1 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
3 * src/converter.C (Move): New method. Used to move file or files
4 from temp dir to the output dir. (this fixes the bug that
5 exporting linuxdoc/docbook document to html would not move all
6 html file from temp directory).
8 * src/support/filetools.C (DirList): Fixed.
10 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
12 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
14 * src/converter.C (Add): Remove $$i when setting latex_command.
16 * src/text.C (IsBoundary): Return false when pos = 0.
18 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
20 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
22 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
24 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
25 need to empty the fields to turn off use of the geometry package!
27 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
29 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
30 (Buffer const &), not a (BufferParams const &) and so fix a crash
31 caused by using current_view before it had been initialised. Not
32 the best way to do this, but much easier than changing
33 Inset::Clone(Buffer const &) to Inset::Clone().
36 * src/tabular.C: changed call to CopyIntoMinibuffer().
38 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
40 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
42 * src/lyxfunc.C (getStatus): disable insertion of floats in a
45 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
47 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
48 changed filter for screen fonts input filter from int to float
50 * src/frontends/xforms/input_validators.c: removed.
51 * src/frontends/xforms/input_validators.C: new file. Can now call C++
52 functions from within the filter functions.
54 * src/frontends/xforms/input_validators.[Ch]
55 (fl_unsigned_float_filter): new filter function.
57 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
58 confused now! And if you think I'm going to do this in
59 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
61 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
63 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
65 * src/WorkArea.C (work_area_handler): don't handle button requests
66 if xbutton.button == 0
68 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
70 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
71 It creates a lot of interesting problems.
73 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
75 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
76 the menu exists in the current menubar before opening it.
78 * src/MenuBackend.C (hasSubmenu): new method.
80 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
81 action value by offsetting actions by a large constant (so that
82 bogs choice result will be less than this constant).
84 * lib/bind/fi_menus.bind: more cleanup to menus.
85 * lib/bind/sciword.bind: ditto.
86 * lib/bind/xemacs.bind: ditto.
87 * lib/bind/emacs.bind: ditto.
88 * lib/bind/pt_menus.bind: ditto.
89 * lib/bind/hu_menus.bind: ditto.
91 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
93 * INSTALL: update PROBLEMS section.
95 * src/lyxlookup.h: remove condition on xforms version, since we
96 should not include it if not appropriate.
98 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
100 * src/LColor.C: "latex text" -> "latex inset" (from
103 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
105 * src/frontends/kde/FormTabularCreate.C:
106 * src/frontends/kde/citationdlg.C:
107 * src/frontends/kde/copyrightdlg.C:
108 * src/frontends/kde/paradlg.C:
109 * src/frontends/kde/paraextradlg.C:
110 * src/frontends/kde/parageneraldlg.C:
111 * src/frontends/kde/printdlg.C:
112 * src/frontends/kde/refdlg.C:
113 * src/frontends/kde/tabcreatedlg.C:
114 * src/frontends/kde/tocdlg.C:
115 * src/frontends/kde/urldlg.C: add necessary headers
118 * src/frontends/kde/dlg/emptytable.C:
119 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
120 default parameters (from Angus Leeming)
122 * src/frontends/kde/dlg/moc/.cvsignore:
123 * src/frontends/kde/dlg/.cvsignore:
124 * src/frontends/kde/moc/.cvsignore: fix the library name
127 * src/frontends/kde/paradlg.C:
128 * src/frontends/kde/parageneraldlg.C:
129 * src/frontends/kde/dlg/para.dlg:
130 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
132 * src/frontends/kde/dlg/README: clarified qtarch version
134 * src/frontends/kde/dlg/Makefile.am: removed the
135 dlg rules as they created spontaneous rebuilds
136 (not a good idea as it requires qtarch)
138 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
140 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
141 fixlevel along with xforms version.
143 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
144 xforms version is strictly less than 0.89.5.
145 * src/lyx_gui.C (LyXGUI): ditto.
146 * src/LyXView.C (show): ditto.
148 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
150 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
151 movement in inset in RTL text.
152 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
153 (workAreaButtonRelease): Do not open a float when there is a selection.
155 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
157 * src/spellchecker.C (RunSpellChecker): Open all floats before
160 * src/text.C (InsertChar): Consider "," as a part of a number
161 (for LTR numbers in RTL text code).
162 (IsBoundary): Fixed (and simplified).
163 (InsertChar): Recalculate cursor boundary.
166 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
168 * src/spellchecker.C: fix figures with pspell enabled
170 * src/insets/figinset.C: workaround for gs hang xforms bug
172 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
174 * lib/bind/??_menus.bind: comment out the entries corresponding to
175 real menus. They should be eventually removed, but I'll let the
176 language maintainers do that.
178 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
180 * src/frontends/kde/parageneraldlg.C:
181 * src/frontends/kde/parageneraldlg.h: don't use
182 a derived class for SpaceAbove/Below
184 * src/frontends/kde/dlg/README: add some info
186 * src/frontends/kde/dlg/*: update data files, update
189 * src/frontends/kde/dlg/moc/Makefile.am: add
192 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
194 * configure.in: add new KDE Makefiles
195 * src/vspace.h: return GlueLength not a normal one
196 * src/support/lstrings.h:
197 * src/support/lstrings.C: add isStrUnsignedInt(),
200 * src/frontends/kde/*: big reorganisation, update
201 FormParagraph, add FormTabCreate
203 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
205 * lib/ui/default.ui: small grammatical change.
207 * src/frontends/xforms/xform_macros.h: removed.
209 * src/frontends/xforms/FormBase.C:
210 * src/frontends/xforms/FormPreferences.C:
211 * src/frontends/xforms/Makefile.am: changes associated with removing
212 xform_macros.h. Should make Lars' debugging a little easier.
214 * src/frontends/xforms/FormPreferences.C:
215 * src/frontends/xforms/FormPreferences.h:
216 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
217 longer use X11 color name database. HSV and RGB dials/sliders.
218 Please let this be the end of this!
220 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
222 * Several files: Allow compilation when the compiler doesn't
225 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
228 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
229 command line options.
231 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
233 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
234 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
237 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
239 * src/frontends/xforms/FormRef.C (updateBrowser):
240 * src/frontends/xforms/forms/form_ref.fd: try clicking on
241 different insets with the sort key active. Now apply this patch!
243 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
245 * src/frontends/xforms/FormPrint.C: set to valid()
246 when we update from the passed parameters.
248 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
250 * src/LColor.C (getFromGUIName): internationalise the comparison.
252 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
253 FormPreferences choice.
255 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
258 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
260 * src/lyxrc.C: more detail for the printer program config
263 * src/LColor.C: ert->latex text. LColor needs a big revamp
264 but will have to wait till after 1.1.6
266 * src/buffer.C: bring up a dialog if we load a document
267 with an un-installed text class, rather than just complain
270 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
272 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
273 the browser form for a combox in a tabbed folder. Bug fix courtesy of
274 Steve Lamont <spl@ncmir.ucsd.edu>.
276 * src/frontends/xforms/FormDocument.C (build):
277 * src/frontends/xforms/FormPreferences.C (Language::build):
278 pass tabfolders to Combox::add() in order to use this work around.
280 * src/frontends/xforms/FormCitation.C (connect): remove max size
282 (update): sort list of bibliography keys.
284 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
286 No max size limitation. Same popup for new and existing insets. Fixes
287 bugs reported by Rob Lahaye.
289 * src/frontends/xforms/FormCitation.C (c-tor):
290 * src/frontends/xforms/FormCopyright.C (c-tor):
291 * src/frontends/xforms/FormError.C (c-tor):
292 * src/frontends/xforms/FormGraphics.C (c-tor):
293 * src/frontends/xforms/FormIndex.C (c-tor):
294 * src/frontends/xforms/FormRef.C (c-tor):
295 * src/frontends/xforms/FormToc.C (c-tor):
296 * src/frontends/xforms/FormUrl.C (c-tor):
297 use correct policy for ButtonController.
299 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
301 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
304 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
306 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
307 Some resizing changes.
309 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
311 * configure.in: fix typo
313 * lib/languages: add ukraninian and change no to no_NO
315 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
317 * src/bufferview_funcs.C (FontSize): use setLyXSize
319 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
321 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
322 to check for systems where mkstemp() is available but not declared
323 in headers. The new autoconf macro lyx_CHECK_DECL can be used
324 to check for declarations in headers.
326 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
328 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
330 * forms/makefile: added bibforms.fd, include_form.fd.
331 Removed lyx_sendfax.fd.
333 * src/LaTeXLog.C (ShowLatexLog):
334 * src/LyXAction.C (init):
335 * src/bufferparams.C (readLanguage): altered messages as suggested by
338 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
341 * src/credits.C: made fd_form_credits non-static, so that it can be
342 redrawn should the xforms colors be re-mapped.
343 * src/spellchecker.C ditto fd_form_spell_options.
345 * src/filedlg.[Ch] (redraw):
346 * src/intl.[Ch] (redraw):
347 * src/lyxfr0.[Ch] (redraw):
348 * src/insets/figinset.[Ch] (redraw):
349 * src/insets/insetexternal.[Ch] (redraw):
350 new methods, connected to Dialogs::redrawGUI.
352 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
353 to be connected to Dialogs::redrawGUI.
355 * src/frontends/xforms/FormCitation.C (build):
356 * src/frontends/xforms/FormCopyright.C (build):
357 * src/frontends/xforms/FormError.C (build):
358 * src/frontends/xforms/FormGraphics.C (build):
359 * src/frontends/xforms/FormIndex.C (build):
360 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
361 * src/frontends/xforms/FormToc.C (build):
362 * src/frontends/xforms/FormUrl.C (build):
363 use the ButtonController correctly.
365 * src/frontends/xforms/FormCopyright.C (build):
366 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
367 the .fd file and into build().
369 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
371 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
373 * src/frontends/xforms/forms/form_citation.fd:
374 * src/frontends/xforms/forms/form_copyright.fd:
375 * src/frontends/xforms/forms/form_error.fd:
376 * src/frontends/xforms/forms/form_graphics.fd:
377 * src/frontends/xforms/forms/form_index.fd:
378 * src/frontends/xforms/forms/form_toc.fd:
379 * src/frontends/xforms/forms/form_url.fd:
380 renamed some of the objects. Named others explicitly for the first time.
381 Added Restore and Apply buttons where appropriate.
383 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
386 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
388 * src/version.h: try the pre2 again
390 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
392 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
394 * src/frontends/kde/FormParagraph.C: added using directive.
396 * src/frontends/kde/paradlg.C: added config.h and using directive.
398 * src/frontends/kde/paradlg.h: added std::qualifier.
400 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
402 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
404 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
406 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
408 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
410 * src/version.h: set back to 1.1.6cvs
412 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
414 * src/version.h: set to 1.1.6pre2
416 2000-11-20 Marko Vendelin <markov@ioc.ee>
418 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
420 * src/frontends/gnome/Makefile.am: updated list of XForms object files
422 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
424 * src/LColor.C (init):
425 * src/lyxrc.C (getDescription): changed some comments as suggested by
428 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
429 disconnect the redrawGUI signal in best-practice fashion.
431 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
432 long_opts_tab to reflect the change in name of this tabfolder, as
433 suggested by John Levon.
434 (connect, disconnect): new methods. Don't do much at present other than
435 ensuring that we can't resize the dialog. This just makes xforms go
437 (lots of methods in Colors): made void rather than bool. The idea is
438 to have an isOk() function that keeps track of whether any input is
439 genuinely invalid and should therefore block Save, Apply.
440 Easier to manipulate the counters rapidly.
441 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
442 compiler will like this code. Much cleaner way of doing things.
444 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
446 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
447 rather than simple counters, following suggestion by John Levon.
449 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
450 than engraved frame + text.
452 * src/frontends/xforms/forms/makefile: removed spurious command.
454 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
456 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
458 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
461 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
463 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
464 see what Lars has changed and what is just white space!
465 Now used X directly to ascertain the RGB color associated with the
467 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
469 Added some sort capability.
470 The X11 color name database input is only displayed if the database
471 isn't found in the standard place.
472 Got rid of struct compare_converter; it wasn't used.
473 Probably some other stuff that I've forgotten.
475 * src/frontends/xforms/FormPreferences.h: changed the names of some
476 methods in the Colors struct. Added a couple of structs to help sort
477 colors by name and by RGBColor.
479 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
480 functions into a new class RWInfo.
482 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
483 The dialog is now almost navigable using the keyboard. Unfortunately,
484 the cursor has to be inside a browser for it to be activated. There is
485 no visual feedback for the key shortcuts to the arrow keys (use
486 Alt-appropriate arrow key, Alt-x).
488 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
491 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
492 xform_helpers.[Ch]. See above.
494 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
496 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
498 * src/screen.C (setCursorColor): new method. Sets the color of the
500 (ShowManualCursor): call it.
501 Constify some local variables.
503 * src/LColor.[Ch] (LColor): add entry for cursor
504 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
507 2000-11-19 Juergen Vigna <jug@sad.it>
509 * src/insets/insettabular.C (draw): fixed text border redraw problem.
510 (calculate_dimensions_of_cells): try to boost up when inserting chars.
512 2000-11-15 Rob Lahaye <lahaye@postech.edu>
514 * lib/ui/default.ui: OptItem used for Fax entry
516 2000-11-17 Matej Cepl <cepl@bigfoot.com>
518 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
520 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
522 * src/vspace.C (nextToken): fix so it can handle length phrases like
523 "10mm+-20mm", "40inplus16mmminus10cm" etc.
525 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
527 * src/frontends/xforms/FormPreferences.C: constify several variables
528 (BrowserLyX): rewrite to not need the choice variable
529 (Modify): rewrite to not need the choide variable
530 (compare_converter): make operator const
532 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
533 correct the writing of \set_color
534 (getDescription): return a const string
536 * src/kbsequence.[Ch] (addkey): remove dead code
538 * src/Painter.C (text): remove some commented code
540 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
542 * src/ColorHandler.[Ch]: removed some header files from .h file.
543 Included LColor.h in .C file.
545 * src/LColor.[Ch]: made class copyable so that I could create a
546 system_lcolor instance.
548 * src/Painter.h: removed LColor.h.
550 * src/lyx_gui.C (create_forms): used AddName.
552 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
553 of user preferences/lyxrc file.
555 * src/lyxrc.C (output): output changes to lcolor.
557 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
559 Moved class xformColor to files xform_helpers.[Ch]. These files,
560 Color.[Ch], could now be moved into src if they would be useful to
563 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
564 Also moved FormPreferences::browseFile here as it can be used by any
565 xform dialog with a "Browse" button. FormGraphics is a perfect example.
567 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
568 ReadableFile): changed the FormPreferences methods a little and moved
569 them here as they'll be useful elsewhere also.
571 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
572 Removed some header files and used forward declarations instead.
574 Removed some methods as they'll be useful elsewhere (see above).
576 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
577 Can also now modify the LyX LColors. However, for reasons that I don't
578 yet understand, it appears that we can use
579 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
580 present. The problem appears to lie in ColorHandler, because I can
581 change the color using LColor.SetColor(). Similarly, when reading in a
582 preferences file with some set_color instances, I'll get a warning
583 like: Color sea green is undefined or may not be redefined
584 Bad lyxrc set_color for sea green
586 Once the buffer is loaded, however, I can happily change to this color.
588 Finally, it appears that I have to set the color of "inset frame"
589 explicitly, or it oscillates from "black" to "indian red" with each
592 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
594 * ANNOUNCE: corrected a spelling mistake.
596 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
599 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
601 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
603 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
606 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
607 match the requirements from the standard better. This is required
608 to work with gnu libstdc++-v3
610 * src/frontends/xforms/FormPreferences.C: add explict pair
611 arguments to browse calls. include support/lyxmanip.h remvoe
612 extern fmt. whitespace changes. reorder variables in
613 FormPreferences.h, to match initalizaton order.
615 * several files: constify more local variables.
617 * src/buffer.C: remove some commented functions.
619 * src/DepTable.C (remove_files_with_extension): temporary
620 work around for gcc 2.97
621 * src/filedlg.C (find): ditto
622 * src/Variables.C (set): ditto
623 * src/LyXAction.C (searchActionArg): ditto
624 (retrieveActionArg): ditto
626 * configure.in: check for mktemp too
628 * UPGRADING: prepare for 1.1.6
630 * Makefile.am (lgbtags): add backup tags for when etags are
631 different than usual.
633 * ANNOUNCE: prepare for 1.1.6
635 * src/support/tempname.C (make_tempfile): new function, wrapper
636 around mkstemp and mktemp. Only mkstemp has been tested.
639 2000-11-14 Rob Lahaye <lahaye@postech.edu>
641 * default.ui: capitalized some menu items to improve shortcuts.
643 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
645 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
647 * src/frontends/xforms/Dialogs.C: add "using" directive.
649 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
651 * src/filedlg.C (Select): highlight suggested file in browser, if
654 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
655 each tab folder is encapsulated in its own class.
656 The Language keymaps are now chosen using a text input and a
657 browser button, rather than a Combox.
658 All the browser buttons are now functional, although LyXFileDlg
659 still needs to be modified to make it straighhtforward to return a
660 directory if that is what is desired.
662 * src/frontends/xforms/forms/form_preferences.fd: use text input
663 and browse button to input the Language keymaps. Add a few
664 callbacks for the browse buttons.
666 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
668 * src/support/tempname.C (tempName): small changes to make it
669 safer. remove the '.' before XXXXXX
671 * src/support/filetools.C (TmpFileName): remove func
674 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
675 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
676 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
677 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
679 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
682 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
685 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
686 for bp (this fixes a reproducible hard crash)
688 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
691 * src/frontends/xforms/FormBase.h: make bp_ private
692 (FormBaseBI): remove default for bp
695 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
698 * src/frontends/xforms/Color.C (RGBColor): made several vars
699 const, changed initialization of j to allow it to be const
702 * several files: added const to local variables.
704 * src/lyx_cb.C: removed several function prototypes and moved them
708 (UpdateLayoutPreamble):
710 (MenuInsertLabel): add BufferView as arguemnt
711 (LayoutsCB): make tmp const
713 * src/layout_forms.h: regenerated
715 * src/debug.C: add Debug::FILES
716 (showLevel) (showTags): translate the desc
718 * src/debug.h: add FILES as debug target
720 * src/bufferlist.C: use current_view as an interim measure becuase
721 of added arguments to MenuWrite and MenuWriteAs
723 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
725 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
727 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
728 libstdc++ is compiled with.
730 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
732 * lib/layouts/docbook-book.layout
733 * lib/layouts/docbook.layout
734 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
735 those paragraphs are expresse as SGML comments <!-- -->.
737 * src/LaTeXFeatures.h
738 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
739 parameter, this allows to express all the include files as relative
740 paths to the master buffer. The verbatim insert works as the other
743 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
745 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
747 (MakeDocBookFile): top_element is always written. Some clean up, as
748 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
750 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
751 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
752 a reference is written instead of the name.
753 (Validate): use the relative path for the filename.
755 * src/insets/insetlabel.C (DocBook): write end tag, for XML
758 * src/support/filetools.h
759 * src/support/filetools.C (IsSGMLFilename): added.
762 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
764 * development/OS2/quick_fix.patch:
766 * README.OS2: quick update to the OS/2 port.
768 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
770 * src/converter.C: add "using" directive.
772 * src/frontends/xforms/FormPreferences.C: add "using" directive.
773 (compare_converter): add "int" as return type.
775 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
778 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
780 * src/lyx_gui.C (create_forms): map the xform colours, should a
781 mapping exist. Ie, call XformColor::read().
783 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
784 and struct HSV as HSVColor.
785 (XformColor::read, XformColor::write) : new methods that
786 input/output any changes to the cform GUI colors.
788 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
791 * src/frontends/xforms/FormPreferences.C Lots of little changes
792 associated with the changed name of the RGB and HSV structs. Can
793 now save changes to xforms GUI to file. Commented out
794 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
795 used currently anyway.
797 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
799 * src/converter.C: A lot of changes:
800 - It is no longer possible to choose between two or more ways to
801 export to some format (the new code uses only the shortest path).
802 However, it is still possible to choose between pdflatex/ps2pdf
803 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
804 - Added several methods that makes the FormPreferences code simpler.
805 - Changed the tokens $$FName and $$OutName to $$i and $$o.
807 * src/exporter.C (Export): lyxrc.use_pdf is set before
808 makeLaTeXFile is called. This works but not very nice.
810 * src/frontends/xforms/FormPreferences.C: The formats/converters
811 tabs are now fully functional.
813 * src/buffer.C (getTocList): Add numbers to the captions.
815 * lib/lyxrc.example: Removed fax section
817 * src/support/rename.C (rename): Delete the old file if lyx::copy
820 2000-11-13 Rob Lahaye <lahaye@postech.edu>
822 * lib/ui/default.ui: minor polishing.
824 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
826 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
829 * lib/Makefile.am (DOCINST): do not install everything in the
830 documentation directory.
832 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
834 * src/bufferlist.C (newFile): set the filename to the constructed
837 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
838 constructed "newfileXX.lyx" name to the dialog
840 * src/frontends/DialogBase.h: make update() non-abstract so
841 KDE doesn't need to implement two update methods for every form
843 * src/frontends/kde/Makefile.am: add missing xforms objects
846 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
848 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
850 * src/frontends/xforms/Color.[Ch]: new files, defining the color
851 structs RGB and HSV. May not be the best place for these files.
852 Perhaps move them into src ?
854 * src/frontends/xforms/Makefile.am: added new files.
856 * src/frontends/xforms/forms/form_preferences.fd:
857 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
858 replaced all instances of "colour" with "color"!
860 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
863 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
864 tab. Can now alter the colors of the xform's GUI on the fly. With
865 the aid of a single static Signal (see below), can "Apply" these
866 changes to all currently open dialogs. (Well, to all of the NEW
867 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
868 subsequently opened dialogs will, of course, also have the new
869 color scheme. Cannot yet save (or load) the choices to file, so
870 they are lost when exiting LyX.
872 * src/frontends/Dialogs.h:
873 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
874 Used to trigger a redraw of any dialogs connected to it because,
875 for example, the GUI colours have been re-mapped.
877 * src/frontends/xforms/FormBase.[Ch]:
878 * src/frontends/xforms/FormDocument.[Ch]:
879 * src/frontends/xforms/FormParagraph.[Ch]:
880 * src/frontends/xforms/FormPreferences.[Ch]:
881 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
882 method, to be connected to Dialogs::redrawGUI. Method must be
883 virtual, because dialogs with tabbed folders need to redraw the
884 forms of each tab folder.
886 * src/LyXView.C (d-tor):
887 * src/frontends/xforms/FormBase.C (d-tor): connected
888 Dialogs::redrawGUI signal to redraw().
890 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
891 removed Assert, because it is identical to that in FormBase.
893 2000-11-10 Rob Lahaye <lahaye@postech.edu>
895 * lib/ui/default.ui: minor polishing.
897 2000-11-10 Juergen Vigna <jug@sad.it>
899 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
900 (deleteLyXText): ditto
902 * src/insets/insettabular.C (InsetButtonPress): don't clear the
903 selection on mouse-button-3.
905 * src/insets/insettabular.h: new function clearSelection(), use this
906 functions inside insettabular.C.
908 * src/insets/insettabular.C (TabularFeatures): clear the selection
909 on remove_row/column.
911 * src/insets/inset.C (scroll): fixed some scroll stuff.
913 * src/insets/insettabular.C (draw): fixed another minor draw problem.
915 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
917 * lib/CREDITS: add Yves Bastide
919 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
921 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
922 check whether C library functions are in the global namespace.
924 * configure.in: calls it.
926 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
929 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
931 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
932 iterators to prevent crash.
934 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
936 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
938 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
939 shortcut for xforms CB to the preemptive or post-handler function.
941 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
942 removed the HIDDEN_TIMER as it's no longer used.
943 Various other small changes.
945 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
946 preemptive handler to obtain feedback, rather than the post-handler.
947 (ColoursLoadBrowser): find "black" and "white" based on RGB values
949 Formats tab is now complete. Converters tab is nearly so.
951 2000-11-09 Juergen Vigna <jug@sad.it>
953 * src/insets/insettext.C (~InsetText):
956 (SetParagraphData): set cache.second to 0 after deleting it!
957 (getLyXText): check if cache.second is not 0 if finding it.
959 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
961 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
962 lyxlex to parse the rgb.txt file.
965 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
966 replace the default '#' comment character.
968 * src/support/tempname.C: add "using" directive
969 * src/frontends/ButtonPolicies.C: ditto.
971 * src/support/filetools.C (DirList): add an explicit cast to avoid
972 a compile error (probably not the right fix)
974 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
976 * src/support/filetools.C (DirList): implement using system functions
978 * src/support/tempname.C: new file
980 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
982 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
984 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
987 * src/frontends/xforms/ButtonController.C: new file
989 * src/os2_defines.h: remove getcwd define
991 * src/lyxvc.C: include support/lyxlib.h
992 (showLog): use lyx::tempName
994 * src/lyx_cb.C: comment out includes that we don't need
995 (AutoSave): use lyx::tempName
997 * src/filedlg.C: include support/lyxlib.h
998 (Reread): use lyx::getcwd
1000 * src/converter.C: include support/filetools.h
1001 (add_options): change to static inline, make tail const
1002 (Add): make old_viewer const
1003 (GetAllFormats): make it a const method, use const_iterator
1004 (enable): make static inline
1005 (SplitFormat): make using_format const
1007 * src/LaTeX.C (run): use lyx::getcwd
1009 * configure.in: check for mkstemp as well
1011 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1013 * src/converter.[Ch] (GetAllCommands): new method.
1015 * src/support/filetools.[Ch] (DirList): new method.
1017 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1018 functionality to the converters tab.
1019 The formats tab is now nearly complete.
1020 The kbmap choices in Languages tab now display the contents of
1021 system_lyxdir/kbd/*.kmap in readable form.
1023 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1024 Moved some variables into the class.
1026 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1027 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1028 colour of active folder to lighter grey instead. Any takers?
1029 (form_colours): added an "Apply" button.
1030 (form_converters): added a "Flags" input field.
1031 (form_formats): added a "Shortcut" input field. Note that we can't use
1032 names such as "input_shortcut" as this buggers up the sed script stuff.
1034 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1042 * src/lyx_sendfax_main.C:
1045 * src/spellchecker.C:
1046 * src/insets/figinset.C:
1047 * src/insets/insetbib.C:
1048 * src/insets/insetexternal.C:
1049 * src/insets/insetinclude.C:
1050 * src/insets/insetinfo.C:
1051 * src/mathed/math_panel.C:
1052 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1053 all "daughter" dialogs now have identical "feel".
1055 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1057 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1058 used (and was only used in one place prior to this patch. Incorrectly!)
1060 * src/frontends/xforms/FormDocument.C: changed some instances of
1061 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1062 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1063 for options_->input_float_placement. This fixes a bug reported by
1066 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1067 functionality into d-tor.
1069 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1070 input of numerals also.
1072 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1073 fl_set_form_atclose(). Can now close dialog from window manager,
1074 fixing a bug reported by Rob Lahaye.
1076 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1078 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1079 are no longer dark. Haven't yet worked out how to lighten the colour of
1080 the active tabfolder. Any ideas anybody?
1081 Adjusted Colours tab a little.
1082 Added Shortcut field to converters tab. Note that we can't create an
1083 fdesign label like "input_shortcut" as this buggers up the sed-script
1086 * src/frontends/xforms/FormPreferences.[Ch]:
1087 (feedback): fixed crash due to to ob=0.
1088 (LanguagesXXX): the kbmap choices now contain the files
1089 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1090 be replaced by an input with a file browse button, but since the browse
1091 buttons don'y yet work, this'll do for the moment.
1092 (FormatsXXX): think that this is now nearly fully functional.
1093 Some points/questions though:
1094 1. Does "Apply" remove formats if no longer present?
1095 2. I think that the browser should list the GUI names rather than the
1097 3. Must ensure that we can't delete Formats used by an existing
1100 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1101 if this is the best way to do this.
1103 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1105 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1107 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1108 for variable assignment.
1110 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1112 * src/lib/ui/default.ui: added sub/superscripts to menu as
1113 Insert->Special characters and cleaned-up the file a bit
1115 2000-11-07 Allan Rae <rae@lyx.org>
1117 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1118 ob isn't 0 before using it. See comments in function.
1120 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1122 * src/frontends/xforms/form_*.C: regenerated
1124 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1126 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1128 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1129 compiling with gcc-2.96
1131 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1133 * src/support/lyxstring.C: add a couple "using" directives.
1135 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1136 a .c_str() here too for good measure.
1137 * src/Spacing.C (set): ditto.
1138 * src/lyxfunc.C (Dispatch): ditto.
1140 * src/insets/insettabular.C (copySelection): change .str() to
1141 .str().c_str() to fix problems with lyxstring.
1142 * src/support/filetools.C (GetFileContents): ditto.
1143 * src/buffer.C (asciiParagraph): ditto.
1144 * src/paragraph.C (String): ditto.
1146 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1147 * lib/bind/sciword.bind: ditto.
1149 * src/LyXAction.C (init): remove "symbol-insert" function, which
1150 shared LFUN_INSERT_MATH with "math-insert".
1152 * lib/configure.m4: == is not a valid operator for command test.
1154 * src/lyxrc.C: add using directive.
1156 * src/converter.h: add std:: qualifier.
1158 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1160 * src/converter.[Ch] and other files: Change the Format class to a
1161 real class, and create two instances: formats and system_format.
1163 * src/lyxrc.C (output): Output the difference between formats and
1166 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1167 (buildFormats): Insert formats into browser.
1168 (inputFormats): Made the browser and add button functional.
1169 (applyFormats): Update formats from format_vec.
1171 * src/converter.C: Changed all (*it). to it->
1172 (Format::dummy): New method.
1173 (Format::importer): New format flag.
1174 (Formats::GetAllFormats): New method.
1175 (Formats::Add): Delete format from the map if prettyname is empty.
1176 (Converter::Convert): Print an error message if moving the file fails.
1177 (Converter::GetReachableTo): New method
1179 * src/MenuBackend.[Ch]: Add support for importformats tag.
1181 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1183 * lib/configure.m4: Add word->tex and ps->fax converters.
1185 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1186 Return fax to file menu.
1190 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1192 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1195 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1198 * src/lyxfunc.C (processKeyEvent): removed
1200 * src/bufferlist.C (emergencyWrite): removed the out commented
1201 emergency write code.
1203 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1205 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1207 * many files: change formatting to be a bit more uniform for
1208 if,while,for,switch statements, remove some parantesis not needed.
1211 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1213 * config/kde.m4: make config more robust when KDEDIR is set
1215 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1217 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1218 not returned a pixmap for "math-insert".
1220 * src/LyXAction.C (init): sort the entries a bit.
1222 2000-11-03 Juergen Vigna <jug@sad.it>
1224 * src/insets/insettabular.h: added fixed number to update codes so
1225 that update is only in one direction.
1227 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1230 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1231 before call to edit because of redraw.
1233 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1235 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1237 * lib/ui/default.ui: Populate "edit_float" menu
1239 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1241 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1242 "floats-operate". The name is ugly (and the func also), but this
1243 is just a band-aid until we switch to new insets.
1245 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1247 * lib/ui/default.ui: update again the menu layout (fix some
1250 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1252 * src/MenuBackend.h (fulllabel): new method.
1254 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1255 the menu shortcuts of a menu are unique and whether they
1256 correspond to a letter of the label.
1257 (expand): call checkShortcuts when debugging.
1259 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1261 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1263 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1265 * lib/examples/*.lyx : '\language default' => '\language english'
1267 * lib/examples/it_splash.lyx : except where it should be italian
1269 * lib/templates/*.lyx : the same
1271 * doc/*.lyx* : the same
1273 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1275 * lib/bind/menus.bind: remove the Layout menu entries, which I
1276 somehow forgot earlier.
1278 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1280 * lib/ui/old-default.ui: keep the old one here for reference (to
1283 * lib/ui/default.ui: update the menu layout
1285 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1287 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1288 Can now Apply to different insets without closing the dialog.
1290 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1291 Can't actually DO anything with them yet, but I'd like a little
1294 * src/frontends/xforms/input_validators.[ch]
1295 (fl_lowercase_filter): new.
1297 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1299 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1300 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1302 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1304 2000-11-02 Juergen Vigna <jug@sad.it>
1306 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1307 on char insertion as it has already be updated by bv->updateInset().
1309 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1310 if an inset inside was updated.
1312 * lib/configure.cmd: commented out fax-search code
1314 2000-11-01 Yves Bastide <stid@acm.org>
1316 * src/tabular.C (OldFormatRead): set tabular language to the
1319 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1321 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1322 class names with non-letter characters (from Yves Bastide).
1324 * lib/ui/default.ui: change Item to OptItem in import menu.
1325 Comment out fax stuff.
1327 * lib/configure.m4: comment out fax-related stuff.
1329 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1331 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1332 useful xforms helper functions. At present contains only formatted().
1333 Input a string and it returns it with line breaks so that in fits
1336 * src/frontends/xforms/Makefile.am: add new files.
1338 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1339 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1342 * src/frontends/xforms/FormPreferences.[Ch]:
1343 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1344 but lots of little clean ups. Removed enum State. Make use of
1345 formatted(). Constify lots of methods. Perhaps best of all: removed
1346 requirement for that horrible reinterpret_cast from pointer to long in
1349 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1351 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1352 conditionalize build on xforms < 0.89
1354 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1356 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1358 * src/LyXAction.C (init): comment out fax
1360 * src/lyxrc.h: comment out the fax enums
1361 comment out the fax variables
1363 * src/commandtags.h: comment out LFUN_FAX
1365 * src/lyxrc.C: disable fax variables.
1366 (read): disable parsing of fax variables
1367 (output): disable writing of fax variables
1368 (getFeedback): now description for fax variables
1370 * src/lyxfunc.C: comment out MenuFax
1371 (Dispatch): disable LFUN_FAX
1373 * src/lyx_cb.C (MenuFax): comment out
1375 * src/WorkArea.C: add <cctype>
1376 (work_area_handler): better key handling, should be ok now.
1377 for accented chars + etc
1379 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1380 lyx_sendfax.h and lyx_sendfax_man.C
1382 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1383 (show): don't call InitLyXLookup when using xforms 0.89
1385 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1387 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1389 * src/support/filetools.C (GetFileContents): close to dummy change
1391 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1393 * src/trans.C (AddDeadkey): workaround stupid compilers.
1395 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1397 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1398 of two-sided document.
1400 2000-10-31 Juergen Vigna <jug@sad.it>
1402 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1404 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1405 xposition to the Edit call.
1407 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1409 * src/trans.C (AddDeadkey): cast explicitly to char.
1411 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1413 * src/tabular.C (AsciiBottomHLine): simplify?
1414 (AsciiTopHLine): simplify?
1415 (print_n_chars): simplify
1416 (DocBook): remove most of the << endl; we should flush the stream
1417 as seldom as possible.
1419 (TeXBottomHLine): ditto
1420 (TeXTopHLine): ditto
1422 (write_attribute): try a templified version.
1423 (set_row_column_number_info): lesson scope of variables
1425 * src/support/lstrings.h (tostr): new specialization of tostr
1427 * src/trans.C (AddDeadkey): slightly cleaner fix.
1429 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1431 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1432 '%%' in Toc menu labels.
1435 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1436 font_norm is iso10646-1.
1438 * src/font.C (ascent): Fixed for 16bit fonts
1439 (descent,lbearing,rbearing): ditto
1441 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1443 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1444 (getFeedback): new static method.
1446 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1447 Now use combox rather than choice to display languages.
1448 Feedback is now output using a new timer callback mechanism, identical
1449 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1451 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1453 * src/minibuffer.C: fix for older compilers
1455 2000-10-30 Juergen Vigna <jug@sad.it>
1457 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1458 has to be Left of the inset otherwise LyXText won't find it!
1460 * src/BufferView2.C (open_new_inset): delete the inset if it can
1463 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1465 * lyx.man: fix typo.
1467 2000-10-29 Marko Vendelin <markov@ioc.ee>
1468 * src/frontends/gnome/FormCitation.C
1469 * src/frontends/gnome/FormCitation.h
1470 * src/frontends/gnome/FormCopyright.C
1471 * src/frontends/gnome/FormCopyright.h
1472 * src/frontends/gnome/FormError.C
1473 * src/frontends/gnome/FormError.h
1474 * src/frontends/gnome/FormIndex.C
1475 * src/frontends/gnome/FormIndex.h
1476 * src/frontends/gnome/FormPrint.C
1477 * src/frontends/gnome/FormPrint.h
1478 * src/frontends/gnome/FormRef.C
1479 * src/frontends/gnome/FormRef.h
1480 * src/frontends/gnome/FormToc.C
1481 * src/frontends/gnome/FormToc.h
1482 * src/frontends/gnome/FormUrl.C
1483 * src/frontends/gnome/FormUrl.h
1484 * src/frontends/gnome/Menubar_pimpl.C
1485 * src/frontends/gnome/mainapp.C
1486 * src/frontends/gnome/mainapp.h
1487 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1488 changing update() to updateSlot() where appropriate
1490 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1492 * src/frontends/xforms/FormPreferences.[Ch]:
1493 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1496 2000-10-28 Juergen Vigna <jug@sad.it>
1498 * src/insets/insettabular.C (draw): fixed drawing bug.
1500 * src/insets/insettext.C (clear):
1502 (SetParagraphData): clearing the TEXT buffers when deleting the
1503 paragraphs used by it.
1505 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1507 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1509 2000-10-27 Juergen Vigna <jug@sad.it>
1511 * src/tabular.C (~LyXTabular): removed not needed anymore.
1513 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1516 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1518 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1521 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1524 * src/frontends/xforms/FormPreferences.[Ch]:
1525 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1526 Reorganised as modules based on tabs. Much easier to follow the
1527 flow and to add new tabs. Added warning and feedback messages.
1530 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1532 * src/tabular.h (DocBook): add std:: qualifier.
1534 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1536 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1537 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1540 * insettabular.C (DocBook): uses the tabular methods to export
1543 * src/insets/insettext.h
1544 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1546 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1548 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1551 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1552 moved misplaced AllowInput two lines up.
1554 * src/buffer.C (readFile): compare float with float, not with int
1556 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1558 * src/minibuffer.C: add "using SigC::slot" statement.
1560 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1562 * src/frontends/xforms/forms/README: updated section about make.
1564 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1565 Tidied some forms up, made two of form_tabular's tabs more
1566 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1567 fixed translation problem with "Column".
1569 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1571 * src/minibuffer.h: use Timeout instead of the xforms timer
1573 (setTimer) rewrite for the Timeout, change to unsigned arg
1574 (set): change to unsigned timer arg
1577 * src/minibuffer.C (TimerCB): removed func
1578 (C_MiniBuffer_TimerCB): removed func
1579 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1580 (peek_event): use a switch statement
1581 (add): don't use fl_add_timer.
1582 (Set): rewrite to use the Timeout
1585 * src/Timeout.[Ch] (setType): return a Timeout &
1586 (setTimeout): ditto, change to unsigned arg for timeout
1588 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1590 * src/mathed/formula.C (mathed_string_width): Use string instead
1591 of a constant size char array.
1593 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1595 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1596 the two recently added operator<< for SMInput and State.
1598 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1600 (OkCancelPolicy): ditto
1601 (OkCancelReadOnlyPolicy): ditto
1602 (NoRepeatedApplyReadOnlyPolicy): ditto
1603 (OkApplyCancelReadOnlyPolicy): ditto
1604 (OkApplyCancelPolicy): ditto
1605 (NoRepeatedApplyPolicy): ditto
1607 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1609 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1610 add the usual std:: qualifiers.
1612 2000-10-25 Juergen Vigna <jug@sad.it>
1614 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1616 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1618 * src/support/filetools.C (MakeRelPath): change some types to
1621 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1622 ButtonPolicy::SMInput and ButtonPolicy::State.
1624 * src/FontLoader.C (reset): small cleanup
1625 (unload): small cleanup
1627 * src/FontInfo.C (getFontname): initialize error to 10000.0
1629 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1631 * src/frontends/xforms/FormPreferences.[Ch]:
1632 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1633 TeX encoding and default paper size sections.
1635 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1637 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1640 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1641 make the message_ empty.
1642 (FormError): don't initialize message_ in initializer list.
1644 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1646 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1648 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1650 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1652 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1654 * src/frontends/kde/*data.[Ch]: _("") is not
1657 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1659 * src/buffer.C: removed redundant using directive.
1661 * src/frontends/DialogBase.h: revert to original definition of
1664 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1665 stuff into two classes, one for each dialog, requires a new
1666 element in the dialogs vector, FormTabularCreate.
1668 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1671 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1672 method. Continues Allan's idea, but means that derived classes
1673 don't need to worry about "update or hide?".
1675 * src/frontends/xforms/FormError.C (showInset): add connection
1678 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1679 one for each dialog. FormTabular now contains main tabular dialog
1682 * src/frontends/xforms/FormTabularCreate.[Ch]:
1683 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1686 * src/frontends/xforms/FormGraphics.[Ch]:
1687 * src/frontends/xforms/forms/form_graphics.fd
1688 * src/frontends/xforms/FormTabular.[Ch]:
1689 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1690 classes of FormInset.
1692 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1693 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1695 * src/frontends/xforms/Makefile.am:
1696 * src/frontends/xforms/forms/makefile: added new files.
1698 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1699 variable. added Signal0 hide signal, in keeping with other GUI-I
1702 * src/support/lstrings.h: removed redundant std:: qualifier as
1703 it's already declared in Lsstream.h.
1705 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1707 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1711 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1713 * src/tabular.C (Ascii): minimize scope of cell.
1715 * src/BufferView2.C (nextWord): return string() instead of 0;
1717 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1719 * src/converter.h: add a std:: qualifier
1721 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1723 * src/importer.[Ch]: New files. Used for importing files into LyX.
1725 * src/lyxfunc.C (doImport): Use the new Importer class.
1727 * src/converter.h: Add shortcut member to the Format class.
1728 Used for holding the menu shortcut.
1730 * src/converter.C and other files: Made a distinction between
1731 format name and format extension. New formats can be defined using
1732 the \format lyxrc tag.
1733 Added two new converter flags: latex and disable.
1735 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1737 * src/support/lyxlib.h: unify namespace/struct implementation.
1738 Remove extra declarations.
1740 * src/support/chdir.C (chdir): remove version taking char const *
1742 * src/support/rename.C: ditto.
1743 * src/support/lyxsum.C: ditto.
1745 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1747 * src/frontends/xforms/FormBase.[Ch]:
1748 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1749 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1750 work only for the next call to fl_show_form(). The correct place to set
1751 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1752 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1753 from FormBase have the minimum size set; no more stupid crashes with
1756 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1758 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1760 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1762 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1764 * src/support/lyxlib.h: changed second argument of mkdir to
1765 unsigned long int (unsigned int would probably have been enough,
1766 but...). Removed <sys/types.h> header.
1767 * src/support/mkdir.C (mkdir): ditto.
1771 2000-10-19 Juergen Vigna <jug@sad.it>
1773 * src/lyxfunc.C (MenuNew): small fix (form John)
1775 * src/screen.C (Update): removed unneeded code.
1777 * src/tabular.C (Ascii): refixed int != uint bug!
1779 * src/support/lyxlib.h: added sys/types.h include for now permits
1780 compiling, but I don't like this!
1782 2000-10-18 Juergen Vigna <jug@sad.it>
1784 * src/text2.C (ClearSelection): if we clear the selection we need
1785 more refresh so set the status apropriately
1787 * src/insets/insettext.C (draw): hopefully finally fixed draw
1790 2000-10-12 Juergen Vigna <jug@sad.it>
1792 * src/insets/insettext.C (draw): another small fix and make a block
1793 so that variables are localized.
1795 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1797 * src/support/lstrings.C (lowercase, uppercase):
1798 use explicit casts to remove compiler warnings.
1800 * src/support/LRegex.C (Impl):
1801 * src/support/StrPool.C (add):
1802 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1803 (AddPath, MakeDisplayPath):
1804 * src/support/lstrings.C (prefixIs, subst):
1805 use correct type to remove compiler warnings.
1807 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1809 * src/support/lyxlib.h:
1810 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1811 portability and to remove compiler warning with DEC cxx.
1813 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1815 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1817 * src/minibuffer.C (peek_event): retun 1 when there has been a
1818 mouseclick in the minibuffer.
1822 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1824 * src/frontends/xforms/FormParagraph.C: more space above/below
1827 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1829 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1830 a char only if real_current_font was changed.
1832 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1834 * NEWS: update somewhat for 1.1.6
1836 * lib/ui/default.ui: clean up.
1838 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1840 * lib/CREDITS: clean up
1842 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1844 * src/combox.[Ch] (select): changed argument back to int
1845 * src/combox.C (peek_event): removed num_bytes as it is declared but
1848 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1849 modified calls to Combox::select() to remove warnings about type
1852 * src/insets/insetbutton.C (width): explicit cast to remove warning
1853 about type conversion.
1855 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1858 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1859 sel_pos_end, refering to cursor position are changed to
1860 LyXParagraph::size_type.
1862 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1863 consistent with LyXCursor::pos().
1864 (inset_pos): changed to LyXParagraph::size_type for same reason.
1866 * src/insets/insettext.C (resizeLyXText): changed some temporary
1867 variables refing to cursor position to LyXParagraph::size_type.
1869 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1871 * src/frontends/kde/<various>: The Great Renaming,
1874 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1876 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1878 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1880 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1881 0 when there are no arguments.
1883 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1885 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1886 to segfaults when pressing Ok in InsetBibtex dialog.
1888 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1890 * forms/layout_forms.fd:
1891 * src/layout_forms.C (create_form_form_character): small change to use
1892 labelframe rather than engraved frame + text
1894 * src/lyx_gui.C (create_forms): initialise choice_language with some
1895 arbitrary value to prevent segfault when dialog is shown.
1897 2000-10-16 Baruch Even <baruch.even@writeme.com>
1899 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1900 is no resulting file. This pertains only to LaTeX output.
1902 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1904 * src/text.C (Backspace): Make sure that the row of the cursor is
1907 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1910 * src/lyx_gui.C (init): Prevent a crash when only one font from
1911 menu/popup fonts is not found.
1913 * lib/lyxrc.example: Add an example for binding a key for language
1916 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1918 * src/converter.C (GetReachable): Changed the returned type to
1920 (IsReachable): New method
1922 * src/MenuBackend.C (expand): Handle formats that appear more
1925 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1927 * src/frontends/support/Makefile.am
1928 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1931 * lib/CREDITS: add Garst Reese.
1933 * src/support/snprintf.h: add extern "C" {} around the definitions.
1935 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1937 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1940 * src/frontends/xforms/FormDocument.C:
1941 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1942 compile without "conversion to integral type of smaller size"
1945 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1947 * src/text.C (GetColumnNearX): Fixed disabled code.
1949 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1951 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1954 * src/support/snprintf.[ch]: new files
1956 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1958 * src/frontends/kde/formprintdialog.C: add
1959 file browser for selecting postscript output
1961 * src/frontends/kde/formprintdialogdata.C:
1962 * src/frontends/kde/formprintdialogdata.h: re-generate
1965 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1967 * src/frontends/gnome/Makefile.am:
1968 * src/frontends/kde/Makefile.am: FormCommand.C
1969 disappeared from xforms
1971 * src/frontends/kde/FormCitation.C:
1972 * src/frontends/kde/FormIndex.C: read-only
1975 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1977 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1980 * src/bufferlist.C: add using directive.
1982 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1984 * src/support/lyxfunctional.h: version of class_fun for void
1985 returns added, const versions of back_inseter_fun and compare_fun
1988 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1990 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1992 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1994 * ChangeLog: cleanup.
1996 * lib/CREDITS: update to add all the contributors we've forgotten.
1997 I have obviously missed some, so tell me whether there were
2000 2000-10-13 Marko Vendelin <markov@ioc.ee>
2002 * src/frontends/gnome/FormCitation.C
2003 * src/frontends/gnome/FormCitation.h
2004 * src/frontends/gnome/FormError.C
2005 * src/frontends/gnome/FormIndex.C
2006 * src/frontends/gnome/FormRef.C
2007 * src/frontends/gnome/FormRef.h
2008 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2010 * src/frontends/gnome/FormCitation.C
2011 * src/frontends/gnome/FormCopyright.C
2012 * src/frontends/gnome/FormError.C
2013 * src/frontends/gnome/FormIndex.C
2014 * src/frontends/gnome/FormRef.C
2015 * src/frontends/gnome/FormToc.C
2016 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2019 * src/frontends/gnome/Menubar_pimpl.C
2020 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2023 2000-10-11 Baruch Even <baruch.even@writeme.com>
2026 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2027 to convey its real action.
2029 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2030 clear the minibuffer and prepare to enter a command.
2032 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2033 the rename from ExecCommand to PrepareForCommand.
2034 * src/lyxfunc.C (Dispatch): ditto.
2036 2000-10-11 Baruch Even <baruch.even@writeme.com>
2038 * src/buffer.C (writeFile): Added test for errors on writing, this
2039 catches all errors and not only file system full errors as intended.
2041 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2043 * src/lyx_gui.C (create_forms): better fix for crash with
2044 translated interface.
2046 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2048 * src/frontends/kde/Makefile.am:
2049 * src/frontends/kde/FormCopyright.C:
2050 * src/frontends/kde/formcopyrightdialog.C:
2051 * src/frontends/kde/formcopyrightdialog.h:
2052 * src/frontends/kde/formcopyrightdialogdata.C:
2053 * src/frontends/kde/formcopyrightdialogdata.h:
2054 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2055 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2056 copyright to use qtarch
2058 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2060 * src/encoding.C (read): Fixed bug that caused an error message at
2061 the end of the file.
2063 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2065 * lib/lyxrc.example: Fixed hebrew example.
2067 2000-10-13 Allan Rae <rae@lyx.org>
2069 * src/frontends/xforms/FormPreferences.C (input): reworking the
2071 (build, update, apply): New inputs in various tabfolders
2073 * src/frontends/xforms/FormToc.C: use new button policy.
2074 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2075 dialogs that either can't use any existing policy or where it just
2078 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2081 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2082 added a bool parameter which is ignored.
2084 * src/buffer.C (setReadonly):
2085 * src/BufferView_pimpl.C (buffer):
2086 * src/frontends/kde/FormCopyright.h (update):
2087 * src/frontends/kde/FormCitation.[Ch] (update):
2088 * src/frontends/kde/FormIndex.[Ch] (update):
2089 * src/frontends/kde/FormPrint.[Ch] (update):
2090 * src/frontends/kde/FormRef.[Ch] (update):
2091 * src/frontends/kde/FormToc.[Ch] (update):
2092 * src/frontends/kde/FormUrl.[Ch] (update):
2093 * src/frontends/gnome/FormCopyright.h (update):
2094 * src/frontends/gnome/FormCitation.[Ch] (update):
2095 * src/frontends/gnome/FormError.[Ch] (update):
2096 * src/frontends/gnome/FormIndex.[Ch] (update):
2097 * src/frontends/gnome/FormPrint.[Ch] (update):
2098 * src/frontends/gnome/FormRef.h (update):
2099 * src/frontends/gnome/FormToc.[Ch] (update):
2100 * src/frontends/gnome/FormUrl.[Ch] (update):
2101 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2102 to updateBufferDependent and DialogBase
2104 * src/frontends/xforms/FormCitation.[hC]:
2105 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2106 * src/frontends/xforms/FormError.[Ch]:
2107 * src/frontends/xforms/FormGraphics.[Ch]:
2108 * src/frontends/xforms/FormIndex.[Ch]:
2109 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2110 and fixed readOnly handling.
2111 * src/frontends/xforms/FormPrint.[Ch]:
2112 * src/frontends/xforms/FormRef.[Ch]:
2113 * src/frontends/xforms/FormTabular.[Ch]:
2114 * src/frontends/xforms/FormToc.[Ch]:
2115 * src/frontends/xforms/FormUrl.[Ch]:
2116 * src/frontends/xforms/FormInset.[Ch]:
2117 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2118 form of updateBufferDependent.
2120 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2121 if form()->visible just in case someone does stuff to the form in a
2124 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2125 the buttoncontroller for everything the enum used to be used for.
2126 (update) It would seem we need to force all dialogs to use a bool
2127 parameter or have two update functions. I chose to go with one.
2128 I did try removing update() from here and FormBase and defining the
2129 appropriate update signatures in FormBaseB[DI] but then ran into the
2130 problem of the update() call in FormBase::show(). Whatever I did
2131 to get around that would require another function and that just
2132 got more confusing. Hence the decision to make everyone have an
2133 update(bool). An alternative might have been to override show() in
2134 FormBaseB[DI] and that would allow the different and appropriate
2137 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2138 true == buffer change occurred. I decided against using a default
2139 template parameter since not all compilers support that at present.
2141 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2143 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2144 army knife" by removing functionality.
2145 (clearStore): removed. All such housekeeping on hide()ing the dialog
2146 is to be carried out by overloaded disconnect() methods.
2147 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2148 superceded by Baruch's neat test (FormGraphics) to update an existing
2149 dialog if a new signal is recieved rather than block all new signals
2151 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2152 only to Inset dialogs.
2153 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2154 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2156 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2158 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2159 as a base class to all inset dialogs. Used solely to connect/disconnect
2160 the Inset::hide signal and to define what action to take on receipt of
2161 a UpdateBufferDependent signal.
2162 (FormCommand): now derived from FormInset.
2164 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2167 * src/frontends/xforms/FormCopyright.[Ch]:
2168 * src/frontends/xforms/FormPreferences.[Ch]:
2169 now derived from FormBaseBI.
2171 * src/frontends/xforms/FormDocument.[Ch]:
2172 * src/frontends/xforms/FormParagraph.[Ch]:
2173 * src/frontends/xforms/FormPrint.[Ch]:
2174 now derived from FormBaseBD.
2176 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2178 * src/frontends/xforms/FormCitation.[Ch]:
2179 * src/frontends/xforms/FormError.[Ch]:
2180 * src/frontends/xforms/FormRef.[Ch]:
2181 * src/frontends/xforms/FormToc.[Ch]:
2182 (clearStore): reworked as disconnect().
2184 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2187 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2189 * src/converter.C (runLaTeX): constify buffer argument
2192 * src/frontends/support/Makefile.am (INCLUDES): fix.
2194 * src/buffer.h: add std:: qualifier
2195 * src/insets/figinset.C (addpidwait): ditto
2196 * src/MenuBackend.C: ditto
2197 * src/buffer.C: ditto
2198 * src/bufferlist.C: ditto
2199 * src/layout.C: ditto
2200 * src/lyxfunc.C: ditto
2202 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2204 * src/lyxtext.h (bidi_level): change return type to
2205 LyXParagraph::size_type.
2207 * src/lyxparagraph.h: change size_type to
2208 TextContainer::difference_type. This should really be
2209 TextContainer::size_type, but we need currently to support signed
2212 2000-10-11 Marko Vendelin <markov@ioc.ee>
2213 * src/frontends/gnome/FormError.h
2214 * src/frontends/gnome/FormRef.C
2215 * src/frontends/gnome/FormRef.h
2216 * src/frontends/gnome/FormError.C
2217 * src/frontends/gnome/Makefile.am
2218 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2219 to Gnome frontend. Both dialogs use "action" area.
2221 2000-10-12 Baruch Even <baruch.even@writeme.com>
2223 * src/graphics/GraphicsCacheItem_pimpl.C:
2224 * src/graphics/Renderer.C:
2225 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2228 2000-10-12 Juergen Vigna <jug@sad.it>
2230 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2231 visible when selecting).
2233 * development/Code_rules/Rules: fixed some typos.
2235 2000-10-09 Baruch Even <baruch.even@writeme.com>
2237 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2238 compiling on egcs 1.1.2 possible.
2240 * src/filedlg.C (comp_direntry::operator() ): ditto.
2242 2000-08-31 Baruch Even <baruch.even@writeme.com>
2244 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2247 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2248 transient it now only gets freed when the object is destructed.
2250 2000-08-24 Baruch Even <baruch.even@writeme.com>
2252 * src/frontends/FormGraphics.h:
2253 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2256 2000-08-20 Baruch Even <baruch.even@writeme.com>
2258 * src/insets/insetgraphics.C:
2259 (draw): Added messages to the drawn rectangle to report status.
2260 (updateInset): Disabled the use of the inline graphics,
2263 2000-08-17 Baruch Even <baruch.even@writeme.com>
2265 * src/frontends/support: Directory added for the support of GUII LyX.
2267 * src/frontends/support/LyXImage.h:
2268 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2271 * src/frontends/support/LyXImage_X.h:
2272 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2273 version of LyXImage, this uses the Xlib Pixmap.
2275 * src/PainterBase.h:
2276 * src/PainterBase.C:
2278 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2279 replacement to Pixmap.
2281 * src/insets/insetgraphics.h:
2282 * src/insets/insetgraphics.C:
2283 * src/graphics/GraphicsCacheItem.h:
2284 * src/graphics/GraphicsCacheItem.C:
2285 * src/graphics/GraphicsCacheItem_pimpl.h:
2286 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2289 * src/graphics/GraphicsCacheItem.h:
2290 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2291 another copy of the object.
2293 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2294 of cacheHandle, this fixed a bug that sent LyX crashing.
2296 * src/graphics/XPM_Renderer.h:
2297 * src/graphics/XPM_Renderer.C:
2298 * src/graphics/EPS_Renderer.h:
2299 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2301 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2303 * src/lyxfunc.C (processKeySym): only handle the
2304 lockinginset/inset stuff if we have a buffer and text loaded...
2306 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2308 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2310 * src/support/lyxfunctional.h: add operator= that takes a reference
2312 * src/lyxserver.C (mkfifo): make first arg const
2314 * src/layout.h: renamed name(...) to setName(...) to work around
2317 * src/buffer.C (setFileName): had to change name of function to
2318 work around bugs in egcs. (renamed from fileName)
2320 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2322 * src/support/translator.h: move helper template classes to
2323 lyxfunctional.h, include "support/lyxfunctional.h"
2325 * src/support/lyxmanip.h: add delaration of fmt
2327 * src/support/lyxfunctional.h: new file
2328 (class_fun_t): new template class
2329 (class_fun): helper template function
2330 (back_insert_fun_iterator): new template class
2331 (back_inserter_fun): helper template function
2332 (compare_memfun_t): new template class
2333 (compare_memfun): helper template function
2334 (equal_1st_in_pair): moved here from translator
2335 (equal_2nd_in_pair): moved here from translator
2337 * src/support/fmt.C: new file
2338 (fmt): new func, can be used for a printf substitute when still
2339 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2341 * src/support/StrPool.C: add some comments
2343 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2346 * src/insets/figinset.C (addpidwait): use std::copy with
2347 ostream_iterator to fill the pidwaitlist
2349 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2351 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2354 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2357 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2359 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2360 (class_update): ditto
2361 (BulletPanel): ditto
2362 (CheckChoiceClass): move initialization of tc and tct
2364 * src/tabular.C: remove current_view
2365 (OldFormatRead): similar to right below [istream::ignore]
2367 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2368 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2369 unused [istream::ignore]
2371 * src/lyxfunc.C: include "support/lyxfunctional.h"
2372 (getInsetByCode): use std::find_if and compare_memfun
2374 * src/lyxfont.C (stateText): remove c_str()
2376 * src/lyx_main.C (setDebuggingLevel): make static
2377 (commandLineHelp): make static
2379 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2380 Screen* together with fl_get_display() and fl_screen
2382 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2383 togheter with fl_get_display() and fl_screen
2384 (create_forms): remove c_str()
2386 * src/layout.C: include "support/lyxfunctional.h"
2387 (hasLayout): use std::find_if and compare_memfun
2388 (GetLayout): use std::find_if and comapre_memfun
2389 (delete_layout): use std::remove_if and compare_memfun
2390 (NumberOfClass): use std:.find_if and compare_memfun
2392 * src/gettext.h: change for the new functions
2394 * src/gettext.C: new file, make _(char const * str) and _(string
2395 const & str) real functions.
2397 * src/font.C (width): rewrite slightly to avoid one extra variable
2399 * src/debug.C: initialize Debug::ANY here
2401 * src/commandtags.h: update number comments
2403 * src/combox.h (get): make const func
2405 (getline): make const
2407 * src/combox.C (input_cb): handle case where fl_get_input can
2410 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2411 "support/lyxfunctional.h", remove current_view variable.
2412 (resize): use std::for_each with std::mem_fun
2413 (getFileNames): use std::copy with back_inserter_fun
2414 (getBuffer): change arg type to unsigned int
2415 (emergencyWriteAll): call emergencyWrite with std::for_each and
2417 (emergencyWrite): new method, the for loop in emergencyWriteAll
2419 (exists): use std::find_if with compare_memfun
2420 (getBuffer): use std::find_if and compare_memfun
2422 * src/buffer.h: add typedefs for iterator_category, value_type
2423 difference_type, pointer and reference for inset_iterator
2424 add postfix ++ for inset_iterator
2425 make inset_iterator::getPos() const
2427 * src/buffer.C: added support/lyxmanip.h
2428 (readFile): use lyxerr << fmt instead of printf
2429 (makeLaTeXFile): use std::copy to write out encodings
2431 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2433 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2434 free and the char * temp.
2435 (hasMenu): use std::find_if and compare_memfun
2438 * src/Makefile.am (lyx_SOURCES): added gettext.C
2440 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2441 string::insert small change to avoid temporary
2443 * src/LColor.C (getGUIName): remove c_str()
2445 * several files: change all occurrences of fl_display to
2448 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2449 that -pedantic is not used for gcc 2.97 (cvs gcc)
2451 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2453 2000-10-11 Allan Rae <rae@lyx.org>
2455 * src/frontends/xforms/FormPreferences.C (input): template path must be
2456 a readable directory. It doesn't need to be writeable.
2457 (build, delete, update, apply): New inputs in the various tabfolders
2459 * src/frontends/xforms/forms/form_preferences.fd:
2460 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2461 several new entries to existing folders. Shuffled some existing stuff
2464 * src/frontends/xforms/forms/form_print.fd:
2465 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2466 Should probably rework PrinterParams as well. Note that the switch to
2467 collated is effectively the same as !unsorted so changing PrinterParams
2468 will require a lot of fiddly changes to reverse the existing logic.
2470 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2472 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2474 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2476 2000-10-10 Allan Rae <rae@lyx.org>
2479 * src/lyxfunc.C (Dispatch):
2481 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2484 * src/lyxrc.C (output): Only write the differences between system lyxrc
2485 and the users settings.
2488 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2490 I'll rewrite this later, after 1.1.6 probably, to keep a single
2491 LyXRC but two instances of a LyXRCStruct.
2493 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2495 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2497 * src/tabular.h: add a few std:: qualifiers.
2499 * src/encoding.C: add using directive.
2500 * src/language.C: ditto.
2502 * src/insets/insetquotes.C (Validate): use languages->lang()
2503 instead of only language.
2505 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2507 * lib/languages: New file.
2509 * lib/encodings: New file.
2511 * src/language.C (Languages): New class.
2512 (read): New method. Reads the languages from the 'languages' file.
2514 * src/encoding.C (Encodings): New class.
2515 (read): New method. Reads the encodings from the 'encodings' file.
2517 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2520 * src/bufferparams.h and a lot of files: Deleted the member language,
2521 and renamed language_info to language
2523 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2524 * src/lyxfont.C (latexWriteStartChanges): ditto.
2525 * src/paragraph.C (validate,TeXOnePar): ditto.
2527 * src/lyxfont.C (update): Restored deleted code.
2529 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2531 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2533 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2535 * src/insets/figinset.[Ch]:
2536 * src/insets/insetinclude.[Ch]:
2537 * src/insets/insetinclude.[Ch]:
2538 * src/insets/insetparent.[Ch]:
2539 * src/insets/insetref.[Ch]:
2540 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2542 * src/insets/*.[Ch]:
2543 * src/mathed/formula.[Ch]:
2544 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2546 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2547 * src/lyx_cb.C (FigureApplyCB):
2548 * src/lyxfunc.C (getStatus, Dispatch):
2549 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2552 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2554 * src/converter.[Ch] (Formats::View):
2555 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2557 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2558 *current_view->buffer(). This will change later, but this patch is way
2561 2000-10-09 Juergen Vigna <jug@sad.it>
2563 * src/text.C (GetRow): small fix.
2565 * src/BufferView_pimpl.C (cursorPrevious):
2566 (cursorNext): added LyXText parameter to function.
2568 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2569 keypress depending on cursor position.
2571 2000-10-06 Juergen Vigna <jug@sad.it>
2573 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2574 (copySelection): redone this function and also copy ascii representa-
2577 * src/tabular.C (Ascii):
2581 (print_n_chars): new functions to realize the ascii export of tabulars.
2583 2000-10-05 Juergen Vigna <jug@sad.it>
2585 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2586 if we don't have a buffer.
2588 2000-10-10 Allan Rae <rae@lyx.org>
2590 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2591 with closing dialog. It seems that nested tabfolders require hiding
2592 of inner tabfolders before hiding the dialog itself. Actually all I
2593 did was hide the active outer folder.
2595 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2596 unless there really is a buffer. hideBufferDependent is called
2599 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2600 POTFILES.in stays in $(srcdir).
2602 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2604 * lib/lyxrc.example: Few changes.
2606 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2608 * src/BufferView_pimpl.C (buffer): only need one the
2609 updateBufferDependent signal to be emitted once! Moved to the end of
2610 the method to allow bv_->text to be updated first.
2612 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2613 and hSignal_ with Dialogs * and BufferDependency variables.
2614 New Buffer * parent_, initialised when the dialog is launched. Used to
2615 check whether to update() or hide() dialog in the new, private
2616 updateOrHide() method that is connected to the updateBufferDependent
2617 signal. Daughter classes dictate what to do using the
2618 ChangedBufferAction enum, passed to the c-tor.
2620 * src/frontends/xforms/FormCitation.C:
2621 * src/frontends/xforms/FormCommand.C:
2622 * src/frontends/xforms/FormCopyright.C:
2623 * src/frontends/xforms/FormDocument.C:
2624 * src/frontends/xforms/FormError.C:
2625 * src/frontends/xforms/FormIndex.C:
2626 * src/frontends/xforms/FormPreferences.C:
2627 * src/frontends/xforms/FormPrint.C:
2628 * src/frontends/xforms/FormRef.C:
2629 * src/frontends/xforms/FormToc.C:
2630 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2633 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2634 ChangedBufferAction enum.
2636 * src/frontends/xforms/FormParagraph.[Ch]
2637 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2640 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2642 * lib/bind/cua.bind: fix a bit.
2643 * lib/bind/emacs.bind: ditto.
2645 * lib/bind/menus.bind: remove real menu entries from there.
2647 * src/spellchecker.C: make sure we only include strings.h when
2650 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2652 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2653 function. It enlarges the maximum number of pup when needed.
2654 (add_toc2): Open a new menu if maximum number of items per menu has
2657 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2659 * src/frontends/kde/FormPrint.C: fix error reporting
2661 * src/frontends/xforms/FormDocument.C: fix compiler
2664 * lib/.cvsignore: add Literate.nw
2666 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2669 * bufferview_funcs.[Ch]
2672 * text2.C: Add support for numbers in RTL text.
2674 2000-10-06 Allan Rae <rae@lyx.org>
2676 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2677 to be gettext.m4 friendly again. ext_l10n.h is now
2678 generated into $top_srcdir instead of $top_builddir
2679 so that lyx.pot will be built correctly -- without
2680 duplicate parsing of ext_l10n.h.
2682 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2684 * src/frontends/kde/FormCitation.C: make the dialog
2685 behave more sensibly
2687 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2689 * config/kde.m4: fix consecutive ./configure runs,
2690 look for qtarch, fix library order
2692 * src/frontends/kde/Makefile.am: tidy up,
2693 add Print dialog, add .dlg dependencies
2695 * src/frontends/kde/FormPrint.C:
2696 * src/frontends/kde/FormPrint.h:
2697 * src/frontends/kde/formprintdialog.C:
2698 * src/frontends/kde/formprintdialog.h:
2699 * src/frontends/kde/formprintdialogdata.C:
2700 * src/frontends/kde/formprintdialogdata.h:
2701 * src/frontends/kde/dlg/formprintdialog.dlg: add
2704 * src/frontends/kde/dlg/README: Added explanatory readme
2706 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2707 script to double-check qtarch's output
2709 * src/frontends/kde/formindexdialog.C:
2710 * src/frontends/kde/formindexdialogdata.C:
2711 * src/frontends/kde/formindexdialogdata.h:
2712 * src/frontends/kde/dlg/formindexdialog.dlg: update
2713 for qtarch, minor fixes
2715 2000-10-05 Allan Rae <rae@lyx.org>
2717 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2718 dialogs when switching buffers update them instead. It's up to each
2719 dialog to decide if it should still be visible or not.
2720 update() should return a bool to control visiblity within show().
2721 Or perhaps better to set a member variable and use that to control
2724 * lib/build-listerrors: create an empty "listerrors" file just to stop
2725 make trying to regenerate it all the time if you don't have noweb
2728 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2730 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2731 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2732 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2733 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2734 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2736 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2738 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2740 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2741 deleting buffer. Closes all buffer-dependent dialogs.
2743 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2745 * src/frontends/xforms/FormCitation.[Ch]:
2746 * src/frontends/xforms/FormPreferences.[Ch]:
2747 * src/frontends/xforms/FormPrint.[Ch]:
2748 * src/frontends/xforms/FormRef.[Ch]:
2749 * src/frontends/xforms/FormUrl.[Ch]: ditto
2751 * src/frontends/xforms/FormDocument.[Ch]:
2752 * src/frontends/xforms/forms/form_document.C.patch:
2753 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2754 pass through a single input() function.
2756 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2758 * lib/build-listerrors: return status as OK
2760 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2762 * lib/lyxrc.example: Updated to new export code
2764 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2766 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2769 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2772 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2773 LyX-Code is defined.
2774 * lib/layouts/amsbook.layout: ditto.
2776 * boost/Makefile.am: fix typo.
2778 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2780 (add_lastfiles): removed.
2781 (add_documents): removed.
2782 (add_formats): removed.
2784 * src/frontends/Menubar.C: remove useless "using" directive.
2786 * src/MenuBackend.h: add a new MenuItem constructor.
2788 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2791 2000-10-04 Allan Rae <rae@lyx.org>
2793 * lib/Makefile.am (listerrors):
2794 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2795 I haven't got notangle installed so Kayvan please test. The output
2796 should end up in $builddir. This also allows people who don't have
2797 noweb installed to complete the make process without error.
2799 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2800 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2801 by JMarc's picky compiler.
2803 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2806 * src/insets/insettabular.C (setPos): change for loop to not use
2807 sequencing operator. Please check this Jürgen.
2809 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2811 * src/insets/insetcite.C (getScreenLabel): ditto
2812 * src/support/filetools.C (QuoteName): ditto
2813 (ChangeExtension): ditto
2815 * src/BufferView_pimpl.C (scrollCB): make heigt int
2817 * src/BufferView2.C (insertInset): comment out unused arg
2819 * boost/Makefile.am (EXTRADIST): new variable
2821 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2823 * src/exporter.C (IsExportable): Fixed
2825 * lib/configure.m4: Small fix
2827 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2829 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2830 * src/insets/insetbib.C (bibitemWidest): ditto.
2831 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2833 2000-10-03 Juergen Vigna <jug@sad.it>
2835 * src/BufferView2.C (theLockingInset): removed const because of
2836 Agnus's compile problems.
2838 * src/insets/insettext.C (LocalDispatch): set the language of the
2839 surronding paragraph on inserting the first character.
2841 * various files: changed use of BufferView::the_locking_inset.
2843 * src/BufferView2.C (theLockingInset):
2844 (theLockingInset): new functions.
2846 * src/BufferView.h: removed the_locking_inset.
2848 * src/lyxtext.h: added the_locking_inset
2850 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2852 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2854 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2856 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2857 * src/mathed/math_cursor.C (IsAlpha): ditto.
2858 * src/mathed/math_inset.C (strnew): ditto.
2859 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2860 (IMetrics): cxp set but never used; removed.
2861 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2862 that the variable in question has been removed also!
2865 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2866 using the Buffer * passed to Latex(), using the BufferView * passed to
2867 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2869 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2870 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2872 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2873 * src/buffer.C (readInset): used new InsetBibtex c-tor
2874 * (getBibkeyList): used new InsetBibtex::getKeys
2876 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2879 * lib/build-listerrors
2881 * src/exporter.C: Add literate programming support to the export code
2884 * src/lyx_cb.C: Remove old literate code.
2886 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2889 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2890 * src/converter.C (View, Convert): Use QuoteName.
2892 * src/insets/figinset.C (Preview): Use Formats::View.
2894 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2896 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2898 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2899 the top of the function, because compaq cxx complains that the
2900 "goto exit_with_message" when the function is disabled bypasses
2902 (MenuNew): try a better fix for the generation of new file names.
2903 This time, I used AddName() instead of AddPath(), hoping Juergen
2906 2000-10-03 Allan Rae <rae@lyx.org>
2908 * src/frontends/xforms/forms/form_preferences.fd:
2909 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2910 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2911 "Look and Feel"->"General" but will need to be split up further into
2912 general output and general input tabs. Current plan is for four outer
2913 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2914 stuff; "Inputs" for input and import configuration; "Outputs" for
2915 output and export configuration; and one more whatever is left over
2916 called "General". The leftovers at present look like being which
2917 viewers to use, spellchecker, language support and might be better
2918 named "Support". I've put "Paths" in "Inputs" for the moment as this
2919 seems reasonable for now at least.
2920 One problem remains: X error kills LyX when you close Preferences.
2922 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2924 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2925 qualifier from form()
2926 * src/frontends/xforms/FormCitation.[Ch]:
2927 * src/frontends/xforms/FormCopyright.[Ch]:
2928 * src/frontends/xforms/FormDocument.[Ch]:
2929 * src/frontends/xforms/FormError.[Ch]:
2930 * src/frontends/xforms/FormIndex.[Ch]:
2931 * src/frontends/xforms/FormPreferences.[Ch]:
2932 * src/frontends/xforms/FormPrint.[Ch]:
2933 * src/frontends/xforms/FormRef.[Ch]:
2934 * src/frontends/xforms/FormToc.[Ch]:
2935 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2937 * src/frontends/xforms/FormCitation.[Ch]:
2938 * src/frontends/xforms/FormIndex.[Ch]:
2939 * src/frontends/xforms/FormRef.[Ch]:
2940 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2941 with Allan's naming policy
2943 * src/frontends/xforms/FormCitation.C: some static casts to remove
2946 2000-10-02 Juergen Vigna <jug@sad.it>
2948 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2949 now you can type or do stuff inside the table-cell also when in dummy
2950 position, fixed visible cursor.
2952 * src/insets/insettext.C (Edit): fixing cursor-view position.
2954 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2955 be used for equal functions in lyxfunc and insettext.
2957 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2959 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2961 * src/frontends/gnome/FormCitation.h:
2962 * src/frontends/gnome/FormCopyright.h:
2963 * src/frontends/gnome/FormIndex.h:
2964 * src/frontends/gnome/FormPrint.h:
2965 * src/frontends/gnome/FormToc.h:
2966 * src/frontends/gnome/FormUrl.h:
2967 * src/frontends/kde/FormCitation.h:
2968 * src/frontends/kde/FormCopyright.h:
2969 * src/frontends/kde/FormIndex.h:
2970 * src/frontends/kde/FormRef.h:
2971 * src/frontends/kde/FormToc.h:
2972 * src/frontends/kde/FormUrl.h: fix remaining users of
2975 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2977 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2978 from depth argument.
2979 (DocBookHandleCaption): ditto.
2980 (DocBookHandleFootnote): ditto.
2981 (SimpleDocBookOnePar): ditto.
2983 * src/frontends/xforms/FormDocument.h (form): remove extra
2984 FormDocument:: qualifier.
2986 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2988 * sigc++/handle.h: ditto.
2990 * src/lyx_gui_misc.C: add "using" directive.
2992 * src/cheaders/cstddef: new file, needed by the boost library (for
2995 2000-10-02 Juergen Vigna <jug@sad.it>
2997 * src/insets/insettext.C (SetFont): better support.
2999 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3001 * src/screen.C (DrawOneRow): some uint refixes!
3003 2000-10-02 Allan Rae <rae@lyx.org>
3005 * boost/.cvsignore: ignore Makefile as well
3007 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3008 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3010 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3011 Left this one out by accident.
3013 * src/frontends/xforms/FormBase.h (restore): default to calling
3014 update() since that will restore the original/currently-applied values.
3015 Any input() triggered error messages will require the derived classes
3016 to redefine restore().
3018 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3019 avoid a segfault. combo_doc_class is the main concern.
3021 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3023 * Simplify build-listerrors in view of GUI-less export ability!
3025 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3027 * src/lyx_main.C (easyParse): Disable gui when exporting
3029 * src/insets/figinset.C:
3032 * src/lyx_gui_misc.C
3033 * src/tabular.C: Changes to allow no-gui.
3035 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3037 * src/support/utility.hpp: removed file
3038 * src/support/block.h: removed file
3040 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3043 * src/mathed/formula.C: add support/lyxlib.h
3044 * src/mathed/formulamacro.C: ditto
3046 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3047 * src/lyxparagraph.h: ditto
3049 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3050 * src/frontends/Makefile.am (INCLUDES): ditto
3051 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3052 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3053 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3054 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3055 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3056 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3058 * src/BufferView.h: use boost/utility.hpp
3059 * src/LColor.h: ditto
3060 * src/LaTeX.h: ditto
3061 * src/LyXAction.h: ditto
3062 * src/LyXView.h: ditto
3063 * src/bufferlist.h: ditto
3064 * src/lastfiles.h: ditto
3065 * src/layout.h: ditto
3066 * src/lyx_gui.h: ditto
3067 * src/lyx_main.h: ditto
3068 * src/lyxlex.h: ditto
3069 * src/lyxrc.h: ditto
3070 * src/frontends/ButtonPolicies.h: ditto
3071 * src/frontends/Dialogs.h: ditto
3072 * src/frontends/xforms/FormBase.h: ditto
3073 * src/frontends/xforms/FormGraphics.h: ditto
3074 * src/frontends/xforms/FormParagraph.h: ditto
3075 * src/frontends/xforms/FormTabular.h: ditto
3076 * src/graphics/GraphicsCache.h: ditto
3077 * src/graphics/Renderer.h: ditto
3078 * src/insets/ExternalTemplate.h: ditto
3079 * src/insets/insetcommand.h: ditto
3080 * src/support/path.h: ditto
3082 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3083 and introduce clause for 2.97.
3085 * boost/libs/README: new file
3087 * boost/boost/utility.hpp: new file
3089 * boost/boost/config.hpp: new file
3091 * boost/boost/array.hpp: new file
3093 * boost/Makefile.am: new file
3095 * boost/.cvsignore: new file
3097 * configure.in (AC_OUTPUT): add boost/Makefile
3099 * Makefile.am (SUBDIRS): add boost
3101 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3103 * src/support/lstrings.C (suffixIs): Fixed.
3105 2000-10-01 Allan Rae <rae@lyx.org>
3107 * src/PrinterParams.h: moved things around to avoid the "can't
3108 inline call" warning.
3110 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3111 into doc++ documentation.
3113 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3115 * src/frontends/xforms/FormRef.C: make use of button controller
3116 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3117 cleaned up button controller usage.
3118 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3119 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3120 use the button controller
3122 * src/frontends/xforms/forms/*.fd: and associated generated files
3123 updated to reflect changes to FormBase. Some other FormXxxx files
3124 also got minor updates to reflect changes to FormBase.
3126 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3127 (hide): made virtual.
3128 (input): return a bool. true == valid input
3129 (RestoreCB, restore): new
3130 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3131 Changes to allow derived dialogs to use a ButtonController and
3132 make sense when doing so: OK button calls ok() and so on.
3134 * src/frontends/xforms/ButtonController.h (class ButtonController):
3135 Switch from template implementation to taking Policy parameter.
3136 Allows FormBase to provide a ButtonController for any dialog.
3138 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3139 Probably should rename connect and disconnect.
3140 (apply): use the radio button groups
3141 (form): needed by FormBase
3142 (build): setup the radio button groups
3144 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3146 * several files: type changes to reduce the number of warnings and
3147 to unify type hangling a bit. Still much to do.
3149 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3151 * lib/images/*: rename a bunch of icons to match Dekel converter
3154 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3157 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3159 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3161 * sigc++/handle.h: ditto for class Handle.
3163 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3165 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3167 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3169 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3170 removal of the "default" language.
3172 * src/combox.h (getline): Check that sel > 0
3174 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3176 * lib/examples/docbook_example.lyx
3177 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3179 * lib/layouts/docbook-book.layout: new docbook book layout.
3181 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3183 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3185 * src/insets/figinset.C (DocBook):fixed small typo.
3187 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3189 * src/insets/insetinclude.h: string include_label doesn't need to be
3192 2000-09-29 Allan Rae <rae@lyx.org>
3194 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3195 Allow derived type to control connection and disconnection from signals
3196 of its choice if desired.
3198 2000-09-28 Juergen Vigna <jug@sad.it>
3200 * src/insets/insettabular.C (update): fixed cursor setting when
3201 the_locking_inset changed.
3202 (draw): made this a bit cleaner.
3203 (InsetButtonPress): fixed!
3205 * various files: added LyXText Parameter to fitCursor call.
3207 * src/BufferView.C (fitCursor): added LyXText parameter.
3209 * src/insets/insettabular.C (draw): small draw fix.
3211 * src/tabular.C: right setting of left/right celllines.
3213 * src/tabular.[Ch]: fixed various types in funcions and structures.
3214 * src/insets/insettabular.C: ditto
3215 * src/frontends/xforms/FormTabular.C: ditto
3217 2000-09-28 Allan Rae <rae@lyx.org>
3219 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3220 that the #ifdef's had been applied to part of what should have been
3221 a complete condition. It's possible there are other tests that
3222 were specific to tables that are also wrong now that InsetTabular is
3223 being used. Now we need to fix the output of '\n' after a table in a
3224 float for the same reason as the original condition:
3225 "don't insert this if we would be adding it before or after a table
3226 in a float. This little trick is needed in order to allow use of
3227 tables in \subfigures or \subtables."
3228 Juergen can you check this?
3230 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3232 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3233 output to the ostream.
3235 * several files: fixed types based on warnings from cxx
3237 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3239 * src/frontends/kde/Makefile.am: fix rule for
3240 formindexdialogdata_moc.C
3242 * src/.cvsignore: add ext_l10n.h to ignore
3244 * acconfig.h: stop messing with __STRICT_ANSI__
3245 * config/gnome.m4: remove option to set -ansi
3246 * config/kde.m4: remove option to set -ansi
3247 * config/lyxinclude.m4: don't set -ansi
3249 2000-09-27 Juergen Vigna <jug@sad.it>
3251 * various files: remove "default" language check.
3253 * src/insets/insetquotes.C: removed use of current_view.
3255 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3256 the one should have red ears by now!
3258 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3259 in more then one paragraph. Fixed cursor-movement/selection.
3261 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3262 paragraphs inside a text inset.
3264 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3265 text-inset if this owner is an inset.
3267 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3269 * src/Bullet.h: changed type of font, character and size to int
3271 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3273 * src/insets/inseturl.[Ch]:
3274 * src/insets/insetref.[Ch]:
3275 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3277 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3279 * src/buffer.C (readFile): block-if statement rearranged to minimise
3280 bloat. Patch does not reverse Jean-Marc's change ;-)
3282 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3283 Class rewritten to store pointers to hide/update signals directly,
3284 rather than Dialogs *. Also defined an enum to ease use. All xforms
3285 forms can now be derived from this class.
3287 * src/frontends/xforms/FormCommand.[Ch]
3288 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3290 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3293 * src/frontends/xforms/forms/form_citation.fd
3294 * src/frontends/xforms/forms/form_copyright.fd
3295 * src/frontends/xforms/forms/form_error.fd
3296 * src/frontends/xforms/forms/form_index.fd
3297 * src/frontends/xforms/forms/form_ref.fd
3298 * src/frontends/xforms/forms/form_toc.fd
3299 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3301 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3303 * src/insets/insetfoot.C: removed redundent using directive.
3305 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3307 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3308 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3310 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3311 created in the constructors in different groups. Then set() just
3312 have to show the groups as needed. This fixes the redraw problems
3313 (and is how the old menu code worked).
3315 * src/support/lyxlib.h: declare the methods as static when we do
3316 not have namespaces.
3318 2000-09-26 Juergen Vigna <jug@sad.it>
3320 * src/buffer.C (asciiParagraph): new function.
3321 (writeFileAscii): new function with parameter ostream.
3322 (writeFileAscii): use now asciiParagraph.
3324 * various inset files: added the linelen parameter to the Ascii-func.
3326 * src/tabular.C (Write): fixed error in writing file introduced by
3327 the last changes from Lars.
3329 * lib/bind/menus.bind: removed not supported functions.
3331 * src/insets/insettext.C (Ascii): implemented this function.
3333 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3335 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3336 (Write): use of the write_attribute functions.
3338 * src/bufferlist.C (close): fixed reasking question!
3340 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3342 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3343 new files use the everwhere possible.
3346 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3347 src/log_form.C src/lyx.C:
3350 * src/buffer.C (runLaTeX): remove func
3352 * src/PaperLayout.C: removed file
3353 * src/ParagraphExtra.C: likewise
3354 * src/bullet_forms.C: likewise
3355 * src/bullet_forms.h: likewise
3356 * src/bullet_forms_cb.C: likewise
3358 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3359 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3362 * several files: remove all traces of the old fd_form_paragraph,
3363 and functions belonging to that.
3365 * several files: remove all traces of the old fd_form_document,
3366 and functions belonging to that.
3368 * several files: constify local variables were possible.
3370 * several files: remove all code that was dead when NEW_EXPORT was
3373 * several files: removed string::c_str in as many places as
3376 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3377 (e): be a bit more outspoken when patching
3378 (updatesrc): only move files if changed.
3380 * forms/layout_forms.h.patch: regenerated
3382 * forms/layout_forms.fd: remove form_document and form_paragraph
3383 and form_quotes and form_paper and form_table_options and
3384 form_paragraph_extra
3386 * forms/form1.fd: remove form_table
3388 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3389 the fdui->... rewrite. Update some comments to xforms 0.88
3391 * forms/bullet_forms.C.patch: removed file
3392 * forms/bullet_forms.fd: likewise
3393 * forms/bullet_forms.h.patch: likewise
3395 * development/Code_rules/Rules: added a section on switch
3396 statements. Updated some comment to xforms 0.88.
3398 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3400 * src/buffer.C (readFile): make sure that the whole version number
3401 is read after \lyxformat (even when it contains a comma)
3403 * lib/ui/default.ui: change shortcut of math menu to M-a.
3405 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3407 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3410 * src/LyXView.C (updateWindowTitle): show the full files name in
3411 window title, limited to 30 characters.
3413 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3414 When a number of characters has been given, we should not assume
3415 that the string is 0-terminated.
3417 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3418 calls (fixes some memory leaks)
3420 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3421 trans member on exit.
3423 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3425 * src/converter.C (GetReachable): fix typo.
3427 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3428 understand ',' instead of '.'.
3429 (GetInteger): rewrite to use strToInt().
3431 2000-09-26 Juergen Vigna <jug@sad.it>
3433 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3434 better visibility and error-message on wrong VSpace input.
3436 * src/language.C (initL): added english again.
3438 2000-09-25 Juergen Vigna <jug@sad.it>
3440 * src/frontends/kde/Dialogs.C (Dialogs):
3441 * src/frontends/gnome/Dialogs.C (Dialogs):
3442 * src/frontends/kde/Makefile.am:
3443 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3445 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3447 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3449 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3451 * src/frontends/xforms/FormParagraph.C:
3452 * src/frontends/xforms/FormParagraph.h:
3453 * src/frontends/xforms/form_paragraph.C:
3454 * src/frontends/xforms/form_paragraph.h:
3455 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3458 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3460 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3461 Paragraph-Data after use.
3463 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3464 non breakable paragraphs.
3466 2000-09-25 Garst R. Reese <reese@isn.net>
3468 * src/language.C (initL): added missing language_country codes.
3470 2000-09-25 Juergen Vigna <jug@sad.it>
3472 * src/insets/insettext.C (InsetText):
3473 (deleteLyXText): remove the not released LyXText structure!
3475 2000-09-24 Marko Vendelin <markov@ioc.ee>
3477 * src/frontends/gnome/mainapp.C
3478 * src/frontends/gnome/mainapp.h: added support for keyboard
3481 * src/frontends/gnome/FormCitation.C
3482 * src/frontends/gnome/FormCitation.h
3483 * src/frontends/gnome/Makefile.am
3484 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3485 FormCitation to use "action area" in mainapp window
3487 * src/frontends/gnome/Menubar_pimpl.C
3488 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3491 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3493 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3494 width/descent/ascent values if name is empty.
3495 (mathed_string_height): Use std::max.
3497 2000-09-25 Allan Rae <rae@lyx.org>
3499 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3500 segfault. This will be completely redesigned soon.
3502 * sigc++: updated libsigc++. Fixes struct timespec bug.
3504 * development/tools/makeLyXsigc.sh: .cvsignore addition
3506 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3508 * several files: removed almost all traces of the old table
3511 * src/TableLayout.C: removed file
3513 2000-09-22 Juergen Vigna <jug@sad.it>
3515 * src/frontends/kde/Dialogs.C: added credits forms.
3517 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3519 * src/frontends/gnome/Dialogs.C: added some forms.
3521 * src/spellchecker.C (init_spell_checker): set language in pspell code
3522 (RunSpellChecker): some modifications for setting language string.
3524 * src/language.[Ch]: added language_country code.
3526 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3528 * src/frontends/Dialogs.h: added new signal showError.
3529 Rearranged existing signals in some sort of alphabetical order.
3531 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3532 FormError.[Ch], form_error.[Ch]
3533 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3534 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3536 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3537 dialogs. I think that this can be used as the base to all these
3540 * src/frontends/xforms/FormError.[Ch]
3541 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3542 implementation of InsetError dialog.
3544 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3546 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3547 * src/frontends/kde/Makefile.am: ditto
3549 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3551 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3552 macrobf. This fixes a bug of invisible text.
3554 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3556 * lib/doc/LaTeXConfig.lyx.in: updated.
3558 * src/language.C (initL): remove language "francais" and change a
3559 bit the names of the two other french variations.
3561 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3562 string that may not be 0-terminated.
3564 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3566 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3568 2000-09-20 Marko Vendelin <markov@ioc.ee>
3570 * src/frontends/gnome/FormCitation.C
3571 * src/frontends/gnome/FormIndex.C
3572 * src/frontends/gnome/FormToc.C
3573 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3574 the variable initialization to shut up the warnings
3576 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3578 * src/table.[Ch]: deleted files
3580 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3583 2000-09-18 Juergen Vigna <jug@sad.it>
3585 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3586 problems with selection. Inserted new LFUN_PASTESELECTION.
3587 (InsetButtonPress): inserted handling of middle mouse-button paste.
3589 * src/spellchecker.C: changed word to word.c_str().
3591 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3593 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3594 included in the ``make dist'' tarball.
3596 2000-09-15 Juergen Vigna <jug@sad.it>
3598 * src/CutAndPaste.C (cutSelection): small fix return the right
3599 end position after cut inside one paragraph only.
3601 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3602 we are locked as otherwise we don't have a valid cursor position!
3604 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3606 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3608 * src/frontends/kde/FormRef.C: added using directive.
3609 * src/frontends/kde/FormToc.C: ditto
3611 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3613 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3615 2000-09-19 Marko Vendelin <markov@ioc.ee>
3617 * src/frontends/gnome/Menubar_pimpl.C
3618 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3619 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3621 * src/frontends/gnome/mainapp.C
3622 * src/frontends/gnome/mainapp.h: support for menu update used
3625 * src/frontends/gnome/mainapp.C
3626 * src/frontends/gnome/mainapp.h: support for "action" area in the
3627 main window. This area is used by small simple dialogs, such as
3630 * src/frontends/gnome/FormIndex.C
3631 * src/frontends/gnome/FormIndex.h
3632 * src/frontends/gnome/FormUrl.C
3633 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3636 * src/frontends/gnome/FormCitation.C
3637 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3638 action area. Only "Insert new citation" is implemented.
3640 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3642 * src/buffer.C (Dispatch): fix call to Dispatch
3643 * src/insets/insetref.C (Edit): likewise
3644 * src/insets/insetparent.C (Edit): likewise
3645 * src/insets/insetinclude.C (include_cb): likewise
3646 * src/frontends/xforms/FormUrl.C (apply): likewise
3647 * src/frontends/xforms/FormToc.C (apply): likewise
3648 * src/frontends/xforms/FormRef.C (apply): likewise
3649 * src/frontends/xforms/FormIndex.C (apply): likewise
3650 * src/frontends/xforms/FormCitation.C (apply): likewise
3651 * src/lyxserver.C (callback): likewise
3652 * src/lyxfunc.C (processKeySym): likewise
3653 (Dispatch): likewise
3654 (Dispatch): likewise
3655 * src/lyx_cb.C (LayoutsCB): likewise
3657 * Makefile.am (sourcedoc): small change
3659 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3661 * src/main.C (main): Don't make an empty GUIRunTime object. all
3662 methods are static. constify a bit remove unneded using + headers.
3664 * src/tabular.C: some more const to local vars move some loop vars
3666 * src/spellchecker.C: added some c_str after some word for pspell
3668 * src/frontends/GUIRunTime.h: add new static method setDefaults
3669 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3670 * src/frontends/kde/GUIRunTime.C (setDefaults):
3671 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3673 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3674 with strnew in arg, use correct emptystring when calling SetName.
3676 * several files: remove all commented code with relation to
3677 HAVE_SSTREAM beeing false. We now only support stringstream and
3680 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3682 * src/lyxfunc.C: construct correctly the automatic new file
3685 * src/text2.C (IsStringInText): change type of variable i to shut
3688 * src/support/sstream.h: do not use namespaces if the compiler
3689 does not support them.
3691 2000-09-15 Marko Vendelin <markov@ioc.ee>
3692 * src/frontends/gnome/FormCitation.C
3693 * src/frontends/gnome/FormCitation.h
3694 * src/frontends/gnome/diainsertcitation_interface.c
3695 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3696 regexp support to FormCitation [Gnome].
3698 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3701 * configure.in: remove unused KDE/GTKGUI define
3703 * src/frontends/kde/FormRef.C
3704 * src/frontends/kde/FormRef.h
3705 * src/frontends/kde/formrefdialog.C
3706 * src/frontends/kde/formrefdialog.h: double click will
3707 go to reference, now it is possible to change a cross-ref
3710 * src/frontends/kde/FormToc.C
3711 * src/frontends/kde/FormToc.h
3712 * src/frontends/kde/formtocdialog.C
3713 * src/frontends/kde/formtocdialog.h: add a depth
3716 * src/frontends/kde/Makefile.am: add QtLyXView.h
3719 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3721 * src/frontends/kde/FormCitation.h: added some using directives.
3723 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3725 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3728 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3731 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3733 * src/buffer.C (pop_tag): revert for the second time a change by
3734 Lars, who seems to really hate having non-local loop variables :)
3736 * src/Lsstream.h: add "using" statements.
3738 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3739 * src/buffer.C (writeFile): ditto
3741 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3743 * src/buffer.C (writeFile): try to fix the locale modified format
3744 number to always be as we want it.
3746 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3747 in XForms 0.89. C-space is now working again.
3749 * src/Lsstream.h src/support/sstream.h: new files.
3751 * also commented out all cases where strstream were used.
3753 * src/Bullet.h (c_str): remove method.
3755 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3757 * a lot of files: get rid of "char const *" and "char *" is as
3758 many places as possible. We only want to use them in interaction
3759 with system of other libraries, not inside lyx.
3761 * a lot of files: return const object is not of pod type. This
3762 helps ensure that temporary objects is not modified. And fits well
3763 with "programming by contract".
3765 * configure.in: check for the locale header too
3767 * Makefile.am (sourcedoc): new tag for generation of doc++
3770 2000-09-14 Juergen Vigna <jug@sad.it>
3772 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3773 callback to check which combo called it and do the right action.
3775 * src/combox.C (combo_cb): added combo * to the callbacks.
3776 (Hide): moved call of callback after Ungrab of the pointer.
3778 * src/intl.h: removed LCombo2 function.
3780 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3781 function as this can now be handled in one function.
3783 * src/combox.h: added Combox * to callback prototype.
3785 * src/frontends/xforms/Toolbar_pimpl.C:
3786 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3788 2000-09-14 Garst Reese <reese@isn.net>
3790 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3791 moved usepackage{xxx}'s to beginning of file. Changed left margin
3792 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3793 underlining from title. Thanks to John Culleton for useful suggestions.
3795 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3797 * src/lyxlex_pimpl.C (setFile): change error message to debug
3800 2000-09-13 Juergen Vigna <jug@sad.it>
3802 * src/frontends/xforms/FormDocument.C: implemented choice_class
3803 as combox and give callback to combo_language so OK/Apply is activated
3806 * src/bufferlist.C (newFile): small fix so already named files
3807 (via an open call) are not requested to be named again on the
3810 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3812 * src/frontends/kde/Makefile.am
3813 * src/frontends/kde/FormRef.C
3814 * src/frontends/kde/FormRef.h
3815 * src/frontends/kde/formrefdialog.C
3816 * src/frontends/kde/formrefdialog.h: implement
3819 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3821 * src/frontends/kde/formtocdialog.C
3822 * src/frontends/kde/formtocdialog.h
3823 * src/frontends/kde/FormToc.C
3824 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3826 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3828 * src/frontends/kde/FormCitation.C: fix thinko
3829 where we didn't always display the reference text
3832 * src/frontends/kde/formurldialog.C
3833 * src/frontends/kde/formurldialog.h
3834 * src/frontends/kde/FormUrl.C
3835 * src/frontends/kde/FormUrl.h: minor cleanups
3837 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3839 * src/frontends/kde/Makefile.am
3840 * src/frontends/kde/FormToc.C
3841 * src/frontends/kde/FormToc.h
3842 * src/frontends/kde/FormCitation.C
3843 * src/frontends/kde/FormCitation.h
3844 * src/frontends/kde/FormIndex.C
3845 * src/frontends/kde/FormIndex.h
3846 * src/frontends/kde/formtocdialog.C
3847 * src/frontends/kde/formtocdialog.h
3848 * src/frontends/kde/formcitationdialog.C
3849 * src/frontends/kde/formcitationdialog.h
3850 * src/frontends/kde/formindexdialog.C
3851 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3853 2000-09-12 Juergen Vigna <jug@sad.it>
3855 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3858 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3860 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3863 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3865 * src/converter.C (Add, Convert): Added support for converter flags:
3866 needaux, resultdir, resultfile.
3867 (Convert): Added new parameter view_file.
3868 (dvips_options): Fixed letter paper option.
3870 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3871 (Export, GetExportableFormats, GetViewableFormats): Added support
3874 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3876 (easyParse): Fixed to work with new export code.
3878 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3881 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3883 * lib/bind/*.bind: Replaced
3884 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3885 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3887 2000-09-11 Juergen Vigna <jug@sad.it>
3889 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3891 * src/main.C (main): now GUII defines global guiruntime!
3893 * src/frontends/gnome/GUIRunTime.C (initApplication):
3894 * src/frontends/kde/GUIRunTime.C (initApplication):
3895 * src/frontends/xforms/GUIRunTime.C (initApplication):
3896 * src/frontends/GUIRunTime.h: added new function initApplication.
3898 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3900 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3902 2000-09-08 Juergen Vigna <jug@sad.it>
3904 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3905 we have already "Reset".
3907 * src/language.C (initL): inserted "default" language and made this
3908 THE default language (and not american!)
3910 * src/paragraph.C: inserted handling of "default" language!
3912 * src/lyxfont.C: ditto
3916 * src/paragraph.C: output the \\par only if we have a following
3917 paragraph otherwise it's not needed.
3919 2000-09-05 Juergen Vigna <jug@sad.it>
3921 * config/pspell.m4: added entry to lyx-flags
3923 * src/spellchecker.C: modified version from Kevin for using pspell
3925 2000-09-01 Marko Vendelin <markov@ioc.ee>
3926 * src/frontends/gnome/Makefile.am
3927 * src/frontends/gnome/FormCitation.C
3928 * src/frontends/gnome/FormCitation.h
3929 * src/frontends/gnome/diainsertcitation_callbacks.c
3930 * src/frontends/gnome/diainsertcitation_callbacks.h
3931 * src/frontends/gnome/diainsertcitation_interface.c
3932 * src/frontends/gnome/diainsertcitation_interface.h
3933 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3934 dialog for Gnome frontend
3936 * src/main.C: Gnome libraries require keeping application name
3937 and its version as strings
3939 * src/frontends/gnome/mainapp.C: Change the name of the main window
3940 from GnomeLyX to PACKAGE
3942 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3944 * src/frontends/Liason.C: add "using: declaration.
3946 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3948 * src/mathed/math_macro.C (Metrics): Set the size of the template
3950 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3952 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3954 * src/converter.C (add_options): New function.
3955 (SetViewer): Change $$FName into '$$FName'.
3956 (View): Add options when running xdvi
3957 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3958 (Convert): The 3rd parameter is now the desired filename. Converts
3959 calls to lyx::rename if necessary.
3960 Add options when running dvips.
3961 (dvi_papersize,dvips_options): New methods.
3963 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3965 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3966 using a call to Converter::dvips_options.
3967 Fixed to work with nex export code.
3969 * src/support/copy.C
3970 * src/support/rename.C: New files
3972 * src/support/syscall.h
3973 * src/support/syscall.C: Added Starttype SystemDontWait.
3975 * lib/ui/default.ui: Changed to work with new export code
3977 * lib/configure.m4: Changed to work with new export code
3979 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3981 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3983 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3984 so that code compiles with DEC cxx.
3986 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3987 to work correctly! Also now supports the additional elements
3990 2000-09-01 Allan Rae <rae@lyx.org>
3992 * src/frontends/ButtonPolicies.C: renamed all the references to
3993 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3995 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3996 since it's a const not a type.
3998 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4000 2000-08-31 Juergen Vigna <jug@sad.it>
4002 * src/insets/figinset.C: Various changes to look if the filename has
4003 an extension and if not add it for inline previewing.
4005 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4007 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4008 make buttonStatus and isReadOnly be const methods. (also reflect
4009 this in derived classes.)
4011 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4012 (nextState): change to be static inline, pass the StateMachine as
4014 (PreferencesPolicy): remove casts
4015 (OkCancelPolicy): remvoe casts
4016 (OkCancelReadOnlyPolicy): remove casts
4017 (NoRepeatedApplyReadOnlyPolicy): remove casts
4018 (OkApplyCancelReadOnlyPolicy): remove casts
4019 (OkApplyCancelPolicy): remove casts
4020 (NoRepeatedApplyPolicy): remove casts
4022 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4024 * src/converter.C: added some using directives
4026 * src/frontends/ButtonPolicies.C: changes to overcome
4027 "need lvalue" error with DEC c++
4029 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4030 to WMHideCB for DEC c++
4032 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4034 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4035 to BulletBMTableCB for DEC c++
4037 2000-08-31 Allan Rae <rae@lyx.org>
4039 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4040 character dialog separately from old document dialogs combo_language.
4043 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4045 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4046 Removed LFUN_REF_CREATE.
4048 * src/MenuBackend.C: Added new tags: toc and references
4050 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4051 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4053 (add_toc, add_references): New methods.
4054 (create_submenu): Handle correctly the case when there is a
4055 seperator after optional menu items.
4057 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4058 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4059 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4061 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4063 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4065 * src/converter.[Ch]: New file for converting between different
4068 * src/export.[Ch]: New file for exporting a LyX file to different
4071 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4072 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4073 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4074 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4075 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4076 RunDocBook, MenuExport.
4078 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4079 Exporter::Preview methods if NEW_EXPORT is defined.
4081 * src/buffer.C (Dispatch): Use Exporter::Export.
4083 * src/lyxrc.C: Added new tags: \converter and \viewer.
4086 * src/LyXAction.C: Define new lyx-function: buffer-update.
4087 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4088 when NEW_EXPORT is defined.
4090 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4092 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4094 * lib/ui/default.ui: Added submenus "view" and "update" to the
4097 * src/filetools.C (GetExtension): New function.
4099 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4101 2000-08-29 Allan Rae <rae@lyx.org>
4103 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4105 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4106 (EnableDocumentLayout): removed
4107 (DisableDocumentLayout): removed
4108 (build): make use of ButtonController's read-only handling to
4109 de/activate various objects. Replaces both of the above functions.
4111 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4112 (readOnly): was read_only
4113 (refresh): fixed dumb mistakes with read_only_ handling
4115 * src/frontends/xforms/forms/form_document.fd:
4116 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4117 tabbed dialogs so the tabs look more like tabs and so its easier to
4118 work out which is the current tab.
4120 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4121 segfault with form_table
4123 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4125 2000-08-28 Juergen Vigna <jug@sad.it>
4127 * acconfig.h: added USE_PSPELL.
4129 * src/config.h.in: added USE_PSPELL.
4131 * autogen.sh: added pspell.m4
4133 * config/pspell.m4: new file.
4135 * src/spellchecker.C: implemented support for pspell libary.
4137 2000-08-25 Juergen Vigna <jug@sad.it>
4139 * src/LyXAction.C (init): renamed LFUN_TABLE to
4140 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4142 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4144 * src/lyxscreen.h: add force_clear variable and fuction to force
4145 a clear area when redrawing in LyXText.
4147 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4149 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4151 * some whitespace and comment changes.
4153 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4155 * src/buffer.C: up te LYX_FORMAT to 2.17
4157 2000-08-23 Juergen Vigna <jug@sad.it>
4159 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4162 * src/insets/insettabular.C (pasteSelection): delete the insets
4163 LyXText as it is not valid anymore.
4164 (copySelection): new function.
4165 (pasteSelection): new function.
4166 (cutSelection): new function.
4167 (LocalDispatch): implemented cut/copy/paste of cell selections.
4169 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4170 don't have a LyXText.
4172 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4174 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4177 2000-08-22 Juergen Vigna <jug@sad.it>
4179 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4180 ifdef form_table out if NEW_TABULAR.
4182 2000-08-21 Juergen Vigna <jug@sad.it>
4184 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4185 (draw): fixed draw position so that the cursor is positioned in the
4187 (InsetMotionNotify): hide/show cursor so the position is updated.
4188 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4189 using cellstart() function where it should be used.
4191 * src/insets/insettext.C (draw): ditto.
4193 * src/tabular.C: fixed initialization of some missing variables and
4194 made BoxType into an enum.
4196 2000-08-22 Marko Vendelin <markov@ioc.ee>
4197 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4198 stock menu item using action numerical value, not its string
4202 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4204 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4205 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4207 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4209 * src/frontends/xforms/GUIRunTime.C: new file
4211 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4212 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4214 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4216 * src/frontends/kde/GUIRunTime.C: new file
4218 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4219 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4221 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4223 * src/frontends/gnome/GUIRunTime.C: new file
4225 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4228 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4229 small change to documetentation.
4231 * src/frontends/GUIRunTime.C: removed file
4233 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4235 * src/lyxparagraph.h: enable NEW_TABULAR as default
4237 * src/lyxfunc.C (processKeySym): remove some commented code
4239 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4240 NEW_TABULAR around the fd_form_table_options.
4242 * src/lyx_gui.C (runTime): call the static member function as
4243 GUIRunTime::runTime().
4245 2000-08-21 Allan Rae <rae@lyx.org>
4247 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4250 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4252 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4254 2000-08-21 Allan Rae <rae@lyx.org>
4256 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4257 keep Garst happy ;-)
4258 * src/frontends/xforms/FormPreferences.C (build): use setOK
4259 * src/frontends/xforms/FormDocument.C (build): use setOK
4260 (FormDocument): use the appropriate policy.
4262 2000-08-21 Allan Rae <rae@lyx.org>
4264 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4265 automatic [de]activation of arbitrary objects when in a read-only state.
4267 * src/frontends/ButtonPolicies.h: More documentation
4268 (isReadOnly): added to support the above.
4270 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4272 2000-08-18 Juergen Vigna <jug@sad.it>
4274 * src/insets/insettabular.C (getStatus): changed to return func_status.
4276 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4277 display toggle menu entries if they are.
4279 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4280 new document layout now.
4282 * src/lyxfunc.C: ditto
4284 * src/lyx_gui_misc.C: ditto
4286 * src/lyx_gui.C: ditto
4288 * lib/ui/default.ui: removed paper and quotes layout as they are now
4289 all in the document layout tabbed folder.
4291 * src/frontends/xforms/forms/form_document.fd: added Restore
4292 button and callbacks for all inputs for Allan's ButtonPolicy.
4294 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4295 (CheckChoiceClass): added missing params setting on class change.
4296 (UpdateLayoutDocument): added for updating the layout on params.
4297 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4298 (FormDocument): Implemented Allan's ButtonPolicy with the
4301 2000-08-17 Allan Rae <rae@lyx.org>
4303 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4304 so we can at least see the credits again.
4306 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4307 controller calls for the appropriate callbacks. Note that since Ok
4308 calls apply followed by cancel, and apply isn't a valid input for the
4309 APPLIED state, the bc_ calls have to be made in the static callback not
4310 within each of the real callbacks.
4312 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4313 (setOk): renamed from setOkay()
4315 2000-08-17 Juergen Vigna <jug@sad.it>
4317 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4318 in the implementation part.
4319 (composeUIInfo): don't show optional menu-items.
4321 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4323 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4325 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4326 text-state when in a text-inset.
4328 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4330 2000-08-17 Marko Vendelin <markov@ioc.ee>
4331 * src/frontends/gnome/FormIndex.C
4332 * src/frontends/gnome/FormIndex.h
4333 * src/frontends/gnome/FormToc.C
4334 * src/frontends/gnome/FormToc.h
4335 * src/frontends/gnome/dialogs
4336 * src/frontends/gnome/diatoc_callbacks.c
4337 * src/frontends/gnome/diatoc_callbacks.h
4338 * src/frontends/gnome/diainsertindex_callbacks.h
4339 * src/frontends/gnome/diainsertindex_callbacks.c
4340 * src/frontends/gnome/diainsertindex_interface.c
4341 * src/frontends/gnome/diainsertindex_interface.h
4342 * src/frontends/gnome/diatoc_interface.h
4343 * src/frontends/gnome/diatoc_interface.c
4344 * src/frontends/gnome/Makefile.am: Table of Contents and
4345 Insert Index dialogs implementation for Gnome frontend
4347 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4349 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4351 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4354 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4356 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4357 destructor. Don't definde if you don't need it
4358 (processEvents): made static, non-blocking events processing for
4360 (runTime): static method. event loop for xforms
4361 * similar as above for kde and gnome.
4363 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4364 new Pimpl is correct
4365 (runTime): new method calss the real frontends runtime func.
4367 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4369 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4371 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4373 2000-08-16 Juergen Vigna <jug@sad.it>
4375 * src/lyx_gui.C (runTime): added GUII RunTime support.
4377 * src/frontends/Makefile.am:
4378 * src/frontends/GUIRunTime.[Ch]:
4379 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4380 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4381 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4383 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4385 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4386 as this is already set in ${FRONTEND_INCLUDE} if needed.
4388 * configure.in (CPPFLAGS): setting the include dir for the frontend
4389 directory and don't set FRONTEND=xforms for now as this is executed
4392 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4394 * src/frontends/kde/Makefile.am:
4395 * src/frontends/kde/FormUrl.C:
4396 * src/frontends/kde/FormUrl.h:
4397 * src/frontends/kde/formurldialog.h:
4398 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4400 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4402 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4404 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4406 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4409 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4411 * src/WorkArea.C (work_area_handler): more work to get te
4412 FL_KEYBOARD to work with xforms 0.88 too, please test.
4414 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4416 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4418 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4421 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4423 * src/Timeout.h: remove Qt::emit hack.
4425 * several files: changes to allo doc++ compilation
4427 * src/lyxfunc.C (processKeySym): new method
4428 (processKeyEvent): comment out if FL_REVISION < 89
4430 * src/WorkArea.C: change some debugging levels.
4431 (WorkArea): set wantkey to FL_KEY_ALL
4432 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4433 clearer code and the use of compose with XForms 0.89. Change to
4434 use signals instead of calling methods in bufferview directly.
4436 * src/Painter.C: change some debugging levels.
4438 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4441 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4442 (workAreaKeyPress): new method
4444 2000-08-14 Juergen Vigna <jug@sad.it>
4446 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4448 * config/kde.m4: addes some features
4450 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4451 include missing xforms dialogs.
4453 * src/Timeout.h: a hack to be able to compile with qt/kde.
4455 * sigc++/.cvsignore: added acinclude.m4
4457 * lib/.cvsignore: added listerros
4459 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4460 xforms tree as objects are needed for other frontends.
4462 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4463 linking with not yet implemented xforms objects.
4465 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4467 2000-08-14 Baruch Even <baruch.even@writeme.com>
4469 * src/frontends/xforms/FormGraphics.h:
4470 * src/frontends/xforms/FormGraphics.C:
4471 * src/frontends/xforms/RadioButtonGroup.h:
4472 * src/frontends/xforms/RadioButtonGroup.C:
4473 * src/insets/insetgraphics.h:
4474 * src/insets/insetgraphics.C:
4475 * src/insets/insetgraphicsParams.h:
4476 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4477 instead of spaces, and various other indentation issues to make the
4478 sources more consistent.
4480 2000-08-14 Marko Vendelin <markov@ioc.ee>
4482 * src/frontends/gnome/dialogs/diaprint.glade
4483 * src/frontends/gnome/FormPrint.C
4484 * src/frontends/gnome/FormPrint.h
4485 * src/frontends/gnome/diaprint_callbacks.c
4486 * src/frontends/gnome/diaprint_callbacks.h
4487 * src/frontends/gnome/diaprint_interface.c
4488 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4491 * src/frontends/gnome/dialogs/diainserturl.glade
4492 * src/frontends/gnome/FormUrl.C
4493 * src/frontends/gnome/FormUrl.h
4494 * src/frontends/gnome/diainserturl_callbacks.c
4495 * src/frontends/gnome/diainserturl_callbacks.h
4496 * src/frontends/gnome/diainserturl_interface.c
4497 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4498 Gnome implementation
4500 * src/frontends/gnome/Dialogs.C
4501 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4502 all other dialogs. Copy all unimplemented dialogs from Xforms
4505 * src/frontends/gnome/support.c
4506 * src/frontends/gnome/support.h: support files generated by Glade
4510 * config/gnome.m4: Gnome configuration scripts
4512 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4513 configure --help message
4515 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4516 only if there are no events pendling in Gnome/Gtk. This enhances
4517 the performance of menus.
4520 2000-08-14 Allan Rae <rae@lyx.org>
4522 * lib/Makefile.am: listerrors cleaning
4524 * lib/listerrors: removed -- generated file
4525 * acinclude.m4: ditto
4526 * sigc++/acinclude.m4: ditto
4528 * src/frontends/xforms/forms/form_citation.fd:
4529 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4532 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4533 `updatesrc` and now we have a `test` target that does what `updatesrc`
4534 used to do. I didn't like having an install target that wasn't related
4537 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4538 on all except FormGraphics. This may yet happen. Followed by a major
4539 cleanup including using FL_TRANSIENT for most of the dialogs. More
4540 changes to come when the ButtonController below is introduced.
4542 * src/frontends/xforms/ButtonController.h: New file for managing up to
4543 four buttons on a dialog according to an externally defined policy.
4544 * src/frontends/xforms/Makefile.am: added above
4546 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4547 Apply and Cancel/Close buttons and everything in between and beyond.
4548 * src/frontends/Makefile.am: added above.
4550 * src/frontends/xforms/forms/form_preferences.fd:
4551 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4552 and removed variable 'status' as a result. Fixed the set_minsize thing.
4553 Use the new screen-font-update after checking screen fonts were changed
4554 Added a "Restore" button to restore the original lyxrc values while
4555 editing. This restores everything not just the last input changed.
4556 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4558 * src/LyXAction.C: screen-font-update added for updating buffers after
4559 screen font settings have been changed.
4560 * src/commandtags.h: ditto
4561 * src/lyxfunc.C: ditto
4563 * forms/lyx.fd: removed screen fonts dialog.
4564 * src/lyx_gui.C: ditto
4565 * src/menus.[Ch]: ditto
4566 * src/lyx.[Ch]: ditto
4567 * src/lyx_cb.C: ditto + code from here moved to make
4568 screen-font-update. And people wonder why progress on GUII is
4569 slow. Look at how scattered this stuff was! It takes forever
4572 * forms/fdfix.sh: Fixup the spacing after commas.
4573 * forms/makefile: Remove date from generated files. Fewer clashes now.
4574 * forms/bullet_forms.C.patch: included someones handwritten changes
4576 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4577 once I've discovered why LyXRC was made noncopyable.
4578 * src/lyx_main.C: ditto
4580 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4582 * src/frontends/xforms/forms/fdfix.sh:
4583 * src/frontends/xforms/forms/fdfixh.sed:
4584 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4585 * src/frontends/xforms/Form*.[hC]:
4586 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4587 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4588 provide a destructor for the struct FD_form_xxxx. Another version of
4589 the set_[max|min]size workaround and a few other cleanups. Actually,
4590 Angus' patch from 20000809.
4592 2000-08-13 Baruch Even <baruch.even@writeme.com>
4594 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4597 2000-08-11 Juergen Vigna <jug@sad.it>
4599 * src/insets/insetgraphics.C (InsetGraphics): changing init
4600 order because of warnings.
4602 * src/frontends/xforms/forms/makefile: adding patching .C with
4605 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4606 from .C.patch to .c.patch
4608 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4609 order because of warning.
4611 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4613 * src/frontends/Liason.C (setMinibuffer): new helper function
4615 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4617 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4619 * lib/ui/default.ui: commented out PaperLayout entry
4621 * src/frontends/xforms/form_document.[Ch]: new added files
4623 * src/frontends/xforms/FormDocument.[Ch]: ditto
4625 * src/frontends/xforms/forms/form_document.fd: ditto
4627 * src/frontends/xforms/forms/form_document.C.patch: ditto
4629 2000-08-10 Juergen Vigna <jug@sad.it>
4631 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4632 (InsetGraphics): initialized cacheHandle to 0.
4633 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4635 2000-08-10 Baruch Even <baruch.even@writeme.com>
4637 * src/graphics/GraphicsCache.h:
4638 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4639 correctly as a cache.
4641 * src/graphics/GraphicsCacheItem.h:
4642 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4645 * src/graphics/GraphicsCacheItem_pimpl.h:
4646 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4649 * src/insets/insetgraphics.h:
4650 * src/insets/insetgraphics.C: Changed from using a signal notification
4651 to polling when image is not loaded.
4653 2000-08-10 Allan Rae <rae@lyx.org>
4655 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4656 that there are two functions that have to been taken out of line by
4657 hand and aren't taken care of in the script. (Just a reminder note)
4659 * sigc++/macros/*.h.m4: Updated as above.
4661 2000-08-09 Juergen Vigna <jug@sad.it>
4663 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4665 * src/insets/insettabular.C: make drawing of single cell smarter.
4667 2000-08-09 Marko Vendelin <markov@ioc.ee>
4668 * src/frontends/gnome/Menubar_pimpl.C
4669 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4670 implementation: new files
4672 * src/frontends/gnome/mainapp.C
4673 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4676 * src/main.C: create Gnome main window
4678 * src/frontends/xforms/Menubar_pimpl.h
4679 * src/frontends/Menubar.C
4680 * src/frontends/Menubar.h: added method Menubar::update that calls
4681 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4683 * src/LyXView.C: calls Menubar::update to update the state
4686 * src/frontends/gnome/Makefile.am: added new files
4688 * src/frontends/Makefile.am: added frontend compiler options
4690 2000-08-08 Juergen Vigna <jug@sad.it>
4692 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4694 * src/bufferlist.C (close):
4695 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4696 documents if exiting without saving.
4698 * src/buffer.C (save): use removeAutosaveFile()
4700 * src/support/filetools.C (removeAutosaveFile): new function.
4702 * src/lyx_cb.C (MenuWrite): returns a bool now.
4703 (MenuWriteAs): check if file could really be saved and revert to the
4705 (MenuWriteAs): removing old autosavefile if existant.
4707 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4708 before Goto toggle declaration, because of compiler warning.
4710 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4712 * src/lyxfunc.C (MenuNew): small fix.
4714 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4716 * src/bufferlist.C (newFile):
4717 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4719 * src/lyxrc.C: added new_ask_filename tag
4721 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4723 * src/lyx.fd: removed code pertaining to form_ref
4724 * src/lyx.[Ch]: ditto
4725 * src/lyx_cb.C: ditto
4726 * src/lyx_gui.C: ditto
4727 * src/lyx_gui_misc.C: ditto
4729 * src/BufferView_pimpl.C (restorePosition): update buffer only
4732 * src/commandtags.h (LFUN_REFTOGGLE): removed
4733 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4734 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4735 (LFUN_REFBACK): renamed LFUN_REF_BACK
4737 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4738 * src/menus.C: ditto
4739 * src/lyxfunc.C (Dispatch): ditto.
4740 InsertRef dialog is now GUI-independent.
4742 * src/texrow.C: added using std::endl;
4744 * src/insets/insetref.[Ch]: strip out large amounts of code.
4745 The inset is now a container and this functionality is now
4746 managed by a new FormRef dialog
4748 * src/frontends/Dialogs.h (showRef, createRef): new signals
4750 * src/frontends/xforms/FormIndex.[Ch],
4751 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4752 when setting dialog's min/max size
4753 * src/frontends/xforms/FormIndex.[Ch]: ditto
4755 * src/frontends/xforms/FormRef.[Ch],
4756 src/frontends/xforms/forms/form_ref.fd: new xforms
4757 implementation of an InsetRef dialog
4759 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4762 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4763 ios::nocreate is not part of the standard. Removed.
4765 2000-08-07 Baruch Even <baruch.even@writeme.com>
4767 * src/graphics/Renderer.h:
4768 * src/graphics/Renderer.C: Added base class for rendering of different
4769 image formats into Pixmaps.
4771 * src/graphics/XPM_Renderer.h:
4772 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4773 in a different class.
4775 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4776 easily add support for other formats.
4778 * src/insets/figinset.C: plugged a leak of an X resource.
4780 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4782 * src/CutAndPaste.[Ch]: make all metods static.
4784 * development/Code_rules/Rules: more work, added section on
4785 Exceptions, and a References section.
4787 * a lot of header files: work to make doc++ able to generate the
4788 source documentation, some workarounds of doc++ problems. Doc++ is
4789 now able to generate the documentation.
4791 2000-08-07 Juergen Vigna <jug@sad.it>
4793 * src/insets/insettabular.C (recomputeTextInsets): removed function
4795 * src/tabular.C (SetWidthOfMulticolCell):
4797 (calculate_width_of_column_NMC): fixed return value so that it really
4798 only returns true if the column-width has changed (there where
4799 problems with muliticolumn-cells in this column).
4801 2000-08-04 Juergen Vigna <jug@sad.it>
4803 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4804 also on the scrollstatus of the inset.
4805 (workAreaMotionNotify): ditto.
4807 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4809 2000-08-01 Juergen Vigna <jug@sad.it>
4811 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4813 * src/commandtags.h:
4814 * src/LyXAction.C (init):
4815 * src/insets/inset.C (LocalDispatch): added support for
4818 * src/insets/inset.C (scroll): new functions.
4820 * src/insets/insettext.C (removeNewlines): new function.
4821 (SetAutoBreakRows): removes forced newlines in the text of the
4822 paragraph if autoBreakRows is set to false.
4824 * src/tabular.C (Latex): generates a parbox around the cell contents
4827 * src/frontends/xforms/FormTabular.C (local_update): removed
4828 the radio_useparbox button.
4830 * src/tabular.C (UseParbox): new function
4832 2000-08-06 Baruch Even <baruch.even@writeme.com>
4834 * src/graphics/GraphicsCache.h:
4835 * src/graphics/GraphicsCache.C:
4836 * src/graphics/GraphicsCacheItem.h:
4837 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4840 * src/insets/insetgraphics.h:
4841 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4842 and the drawing of the inline image.
4844 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4845 loaded into the wrong position.
4847 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4850 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4852 * src/support/translator.h: move all typedefs to public section
4854 * src/support/filetools.C (MakeLatexName): return string const
4856 (TmpFileName): ditto
4857 (FileOpenSearch): ditto
4859 (LibFileSearch): ditto
4860 (i18nLibFileSearch): ditto
4863 (CreateTmpDir): ditto
4864 (CreateBufferTmpDir): ditto
4865 (CreateLyXTmpDir): ditto
4868 (MakeAbsPath): ditto
4870 (OnlyFilename): ditto
4872 (NormalizePath): ditto
4873 (CleanupPath): ditto
4874 (GetFileContents): ditto
4875 (ReplaceEnvironmentPath): ditto
4876 (MakeRelPath): ditto
4878 (ChangeExtension): ditto
4879 (MakeDisplayPath): ditto
4880 (do_popen): return cmdret const
4881 (findtexfile): return string const
4883 * src/support/DebugStream.h: add some /// to please doc++
4885 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4887 * src/texrow.C (same_rownumber): functor to use with find_if
4888 (getIdFromRow): rewritten to use find_if and to not update the
4889 positions. return true if row is found
4890 (increasePos): new method, use to update positions
4892 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4894 * src/lyxlex_pimpl.C (verifyTable): new method
4897 (GetString): return string const
4898 (pushTable): rewrite to use std::stack
4900 (setFile): better check
4903 * src/lyxlex.h: make LyXLex noncopyable
4905 * src/lyxlex.C (text): return char const * const
4906 (GetString): return string const
4907 (getLongString): return string const
4909 * src/lyx_gui_misc.C (askForText): return pair<...> const
4911 * src/lastfiles.[Ch] (operator): return string const
4913 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4914 istringstream not char const *.
4915 move token.end() out of loop.
4916 (readFile): move initializaton of token
4918 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4919 getIdFromRow is successful.
4921 * lib/bind/emacs.bind: don't include menus bind
4923 * development/Code_rules/Rules: the beginnings of making this
4924 better and covering more of the unwritten rules that we have.
4926 * development/Code_rules/Recommendations: a couple of wording
4929 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4931 * src/support/strerror.c: remove C++ comment.
4933 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4935 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4936 LFUN_INDEX_INSERT_LAST
4938 * src/texrow.C (getIdFromRow): changed from const_iterator to
4939 iterator, allowing code to compile with DEC cxx
4941 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4942 stores part of the class, as suggested by Allan. Will allow
4944 (apply): test to apply uses InsetCommandParams operator!=
4946 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4947 (apply): test to apply uses InsetCommandParams operator!=
4949 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4950 stores part of the class.
4951 (update): removed limits on min/max size.
4953 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4954 (apply): test to apply uses InsetCommandParams operator!=
4956 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4957 (Read, Write, scanCommand, getCommand): moved functionality
4958 into InsetCommandParams.
4960 (getScreenLabel): made pure virtual
4961 new InsetCommandParams operators== and !=
4963 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4964 c-tors based on InsetCommandParams. Removed others.
4965 * src/insets/insetinclude.[Ch]: ditto
4966 * src/insets/insetlabel.[Ch]: ditto
4967 * src/insets/insetparent.[Ch]: ditto
4968 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4970 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4971 insets derived from InsetCommand created using similar c-tors
4972 based on InsetCommandParams
4973 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4974 * src/menus.C (ShowRefsMenu): ditto
4975 * src/paragraph.C (Clone): ditto
4976 * src/text2.C (SetCounter): ditto
4977 * src/lyxfunc.C (Dispatch) ditto
4978 Also recreated old InsetIndex behaviour exactly. Can now
4979 index-insert at the start of a paragraph and index-insert-last
4980 without launching the pop-up.
4982 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4984 * lib/lyxrc.example: mark te pdf options as non functional.
4986 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4987 (isStrDbl): move tmpstr.end() out of loop.
4988 (strToDbl): move intialization of tmpstr
4989 (lowercase): return string const and move tmp.end() out of loop.
4990 (uppercase): return string const and move tmp.edn() out of loop.
4991 (prefixIs): add assertion
4996 (containsOnly): ditto
4997 (containsOnly): ditto
4998 (containsOnly): ditto
4999 (countChar): make last arg char not char const
5000 (token): return string const
5001 (subst): return string const, move tmp.end() out of loop.
5002 (subst): return string const, add assertion
5003 (strip): return string const
5004 (frontStrip): return string const, add assertion
5005 (frontStrip): return string const
5010 * src/support/lstrings.C: add inclde "LAssert.h"
5011 (isStrInt): move tmpstr.end() out of loop.
5013 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5014 toollist.end() out of loop.
5015 (deactivate): move toollist.end() out of loop.
5016 (update): move toollist.end() out of loop.
5017 (updateLayoutList): move tc.end() out of loop.
5018 (add): move toollist.end() out of loop.
5020 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5021 md.end() out of loop.
5023 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5025 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5028 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5029 (Erase): move insetlist.end() out of loop.
5031 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5032 ref to const string as first arg. Move initialization of some
5033 variables, whitespace changes.
5035 * src/kbmap.C (defkey): move table.end() out of loop.
5036 (kb_keymap): move table.end() out of loop.
5037 (findbinding): move table.end() out of loop.
5039 * src/MenuBackend.C (hasMenu): move end() out of loop.
5040 (getMenu): move end() out of loop.
5041 (getMenu): move menulist_.end() out of loop.
5043 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5045 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5048 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5049 (getFromLyXName): move infotab.end() out of loop.
5051 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5052 -fvtable-thunks -ffunction-sections -fdata-sections
5054 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5056 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5059 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5061 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5063 * src/frontends/xforms/FormCitation.[Ch],
5064 src/frontends/xforms/FormIndex.[Ch],
5065 src/frontends/xforms/FormToc.[Ch],
5066 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5068 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5070 * src/commandtags.h: renamed, created some flags for citation
5073 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5075 * src/lyxfunc.C (dispatch): use signals to insert index entry
5077 * src/frontends/Dialogs.h: new signal createIndex
5079 * src/frontends/xforms/FormCommand.[Ch],
5080 src/frontends/xforms/FormCitation.[Ch],
5081 src/frontends/xforms/FormToc.[Ch],
5082 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5084 * src/insets/insetindex.[Ch]: GUI-independent
5086 * src/frontends/xforms/FormIndex.[Ch],
5087 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5090 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5092 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5093 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5095 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5097 * src/insets/insetref.C (Latex): rewrite so that there is now
5098 question that a initialization is requested.
5100 * src/insets/insetcommand.h: reenable the hide signal
5102 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5104 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5105 fix handling of shortcuts (many bugs :)
5106 (add_lastfiles): ditto.
5108 * lib/ui/default.ui: fix a few shortcuts.
5110 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5112 * Makefile.am: Fix ``rpmdist'' target to return the exit
5113 status of the ``rpm'' command, instead of the last command in
5114 the chain (the ``rm lyx.xpm'' command, which always returns
5117 2000-08-02 Allan Rae <rae@lyx.org>
5119 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5120 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5121 * src/frontends/xforms/FormToc.C (FormToc): ditto
5123 * src/frontends/xforms/Makefile.am: A few forgotten files
5125 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5126 Signals-not-copyable-problem Lars' started commenting out.
5128 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5130 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5132 * src/insets/insetcommand.h: Signals is not copyable so anoter
5133 scheme for automatic hiding of forms must be used.
5135 * src/frontends/xforms/FormCitation.h: don't inerit from
5136 noncopyable, FormCommand already does that.
5137 * src/frontends/xforms/FormToc.h: ditto
5138 * src/frontends/xforms/FormUrl.h: ditto
5140 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5142 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5144 * src/insets/insetcommand.h (hide): new SigC::Signal0
5145 (d-tor) new virtual destructor emits hide signal
5147 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5148 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5150 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5151 LOF and LOT. Inset is now GUI-independent
5153 * src/insets/insetloa.[Ch]: redundant
5154 * src/insets/insetlof.[Ch]: ditto
5155 * src/insets/insetlot.[Ch]: ditto
5157 * src/frontends/xforms/forms/form_url.fd: tweaked!
5158 * src/frontends/xforms/forms/form_citation.fd: ditto
5160 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5161 dialogs dealing with InsetCommand insets
5163 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5164 FormCommand base class
5165 * src/frontends/xforms/FormUrl.[Ch]: ditto
5167 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5169 * src/frontends/xforms/FormToc.[Ch]: ditto
5171 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5172 passed a generic InsetCommand pointer
5173 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5175 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5176 and modified InsetTOC class
5177 * src/buffer.C: ditto
5179 * forms/lyx.fd: strip out old FD_form_toc code
5180 * src/lyx_gui_misc.C: ditto
5181 * src/lyx_gui.C: ditto
5182 * src/lyx_cb.C: ditto
5183 * src/lyx.[Ch]: ditto
5185 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5187 * src/support/utility.hpp: tr -d '\r'
5189 2000-08-01 Juergen Vigna <jug@sad.it>
5191 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5193 * src/commandtags.h:
5194 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5195 LFUN_TABULAR_FEATURES.
5197 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5198 LFUN_LAYOUT_TABULAR.
5200 * src/insets/insettabular.C (getStatus): implemented helper function.
5202 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5204 2000-07-31 Juergen Vigna <jug@sad.it>
5206 * src/text.C (draw): fixed screen update problem for text-insets.
5208 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5209 something changed probably this has to be added in various other
5212 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5214 2000-07-31 Baruch Even <baruch.even@writeme.com>
5216 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5217 templates to satisfy compaq cxx.
5220 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5222 * src/support/translator.h (equal_1st_in_pair::operator()): take
5223 const ref pair_type as arg.
5224 (equal_2nd_in_pair::operator()): ditto
5225 (Translator::~Translator): remove empty d-tor.
5227 * src/graphics/GraphicsCache.C: move include config.h to top, also
5228 put initialization of GraphicsCache::singleton here.
5229 (~GraphicsCache): move here
5230 (addFile): take const ref as arg
5233 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5235 * src/BufferView2.C (insertLyXFile): change te with/without header
5238 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5240 * src/frontends/xforms/FormGraphics.C (apply): add some
5241 static_cast. Not very nice, but required by compaq cxx.
5243 * src/frontends/xforms/RadioButtonGroup.h: include header
5244 <utility> instead of <pair.h>
5246 * src/insets/insetgraphicsParams.C: add using directive.
5247 (readResize): change return type to void.
5248 (readOrigin): ditto.
5250 * src/lyxfunc.C (getStatus): add missing break for build-program
5251 function; add test for Literate for export functions.
5253 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5254 entries in Options menu.
5256 2000-07-31 Baruch Even <baruch.even@writeme.com>
5258 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5259 protect against auto-allocation; release icon when needed.
5261 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5263 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5264 on usual typewriter.
5266 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5267 earlier czech.kmap), useful only for programming.
5269 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5271 * src/frontends/xforms/FormCitation.h: fix conditioning around
5274 2000-07-31 Juergen Vigna <jug@sad.it>
5276 * src/frontends/xforms/FormTabular.C (local_update): changed
5277 radio_linebreaks to radio_useparbox and added radio_useminipage.
5279 * src/tabular.C: made support for using minipages/parboxes.
5281 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5283 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5285 (descent): so the cursor is in the middle.
5286 (width): bit smaller box.
5288 * src/insets/insetgraphics.h: added display() function.
5290 2000-07-31 Baruch Even <baruch.even@writeme.com>
5292 * src/frontends/Dialogs.h: Added showGraphics signals.
5294 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5295 xforms form definition of the graphics dialog.
5297 * src/frontends/xforms/FormGraphics.h:
5298 * src/frontends/xforms/FormGraphics.C: Added files, the
5299 GUIndependent code of InsetGraphics
5301 * src/insets/insetgraphics.h:
5302 * src/insets/insetgraphics.C: Major writing to make it work.
5304 * src/insets/insetgraphicsParams.h:
5305 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5306 struct between InsetGraphics and GUI.
5308 * src/LaTeXFeatures.h:
5309 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5310 support for graphicx package.
5312 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5313 for the graphics inset.
5315 * src/support/translator.h: Added file, used in
5316 InsetGraphicsParams. this is a template to translate between two
5319 * src/frontends/xforms/RadioButtonGroup.h:
5320 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5321 way to easily control a radio button group.
5323 2000-07-28 Juergen Vigna <jug@sad.it>
5325 * src/insets/insettabular.C (LocalDispatch):
5326 (TabularFeatures): added support for lyx-functions of tabular features.
5327 (cellstart): refixed this function after someone wrongly changed it.
5329 * src/commandtags.h:
5330 * src/LyXAction.C (init): added support for tabular-features
5332 2000-07-28 Allan Rae <rae@lyx.org>
5334 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5335 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5336 triggers the callback for input checking. As a result we sometimes get
5337 "LyX: This shouldn't happen..." printed to cerr.
5338 (input): Started using status variable since I only free() on
5339 destruction. Some input checking for paths and font sizes.
5341 * src/frontends/xforms/FormPreferences.h: Use status to control
5342 activation of Ok and Apply
5344 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5345 callback. Also resized to stop segfaults with 0.88. The problem is
5346 that xforms-0.88 requires the folder to be wide enough to fit all the
5347 tabs. If it isn't it causes all sorts of problems.
5349 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5351 * src/frontends/xforms/forms/README: Reflect reality.
5353 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5354 * src/frontends/xforms/forms/makefile: ditto.
5356 * src/commandtags.h: Get access to new Preferences dialog
5357 * src/LyXAction.C: ditto
5358 * src/lyxfunc.C: ditto
5359 * lib/ui/default.ui: ditto
5361 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5363 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5365 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5368 * src/frontends/xforms/form_url.[Ch]: added.
5370 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5372 * src/insets/insetbib.h: fixed bug in previous commit
5374 * src/frontends/xforms/FormUrl.h: ditto
5376 * src/frontends/xforms/FormPrint.h: ditto
5378 * src/frontends/xforms/FormPreferences.h: ditto
5380 * src/frontends/xforms/FormCopyright.h: ditto
5382 * src/frontends/xforms/FormCitation.C: ditto
5384 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5385 private copyconstructor and private default contructor
5387 * src/support/Makefile.am: add utility.hpp
5389 * src/support/utility.hpp: new file from boost
5391 * src/insets/insetbib.h: set owner in clone
5393 * src/frontends/xforms/FormCitation.C: added missing include
5396 * src/insets/form_url.[Ch]: removed
5398 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5400 * development/lyx.spec.in
5401 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5402 file/directory re-organization.
5404 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5406 * src/insets/insetcommand.[Ch]: moved the string data and
5407 associated manipulation methods into a new stand-alone class
5408 InsetCommandParams. This class has two additional methods
5409 getAsString() and setFromString() allowing the contents to be
5410 moved around as a single string.
5411 (addContents) method removed.
5412 (setContents) method no longer virtual.
5414 * src/buffer.C (readInset): made use of new InsetCitation,
5415 InsetUrl constructors based on InsetCommandParams.
5417 * src/commandtags.h: add LFUN_INSERT_URL
5419 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5420 independent InsetUrl and use InsetCommandParams to extract
5421 string info and create new Insets.
5423 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5425 * src/frontends/xforms/FormCitation.C (apply): uses
5428 * src/frontends/xforms/form_url.C
5429 * src/frontends/xforms/form_url.h
5430 * src/frontends/xforms/FormUrl.h
5431 * src/frontends/xforms/FormUrl.C
5432 * src/frontends/xforms/forms/form_url.fd: new files
5434 * src/insets/insetcite.[Ch]: removed unused constructors.
5436 * src/insets/insetinclude.[Ch]: no longer store filename
5438 * src/insets/inseturl.[Ch]: GUI-independent.
5440 2000-07-26 Juergen Vigna <jug@sad.it>
5441 * renamed frontend from gtk to gnome as it is that what is realized
5442 and did the necessary changes in the files.
5444 2000-07-26 Marko Vendelin <markov@ioc.ee>
5446 * configure.in: cleaning up gnome configuration scripts
5448 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5450 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5451 shortcuts syndrom by redrawing them explicitely (a better solution
5452 would be appreciated).
5454 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5456 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5459 * src/lyx_cb.C (MenuExport): change html export to do the right
5460 thing depending of the document type (instead of having
5461 html-linuxdoc and html-docbook).
5462 * src/lyxfunc.C (getStatus): update for html
5463 * lib/ui/default.ui: simplify due to the above change.
5464 * src/menus.C (ShowFileMenu): update too (in case we need it).
5466 * src/MenuBackend.C (read): if a menu is defined twice, add the
5467 new entries to the exiting one.
5469 2000-07-26 Juergen Vigna <jug@sad.it>
5471 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5473 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5474 and return a bool if it did actual save the file.
5475 (AutoSave): don't autosave a unnamed doc.
5477 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5478 check if this is an UNNAMED new file and react to it.
5479 (newFile): set buffer to unnamed and change to not mark a new
5480 buffer dirty if I didn't do anything with it.
5482 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5484 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5486 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5487 friend as per Angus's patch posted to lyx-devel.
5489 * src/ext_l10n.h: updated
5491 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5492 gettext on the style string right before inserting them into the
5495 * autogen.sh: add code to extract style strings form layout files,
5496 not good enough yet.
5498 * src/frontends/gtk/.cvsignore: add MAKEFILE
5500 * src/MenuBackend.C (read): run the label strings through gettext
5501 before storing them in the containers.
5503 * src/ext_l10n.h: new file
5505 * autogen.sh : generate the ext_l10n.h file here
5507 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5509 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5512 * lib/ui/default.ui: fix a couple of typos.
5514 * config/gnome/gtk.m4: added (and added to the list of files in
5517 * src/insets/insetinclude.C (unique_id): fix when we are using
5518 lyxstring instead of basic_string<>.
5519 * src/insets/insettext.C (LocalDispatch): ditto.
5520 * src/support/filetools.C: ditto.
5522 * lib/configure.m4: create the ui/ directory if necessary.
5524 * src/LyXView.[Ch] (updateToolbar): new method.
5526 * src/BufferView_pimpl.C (buffer): update the toolbar when
5527 opening/closing buffer.
5529 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5531 * src/LyXAction.C (getActionName): enhance to return also the name
5532 and options of pseudo-actions.
5533 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5535 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5536 as an example of what is possible). Used in File->Build too (more
5537 useful) and in the import/export menus (to mimick the complicated
5538 handling of linuxdoc and friends). Try to update all the entries.
5540 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5543 * src/MenuBackend.C (read): Parse the new OptItem tag.
5545 * src/MenuBackend.h: Add a new optional_ data member (used if the
5546 entry should be omitted when the lyxfunc is disabled).
5548 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5549 function, used as a shortcut.
5550 (create_submenu): align correctly the shortcuts on the widest
5553 * src/MenuBackend.h: MenuItem.label() only returns the label of
5554 the menu without shortcut; new method shortcut().
5556 2000-07-14 Marko Vendelin <markov@ioc.ee>
5558 * src/frontends/gtk/Dialogs.C:
5559 * src/frontends/gtk/FormCopyright.C:
5560 * src/frontends/gtk/FormCopyright.h:
5561 * src/frontends/gtk/Makefile.am: added these source-files for the
5562 Gtk/Gnome support of the Copyright-Dialog.
5564 * src/main.C: added Gnome::Main initialization if using
5565 Gtk/Gnome frontend-GUI.
5567 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5569 * config/gnome/aclocal-include.m4
5570 * config/gnome/compiler-flags.m4
5571 * config/gnome/curses.m4
5572 * config/gnome/gnome--.m4
5573 * config/gnome/gnome-bonobo-check.m4
5574 * config/gnome/gnome-common.m4
5575 * config/gnome/gnome-fileutils.m4
5576 * config/gnome/gnome-ghttp-check.m4
5577 * config/gnome/gnome-gnorba-check.m4
5578 * config/gnome/gnome-guile-checks.m4
5579 * config/gnome/gnome-libgtop-check.m4
5580 * config/gnome/gnome-objc-checks.m4
5581 * config/gnome/gnome-orbit-check.m4
5582 * config/gnome/gnome-print-check.m4
5583 * config/gnome/gnome-pthread-check.m4
5584 * config/gnome/gnome-support.m4
5585 * config/gnome/gnome-undelfs.m4
5586 * config/gnome/gnome-vfs.m4
5587 * config/gnome/gnome-x-checks.m4
5588 * config/gnome/gnome-xml-check.m4
5589 * config/gnome/gnome.m4
5590 * config/gnome/gperf-check.m4
5591 * config/gnome/gtk--.m4
5592 * config/gnome/linger.m4
5593 * config/gnome/need-declaration.m4: added configuration scripts
5594 for Gtk/Gnome frontend-GUI
5596 * configure.in: added support for the --with-frontend=gtk option
5598 * autogen.sh: added config/gnome/* to list of config-files
5600 * acconfig.h: added define for GTKGUI-support
5602 * config/lyxinclude.m4: added --with-frontend[=value] option value
5603 for Gtk/Gnome frontend-GUI support.
5605 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5607 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5611 * src/paragraph.C (GetChar): remove non-const version
5613 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5614 (search_kw): use it.
5616 * src/lyx_main.C (init): if "preferences" exist, read that instead
5618 (ReadRcFile): return bool if the file could be read ok.
5619 (ReadUIFile): add a check to see if lex file is set ok.
5621 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5622 bastring can be used instead of lyxstring (still uses the old code
5623 if std::string is good enough or if lyxstring is used.)
5625 * src/encoding.C: make the arrays static, move ininle functions
5627 * src/encoding.h: from here.
5629 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5630 (parseSingleLyXformat2Token): move inset parsing to separate method
5631 (readInset): new private method
5633 * src/Variables.h: remove virtual from get().
5635 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5636 access to NEW_INSETS and NEW_TABULAR
5638 * src/MenuBackend.h: remove superfluous forward declaration of
5639 MenuItem. Add documentations tags "///", remove empty MenuItem
5640 destructor, remove private default contructor.
5642 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5644 (read): more string mlabel and mname to where they are used
5645 (read): remove unused variables mlabel and mname
5646 (defaults): unconditional clear, make menusetup take advantage of
5647 add returning Menu &.
5649 * src/LyXView.h: define NEW_MENUBAR as default
5651 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5652 to NEW_INSETS and NEW_TABULAR.
5653 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5654 defined. Change some of the "xxxx-inset-insert" functions names to
5657 * several files: more enahncements to NEW_INSETS and the resulting
5660 * lib/lyxrc.example (\date_insert_format): move to misc section
5662 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5663 bastring and use AC_CACHE_CHECK.
5664 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5665 the system have the newest methods. uses AC_CACHE_CHECK
5666 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5667 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5668 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5670 * configure.in: add LYX_CXX_GOOD_STD_STRING
5672 * acinclude.m4: recreated
5674 2000-07-24 Amir Karger <karger@lyx.org>
5676 * README: add Hebrew, Arabic kmaps
5679 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5681 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5684 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5686 * Lot of files: add pragma interface/implementation.
5688 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5690 * lib/ui/default.ui: new file (ans new directory). Contains the
5691 default menu and toolbar.
5693 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5694 global space. Toolbars are now read (as menus) in ui files.
5696 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5698 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5699 is disabled because the document is read-only. We want to have the
5700 toggle state of the function anyway.
5701 (getStatus): add code for LFUN_VC* functions (mimicking what is
5702 done in old-style menus)
5704 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5705 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5707 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5708 * src/BufferView_pimpl.C: ditto.
5709 * src/lyxfunc.C: ditto.
5711 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5712 default). This replaces old-style menus by new ones.
5714 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5715 MenuItem. Contain the data structure of a menu.
5717 * src/insets/insettext.C: use LyXView::setLayout instead of
5718 accessing directly the toolbar combox.
5719 * src/lyxfunc.C (Dispatch): ditto.
5721 * src/LyXView.C (setLayout): new method, which just calls
5722 Toolbar::setLayout().
5723 (updateLayoutChoice): move part of this method in Toolbar.
5725 * src/toolbar.[Ch]: removed.
5727 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5728 implementation the toolbar.
5730 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5731 the toolbar. It might make sense to merge it with ToolbarDefaults
5733 (setLayout): new function.
5734 (updateLayoutList): ditto.
5735 (openLayoutList): ditto.
5737 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5738 xforms implementation of the toolbar.
5739 (get_toolbar_func): comment out, since I do not
5740 know what it is good for.
5742 * src/ToolbarDefaults.h: Add the ItemType enum.
5744 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5745 for a list of allocated C strings. Used in Menubar xforms
5746 implementation to avoid memory leaks.
5748 * src/support/lstrings.[Ch] (uppercase): new version taking and
5752 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5753 * lib/bind/emacs.bind: ditto.
5755 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5757 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5758 forward decl of LyXView.
5760 * src/toolbar.C (toolbarItem): moved from toolbar.h
5761 (toolbarItem::clean): ditto
5762 (toolbarItem::~toolbarItem): ditto
5763 (toolbarItem::operator): ditto
5765 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5767 * src/paragraph.h: control the NEW_TABULAR define from here
5769 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5770 USE_TABULAR_INSETS to NEW_TABULAR
5772 * src/ToolbarDefaults.C: add include "lyxlex.h"
5774 * files using the old table/tabular: use NEW_TABULAR to control
5775 compilation of old tabular stuff.
5777 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5780 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5781 planemet in reading of old style floats, fix the \end_deeper
5782 problem when reading old style floats.
5784 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5786 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5788 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5790 * lib/bind/sciword.bind: updated.
5792 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5794 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5795 layout write problem
5797 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5799 * src/Makefile.am (INCLUDES): remove image directory from include
5802 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5803 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5805 * src/LyXView.C (create_form_form_main): read the application icon
5808 * lib/images/*.xpm: change the icons to use transparent color for
5811 * src/toolbar.C (update): change the color of the button when it
5814 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5816 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5817 setting explicitely the minibuffer.
5818 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5820 * src/LyXView.C (showState): new function. Shows font information
5821 in minibuffer and update toolbar state.
5822 (LyXView): call Toolbar::update after creating the
5825 * src/toolbar.C: change toollist to be a vector instead of a
5827 (BubbleTimerCB): get help string directly from the callback
5828 argument of the corresponding icon (which is the action)
5829 (set): remove unnecessary ugliness.
5830 (update): new function. update the icons (depressed, disabled)
5831 depending of the status of the corresponding action.
5833 * src/toolbar.h: remove help in toolbarItem
5835 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5837 * src/Painter.C (text): Added code for using symbol glyphs from
5838 iso10646 fonts. Currently diabled.
5840 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5843 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5844 magyar,turkish and usorbian.
5846 * src/paragraph.C (isMultiLingual): Made more efficient.
5848 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5851 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5852 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5853 Also changed the prototype to "bool math_insert_greek(char)".
5855 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5857 * lots of files: apply the NEW_INSETS on all code that will not be
5858 needed when we move to use the new insets. Enable the define in
5859 lyxparagrah.h to try it.
5861 * src/insets/insettabular.C (cellstart): change to be a static
5863 (InsetTabular): initialize buffer in the initializer list.
5865 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5867 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5868 form_print.h out of the header file. Replaced with forward
5869 declarations of the relevant struct.
5871 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5874 * src/commandtags.h: do not include "debug.h" which does not
5875 belong there. #include it in some other places because of this
5878 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5880 * src/insets/insetcaption.C: add a couple "using" directives.
5882 * src/toolbar.C (add): get the help text directly from lyxaction.
5884 (setPixmap): new function. Loads from disk and sets a pixmap on a
5885 botton; the name of the pixmap file is derived from the command
5888 * src/toolbar.h: remove members isBitmap and pixmap from
5891 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5892 * lib/images/: move many files from images/banner.xpm.
5894 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5896 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5897 * src/toolbar.C: ditto.
5898 * configure.in: ditto.
5899 * INSTALL: document.
5901 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5902 the spellchecker popup is closed from the WM.
5904 2000-07-19 Juergen Vigna <jug@sad.it>
5906 * src/insets/insetfloat.C (Write): small fix because we use the
5907 insetname for the type now!
5909 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5911 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5914 * src/frontends/Dialogs.h: removed hideCitation signal
5916 * src/insets/insetcite.h: added hide signal
5918 * src/insets/insetcite.C (~InsetCitation): emits new signal
5919 (getScreenLabel): "intelligent" label should now fit on the screen!
5921 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5923 * src/frontends/xforms/FormCitation.C (showInset): connects
5924 hide() to the inset's hide signal
5925 (show): modified to use fl_set_object_position rather than
5926 fl_set_object_geometry wherever possible
5928 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5930 * src/insets/lyxinset.h: add caption code
5932 * src/insets/insetfloat.C (type): new method
5934 * src/insets/insetcaption.C (Write): new method
5936 (LyxCode): new method
5938 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5939 to get it right together with using the FloatList.
5941 * src/commandtags.h: add LFUN_INSET_CAPTION
5942 * src/lyxfunc.C (Dispatch): handle it
5944 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5947 * src/Variables.[Ch]: make expand take a const reference, remove
5948 the destructor, some whitespace changes.
5950 * src/LyXAction.C (init): add caption-inset-insert
5952 * src/FloatList.C (FloatList): update the default floats a bit.
5954 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5956 * src/Variables.[Ch]: new files. Intended to be used for language
5957 specific strings (like \chaptername) and filename substitution in
5960 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5962 * lib/kbd/american.kmap: update
5964 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5966 * src/bufferparams.[Ch]: remove member allowAccents.
5968 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5970 * src/LaTeXLog.C: use the log_form.h header.
5971 * src/lyx_gui.C: ditto.
5972 * src/lyx_gui_misc.C: ditto.
5973 * src/lyxvc.h: ditto.
5975 * forms/log_form.fd: new file, created from latexoptions.fd. I
5976 kept the log popup and nuked the options form.
5978 * src/{la,}texoptions.[Ch]: removed.
5979 * src/lyx_cb.C (LaTeXOptions): ditto
5981 * src/lyx_gui.C (create_forms): do not handle the
5982 fd_latex_options form.
5984 2000-07-18 Juergen Vigna <jug@sad.it>
5986 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5987 name of the inset so that it can be requested outside (text2.C).
5989 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5992 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5994 * src/mathed/formula.h (ConvertFont): constify
5996 * src/mathed/formula.C (Read): add warning if \end_inset is not
5997 found on expected place.
5999 * src/insets/lyxinset.h (ConvertFont): consify
6001 * src/insets/insetquotes.C (ConvertFont): constify
6002 * src/insets/insetquotes.h: ditto
6004 * src/insets/insetinfo.h: add labelfont
6006 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6007 (ascent): use labelfont
6011 (Write): make .lyx file a bit nicer
6013 * src/insets/insetfloat.C (Write): simplify somewhat...
6014 (Read): add warning if arg is not found
6016 * src/insets/insetcollapsable.C: add using std::max
6017 (Read): move string token and add warning in arg is not found
6018 (draw): use std::max to get the right ty
6019 (getMaxWidth): simplify by using std::max
6021 * src/insets/insetsection.h: new file
6022 * src/insets/insetsection.C: new file
6023 * src/insets/insetcaption.h: new file
6024 * src/insets/insetcaption.C: new file
6026 * src/insets/inset.C (ConvertFont): constify signature
6028 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6029 insetcaption.[Ch] and insetsection.[Ch]
6031 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6032 uses to use LABEL_COUNTER_CHAPTER instead.
6033 * src/text2.C (SetCounter): here
6035 * src/counters.h: new file
6036 * src/counters.C: new file
6037 * src/Sectioning.h: new file
6038 * src/Sectioning.C: new file
6040 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6042 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6044 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6047 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6050 2000-07-17 Juergen Vigna <jug@sad.it>
6052 * src/tabular.C (Validate): check if array-package is needed.
6053 (SetVAlignment): added support for vertical alignment.
6054 (SetLTFoot): better support for longtable header/footers
6055 (Latex): modified to support added features.
6057 * src/LaTeXFeatures.[Ch]: added array-package.
6059 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6061 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6064 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6066 * configure.in: do not forget to put a space after -isystem.
6068 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6070 * lib/kbd/arabic.kmap: a few fixes.
6072 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6074 * some whitespace chagnes to a number of files.
6076 * src/support/DebugStream.h: change to make it easier for
6077 doc++ to parse correctly.
6078 * src/support/lyxstring.h: ditto
6080 * src/mathed/math_utils.C (compara): change to have only one
6082 (MathedLookupBOP): change because of the above.
6084 * src/mathed/math_delim.C (math_deco_compare): change to have only
6086 (search_deco): change becasue of the above.
6088 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6089 instead of manually coded one.
6091 * src/insets/insetquotes.C (Read): read the \end_inset too
6093 * src/insets/insetlatex.h: remove file
6094 * src/insets/insetlatex.C: remove file
6096 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6098 (InsetPrintIndex): remove destructor
6100 * src/insets/insetinclude.h: remove default constructor
6102 * src/insets/insetfloat.C: work to make it work better
6104 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6106 * src/insets/insetcite.h (InsetCitation): remove default constructor
6108 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6110 * src/text.C (GetColumnNearX): comment out some currently unused code.
6112 * src/paragraph.C (writeFile): move some initializations closer to
6114 (CutIntoMinibuffer): small change to use new matchIT operator
6118 (InsertInset): ditto
6121 (InsetIterator): ditto
6122 (Erase): small change to use new matchFT operator
6124 (GetFontSettings): ditto
6125 (HighestFontInRange): ditto
6128 * src/lyxparagraph.h: some chars changed to value_type
6129 (matchIT): because of some stronger checking (perhaps too strong)
6130 in SGI STL, the two operator() unified to one.
6133 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6135 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6136 the last inset read added
6137 (parseSingleLyXformat2Token): some more (future) compability code added
6138 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6139 (parseSingleLyXformat2Token): set last_inset_read
6140 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6141 (parseSingleLyXformat2Token): don't double intializw string next_token
6143 * src/TextCache.C (text_fits::operator()): add const's to the signature
6144 (has_buffer::operator()): ditto
6146 * src/Floating.h: add some comments on the class
6148 * src/FloatList.[Ch] (typeExist): new method
6151 * src/BackStack.h: added default constructor, wanted by Gcc.
6153 2000-07-14 Juergen Vigna <jug@sad.it>
6155 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6157 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6159 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6160 do a redraw when the window is resized!
6161 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6163 * src/insets/insettext.C (resizeLyXText): added function to correctly
6164 being able to resize the LyXWindow.
6166 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6168 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6170 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6171 crashes when closing dialog to a deleted inset.
6173 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6174 method! Now similar to other insets.
6176 2000-07-13 Juergen Vigna <jug@sad.it>
6178 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6180 * lib/examples/Literate.lyx: small patch!
6182 * src/insets/insetbib.C (Read): added this function because of wrong
6183 Write (without [begin|end]_inset).
6185 2000-07-11 Juergen Vigna <jug@sad.it>
6187 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6188 as the insertInset could not be good!
6190 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6191 the bool param should not be last.
6193 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6195 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6196 did submit that to Karl).
6198 * configure.in: use -isystem instead of -I for X headers. This
6199 fixes a problem on solaris with a recent gcc;
6200 put the front-end code after the X detection code;
6201 configure in sigc++ before lib/
6203 * src/lyx_main.C (commandLineHelp): remove -display from command
6206 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6208 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6209 Also put in Makefile rules for building the ``listerrors''
6210 program for parsing errors from literate programs written in LyX.
6212 * lib/build-listerrors: Added small shell script as part of compile
6213 process. This builds a working ``listerrors'' binary if noweb is
6214 installed and either 1) the VNC X server is installed on the machine,
6215 or 2) the user is compiling from within a GUI. The existence of a GUI
6216 is necessary to use the ``lyx --export'' feature for now. This
6217 hack can be removed once ``lyx --export'' no longer requires a GUI to
6220 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6222 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6223 now passed back correctly from gcc and placed "under" error
6224 buttons in a Literate LyX source.
6226 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6228 * src/text.C (GetColumnNearX): Better behavior when a RTL
6229 paragraph is ended by LTR text.
6231 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6234 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6236 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6237 true when clipboard is empty.
6239 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6241 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6242 row of the paragraph.
6243 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6244 to prevent calculation of bidi tables
6246 2000-07-07 Juergen Vigna <jug@sad.it>
6248 * src/screen.C (ToggleSelection): added y_offset and x_offset
6251 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6254 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6256 * src/insets/insettext.C: fixed Layout-Display!
6258 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6260 * configure.in: add check for strings.h header.
6262 * src/spellchecker.C: include <strings.h> in order to have a
6263 definition for bzero().
6265 2000-07-07 Juergen Vigna <jug@sad.it>
6267 * src/insets/insettext.C (draw): set the status of the bv->text to
6268 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6270 * src/screen.C (DrawOneRow):
6271 (DrawFromTo): redraw the actual row if something has changed in it
6274 * src/text.C (draw): call an update of the toplevel-inset if something
6275 has changed inside while drawing.
6277 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6279 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6281 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6282 processing inside class.
6284 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6285 processing inside class.
6287 * src/insets/insetindex.h new struct Holder, consistent with other
6290 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6291 citation dialog from main code and placed it in src/frontends/xforms.
6292 Dialog launched through signals instead of callbacks
6294 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6296 * lyx.man: update the options description.
6298 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6300 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6301 handle neg values, set min width to 590, add doc about -display
6303 2000-07-05 Juergen Vigna <jug@sad.it>
6305 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6306 calls to BufferView *.
6308 * src/insets/insettext.C (checkAndActivateInset): small fix non
6309 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6311 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6312 their \end_inset token!
6314 2000-07-04 edscott <edscott@imp.mx>
6316 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6317 lib/lyxrc.example: added option \wheel_jump
6319 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6321 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6322 remove support for -width,-height,-xpos and -ypos.
6324 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6326 * src/encoding.[Ch]: New files.
6328 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6329 (text): Call to the underline() method only when needed.
6331 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6333 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6334 encoding(s) for the document.
6336 * src/bufferparams.C (BufferParams): Changed default value of
6339 * src/language.C (newLang): Removed.
6340 (items[]): Added encoding information for all defined languages.
6342 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6343 encoding choice button.
6345 * src/lyxrc.h (font_norm_type): New member variable.
6346 (set_font_norm_type): New method.
6348 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6349 paragraphs with different encodings.
6351 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6352 (TransformChar): Changed to work correctly with Arabic points.
6353 (draw): Added support for drawing Arabic points.
6354 (draw): Removed code for drawing underbars (this is done by
6357 * src/support/textutils.h (IsPrintableNonspace): New function.
6359 * src/BufferView_pimpl.h: Added "using SigC::Object".
6360 * src/LyXView.h: ditto.
6362 * src/insets/insetinclude.h (include_label): Changed to mutable.
6364 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6366 * src/mathed/math_iter.h: remove empty destructor
6368 * src/mathed/math_cursor.h: remove empty destructor
6370 * src/insets/lyxinset.h: add THEOREM_CODE
6372 * src/insets/insettheorem.[Ch]: new files
6374 * src/insets/insetminipage.C: (InsertInset): remove
6376 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6378 (InsertInset): remove
6380 * src/insets/insetlist.C: (InsertList): remove
6382 * src/insets/insetfootlike.[Ch]: new files
6384 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6387 (InsertInset): ditto
6389 * src/insets/insetert.C: remove include Painter.h, reindent
6390 (InsertInset): move to header
6392 * src/insets/insetcollapsable.h: remove explicit from default
6393 contructor, remove empty destructor, add InsertInset
6395 * src/insets/insetcollapsable.C (InsertInset): new func
6397 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6399 * src/vspace.h: add explicit to constructor
6401 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6402 \textcompwordmark, please test this.
6404 * src/lyxrc.C: set ascii_linelen to 65 by default
6406 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6408 * src/commandtags.h: add LFUN_INSET_THEOREM
6410 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6411 (makeLinuxDocFile): remove _some_ of the nice logic
6412 (makeDocBookFile): ditto
6414 * src/Painter.[Ch]: (~Painter): removed
6416 * src/LyXAction.C (init): entry for insettheorem added
6418 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6420 (deplog): code to detect files generated by LaTeX, needs testing
6423 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6425 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6427 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6429 * src/LaTeX.C (deplog): Add a check for files that are going to be
6430 created by the first latex run, part of the project to remove the
6433 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6434 contents to the extension list.
6436 2000-07-04 Juergen Vigna <jug@sad.it>
6438 * src/text.C (NextBreakPoint): added support for needFullRow()
6440 * src/insets/lyxinset.h: added needFullRow()
6442 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6445 * src/insets/insettext.C: lots of changes for update!
6447 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6449 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6451 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6453 * src/insets/insetinclude.C (InsetInclude): fixed
6454 initialization of include_label.
6455 (unique_id): now returns a string.
6457 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6459 * src/LaTeXFeatures.h: new member IncludedFiles, for
6460 a map of key, included file name.
6462 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6463 with the included files for inclusion in SGML preamble,
6464 i. e., linuxdoc and docbook.
6467 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6468 nice (is the generated linuxdoc code to be exported?), that
6469 allows to remove column, and only_body that will be true for
6470 slave documents. Insets are allowed inside SGML font type.
6471 New handling of the SGML preamble for included files.
6472 (makeDocBookFile): the same for docbook.
6474 * src/insets/insetinclude.h:
6475 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6477 (DocBook): new export methods.
6479 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6480 and makeDocBookFile.
6482 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6483 formats to export with command line argument -x.
6485 2000-06-29 Juergen Vigna <jug@sad.it>
6487 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6488 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6490 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6491 region could already been cleared by an inset!
6493 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6495 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6498 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6500 (cursorToggle): remove special handling of lyx focus.
6502 2000-06-28 Juergen Vigna <jug@sad.it>
6504 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6507 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6509 * src/insets/insetindex.C (Edit): add a callback when popup is
6512 * src/insets/insettext.C (LocalDispatch):
6513 * src/insets/insetmarginal.h:
6514 * src/insets/insetlist.h:
6515 * src/insets/insetfoot.h:
6516 * src/insets/insetfloat.h:
6517 * src/insets/insetert.h: add a missing std:: qualifier.
6519 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6521 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6524 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6526 * src/insets/insettext.C (Read): remove tmptok unused variable
6527 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6528 (InsertInset): change for new InsetInset code
6530 * src/insets/insettext.h: add TEXT inline method
6532 * src/insets/insettext.C: remove TEXT macro
6534 * src/insets/insetmarginal.C (Write): new method
6535 (Latex): change output slightly
6537 * src/insets/insetfoot.C (Write): new method
6538 (Latex): change output slightly (don't use endl when no need)
6540 * src/insets/insetert.C (Write): new method
6542 * src/insets/insetcollapsable.h: make button_length, button_top_y
6543 and button_bottm_y protected.
6545 * src/insets/insetcollapsable.C (Write): simplify code by using
6546 tostr. Also do not output the float name, the children class
6547 should to that to get control over own arguments
6549 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6550 src/insets/insetminipage.[Ch]:
6553 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6555 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6557 * src/Makefile.am (lyx_SOURCES): add the new files
6559 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6560 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6561 * src/commandtags.h: ditto
6563 * src/LaTeXFeatures.h: add a std::set of used floattypes
6565 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6567 * src/FloatList.[Ch] src/Floating.h: new files
6569 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6571 * src/lyx_cb.C (TableApplyCB): ditto
6573 * src/text2.C: ditto
6574 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6575 (parseSingleLyXformat2Token): ditto + add code for
6576 backwards compability for old float styles + add code for new insets
6578 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6580 (InsertInset(size_type, Inset *, LyXFont)): new method
6581 (InsetChar(size_type, char)): changed to use the other InsetChar
6582 with a LyXFont(ALL_INHERIT).
6583 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6584 insert the META_INSET.
6586 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6588 * sigc++/thread.h (Threads): from here
6590 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6591 definition out of line
6592 * sigc++/scope.h: from here
6594 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6596 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6597 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6599 * Makefile.am (bindist): new target.
6601 * INSTALL: add instructions for doing a binary distribution.
6603 * development/tools/README.bin.example: update a bit.
6605 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6608 * lib/lyxrc.example: new lyxrc tag \set_color.
6610 * src/lyxfunc.C (Dispatch):
6611 * src/commandtags.h:
6612 * src/LyXAction.C: new lyxfunc "set-color".
6614 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6615 and an x11name given as strings.
6617 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6618 cache when a color is changed.
6620 2000-06-26 Juergen Vigna <jug@sad.it>
6622 * src/lyxrow.C (width): added this functions and variable.
6624 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6627 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6629 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6631 * images/undo_bw.xpm: new icon.
6632 * images/redo_bw.xpm: ditto.
6634 * configure.in (INSTALL_SCRIPT): change value to
6635 ${INSTALL} to avoid failures of install-script target.
6636 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6638 * src/BufferView.h: add a magic "friend" declaration to please
6641 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6643 * forms/cite.fd: modified to allow resizing without messing
6646 * src/insetcite.C: Uses code from cite.fd almost without
6648 User can now resize dialog in the x-direction.
6649 Resizing the dialog in the y-direction is prevented, as the
6650 code does this intelligently already.
6652 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6654 * INSTALL: remove obsolete entry in "problems" section.
6656 * lib/examples/sl_*.lyx: update of the slovenian examples.
6658 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6660 2000-06-23 Juergen Vigna <jug@sad.it>
6662 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6664 * src/buffer.C (resize): delete the LyXText of textinsets.
6666 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6668 * src/insets/lyxinset.h: added another parameter 'cleared' to
6669 the draw() function.
6671 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6672 unlocking inset in inset.
6674 2000-06-22 Juergen Vigna <jug@sad.it>
6676 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6677 of insets and moved first to LyXText.
6679 * src/mathed/formulamacro.[Ch]:
6680 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6682 2000-06-21 Juergen Vigna <jug@sad.it>
6684 * src/text.C (GetVisibleRow): look if I should clear the area or not
6685 using Inset::doClearArea() function.
6687 * src/insets/lyxinset.h: added doClearArea() function and
6688 modified draw(Painter &, ...) to draw(BufferView *, ...)
6690 * src/text2.C (UpdateInset): return bool insted of int
6692 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6694 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6695 combox in the character popup
6697 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6698 BufferParams const & params
6700 2000-06-20 Juergen Vigna <jug@sad.it>
6702 * src/insets/insettext.C (SetParagraphData): set insetowner on
6705 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6707 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6708 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6710 (form_main_): remove
6712 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6713 (create_form_form_main): remove FD_form_main stuff, connect to
6714 autosave_timeout signal
6716 * src/LyXView.[Ch] (getMainForm): remove
6717 (UpdateTimerCB): remove
6718 * src/BufferView_pimpl.h: inherit from SigC::Object
6720 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6721 signal instead of callback
6723 * src/BufferView.[Ch] (cursorToggleCB): remove
6725 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6727 * src/BufferView_pimpl.C: changes because of the one below
6729 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6730 instead of storing a pointer to a LyXText.
6732 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6734 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6736 * src/lyxparagraph.h
6738 * src/paragraph.C: Changed fontlist to a sorted vector.
6740 2000-06-19 Juergen Vigna <jug@sad.it>
6742 * src/BufferView.h: added screen() function.
6744 * src/insets/insettext.C (LocalDispatch): some selection code
6747 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6749 * src/insets/insettext.C (SetParagraphData):
6751 (InsetText): fixes for multiple paragraphs.
6753 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6755 * development/lyx.spec.in: Call configure with ``--without-warnings''
6756 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6757 This should be fine, however, since we generally don't want to be
6758 verbose when making an RPM.
6760 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6762 * lib/scripts/fig2pstex.py: New file
6764 2000-06-16 Juergen Vigna <jug@sad.it>
6766 * src/insets/insettabular.C (UpdateLocal):
6767 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6768 (LocalDispatch): Changed all functions to use LyXText.
6770 2000-06-15 Juergen Vigna <jug@sad.it>
6772 * src/text.C (SetHeightOfRow): call inset::update before requesting
6775 * src/insets/insettext.C (update):
6776 * src/insets/insettabular.C (update): added implementation
6778 * src/insets/lyxinset.h: added update function
6780 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6782 * src/text.C (SelectNextWord): protect against null pointers with
6783 old-style string streams. (fix from Paul Theo Gonciari
6786 * src/cite.[Ch]: remove erroneous files.
6788 * lib/configure.m4: update the list of created directories.
6790 * src/lyxrow.C: include <config.h>
6791 * src/lyxcursor.C: ditto.
6793 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6795 * lib/examples/decimal.lyx: new example file from Mike.
6797 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6798 to find template definitions (from Dekel)
6800 * src/frontends/.cvsignore: add a few things.
6802 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6804 * src/Timeout.C (TimeOut): remove default argument.
6806 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6809 * src/insets/ExternalTemplate.C: add a "using" directive.
6811 * src/lyx_main.h: remove the act_ struct, which seems unused
6814 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6816 * LyX Developers Meeting: All files changed, due to random C++ (by
6817 coincidence) code generator script.
6819 - external inset (cool!)
6820 - initial online editing of preferences
6821 - insettabular breaks insettext(s contents)
6823 - some DocBook fixes
6824 - example files update
6825 - other cool stuff, create a diff and look for yourself.
6827 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6829 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6830 -1 this is a non-line-breaking textinset.
6832 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6833 if there is no width set.
6835 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6837 * Lots of files: Merged the dialogbase branch.
6839 2000-06-09 Allan Rae <rae@lyx.org>
6841 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6842 and the Dispatch methods that used it.
6844 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6845 access to functions formerly kept in Dispatch.
6847 2000-05-19 Allan Rae <rae@lyx.org>
6849 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6850 made to_page and count_copies integers again. from_page remains a
6851 string however because I want to allow entry of a print range like
6852 "1,4,22-25" using this field.
6854 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6855 and printer-params-get. These aren't useful from the minibuffer but
6856 could be used by a script/LyXServer app provided it passes a suitable
6857 auto_mem_buffer. I guess I should take a look at how the LyXServer
6858 works and make it support xtl buffers.
6860 * sigc++/: updated to libsigc++-1.0.1
6862 * src/xtl/: updated to xtl-1.3.pl.11
6864 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6865 those changes done to the files in src/ are actually recreated when
6866 they get regenerated. Please don't ever accept a patch that changes a
6867 dialog unless that patch includes the changes to the corresponding *.fd
6870 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6871 stringOnlyContains, renamed it and generalised it.
6873 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6874 branch. Removed the remaining old form_print code.
6876 2000-04-26 Allan Rae <rae@lyx.org>
6878 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6879 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6881 2000-04-25 Allan Rae <rae@lyx.org>
6883 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6884 against a base of xtl-1.3.pl.4
6886 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6887 filter the Id: entries so they still show the xtl version number
6890 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6891 into the src/xtl code. Patch still pending with José (XTL)
6893 2000-04-24 Allan Rae <rae@lyx.org>
6895 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6896 both more generic and much safer. Use the new template functions.
6897 * src/buffer.[Ch] (Dispatch): ditto.
6899 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6900 and mem buffer more intelligently. Also a little general cleanup.
6903 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6904 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6905 * src/xtl/Makefile.am: ditto.
6906 * src/xtl/.cvsignore: ditto.
6907 * src/Makefile.am: ditto.
6909 * src/PrinterParams.h: Removed the macros member functions. Added a
6910 testInvariant member function. A bit of tidying up and commenting.
6911 Included Angus's idea for fixing operation with egcs-1.1.2.
6913 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6914 cool expansion of XTL's mem_buffer to support automatic memory
6915 management within the buffer itself. Removed the various macros and
6916 replaced them with template functions that use either auto_mem_buffer
6917 or mem_buffer depending on a #define. The mem_buffer support will
6918 disappear as soon as the auto_mem_buffer is confirmed to be good on
6919 other platforms/compilers. That is, it's there so you've got something
6922 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6923 effectively forked XTL. However I expect José will include my code
6924 into the next major release. Also fixed a memory leak.
6925 * src/xtl/text.h: ditto.
6926 * src/xtl/xdr.h: ditto.
6927 * src/xtl/giop.h: ditto.
6929 2000-04-16 Allan Rae <rae@lyx.org>
6931 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6932 by autogen.sh and removed by maintainer-clean anyway.
6933 * .cvsignore, sigc++/.cvsignore: Support the above.
6935 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6937 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6939 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6940 macros, renamed static callback-target member functions to suit new
6941 scheme and made them public.
6942 * src/frontends/xforms/forms/form_print.fd: ditto.
6943 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6945 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6948 * src/xtl/: New directory containing a minimal distribution of XTL.
6949 This is XTL-1.3.pl.4.
6951 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6953 2000-04-15 Allan Rae <rae@lyx.org>
6955 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6957 * sigc++/: Updated to libsigc++-1.0.0
6959 2000-04-14 Allan Rae <rae@lyx.org>
6961 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6962 use the generic ones in future. I'll modify my conversion script.
6964 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6966 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6967 (CloseAllBufferRelatedDialogs): Renamed.
6968 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6970 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6971 of the generic ones. These are the same ones my conversion script
6974 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6975 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6976 * src/buffer.C (Dispatch): ditto
6978 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6979 functions for updating and hiding buffer dependent dialogs.
6980 * src/BufferView.C (buffer): ditto
6981 * src/buffer.C (setReadonly): ditto
6982 * src/lyxfunc.C (CloseBuffer): ditto
6984 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6985 Dialogs.h, and hence all the SigC stuff, into every file that includes
6986 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6988 * src/BufferView2.C: reduce the number of headers included by buffer.h
6990 2000-04-11 Allan Rae <rae@lyx.org>
6992 * src/frontends/xforms/xform_macros.h: A small collection of macros
6993 for building C callbacks.
6995 * src/frontends/xforms/Makefile.am: Added above file.
6997 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6998 scheme again. This time it should work for JMarc. If this is
6999 successful I'll revise my conversion script to automate some of this.
7000 The static member functions in the class also have to be public for
7001 this scheme will work. If the scheme works (it's almost identical to
7002 the way BufferView::cursorToggleCB is handled so it should work) then
7003 FormCopyright and FormPrint will be ready for inclusion into the main
7004 trunk immediately after 1.1.5 is released -- provided we're prepared
7005 for complaints about lame compilers not handling XTL.
7007 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7009 2000-04-07 Allan Rae <rae@lyx.org>
7011 * config/lyxinclude.m4: A bit more tidying up (Angus)
7013 * src/LString.h: JMarc's <string> header fix
7015 * src/PrinterParams.h: Used string for most data to remove some
7016 ugly code in the Print dialog and avoid even uglier code when
7017 appending the ints to a string for output.
7019 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7020 and moved "default:" back to the end of switch statement. Cleaned
7021 up the printing so it uses the right function calls and so the
7022 "print to file" option actually puts the file in the right directory.
7024 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7026 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7027 and Ok+Apply button control into a separate method: input (Angus).
7028 (input) Cleaned it up and improved it to be very thorough now.
7029 (All CB) static_cast used instead of C style cast (Angus). This will
7030 probably change again once we've worked out how to keep gcc-2.8.1 happy
7031 with real C callbacks.
7032 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7033 ignore some of the bool settings and has random numbers instead. Needs
7034 some more investigation. Added other input length checks and checking
7035 of file and printer names.
7037 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7038 would link (Angus). Seems the old code doesn't compile with the pragma
7039 statement either. Separated callback entries from internal methods.
7041 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7043 2000-03-17 Allan Rae <rae@lyx.org>
7045 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7046 need it? Maybe it could go in Dialogs instead? I could make it a
7047 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7048 values to get the bool return value.
7049 (Dispatch): New overloaded method for xtl support.
7051 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7052 extern "C" callback instead of static member functions. Hopefully,
7053 JMarc will be able to compile this. I haven't changed
7054 forms/form_copyright.fd yet. Breaking one of my own rules already.
7056 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7057 because they aren't useful from the minibuffer. Maybe a LyXServer
7058 might want a help message though?
7060 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7062 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7063 xtl which needs both rtti and exceptions.
7065 * src/support/Makefile.am:
7066 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7068 * src/frontends/xforms/input_validators.[ch]: input filters and
7069 validators. These conrol what keys are valid in input boxes.
7070 Use them and write some more. Much better idea than waiting till
7071 after the user has pressed Ok to say that the input fields don't make
7074 * src/frontends/xforms/Makefile.am:
7075 * src/frontends/xforms/forms/form_print.fd:
7076 * src/frontends/xforms/forms/makefile:
7077 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7078 new scheme. Still have to make sure I haven't missed anything from
7079 the current implementation.
7081 * src/Makefile.am, src/PrinterParams.h: New data store.
7083 * other files: Added a couple of copyright notices.
7085 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7087 * src/insets/insetbib.h: move Holder struct in public space.
7089 * src/frontends/include/DialogBase.h: use SigC:: only when
7090 SIGC_CXX_NAMESPACES is defined.
7091 * src/frontends/include/Dialogs.h: ditto.
7093 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7095 * src/frontends/xforms/FormCopyright.[Ch]: do not
7096 mention SigC:: explicitely.
7098 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7100 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7101 deals with testing KDE in main configure.in
7102 * configure.in: ditto.
7104 2000-02-22 Allan Rae <rae@lyx.org>
7106 * Lots of files: Merged from HEAD
7108 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7109 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7111 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7113 * sigc++/: new minidist.
7115 2000-02-14 Allan Rae <rae@lyx.org>
7117 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7119 2000-02-08 Juergen Vigna <jug@sad.it>
7121 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7122 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7124 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7125 for this port and so it is much easier for other people to port
7126 dialogs in a common development environment.
7128 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7129 the QT/KDE implementation.
7131 * src/frontends/kde/Dialogs.C:
7132 * src/frontends/kde/FormCopyright.C:
7133 * src/frontends/kde/FormCopyright.h:
7134 * src/frontends/kde/Makefile.am:
7135 * src/frontends/kde/formcopyrightdialog.C:
7136 * src/frontends/kde/formcopyrightdialog.h:
7137 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7138 for the kde support of the Copyright-Dialog.
7140 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7141 subdir-substitution instead of hardcoded 'xforms' as we now have also
7144 * src/frontends/include/DialogBase.h (Object): just commented the
7145 label after #endif (nasty warning and I don't like warnings ;)
7147 * src/main.C (main): added KApplication initialization if using
7150 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7151 For now only the KDE event-loop is added if frontend==kde.
7153 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7155 * configure.in: added support for the --with-frontend[=value] option
7157 * autogen.sh: added kde.m4 file to list of config-files
7159 * acconfig.h: added define for KDEGUI-support
7161 * config/kde.m4: added configuration functions for KDE-port
7163 * config/lyxinclude.m4: added --with-frontend[=value] option with
7164 support for xforms and KDE.
7166 2000-02-08 Allan Rae <rae@lyx.org>
7168 * all Makefile.am: Fixed up so the make targets dist, distclean,
7169 install and uninstall all work even if builddir != srcdir. Still
7170 have a new sigc++ minidist update to come.
7172 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7174 2000-02-01 Allan Rae <rae@lyx.org>
7176 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7177 Many mods to get builddir != srcdir working.
7179 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7180 for building on NT and so we can do the builddir != srcdir stuff.
7182 2000-01-30 Allan Rae <rae@lyx.org>
7184 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7185 This will stay in "rae" branch. We probably don't really need it in
7186 the main trunk as anyone who wants to help programming it should get
7187 a full library installed also. So they can check both included and
7188 system supplied library compilation.
7190 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7191 Added a 'mini' distribution of libsigc++. If you feel the urge to
7192 change something in these directories - Resist it. If you can't
7193 resist the urge then you should modify the following script and rebuild
7194 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7195 all happen. Still uses a hacked version of libsigc++'s configure.in.
7196 I'm quite happy with the results. I'm not sure the extra work to turn
7197 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7198 worth the trouble and would probably lead to extra maintenance
7200 I haven't tested the following important make targets: install, dist.
7201 Not ready for prime time but very close. Maybe 1.1.5.
7203 * development/tools/makeLyXsigc.sh: A shell script to automatically
7204 generate our mini-dist of libsigc++. It can only be used with a CVS
7205 checkout of libsigc++ not a tarball distribution. It's well commented.
7206 This will end up as part of the libsigc++ distribution so other apps
7207 can easily have an included mini-dist. If someone makes mods to the
7208 sigc++ subpackage without modifying this script to generate those
7209 changes I'll be very upset!
7211 * src/frontends/: Started the gui/system indep structure.
7213 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7214 to access the gui-indep dialogs are in this class. Much improved
7215 design compared to previous revision. Lars, please refrain from
7216 moving this header into src/ like you did with Popups.h last time.
7218 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7220 * src/frontends/xforms/: Started the gui-indep system with a single
7221 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7224 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7225 Here you'll find a very useful makefile and automated fdfix.sh that
7226 makes updating dailogs a no-brainer -- provided you follow the rules
7227 set out in the README. I'm thinking about adding another script to
7228 automatically generate skeleton code for a new dialog given just the
7231 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7232 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7233 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7235 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7237 * src/support/LSubstring.C (operator): simplify
7239 * src/lyxtext.h: removed bparams, use buffer_->params instead
7241 * src/lyxrow.h: make Row a real class, move all variables to
7242 private and use accessors.
7244 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7246 (isRightToLeftPar): ditto
7247 (ChangeLanguage): ditto
7248 (isMultiLingual): ditto
7251 (SimpleTeXOnePar): ditto
7252 (TeXEnvironment): ditto
7253 (GetEndLabel): ditto
7255 (SetOnlyLayout): ditto
7256 (BreakParagraph): ditto
7257 (BreakParagraphConservative): ditto
7258 (GetFontSettings): ditto
7260 (CopyIntoMinibuffer): ditto
7261 (CutIntoMinibuffer): ditto
7262 (PasteParagraph): ditto
7263 (SetPExtraType): ditto
7264 (UnsetPExtraType): ditto
7265 (DocBookContTableRows): ditto
7266 (SimpleDocBookOneTablePar): ditto
7268 (TeXFootnote): ditto
7269 (SimpleTeXOneTablePar): ditto
7270 (TeXContTableRows): ditto
7271 (SimpleTeXSpecialChars): ditto
7274 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7275 to private and use accessors.
7277 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7278 this, we did not use it anymore and has not been for ages. Just a
7279 waste of cpu cycles.
7281 * src/language.h: make Language a real class, move all variables
7282 to private and use accessors.
7284 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7285 (create_view): remove
7286 (update): some changes for new timer
7287 (cursorToggle): use new timer
7288 (beforeChange): change for new timer
7290 * src/BufferView.h (cursorToggleCB): removed last paramter because
7293 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7294 (cursorToggleCB): change because of new timer code
7296 * lib/CREDITS: updated own mailaddress
7298 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7300 * src/support/filetools.C (PutEnv): fix the code in case neither
7301 putenv() nor setenv() have been found.
7303 * INSTALL: mention the install-strip Makefile target.
7305 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7306 read-only documents.
7308 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7310 * lib/reLyX/configure.in (VERSION): avoid using a previously
7311 generated reLyX wrapper to find out $prefix.
7313 * lib/examples/eu_adibide_lyx-atua.lyx:
7314 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7315 translation of the Tutorial (Dooteo)
7317 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7319 * forms/cite.fd: new citation dialog
7321 * src/insetcite.[Ch]: the new citation dialog is moved into
7324 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7327 * src/insets/insetcommand.h: data members made private.
7329 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7331 * LyX 1.1.5 released
7333 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7335 * src/version.h (LYX_RELEASE): to 1.1.5
7337 * src/spellchecker.C (RunSpellChecker): return false if the
7338 spellchecker dies upon creation.
7340 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7342 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7343 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7347 * lib/CREDITS: update entry for Martin Vermeer.
7349 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7351 * src/text.C (draw): Draw foreign language bars at the bottom of
7352 the row instead of at the baseline.
7354 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7356 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7358 * lib/bind/de_menus.bind: updated
7360 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7362 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7364 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7366 * src/menus.C (Limit_string_length): New function
7367 (ShowTocMenu): Limit the number of items/length of items in the
7370 * src/paragraph.C (String): Correct result for a paragraph inside
7373 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7375 * src/bufferlist.C (close): test of buf->getuser() == NULL
7377 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7379 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7380 Do not call to SetCursor when the paragraph is a closed footnote!
7382 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7384 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7387 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7389 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7392 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7393 reference popup, that activates the reference-back action
7395 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7397 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7398 the menus. Also fixed a bug.
7400 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7401 the math panels when switching buffers (unless new buffer is readonly).
7403 * src/BufferView.C (NoSavedPositions)
7404 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7406 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7408 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7409 less of dvi dirty or not.
7411 * src/trans_mgr.[Ch] (insert): change first parameter to string
7414 * src/chset.[Ch] (encodeString): add const to first parameter
7416 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7418 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7422 * src/LaTeX.C (deplog): better searching for dependency files in
7423 the latex log. Uses now regexps.
7425 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7426 instead of the box hack or \hfill.
7428 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7430 * src/lyxfunc.C (doImportHelper): do not create the file before
7431 doing the actual import.
7432 (doImportASCIIasLines): create a new file before doing the insert.
7433 (doImportASCIIasParagraphs): ditto.
7435 * lib/lyxrc.example: remove mention of non-existing commands
7437 * lyx.man: remove mention of color-related switches.
7439 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7441 * src/lyx_gui.C: remove all the color-related ressources, which
7442 are not used anymore.
7444 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7447 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7449 * src/lyxrc.C (read): Add a missing break in the switch
7451 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7453 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7455 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7458 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7460 * src/text.C (draw): draw bars under foreign language words.
7462 * src/LColor.[Ch]: add LColor::language
7464 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7466 * src/lyxcursor.h (boundary): New member variable
7468 * src/text.C (IsBoundary): New methods
7470 * src/text.C: Use the above for currect cursor movement when there
7471 is both RTL & LTR text.
7473 * src/text2.C: ditto
7475 * src/bufferview_funcs.C (ToggleAndShow): ditto
7477 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7479 * src/text.C (DeleteLineForward): set selection to true to avoid
7480 that DeleteEmptyParagraphMechanism does some magic. This is how it
7481 is done in all other functions, and seems reasonable.
7482 (DeleteWordForward): do not jump over non-word stuff, since
7483 CursorRightOneWord() already does it.
7485 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7486 DeleteWordBackward, since they seem safe to me (since selection is
7487 set to "true") DeleteEmptyParagraphMechanism does nothing.
7489 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7491 * src/lyx_main.C (easyParse): simplify the code by factoring the
7492 part that removes parameters from the command line.
7493 (LyX): check wether wrong command line options have been given.
7495 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7497 * src/lyx_main.C : add support for specifying user LyX
7498 directory via command line option -userdir.
7500 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7502 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7503 the number of items per popup.
7504 (Add_to_refs_menu): Ditto.
7506 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7508 * src/lyxparagraph.h: renamed ClearParagraph() to
7509 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7510 textclass as parameter, and do nothing if free_spacing is
7511 true. This fixes part of the line-delete-forward problems.
7513 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7514 (pasteSelection): ditto.
7515 (SwitchLayoutsBetweenClasses): more translatable strings.
7517 * src/text2.C (CutSelection): use StripLeadingSpaces.
7518 (PasteSelection): ditto.
7519 (DeleteEmptyParagraphMechanism): ditto.
7521 2000-05-26 Juergen Vigna <jug@sad.it>
7523 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7524 is not needed in tabular insets.
7526 * src/insets/insettabular.C (TabularFeatures): added missing features.
7528 * src/tabular.C (DeleteColumn):
7530 (AppendRow): implemented this functions
7531 (cellsturct::operator=): clone the inset too;
7533 2000-05-23 Juergen Vigna <jug@sad.it>
7535 * src/insets/insettabular.C (LocalDispatch): better selection support
7536 when having multicolumn-cells.
7538 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7540 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7542 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7544 * src/ColorHandler.C (getGCForeground): put more test into _()
7546 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7549 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7552 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7554 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7555 there are no labels, or when buffer is readonly.
7557 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7558 there are no labels, buffer is SGML, or when buffer is readonly.
7560 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7562 * src/LColor.C (LColor): change a couple of grey40 to grey60
7563 (LColor): rewore initalization to make compiles go some magnitude
7565 (getGUIName): don't use gettext until we need the string.
7567 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7569 * src/Bullet.[Ch]: Fixed a small bug.
7571 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7573 * src/paragraph.C (String): Several fixes/improvements
7575 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7577 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7579 * src/paragraph.C (String): give more correct output.
7581 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7583 * src/lyxfont.C (stateText) Do not output the language if it is
7584 eqaul to the language of the document.
7586 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7587 between two paragraphs with the same language.
7589 * src/paragraph.C (getParLanguage) Return a correct answer for an
7590 empty dummy paragraph.
7592 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7595 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7598 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7599 the menus/popup, if requested fonts are unavailable.
7601 2000-05-22 Juergen Vigna <jug@sad.it>
7603 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7604 movement support (Up/Down/Tab/Shift-Tab).
7605 (LocalDispatch): added also preliminari cursor-selection.
7607 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7609 * src/paragraph.C (PasteParagraph): Hopefully now right!
7611 2000-05-22 Garst R. Reese <reese@isn.net>
7613 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7614 of list, change all references to Environment to Command
7615 * tex/hollywood.cls : rewrite environments as commands, add
7616 \uppercase to interiorshot and exteriorshot to force uppecase.
7617 * tex/broadway.cls : rewrite environments as commands. Tweak
7620 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7622 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7623 size of items: use a constant intead of the hardcoded 40, and more
7624 importantly do not remove the %m and %x tags added at the end.
7625 (Add_to_refs_menu): use vector::size_type instead of
7626 unsigned int as basic types for the variables. _Please_ do not
7627 assume that size_t is equal to unsigned int. On an alpha, this is
7628 unsigned long, which is _not_ the same.
7630 * src/language.C (initL): remove language "hungarian", since it
7631 seems that "magyar" is better.
7633 2000-05-22 Juergen Vigna <jug@sad.it>
7635 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7637 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7640 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7641 next was deleted but not set to 0.
7643 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7645 * src/language.C (initL): change the initialization of languages
7646 so that compiles goes _fast_.
7648 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7651 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7653 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7657 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7659 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7661 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7665 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7668 * src/insets/insetlo*.[Ch]: Made editable
7670 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7672 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7673 the current selection.
7675 * src/BufferView_pimpl.C (stuffClipboard): new method
7677 * src/BufferView.C (stuffClipboard): new method
7679 * src/paragraph.C (String): new method
7681 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7682 LColor::ignore when lyxname is not found.
7684 * src/BufferView.C (pasteSelection): new method
7686 * src/BufferView_pimpl.C (pasteSelection): new method
7688 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7690 * src/WorkArea.C (request_clipboard_cb): new static function
7691 (getClipboard): new method
7692 (putClipboard): new method
7694 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7696 * LyX 1.1.5pre2 released
7698 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7700 * src/vspace.C (operator=): removed
7701 (operator=): removed
7703 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7705 * src/layout.C (NumberOfClass): manually set the type in make_pair
7706 (NumberOfLayout): ditto
7708 * src/language.C: use the Language constructor for ignore_lang
7710 * src/language.h: add constructors to struct Language
7712 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7714 * src/text2.C (SetCursorIntern): comment out #warning
7716 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7718 * src/mathed/math_iter.h: initialize sx and sw to 0
7720 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7722 * forms/lyx.fd: Redesign of form_ref
7724 * src/LaTeXFeatures.[Ch]
7728 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7731 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7732 and Buffer::inset_iterator.
7734 * src/menus.C: Added new menus: TOC and Refs.
7736 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7738 * src/buffer.C (getTocList): New method.
7740 * src/BufferView2.C (ChangeRefs): New method.
7742 * src/buffer.C (getLabelList): New method. It replaces the old
7743 getReferenceList. The return type is vector<string> instead of
7746 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7747 the old getLabel() and GetNumberOfLabels() methods.
7748 * src/insets/insetlabel.C (getLabelList): ditto
7749 * src/mathed/formula.C (getLabelList): ditto
7751 * src/paragraph.C (String): New method.
7753 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7754 Uses the new getTocList() method.
7755 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7756 which automatically updates the contents of the browser.
7757 (RefUpdateCB): Use the new getLabelList method.
7759 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7761 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7763 * src/spellchecker.C: Added using std::reverse;
7765 2000-05-19 Juergen Vigna <jug@sad.it>
7767 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7769 * src/insets/insettext.C (computeTextRows): small fix for display of
7770 1 character after a newline.
7772 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7775 2000-05-18 Juergen Vigna <jug@sad.it>
7777 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7778 when changing width of column.
7780 * src/tabular.C (set_row_column_number_info): setting of
7781 autobreak rows if necessary.
7783 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7785 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7787 * src/vc-backend.*: renamed stat() to status() and vcstat to
7788 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7789 compilation broke. The new name seems more relevant, anyway.
7791 2000-05-17 Juergen Vigna <jug@sad.it>
7793 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7794 which was wrong if the removing caused removing of rows!
7796 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7797 (pushToken): new function.
7799 * src/text2.C (CutSelection): fix problem discovered with purify
7801 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7803 * src/debug.C (showTags): enlarge the first column, now that we
7804 have 6-digits debug codes.
7806 * lib/layouts/hollywood.layout:
7807 * lib/tex/hollywood.cls:
7808 * lib/tex/brodway.cls:
7809 * lib/layouts/brodway.layout: more commands and fewer
7810 environments. Preambles moved in the .cls files. Broadway now has
7811 more options on scene numbering and less whitespace (from Garst)
7813 * src/insets/insetbib.C (getKeys): make sure that we are in the
7814 document directory, in case the bib file is there.
7816 * src/insets/insetbib.C (Latex): revert bogus change.
7818 2000-05-16 Juergen Vigna <jug@sad.it>
7820 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7821 the TabularLayout on cursor move.
7823 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7825 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7828 (draw): fixed cursor position and drawing so that the cursor is
7829 visible when before the tabular-inset.
7831 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7832 when creating from old insettext.
7834 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7836 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7838 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7839 * lib/tex/brodway.cls: ditto
7841 * lib/layouts/brodway.layout: change alignment of parenthical
7844 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7846 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7847 versions 0.88 and 0.89 are supported.
7849 2000-05-15 Juergen Vigna <jug@sad.it>
7851 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7854 * src/insets/insettext.C (computeTextRows): redone completely this
7855 function in a much cleaner way, because of problems when having a
7857 (draw): added a frame border when the inset is locked.
7858 (SetDrawLockedFrame): this sets if we draw the border or not.
7859 (SetFrameColor): this sets the frame color (default=insetframe).
7861 * src/insets/lyxinset.h: added x() and y() functions which return
7862 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7863 function which is needed to see if we have a locking inset of some
7864 type in this inset (needed for now in insettabular).
7866 * src/vspace.C (inPixels): the same function also without a BufferView
7867 parameter as so it is easier to use it in some ocasions.
7869 * src/lyxfunc.C: changed all places where insertInset was used so
7870 that now if it couldn't be inserted it is deleted!
7872 * src/TabularLayout.C:
7873 * src/TableLayout.C: added support for new tabular-inset!
7875 * src/BufferView2.C (insertInset): this now returns a bool if the
7876 inset was really inserted!!!
7878 * src/tabular.C (GetLastCellInRow):
7879 (GetFirstCellInRow): new helper functions.
7880 (Latex): implemented for new tabular class.
7884 (TeXTopHLine): new Latex() helper functions.
7886 2000-05-12 Juergen Vigna <jug@sad.it>
7888 * src/mathed/formulamacro.C (Read):
7889 * src/mathed/formula.C (Read): read also the \end_inset here!
7891 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7893 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7894 crush when saving formulae with unbalanced parenthesis.
7896 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7898 * src/layout.C: Add new keyword "endlabelstring" to layout file
7900 * src/text.C (GetVisibleRow): Draw endlabel string.
7902 * lib/layouts/broadway.layout
7903 * lib/layouts/hollywood.layout: Added endlabel for the
7904 Parenthetical layout.
7906 * lib/layouts/heb-article.layout: Do not use slanted font shape
7907 for Theorem like environments.
7909 * src/buffer.C (makeLaTeXFile): Always add "american" to
7910 the UsedLanguages list if document language is RTL.
7912 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7914 * add addendum to README.OS2 and small patch (from SMiyata)
7916 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7918 * many files: correct the calls to ChangeExtension().
7920 * src/support/filetools.C (ChangeExtension): remove the no_path
7921 argument, which does not belong there. Use OnlyFileName() instead.
7923 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7924 files when LaTeXing a non-nice latex file.
7926 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7927 a chain of "if". Return false when deadkeys are not handled.
7929 * src/lyx_main.C (LyX): adapted the code for default bindings.
7931 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7932 bindings for basic functionality (except deadkeys).
7933 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7935 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7936 several methods: handle override_x_deadkeys.
7938 * src/lyxrc.h: remove the "bindings" map, which did not make much
7939 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7941 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7943 * src/lyxfont.C (stateText): use a saner method to determine
7944 whether the font is "default". Seems to fix the crash with DEC
7947 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7949 2000-05-08 Juergen Vigna <jug@sad.it>
7951 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7952 TabularLayoutMenu with mouse-button-3
7953 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7955 * src/TabularLayout.C: added this file for having a Layout for
7958 2000-05-05 Juergen Vigna <jug@sad.it>
7960 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7961 recalculating inset-widths.
7962 (TabularFeatures): activated this function so that I can change
7963 tabular-features via menu.
7965 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7966 that I can test some functions with the Table menu.
7968 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7970 * src/lyxfont.C (stateText): guard against stupid c++libs.
7972 * src/tabular.C: add using std::vector
7973 some whitespace changes, + removed som autogenerated code.
7975 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7977 2000-05-05 Juergen Vigna <jug@sad.it>
7979 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7980 row, columns and cellstructures.
7982 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7984 * lib/lyxrc.example: remove obsolete entries.
7986 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7987 reading of protected_separator for free_spacing.
7989 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7991 * src/text.C (draw): do not display an exclamation mark in the
7992 margin for margin notes. This is confusing, ugly and
7995 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7996 AMS math' is checked.
7998 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7999 name to see whether including the amsmath package is needed.
8001 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8003 * src/paragraph.C (validate): Compute UsedLanguages correctly
8004 (don't insert the american language if it doesn't appear in the
8007 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8008 The argument of \thanks{} command is considered moving argument
8010 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8013 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8015 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8016 for appendix/minipage/depth. The lines can be now both in the footnote
8017 frame, and outside the frame.
8019 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8022 2000-05-05 Juergen Vigna <jug@sad.it>
8024 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8025 neede only in tabular.[Ch].
8027 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8029 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8031 (Write): write '~' for PROTECTED_SEPARATOR
8033 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8035 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8038 * src/mathed/formula.C (drawStr): rename size to siz.
8040 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8041 possibly fix a bug by not changing the pflags = flags to piflags =
8044 2000-05-05 Juergen Vigna <jug@sad.it>
8046 * src/insets/insetbib.C: moved using directive
8048 * src/ImportNoweb.C: small fix for being able to compile (missing
8051 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8053 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8054 to use clear, since we don't depend on this in the code. Add test
8057 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8059 * (various *.C files): add using std::foo directives to please dec
8062 * replace calls to string::clear() to string::erase() (Angus)
8064 * src/cheaders/cmath: modified to provide std::abs.
8066 2000-05-04 Juergen Vigna <jug@sad.it>
8068 * src/insets/insettext.C: Prepared all for inserting of multiple
8069 paragraphs. Still display stuff to do (alignment and other things),
8070 but I would like to use LyXText to do this when we cleaned out the
8071 table-support stuff.
8073 * src/insets/insettabular.C: Changed lot of stuff and added lots
8074 of functionality still a lot to do.
8076 * src/tabular.C: Various functions changed name and moved to be
8077 const functions. Added new Read and Write functions and changed
8078 lots of things so it works good with tabular-insets (also removed
8079 some stuff which is not needed anymore * hacks *).
8081 * src/lyxcursor.h: added operators == and != which just look if
8082 par and pos are (not) equal.
8084 * src/buffer.C (latexParagraphs): inserted this function to latex
8085 all paragraphs form par to endpar as then I can use this too for
8088 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8089 so that I can call this to from text insets with their own cursor.
8091 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8092 output off all paragraphs (because of the fix below)!
8094 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8095 the very last paragraph (this could be also the last paragraph of an
8098 * src/texrow.h: added rows() call which returns the count-variable.
8100 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8102 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8104 * lib/configure.m4: better autodetection of DocBook tools.
8106 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8108 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8110 * src/lyx_cb.C: add using std::reverse;
8112 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8115 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8116 selected files. Should fix repeated errors from generated files.
8118 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8120 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8122 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8123 the spellchecker popup.
8125 * lib/lyxrc.example: Removed the \number_inset section
8127 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8129 * src/insets/figinset.C (various): Use IsFileReadable() to make
8130 sure that the file actually exist. Relying on ghostscripts errors
8131 is a bad idea since they can lead to X server crashes.
8133 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8135 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8138 * lib/lyxrc.example: smallish typo in description of
8139 \view_dvi_paper_option
8141 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8144 * src/lyxfunc.C: doImportHelper to factor out common code of the
8145 various import methods. New functions doImportASCIIasLines,
8146 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8147 doImportLinuxDoc for the format specific parts.
8150 * buffer.C: Dispatch returns now a bool to indicate success
8153 * lyx_gui.C: Add getLyXView() for member access
8155 * lyx_main.C: Change logic for batch commands: First try
8156 Buffer::Dispatch (possibly without GUI), if that fails, use
8159 * lyx_main.C: Add support for --import command line switch.
8160 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8161 Available Formats: Everything accepted by 'buffer-import <format>'
8163 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8165 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8168 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8169 documents will be reformatted upon reentry.
8171 2000-04-27 Juergen Vigna <jug@sad.it>
8173 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8174 correctly only last pos this was a bug.
8176 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8178 * release of lyx-1.1.5pre1
8180 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8182 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8184 * src/menus.C: revert the change of naming (Figure->Graphic...)
8185 from 2000-04-11. It was incomplete and bad.
8187 * src/LColor.[Ch]: add LColor::depthbar.
8188 * src/text.C (GetVisibleRow): use it.
8190 * README: update the languages list.
8192 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8194 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8197 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8199 * README: remove sections that were just wrong.
8201 * src/text2.C (GetRowNearY): remove currentrow code
8203 * src/text.C (GetRow): remove currentrow code
8205 * src/screen.C (Update): rewritten a bit.
8206 (SmallUpdate): removed func
8208 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8210 (FullRebreak): return bool
8211 (currentrow): remove var
8212 (currentrow_y): ditto
8214 * src/lyxscreen.h (Draw): change arg to unsigned long
8215 (FitCursor): return bool
8216 (FitManualCursor): ditto
8217 (Smallpdate): remove func
8218 (first): change to unsigned long
8219 (DrawOneRow): change second arg to long (from long &)
8220 (screen_refresh_y): remove var
8221 (scree_refresh_row): ditto
8223 * src/lyxrow.h: change baseline to usigned int from unsigned
8224 short, this brings some implicit/unsigned issues out in the open.
8226 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8228 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8229 instead of smallUpdate.
8231 * src/lyxcursor.h: change y to unsigned long
8233 * src/buffer.h: don't call updateScrollbar after fitcursor
8235 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8236 where they are used. Removed "\\direction", this was not present
8237 in 1.1.4 and is already obsolete. Commented out some code that I
8238 believe to never be called.
8239 (runLiterate): don't call updateScrollbar after fitCursor
8241 (buildProgram): ditto
8244 * src/WorkArea.h (workWidth): change return val to unsigned
8247 (redraw): remove the button redraws
8248 (setScrollbarValue): change for scrollbar
8249 (getScrollbarValue): change for scrollbar
8250 (getScrollbarBounds): change for scrollbar
8252 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8253 (C_WorkArea_down_cb): removed func
8254 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8255 (resize): change for scrollbar
8256 (setScrollbar): ditto
8257 (setScrollbarBounds): ditto
8258 (setScrollbarIncrements): ditto
8259 (up_cb): removed func
8260 (down_cb): removed func
8261 (scroll_cb): change for scrollbar
8262 (work_area_handler): ditto
8264 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8265 when FitCursor did something.
8266 (updateScrollbar): some unsigned changes
8267 (downCB): removed func
8268 (scrollUpOnePage): removed func
8269 (scrollDownOnePage): remvoed func
8270 (workAreaMotionNotify): don't call screen->FitCursor but use
8271 fitCursor instead. and bool return val
8272 (workAreaButtonPress): ditto
8273 (workAreaButtonRelease): some unsigned changes
8274 (checkInsetHit): ditto
8275 (workAreaExpose): ditto
8276 (update): parts rewritten, comments about the signed char arg added
8277 (smallUpdate): removed func
8278 (cursorPrevious): call needed updateScrollbar
8281 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8284 * src/BufferView.[Ch] (upCB): removed func
8285 (downCB): removed func
8286 (smallUpdate): removed func
8288 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8290 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8291 currentrow, currentrow_y optimization. This did not help a lot and
8292 if we want to do this kind of optimization we should rather use
8293 cursor.row instead of the currentrow.
8295 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8296 buffer spacing and klyx spacing support.
8298 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8300 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8303 2000-04-26 Juergen Vigna <jug@sad.it>
8305 * src/insets/figinset.C: fixes to Lars sstream changes!
8307 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8309 * A lot of files: Added Ascii(ostream &) methods to all inset
8310 classes. Used when exporting to ASCII.
8312 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8313 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8316 * src/text2.C (ToggleFree): Disabled implicit word selection when
8317 there is a change in the language
8319 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8320 no output was generated for end-of-sentence inset.
8322 * src/insets/lyxinset.h
8325 * src/paragraph.C: Removed the insetnumber code
8327 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8329 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8331 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8332 no_babel and no_epsfig completely from the file.
8333 (parseSingleLyXformat2Token): add handling for per-paragraph
8334 spacing as written by klyx.
8336 * src/insets/figinset.C: applied patch by Andre. Made it work with
8339 2000-04-20 Juergen Vigna <jug@sad.it>
8341 * src/insets/insettext.C (cutSelection):
8342 (copySelection): Fixed with selection from right to left.
8343 (draw): now the rows are not recalculated at every draw.
8344 (computeTextRows): for now reset the inset-owner here (this is
8345 important for an undo or copy where the inset-owner is not set
8348 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8349 motion to the_locking_inset screen->first was forgotten, this was
8350 not important till we got multiline insets.
8352 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8354 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8355 code seems to be alright (it is code changed by Dekel, and the
8356 intent is indeed that all macros should be defined \protect'ed)
8358 * NEWS: a bit of reorganisation of the new user-visible features.
8360 2000-04-19 Juergen Vigna <jug@sad.it>
8362 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8363 position. Set the inset_owner of the used paragraph so that it knows
8364 that it is inside an inset. Fixed cursor handling with mouse and
8365 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8366 and cleanups to make TextInsets work better.
8368 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8369 Changed parameters of various functions and added LockInsetInInset().
8371 * src/insets/insettext.C:
8373 * src/insets/insetcollapsable.h:
8374 * src/insets/insetcollapsable.C:
8375 * src/insets/insetfoot.h:
8376 * src/insets/insetfoot.C:
8377 * src/insets/insetert.h:
8378 * src/insets/insetert.C: cleaned up the code so that it works now
8379 correctly with insettext.
8381 * src/insets/inset.C:
8382 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8383 that insets in insets are supported right.
8386 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8388 * src/paragraph.C: some small fixes
8390 * src/debug.h: inserted INSETS debug info
8392 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8393 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8395 * src/commandtags.h:
8396 * src/LyXAction.C: insert code for InsetTabular.
8398 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8399 not Button1MotionMask.
8400 (workAreaButtonRelease): send always a InsetButtonRelease event to
8402 (checkInsetHit): some setCursor fixes (always with insets).
8404 * src/BufferView2.C (lockInset): returns a bool now and extended for
8405 locking insets inside insets.
8406 (showLockedInsetCursor): it is important to have the cursor always
8407 before the locked inset.
8408 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8410 * src/BufferView.h: made lockInset return a bool.
8412 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8414 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8415 that is used also internally but can be called as public to have back
8416 a cursor pos which is not set internally.
8417 (SetCursorIntern): Changed to use above function.
8419 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8421 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8426 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8427 patches for things that should be in or should be changed.
8429 * src/* [insetfiles]: change "usigned char fragile" to bool
8430 fragile. There was only one point that could that be questioned
8431 and that is commented in formulamacro.C. Grep for "CHECK".
8433 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8434 (DeleteBuffer): take it out of CutAndPaste and make it static.
8436 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8438 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8439 output the spacing envir commands. Also the new commands used in
8440 the LaTeX output makes the result better.
8442 * src/Spacing.C (writeEnvirBegin): new method
8443 (writeEnvirEnd): new method
8445 2000-04-18 Juergen Vigna <jug@sad.it>
8447 * src/CutAndPaste.C: made textclass a static member of the class
8448 as otherwise it is not accesed right!!!
8450 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8452 * forms/layout_forms.fd
8453 * src/layout_forms.h
8454 * src/layout_forms.C (create_form_form_character)
8455 * src/lyx_cb.C (UserFreeFont)
8456 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8457 documents (in the layout->character popup).
8459 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8461 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8462 \spell_command was in fact not honored (from Kevin Atkinson).
8464 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8467 * src/lyx_gui.h: make lyxViews private (Angus)
8469 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8471 * src/mathed/math_write.C
8472 (MathMatrixInset::Write) Put \protect before \begin{array} and
8473 \end{array} if fragile
8474 (MathParInset::Write): Put \protect before \\ if fragile
8476 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8478 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8479 initialization if the LyXColorHandler must be done after the
8480 connections to the XServer has been established.
8482 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8483 get the background pixel from the lyxColorhandler so that the
8484 figures are rendered with the correct background color.
8485 (NextToken): removed functions.
8486 (GetPSSizes): use ifs >> string instead of NextToken.
8488 * src/Painter.[Ch]: the color cache moved out of this file.
8490 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8493 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8495 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8496 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8498 * src/BufferView.C (enterView): new func
8499 (leaveView): new func
8501 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8503 (leaveView): new func, undefines xterm cursor when approp.
8505 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8506 (AllowInput): delete the Workarea cursor handling from this func.
8508 * src/Painter.C (underline): draw a slimer underline in most cases.
8510 * src/lyx_main.C (error_handler): use extern "C"
8512 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8514 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8515 sent directly to me.
8517 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8518 to the list by Dekel.
8520 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8523 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8524 methods from lyx_cb.here.
8526 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8529 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8531 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8532 instead of using current_view directly.
8534 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8536 * src/LyXAction.C (init): add the paragraph-spacing command.
8538 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8540 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8542 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8543 different from the documents.
8545 * src/text.C (SetHeightOfRow): take paragraph spacing into
8546 account, paragraph spacing takes precedence over buffer spacing
8547 (GetVisibleRow): ditto
8549 * src/paragraph.C (writeFile): output the spacing parameter too.
8550 (validate): set the correct features if spacing is used in the
8552 (Clear): set spacing to default
8553 (MakeSameLayout): spacing too
8554 (HasSameLayout): spacing too
8555 (SetLayout): spacing too
8556 (TeXOnePar): output the spacing commands
8558 * src/lyxparagraph.h: added a spacing variable for use with
8559 per-paragraph spacing.
8561 * src/Spacing.h: add a Default spacing and a method to check if
8562 the current spacing is default. also added an operator==
8564 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8567 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8569 * src/lyxserver.C (callback): fix dispatch of functions
8571 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8572 printf() into lyxerr call.
8574 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8577 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8578 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8579 the "Float" from each of the subitems.
8580 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8582 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8583 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8584 documented the change so that the workaround can be nuked later.
8586 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8589 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8591 * src/buffer.C (getLatexName): ditto
8592 (setReadonly): ditto
8594 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8596 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8597 avoid some uses of current_view. Added also a bufferParams()
8598 method to get at this.
8600 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8602 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8604 * src/lyxparagraph.[Ch]: removed
8605 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8606 with operators used by lower_bound and
8607 upper_bound in InsetTable's
8608 Make struct InsetTable private again. Used matchpos.
8610 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8612 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8613 document, the language of existing text is changed (unless the
8614 document is multi-lingual)
8616 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8618 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8620 * A lot of files: A rewrite of the Right-to-Left support.
8622 2000-04-10 Juergen Vigna <jug@sad.it>
8624 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8625 misplaced cursor when inset in inset is locked.
8627 * src/insets/insettext.C (LocalDispatch): small fix so that a
8628 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8630 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8631 footnote font should be decreased in size twice when displaying.
8633 * src/insets/insettext.C (GetDrawFont): inserted this function as
8634 the drawing-font may differ from the real paragraph font.
8636 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8637 insets (inset in inset!).
8639 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8640 function here because we don't want footnotes inside footnotes.
8642 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8644 (init): now set the inset_owner in paragraph.C
8645 (LocalDispatch): added some resetPos() in the right position
8648 (pasteSelection): changed to use the new CutAndPaste-Class.
8650 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8651 which tells if it is allowed to insert another inset inside this one.
8653 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8654 SwitchLayoutsBetweenClasses.
8656 * src/text2.C (InsertInset): checking of the new paragraph-function
8658 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8659 is not needed anymore here!
8662 (PasteSelection): redone (also with #ifdef) so that now this uses
8663 the CutAndPaste-Class.
8664 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8667 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8668 from/to text/insets.
8670 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8671 so that the paragraph knows if it is inside an (text)-inset.
8672 (InsertFromMinibuffer): changed return-value to bool as now it
8673 may happen that an inset is not inserted in the paragraph.
8674 (InsertInsetAllowed): this checks if it is allowed to insert an
8675 inset in this paragraph.
8677 (BreakParagraphConservative):
8678 (BreakParagraph) : small change for the above change of the return
8679 value of InsertFromMinibuffer.
8681 * src/lyxparagraph.h: added inset_owner and the functions to handle
8682 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8684 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8686 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8687 functions from BufferView to BufferView::Pimpl to ease maintence.
8689 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8690 correctly. Also use SetCursorIntern instead of SetCursor.
8692 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8695 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8697 * src/WorkArea.C (belowMouse): manually implement below mouse.
8699 * src/*: Add "explicit" on several constructors, I added probably
8700 some unneeded ones. A couple of changes to code because of this.
8702 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8703 implementation and private parts from the users of BufferView. Not
8706 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8707 implementation and private parts from the users of LyXLex. Not
8710 * src/BufferView_pimpl.[Ch]: new files
8712 * src/lyxlex_pimpl.[Ch]: new files
8714 * src/LyXView.[Ch]: some inline functions move out-of-line
8716 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8718 * src/lyxparagraph.h: make struct InsetTable public.
8720 * src/support/lyxstring.h: change lyxstring::difference_type to be
8721 ptrdiff_t. Add std:: modifiers to streams.
8723 * src/font.C: include the <cctype> header, for islower() and
8726 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8728 * src/font.[Ch]: new files. Contains the metric functions for
8729 fonts, takes a LyXFont as parameter. Better separation of concepts.
8731 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8732 changes because of this.
8734 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8736 * src/*: compile with -Winline and move functions that don't
8739 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8742 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8744 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8745 (various files changed because of this)
8747 * src/Painter.C (text): fixed the drawing of smallcaps.
8749 * src/lyxfont.[Ch] (drawText): removed unused member func.
8752 * src/*.C: added needed "using" statements and "std::" qualifiers.
8754 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8756 * src/*.h: removed all use of "using" from header files use
8757 qualifier std:: instead.
8759 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8761 * src/text.C (Backspace): some additional cleanups (we already
8762 know whether cursor.pos is 0 or not).
8764 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8765 automake does not provide one).
8767 * src/bmtable.h: replace C++ comments with C comments.
8769 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8771 * src/screen.C (ShowCursor): Change the shape of the cursor if
8772 the current language is not equal to the language of the document.
8773 (If the cursor change its shape unexpectedly, then you've found a bug)
8775 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8778 * src/insets/insetnumber.[Ch]: New files.
8780 * src/LyXAction.C (init)
8781 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8784 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8786 * src/lyxparagraph.h
8787 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8788 (the vector is kept sorted).
8790 * src/text.C (GetVisibleRow): Draw selection correctly when there
8791 is both LTR and RTL text.
8793 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8794 which is much faster.
8796 * src/text.C (GetVisibleRow and other): Do not draw the last space
8797 in a row if the direction of the last letter is not equal to the
8798 direction of the paragraph.
8800 * src/lyxfont.C (latexWriteStartChanges):
8801 Check that font language is not equal to basefont language.
8802 (latexWriteEndChanges): ditto
8804 * src/lyx_cb.C (StyleReset): Don't change the language while using
8805 the font-default command.
8807 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8808 empty paragraph before a footnote.
8810 * src/insets/insetcommand.C (draw): Increase x correctly.
8812 * src/screen.C (ShowCursor): Change cursor shape if
8813 current language != document language.
8815 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8817 2000-03-31 Juergen Vigna <jug@sad.it>
8819 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8820 (Clone): changed mode how the paragraph-data is copied to the
8821 new clone-paragraph.
8823 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8824 GetInset(pos) with no inset anymore there (in inset UNDO)
8826 * src/insets/insetcommand.C (draw): small fix as here x is
8827 incremented not as much as width() returns (2 before, 2 behind = 4)
8829 2000-03-30 Juergen Vigna <jug@sad.it>
8831 * src/insets/insettext.C (InsetText): small fix in initialize
8832 widthOffset (should not be done in the init() function)
8834 2000-03-29 Amir Karger <karger@lyx.org>
8836 * lib/examples/it_ItemizeBullets.lyx: translation by
8839 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8841 2000-03-29 Juergen Vigna <jug@sad.it>
8843 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8845 * src/insets/insetfoot.C (Clone): small change as for the below
8846 new init function in the text-inset
8848 * src/insets/insettext.C (init): new function as I've seen that
8849 clone did not copy the Paragraph-Data!
8850 (LocalDispatch): Added code so that now we have some sort of Undo
8851 functionality (well actually we HAVE Undo ;)
8853 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8855 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8857 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8860 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8862 * src/main.C: added a runtime check that verifies that the xforms
8863 header used when building LyX and the library used when running
8864 LyX match. Exit with a message if they don't match. This is a
8865 version number check only.
8867 * src/buffer.C (save): Don't allocate memory on the heap for
8868 struct utimbuf times.
8870 * *: some using changes, use iosfwd instead of the real headers.
8872 * src/lyxfont.C use char const * instead of string for the static
8873 strings. Rewrite some functions to use sstream.
8875 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8877 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8880 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8882 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8883 of Geodesy (from Martin Vermeer)
8885 * lib/layouts/svjour.inc: include file for the Springer svjour
8886 class. It can be used to support journals other than JoG.
8888 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8889 Miskiewicz <misiek@pld.org.pl>)
8890 * lib/reLyX/Makefile.am: ditto.
8892 2000-03-27 Juergen Vigna <jug@sad.it>
8894 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8895 also some modifications with operations on selected text.
8897 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8898 problems with clicking on insets (last famous words ;)
8900 * src/insets/insetcommand.C (draw):
8901 (width): Changed to have a bit of space before and after the inset so
8902 that the blinking cursor can be seen (otherwise it was hidden)
8904 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8906 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8907 would not be added to the link list when an installed gettext (not
8908 part of libc) is found.
8910 2000-03-24 Juergen Vigna <jug@sad.it>
8912 * src/insets/insetcollapsable.C (Edit):
8913 * src/mathed/formula.C (InsetButtonRelease):
8914 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8917 * src/BufferView.C (workAreaButtonPress):
8918 (workAreaButtonRelease):
8919 (checkInsetHit): Finally fixed the clicking on insets be handled
8922 * src/insets/insetert.C (Edit): inserted this call so that ERT
8923 insets work always with LaTeX-font
8925 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8927 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8928 caused lyx to startup with no GUI in place, causing in a crash
8929 upon startup when called with arguments.
8931 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8933 * src/FontLoader.C: better initialization of dummyXFontStruct.
8935 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8937 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8938 for linuxdoc and docbook import and export format options.
8940 * lib/lyxrc.example Example of default values for the previous flags.
8942 * src/lyx_cb.C Use those flags instead of the hardwired values for
8943 linuxdoc and docbook export.
8945 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8948 * src/menus.C Added menus entries for the new import/exports formats.
8950 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8952 * src/lyxrc.*: Added support for running without Gui
8955 * src/FontLoader.C: sensible defaults if no fonts are needed
8957 * src/lyx_cb.C: New function ShowMessage (writes either to the
8958 minibuffer or cout in case of no gui
8959 New function AskOverwrite for common stuff
8960 Consequently various changes to call these functions
8962 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8963 wild guess at sensible screen resolution when having no gui
8965 * src/lyxfont.C: no gui, no fonts... set some defaults
8967 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8969 * src/LColor.C: made the command inset background a bit lighter.
8971 2000-03-20 Hartmut Goebel <goebel@noris.net>
8973 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8974 stdstruct.inc. Koma-Script added some title elements which
8975 otherwise have been listed below "bibliography". This split allows
8976 adding title elements to where they belong.
8978 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8979 define the additional title elements and then include
8982 * many other layout files: changed to include stdtitle.inc just
8983 before stdstruct.inc.
8985 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8987 * src/buffer.C: (save) Added the option to store all backup files
8988 in a single directory
8990 * src/lyxrc.[Ch]: Added variable \backupdir_path
8992 * lib/lyxrc.example: Added descriptions of recently added variables
8994 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8995 bibtex inset, not closing the bibtex popup when deleting the inset)
8997 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8999 * src/lyx_cb.C: add a couple using directives.
9001 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9002 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9003 import based on the filename.
9005 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9006 file would be imported at start, if the filename where of a sgml file.
9008 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9010 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9012 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9013 * src/lyxfont.h Replaced the member variable bits.direction by the
9014 member variable lang. Made many changes in other files.
9015 This allows having a multi-lingual document
9017 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9018 that change the current language to <l>.
9019 Removed the command "font-rtl"
9021 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9022 format for Hebrew documents)
9024 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9025 When auto_mathmode is "true", pressing a digit key in normal mode
9026 will cause entering into mathmode.
9027 If auto_mathmode is "rtl" then this behavior will be active only
9028 when writing right-to-left text.
9030 * src/text2.C (InsertStringA) The string is inserted using the
9033 * src/paragraph.C (GetEndLabel) Gives a correct result for
9034 footnote paragraphs.
9036 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9038 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9040 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9041 front of PasteParagraph. Never insert a ' '. This should at least
9042 fix some cause for the segfaults that we have been experiencing,
9043 it also fixes backspace behaviour slightly. (Phu!)
9045 * src/support/lstrings.C (compare_no_case): some change to make it
9046 compile with gcc 2.95.2 and stdlibc++-v3
9048 * src/text2.C (MeltFootnoteEnvironment): change type o
9049 first_footnote_par_is_not_empty to bool.
9051 * src/lyxparagraph.h: make text private. Changes in other files
9053 (fitToSize): new function
9054 (setContentsFromPar): new function
9055 (clearContents): new function
9056 (SetChar): new function
9058 * src/paragraph.C (readSimpleWholeFile): deleted.
9060 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9061 the file, just use a simple string instead. Also read the file in
9062 a more maintainable manner.
9064 * src/text2.C (InsertStringA): deleted.
9065 (InsertStringB): deleted.
9067 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9069 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9070 RedoParagraphs from the doublespace handling part, just set status
9071 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9072 done, but perhaps not like this.)
9074 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9076 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9077 character when inserting an inset.
9079 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9081 * src/bufferparams.C (readLanguage): now takes "default" into
9084 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9085 also initialize the toplevel_keymap with the default bindings from
9088 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9090 * all files using lyxrc: have lyxrc as a real variable and not a
9091 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9094 * src/lyxrc.C: remove double call to defaultKeyBindings
9096 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9097 toolbar defauls using lyxlex. Remove enums, structs, functions
9100 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9101 toolbar defaults. Also store default keybindings in a map.
9103 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9104 storing the toolbar defaults without any xforms dependencies.
9106 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9107 applied. Changed to use iterators.
9109 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9111 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9112 systems that don't have LINGUAS set to begin with.
9114 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9116 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9117 the list by Dekel Tsur.
9119 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9121 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9122 * src/insets/form_graphics.C: ditto.
9124 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9126 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9128 * src/bufferparams.C (readLanguage): use the new language map
9130 * src/intl.C (InitKeyMapper): use the new language map
9132 * src/lyx_gui.C (create_forms): use the new language map
9134 * src/language.[Ch]: New files. Used for holding the information
9135 about each language. Now! Use this new language map enhance it and
9136 make it really usable for our needs.
9138 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9140 * screen.C (ShowCursor): Removed duplicate code.
9141 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9142 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9144 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9147 * src/text.C Added TransformChar method. Used for rendering Arabic
9148 text correctly (change the glyphs of the letter according to the
9149 position in the word)
9154 * src/lyxrc.C Added lyxrc command {language_command_begin,
9155 language_command_end,language_command_ltr,language_command_rtl,
9156 language_package} which allows the use of either arabtex or Omega
9159 * src/lyx_gui.C (init)
9161 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9162 to use encoding for menu fonts which is different than the encoding
9165 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9166 do not load the babel package.
9167 To write an English document with Hebrew/Arabic, change the document
9168 language to "english".
9170 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9171 (alphaCounter): changed to return char
9172 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9174 * lib/lyxrc.example Added examples for Hebrew/Arabic
9177 * src/layout.C Added layout command endlabeltype
9179 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9181 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9183 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9185 * src/mathed/math_delim.C (search_deco): return a
9186 math_deco_struct* instead of index.
9188 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9190 * All files with a USE_OSTREAM_ONLY within: removed all code that
9191 was unused when USE_OSTREAM_ONLY is defined.
9193 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9194 of any less. Removed header and using.
9196 * src/text.C (GetVisibleRow): draw the string "Page Break
9197 (top/bottom)" on screen when drawing a pagebreak line.
9199 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9201 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9203 * src/mathed/math_macro.C (draw): do some cast magic.
9206 * src/mathed/math_defs.h: change byte* argument to byte const*.
9208 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9210 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9211 know it is right to return InsetFoot* too, but cxx does not like
9214 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9216 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9218 * src/mathed/math_delim.C: change == to proper assignment.
9220 2000-03-09 Juergen Vigna <jug@sad.it>
9222 * src/insets/insettext.C (setPos): fixed various cursor positioning
9223 problems (via mouse and cursor-keys)
9224 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9225 inset (still a small display problem but it works ;)
9227 * src/insets/insetcollapsable.C (draw): added button_top_y and
9228 button_bottom_y to have correct values for clicking on the inset.
9230 * src/support/lyxalgo.h: commented out 'using std::less'
9232 2000-03-08 Juergen Vigna <jug@sad.it>
9234 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9235 Button-Release event closes as it is alos the Release-Event
9238 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9240 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9242 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9243 can add multiple spaces in Scrap (literate programming) styles...
9244 which, by the way, is how I got hooked on LyX to begin with.
9246 * src/mathed/formula.C (Write): Added dummy variable to an
9247 inset::Latex() call.
9248 (Latex): Add free_spacing boolean to inset::Latex()
9250 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9252 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9253 virtual function to include the free_spacing boolean from
9254 the containing paragraph's style.
9256 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9257 Added free_spacing boolean arg to match inset.h
9259 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9260 Added free_spacing boolean arg to match inset.h
9262 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9263 Added free_spacing boolean and made sure that if in a free_spacing
9264 paragraph, that we output normal space if there is a protected space.
9266 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9267 Added free_spacing boolean arg to match inset.h
9269 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9270 Added free_spacing boolean arg to match inset.h
9272 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9273 Added free_spacing boolean arg to match inset.h
9275 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9276 Added free_spacing boolean arg to match inset.h
9278 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9279 Added free_spacing boolean arg to match inset.h
9281 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9282 free_spacing boolean arg to match inset.h
9284 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9285 Added free_spacing boolean arg to match inset.h
9287 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9288 Added free_spacing boolean arg to match inset.h
9290 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9291 Added free_spacing boolean arg to match inset.h
9293 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9294 Added free_spacing boolean arg to match inset.h
9296 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9297 Added free_spacing boolean arg to match inset.h
9299 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9300 free_spacing boolean arg to match inset.h
9302 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9303 free_spacing boolean arg to match inset.h
9305 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9306 ignore free_spacing paragraphs. The user's spaces are left
9309 * src/text.C (InsertChar): Fixed the free_spacing layout
9310 attribute behavior. Now, if free_spacing is set, you can
9311 add multiple spaces in a paragraph with impunity (and they
9312 get output verbatim).
9313 (SelectSelectedWord): Added dummy argument to inset::Latex()
9316 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9319 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9320 paragraph layouts now only input a simple space instead.
9321 Special character insets don't make any sense in free-spacing
9324 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9325 hard-spaces in the *input* file to simple spaces if the layout
9326 is free-spacing. This converts old files which had to have
9327 hard-spaces in free-spacing layouts where a simple space was
9329 (writeFileAscii): Added free_spacing check to pass to the newly
9330 reworked inset::Latex(...) methods. The inset::Latex() code
9331 ensures that hard-spaces in free-spacing paragraphs get output
9332 as spaces (rather than "~").
9334 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9336 * src/mathed/math_delim.C (draw): draw the empty placeholder
9337 delims with a onoffdash line.
9338 (struct math_deco_compare): struct that holds the "functors" used
9339 for the sort and the binary search in math_deco_table.
9340 (class init_deco_table): class used for initial sort of the
9342 (search_deco): use lower_bound to do a binary search in the
9345 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9347 * src/lyxrc.C: a small secret thingie...
9349 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9350 and to not flush the stream as often as it used to.
9352 * src/support/lyxalgo.h: new file
9353 (sorted): template function used for checking if a sequence is
9354 sorted or not. Two versions with and without user supplied
9355 compare. Uses same compare as std::sort.
9357 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9358 it and give warning on lyxerr.
9360 (struct compare_tags): struct with function operators used for
9361 checking if sorted, sorting and lower_bound.
9362 (search_kw): use lower_bound instead of manually implemented
9365 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9367 * src/insets/insetcollapsable.h: fix Clone() declaration.
9368 * src/insets/insetfoot.h: ditto.
9370 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9372 2000-03-08 Juergen Vigna <jug@sad.it>
9374 * src/insets/lyxinset.h: added owner call which tells us if
9375 this inset is inside another inset. Changed also the return-type
9376 of Editable to an enum so it tells clearer what the return-value is.
9378 * src/insets/insettext.C (computeTextRows): fixed computing of
9379 textinsets which split automatically on more rows.
9381 * src/insets/insetert.[Ch]: changed this to be of BaseType
9384 * src/insets/insetfoot.[Ch]: added footnote inset
9386 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9387 collapsable insets (like footnote, ert, ...)
9389 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9391 * src/lyxdraw.h: remvoe file
9393 * src/lyxdraw.C: remove file
9395 * src/insets/insettext.C: added <algorithm>.
9397 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9399 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9400 (matrix_cb): case MM_OK use string stream
9402 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9405 * src/mathed/math_macro.C (draw): use string stream
9406 (Metrics): use string stream
9408 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9409 directly to the ostream.
9411 * src/vspace.C (asString): use string stream.
9412 (asString): use string stream
9413 (asLatexString): use string stream
9415 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9416 setting Spacing::Other.
9418 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9419 sprintf when creating the stretch vale.
9421 * src/text2.C (alphaCounter): changed to return a string and to
9422 not use a static variable internally. Also fixed a one-off bug.
9423 (SetCounter): changed the drawing of the labels to use string
9424 streams instead of sprintf.
9426 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9427 manipulator to use a scheme that does not require library support.
9428 This is also the way it is done in the new GNU libstdc++. Should
9429 work with DEC cxx now.
9431 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9433 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9434 end. This fixes a bug.
9436 * src/mathed (all files concerned with file writing): apply the
9437 USE_OSTREAM_ONLY changes to mathed too.
9439 * src/support/DebugStream.h: make the constructor explicit.
9441 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9442 count and ostream squashed.
9444 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9446 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9448 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9449 ostringstream uses STL strings, and we might not.
9451 * src/insets/insetspecialchar.C: add using directive.
9452 * src/insets/insettext.C: ditto.
9454 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9456 * lib/layouts/seminar.layout: feeble attempt at a layout for
9457 seminar.cls, far from completet and could really use some looking
9458 at from people used to write layout files.
9460 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9461 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9462 a lot nicer and works nicely with ostreams.
9464 * src/mathed/formula.C (draw): a slightly different solution that
9465 the one posted to the list, but I think this one works too. (font
9466 size wrong in headers.)
9468 * src/insets/insettext.C (computeTextRows): some fiddling on
9469 Jürgens turf, added some comments that he should read.
9471 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9472 used and it gave compiler warnings.
9473 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9476 * src/lyx_gui.C (create_forms): do the right thing when
9477 show_banner is true/false.
9479 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9480 show_banner is false.
9482 * most file writing files: Now use iostreams to do almost all of
9483 the writing. Also instead of passing string &, we now use
9484 stringstreams. mathed output is still not adapted to iostreams.
9485 This change can be turned off by commenting out all the occurences
9486 of the "#define USE_OSTREAM_ONLY 1" lines.
9488 * src/WorkArea.C (createPixmap): don't output debug messages.
9489 (WorkArea): don't output debug messages.
9491 * lib/lyxrc.example: added a comment about the new variable
9494 * development/Code_rules/Rules: Added some more commente about how
9495 to build class interfaces and on how better encapsulation can be
9498 2000-03-03 Juergen Vigna <jug@sad.it>
9500 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9501 automatically with the width of the LyX-Window
9503 * src/insets/insettext.C (computeTextRows): fixed update bug in
9504 displaying text-insets (scrollvalues where not initialized!)
9506 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9508 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9509 id in the check of the result from lower_bound is not enough since
9510 lower_bound can return last too, and then res->id will not be a
9513 * all insets and some code that use them: I have conditionalized
9514 removed the Latex(string & out, ...) this means that only the
9515 Latex(ostream &, ...) will be used. This is a work in progress to
9516 move towards using streams for all output of files.
9518 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9521 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9523 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9524 routine (this fixes bug where greek letters were surrounded by too
9527 * src/support/filetools.C (findtexfile): change a bit the search
9528 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9529 no longer passed to kpsewhich, we may have to change that later.
9531 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9532 warning options to avoid problems with X header files (from Angus
9534 * acinclude.m4: regenerated.
9536 2000-03-02 Juergen Vigna <jug@sad.it>
9538 * src/insets/insettext.C (WriteParagraphData): Using the
9539 par->writeFile() function for writing paragraph-data.
9540 (Read): Using buffer->parseSingleLyXformat2Token()-function
9541 for parsing paragraph data!
9543 * src/buffer.C (readLyXformat2): removed all parse data and using
9544 the new parseSingleLyXformat2Token()-function.
9545 (parseSingleLyXformat2Token): added this function to parse (read)
9546 lyx-file-format (this is called also from text-insets now!)
9548 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9550 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9553 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9554 directly instead of going through a func. One very bad thing: a
9555 static LyXFindReplace, but I don't know where to place it.
9557 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9558 string instead of char[]. Also changed to static.
9559 (GetSelectionOrWordAtCursor): changed to static inline
9560 (SetSelectionOverLenChars): ditto.
9562 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9563 current_view and global variables. both classes has changed names
9564 and LyXFindReplace is not inherited from SearchForm.
9566 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9567 fl_form_search form.
9569 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9571 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9573 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9574 bound (from Kayvan).
9576 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9578 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9580 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9582 * some things that I should comment but the local pub says head to
9585 * comment out all code that belongs to the Roff code for Ascii
9586 export of tables. (this is unused)
9588 * src/LyXView.C: use correct type for global variable
9589 current_layout. (LyXTextClass::size_type)
9591 * some code to get the new insetgraphics closer to working I'd be
9592 grateful for any help.
9594 * src/BufferView2.C (insertInset): use the return type of
9595 NumberOfLayout properly. (also changes in other files)
9597 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9598 this as a test. I want to know what breaks because of this.
9600 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9602 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9604 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9605 to use a \makebox in the label, this allows proper justification
9606 with out using protected spaces or multiple hfills. Now it is
9607 "label" for left justified, "\hfill label\hfill" for center, and
9608 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9609 should be changed accordingly.
9611 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9613 * src/lyxtext.h: change SetLayout() to take a
9614 LyXTextClass::size_type instead of a char (when there is more than
9615 127 layouts in a class); also change type of copylayouttype.
9616 * src/text2.C (SetLayout): ditto.
9617 * src/LyXView.C (updateLayoutChoice): ditto.
9619 * src/LaTeX.C (scanLogFile): errors where the line number was not
9620 given just after the '!'-line were ignored (from Dekel Tsur).
9622 * lib/lyxrc.example: fix description of \date_insert_format
9624 * lib/layouts/llncs.layout: new layout, contributed by Martin
9627 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9629 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9630 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9631 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9632 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9633 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9634 paragraph.C, text.C, text2.C)
9636 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9638 * src/insets/insettext.C (LocalDispatch): remove extra break
9641 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9642 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9644 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9645 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9647 * src/insets/insetbib.h: move InsetBibkey::Holder and
9648 InsetCitation::Holder in public space.
9650 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9652 * src/insets/insettext.h: small change to get the new files from
9653 Juergen to compile (use "string", not "class string").
9655 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9656 const & as parameter to LocalDispatch, use LyXFont const & as
9657 paramter to some other func. This also had impacto on lyxinsets.h
9658 and the two mathed insets.
9660 2000-02-24 Juergen Vigna <jug@sad.it>
9663 * src/commandtags.h:
9665 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9669 * src/BufferView2.C: added/updated code for various inset-functions
9671 * src/insets/insetert.[Ch]: added implementation of InsetERT
9673 * src/insets/insettext.[Ch]: added implementation of InsetText
9675 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9676 (draw): added preliminary code for inset scrolling not finshed yet
9678 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9679 as it is in lyxfunc.C now
9681 * src/insets/lyxinset.h: Added functions for text-insets
9683 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9685 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9686 BufferView and reimplement the list as a queue put inside its own
9689 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9691 * several files: use the new interface to the "updateinsetlist"
9693 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9695 (work_area_handler): call BufferView::trippleClick on trippleclick.
9697 * src/BufferView.C (doubleClick): new function, selects word on
9699 (trippleClick): new function, selects line on trippleclick.
9701 2000-02-22 Allan Rae <rae@lyx.org>
9703 * lib/bind/xemacs.bind: buffer-previous not supported
9705 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9707 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9710 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9712 * src/bufferlist.C: get rid of current_view from this file
9714 * src/spellchecker.C: get rid of current_view from this file
9716 * src/vspace.C: get rid of current_view from this file
9717 (inPixels): added BufferView parameter for this func
9718 (asLatexCommand): added a BufferParams for this func
9720 * src/text.C src/text2.C: get rid of current_view from these
9723 * src/lyxfont.C (getFontDirection): move this function here from
9726 * src/bufferparams.C (getDocumentDirection): move this function
9729 * src/paragraph.C (getParDirection): move this function here from
9731 (getLetterDirection): ditto
9733 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9735 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9736 resize due to wrong pixmap beeing used. Also took the opurtunity
9737 to make the LyXScreen stateless on regard to WorkArea and some
9738 general cleanup in the same files.
9740 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9742 * src/Makefile.am: add missing direction.h
9744 * src/PainterBase.h: made the width functions const.
9746 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9749 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9751 * src/insets/insetlatexaccent.C (draw): make the accents draw
9752 better, at present this will only work well with iso8859-1.
9754 * several files: remove the old drawing code, now we use the new
9757 * several files: remove support for mono_video, reverse_video and
9760 2000-02-17 Juergen Vigna <jug@sad.it>
9762 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9763 int ** as we have to return the pointer, otherwise we have only
9764 NULL pointers in the returning function.
9766 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9768 * src/LaTeX.C (operator()): quote file name when running latex.
9770 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9772 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9773 (bubble tip), this removes our special handling of this.
9775 * Remove all code that is unused now that we have the new
9776 workarea. (Code that are not active when NEW_WA is defined.)
9778 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9780 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9782 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9783 nonexisting layout; correctly redirect obsoleted layouts.
9785 * lib/lyxrc.example: document \view_dvi_paper_option
9787 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9790 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9791 (PreviewDVI): handle the view_dvi_paper_option variable.
9792 [Both from Roland Krause]
9794 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9796 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9797 char const *, int, LyXFont)
9798 (text(int, int, string, LyXFont)): ditto
9800 * src/text.C (InsertCharInTable): attempt to fix the double-space
9801 feature in tables too.
9802 (BackspaceInTable): ditto.
9803 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9805 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9807 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9809 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9810 newly found text in textcache to this.
9811 (buffer): set the owner of the text put into the textcache to 0
9813 * src/insets/figinset.C (draw): fixed the drawing of figures with
9816 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9817 drawing of mathframe, hfills, protected space, table lines. I have
9818 now no outstanding drawing problems with the new Painter code.
9820 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9822 * src/PainterBase.C (ellipse, circle): do not specify the default
9825 * src/LColor.h: add using directive.
9827 * src/Painter.[Ch]: change return type of methods from Painter& to
9828 PainterBase&. Add a using directive.
9830 * src/WorkArea.C: wrap xforms callbacks in C functions
9833 * lib/layouts/foils.layout: font fix and simplifications from Carl
9836 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9838 * a lot of files: The Painter, LColor and WorkArea from the old
9839 devel branch has been ported to lyx-devel. Some new files and a
9840 lot of #ifdeffed code. The new workarea is enabled by default, but
9841 if you want to test the new Painter and LColor you have to compile
9842 with USE_PAINTER defined (do this in config.h f.ex.) There are
9843 still some rought edges, and I'd like some help to clear those
9844 out. It looks stable (loads and displays the Userguide very well).
9847 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9849 * src/buffer.C (pop_tag): revert to the previous implementation
9850 (use a global variable for both loops).
9852 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9854 * src/lyxrc.C (LyXRC): change slightly default date format.
9856 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9857 there is an English text with a footnote that starts with a Hebrew
9858 paragraph, or vice versa.
9859 (TeXFootnote): ditto.
9861 * src/text.C (LeftMargin): allow for negative values for
9862 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9865 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9866 for input encoding (cyrillic)
9868 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9870 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9873 * src/toolbar.C (set): ditto
9874 * src/insets/insetbib.C (create_form_citation_form): ditto
9876 * lib/CREDITS: added Dekel Tsur.
9878 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9879 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9880 hebrew supports files from Dekel Tsur.
9882 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9883 <tzafrir@technion.ac.il>
9885 * src/lyxrc.C: put \date_insert_format at the right place.
9887 * src/buffer.C (makeLaTeXFile): fix the handling of
9888 BufferParams::sides when writing out latex files.
9890 * src/BufferView2.C: add a "using" directive.
9892 * src/support/lyxsum.C (sum): when we use lyxstring,
9893 ostringstream::str needs an additional .c_str().
9895 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9897 * src/support/filetools.C (ChangeExtension): patch from Etienne
9900 * src/TextCache.C (show): remove const_cast and make second
9901 parameter non-const LyXText *.
9903 * src/TextCache.h: use non const LyXText in show.
9905 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9908 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9910 * src/support/lyxsum.C: rework to be more flexible.
9912 * several places: don't check if a pointer is 0 if you are going
9915 * src/text.C: remove some dead code.
9917 * src/insets/figinset.C: remove some dead code
9919 * src/buffer.C: move the BufferView funcs to BufferView2.C
9920 remove all support for insetlatexdel
9921 remove support for oldpapersize stuff
9922 made some member funcs const
9924 * src/kbmap.C: use a std::list to store the bindings in.
9926 * src/BufferView2.C: new file
9928 * src/kbsequence.[Ch]: new files
9930 * src/LyXAction.C + others: remove all trace of buffer-previous
9932 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9933 only have one copy in the binary of this table.
9935 * hebrew patch: moved some functions from LyXText to more
9936 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9938 * several files: remove support for XForms older than 0.88
9940 remove some #if 0 #endif code
9942 * src/TextCache.[Ch]: new file. Holds the textcache.
9944 * src/BufferView.C: changes to use the new TextCache interface.
9945 (waitForX): remove the now unused code.
9947 * src/BackStack.h: remove some commented code
9949 * lib/bind/emacs.bind: remove binding for buffer-previous
9951 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9953 * applied the hebrew patch.
9955 * src/lyxrow.h: make sure that all Row variables are initialized.
9957 * src/text2.C (TextHandleUndo): comment out a delete, this might
9958 introduce a memory leak, but should also help us to not try to
9959 read freed memory. We need to look at this one.
9961 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9962 (LyXParagraph): initalize footnotekind.
9964 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9965 forgot this when applying the patch. Please heed the warnings.
9967 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9968 (aka. reformat problem)
9970 * src/bufferlist.C (exists): made const, and use const_iterator
9971 (isLoaded): new func.
9972 (release): use std::find to find the correct buffer.
9974 * src/bufferlist.h: made getState a const func.
9975 made empty a const func.
9976 made exists a const func.
9979 2000-02-01 Juergen Vigna <jug@sad.it>
9981 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9983 * po/it.po: updated a bit the italian po file and also changed the
9984 'file nuovo' for newfile to 'filenuovo' without a space, this did
9987 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9988 for the new insert_date command.
9990 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9991 from jdblair, to insert a date into the current text conforming to
9992 a strftime format (for now only considering the locale-set and not
9993 the document-language).
9995 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9997 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9998 Bounds Read error seen by purify. The problem was that islower is
9999 a macros which takes an unsigned char and uses it as an index for
10000 in array of characters properties (and is thus subject to the
10004 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10005 correctly the paper sides radio buttons.
10006 (UpdateDocumentButtons): ditto.
10008 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10010 * src/kbmap.C (getsym + others): change to return unsigned int,
10011 returning a long can give problems on 64 bit systems. (I assume
10012 that int is 32bit on 64bit systems)
10014 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10016 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10017 LyXLookupString to be zero-terminated. Really fixes problems seen
10018 by purify, I think.
10020 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10022 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10023 write a (char*)0 to the lyxerr stream.
10025 * src/lastfiles.C: move algorithm before the using statemets.
10027 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10029 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10030 complains otherwise).
10031 * src/table.C: ditto
10033 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10036 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10037 that I removed earlier... It is really needed.
10039 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10041 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10043 * INSTALL: update xforms home page URL.
10045 * lib/configure.m4: fix a bug with unreadable layout files.
10047 * src/table.C (calculate_width_of_column): add "using std::max"
10050 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10052 * several files: marked several lines with "DEL LINE", this is
10053 lines that can be deleted without changing anything.
10054 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10055 checks this anyway */
10058 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10060 * src/DepTable.C (update): add a "+" at the end when the checksum
10061 is different. (debugging string only)
10063 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10064 the next inset to not be displayed. This should also fix the list
10065 of labels in the "Insert Crossreference" dialog.
10067 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10069 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10070 when regex was not found.
10072 * src/support/lstrings.C (lowercase): use handcoded transform always.
10075 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10076 old_cursor.par->prev could be 0.
10078 * several files: changed post inc/dec to pre inc/dec
10080 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10081 write the lastfiles to file.
10083 * src/BufferView.C (buffer): only show TextCache info when debugging
10085 (resizeCurrentBuffer): ditto
10086 (workAreaExpose): ditto
10088 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10090 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10092 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10093 a bit better by removing the special case for \i and \j.
10095 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10097 * src/lyx_main.C (easyParse): remove test for bad comand line
10098 options, since this broke all xforms-related parsing.
10100 * src/kbmap.C (getsym): set return type to unsigned long, as
10101 declared in header. On an alpha, long is _not_ the same as int.
10103 * src/support/LOstream.h: add a "using std::flush;"
10105 * src/insets/figinset.C: ditto.
10107 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10109 * src/bufferlist.C (write): use blinding fast file copy instead of
10110 "a char at a time", now we are doing it the C++ way.
10112 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10113 std::list<int> instead.
10114 (addpidwait): reflect move to std::list<int>
10115 (sigchldchecker): ditto
10117 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10120 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10121 that obviously was wrong...
10123 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10124 c, this avoids warnings with purify and islower.
10126 * src/insets/figinset.C: rename struct queue to struct
10127 queue_element and rewrite to use a std::queue. gsqueue is now a
10128 std::queue<queue_element>
10129 (runqueue): reflect move to std::queue
10132 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10133 we would get "1" "0" instead of "true" "false. Also make the tostr
10136 2000-01-21 Juergen Vigna <jug@sad.it>
10138 * src/buffer.C (writeFileAscii): Disabled code for special groff
10139 handling of tabulars till I fix this in table.C
10141 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10143 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10145 * src/support/lyxlib.h: ditto.
10147 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10149 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10150 and 'j' look better. This might fix the "macron" bug that has been
10153 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10154 functions as one template function. Delete the old versions.
10156 * src/support/lyxsum.C: move using std::ifstream inside
10159 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10162 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10164 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10166 * src/insets/figinset.C (InitFigures): use new instead of malloc
10167 to allocate memory for figures and bitmaps.
10168 (DoneFigures): use delete[] instead of free to deallocate memory
10169 for figures and bitmaps.
10170 (runqueue): use new to allocate
10171 (getfigdata): use new/delete[] instead of malloc/free
10172 (RegisterFigure): ditto
10174 * some files: moved some declarations closer to first use, small
10175 whitespace changes use preincrement instead of postincrement where
10176 it does not make a difference.
10178 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10179 step on the way to use stl::containers for key maps.
10181 * src/bufferlist.h: add a typedef for const_iterator and const
10182 versions of begin and end.
10184 * src/bufferlist.[Ch]: change name of member variable _state to
10185 state_. (avoid reserved names)
10187 (getFileNames): returns the filenames of the buffers in a vector.
10189 * configure.in (ALL_LINGUAS): added ro
10191 * src/support/putenv.C: new file
10193 * src/support/mkdir.C: new file
10195 2000-01-20 Allan Rae <rae@lyx.org>
10197 * lib/layouts/IEEEtran.layout: Added several theorem environments
10199 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10200 couple of minor additions.
10202 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10203 (except for those in footnotes of course)
10205 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10207 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10209 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10210 std::sort and std::lower_bound instead of qsort and handwritten
10212 (struct compara): struct that holds the functors used by std::sort
10213 and std::lower_bound in MathedLookupBOP.
10215 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10217 * src/support/LAssert.h: do not do partial specialization. We do
10218 not really need it.
10220 * src/support/lyxlib.h: note that lyx::getUserName() and
10221 lyx::date() are not in use right now. Should these be suppressed?
10223 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10224 (makeLinuxDocFile): do not put date and user name in linuxdoc
10227 * src/support/lyxlib.h (kill): change first argument to long int,
10228 since that's what solaris uses.
10230 * src/support/kill.C (kill): fix declaration to match prototype.
10232 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10233 actually check whether namespaces are supported. This is not what
10236 * src/support/lyxsum.C: add a using directive.
10238 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10240 * src/support/kill.C: if we have namespace support we don't have
10241 to include lyxlib.h.
10243 * src/support/lyxlib.h: use namespace lyx if supported.
10245 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10247 * src/support/date.C: new file
10249 * src/support/chdir.C: new file
10251 * src/support/getUserName.C: new file
10253 * src/support/getcwd.C: new file
10255 * src/support/abort.C: new file
10257 * src/support/kill.C: new file
10259 * src/support/lyxlib.h: moved all the functions in this file
10260 insede struct lyx. Added also kill and abort to this struct. This
10261 is a way to avoid the "kill is not defined in <csignal>", we make
10262 C++ wrappers for functions that are not ANSI C or ANSI C++.
10264 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10265 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10266 lyx it has been renamed to sum.
10268 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10270 * src/text.C: add using directives for std::min and std::max.
10272 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10274 * src/texrow.C (getIdFromRow): actually return something useful in
10275 id and pos. Hopefully fixes the bug with positionning of errorbox
10278 * src/lyx_main.C (easyParse): output an error and exit if an
10279 incorrect command line option has been given.
10281 * src/spellchecker.C (ispell_check_word): document a memory leak.
10283 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10284 where a "struct utimbuf" is allocated with "new" and deleted with
10287 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10289 * src/text2.C (CutSelection): don't delete double spaces.
10290 (PasteSelection): ditto
10291 (CopySelection): ditto
10293 * src/text.C (Backspace): don't delete double spaces.
10295 * src/lyxlex.C (next): fix a bug that were only present with
10296 conformant std::istream::get to read comment lines, use
10297 std::istream::getline instead. This seems to fix the problem.
10299 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10301 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10302 allowed to insert space before space" editing problem. Please read
10303 commends at the beginning of the function. Comments about usage
10306 * src/text.C (InsertChar): fix for the "not allowed to insert
10307 space before space" editing problem.
10309 * src/text2.C (DeleteEmptyParagraphMechanism): when
10310 IsEmptyTableRow can only return false this last "else if" will
10311 always be a no-op. Commented out.
10313 * src/text.C (RedoParagraph): As far as I can understand tmp
10314 cursor is not really needed.
10316 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10317 present it could only return false anyway.
10318 (several functions): Did something not so smart...added a const
10319 specifier on a lot of methods.
10321 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10322 and add a tmp->text.resize. The LyXParagraph constructor does the
10324 (BreakParagraphConservative): ditto
10326 * src/support/path.h (Path): add a define so that the wrong usage
10327 "Path("/tmp") will be flagged as a compilation error:
10328 "`unnamed_Path' undeclared (first use this function)"
10330 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10332 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10333 which was bogus for several reasons.
10335 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10337 (runBibTeX): ditto.
10339 * autogen.sh: do not use "type -path" (what's that anyway?).
10341 * src/support/filetools.C (findtexfile): remove extraneous space
10342 which caused a kpsewhich warning (at least with kpathsea version
10345 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10347 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10349 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10351 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10353 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10355 * src/paragraph.C (BreakParagraph): do not reserve space on text
10356 if we don't need to (otherwise, if pos_end < pos, we end up
10357 reserving huge amounts of memory due to bad unsigned karma).
10358 (BreakParagraphConservative): ditto, although I have not seen
10359 evidence the bug can happen here.
10361 * src/lyxparagraph.h: add a using std::list.
10363 2000-01-11 Juergen Vigna <jug@sad.it>
10365 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10366 could not be found.
10368 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10370 * src/vc-backend.C (doVCCommand): change to be static and take one
10371 more parameter: the path to chdir too be fore executing the command.
10372 (retrive): new function equiv to "co -r"
10374 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10375 file_not_found_hook is true.
10377 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10379 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10380 if a file is readwrite,readonly...anything else.
10382 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10384 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10385 (CreatePostscript): name change from MenuRunDVIPS (or something)
10386 (PreviewPostscript): name change from MenuPreviewPS
10387 (PreviewDVI): name change from MenuPreviewDVI
10389 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10390 \view_pdf_command., \pdf_to_ps_command
10392 * lib/configure.m4: added search for PDF viewer, and search for
10393 PDF to PS converter.
10394 (lyxrc.defaults output): add \pdflatex_command,
10395 \view_pdf_command and \pdf_to_ps_command.
10397 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10399 * src/bufferlist.C (write): we don't use blocksize for anything so
10402 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10404 * src/support/block.h: disable operator T* (), since it causes
10405 problems with both compilers I tried. See comments in the file.
10407 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10410 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10411 variable LYX_DIR_10x to LYX_DIR_11x.
10413 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10415 * INSTALL: document --with-lyxname.
10418 * configure.in: new configure flag --with-lyxname which allows to
10419 choose the name under which lyx is installed. Default is "lyx", of
10420 course. It used to be possible to do this with --program-suffix,
10421 but the later has in fact a different meaning for autoconf.
10423 * src/support/lstrings.h (lstrchr): reformat a bit.
10425 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10426 * src/mathed/math_defs.h: ditto.
10428 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10430 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10431 true, decides if we create a backup file or not when saving. New
10432 tag and variable \pdf_mode, defaults to false. New tag and
10433 variable \pdflatex_command, defaults to pdflatex. New tag and
10434 variable \view_pdf_command, defaults to xpdf. New tag and variable
10435 \pdf_to_ps_command, defaults to pdf2ps.
10437 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10439 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10440 does not have a BufferView.
10441 (unlockInset): ditto + don't access the_locking_inset if the
10442 buffer does not have a BufferView.
10444 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10445 certain circumstances so that we don't continue a keyboard
10446 operation long after the key was released. Try f.ex. to load a
10447 large document, press PageDown for some seconds and then release
10448 it. Before this change the document would contine to scroll for
10449 some time, with this change it stops imidiatly.
10451 * src/support/block.h: don't allocate more space than needed. As
10452 long as we don't try to write to the arr[x] in a array_type arr[x]
10453 it is perfectly ok. (if you write to it you might segfault).
10454 added operator value_type*() so that is possible to pass the array
10455 to functions expecting a C-pointer.
10457 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10460 * intl/*: updated to gettext 0.10.35, tried to add our own
10461 required modifications. Please verify.
10463 * po/*: updated to gettext 0.10.35, tried to add our own required
10464 modifications. Please verify.
10466 * src/support/lstrings.C (tostr): go at fixing the problem with
10467 cxx and stringstream. When stringstream is used return
10468 oss.str().c_str() so that problems with lyxstring and basic_string
10469 are avoided. Note that the best solution would be for cxx to use
10470 basic_string all the way, but it is not conformant yet. (it seems)
10472 * src/lyx_cb.C + other files: moved several global functions to
10473 class BufferView, some have been moved to BufferView.[Ch] others
10474 are still located in lyx_cb.C. Code changes because of this. (part
10475 of "get rid of current_view project".)
10477 * src/buffer.C + other files: moved several Buffer functions to
10478 class BufferView, the functions are still present in buffer.C.
10479 Code changes because of this.
10481 * config/lcmessage.m4: updated to most recent. used when creating
10484 * config/progtest.m4: updated to most recent. used when creating
10487 * config/gettext.m4: updated to most recent. applied patch for
10490 * config/gettext.m4.patch: new file that shows what changes we
10491 have done to the local copy of gettext.m4.
10493 * config/libtool.m4: new file, used in creation of acinclude.m4
10495 * config/lyxinclude.m4: new file, this is the lyx created m4
10496 macros, used in making acinclude.m4.
10498 * autogen.sh: GNU m4 discovered as a separate task not as part of
10499 the lib/configure creation.
10500 Generate acinlucde from files in config. Actually cat
10501 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10502 easier to upgrade .m4 files that really are external.
10504 * src/Spacing.h: moved using std::istringstream to right after
10505 <sstream>. This should fix the problem seen with some compilers.
10507 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10509 * src/lyx_cb.C: began some work to remove the dependency a lot of
10510 functions have on BufferView::text, even if not really needed.
10511 (GetCurrentTextClass): removed this func, it only hid the
10514 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10515 forgot this in last commit.
10517 * src/Bullet.C (bulletEntry): use static char const *[] for the
10518 tables, becuase of this the return arg had to change to string.
10519 (bulletSize): ditto
10520 (~Bullet): removed unneeded destructor
10522 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10523 (insetSleep): moved from Buffer
10524 (insetWakeup): moved from Buffer
10525 (insetUnlock): moved from Buffer
10527 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10528 from Buffer to BufferView.
10530 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10532 * config/ltmain.sh: updated to version 1.3.4 of libtool
10534 * config/ltconfig: updated to version 1.3.4 of libtool
10536 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10539 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10540 Did I get that right?
10542 * src/lyxlex.h: add a "using" directive or two.
10543 * src/Spacing.h: ditto.
10544 * src/insets/figinset.C: ditto.
10545 * src/support/filetools.C: ditto.
10546 * src/support/lstrings.C: ditto.
10547 * src/BufferView.C: ditto.
10548 * src/bufferlist.C: ditto.
10549 * src/lyx_cb.C: ditto.
10550 * src/lyxlex.C: ditto.
10552 * NEWS: add some changes for 1.1.4.
10554 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10556 * src/BufferView.C: first go at a TextCache to speed up switching
10559 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10561 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10562 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10563 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10564 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10567 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10568 members of the struct are correctly initialized to 0 (detected by
10570 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10571 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10573 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10574 pidwait, since it was allocated with "new". This was potentially
10575 very bad. Thanks to Michael Schmitt for running purify for us.
10578 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10580 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10582 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10584 1999-12-30 Allan Rae <rae@lyx.org>
10586 * lib/templates/IEEEtran.lyx: minor change
10588 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10589 src/mathed/formula.C (LocalDispatch): askForText changes
10591 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10592 know when a user has cancelled input. Fixes annoying problems with
10593 inserting labels and version control.
10595 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10597 * src/support/lstrings.C (tostr): rewritten to use strstream and
10600 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10602 * src/support/filetools.C (IsFileWriteable): use fstream to check
10603 (IsDirWriteable): use fileinfo to check
10605 * src/support/filetools.h (FilePtr): whole class deleted
10607 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10609 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10611 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10613 * src/bufferlist.C (write): use ifstream and ofstream instead of
10616 * src/Spacing.h: use istrstream instead of sscanf
10618 * src/mathed/math_defs.h: change first arg to istream from FILE*
10620 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10622 * src/mathed/math_parser.C: have yyis to be an istream
10623 (LexGetArg): use istream (yyis)
10625 (mathed_parse): ditto
10626 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10628 * src/mathed/formula.C (Read): rewritten to use istream
10630 * src/mathed/formulamacro.C (Read): rewritten to use istream
10632 * src/lyxlex.h (~LyXLex): deleted desturctor
10633 (getStream): new function, returns an istream
10634 (getFile): deleted funtion
10635 (IsOK): return is.good();
10637 * src/lyxlex.C (LyXLex): delete file and owns_file
10638 (setFile): open an filebuf and assign that to a istream instead of
10640 (setStream): new function, takes an istream as arg.
10641 (setFile): deleted function
10642 (EatLine): rewritten us use istream instead of FILE*
10646 * src/table.C (LyXTable): use istream instead of FILE*
10647 (Read): rewritten to take an istream instead of FILE*
10649 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10651 * src/buffer.C (Dispatch): remove an extraneous break statement.
10653 * src/support/filetools.C (QuoteName): change to do simple
10654 'quoting'. More work is necessary. Also changed to do nothing
10655 under emx (needs fix too).
10656 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10658 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10659 config.h.in to the AC_DEFINE_UNQUOTED() call.
10660 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10661 needs char * as argument (because Solaris 7 declares it like
10664 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10665 remove definition of BZERO.
10667 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10669 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10670 defined, "lyxregex.h" if not.
10672 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10674 (REGEX): new variable that is set to regex.c lyxregex.h when
10675 AM_CONDITIONAL USE_REGEX is set.
10676 (libsupport_la_SOURCES): add $(REGEX)
10678 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10681 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10684 * configure.in: add call to LYX_REGEX
10686 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10687 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10689 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10691 * lib/bind/fi_menus.bind: new file, from
10692 pauli.virtanen@saunalahti.fi.
10694 * src/buffer.C (getBibkeyList): pass the parameter delim to
10695 InsetInclude::getKeys and InsetBibtex::getKeys.
10697 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10698 is passed to Buffer::getBibkeyList
10700 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10701 instead of the hardcoded comma.
10703 * src/insets/insetbib.C (getKeys): make sure that there are not
10704 leading blanks in bibtex keys. Normal latex does not care, but
10705 harvard.sty seems to dislike blanks at the beginning of citation
10706 keys. In particular, the retturn value of the function is
10708 * INSTALL: make it clear that libstdc++ is needed and that gcc
10709 2.7.x probably does not work.
10711 * src/support/filetools.C (findtexfile): make debug message go to
10713 * src/insets/insetbib.C (getKeys): ditto
10715 * src/debug.C (showTags): make sure that the output is correctly
10718 * configure.in: add a comment for TWO_COLOR_ICON define.
10720 * acconfig.h: remove all the entries that already defined in
10721 configure.in or acinclude.m4.
10723 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10724 to avoid user name, date and copyright.
10726 1999-12-21 Juergen Vigna <jug@sad.it>
10728 * src/table.C (Read): Now read bogus row format informations
10729 if the format is < 5 so that afterwards the table can
10730 be read by lyx but without any format-info. Fixed the
10731 crash we experienced when not doing this.
10733 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10735 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10736 (RedoDrawingOfParagraph): ditto
10737 (RedoParagraphs): ditto
10738 (RemoveTableRow): ditto
10740 * src/text.C (Fill): rename arg paperwidth -> paper_width
10742 * src/buffer.C (insertLyXFile): rename var filename -> fname
10743 (writeFile): rename arg filename -> fname
10744 (writeFileAscii): ditto
10745 (makeLaTeXFile): ditto
10746 (makeLinuxDocFile): ditto
10747 (makeDocBookFile): ditto
10749 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10752 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10754 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10757 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10758 compiled by a C compiler not C++.
10760 * src/layout.h (LyXTextClass): added typedef for const_iterator
10761 (LyXTextClassList): added typedef for const_iterator + member
10762 functions begin and end.
10764 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10765 iterators to fill the choice_class.
10766 (updateLayoutChoice): rewritten to use iterators to fill the
10767 layoutlist in the toolbar.
10769 * src/BufferView.h (BufferView::work_area_width): removed unused
10772 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10774 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10775 (sgmlCloseTag): ditto
10777 * src/support/lstrings.h: return type of countChar changed to
10780 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10781 what version of this func to use. Also made to return unsigned int.
10783 * configure.in: call LYX_STD_COUNT
10785 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10786 conforming std::count.
10788 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10790 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10791 and a subscript would give bad display (patch from Dekel Tsur
10792 <dekel@math.tau.ac.il>).
10794 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10796 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10799 * src/chset.h: add a few 'using' directives
10801 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10802 triggered when no buffer is active
10804 * src/layout.C: removed `break' after `return' in switch(), since
10807 * src/lyx_main.C (init): make sure LyX can be ran in place even
10808 when libtool has done its magic with shared libraries. Fix the
10809 test for the case when the system directory has not been found.
10811 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10812 name for the latex file.
10813 (MenuMakeHTML): ditto
10815 * src/buffer.h: add an optional boolean argument, which is passed
10816 to ChangeExtension.
10818 1999-12-20 Allan Rae <rae@lyx.org>
10820 * lib/templates/IEEEtran.lyx: small correction and update.
10822 * configure.in: Attempted to use LYX_PATH_HEADER
10824 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10826 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10827 input from JMarc. Now use preprocessor to find the header.
10828 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10829 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10830 LYX_STL_STRING_FWD. See comments in file.
10832 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10834 * The global MiniBuffer * minibuffer variable is dead.
10836 * The global FD_form_main * fd_form_main variable is dead.
10838 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10840 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10842 * src/table.h: add the LOstream.h header
10843 * src/debug.h: ditto
10845 * src/LyXAction.h: change the explaination of the ReadOnly
10846 attribute: is indicates that the function _can_ be used.
10848 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10851 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10853 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10859 * src/paragraph.C (GetWord): assert on pos>=0
10862 * src/support/lyxstring.C: condition the use of an invariant on
10864 * src/support/lyxstring.h: ditto
10866 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10867 Use LAssert.h instead of plain assert().
10869 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10871 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10872 * src/support/filetools.C: ditto
10874 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10877 * INSTALL: document the new configure flags
10879 * configure.in: suppress --with-debug; add --enable-assertions
10881 * acinclude.m4: various changes in alignment of help strings.
10883 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10885 * src/kbmap.C: commented out the use of the hash map in kb_map,
10886 beginning of movement to a stl::container.
10888 * several files: removed code that was not in effect when
10889 MOVE_TEXT was defined.
10891 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10892 for escaping should not be used. We can discuss if the string
10893 should be enclosed in f.ex. [] instead of "".
10895 * src/trans_mgr.C (insert): use the new returned value from
10896 encodeString to get deadkeys and keymaps done correctly.
10898 * src/chset.C (encodeString): changed to return a pair, to tell
10899 what to use if we know the string.
10901 * src/lyxscreen.h (fillArc): new function.
10903 * src/FontInfo.C (resize): rewritten to use more std::string like
10904 structore, especially string::replace.
10906 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10909 * configure.in (chmod +x some scripts): remove config/gcc-hack
10911 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10913 * src/buffer.C (writeFile): change once again the top comment in a
10914 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10915 instead of an hardcoded version number.
10916 (makeDocBookFile): ditto
10918 * src/version.h: add new define LYX_DOCVERSION
10920 * po/de.po: update from Pit Sütterlin
10921 * lib/bind/de_menus.bind: ditto.
10923 * src/lyxfunc.C (Dispatch): call MenuExport()
10924 * src/buffer.C (Dispatch): ditto
10926 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10927 LyXFunc::Dispatch().
10928 (MenuExport): new function, moved from
10929 LyXFunc::Dispatch().
10931 * src/trans_mgr.C (insert): small cleanup
10932 * src/chset.C (loadFile): ditto
10934 * lib/kbd/iso8859-1.cdef: add missing backslashes
10936 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10938 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10939 help with placing the manually drawn accents better.
10941 (Draw): x2 and hg changed to float to minimize rounding errors and
10942 help place the accents better.
10944 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10945 unsigned short to char is just wrong...cast the char to unsigned
10946 char instead so that the two values can compare sanely. This
10947 should also make the display of insetlatexaccents better and
10948 perhaps also some other insets.
10950 (lbearing): new function
10953 1999-12-15 Allan Rae <rae@lyx.org>
10955 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10956 header that provides a wrapper around the very annoying SGI STL header
10959 * src/support/lyxstring.C, src/LString.h:
10960 removed old SGI-STL-compatability attempts.
10962 * configure.in: Use LYX_STL_STRING_FWD.
10964 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10965 stl_string_fwd.h is around and try to determine it's location.
10966 Major improvement over previous SGI STL 3.2 compatability.
10967 Three small problems remain with this function due to my zero
10968 knowledge of autoconf. JMarc and lgb see the comments in the code.
10970 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10972 * src/broken_const.h, config/hack-gcc, config/README: removed
10974 * configure.in: remove --with-gcc-hack option; do not call
10977 * INSTALL: remove documentation of --with-broken-const and
10980 * acconfig.h: remove all trace of BROKEN_CONST define
10982 * src/buffer.C (makeDocBookFile): update version number in output
10984 (SimpleDocBookOnePar): fix an assert when trying to a character
10985 access beyond string length
10988 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10990 * po/de.po: fix the Export menu
10992 * lyx.man: update the description of -dbg
10994 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10995 (commandLineHelp): updated
10996 (easyParse): show list of available debug levels if -dbg is passed
10999 * src/Makefile.am: add debug.C
11001 * src/debug.h: moved some code to debug.C
11003 * src/debug.C: new file. Contains code to set and show debug
11006 * src/layout.C: remove 'break' after 'continue' in switch
11007 statements, since these cannot be reached.
11009 1999-12-13 Allan Rae <rae@lyx.org>
11011 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11012 (in_word_set): hash() -> math_hash()
11014 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11016 * acconfig.h: Added a test for whether we are using exceptions in the
11017 current compilation run. If so USING_EXCEPTIONS is defined.
11019 * config.in: Check for existance of stl_string_fwd.h
11020 * src/LString.h: If compiling --with-included-string and SGI's
11021 STL version 3.2 is present (see above test) we need to block their
11022 forward declaration of string and supply a __get_c_string().
11023 However, it turns out this is only necessary if compiling with
11024 exceptions enabled so I've a bit more to add yet.
11026 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11027 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11028 src/support/LRegex.h, src/undo.h:
11029 Shuffle the order of the included files a little to ensure that
11030 LString.h gets included before anything that includes stl_string_fwd.h
11032 * src/support/lyxstring.C: We need to #include LString.h instead of
11033 lyxstring.h to get the necessary definition of __get_c_string.
11034 (__get_c_string): New function. This is defined static just like SGI's
11035 although why they need to do this I'm not sure. Perhaps it should be
11036 in lstrings.C instead.
11038 * lib/templates/IEEEtran.lyx: New template file.
11040 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11042 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11043 * intl/Makefile.in (MKINSTALLDIRS): ditto
11045 * src/LyXAction.C (init): changed to hold the LFUN data in a
11046 automatic array in stead of in callso to newFunc, this speeds up
11047 compilation a lot. Also all the memory used by the array is
11048 returned when the init is completed.
11050 * a lot of files: compiled with -Wold-style-cast, changed most of
11051 the reported offenders to C++ style casts. Did not change the
11052 offenders in C files.
11054 * src/trans.h (Match): change argument type to unsigned int.
11056 * src/support/DebugStream.C: fix some types on the streambufs so
11057 that it works on a conforming implementation.
11059 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11061 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11063 * src/support/lyxstring.C: remove the inline added earlier since
11064 they cause a bunch of unsatisfied symbols when linking with dec
11065 cxx. Cxx likes to have the body of inlines at the place where they
11068 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11069 accessing negative bounds in array. This fixes the crash when
11070 inserting accented characters.
11071 * src/trans.h (Match): ditto
11073 * src/buffer.C (Dispatch): since this is a void, it should not try
11074 to return anything...
11076 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11078 * src/buffer.h: removed the two friends from Buffer. Some changes
11079 because of this. Buffer::getFileName and Buffer::setFileName
11080 renamed to Buffer::fileName() and Buffer::fileName(...).
11082 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11084 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11085 and Buffer::update(short) to BufferView. This move is currently
11086 controlled by a define MOVE_TEXT, this will be removed when all
11087 shows to be ok. This move paves the way for better separation
11088 between buffer contents and buffer view. One side effect is that
11089 the BufferView needs a rebreak when swiching buffers, if we want
11090 to avoid this we can add a cache that holds pointers to LyXText's
11091 that is not currently in use.
11093 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11096 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11098 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11100 * lyx_main.C: new command line option -x (or --execute) and
11101 -e (or --export). Now direct conversion from .lyx to .tex
11102 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11103 Unfortunately, X is still needed and the GUI pops up during the
11106 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11108 * src/Spacing.C: add a using directive to bring stream stuff into
11110 * src/paragraph.C: ditto
11111 * src/buffer.C: ditto
11113 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11114 from Lars' announcement).
11116 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11117 example files from Tino Meinen.
11119 1999-12-06 Allan Rae <rae@lyx.org>
11121 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11123 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11125 * src/support/lyxstring.C: added a lot of inline for no good
11128 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11129 latexWriteEndChanges, they were not used.
11131 * src/layout.h (operator<<): output operator for PageSides
11133 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11135 * some example files: loaded in LyX 1.0.4 and saved again to update
11136 certain constructs (table format)
11138 * a lot of files: did the change to use fstream/iostream for all
11139 writing of files. Done with a close look at Andre Poenitz's patch.
11141 * some files: whitespace changes.
11143 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11145 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11146 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11147 architecture, we provide our own. It is used unconditionnally, but
11148 I do not think this is a performance problem. Thanks to Angus
11149 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11150 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11152 (GetInset): use my_memcpy.
11156 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11157 it is easier to understand, but it uses less TeX-only constructs now.
11159 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11160 elements contain spaces
11162 * lib/configure: regenerated
11164 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11165 elements contain spaces; display the list of programs that are
11168 * autogen.sh: make sure lib/configure is executable
11170 * lib/examples/*: rename the tutorial examples to begin with the
11171 two-letters language code.
11173 * src/lyxfunc.C (getStatus): do not query current font if no
11176 * src/lyx_cb.C (RunScript): use QuoteName
11177 (MenuRunDvips): ditto
11178 (PrintApplyCB): ditto
11180 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11181 around argument, so that it works well with the current shell.
11182 Does not work properly with OS/2 shells currently.
11184 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11185 * src/LyXSendto.C (SendtoApplyCB): ditto
11186 * src/lyxfunc.C (Dispatch): ditto
11187 * src/buffer.C (runLaTeX): ditto
11188 (runLiterate): ditto
11189 (buildProgram): ditto
11191 * src/lyx_cb.C (RunScript): ditto
11192 (MenuMakeLaTeX): ditto
11194 * src/buffer.h (getLatexName): new method
11196 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11198 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11200 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11201 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11202 (create_math_panel): ditto
11204 * src/lyxfunc.C (getStatus): re-activate the code which gets
11205 current font and cursor; add test for export to html.
11207 * src/lyxrc.C (read): remove unreachable break statements; add a
11210 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11212 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11214 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11215 introduced by faulty regex.
11216 * src/buffer.C: ditto
11217 * src/lastfiles.C: ditto
11218 * src/paragraph.C: ditto
11219 * src/table.C: ditto
11220 * src/vspace.C: ditto
11221 * src/insets/figinset.C: ditto
11222 Note: most of these is absolutely harmless, except the one in
11223 src/mathed formula.C.
11225 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11227 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11228 operation, yielding correct results for the reLyX command.
11230 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11232 * src/support/filetools.C (ExpandPath): removed an over eager
11234 (ReplaceEnvironmentPath): ditto
11236 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11237 shows that we are doing something fishy in our code...
11238 (BubblePost): ditto
11241 * src/lyxrc.C (read): use a double switch trick to get more help
11242 from the compiler. (the same trick is used in layout.C)
11243 (write): new function. opens a ofstream and pass that to output
11244 (output): new function, takes a ostream and writes the lyxrc
11245 elemts to it. uses a dummy switch to make sure no elements are
11248 * src/lyxlex.h: added a struct pushpophelper for use in functions
11249 with more than one exit point.
11251 * src/lyxlex.[Ch] (GetInteger): made it const
11255 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11257 * src/layout.[hC] : LayoutTags splitted into several enums, new
11258 methods created, better error handling cleaner use of lyxlex. Read
11261 * src/bmtable.[Ch]: change some member prototypes because of the
11262 image const changes.
11264 * commandtags.h, src/LyXAction.C (init): new function:
11265 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11266 This file is not read automatically but you can add \input
11267 preferences to your lyxrc if you want to. We need to discuss how
11270 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11271 in .aux, also remove .bib and .bst files from dependencies when
11274 * src/BufferView.C, src/LyXView.C: add const_cast several places
11275 because of changes to images.
11277 * lib/images/*: same change as for images/*
11279 * lib/lyxrc.example: Default for accept_compound is false not no.
11281 * images/*: changed to be const, however I have som misgivings
11282 about this change so it might be changed back.
11284 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11286 * lib/configure, po/POTFILES.in: regenerated
11288 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11290 * config/lib_configure.m4: removed
11292 * lib/configure.m4: new file (was config/lib_configure.m4)
11294 * configure.in: do not test for rtti, since we do not use it.
11296 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11298 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11299 doubling of allocated space scheme. This makes it faster for large
11300 strings end to use less memory for small strings. xtra rememoved.
11302 * src/insets/figinset.C (waitalarm): commented out.
11303 (GhostscriptMsg): use static_cast
11304 (GhostscriptMsg): use new instead of malloc to allocate memory for
11305 cmap. also delete the memory after use.
11307 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11309 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11310 for changes in bibtex database or style.
11311 (runBibTeX): remove all .bib and .bst files from dep before we
11313 (run): use scanAuc in when dep file already exist.
11315 * src/DepTable.C (remove_files_with_extension): new method
11316 (exist): new method
11318 * src/DepTable.[Ch]: made many of the methods const.
11320 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11322 * src/bufferparams.C: make sure that the default textclass is
11323 "article". It used to be the first one by description order, but
11324 now the first one is "docbook".
11326 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11327 string; call Debug::value.
11328 (easyParse): pass complete argument to setDebuggingLevel().
11330 * src/debug.h (value): fix the code that parses debug levels.
11332 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11335 * src/LyXAction.C: use Debug::ACTION as debug channel.
11337 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11339 * NEWS: updated for the future 1.1.3 release.
11341 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11342 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11343 it should. This is of course a controversial change (since many
11344 people will find that their lyx workscreen is suddenly full of
11345 red), but done for the sake of correctness.
11347 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11348 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11350 * src/insets/inseterror.h, src/insets/inseturl.h,
11351 src/insets/insetinfo.h, src/insets/figinset.h,
11352 src/mathed/formulamacro.h, src/mathed/math_macro.h
11353 (EditMessage): add a missing const and add _() to make sure that
11354 translation happens
11356 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11357 src/insets/insetbib.C, src/support/filetools.C: add `using'
11358 directives for cxx.
11360 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11361 doing 'Insert index of last word' at the beginning of a paragraph.
11363 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11365 * several files: white-space changes.
11367 * src/mathed/formula.C: removed IsAlpha and IsDigit
11369 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11370 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11373 * src/insets/figinset.C (GetPSSizes): don't break when
11374 "EndComments" is seen. But break when a boundingbox is read.
11376 * all classes inherited from Inset: return value of Clone
11377 changed back to Inset *.
11379 * all classes inherited form MathInset: return value of Clone
11380 changed back to MathedInset *.
11382 * src/insets/figinset.C (runqueue): use a ofstream to output the
11383 gs/ps file. Might need some setpresicion or setw. However I can
11384 see no problem with the current code.
11385 (runqueue): use sleep instead of the alarm/signal code. I just
11386 can't see the difference.
11388 * src/paragraph.C (LyXParagraph): reserve space in the new
11389 paragraph and resize the inserted paragraph to just fit.
11391 * src/lyxfunc.h (operator|=): added operator for func_status.
11393 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11394 check for readable file.
11396 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11397 check for readable file.
11398 (MenuMakeLinuxDoc): ditto
11399 (MenuMakeDocBook): ditto
11400 (MenuMakeAscii): ditto
11401 (InsertAsciiFile): split the test for openable and readable
11403 * src/bmtable.C (draw_bitmaptable): use
11404 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11406 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11407 findtexfile from LaTeX to filetools.
11409 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11410 instead of FilePtr. Needs to be verified by a literate user.
11412 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11414 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11415 (EditMessage): likewise.
11417 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11418 respectively as \textasciitilde and \textasciicircum.
11420 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11422 * src/support/lyxstring.h: made the methods that take iterators
11423 use const_iterator.
11425 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11426 (regexMatch): made is use the real regex class.
11428 * src/support/Makefile.am: changed to use libtool
11430 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11432 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11434 (MathIsInset ++): changed several macros to be inline functions
11437 * src/mathed/Makefile.am: changed to use libtool
11439 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11441 * src/insets/inset* : Clone changed to const and return type is
11442 the true insettype not just Inset*.
11444 * src/insets/Makefile.am: changed to use libtool
11446 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11448 * src/undo.[Ch] : added empty() and changed some of the method
11451 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11453 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11454 setID use block<> for the bullets array, added const several places.
11456 * src/lyxfunc.C (getStatus): new function
11458 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11459 LyXAction, added const to several funtions.
11461 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11462 a std::map, and to store the dir items in a vector.
11464 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11467 * src/LyXView.[Ch] + other files : changed currentView to view.
11469 * src/LyXAction.[Ch] : ported from the old devel branch.
11471 * src/.cvsignore: added .libs and a.out
11473 * configure.in : changes to use libtool.
11475 * acinclude.m4 : inserted libtool.m4
11477 * .cvsignore: added libtool
11479 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11481 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11482 file name in insets and mathed directories (otherwise the
11483 dependency is not taken in account under cygwin).
11485 * src/text2.C (InsertString[AB]): make sure that we do not try to
11486 read characters past the string length.
11488 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11490 * lib/doc/LaTeXConfig.lyx.in,
11491 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11493 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11494 file saying who created them and when this heppened; this is
11495 useless and annoys tools like cvs.
11497 * lib/layouts/g-brief-{en,de}.layout,
11498 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11499 from Thomas Hartkens <thomas@hartkens.de>.
11501 * src/{insets,mathed}/Makefile.am: do not declare an empty
11502 LDFLAGS, so that it can be set at configure time (useful on Irix
11505 * lib/reLyX/configure.in: make sure that the prefix is set
11506 correctly in LYX_DIR.
11508 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11510 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11511 be used by 'command-sequence' this allows to bind a key to a
11512 sequence of LyX-commands
11513 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11515 * src/LyXAction.C: add "command-sequence"
11517 * src/LyXFunction.C: handling of "command-sequence"
11519 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11520 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11522 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11524 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11526 * src/buffer.C (writeFile): Do not output a comment giving user
11527 and date at the beginning of a .lyx file. This is useless and
11528 annoys cvs anyway; update version number to 1.1.
11530 * src/Makefile.am (LYX_DIR): add this definition, so that a
11531 default path is hardcoded in LyX.
11533 * configure.in: Use LYX_GNU_GETTEXT.
11535 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11536 AM_GNU_GETTEXT with a bug fixed.
11538 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11540 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11542 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11543 which is used to point to LyX data is now LYX_DIR_11x.
11545 * lyx.man: convert to a unix text file; small updates.
11547 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11549 * src/support/LSubstring.[Ch]: made the second arg of most of the
11550 constructors be a const reference.
11552 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11555 * src/support/lyxstring.[Ch] (swap): added missing member function
11556 and specialization of swap(str, str);
11558 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11560 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11561 trace of the old one.
11563 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11564 put the member definitions in undo.C.
11566 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11567 NEW_TEXT and have now only code that was included when this was
11570 * src/intl.C (LCombo): use static_cast
11572 (DispatchCallback): ditto
11574 * src/definitions.h: removed whole file
11576 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11578 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11579 parsing and stores in a std:map. a regex defines the file format.
11580 removed unneeded members.
11582 * src/bufferparams.h: added several enums from definitions.h here.
11583 Removed unsused destructor. Changed some types to use proper enum
11584 types. use block to have the temp_bullets and user_defined_bullets
11585 and to make the whole class assignable.
11587 * src/bufferparams.C (Copy): removed this functions, use a default
11588 assignment instead.
11590 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11593 * src/buffer.C (readLyXformat2): commend out all that have with
11594 oldpapersize to do. also comment out all that hve to do with
11595 insetlatex and insetlatexdel.
11596 (setOldPaperStuff): commented out
11598 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11600 * src/LyXAction.C: remove use of inset-latex-insert
11602 * src/mathed/math_panel.C (button_cb): use static_cast
11604 * src/insets/Makefile.am (insets_o_SOURCES): removed
11607 * src/support/lyxstring.C (helper): use the unsigned long
11608 specifier, UL, instead of a static_cast.
11610 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11612 * src/support/block.h: new file. to be used as a c-style array in
11613 classes, so that the class can be assignable.
11615 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11617 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11618 NULL, make sure to return an empty string (it is not possible to
11619 set a string to NULL).
11621 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11623 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11625 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11627 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11628 link line, so that Irix users (for example) can set it explicitely to
11631 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11632 it can be overidden at make time (static or dynamic link, for
11635 * src/vc-backend.C, src/LaTeXFeatures.h,
11636 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11637 statements to bring templates to global namespace.
11639 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11641 * src/support/lyxstring.C (operator[] const): make it standard
11644 * src/minibuffer.C (Init): changed to reflect that more
11645 information is given from the lyxvc and need not be provided here.
11647 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11649 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11651 * src/LyXView.C (UpdateTimerCB): use static_cast
11652 (KeyPressMask_raw_callback): ditto
11654 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11655 buffer_, a lot of changes because of this. currentBuffer() ->
11656 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11657 also changes to other files because of this.
11659 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11661 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11662 have no support for RCS and partial support for CVS, will be
11665 * src/insets/ several files: changes because of function name
11666 changes in Bufferview and LyXView.
11668 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11670 * src/support/LSubstring.[Ch]: new files. These implement a
11671 Substring that can be very convenient to use. i.e. is this
11673 string a = "Mary had a little sheep";
11674 Substring(a, "sheep") = "lamb";
11675 a is now "Mary has a little lamb".
11677 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11678 out patterns and subpatterns of strings. It is used by LSubstring
11679 and also by vc-backend.C
11681 * src/support/lyxstring.C: went over all the assertions used and
11682 tried to correct the wrong ones and flag which of them is required
11683 by the standard. some bugs found because of this. Also removed a
11684 couple of assertions.
11686 * src/support/Makefile.am (libsupport_a_SOURCES): added
11687 LSubstring.[Ch] and LRegex.[Ch]
11689 * src/support/FileInfo.h: have struct stat buf as an object and
11690 not a pointer to one, some changes because of this.
11692 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11693 information in layout when adding the layouts preamble to the
11694 textclass preamble.
11696 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11699 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11700 because of bug in OS/2.
11702 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11704 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11705 \verbatim@font instead of \ttfamily, so that it can be redefined.
11707 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11708 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11709 src/layout.h, src/text2.C: add 'using' directive to bring the
11710 STL templates we need from the std:: namespace to the global one.
11711 Needed by DEC cxx in strict ansi mode.
11713 * src/support/LIstream.h,src/support/LOstream.h,
11714 src/support/lyxstring.h,src/table.h,
11715 src/lyxlookup.h: do not include <config.h> in header
11716 files. This should be done in the .C files only.
11718 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11722 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11724 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11725 from Kayvan to fix the tth invokation.
11727 * development/lyx.spec.in: updates from Kayvan to reflect the
11728 changes of file names.
11730 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11732 * src/text2.C (InsertStringB): use std::copy
11733 (InsertStringA): use std::copy
11735 * src/bufferlist.C: use a vector to store the buffers in. This is
11736 an internal change and should not affect any other thing.
11738 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11741 * src/text.C (Fill): fix potential bug, one off bug.
11743 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11745 * src/Makefile.am (lyx_main.o): add more files it depends on.
11747 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11749 * src/support/lyxstring.C: use size_t for the reference count,
11750 size, reserved memory and xtra.
11751 (internal_compare): new private member function. Now the compare
11752 functions should work for std::strings that have embedded '\0'
11754 (compare): all compare functions rewritten to use
11757 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11759 * src/support/lyxstring.C (compare): pass c_str()
11760 (compare): pass c_str
11761 (compare): pass c_str
11763 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11765 * src/support/DebugStream.C: <config.h> was not included correctly.
11767 * lib/configure: forgot to re-generate it :( I'll make this file
11768 auto generated soon.
11770 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11772 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11775 * src/support/lyxstring.C: some changes from length() to rep->sz.
11776 avoids a function call.
11778 * src/support/filetools.C (SpaceLess): yet another version of the
11779 algorithm...now per Jean-Marc's suggestions.
11781 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11783 * src/layout.C (less_textclass_desc): functor for use in sorting
11785 (LyXTextClass::Read): sort the textclasses after reading.
11787 * src/support/filetools.C (SpaceLess): new version of the
11788 SpaceLess functions. What problems does this one give? Please
11791 * images/banner_bw.xbm: made the arrays unsigned char *
11793 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11795 * src/support/lyxstring.C (find): remove bogus assertion in the
11796 two versions of find where this has not been done yet.
11798 * src/support/lyxlib.h: add missing int return type to
11801 * src/menus.C (ShowFileMenu): disable exporting to html if no
11802 html export command is present.
11804 * config/lib_configure.m4: add a test for an HTML converter. The
11805 programs checked for are, in this order: tth, latex2html and
11808 * lib/configure: generated from config/lib_configure.m4.
11810 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11811 html converter. The parameters are now passed through $$FName and
11812 $$OutName, instead of standard input/output.
11814 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11816 * lib/lyxrc.example: update description of \html_command.
11817 add "quotes" around \screen_font_xxx font setting examples to help
11818 people who use fonts with spaces in their names.
11820 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11822 * Distribution files: updates for v1.1.2
11824 * src/support/lyxstring.C (find): remove bogus assert and return
11825 npos for the same condition.
11827 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11829 * added patch for OS/2 from SMiyata.
11831 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11833 * src/text2.C (CutSelection): make space_wrapped a bool
11834 (CutSelection): dont declare int i until we have to.
11835 (alphaCounter): return a char const *.
11837 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11839 * src/support/syscall.C (Systemcalls::kill):
11840 src/support/filetools.C (PutEnv, PutEnvPath):
11841 src/lyx_cb.C (addNewlineAndDepth):
11842 src/FontInfo.C (FontInfo::resize): condition some #warning
11843 directives with WITH_WARNINGS.
11846 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11848 * src/layout.[Ch] + several files: access to class variables
11849 limited and made accessor functions instead a lot of code changed
11850 becuase of this. Also instead of returning pointers often a const
11851 reference is returned instead.
11853 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11855 * src/Makefile.am (dist-hook): added used to remove the CVS from
11856 cheaders upon creating a dist
11857 (EXTRA_DIST): added cheaders
11859 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11860 a character not as a small integer.
11862 * src/support/lyxstring.C (find): removed Assert and added i >=
11863 rep->sz to the first if.
11865 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11867 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11868 src/LyXView.C src/buffer.C src/bufferparams.C
11869 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11870 src/text2.C src/insets/insetinclude.C:
11871 lyxlayout renamed to textclasslist.
11873 * src/layout.C: some lyxerr changes.
11875 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11876 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11877 (LyXLayoutList): removed all traces of this class.
11878 (LyXTextClass::Read): rewrote LT_STYLE
11879 (LyXTextClass::hasLayout): new function
11880 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11881 both const and nonconst version.
11882 (LyXTextClass::delete_layout): new function.
11883 (LyXTextClassList::Style): bug fix. do the right thing if layout
11885 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11886 (LyXTextClassList::NameOfLayout): ditto
11887 (LyXTextClassList::Load): ditto
11889 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11891 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11893 * src/LyXAction.C (LookupFunc): added a workaround for sun
11894 compiler, on the other hand...we don't know if the current code
11895 compiles on sun at all...
11897 * src/support/filetools.C (CleanupPath): subst fix
11899 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11902 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11903 complained about this one?
11905 * src/insets/insetinclude.C (Latex): subst fix
11907 * src/insets/insetbib.C (getKeys): subst fix
11909 * src/LyXSendto.C (SendtoApplyCB): subst fix
11911 * src/lyx_main.C (init): subst fix
11913 * src/layout.C (Read): subst fix
11915 * src/lyx_sendfax_main.C (button_send): subst fix
11917 * src/buffer.C (RoffAsciiTable): subst fix
11919 * src/lyx_cb.C (MenuFax): subst fix
11920 (PrintApplyCB): subst fix
11922 1999-10-26 Juergen Vigna <jug@sad.it>
11924 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11926 (Read): Cleaned up this code so now we read only format vestion >= 5
11928 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11930 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11931 come nobody has complained about this one?
11933 * src/insets/insetinclude.C (Latex): subst fix
11935 * src/insets/insetbib.C (getKeys): subst fix
11937 * src/lyx_main.C (init): subst fix
11939 * src/layout.C (Read): subst fix
11941 * src/buffer.C (RoffAsciiTable): subst fix
11943 * src/lyx_cb.C (MenuFax): subst fix.
11945 * src/layout.[hC] + some other files: rewrote to use
11946 std::container to store textclasses and layouts in.
11947 Simplified, removed a lot of code. Make all classes
11948 assignable. Further simplifications and review of type
11949 use still to be one.
11951 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11952 lastfiles to create the lastfiles partr of the menu.
11954 * src/lastfiles.[Ch]: rewritten to use deque to store the
11955 lastfiles in. Uses fstream for reading and writing. Simplifies
11958 * src/support/syscall.C: remove explicit cast.
11960 * src/BufferView.C (CursorToggleCB): removed code snippets that
11961 were commented out.
11962 use explicat C++ style casts instead of C style casts. also use
11963 u_vdata instea of passing pointers in longs.
11965 * src/PaperLayout.C: removed code snippets that were commented out.
11967 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11969 * src/lyx_main.C: removed code snippets that wer commented out.
11971 * src/paragraph.C: removed code snippets that were commented out.
11973 * src/lyxvc.C (logClose): use static_cast
11975 (viewLog): remove explicit cast to void*
11976 (showLog): removed old commented code
11978 * src/menus.C: use static_cast instead of C style casts. use
11979 u_vdata instead of u_ldata. remove explicit cast to (long) for
11980 pointers. Removed old code that was commented out.
11982 * src/insets/inset.C: removed old commented func
11984 * src/insets/insetref.C (InsetRef): removed old code that had been
11985 commented out for a long time.
11987 (escape): removed C style cast
11989 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11991 * src/insets/insetlatex.C (Draw): removed old commented code
11992 (Read): rewritten to use string
11994 * src/insets/insetlabel.C (escape): removed C style cast
11996 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11998 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11999 old commented code.
12001 * src/insets/insetinclude.h: removed a couple of stupid bools
12003 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12004 (Clone): remove C style cast
12005 (getKeys): changed list to lst because of std::list
12007 * src/insets/inseterror.C (Draw): removed som old commented code.
12009 * src/insets/insetcommand.C (Draw): removed some old commented code.
12011 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12012 commented out forever.
12013 (bibitem_cb): use static_cast instead of C style cast
12014 use of vdata changed to u_vdata.
12016 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12018 (CloseUrlCB): use static_cast instead of C style cast.
12019 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12021 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12022 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12023 (CloseInfoCB): static_cast from ob->u_vdata instead.
12024 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12027 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12028 (C_InsetError_CloseErrorCB): forward the ob parameter
12029 (CloseErrorCB): static_cast from ob->u_vdata instead.
12031 * src/vspace.h: include LString.h since we use string in this class.
12033 * src/vspace.C (lyx_advance): changed name from advance because of
12034 nameclash with stl. And since we cannot use namespaces yet...I
12035 used a lyx_ prefix instead. Expect this to change when we begin
12038 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12040 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12041 and removed now defunct constructor and deconstructor.
12043 * src/BufferView.h: have backstack as a object not as a pointer.
12044 removed initialization from constructor. added include for BackStack
12046 * development/lyx.spec.in (%build): add CFLAGS also.
12048 * src/screen.C (drawFrame): removed another warning.
12050 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12052 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12053 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12054 README and ANNOUNCE a bit for the next release. More work is
12057 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12058 unbreakable if we are in freespacing mode (LyX-Code), but not in
12061 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12063 * src/BackStack.h: fixed initialization order in constructor
12065 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12067 * acinclude.m4 (VERSION): new rules for when a version is
12068 development, added also a variable for prerelease.
12069 (warnings): we set with_warnings=yes for prereleases
12070 (lyx_opt): prereleases compile with same optimization as development
12071 (CXXFLAGS): only use pedantic if we are a development version
12073 * src/BufferView.C (restorePosition): don't do anything if the
12074 backstack is empty.
12076 * src/BackStack.h: added member empty, use this to test if there
12077 is anything to pop...
12079 1999-10-25 Juergen Vigna <jug@sad.it>
12082 * forms/layout_forms.fd +
12083 * forms/latexoptions.fd +
12084 * lyx.fd: changed for various form resize issues
12086 * src/mathed/math_panel.C +
12087 * src/insets/inseterror.C +
12088 * src/insets/insetinfo.C +
12089 * src/insets/inseturl.C +
12090 * src/insets/inseturl.h +
12092 * src/LyXSendto.C +
12093 * src/PaperLayout.C +
12094 * src/ParagraphExtra.C +
12095 * src/TableLayout.C +
12097 * src/layout_forms.C +
12104 * src/menus.C: fixed various resize issues. So now forms can be
12105 resized savely or not be resized at all.
12107 * forms/form_url.fd +
12108 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12111 * src/insets/Makefile.am: added files form_url.[Ch]
12113 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12115 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12116 (and presumably 6.2).
12118 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12119 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12120 remaining static member callbacks.
12122 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12125 * src/support/lyxstring.h: declare struct Srep as friend of
12126 lyxstring, since DEC cxx complains otherwise.
12128 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12130 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12132 * src/LaTeX.C (run): made run_bibtex also depend on files with
12134 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12135 are put into the dependency file.
12137 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12138 the code has shown itself to work
12139 (create_ispell_pipe): removed another warning, added a comment
12142 * src/minibuffer.C (ExecutingCB): removed code that has been
12143 commented out a long time
12145 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12146 out code + a warning.
12148 * src/support/lyxstring.h: comment out the three private
12149 operators, when compiling with string ansi conforming compilers
12150 they make problems.
12152 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12154 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12155 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12158 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12161 * src/mathed/math_panel.C (create_math_panel): remove explicit
12164 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12167 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12168 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12169 to XCreatePixmapFromBitmapData
12170 (fl_set_bmtable_data): change the last argument to be unsigned
12172 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12173 and bh to be unsigned int, remove explicit casts in call to
12174 XReadBitmapFileData.
12176 * images/arrows.xbm: made the arrays unsigned char *
12177 * images/varsz.xbm: ditto
12178 * images/misc.xbm: ditto
12179 * images/greek.xbm: ditto
12180 * images/dots.xbm: ditto
12181 * images/brel.xbm: ditto
12182 * images/bop.xbm: ditto
12184 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12186 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12187 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12188 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12190 (LYX_CXX_CHEADERS): added <clocale> to the test.
12192 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12194 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12196 * src/support/lyxstring.C (append): fixed something that must be a
12197 bug, rep->assign was used instead of rep->append.
12199 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12202 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12203 lyx insert double chars. Fix spotted by Kayvan.
12205 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12207 * Fixed the tth support. I messed up with the Emacs patch apply feature
12208 and omitted the changes in lyxrc.C.
12210 1999-10-22 Juergen Vigna <jug@sad.it>
12212 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12214 * src/lyx_cb.C (MenuInsertRef) +
12215 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12216 the form cannot be resized under it limits (fixes a segfault)
12218 * src/lyx.C (create_form_form_ref) +
12219 * forms/lyx.fd: Changed Gravity on name input field so that it is
12222 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12224 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12225 <ostream> and <istream>.
12227 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12228 whether <fstream> provides the latest standard features, or if we
12229 have an oldstyle library (like in egcs).
12230 (LYX_CXX_STL_STRING): fix the test.
12232 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12233 code on MODERN_STL_STREAM.
12235 * src/support/lyxstring.h: use L{I,O}stream.h.
12237 * src/support/L{I,O}stream.h: new files, designed to setup
12238 correctly streams for our use
12239 - includes the right header depending on STL capabilities
12240 - puts std::ostream and std::endl (for LOStream.h) or
12241 std::istream (LIStream.h) in toplevel namespace.
12243 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12245 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12246 was a bib file that had been changed we ensure that bibtex is run.
12247 (runBibTeX): enhanced to extract the names of the bib files and
12248 getting their absolute path and enter them into the dep file.
12249 (findtexfile): static func that is used to look for tex-files,
12250 checks for absolute patchs and tries also with kpsewhich.
12251 Alternative ways of finding the correct files are wanted. Will
12253 (do_popen): function that runs a command using popen and returns
12254 the whole output of that command in a string. Should be moved to
12257 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12258 file with extension ext has changed.
12260 * src/insets/figinset.C: added ifdef guards around the fl_free
12261 code that jug commented out. Now it is commented out when
12262 compiling with XForms == 0.89.
12264 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12265 to lyxstring.C, and only keep a forward declaration in
12266 lyxstring.h. Simplifies the header file a bit and should help a
12267 bit on compile time too. Also changes to Srep will not mandate a
12268 recompile of code just using string.
12269 (~lyxstring): definition moved here since it uses srep.
12270 (size): definition moved here since it uses srep.
12272 * src/support/lyxstring.h: removed a couple of "inline" that should
12275 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12277 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12280 1999-10-21 Juergen Vigna <jug@sad.it>
12282 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12283 set to left if I just remove the width entry (or it is empty).
12285 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12286 paragraph when having dummy paragraphs.
12288 1999-10-20 Juergen Vigna <jug@sad.it>
12290 * src/insets/figinset.C: just commented some fl_free_form calls
12291 and added warnings so that this calls should be activated later
12292 again. This avoids for now a segfault, but we have a memory leak!
12294 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12295 'const char * argument' to 'string argument', this should
12296 fix some Asserts() in lyxstring.C.
12298 * src/lyxfunc.h: Removed the function argAsString(const char *)
12299 as it is not used anymore.
12301 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12303 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12306 * src/Literate.h: some funcs moved from public to private to make
12307 interface clearer. Unneeded args removed.
12309 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12311 (scanBuildLogFile): ditto
12313 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12314 normal TeX Error. Still room for improvement.
12316 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12318 * src/buffer.C (insertErrors): changes to make the error
12319 desctription show properly.
12321 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12324 * src/support/lyxstring.C (helper): changed to use
12325 sizeof(object->rep->ref).
12326 (operator>>): changed to use a pointer instead.
12328 * src/support/lyxstring.h: changed const reference & to value_type
12329 const & lets see if that helps.
12331 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12333 * Makefile.am (rpmdist): fixed to have non static package and
12336 * src/support/lyxstring.C: removed the compilation guards
12338 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12341 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12342 conditional compile of lyxstring.Ch
12344 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12345 stupid check, but it is a lot better than the bastring hack.
12346 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12348 * several files: changed string::erase into string::clear. Not
12351 * src/chset.C (encodeString): use a char temporary instead
12353 * src/table.C (TexEndOfCell): added tostr around
12354 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12355 (TexEndOfCell): ditto
12356 (TexEndOfCell): ditto
12357 (TexEndOfCell): ditto
12358 (DocBookEndOfCell): ditto
12359 (DocBookEndOfCell): ditto
12360 (DocBookEndOfCell): ditto
12361 (DocBookEndOfCell): ditto
12363 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12365 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12367 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12368 (MenuBuildProg): added tostr around ret
12369 (MenuRunChktex): added tostr around ret
12370 (DocumentApplyCB): added tostr around ret
12372 * src/chset.C (encodeString): added tostr around t->ic
12374 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12375 (makeLaTeXFile): added tostr around tocdepth
12376 (makeLaTeXFile): added tostr around ftcound - 1
12378 * src/insets/insetbib.C (setCounter): added tostr around counter.
12380 * src/support/lyxstring.h: added an operator+=(int) to catch more
12383 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12384 (lyxstring): We DON'T allow NULL pointers.
12386 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12388 * src/mathed/math_macro.C (MathMacroArgument::Write,
12389 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12390 when writing them out.
12392 * src/LString.C: remove, since it is not used anymore.
12394 * src/support/lyxstring.C: condition the content to
12395 USE_INCLUDED_STRING macro.
12397 * src/mathed/math_symbols.C, src/support/lstrings.C,
12398 src/support/lyxstring.C: add `using' directive to specify what
12399 we need in <algorithm>. I do not think that we need to
12400 conditionalize this, but any thought is appreciated.
12402 * many files: change all callback functions to "C" linkage
12403 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12404 strict_ansi. Those who were static are now global.
12405 The case of callbacks which are static class members is
12406 trickier, since we have to make C wrappers around them (see
12407 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12408 did not finish this yet, since it defeats the purpose of
12409 encapsulation, and I am not sure what the best route is.
12411 1999-10-19 Juergen Vigna <jug@sad.it>
12413 * src/support/lyxstring.C (lyxstring): we permit to have a null
12414 pointer as assignment value and just don't assign it.
12416 * src/vspace.C (nextToken): corrected this function substituting
12417 find_first(_not)_of with find_last_of.
12419 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12420 (TableOptCloseCB) (TableSpeCloseCB):
12421 inserted fl_set_focus call for problem with fl_hide_form() in
12424 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12426 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12429 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12431 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12432 LyXLex::next() and not eatline() to get its argument.
12434 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12436 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12437 instead, use fstreams for io of the depfile, removed unneeded
12438 functions and variables.
12440 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12441 vector instead, removed all functions and variables that is not in
12444 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12446 * src/buffer.C (insertErrors): use new interface to TeXError
12448 * Makefile.am (rpmdist): added a rpmdist target
12450 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12451 per Kayvan's instructions.
12453 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12455 * src/Makefile.am: add a definition for localedir, so that locales
12456 are found after installation (Kayvan)
12458 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12460 * development/.cvsignore: new file.
12462 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12464 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12465 C++ compiler provides wrappers for C headers and use our alternate
12468 * configure.in: use LYX_CXX_CHEADERS.
12470 * src/cheader/: new directory, populated with cname headers from
12471 libstdc++-2.8.1. They are a bit old, but probably good enough for
12472 what we want (support compilers who lack them).
12474 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12475 from includes. It turns out is was stupid.
12477 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12479 * lib/Makefile.am (install-data-local): forgot a ';'
12480 (install-data-local): forgot a '\'
12481 (libinstalldirs): needed after all. reintroduced.
12483 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12485 * configure.in (AC_OUTPUT): added lyx.spec
12487 * development/lyx.spec: removed file
12489 * development/lyx.spec.in: new file
12491 * po/*.po: merged with lyx.pot becuase of make distcheck
12493 * lib/Makefile.am (dist-hook): added dist-hook so that
12494 documentation files will be included when doing a make
12495 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12496 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12498 more: tried to make install do the right thing, exclude CVS dirs
12501 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12502 Path would fit in more nicely.
12504 * all files that used to use pathstack: uses now Path instead.
12505 This change was a lot easier than expected.
12507 * src/support/path.h: new file
12509 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12511 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12513 * src/support/lyxstring.C (getline): Default arg was given for
12516 * Configure.cmd: removed file
12518 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12520 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12521 streams classes and types, add the proper 'using' statements when
12522 MODERN_STL is defined.
12524 * src/debug.h: move the << operator definition after the inclusion
12527 * src/support/filetools.C: include "LAssert.h", which is needed
12530 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12533 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12534 include "debug.h" to define a proper ostream.
12536 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12538 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12539 method to the SystemCall class which can kill a process, but it's
12540 not fully implemented yet.
12542 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12544 * src/support/FileInfo.h: Better documentation
12546 * src/lyxfunc.C: Added support for buffer-export html
12548 * src/menus.C: Added Export->As HTML...
12550 * lib/bind/*.bind: Added short-cut for buffer-export html
12552 * src/lyxrc.*: Added support for new \tth_command
12554 * lib/lyxrc.example: Added stuff for new \tth_command
12556 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12558 * lib/Makefile.am (IMAGES): removed images/README
12559 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12560 installes in correct place. Check permisions is installed
12563 * src/LaTeX.C: some no-op changes moved declaration of some
12566 * src/LaTeX.h (LATEX_H): changed include guard name
12568 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12570 * lib/reLyX/Makefile.am: install noweb2lyx.
12572 * lib/Makefile.am: install configure.
12574 * lib/reLyX/configure.in: declare a config aux dir; set package
12575 name to lyx (not sure what the best solution is); generate noweb2lyx.
12577 * lib/layouts/egs.layout: fix the bibliography layout.
12579 1999-10-08 Jürgen Vigna <jug@sad.it>
12581 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12582 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12583 it returned without continuing to search the path.
12585 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12587 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12588 also fixes a bug. It is not allowed to do tricks with std::strings
12589 like: string a("hei"); &a[e]; this will not give what you
12590 think... Any reason for the complexity in this func?
12592 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12594 * Updated README and INSTALL a bit, mostly to check that my
12595 CVS rights are correctly set up.
12597 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12599 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12600 does not allow '\0' chars but lyxstring and std::string does.
12602 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12604 * autogen.sh (AUTOCONF): let the autogen script create the
12605 POTFILES.in file too. POTFILES.in should perhaps now not be
12606 included in the cvs module.
12608 * some more files changed to use C++ includes instead of C ones.
12610 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12612 (Reread): added tostr to nlink. buggy output otherwise.
12613 (Reread): added a string() around szMode when assigning to Buffer,
12614 without this I got a log of garbled info strings.
12616 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12619 * I have added several ostream & operator<<(ostream &, some_type)
12620 functions. This has been done to avoid casting and warnings when
12621 outputting enums to lyxerr. This as thus eliminated a lot of
12622 explicit casts and has made the code clearer. Among the enums
12623 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12624 mathed enums, some font enum the Debug::type enum.
12626 * src/support/lyxstring.h (clear): missing method. equivalent of
12629 * all files that contained "stderr": rewrote constructs that used
12630 stderr to use lyxerr instead. (except bmtable)
12632 * src/support/DebugStream.h (level): and the passed t with
12633 Debug::ANY to avoid spurious bits set.
12635 * src/debug.h (Debug::type value): made it accept strings of the
12636 type INFO,INIT,KEY.
12638 * configure.in (Check for programs): Added a check for kpsewhich,
12639 the latex generation will use this later to better the dicovery of
12642 * src/BufferView.C (create_view): we don't need to cast this to
12643 (void*) that is done automatically.
12644 (WorkAreaButtonPress): removed some dead code.
12646 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12648 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12649 is not overwritten when translated (David Sua'rez de Lis).
12651 * lib/CREDITS: Added David Sua'rez de Lis
12653 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12655 * src/bufferparams.C (BufferParams): default input encoding is now
12658 * acinclude.m4 (cross_compiling): comment out macro
12659 LYX_GXX_STRENGTH_REDUCE.
12661 * acconfig.h: make sure that const is not defined (to empty) when
12662 we are compiling C++. Remove commented out code using SIZEOF_xx
12665 * configure.in : move the test for const and inline as late as
12666 possible so that these C tests do not interefere with C++ ones.
12667 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12668 has not been proven.
12670 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12672 * src/table.C (getDocBookAlign): remove bad default value for
12673 isColumn parameter.
12675 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12677 (ShowFileMenu2): ditto.
12679 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12680 of files to ignore.
12682 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12684 * Most files: finished the change from the old error code to use
12685 DebugStream for all lyxerr debugging. Only minor changes remain
12686 (e.g. the setting of debug levels using strings instead of number)
12688 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12690 * src/layout.C (Add): Changed to use compare_no_case instead of
12693 * src/FontInfo.C: changed loop variable type too string::size_type.
12695 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12697 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12698 set ETAGS_ARGS to --c++
12700 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12702 * src/table.C (DocBookEndOfCell): commented out two unused variables
12704 * src/paragraph.C: commented out four unused variables.
12706 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12707 insed a if clause with type string::size_type.
12709 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12712 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12714 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12715 variable, also changed loop to go from 0 to lenght + 1, instead of
12716 -1 to length. This should be correct.
12718 * src/LaTeX.C (scanError): use string::size_type as loop variable
12721 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12722 (l.896) since y_tmp and row was not used anyway.
12724 * src/insets/insetref.C (escape): use string::size_type as loop
12727 * src/insets/insetquotes.C (Width): use string::size_type as loop
12729 (Draw): use string::size_type as loop variable type.
12731 * src/insets/insetlatexaccent.C (checkContents): use
12732 string::size_type as loop variable type.
12734 * src/insets/insetlabel.C (escape): use string::size_type as loop
12737 * src/insets/insetinfo.C: added an extern for current_view.
12739 * src/insets/insetcommand.C (scanCommand): use string::size_type
12740 as loop variable type.
12742 * most files: removed the RCS tags. With them we had to recompile
12743 a lot of files after a simple cvs commit. Also we have never used
12744 them for anything meaningful.
12746 * most files: tags-query-replace NULL 0. As adviced several plases
12747 we now use "0" instead of "NULL" in our code.
12749 * src/support/filetools.C (SpaceLess): use string::size_type as
12750 loop variable type.
12752 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12754 * src/paragraph.C: fixed up some more string stuff.
12756 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12758 * src/support/filetools.h: make modestr a std::string.
12760 * src/filetools.C (GetEnv): made ch really const.
12762 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12763 made code that used these use max/min from <algorithm> instead.
12765 * changed several c library include files to their equivalent c++
12766 library include files. All is not changed yet.
12768 * created a support subdir in src, put lyxstring and lstrings
12769 there + the extra files atexit, fileblock, strerror. Created
12770 Makefile.am. edited configure.in and src/Makefile.am to use this
12771 new subdir. More files moved to support.
12773 * imported som of the functions from repository lyx, filetools
12775 * ran tags-query-replace on LString -> string, corrected the bogus
12776 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12777 is still some errors in there. This is errors where too much or
12778 too litle get deleted from strings (string::erase, string::substr,
12779 string::replace), there can also be some off by one errors, or
12780 just plain wrong use of functions from lstrings. Viewing of quotes
12783 * LyX is now running fairly well with string, but there are
12784 certainly some bugs yet (see above) also string is quite different
12785 from LString among others in that it does not allow null pointers
12786 passed in and will abort if it gets any.
12788 * Added the revtex4 files I forgot when setting up the repository.
12790 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12792 * All over: Tried to clean everything up so that only the files
12793 that we really need are included in the cvs repository.
12794 * Switched to use automake.
12795 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12796 * Install has not been checked.
12798 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12800 * po/pt.po: Three errors:
12801 l.533 and l.538 format specification error
12802 l. 402 duplicate entry, I just deleted it.