/frontends/xforms/FormPreferences.C (build): use setOK
4638 * src/frontends/xforms/FormDocument.C (build): use setOK
4639 (FormDocument): use the appropriate policy.
4641 2000-08-21 Allan Rae <rae@lyx.org>
4643 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4644 automatic [de]activation of arbitrary objects when in a read-only state.
4646 * src/frontends/ButtonPolicies.h: More documentation
4647 (isReadOnly): added to support the above.
4649 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4651 2000-08-18 Juergen Vigna <jug@sad.it>
4653 * src/insets/insettabular.C (getStatus): changed to return func_status.
4655 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4656 display toggle menu entries if they are.
4658 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4659 new document layout now.
4661 * src/lyxfunc.C: ditto
4663 * src/lyx_gui_misc.C: ditto
4665 * src/lyx_gui.C: ditto
4667 * lib/ui/default.ui: removed paper and quotes layout as they are now
4668 all in the document layout tabbed folder.
4670 * src/frontends/xforms/forms/form_document.fd: added Restore
4671 button and callbacks for all inputs for Allan's ButtonPolicy.
4673 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4674 (CheckChoiceClass): added missing params setting on class change.
4675 (UpdateLayoutDocument): added for updating the layout on params.
4676 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4677 (FormDocument): Implemented Allan's ButtonPolicy with the
4680 2000-08-17 Allan Rae <rae@lyx.org>
4682 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4683 so we can at least see the credits again.
4685 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4686 controller calls for the appropriate callbacks. Note that since Ok
4687 calls apply followed by cancel, and apply isn't a valid input for the
4688 APPLIED state, the bc_ calls have to be made in the static callback not
4689 within each of the real callbacks.
4691 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4692 (setOk): renamed from setOkay()
4694 2000-08-17 Juergen Vigna <jug@sad.it>
4696 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4697 in the implementation part.
4698 (composeUIInfo): don't show optional menu-items.
4700 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4702 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4704 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4705 text-state when in a text-inset.
4707 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4709 2000-08-17 Marko Vendelin <markov@ioc.ee>
4710 * src/frontends/gnome/FormIndex.C
4711 * src/frontends/gnome/FormIndex.h
4712 * src/frontends/gnome/FormToc.C
4713 * src/frontends/gnome/FormToc.h
4714 * src/frontends/gnome/dialogs
4715 * src/frontends/gnome/diatoc_callbacks.c
4716 * src/frontends/gnome/diatoc_callbacks.h
4717 * src/frontends/gnome/diainsertindex_callbacks.h
4718 * src/frontends/gnome/diainsertindex_callbacks.c
4719 * src/frontends/gnome/diainsertindex_interface.c
4720 * src/frontends/gnome/diainsertindex_interface.h
4721 * src/frontends/gnome/diatoc_interface.h
4722 * src/frontends/gnome/diatoc_interface.c
4723 * src/frontends/gnome/Makefile.am: Table of Contents and
4724 Insert Index dialogs implementation for Gnome frontend
4726 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4728 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4730 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4733 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4735 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4736 destructor. Don't definde if you don't need it
4737 (processEvents): made static, non-blocking events processing for
4739 (runTime): static method. event loop for xforms
4740 * similar as above for kde and gnome.
4742 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4743 new Pimpl is correct
4744 (runTime): new method calss the real frontends runtime func.
4746 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4748 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4750 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4752 2000-08-16 Juergen Vigna <jug@sad.it>
4754 * src/lyx_gui.C (runTime): added GUII RunTime support.
4756 * src/frontends/Makefile.am:
4757 * src/frontends/GUIRunTime.[Ch]:
4758 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4759 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4760 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4762 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4764 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4765 as this is already set in ${FRONTEND_INCLUDE} if needed.
4767 * configure.in (CPPFLAGS): setting the include dir for the frontend
4768 directory and don't set FRONTEND=xforms for now as this is executed
4771 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4773 * src/frontends/kde/Makefile.am:
4774 * src/frontends/kde/FormUrl.C:
4775 * src/frontends/kde/FormUrl.h:
4776 * src/frontends/kde/formurldialog.h:
4777 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4779 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4781 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4783 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4785 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4788 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4790 * src/WorkArea.C (work_area_handler): more work to get te
4791 FL_KEYBOARD to work with xforms 0.88 too, please test.
4793 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4795 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4797 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4800 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4802 * src/Timeout.h: remove Qt::emit hack.
4804 * several files: changes to allo doc++ compilation
4806 * src/lyxfunc.C (processKeySym): new method
4807 (processKeyEvent): comment out if FL_REVISION < 89
4809 * src/WorkArea.C: change some debugging levels.
4810 (WorkArea): set wantkey to FL_KEY_ALL
4811 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4812 clearer code and the use of compose with XForms 0.89. Change to
4813 use signals instead of calling methods in bufferview directly.
4815 * src/Painter.C: change some debugging levels.
4817 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4820 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4821 (workAreaKeyPress): new method
4823 2000-08-14 Juergen Vigna <jug@sad.it>
4825 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4827 * config/kde.m4: addes some features
4829 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4830 include missing xforms dialogs.
4832 * src/Timeout.h: a hack to be able to compile with qt/kde.
4834 * sigc++/.cvsignore: added acinclude.m4
4836 * lib/.cvsignore: added listerros
4838 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4839 xforms tree as objects are needed for other frontends.
4841 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4842 linking with not yet implemented xforms objects.
4844 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4846 2000-08-14 Baruch Even <baruch.even@writeme.com>
4848 * src/frontends/xforms/FormGraphics.h:
4849 * src/frontends/xforms/FormGraphics.C:
4850 * src/frontends/xforms/RadioButtonGroup.h:
4851 * src/frontends/xforms/RadioButtonGroup.C:
4852 * src/insets/insetgraphics.h:
4853 * src/insets/insetgraphics.C:
4854 * src/insets/insetgraphicsParams.h:
4855 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4856 instead of spaces, and various other indentation issues to make the
4857 sources more consistent.
4859 2000-08-14 Marko Vendelin <markov@ioc.ee>
4861 * src/frontends/gnome/dialogs/diaprint.glade
4862 * src/frontends/gnome/FormPrint.C
4863 * src/frontends/gnome/FormPrint.h
4864 * src/frontends/gnome/diaprint_callbacks.c
4865 * src/frontends/gnome/diaprint_callbacks.h
4866 * src/frontends/gnome/diaprint_interface.c
4867 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4870 * src/frontends/gnome/dialogs/diainserturl.glade
4871 * src/frontends/gnome/FormUrl.C
4872 * src/frontends/gnome/FormUrl.h
4873 * src/frontends/gnome/diainserturl_callbacks.c
4874 * src/frontends/gnome/diainserturl_callbacks.h
4875 * src/frontends/gnome/diainserturl_interface.c
4876 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4877 Gnome implementation
4879 * src/frontends/gnome/Dialogs.C
4880 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4881 all other dialogs. Copy all unimplemented dialogs from Xforms
4884 * src/frontends/gnome/support.c
4885 * src/frontends/gnome/support.h: support files generated by Glade
4889 * config/gnome.m4: Gnome configuration scripts
4891 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4892 configure --help message
4894 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4895 only if there are no events pendling in Gnome/Gtk. This enhances
4896 the performance of menus.
4899 2000-08-14 Allan Rae <rae@lyx.org>
4901 * lib/Makefile.am: listerrors cleaning
4903 * lib/listerrors: removed -- generated file
4904 * acinclude.m4: ditto
4905 * sigc++/acinclude.m4: ditto
4907 * src/frontends/xforms/forms/form_citation.fd:
4908 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4911 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4912 `updatesrc` and now we have a `test` target that does what `updatesrc`
4913 used to do. I didn't like having an install target that wasn't related
4916 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4917 on all except FormGraphics. This may yet happen. Followed by a major
4918 cleanup including using FL_TRANSIENT for most of the dialogs. More
4919 changes to come when the ButtonController below is introduced.
4921 * src/frontends/xforms/ButtonController.h: New file for managing up to
4922 four buttons on a dialog according to an externally defined policy.
4923 * src/frontends/xforms/Makefile.am: added above
4925 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4926 Apply and Cancel/Close buttons and everything in between and beyond.
4927 * src/frontends/Makefile.am: added above.
4929 * src/frontends/xforms/forms/form_preferences.fd:
4930 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4931 and removed variable 'status' as a result. Fixed the set_minsize thing.
4932 Use the new screen-font-update after checking screen fonts were changed
4933 Added a "Restore" button to restore the original lyxrc values while
4934 editing. This restores everything not just the last input changed.
4935 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4937 * src/LyXAction.C: screen-font-update added for updating buffers after
4938 screen font settings have been changed.
4939 * src/commandtags.h: ditto
4940 * src/lyxfunc.C: ditto
4942 * forms/lyx.fd: removed screen fonts dialog.
4943 * src/lyx_gui.C: ditto
4944 * src/menus.[Ch]: ditto
4945 * src/lyx.[Ch]: ditto
4946 * src/lyx_cb.C: ditto + code from here moved to make
4947 screen-font-update. And people wonder why progress on GUII is
4948 slow. Look at how scattered this stuff was! It takes forever
4951 * forms/fdfix.sh: Fixup the spacing after commas.
4952 * forms/makefile: Remove date from generated files. Fewer clashes now.
4953 * forms/bullet_forms.C.patch: included someones handwritten changes
4955 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4956 once I've discovered why LyXRC was made noncopyable.
4957 * src/lyx_main.C: ditto
4959 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4961 * src/frontends/xforms/forms/fdfix.sh:
4962 * src/frontends/xforms/forms/fdfixh.sed:
4963 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4964 * src/frontends/xforms/Form*.[hC]:
4965 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4966 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4967 provide a destructor for the struct FD_form_xxxx. Another version of
4968 the set_[max|min]size workaround and a few other cleanups. Actually,
4969 Angus' patch from 20000809.
4971 2000-08-13 Baruch Even <baruch.even@writeme.com>
4973 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4976 2000-08-11 Juergen Vigna <jug@sad.it>
4978 * src/insets/insetgraphics.C (InsetGraphics): changing init
4979 order because of warnings.
4981 * src/frontends/xforms/forms/makefile: adding patching .C with
4984 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4985 from .C.patch to .c.patch
4987 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4988 order because of warning.
4990 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4992 * src/frontends/Liason.C (setMinibuffer): new helper function
4994 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4996 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4998 * lib/ui/default.ui: commented out PaperLayout entry
5000 * src/frontends/xforms/form_document.[Ch]: new added files
5002 * src/frontends/xforms/FormDocument.[Ch]: ditto
5004 * src/frontends/xforms/forms/form_document.fd: ditto
5006 * src/frontends/xforms/forms/form_document.C.patch: ditto
5008 2000-08-10 Juergen Vigna <jug@sad.it>
5010 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
5011 (InsetGraphics): initialized cacheHandle to 0.
5012 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
5014 2000-08-10 Baruch Even <baruch.even@writeme.com>
5016 * src/graphics/GraphicsCache.h:
5017 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
5018 correctly as a cache.
5020 * src/graphics/GraphicsCacheItem.h:
5021 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
5024 * src/graphics/GraphicsCacheItem_pimpl.h:
5025 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
5028 * src/insets/insetgraphics.h:
5029 * src/insets/insetgraphics.C: Changed from using a signal notification
5030 to polling when image is not loaded.
5032 2000-08-10 Allan Rae <rae@lyx.org>
5034 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
5035 that there are two functions that have to been taken out of line by
5036 hand and aren't taken care of in the script. (Just a reminder note)
5038 * sigc++/macros/*.h.m4: Updated as above.
5040 2000-08-09 Juergen Vigna <jug@sad.it>
5042 * src/insets/insettext.C (draw): small fix for clearing rectangle.
5044 * src/insets/insettabular.C: make drawing of single cell smarter.
5046 2000-08-09 Marko Vendelin <markov@ioc.ee>
5047 * src/frontends/gnome/Menubar_pimpl.C
5048 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
5049 implementation: new files
5051 * src/frontends/gnome/mainapp.C
5052 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
5055 * src/main.C: create Gnome main window
5057 * src/frontends/xforms/Menubar_pimpl.h
5058 * src/frontends/Menubar.C
5059 * src/frontends/Menubar.h: added method Menubar::update that calls
5060 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
5062 * src/LyXView.C: calls Menubar::update to update the state
5065 * src/frontends/gnome/Makefile.am: added new files
5067 * src/frontends/Makefile.am: added frontend compiler options
5069 2000-08-08 Juergen Vigna <jug@sad.it>
5071 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
5073 * src/bufferlist.C (close):
5074 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
5075 documents if exiting without saving.
5077 * src/buffer.C (save): use removeAutosaveFile()
5079 * src/support/filetools.C (removeAutosaveFile): new function.
5081 * src/lyx_cb.C (MenuWrite): returns a bool now.
5082 (MenuWriteAs): check if file could really be saved and revert to the
5084 (MenuWriteAs): removing old autosavefile if existant.
5086 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
5087 before Goto toggle declaration, because of compiler warning.
5089 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
5091 * src/lyxfunc.C (MenuNew): small fix.
5093 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
5095 * src/bufferlist.C (newFile):
5096 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
5098 * src/lyxrc.C: added new_ask_filename tag
5100 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
5102 * src/lyx.fd: removed code pertaining to form_ref
5103 * src/lyx.[Ch]: ditto
5104 * src/lyx_cb.C: ditto
5105 * src/lyx_gui.C: ditto
5106 * src/lyx_gui_misc.C: ditto
5108 * src/BufferView_pimpl.C (restorePosition): update buffer only
5111 * src/commandtags.h (LFUN_REFTOGGLE): removed
5112 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
5113 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
5114 (LFUN_REFBACK): renamed LFUN_REF_BACK
5116 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
5117 * src/menus.C: ditto
5118 * src/lyxfunc.C (Dispatch): ditto.
5119 InsertRef dialog is now GUI-independent.
5121 * src/texrow.C: added using std::endl;
5123 * src/insets/insetref.[Ch]: strip out large amounts of code.
5124 The inset is now a container and this functionality is now
5125 managed by a new FormRef dialog
5127 * src/frontends/Dialogs.h (showRef, createRef): new signals
5129 * src/frontends/xforms/FormIndex.[Ch],
5130 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
5131 when setting dialog's min/max size
5132 * src/frontends/xforms/FormIndex.[Ch]: ditto
5134 * src/frontends/xforms/FormRef.[Ch],
5135 src/frontends/xforms/forms/form_ref.fd: new xforms
5136 implementation of an InsetRef dialog
5138 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
5141 * src/graphics/XPM_Renderer.C (isImageFormatOK):
5142 ios::nocreate is not part of the standard. Removed.
5144 2000-08-07 Baruch Even <baruch.even@writeme.com>
5146 * src/graphics/Renderer.h:
5147 * src/graphics/Renderer.C: Added base class for rendering of different
5148 image formats into Pixmaps.
5150 * src/graphics/XPM_Renderer.h:
5151 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
5152 in a different class.
5154 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
5155 easily add support for other formats.
5157 * src/insets/figinset.C: plugged a leak of an X resource.
5159 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5161 * src/CutAndPaste.[Ch]: make all metods static.
5163 * development/Code_rules/Rules: more work, added section on
5164 Exceptions, and a References section.
5166 * a lot of header files: work to make doc++ able to generate the
5167 source documentation, some workarounds of doc++ problems. Doc++ is
5168 now able to generate the documentation.
5170 2000-08-07 Juergen Vigna <jug@sad.it>
5172 * src/insets/insettabular.C (recomputeTextInsets): removed function
5174 * src/tabular.C (SetWidthOfMulticolCell):
5176 (calculate_width_of_column_NMC): fixed return value so that it really
5177 only returns true if the column-width has changed (there where
5178 problems with muliticolumn-cells in this column).
5180 2000-08-04 Juergen Vigna <jug@sad.it>
5182 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5183 also on the scrollstatus of the inset.
5184 (workAreaMotionNotify): ditto.
5186 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5188 2000-08-01 Juergen Vigna <jug@sad.it>
5190 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5192 * src/commandtags.h:
5193 * src/LyXAction.C (init):
5194 * src/insets/inset.C (LocalDispatch): added support for
5197 * src/insets/inset.C (scroll): new functions.
5199 * src/insets/insettext.C (removeNewlines): new function.
5200 (SetAutoBreakRows): removes forced newlines in the text of the
5201 paragraph if autoBreakRows is set to false.
5203 * src/tabular.C (Latex): generates a parbox around the cell contents
5206 * src/frontends/xforms/FormTabular.C (local_update): removed
5207 the radio_useparbox button.
5209 * src/tabular.C (UseParbox): new function
5211 2000-08-06 Baruch Even <baruch.even@writeme.com>
5213 * src/graphics/GraphicsCache.h:
5214 * src/graphics/GraphicsCache.C:
5215 * src/graphics/GraphicsCacheItem.h:
5216 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5219 * src/insets/insetgraphics.h:
5220 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5221 and the drawing of the inline image.
5223 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5224 loaded into the wrong position.
5226 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5229 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5231 * src/support/translator.h: move all typedefs to public section
5233 * src/support/filetools.C (MakeLatexName): return string const
5235 (TmpFileName): ditto
5236 (FileOpenSearch): ditto
5238 (LibFileSearch): ditto
5239 (i18nLibFileSearch): ditto
5242 (CreateTmpDir): ditto
5243 (CreateBufferTmpDir): ditto
5244 (CreateLyXTmpDir): ditto
5247 (MakeAbsPath): ditto
5249 (OnlyFilename): ditto
5251 (NormalizePath): ditto
5252 (CleanupPath): ditto
5253 (GetFileContents): ditto
5254 (ReplaceEnvironmentPath): ditto
5255 (MakeRelPath): ditto
5257 (ChangeExtension): ditto
5258 (MakeDisplayPath): ditto
5259 (do_popen): return cmdret const
5260 (findtexfile): return string const
5262 * src/support/DebugStream.h: add some /// to please doc++
5264 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5266 * src/texrow.C (same_rownumber): functor to use with find_if
5267 (getIdFromRow): rewritten to use find_if and to not update the
5268 positions. return true if row is found
5269 (increasePos): new method, use to update positions
5271 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5273 * src/lyxlex_pimpl.C (verifyTable): new method
5276 (GetString): return string const
5277 (pushTable): rewrite to use std::stack
5279 (setFile): better check
5282 * src/lyxlex.h: make LyXLex noncopyable
5284 * src/lyxlex.C (text): return char const * const
5285 (GetString): return string const
5286 (getLongString): return string const
5288 * src/lyx_gui_misc.C (askForText): return pair<...> const
5290 * src/lastfiles.[Ch] (operator): return string const
5292 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5293 istringstream not char const *.
5294 move token.end() out of loop.
5295 (readFile): move initializaton of token
5297 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5298 getIdFromRow is successful.
5300 * lib/bind/emacs.bind: don't include menus bind
5302 * development/Code_rules/Rules: the beginnings of making this
5303 better and covering more of the unwritten rules that we have.
5305 * development/Code_rules/Recommendations: a couple of wording
5308 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5310 * src/support/strerror.c: remove C++ comment.
5312 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5314 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5315 LFUN_INDEX_INSERT_LAST
5317 * src/texrow.C (getIdFromRow): changed from const_iterator to
5318 iterator, allowing code to compile with DEC cxx
5320 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5321 stores part of the class, as suggested by Allan. Will allow
5323 (apply): test to apply uses InsetCommandParams operator!=
5325 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5326 (apply): test to apply uses InsetCommandParams operator!=
5328 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5329 stores part of the class.
5330 (update): removed limits on min/max size.
5332 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5333 (apply): test to apply uses InsetCommandParams operator!=
5335 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5336 (Read, Write, scanCommand, getCommand): moved functionality
5337 into InsetCommandParams.
5339 (getScreenLabel): made pure virtual
5340 new InsetCommandParams operators== and !=
5342 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5343 c-tors based on InsetCommandParams. Removed others.
5344 * src/insets/insetinclude.[Ch]: ditto
5345 * src/insets/insetlabel.[Ch]: ditto
5346 * src/insets/insetparent.[Ch]: ditto
5347 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5349 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5350 insets derived from InsetCommand created using similar c-tors
5351 based on InsetCommandParams
5352 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5353 * src/menus.C (ShowRefsMenu): ditto
5354 * src/paragraph.C (Clone): ditto
5355 * src/text2.C (SetCounter): ditto
5356 * src/lyxfunc.C (Dispatch) ditto
5357 Also recreated old InsetIndex behaviour exactly. Can now
5358 index-insert at the start of a paragraph and index-insert-last
5359 without launching the pop-up.
5361 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5363 * lib/lyxrc.example: mark te pdf options as non functional.
5365 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5366 (isStrDbl): move tmpstr.end() out of loop.
5367 (strToDbl): move intialization of tmpstr
5368 (lowercase): return string const and move tmp.end() out of loop.
5369 (uppercase): return string const and move tmp.edn() out of loop.
5370 (prefixIs): add assertion
5375 (containsOnly): ditto
5376 (containsOnly): ditto
5377 (containsOnly): ditto
5378 (countChar): make last arg char not char const
5379 (token): return string const
5380 (subst): return string const, move tmp.end() out of loop.
5381 (subst): return string const, add assertion
5382 (strip): return string const
5383 (frontStrip): return string const, add assertion
5384 (frontStrip): return string const
5389 * src/support/lstrings.C: add inclde "LAssert.h"
5390 (isStrInt): move tmpstr.end() out of loop.
5392 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5393 toollist.end() out of loop.
5394 (deactivate): move toollist.end() out of loop.
5395 (update): move toollist.end() out of loop.
5396 (updateLayoutList): move tc.end() out of loop.
5397 (add): move toollist.end() out of loop.
5399 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5400 md.end() out of loop.
5402 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5404 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5407 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5408 (Erase): move insetlist.end() out of loop.
5410 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5411 ref to const string as first arg. Move initialization of some
5412 variables, whitespace changes.
5414 * src/kbmap.C (defkey): move table.end() out of loop.
5415 (kb_keymap): move table.end() out of loop.
5416 (findbinding): move table.end() out of loop.
5418 * src/MenuBackend.C (hasMenu): move end() out of loop.
5419 (getMenu): move end() out of loop.
5420 (getMenu): move menulist_.end() out of loop.
5422 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5424 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5427 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5428 (getFromLyXName): move infotab.end() out of loop.
5430 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5431 -fvtable-thunks -ffunction-sections -fdata-sections
5433 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5435 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5438 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5440 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5442 * src/frontends/xforms/FormCitation.[Ch],
5443 src/frontends/xforms/FormIndex.[Ch],
5444 src/frontends/xforms/FormToc.[Ch],
5445 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5447 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5449 * src/commandtags.h: renamed, created some flags for citation
5452 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5454 * src/lyxfunc.C (dispatch): use signals to insert index entry
5456 * src/frontends/Dialogs.h: new signal createIndex
5458 * src/frontends/xforms/FormCommand.[Ch],
5459 src/frontends/xforms/FormCitation.[Ch],
5460 src/frontends/xforms/FormToc.[Ch],
5461 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5463 * src/insets/insetindex.[Ch]: GUI-independent
5465 * src/frontends/xforms/FormIndex.[Ch],
5466 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5469 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5471 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5472 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5474 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5476 * src/insets/insetref.C (Latex): rewrite so that there is now
5477 question that a initialization is requested.
5479 * src/insets/insetcommand.h: reenable the hide signal
5481 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5483 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5484 fix handling of shortcuts (many bugs :)
5485 (add_lastfiles): ditto.
5487 * lib/ui/default.ui: fix a few shortcuts.
5489 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5491 * Makefile.am: Fix ``rpmdist'' target to return the exit
5492 status of the ``rpm'' command, instead of the last command in
5493 the chain (the ``rm lyx.xpm'' command, which always returns
5496 2000-08-02 Allan Rae <rae@lyx.org>
5498 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5499 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5500 * src/frontends/xforms/FormToc.C (FormToc): ditto
5502 * src/frontends/xforms/Makefile.am: A few forgotten files
5504 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5505 Signals-not-copyable-problem Lars' started commenting out.
5507 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5509 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5511 * src/insets/insetcommand.h: Signals is not copyable so anoter
5512 scheme for automatic hiding of forms must be used.
5514 * src/frontends/xforms/FormCitation.h: don't inerit from
5515 noncopyable, FormCommand already does that.
5516 * src/frontends/xforms/FormToc.h: ditto
5517 * src/frontends/xforms/FormUrl.h: ditto
5519 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5521 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5523 * src/insets/insetcommand.h (hide): new SigC::Signal0
5524 (d-tor) new virtual destructor emits hide signal
5526 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5527 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5529 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5530 LOF and LOT. Inset is now GUI-independent
5532 * src/insets/insetloa.[Ch]: redundant
5533 * src/insets/insetlof.[Ch]: ditto
5534 * src/insets/insetlot.[Ch]: ditto
5536 * src/frontends/xforms/forms/form_url.fd: tweaked!
5537 * src/frontends/xforms/forms/form_citation.fd: ditto
5539 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5540 dialogs dealing with InsetCommand insets
5542 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5543 FormCommand base class
5544 * src/frontends/xforms/FormUrl.[Ch]: ditto
5546 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5548 * src/frontends/xforms/FormToc.[Ch]: ditto
5550 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5551 passed a generic InsetCommand pointer
5552 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5554 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5555 and modified InsetTOC class
5556 * src/buffer.C: ditto
5558 * forms/lyx.fd: strip out old FD_form_toc code
5559 * src/lyx_gui_misc.C: ditto
5560 * src/lyx_gui.C: ditto
5561 * src/lyx_cb.C: ditto
5562 * src/lyx.[Ch]: ditto
5564 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5566 * src/support/utility.hpp: tr -d '\r'
5568 2000-08-01 Juergen Vigna <jug@sad.it>
5570 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5572 * src/commandtags.h:
5573 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5574 LFUN_TABULAR_FEATURES.
5576 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5577 LFUN_LAYOUT_TABULAR.
5579 * src/insets/insettabular.C (getStatus): implemented helper function.
5581 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5583 2000-07-31 Juergen Vigna <jug@sad.it>
5585 * src/text.C (draw): fixed screen update problem for text-insets.
5587 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5588 something changed probably this has to be added in various other
5591 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5593 2000-07-31 Baruch Even <baruch.even@writeme.com>
5595 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5596 templates to satisfy compaq cxx.
5599 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5601 * src/support/translator.h (equal_1st_in_pair::operator()): take
5602 const ref pair_type as arg.
5603 (equal_2nd_in_pair::operator()): ditto
5604 (Translator::~Translator): remove empty d-tor.
5606 * src/graphics/GraphicsCache.C: move include config.h to top, also
5607 put initialization of GraphicsCache::singleton here.
5608 (~GraphicsCache): move here
5609 (addFile): take const ref as arg
5612 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5614 * src/BufferView2.C (insertLyXFile): change te with/without header
5617 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5619 * src/frontends/xforms/FormGraphics.C (apply): add some
5620 static_cast. Not very nice, but required by compaq cxx.
5622 * src/frontends/xforms/RadioButtonGroup.h: include header
5623 <utility> instead of <pair.h>
5625 * src/insets/insetgraphicsParams.C: add using directive.
5626 (readResize): change return type to void.
5627 (readOrigin): ditto.
5629 * src/lyxfunc.C (getStatus): add missing break for build-program
5630 function; add test for Literate for export functions.
5632 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5633 entries in Options menu.
5635 2000-07-31 Baruch Even <baruch.even@writeme.com>
5637 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5638 protect against auto-allocation; release icon when needed.
5640 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5642 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5643 on usual typewriter.
5645 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5646 earlier czech.kmap), useful only for programming.
5648 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5650 * src/frontends/xforms/FormCitation.h: fix conditioning around
5653 2000-07-31 Juergen Vigna <jug@sad.it>
5655 * src/frontends/xforms/FormTabular.C (local_update): changed
5656 radio_linebreaks to radio_useparbox and added radio_useminipage.
5658 * src/tabular.C: made support for using minipages/parboxes.
5660 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5662 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5664 (descent): so the cursor is in the middle.
5665 (width): bit smaller box.
5667 * src/insets/insetgraphics.h: added display() function.
5669 2000-07-31 Baruch Even <baruch.even@writeme.com>
5671 * src/frontends/Dialogs.h: Added showGraphics signals.
5673 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5674 xforms form definition of the graphics dialog.
5676 * src/frontends/xforms/FormGraphics.h:
5677 * src/frontends/xforms/FormGraphics.C: Added files, the
5678 GUIndependent code of InsetGraphics
5680 * src/insets/insetgraphics.h:
5681 * src/insets/insetgraphics.C: Major writing to make it work.
5683 * src/insets/insetgraphicsParams.h:
5684 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5685 struct between InsetGraphics and GUI.
5687 * src/LaTeXFeatures.h:
5688 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5689 support for graphicx package.
5691 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5692 for the graphics inset.
5694 * src/support/translator.h: Added file, used in
5695 InsetGraphicsParams. this is a template to translate between two
5698 * src/frontends/xforms/RadioButtonGroup.h:
5699 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5700 way to easily control a radio button group.
5702 2000-07-28 Juergen Vigna <jug@sad.it>
5704 * src/insets/insettabular.C (LocalDispatch):
5705 (TabularFeatures): added support for lyx-functions of tabular features.
5706 (cellstart): refixed this function after someone wrongly changed it.
5708 * src/commandtags.h:
5709 * src/LyXAction.C (init): added support for tabular-features
5711 2000-07-28 Allan Rae <rae@lyx.org>
5713 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5714 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5715 triggers the callback for input checking. As a result we sometimes get
5716 "LyX: This shouldn't happen..." printed to cerr.
5717 (input): Started using status variable since I only free() on
5718 destruction. Some input checking for paths and font sizes.
5720 * src/frontends/xforms/FormPreferences.h: Use status to control
5721 activation of Ok and Apply
5723 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5724 callback. Also resized to stop segfaults with 0.88. The problem is
5725 that xforms-0.88 requires the folder to be wide enough to fit all the
5726 tabs. If it isn't it causes all sorts of problems.
5728 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5730 * src/frontends/xforms/forms/README: Reflect reality.
5732 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5733 * src/frontends/xforms/forms/makefile: ditto.
5735 * src/commandtags.h: Get access to new Preferences dialog
5736 * src/LyXAction.C: ditto
5737 * src/lyxfunc.C: ditto
5738 * lib/ui/default.ui: ditto
5740 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5742 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5744 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5747 * src/frontends/xforms/form_url.[Ch]: added.
5749 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5751 * src/insets/insetbib.h: fixed bug in previous commit
5753 * src/frontends/xforms/FormUrl.h: ditto
5755 * src/frontends/xforms/FormPrint.h: ditto
5757 * src/frontends/xforms/FormPreferences.h: ditto
5759 * src/frontends/xforms/FormCopyright.h: ditto
5761 * src/frontends/xforms/FormCitation.C: ditto
5763 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5764 private copyconstructor and private default contructor
5766 * src/support/Makefile.am: add utility.hpp
5768 * src/support/utility.hpp: new file from boost
5770 * src/insets/insetbib.h: set owner in clone
5772 * src/frontends/xforms/FormCitation.C: added missing include
5775 * src/insets/form_url.[Ch]: removed
5777 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5779 * development/lyx.spec.in
5780 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5781 file/directory re-organization.
5783 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5785 * src/insets/insetcommand.[Ch]: moved the string data and
5786 associated manipulation methods into a new stand-alone class
5787 InsetCommandParams. This class has two additional methods
5788 getAsString() and setFromString() allowing the contents to be
5789 moved around as a single string.
5790 (addContents) method removed.
5791 (setContents) method no longer virtual.
5793 * src/buffer.C (readInset): made use of new InsetCitation,
5794 InsetUrl constructors based on InsetCommandParams.
5796 * src/commandtags.h: add LFUN_INSERT_URL
5798 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5799 independent InsetUrl and use InsetCommandParams to extract
5800 string info and create new Insets.
5802 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5804 * src/frontends/xforms/FormCitation.C (apply): uses
5807 * src/frontends/xforms/form_url.C
5808 * src/frontends/xforms/form_url.h
5809 * src/frontends/xforms/FormUrl.h
5810 * src/frontends/xforms/FormUrl.C
5811 * src/frontends/xforms/forms/form_url.fd: new files
5813 * src/insets/insetcite.[Ch]: removed unused constructors.
5815 * src/insets/insetinclude.[Ch]: no longer store filename
5817 * src/insets/inseturl.[Ch]: GUI-independent.
5819 2000-07-26 Juergen Vigna <jug@sad.it>
5820 * renamed frontend from gtk to gnome as it is that what is realized
5821 and did the necessary changes in the files.
5823 2000-07-26 Marko Vendelin <markov@ioc.ee>
5825 * configure.in: cleaning up gnome configuration scripts
5827 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5829 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5830 shortcuts syndrom by redrawing them explicitely (a better solution
5831 would be appreciated).
5833 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5835 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5838 * src/lyx_cb.C (MenuExport): change html export to do the right
5839 thing depending of the document type (instead of having
5840 html-linuxdoc and html-docbook).
5841 * src/lyxfunc.C (getStatus): update for html
5842 * lib/ui/default.ui: simplify due to the above change.
5843 * src/menus.C (ShowFileMenu): update too (in case we need it).
5845 * src/MenuBackend.C (read): if a menu is defined twice, add the
5846 new entries to the exiting one.
5848 2000-07-26 Juergen Vigna <jug@sad.it>
5850 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5852 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5853 and return a bool if it did actual save the file.
5854 (AutoSave): don't autosave a unnamed doc.
5856 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5857 check if this is an UNNAMED new file and react to it.
5858 (newFile): set buffer to unnamed and change to not mark a new
5859 buffer dirty if I didn't do anything with it.
5861 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5863 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5865 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5866 friend as per Angus's patch posted to lyx-devel.
5868 * src/ext_l10n.h: updated
5870 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5871 gettext on the style string right before inserting them into the
5874 * autogen.sh: add code to extract style strings form layout files,
5875 not good enough yet.
5877 * src/frontends/gtk/.cvsignore: add MAKEFILE
5879 * src/MenuBackend.C (read): run the label strings through gettext
5880 before storing them in the containers.
5882 * src/ext_l10n.h: new file
5884 * autogen.sh : generate the ext_l10n.h file here
5886 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5888 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5891 * lib/ui/default.ui: fix a couple of typos.
5893 * config/gnome/gtk.m4: added (and added to the list of files in
5896 * src/insets/insetinclude.C (unique_id): fix when we are using
5897 lyxstring instead of basic_string<>.
5898 * src/insets/insettext.C (LocalDispatch): ditto.
5899 * src/support/filetools.C: ditto.
5901 * lib/configure.m4: create the ui/ directory if necessary.
5903 * src/LyXView.[Ch] (updateToolbar): new method.
5905 * src/BufferView_pimpl.C (buffer): update the toolbar when
5906 opening/closing buffer.
5908 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5910 * src/LyXAction.C (getActionName): enhance to return also the name
5911 and options of pseudo-actions.
5912 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5914 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5915 as an example of what is possible). Used in File->Build too (more
5916 useful) and in the import/export menus (to mimick the complicated
5917 handling of linuxdoc and friends). Try to update all the entries.
5919 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5922 * src/MenuBackend.C (read): Parse the new OptItem tag.
5924 * src/MenuBackend.h: Add a new optional_ data member (used if the
5925 entry should be omitted when the lyxfunc is disabled).
5927 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5928 function, used as a shortcut.
5929 (create_submenu): align correctly the shortcuts on the widest
5932 * src/MenuBackend.h: MenuItem.label() only returns the label of
5933 the menu without shortcut; new method shortcut().
5935 2000-07-14 Marko Vendelin <markov@ioc.ee>
5937 * src/frontends/gtk/Dialogs.C:
5938 * src/frontends/gtk/FormCopyright.C:
5939 * src/frontends/gtk/FormCopyright.h:
5940 * src/frontends/gtk/Makefile.am: added these source-files for the
5941 Gtk/Gnome support of the Copyright-Dialog.
5943 * src/main.C: added Gnome::Main initialization if using
5944 Gtk/Gnome frontend-GUI.
5946 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5948 * config/gnome/aclocal-include.m4
5949 * config/gnome/compiler-flags.m4
5950 * config/gnome/curses.m4
5951 * config/gnome/gnome--.m4
5952 * config/gnome/gnome-bonobo-check.m4
5953 * config/gnome/gnome-common.m4
5954 * config/gnome/gnome-fileutils.m4
5955 * config/gnome/gnome-ghttp-check.m4
5956 * config/gnome/gnome-gnorba-check.m4
5957 * config/gnome/gnome-guile-checks.m4
5958 * config/gnome/gnome-libgtop-check.m4
5959 * config/gnome/gnome-objc-checks.m4
5960 * config/gnome/gnome-orbit-check.m4
5961 * config/gnome/gnome-print-check.m4
5962 * config/gnome/gnome-pthread-check.m4
5963 * config/gnome/gnome-support.m4
5964 * config/gnome/gnome-undelfs.m4
5965 * config/gnome/gnome-vfs.m4
5966 * config/gnome/gnome-x-checks.m4
5967 * config/gnome/gnome-xml-check.m4
5968 * config/gnome/gnome.m4
5969 * config/gnome/gperf-check.m4
5970 * config/gnome/gtk--.m4
5971 * config/gnome/linger.m4
5972 * config/gnome/need-declaration.m4: added configuration scripts
5973 for Gtk/Gnome frontend-GUI
5975 * configure.in: added support for the --with-frontend=gtk option
5977 * autogen.sh: added config/gnome/* to list of config-files
5979 * acconfig.h: added define for GTKGUI-support
5981 * config/lyxinclude.m4: added --with-frontend[=value] option value
5982 for Gtk/Gnome frontend-GUI support.
5984 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5986 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5990 * src/paragraph.C (GetChar): remove non-const version
5992 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5993 (search_kw): use it.
5995 * src/lyx_main.C (init): if "preferences" exist, read that instead
5997 (ReadRcFile): return bool if the file could be read ok.
5998 (ReadUIFile): add a check to see if lex file is set ok.
6000 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
6001 bastring can be used instead of lyxstring (still uses the old code
6002 if std::string is good enough or if lyxstring is used.)
6004 * src/encoding.C: make the arrays static, move ininle functions
6006 * src/encoding.h: from here.
6008 * src/buffer.C: have last_isnet_read as a file scope variable for now.
6009 (parseSingleLyXformat2Token): move inset parsing to separate method
6010 (readInset): new private method
6012 * src/Variables.h: remove virtual from get().
6014 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
6015 access to NEW_INSETS and NEW_TABULAR
6017 * src/MenuBackend.h: remove superfluous forward declaration of
6018 MenuItem. Add documentations tags "///", remove empty MenuItem
6019 destructor, remove private default contructor.
6021 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
6023 (read): more string mlabel and mname to where they are used
6024 (read): remove unused variables mlabel and mname
6025 (defaults): unconditional clear, make menusetup take advantage of
6026 add returning Menu &.
6028 * src/LyXView.h: define NEW_MENUBAR as default
6030 * src/LyXAction.C: include lyxparagraph.h temporary to get access
6031 to NEW_INSETS and NEW_TABULAR.
6032 (init): commetn out some funcs that is obsolete when NEW_INSETS is
6033 defined. Change some of the "xxxx-inset-insert" functions names to
6036 * several files: more enahncements to NEW_INSETS and the resulting
6039 * lib/lyxrc.example (\date_insert_format): move to misc section
6041 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
6042 bastring and use AC_CACHE_CHECK.
6043 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
6044 the system have the newest methods. uses AC_CACHE_CHECK
6045 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
6046 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
6047 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
6049 * configure.in: add LYX_CXX_GOOD_STD_STRING
6051 * acinclude.m4: recreated
6053 2000-07-24 Amir Karger <karger@lyx.org>
6055 * README: add Hebrew, Arabic kmaps
6058 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6060 * src/buffer.C (writeFileAscii): Define actcell as an int instead
6063 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6065 * Lot of files: add pragma interface/implementation.
6067 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
6069 * lib/ui/default.ui: new file (ans new directory). Contains the
6070 default menu and toolbar.
6072 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
6073 global space. Toolbars are now read (as menus) in ui files.
6075 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
6077 * src/lyxfunc.C (getStatus): do not exit immediately if a command
6078 is disabled because the document is read-only. We want to have the
6079 toggle state of the function anyway.
6080 (getStatus): add code for LFUN_VC* functions (mimicking what is
6081 done in old-style menus)
6083 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
6084 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
6086 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
6087 * src/BufferView_pimpl.C: ditto.
6088 * src/lyxfunc.C: ditto.
6090 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
6091 default). This replaces old-style menus by new ones.
6093 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
6094 MenuItem. Contain the data structure of a menu.
6096 * src/insets/insettext.C: use LyXView::setLayout instead of
6097 accessing directly the toolbar combox.
6098 * src/lyxfunc.C (Dispatch): ditto.
6100 * src/LyXView.C (setLayout): new method, which just calls
6101 Toolbar::setLayout().
6102 (updateLayoutChoice): move part of this method in Toolbar.
6104 * src/toolbar.[Ch]: removed.
6106 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
6107 implementation the toolbar.
6109 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
6110 the toolbar. It might make sense to merge it with ToolbarDefaults
6112 (setLayout): new function.
6113 (updateLayoutList): ditto.
6114 (openLayoutList): ditto.
6116 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
6117 xforms implementation of the toolbar.
6118 (get_toolbar_func): comment out, since I do not
6119 know what it is good for.
6121 * src/ToolbarDefaults.h: Add the ItemType enum.
6123 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
6124 for a list of allocated C strings. Used in Menubar xforms
6125 implementation to avoid memory leaks.
6127 * src/support/lstrings.[Ch] (uppercase): new version taking and
6131 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
6132 * lib/bind/emacs.bind: ditto.
6134 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6136 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
6137 forward decl of LyXView.
6139 * src/toolbar.C (toolbarItem): moved from toolbar.h
6140 (toolbarItem::clean): ditto
6141 (toolbarItem::~toolbarItem): ditto
6142 (toolbarItem::operator): ditto
6144 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
6146 * src/paragraph.h: control the NEW_TABULAR define from here
6148 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
6149 USE_TABULAR_INSETS to NEW_TABULAR
6151 * src/ToolbarDefaults.C: add include "lyxlex.h"
6153 * files using the old table/tabular: use NEW_TABULAR to control
6154 compilation of old tabular stuff.
6156 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
6159 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
6160 planemet in reading of old style floats, fix the \end_deeper
6161 problem when reading old style floats.
6163 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6165 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
6167 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
6169 * lib/bind/sciword.bind: updated.
6171 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6173 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
6174 layout write problem
6176 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6178 * src/Makefile.am (INCLUDES): remove image directory from include
6181 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6182 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6184 * src/LyXView.C (create_form_form_main): read the application icon
6187 * lib/images/*.xpm: change the icons to use transparent color for
6190 * src/toolbar.C (update): change the color of the button when it
6193 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6195 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6196 setting explicitely the minibuffer.
6197 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6199 * src/LyXView.C (showState): new function. Shows font information
6200 in minibuffer and update toolbar state.
6201 (LyXView): call Toolbar::update after creating the
6204 * src/toolbar.C: change toollist to be a vector instead of a
6206 (BubbleTimerCB): get help string directly from the callback
6207 argument of the corresponding icon (which is the action)
6208 (set): remove unnecessary ugliness.
6209 (update): new function. update the icons (depressed, disabled)
6210 depending of the status of the corresponding action.
6212 * src/toolbar.h: remove help in toolbarItem
6214 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6216 * src/Painter.C (text): Added code for using symbol glyphs from
6217 iso10646 fonts. Currently diabled.
6219 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6222 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6223 magyar,turkish and usorbian.
6225 * src/paragraph.C (isMultiLingual): Made more efficient.
6227 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6230 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6231 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6232 Also changed the prototype to "bool math_insert_greek(char)".
6234 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6236 * lots of files: apply the NEW_INSETS on all code that will not be
6237 needed when we move to use the new insets. Enable the define in
6238 lyxparagrah.h to try it.
6240 * src/insets/insettabular.C (cellstart): change to be a static
6242 (InsetTabular): initialize buffer in the initializer list.
6244 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6246 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6247 form_print.h out of the header file. Replaced with forward
6248 declarations of the relevant struct.
6250 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6253 * src/commandtags.h: do not include "debug.h" which does not
6254 belong there. #include it in some other places because of this
6257 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6259 * src/insets/insetcaption.C: add a couple "using" directives.
6261 * src/toolbar.C (add): get the help text directly from lyxaction.
6263 (setPixmap): new function. Loads from disk and sets a pixmap on a
6264 botton; the name of the pixmap file is derived from the command
6267 * src/toolbar.h: remove members isBitmap and pixmap from
6270 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6271 * lib/images/: move many files from images/banner.xpm.
6273 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6275 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6276 * src/toolbar.C: ditto.
6277 * configure.in: ditto.
6278 * INSTALL: document.
6280 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6281 the spellchecker popup is closed from the WM.
6283 2000-07-19 Juergen Vigna <jug@sad.it>
6285 * src/insets/insetfloat.C (Write): small fix because we use the
6286 insetname for the type now!
6288 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6290 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6293 * src/frontends/Dialogs.h: removed hideCitation signal
6295 * src/insets/insetcite.h: added hide signal
6297 * src/insets/insetcite.C (~InsetCitation): emits new signal
6298 (getScreenLabel): "intelligent" label should now fit on the screen!
6300 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6302 * src/frontends/xforms/FormCitation.C (showInset): connects
6303 hide() to the inset's hide signal
6304 (show): modified to use fl_set_object_position rather than
6305 fl_set_object_geometry wherever possible
6307 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6309 * src/insets/lyxinset.h: add caption code
6311 * src/insets/insetfloat.C (type): new method
6313 * src/insets/insetcaption.C (Write): new method
6315 (LyxCode): new method
6317 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6318 to get it right together with using the FloatList.
6320 * src/commandtags.h: add LFUN_INSET_CAPTION
6321 * src/lyxfunc.C (Dispatch): handle it
6323 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6326 * src/Variables.[Ch]: make expand take a const reference, remove
6327 the destructor, some whitespace changes.
6329 * src/LyXAction.C (init): add caption-inset-insert
6331 * src/FloatList.C (FloatList): update the default floats a bit.
6333 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6335 * src/Variables.[Ch]: new files. Intended to be used for language
6336 specific strings (like \chaptername) and filename substitution in
6339 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6341 * lib/kbd/american.kmap: update
6343 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6345 * src/bufferparams.[Ch]: remove member allowAccents.
6347 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6349 * src/LaTeXLog.C: use the log_form.h header.
6350 * src/lyx_gui.C: ditto.
6351 * src/lyx_gui_misc.C: ditto.
6352 * src/lyxvc.h: ditto.
6354 * forms/log_form.fd: new file, created from latexoptions.fd. I
6355 kept the log popup and nuked the options form.
6357 * src/{la,}texoptions.[Ch]: removed.
6358 * src/lyx_cb.C (LaTeXOptions): ditto
6360 * src/lyx_gui.C (create_forms): do not handle the
6361 fd_latex_options form.
6363 2000-07-18 Juergen Vigna <jug@sad.it>
6365 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6366 name of the inset so that it can be requested outside (text2.C).
6368 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6371 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6373 * src/mathed/formula.h (ConvertFont): constify
6375 * src/mathed/formula.C (Read): add warning if \end_inset is not
6376 found on expected place.
6378 * src/insets/lyxinset.h (ConvertFont): consify
6380 * src/insets/insetquotes.C (ConvertFont): constify
6381 * src/insets/insetquotes.h: ditto
6383 * src/insets/insetinfo.h: add labelfont
6385 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6386 (ascent): use labelfont
6390 (Write): make .lyx file a bit nicer
6392 * src/insets/insetfloat.C (Write): simplify somewhat...
6393 (Read): add warning if arg is not found
6395 * src/insets/insetcollapsable.C: add using std::max
6396 (Read): move string token and add warning in arg is not found
6397 (draw): use std::max to get the right ty
6398 (getMaxWidth): simplify by using std::max
6400 * src/insets/insetsection.h: new file
6401 * src/insets/insetsection.C: new file
6402 * src/insets/insetcaption.h: new file
6403 * src/insets/insetcaption.C: new file
6405 * src/insets/inset.C (ConvertFont): constify signature
6407 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6408 insetcaption.[Ch] and insetsection.[Ch]
6410 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6411 uses to use LABEL_COUNTER_CHAPTER instead.
6412 * src/text2.C (SetCounter): here
6414 * src/counters.h: new file
6415 * src/counters.C: new file
6416 * src/Sectioning.h: new file
6417 * src/Sectioning.C: new file
6419 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6421 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6423 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6426 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6429 2000-07-17 Juergen Vigna <jug@sad.it>
6431 * src/tabular.C (Validate): check if array-package is needed.
6432 (SetVAlignment): added support for vertical alignment.
6433 (SetLTFoot): better support for longtable header/footers
6434 (Latex): modified to support added features.
6436 * src/LaTeXFeatures.[Ch]: added array-package.
6438 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6440 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6443 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6445 * configure.in: do not forget to put a space after -isystem.
6447 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6449 * lib/kbd/arabic.kmap: a few fixes.
6451 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6453 * some whitespace chagnes to a number of files.
6455 * src/support/DebugStream.h: change to make it easier for
6456 doc++ to parse correctly.
6457 * src/support/lyxstring.h: ditto
6459 * src/mathed/math_utils.C (compara): change to have only one
6461 (MathedLookupBOP): change because of the above.
6463 * src/mathed/math_delim.C (math_deco_compare): change to have only
6465 (search_deco): change becasue of the above.
6467 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6468 instead of manually coded one.
6470 * src/insets/insetquotes.C (Read): read the \end_inset too
6472 * src/insets/insetlatex.h: remove file
6473 * src/insets/insetlatex.C: remove file
6475 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6477 (InsetPrintIndex): remove destructor
6479 * src/insets/insetinclude.h: remove default constructor
6481 * src/insets/insetfloat.C: work to make it work better
6483 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6485 * src/insets/insetcite.h (InsetCitation): remove default constructor
6487 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6489 * src/text.C (GetColumnNearX): comment out some currently unused code.
6491 * src/paragraph.C (writeFile): move some initializations closer to
6493 (CutIntoMinibuffer): small change to use new matchIT operator
6497 (InsertInset): ditto
6500 (InsetIterator): ditto
6501 (Erase): small change to use new matchFT operator
6503 (GetFontSettings): ditto
6504 (HighestFontInRange): ditto
6507 * src/lyxparagraph.h: some chars changed to value_type
6508 (matchIT): because of some stronger checking (perhaps too strong)
6509 in SGI STL, the two operator() unified to one.
6512 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6514 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6515 the last inset read added
6516 (parseSingleLyXformat2Token): some more (future) compability code added
6517 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6518 (parseSingleLyXformat2Token): set last_inset_read
6519 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6520 (parseSingleLyXformat2Token): don't double intializw string next_token
6522 * src/TextCache.C (text_fits::operator()): add const's to the signature
6523 (has_buffer::operator()): ditto
6525 * src/Floating.h: add some comments on the class
6527 * src/FloatList.[Ch] (typeExist): new method
6530 * src/BackStack.h: added default constructor, wanted by Gcc.
6532 2000-07-14 Juergen Vigna <jug@sad.it>
6534 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6536 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6538 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6539 do a redraw when the window is resized!
6540 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6542 * src/insets/insettext.C (resizeLyXText): added function to correctly
6543 being able to resize the LyXWindow.
6545 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6547 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6549 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6550 crashes when closing dialog to a deleted inset.
6552 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6553 method! Now similar to other insets.
6555 2000-07-13 Juergen Vigna <jug@sad.it>
6557 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6559 * lib/examples/Literate.lyx: small patch!
6561 * src/insets/insetbib.C (Read): added this function because of wrong
6562 Write (without [begin|end]_inset).
6564 2000-07-11 Juergen Vigna <jug@sad.it>
6566 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6567 as the insertInset could not be good!
6569 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6570 the bool param should not be last.
6572 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6574 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6575 did submit that to Karl).
6577 * configure.in: use -isystem instead of -I for X headers. This
6578 fixes a problem on solaris with a recent gcc;
6579 put the front-end code after the X detection code;
6580 configure in sigc++ before lib/
6582 * src/lyx_main.C (commandLineHelp): remove -display from command
6585 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6587 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6588 Also put in Makefile rules for building the ``listerrors''
6589 program for parsing errors from literate programs written in LyX.
6591 * lib/build-listerrors: Added small shell script as part of compile
6592 process. This builds a working ``listerrors'' binary if noweb is
6593 installed and either 1) the VNC X server is installed on the machine,
6594 or 2) the user is compiling from within a GUI. The existence of a GUI
6595 is necessary to use the ``lyx --export'' feature for now. This
6596 hack can be removed once ``lyx --export'' no longer requires a GUI to
6599 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6601 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6602 now passed back correctly from gcc and placed "under" error
6603 buttons in a Literate LyX source.
6605 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6607 * src/text.C (GetColumnNearX): Better behavior when a RTL
6608 paragraph is ended by LTR text.
6610 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6613 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6615 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6616 true when clipboard is empty.
6618 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6620 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6621 row of the paragraph.
6622 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6623 to prevent calculation of bidi tables
6625 2000-07-07 Juergen Vigna <jug@sad.it>
6627 * src/screen.C (ToggleSelection): added y_offset and x_offset
6630 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6633 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6635 * src/insets/insettext.C: fixed Layout-Display!
6637 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6639 * configure.in: add check for strings.h header.
6641 * src/spellchecker.C: include <strings.h> in order to have a
6642 definition for bzero().
6644 2000-07-07 Juergen Vigna <jug@sad.it>
6646 * src/insets/insettext.C (draw): set the status of the bv->text to
6647 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6649 * src/screen.C (DrawOneRow):
6650 (DrawFromTo): redraw the actual row if something has changed in it
6653 * src/text.C (draw): call an update of the toplevel-inset if something
6654 has changed inside while drawing.
6656 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6658 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6660 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6661 processing inside class.
6663 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6664 processing inside class.
6666 * src/insets/insetindex.h new struct Holder, consistent with other
6669 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6670 citation dialog from main code and placed it in src/frontends/xforms.
6671 Dialog launched through signals instead of callbacks
6673 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6675 * lyx.man: update the options description.
6677 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6679 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6680 handle neg values, set min width to 590, add doc about -display
6682 2000-07-05 Juergen Vigna <jug@sad.it>
6684 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6685 calls to BufferView *.
6687 * src/insets/insettext.C (checkAndActivateInset): small fix non
6688 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6690 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6691 their \end_inset token!
6693 2000-07-04 edscott <edscott@imp.mx>
6695 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6696 lib/lyxrc.example: added option \wheel_jump
6698 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6700 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6701 remove support for -width,-height,-xpos and -ypos.
6703 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6705 * src/encoding.[Ch]: New files.
6707 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6708 (text): Call to the underline() method only when needed.
6710 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6712 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6713 encoding(s) for the document.
6715 * src/bufferparams.C (BufferParams): Changed default value of
6718 * src/language.C (newLang): Removed.
6719 (items[]): Added encoding information for all defined languages.
6721 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6722 encoding choice button.
6724 * src/lyxrc.h (font_norm_type): New member variable.
6725 (set_font_norm_type): New method.
6727 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6728 paragraphs with different encodings.
6730 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6731 (TransformChar): Changed to work correctly with Arabic points.
6732 (draw): Added support for drawing Arabic points.
6733 (draw): Removed code for drawing underbars (this is done by
6736 * src/support/textutils.h (IsPrintableNonspace): New function.
6738 * src/BufferView_pimpl.h: Added "using SigC::Object".
6739 * src/LyXView.h: ditto.
6741 * src/insets/insetinclude.h (include_label): Changed to mutable.
6743 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6745 * src/mathed/math_iter.h: remove empty destructor
6747 * src/mathed/math_cursor.h: remove empty destructor
6749 * src/insets/lyxinset.h: add THEOREM_CODE
6751 * src/insets/insettheorem.[Ch]: new files
6753 * src/insets/insetminipage.C: (InsertInset): remove
6755 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6757 (InsertInset): remove
6759 * src/insets/insetlist.C: (InsertList): remove
6761 * src/insets/insetfootlike.[Ch]: new files
6763 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6766 (InsertInset): ditto
6768 * src/insets/insetert.C: remove include Painter.h, reindent
6769 (InsertInset): move to header
6771 * src/insets/insetcollapsable.h: remove explicit from default
6772 contructor, remove empty destructor, add InsertInset
6774 * src/insets/insetcollapsable.C (InsertInset): new func
6776 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6778 * src/vspace.h: add explicit to constructor
6780 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6781 \textcompwordmark, please test this.
6783 * src/lyxrc.C: set ascii_linelen to 65 by default
6785 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6787 * src/commandtags.h: add LFUN_INSET_THEOREM
6789 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6790 (makeLinuxDocFile): remove _some_ of the nice logic
6791 (makeDocBookFile): ditto
6793 * src/Painter.[Ch]: (~Painter): removed
6795 * src/LyXAction.C (init): entry for insettheorem added
6797 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6799 (deplog): code to detect files generated by LaTeX, needs testing
6802 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6804 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6806 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6808 * src/LaTeX.C (deplog): Add a check for files that are going to be
6809 created by the first latex run, part of the project to remove the
6812 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6813 contents to the extension list.
6815 2000-07-04 Juergen Vigna <jug@sad.it>
6817 * src/text.C (NextBreakPoint): added support for needFullRow()
6819 * src/insets/lyxinset.h: added needFullRow()
6821 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6824 * src/insets/insettext.C: lots of changes for update!
6826 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6828 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6830 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6832 * src/insets/insetinclude.C (InsetInclude): fixed
6833 initialization of include_label.
6834 (unique_id): now returns a string.
6836 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6838 * src/LaTeXFeatures.h: new member IncludedFiles, for
6839 a map of key, included file name.
6841 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6842 with the included files for inclusion in SGML preamble,
6843 i. e., linuxdoc and docbook.
6846 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6847 nice (is the generated linuxdoc code to be exported?), that
6848 allows to remove column, and only_body that will be true for
6849 slave documents. Insets are allowed inside SGML font type.
6850 New handling of the SGML preamble for included files.
6851 (makeDocBookFile): the same for docbook.
6853 * src/insets/insetinclude.h:
6854 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6856 (DocBook): new export methods.
6858 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6859 and makeDocBookFile.
6861 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6862 formats to export with command line argument -x.
6864 2000-06-29 Juergen Vigna <jug@sad.it>
6866 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6867 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6869 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6870 region could already been cleared by an inset!
6872 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6874 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6877 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6879 (cursorToggle): remove special handling of lyx focus.
6881 2000-06-28 Juergen Vigna <jug@sad.it>
6883 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6886 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6888 * src/insets/insetindex.C (Edit): add a callback when popup is
6891 * src/insets/insettext.C (LocalDispatch):
6892 * src/insets/insetmarginal.h:
6893 * src/insets/insetlist.h:
6894 * src/insets/insetfoot.h:
6895 * src/insets/insetfloat.h:
6896 * src/insets/insetert.h: add a missing std:: qualifier.
6898 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6900 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6903 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6905 * src/insets/insettext.C (Read): remove tmptok unused variable
6906 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6907 (InsertInset): change for new InsetInset code
6909 * src/insets/insettext.h: add TEXT inline method
6911 * src/insets/insettext.C: remove TEXT macro
6913 * src/insets/insetmarginal.C (Write): new method
6914 (Latex): change output slightly
6916 * src/insets/insetfoot.C (Write): new method
6917 (Latex): change output slightly (don't use endl when no need)
6919 * src/insets/insetert.C (Write): new method
6921 * src/insets/insetcollapsable.h: make button_length, button_top_y
6922 and button_bottm_y protected.
6924 * src/insets/insetcollapsable.C (Write): simplify code by using
6925 tostr. Also do not output the float name, the children class
6926 should to that to get control over own arguments
6928 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6929 src/insets/insetminipage.[Ch]:
6932 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6934 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6936 * src/Makefile.am (lyx_SOURCES): add the new files
6938 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6939 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6940 * src/commandtags.h: ditto
6942 * src/LaTeXFeatures.h: add a std::set of used floattypes
6944 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6946 * src/FloatList.[Ch] src/Floating.h: new files
6948 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6950 * src/lyx_cb.C (TableApplyCB): ditto
6952 * src/text2.C: ditto
6953 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6954 (parseSingleLyXformat2Token): ditto + add code for
6955 backwards compability for old float styles + add code for new insets
6957 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6959 (InsertInset(size_type, Inset *, LyXFont)): new method
6960 (InsetChar(size_type, char)): changed to use the other InsetChar
6961 with a LyXFont(ALL_INHERIT).
6962 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6963 insert the META_INSET.
6965 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6967 * sigc++/thread.h (Threads): from here
6969 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6970 definition out of line
6971 * sigc++/scope.h: from here
6973 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6975 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6976 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6978 * Makefile.am (bindist): new target.
6980 * INSTALL: add instructions for doing a binary distribution.
6982 * development/tools/README.bin.example: update a bit.
6984 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6987 * lib/lyxrc.example: new lyxrc tag \set_color.
6989 * src/lyxfunc.C (Dispatch):
6990 * src/commandtags.h:
6991 * src/LyXAction.C: new lyxfunc "set-color".
6993 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6994 and an x11name given as strings.
6996 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6997 cache when a color is changed.
6999 2000-06-26 Juergen Vigna <jug@sad.it>
7001 * src/lyxrow.C (width): added this functions and variable.
7003 * src/insets/insetcite.C (create_form_citation_form): some Gravity
7006 * src/text.C (SetHeightOfRow): fixed calcualting of width.
7008 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7010 * images/undo_bw.xpm: new icon.
7011 * images/redo_bw.xpm: ditto.
7013 * configure.in (INSTALL_SCRIPT): change value to
7014 ${INSTALL} to avoid failures of install-script target.
7015 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
7017 * src/BufferView.h: add a magic "friend" declaration to please
7020 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
7022 * forms/cite.fd: modified to allow resizing without messing
7025 * src/insetcite.C: Uses code from cite.fd almost without
7027 User can now resize dialog in the x-direction.
7028 Resizing the dialog in the y-direction is prevented, as the
7029 code does this intelligently already.
7031 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7033 * INSTALL: remove obsolete entry in "problems" section.
7035 * lib/examples/sl_*.lyx: update of the slovenian examples.
7037 * src/support/FileInfo.[Ch] (getBlockSize): remove.
7039 2000-06-23 Juergen Vigna <jug@sad.it>
7041 * src/lyxtext.h: added a 'cleared' flag to draw() function.
7043 * src/buffer.C (resize): delete the LyXText of textinsets.
7045 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
7047 * src/insets/lyxinset.h: added another parameter 'cleared' to
7048 the draw() function.
7050 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
7051 unlocking inset in inset.
7053 2000-06-22 Juergen Vigna <jug@sad.it>
7055 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
7056 of insets and moved first to LyXText.
7058 * src/mathed/formulamacro.[Ch]:
7059 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
7061 2000-06-21 Juergen Vigna <jug@sad.it>
7063 * src/text.C (GetVisibleRow): look if I should clear the area or not
7064 using Inset::doClearArea() function.
7066 * src/insets/lyxinset.h: added doClearArea() function and
7067 modified draw(Painter &, ...) to draw(BufferView *, ...)
7069 * src/text2.C (UpdateInset): return bool insted of int
7071 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
7073 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
7074 combox in the character popup
7076 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
7077 BufferParams const & params
7079 2000-06-20 Juergen Vigna <jug@sad.it>
7081 * src/insets/insettext.C (SetParagraphData): set insetowner on
7084 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7086 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
7087 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
7089 (form_main_): remove
7091 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
7092 (create_form_form_main): remove FD_form_main stuff, connect to
7093 autosave_timeout signal
7095 * src/LyXView.[Ch] (getMainForm): remove
7096 (UpdateTimerCB): remove
7097 * src/BufferView_pimpl.h: inherit from SigC::Object
7099 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
7100 signal instead of callback
7102 * src/BufferView.[Ch] (cursorToggleCB): remove
7104 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7106 * src/BufferView_pimpl.C: changes because of the one below
7108 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
7109 instead of storing a pointer to a LyXText.
7111 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
7113 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
7115 * src/lyxparagraph.h
7117 * src/paragraph.C: Changed fontlist to a sorted vector.
7119 2000-06-19 Juergen Vigna <jug@sad.it>
7121 * src/BufferView.h: added screen() function.
7123 * src/insets/insettext.C (LocalDispatch): some selection code
7126 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
7128 * src/insets/insettext.C (SetParagraphData):
7130 (InsetText): fixes for multiple paragraphs.
7132 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
7134 * development/lyx.spec.in: Call configure with ``--without-warnings''
7135 to work around a bug with the Makefiles when doing ``make lyxrpm''.
7136 This should be fine, however, since we generally don't want to be
7137 verbose when making an RPM.
7139 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
7141 * lib/scripts/fig2pstex.py: New file
7143 2000-06-16 Juergen Vigna <jug@sad.it>
7145 * src/insets/insettabular.C (UpdateLocal):
7146 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
7147 (LocalDispatch): Changed all functions to use LyXText.
7149 2000-06-15 Juergen Vigna <jug@sad.it>
7151 * src/text.C (SetHeightOfRow): call inset::update before requesting
7154 * src/insets/insettext.C (update):
7155 * src/insets/insettabular.C (update): added implementation
7157 * src/insets/lyxinset.h: added update function
7159 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7161 * src/text.C (SelectNextWord): protect against null pointers with
7162 old-style string streams. (fix from Paul Theo Gonciari
7165 * src/cite.[Ch]: remove erroneous files.
7167 * lib/configure.m4: update the list of created directories.
7169 * src/lyxrow.C: include <config.h>
7170 * src/lyxcursor.C: ditto.
7172 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7174 * lib/examples/decimal.lyx: new example file from Mike.
7176 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
7177 to find template definitions (from Dekel)
7179 * src/frontends/.cvsignore: add a few things.
7181 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7183 * src/Timeout.C (TimeOut): remove default argument.
7185 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7188 * src/insets/ExternalTemplate.C: add a "using" directive.
7190 * src/lyx_main.h: remove the act_ struct, which seems unused
7193 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7195 * LyX Developers Meeting: All files changed, due to random C++ (by
7196 coincidence) code generator script.
7198 - external inset (cool!)
7199 - initial online editing of preferences
7200 - insettabular breaks insettext(s contents)
7202 - some DocBook fixes
7203 - example files update
7204 - other cool stuff, create a diff and look for yourself.
7206 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7208 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7209 -1 this is a non-line-breaking textinset.
7211 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7212 if there is no width set.
7214 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7216 * Lots of files: Merged the dialogbase branch.
7218 2000-06-09 Allan Rae <rae@lyx.org>
7220 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7221 and the Dispatch methods that used it.
7223 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7224 access to functions formerly kept in Dispatch.
7226 2000-05-19 Allan Rae <rae@lyx.org>
7228 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7229 made to_page and count_copies integers again. from_page remains a
7230 string however because I want to allow entry of a print range like
7231 "1,4,22-25" using this field.
7233 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7234 and printer-params-get. These aren't useful from the minibuffer but
7235 could be used by a script/LyXServer app provided it passes a suitable
7236 auto_mem_buffer. I guess I should take a look at how the LyXServer
7237 works and make it support xtl buffers.
7239 * sigc++/: updated to libsigc++-1.0.1
7241 * src/xtl/: updated to xtl-1.3.pl.11
7243 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7244 those changes done to the files in src/ are actually recreated when
7245 they get regenerated. Please don't ever accept a patch that changes a
7246 dialog unless that patch includes the changes to the corresponding *.fd
7249 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7250 stringOnlyContains, renamed it and generalised it.
7252 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7253 branch. Removed the remaining old form_print code.
7255 2000-04-26 Allan Rae <rae@lyx.org>
7257 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7258 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7260 2000-04-25 Allan Rae <rae@lyx.org>
7262 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7263 against a base of xtl-1.3.pl.4
7265 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7266 filter the Id: entries so they still show the xtl version number
7269 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7270 into the src/xtl code. Patch still pending with José (XTL)
7272 2000-04-24 Allan Rae <rae@lyx.org>
7274 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7275 both more generic and much safer. Use the new template functions.
7276 * src/buffer.[Ch] (Dispatch): ditto.
7278 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7279 and mem buffer more intelligently. Also a little general cleanup.
7282 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7283 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7284 * src/xtl/Makefile.am: ditto.
7285 * src/xtl/.cvsignore: ditto.
7286 * src/Makefile.am: ditto.
7288 * src/PrinterParams.h: Removed the macros member functions. Added a
7289 testInvariant member function. A bit of tidying up and commenting.
7290 Included Angus's idea for fixing operation with egcs-1.1.2.
7292 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7293 cool expansion of XTL's mem_buffer to support automatic memory
7294 management within the buffer itself. Removed the various macros and
7295 replaced them with template functions that use either auto_mem_buffer
7296 or mem_buffer depending on a #define. The mem_buffer support will
7297 disappear as soon as the auto_mem_buffer is confirmed to be good on
7298 other platforms/compilers. That is, it's there so you've got something
7301 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7302 effectively forked XTL. However I expect José will include my code
7303 into the next major release. Also fixed a memory leak.
7304 * src/xtl/text.h: ditto.
7305 * src/xtl/xdr.h: ditto.
7306 * src/xtl/giop.h: ditto.
7308 2000-04-16 Allan Rae <rae@lyx.org>
7310 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7311 by autogen.sh and removed by maintainer-clean anyway.
7312 * .cvsignore, sigc++/.cvsignore: Support the above.
7314 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7316 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7318 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7319 macros, renamed static callback-target member functions to suit new
7320 scheme and made them public.
7321 * src/frontends/xforms/forms/form_print.fd: ditto.
7322 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7324 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7327 * src/xtl/: New directory containing a minimal distribution of XTL.
7328 This is XTL-1.3.pl.4.
7330 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7332 2000-04-15 Allan Rae <rae@lyx.org>
7334 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7336 * sigc++/: Updated to libsigc++-1.0.0
7338 2000-04-14 Allan Rae <rae@lyx.org>
7340 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7341 use the generic ones in future. I'll modify my conversion script.
7343 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7345 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7346 (CloseAllBufferRelatedDialogs): Renamed.
7347 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7349 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7350 of the generic ones. These are the same ones my conversion script
7353 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7354 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7355 * src/buffer.C (Dispatch): ditto
7357 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7358 functions for updating and hiding buffer dependent dialogs.
7359 * src/BufferView.C (buffer): ditto
7360 * src/buffer.C (setReadonly): ditto
7361 * src/lyxfunc.C (CloseBuffer): ditto
7363 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7364 Dialogs.h, and hence all the SigC stuff, into every file that includes
7365 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7367 * src/BufferView2.C: reduce the number of headers included by buffer.h
7369 2000-04-11 Allan Rae <rae@lyx.org>
7371 * src/frontends/xforms/xform_macros.h: A small collection of macros
7372 for building C callbacks.
7374 * src/frontends/xforms/Makefile.am: Added above file.
7376 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7377 scheme again. This time it should work for JMarc. If this is
7378 successful I'll revise my conversion script to automate some of this.
7379 The static member functions in the class also have to be public for
7380 this scheme will work. If the scheme works (it's almost identical to
7381 the way BufferView::cursorToggleCB is handled so it should work) then
7382 FormCopyright and FormPrint will be ready for inclusion into the main
7383 trunk immediately after 1.1.5 is released -- provided we're prepared
7384 for complaints about lame compilers not handling XTL.
7386 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7388 2000-04-07 Allan Rae <rae@lyx.org>
7390 * config/lyxinclude.m4: A bit more tidying up (Angus)
7392 * src/LString.h: JMarc's <string> header fix
7394 * src/PrinterParams.h: Used string for most data to remove some
7395 ugly code in the Print dialog and avoid even uglier code when
7396 appending the ints to a string for output.
7398 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7399 and moved "default:" back to the end of switch statement. Cleaned
7400 up the printing so it uses the right function calls and so the
7401 "print to file" option actually puts the file in the right directory.
7403 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7405 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7406 and Ok+Apply button control into a separate method: input (Angus).
7407 (input) Cleaned it up and improved it to be very thorough now.
7408 (All CB) static_cast used instead of C style cast (Angus). This will
7409 probably change again once we've worked out how to keep gcc-2.8.1 happy
7410 with real C callbacks.
7411 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7412 ignore some of the bool settings and has random numbers instead. Needs
7413 some more investigation. Added other input length checks and checking
7414 of file and printer names.
7416 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7417 would link (Angus). Seems the old code doesn't compile with the pragma
7418 statement either. Separated callback entries from internal methods.
7420 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7422 2000-03-17 Allan Rae <rae@lyx.org>
7424 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7425 need it? Maybe it could go in Dialogs instead? I could make it a
7426 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7427 values to get the bool return value.
7428 (Dispatch): New overloaded method for xtl support.
7430 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7431 extern "C" callback instead of static member functions. Hopefully,
7432 JMarc will be able to compile this. I haven't changed
7433 forms/form_copyright.fd yet. Breaking one of my own rules already.
7435 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7436 because they aren't useful from the minibuffer. Maybe a LyXServer
7437 might want a help message though?
7439 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7441 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7442 xtl which needs both rtti and exceptions.
7444 * src/support/Makefile.am:
7445 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7447 * src/frontends/xforms/input_validators.[ch]: input filters and
7448 validators. These conrol what keys are valid in input boxes.
7449 Use them and write some more. Much better idea than waiting till
7450 after the user has pressed Ok to say that the input fields don't make
7453 * src/frontends/xforms/Makefile.am:
7454 * src/frontends/xforms/forms/form_print.fd:
7455 * src/frontends/xforms/forms/makefile:
7456 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7457 new scheme. Still have to make sure I haven't missed anything from
7458 the current implementation.
7460 * src/Makefile.am, src/PrinterParams.h: New data store.
7462 * other files: Added a couple of copyright notices.
7464 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7466 * src/insets/insetbib.h: move Holder struct in public space.
7468 * src/frontends/include/DialogBase.h: use SigC:: only when
7469 SIGC_CXX_NAMESPACES is defined.
7470 * src/frontends/include/Dialogs.h: ditto.
7472 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7474 * src/frontends/xforms/FormCopyright.[Ch]: do not
7475 mention SigC:: explicitely.
7477 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7479 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7480 deals with testing KDE in main configure.in
7481 * configure.in: ditto.
7483 2000-02-22 Allan Rae <rae@lyx.org>
7485 * Lots of files: Merged from HEAD
7487 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7488 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7490 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7492 * sigc++/: new minidist.
7494 2000-02-14 Allan Rae <rae@lyx.org>
7496 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7498 2000-02-08 Juergen Vigna <jug@sad.it>
7500 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7501 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7503 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7504 for this port and so it is much easier for other people to port
7505 dialogs in a common development environment.
7507 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7508 the QT/KDE implementation.
7510 * src/frontends/kde/Dialogs.C:
7511 * src/frontends/kde/FormCopyright.C:
7512 * src/frontends/kde/FormCopyright.h:
7513 * src/frontends/kde/Makefile.am:
7514 * src/frontends/kde/formcopyrightdialog.C:
7515 * src/frontends/kde/formcopyrightdialog.h:
7516 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7517 for the kde support of the Copyright-Dialog.
7519 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7520 subdir-substitution instead of hardcoded 'xforms' as we now have also
7523 * src/frontends/include/DialogBase.h (Object): just commented the
7524 label after #endif (nasty warning and I don't like warnings ;)
7526 * src/main.C (main): added KApplication initialization if using
7529 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7530 For now only the KDE event-loop is added if frontend==kde.
7532 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7534 * configure.in: added support for the --with-frontend[=value] option
7536 * autogen.sh: added kde.m4 file to list of config-files
7538 * acconfig.h: added define for KDEGUI-support
7540 * config/kde.m4: added configuration functions for KDE-port
7542 * config/lyxinclude.m4: added --with-frontend[=value] option with
7543 support for xforms and KDE.
7545 2000-02-08 Allan Rae <rae@lyx.org>
7547 * all Makefile.am: Fixed up so the make targets dist, distclean,
7548 install and uninstall all work even if builddir != srcdir. Still
7549 have a new sigc++ minidist update to come.
7551 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7553 2000-02-01 Allan Rae <rae@lyx.org>
7555 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7556 Many mods to get builddir != srcdir working.
7558 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7559 for building on NT and so we can do the builddir != srcdir stuff.
7561 2000-01-30 Allan Rae <rae@lyx.org>
7563 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7564 This will stay in "rae" branch. We probably don't really need it in
7565 the main trunk as anyone who wants to help programming it should get
7566 a full library installed also. So they can check both included and
7567 system supplied library compilation.
7569 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7570 Added a 'mini' distribution of libsigc++. If you feel the urge to
7571 change something in these directories - Resist it. If you can't
7572 resist the urge then you should modify the following script and rebuild
7573 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7574 all happen. Still uses a hacked version of libsigc++'s configure.in.
7575 I'm quite happy with the results. I'm not sure the extra work to turn
7576 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7577 worth the trouble and would probably lead to extra maintenance
7579 I haven't tested the following important make targets: install, dist.
7580 Not ready for prime time but very close. Maybe 1.1.5.
7582 * development/tools/makeLyXsigc.sh: A shell script to automatically
7583 generate our mini-dist of libsigc++. It can only be used with a CVS
7584 checkout of libsigc++ not a tarball distribution. It's well commented.
7585 This will end up as part of the libsigc++ distribution so other apps
7586 can easily have an included mini-dist. If someone makes mods to the
7587 sigc++ subpackage without modifying this script to generate those
7588 changes I'll be very upset!
7590 * src/frontends/: Started the gui/system indep structure.
7592 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7593 to access the gui-indep dialogs are in this class. Much improved
7594 design compared to previous revision. Lars, please refrain from
7595 moving this header into src/ like you did with Popups.h last time.
7597 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7599 * src/frontends/xforms/: Started the gui-indep system with a single
7600 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7603 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7604 Here you'll find a very useful makefile and automated fdfix.sh that
7605 makes updating dailogs a no-brainer -- provided you follow the rules
7606 set out in the README. I'm thinking about adding another script to
7607 automatically generate skeleton code for a new dialog given just the
7610 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7611 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7612 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7614 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7616 * src/support/LSubstring.C (operator): simplify
7618 * src/lyxtext.h: removed bparams, use buffer_->params instead
7620 * src/lyxrow.h: make Row a real class, move all variables to
7621 private and use accessors.
7623 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7625 (isRightToLeftPar): ditto
7626 (ChangeLanguage): ditto
7627 (isMultiLingual): ditto
7630 (SimpleTeXOnePar): ditto
7631 (TeXEnvironment): ditto
7632 (GetEndLabel): ditto
7634 (SetOnlyLayout): ditto
7635 (BreakParagraph): ditto
7636 (BreakParagraphConservative): ditto
7637 (GetFontSettings): ditto
7639 (CopyIntoMinibuffer): ditto
7640 (CutIntoMinibuffer): ditto
7641 (PasteParagraph): ditto
7642 (SetPExtraType): ditto
7643 (UnsetPExtraType): ditto
7644 (DocBookContTableRows): ditto
7645 (SimpleDocBookOneTablePar): ditto
7647 (TeXFootnote): ditto
7648 (SimpleTeXOneTablePar): ditto
7649 (TeXContTableRows): ditto
7650 (SimpleTeXSpecialChars): ditto
7653 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7654 to private and use accessors.
7656 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7657 this, we did not use it anymore and has not been for ages. Just a
7658 waste of cpu cycles.
7660 * src/language.h: make Language a real class, move all variables
7661 to private and use accessors.
7663 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7664 (create_view): remove
7665 (update): some changes for new timer
7666 (cursorToggle): use new timer
7667 (beforeChange): change for new timer
7669 * src/BufferView.h (cursorToggleCB): removed last paramter because
7672 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7673 (cursorToggleCB): change because of new timer code
7675 * lib/CREDITS: updated own mailaddress
7677 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7679 * src/support/filetools.C (PutEnv): fix the code in case neither
7680 putenv() nor setenv() have been found.
7682 * INSTALL: mention the install-strip Makefile target.
7684 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7685 read-only documents.
7687 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7689 * lib/reLyX/configure.in (VERSION): avoid using a previously
7690 generated reLyX wrapper to find out $prefix.
7692 * lib/examples/eu_adibide_lyx-atua.lyx:
7693 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7694 translation of the Tutorial (Dooteo)
7696 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7698 * forms/cite.fd: new citation dialog
7700 * src/insetcite.[Ch]: the new citation dialog is moved into
7703 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7706 * src/insets/insetcommand.h: data members made private.
7708 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7710 * LyX 1.1.5 released
7712 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7714 * src/version.h (LYX_RELEASE): to 1.1.5
7716 * src/spellchecker.C (RunSpellChecker): return false if the
7717 spellchecker dies upon creation.
7719 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7721 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7722 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7726 * lib/CREDITS: update entry for Martin Vermeer.
7728 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7730 * src/text.C (draw): Draw foreign language bars at the bottom of
7731 the row instead of at the baseline.
7733 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7735 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7737 * lib/bind/de_menus.bind: updated
7739 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7741 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7743 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7745 * src/menus.C (Limit_string_length): New function
7746 (ShowTocMenu): Limit the number of items/length of items in the
7749 * src/paragraph.C (String): Correct result for a paragraph inside
7752 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7754 * src/bufferlist.C (close): test of buf->getuser() == NULL
7756 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7758 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7759 Do not call to SetCursor when the paragraph is a closed footnote!
7761 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7763 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7766 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7768 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7771 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7772 reference popup, that activates the reference-back action
7774 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7776 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7777 the menus. Also fixed a bug.
7779 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7780 the math panels when switching buffers (unless new buffer is readonly).
7782 * src/BufferView.C (NoSavedPositions)
7783 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7785 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7787 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7788 less of dvi dirty or not.
7790 * src/trans_mgr.[Ch] (insert): change first parameter to string
7793 * src/chset.[Ch] (encodeString): add const to first parameter
7795 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7797 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7801 * src/LaTeX.C (deplog): better searching for dependency files in
7802 the latex log. Uses now regexps.
7804 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7805 instead of the box hack or \hfill.
7807 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7809 * src/lyxfunc.C (doImportHelper): do not create the file before
7810 doing the actual import.
7811 (doImportASCIIasLines): create a new file before doing the insert.
7812 (doImportASCIIasParagraphs): ditto.
7814 * lib/lyxrc.example: remove mention of non-existing commands
7816 * lyx.man: remove mention of color-related switches.
7818 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7820 * src/lyx_gui.C: remove all the color-related ressources, which
7821 are not used anymore.
7823 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7826 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7828 * src/lyxrc.C (read): Add a missing break in the switch
7830 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7832 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7834 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7837 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7839 * src/text.C (draw): draw bars under foreign language words.
7841 * src/LColor.[Ch]: add LColor::language
7843 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7845 * src/lyxcursor.h (boundary): New member variable
7847 * src/text.C (IsBoundary): New methods
7849 * src/text.C: Use the above for currect cursor movement when there
7850 is both RTL & LTR text.
7852 * src/text2.C: ditto
7854 * src/bufferview_funcs.C (ToggleAndShow): ditto
7856 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7858 * src/text.C (DeleteLineForward): set selection to true to avoid
7859 that DeleteEmptyParagraphMechanism does some magic. This is how it
7860 is done in all other functions, and seems reasonable.
7861 (DeleteWordForward): do not jump over non-word stuff, since
7862 CursorRightOneWord() already does it.
7864 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7865 DeleteWordBackward, since they seem safe to me (since selection is
7866 set to "true") DeleteEmptyParagraphMechanism does nothing.
7868 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7870 * src/lyx_main.C (easyParse): simplify the code by factoring the
7871 part that removes parameters from the command line.
7872 (LyX): check wether wrong command line options have been given.
7874 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7876 * src/lyx_main.C : add support for specifying user LyX
7877 directory via command line option -userdir.
7879 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7881 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7882 the number of items per popup.
7883 (Add_to_refs_menu): Ditto.
7885 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7887 * src/lyxparagraph.h: renamed ClearParagraph() to
7888 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7889 textclass as parameter, and do nothing if free_spacing is
7890 true. This fixes part of the line-delete-forward problems.
7892 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7893 (pasteSelection): ditto.
7894 (SwitchLayoutsBetweenClasses): more translatable strings.
7896 * src/text2.C (CutSelection): use StripLeadingSpaces.
7897 (PasteSelection): ditto.
7898 (DeleteEmptyParagraphMechanism): ditto.
7900 2000-05-26 Juergen Vigna <jug@sad.it>
7902 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7903 is not needed in tabular insets.
7905 * src/insets/insettabular.C (TabularFeatures): added missing features.
7907 * src/tabular.C (DeleteColumn):
7909 (AppendRow): implemented this functions
7910 (cellsturct::operator=): clone the inset too;
7912 2000-05-23 Juergen Vigna <jug@sad.it>
7914 * src/insets/insettabular.C (LocalDispatch): better selection support
7915 when having multicolumn-cells.
7917 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7919 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7921 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7923 * src/ColorHandler.C (getGCForeground): put more test into _()
7925 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7928 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7931 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7933 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7934 there are no labels, or when buffer is readonly.
7936 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7937 there are no labels, buffer is SGML, or when buffer is readonly.
7939 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7941 * src/LColor.C (LColor): change a couple of grey40 to grey60
7942 (LColor): rewore initalization to make compiles go some magnitude
7944 (getGUIName): don't use gettext until we need the string.
7946 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7948 * src/Bullet.[Ch]: Fixed a small bug.
7950 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7952 * src/paragraph.C (String): Several fixes/improvements
7954 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7956 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7958 * src/paragraph.C (String): give more correct output.
7960 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7962 * src/lyxfont.C (stateText) Do not output the language if it is
7963 eqaul to the language of the document.
7965 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7966 between two paragraphs with the same language.
7968 * src/paragraph.C (getParLanguage) Return a correct answer for an
7969 empty dummy paragraph.
7971 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7974 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7977 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7978 the menus/popup, if requested fonts are unavailable.
7980 2000-05-22 Juergen Vigna <jug@sad.it>
7982 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7983 movement support (Up/Down/Tab/Shift-Tab).
7984 (LocalDispatch): added also preliminari cursor-selection.
7986 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7988 * src/paragraph.C (PasteParagraph): Hopefully now right!
7990 2000-05-22 Garst R. Reese <reese@isn.net>
7992 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7993 of list, change all references to Environment to Command
7994 * tex/hollywood.cls : rewrite environments as commands, add
7995 \uppercase to interiorshot and exteriorshot to force uppecase.
7996 * tex/broadway.cls : rewrite environments as commands. Tweak
7999 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8001 * src/menus.C (Add_to_toc_menu): fix the code which limits the
8002 size of items: use a constant intead of the hardcoded 40, and more
8003 importantly do not remove the %m and %x tags added at the end.
8004 (Add_to_refs_menu): use vector::size_type instead of
8005 unsigned int as basic types for the variables. _Please_ do not
8006 assume that size_t is equal to unsigned int. On an alpha, this is
8007 unsigned long, which is _not_ the same.
8009 * src/language.C (initL): remove language "hungarian", since it
8010 seems that "magyar" is better.
8012 2000-05-22 Juergen Vigna <jug@sad.it>
8014 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
8016 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
8019 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
8020 next was deleted but not set to 0.
8022 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8024 * src/language.C (initL): change the initialization of languages
8025 so that compiles goes _fast_.
8027 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
8030 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
8032 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8036 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8038 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
8040 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
8044 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
8047 * src/insets/insetlo*.[Ch]: Made editable
8049 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8051 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
8052 the current selection.
8054 * src/BufferView_pimpl.C (stuffClipboard): new method
8056 * src/BufferView.C (stuffClipboard): new method
8058 * src/paragraph.C (String): new method
8060 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
8061 LColor::ignore when lyxname is not found.
8063 * src/BufferView.C (pasteSelection): new method
8065 * src/BufferView_pimpl.C (pasteSelection): new method
8067 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
8069 * src/WorkArea.C (request_clipboard_cb): new static function
8070 (getClipboard): new method
8071 (putClipboard): new method
8073 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8075 * LyX 1.1.5pre2 released
8077 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8079 * src/vspace.C (operator=): removed
8080 (operator=): removed
8082 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
8084 * src/layout.C (NumberOfClass): manually set the type in make_pair
8085 (NumberOfLayout): ditto
8087 * src/language.C: use the Language constructor for ignore_lang
8089 * src/language.h: add constructors to struct Language
8091 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
8093 * src/text2.C (SetCursorIntern): comment out #warning
8095 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
8097 * src/mathed/math_iter.h: initialize sx and sw to 0
8099 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8101 * forms/lyx.fd: Redesign of form_ref
8103 * src/LaTeXFeatures.[Ch]
8107 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
8110 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
8111 and Buffer::inset_iterator.
8113 * src/menus.C: Added new menus: TOC and Refs.
8115 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
8117 * src/buffer.C (getTocList): New method.
8119 * src/BufferView2.C (ChangeRefs): New method.
8121 * src/buffer.C (getLabelList): New method. It replaces the old
8122 getReferenceList. The return type is vector<string> instead of
8125 * src/insets/insetinclude.C (getLabelList): New method. Replaces
8126 the old getLabel() and GetNumberOfLabels() methods.
8127 * src/insets/insetlabel.C (getLabelList): ditto
8128 * src/mathed/formula.C (getLabelList): ditto
8130 * src/paragraph.C (String): New method.
8132 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
8133 Uses the new getTocList() method.
8134 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
8135 which automatically updates the contents of the browser.
8136 (RefUpdateCB): Use the new getLabelList method.
8138 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
8140 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
8142 * src/spellchecker.C: Added using std::reverse;
8144 2000-05-19 Juergen Vigna <jug@sad.it>
8146 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
8148 * src/insets/insettext.C (computeTextRows): small fix for display of
8149 1 character after a newline.
8151 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
8154 2000-05-18 Juergen Vigna <jug@sad.it>
8156 * src/insets/insettabular.C (TabularFeatures): fixed update of display
8157 when changing width of column.
8159 * src/tabular.C (set_row_column_number_info): setting of
8160 autobreak rows if necessary.
8162 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8164 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
8166 * src/vc-backend.*: renamed stat() to status() and vcstat to
8167 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
8168 compilation broke. The new name seems more relevant, anyway.
8170 2000-05-17 Juergen Vigna <jug@sad.it>
8172 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
8173 which was wrong if the removing caused removing of rows!
8175 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
8176 (pushToken): new function.
8178 * src/text2.C (CutSelection): fix problem discovered with purify
8180 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8182 * src/debug.C (showTags): enlarge the first column, now that we
8183 have 6-digits debug codes.
8185 * lib/layouts/hollywood.layout:
8186 * lib/tex/hollywood.cls:
8187 * lib/tex/brodway.cls:
8188 * lib/layouts/brodway.layout: more commands and fewer
8189 environments. Preambles moved in the .cls files. Broadway now has
8190 more options on scene numbering and less whitespace (from Garst)
8192 * src/insets/insetbib.C (getKeys): make sure that we are in the
8193 document directory, in case the bib file is there.
8195 * src/insets/insetbib.C (Latex): revert bogus change.
8197 2000-05-16 Juergen Vigna <jug@sad.it>
8199 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8200 the TabularLayout on cursor move.
8202 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8204 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8207 (draw): fixed cursor position and drawing so that the cursor is
8208 visible when before the tabular-inset.
8210 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8211 when creating from old insettext.
8213 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8215 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8217 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8218 * lib/tex/brodway.cls: ditto
8220 * lib/layouts/brodway.layout: change alignment of parenthical
8223 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8225 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8226 versions 0.88 and 0.89 are supported.
8228 2000-05-15 Juergen Vigna <jug@sad.it>
8230 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8233 * src/insets/insettext.C (computeTextRows): redone completely this
8234 function in a much cleaner way, because of problems when having a
8236 (draw): added a frame border when the inset is locked.
8237 (SetDrawLockedFrame): this sets if we draw the border or not.
8238 (SetFrameColor): this sets the frame color (default=insetframe).
8240 * src/insets/lyxinset.h: added x() and y() functions which return
8241 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8242 function which is needed to see if we have a locking inset of some
8243 type in this inset (needed for now in insettabular).
8245 * src/vspace.C (inPixels): the same function also without a BufferView
8246 parameter as so it is easier to use it in some ocasions.
8248 * src/lyxfunc.C: changed all places where insertInset was used so
8249 that now if it couldn't be inserted it is deleted!
8251 * src/TabularLayout.C:
8252 * src/TableLayout.C: added support for new tabular-inset!
8254 * src/BufferView2.C (insertInset): this now returns a bool if the
8255 inset was really inserted!!!
8257 * src/tabular.C (GetLastCellInRow):
8258 (GetFirstCellInRow): new helper functions.
8259 (Latex): implemented for new tabular class.
8263 (TeXTopHLine): new Latex() helper functions.
8265 2000-05-12 Juergen Vigna <jug@sad.it>
8267 * src/mathed/formulamacro.C (Read):
8268 * src/mathed/formula.C (Read): read also the \end_inset here!
8270 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8272 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8273 crush when saving formulae with unbalanced parenthesis.
8275 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8277 * src/layout.C: Add new keyword "endlabelstring" to layout file
8279 * src/text.C (GetVisibleRow): Draw endlabel string.
8281 * lib/layouts/broadway.layout
8282 * lib/layouts/hollywood.layout: Added endlabel for the
8283 Parenthetical layout.
8285 * lib/layouts/heb-article.layout: Do not use slanted font shape
8286 for Theorem like environments.
8288 * src/buffer.C (makeLaTeXFile): Always add "american" to
8289 the UsedLanguages list if document language is RTL.
8291 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8293 * add addendum to README.OS2 and small patch (from SMiyata)
8295 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8297 * many files: correct the calls to ChangeExtension().
8299 * src/support/filetools.C (ChangeExtension): remove the no_path
8300 argument, which does not belong there. Use OnlyFileName() instead.
8302 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8303 files when LaTeXing a non-nice latex file.
8305 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8306 a chain of "if". Return false when deadkeys are not handled.
8308 * src/lyx_main.C (LyX): adapted the code for default bindings.
8310 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8311 bindings for basic functionality (except deadkeys).
8312 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8314 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8315 several methods: handle override_x_deadkeys.
8317 * src/lyxrc.h: remove the "bindings" map, which did not make much
8318 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8320 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8322 * src/lyxfont.C (stateText): use a saner method to determine
8323 whether the font is "default". Seems to fix the crash with DEC
8326 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8328 2000-05-08 Juergen Vigna <jug@sad.it>
8330 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8331 TabularLayoutMenu with mouse-button-3
8332 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8334 * src/TabularLayout.C: added this file for having a Layout for
8337 2000-05-05 Juergen Vigna <jug@sad.it>
8339 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8340 recalculating inset-widths.
8341 (TabularFeatures): activated this function so that I can change
8342 tabular-features via menu.
8344 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8345 that I can test some functions with the Table menu.
8347 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8349 * src/lyxfont.C (stateText): guard against stupid c++libs.
8351 * src/tabular.C: add using std::vector
8352 some whitespace changes, + removed som autogenerated code.
8354 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8356 2000-05-05 Juergen Vigna <jug@sad.it>
8358 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8359 row, columns and cellstructures.
8361 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8363 * lib/lyxrc.example: remove obsolete entries.
8365 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8366 reading of protected_separator for free_spacing.
8368 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8370 * src/text.C (draw): do not display an exclamation mark in the
8371 margin for margin notes. This is confusing, ugly and
8374 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8375 AMS math' is checked.
8377 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8378 name to see whether including the amsmath package is needed.
8380 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8382 * src/paragraph.C (validate): Compute UsedLanguages correctly
8383 (don't insert the american language if it doesn't appear in the
8386 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8387 The argument of \thanks{} command is considered moving argument
8389 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8392 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8394 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8395 for appendix/minipage/depth. The lines can be now both in the footnote
8396 frame, and outside the frame.
8398 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8401 2000-05-05 Juergen Vigna <jug@sad.it>
8403 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8404 neede only in tabular.[Ch].
8406 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8408 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8410 (Write): write '~' for PROTECTED_SEPARATOR
8412 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8414 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8417 * src/mathed/formula.C (drawStr): rename size to siz.
8419 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8420 possibly fix a bug by not changing the pflags = flags to piflags =
8423 2000-05-05 Juergen Vigna <jug@sad.it>
8425 * src/insets/insetbib.C: moved using directive
8427 * src/ImportNoweb.C: small fix for being able to compile (missing
8430 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8432 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8433 to use clear, since we don't depend on this in the code. Add test
8436 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8438 * (various *.C files): add using std::foo directives to please dec
8441 * replace calls to string::clear() to string::erase() (Angus)
8443 * src/cheaders/cmath: modified to provide std::abs.
8445 2000-05-04 Juergen Vigna <jug@sad.it>
8447 * src/insets/insettext.C: Prepared all for inserting of multiple
8448 paragraphs. Still display stuff to do (alignment and other things),
8449 but I would like to use LyXText to do this when we cleaned out the
8450 table-support stuff.
8452 * src/insets/insettabular.C: Changed lot of stuff and added lots
8453 of functionality still a lot to do.
8455 * src/tabular.C: Various functions changed name and moved to be
8456 const functions. Added new Read and Write functions and changed
8457 lots of things so it works good with tabular-insets (also removed
8458 some stuff which is not needed anymore * hacks *).
8460 * src/lyxcursor.h: added operators == and != which just look if
8461 par and pos are (not) equal.
8463 * src/buffer.C (latexParagraphs): inserted this function to latex
8464 all paragraphs form par to endpar as then I can use this too for
8467 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8468 so that I can call this to from text insets with their own cursor.
8470 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8471 output off all paragraphs (because of the fix below)!
8473 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8474 the very last paragraph (this could be also the last paragraph of an
8477 * src/texrow.h: added rows() call which returns the count-variable.
8479 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8481 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8483 * lib/configure.m4: better autodetection of DocBook tools.
8485 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8487 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8489 * src/lyx_cb.C: add using std::reverse;
8491 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8494 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8495 selected files. Should fix repeated errors from generated files.
8497 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8499 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8501 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8502 the spellchecker popup.
8504 * lib/lyxrc.example: Removed the \number_inset section
8506 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8508 * src/insets/figinset.C (various): Use IsFileReadable() to make
8509 sure that the file actually exist. Relying on ghostscripts errors
8510 is a bad idea since they can lead to X server crashes.
8512 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8514 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8517 * lib/lyxrc.example: smallish typo in description of
8518 \view_dvi_paper_option
8520 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8523 * src/lyxfunc.C: doImportHelper to factor out common code of the
8524 various import methods. New functions doImportASCIIasLines,
8525 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8526 doImportLinuxDoc for the format specific parts.
8529 * buffer.C: Dispatch returns now a bool to indicate success
8532 * lyx_gui.C: Add getLyXView() for member access
8534 * lyx_main.C: Change logic for batch commands: First try
8535 Buffer::Dispatch (possibly without GUI), if that fails, use
8538 * lyx_main.C: Add support for --import command line switch.
8539 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8540 Available Formats: Everything accepted by 'buffer-import <format>'
8542 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8544 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8547 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8548 documents will be reformatted upon reentry.
8550 2000-04-27 Juergen Vigna <jug@sad.it>
8552 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8553 correctly only last pos this was a bug.
8555 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8557 * release of lyx-1.1.5pre1
8559 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8561 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8563 * src/menus.C: revert the change of naming (Figure->Graphic...)
8564 from 2000-04-11. It was incomplete and bad.
8566 * src/LColor.[Ch]: add LColor::depthbar.
8567 * src/text.C (GetVisibleRow): use it.
8569 * README: update the languages list.
8571 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8573 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8576 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8578 * README: remove sections that were just wrong.
8580 * src/text2.C (GetRowNearY): remove currentrow code
8582 * src/text.C (GetRow): remove currentrow code
8584 * src/screen.C (Update): rewritten a bit.
8585 (SmallUpdate): removed func
8587 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8589 (FullRebreak): return bool
8590 (currentrow): remove var
8591 (currentrow_y): ditto
8593 * src/lyxscreen.h (Draw): change arg to unsigned long
8594 (FitCursor): return bool
8595 (FitManualCursor): ditto
8596 (Smallpdate): remove func
8597 (first): change to unsigned long
8598 (DrawOneRow): change second arg to long (from long &)
8599 (screen_refresh_y): remove var
8600 (scree_refresh_row): ditto
8602 * src/lyxrow.h: change baseline to usigned int from unsigned
8603 short, this brings some implicit/unsigned issues out in the open.
8605 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8607 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8608 instead of smallUpdate.
8610 * src/lyxcursor.h: change y to unsigned long
8612 * src/buffer.h: don't call updateScrollbar after fitcursor
8614 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8615 where they are used. Removed "\\direction", this was not present
8616 in 1.1.4 and is already obsolete. Commented out some code that I
8617 believe to never be called.
8618 (runLiterate): don't call updateScrollbar after fitCursor
8620 (buildProgram): ditto
8623 * src/WorkArea.h (workWidth): change return val to unsigned
8626 (redraw): remove the button redraws
8627 (setScrollbarValue): change for scrollbar
8628 (getScrollbarValue): change for scrollbar
8629 (getScrollbarBounds): change for scrollbar
8631 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8632 (C_WorkArea_down_cb): removed func
8633 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8634 (resize): change for scrollbar
8635 (setScrollbar): ditto
8636 (setScrollbarBounds): ditto
8637 (setScrollbarIncrements): ditto
8638 (up_cb): removed func
8639 (down_cb): removed func
8640 (scroll_cb): change for scrollbar
8641 (work_area_handler): ditto
8643 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8644 when FitCursor did something.
8645 (updateScrollbar): some unsigned changes
8646 (downCB): removed func
8647 (scrollUpOnePage): removed func
8648 (scrollDownOnePage): remvoed func
8649 (workAreaMotionNotify): don't call screen->FitCursor but use
8650 fitCursor instead. and bool return val
8651 (workAreaButtonPress): ditto
8652 (workAreaButtonRelease): some unsigned changes
8653 (checkInsetHit): ditto
8654 (workAreaExpose): ditto
8655 (update): parts rewritten, comments about the signed char arg added
8656 (smallUpdate): removed func
8657 (cursorPrevious): call needed updateScrollbar
8660 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8663 * src/BufferView.[Ch] (upCB): removed func
8664 (downCB): removed func
8665 (smallUpdate): removed func
8667 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8669 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8670 currentrow, currentrow_y optimization. This did not help a lot and
8671 if we want to do this kind of optimization we should rather use
8672 cursor.row instead of the currentrow.
8674 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8675 buffer spacing and klyx spacing support.
8677 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8679 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8682 2000-04-26 Juergen Vigna <jug@sad.it>
8684 * src/insets/figinset.C: fixes to Lars sstream changes!
8686 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8688 * A lot of files: Added Ascii(ostream &) methods to all inset
8689 classes. Used when exporting to ASCII.
8691 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8692 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8695 * src/text2.C (ToggleFree): Disabled implicit word selection when
8696 there is a change in the language
8698 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8699 no output was generated for end-of-sentence inset.
8701 * src/insets/lyxinset.h
8704 * src/paragraph.C: Removed the insetnumber code
8706 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8708 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8710 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8711 no_babel and no_epsfig completely from the file.
8712 (parseSingleLyXformat2Token): add handling for per-paragraph
8713 spacing as written by klyx.
8715 * src/insets/figinset.C: applied patch by Andre. Made it work with
8718 2000-04-20 Juergen Vigna <jug@sad.it>
8720 * src/insets/insettext.C (cutSelection):
8721 (copySelection): Fixed with selection from right to left.
8722 (draw): now the rows are not recalculated at every draw.
8723 (computeTextRows): for now reset the inset-owner here (this is
8724 important for an undo or copy where the inset-owner is not set
8727 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8728 motion to the_locking_inset screen->first was forgotten, this was
8729 not important till we got multiline insets.
8731 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8733 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8734 code seems to be alright (it is code changed by Dekel, and the
8735 intent is indeed that all macros should be defined \protect'ed)
8737 * NEWS: a bit of reorganisation of the new user-visible features.
8739 2000-04-19 Juergen Vigna <jug@sad.it>
8741 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8742 position. Set the inset_owner of the used paragraph so that it knows
8743 that it is inside an inset. Fixed cursor handling with mouse and
8744 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8745 and cleanups to make TextInsets work better.
8747 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8748 Changed parameters of various functions and added LockInsetInInset().
8750 * src/insets/insettext.C:
8752 * src/insets/insetcollapsable.h:
8753 * src/insets/insetcollapsable.C:
8754 * src/insets/insetfoot.h:
8755 * src/insets/insetfoot.C:
8756 * src/insets/insetert.h:
8757 * src/insets/insetert.C: cleaned up the code so that it works now
8758 correctly with insettext.
8760 * src/insets/inset.C:
8761 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8762 that insets in insets are supported right.
8765 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8767 * src/paragraph.C: some small fixes
8769 * src/debug.h: inserted INSETS debug info
8771 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8772 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8774 * src/commandtags.h:
8775 * src/LyXAction.C: insert code for InsetTabular.
8777 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8778 not Button1MotionMask.
8779 (workAreaButtonRelease): send always a InsetButtonRelease event to
8781 (checkInsetHit): some setCursor fixes (always with insets).
8783 * src/BufferView2.C (lockInset): returns a bool now and extended for
8784 locking insets inside insets.
8785 (showLockedInsetCursor): it is important to have the cursor always
8786 before the locked inset.
8787 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8789 * src/BufferView.h: made lockInset return a bool.
8791 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8793 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8794 that is used also internally but can be called as public to have back
8795 a cursor pos which is not set internally.
8796 (SetCursorIntern): Changed to use above function.
8798 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8800 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8805 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8806 patches for things that should be in or should be changed.
8808 * src/* [insetfiles]: change "usigned char fragile" to bool
8809 fragile. There was only one point that could that be questioned
8810 and that is commented in formulamacro.C. Grep for "CHECK".
8812 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8813 (DeleteBuffer): take it out of CutAndPaste and make it static.
8815 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8817 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8818 output the spacing envir commands. Also the new commands used in
8819 the LaTeX output makes the result better.
8821 * src/Spacing.C (writeEnvirBegin): new method
8822 (writeEnvirEnd): new method
8824 2000-04-18 Juergen Vigna <jug@sad.it>
8826 * src/CutAndPaste.C: made textclass a static member of the class
8827 as otherwise it is not accesed right!!!
8829 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8831 * forms/layout_forms.fd
8832 * src/layout_forms.h
8833 * src/layout_forms.C (create_form_form_character)
8834 * src/lyx_cb.C (UserFreeFont)
8835 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8836 documents (in the layout->character popup).
8838 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8840 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8841 \spell_command was in fact not honored (from Kevin Atkinson).
8843 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8846 * src/lyx_gui.h: make lyxViews private (Angus)
8848 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8850 * src/mathed/math_write.C
8851 (MathMatrixInset::Write) Put \protect before \begin{array} and
8852 \end{array} if fragile
8853 (MathParInset::Write): Put \protect before \\ if fragile
8855 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8857 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8858 initialization if the LyXColorHandler must be done after the
8859 connections to the XServer has been established.
8861 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8862 get the background pixel from the lyxColorhandler so that the
8863 figures are rendered with the correct background color.
8864 (NextToken): removed functions.
8865 (GetPSSizes): use ifs >> string instead of NextToken.
8867 * src/Painter.[Ch]: the color cache moved out of this file.
8869 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8872 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8874 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8875 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8877 * src/BufferView.C (enterView): new func
8878 (leaveView): new func
8880 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8882 (leaveView): new func, undefines xterm cursor when approp.
8884 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8885 (AllowInput): delete the Workarea cursor handling from this func.
8887 * src/Painter.C (underline): draw a slimer underline in most cases.
8889 * src/lyx_main.C (error_handler): use extern "C"
8891 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8893 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8894 sent directly to me.
8896 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8897 to the list by Dekel.
8899 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8902 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8903 methods from lyx_cb.here.
8905 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8908 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8910 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8911 instead of using current_view directly.
8913 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8915 * src/LyXAction.C (init): add the paragraph-spacing command.
8917 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8919 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8921 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8922 different from the documents.
8924 * src/text.C (SetHeightOfRow): take paragraph spacing into
8925 account, paragraph spacing takes precedence over buffer spacing
8926 (GetVisibleRow): ditto
8928 * src/paragraph.C (writeFile): output the spacing parameter too.
8929 (validate): set the correct features if spacing is used in the
8931 (Clear): set spacing to default
8932 (MakeSameLayout): spacing too
8933 (HasSameLayout): spacing too
8934 (SetLayout): spacing too
8935 (TeXOnePar): output the spacing commands
8937 * src/lyxparagraph.h: added a spacing variable for use with
8938 per-paragraph spacing.
8940 * src/Spacing.h: add a Default spacing and a method to check if
8941 the current spacing is default. also added an operator==
8943 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8946 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8948 * src/lyxserver.C (callback): fix dispatch of functions
8950 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8951 printf() into lyxerr call.
8953 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8956 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8957 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8958 the "Float" from each of the subitems.
8959 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8961 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8962 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8963 documented the change so that the workaround can be nuked later.
8965 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8968 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8970 * src/buffer.C (getLatexName): ditto
8971 (setReadonly): ditto
8973 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8975 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8976 avoid some uses of current_view. Added also a bufferParams()
8977 method to get at this.
8979 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8981 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8983 * src/lyxparagraph.[Ch]: removed
8984 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8985 with operators used by lower_bound and
8986 upper_bound in InsetTable's
8987 Make struct InsetTable private again. Used matchpos.
8989 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8991 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8992 document, the language of existing text is changed (unless the
8993 document is multi-lingual)
8995 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8997 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8999 * A lot of files: A rewrite of the Right-to-Left support.
9001 2000-04-10 Juergen Vigna <jug@sad.it>
9003 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
9004 misplaced cursor when inset in inset is locked.
9006 * src/insets/insettext.C (LocalDispatch): small fix so that a
9007 BREAKLINE is not inserted if we don't permit it with autBreakRows.
9009 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
9010 footnote font should be decreased in size twice when displaying.
9012 * src/insets/insettext.C (GetDrawFont): inserted this function as
9013 the drawing-font may differ from the real paragraph font.
9015 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
9016 insets (inset in inset!).
9018 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
9019 function here because we don't want footnotes inside footnotes.
9021 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
9023 (init): now set the inset_owner in paragraph.C
9024 (LocalDispatch): added some resetPos() in the right position
9027 (pasteSelection): changed to use the new CutAndPaste-Class.
9029 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
9030 which tells if it is allowed to insert another inset inside this one.
9032 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
9033 SwitchLayoutsBetweenClasses.
9035 * src/text2.C (InsertInset): checking of the new paragraph-function
9037 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
9038 is not needed anymore here!
9041 (PasteSelection): redone (also with #ifdef) so that now this uses
9042 the CutAndPaste-Class.
9043 (SwitchLayoutsBetweenClasses): removed here and implemented in the
9046 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
9047 from/to text/insets.
9049 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
9050 so that the paragraph knows if it is inside an (text)-inset.
9051 (InsertFromMinibuffer): changed return-value to bool as now it
9052 may happen that an inset is not inserted in the paragraph.
9053 (InsertInsetAllowed): this checks if it is allowed to insert an
9054 inset in this paragraph.
9056 (BreakParagraphConservative):
9057 (BreakParagraph) : small change for the above change of the return
9058 value of InsertFromMinibuffer.
9060 * src/lyxparagraph.h: added inset_owner and the functions to handle
9061 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
9063 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9065 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
9066 functions from BufferView to BufferView::Pimpl to ease maintence.
9068 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
9069 correctly. Also use SetCursorIntern instead of SetCursor.
9071 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
9074 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9076 * src/WorkArea.C (belowMouse): manually implement below mouse.
9078 * src/*: Add "explicit" on several constructors, I added probably
9079 some unneeded ones. A couple of changes to code because of this.
9081 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
9082 implementation and private parts from the users of BufferView. Not
9085 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
9086 implementation and private parts from the users of LyXLex. Not
9089 * src/BufferView_pimpl.[Ch]: new files
9091 * src/lyxlex_pimpl.[Ch]: new files
9093 * src/LyXView.[Ch]: some inline functions move out-of-line
9095 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9097 * src/lyxparagraph.h: make struct InsetTable public.
9099 * src/support/lyxstring.h: change lyxstring::difference_type to be
9100 ptrdiff_t. Add std:: modifiers to streams.
9102 * src/font.C: include the <cctype> header, for islower() and
9105 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9107 * src/font.[Ch]: new files. Contains the metric functions for
9108 fonts, takes a LyXFont as parameter. Better separation of concepts.
9110 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
9111 changes because of this.
9113 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
9115 * src/*: compile with -Winline and move functions that don't
9118 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
9121 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9123 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
9124 (various files changed because of this)
9126 * src/Painter.C (text): fixed the drawing of smallcaps.
9128 * src/lyxfont.[Ch] (drawText): removed unused member func.
9131 * src/*.C: added needed "using" statements and "std::" qualifiers.
9133 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
9135 * src/*.h: removed all use of "using" from header files use
9136 qualifier std:: instead.
9138 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9140 * src/text.C (Backspace): some additional cleanups (we already
9141 know whether cursor.pos is 0 or not).
9143 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
9144 automake does not provide one).
9146 * src/bmtable.h: replace C++ comments with C comments.
9148 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
9150 * src/screen.C (ShowCursor): Change the shape of the cursor if
9151 the current language is not equal to the language of the document.
9152 (If the cursor change its shape unexpectedly, then you've found a bug)
9154 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
9157 * src/insets/insetnumber.[Ch]: New files.
9159 * src/LyXAction.C (init)
9160 * src/lyxfunc.C (dispatch): Add command number-inset-insert
9163 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
9165 * src/lyxparagraph.h
9166 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
9167 (the vector is kept sorted).
9169 * src/text.C (GetVisibleRow): Draw selection correctly when there
9170 is both LTR and RTL text.
9172 * src/paragraph.C (Clone): Use the assignment operator for cloning,
9173 which is much faster.
9175 * src/text.C (GetVisibleRow and other): Do not draw the last space
9176 in a row if the direction of the last letter is not equal to the
9177 direction of the paragraph.
9179 * src/lyxfont.C (latexWriteStartChanges):
9180 Check that font language is not equal to basefont language.
9181 (latexWriteEndChanges): ditto
9183 * src/lyx_cb.C (StyleReset): Don't change the language while using
9184 the font-default command.
9186 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9187 empty paragraph before a footnote.
9189 * src/insets/insetcommand.C (draw): Increase x correctly.
9191 * src/screen.C (ShowCursor): Change cursor shape if
9192 current language != document language.
9194 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9196 2000-03-31 Juergen Vigna <jug@sad.it>
9198 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9199 (Clone): changed mode how the paragraph-data is copied to the
9200 new clone-paragraph.
9202 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9203 GetInset(pos) with no inset anymore there (in inset UNDO)
9205 * src/insets/insetcommand.C (draw): small fix as here x is
9206 incremented not as much as width() returns (2 before, 2 behind = 4)
9208 2000-03-30 Juergen Vigna <jug@sad.it>
9210 * src/insets/insettext.C (InsetText): small fix in initialize
9211 widthOffset (should not be done in the init() function)
9213 2000-03-29 Amir Karger <karger@lyx.org>
9215 * lib/examples/it_ItemizeBullets.lyx: translation by
9218 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9220 2000-03-29 Juergen Vigna <jug@sad.it>
9222 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9224 * src/insets/insetfoot.C (Clone): small change as for the below
9225 new init function in the text-inset
9227 * src/insets/insettext.C (init): new function as I've seen that
9228 clone did not copy the Paragraph-Data!
9229 (LocalDispatch): Added code so that now we have some sort of Undo
9230 functionality (well actually we HAVE Undo ;)
9232 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9234 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9236 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9239 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9241 * src/main.C: added a runtime check that verifies that the xforms
9242 header used when building LyX and the library used when running
9243 LyX match. Exit with a message if they don't match. This is a
9244 version number check only.
9246 * src/buffer.C (save): Don't allocate memory on the heap for
9247 struct utimbuf times.
9249 * *: some using changes, use iosfwd instead of the real headers.
9251 * src/lyxfont.C use char const * instead of string for the static
9252 strings. Rewrite some functions to use sstream.
9254 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9256 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9259 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9261 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9262 of Geodesy (from Martin Vermeer)
9264 * lib/layouts/svjour.inc: include file for the Springer svjour
9265 class. It can be used to support journals other than JoG.
9267 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9268 Miskiewicz <misiek@pld.org.pl>)
9269 * lib/reLyX/Makefile.am: ditto.
9271 2000-03-27 Juergen Vigna <jug@sad.it>
9273 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9274 also some modifications with operations on selected text.
9276 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9277 problems with clicking on insets (last famous words ;)
9279 * src/insets/insetcommand.C (draw):
9280 (width): Changed to have a bit of space before and after the inset so
9281 that the blinking cursor can be seen (otherwise it was hidden)
9283 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9285 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9286 would not be added to the link list when an installed gettext (not
9287 part of libc) is found.
9289 2000-03-24 Juergen Vigna <jug@sad.it>
9291 * src/insets/insetcollapsable.C (Edit):
9292 * src/mathed/formula.C (InsetButtonRelease):
9293 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9296 * src/BufferView.C (workAreaButtonPress):
9297 (workAreaButtonRelease):
9298 (checkInsetHit): Finally fixed the clicking on insets be handled
9301 * src/insets/insetert.C (Edit): inserted this call so that ERT
9302 insets work always with LaTeX-font
9304 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9306 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9307 caused lyx to startup with no GUI in place, causing in a crash
9308 upon startup when called with arguments.
9310 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9312 * src/FontLoader.C: better initialization of dummyXFontStruct.
9314 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9316 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9317 for linuxdoc and docbook import and export format options.
9319 * lib/lyxrc.example Example of default values for the previous flags.
9321 * src/lyx_cb.C Use those flags instead of the hardwired values for
9322 linuxdoc and docbook export.
9324 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9327 * src/menus.C Added menus entries for the new import/exports formats.
9329 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9331 * src/lyxrc.*: Added support for running without Gui
9334 * src/FontLoader.C: sensible defaults if no fonts are needed
9336 * src/lyx_cb.C: New function ShowMessage (writes either to the
9337 minibuffer or cout in case of no gui
9338 New function AskOverwrite for common stuff
9339 Consequently various changes to call these functions
9341 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9342 wild guess at sensible screen resolution when having no gui
9344 * src/lyxfont.C: no gui, no fonts... set some defaults
9346 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9348 * src/LColor.C: made the command inset background a bit lighter.
9350 2000-03-20 Hartmut Goebel <goebel@noris.net>
9352 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9353 stdstruct.inc. Koma-Script added some title elements which
9354 otherwise have been listed below "bibliography". This split allows
9355 adding title elements to where they belong.
9357 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9358 define the additional title elements and then include
9361 * many other layout files: changed to include stdtitle.inc just
9362 before stdstruct.inc.
9364 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9366 * src/buffer.C: (save) Added the option to store all backup files
9367 in a single directory
9369 * src/lyxrc.[Ch]: Added variable \backupdir_path
9371 * lib/lyxrc.example: Added descriptions of recently added variables
9373 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9374 bibtex inset, not closing the bibtex popup when deleting the inset)
9376 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9378 * src/lyx_cb.C: add a couple using directives.
9380 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9381 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9382 import based on the filename.
9384 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9385 file would be imported at start, if the filename where of a sgml file.
9387 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9389 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9391 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9392 * src/lyxfont.h Replaced the member variable bits.direction by the
9393 member variable lang. Made many changes in other files.
9394 This allows having a multi-lingual document
9396 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9397 that change the current language to <l>.
9398 Removed the command "font-rtl"
9400 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9401 format for Hebrew documents)
9403 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9404 When auto_mathmode is "true", pressing a digit key in normal mode
9405 will cause entering into mathmode.
9406 If auto_mathmode is "rtl" then this behavior will be active only
9407 when writing right-to-left text.
9409 * src/text2.C (InsertStringA) The string is inserted using the
9412 * src/paragraph.C (GetEndLabel) Gives a correct result for
9413 footnote paragraphs.
9415 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9417 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9419 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9420 front of PasteParagraph. Never insert a ' '. This should at least
9421 fix some cause for the segfaults that we have been experiencing,
9422 it also fixes backspace behaviour slightly. (Phu!)
9424 * src/support/lstrings.C (compare_no_case): some change to make it
9425 compile with gcc 2.95.2 and stdlibc++-v3
9427 * src/text2.C (MeltFootnoteEnvironment): change type o
9428 first_footnote_par_is_not_empty to bool.
9430 * src/lyxparagraph.h: make text private. Changes in other files
9432 (fitToSize): new function
9433 (setContentsFromPar): new function
9434 (clearContents): new function
9435 (SetChar): new function
9437 * src/paragraph.C (readSimpleWholeFile): deleted.
9439 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9440 the file, just use a simple string instead. Also read the file in
9441 a more maintainable manner.
9443 * src/text2.C (InsertStringA): deleted.
9444 (InsertStringB): deleted.
9446 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9448 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9449 RedoParagraphs from the doublespace handling part, just set status
9450 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9451 done, but perhaps not like this.)
9453 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9455 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9456 character when inserting an inset.
9458 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9460 * src/bufferparams.C (readLanguage): now takes "default" into
9463 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9464 also initialize the toplevel_keymap with the default bindings from
9467 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9469 * all files using lyxrc: have lyxrc as a real variable and not a
9470 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9473 * src/lyxrc.C: remove double call to defaultKeyBindings
9475 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9476 toolbar defauls using lyxlex. Remove enums, structs, functions
9479 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9480 toolbar defaults. Also store default keybindings in a map.
9482 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9483 storing the toolbar defaults without any xforms dependencies.
9485 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9486 applied. Changed to use iterators.
9488 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9490 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9491 systems that don't have LINGUAS set to begin with.
9493 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9495 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9496 the list by Dekel Tsur.
9498 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9500 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9501 * src/insets/form_graphics.C: ditto.
9503 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9505 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9507 * src/bufferparams.C (readLanguage): use the new language map
9509 * src/intl.C (InitKeyMapper): use the new language map
9511 * src/lyx_gui.C (create_forms): use the new language map
9513 * src/language.[Ch]: New files. Used for holding the information
9514 about each language. Now! Use this new language map enhance it and
9515 make it really usable for our needs.
9517 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9519 * screen.C (ShowCursor): Removed duplicate code.
9520 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9521 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9523 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9526 * src/text.C Added TransformChar method. Used for rendering Arabic
9527 text correctly (change the glyphs of the letter according to the
9528 position in the word)
9533 * src/lyxrc.C Added lyxrc command {language_command_begin,
9534 language_command_end,language_command_ltr,language_command_rtl,
9535 language_package} which allows the use of either arabtex or Omega
9538 * src/lyx_gui.C (init)
9540 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9541 to use encoding for menu fonts which is different than the encoding
9544 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9545 do not load the babel package.
9546 To write an English document with Hebrew/Arabic, change the document
9547 language to "english".
9549 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9550 (alphaCounter): changed to return char
9551 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9553 * lib/lyxrc.example Added examples for Hebrew/Arabic
9556 * src/layout.C Added layout command endlabeltype
9558 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9560 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9562 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9564 * src/mathed/math_delim.C (search_deco): return a
9565 math_deco_struct* instead of index.
9567 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9569 * All files with a USE_OSTREAM_ONLY within: removed all code that
9570 was unused when USE_OSTREAM_ONLY is defined.
9572 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9573 of any less. Removed header and using.
9575 * src/text.C (GetVisibleRow): draw the string "Page Break
9576 (top/bottom)" on screen when drawing a pagebreak line.
9578 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9580 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9582 * src/mathed/math_macro.C (draw): do some cast magic.
9585 * src/mathed/math_defs.h: change byte* argument to byte const*.
9587 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9589 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9590 know it is right to return InsetFoot* too, but cxx does not like
9593 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9595 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9597 * src/mathed/math_delim.C: change == to proper assignment.
9599 2000-03-09 Juergen Vigna <jug@sad.it>
9601 * src/insets/insettext.C (setPos): fixed various cursor positioning
9602 problems (via mouse and cursor-keys)
9603 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9604 inset (still a small display problem but it works ;)
9606 * src/insets/insetcollapsable.C (draw): added button_top_y and
9607 button_bottom_y to have correct values for clicking on the inset.
9609 * src/support/lyxalgo.h: commented out 'using std::less'
9611 2000-03-08 Juergen Vigna <jug@sad.it>
9613 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9614 Button-Release event closes as it is alos the Release-Event
9617 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9619 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9621 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9622 can add multiple spaces in Scrap (literate programming) styles...
9623 which, by the way, is how I got hooked on LyX to begin with.
9625 * src/mathed/formula.C (Write): Added dummy variable to an
9626 inset::Latex() call.
9627 (Latex): Add free_spacing boolean to inset::Latex()
9629 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9631 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9632 virtual function to include the free_spacing boolean from
9633 the containing paragraph's style.
9635 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9636 Added free_spacing boolean arg to match inset.h
9638 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9639 Added free_spacing boolean arg to match inset.h
9641 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9642 Added free_spacing boolean and made sure that if in a free_spacing
9643 paragraph, that we output normal space if there is a protected space.
9645 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9646 Added free_spacing boolean arg to match inset.h
9648 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9649 Added free_spacing boolean arg to match inset.h
9651 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9652 Added free_spacing boolean arg to match inset.h
9654 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9655 Added free_spacing boolean arg to match inset.h
9657 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9658 Added free_spacing boolean arg to match inset.h
9660 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9661 free_spacing boolean arg to match inset.h
9663 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9664 Added free_spacing boolean arg to match inset.h
9666 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9667 Added free_spacing boolean arg to match inset.h
9669 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9670 Added free_spacing boolean arg to match inset.h
9672 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9673 Added free_spacing boolean arg to match inset.h
9675 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9676 Added free_spacing boolean arg to match inset.h
9678 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9679 free_spacing boolean arg to match inset.h
9681 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9682 free_spacing boolean arg to match inset.h
9684 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9685 ignore free_spacing paragraphs. The user's spaces are left
9688 * src/text.C (InsertChar): Fixed the free_spacing layout
9689 attribute behavior. Now, if free_spacing is set, you can
9690 add multiple spaces in a paragraph with impunity (and they
9691 get output verbatim).
9692 (SelectSelectedWord): Added dummy argument to inset::Latex()
9695 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9698 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9699 paragraph layouts now only input a simple space instead.
9700 Special character insets don't make any sense in free-spacing
9703 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9704 hard-spaces in the *input* file to simple spaces if the layout
9705 is free-spacing. This converts old files which had to have
9706 hard-spaces in free-spacing layouts where a simple space was
9708 (writeFileAscii): Added free_spacing check to pass to the newly
9709 reworked inset::Latex(...) methods. The inset::Latex() code
9710 ensures that hard-spaces in free-spacing paragraphs get output
9711 as spaces (rather than "~").
9713 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9715 * src/mathed/math_delim.C (draw): draw the empty placeholder
9716 delims with a onoffdash line.
9717 (struct math_deco_compare): struct that holds the "functors" used
9718 for the sort and the binary search in math_deco_table.
9719 (class init_deco_table): class used for initial sort of the
9721 (search_deco): use lower_bound to do a binary search in the
9724 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9726 * src/lyxrc.C: a small secret thingie...
9728 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9729 and to not flush the stream as often as it used to.
9731 * src/support/lyxalgo.h: new file
9732 (sorted): template function used for checking if a sequence is
9733 sorted or not. Two versions with and without user supplied
9734 compare. Uses same compare as std::sort.
9736 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9737 it and give warning on lyxerr.
9739 (struct compare_tags): struct with function operators used for
9740 checking if sorted, sorting and lower_bound.
9741 (search_kw): use lower_bound instead of manually implemented
9744 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9746 * src/insets/insetcollapsable.h: fix Clone() declaration.
9747 * src/insets/insetfoot.h: ditto.
9749 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9751 2000-03-08 Juergen Vigna <jug@sad.it>
9753 * src/insets/lyxinset.h: added owner call which tells us if
9754 this inset is inside another inset. Changed also the return-type
9755 of Editable to an enum so it tells clearer what the return-value is.
9757 * src/insets/insettext.C (computeTextRows): fixed computing of
9758 textinsets which split automatically on more rows.
9760 * src/insets/insetert.[Ch]: changed this to be of BaseType
9763 * src/insets/insetfoot.[Ch]: added footnote inset
9765 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9766 collapsable insets (like footnote, ert, ...)
9768 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9770 * src/lyxdraw.h: remvoe file
9772 * src/lyxdraw.C: remove file
9774 * src/insets/insettext.C: added <algorithm>.
9776 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9778 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9779 (matrix_cb): case MM_OK use string stream
9781 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9784 * src/mathed/math_macro.C (draw): use string stream
9785 (Metrics): use string stream
9787 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9788 directly to the ostream.
9790 * src/vspace.C (asString): use string stream.
9791 (asString): use string stream
9792 (asLatexString): use string stream
9794 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9795 setting Spacing::Other.
9797 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9798 sprintf when creating the stretch vale.
9800 * src/text2.C (alphaCounter): changed to return a string and to
9801 not use a static variable internally. Also fixed a one-off bug.
9802 (SetCounter): changed the drawing of the labels to use string
9803 streams instead of sprintf.
9805 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9806 manipulator to use a scheme that does not require library support.
9807 This is also the way it is done in the new GNU libstdc++. Should
9808 work with DEC cxx now.
9810 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9812 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9813 end. This fixes a bug.
9815 * src/mathed (all files concerned with file writing): apply the
9816 USE_OSTREAM_ONLY changes to mathed too.
9818 * src/support/DebugStream.h: make the constructor explicit.
9820 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9821 count and ostream squashed.
9823 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9825 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9827 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9828 ostringstream uses STL strings, and we might not.
9830 * src/insets/insetspecialchar.C: add using directive.
9831 * src/insets/insettext.C: ditto.
9833 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9835 * lib/layouts/seminar.layout: feeble attempt at a layout for
9836 seminar.cls, far from completet and could really use some looking
9837 at from people used to write layout files.
9839 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9840 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9841 a lot nicer and works nicely with ostreams.
9843 * src/mathed/formula.C (draw): a slightly different solution that
9844 the one posted to the list, but I think this one works too. (font
9845 size wrong in headers.)
9847 * src/insets/insettext.C (computeTextRows): some fiddling on
9848 Jürgens turf, added some comments that he should read.
9850 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9851 used and it gave compiler warnings.
9852 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9855 * src/lyx_gui.C (create_forms): do the right thing when
9856 show_banner is true/false.
9858 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9859 show_banner is false.
9861 * most file writing files: Now use iostreams to do almost all of
9862 the writing. Also instead of passing string &, we now use
9863 stringstreams. mathed output is still not adapted to iostreams.
9864 This change can be turned off by commenting out all the occurences
9865 of the "#define USE_OSTREAM_ONLY 1" lines.
9867 * src/WorkArea.C (createPixmap): don't output debug messages.
9868 (WorkArea): don't output debug messages.
9870 * lib/lyxrc.example: added a comment about the new variable
9873 * development/Code_rules/Rules: Added some more commente about how
9874 to build class interfaces and on how better encapsulation can be
9877 2000-03-03 Juergen Vigna <jug@sad.it>
9879 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9880 automatically with the width of the LyX-Window
9882 * src/insets/insettext.C (computeTextRows): fixed update bug in
9883 displaying text-insets (scrollvalues where not initialized!)
9885 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9887 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9888 id in the check of the result from lower_bound is not enough since
9889 lower_bound can return last too, and then res->id will not be a
9892 * all insets and some code that use them: I have conditionalized
9893 removed the Latex(string & out, ...) this means that only the
9894 Latex(ostream &, ...) will be used. This is a work in progress to
9895 move towards using streams for all output of files.
9897 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9900 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9902 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9903 routine (this fixes bug where greek letters were surrounded by too
9906 * src/support/filetools.C (findtexfile): change a bit the search
9907 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9908 no longer passed to kpsewhich, we may have to change that later.
9910 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9911 warning options to avoid problems with X header files (from Angus
9913 * acinclude.m4: regenerated.
9915 2000-03-02 Juergen Vigna <jug@sad.it>
9917 * src/insets/insettext.C (WriteParagraphData): Using the
9918 par->writeFile() function for writing paragraph-data.
9919 (Read): Using buffer->parseSingleLyXformat2Token()-function
9920 for parsing paragraph data!
9922 * src/buffer.C (readLyXformat2): removed all parse data and using
9923 the new parseSingleLyXformat2Token()-function.
9924 (parseSingleLyXformat2Token): added this function to parse (read)
9925 lyx-file-format (this is called also from text-insets now!)
9927 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9929 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9932 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9933 directly instead of going through a func. One very bad thing: a
9934 static LyXFindReplace, but I don't know where to place it.
9936 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9937 string instead of char[]. Also changed to static.
9938 (GetSelectionOrWordAtCursor): changed to static inline
9939 (SetSelectionOverLenChars): ditto.
9941 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9942 current_view and global variables. both classes has changed names
9943 and LyXFindReplace is not inherited from SearchForm.
9945 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9946 fl_form_search form.
9948 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9950 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9952 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9953 bound (from Kayvan).
9955 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9957 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9959 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9961 * some things that I should comment but the local pub says head to
9964 * comment out all code that belongs to the Roff code for Ascii
9965 export of tables. (this is unused)
9967 * src/LyXView.C: use correct type for global variable
9968 current_layout. (LyXTextClass::size_type)
9970 * some code to get the new insetgraphics closer to working I'd be
9971 grateful for any help.
9973 * src/BufferView2.C (insertInset): use the return type of
9974 NumberOfLayout properly. (also changes in other files)
9976 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9977 this as a test. I want to know what breaks because of this.
9979 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9981 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9983 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9984 to use a \makebox in the label, this allows proper justification
9985 with out using protected spaces or multiple hfills. Now it is
9986 "label" for left justified, "\hfill label\hfill" for center, and
9987 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9988 should be changed accordingly.
9990 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9992 * src/lyxtext.h: change SetLayout() to take a
9993 LyXTextClass::size_type instead of a char (when there is more than
9994 127 layouts in a class); also change type of copylayouttype.
9995 * src/text2.C (SetLayout): ditto.
9996 * src/LyXView.C (updateLayoutChoice): ditto.
9998 * src/LaTeX.C (scanLogFile): errors where the line number was not
9999 given just after the '!'-line were ignored (from Dekel Tsur).
10001 * lib/lyxrc.example: fix description of \date_insert_format
10003 * lib/layouts/llncs.layout: new layout, contributed by Martin
10006 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10008 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
10009 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
10010 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
10011 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
10012 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
10013 paragraph.C, text.C, text2.C)
10015 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10017 * src/insets/insettext.C (LocalDispatch): remove extra break
10020 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
10021 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
10023 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
10024 * src/insets/insettext.[Ch] (GetCursorPos): ditto
10026 * src/insets/insetbib.h: move InsetBibkey::Holder and
10027 InsetCitation::Holder in public space.
10029 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10031 * src/insets/insettext.h: small change to get the new files from
10032 Juergen to compile (use "string", not "class string").
10034 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
10035 const & as parameter to LocalDispatch, use LyXFont const & as
10036 paramter to some other func. This also had impacto on lyxinsets.h
10037 and the two mathed insets.
10039 2000-02-24 Juergen Vigna <jug@sad.it>
10042 * src/commandtags.h:
10044 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
10048 * src/BufferView2.C: added/updated code for various inset-functions
10050 * src/insets/insetert.[Ch]: added implementation of InsetERT
10052 * src/insets/insettext.[Ch]: added implementation of InsetText
10054 * src/insets/inset.C (Edit): added "unsigned int button" parameter
10055 (draw): added preliminary code for inset scrolling not finshed yet
10057 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
10058 as it is in lyxfunc.C now
10060 * src/insets/lyxinset.h: Added functions for text-insets
10062 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10064 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
10065 BufferView and reimplement the list as a queue put inside its own
10068 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
10070 * several files: use the new interface to the "updateinsetlist"
10072 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
10074 (work_area_handler): call BufferView::trippleClick on trippleclick.
10076 * src/BufferView.C (doubleClick): new function, selects word on
10078 (trippleClick): new function, selects line on trippleclick.
10080 2000-02-22 Allan Rae <rae@lyx.org>
10082 * lib/bind/xemacs.bind: buffer-previous not supported
10084 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10086 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
10089 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10091 * src/bufferlist.C: get rid of current_view from this file
10093 * src/spellchecker.C: get rid of current_view from this file
10095 * src/vspace.C: get rid of current_view from this file
10096 (inPixels): added BufferView parameter for this func
10097 (asLatexCommand): added a BufferParams for this func
10099 * src/text.C src/text2.C: get rid of current_view from these
10102 * src/lyxfont.C (getFontDirection): move this function here from
10105 * src/bufferparams.C (getDocumentDirection): move this function
10108 * src/paragraph.C (getParDirection): move this function here from
10110 (getLetterDirection): ditto
10112 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
10114 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
10115 resize due to wrong pixmap beeing used. Also took the opurtunity
10116 to make the LyXScreen stateless on regard to WorkArea and some
10117 general cleanup in the same files.
10119 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10121 * src/Makefile.am: add missing direction.h
10123 * src/PainterBase.h: made the width functions const.
10125 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
10128 * src/insets/insetcommand.C (draw): draw Editable as buttons.
10130 * src/insets/insetlatexaccent.C (draw): make the accents draw
10131 better, at present this will only work well with iso8859-1.
10133 * several files: remove the old drawing code, now we use the new
10136 * several files: remove support for mono_video, reverse_video and
10139 2000-02-17 Juergen Vigna <jug@sad.it>
10141 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
10142 int ** as we have to return the pointer, otherwise we have only
10143 NULL pointers in the returning function.
10145 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10147 * src/LaTeX.C (operator()): quote file name when running latex.
10149 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10151 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
10152 (bubble tip), this removes our special handling of this.
10154 * Remove all code that is unused now that we have the new
10155 workarea. (Code that are not active when NEW_WA is defined.)
10157 * Make the uses of XSync not conditionalized on define USE_XSYNC.
10159 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10161 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
10162 nonexisting layout; correctly redirect obsoleted layouts.
10164 * lib/lyxrc.example: document \view_dvi_paper_option
10166 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
10169 * src/lyx_cb.C (RunScript): handle $$FName for command names.
10170 (PreviewDVI): handle the view_dvi_paper_option variable.
10171 [Both from Roland Krause]
10173 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10175 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
10176 char const *, int, LyXFont)
10177 (text(int, int, string, LyXFont)): ditto
10179 * src/text.C (InsertCharInTable): attempt to fix the double-space
10180 feature in tables too.
10181 (BackspaceInTable): ditto.
10182 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10184 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10186 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10188 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10189 newly found text in textcache to this.
10190 (buffer): set the owner of the text put into the textcache to 0
10192 * src/insets/figinset.C (draw): fixed the drawing of figures with
10195 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10196 drawing of mathframe, hfills, protected space, table lines. I have
10197 now no outstanding drawing problems with the new Painter code.
10199 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10201 * src/PainterBase.C (ellipse, circle): do not specify the default
10204 * src/LColor.h: add using directive.
10206 * src/Painter.[Ch]: change return type of methods from Painter& to
10207 PainterBase&. Add a using directive.
10209 * src/WorkArea.C: wrap xforms callbacks in C functions
10212 * lib/layouts/foils.layout: font fix and simplifications from Carl
10215 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10217 * a lot of files: The Painter, LColor and WorkArea from the old
10218 devel branch has been ported to lyx-devel. Some new files and a
10219 lot of #ifdeffed code. The new workarea is enabled by default, but
10220 if you want to test the new Painter and LColor you have to compile
10221 with USE_PAINTER defined (do this in config.h f.ex.) There are
10222 still some rought edges, and I'd like some help to clear those
10223 out. It looks stable (loads and displays the Userguide very well).
10226 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10228 * src/buffer.C (pop_tag): revert to the previous implementation
10229 (use a global variable for both loops).
10231 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10233 * src/lyxrc.C (LyXRC): change slightly default date format.
10235 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10236 there is an English text with a footnote that starts with a Hebrew
10237 paragraph, or vice versa.
10238 (TeXFootnote): ditto.
10240 * src/text.C (LeftMargin): allow for negative values for
10241 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10244 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10245 for input encoding (cyrillic)
10247 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10249 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10252 * src/toolbar.C (set): ditto
10253 * src/insets/insetbib.C (create_form_citation_form): ditto
10255 * lib/CREDITS: added Dekel Tsur.
10257 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10258 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10259 hebrew supports files from Dekel Tsur.
10261 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10262 <tzafrir@technion.ac.il>
10264 * src/lyxrc.C: put \date_insert_format at the right place.
10266 * src/buffer.C (makeLaTeXFile): fix the handling of
10267 BufferParams::sides when writing out latex files.
10269 * src/BufferView2.C: add a "using" directive.
10271 * src/support/lyxsum.C (sum): when we use lyxstring,
10272 ostringstream::str needs an additional .c_str().
10274 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10276 * src/support/filetools.C (ChangeExtension): patch from Etienne
10279 * src/TextCache.C (show): remove const_cast and make second
10280 parameter non-const LyXText *.
10282 * src/TextCache.h: use non const LyXText in show.
10284 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10287 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10289 * src/support/lyxsum.C: rework to be more flexible.
10291 * several places: don't check if a pointer is 0 if you are going
10294 * src/text.C: remove some dead code.
10296 * src/insets/figinset.C: remove some dead code
10298 * src/buffer.C: move the BufferView funcs to BufferView2.C
10299 remove all support for insetlatexdel
10300 remove support for oldpapersize stuff
10301 made some member funcs const
10303 * src/kbmap.C: use a std::list to store the bindings in.
10305 * src/BufferView2.C: new file
10307 * src/kbsequence.[Ch]: new files
10309 * src/LyXAction.C + others: remove all trace of buffer-previous
10311 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10312 only have one copy in the binary of this table.
10314 * hebrew patch: moved some functions from LyXText to more
10315 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10317 * several files: remove support for XForms older than 0.88
10318 whitespace changes.
10319 remove some #if 0 #endif code
10321 * src/TextCache.[Ch]: new file. Holds the textcache.
10323 * src/BufferView.C: changes to use the new TextCache interface.
10324 (waitForX): remove the now unused code.
10326 * src/BackStack.h: remove some commented code
10328 * lib/bind/emacs.bind: remove binding for buffer-previous
10330 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10332 * applied the hebrew patch.
10334 * src/lyxrow.h: make sure that all Row variables are initialized.
10336 * src/text2.C (TextHandleUndo): comment out a delete, this might
10337 introduce a memory leak, but should also help us to not try to
10338 read freed memory. We need to look at this one.
10340 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10341 (LyXParagraph): initalize footnotekind.
10343 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10344 forgot this when applying the patch. Please heed the warnings.
10346 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10347 (aka. reformat problem)
10349 * src/bufferlist.C (exists): made const, and use const_iterator
10350 (isLoaded): new func.
10351 (release): use std::find to find the correct buffer.
10353 * src/bufferlist.h: made getState a const func.
10354 made empty a const func.
10355 made exists a const func.
10358 2000-02-01 Juergen Vigna <jug@sad.it>
10360 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10362 * po/it.po: updated a bit the italian po file and also changed the
10363 'file nuovo' for newfile to 'filenuovo' without a space, this did
10366 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10367 for the new insert_date command.
10369 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10370 from jdblair, to insert a date into the current text conforming to
10371 a strftime format (for now only considering the locale-set and not
10372 the document-language).
10374 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10376 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10377 Bounds Read error seen by purify. The problem was that islower is
10378 a macros which takes an unsigned char and uses it as an index for
10379 in array of characters properties (and is thus subject to the
10383 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10384 correctly the paper sides radio buttons.
10385 (UpdateDocumentButtons): ditto.
10387 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10389 * src/kbmap.C (getsym + others): change to return unsigned int,
10390 returning a long can give problems on 64 bit systems. (I assume
10391 that int is 32bit on 64bit systems)
10393 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10395 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10396 LyXLookupString to be zero-terminated. Really fixes problems seen
10397 by purify, I think.
10399 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10401 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10402 write a (char*)0 to the lyxerr stream.
10404 * src/lastfiles.C: move algorithm before the using statemets.
10406 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10408 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10409 complains otherwise).
10410 * src/table.C: ditto
10412 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10415 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10416 that I removed earlier... It is really needed.
10418 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10420 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10422 * INSTALL: update xforms home page URL.
10424 * lib/configure.m4: fix a bug with unreadable layout files.
10426 * src/table.C (calculate_width_of_column): add "using std::max"
10429 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10431 * several files: marked several lines with "DEL LINE", this is
10432 lines that can be deleted without changing anything.
10433 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10434 checks this anyway */
10437 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10439 * src/DepTable.C (update): add a "+" at the end when the checksum
10440 is different. (debugging string only)
10442 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10443 the next inset to not be displayed. This should also fix the list
10444 of labels in the "Insert Crossreference" dialog.
10446 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10448 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10449 when regex was not found.
10451 * src/support/lstrings.C (lowercase): use handcoded transform always.
10454 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10455 old_cursor.par->prev could be 0.
10457 * several files: changed post inc/dec to pre inc/dec
10459 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10460 write the lastfiles to file.
10462 * src/BufferView.C (buffer): only show TextCache info when debugging
10464 (resizeCurrentBuffer): ditto
10465 (workAreaExpose): ditto
10467 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10469 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10471 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10472 a bit better by removing the special case for \i and \j.
10474 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10476 * src/lyx_main.C (easyParse): remove test for bad comand line
10477 options, since this broke all xforms-related parsing.
10479 * src/kbmap.C (getsym): set return type to unsigned long, as
10480 declared in header. On an alpha, long is _not_ the same as int.
10482 * src/support/LOstream.h: add a "using std::flush;"
10484 * src/insets/figinset.C: ditto.
10486 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10488 * src/bufferlist.C (write): use blinding fast file copy instead of
10489 "a char at a time", now we are doing it the C++ way.
10491 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10492 std::list<int> instead.
10493 (addpidwait): reflect move to std::list<int>
10494 (sigchldchecker): ditto
10496 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10499 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10500 that obviously was wrong...
10502 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10503 c, this avoids warnings with purify and islower.
10505 * src/insets/figinset.C: rename struct queue to struct
10506 queue_element and rewrite to use a std::queue. gsqueue is now a
10507 std::queue<queue_element>
10508 (runqueue): reflect move to std::queue
10511 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10512 we would get "1" "0" instead of "true" "false. Also make the tostr
10515 2000-01-21 Juergen Vigna <jug@sad.it>
10517 * src/buffer.C (writeFileAscii): Disabled code for special groff
10518 handling of tabulars till I fix this in table.C
10520 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10522 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10524 * src/support/lyxlib.h: ditto.
10526 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10528 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10529 and 'j' look better. This might fix the "macron" bug that has been
10532 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10533 functions as one template function. Delete the old versions.
10535 * src/support/lyxsum.C: move using std::ifstream inside
10538 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10541 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10543 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10545 * src/insets/figinset.C (InitFigures): use new instead of malloc
10546 to allocate memory for figures and bitmaps.
10547 (DoneFigures): use delete[] instead of free to deallocate memory
10548 for figures and bitmaps.
10549 (runqueue): use new to allocate
10550 (getfigdata): use new/delete[] instead of malloc/free
10551 (RegisterFigure): ditto
10553 * some files: moved some declarations closer to first use, small
10554 whitespace changes use preincrement instead of postincrement where
10555 it does not make a difference.
10557 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10558 step on the way to use stl::containers for key maps.
10560 * src/bufferlist.h: add a typedef for const_iterator and const
10561 versions of begin and end.
10563 * src/bufferlist.[Ch]: change name of member variable _state to
10564 state_. (avoid reserved names)
10566 (getFileNames): returns the filenames of the buffers in a vector.
10568 * configure.in (ALL_LINGUAS): added ro
10570 * src/support/putenv.C: new file
10572 * src/support/mkdir.C: new file
10574 2000-01-20 Allan Rae <rae@lyx.org>
10576 * lib/layouts/IEEEtran.layout: Added several theorem environments
10578 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10579 couple of minor additions.
10581 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10582 (except for those in footnotes of course)
10584 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10586 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10588 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10589 std::sort and std::lower_bound instead of qsort and handwritten
10591 (struct compara): struct that holds the functors used by std::sort
10592 and std::lower_bound in MathedLookupBOP.
10594 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10596 * src/support/LAssert.h: do not do partial specialization. We do
10597 not really need it.
10599 * src/support/lyxlib.h: note that lyx::getUserName() and
10600 lyx::date() are not in use right now. Should these be suppressed?
10602 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10603 (makeLinuxDocFile): do not put date and user name in linuxdoc
10606 * src/support/lyxlib.h (kill): change first argument to long int,
10607 since that's what solaris uses.
10609 * src/support/kill.C (kill): fix declaration to match prototype.
10611 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10612 actually check whether namespaces are supported. This is not what
10615 * src/support/lyxsum.C: add a using directive.
10617 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10619 * src/support/kill.C: if we have namespace support we don't have
10620 to include lyxlib.h.
10622 * src/support/lyxlib.h: use namespace lyx if supported.
10624 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10626 * src/support/date.C: new file
10628 * src/support/chdir.C: new file
10630 * src/support/getUserName.C: new file
10632 * src/support/getcwd.C: new file
10634 * src/support/abort.C: new file
10636 * src/support/kill.C: new file
10638 * src/support/lyxlib.h: moved all the functions in this file
10639 insede struct lyx. Added also kill and abort to this struct. This
10640 is a way to avoid the "kill is not defined in <csignal>", we make
10641 C++ wrappers for functions that are not ANSI C or ANSI C++.
10643 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10644 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10645 lyx it has been renamed to sum.
10647 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10649 * src/text.C: add using directives for std::min and std::max.
10651 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10653 * src/texrow.C (getIdFromRow): actually return something useful in
10654 id and pos. Hopefully fixes the bug with positionning of errorbox
10657 * src/lyx_main.C (easyParse): output an error and exit if an
10658 incorrect command line option has been given.
10660 * src/spellchecker.C (ispell_check_word): document a memory leak.
10662 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10663 where a "struct utimbuf" is allocated with "new" and deleted with
10666 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10668 * src/text2.C (CutSelection): don't delete double spaces.
10669 (PasteSelection): ditto
10670 (CopySelection): ditto
10672 * src/text.C (Backspace): don't delete double spaces.
10674 * src/lyxlex.C (next): fix a bug that were only present with
10675 conformant std::istream::get to read comment lines, use
10676 std::istream::getline instead. This seems to fix the problem.
10678 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10680 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10681 allowed to insert space before space" editing problem. Please read
10682 commends at the beginning of the function. Comments about usage
10685 * src/text.C (InsertChar): fix for the "not allowed to insert
10686 space before space" editing problem.
10688 * src/text2.C (DeleteEmptyParagraphMechanism): when
10689 IsEmptyTableRow can only return false this last "else if" will
10690 always be a no-op. Commented out.
10692 * src/text.C (RedoParagraph): As far as I can understand tmp
10693 cursor is not really needed.
10695 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10696 present it could only return false anyway.
10697 (several functions): Did something not so smart...added a const
10698 specifier on a lot of methods.
10700 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10701 and add a tmp->text.resize. The LyXParagraph constructor does the
10703 (BreakParagraphConservative): ditto
10705 * src/support/path.h (Path): add a define so that the wrong usage
10706 "Path("/tmp") will be flagged as a compilation error:
10707 "`unnamed_Path' undeclared (first use this function)"
10709 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10711 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10712 which was bogus for several reasons.
10714 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10716 (runBibTeX): ditto.
10718 * autogen.sh: do not use "type -path" (what's that anyway?).
10720 * src/support/filetools.C (findtexfile): remove extraneous space
10721 which caused a kpsewhich warning (at least with kpathsea version
10724 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10726 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10728 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10730 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10732 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10734 * src/paragraph.C (BreakParagraph): do not reserve space on text
10735 if we don't need to (otherwise, if pos_end < pos, we end up
10736 reserving huge amounts of memory due to bad unsigned karma).
10737 (BreakParagraphConservative): ditto, although I have not seen
10738 evidence the bug can happen here.
10740 * src/lyxparagraph.h: add a using std::list.
10742 2000-01-11 Juergen Vigna <jug@sad.it>
10744 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10745 could not be found.
10747 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10749 * src/vc-backend.C (doVCCommand): change to be static and take one
10750 more parameter: the path to chdir too be fore executing the command.
10751 (retrive): new function equiv to "co -r"
10753 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10754 file_not_found_hook is true.
10756 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10758 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10759 if a file is readwrite,readonly...anything else.
10761 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10763 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10764 (CreatePostscript): name change from MenuRunDVIPS (or something)
10765 (PreviewPostscript): name change from MenuPreviewPS
10766 (PreviewDVI): name change from MenuPreviewDVI
10768 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10769 \view_pdf_command., \pdf_to_ps_command
10771 * lib/configure.m4: added search for PDF viewer, and search for
10772 PDF to PS converter.
10773 (lyxrc.defaults output): add \pdflatex_command,
10774 \view_pdf_command and \pdf_to_ps_command.
10776 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10778 * src/bufferlist.C (write): we don't use blocksize for anything so
10781 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10783 * src/support/block.h: disable operator T* (), since it causes
10784 problems with both compilers I tried. See comments in the file.
10786 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10789 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10790 variable LYX_DIR_10x to LYX_DIR_11x.
10792 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10794 * INSTALL: document --with-lyxname.
10797 * configure.in: new configure flag --with-lyxname which allows to
10798 choose the name under which lyx is installed. Default is "lyx", of
10799 course. It used to be possible to do this with --program-suffix,
10800 but the later has in fact a different meaning for autoconf.
10802 * src/support/lstrings.h (lstrchr): reformat a bit.
10804 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10805 * src/mathed/math_defs.h: ditto.
10807 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10809 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10810 true, decides if we create a backup file or not when saving. New
10811 tag and variable \pdf_mode, defaults to false. New tag and
10812 variable \pdflatex_command, defaults to pdflatex. New tag and
10813 variable \view_pdf_command, defaults to xpdf. New tag and variable
10814 \pdf_to_ps_command, defaults to pdf2ps.
10816 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10818 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10819 does not have a BufferView.
10820 (unlockInset): ditto + don't access the_locking_inset if the
10821 buffer does not have a BufferView.
10823 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10824 certain circumstances so that we don't continue a keyboard
10825 operation long after the key was released. Try f.ex. to load a
10826 large document, press PageDown for some seconds and then release
10827 it. Before this change the document would contine to scroll for
10828 some time, with this change it stops imidiatly.
10830 * src/support/block.h: don't allocate more space than needed. As
10831 long as we don't try to write to the arr[x] in a array_type arr[x]
10832 it is perfectly ok. (if you write to it you might segfault).
10833 added operator value_type*() so that is possible to pass the array
10834 to functions expecting a C-pointer.
10836 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10839 * intl/*: updated to gettext 0.10.35, tried to add our own
10840 required modifications. Please verify.
10842 * po/*: updated to gettext 0.10.35, tried to add our own required
10843 modifications. Please verify.
10845 * src/support/lstrings.C (tostr): go at fixing the problem with
10846 cxx and stringstream. When stringstream is used return
10847 oss.str().c_str() so that problems with lyxstring and basic_string
10848 are avoided. Note that the best solution would be for cxx to use
10849 basic_string all the way, but it is not conformant yet. (it seems)
10851 * src/lyx_cb.C + other files: moved several global functions to
10852 class BufferView, some have been moved to BufferView.[Ch] others
10853 are still located in lyx_cb.C. Code changes because of this. (part
10854 of "get rid of current_view project".)
10856 * src/buffer.C + other files: moved several Buffer functions to
10857 class BufferView, the functions are still present in buffer.C.
10858 Code changes because of this.
10860 * config/lcmessage.m4: updated to most recent. used when creating
10863 * config/progtest.m4: updated to most recent. used when creating
10866 * config/gettext.m4: updated to most recent. applied patch for
10869 * config/gettext.m4.patch: new file that shows what changes we
10870 have done to the local copy of gettext.m4.
10872 * config/libtool.m4: new file, used in creation of acinclude.m4
10874 * config/lyxinclude.m4: new file, this is the lyx created m4
10875 macros, used in making acinclude.m4.
10877 * autogen.sh: GNU m4 discovered as a separate task not as part of
10878 the lib/configure creation.
10879 Generate acinlucde from files in config. Actually cat
10880 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10881 easier to upgrade .m4 files that really are external.
10883 * src/Spacing.h: moved using std::istringstream to right after
10884 <sstream>. This should fix the problem seen with some compilers.
10886 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10888 * src/lyx_cb.C: began some work to remove the dependency a lot of
10889 functions have on BufferView::text, even if not really needed.
10890 (GetCurrentTextClass): removed this func, it only hid the
10893 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10894 forgot this in last commit.
10896 * src/Bullet.C (bulletEntry): use static char const *[] for the
10897 tables, becuase of this the return arg had to change to string.
10898 (bulletSize): ditto
10899 (~Bullet): removed unneeded destructor
10901 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10902 (insetSleep): moved from Buffer
10903 (insetWakeup): moved from Buffer
10904 (insetUnlock): moved from Buffer
10906 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10907 from Buffer to BufferView.
10909 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10911 * config/ltmain.sh: updated to version 1.3.4 of libtool
10913 * config/ltconfig: updated to version 1.3.4 of libtool
10915 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10918 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10919 Did I get that right?
10921 * src/lyxlex.h: add a "using" directive or two.
10922 * src/Spacing.h: ditto.
10923 * src/insets/figinset.C: ditto.
10924 * src/support/filetools.C: ditto.
10925 * src/support/lstrings.C: ditto.
10926 * src/BufferView.C: ditto.
10927 * src/bufferlist.C: ditto.
10928 * src/lyx_cb.C: ditto.
10929 * src/lyxlex.C: ditto.
10931 * NEWS: add some changes for 1.1.4.
10933 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10935 * src/BufferView.C: first go at a TextCache to speed up switching
10938 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10940 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10941 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10942 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10943 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10946 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10947 members of the struct are correctly initialized to 0 (detected by
10949 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10950 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10952 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10953 pidwait, since it was allocated with "new". This was potentially
10954 very bad. Thanks to Michael Schmitt for running purify for us.
10957 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10959 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10961 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10963 1999-12-30 Allan Rae <rae@lyx.org>
10965 * lib/templates/IEEEtran.lyx: minor change
10967 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10968 src/mathed/formula.C (LocalDispatch): askForText changes
10970 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10971 know when a user has cancelled input. Fixes annoying problems with
10972 inserting labels and version control.
10974 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10976 * src/support/lstrings.C (tostr): rewritten to use strstream and
10979 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10981 * src/support/filetools.C (IsFileWriteable): use fstream to check
10982 (IsDirWriteable): use fileinfo to check
10984 * src/support/filetools.h (FilePtr): whole class deleted
10986 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10988 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10990 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10992 * src/bufferlist.C (write): use ifstream and ofstream instead of
10995 * src/Spacing.h: use istrstream instead of sscanf
10997 * src/mathed/math_defs.h: change first arg to istream from FILE*
10999 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
11001 * src/mathed/math_parser.C: have yyis to be an istream
11002 (LexGetArg): use istream (yyis)
11004 (mathed_parse): ditto
11005 (mathed_parser_file): first arg istream instead of FILE*, set yyis
11007 * src/mathed/formula.C (Read): rewritten to use istream
11009 * src/mathed/formulamacro.C (Read): rewritten to use istream
11011 * src/lyxlex.h (~LyXLex): deleted desturctor
11012 (getStream): new function, returns an istream
11013 (getFile): deleted funtion
11014 (IsOK): return is.good();
11016 * src/lyxlex.C (LyXLex): delete file and owns_file
11017 (setFile): open an filebuf and assign that to a istream instead of
11019 (setStream): new function, takes an istream as arg.
11020 (setFile): deleted function
11021 (EatLine): rewritten us use istream instead of FILE*
11025 * src/table.C (LyXTable): use istream instead of FILE*
11026 (Read): rewritten to take an istream instead of FILE*
11028 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11030 * src/buffer.C (Dispatch): remove an extraneous break statement.
11032 * src/support/filetools.C (QuoteName): change to do simple
11033 'quoting'. More work is necessary. Also changed to do nothing
11034 under emx (needs fix too).
11035 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
11037 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
11038 config.h.in to the AC_DEFINE_UNQUOTED() call.
11039 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
11040 needs char * as argument (because Solaris 7 declares it like
11043 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
11044 remove definition of BZERO.
11046 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11048 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
11049 defined, "lyxregex.h" if not.
11051 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
11053 (REGEX): new variable that is set to regex.c lyxregex.h when
11054 AM_CONDITIONAL USE_REGEX is set.
11055 (libsupport_la_SOURCES): add $(REGEX)
11057 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
11060 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
11063 * configure.in: add call to LYX_REGEX
11065 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
11066 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
11068 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11070 * lib/bind/fi_menus.bind: new file, from
11071 pauli.virtanen@saunalahti.fi.
11073 * src/buffer.C (getBibkeyList): pass the parameter delim to
11074 InsetInclude::getKeys and InsetBibtex::getKeys.
11076 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
11077 is passed to Buffer::getBibkeyList
11079 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
11080 instead of the hardcoded comma.
11082 * src/insets/insetbib.C (getKeys): make sure that there are not
11083 leading blanks in bibtex keys. Normal latex does not care, but
11084 harvard.sty seems to dislike blanks at the beginning of citation
11085 keys. In particular, the retturn value of the function is
11087 * INSTALL: make it clear that libstdc++ is needed and that gcc
11088 2.7.x probably does not work.
11090 * src/support/filetools.C (findtexfile): make debug message go to
11092 * src/insets/insetbib.C (getKeys): ditto
11094 * src/debug.C (showTags): make sure that the output is correctly
11097 * configure.in: add a comment for TWO_COLOR_ICON define.
11099 * acconfig.h: remove all the entries that already defined in
11100 configure.in or acinclude.m4.
11102 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
11103 to avoid user name, date and copyright.
11105 1999-12-21 Juergen Vigna <jug@sad.it>
11107 * src/table.C (Read): Now read bogus row format informations
11108 if the format is < 5 so that afterwards the table can
11109 be read by lyx but without any format-info. Fixed the
11110 crash we experienced when not doing this.
11112 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
11114 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
11115 (RedoDrawingOfParagraph): ditto
11116 (RedoParagraphs): ditto
11117 (RemoveTableRow): ditto
11119 * src/text.C (Fill): rename arg paperwidth -> paper_width
11121 * src/buffer.C (insertLyXFile): rename var filename -> fname
11122 (writeFile): rename arg filename -> fname
11123 (writeFileAscii): ditto
11124 (makeLaTeXFile): ditto
11125 (makeLinuxDocFile): ditto
11126 (makeDocBookFile): ditto
11128 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
11131 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
11133 * src/bmtable.h: add extern "C" on this file when __cplusplus is
11136 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
11137 compiled by a C compiler not C++.
11139 * src/layout.h (LyXTextClass): added typedef for const_iterator
11140 (LyXTextClassList): added typedef for const_iterator + member
11141 functions begin and end.
11143 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
11144 iterators to fill the choice_class.
11145 (updateLayoutChoice): rewritten to use iterators to fill the
11146 layoutlist in the toolbar.
11148 * src/BufferView.h (BufferView::work_area_width): removed unused
11151 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
11153 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
11154 (sgmlCloseTag): ditto
11156 * src/support/lstrings.h: return type of countChar changed to
11159 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
11160 what version of this func to use. Also made to return unsigned int.
11162 * configure.in: call LYX_STD_COUNT
11164 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
11165 conforming std::count.
11167 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11169 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
11170 and a subscript would give bad display (patch from Dekel Tsur
11171 <dekel@math.tau.ac.il>).
11173 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
11175 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
11178 * src/chset.h: add a few 'using' directives
11180 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
11181 triggered when no buffer is active
11183 * src/layout.C: removed `break' after `return' in switch(), since
11186 * src/lyx_main.C (init): make sure LyX can be ran in place even
11187 when libtool has done its magic with shared libraries. Fix the
11188 test for the case when the system directory has not been found.
11190 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11191 name for the latex file.
11192 (MenuMakeHTML): ditto
11194 * src/buffer.h: add an optional boolean argument, which is passed
11195 to ChangeExtension.
11197 1999-12-20 Allan Rae <rae@lyx.org>
11199 * lib/templates/IEEEtran.lyx: small correction and update.
11201 * configure.in: Attempted to use LYX_PATH_HEADER
11203 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11205 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11206 input from JMarc. Now use preprocessor to find the header.
11207 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11208 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11209 LYX_STL_STRING_FWD. See comments in file.
11211 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11213 * The global MiniBuffer * minibuffer variable is dead.
11215 * The global FD_form_main * fd_form_main variable is dead.
11217 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11219 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11221 * src/table.h: add the LOstream.h header
11222 * src/debug.h: ditto
11224 * src/LyXAction.h: change the explaination of the ReadOnly
11225 attribute: is indicates that the function _can_ be used.
11227 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11230 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11232 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11238 * src/paragraph.C (GetWord): assert on pos>=0
11241 * src/support/lyxstring.C: condition the use of an invariant on
11243 * src/support/lyxstring.h: ditto
11245 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11246 Use LAssert.h instead of plain assert().
11248 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11250 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11251 * src/support/filetools.C: ditto
11253 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11256 * INSTALL: document the new configure flags
11258 * configure.in: suppress --with-debug; add --enable-assertions
11260 * acinclude.m4: various changes in alignment of help strings.
11262 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11264 * src/kbmap.C: commented out the use of the hash map in kb_map,
11265 beginning of movement to a stl::container.
11267 * several files: removed code that was not in effect when
11268 MOVE_TEXT was defined.
11270 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11271 for escaping should not be used. We can discuss if the string
11272 should be enclosed in f.ex. [] instead of "".
11274 * src/trans_mgr.C (insert): use the new returned value from
11275 encodeString to get deadkeys and keymaps done correctly.
11277 * src/chset.C (encodeString): changed to return a pair, to tell
11278 what to use if we know the string.
11280 * src/lyxscreen.h (fillArc): new function.
11282 * src/FontInfo.C (resize): rewritten to use more std::string like
11283 structore, especially string::replace.
11285 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11288 * configure.in (chmod +x some scripts): remove config/gcc-hack
11290 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11292 * src/buffer.C (writeFile): change once again the top comment in a
11293 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11294 instead of an hardcoded version number.
11295 (makeDocBookFile): ditto
11297 * src/version.h: add new define LYX_DOCVERSION
11299 * po/de.po: update from Pit Sütterlin
11300 * lib/bind/de_menus.bind: ditto.
11302 * src/lyxfunc.C (Dispatch): call MenuExport()
11303 * src/buffer.C (Dispatch): ditto
11305 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11306 LyXFunc::Dispatch().
11307 (MenuExport): new function, moved from
11308 LyXFunc::Dispatch().
11310 * src/trans_mgr.C (insert): small cleanup
11311 * src/chset.C (loadFile): ditto
11313 * lib/kbd/iso8859-1.cdef: add missing backslashes
11315 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11317 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11318 help with placing the manually drawn accents better.
11320 (Draw): x2 and hg changed to float to minimize rounding errors and
11321 help place the accents better.
11323 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11324 unsigned short to char is just wrong...cast the char to unsigned
11325 char instead so that the two values can compare sanely. This
11326 should also make the display of insetlatexaccents better and
11327 perhaps also some other insets.
11329 (lbearing): new function
11332 1999-12-15 Allan Rae <rae@lyx.org>
11334 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11335 header that provides a wrapper around the very annoying SGI STL header
11338 * src/support/lyxstring.C, src/LString.h:
11339 removed old SGI-STL-compatability attempts.
11341 * configure.in: Use LYX_STL_STRING_FWD.
11343 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11344 stl_string_fwd.h is around and try to determine it's location.
11345 Major improvement over previous SGI STL 3.2 compatability.
11346 Three small problems remain with this function due to my zero
11347 knowledge of autoconf. JMarc and lgb see the comments in the code.
11349 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11351 * src/broken_const.h, config/hack-gcc, config/README: removed
11353 * configure.in: remove --with-gcc-hack option; do not call
11356 * INSTALL: remove documentation of --with-broken-const and
11359 * acconfig.h: remove all trace of BROKEN_CONST define
11361 * src/buffer.C (makeDocBookFile): update version number in output
11363 (SimpleDocBookOnePar): fix an assert when trying to a character
11364 access beyond string length
11367 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11369 * po/de.po: fix the Export menu
11371 * lyx.man: update the description of -dbg
11373 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11374 (commandLineHelp): updated
11375 (easyParse): show list of available debug levels if -dbg is passed
11378 * src/Makefile.am: add debug.C
11380 * src/debug.h: moved some code to debug.C
11382 * src/debug.C: new file. Contains code to set and show debug
11385 * src/layout.C: remove 'break' after 'continue' in switch
11386 statements, since these cannot be reached.
11388 1999-12-13 Allan Rae <rae@lyx.org>
11390 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11391 (in_word_set): hash() -> math_hash()
11393 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11395 * acconfig.h: Added a test for whether we are using exceptions in the
11396 current compilation run. If so USING_EXCEPTIONS is defined.
11398 * config.in: Check for existance of stl_string_fwd.h
11399 * src/LString.h: If compiling --with-included-string and SGI's
11400 STL version 3.2 is present (see above test) we need to block their
11401 forward declaration of string and supply a __get_c_string().
11402 However, it turns out this is only necessary if compiling with
11403 exceptions enabled so I've a bit more to add yet.
11405 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11406 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11407 src/support/LRegex.h, src/undo.h:
11408 Shuffle the order of the included files a little to ensure that
11409 LString.h gets included before anything that includes stl_string_fwd.h
11411 * src/support/lyxstring.C: We need to #include LString.h instead of
11412 lyxstring.h to get the necessary definition of __get_c_string.
11413 (__get_c_string): New function. This is defined static just like SGI's
11414 although why they need to do this I'm not sure. Perhaps it should be
11415 in lstrings.C instead.
11417 * lib/templates/IEEEtran.lyx: New template file.
11419 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11421 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11422 * intl/Makefile.in (MKINSTALLDIRS): ditto
11424 * src/LyXAction.C (init): changed to hold the LFUN data in a
11425 automatic array in stead of in callso to newFunc, this speeds up
11426 compilation a lot. Also all the memory used by the array is
11427 returned when the init is completed.
11429 * a lot of files: compiled with -Wold-style-cast, changed most of
11430 the reported offenders to C++ style casts. Did not change the
11431 offenders in C files.
11433 * src/trans.h (Match): change argument type to unsigned int.
11435 * src/support/DebugStream.C: fix some types on the streambufs so
11436 that it works on a conforming implementation.
11438 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11440 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11442 * src/support/lyxstring.C: remove the inline added earlier since
11443 they cause a bunch of unsatisfied symbols when linking with dec
11444 cxx. Cxx likes to have the body of inlines at the place where they
11447 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11448 accessing negative bounds in array. This fixes the crash when
11449 inserting accented characters.
11450 * src/trans.h (Match): ditto
11452 * src/buffer.C (Dispatch): since this is a void, it should not try
11453 to return anything...
11455 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11457 * src/buffer.h: removed the two friends from Buffer. Some changes
11458 because of this. Buffer::getFileName and Buffer::setFileName
11459 renamed to Buffer::fileName() and Buffer::fileName(...).
11461 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11463 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11464 and Buffer::update(short) to BufferView. This move is currently
11465 controlled by a define MOVE_TEXT, this will be removed when all
11466 shows to be ok. This move paves the way for better separation
11467 between buffer contents and buffer view. One side effect is that
11468 the BufferView needs a rebreak when swiching buffers, if we want
11469 to avoid this we can add a cache that holds pointers to LyXText's
11470 that is not currently in use.
11472 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11475 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11477 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11479 * lyx_main.C: new command line option -x (or --execute) and
11480 -e (or --export). Now direct conversion from .lyx to .tex
11481 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11482 Unfortunately, X is still needed and the GUI pops up during the
11485 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11487 * src/Spacing.C: add a using directive to bring stream stuff into
11489 * src/paragraph.C: ditto
11490 * src/buffer.C: ditto
11492 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11493 from Lars' announcement).
11495 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11496 example files from Tino Meinen.
11498 1999-12-06 Allan Rae <rae@lyx.org>
11500 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11502 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11504 * src/support/lyxstring.C: added a lot of inline for no good
11507 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11508 latexWriteEndChanges, they were not used.
11510 * src/layout.h (operator<<): output operator for PageSides
11512 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11514 * some example files: loaded in LyX 1.0.4 and saved again to update
11515 certain constructs (table format)
11517 * a lot of files: did the change to use fstream/iostream for all
11518 writing of files. Done with a close look at Andre Poenitz's patch.
11520 * some files: whitespace changes.
11522 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11524 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11525 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11526 architecture, we provide our own. It is used unconditionnally, but
11527 I do not think this is a performance problem. Thanks to Angus
11528 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11529 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11531 (GetInset): use my_memcpy.
11535 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11536 it is easier to understand, but it uses less TeX-only constructs now.
11538 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11539 elements contain spaces
11541 * lib/configure: regenerated
11543 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11544 elements contain spaces; display the list of programs that are
11547 * autogen.sh: make sure lib/configure is executable
11549 * lib/examples/*: rename the tutorial examples to begin with the
11550 two-letters language code.
11552 * src/lyxfunc.C (getStatus): do not query current font if no
11555 * src/lyx_cb.C (RunScript): use QuoteName
11556 (MenuRunDvips): ditto
11557 (PrintApplyCB): ditto
11559 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11560 around argument, so that it works well with the current shell.
11561 Does not work properly with OS/2 shells currently.
11563 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11564 * src/LyXSendto.C (SendtoApplyCB): ditto
11565 * src/lyxfunc.C (Dispatch): ditto
11566 * src/buffer.C (runLaTeX): ditto
11567 (runLiterate): ditto
11568 (buildProgram): ditto
11570 * src/lyx_cb.C (RunScript): ditto
11571 (MenuMakeLaTeX): ditto
11573 * src/buffer.h (getLatexName): new method
11575 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11577 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11579 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11580 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11581 (create_math_panel): ditto
11583 * src/lyxfunc.C (getStatus): re-activate the code which gets
11584 current font and cursor; add test for export to html.
11586 * src/lyxrc.C (read): remove unreachable break statements; add a
11589 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11591 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11593 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11594 introduced by faulty regex.
11595 * src/buffer.C: ditto
11596 * src/lastfiles.C: ditto
11597 * src/paragraph.C: ditto
11598 * src/table.C: ditto
11599 * src/vspace.C: ditto
11600 * src/insets/figinset.C: ditto
11601 Note: most of these is absolutely harmless, except the one in
11602 src/mathed formula.C.
11604 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11606 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11607 operation, yielding correct results for the reLyX command.
11609 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11611 * src/support/filetools.C (ExpandPath): removed an over eager
11613 (ReplaceEnvironmentPath): ditto
11615 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11616 shows that we are doing something fishy in our code...
11617 (BubblePost): ditto
11620 * src/lyxrc.C (read): use a double switch trick to get more help
11621 from the compiler. (the same trick is used in layout.C)
11622 (write): new function. opens a ofstream and pass that to output
11623 (output): new function, takes a ostream and writes the lyxrc
11624 elemts to it. uses a dummy switch to make sure no elements are
11627 * src/lyxlex.h: added a struct pushpophelper for use in functions
11628 with more than one exit point.
11630 * src/lyxlex.[Ch] (GetInteger): made it const
11634 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11636 * src/layout.[hC] : LayoutTags splitted into several enums, new
11637 methods created, better error handling cleaner use of lyxlex. Read
11640 * src/bmtable.[Ch]: change some member prototypes because of the
11641 image const changes.
11643 * commandtags.h, src/LyXAction.C (init): new function:
11644 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11645 This file is not read automatically but you can add \input
11646 preferences to your lyxrc if you want to. We need to discuss how
11649 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11650 in .aux, also remove .bib and .bst files from dependencies when
11653 * src/BufferView.C, src/LyXView.C: add const_cast several places
11654 because of changes to images.
11656 * lib/images/*: same change as for images/*
11658 * lib/lyxrc.example: Default for accept_compound is false not no.
11660 * images/*: changed to be const, however I have som misgivings
11661 about this change so it might be changed back.
11663 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11665 * lib/configure, po/POTFILES.in: regenerated
11667 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11669 * config/lib_configure.m4: removed
11671 * lib/configure.m4: new file (was config/lib_configure.m4)
11673 * configure.in: do not test for rtti, since we do not use it.
11675 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11677 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11678 doubling of allocated space scheme. This makes it faster for large
11679 strings end to use less memory for small strings. xtra rememoved.
11681 * src/insets/figinset.C (waitalarm): commented out.
11682 (GhostscriptMsg): use static_cast
11683 (GhostscriptMsg): use new instead of malloc to allocate memory for
11684 cmap. also delete the memory after use.
11686 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11688 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11689 for changes in bibtex database or style.
11690 (runBibTeX): remove all .bib and .bst files from dep before we
11692 (run): use scanAuc in when dep file already exist.
11694 * src/DepTable.C (remove_files_with_extension): new method
11695 (exist): new method
11697 * src/DepTable.[Ch]: made many of the methods const.
11699 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11701 * src/bufferparams.C: make sure that the default textclass is
11702 "article". It used to be the first one by description order, but
11703 now the first one is "docbook".
11705 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11706 string; call Debug::value.
11707 (easyParse): pass complete argument to setDebuggingLevel().
11709 * src/debug.h (value): fix the code that parses debug levels.
11711 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11714 * src/LyXAction.C: use Debug::ACTION as debug channel.
11716 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11718 * NEWS: updated for the future 1.1.3 release.
11720 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11721 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11722 it should. This is of course a controversial change (since many
11723 people will find that their lyx workscreen is suddenly full of
11724 red), but done for the sake of correctness.
11726 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11727 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11729 * src/insets/inseterror.h, src/insets/inseturl.h,
11730 src/insets/insetinfo.h, src/insets/figinset.h,
11731 src/mathed/formulamacro.h, src/mathed/math_macro.h
11732 (EditMessage): add a missing const and add _() to make sure that
11733 translation happens
11735 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11736 src/insets/insetbib.C, src/support/filetools.C: add `using'
11737 directives for cxx.
11739 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11740 doing 'Insert index of last word' at the beginning of a paragraph.
11742 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11744 * several files: white-space changes.
11746 * src/mathed/formula.C: removed IsAlpha and IsDigit
11748 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11749 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11752 * src/insets/figinset.C (GetPSSizes): don't break when
11753 "EndComments" is seen. But break when a boundingbox is read.
11755 * all classes inherited from Inset: return value of Clone
11756 changed back to Inset *.
11758 * all classes inherited form MathInset: return value of Clone
11759 changed back to MathedInset *.
11761 * src/insets/figinset.C (runqueue): use a ofstream to output the
11762 gs/ps file. Might need some setpresicion or setw. However I can
11763 see no problem with the current code.
11764 (runqueue): use sleep instead of the alarm/signal code. I just
11765 can't see the difference.
11767 * src/paragraph.C (LyXParagraph): reserve space in the new
11768 paragraph and resize the inserted paragraph to just fit.
11770 * src/lyxfunc.h (operator|=): added operator for func_status.
11772 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11773 check for readable file.
11775 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11776 check for readable file.
11777 (MenuMakeLinuxDoc): ditto
11778 (MenuMakeDocBook): ditto
11779 (MenuMakeAscii): ditto
11780 (InsertAsciiFile): split the test for openable and readable
11782 * src/bmtable.C (draw_bitmaptable): use
11783 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11785 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11786 findtexfile from LaTeX to filetools.
11788 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11789 instead of FilePtr. Needs to be verified by a literate user.
11791 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11793 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11794 (EditMessage): likewise.
11796 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11797 respectively as \textasciitilde and \textasciicircum.
11799 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11801 * src/support/lyxstring.h: made the methods that take iterators
11802 use const_iterator.
11804 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11805 (regexMatch): made is use the real regex class.
11807 * src/support/Makefile.am: changed to use libtool
11809 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11811 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11813 (MathIsInset ++): changed several macros to be inline functions
11816 * src/mathed/Makefile.am: changed to use libtool
11818 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11820 * src/insets/inset* : Clone changed to const and return type is
11821 the true insettype not just Inset*.
11823 * src/insets/Makefile.am: changed to use libtool
11825 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11827 * src/undo.[Ch] : added empty() and changed some of the method
11830 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11832 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11833 setID use block<> for the bullets array, added const several places.
11835 * src/lyxfunc.C (getStatus): new function
11837 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11838 LyXAction, added const to several funtions.
11840 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11841 a std::map, and to store the dir items in a vector.
11843 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11846 * src/LyXView.[Ch] + other files : changed currentView to view.
11848 * src/LyXAction.[Ch] : ported from the old devel branch.
11850 * src/.cvsignore: added .libs and a.out
11852 * configure.in : changes to use libtool.
11854 * acinclude.m4 : inserted libtool.m4
11856 * .cvsignore: added libtool
11858 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11860 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11861 file name in insets and mathed directories (otherwise the
11862 dependency is not taken in account under cygwin).
11864 * src/text2.C (InsertString[AB]): make sure that we do not try to
11865 read characters past the string length.
11867 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11869 * lib/doc/LaTeXConfig.lyx.in,
11870 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11872 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11873 file saying who created them and when this heppened; this is
11874 useless and annoys tools like cvs.
11876 * lib/layouts/g-brief-{en,de}.layout,
11877 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11878 from Thomas Hartkens <thomas@hartkens.de>.
11880 * src/{insets,mathed}/Makefile.am: do not declare an empty
11881 LDFLAGS, so that it can be set at configure time (useful on Irix
11884 * lib/reLyX/configure.in: make sure that the prefix is set
11885 correctly in LYX_DIR.
11887 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11889 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11890 be used by 'command-sequence' this allows to bind a key to a
11891 sequence of LyX-commands
11892 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11894 * src/LyXAction.C: add "command-sequence"
11896 * src/LyXFunction.C: handling of "command-sequence"
11898 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11899 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11901 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11903 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11905 * src/buffer.C (writeFile): Do not output a comment giving user
11906 and date at the beginning of a .lyx file. This is useless and
11907 annoys cvs anyway; update version number to 1.1.
11909 * src/Makefile.am (LYX_DIR): add this definition, so that a
11910 default path is hardcoded in LyX.
11912 * configure.in: Use LYX_GNU_GETTEXT.
11914 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11915 AM_GNU_GETTEXT with a bug fixed.
11917 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11919 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11921 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11922 which is used to point to LyX data is now LYX_DIR_11x.
11924 * lyx.man: convert to a unix text file; small updates.
11926 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11928 * src/support/LSubstring.[Ch]: made the second arg of most of the
11929 constructors be a const reference.
11931 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11934 * src/support/lyxstring.[Ch] (swap): added missing member function
11935 and specialization of swap(str, str);
11937 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11939 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11940 trace of the old one.
11942 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11943 put the member definitions in undo.C.
11945 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11946 NEW_TEXT and have now only code that was included when this was
11949 * src/intl.C (LCombo): use static_cast
11951 (DispatchCallback): ditto
11953 * src/definitions.h: removed whole file
11955 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11957 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11958 parsing and stores in a std:map. a regex defines the file format.
11959 removed unneeded members.
11961 * src/bufferparams.h: added several enums from definitions.h here.
11962 Removed unsused destructor. Changed some types to use proper enum
11963 types. use block to have the temp_bullets and user_defined_bullets
11964 and to make the whole class assignable.
11966 * src/bufferparams.C (Copy): removed this functions, use a default
11967 assignment instead.
11969 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11972 * src/buffer.C (readLyXformat2): commend out all that have with
11973 oldpapersize to do. also comment out all that hve to do with
11974 insetlatex and insetlatexdel.
11975 (setOldPaperStuff): commented out
11977 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11979 * src/LyXAction.C: remove use of inset-latex-insert
11981 * src/mathed/math_panel.C (button_cb): use static_cast
11983 * src/insets/Makefile.am (insets_o_SOURCES): removed
11986 * src/support/lyxstring.C (helper): use the unsigned long
11987 specifier, UL, instead of a static_cast.
11989 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11991 * src/support/block.h: new file. to be used as a c-style array in
11992 classes, so that the class can be assignable.
11994 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11996 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11997 NULL, make sure to return an empty string (it is not possible to
11998 set a string to NULL).
12000 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12002 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
12004 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
12006 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
12007 link line, so that Irix users (for example) can set it explicitely to
12010 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
12011 it can be overidden at make time (static or dynamic link, for
12014 * src/vc-backend.C, src/LaTeXFeatures.h,
12015 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
12016 statements to bring templates to global namespace.
12018 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
12020 * src/support/lyxstring.C (operator[] const): make it standard
12023 * src/minibuffer.C (Init): changed to reflect that more
12024 information is given from the lyxvc and need not be provided here.
12026 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
12028 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
12030 * src/LyXView.C (UpdateTimerCB): use static_cast
12031 (KeyPressMask_raw_callback): ditto
12033 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
12034 buffer_, a lot of changes because of this. currentBuffer() ->
12035 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
12036 also changes to other files because of this.
12038 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
12040 * src/vc-backend.[Ch]: new files. The backends for vc handling,
12041 have no support for RCS and partial support for CVS, will be
12044 * src/insets/ several files: changes because of function name
12045 changes in Bufferview and LyXView.
12047 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
12049 * src/support/LSubstring.[Ch]: new files. These implement a
12050 Substring that can be very convenient to use. i.e. is this
12052 string a = "Mary had a little sheep";
12053 Substring(a, "sheep") = "lamb";
12054 a is now "Mary has a little lamb".
12056 * src/support/LRegex.[Ch]: a regex class that can be used to pick
12057 out patterns and subpatterns of strings. It is used by LSubstring
12058 and also by vc-backend.C
12060 * src/support/lyxstring.C: went over all the assertions used and
12061 tried to correct the wrong ones and flag which of them is required
12062 by the standard. some bugs found because of this. Also removed a
12063 couple of assertions.
12065 * src/support/Makefile.am (libsupport_a_SOURCES): added
12066 LSubstring.[Ch] and LRegex.[Ch]
12068 * src/support/FileInfo.h: have struct stat buf as an object and
12069 not a pointer to one, some changes because of this.
12071 * src/LaTeXFeatures.C (getTClassPreamble): also use the
12072 information in layout when adding the layouts preamble to the
12073 textclass preamble.
12075 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
12078 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
12079 because of bug in OS/2.
12081 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12083 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
12084 \verbatim@font instead of \ttfamily, so that it can be redefined.
12086 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
12087 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
12088 src/layout.h, src/text2.C: add 'using' directive to bring the
12089 STL templates we need from the std:: namespace to the global one.
12090 Needed by DEC cxx in strict ansi mode.
12092 * src/support/LIstream.h,src/support/LOstream.h,
12093 src/support/lyxstring.h,src/table.h,
12094 src/lyxlookup.h: do not include <config.h> in header
12095 files. This should be done in the .C files only.
12097 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
12101 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12103 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
12104 from Kayvan to fix the tth invokation.
12106 * development/lyx.spec.in: updates from Kayvan to reflect the
12107 changes of file names.
12109 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12111 * src/text2.C (InsertStringB): use std::copy
12112 (InsertStringA): use std::copy
12114 * src/bufferlist.C: use a vector to store the buffers in. This is
12115 an internal change and should not affect any other thing.
12117 * src/BufferView.C (waitForX): use XSync instead of the lengthy
12120 * src/text.C (Fill): fix potential bug, one off bug.
12122 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12124 * src/Makefile.am (lyx_main.o): add more files it depends on.
12126 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
12128 * src/support/lyxstring.C: use size_t for the reference count,
12129 size, reserved memory and xtra.
12130 (internal_compare): new private member function. Now the compare
12131 functions should work for std::strings that have embedded '\0'
12133 (compare): all compare functions rewritten to use
12136 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12138 * src/support/lyxstring.C (compare): pass c_str()
12139 (compare): pass c_str
12140 (compare): pass c_str
12142 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12144 * src/support/DebugStream.C: <config.h> was not included correctly.
12146 * lib/configure: forgot to re-generate it :( I'll make this file
12147 auto generated soon.
12149 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12151 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
12154 * src/support/lyxstring.C: some changes from length() to rep->sz.
12155 avoids a function call.
12157 * src/support/filetools.C (SpaceLess): yet another version of the
12158 algorithm...now per Jean-Marc's suggestions.
12160 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12162 * src/layout.C (less_textclass_desc): functor for use in sorting
12164 (LyXTextClass::Read): sort the textclasses after reading.
12166 * src/support/filetools.C (SpaceLess): new version of the
12167 SpaceLess functions. What problems does this one give? Please
12170 * images/banner_bw.xbm: made the arrays unsigned char *
12172 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12174 * src/support/lyxstring.C (find): remove bogus assertion in the
12175 two versions of find where this has not been done yet.
12177 * src/support/lyxlib.h: add missing int return type to
12180 * src/menus.C (ShowFileMenu): disable exporting to html if no
12181 html export command is present.
12183 * config/lib_configure.m4: add a test for an HTML converter. The
12184 programs checked for are, in this order: tth, latex2html and
12187 * lib/configure: generated from config/lib_configure.m4.
12189 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12190 html converter. The parameters are now passed through $$FName and
12191 $$OutName, instead of standard input/output.
12193 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12195 * lib/lyxrc.example: update description of \html_command.
12196 add "quotes" around \screen_font_xxx font setting examples to help
12197 people who use fonts with spaces in their names.
12199 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12201 * Distribution files: updates for v1.1.2
12203 * src/support/lyxstring.C (find): remove bogus assert and return
12204 npos for the same condition.
12206 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12208 * added patch for OS/2 from SMiyata.
12210 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12212 * src/text2.C (CutSelection): make space_wrapped a bool
12213 (CutSelection): dont declare int i until we have to.
12214 (alphaCounter): return a char const *.
12216 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12218 * src/support/syscall.C (Systemcalls::kill):
12219 src/support/filetools.C (PutEnv, PutEnvPath):
12220 src/lyx_cb.C (addNewlineAndDepth):
12221 src/FontInfo.C (FontInfo::resize): condition some #warning
12222 directives with WITH_WARNINGS.
12225 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12227 * src/layout.[Ch] + several files: access to class variables
12228 limited and made accessor functions instead a lot of code changed
12229 becuase of this. Also instead of returning pointers often a const
12230 reference is returned instead.
12232 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12234 * src/Makefile.am (dist-hook): added used to remove the CVS from
12235 cheaders upon creating a dist
12236 (EXTRA_DIST): added cheaders
12238 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12239 a character not as a small integer.
12241 * src/support/lyxstring.C (find): removed Assert and added i >=
12242 rep->sz to the first if.
12244 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12246 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12247 src/LyXView.C src/buffer.C src/bufferparams.C
12248 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12249 src/text2.C src/insets/insetinclude.C:
12250 lyxlayout renamed to textclasslist.
12252 * src/layout.C: some lyxerr changes.
12254 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12255 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12256 (LyXLayoutList): removed all traces of this class.
12257 (LyXTextClass::Read): rewrote LT_STYLE
12258 (LyXTextClass::hasLayout): new function
12259 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12260 both const and nonconst version.
12261 (LyXTextClass::delete_layout): new function.
12262 (LyXTextClassList::Style): bug fix. do the right thing if layout
12264 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12265 (LyXTextClassList::NameOfLayout): ditto
12266 (LyXTextClassList::Load): ditto
12268 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12270 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12272 * src/LyXAction.C (LookupFunc): added a workaround for sun
12273 compiler, on the other hand...we don't know if the current code
12274 compiles on sun at all...
12276 * src/support/filetools.C (CleanupPath): subst fix
12278 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12281 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12282 complained about this one?
12284 * src/insets/insetinclude.C (Latex): subst fix
12286 * src/insets/insetbib.C (getKeys): subst fix
12288 * src/LyXSendto.C (SendtoApplyCB): subst fix
12290 * src/lyx_main.C (init): subst fix
12292 * src/layout.C (Read): subst fix
12294 * src/lyx_sendfax_main.C (button_send): subst fix
12296 * src/buffer.C (RoffAsciiTable): subst fix
12298 * src/lyx_cb.C (MenuFax): subst fix
12299 (PrintApplyCB): subst fix
12301 1999-10-26 Juergen Vigna <jug@sad.it>
12303 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12305 (Read): Cleaned up this code so now we read only format vestion >= 5
12307 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12309 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12310 come nobody has complained about this one?
12312 * src/insets/insetinclude.C (Latex): subst fix
12314 * src/insets/insetbib.C (getKeys): subst fix
12316 * src/lyx_main.C (init): subst fix
12318 * src/layout.C (Read): subst fix
12320 * src/buffer.C (RoffAsciiTable): subst fix
12322 * src/lyx_cb.C (MenuFax): subst fix.
12324 * src/layout.[hC] + some other files: rewrote to use
12325 std::container to store textclasses and layouts in.
12326 Simplified, removed a lot of code. Make all classes
12327 assignable. Further simplifications and review of type
12328 use still to be one.
12330 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12331 lastfiles to create the lastfiles partr of the menu.
12333 * src/lastfiles.[Ch]: rewritten to use deque to store the
12334 lastfiles in. Uses fstream for reading and writing. Simplifies
12337 * src/support/syscall.C: remove explicit cast.
12339 * src/BufferView.C (CursorToggleCB): removed code snippets that
12340 were commented out.
12341 use explicat C++ style casts instead of C style casts. also use
12342 u_vdata instea of passing pointers in longs.
12344 * src/PaperLayout.C: removed code snippets that were commented out.
12346 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12348 * src/lyx_main.C: removed code snippets that wer commented out.
12350 * src/paragraph.C: removed code snippets that were commented out.
12352 * src/lyxvc.C (logClose): use static_cast
12354 (viewLog): remove explicit cast to void*
12355 (showLog): removed old commented code
12357 * src/menus.C: use static_cast instead of C style casts. use
12358 u_vdata instead of u_ldata. remove explicit cast to (long) for
12359 pointers. Removed old code that was commented out.
12361 * src/insets/inset.C: removed old commented func
12363 * src/insets/insetref.C (InsetRef): removed old code that had been
12364 commented out for a long time.
12366 (escape): removed C style cast
12368 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12370 * src/insets/insetlatex.C (Draw): removed old commented code
12371 (Read): rewritten to use string
12373 * src/insets/insetlabel.C (escape): removed C style cast
12375 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12377 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12378 old commented code.
12380 * src/insets/insetinclude.h: removed a couple of stupid bools
12382 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12383 (Clone): remove C style cast
12384 (getKeys): changed list to lst because of std::list
12386 * src/insets/inseterror.C (Draw): removed som old commented code.
12388 * src/insets/insetcommand.C (Draw): removed some old commented code.
12390 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12391 commented out forever.
12392 (bibitem_cb): use static_cast instead of C style cast
12393 use of vdata changed to u_vdata.
12395 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12397 (CloseUrlCB): use static_cast instead of C style cast.
12398 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12400 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12401 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12402 (CloseInfoCB): static_cast from ob->u_vdata instead.
12403 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12406 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12407 (C_InsetError_CloseErrorCB): forward the ob parameter
12408 (CloseErrorCB): static_cast from ob->u_vdata instead.
12410 * src/vspace.h: include LString.h since we use string in this class.
12412 * src/vspace.C (lyx_advance): changed name from advance because of
12413 nameclash with stl. And since we cannot use namespaces yet...I
12414 used a lyx_ prefix instead. Expect this to change when we begin
12417 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12419 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12420 and removed now defunct constructor and deconstructor.
12422 * src/BufferView.h: have backstack as a object not as a pointer.
12423 removed initialization from constructor. added include for BackStack
12425 * development/lyx.spec.in (%build): add CFLAGS also.
12427 * src/screen.C (drawFrame): removed another warning.
12429 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12431 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12432 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12433 README and ANNOUNCE a bit for the next release. More work is
12436 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12437 unbreakable if we are in freespacing mode (LyX-Code), but not in
12440 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12442 * src/BackStack.h: fixed initialization order in constructor
12444 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12446 * acinclude.m4 (VERSION): new rules for when a version is
12447 development, added also a variable for prerelease.
12448 (warnings): we set with_warnings=yes for prereleases
12449 (lyx_opt): prereleases compile with same optimization as development
12450 (CXXFLAGS): only use pedantic if we are a development version
12452 * src/BufferView.C (restorePosition): don't do anything if the
12453 backstack is empty.
12455 * src/BackStack.h: added member empty, use this to test if there
12456 is anything to pop...
12458 1999-10-25 Juergen Vigna <jug@sad.it>
12461 * forms/layout_forms.fd +
12462 * forms/latexoptions.fd +
12463 * lyx.fd: changed for various form resize issues
12465 * src/mathed/math_panel.C +
12466 * src/insets/inseterror.C +
12467 * src/insets/insetinfo.C +
12468 * src/insets/inseturl.C +
12469 * src/insets/inseturl.h +
12471 * src/LyXSendto.C +
12472 * src/PaperLayout.C +
12473 * src/ParagraphExtra.C +
12474 * src/TableLayout.C +
12476 * src/layout_forms.C +
12483 * src/menus.C: fixed various resize issues. So now forms can be
12484 resized savely or not be resized at all.
12486 * forms/form_url.fd +
12487 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12490 * src/insets/Makefile.am: added files form_url.[Ch]
12492 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12494 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12495 (and presumably 6.2).
12497 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12498 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12499 remaining static member callbacks.
12501 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12504 * src/support/lyxstring.h: declare struct Srep as friend of
12505 lyxstring, since DEC cxx complains otherwise.
12507 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12509 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12511 * src/LaTeX.C (run): made run_bibtex also depend on files with
12513 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12514 are put into the dependency file.
12516 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12517 the code has shown itself to work
12518 (create_ispell_pipe): removed another warning, added a comment
12521 * src/minibuffer.C (ExecutingCB): removed code that has been
12522 commented out a long time
12524 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12525 out code + a warning.
12527 * src/support/lyxstring.h: comment out the three private
12528 operators, when compiling with string ansi conforming compilers
12529 they make problems.
12531 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12533 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12534 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12537 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12540 * src/mathed/math_panel.C (create_math_panel): remove explicit
12543 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12546 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12547 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12548 to XCreatePixmapFromBitmapData
12549 (fl_set_bmtable_data): change the last argument to be unsigned
12551 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12552 and bh to be unsigned int, remove explicit casts in call to
12553 XReadBitmapFileData.
12555 * images/arrows.xbm: made the arrays unsigned char *
12556 * images/varsz.xbm: ditto
12557 * images/misc.xbm: ditto
12558 * images/greek.xbm: ditto
12559 * images/dots.xbm: ditto
12560 * images/brel.xbm: ditto
12561 * images/bop.xbm: ditto
12563 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12565 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12566 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12567 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12569 (LYX_CXX_CHEADERS): added <clocale> to the test.
12571 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12573 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12575 * src/support/lyxstring.C (append): fixed something that must be a
12576 bug, rep->assign was used instead of rep->append.
12578 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12581 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12582 lyx insert double chars. Fix spotted by Kayvan.
12584 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12586 * Fixed the tth support. I messed up with the Emacs patch apply feature
12587 and omitted the changes in lyxrc.C.
12589 1999-10-22 Juergen Vigna <jug@sad.it>
12591 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12593 * src/lyx_cb.C (MenuInsertRef) +
12594 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12595 the form cannot be resized under it limits (fixes a segfault)
12597 * src/lyx.C (create_form_form_ref) +
12598 * forms/lyx.fd: Changed Gravity on name input field so that it is
12601 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12603 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12604 <ostream> and <istream>.
12606 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12607 whether <fstream> provides the latest standard features, or if we
12608 have an oldstyle library (like in egcs).
12609 (LYX_CXX_STL_STRING): fix the test.
12611 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12612 code on MODERN_STL_STREAM.
12614 * src/support/lyxstring.h: use L{I,O}stream.h.
12616 * src/support/L{I,O}stream.h: new files, designed to setup
12617 correctly streams for our use
12618 - includes the right header depending on STL capabilities
12619 - puts std::ostream and std::endl (for LOStream.h) or
12620 std::istream (LIStream.h) in toplevel namespace.
12622 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12624 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12625 was a bib file that had been changed we ensure that bibtex is run.
12626 (runBibTeX): enhanced to extract the names of the bib files and
12627 getting their absolute path and enter them into the dep file.
12628 (findtexfile): static func that is used to look for tex-files,
12629 checks for absolute patchs and tries also with kpsewhich.
12630 Alternative ways of finding the correct files are wanted. Will
12632 (do_popen): function that runs a command using popen and returns
12633 the whole output of that command in a string. Should be moved to
12636 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12637 file with extension ext has changed.
12639 * src/insets/figinset.C: added ifdef guards around the fl_free
12640 code that jug commented out. Now it is commented out when
12641 compiling with XForms == 0.89.
12643 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12644 to lyxstring.C, and only keep a forward declaration in
12645 lyxstring.h. Simplifies the header file a bit and should help a
12646 bit on compile time too. Also changes to Srep will not mandate a
12647 recompile of code just using string.
12648 (~lyxstring): definition moved here since it uses srep.
12649 (size): definition moved here since it uses srep.
12651 * src/support/lyxstring.h: removed a couple of "inline" that should
12654 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12656 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12659 1999-10-21 Juergen Vigna <jug@sad.it>
12661 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12662 set to left if I just remove the width entry (or it is empty).
12664 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12665 paragraph when having dummy paragraphs.
12667 1999-10-20 Juergen Vigna <jug@sad.it>
12669 * src/insets/figinset.C: just commented some fl_free_form calls
12670 and added warnings so that this calls should be activated later
12671 again. This avoids for now a segfault, but we have a memory leak!
12673 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12674 'const char * argument' to 'string argument', this should
12675 fix some Asserts() in lyxstring.C.
12677 * src/lyxfunc.h: Removed the function argAsString(const char *)
12678 as it is not used anymore.
12680 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12682 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12685 * src/Literate.h: some funcs moved from public to private to make
12686 interface clearer. Unneeded args removed.
12688 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12690 (scanBuildLogFile): ditto
12692 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12693 normal TeX Error. Still room for improvement.
12695 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12697 * src/buffer.C (insertErrors): changes to make the error
12698 desctription show properly.
12700 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12703 * src/support/lyxstring.C (helper): changed to use
12704 sizeof(object->rep->ref).
12705 (operator>>): changed to use a pointer instead.
12707 * src/support/lyxstring.h: changed const reference & to value_type
12708 const & lets see if that helps.
12710 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12712 * Makefile.am (rpmdist): fixed to have non static package and
12715 * src/support/lyxstring.C: removed the compilation guards
12717 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12720 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12721 conditional compile of lyxstring.Ch
12723 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12724 stupid check, but it is a lot better than the bastring hack.
12725 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12727 * several files: changed string::erase into string::clear. Not
12730 * src/chset.C (encodeString): use a char temporary instead
12732 * src/table.C (TexEndOfCell): added tostr around
12733 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12734 (TexEndOfCell): ditto
12735 (TexEndOfCell): ditto
12736 (TexEndOfCell): ditto
12737 (DocBookEndOfCell): ditto
12738 (DocBookEndOfCell): ditto
12739 (DocBookEndOfCell): ditto
12740 (DocBookEndOfCell): ditto
12742 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12744 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12746 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12747 (MenuBuildProg): added tostr around ret
12748 (MenuRunChktex): added tostr around ret
12749 (DocumentApplyCB): added tostr around ret
12751 * src/chset.C (encodeString): added tostr around t->ic
12753 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12754 (makeLaTeXFile): added tostr around tocdepth
12755 (makeLaTeXFile): added tostr around ftcound - 1
12757 * src/insets/insetbib.C (setCounter): added tostr around counter.
12759 * src/support/lyxstring.h: added an operator+=(int) to catch more
12762 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12763 (lyxstring): We DON'T allow NULL pointers.
12765 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12767 * src/mathed/math_macro.C (MathMacroArgument::Write,
12768 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12769 when writing them out.
12771 * src/LString.C: remove, since it is not used anymore.
12773 * src/support/lyxstring.C: condition the content to
12774 USE_INCLUDED_STRING macro.
12776 * src/mathed/math_symbols.C, src/support/lstrings.C,
12777 src/support/lyxstring.C: add `using' directive to specify what
12778 we need in <algorithm>. I do not think that we need to
12779 conditionalize this, but any thought is appreciated.
12781 * many files: change all callback functions to "C" linkage
12782 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12783 strict_ansi. Those who were static are now global.
12784 The case of callbacks which are static class members is
12785 trickier, since we have to make C wrappers around them (see
12786 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12787 did not finish this yet, since it defeats the purpose of
12788 encapsulation, and I am not sure what the best route is.
12790 1999-10-19 Juergen Vigna <jug@sad.it>
12792 * src/support/lyxstring.C (lyxstring): we permit to have a null
12793 pointer as assignment value and just don't assign it.
12795 * src/vspace.C (nextToken): corrected this function substituting
12796 find_first(_not)_of with find_last_of.
12798 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12799 (TableOptCloseCB) (TableSpeCloseCB):
12800 inserted fl_set_focus call for problem with fl_hide_form() in
12803 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12805 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12808 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12810 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12811 LyXLex::next() and not eatline() to get its argument.
12813 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12815 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12816 instead, use fstreams for io of the depfile, removed unneeded
12817 functions and variables.
12819 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12820 vector instead, removed all functions and variables that is not in
12823 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12825 * src/buffer.C (insertErrors): use new interface to TeXError
12827 * Makefile.am (rpmdist): added a rpmdist target
12829 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12830 per Kayvan's instructions.
12832 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12834 * src/Makefile.am: add a definition for localedir, so that locales
12835 are found after installation (Kayvan)
12837 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12839 * development/.cvsignore: new file.
12841 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12843 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12844 C++ compiler provides wrappers for C headers and use our alternate
12847 * configure.in: use LYX_CXX_CHEADERS.
12849 * src/cheader/: new directory, populated with cname headers from
12850 libstdc++-2.8.1. They are a bit old, but probably good enough for
12851 what we want (support compilers who lack them).
12853 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12854 from includes. It turns out is was stupid.
12856 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12858 * lib/Makefile.am (install-data-local): forgot a ';'
12859 (install-data-local): forgot a '\'
12860 (libinstalldirs): needed after all. reintroduced.
12862 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12864 * configure.in (AC_OUTPUT): added lyx.spec
12866 * development/lyx.spec: removed file
12868 * development/lyx.spec.in: new file
12870 * po/*.po: merged with lyx.pot becuase of make distcheck
12872 * lib/Makefile.am (dist-hook): added dist-hook so that
12873 documentation files will be included when doing a make
12874 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12875 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12877 more: tried to make install do the right thing, exclude CVS dirs
12880 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12881 Path would fit in more nicely.
12883 * all files that used to use pathstack: uses now Path instead.
12884 This change was a lot easier than expected.
12886 * src/support/path.h: new file
12888 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12890 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12892 * src/support/lyxstring.C (getline): Default arg was given for
12895 * Configure.cmd: removed file
12897 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12899 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12900 streams classes and types, add the proper 'using' statements when
12901 MODERN_STL is defined.
12903 * src/debug.h: move the << operator definition after the inclusion
12906 * src/support/filetools.C: include "LAssert.h", which is needed
12909 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12912 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12913 include "debug.h" to define a proper ostream.
12915 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12917 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12918 method to the SystemCall class which can kill a process, but it's
12919 not fully implemented yet.
12921 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12923 * src/support/FileInfo.h: Better documentation
12925 * src/lyxfunc.C: Added support for buffer-export html
12927 * src/menus.C: Added Export->As HTML...
12929 * lib/bind/*.bind: Added short-cut for buffer-export html
12931 * src/lyxrc.*: Added support for new \tth_command
12933 * lib/lyxrc.example: Added stuff for new \tth_command
12935 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12937 * lib/Makefile.am (IMAGES): removed images/README
12938 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12939 installes in correct place. Check permisions is installed
12942 * src/LaTeX.C: some no-op changes moved declaration of some
12945 * src/LaTeX.h (LATEX_H): changed include guard name
12947 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12949 * lib/reLyX/Makefile.am: install noweb2lyx.
12951 * lib/Makefile.am: install configure.
12953 * lib/reLyX/configure.in: declare a config aux dir; set package
12954 name to lyx (not sure what the best solution is); generate noweb2lyx.
12956 * lib/layouts/egs.layout: fix the bibliography layout.
12958 1999-10-08 Jürgen Vigna <jug@sad.it>
12960 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12961 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12962 it returned without continuing to search the path.
12964 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12966 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12967 also fixes a bug. It is not allowed to do tricks with std::strings
12968 like: string a("hei"); &a[e]; this will not give what you
12969 think... Any reason for the complexity in this func?
12971 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12973 * Updated README and INSTALL a bit, mostly to check that my
12974 CVS rights are correctly set up.
12976 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12978 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12979 does not allow '\0' chars but lyxstring and std::string does.
12981 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12983 * autogen.sh (AUTOCONF): let the autogen script create the
12984 POTFILES.in file too. POTFILES.in should perhaps now not be
12985 included in the cvs module.
12987 * some more files changed to use C++ includes instead of C ones.
12989 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12991 (Reread): added tostr to nlink. buggy output otherwise.
12992 (Reread): added a string() around szMode when assigning to Buffer,
12993 without this I got a log of garbled info strings.
12995 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12998 * I have added several ostream & operator<<(ostream &, some_type)
12999 functions. This has been done to avoid casting and warnings when
13000 outputting enums to lyxerr. This as thus eliminated a lot of
13001 explicit casts and has made the code clearer. Among the enums
13002 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
13003 mathed enums, some font enum the Debug::type enum.
13005 * src/support/lyxstring.h (clear): missing method. equivalent of
13008 * all files that contained "stderr": rewrote constructs that used
13009 stderr to use lyxerr instead. (except bmtable)
13011 * src/support/DebugStream.h (level): and the passed t with
13012 Debug::ANY to avoid spurious bits set.
13014 * src/debug.h (Debug::type value): made it accept strings of the
13015 type INFO,INIT,KEY.
13017 * configure.in (Check for programs): Added a check for kpsewhich,
13018 the latex generation will use this later to better the dicovery of
13021 * src/BufferView.C (create_view): we don't need to cast this to
13022 (void*) that is done automatically.
13023 (WorkAreaButtonPress): removed some dead code.
13025 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13027 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
13028 is not overwritten when translated (David Sua'rez de Lis).
13030 * lib/CREDITS: Added David Sua'rez de Lis
13032 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
13034 * src/bufferparams.C (BufferParams): default input encoding is now
13037 * acinclude.m4 (cross_compiling): comment out macro
13038 LYX_GXX_STRENGTH_REDUCE.
13040 * acconfig.h: make sure that const is not defined (to empty) when
13041 we are compiling C++. Remove commented out code using SIZEOF_xx
13044 * configure.in : move the test for const and inline as late as
13045 possible so that these C tests do not interefere with C++ ones.
13046 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
13047 has not been proven.
13049 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
13051 * src/table.C (getDocBookAlign): remove bad default value for
13052 isColumn parameter.
13054 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
13056 (ShowFileMenu2): ditto.
13058 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
13059 of files to ignore.
13061 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
13063 * Most files: finished the change from the old error code to use
13064 DebugStream for all lyxerr debugging. Only minor changes remain
13065 (e.g. the setting of debug levels using strings instead of number)
13067 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
13069 * src/layout.C (Add): Changed to use compare_no_case instead of
13072 * src/FontInfo.C: changed loop variable type too string::size_type.
13074 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
13076 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
13077 set ETAGS_ARGS to --c++
13079 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
13081 * src/table.C (DocBookEndOfCell): commented out two unused variables
13083 * src/paragraph.C: commented out four unused variables.
13085 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
13086 insed a if clause with type string::size_type.
13088 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
13091 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
13093 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
13094 variable, also changed loop to go from 0 to lenght + 1, instead of
13095 -1 to length. This should be correct.
13097 * src/LaTeX.C (scanError): use string::size_type as loop variable
13100 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
13101 (l.896) since y_tmp and row was not used anyway.
13103 * src/insets/insetref.C (escape): use string::size_type as loop
13106 * src/insets/insetquotes.C (Width): use string::size_type as loop
13108 (Draw): use string::size_type as loop variable type.
13110 * src/insets/insetlatexaccent.C (checkContents): use
13111 string::size_type as loop variable type.
13113 * src/insets/insetlabel.C (escape): use string::size_type as loop
13116 * src/insets/insetinfo.C: added an extern for current_view.
13118 * src/insets/insetcommand.C (scanCommand): use string::size_type
13119 as loop variable type.
13121 * most files: removed the RCS tags. With them we had to recompile
13122 a lot of files after a simple cvs commit. Also we have never used
13123 them for anything meaningful.
13125 * most files: tags-query-replace NULL 0. As adviced several plases
13126 we now use "0" instead of "NULL" in our code.
13128 * src/support/filetools.C (SpaceLess): use string::size_type as
13129 loop variable type.
13131 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
13133 * src/paragraph.C: fixed up some more string stuff.
13135 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
13137 * src/support/filetools.h: make modestr a std::string.
13139 * src/filetools.C (GetEnv): made ch really const.
13141 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
13142 made code that used these use max/min from <algorithm> instead.
13144 * changed several c library include files to their equivalent c++
13145 library include files. All is not changed yet.
13147 * created a support subdir in src, put lyxstring and lstrings
13148 there + the extra files atexit, fileblock, strerror. Created
13149 Makefile.am. edited configure.in and src/Makefile.am to use this
13150 new subdir. More files moved to support.
13152 * imported som of the functions from repository lyx, filetools
13154 * ran tags-query-replace on LString -> string, corrected the bogus
13155 cases. Tried to make use of lstrings.[hC], debugged a lot. There
13156 is still some errors in there. This is errors where too much or
13157 too litle get deleted from strings (string::erase, string::substr,
13158 string::replace), there can also be some off by one errors, or
13159 just plain wrong use of functions from lstrings. Viewing of quotes
13162 * LyX is now running fairly well with string, but there are
13163 certainly some bugs yet (see above) also string is quite different
13164 from LString among others in that it does not allow null pointers
13165 passed in and will abort if it gets any.
13167 * Added the revtex4 files I forgot when setting up the repository.
13169 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
13171 * All over: Tried to clean everything up so that only the files
13172 that we really need are included in the cvs repository.
13173 * Switched to use automake.
13174 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
13175 * Install has not been checked.
13177 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
13179 * po/pt.po: Three errors:
13180 l.533 and l.538 format specification error
13181 l. 402 duplicate entry, I just deleted it.