1 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * configure.in: fix typo
5 * lib/languages: add ukraninian and change no to no_NO
7 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
9 * src/bufferview_funcs.C (FontSize): use setLyXSize
11 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
13 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
14 to check for systems where mkstemp() is available but not declared
15 in headers. The new autoconf macro lyx_CHECK_DECL can be used
16 to check for declarations in headers.
18 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
20 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
22 * forms/makefile: added bibforms.fd, include_form.fd.
23 Removed lyx_sendfax.fd.
25 * src/LaTeXLog.C (ShowLatexLog):
26 * src/LyXAction.C (init):
27 * src/bufferparams.C (readLanguage): altered messages as suggested by
30 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
33 * src/credits.C: made fd_form_credits non-static, so that it can be
34 redrawn should the xforms colors be re-mapped.
35 * src/spellchecker.C ditto fd_form_spell_options.
37 * src/filedlg.[Ch] (redraw):
38 * src/intl.[Ch] (redraw):
39 * src/lyxfr0.[Ch] (redraw):
40 * src/insets/figinset.[Ch] (redraw):
41 * src/insets/insetexternal.[Ch] (redraw):
42 new methods, connected to Dialogs::redrawGUI.
44 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
45 to be connected to Dialogs::redrawGUI.
47 * src/frontends/xforms/FormCitation.C (build):
48 * src/frontends/xforms/FormCopyright.C (build):
49 * src/frontends/xforms/FormError.C (build):
50 * src/frontends/xforms/FormGraphics.C (build):
51 * src/frontends/xforms/FormIndex.C (build):
52 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
53 * src/frontends/xforms/FormToc.C (build):
54 * src/frontends/xforms/FormUrl.C (build):
55 use the ButtonController correctly.
57 * src/frontends/xforms/FormCopyright.C (build):
58 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
59 the .fd file and into build().
61 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
63 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
65 * src/frontends/xforms/forms/form_citation.fd:
66 * src/frontends/xforms/forms/form_copyright.fd:
67 * src/frontends/xforms/forms/form_error.fd:
68 * src/frontends/xforms/forms/form_graphics.fd:
69 * src/frontends/xforms/forms/form_index.fd:
70 * src/frontends/xforms/forms/form_toc.fd:
71 * src/frontends/xforms/forms/form_url.fd:
72 renamed some of the objects. Named others explicitly for the first time.
73 Added Restore and Apply buttons where appropriate.
75 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
78 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
80 * src/version.h: try the pre2 again
82 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
84 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
86 * src/frontends/kde/FormParagraph.C: added using directive.
88 * src/frontends/kde/paradlg.C: added config.h and using directive.
90 * src/frontends/kde/paradlg.h: added std::qualifier.
92 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
94 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
96 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
98 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
100 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
102 * src/version.h: set back to 1.1.6cvs
104 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
106 * src/version.h: set to 1.1.6pre2
108 2000-11-20 Marko Vendelin <markov@ioc.ee>
110 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
112 * src/frontends/gnome/Makefile.am: updated list of XForms object files
114 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
116 * src/LColor.C (init):
117 * src/lyxrc.C (getDescription): changed some comments as suggested by
120 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
121 disconnect the redrawGUI signal in best-practice fashion.
123 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
124 long_opts_tab to reflect the change in name of this tabfolder, as
125 suggested by John Levon.
126 (connect, disconnect): new methods. Don't do much at present other than
127 ensuring that we can't resize the dialog. This just makes xforms go
129 (lots of methods in Colors): made void rather than bool. The idea is
130 to have an isOk() function that keeps track of whether any input is
131 genuinely invalid and should therefore block Save, Apply.
132 Easier to manipulate the counters rapidly.
133 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
134 compiler will like this code. Much cleaner way of doing things.
136 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
138 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
139 rather than simple counters, following suggestion by John Levon.
141 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
142 than engraved frame + text.
144 * src/frontends/xforms/forms/makefile: removed spurious command.
146 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
148 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
150 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
153 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
155 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
156 see what Lars has changed and what is just white space!
157 Now used X directly to ascertain the RGB color associated with the
159 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
161 Added some sort capability.
162 The X11 color name database input is only displayed if the database
163 isn't found in the standard place.
164 Got rid of struct compare_converter; it wasn't used.
165 Probably some other stuff that I've forgotten.
167 * src/frontends/xforms/FormPreferences.h: changed the names of some
168 methods in the Colors struct. Added a couple of structs to help sort
169 colors by name and by RGBColor.
171 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
172 functions into a new class RWInfo.
174 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
175 The dialog is now almost navigable using the keyboard. Unfortunately,
176 the cursor has to be inside a browser for it to be activated. There is
177 no visual feedback for the key shortcuts to the arrow keys (use
178 Alt-appropriate arrow key, Alt-x).
180 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
183 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
184 xform_helpers.[Ch]. See above.
186 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
188 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
190 * src/screen.C (setCursorColor): new method. Sets the color of the
192 (ShowManualCursor): call it.
193 Constify some local variables.
195 * src/LColor.[Ch] (LColor): add entry for cursor
196 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
199 2000-11-19 Juergen Vigna <jug@sad.it>
201 * src/insets/insettabular.C (draw): fixed text border redraw problem.
202 (calculate_dimensions_of_cells): try to boost up when inserting chars.
204 2000-11-15 Rob Lahaye <lahaye@postech.edu>
206 * lib/ui/default.ui: OptItem used for Fax entry
208 2000-11-17 Matej Cepl <cepl@bigfoot.com>
210 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
212 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
214 * src/vspace.C (nextToken): fix so it can handle length phrases like
215 "10mm+-20mm", "40inplus16mmminus10cm" etc.
217 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
219 * src/frontends/xforms/FormPreferences.C: constify several variables
220 (BrowserLyX): rewrite to not need the choice variable
221 (Modify): rewrite to not need the choide variable
222 (compare_converter): make operator const
224 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
225 correct the writing of \set_color
226 (getDescription): return a const string
228 * src/kbsequence.[Ch] (addkey): remove dead code
230 * src/Painter.C (text): remove some commented code
232 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
234 * src/ColorHandler.[Ch]: removed some header files from .h file.
235 Included LColor.h in .C file.
237 * src/LColor.[Ch]: made class copyable so that I could create a
238 system_lcolor instance.
240 * src/Painter.h: removed LColor.h.
242 * src/lyx_gui.C (create_forms): used AddName.
244 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
245 of user preferences/lyxrc file.
247 * src/lyxrc.C (output): output changes to lcolor.
249 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
251 Moved class xformColor to files xform_helpers.[Ch]. These files,
252 Color.[Ch], could now be moved into src if they would be useful to
255 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
256 Also moved FormPreferences::browseFile here as it can be used by any
257 xform dialog with a "Browse" button. FormGraphics is a perfect example.
259 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
260 ReadableFile): changed the FormPreferences methods a little and moved
261 them here as they'll be useful elsewhere also.
263 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
264 Removed some header files and used forward declarations instead.
266 Removed some methods as they'll be useful elsewhere (see above).
268 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
269 Can also now modify the LyX LColors. However, for reasons that I don't
270 yet understand, it appears that we can use
271 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
272 present. The problem appears to lie in ColorHandler, because I can
273 change the color using LColor.SetColor(). Similarly, when reading in a
274 preferences file with some set_color instances, I'll get a warning
275 like: Color sea green is undefined or may not be redefined
276 Bad lyxrc set_color for sea green
278 Once the buffer is loaded, however, I can happily change to this color.
280 Finally, it appears that I have to set the color of "inset frame"
281 explicitly, or it oscillates from "black" to "indian red" with each
284 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
286 * ANNOUNCE: corrected a spelling mistake.
288 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
291 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
293 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
295 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
298 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
299 match the requirements from the standard better. This is required
300 to work with gnu libstdc++-v3
302 * src/frontends/xforms/FormPreferences.C: add explict pair
303 arguments to browse calls. include support/lyxmanip.h remvoe
304 extern fmt. whitespace changes. reorder variables in
305 FormPreferences.h, to match initalizaton order.
307 * several files: constify more local variables.
309 * src/buffer.C: remove some commented functions.
311 * src/DepTable.C (remove_files_with_extension): temporary
312 work around for gcc 2.97
313 * src/filedlg.C (find): ditto
314 * src/Variables.C (set): ditto
315 * src/LyXAction.C (searchActionArg): ditto
316 (retrieveActionArg): ditto
318 * configure.in: check for mktemp too
320 * UPGRADING: prepare for 1.1.6
322 * Makefile.am (lgbtags): add backup tags for when etags are
323 different than usual.
325 * ANNOUNCE: prepare for 1.1.6
327 * src/support/tempname.C (make_tempfile): new function, wrapper
328 around mkstemp and mktemp. Only mkstemp has been tested.
331 2000-11-14 Rob Lahaye <lahaye@postech.edu>
333 * default.ui: capitalized some menu items to improve shortcuts.
335 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
337 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
339 * src/frontends/xforms/Dialogs.C: add "using" directive.
341 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
343 * src/filedlg.C (Select): highlight suggested file in browser, if
346 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
347 each tab folder is encapsulated in its own class.
348 The Language keymaps are now chosen using a text input and a
349 browser button, rather than a Combox.
350 All the browser buttons are now functional, although LyXFileDlg
351 still needs to be modified to make it straighhtforward to return a
352 directory if that is what is desired.
354 * src/frontends/xforms/forms/form_preferences.fd: use text input
355 and browse button to input the Language keymaps. Add a few
356 callbacks for the browse buttons.
358 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
360 * src/support/tempname.C (tempName): small changes to make it
361 safer. remove the '.' before XXXXXX
363 * src/support/filetools.C (TmpFileName): remove func
366 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
367 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
368 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
369 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
371 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
374 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
377 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
378 for bp (this fixes a reproducible hard crash)
380 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
383 * src/frontends/xforms/FormBase.h: make bp_ private
384 (FormBaseBI): remove default for bp
387 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
390 * src/frontends/xforms/Color.C (RGBColor): made several vars
391 const, changed initialization of j to allow it to be const
394 * several files: added const to local variables.
396 * src/lyx_cb.C: removed several function prototypes and moved them
400 (UpdateLayoutPreamble):
402 (MenuInsertLabel): add BufferView as arguemnt
403 (LayoutsCB): make tmp const
405 * src/layout_forms.h: regenerated
407 * src/debug.C: add Debug::FILES
408 (showLevel) (showTags): translate the desc
410 * src/debug.h: add FILES as debug target
412 * src/bufferlist.C: use current_view as an interim measure becuase
413 of added arguments to MenuWrite and MenuWriteAs
415 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
417 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
419 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
420 libstdc++ is compiled with.
422 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
424 * lib/layouts/docbook-book.layout
425 * lib/layouts/docbook.layout
426 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
427 those paragraphs are expresse as SGML comments <!-- -->.
429 * src/LaTeXFeatures.h
430 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
431 parameter, this allows to express all the include files as relative
432 paths to the master buffer. The verbatim insert works as the other
435 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
437 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
439 (MakeDocBookFile): top_element is always written. Some clean up, as
440 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
442 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
443 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
444 a reference is written instead of the name.
445 (Validate): use the relative path for the filename.
447 * src/insets/insetlabel.C (DocBook): write end tag, for XML
450 * src/support/filetools.h
451 * src/support/filetools.C (IsSGMLFilename): added.
454 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
456 * development/OS2/quick_fix.patch:
458 * README.OS2: quick update to the OS/2 port.
460 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
462 * src/converter.C: add "using" directive.
464 * src/frontends/xforms/FormPreferences.C: add "using" directive.
465 (compare_converter): add "int" as return type.
467 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
470 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
472 * src/lyx_gui.C (create_forms): map the xform colours, should a
473 mapping exist. Ie, call XformColor::read().
475 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
476 and struct HSV as HSVColor.
477 (XformColor::read, XformColor::write) : new methods that
478 input/output any changes to the cform GUI colors.
480 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
483 * src/frontends/xforms/FormPreferences.C Lots of little changes
484 associated with the changed name of the RGB and HSV structs. Can
485 now save changes to xforms GUI to file. Commented out
486 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
487 used currently anyway.
489 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
491 * src/converter.C: A lot of changes:
492 - It is no longer possible to choose between two or more ways to
493 export to some format (the new code uses only the shortest path).
494 However, it is still possible to choose between pdflatex/ps2pdf
495 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
496 - Added several methods that makes the FormPreferences code simpler.
497 - Changed the tokens $$FName and $$OutName to $$i and $$o.
499 * src/exporter.C (Export): lyxrc.use_pdf is set before
500 makeLaTeXFile is called. This works but not very nice.
502 * src/frontends/xforms/FormPreferences.C: The formats/converters
503 tabs are now fully functional.
505 * src/buffer.C (getTocList): Add numbers to the captions.
507 * lib/lyxrc.example: Removed fax section
509 * src/support/rename.C (rename): Delete the old file if lyx::copy
512 2000-11-13 Rob Lahaye <lahaye@postech.edu>
514 * lib/ui/default.ui: minor polishing.
516 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
518 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
521 * lib/Makefile.am (DOCINST): do not install everything in the
522 documentation directory.
524 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
526 * src/bufferlist.C (newFile): set the filename to the constructed
529 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
530 constructed "newfileXX.lyx" name to the dialog
532 * src/frontends/DialogBase.h: make update() non-abstract so
533 KDE doesn't need to implement two update methods for every form
535 * src/frontends/kde/Makefile.am: add missing xforms objects
538 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
540 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
542 * src/frontends/xforms/Color.[Ch]: new files, defining the color
543 structs RGB and HSV. May not be the best place for these files.
544 Perhaps move them into src ?
546 * src/frontends/xforms/Makefile.am: added new files.
548 * src/frontends/xforms/forms/form_preferences.fd:
549 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
550 replaced all instances of "colour" with "color"!
552 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
555 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
556 tab. Can now alter the colors of the xform's GUI on the fly. With
557 the aid of a single static Signal (see below), can "Apply" these
558 changes to all currently open dialogs. (Well, to all of the NEW
559 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
560 subsequently opened dialogs will, of course, also have the new
561 color scheme. Cannot yet save (or load) the choices to file, so
562 they are lost when exiting LyX.
564 * src/frontends/Dialogs.h:
565 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
566 Used to trigger a redraw of any dialogs connected to it because,
567 for example, the GUI colours have been re-mapped.
569 * src/frontends/xforms/FormBase.[Ch]:
570 * src/frontends/xforms/FormDocument.[Ch]:
571 * src/frontends/xforms/FormParagraph.[Ch]:
572 * src/frontends/xforms/FormPreferences.[Ch]:
573 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
574 method, to be connected to Dialogs::redrawGUI. Method must be
575 virtual, because dialogs with tabbed folders need to redraw the
576 forms of each tab folder.
578 * src/LyXView.C (d-tor):
579 * src/frontends/xforms/FormBase.C (d-tor): connected
580 Dialogs::redrawGUI signal to redraw().
582 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
583 removed Assert, because it is identical to that in FormBase.
585 2000-11-10 Rob Lahaye <lahaye@postech.edu>
587 * lib/ui/default.ui: minor polishing.
589 2000-11-10 Juergen Vigna <jug@sad.it>
591 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
592 (deleteLyXText): ditto
594 * src/insets/insettabular.C (InsetButtonPress): don't clear the
595 selection on mouse-button-3.
597 * src/insets/insettabular.h: new function clearSelection(), use this
598 functions inside insettabular.C.
600 * src/insets/insettabular.C (TabularFeatures): clear the selection
601 on remove_row/column.
603 * src/insets/inset.C (scroll): fixed some scroll stuff.
605 * src/insets/insettabular.C (draw): fixed another minor draw problem.
607 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
609 * lib/CREDITS: add Yves Bastide
611 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
613 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
614 check whether C library functions are in the global namespace.
616 * configure.in: calls it.
618 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
621 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
623 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
624 iterators to prevent crash.
626 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
628 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
630 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
631 shortcut for xforms CB to the preemptive or post-handler function.
633 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
634 removed the HIDDEN_TIMER as it's no longer used.
635 Various other small changes.
637 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
638 preemptive handler to obtain feedback, rather than the post-handler.
639 (ColoursLoadBrowser): find "black" and "white" based on RGB values
641 Formats tab is now complete. Converters tab is nearly so.
643 2000-11-09 Juergen Vigna <jug@sad.it>
645 * src/insets/insettext.C (~InsetText):
648 (SetParagraphData): set cache.second to 0 after deleting it!
649 (getLyXText): check if cache.second is not 0 if finding it.
651 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
653 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
654 lyxlex to parse the rgb.txt file.
657 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
658 replace the default '#' comment character.
660 * src/support/tempname.C: add "using" directive
661 * src/frontends/ButtonPolicies.C: ditto.
663 * src/support/filetools.C (DirList): add an explicit cast to avoid
664 a compile error (probably not the right fix)
666 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
668 * src/support/filetools.C (DirList): implement using system functions
670 * src/support/tempname.C: new file
672 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
674 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
676 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
679 * src/frontends/xforms/ButtonController.C: new file
681 * src/os2_defines.h: remove getcwd define
683 * src/lyxvc.C: include support/lyxlib.h
684 (showLog): use lyx::tempName
686 * src/lyx_cb.C: comment out includes that we don't need
687 (AutoSave): use lyx::tempName
689 * src/filedlg.C: include support/lyxlib.h
690 (Reread): use lyx::getcwd
692 * src/converter.C: include support/filetools.h
693 (add_options): change to static inline, make tail const
694 (Add): make old_viewer const
695 (GetAllFormats): make it a const method, use const_iterator
696 (enable): make static inline
697 (SplitFormat): make using_format const
699 * src/LaTeX.C (run): use lyx::getcwd
701 * configure.in: check for mkstemp as well
703 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
705 * src/converter.[Ch] (GetAllCommands): new method.
707 * src/support/filetools.[Ch] (DirList): new method.
709 * src/frontends/xforms/FormPreferences.C: started (just!) adding
710 functionality to the converters tab.
711 The formats tab is now nearly complete.
712 The kbmap choices in Languages tab now display the contents of
713 system_lyxdir/kbd/*.kmap in readable form.
715 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
716 Moved some variables into the class.
718 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
719 inactive tab folder to FL_COL1. Haven't yet worked out how to change
720 colour of active folder to lighter grey instead. Any takers?
721 (form_colours): added an "Apply" button.
722 (form_converters): added a "Flags" input field.
723 (form_formats): added a "Shortcut" input field. Note that we can't use
724 names such as "input_shortcut" as this buggers up the sed script stuff.
726 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
734 * src/lyx_sendfax_main.C:
737 * src/spellchecker.C:
738 * src/insets/figinset.C:
739 * src/insets/insetbib.C:
740 * src/insets/insetexternal.C:
741 * src/insets/insetinclude.C:
742 * src/insets/insetinfo.C:
743 * src/mathed/math_panel.C:
744 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
745 all "daughter" dialogs now have identical "feel".
747 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
749 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
750 used (and was only used in one place prior to this patch. Incorrectly!)
752 * src/frontends/xforms/FormDocument.C: changed some instances of
753 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
754 sense. Also added fl_set_input_return() for class_->input_doc_extra and
755 for options_->input_float_placement. This fixes a bug reported by
758 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
759 functionality into d-tor.
761 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
762 input of numerals also.
764 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
765 fl_set_form_atclose(). Can now close dialog from window manager,
766 fixing a bug reported by Rob Lahaye.
768 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
770 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
771 are no longer dark. Haven't yet worked out how to lighten the colour of
772 the active tabfolder. Any ideas anybody?
773 Adjusted Colours tab a little.
774 Added Shortcut field to converters tab. Note that we can't create an
775 fdesign label like "input_shortcut" as this buggers up the sed-script
778 * src/frontends/xforms/FormPreferences.[Ch]:
779 (feedback): fixed crash due to to ob=0.
780 (LanguagesXXX): the kbmap choices now contain the files
781 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
782 be replaced by an input with a file browse button, but since the browse
783 buttons don'y yet work, this'll do for the moment.
784 (FormatsXXX): think that this is now nearly fully functional.
785 Some points/questions though:
786 1. Does "Apply" remove formats if no longer present?
787 2. I think that the browser should list the GUI names rather than the
789 3. Must ensure that we can't delete Formats used by an existing
792 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
793 if this is the best way to do this.
795 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
797 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
799 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
800 for variable assignment.
802 2000-11-07 Rob Lahaye <lahaye@postech.edu>
804 * src/lib/ui/default.ui: added sub/superscripts to menu as
805 Insert->Special characters and cleaned-up the file a bit
807 2000-11-07 Allan Rae <rae@lyx.org>
809 * src/frontends/xforms/FormPreferences.C (feedback): make sure
810 ob isn't 0 before using it. See comments in function.
812 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
814 * src/frontends/xforms/form_*.C: regenerated
816 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
818 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
820 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
821 compiling with gcc-2.96
823 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
825 * src/support/lyxstring.C: add a couple "using" directives.
827 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
828 a .c_str() here too for good measure.
829 * src/Spacing.C (set): ditto.
830 * src/lyxfunc.C (Dispatch): ditto.
832 * src/insets/insettabular.C (copySelection): change .str() to
833 .str().c_str() to fix problems with lyxstring.
834 * src/support/filetools.C (GetFileContents): ditto.
835 * src/buffer.C (asciiParagraph): ditto.
836 * src/paragraph.C (String): ditto.
838 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
839 * lib/bind/sciword.bind: ditto.
841 * src/LyXAction.C (init): remove "symbol-insert" function, which
842 shared LFUN_INSERT_MATH with "math-insert".
844 * lib/configure.m4: == is not a valid operator for command test.
846 * src/lyxrc.C: add using directive.
848 * src/converter.h: add std:: qualifier.
850 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
852 * src/converter.[Ch] and other files: Change the Format class to a
853 real class, and create two instances: formats and system_format.
855 * src/lyxrc.C (output): Output the difference between formats and
858 * src/frontends/xforms/FormPreferences.C (input): Simplify.
859 (buildFormats): Insert formats into browser.
860 (inputFormats): Made the browser and add button functional.
861 (applyFormats): Update formats from format_vec.
863 * src/converter.C: Changed all (*it). to it->
864 (Format::dummy): New method.
865 (Format::importer): New format flag.
866 (Formats::GetAllFormats): New method.
867 (Formats::Add): Delete format from the map if prettyname is empty.
868 (Converter::Convert): Print an error message if moving the file fails.
869 (Converter::GetReachableTo): New method
871 * src/MenuBackend.[Ch]: Add support for importformats tag.
873 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
875 * lib/configure.m4: Add word->tex and ps->fax converters.
877 * lib/ui/default.ui: Use ImportFormats on file->import menu.
878 Return fax to file menu.
882 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
884 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
887 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
890 * src/lyxfunc.C (processKeyEvent): removed
892 * src/bufferlist.C (emergencyWrite): removed the out commented
893 emergency write code.
895 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
897 * src/LyXView.[Ch]: remove the outcommented raw_callback code
899 * many files: change formatting to be a bit more uniform for
900 if,while,for,switch statements, remove some parantesis not needed.
903 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
905 * config/kde.m4: make config more robust when KDEDIR is set
907 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
909 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
910 not returned a pixmap for "math-insert".
912 * src/LyXAction.C (init): sort the entries a bit.
914 2000-11-03 Juergen Vigna <jug@sad.it>
916 * src/insets/insettabular.h: added fixed number to update codes so
917 that update is only in one direction.
919 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
922 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
923 before call to edit because of redraw.
925 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
927 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
929 * lib/ui/default.ui: Populate "edit_float" menu
931 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
933 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
934 "floats-operate". The name is ugly (and the func also), but this
935 is just a band-aid until we switch to new insets.
937 2000-11-03 Rob Lahaye <lahaye@postech.edu>
939 * lib/ui/default.ui: update again the menu layout (fix some
942 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
944 * src/MenuBackend.h (fulllabel): new method.
946 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
947 the menu shortcuts of a menu are unique and whether they
948 correspond to a letter of the label.
949 (expand): call checkShortcuts when debugging.
951 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
953 * src/insets/insettext.C (InsetButtonPress): shut off warning.
955 2000-11-02 Lior Silberman <lior@Princeton.EDU>
957 * lib/examples/*.lyx : '\language default' => '\language english'
959 * lib/examples/it_splash.lyx : except where it should be italian
961 * lib/templates/*.lyx : the same
963 * doc/*.lyx* : the same
965 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
967 * lib/bind/menus.bind: remove the Layout menu entries, which I
968 somehow forgot earlier.
970 2000-11-03 Rob Lahaye <lahaye@postech.edu>
972 * lib/ui/old-default.ui: keep the old one here for reference (to
975 * lib/ui/default.ui: update the menu layout
977 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
979 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
980 Can now Apply to different insets without closing the dialog.
982 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
983 Can't actually DO anything with them yet, but I'd like a little
986 * src/frontends/xforms/input_validators.[ch]
987 (fl_lowercase_filter): new.
989 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
991 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
992 of MATH_CODE. This fixes a bug with math-macros in RTL text.
994 * src/text.C (PrepareToPrint): Show math-macros block aligned.
996 2000-11-02 Juergen Vigna <jug@sad.it>
998 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
999 on char insertion as it has already be updated by bv->updateInset().
1001 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1002 if an inset inside was updated.
1004 * lib/configure.cmd: commented out fax-search code
1006 2000-11-01 Yves Bastide <stid@acm.org>
1008 * src/tabular.C (OldFormatRead): set tabular language to the
1011 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1013 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1014 class names with non-letter characters (from Yves Bastide).
1016 * lib/ui/default.ui: change Item to OptItem in import menu.
1017 Comment out fax stuff.
1019 * lib/configure.m4: comment out fax-related stuff.
1021 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1023 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1024 useful xforms helper functions. At present contains only formatted().
1025 Input a string and it returns it with line breaks so that in fits
1028 * src/frontends/xforms/Makefile.am: add new files.
1030 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1031 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1034 * src/frontends/xforms/FormPreferences.[Ch]:
1035 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1036 but lots of little clean ups. Removed enum State. Make use of
1037 formatted(). Constify lots of methods. Perhaps best of all: removed
1038 requirement for that horrible reinterpret_cast from pointer to long in
1041 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1043 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1044 conditionalize build on xforms < 0.89
1046 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1048 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1050 * src/LyXAction.C (init): comment out fax
1052 * src/lyxrc.h: comment out the fax enums
1053 comment out the fax variables
1055 * src/commandtags.h: comment out LFUN_FAX
1057 * src/lyxrc.C: disable fax variables.
1058 (read): disable parsing of fax variables
1059 (output): disable writing of fax variables
1060 (getFeedback): now description for fax variables
1062 * src/lyxfunc.C: comment out MenuFax
1063 (Dispatch): disable LFUN_FAX
1065 * src/lyx_cb.C (MenuFax): comment out
1067 * src/WorkArea.C: add <cctype>
1068 (work_area_handler): better key handling, should be ok now.
1069 for accented chars + etc
1071 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1072 lyx_sendfax.h and lyx_sendfax_man.C
1074 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1075 (show): don't call InitLyXLookup when using xforms 0.89
1077 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1079 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1081 * src/support/filetools.C (GetFileContents): close to dummy change
1083 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1085 * src/trans.C (AddDeadkey): workaround stupid compilers.
1087 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1089 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1090 of two-sided document.
1092 2000-10-31 Juergen Vigna <jug@sad.it>
1094 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1096 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1097 xposition to the Edit call.
1099 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1101 * src/trans.C (AddDeadkey): cast explicitly to char.
1103 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1105 * src/tabular.C (AsciiBottomHLine): simplify?
1106 (AsciiTopHLine): simplify?
1107 (print_n_chars): simplify
1108 (DocBook): remove most of the << endl; we should flush the stream
1109 as seldom as possible.
1111 (TeXBottomHLine): ditto
1112 (TeXTopHLine): ditto
1114 (write_attribute): try a templified version.
1115 (set_row_column_number_info): lesson scope of variables
1117 * src/support/lstrings.h (tostr): new specialization of tostr
1119 * src/trans.C (AddDeadkey): slightly cleaner fix.
1121 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1123 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1124 '%%' in Toc menu labels.
1127 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1128 font_norm is iso10646-1.
1130 * src/font.C (ascent): Fixed for 16bit fonts
1131 (descent,lbearing,rbearing): ditto
1133 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1135 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1136 (getFeedback): new static method.
1138 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1139 Now use combox rather than choice to display languages.
1140 Feedback is now output using a new timer callback mechanism, identical
1141 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1143 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1145 * src/minibuffer.C: fix for older compilers
1147 2000-10-30 Juergen Vigna <jug@sad.it>
1149 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1150 has to be Left of the inset otherwise LyXText won't find it!
1152 * src/BufferView2.C (open_new_inset): delete the inset if it can
1155 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1157 * lyx.man: fix typo.
1159 2000-10-29 Marko Vendelin <markov@ioc.ee>
1160 * src/frontends/gnome/FormCitation.C
1161 * src/frontends/gnome/FormCitation.h
1162 * src/frontends/gnome/FormCopyright.C
1163 * src/frontends/gnome/FormCopyright.h
1164 * src/frontends/gnome/FormError.C
1165 * src/frontends/gnome/FormError.h
1166 * src/frontends/gnome/FormIndex.C
1167 * src/frontends/gnome/FormIndex.h
1168 * src/frontends/gnome/FormPrint.C
1169 * src/frontends/gnome/FormPrint.h
1170 * src/frontends/gnome/FormRef.C
1171 * src/frontends/gnome/FormRef.h
1172 * src/frontends/gnome/FormToc.C
1173 * src/frontends/gnome/FormToc.h
1174 * src/frontends/gnome/FormUrl.C
1175 * src/frontends/gnome/FormUrl.h
1176 * src/frontends/gnome/Menubar_pimpl.C
1177 * src/frontends/gnome/mainapp.C
1178 * src/frontends/gnome/mainapp.h
1179 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1180 changing update() to updateSlot() where appropriate
1182 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1184 * src/frontends/xforms/FormPreferences.[Ch]:
1185 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1188 2000-10-28 Juergen Vigna <jug@sad.it>
1190 * src/insets/insettabular.C (draw): fixed drawing bug.
1192 * src/insets/insettext.C (clear):
1194 (SetParagraphData): clearing the TEXT buffers when deleting the
1195 paragraphs used by it.
1197 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1199 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1201 2000-10-27 Juergen Vigna <jug@sad.it>
1203 * src/tabular.C (~LyXTabular): removed not needed anymore.
1205 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1208 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1210 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1213 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1216 * src/frontends/xforms/FormPreferences.[Ch]:
1217 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1218 Reorganised as modules based on tabs. Much easier to follow the
1219 flow and to add new tabs. Added warning and feedback messages.
1222 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1224 * src/tabular.h (DocBook): add std:: qualifier.
1226 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1228 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1229 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1232 * insettabular.C (DocBook): uses the tabular methods to export
1235 * src/insets/insettext.h
1236 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1238 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1240 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1243 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1244 moved misplaced AllowInput two lines up.
1246 * src/buffer.C (readFile): compare float with float, not with int
1248 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1250 * src/minibuffer.C: add "using SigC::slot" statement.
1252 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1254 * src/frontends/xforms/forms/README: updated section about make.
1256 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1257 Tidied some forms up, made two of form_tabular's tabs more
1258 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1259 fixed translation problem with "Column".
1261 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1263 * src/minibuffer.h: use Timeout instead of the xforms timer
1265 (setTimer) rewrite for the Timeout, change to unsigned arg
1266 (set): change to unsigned timer arg
1269 * src/minibuffer.C (TimerCB): removed func
1270 (C_MiniBuffer_TimerCB): removed func
1271 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1272 (peek_event): use a switch statement
1273 (add): don't use fl_add_timer.
1274 (Set): rewrite to use the Timeout
1277 * src/Timeout.[Ch] (setType): return a Timeout &
1278 (setTimeout): ditto, change to unsigned arg for timeout
1280 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1282 * src/mathed/formula.C (mathed_string_width): Use string instead
1283 of a constant size char array.
1285 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1287 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1288 the two recently added operator<< for SMInput and State.
1290 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1292 (OkCancelPolicy): ditto
1293 (OkCancelReadOnlyPolicy): ditto
1294 (NoRepeatedApplyReadOnlyPolicy): ditto
1295 (OkApplyCancelReadOnlyPolicy): ditto
1296 (OkApplyCancelPolicy): ditto
1297 (NoRepeatedApplyPolicy): ditto
1299 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1301 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1302 add the usual std:: qualifiers.
1304 2000-10-25 Juergen Vigna <jug@sad.it>
1306 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1308 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1310 * src/support/filetools.C (MakeRelPath): change some types to
1313 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1314 ButtonPolicy::SMInput and ButtonPolicy::State.
1316 * src/FontLoader.C (reset): small cleanup
1317 (unload): small cleanup
1319 * src/FontInfo.C (getFontname): initialize error to 10000.0
1321 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1323 * src/frontends/xforms/FormPreferences.[Ch]:
1324 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1325 TeX encoding and default paper size sections.
1327 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1329 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1332 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1333 make the message_ empty.
1334 (FormError): don't initialize message_ in initializer list.
1336 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1338 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1340 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1342 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1344 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1346 * src/frontends/kde/*data.[Ch]: _("") is not
1349 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1351 * src/buffer.C: removed redundant using directive.
1353 * src/frontends/DialogBase.h: revert to original definition of
1356 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1357 stuff into two classes, one for each dialog, requires a new
1358 element in the dialogs vector, FormTabularCreate.
1360 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1363 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1364 method. Continues Allan's idea, but means that derived classes
1365 don't need to worry about "update or hide?".
1367 * src/frontends/xforms/FormError.C (showInset): add connection
1370 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1371 one for each dialog. FormTabular now contains main tabular dialog
1374 * src/frontends/xforms/FormTabularCreate.[Ch]:
1375 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1378 * src/frontends/xforms/FormGraphics.[Ch]:
1379 * src/frontends/xforms/forms/form_graphics.fd
1380 * src/frontends/xforms/FormTabular.[Ch]:
1381 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1382 classes of FormInset.
1384 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1385 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1387 * src/frontends/xforms/Makefile.am:
1388 * src/frontends/xforms/forms/makefile: added new files.
1390 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1391 variable. added Signal0 hide signal, in keeping with other GUI-I
1394 * src/support/lstrings.h: removed redundant std:: qualifier as
1395 it's already declared in Lsstream.h.
1397 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1399 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1403 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1405 * src/tabular.C (Ascii): minimize scope of cell.
1407 * src/BufferView2.C (nextWord): return string() instead of 0;
1409 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1411 * src/converter.h: add a std:: qualifier
1413 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1415 * src/importer.[Ch]: New files. Used for importing files into LyX.
1417 * src/lyxfunc.C (doImport): Use the new Importer class.
1419 * src/converter.h: Add shortcut member to the Format class.
1420 Used for holding the menu shortcut.
1422 * src/converter.C and other files: Made a distinction between
1423 format name and format extension. New formats can be defined using
1424 the \format lyxrc tag.
1425 Added two new converter flags: latex and disable.
1427 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1429 * src/support/lyxlib.h: unify namespace/struct implementation.
1430 Remove extra declarations.
1432 * src/support/chdir.C (chdir): remove version taking char const *
1434 * src/support/rename.C: ditto.
1435 * src/support/lyxsum.C: ditto.
1437 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1439 * src/frontends/xforms/FormBase.[Ch]:
1440 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1441 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1442 work only for the next call to fl_show_form(). The correct place to set
1443 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1444 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1445 from FormBase have the minimum size set; no more stupid crashes with
1448 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1450 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1452 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1454 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1456 * src/support/lyxlib.h: changed second argument of mkdir to
1457 unsigned long int (unsigned int would probably have been enough,
1458 but...). Removed <sys/types.h> header.
1459 * src/support/mkdir.C (mkdir): ditto.
1463 2000-10-19 Juergen Vigna <jug@sad.it>
1465 * src/lyxfunc.C (MenuNew): small fix (form John)
1467 * src/screen.C (Update): removed unneeded code.
1469 * src/tabular.C (Ascii): refixed int != uint bug!
1471 * src/support/lyxlib.h: added sys/types.h include for now permits
1472 compiling, but I don't like this!
1474 2000-10-18 Juergen Vigna <jug@sad.it>
1476 * src/text2.C (ClearSelection): if we clear the selection we need
1477 more refresh so set the status apropriately
1479 * src/insets/insettext.C (draw): hopefully finally fixed draw
1482 2000-10-12 Juergen Vigna <jug@sad.it>
1484 * src/insets/insettext.C (draw): another small fix and make a block
1485 so that variables are localized.
1487 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1489 * src/support/lstrings.C (lowercase, uppercase):
1490 use explicit casts to remove compiler warnings.
1492 * src/support/LRegex.C (Impl):
1493 * src/support/StrPool.C (add):
1494 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1495 (AddPath, MakeDisplayPath):
1496 * src/support/lstrings.C (prefixIs, subst):
1497 use correct type to remove compiler warnings.
1499 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1501 * src/support/lyxlib.h:
1502 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1503 portability and to remove compiler warning with DEC cxx.
1505 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1507 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1509 * src/minibuffer.C (peek_event): retun 1 when there has been a
1510 mouseclick in the minibuffer.
1514 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1516 * src/frontends/xforms/FormParagraph.C: more space above/below
1519 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1521 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1522 a char only if real_current_font was changed.
1524 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1526 * NEWS: update somewhat for 1.1.6
1528 * lib/ui/default.ui: clean up.
1530 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1532 * lib/CREDITS: clean up
1534 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1536 * src/combox.[Ch] (select): changed argument back to int
1537 * src/combox.C (peek_event): removed num_bytes as it is declared but
1540 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1541 modified calls to Combox::select() to remove warnings about type
1544 * src/insets/insetbutton.C (width): explicit cast to remove warning
1545 about type conversion.
1547 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1550 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1551 sel_pos_end, refering to cursor position are changed to
1552 LyXParagraph::size_type.
1554 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1555 consistent with LyXCursor::pos().
1556 (inset_pos): changed to LyXParagraph::size_type for same reason.
1558 * src/insets/insettext.C (resizeLyXText): changed some temporary
1559 variables refing to cursor position to LyXParagraph::size_type.
1561 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1563 * src/frontends/kde/<various>: The Great Renaming,
1566 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1568 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1570 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1572 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1573 0 when there are no arguments.
1575 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1577 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1578 to segfaults when pressing Ok in InsetBibtex dialog.
1580 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1582 * forms/layout_forms.fd:
1583 * src/layout_forms.C (create_form_form_character): small change to use
1584 labelframe rather than engraved frame + text
1586 * src/lyx_gui.C (create_forms): initialise choice_language with some
1587 arbitrary value to prevent segfault when dialog is shown.
1589 2000-10-16 Baruch Even <baruch.even@writeme.com>
1591 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1592 is no resulting file. This pertains only to LaTeX output.
1594 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1596 * src/text.C (Backspace): Make sure that the row of the cursor is
1599 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1602 * src/lyx_gui.C (init): Prevent a crash when only one font from
1603 menu/popup fonts is not found.
1605 * lib/lyxrc.example: Add an example for binding a key for language
1608 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1610 * src/converter.C (GetReachable): Changed the returned type to
1612 (IsReachable): New method
1614 * src/MenuBackend.C (expand): Handle formats that appear more
1617 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1619 * src/frontends/support/Makefile.am
1620 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1623 * lib/CREDITS: add Garst Reese.
1625 * src/support/snprintf.h: add extern "C" {} around the definitions.
1627 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1629 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1632 * src/frontends/xforms/FormDocument.C:
1633 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1634 compile without "conversion to integral type of smaller size"
1637 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1639 * src/text.C (GetColumnNearX): Fixed disabled code.
1641 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1643 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1646 * src/support/snprintf.[ch]: new files
1648 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1650 * src/frontends/kde/formprintdialog.C: add
1651 file browser for selecting postscript output
1653 * src/frontends/kde/formprintdialogdata.C:
1654 * src/frontends/kde/formprintdialogdata.h: re-generate
1657 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1659 * src/frontends/gnome/Makefile.am:
1660 * src/frontends/kde/Makefile.am: FormCommand.C
1661 disappeared from xforms
1663 * src/frontends/kde/FormCitation.C:
1664 * src/frontends/kde/FormIndex.C: read-only
1667 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1669 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1672 * src/bufferlist.C: add using directive.
1674 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1676 * src/support/lyxfunctional.h: version of class_fun for void
1677 returns added, const versions of back_inseter_fun and compare_fun
1680 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1682 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1684 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1686 * ChangeLog: cleanup.
1688 * lib/CREDITS: update to add all the contributors we've forgotten.
1689 I have obviously missed some, so tell me whether there were
1692 2000-10-13 Marko Vendelin <markov@ioc.ee>
1694 * src/frontends/gnome/FormCitation.C
1695 * src/frontends/gnome/FormCitation.h
1696 * src/frontends/gnome/FormError.C
1697 * src/frontends/gnome/FormIndex.C
1698 * src/frontends/gnome/FormRef.C
1699 * src/frontends/gnome/FormRef.h
1700 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1702 * src/frontends/gnome/FormCitation.C
1703 * src/frontends/gnome/FormCopyright.C
1704 * src/frontends/gnome/FormError.C
1705 * src/frontends/gnome/FormIndex.C
1706 * src/frontends/gnome/FormRef.C
1707 * src/frontends/gnome/FormToc.C
1708 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1711 * src/frontends/gnome/Menubar_pimpl.C
1712 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1715 2000-10-11 Baruch Even <baruch.even@writeme.com>
1718 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1719 to convey its real action.
1721 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1722 clear the minibuffer and prepare to enter a command.
1724 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1725 the rename from ExecCommand to PrepareForCommand.
1726 * src/lyxfunc.C (Dispatch): ditto.
1728 2000-10-11 Baruch Even <baruch.even@writeme.com>
1730 * src/buffer.C (writeFile): Added test for errors on writing, this
1731 catches all errors and not only file system full errors as intended.
1733 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1735 * src/lyx_gui.C (create_forms): better fix for crash with
1736 translated interface.
1738 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1740 * src/frontends/kde/Makefile.am:
1741 * src/frontends/kde/FormCopyright.C:
1742 * src/frontends/kde/formcopyrightdialog.C:
1743 * src/frontends/kde/formcopyrightdialog.h:
1744 * src/frontends/kde/formcopyrightdialogdata.C:
1745 * src/frontends/kde/formcopyrightdialogdata.h:
1746 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1747 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1748 copyright to use qtarch
1750 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1752 * src/encoding.C (read): Fixed bug that caused an error message at
1753 the end of the file.
1755 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1757 * lib/lyxrc.example: Fixed hebrew example.
1759 2000-10-13 Allan Rae <rae@lyx.org>
1761 * src/frontends/xforms/FormPreferences.C (input): reworking the
1763 (build, update, apply): New inputs in various tabfolders
1765 * src/frontends/xforms/FormToc.C: use new button policy.
1766 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1767 dialogs that either can't use any existing policy or where it just
1770 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1773 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1774 added a bool parameter which is ignored.
1776 * src/buffer.C (setReadonly):
1777 * src/BufferView_pimpl.C (buffer):
1778 * src/frontends/kde/FormCopyright.h (update):
1779 * src/frontends/kde/FormCitation.[Ch] (update):
1780 * src/frontends/kde/FormIndex.[Ch] (update):
1781 * src/frontends/kde/FormPrint.[Ch] (update):
1782 * src/frontends/kde/FormRef.[Ch] (update):
1783 * src/frontends/kde/FormToc.[Ch] (update):
1784 * src/frontends/kde/FormUrl.[Ch] (update):
1785 * src/frontends/gnome/FormCopyright.h (update):
1786 * src/frontends/gnome/FormCitation.[Ch] (update):
1787 * src/frontends/gnome/FormError.[Ch] (update):
1788 * src/frontends/gnome/FormIndex.[Ch] (update):
1789 * src/frontends/gnome/FormPrint.[Ch] (update):
1790 * src/frontends/gnome/FormRef.h (update):
1791 * src/frontends/gnome/FormToc.[Ch] (update):
1792 * src/frontends/gnome/FormUrl.[Ch] (update):
1793 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1794 to updateBufferDependent and DialogBase
1796 * src/frontends/xforms/FormCitation.[hC]:
1797 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1798 * src/frontends/xforms/FormError.[Ch]:
1799 * src/frontends/xforms/FormGraphics.[Ch]:
1800 * src/frontends/xforms/FormIndex.[Ch]:
1801 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1802 and fixed readOnly handling.
1803 * src/frontends/xforms/FormPrint.[Ch]:
1804 * src/frontends/xforms/FormRef.[Ch]:
1805 * src/frontends/xforms/FormTabular.[Ch]:
1806 * src/frontends/xforms/FormToc.[Ch]:
1807 * src/frontends/xforms/FormUrl.[Ch]:
1808 * src/frontends/xforms/FormInset.[Ch]:
1809 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1810 form of updateBufferDependent.
1812 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1813 if form()->visible just in case someone does stuff to the form in a
1816 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1817 the buttoncontroller for everything the enum used to be used for.
1818 (update) It would seem we need to force all dialogs to use a bool
1819 parameter or have two update functions. I chose to go with one.
1820 I did try removing update() from here and FormBase and defining the
1821 appropriate update signatures in FormBaseB[DI] but then ran into the
1822 problem of the update() call in FormBase::show(). Whatever I did
1823 to get around that would require another function and that just
1824 got more confusing. Hence the decision to make everyone have an
1825 update(bool). An alternative might have been to override show() in
1826 FormBaseB[DI] and that would allow the different and appropriate
1829 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1830 true == buffer change occurred. I decided against using a default
1831 template parameter since not all compilers support that at present.
1833 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1835 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1836 army knife" by removing functionality.
1837 (clearStore): removed. All such housekeeping on hide()ing the dialog
1838 is to be carried out by overloaded disconnect() methods.
1839 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1840 superceded by Baruch's neat test (FormGraphics) to update an existing
1841 dialog if a new signal is recieved rather than block all new signals
1843 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1844 only to Inset dialogs.
1845 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1846 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1848 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1850 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1851 as a base class to all inset dialogs. Used solely to connect/disconnect
1852 the Inset::hide signal and to define what action to take on receipt of
1853 a UpdateBufferDependent signal.
1854 (FormCommand): now derived from FormInset.
1856 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1859 * src/frontends/xforms/FormCopyright.[Ch]:
1860 * src/frontends/xforms/FormPreferences.[Ch]:
1861 now derived from FormBaseBI.
1863 * src/frontends/xforms/FormDocument.[Ch]:
1864 * src/frontends/xforms/FormParagraph.[Ch]:
1865 * src/frontends/xforms/FormPrint.[Ch]:
1866 now derived from FormBaseBD.
1868 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1870 * src/frontends/xforms/FormCitation.[Ch]:
1871 * src/frontends/xforms/FormError.[Ch]:
1872 * src/frontends/xforms/FormRef.[Ch]:
1873 * src/frontends/xforms/FormToc.[Ch]:
1874 (clearStore): reworked as disconnect().
1876 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1879 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1881 * src/converter.C (runLaTeX): constify buffer argument
1884 * src/frontends/support/Makefile.am (INCLUDES): fix.
1886 * src/buffer.h: add std:: qualifier
1887 * src/insets/figinset.C (addpidwait): ditto
1888 * src/MenuBackend.C: ditto
1889 * src/buffer.C: ditto
1890 * src/bufferlist.C: ditto
1891 * src/layout.C: ditto
1892 * src/lyxfunc.C: ditto
1894 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1896 * src/lyxtext.h (bidi_level): change return type to
1897 LyXParagraph::size_type.
1899 * src/lyxparagraph.h: change size_type to
1900 TextContainer::difference_type. This should really be
1901 TextContainer::size_type, but we need currently to support signed
1904 2000-10-11 Marko Vendelin <markov@ioc.ee>
1905 * src/frontends/gnome/FormError.h
1906 * src/frontends/gnome/FormRef.C
1907 * src/frontends/gnome/FormRef.h
1908 * src/frontends/gnome/FormError.C
1909 * src/frontends/gnome/Makefile.am
1910 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1911 to Gnome frontend. Both dialogs use "action" area.
1913 2000-10-12 Baruch Even <baruch.even@writeme.com>
1915 * src/graphics/GraphicsCacheItem_pimpl.C:
1916 * src/graphics/Renderer.C:
1917 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1920 2000-10-12 Juergen Vigna <jug@sad.it>
1922 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1923 visible when selecting).
1925 * development/Code_rules/Rules: fixed some typos.
1927 2000-10-09 Baruch Even <baruch.even@writeme.com>
1929 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1930 compiling on egcs 1.1.2 possible.
1932 * src/filedlg.C (comp_direntry::operator() ): ditto.
1934 2000-08-31 Baruch Even <baruch.even@writeme.com>
1936 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1939 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1940 transient it now only gets freed when the object is destructed.
1942 2000-08-24 Baruch Even <baruch.even@writeme.com>
1944 * src/frontends/FormGraphics.h:
1945 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1948 2000-08-20 Baruch Even <baruch.even@writeme.com>
1950 * src/insets/insetgraphics.C:
1951 (draw): Added messages to the drawn rectangle to report status.
1952 (updateInset): Disabled the use of the inline graphics,
1955 2000-08-17 Baruch Even <baruch.even@writeme.com>
1957 * src/frontends/support: Directory added for the support of GUII LyX.
1959 * src/frontends/support/LyXImage.h:
1960 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1963 * src/frontends/support/LyXImage_X.h:
1964 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1965 version of LyXImage, this uses the Xlib Pixmap.
1967 * src/PainterBase.h:
1968 * src/PainterBase.C:
1970 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1971 replacement to Pixmap.
1973 * src/insets/insetgraphics.h:
1974 * src/insets/insetgraphics.C:
1975 * src/graphics/GraphicsCacheItem.h:
1976 * src/graphics/GraphicsCacheItem.C:
1977 * src/graphics/GraphicsCacheItem_pimpl.h:
1978 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1981 * src/graphics/GraphicsCacheItem.h:
1982 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1983 another copy of the object.
1985 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1986 of cacheHandle, this fixed a bug that sent LyX crashing.
1988 * src/graphics/XPM_Renderer.h:
1989 * src/graphics/XPM_Renderer.C:
1990 * src/graphics/EPS_Renderer.h:
1991 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1993 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1995 * src/lyxfunc.C (processKeySym): only handle the
1996 lockinginset/inset stuff if we have a buffer and text loaded...
1998 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2000 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2002 * src/support/lyxfunctional.h: add operator= that takes a reference
2004 * src/lyxserver.C (mkfifo): make first arg const
2006 * src/layout.h: renamed name(...) to setName(...) to work around
2009 * src/buffer.C (setFileName): had to change name of function to
2010 work around bugs in egcs. (renamed from fileName)
2012 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2014 * src/support/translator.h: move helper template classes to
2015 lyxfunctional.h, include "support/lyxfunctional.h"
2017 * src/support/lyxmanip.h: add delaration of fmt
2019 * src/support/lyxfunctional.h: new file
2020 (class_fun_t): new template class
2021 (class_fun): helper template function
2022 (back_insert_fun_iterator): new template class
2023 (back_inserter_fun): helper template function
2024 (compare_memfun_t): new template class
2025 (compare_memfun): helper template function
2026 (equal_1st_in_pair): moved here from translator
2027 (equal_2nd_in_pair): moved here from translator
2029 * src/support/fmt.C: new file
2030 (fmt): new func, can be used for a printf substitute when still
2031 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2033 * src/support/StrPool.C: add some comments
2035 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2038 * src/insets/figinset.C (addpidwait): use std::copy with
2039 ostream_iterator to fill the pidwaitlist
2041 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2043 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2046 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2049 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2051 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2052 (class_update): ditto
2053 (BulletPanel): ditto
2054 (CheckChoiceClass): move initialization of tc and tct
2056 * src/tabular.C: remove current_view
2057 (OldFormatRead): similar to right below [istream::ignore]
2059 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2060 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2061 unused [istream::ignore]
2063 * src/lyxfunc.C: include "support/lyxfunctional.h"
2064 (getInsetByCode): use std::find_if and compare_memfun
2066 * src/lyxfont.C (stateText): remove c_str()
2068 * src/lyx_main.C (setDebuggingLevel): make static
2069 (commandLineHelp): make static
2071 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2072 Screen* together with fl_get_display() and fl_screen
2074 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2075 togheter with fl_get_display() and fl_screen
2076 (create_forms): remove c_str()
2078 * src/layout.C: include "support/lyxfunctional.h"
2079 (hasLayout): use std::find_if and compare_memfun
2080 (GetLayout): use std::find_if and comapre_memfun
2081 (delete_layout): use std::remove_if and compare_memfun
2082 (NumberOfClass): use std:.find_if and compare_memfun
2084 * src/gettext.h: change for the new functions
2086 * src/gettext.C: new file, make _(char const * str) and _(string
2087 const & str) real functions.
2089 * src/font.C (width): rewrite slightly to avoid one extra variable
2091 * src/debug.C: initialize Debug::ANY here
2093 * src/commandtags.h: update number comments
2095 * src/combox.h (get): make const func
2097 (getline): make const
2099 * src/combox.C (input_cb): handle case where fl_get_input can
2102 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2103 "support/lyxfunctional.h", remove current_view variable.
2104 (resize): use std::for_each with std::mem_fun
2105 (getFileNames): use std::copy with back_inserter_fun
2106 (getBuffer): change arg type to unsigned int
2107 (emergencyWriteAll): call emergencyWrite with std::for_each and
2109 (emergencyWrite): new method, the for loop in emergencyWriteAll
2111 (exists): use std::find_if with compare_memfun
2112 (getBuffer): use std::find_if and compare_memfun
2114 * src/buffer.h: add typedefs for iterator_category, value_type
2115 difference_type, pointer and reference for inset_iterator
2116 add postfix ++ for inset_iterator
2117 make inset_iterator::getPos() const
2119 * src/buffer.C: added support/lyxmanip.h
2120 (readFile): use lyxerr << fmt instead of printf
2121 (makeLaTeXFile): use std::copy to write out encodings
2123 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2125 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2126 free and the char * temp.
2127 (hasMenu): use std::find_if and compare_memfun
2130 * src/Makefile.am (lyx_SOURCES): added gettext.C
2132 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2133 string::insert small change to avoid temporary
2135 * src/LColor.C (getGUIName): remove c_str()
2137 * several files: change all occurrences of fl_display to
2140 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2141 that -pedantic is not used for gcc 2.97 (cvs gcc)
2143 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2145 2000-10-11 Allan Rae <rae@lyx.org>
2147 * src/frontends/xforms/FormPreferences.C (input): template path must be
2148 a readable directory. It doesn't need to be writeable.
2149 (build, delete, update, apply): New inputs in the various tabfolders
2151 * src/frontends/xforms/forms/form_preferences.fd:
2152 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2153 several new entries to existing folders. Shuffled some existing stuff
2156 * src/frontends/xforms/forms/form_print.fd:
2157 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2158 Should probably rework PrinterParams as well. Note that the switch to
2159 collated is effectively the same as !unsorted so changing PrinterParams
2160 will require a lot of fiddly changes to reverse the existing logic.
2162 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2164 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2166 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2168 2000-10-10 Allan Rae <rae@lyx.org>
2171 * src/lyxfunc.C (Dispatch):
2173 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2176 * src/lyxrc.C (output): Only write the differences between system lyxrc
2177 and the users settings.
2180 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2182 I'll rewrite this later, after 1.1.6 probably, to keep a single
2183 LyXRC but two instances of a LyXRCStruct.
2185 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2187 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2189 * src/tabular.h: add a few std:: qualifiers.
2191 * src/encoding.C: add using directive.
2192 * src/language.C: ditto.
2194 * src/insets/insetquotes.C (Validate): use languages->lang()
2195 instead of only language.
2197 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2199 * lib/languages: New file.
2201 * lib/encodings: New file.
2203 * src/language.C (Languages): New class.
2204 (read): New method. Reads the languages from the 'languages' file.
2206 * src/encoding.C (Encodings): New class.
2207 (read): New method. Reads the encodings from the 'encodings' file.
2209 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2212 * src/bufferparams.h and a lot of files: Deleted the member language,
2213 and renamed language_info to language
2215 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2216 * src/lyxfont.C (latexWriteStartChanges): ditto.
2217 * src/paragraph.C (validate,TeXOnePar): ditto.
2219 * src/lyxfont.C (update): Restored deleted code.
2221 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2223 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2225 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2227 * src/insets/figinset.[Ch]:
2228 * src/insets/insetinclude.[Ch]:
2229 * src/insets/insetinclude.[Ch]:
2230 * src/insets/insetparent.[Ch]:
2231 * src/insets/insetref.[Ch]:
2232 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2234 * src/insets/*.[Ch]:
2235 * src/mathed/formula.[Ch]:
2236 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2238 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2239 * src/lyx_cb.C (FigureApplyCB):
2240 * src/lyxfunc.C (getStatus, Dispatch):
2241 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2244 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2246 * src/converter.[Ch] (Formats::View):
2247 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2249 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2250 *current_view->buffer(). This will change later, but this patch is way
2253 2000-10-09 Juergen Vigna <jug@sad.it>
2255 * src/text.C (GetRow): small fix.
2257 * src/BufferView_pimpl.C (cursorPrevious):
2258 (cursorNext): added LyXText parameter to function.
2260 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2261 keypress depending on cursor position.
2263 2000-10-06 Juergen Vigna <jug@sad.it>
2265 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2266 (copySelection): redone this function and also copy ascii representa-
2269 * src/tabular.C (Ascii):
2273 (print_n_chars): new functions to realize the ascii export of tabulars.
2275 2000-10-05 Juergen Vigna <jug@sad.it>
2277 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2278 if we don't have a buffer.
2280 2000-10-10 Allan Rae <rae@lyx.org>
2282 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2283 with closing dialog. It seems that nested tabfolders require hiding
2284 of inner tabfolders before hiding the dialog itself. Actually all I
2285 did was hide the active outer folder.
2287 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2288 unless there really is a buffer. hideBufferDependent is called
2291 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2292 POTFILES.in stays in $(srcdir).
2294 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2296 * lib/lyxrc.example: Few changes.
2298 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2300 * src/BufferView_pimpl.C (buffer): only need one the
2301 updateBufferDependent signal to be emitted once! Moved to the end of
2302 the method to allow bv_->text to be updated first.
2304 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2305 and hSignal_ with Dialogs * and BufferDependency variables.
2306 New Buffer * parent_, initialised when the dialog is launched. Used to
2307 check whether to update() or hide() dialog in the new, private
2308 updateOrHide() method that is connected to the updateBufferDependent
2309 signal. Daughter classes dictate what to do using the
2310 ChangedBufferAction enum, passed to the c-tor.
2312 * src/frontends/xforms/FormCitation.C:
2313 * src/frontends/xforms/FormCommand.C:
2314 * src/frontends/xforms/FormCopyright.C:
2315 * src/frontends/xforms/FormDocument.C:
2316 * src/frontends/xforms/FormError.C:
2317 * src/frontends/xforms/FormIndex.C:
2318 * src/frontends/xforms/FormPreferences.C:
2319 * src/frontends/xforms/FormPrint.C:
2320 * src/frontends/xforms/FormRef.C:
2321 * src/frontends/xforms/FormToc.C:
2322 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2325 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2326 ChangedBufferAction enum.
2328 * src/frontends/xforms/FormParagraph.[Ch]
2329 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2332 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2334 * lib/bind/cua.bind: fix a bit.
2335 * lib/bind/emacs.bind: ditto.
2337 * lib/bind/menus.bind: remove real menu entries from there.
2339 * src/spellchecker.C: make sure we only include strings.h when
2342 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2344 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2345 function. It enlarges the maximum number of pup when needed.
2346 (add_toc2): Open a new menu if maximum number of items per menu has
2349 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2351 * src/frontends/kde/FormPrint.C: fix error reporting
2353 * src/frontends/xforms/FormDocument.C: fix compiler
2356 * lib/.cvsignore: add Literate.nw
2358 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2361 * bufferview_funcs.[Ch]
2364 * text2.C: Add support for numbers in RTL text.
2366 2000-10-06 Allan Rae <rae@lyx.org>
2368 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2369 to be gettext.m4 friendly again. ext_l10n.h is now
2370 generated into $top_srcdir instead of $top_builddir
2371 so that lyx.pot will be built correctly -- without
2372 duplicate parsing of ext_l10n.h.
2374 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2376 * src/frontends/kde/FormCitation.C: make the dialog
2377 behave more sensibly
2379 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2381 * config/kde.m4: fix consecutive ./configure runs,
2382 look for qtarch, fix library order
2384 * src/frontends/kde/Makefile.am: tidy up,
2385 add Print dialog, add .dlg dependencies
2387 * src/frontends/kde/FormPrint.C:
2388 * src/frontends/kde/FormPrint.h:
2389 * src/frontends/kde/formprintdialog.C:
2390 * src/frontends/kde/formprintdialog.h:
2391 * src/frontends/kde/formprintdialogdata.C:
2392 * src/frontends/kde/formprintdialogdata.h:
2393 * src/frontends/kde/dlg/formprintdialog.dlg: add
2396 * src/frontends/kde/dlg/README: Added explanatory readme
2398 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2399 script to double-check qtarch's output
2401 * src/frontends/kde/formindexdialog.C:
2402 * src/frontends/kde/formindexdialogdata.C:
2403 * src/frontends/kde/formindexdialogdata.h:
2404 * src/frontends/kde/dlg/formindexdialog.dlg: update
2405 for qtarch, minor fixes
2407 2000-10-05 Allan Rae <rae@lyx.org>
2409 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2410 dialogs when switching buffers update them instead. It's up to each
2411 dialog to decide if it should still be visible or not.
2412 update() should return a bool to control visiblity within show().
2413 Or perhaps better to set a member variable and use that to control
2416 * lib/build-listerrors: create an empty "listerrors" file just to stop
2417 make trying to regenerate it all the time if you don't have noweb
2420 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2422 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2423 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2424 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2425 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2426 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2428 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2430 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2432 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2433 deleting buffer. Closes all buffer-dependent dialogs.
2435 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2437 * src/frontends/xforms/FormCitation.[Ch]:
2438 * src/frontends/xforms/FormPreferences.[Ch]:
2439 * src/frontends/xforms/FormPrint.[Ch]:
2440 * src/frontends/xforms/FormRef.[Ch]:
2441 * src/frontends/xforms/FormUrl.[Ch]: ditto
2443 * src/frontends/xforms/FormDocument.[Ch]:
2444 * src/frontends/xforms/forms/form_document.C.patch:
2445 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2446 pass through a single input() function.
2448 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2450 * lib/build-listerrors: return status as OK
2452 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2454 * lib/lyxrc.example: Updated to new export code
2456 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2458 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2461 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2464 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2465 LyX-Code is defined.
2466 * lib/layouts/amsbook.layout: ditto.
2468 * boost/Makefile.am: fix typo.
2470 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2472 (add_lastfiles): removed.
2473 (add_documents): removed.
2474 (add_formats): removed.
2476 * src/frontends/Menubar.C: remove useless "using" directive.
2478 * src/MenuBackend.h: add a new MenuItem constructor.
2480 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2483 2000-10-04 Allan Rae <rae@lyx.org>
2485 * lib/Makefile.am (listerrors):
2486 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2487 I haven't got notangle installed so Kayvan please test. The output
2488 should end up in $builddir. This also allows people who don't have
2489 noweb installed to complete the make process without error.
2491 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2492 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2493 by JMarc's picky compiler.
2495 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2498 * src/insets/insettabular.C (setPos): change for loop to not use
2499 sequencing operator. Please check this Jürgen.
2501 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2503 * src/insets/insetcite.C (getScreenLabel): ditto
2504 * src/support/filetools.C (QuoteName): ditto
2505 (ChangeExtension): ditto
2507 * src/BufferView_pimpl.C (scrollCB): make heigt int
2509 * src/BufferView2.C (insertInset): comment out unused arg
2511 * boost/Makefile.am (EXTRADIST): new variable
2513 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2515 * src/exporter.C (IsExportable): Fixed
2517 * lib/configure.m4: Small fix
2519 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2521 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2522 * src/insets/insetbib.C (bibitemWidest): ditto.
2523 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2525 2000-10-03 Juergen Vigna <jug@sad.it>
2527 * src/BufferView2.C (theLockingInset): removed const because of
2528 Agnus's compile problems.
2530 * src/insets/insettext.C (LocalDispatch): set the language of the
2531 surronding paragraph on inserting the first character.
2533 * various files: changed use of BufferView::the_locking_inset.
2535 * src/BufferView2.C (theLockingInset):
2536 (theLockingInset): new functions.
2538 * src/BufferView.h: removed the_locking_inset.
2540 * src/lyxtext.h: added the_locking_inset
2542 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2544 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2546 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2548 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2549 * src/mathed/math_cursor.C (IsAlpha): ditto.
2550 * src/mathed/math_inset.C (strnew): ditto.
2551 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2552 (IMetrics): cxp set but never used; removed.
2553 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2554 that the variable in question has been removed also!
2557 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2558 using the Buffer * passed to Latex(), using the BufferView * passed to
2559 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2561 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2562 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2564 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2565 * src/buffer.C (readInset): used new InsetBibtex c-tor
2566 * (getBibkeyList): used new InsetBibtex::getKeys
2568 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2571 * lib/build-listerrors
2573 * src/exporter.C: Add literate programming support to the export code
2576 * src/lyx_cb.C: Remove old literate code.
2578 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2581 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2582 * src/converter.C (View, Convert): Use QuoteName.
2584 * src/insets/figinset.C (Preview): Use Formats::View.
2586 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2588 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2590 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2591 the top of the function, because compaq cxx complains that the
2592 "goto exit_with_message" when the function is disabled bypasses
2594 (MenuNew): try a better fix for the generation of new file names.
2595 This time, I used AddName() instead of AddPath(), hoping Juergen
2598 2000-10-03 Allan Rae <rae@lyx.org>
2600 * src/frontends/xforms/forms/form_preferences.fd:
2601 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2602 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2603 "Look and Feel"->"General" but will need to be split up further into
2604 general output and general input tabs. Current plan is for four outer
2605 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2606 stuff; "Inputs" for input and import configuration; "Outputs" for
2607 output and export configuration; and one more whatever is left over
2608 called "General". The leftovers at present look like being which
2609 viewers to use, spellchecker, language support and might be better
2610 named "Support". I've put "Paths" in "Inputs" for the moment as this
2611 seems reasonable for now at least.
2612 One problem remains: X error kills LyX when you close Preferences.
2614 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2616 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2617 qualifier from form()
2618 * src/frontends/xforms/FormCitation.[Ch]:
2619 * src/frontends/xforms/FormCopyright.[Ch]:
2620 * src/frontends/xforms/FormDocument.[Ch]:
2621 * src/frontends/xforms/FormError.[Ch]:
2622 * src/frontends/xforms/FormIndex.[Ch]:
2623 * src/frontends/xforms/FormPreferences.[Ch]:
2624 * src/frontends/xforms/FormPrint.[Ch]:
2625 * src/frontends/xforms/FormRef.[Ch]:
2626 * src/frontends/xforms/FormToc.[Ch]:
2627 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2629 * src/frontends/xforms/FormCitation.[Ch]:
2630 * src/frontends/xforms/FormIndex.[Ch]:
2631 * src/frontends/xforms/FormRef.[Ch]:
2632 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2633 with Allan's naming policy
2635 * src/frontends/xforms/FormCitation.C: some static casts to remove
2638 2000-10-02 Juergen Vigna <jug@sad.it>
2640 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2641 now you can type or do stuff inside the table-cell also when in dummy
2642 position, fixed visible cursor.
2644 * src/insets/insettext.C (Edit): fixing cursor-view position.
2646 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2647 be used for equal functions in lyxfunc and insettext.
2649 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2651 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2653 * src/frontends/gnome/FormCitation.h:
2654 * src/frontends/gnome/FormCopyright.h:
2655 * src/frontends/gnome/FormIndex.h:
2656 * src/frontends/gnome/FormPrint.h:
2657 * src/frontends/gnome/FormToc.h:
2658 * src/frontends/gnome/FormUrl.h:
2659 * src/frontends/kde/FormCitation.h:
2660 * src/frontends/kde/FormCopyright.h:
2661 * src/frontends/kde/FormIndex.h:
2662 * src/frontends/kde/FormRef.h:
2663 * src/frontends/kde/FormToc.h:
2664 * src/frontends/kde/FormUrl.h: fix remaining users of
2667 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2669 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2670 from depth argument.
2671 (DocBookHandleCaption): ditto.
2672 (DocBookHandleFootnote): ditto.
2673 (SimpleDocBookOnePar): ditto.
2675 * src/frontends/xforms/FormDocument.h (form): remove extra
2676 FormDocument:: qualifier.
2678 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2680 * sigc++/handle.h: ditto.
2682 * src/lyx_gui_misc.C: add "using" directive.
2684 * src/cheaders/cstddef: new file, needed by the boost library (for
2687 2000-10-02 Juergen Vigna <jug@sad.it>
2689 * src/insets/insettext.C (SetFont): better support.
2691 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2693 * src/screen.C (DrawOneRow): some uint refixes!
2695 2000-10-02 Allan Rae <rae@lyx.org>
2697 * boost/.cvsignore: ignore Makefile as well
2699 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2700 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2702 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2703 Left this one out by accident.
2705 * src/frontends/xforms/FormBase.h (restore): default to calling
2706 update() since that will restore the original/currently-applied values.
2707 Any input() triggered error messages will require the derived classes
2708 to redefine restore().
2710 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2711 avoid a segfault. combo_doc_class is the main concern.
2713 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2715 * Simplify build-listerrors in view of GUI-less export ability!
2717 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2719 * src/lyx_main.C (easyParse): Disable gui when exporting
2721 * src/insets/figinset.C:
2724 * src/lyx_gui_misc.C
2725 * src/tabular.C: Changes to allow no-gui.
2727 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2729 * src/support/utility.hpp: removed file
2730 * src/support/block.h: removed file
2732 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2735 * src/mathed/formula.C: add support/lyxlib.h
2736 * src/mathed/formulamacro.C: ditto
2738 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2739 * src/lyxparagraph.h: ditto
2741 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2742 * src/frontends/Makefile.am (INCLUDES): ditto
2743 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2744 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2745 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2746 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2747 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2748 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2750 * src/BufferView.h: use boost/utility.hpp
2751 * src/LColor.h: ditto
2752 * src/LaTeX.h: ditto
2753 * src/LyXAction.h: ditto
2754 * src/LyXView.h: ditto
2755 * src/bufferlist.h: ditto
2756 * src/lastfiles.h: ditto
2757 * src/layout.h: ditto
2758 * src/lyx_gui.h: ditto
2759 * src/lyx_main.h: ditto
2760 * src/lyxlex.h: ditto
2761 * src/lyxrc.h: ditto
2762 * src/frontends/ButtonPolicies.h: ditto
2763 * src/frontends/Dialogs.h: ditto
2764 * src/frontends/xforms/FormBase.h: ditto
2765 * src/frontends/xforms/FormGraphics.h: ditto
2766 * src/frontends/xforms/FormParagraph.h: ditto
2767 * src/frontends/xforms/FormTabular.h: ditto
2768 * src/graphics/GraphicsCache.h: ditto
2769 * src/graphics/Renderer.h: ditto
2770 * src/insets/ExternalTemplate.h: ditto
2771 * src/insets/insetcommand.h: ditto
2772 * src/support/path.h: ditto
2774 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2775 and introduce clause for 2.97.
2777 * boost/libs/README: new file
2779 * boost/boost/utility.hpp: new file
2781 * boost/boost/config.hpp: new file
2783 * boost/boost/array.hpp: new file
2785 * boost/Makefile.am: new file
2787 * boost/.cvsignore: new file
2789 * configure.in (AC_OUTPUT): add boost/Makefile
2791 * Makefile.am (SUBDIRS): add boost
2793 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2795 * src/support/lstrings.C (suffixIs): Fixed.
2797 2000-10-01 Allan Rae <rae@lyx.org>
2799 * src/PrinterParams.h: moved things around to avoid the "can't
2800 inline call" warning.
2802 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2803 into doc++ documentation.
2805 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2807 * src/frontends/xforms/FormRef.C: make use of button controller
2808 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2809 cleaned up button controller usage.
2810 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2811 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2812 use the button controller
2814 * src/frontends/xforms/forms/*.fd: and associated generated files
2815 updated to reflect changes to FormBase. Some other FormXxxx files
2816 also got minor updates to reflect changes to FormBase.
2818 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2819 (hide): made virtual.
2820 (input): return a bool. true == valid input
2821 (RestoreCB, restore): new
2822 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2823 Changes to allow derived dialogs to use a ButtonController and
2824 make sense when doing so: OK button calls ok() and so on.
2826 * src/frontends/xforms/ButtonController.h (class ButtonController):
2827 Switch from template implementation to taking Policy parameter.
2828 Allows FormBase to provide a ButtonController for any dialog.
2830 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2831 Probably should rename connect and disconnect.
2832 (apply): use the radio button groups
2833 (form): needed by FormBase
2834 (build): setup the radio button groups
2836 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2838 * several files: type changes to reduce the number of warnings and
2839 to unify type hangling a bit. Still much to do.
2841 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2843 * lib/images/*: rename a bunch of icons to match Dekel converter
2846 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2849 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2851 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2853 * sigc++/handle.h: ditto for class Handle.
2855 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2857 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2859 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2861 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2862 removal of the "default" language.
2864 * src/combox.h (getline): Check that sel > 0
2866 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2868 * lib/examples/docbook_example.lyx
2869 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2871 * lib/layouts/docbook-book.layout: new docbook book layout.
2873 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2875 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2877 * src/insets/figinset.C (DocBook):fixed small typo.
2879 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2881 * src/insets/insetinclude.h: string include_label doesn't need to be
2884 2000-09-29 Allan Rae <rae@lyx.org>
2886 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2887 Allow derived type to control connection and disconnection from signals
2888 of its choice if desired.
2890 2000-09-28 Juergen Vigna <jug@sad.it>
2892 * src/insets/insettabular.C (update): fixed cursor setting when
2893 the_locking_inset changed.
2894 (draw): made this a bit cleaner.
2895 (InsetButtonPress): fixed!
2897 * various files: added LyXText Parameter to fitCursor call.
2899 * src/BufferView.C (fitCursor): added LyXText parameter.
2901 * src/insets/insettabular.C (draw): small draw fix.
2903 * src/tabular.C: right setting of left/right celllines.
2905 * src/tabular.[Ch]: fixed various types in funcions and structures.
2906 * src/insets/insettabular.C: ditto
2907 * src/frontends/xforms/FormTabular.C: ditto
2909 2000-09-28 Allan Rae <rae@lyx.org>
2911 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2912 that the #ifdef's had been applied to part of what should have been
2913 a complete condition. It's possible there are other tests that
2914 were specific to tables that are also wrong now that InsetTabular is
2915 being used. Now we need to fix the output of '\n' after a table in a
2916 float for the same reason as the original condition:
2917 "don't insert this if we would be adding it before or after a table
2918 in a float. This little trick is needed in order to allow use of
2919 tables in \subfigures or \subtables."
2920 Juergen can you check this?
2922 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2924 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2925 output to the ostream.
2927 * several files: fixed types based on warnings from cxx
2929 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2931 * src/frontends/kde/Makefile.am: fix rule for
2932 formindexdialogdata_moc.C
2934 * src/.cvsignore: add ext_l10n.h to ignore
2936 * acconfig.h: stop messing with __STRICT_ANSI__
2937 * config/gnome.m4: remove option to set -ansi
2938 * config/kde.m4: remove option to set -ansi
2939 * config/lyxinclude.m4: don't set -ansi
2941 2000-09-27 Juergen Vigna <jug@sad.it>
2943 * various files: remove "default" language check.
2945 * src/insets/insetquotes.C: removed use of current_view.
2947 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2948 the one should have red ears by now!
2950 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2951 in more then one paragraph. Fixed cursor-movement/selection.
2953 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2954 paragraphs inside a text inset.
2956 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2957 text-inset if this owner is an inset.
2959 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2961 * src/Bullet.h: changed type of font, character and size to int
2963 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2965 * src/insets/inseturl.[Ch]:
2966 * src/insets/insetref.[Ch]:
2967 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2969 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2971 * src/buffer.C (readFile): block-if statement rearranged to minimise
2972 bloat. Patch does not reverse Jean-Marc's change ;-)
2974 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2975 Class rewritten to store pointers to hide/update signals directly,
2976 rather than Dialogs *. Also defined an enum to ease use. All xforms
2977 forms can now be derived from this class.
2979 * src/frontends/xforms/FormCommand.[Ch]
2980 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2982 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2985 * src/frontends/xforms/forms/form_citation.fd
2986 * src/frontends/xforms/forms/form_copyright.fd
2987 * src/frontends/xforms/forms/form_error.fd
2988 * src/frontends/xforms/forms/form_index.fd
2989 * src/frontends/xforms/forms/form_ref.fd
2990 * src/frontends/xforms/forms/form_toc.fd
2991 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2993 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2995 * src/insets/insetfoot.C: removed redundent using directive.
2997 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2999 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3000 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3002 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3003 created in the constructors in different groups. Then set() just
3004 have to show the groups as needed. This fixes the redraw problems
3005 (and is how the old menu code worked).
3007 * src/support/lyxlib.h: declare the methods as static when we do
3008 not have namespaces.
3010 2000-09-26 Juergen Vigna <jug@sad.it>
3012 * src/buffer.C (asciiParagraph): new function.
3013 (writeFileAscii): new function with parameter ostream.
3014 (writeFileAscii): use now asciiParagraph.
3016 * various inset files: added the linelen parameter to the Ascii-func.
3018 * src/tabular.C (Write): fixed error in writing file introduced by
3019 the last changes from Lars.
3021 * lib/bind/menus.bind: removed not supported functions.
3023 * src/insets/insettext.C (Ascii): implemented this function.
3025 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3027 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3028 (Write): use of the write_attribute functions.
3030 * src/bufferlist.C (close): fixed reasking question!
3032 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3034 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3035 new files use the everwhere possible.
3038 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3039 src/log_form.C src/lyx.C:
3042 * src/buffer.C (runLaTeX): remove func
3044 * src/PaperLayout.C: removed file
3045 * src/ParagraphExtra.C: likewise
3046 * src/bullet_forms.C: likewise
3047 * src/bullet_forms.h: likewise
3048 * src/bullet_forms_cb.C: likewise
3050 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3051 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3054 * several files: remove all traces of the old fd_form_paragraph,
3055 and functions belonging to that.
3057 * several files: remove all traces of the old fd_form_document,
3058 and functions belonging to that.
3060 * several files: constify local variables were possible.
3062 * several files: remove all code that was dead when NEW_EXPORT was
3065 * several files: removed string::c_str in as many places as
3068 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3069 (e): be a bit more outspoken when patching
3070 (updatesrc): only move files if changed.
3072 * forms/layout_forms.h.patch: regenerated
3074 * forms/layout_forms.fd: remove form_document and form_paragraph
3075 and form_quotes and form_paper and form_table_options and
3076 form_paragraph_extra
3078 * forms/form1.fd: remove form_table
3080 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3081 the fdui->... rewrite. Update some comments to xforms 0.88
3083 * forms/bullet_forms.C.patch: removed file
3084 * forms/bullet_forms.fd: likewise
3085 * forms/bullet_forms.h.patch: likewise
3087 * development/Code_rules/Rules: added a section on switch
3088 statements. Updated some comment to xforms 0.88.
3090 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3092 * src/buffer.C (readFile): make sure that the whole version number
3093 is read after \lyxformat (even when it contains a comma)
3095 * lib/ui/default.ui: change shortcut of math menu to M-a.
3097 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3099 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3102 * src/LyXView.C (updateWindowTitle): show the full files name in
3103 window title, limited to 30 characters.
3105 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3106 When a number of characters has been given, we should not assume
3107 that the string is 0-terminated.
3109 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3110 calls (fixes some memory leaks)
3112 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3113 trans member on exit.
3115 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3117 * src/converter.C (GetReachable): fix typo.
3119 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3120 understand ',' instead of '.'.
3121 (GetInteger): rewrite to use strToInt().
3123 2000-09-26 Juergen Vigna <jug@sad.it>
3125 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3126 better visibility and error-message on wrong VSpace input.
3128 * src/language.C (initL): added english again.
3130 2000-09-25 Juergen Vigna <jug@sad.it>
3132 * src/frontends/kde/Dialogs.C (Dialogs):
3133 * src/frontends/gnome/Dialogs.C (Dialogs):
3134 * src/frontends/kde/Makefile.am:
3135 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3137 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3139 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3141 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3143 * src/frontends/xforms/FormParagraph.C:
3144 * src/frontends/xforms/FormParagraph.h:
3145 * src/frontends/xforms/form_paragraph.C:
3146 * src/frontends/xforms/form_paragraph.h:
3147 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3150 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3152 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3153 Paragraph-Data after use.
3155 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3156 non breakable paragraphs.
3158 2000-09-25 Garst R. Reese <reese@isn.net>
3160 * src/language.C (initL): added missing language_country codes.
3162 2000-09-25 Juergen Vigna <jug@sad.it>
3164 * src/insets/insettext.C (InsetText):
3165 (deleteLyXText): remove the not released LyXText structure!
3167 2000-09-24 Marko Vendelin <markov@ioc.ee>
3169 * src/frontends/gnome/mainapp.C
3170 * src/frontends/gnome/mainapp.h: added support for keyboard
3173 * src/frontends/gnome/FormCitation.C
3174 * src/frontends/gnome/FormCitation.h
3175 * src/frontends/gnome/Makefile.am
3176 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3177 FormCitation to use "action area" in mainapp window
3179 * src/frontends/gnome/Menubar_pimpl.C
3180 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3183 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3185 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3186 width/descent/ascent values if name is empty.
3187 (mathed_string_height): Use std::max.
3189 2000-09-25 Allan Rae <rae@lyx.org>
3191 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3192 segfault. This will be completely redesigned soon.
3194 * sigc++: updated libsigc++. Fixes struct timespec bug.
3196 * development/tools/makeLyXsigc.sh: .cvsignore addition
3198 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3200 * several files: removed almost all traces of the old table
3203 * src/TableLayout.C: removed file
3205 2000-09-22 Juergen Vigna <jug@sad.it>
3207 * src/frontends/kde/Dialogs.C: added credits forms.
3209 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3211 * src/frontends/gnome/Dialogs.C: added some forms.
3213 * src/spellchecker.C (init_spell_checker): set language in pspell code
3214 (RunSpellChecker): some modifications for setting language string.
3216 * src/language.[Ch]: added language_country code.
3218 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3220 * src/frontends/Dialogs.h: added new signal showError.
3221 Rearranged existing signals in some sort of alphabetical order.
3223 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3224 FormError.[Ch], form_error.[Ch]
3225 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3226 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3228 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3229 dialogs. I think that this can be used as the base to all these
3232 * src/frontends/xforms/FormError.[Ch]
3233 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3234 implementation of InsetError dialog.
3236 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3238 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3239 * src/frontends/kde/Makefile.am: ditto
3241 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3243 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3244 macrobf. This fixes a bug of invisible text.
3246 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3248 * lib/doc/LaTeXConfig.lyx.in: updated.
3250 * src/language.C (initL): remove language "francais" and change a
3251 bit the names of the two other french variations.
3253 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3254 string that may not be 0-terminated.
3256 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3258 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3260 2000-09-20 Marko Vendelin <markov@ioc.ee>
3262 * src/frontends/gnome/FormCitation.C
3263 * src/frontends/gnome/FormIndex.C
3264 * src/frontends/gnome/FormToc.C
3265 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3266 the variable initialization to shut up the warnings
3268 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3270 * src/table.[Ch]: deleted files
3272 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3275 2000-09-18 Juergen Vigna <jug@sad.it>
3277 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3278 problems with selection. Inserted new LFUN_PASTESELECTION.
3279 (InsetButtonPress): inserted handling of middle mouse-button paste.
3281 * src/spellchecker.C: changed word to word.c_str().
3283 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3285 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3286 included in the ``make dist'' tarball.
3288 2000-09-15 Juergen Vigna <jug@sad.it>
3290 * src/CutAndPaste.C (cutSelection): small fix return the right
3291 end position after cut inside one paragraph only.
3293 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3294 we are locked as otherwise we don't have a valid cursor position!
3296 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3298 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3300 * src/frontends/kde/FormRef.C: added using directive.
3301 * src/frontends/kde/FormToc.C: ditto
3303 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3305 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3307 2000-09-19 Marko Vendelin <markov@ioc.ee>
3309 * src/frontends/gnome/Menubar_pimpl.C
3310 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3311 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3313 * src/frontends/gnome/mainapp.C
3314 * src/frontends/gnome/mainapp.h: support for menu update used
3317 * src/frontends/gnome/mainapp.C
3318 * src/frontends/gnome/mainapp.h: support for "action" area in the
3319 main window. This area is used by small simple dialogs, such as
3322 * src/frontends/gnome/FormIndex.C
3323 * src/frontends/gnome/FormIndex.h
3324 * src/frontends/gnome/FormUrl.C
3325 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3328 * src/frontends/gnome/FormCitation.C
3329 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3330 action area. Only "Insert new citation" is implemented.
3332 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3334 * src/buffer.C (Dispatch): fix call to Dispatch
3335 * src/insets/insetref.C (Edit): likewise
3336 * src/insets/insetparent.C (Edit): likewise
3337 * src/insets/insetinclude.C (include_cb): likewise
3338 * src/frontends/xforms/FormUrl.C (apply): likewise
3339 * src/frontends/xforms/FormToc.C (apply): likewise
3340 * src/frontends/xforms/FormRef.C (apply): likewise
3341 * src/frontends/xforms/FormIndex.C (apply): likewise
3342 * src/frontends/xforms/FormCitation.C (apply): likewise
3343 * src/lyxserver.C (callback): likewise
3344 * src/lyxfunc.C (processKeySym): likewise
3345 (Dispatch): likewise
3346 (Dispatch): likewise
3347 * src/lyx_cb.C (LayoutsCB): likewise
3349 * Makefile.am (sourcedoc): small change
3351 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3353 * src/main.C (main): Don't make an empty GUIRunTime object. all
3354 methods are static. constify a bit remove unneded using + headers.
3356 * src/tabular.C: some more const to local vars move some loop vars
3358 * src/spellchecker.C: added some c_str after some word for pspell
3360 * src/frontends/GUIRunTime.h: add new static method setDefaults
3361 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3362 * src/frontends/kde/GUIRunTime.C (setDefaults):
3363 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3365 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3366 with strnew in arg, use correct emptystring when calling SetName.
3368 * several files: remove all commented code with relation to
3369 HAVE_SSTREAM beeing false. We now only support stringstream and
3372 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3374 * src/lyxfunc.C: construct correctly the automatic new file
3377 * src/text2.C (IsStringInText): change type of variable i to shut
3380 * src/support/sstream.h: do not use namespaces if the compiler
3381 does not support them.
3383 2000-09-15 Marko Vendelin <markov@ioc.ee>
3384 * src/frontends/gnome/FormCitation.C
3385 * src/frontends/gnome/FormCitation.h
3386 * src/frontends/gnome/diainsertcitation_interface.c
3387 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3388 regexp support to FormCitation [Gnome].
3390 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3393 * configure.in: remove unused KDE/GTKGUI define
3395 * src/frontends/kde/FormRef.C
3396 * src/frontends/kde/FormRef.h
3397 * src/frontends/kde/formrefdialog.C
3398 * src/frontends/kde/formrefdialog.h: double click will
3399 go to reference, now it is possible to change a cross-ref
3402 * src/frontends/kde/FormToc.C
3403 * src/frontends/kde/FormToc.h
3404 * src/frontends/kde/formtocdialog.C
3405 * src/frontends/kde/formtocdialog.h: add a depth
3408 * src/frontends/kde/Makefile.am: add QtLyXView.h
3411 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3413 * src/frontends/kde/FormCitation.h: added some using directives.
3415 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3417 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3420 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3423 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3425 * src/buffer.C (pop_tag): revert for the second time a change by
3426 Lars, who seems to really hate having non-local loop variables :)
3428 * src/Lsstream.h: add "using" statements.
3430 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3431 * src/buffer.C (writeFile): ditto
3433 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3435 * src/buffer.C (writeFile): try to fix the locale modified format
3436 number to always be as we want it.
3438 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3439 in XForms 0.89. C-space is now working again.
3441 * src/Lsstream.h src/support/sstream.h: new files.
3443 * also commented out all cases where strstream were used.
3445 * src/Bullet.h (c_str): remove method.
3447 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3449 * a lot of files: get rid of "char const *" and "char *" is as
3450 many places as possible. We only want to use them in interaction
3451 with system of other libraries, not inside lyx.
3453 * a lot of files: return const object is not of pod type. This
3454 helps ensure that temporary objects is not modified. And fits well
3455 with "programming by contract".
3457 * configure.in: check for the locale header too
3459 * Makefile.am (sourcedoc): new tag for generation of doc++
3462 2000-09-14 Juergen Vigna <jug@sad.it>
3464 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3465 callback to check which combo called it and do the right action.
3467 * src/combox.C (combo_cb): added combo * to the callbacks.
3468 (Hide): moved call of callback after Ungrab of the pointer.
3470 * src/intl.h: removed LCombo2 function.
3472 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3473 function as this can now be handled in one function.
3475 * src/combox.h: added Combox * to callback prototype.
3477 * src/frontends/xforms/Toolbar_pimpl.C:
3478 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3480 2000-09-14 Garst Reese <reese@isn.net>
3482 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3483 moved usepackage{xxx}'s to beginning of file. Changed left margin
3484 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3485 underlining from title. Thanks to John Culleton for useful suggestions.
3487 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3489 * src/lyxlex_pimpl.C (setFile): change error message to debug
3492 2000-09-13 Juergen Vigna <jug@sad.it>
3494 * src/frontends/xforms/FormDocument.C: implemented choice_class
3495 as combox and give callback to combo_language so OK/Apply is activated
3498 * src/bufferlist.C (newFile): small fix so already named files
3499 (via an open call) are not requested to be named again on the
3502 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3504 * src/frontends/kde/Makefile.am
3505 * src/frontends/kde/FormRef.C
3506 * src/frontends/kde/FormRef.h
3507 * src/frontends/kde/formrefdialog.C
3508 * src/frontends/kde/formrefdialog.h: implement
3511 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3513 * src/frontends/kde/formtocdialog.C
3514 * src/frontends/kde/formtocdialog.h
3515 * src/frontends/kde/FormToc.C
3516 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3518 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3520 * src/frontends/kde/FormCitation.C: fix thinko
3521 where we didn't always display the reference text
3524 * src/frontends/kde/formurldialog.C
3525 * src/frontends/kde/formurldialog.h
3526 * src/frontends/kde/FormUrl.C
3527 * src/frontends/kde/FormUrl.h: minor cleanups
3529 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3531 * src/frontends/kde/Makefile.am
3532 * src/frontends/kde/FormToc.C
3533 * src/frontends/kde/FormToc.h
3534 * src/frontends/kde/FormCitation.C
3535 * src/frontends/kde/FormCitation.h
3536 * src/frontends/kde/FormIndex.C
3537 * src/frontends/kde/FormIndex.h
3538 * src/frontends/kde/formtocdialog.C
3539 * src/frontends/kde/formtocdialog.h
3540 * src/frontends/kde/formcitationdialog.C
3541 * src/frontends/kde/formcitationdialog.h
3542 * src/frontends/kde/formindexdialog.C
3543 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3545 2000-09-12 Juergen Vigna <jug@sad.it>
3547 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3550 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3552 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3555 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3557 * src/converter.C (Add, Convert): Added support for converter flags:
3558 needaux, resultdir, resultfile.
3559 (Convert): Added new parameter view_file.
3560 (dvips_options): Fixed letter paper option.
3562 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3563 (Export, GetExportableFormats, GetViewableFormats): Added support
3566 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3568 (easyParse): Fixed to work with new export code.
3570 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3573 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3575 * lib/bind/*.bind: Replaced
3576 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3577 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3579 2000-09-11 Juergen Vigna <jug@sad.it>
3581 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3583 * src/main.C (main): now GUII defines global guiruntime!
3585 * src/frontends/gnome/GUIRunTime.C (initApplication):
3586 * src/frontends/kde/GUIRunTime.C (initApplication):
3587 * src/frontends/xforms/GUIRunTime.C (initApplication):
3588 * src/frontends/GUIRunTime.h: added new function initApplication.
3590 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3592 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3594 2000-09-08 Juergen Vigna <jug@sad.it>
3596 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3597 we have already "Reset".
3599 * src/language.C (initL): inserted "default" language and made this
3600 THE default language (and not american!)
3602 * src/paragraph.C: inserted handling of "default" language!
3604 * src/lyxfont.C: ditto
3608 * src/paragraph.C: output the \\par only if we have a following
3609 paragraph otherwise it's not needed.
3611 2000-09-05 Juergen Vigna <jug@sad.it>
3613 * config/pspell.m4: added entry to lyx-flags
3615 * src/spellchecker.C: modified version from Kevin for using pspell
3617 2000-09-01 Marko Vendelin <markov@ioc.ee>
3618 * src/frontends/gnome/Makefile.am
3619 * src/frontends/gnome/FormCitation.C
3620 * src/frontends/gnome/FormCitation.h
3621 * src/frontends/gnome/diainsertcitation_callbacks.c
3622 * src/frontends/gnome/diainsertcitation_callbacks.h
3623 * src/frontends/gnome/diainsertcitation_interface.c
3624 * src/frontends/gnome/diainsertcitation_interface.h
3625 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3626 dialog for Gnome frontend
3628 * src/main.C: Gnome libraries require keeping application name
3629 and its version as strings
3631 * src/frontends/gnome/mainapp.C: Change the name of the main window
3632 from GnomeLyX to PACKAGE
3634 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3636 * src/frontends/Liason.C: add "using: declaration.
3638 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3640 * src/mathed/math_macro.C (Metrics): Set the size of the template
3642 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3644 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3646 * src/converter.C (add_options): New function.
3647 (SetViewer): Change $$FName into '$$FName'.
3648 (View): Add options when running xdvi
3649 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3650 (Convert): The 3rd parameter is now the desired filename. Converts
3651 calls to lyx::rename if necessary.
3652 Add options when running dvips.
3653 (dvi_papersize,dvips_options): New methods.
3655 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3657 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3658 using a call to Converter::dvips_options.
3659 Fixed to work with nex export code.
3661 * src/support/copy.C
3662 * src/support/rename.C: New files
3664 * src/support/syscall.h
3665 * src/support/syscall.C: Added Starttype SystemDontWait.
3667 * lib/ui/default.ui: Changed to work with new export code
3669 * lib/configure.m4: Changed to work with new export code
3671 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3673 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3675 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3676 so that code compiles with DEC cxx.
3678 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3679 to work correctly! Also now supports the additional elements
3682 2000-09-01 Allan Rae <rae@lyx.org>
3684 * src/frontends/ButtonPolicies.C: renamed all the references to
3685 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3687 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3688 since it's a const not a type.
3690 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3692 2000-08-31 Juergen Vigna <jug@sad.it>
3694 * src/insets/figinset.C: Various changes to look if the filename has
3695 an extension and if not add it for inline previewing.
3697 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3699 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3700 make buttonStatus and isReadOnly be const methods. (also reflect
3701 this in derived classes.)
3703 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3704 (nextState): change to be static inline, pass the StateMachine as
3706 (PreferencesPolicy): remove casts
3707 (OkCancelPolicy): remvoe casts
3708 (OkCancelReadOnlyPolicy): remove casts
3709 (NoRepeatedApplyReadOnlyPolicy): remove casts
3710 (OkApplyCancelReadOnlyPolicy): remove casts
3711 (OkApplyCancelPolicy): remove casts
3712 (NoRepeatedApplyPolicy): remove casts
3714 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3716 * src/converter.C: added some using directives
3718 * src/frontends/ButtonPolicies.C: changes to overcome
3719 "need lvalue" error with DEC c++
3721 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3722 to WMHideCB for DEC c++
3724 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3726 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3727 to BulletBMTableCB for DEC c++
3729 2000-08-31 Allan Rae <rae@lyx.org>
3731 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3732 character dialog separately from old document dialogs combo_language.
3735 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3737 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3738 Removed LFUN_REF_CREATE.
3740 * src/MenuBackend.C: Added new tags: toc and references
3742 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3743 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3745 (add_toc, add_references): New methods.
3746 (create_submenu): Handle correctly the case when there is a
3747 seperator after optional menu items.
3749 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3750 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3751 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3753 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3755 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3757 * src/converter.[Ch]: New file for converting between different
3760 * src/export.[Ch]: New file for exporting a LyX file to different
3763 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3764 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3765 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3766 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3767 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3768 RunDocBook, MenuExport.
3770 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3771 Exporter::Preview methods if NEW_EXPORT is defined.
3773 * src/buffer.C (Dispatch): Use Exporter::Export.
3775 * src/lyxrc.C: Added new tags: \converter and \viewer.
3778 * src/LyXAction.C: Define new lyx-function: buffer-update.
3779 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3780 when NEW_EXPORT is defined.
3782 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3784 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3786 * lib/ui/default.ui: Added submenus "view" and "update" to the
3789 * src/filetools.C (GetExtension): New function.
3791 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3793 2000-08-29 Allan Rae <rae@lyx.org>
3795 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3797 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3798 (EnableDocumentLayout): removed
3799 (DisableDocumentLayout): removed
3800 (build): make use of ButtonController's read-only handling to
3801 de/activate various objects. Replaces both of the above functions.
3803 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3804 (readOnly): was read_only
3805 (refresh): fixed dumb mistakes with read_only_ handling
3807 * src/frontends/xforms/forms/form_document.fd:
3808 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3809 tabbed dialogs so the tabs look more like tabs and so its easier to
3810 work out which is the current tab.
3812 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3813 segfault with form_table
3815 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3817 2000-08-28 Juergen Vigna <jug@sad.it>
3819 * acconfig.h: added USE_PSPELL.
3821 * src/config.h.in: added USE_PSPELL.
3823 * autogen.sh: added pspell.m4
3825 * config/pspell.m4: new file.
3827 * src/spellchecker.C: implemented support for pspell libary.
3829 2000-08-25 Juergen Vigna <jug@sad.it>
3831 * src/LyXAction.C (init): renamed LFUN_TABLE to
3832 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3834 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3836 * src/lyxscreen.h: add force_clear variable and fuction to force
3837 a clear area when redrawing in LyXText.
3839 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3841 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3843 * some whitespace and comment changes.
3845 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3847 * src/buffer.C: up te LYX_FORMAT to 2.17
3849 2000-08-23 Juergen Vigna <jug@sad.it>
3851 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3854 * src/insets/insettabular.C (pasteSelection): delete the insets
3855 LyXText as it is not valid anymore.
3856 (copySelection): new function.
3857 (pasteSelection): new function.
3858 (cutSelection): new function.
3859 (LocalDispatch): implemented cut/copy/paste of cell selections.
3861 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3862 don't have a LyXText.
3864 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3866 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3869 2000-08-22 Juergen Vigna <jug@sad.it>
3871 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3872 ifdef form_table out if NEW_TABULAR.
3874 2000-08-21 Juergen Vigna <jug@sad.it>
3876 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3877 (draw): fixed draw position so that the cursor is positioned in the
3879 (InsetMotionNotify): hide/show cursor so the position is updated.
3880 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3881 using cellstart() function where it should be used.
3883 * src/insets/insettext.C (draw): ditto.
3885 * src/tabular.C: fixed initialization of some missing variables and
3886 made BoxType into an enum.
3888 2000-08-22 Marko Vendelin <markov@ioc.ee>
3889 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3890 stock menu item using action numerical value, not its string
3894 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3896 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3897 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3899 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3901 * src/frontends/xforms/GUIRunTime.C: new file
3903 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3904 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3906 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3908 * src/frontends/kde/GUIRunTime.C: new file
3910 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3911 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3913 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3915 * src/frontends/gnome/GUIRunTime.C: new file
3917 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3920 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3921 small change to documetentation.
3923 * src/frontends/GUIRunTime.C: removed file
3925 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3927 * src/lyxparagraph.h: enable NEW_TABULAR as default
3929 * src/lyxfunc.C (processKeySym): remove some commented code
3931 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3932 NEW_TABULAR around the fd_form_table_options.
3934 * src/lyx_gui.C (runTime): call the static member function as
3935 GUIRunTime::runTime().
3937 2000-08-21 Allan Rae <rae@lyx.org>
3939 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3942 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3944 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3946 2000-08-21 Allan Rae <rae@lyx.org>
3948 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3949 keep Garst happy ;-)
3950 * src/frontends/xforms/FormPreferences.C (build): use setOK
3951 * src/frontends/xforms/FormDocument.C (build): use setOK
3952 (FormDocument): use the appropriate policy.
3954 2000-08-21 Allan Rae <rae@lyx.org>
3956 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3957 automatic [de]activation of arbitrary objects when in a read-only state.
3959 * src/frontends/ButtonPolicies.h: More documentation
3960 (isReadOnly): added to support the above.
3962 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3964 2000-08-18 Juergen Vigna <jug@sad.it>
3966 * src/insets/insettabular.C (getStatus): changed to return func_status.
3968 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3969 display toggle menu entries if they are.
3971 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3972 new document layout now.
3974 * src/lyxfunc.C: ditto
3976 * src/lyx_gui_misc.C: ditto
3978 * src/lyx_gui.C: ditto
3980 * lib/ui/default.ui: removed paper and quotes layout as they are now
3981 all in the document layout tabbed folder.
3983 * src/frontends/xforms/forms/form_document.fd: added Restore
3984 button and callbacks for all inputs for Allan's ButtonPolicy.
3986 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3987 (CheckChoiceClass): added missing params setting on class change.
3988 (UpdateLayoutDocument): added for updating the layout on params.
3989 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3990 (FormDocument): Implemented Allan's ButtonPolicy with the
3993 2000-08-17 Allan Rae <rae@lyx.org>
3995 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3996 so we can at least see the credits again.
3998 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3999 controller calls for the appropriate callbacks. Note that since Ok
4000 calls apply followed by cancel, and apply isn't a valid input for the
4001 APPLIED state, the bc_ calls have to be made in the static callback not
4002 within each of the real callbacks.
4004 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4005 (setOk): renamed from setOkay()
4007 2000-08-17 Juergen Vigna <jug@sad.it>
4009 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4010 in the implementation part.
4011 (composeUIInfo): don't show optional menu-items.
4013 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4015 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4017 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4018 text-state when in a text-inset.
4020 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4022 2000-08-17 Marko Vendelin <markov@ioc.ee>
4023 * src/frontends/gnome/FormIndex.C
4024 * src/frontends/gnome/FormIndex.h
4025 * src/frontends/gnome/FormToc.C
4026 * src/frontends/gnome/FormToc.h
4027 * src/frontends/gnome/dialogs
4028 * src/frontends/gnome/diatoc_callbacks.c
4029 * src/frontends/gnome/diatoc_callbacks.h
4030 * src/frontends/gnome/diainsertindex_callbacks.h
4031 * src/frontends/gnome/diainsertindex_callbacks.c
4032 * src/frontends/gnome/diainsertindex_interface.c
4033 * src/frontends/gnome/diainsertindex_interface.h
4034 * src/frontends/gnome/diatoc_interface.h
4035 * src/frontends/gnome/diatoc_interface.c
4036 * src/frontends/gnome/Makefile.am: Table of Contents and
4037 Insert Index dialogs implementation for Gnome frontend
4039 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4041 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4043 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4046 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4048 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4049 destructor. Don't definde if you don't need it
4050 (processEvents): made static, non-blocking events processing for
4052 (runTime): static method. event loop for xforms
4053 * similar as above for kde and gnome.
4055 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4056 new Pimpl is correct
4057 (runTime): new method calss the real frontends runtime func.
4059 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4061 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4063 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4065 2000-08-16 Juergen Vigna <jug@sad.it>
4067 * src/lyx_gui.C (runTime): added GUII RunTime support.
4069 * src/frontends/Makefile.am:
4070 * src/frontends/GUIRunTime.[Ch]:
4071 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4072 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4073 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4075 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4077 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4078 as this is already set in ${FRONTEND_INCLUDE} if needed.
4080 * configure.in (CPPFLAGS): setting the include dir for the frontend
4081 directory and don't set FRONTEND=xforms for now as this is executed
4084 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4086 * src/frontends/kde/Makefile.am:
4087 * src/frontends/kde/FormUrl.C:
4088 * src/frontends/kde/FormUrl.h:
4089 * src/frontends/kde/formurldialog.h:
4090 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4092 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4094 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4096 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4098 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4101 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4103 * src/WorkArea.C (work_area_handler): more work to get te
4104 FL_KEYBOARD to work with xforms 0.88 too, please test.
4106 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4108 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4110 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4113 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4115 * src/Timeout.h: remove Qt::emit hack.
4117 * several files: changes to allo doc++ compilation
4119 * src/lyxfunc.C (processKeySym): new method
4120 (processKeyEvent): comment out if FL_REVISION < 89
4122 * src/WorkArea.C: change some debugging levels.
4123 (WorkArea): set wantkey to FL_KEY_ALL
4124 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4125 clearer code and the use of compose with XForms 0.89. Change to
4126 use signals instead of calling methods in bufferview directly.
4128 * src/Painter.C: change some debugging levels.
4130 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4133 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4134 (workAreaKeyPress): new method
4136 2000-08-14 Juergen Vigna <jug@sad.it>
4138 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4140 * config/kde.m4: addes some features
4142 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4143 include missing xforms dialogs.
4145 * src/Timeout.h: a hack to be able to compile with qt/kde.
4147 * sigc++/.cvsignore: added acinclude.m4
4149 * lib/.cvsignore: added listerros
4151 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4152 xforms tree as objects are needed for other frontends.
4154 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4155 linking with not yet implemented xforms objects.
4157 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4159 2000-08-14 Baruch Even <baruch.even@writeme.com>
4161 * src/frontends/xforms/FormGraphics.h:
4162 * src/frontends/xforms/FormGraphics.C:
4163 * src/frontends/xforms/RadioButtonGroup.h:
4164 * src/frontends/xforms/RadioButtonGroup.C:
4165 * src/insets/insetgraphics.h:
4166 * src/insets/insetgraphics.C:
4167 * src/insets/insetgraphicsParams.h:
4168 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4169 instead of spaces, and various other indentation issues to make the
4170 sources more consistent.
4172 2000-08-14 Marko Vendelin <markov@ioc.ee>
4174 * src/frontends/gnome/dialogs/diaprint.glade
4175 * src/frontends/gnome/FormPrint.C
4176 * src/frontends/gnome/FormPrint.h
4177 * src/frontends/gnome/diaprint_callbacks.c
4178 * src/frontends/gnome/diaprint_callbacks.h
4179 * src/frontends/gnome/diaprint_interface.c
4180 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4183 * src/frontends/gnome/dialogs/diainserturl.glade
4184 * src/frontends/gnome/FormUrl.C
4185 * src/frontends/gnome/FormUrl.h
4186 * src/frontends/gnome/diainserturl_callbacks.c
4187 * src/frontends/gnome/diainserturl_callbacks.h
4188 * src/frontends/gnome/diainserturl_interface.c
4189 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4190 Gnome implementation
4192 * src/frontends/gnome/Dialogs.C
4193 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4194 all other dialogs. Copy all unimplemented dialogs from Xforms
4197 * src/frontends/gnome/support.c
4198 * src/frontends/gnome/support.h: support files generated by Glade
4202 * config/gnome.m4: Gnome configuration scripts
4204 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4205 configure --help message
4207 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4208 only if there are no events pendling in Gnome/Gtk. This enhances
4209 the performance of menus.
4212 2000-08-14 Allan Rae <rae@lyx.org>
4214 * lib/Makefile.am: listerrors cleaning
4216 * lib/listerrors: removed -- generated file
4217 * acinclude.m4: ditto
4218 * sigc++/acinclude.m4: ditto
4220 * src/frontends/xforms/forms/form_citation.fd:
4221 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4224 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4225 `updatesrc` and now we have a `test` target that does what `updatesrc`
4226 used to do. I didn't like having an install target that wasn't related
4229 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4230 on all except FormGraphics. This may yet happen. Followed by a major
4231 cleanup including using FL_TRANSIENT for most of the dialogs. More
4232 changes to come when the ButtonController below is introduced.
4234 * src/frontends/xforms/ButtonController.h: New file for managing up to
4235 four buttons on a dialog according to an externally defined policy.
4236 * src/frontends/xforms/Makefile.am: added above
4238 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4239 Apply and Cancel/Close buttons and everything in between and beyond.
4240 * src/frontends/Makefile.am: added above.
4242 * src/frontends/xforms/forms/form_preferences.fd:
4243 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4244 and removed variable 'status' as a result. Fixed the set_minsize thing.
4245 Use the new screen-font-update after checking screen fonts were changed
4246 Added a "Restore" button to restore the original lyxrc values while
4247 editing. This restores everything not just the last input changed.
4248 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4250 * src/LyXAction.C: screen-font-update added for updating buffers after
4251 screen font settings have been changed.
4252 * src/commandtags.h: ditto
4253 * src/lyxfunc.C: ditto
4255 * forms/lyx.fd: removed screen fonts dialog.
4256 * src/lyx_gui.C: ditto
4257 * src/menus.[Ch]: ditto
4258 * src/lyx.[Ch]: ditto
4259 * src/lyx_cb.C: ditto + code from here moved to make
4260 screen-font-update. And people wonder why progress on GUII is
4261 slow. Look at how scattered this stuff was! It takes forever
4264 * forms/fdfix.sh: Fixup the spacing after commas.
4265 * forms/makefile: Remove date from generated files. Fewer clashes now.
4266 * forms/bullet_forms.C.patch: included someones handwritten changes
4268 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4269 once I've discovered why LyXRC was made noncopyable.
4270 * src/lyx_main.C: ditto
4272 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4274 * src/frontends/xforms/forms/fdfix.sh:
4275 * src/frontends/xforms/forms/fdfixh.sed:
4276 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4277 * src/frontends/xforms/Form*.[hC]:
4278 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4279 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4280 provide a destructor for the struct FD_form_xxxx. Another version of
4281 the set_[max|min]size workaround and a few other cleanups. Actually,
4282 Angus' patch from 20000809.
4284 2000-08-13 Baruch Even <baruch.even@writeme.com>
4286 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4289 2000-08-11 Juergen Vigna <jug@sad.it>
4291 * src/insets/insetgraphics.C (InsetGraphics): changing init
4292 order because of warnings.
4294 * src/frontends/xforms/forms/makefile: adding patching .C with
4297 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4298 from .C.patch to .c.patch
4300 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4301 order because of warning.
4303 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4305 * src/frontends/Liason.C (setMinibuffer): new helper function
4307 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4309 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4311 * lib/ui/default.ui: commented out PaperLayout entry
4313 * src/frontends/xforms/form_document.[Ch]: new added files
4315 * src/frontends/xforms/FormDocument.[Ch]: ditto
4317 * src/frontends/xforms/forms/form_document.fd: ditto
4319 * src/frontends/xforms/forms/form_document.C.patch: ditto
4321 2000-08-10 Juergen Vigna <jug@sad.it>
4323 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4324 (InsetGraphics): initialized cacheHandle to 0.
4325 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4327 2000-08-10 Baruch Even <baruch.even@writeme.com>
4329 * src/graphics/GraphicsCache.h:
4330 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4331 correctly as a cache.
4333 * src/graphics/GraphicsCacheItem.h:
4334 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4337 * src/graphics/GraphicsCacheItem_pimpl.h:
4338 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4341 * src/insets/insetgraphics.h:
4342 * src/insets/insetgraphics.C: Changed from using a signal notification
4343 to polling when image is not loaded.
4345 2000-08-10 Allan Rae <rae@lyx.org>
4347 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4348 that there are two functions that have to been taken out of line by
4349 hand and aren't taken care of in the script. (Just a reminder note)
4351 * sigc++/macros/*.h.m4: Updated as above.
4353 2000-08-09 Juergen Vigna <jug@sad.it>
4355 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4357 * src/insets/insettabular.C: make drawing of single cell smarter.
4359 2000-08-09 Marko Vendelin <markov@ioc.ee>
4360 * src/frontends/gnome/Menubar_pimpl.C
4361 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4362 implementation: new files
4364 * src/frontends/gnome/mainapp.C
4365 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4368 * src/main.C: create Gnome main window
4370 * src/frontends/xforms/Menubar_pimpl.h
4371 * src/frontends/Menubar.C
4372 * src/frontends/Menubar.h: added method Menubar::update that calls
4373 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4375 * src/LyXView.C: calls Menubar::update to update the state
4378 * src/frontends/gnome/Makefile.am: added new files
4380 * src/frontends/Makefile.am: added frontend compiler options
4382 2000-08-08 Juergen Vigna <jug@sad.it>
4384 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4386 * src/bufferlist.C (close):
4387 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4388 documents if exiting without saving.
4390 * src/buffer.C (save): use removeAutosaveFile()
4392 * src/support/filetools.C (removeAutosaveFile): new function.
4394 * src/lyx_cb.C (MenuWrite): returns a bool now.
4395 (MenuWriteAs): check if file could really be saved and revert to the
4397 (MenuWriteAs): removing old autosavefile if existant.
4399 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4400 before Goto toggle declaration, because of compiler warning.
4402 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4404 * src/lyxfunc.C (MenuNew): small fix.
4406 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4408 * src/bufferlist.C (newFile):
4409 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4411 * src/lyxrc.C: added new_ask_filename tag
4413 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4415 * src/lyx.fd: removed code pertaining to form_ref
4416 * src/lyx.[Ch]: ditto
4417 * src/lyx_cb.C: ditto
4418 * src/lyx_gui.C: ditto
4419 * src/lyx_gui_misc.C: ditto
4421 * src/BufferView_pimpl.C (restorePosition): update buffer only
4424 * src/commandtags.h (LFUN_REFTOGGLE): removed
4425 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4426 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4427 (LFUN_REFBACK): renamed LFUN_REF_BACK
4429 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4430 * src/menus.C: ditto
4431 * src/lyxfunc.C (Dispatch): ditto.
4432 InsertRef dialog is now GUI-independent.
4434 * src/texrow.C: added using std::endl;
4436 * src/insets/insetref.[Ch]: strip out large amounts of code.
4437 The inset is now a container and this functionality is now
4438 managed by a new FormRef dialog
4440 * src/frontends/Dialogs.h (showRef, createRef): new signals
4442 * src/frontends/xforms/FormIndex.[Ch],
4443 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4444 when setting dialog's min/max size
4445 * src/frontends/xforms/FormIndex.[Ch]: ditto
4447 * src/frontends/xforms/FormRef.[Ch],
4448 src/frontends/xforms/forms/form_ref.fd: new xforms
4449 implementation of an InsetRef dialog
4451 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4454 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4455 ios::nocreate is not part of the standard. Removed.
4457 2000-08-07 Baruch Even <baruch.even@writeme.com>
4459 * src/graphics/Renderer.h:
4460 * src/graphics/Renderer.C: Added base class for rendering of different
4461 image formats into Pixmaps.
4463 * src/graphics/XPM_Renderer.h:
4464 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4465 in a different class.
4467 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4468 easily add support for other formats.
4470 * src/insets/figinset.C: plugged a leak of an X resource.
4472 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4474 * src/CutAndPaste.[Ch]: make all metods static.
4476 * development/Code_rules/Rules: more work, added section on
4477 Exceptions, and a References section.
4479 * a lot of header files: work to make doc++ able to generate the
4480 source documentation, some workarounds of doc++ problems. Doc++ is
4481 now able to generate the documentation.
4483 2000-08-07 Juergen Vigna <jug@sad.it>
4485 * src/insets/insettabular.C (recomputeTextInsets): removed function
4487 * src/tabular.C (SetWidthOfMulticolCell):
4489 (calculate_width_of_column_NMC): fixed return value so that it really
4490 only returns true if the column-width has changed (there where
4491 problems with muliticolumn-cells in this column).
4493 2000-08-04 Juergen Vigna <jug@sad.it>
4495 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4496 also on the scrollstatus of the inset.
4497 (workAreaMotionNotify): ditto.
4499 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4501 2000-08-01 Juergen Vigna <jug@sad.it>
4503 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4505 * src/commandtags.h:
4506 * src/LyXAction.C (init):
4507 * src/insets/inset.C (LocalDispatch): added support for
4510 * src/insets/inset.C (scroll): new functions.
4512 * src/insets/insettext.C (removeNewlines): new function.
4513 (SetAutoBreakRows): removes forced newlines in the text of the
4514 paragraph if autoBreakRows is set to false.
4516 * src/tabular.C (Latex): generates a parbox around the cell contents
4519 * src/frontends/xforms/FormTabular.C (local_update): removed
4520 the radio_useparbox button.
4522 * src/tabular.C (UseParbox): new function
4524 2000-08-06 Baruch Even <baruch.even@writeme.com>
4526 * src/graphics/GraphicsCache.h:
4527 * src/graphics/GraphicsCache.C:
4528 * src/graphics/GraphicsCacheItem.h:
4529 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4532 * src/insets/insetgraphics.h:
4533 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4534 and the drawing of the inline image.
4536 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4537 loaded into the wrong position.
4539 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4542 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4544 * src/support/translator.h: move all typedefs to public section
4546 * src/support/filetools.C (MakeLatexName): return string const
4548 (TmpFileName): ditto
4549 (FileOpenSearch): ditto
4551 (LibFileSearch): ditto
4552 (i18nLibFileSearch): ditto
4555 (CreateTmpDir): ditto
4556 (CreateBufferTmpDir): ditto
4557 (CreateLyXTmpDir): ditto
4560 (MakeAbsPath): ditto
4562 (OnlyFilename): ditto
4564 (NormalizePath): ditto
4565 (CleanupPath): ditto
4566 (GetFileContents): ditto
4567 (ReplaceEnvironmentPath): ditto
4568 (MakeRelPath): ditto
4570 (ChangeExtension): ditto
4571 (MakeDisplayPath): ditto
4572 (do_popen): return cmdret const
4573 (findtexfile): return string const
4575 * src/support/DebugStream.h: add some /// to please doc++
4577 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4579 * src/texrow.C (same_rownumber): functor to use with find_if
4580 (getIdFromRow): rewritten to use find_if and to not update the
4581 positions. return true if row is found
4582 (increasePos): new method, use to update positions
4584 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4586 * src/lyxlex_pimpl.C (verifyTable): new method
4589 (GetString): return string const
4590 (pushTable): rewrite to use std::stack
4592 (setFile): better check
4595 * src/lyxlex.h: make LyXLex noncopyable
4597 * src/lyxlex.C (text): return char const * const
4598 (GetString): return string const
4599 (getLongString): return string const
4601 * src/lyx_gui_misc.C (askForText): return pair<...> const
4603 * src/lastfiles.[Ch] (operator): return string const
4605 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4606 istringstream not char const *.
4607 move token.end() out of loop.
4608 (readFile): move initializaton of token
4610 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4611 getIdFromRow is successful.
4613 * lib/bind/emacs.bind: don't include menus bind
4615 * development/Code_rules/Rules: the beginnings of making this
4616 better and covering more of the unwritten rules that we have.
4618 * development/Code_rules/Recommendations: a couple of wording
4621 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4623 * src/support/strerror.c: remove C++ comment.
4625 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4627 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4628 LFUN_INDEX_INSERT_LAST
4630 * src/texrow.C (getIdFromRow): changed from const_iterator to
4631 iterator, allowing code to compile with DEC cxx
4633 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4634 stores part of the class, as suggested by Allan. Will allow
4636 (apply): test to apply uses InsetCommandParams operator!=
4638 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4639 (apply): test to apply uses InsetCommandParams operator!=
4641 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4642 stores part of the class.
4643 (update): removed limits on min/max size.
4645 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4646 (apply): test to apply uses InsetCommandParams operator!=
4648 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4649 (Read, Write, scanCommand, getCommand): moved functionality
4650 into InsetCommandParams.
4652 (getScreenLabel): made pure virtual
4653 new InsetCommandParams operators== and !=
4655 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4656 c-tors based on InsetCommandParams. Removed others.
4657 * src/insets/insetinclude.[Ch]: ditto
4658 * src/insets/insetlabel.[Ch]: ditto
4659 * src/insets/insetparent.[Ch]: ditto
4660 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4662 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4663 insets derived from InsetCommand created using similar c-tors
4664 based on InsetCommandParams
4665 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4666 * src/menus.C (ShowRefsMenu): ditto
4667 * src/paragraph.C (Clone): ditto
4668 * src/text2.C (SetCounter): ditto
4669 * src/lyxfunc.C (Dispatch) ditto
4670 Also recreated old InsetIndex behaviour exactly. Can now
4671 index-insert at the start of a paragraph and index-insert-last
4672 without launching the pop-up.
4674 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4676 * lib/lyxrc.example: mark te pdf options as non functional.
4678 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4679 (isStrDbl): move tmpstr.end() out of loop.
4680 (strToDbl): move intialization of tmpstr
4681 (lowercase): return string const and move tmp.end() out of loop.
4682 (uppercase): return string const and move tmp.edn() out of loop.
4683 (prefixIs): add assertion
4688 (containsOnly): ditto
4689 (containsOnly): ditto
4690 (containsOnly): ditto
4691 (countChar): make last arg char not char const
4692 (token): return string const
4693 (subst): return string const, move tmp.end() out of loop.
4694 (subst): return string const, add assertion
4695 (strip): return string const
4696 (frontStrip): return string const, add assertion
4697 (frontStrip): return string const
4702 * src/support/lstrings.C: add inclde "LAssert.h"
4703 (isStrInt): move tmpstr.end() out of loop.
4705 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4706 toollist.end() out of loop.
4707 (deactivate): move toollist.end() out of loop.
4708 (update): move toollist.end() out of loop.
4709 (updateLayoutList): move tc.end() out of loop.
4710 (add): move toollist.end() out of loop.
4712 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4713 md.end() out of loop.
4715 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4717 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4720 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4721 (Erase): move insetlist.end() out of loop.
4723 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4724 ref to const string as first arg. Move initialization of some
4725 variables, whitespace changes.
4727 * src/kbmap.C (defkey): move table.end() out of loop.
4728 (kb_keymap): move table.end() out of loop.
4729 (findbinding): move table.end() out of loop.
4731 * src/MenuBackend.C (hasMenu): move end() out of loop.
4732 (getMenu): move end() out of loop.
4733 (getMenu): move menulist_.end() out of loop.
4735 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4737 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4740 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4741 (getFromLyXName): move infotab.end() out of loop.
4743 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4744 -fvtable-thunks -ffunction-sections -fdata-sections
4746 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4748 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4751 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4753 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4755 * src/frontends/xforms/FormCitation.[Ch],
4756 src/frontends/xforms/FormIndex.[Ch],
4757 src/frontends/xforms/FormToc.[Ch],
4758 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4760 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4762 * src/commandtags.h: renamed, created some flags for citation
4765 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4767 * src/lyxfunc.C (dispatch): use signals to insert index entry
4769 * src/frontends/Dialogs.h: new signal createIndex
4771 * src/frontends/xforms/FormCommand.[Ch],
4772 src/frontends/xforms/FormCitation.[Ch],
4773 src/frontends/xforms/FormToc.[Ch],
4774 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4776 * src/insets/insetindex.[Ch]: GUI-independent
4778 * src/frontends/xforms/FormIndex.[Ch],
4779 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4782 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4784 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4785 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4787 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4789 * src/insets/insetref.C (Latex): rewrite so that there is now
4790 question that a initialization is requested.
4792 * src/insets/insetcommand.h: reenable the hide signal
4794 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4796 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4797 fix handling of shortcuts (many bugs :)
4798 (add_lastfiles): ditto.
4800 * lib/ui/default.ui: fix a few shortcuts.
4802 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4804 * Makefile.am: Fix ``rpmdist'' target to return the exit
4805 status of the ``rpm'' command, instead of the last command in
4806 the chain (the ``rm lyx.xpm'' command, which always returns
4809 2000-08-02 Allan Rae <rae@lyx.org>
4811 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4812 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4813 * src/frontends/xforms/FormToc.C (FormToc): ditto
4815 * src/frontends/xforms/Makefile.am: A few forgotten files
4817 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4818 Signals-not-copyable-problem Lars' started commenting out.
4820 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4822 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4824 * src/insets/insetcommand.h: Signals is not copyable so anoter
4825 scheme for automatic hiding of forms must be used.
4827 * src/frontends/xforms/FormCitation.h: don't inerit from
4828 noncopyable, FormCommand already does that.
4829 * src/frontends/xforms/FormToc.h: ditto
4830 * src/frontends/xforms/FormUrl.h: ditto
4832 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4834 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4836 * src/insets/insetcommand.h (hide): new SigC::Signal0
4837 (d-tor) new virtual destructor emits hide signal
4839 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4840 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4842 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4843 LOF and LOT. Inset is now GUI-independent
4845 * src/insets/insetloa.[Ch]: redundant
4846 * src/insets/insetlof.[Ch]: ditto
4847 * src/insets/insetlot.[Ch]: ditto
4849 * src/frontends/xforms/forms/form_url.fd: tweaked!
4850 * src/frontends/xforms/forms/form_citation.fd: ditto
4852 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4853 dialogs dealing with InsetCommand insets
4855 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4856 FormCommand base class
4857 * src/frontends/xforms/FormUrl.[Ch]: ditto
4859 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4861 * src/frontends/xforms/FormToc.[Ch]: ditto
4863 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4864 passed a generic InsetCommand pointer
4865 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4867 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4868 and modified InsetTOC class
4869 * src/buffer.C: ditto
4871 * forms/lyx.fd: strip out old FD_form_toc code
4872 * src/lyx_gui_misc.C: ditto
4873 * src/lyx_gui.C: ditto
4874 * src/lyx_cb.C: ditto
4875 * src/lyx.[Ch]: ditto
4877 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4879 * src/support/utility.hpp: tr -d '\r'
4881 2000-08-01 Juergen Vigna <jug@sad.it>
4883 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4885 * src/commandtags.h:
4886 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4887 LFUN_TABULAR_FEATURES.
4889 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4890 LFUN_LAYOUT_TABULAR.
4892 * src/insets/insettabular.C (getStatus): implemented helper function.
4894 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4896 2000-07-31 Juergen Vigna <jug@sad.it>
4898 * src/text.C (draw): fixed screen update problem for text-insets.
4900 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4901 something changed probably this has to be added in various other
4904 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4906 2000-07-31 Baruch Even <baruch.even@writeme.com>
4908 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4909 templates to satisfy compaq cxx.
4912 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4914 * src/support/translator.h (equal_1st_in_pair::operator()): take
4915 const ref pair_type as arg.
4916 (equal_2nd_in_pair::operator()): ditto
4917 (Translator::~Translator): remove empty d-tor.
4919 * src/graphics/GraphicsCache.C: move include config.h to top, also
4920 put initialization of GraphicsCache::singleton here.
4921 (~GraphicsCache): move here
4922 (addFile): take const ref as arg
4925 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4927 * src/BufferView2.C (insertLyXFile): change te with/without header
4930 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4932 * src/frontends/xforms/FormGraphics.C (apply): add some
4933 static_cast. Not very nice, but required by compaq cxx.
4935 * src/frontends/xforms/RadioButtonGroup.h: include header
4936 <utility> instead of <pair.h>
4938 * src/insets/insetgraphicsParams.C: add using directive.
4939 (readResize): change return type to void.
4940 (readOrigin): ditto.
4942 * src/lyxfunc.C (getStatus): add missing break for build-program
4943 function; add test for Literate for export functions.
4945 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4946 entries in Options menu.
4948 2000-07-31 Baruch Even <baruch.even@writeme.com>
4950 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4951 protect against auto-allocation; release icon when needed.
4953 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4955 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4956 on usual typewriter.
4958 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4959 earlier czech.kmap), useful only for programming.
4961 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4963 * src/frontends/xforms/FormCitation.h: fix conditioning around
4966 2000-07-31 Juergen Vigna <jug@sad.it>
4968 * src/frontends/xforms/FormTabular.C (local_update): changed
4969 radio_linebreaks to radio_useparbox and added radio_useminipage.
4971 * src/tabular.C: made support for using minipages/parboxes.
4973 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4975 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4977 (descent): so the cursor is in the middle.
4978 (width): bit smaller box.
4980 * src/insets/insetgraphics.h: added display() function.
4982 2000-07-31 Baruch Even <baruch.even@writeme.com>
4984 * src/frontends/Dialogs.h: Added showGraphics signals.
4986 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4987 xforms form definition of the graphics dialog.
4989 * src/frontends/xforms/FormGraphics.h:
4990 * src/frontends/xforms/FormGraphics.C: Added files, the
4991 GUIndependent code of InsetGraphics
4993 * src/insets/insetgraphics.h:
4994 * src/insets/insetgraphics.C: Major writing to make it work.
4996 * src/insets/insetgraphicsParams.h:
4997 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4998 struct between InsetGraphics and GUI.
5000 * src/LaTeXFeatures.h:
5001 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5002 support for graphicx package.
5004 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5005 for the graphics inset.
5007 * src/support/translator.h: Added file, used in
5008 InsetGraphicsParams. this is a template to translate between two
5011 * src/frontends/xforms/RadioButtonGroup.h:
5012 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5013 way to easily control a radio button group.
5015 2000-07-28 Juergen Vigna <jug@sad.it>
5017 * src/insets/insettabular.C (LocalDispatch):
5018 (TabularFeatures): added support for lyx-functions of tabular features.
5019 (cellstart): refixed this function after someone wrongly changed it.
5021 * src/commandtags.h:
5022 * src/LyXAction.C (init): added support for tabular-features
5024 2000-07-28 Allan Rae <rae@lyx.org>
5026 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5027 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5028 triggers the callback for input checking. As a result we sometimes get
5029 "LyX: This shouldn't happen..." printed to cerr.
5030 (input): Started using status variable since I only free() on
5031 destruction. Some input checking for paths and font sizes.
5033 * src/frontends/xforms/FormPreferences.h: Use status to control
5034 activation of Ok and Apply
5036 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5037 callback. Also resized to stop segfaults with 0.88. The problem is
5038 that xforms-0.88 requires the folder to be wide enough to fit all the
5039 tabs. If it isn't it causes all sorts of problems.
5041 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5043 * src/frontends/xforms/forms/README: Reflect reality.
5045 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5046 * src/frontends/xforms/forms/makefile: ditto.
5048 * src/commandtags.h: Get access to new Preferences dialog
5049 * src/LyXAction.C: ditto
5050 * src/lyxfunc.C: ditto
5051 * lib/ui/default.ui: ditto
5053 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5055 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5057 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5060 * src/frontends/xforms/form_url.[Ch]: added.
5062 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5064 * src/insets/insetbib.h: fixed bug in previous commit
5066 * src/frontends/xforms/FormUrl.h: ditto
5068 * src/frontends/xforms/FormPrint.h: ditto
5070 * src/frontends/xforms/FormPreferences.h: ditto
5072 * src/frontends/xforms/FormCopyright.h: ditto
5074 * src/frontends/xforms/FormCitation.C: ditto
5076 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5077 private copyconstructor and private default contructor
5079 * src/support/Makefile.am: add utility.hpp
5081 * src/support/utility.hpp: new file from boost
5083 * src/insets/insetbib.h: set owner in clone
5085 * src/frontends/xforms/FormCitation.C: added missing include
5088 * src/insets/form_url.[Ch]: removed
5090 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5092 * development/lyx.spec.in
5093 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5094 file/directory re-organization.
5096 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5098 * src/insets/insetcommand.[Ch]: moved the string data and
5099 associated manipulation methods into a new stand-alone class
5100 InsetCommandParams. This class has two additional methods
5101 getAsString() and setFromString() allowing the contents to be
5102 moved around as a single string.
5103 (addContents) method removed.
5104 (setContents) method no longer virtual.
5106 * src/buffer.C (readInset): made use of new InsetCitation,
5107 InsetUrl constructors based on InsetCommandParams.
5109 * src/commandtags.h: add LFUN_INSERT_URL
5111 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5112 independent InsetUrl and use InsetCommandParams to extract
5113 string info and create new Insets.
5115 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5117 * src/frontends/xforms/FormCitation.C (apply): uses
5120 * src/frontends/xforms/form_url.C
5121 * src/frontends/xforms/form_url.h
5122 * src/frontends/xforms/FormUrl.h
5123 * src/frontends/xforms/FormUrl.C
5124 * src/frontends/xforms/forms/form_url.fd: new files
5126 * src/insets/insetcite.[Ch]: removed unused constructors.
5128 * src/insets/insetinclude.[Ch]: no longer store filename
5130 * src/insets/inseturl.[Ch]: GUI-independent.
5132 2000-07-26 Juergen Vigna <jug@sad.it>
5133 * renamed frontend from gtk to gnome as it is that what is realized
5134 and did the necessary changes in the files.
5136 2000-07-26 Marko Vendelin <markov@ioc.ee>
5138 * configure.in: cleaning up gnome configuration scripts
5140 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5142 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5143 shortcuts syndrom by redrawing them explicitely (a better solution
5144 would be appreciated).
5146 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5148 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5151 * src/lyx_cb.C (MenuExport): change html export to do the right
5152 thing depending of the document type (instead of having
5153 html-linuxdoc and html-docbook).
5154 * src/lyxfunc.C (getStatus): update for html
5155 * lib/ui/default.ui: simplify due to the above change.
5156 * src/menus.C (ShowFileMenu): update too (in case we need it).
5158 * src/MenuBackend.C (read): if a menu is defined twice, add the
5159 new entries to the exiting one.
5161 2000-07-26 Juergen Vigna <jug@sad.it>
5163 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5165 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5166 and return a bool if it did actual save the file.
5167 (AutoSave): don't autosave a unnamed doc.
5169 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5170 check if this is an UNNAMED new file and react to it.
5171 (newFile): set buffer to unnamed and change to not mark a new
5172 buffer dirty if I didn't do anything with it.
5174 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5176 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5178 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5179 friend as per Angus's patch posted to lyx-devel.
5181 * src/ext_l10n.h: updated
5183 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5184 gettext on the style string right before inserting them into the
5187 * autogen.sh: add code to extract style strings form layout files,
5188 not good enough yet.
5190 * src/frontends/gtk/.cvsignore: add MAKEFILE
5192 * src/MenuBackend.C (read): run the label strings through gettext
5193 before storing them in the containers.
5195 * src/ext_l10n.h: new file
5197 * autogen.sh : generate the ext_l10n.h file here
5199 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5201 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5204 * lib/ui/default.ui: fix a couple of typos.
5206 * config/gnome/gtk.m4: added (and added to the list of files in
5209 * src/insets/insetinclude.C (unique_id): fix when we are using
5210 lyxstring instead of basic_string<>.
5211 * src/insets/insettext.C (LocalDispatch): ditto.
5212 * src/support/filetools.C: ditto.
5214 * lib/configure.m4: create the ui/ directory if necessary.
5216 * src/LyXView.[Ch] (updateToolbar): new method.
5218 * src/BufferView_pimpl.C (buffer): update the toolbar when
5219 opening/closing buffer.
5221 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5223 * src/LyXAction.C (getActionName): enhance to return also the name
5224 and options of pseudo-actions.
5225 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5227 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5228 as an example of what is possible). Used in File->Build too (more
5229 useful) and in the import/export menus (to mimick the complicated
5230 handling of linuxdoc and friends). Try to update all the entries.
5232 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5235 * src/MenuBackend.C (read): Parse the new OptItem tag.
5237 * src/MenuBackend.h: Add a new optional_ data member (used if the
5238 entry should be omitted when the lyxfunc is disabled).
5240 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5241 function, used as a shortcut.
5242 (create_submenu): align correctly the shortcuts on the widest
5245 * src/MenuBackend.h: MenuItem.label() only returns the label of
5246 the menu without shortcut; new method shortcut().
5248 2000-07-14 Marko Vendelin <markov@ioc.ee>
5250 * src/frontends/gtk/Dialogs.C:
5251 * src/frontends/gtk/FormCopyright.C:
5252 * src/frontends/gtk/FormCopyright.h:
5253 * src/frontends/gtk/Makefile.am: added these source-files for the
5254 Gtk/Gnome support of the Copyright-Dialog.
5256 * src/main.C: added Gnome::Main initialization if using
5257 Gtk/Gnome frontend-GUI.
5259 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5261 * config/gnome/aclocal-include.m4
5262 * config/gnome/compiler-flags.m4
5263 * config/gnome/curses.m4
5264 * config/gnome/gnome--.m4
5265 * config/gnome/gnome-bonobo-check.m4
5266 * config/gnome/gnome-common.m4
5267 * config/gnome/gnome-fileutils.m4
5268 * config/gnome/gnome-ghttp-check.m4
5269 * config/gnome/gnome-gnorba-check.m4
5270 * config/gnome/gnome-guile-checks.m4
5271 * config/gnome/gnome-libgtop-check.m4
5272 * config/gnome/gnome-objc-checks.m4
5273 * config/gnome/gnome-orbit-check.m4
5274 * config/gnome/gnome-print-check.m4
5275 * config/gnome/gnome-pthread-check.m4
5276 * config/gnome/gnome-support.m4
5277 * config/gnome/gnome-undelfs.m4
5278 * config/gnome/gnome-vfs.m4
5279 * config/gnome/gnome-x-checks.m4
5280 * config/gnome/gnome-xml-check.m4
5281 * config/gnome/gnome.m4
5282 * config/gnome/gperf-check.m4
5283 * config/gnome/gtk--.m4
5284 * config/gnome/linger.m4
5285 * config/gnome/need-declaration.m4: added configuration scripts
5286 for Gtk/Gnome frontend-GUI
5288 * configure.in: added support for the --with-frontend=gtk option
5290 * autogen.sh: added config/gnome/* to list of config-files
5292 * acconfig.h: added define for GTKGUI-support
5294 * config/lyxinclude.m4: added --with-frontend[=value] option value
5295 for Gtk/Gnome frontend-GUI support.
5297 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5299 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5303 * src/paragraph.C (GetChar): remove non-const version
5305 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5306 (search_kw): use it.
5308 * src/lyx_main.C (init): if "preferences" exist, read that instead
5310 (ReadRcFile): return bool if the file could be read ok.
5311 (ReadUIFile): add a check to see if lex file is set ok.
5313 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5314 bastring can be used instead of lyxstring (still uses the old code
5315 if std::string is good enough or if lyxstring is used.)
5317 * src/encoding.C: make the arrays static, move ininle functions
5319 * src/encoding.h: from here.
5321 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5322 (parseSingleLyXformat2Token): move inset parsing to separate method
5323 (readInset): new private method
5325 * src/Variables.h: remove virtual from get().
5327 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5328 access to NEW_INSETS and NEW_TABULAR
5330 * src/MenuBackend.h: remove superfluous forward declaration of
5331 MenuItem. Add documentations tags "///", remove empty MenuItem
5332 destructor, remove private default contructor.
5334 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5336 (read): more string mlabel and mname to where they are used
5337 (read): remove unused variables mlabel and mname
5338 (defaults): unconditional clear, make menusetup take advantage of
5339 add returning Menu &.
5341 * src/LyXView.h: define NEW_MENUBAR as default
5343 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5344 to NEW_INSETS and NEW_TABULAR.
5345 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5346 defined. Change some of the "xxxx-inset-insert" functions names to
5349 * several files: more enahncements to NEW_INSETS and the resulting
5352 * lib/lyxrc.example (\date_insert_format): move to misc section
5354 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5355 bastring and use AC_CACHE_CHECK.
5356 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5357 the system have the newest methods. uses AC_CACHE_CHECK
5358 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5359 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5360 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5362 * configure.in: add LYX_CXX_GOOD_STD_STRING
5364 * acinclude.m4: recreated
5366 2000-07-24 Amir Karger <karger@lyx.org>
5368 * README: add Hebrew, Arabic kmaps
5371 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5373 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5376 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5378 * Lot of files: add pragma interface/implementation.
5380 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5382 * lib/ui/default.ui: new file (ans new directory). Contains the
5383 default menu and toolbar.
5385 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5386 global space. Toolbars are now read (as menus) in ui files.
5388 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5390 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5391 is disabled because the document is read-only. We want to have the
5392 toggle state of the function anyway.
5393 (getStatus): add code for LFUN_VC* functions (mimicking what is
5394 done in old-style menus)
5396 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5397 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5399 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5400 * src/BufferView_pimpl.C: ditto.
5401 * src/lyxfunc.C: ditto.
5403 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5404 default). This replaces old-style menus by new ones.
5406 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5407 MenuItem. Contain the data structure of a menu.
5409 * src/insets/insettext.C: use LyXView::setLayout instead of
5410 accessing directly the toolbar combox.
5411 * src/lyxfunc.C (Dispatch): ditto.
5413 * src/LyXView.C (setLayout): new method, which just calls
5414 Toolbar::setLayout().
5415 (updateLayoutChoice): move part of this method in Toolbar.
5417 * src/toolbar.[Ch]: removed.
5419 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5420 implementation the toolbar.
5422 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5423 the toolbar. It might make sense to merge it with ToolbarDefaults
5425 (setLayout): new function.
5426 (updateLayoutList): ditto.
5427 (openLayoutList): ditto.
5429 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5430 xforms implementation of the toolbar.
5431 (get_toolbar_func): comment out, since I do not
5432 know what it is good for.
5434 * src/ToolbarDefaults.h: Add the ItemType enum.
5436 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5437 for a list of allocated C strings. Used in Menubar xforms
5438 implementation to avoid memory leaks.
5440 * src/support/lstrings.[Ch] (uppercase): new version taking and
5444 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5445 * lib/bind/emacs.bind: ditto.
5447 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5449 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5450 forward decl of LyXView.
5452 * src/toolbar.C (toolbarItem): moved from toolbar.h
5453 (toolbarItem::clean): ditto
5454 (toolbarItem::~toolbarItem): ditto
5455 (toolbarItem::operator): ditto
5457 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5459 * src/paragraph.h: control the NEW_TABULAR define from here
5461 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5462 USE_TABULAR_INSETS to NEW_TABULAR
5464 * src/ToolbarDefaults.C: add include "lyxlex.h"
5466 * files using the old table/tabular: use NEW_TABULAR to control
5467 compilation of old tabular stuff.
5469 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5472 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5473 planemet in reading of old style floats, fix the \end_deeper
5474 problem when reading old style floats.
5476 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5478 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5480 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5482 * lib/bind/sciword.bind: updated.
5484 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5486 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5487 layout write problem
5489 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5491 * src/Makefile.am (INCLUDES): remove image directory from include
5494 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5495 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5497 * src/LyXView.C (create_form_form_main): read the application icon
5500 * lib/images/*.xpm: change the icons to use transparent color for
5503 * src/toolbar.C (update): change the color of the button when it
5506 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5508 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5509 setting explicitely the minibuffer.
5510 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5512 * src/LyXView.C (showState): new function. Shows font information
5513 in minibuffer and update toolbar state.
5514 (LyXView): call Toolbar::update after creating the
5517 * src/toolbar.C: change toollist to be a vector instead of a
5519 (BubbleTimerCB): get help string directly from the callback
5520 argument of the corresponding icon (which is the action)
5521 (set): remove unnecessary ugliness.
5522 (update): new function. update the icons (depressed, disabled)
5523 depending of the status of the corresponding action.
5525 * src/toolbar.h: remove help in toolbarItem
5527 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5529 * src/Painter.C (text): Added code for using symbol glyphs from
5530 iso10646 fonts. Currently diabled.
5532 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5535 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5536 magyar,turkish and usorbian.
5538 * src/paragraph.C (isMultiLingual): Made more efficient.
5540 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5543 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5544 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5545 Also changed the prototype to "bool math_insert_greek(char)".
5547 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5549 * lots of files: apply the NEW_INSETS on all code that will not be
5550 needed when we move to use the new insets. Enable the define in
5551 lyxparagrah.h to try it.
5553 * src/insets/insettabular.C (cellstart): change to be a static
5555 (InsetTabular): initialize buffer in the initializer list.
5557 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5559 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5560 form_print.h out of the header file. Replaced with forward
5561 declarations of the relevant struct.
5563 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5566 * src/commandtags.h: do not include "debug.h" which does not
5567 belong there. #include it in some other places because of this
5570 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5572 * src/insets/insetcaption.C: add a couple "using" directives.
5574 * src/toolbar.C (add): get the help text directly from lyxaction.
5576 (setPixmap): new function. Loads from disk and sets a pixmap on a
5577 botton; the name of the pixmap file is derived from the command
5580 * src/toolbar.h: remove members isBitmap and pixmap from
5583 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5584 * lib/images/: move many files from images/banner.xpm.
5586 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5588 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5589 * src/toolbar.C: ditto.
5590 * configure.in: ditto.
5591 * INSTALL: document.
5593 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5594 the spellchecker popup is closed from the WM.
5596 2000-07-19 Juergen Vigna <jug@sad.it>
5598 * src/insets/insetfloat.C (Write): small fix because we use the
5599 insetname for the type now!
5601 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5603 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5606 * src/frontends/Dialogs.h: removed hideCitation signal
5608 * src/insets/insetcite.h: added hide signal
5610 * src/insets/insetcite.C (~InsetCitation): emits new signal
5611 (getScreenLabel): "intelligent" label should now fit on the screen!
5613 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5615 * src/frontends/xforms/FormCitation.C (showInset): connects
5616 hide() to the inset's hide signal
5617 (show): modified to use fl_set_object_position rather than
5618 fl_set_object_geometry wherever possible
5620 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5622 * src/insets/lyxinset.h: add caption code
5624 * src/insets/insetfloat.C (type): new method
5626 * src/insets/insetcaption.C (Write): new method
5628 (LyxCode): new method
5630 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5631 to get it right together with using the FloatList.
5633 * src/commandtags.h: add LFUN_INSET_CAPTION
5634 * src/lyxfunc.C (Dispatch): handle it
5636 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5639 * src/Variables.[Ch]: make expand take a const reference, remove
5640 the destructor, some whitespace changes.
5642 * src/LyXAction.C (init): add caption-inset-insert
5644 * src/FloatList.C (FloatList): update the default floats a bit.
5646 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5648 * src/Variables.[Ch]: new files. Intended to be used for language
5649 specific strings (like \chaptername) and filename substitution in
5652 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5654 * lib/kbd/american.kmap: update
5656 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5658 * src/bufferparams.[Ch]: remove member allowAccents.
5660 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5662 * src/LaTeXLog.C: use the log_form.h header.
5663 * src/lyx_gui.C: ditto.
5664 * src/lyx_gui_misc.C: ditto.
5665 * src/lyxvc.h: ditto.
5667 * forms/log_form.fd: new file, created from latexoptions.fd. I
5668 kept the log popup and nuked the options form.
5670 * src/{la,}texoptions.[Ch]: removed.
5671 * src/lyx_cb.C (LaTeXOptions): ditto
5673 * src/lyx_gui.C (create_forms): do not handle the
5674 fd_latex_options form.
5676 2000-07-18 Juergen Vigna <jug@sad.it>
5678 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5679 name of the inset so that it can be requested outside (text2.C).
5681 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5684 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5686 * src/mathed/formula.h (ConvertFont): constify
5688 * src/mathed/formula.C (Read): add warning if \end_inset is not
5689 found on expected place.
5691 * src/insets/lyxinset.h (ConvertFont): consify
5693 * src/insets/insetquotes.C (ConvertFont): constify
5694 * src/insets/insetquotes.h: ditto
5696 * src/insets/insetinfo.h: add labelfont
5698 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5699 (ascent): use labelfont
5703 (Write): make .lyx file a bit nicer
5705 * src/insets/insetfloat.C (Write): simplify somewhat...
5706 (Read): add warning if arg is not found
5708 * src/insets/insetcollapsable.C: add using std::max
5709 (Read): move string token and add warning in arg is not found
5710 (draw): use std::max to get the right ty
5711 (getMaxWidth): simplify by using std::max
5713 * src/insets/insetsection.h: new file
5714 * src/insets/insetsection.C: new file
5715 * src/insets/insetcaption.h: new file
5716 * src/insets/insetcaption.C: new file
5718 * src/insets/inset.C (ConvertFont): constify signature
5720 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5721 insetcaption.[Ch] and insetsection.[Ch]
5723 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5724 uses to use LABEL_COUNTER_CHAPTER instead.
5725 * src/text2.C (SetCounter): here
5727 * src/counters.h: new file
5728 * src/counters.C: new file
5729 * src/Sectioning.h: new file
5730 * src/Sectioning.C: new file
5732 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5734 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5736 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5739 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5742 2000-07-17 Juergen Vigna <jug@sad.it>
5744 * src/tabular.C (Validate): check if array-package is needed.
5745 (SetVAlignment): added support for vertical alignment.
5746 (SetLTFoot): better support for longtable header/footers
5747 (Latex): modified to support added features.
5749 * src/LaTeXFeatures.[Ch]: added array-package.
5751 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5753 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5756 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5758 * configure.in: do not forget to put a space after -isystem.
5760 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5762 * lib/kbd/arabic.kmap: a few fixes.
5764 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5766 * some whitespace chagnes to a number of files.
5768 * src/support/DebugStream.h: change to make it easier for
5769 doc++ to parse correctly.
5770 * src/support/lyxstring.h: ditto
5772 * src/mathed/math_utils.C (compara): change to have only one
5774 (MathedLookupBOP): change because of the above.
5776 * src/mathed/math_delim.C (math_deco_compare): change to have only
5778 (search_deco): change becasue of the above.
5780 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5781 instead of manually coded one.
5783 * src/insets/insetquotes.C (Read): read the \end_inset too
5785 * src/insets/insetlatex.h: remove file
5786 * src/insets/insetlatex.C: remove file
5788 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5790 (InsetPrintIndex): remove destructor
5792 * src/insets/insetinclude.h: remove default constructor
5794 * src/insets/insetfloat.C: work to make it work better
5796 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5798 * src/insets/insetcite.h (InsetCitation): remove default constructor
5800 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5802 * src/text.C (GetColumnNearX): comment out some currently unused code.
5804 * src/paragraph.C (writeFile): move some initializations closer to
5806 (CutIntoMinibuffer): small change to use new matchIT operator
5810 (InsertInset): ditto
5813 (InsetIterator): ditto
5814 (Erase): small change to use new matchFT operator
5816 (GetFontSettings): ditto
5817 (HighestFontInRange): ditto
5820 * src/lyxparagraph.h: some chars changed to value_type
5821 (matchIT): because of some stronger checking (perhaps too strong)
5822 in SGI STL, the two operator() unified to one.
5825 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5827 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5828 the last inset read added
5829 (parseSingleLyXformat2Token): some more (future) compability code added
5830 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5831 (parseSingleLyXformat2Token): set last_inset_read
5832 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5833 (parseSingleLyXformat2Token): don't double intializw string next_token
5835 * src/TextCache.C (text_fits::operator()): add const's to the signature
5836 (has_buffer::operator()): ditto
5838 * src/Floating.h: add some comments on the class
5840 * src/FloatList.[Ch] (typeExist): new method
5843 * src/BackStack.h: added default constructor, wanted by Gcc.
5845 2000-07-14 Juergen Vigna <jug@sad.it>
5847 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5849 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5851 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5852 do a redraw when the window is resized!
5853 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5855 * src/insets/insettext.C (resizeLyXText): added function to correctly
5856 being able to resize the LyXWindow.
5858 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5860 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5862 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5863 crashes when closing dialog to a deleted inset.
5865 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5866 method! Now similar to other insets.
5868 2000-07-13 Juergen Vigna <jug@sad.it>
5870 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5872 * lib/examples/Literate.lyx: small patch!
5874 * src/insets/insetbib.C (Read): added this function because of wrong
5875 Write (without [begin|end]_inset).
5877 2000-07-11 Juergen Vigna <jug@sad.it>
5879 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5880 as the insertInset could not be good!
5882 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5883 the bool param should not be last.
5885 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5887 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5888 did submit that to Karl).
5890 * configure.in: use -isystem instead of -I for X headers. This
5891 fixes a problem on solaris with a recent gcc;
5892 put the front-end code after the X detection code;
5893 configure in sigc++ before lib/
5895 * src/lyx_main.C (commandLineHelp): remove -display from command
5898 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5900 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5901 Also put in Makefile rules for building the ``listerrors''
5902 program for parsing errors from literate programs written in LyX.
5904 * lib/build-listerrors: Added small shell script as part of compile
5905 process. This builds a working ``listerrors'' binary if noweb is
5906 installed and either 1) the VNC X server is installed on the machine,
5907 or 2) the user is compiling from within a GUI. The existence of a GUI
5908 is necessary to use the ``lyx --export'' feature for now. This
5909 hack can be removed once ``lyx --export'' no longer requires a GUI to
5912 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5914 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5915 now passed back correctly from gcc and placed "under" error
5916 buttons in a Literate LyX source.
5918 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5920 * src/text.C (GetColumnNearX): Better behavior when a RTL
5921 paragraph is ended by LTR text.
5923 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5926 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5928 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5929 true when clipboard is empty.
5931 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5933 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5934 row of the paragraph.
5935 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5936 to prevent calculation of bidi tables
5938 2000-07-07 Juergen Vigna <jug@sad.it>
5940 * src/screen.C (ToggleSelection): added y_offset and x_offset
5943 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5946 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5948 * src/insets/insettext.C: fixed Layout-Display!
5950 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5952 * configure.in: add check for strings.h header.
5954 * src/spellchecker.C: include <strings.h> in order to have a
5955 definition for bzero().
5957 2000-07-07 Juergen Vigna <jug@sad.it>
5959 * src/insets/insettext.C (draw): set the status of the bv->text to
5960 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5962 * src/screen.C (DrawOneRow):
5963 (DrawFromTo): redraw the actual row if something has changed in it
5966 * src/text.C (draw): call an update of the toplevel-inset if something
5967 has changed inside while drawing.
5969 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5971 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5973 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5974 processing inside class.
5976 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5977 processing inside class.
5979 * src/insets/insetindex.h new struct Holder, consistent with other
5982 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5983 citation dialog from main code and placed it in src/frontends/xforms.
5984 Dialog launched through signals instead of callbacks
5986 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5988 * lyx.man: update the options description.
5990 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5992 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5993 handle neg values, set min width to 590, add doc about -display
5995 2000-07-05 Juergen Vigna <jug@sad.it>
5997 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5998 calls to BufferView *.
6000 * src/insets/insettext.C (checkAndActivateInset): small fix non
6001 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6003 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6004 their \end_inset token!
6006 2000-07-04 edscott <edscott@imp.mx>
6008 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6009 lib/lyxrc.example: added option \wheel_jump
6011 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6013 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6014 remove support for -width,-height,-xpos and -ypos.
6016 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6018 * src/encoding.[Ch]: New files.
6020 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6021 (text): Call to the underline() method only when needed.
6023 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6025 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6026 encoding(s) for the document.
6028 * src/bufferparams.C (BufferParams): Changed default value of
6031 * src/language.C (newLang): Removed.
6032 (items[]): Added encoding information for all defined languages.
6034 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6035 encoding choice button.
6037 * src/lyxrc.h (font_norm_type): New member variable.
6038 (set_font_norm_type): New method.
6040 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6041 paragraphs with different encodings.
6043 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6044 (TransformChar): Changed to work correctly with Arabic points.
6045 (draw): Added support for drawing Arabic points.
6046 (draw): Removed code for drawing underbars (this is done by
6049 * src/support/textutils.h (IsPrintableNonspace): New function.
6051 * src/BufferView_pimpl.h: Added "using SigC::Object".
6052 * src/LyXView.h: ditto.
6054 * src/insets/insetinclude.h (include_label): Changed to mutable.
6056 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6058 * src/mathed/math_iter.h: remove empty destructor
6060 * src/mathed/math_cursor.h: remove empty destructor
6062 * src/insets/lyxinset.h: add THEOREM_CODE
6064 * src/insets/insettheorem.[Ch]: new files
6066 * src/insets/insetminipage.C: (InsertInset): remove
6068 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6070 (InsertInset): remove
6072 * src/insets/insetlist.C: (InsertList): remove
6074 * src/insets/insetfootlike.[Ch]: new files
6076 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6079 (InsertInset): ditto
6081 * src/insets/insetert.C: remove include Painter.h, reindent
6082 (InsertInset): move to header
6084 * src/insets/insetcollapsable.h: remove explicit from default
6085 contructor, remove empty destructor, add InsertInset
6087 * src/insets/insetcollapsable.C (InsertInset): new func
6089 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6091 * src/vspace.h: add explicit to constructor
6093 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6094 \textcompwordmark, please test this.
6096 * src/lyxrc.C: set ascii_linelen to 65 by default
6098 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6100 * src/commandtags.h: add LFUN_INSET_THEOREM
6102 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6103 (makeLinuxDocFile): remove _some_ of the nice logic
6104 (makeDocBookFile): ditto
6106 * src/Painter.[Ch]: (~Painter): removed
6108 * src/LyXAction.C (init): entry for insettheorem added
6110 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6112 (deplog): code to detect files generated by LaTeX, needs testing
6115 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6117 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6119 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6121 * src/LaTeX.C (deplog): Add a check for files that are going to be
6122 created by the first latex run, part of the project to remove the
6125 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6126 contents to the extension list.
6128 2000-07-04 Juergen Vigna <jug@sad.it>
6130 * src/text.C (NextBreakPoint): added support for needFullRow()
6132 * src/insets/lyxinset.h: added needFullRow()
6134 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6137 * src/insets/insettext.C: lots of changes for update!
6139 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6141 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6143 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6145 * src/insets/insetinclude.C (InsetInclude): fixed
6146 initialization of include_label.
6147 (unique_id): now returns a string.
6149 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6151 * src/LaTeXFeatures.h: new member IncludedFiles, for
6152 a map of key, included file name.
6154 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6155 with the included files for inclusion in SGML preamble,
6156 i. e., linuxdoc and docbook.
6159 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6160 nice (is the generated linuxdoc code to be exported?), that
6161 allows to remove column, and only_body that will be true for
6162 slave documents. Insets are allowed inside SGML font type.
6163 New handling of the SGML preamble for included files.
6164 (makeDocBookFile): the same for docbook.
6166 * src/insets/insetinclude.h:
6167 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6169 (DocBook): new export methods.
6171 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6172 and makeDocBookFile.
6174 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6175 formats to export with command line argument -x.
6177 2000-06-29 Juergen Vigna <jug@sad.it>
6179 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6180 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6182 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6183 region could already been cleared by an inset!
6185 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6187 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6190 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6192 (cursorToggle): remove special handling of lyx focus.
6194 2000-06-28 Juergen Vigna <jug@sad.it>
6196 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6199 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6201 * src/insets/insetindex.C (Edit): add a callback when popup is
6204 * src/insets/insettext.C (LocalDispatch):
6205 * src/insets/insetmarginal.h:
6206 * src/insets/insetlist.h:
6207 * src/insets/insetfoot.h:
6208 * src/insets/insetfloat.h:
6209 * src/insets/insetert.h: add a missing std:: qualifier.
6211 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6213 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6216 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6218 * src/insets/insettext.C (Read): remove tmptok unused variable
6219 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6220 (InsertInset): change for new InsetInset code
6222 * src/insets/insettext.h: add TEXT inline method
6224 * src/insets/insettext.C: remove TEXT macro
6226 * src/insets/insetmarginal.C (Write): new method
6227 (Latex): change output slightly
6229 * src/insets/insetfoot.C (Write): new method
6230 (Latex): change output slightly (don't use endl when no need)
6232 * src/insets/insetert.C (Write): new method
6234 * src/insets/insetcollapsable.h: make button_length, button_top_y
6235 and button_bottm_y protected.
6237 * src/insets/insetcollapsable.C (Write): simplify code by using
6238 tostr. Also do not output the float name, the children class
6239 should to that to get control over own arguments
6241 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6242 src/insets/insetminipage.[Ch]:
6245 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6247 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6249 * src/Makefile.am (lyx_SOURCES): add the new files
6251 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6252 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6253 * src/commandtags.h: ditto
6255 * src/LaTeXFeatures.h: add a std::set of used floattypes
6257 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6259 * src/FloatList.[Ch] src/Floating.h: new files
6261 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6263 * src/lyx_cb.C (TableApplyCB): ditto
6265 * src/text2.C: ditto
6266 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6267 (parseSingleLyXformat2Token): ditto + add code for
6268 backwards compability for old float styles + add code for new insets
6270 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6272 (InsertInset(size_type, Inset *, LyXFont)): new method
6273 (InsetChar(size_type, char)): changed to use the other InsetChar
6274 with a LyXFont(ALL_INHERIT).
6275 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6276 insert the META_INSET.
6278 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6280 * sigc++/thread.h (Threads): from here
6282 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6283 definition out of line
6284 * sigc++/scope.h: from here
6286 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6288 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6289 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6291 * Makefile.am (bindist): new target.
6293 * INSTALL: add instructions for doing a binary distribution.
6295 * development/tools/README.bin.example: update a bit.
6297 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6300 * lib/lyxrc.example: new lyxrc tag \set_color.
6302 * src/lyxfunc.C (Dispatch):
6303 * src/commandtags.h:
6304 * src/LyXAction.C: new lyxfunc "set-color".
6306 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6307 and an x11name given as strings.
6309 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6310 cache when a color is changed.
6312 2000-06-26 Juergen Vigna <jug@sad.it>
6314 * src/lyxrow.C (width): added this functions and variable.
6316 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6319 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6321 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6323 * images/undo_bw.xpm: new icon.
6324 * images/redo_bw.xpm: ditto.
6326 * configure.in (INSTALL_SCRIPT): change value to
6327 ${INSTALL} to avoid failures of install-script target.
6328 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6330 * src/BufferView.h: add a magic "friend" declaration to please
6333 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6335 * forms/cite.fd: modified to allow resizing without messing
6338 * src/insetcite.C: Uses code from cite.fd almost without
6340 User can now resize dialog in the x-direction.
6341 Resizing the dialog in the y-direction is prevented, as the
6342 code does this intelligently already.
6344 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6346 * INSTALL: remove obsolete entry in "problems" section.
6348 * lib/examples/sl_*.lyx: update of the slovenian examples.
6350 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6352 2000-06-23 Juergen Vigna <jug@sad.it>
6354 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6356 * src/buffer.C (resize): delete the LyXText of textinsets.
6358 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6360 * src/insets/lyxinset.h: added another parameter 'cleared' to
6361 the draw() function.
6363 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6364 unlocking inset in inset.
6366 2000-06-22 Juergen Vigna <jug@sad.it>
6368 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6369 of insets and moved first to LyXText.
6371 * src/mathed/formulamacro.[Ch]:
6372 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6374 2000-06-21 Juergen Vigna <jug@sad.it>
6376 * src/text.C (GetVisibleRow): look if I should clear the area or not
6377 using Inset::doClearArea() function.
6379 * src/insets/lyxinset.h: added doClearArea() function and
6380 modified draw(Painter &, ...) to draw(BufferView *, ...)
6382 * src/text2.C (UpdateInset): return bool insted of int
6384 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6386 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6387 combox in the character popup
6389 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6390 BufferParams const & params
6392 2000-06-20 Juergen Vigna <jug@sad.it>
6394 * src/insets/insettext.C (SetParagraphData): set insetowner on
6397 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6399 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6400 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6402 (form_main_): remove
6404 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6405 (create_form_form_main): remove FD_form_main stuff, connect to
6406 autosave_timeout signal
6408 * src/LyXView.[Ch] (getMainForm): remove
6409 (UpdateTimerCB): remove
6410 * src/BufferView_pimpl.h: inherit from SigC::Object
6412 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6413 signal instead of callback
6415 * src/BufferView.[Ch] (cursorToggleCB): remove
6417 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6419 * src/BufferView_pimpl.C: changes because of the one below
6421 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6422 instead of storing a pointer to a LyXText.
6424 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6426 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6428 * src/lyxparagraph.h
6430 * src/paragraph.C: Changed fontlist to a sorted vector.
6432 2000-06-19 Juergen Vigna <jug@sad.it>
6434 * src/BufferView.h: added screen() function.
6436 * src/insets/insettext.C (LocalDispatch): some selection code
6439 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6441 * src/insets/insettext.C (SetParagraphData):
6443 (InsetText): fixes for multiple paragraphs.
6445 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6447 * development/lyx.spec.in: Call configure with ``--without-warnings''
6448 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6449 This should be fine, however, since we generally don't want to be
6450 verbose when making an RPM.
6452 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6454 * lib/scripts/fig2pstex.py: New file
6456 2000-06-16 Juergen Vigna <jug@sad.it>
6458 * src/insets/insettabular.C (UpdateLocal):
6459 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6460 (LocalDispatch): Changed all functions to use LyXText.
6462 2000-06-15 Juergen Vigna <jug@sad.it>
6464 * src/text.C (SetHeightOfRow): call inset::update before requesting
6467 * src/insets/insettext.C (update):
6468 * src/insets/insettabular.C (update): added implementation
6470 * src/insets/lyxinset.h: added update function
6472 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6474 * src/text.C (SelectNextWord): protect against null pointers with
6475 old-style string streams. (fix from Paul Theo Gonciari
6478 * src/cite.[Ch]: remove erroneous files.
6480 * lib/configure.m4: update the list of created directories.
6482 * src/lyxrow.C: include <config.h>
6483 * src/lyxcursor.C: ditto.
6485 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6487 * lib/examples/decimal.lyx: new example file from Mike.
6489 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6490 to find template definitions (from Dekel)
6492 * src/frontends/.cvsignore: add a few things.
6494 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6496 * src/Timeout.C (TimeOut): remove default argument.
6498 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6501 * src/insets/ExternalTemplate.C: add a "using" directive.
6503 * src/lyx_main.h: remove the act_ struct, which seems unused
6506 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6508 * LyX Developers Meeting: All files changed, due to random C++ (by
6509 coincidence) code generator script.
6511 - external inset (cool!)
6512 - initial online editing of preferences
6513 - insettabular breaks insettext(s contents)
6515 - some DocBook fixes
6516 - example files update
6517 - other cool stuff, create a diff and look for yourself.
6519 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6521 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6522 -1 this is a non-line-breaking textinset.
6524 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6525 if there is no width set.
6527 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6529 * Lots of files: Merged the dialogbase branch.
6531 2000-06-09 Allan Rae <rae@lyx.org>
6533 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6534 and the Dispatch methods that used it.
6536 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6537 access to functions formerly kept in Dispatch.
6539 2000-05-19 Allan Rae <rae@lyx.org>
6541 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6542 made to_page and count_copies integers again. from_page remains a
6543 string however because I want to allow entry of a print range like
6544 "1,4,22-25" using this field.
6546 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6547 and printer-params-get. These aren't useful from the minibuffer but
6548 could be used by a script/LyXServer app provided it passes a suitable
6549 auto_mem_buffer. I guess I should take a look at how the LyXServer
6550 works and make it support xtl buffers.
6552 * sigc++/: updated to libsigc++-1.0.1
6554 * src/xtl/: updated to xtl-1.3.pl.11
6556 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6557 those changes done to the files in src/ are actually recreated when
6558 they get regenerated. Please don't ever accept a patch that changes a
6559 dialog unless that patch includes the changes to the corresponding *.fd
6562 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6563 stringOnlyContains, renamed it and generalised it.
6565 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6566 branch. Removed the remaining old form_print code.
6568 2000-04-26 Allan Rae <rae@lyx.org>
6570 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6571 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6573 2000-04-25 Allan Rae <rae@lyx.org>
6575 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6576 against a base of xtl-1.3.pl.4
6578 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6579 filter the Id: entries so they still show the xtl version number
6582 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6583 into the src/xtl code. Patch still pending with José (XTL)
6585 2000-04-24 Allan Rae <rae@lyx.org>
6587 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6588 both more generic and much safer. Use the new template functions.
6589 * src/buffer.[Ch] (Dispatch): ditto.
6591 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6592 and mem buffer more intelligently. Also a little general cleanup.
6595 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6596 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6597 * src/xtl/Makefile.am: ditto.
6598 * src/xtl/.cvsignore: ditto.
6599 * src/Makefile.am: ditto.
6601 * src/PrinterParams.h: Removed the macros member functions. Added a
6602 testInvariant member function. A bit of tidying up and commenting.
6603 Included Angus's idea for fixing operation with egcs-1.1.2.
6605 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6606 cool expansion of XTL's mem_buffer to support automatic memory
6607 management within the buffer itself. Removed the various macros and
6608 replaced them with template functions that use either auto_mem_buffer
6609 or mem_buffer depending on a #define. The mem_buffer support will
6610 disappear as soon as the auto_mem_buffer is confirmed to be good on
6611 other platforms/compilers. That is, it's there so you've got something
6614 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6615 effectively forked XTL. However I expect José will include my code
6616 into the next major release. Also fixed a memory leak.
6617 * src/xtl/text.h: ditto.
6618 * src/xtl/xdr.h: ditto.
6619 * src/xtl/giop.h: ditto.
6621 2000-04-16 Allan Rae <rae@lyx.org>
6623 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6624 by autogen.sh and removed by maintainer-clean anyway.
6625 * .cvsignore, sigc++/.cvsignore: Support the above.
6627 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6629 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6631 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6632 macros, renamed static callback-target member functions to suit new
6633 scheme and made them public.
6634 * src/frontends/xforms/forms/form_print.fd: ditto.
6635 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6637 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6640 * src/xtl/: New directory containing a minimal distribution of XTL.
6641 This is XTL-1.3.pl.4.
6643 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6645 2000-04-15 Allan Rae <rae@lyx.org>
6647 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6649 * sigc++/: Updated to libsigc++-1.0.0
6651 2000-04-14 Allan Rae <rae@lyx.org>
6653 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6654 use the generic ones in future. I'll modify my conversion script.
6656 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6658 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6659 (CloseAllBufferRelatedDialogs): Renamed.
6660 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6662 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6663 of the generic ones. These are the same ones my conversion script
6666 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6667 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6668 * src/buffer.C (Dispatch): ditto
6670 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6671 functions for updating and hiding buffer dependent dialogs.
6672 * src/BufferView.C (buffer): ditto
6673 * src/buffer.C (setReadonly): ditto
6674 * src/lyxfunc.C (CloseBuffer): ditto
6676 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6677 Dialogs.h, and hence all the SigC stuff, into every file that includes
6678 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6680 * src/BufferView2.C: reduce the number of headers included by buffer.h
6682 2000-04-11 Allan Rae <rae@lyx.org>
6684 * src/frontends/xforms/xform_macros.h: A small collection of macros
6685 for building C callbacks.
6687 * src/frontends/xforms/Makefile.am: Added above file.
6689 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6690 scheme again. This time it should work for JMarc. If this is
6691 successful I'll revise my conversion script to automate some of this.
6692 The static member functions in the class also have to be public for
6693 this scheme will work. If the scheme works (it's almost identical to
6694 the way BufferView::cursorToggleCB is handled so it should work) then
6695 FormCopyright and FormPrint will be ready for inclusion into the main
6696 trunk immediately after 1.1.5 is released -- provided we're prepared
6697 for complaints about lame compilers not handling XTL.
6699 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6701 2000-04-07 Allan Rae <rae@lyx.org>
6703 * config/lyxinclude.m4: A bit more tidying up (Angus)
6705 * src/LString.h: JMarc's <string> header fix
6707 * src/PrinterParams.h: Used string for most data to remove some
6708 ugly code in the Print dialog and avoid even uglier code when
6709 appending the ints to a string for output.
6711 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6712 and moved "default:" back to the end of switch statement. Cleaned
6713 up the printing so it uses the right function calls and so the
6714 "print to file" option actually puts the file in the right directory.
6716 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6718 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6719 and Ok+Apply button control into a separate method: input (Angus).
6720 (input) Cleaned it up and improved it to be very thorough now.
6721 (All CB) static_cast used instead of C style cast (Angus). This will
6722 probably change again once we've worked out how to keep gcc-2.8.1 happy
6723 with real C callbacks.
6724 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6725 ignore some of the bool settings and has random numbers instead. Needs
6726 some more investigation. Added other input length checks and checking
6727 of file and printer names.
6729 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6730 would link (Angus). Seems the old code doesn't compile with the pragma
6731 statement either. Separated callback entries from internal methods.
6733 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6735 2000-03-17 Allan Rae <rae@lyx.org>
6737 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6738 need it? Maybe it could go in Dialogs instead? I could make it a
6739 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6740 values to get the bool return value.
6741 (Dispatch): New overloaded method for xtl support.
6743 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6744 extern "C" callback instead of static member functions. Hopefully,
6745 JMarc will be able to compile this. I haven't changed
6746 forms/form_copyright.fd yet. Breaking one of my own rules already.
6748 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6749 because they aren't useful from the minibuffer. Maybe a LyXServer
6750 might want a help message though?
6752 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6754 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6755 xtl which needs both rtti and exceptions.
6757 * src/support/Makefile.am:
6758 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6760 * src/frontends/xforms/input_validators.[ch]: input filters and
6761 validators. These conrol what keys are valid in input boxes.
6762 Use them and write some more. Much better idea than waiting till
6763 after the user has pressed Ok to say that the input fields don't make
6766 * src/frontends/xforms/Makefile.am:
6767 * src/frontends/xforms/forms/form_print.fd:
6768 * src/frontends/xforms/forms/makefile:
6769 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6770 new scheme. Still have to make sure I haven't missed anything from
6771 the current implementation.
6773 * src/Makefile.am, src/PrinterParams.h: New data store.
6775 * other files: Added a couple of copyright notices.
6777 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6779 * src/insets/insetbib.h: move Holder struct in public space.
6781 * src/frontends/include/DialogBase.h: use SigC:: only when
6782 SIGC_CXX_NAMESPACES is defined.
6783 * src/frontends/include/Dialogs.h: ditto.
6785 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6787 * src/frontends/xforms/FormCopyright.[Ch]: do not
6788 mention SigC:: explicitely.
6790 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6792 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6793 deals with testing KDE in main configure.in
6794 * configure.in: ditto.
6796 2000-02-22 Allan Rae <rae@lyx.org>
6798 * Lots of files: Merged from HEAD
6800 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6801 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6803 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6805 * sigc++/: new minidist.
6807 2000-02-14 Allan Rae <rae@lyx.org>
6809 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6811 2000-02-08 Juergen Vigna <jug@sad.it>
6813 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6814 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6816 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6817 for this port and so it is much easier for other people to port
6818 dialogs in a common development environment.
6820 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6821 the QT/KDE implementation.
6823 * src/frontends/kde/Dialogs.C:
6824 * src/frontends/kde/FormCopyright.C:
6825 * src/frontends/kde/FormCopyright.h:
6826 * src/frontends/kde/Makefile.am:
6827 * src/frontends/kde/formcopyrightdialog.C:
6828 * src/frontends/kde/formcopyrightdialog.h:
6829 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6830 for the kde support of the Copyright-Dialog.
6832 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6833 subdir-substitution instead of hardcoded 'xforms' as we now have also
6836 * src/frontends/include/DialogBase.h (Object): just commented the
6837 label after #endif (nasty warning and I don't like warnings ;)
6839 * src/main.C (main): added KApplication initialization if using
6842 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6843 For now only the KDE event-loop is added if frontend==kde.
6845 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6847 * configure.in: added support for the --with-frontend[=value] option
6849 * autogen.sh: added kde.m4 file to list of config-files
6851 * acconfig.h: added define for KDEGUI-support
6853 * config/kde.m4: added configuration functions for KDE-port
6855 * config/lyxinclude.m4: added --with-frontend[=value] option with
6856 support for xforms and KDE.
6858 2000-02-08 Allan Rae <rae@lyx.org>
6860 * all Makefile.am: Fixed up so the make targets dist, distclean,
6861 install and uninstall all work even if builddir != srcdir. Still
6862 have a new sigc++ minidist update to come.
6864 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6866 2000-02-01 Allan Rae <rae@lyx.org>
6868 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6869 Many mods to get builddir != srcdir working.
6871 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6872 for building on NT and so we can do the builddir != srcdir stuff.
6874 2000-01-30 Allan Rae <rae@lyx.org>
6876 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6877 This will stay in "rae" branch. We probably don't really need it in
6878 the main trunk as anyone who wants to help programming it should get
6879 a full library installed also. So they can check both included and
6880 system supplied library compilation.
6882 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6883 Added a 'mini' distribution of libsigc++. If you feel the urge to
6884 change something in these directories - Resist it. If you can't
6885 resist the urge then you should modify the following script and rebuild
6886 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6887 all happen. Still uses a hacked version of libsigc++'s configure.in.
6888 I'm quite happy with the results. I'm not sure the extra work to turn
6889 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6890 worth the trouble and would probably lead to extra maintenance
6892 I haven't tested the following important make targets: install, dist.
6893 Not ready for prime time but very close. Maybe 1.1.5.
6895 * development/tools/makeLyXsigc.sh: A shell script to automatically
6896 generate our mini-dist of libsigc++. It can only be used with a CVS
6897 checkout of libsigc++ not a tarball distribution. It's well commented.
6898 This will end up as part of the libsigc++ distribution so other apps
6899 can easily have an included mini-dist. If someone makes mods to the
6900 sigc++ subpackage without modifying this script to generate those
6901 changes I'll be very upset!
6903 * src/frontends/: Started the gui/system indep structure.
6905 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6906 to access the gui-indep dialogs are in this class. Much improved
6907 design compared to previous revision. Lars, please refrain from
6908 moving this header into src/ like you did with Popups.h last time.
6910 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6912 * src/frontends/xforms/: Started the gui-indep system with a single
6913 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6916 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6917 Here you'll find a very useful makefile and automated fdfix.sh that
6918 makes updating dailogs a no-brainer -- provided you follow the rules
6919 set out in the README. I'm thinking about adding another script to
6920 automatically generate skeleton code for a new dialog given just the
6923 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6924 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6925 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6927 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6929 * src/support/LSubstring.C (operator): simplify
6931 * src/lyxtext.h: removed bparams, use buffer_->params instead
6933 * src/lyxrow.h: make Row a real class, move all variables to
6934 private and use accessors.
6936 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6938 (isRightToLeftPar): ditto
6939 (ChangeLanguage): ditto
6940 (isMultiLingual): ditto
6943 (SimpleTeXOnePar): ditto
6944 (TeXEnvironment): ditto
6945 (GetEndLabel): ditto
6947 (SetOnlyLayout): ditto
6948 (BreakParagraph): ditto
6949 (BreakParagraphConservative): ditto
6950 (GetFontSettings): ditto
6952 (CopyIntoMinibuffer): ditto
6953 (CutIntoMinibuffer): ditto
6954 (PasteParagraph): ditto
6955 (SetPExtraType): ditto
6956 (UnsetPExtraType): ditto
6957 (DocBookContTableRows): ditto
6958 (SimpleDocBookOneTablePar): ditto
6960 (TeXFootnote): ditto
6961 (SimpleTeXOneTablePar): ditto
6962 (TeXContTableRows): ditto
6963 (SimpleTeXSpecialChars): ditto
6966 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6967 to private and use accessors.
6969 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6970 this, we did not use it anymore and has not been for ages. Just a
6971 waste of cpu cycles.
6973 * src/language.h: make Language a real class, move all variables
6974 to private and use accessors.
6976 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6977 (create_view): remove
6978 (update): some changes for new timer
6979 (cursorToggle): use new timer
6980 (beforeChange): change for new timer
6982 * src/BufferView.h (cursorToggleCB): removed last paramter because
6985 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6986 (cursorToggleCB): change because of new timer code
6988 * lib/CREDITS: updated own mailaddress
6990 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6992 * src/support/filetools.C (PutEnv): fix the code in case neither
6993 putenv() nor setenv() have been found.
6995 * INSTALL: mention the install-strip Makefile target.
6997 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6998 read-only documents.
7000 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7002 * lib/reLyX/configure.in (VERSION): avoid using a previously
7003 generated reLyX wrapper to find out $prefix.
7005 * lib/examples/eu_adibide_lyx-atua.lyx:
7006 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7007 translation of the Tutorial (Dooteo)
7009 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7011 * forms/cite.fd: new citation dialog
7013 * src/insetcite.[Ch]: the new citation dialog is moved into
7016 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7019 * src/insets/insetcommand.h: data members made private.
7021 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7023 * LyX 1.1.5 released
7025 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7027 * src/version.h (LYX_RELEASE): to 1.1.5
7029 * src/spellchecker.C (RunSpellChecker): return false if the
7030 spellchecker dies upon creation.
7032 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7034 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7035 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7039 * lib/CREDITS: update entry for Martin Vermeer.
7041 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7043 * src/text.C (draw): Draw foreign language bars at the bottom of
7044 the row instead of at the baseline.
7046 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7048 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7050 * lib/bind/de_menus.bind: updated
7052 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7054 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7056 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7058 * src/menus.C (Limit_string_length): New function
7059 (ShowTocMenu): Limit the number of items/length of items in the
7062 * src/paragraph.C (String): Correct result for a paragraph inside
7065 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7067 * src/bufferlist.C (close): test of buf->getuser() == NULL
7069 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7071 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7072 Do not call to SetCursor when the paragraph is a closed footnote!
7074 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7076 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7079 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7081 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7084 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7085 reference popup, that activates the reference-back action
7087 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7089 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7090 the menus. Also fixed a bug.
7092 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7093 the math panels when switching buffers (unless new buffer is readonly).
7095 * src/BufferView.C (NoSavedPositions)
7096 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7098 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7100 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7101 less of dvi dirty or not.
7103 * src/trans_mgr.[Ch] (insert): change first parameter to string
7106 * src/chset.[Ch] (encodeString): add const to first parameter
7108 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7110 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7114 * src/LaTeX.C (deplog): better searching for dependency files in
7115 the latex log. Uses now regexps.
7117 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7118 instead of the box hack or \hfill.
7120 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7122 * src/lyxfunc.C (doImportHelper): do not create the file before
7123 doing the actual import.
7124 (doImportASCIIasLines): create a new file before doing the insert.
7125 (doImportASCIIasParagraphs): ditto.
7127 * lib/lyxrc.example: remove mention of non-existing commands
7129 * lyx.man: remove mention of color-related switches.
7131 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7133 * src/lyx_gui.C: remove all the color-related ressources, which
7134 are not used anymore.
7136 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7139 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7141 * src/lyxrc.C (read): Add a missing break in the switch
7143 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7145 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7147 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7150 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7152 * src/text.C (draw): draw bars under foreign language words.
7154 * src/LColor.[Ch]: add LColor::language
7156 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7158 * src/lyxcursor.h (boundary): New member variable
7160 * src/text.C (IsBoundary): New methods
7162 * src/text.C: Use the above for currect cursor movement when there
7163 is both RTL & LTR text.
7165 * src/text2.C: ditto
7167 * src/bufferview_funcs.C (ToggleAndShow): ditto
7169 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7171 * src/text.C (DeleteLineForward): set selection to true to avoid
7172 that DeleteEmptyParagraphMechanism does some magic. This is how it
7173 is done in all other functions, and seems reasonable.
7174 (DeleteWordForward): do not jump over non-word stuff, since
7175 CursorRightOneWord() already does it.
7177 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7178 DeleteWordBackward, since they seem safe to me (since selection is
7179 set to "true") DeleteEmptyParagraphMechanism does nothing.
7181 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7183 * src/lyx_main.C (easyParse): simplify the code by factoring the
7184 part that removes parameters from the command line.
7185 (LyX): check wether wrong command line options have been given.
7187 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7189 * src/lyx_main.C : add support for specifying user LyX
7190 directory via command line option -userdir.
7192 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7194 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7195 the number of items per popup.
7196 (Add_to_refs_menu): Ditto.
7198 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7200 * src/lyxparagraph.h: renamed ClearParagraph() to
7201 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7202 textclass as parameter, and do nothing if free_spacing is
7203 true. This fixes part of the line-delete-forward problems.
7205 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7206 (pasteSelection): ditto.
7207 (SwitchLayoutsBetweenClasses): more translatable strings.
7209 * src/text2.C (CutSelection): use StripLeadingSpaces.
7210 (PasteSelection): ditto.
7211 (DeleteEmptyParagraphMechanism): ditto.
7213 2000-05-26 Juergen Vigna <jug@sad.it>
7215 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7216 is not needed in tabular insets.
7218 * src/insets/insettabular.C (TabularFeatures): added missing features.
7220 * src/tabular.C (DeleteColumn):
7222 (AppendRow): implemented this functions
7223 (cellsturct::operator=): clone the inset too;
7225 2000-05-23 Juergen Vigna <jug@sad.it>
7227 * src/insets/insettabular.C (LocalDispatch): better selection support
7228 when having multicolumn-cells.
7230 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7232 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7234 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7236 * src/ColorHandler.C (getGCForeground): put more test into _()
7238 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7241 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7244 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7246 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7247 there are no labels, or when buffer is readonly.
7249 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7250 there are no labels, buffer is SGML, or when buffer is readonly.
7252 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7254 * src/LColor.C (LColor): change a couple of grey40 to grey60
7255 (LColor): rewore initalization to make compiles go some magnitude
7257 (getGUIName): don't use gettext until we need the string.
7259 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7261 * src/Bullet.[Ch]: Fixed a small bug.
7263 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7265 * src/paragraph.C (String): Several fixes/improvements
7267 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7269 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7271 * src/paragraph.C (String): give more correct output.
7273 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7275 * src/lyxfont.C (stateText) Do not output the language if it is
7276 eqaul to the language of the document.
7278 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7279 between two paragraphs with the same language.
7281 * src/paragraph.C (getParLanguage) Return a correct answer for an
7282 empty dummy paragraph.
7284 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7287 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7290 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7291 the menus/popup, if requested fonts are unavailable.
7293 2000-05-22 Juergen Vigna <jug@sad.it>
7295 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7296 movement support (Up/Down/Tab/Shift-Tab).
7297 (LocalDispatch): added also preliminari cursor-selection.
7299 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7301 * src/paragraph.C (PasteParagraph): Hopefully now right!
7303 2000-05-22 Garst R. Reese <reese@isn.net>
7305 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7306 of list, change all references to Environment to Command
7307 * tex/hollywood.cls : rewrite environments as commands, add
7308 \uppercase to interiorshot and exteriorshot to force uppecase.
7309 * tex/broadway.cls : rewrite environments as commands. Tweak
7312 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7314 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7315 size of items: use a constant intead of the hardcoded 40, and more
7316 importantly do not remove the %m and %x tags added at the end.
7317 (Add_to_refs_menu): use vector::size_type instead of
7318 unsigned int as basic types for the variables. _Please_ do not
7319 assume that size_t is equal to unsigned int. On an alpha, this is
7320 unsigned long, which is _not_ the same.
7322 * src/language.C (initL): remove language "hungarian", since it
7323 seems that "magyar" is better.
7325 2000-05-22 Juergen Vigna <jug@sad.it>
7327 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7329 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7332 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7333 next was deleted but not set to 0.
7335 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7337 * src/language.C (initL): change the initialization of languages
7338 so that compiles goes _fast_.
7340 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7343 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7345 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7349 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7351 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7353 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7357 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7360 * src/insets/insetlo*.[Ch]: Made editable
7362 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7364 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7365 the current selection.
7367 * src/BufferView_pimpl.C (stuffClipboard): new method
7369 * src/BufferView.C (stuffClipboard): new method
7371 * src/paragraph.C (String): new method
7373 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7374 LColor::ignore when lyxname is not found.
7376 * src/BufferView.C (pasteSelection): new method
7378 * src/BufferView_pimpl.C (pasteSelection): new method
7380 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7382 * src/WorkArea.C (request_clipboard_cb): new static function
7383 (getClipboard): new method
7384 (putClipboard): new method
7386 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7388 * LyX 1.1.5pre2 released
7390 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7392 * src/vspace.C (operator=): removed
7393 (operator=): removed
7395 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7397 * src/layout.C (NumberOfClass): manually set the type in make_pair
7398 (NumberOfLayout): ditto
7400 * src/language.C: use the Language constructor for ignore_lang
7402 * src/language.h: add constructors to struct Language
7404 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7406 * src/text2.C (SetCursorIntern): comment out #warning
7408 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7410 * src/mathed/math_iter.h: initialize sx and sw to 0
7412 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7414 * forms/lyx.fd: Redesign of form_ref
7416 * src/LaTeXFeatures.[Ch]
7420 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7423 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7424 and Buffer::inset_iterator.
7426 * src/menus.C: Added new menus: TOC and Refs.
7428 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7430 * src/buffer.C (getTocList): New method.
7432 * src/BufferView2.C (ChangeRefs): New method.
7434 * src/buffer.C (getLabelList): New method. It replaces the old
7435 getReferenceList. The return type is vector<string> instead of
7438 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7439 the old getLabel() and GetNumberOfLabels() methods.
7440 * src/insets/insetlabel.C (getLabelList): ditto
7441 * src/mathed/formula.C (getLabelList): ditto
7443 * src/paragraph.C (String): New method.
7445 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7446 Uses the new getTocList() method.
7447 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7448 which automatically updates the contents of the browser.
7449 (RefUpdateCB): Use the new getLabelList method.
7451 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7453 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7455 * src/spellchecker.C: Added using std::reverse;
7457 2000-05-19 Juergen Vigna <jug@sad.it>
7459 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7461 * src/insets/insettext.C (computeTextRows): small fix for display of
7462 1 character after a newline.
7464 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7467 2000-05-18 Juergen Vigna <jug@sad.it>
7469 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7470 when changing width of column.
7472 * src/tabular.C (set_row_column_number_info): setting of
7473 autobreak rows if necessary.
7475 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7477 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7479 * src/vc-backend.*: renamed stat() to status() and vcstat to
7480 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7481 compilation broke. The new name seems more relevant, anyway.
7483 2000-05-17 Juergen Vigna <jug@sad.it>
7485 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7486 which was wrong if the removing caused removing of rows!
7488 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7489 (pushToken): new function.
7491 * src/text2.C (CutSelection): fix problem discovered with purify
7493 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7495 * src/debug.C (showTags): enlarge the first column, now that we
7496 have 6-digits debug codes.
7498 * lib/layouts/hollywood.layout:
7499 * lib/tex/hollywood.cls:
7500 * lib/tex/brodway.cls:
7501 * lib/layouts/brodway.layout: more commands and fewer
7502 environments. Preambles moved in the .cls files. Broadway now has
7503 more options on scene numbering and less whitespace (from Garst)
7505 * src/insets/insetbib.C (getKeys): make sure that we are in the
7506 document directory, in case the bib file is there.
7508 * src/insets/insetbib.C (Latex): revert bogus change.
7510 2000-05-16 Juergen Vigna <jug@sad.it>
7512 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7513 the TabularLayout on cursor move.
7515 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7517 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7520 (draw): fixed cursor position and drawing so that the cursor is
7521 visible when before the tabular-inset.
7523 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7524 when creating from old insettext.
7526 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7528 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7530 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7531 * lib/tex/brodway.cls: ditto
7533 * lib/layouts/brodway.layout: change alignment of parenthical
7536 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7538 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7539 versions 0.88 and 0.89 are supported.
7541 2000-05-15 Juergen Vigna <jug@sad.it>
7543 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7546 * src/insets/insettext.C (computeTextRows): redone completely this
7547 function in a much cleaner way, because of problems when having a
7549 (draw): added a frame border when the inset is locked.
7550 (SetDrawLockedFrame): this sets if we draw the border or not.
7551 (SetFrameColor): this sets the frame color (default=insetframe).
7553 * src/insets/lyxinset.h: added x() and y() functions which return
7554 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7555 function which is needed to see if we have a locking inset of some
7556 type in this inset (needed for now in insettabular).
7558 * src/vspace.C (inPixels): the same function also without a BufferView
7559 parameter as so it is easier to use it in some ocasions.
7561 * src/lyxfunc.C: changed all places where insertInset was used so
7562 that now if it couldn't be inserted it is deleted!
7564 * src/TabularLayout.C:
7565 * src/TableLayout.C: added support for new tabular-inset!
7567 * src/BufferView2.C (insertInset): this now returns a bool if the
7568 inset was really inserted!!!
7570 * src/tabular.C (GetLastCellInRow):
7571 (GetFirstCellInRow): new helper functions.
7572 (Latex): implemented for new tabular class.
7576 (TeXTopHLine): new Latex() helper functions.
7578 2000-05-12 Juergen Vigna <jug@sad.it>
7580 * src/mathed/formulamacro.C (Read):
7581 * src/mathed/formula.C (Read): read also the \end_inset here!
7583 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7585 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7586 crush when saving formulae with unbalanced parenthesis.
7588 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7590 * src/layout.C: Add new keyword "endlabelstring" to layout file
7592 * src/text.C (GetVisibleRow): Draw endlabel string.
7594 * lib/layouts/broadway.layout
7595 * lib/layouts/hollywood.layout: Added endlabel for the
7596 Parenthetical layout.
7598 * lib/layouts/heb-article.layout: Do not use slanted font shape
7599 for Theorem like environments.
7601 * src/buffer.C (makeLaTeXFile): Always add "american" to
7602 the UsedLanguages list if document language is RTL.
7604 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7606 * add addendum to README.OS2 and small patch (from SMiyata)
7608 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7610 * many files: correct the calls to ChangeExtension().
7612 * src/support/filetools.C (ChangeExtension): remove the no_path
7613 argument, which does not belong there. Use OnlyFileName() instead.
7615 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7616 files when LaTeXing a non-nice latex file.
7618 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7619 a chain of "if". Return false when deadkeys are not handled.
7621 * src/lyx_main.C (LyX): adapted the code for default bindings.
7623 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7624 bindings for basic functionality (except deadkeys).
7625 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7627 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7628 several methods: handle override_x_deadkeys.
7630 * src/lyxrc.h: remove the "bindings" map, which did not make much
7631 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7633 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7635 * src/lyxfont.C (stateText): use a saner method to determine
7636 whether the font is "default". Seems to fix the crash with DEC
7639 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7641 2000-05-08 Juergen Vigna <jug@sad.it>
7643 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7644 TabularLayoutMenu with mouse-button-3
7645 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7647 * src/TabularLayout.C: added this file for having a Layout for
7650 2000-05-05 Juergen Vigna <jug@sad.it>
7652 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7653 recalculating inset-widths.
7654 (TabularFeatures): activated this function so that I can change
7655 tabular-features via menu.
7657 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7658 that I can test some functions with the Table menu.
7660 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7662 * src/lyxfont.C (stateText): guard against stupid c++libs.
7664 * src/tabular.C: add using std::vector
7665 some whitespace changes, + removed som autogenerated code.
7667 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7669 2000-05-05 Juergen Vigna <jug@sad.it>
7671 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7672 row, columns and cellstructures.
7674 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7676 * lib/lyxrc.example: remove obsolete entries.
7678 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7679 reading of protected_separator for free_spacing.
7681 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7683 * src/text.C (draw): do not display an exclamation mark in the
7684 margin for margin notes. This is confusing, ugly and
7687 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7688 AMS math' is checked.
7690 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7691 name to see whether including the amsmath package is needed.
7693 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7695 * src/paragraph.C (validate): Compute UsedLanguages correctly
7696 (don't insert the american language if it doesn't appear in the
7699 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7700 The argument of \thanks{} command is considered moving argument
7702 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7705 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7707 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7708 for appendix/minipage/depth. The lines can be now both in the footnote
7709 frame, and outside the frame.
7711 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7714 2000-05-05 Juergen Vigna <jug@sad.it>
7716 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7717 neede only in tabular.[Ch].
7719 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7721 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7723 (Write): write '~' for PROTECTED_SEPARATOR
7725 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7727 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7730 * src/mathed/formula.C (drawStr): rename size to siz.
7732 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7733 possibly fix a bug by not changing the pflags = flags to piflags =
7736 2000-05-05 Juergen Vigna <jug@sad.it>
7738 * src/insets/insetbib.C: moved using directive
7740 * src/ImportNoweb.C: small fix for being able to compile (missing
7743 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7745 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7746 to use clear, since we don't depend on this in the code. Add test
7749 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7751 * (various *.C files): add using std::foo directives to please dec
7754 * replace calls to string::clear() to string::erase() (Angus)
7756 * src/cheaders/cmath: modified to provide std::abs.
7758 2000-05-04 Juergen Vigna <jug@sad.it>
7760 * src/insets/insettext.C: Prepared all for inserting of multiple
7761 paragraphs. Still display stuff to do (alignment and other things),
7762 but I would like to use LyXText to do this when we cleaned out the
7763 table-support stuff.
7765 * src/insets/insettabular.C: Changed lot of stuff and added lots
7766 of functionality still a lot to do.
7768 * src/tabular.C: Various functions changed name and moved to be
7769 const functions. Added new Read and Write functions and changed
7770 lots of things so it works good with tabular-insets (also removed
7771 some stuff which is not needed anymore * hacks *).
7773 * src/lyxcursor.h: added operators == and != which just look if
7774 par and pos are (not) equal.
7776 * src/buffer.C (latexParagraphs): inserted this function to latex
7777 all paragraphs form par to endpar as then I can use this too for
7780 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7781 so that I can call this to from text insets with their own cursor.
7783 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7784 output off all paragraphs (because of the fix below)!
7786 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7787 the very last paragraph (this could be also the last paragraph of an
7790 * src/texrow.h: added rows() call which returns the count-variable.
7792 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7794 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7796 * lib/configure.m4: better autodetection of DocBook tools.
7798 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7800 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7802 * src/lyx_cb.C: add using std::reverse;
7804 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7807 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7808 selected files. Should fix repeated errors from generated files.
7810 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7812 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7814 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7815 the spellchecker popup.
7817 * lib/lyxrc.example: Removed the \number_inset section
7819 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7821 * src/insets/figinset.C (various): Use IsFileReadable() to make
7822 sure that the file actually exist. Relying on ghostscripts errors
7823 is a bad idea since they can lead to X server crashes.
7825 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7827 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7830 * lib/lyxrc.example: smallish typo in description of
7831 \view_dvi_paper_option
7833 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7836 * src/lyxfunc.C: doImportHelper to factor out common code of the
7837 various import methods. New functions doImportASCIIasLines,
7838 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7839 doImportLinuxDoc for the format specific parts.
7842 * buffer.C: Dispatch returns now a bool to indicate success
7845 * lyx_gui.C: Add getLyXView() for member access
7847 * lyx_main.C: Change logic for batch commands: First try
7848 Buffer::Dispatch (possibly without GUI), if that fails, use
7851 * lyx_main.C: Add support for --import command line switch.
7852 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7853 Available Formats: Everything accepted by 'buffer-import <format>'
7855 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7857 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7860 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7861 documents will be reformatted upon reentry.
7863 2000-04-27 Juergen Vigna <jug@sad.it>
7865 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7866 correctly only last pos this was a bug.
7868 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7870 * release of lyx-1.1.5pre1
7872 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7874 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7876 * src/menus.C: revert the change of naming (Figure->Graphic...)
7877 from 2000-04-11. It was incomplete and bad.
7879 * src/LColor.[Ch]: add LColor::depthbar.
7880 * src/text.C (GetVisibleRow): use it.
7882 * README: update the languages list.
7884 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7886 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7889 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7891 * README: remove sections that were just wrong.
7893 * src/text2.C (GetRowNearY): remove currentrow code
7895 * src/text.C (GetRow): remove currentrow code
7897 * src/screen.C (Update): rewritten a bit.
7898 (SmallUpdate): removed func
7900 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7902 (FullRebreak): return bool
7903 (currentrow): remove var
7904 (currentrow_y): ditto
7906 * src/lyxscreen.h (Draw): change arg to unsigned long
7907 (FitCursor): return bool
7908 (FitManualCursor): ditto
7909 (Smallpdate): remove func
7910 (first): change to unsigned long
7911 (DrawOneRow): change second arg to long (from long &)
7912 (screen_refresh_y): remove var
7913 (scree_refresh_row): ditto
7915 * src/lyxrow.h: change baseline to usigned int from unsigned
7916 short, this brings some implicit/unsigned issues out in the open.
7918 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7920 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7921 instead of smallUpdate.
7923 * src/lyxcursor.h: change y to unsigned long
7925 * src/buffer.h: don't call updateScrollbar after fitcursor
7927 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7928 where they are used. Removed "\\direction", this was not present
7929 in 1.1.4 and is already obsolete. Commented out some code that I
7930 believe to never be called.
7931 (runLiterate): don't call updateScrollbar after fitCursor
7933 (buildProgram): ditto
7936 * src/WorkArea.h (workWidth): change return val to unsigned
7939 (redraw): remove the button redraws
7940 (setScrollbarValue): change for scrollbar
7941 (getScrollbarValue): change for scrollbar
7942 (getScrollbarBounds): change for scrollbar
7944 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7945 (C_WorkArea_down_cb): removed func
7946 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7947 (resize): change for scrollbar
7948 (setScrollbar): ditto
7949 (setScrollbarBounds): ditto
7950 (setScrollbarIncrements): ditto
7951 (up_cb): removed func
7952 (down_cb): removed func
7953 (scroll_cb): change for scrollbar
7954 (work_area_handler): ditto
7956 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7957 when FitCursor did something.
7958 (updateScrollbar): some unsigned changes
7959 (downCB): removed func
7960 (scrollUpOnePage): removed func
7961 (scrollDownOnePage): remvoed func
7962 (workAreaMotionNotify): don't call screen->FitCursor but use
7963 fitCursor instead. and bool return val
7964 (workAreaButtonPress): ditto
7965 (workAreaButtonRelease): some unsigned changes
7966 (checkInsetHit): ditto
7967 (workAreaExpose): ditto
7968 (update): parts rewritten, comments about the signed char arg added
7969 (smallUpdate): removed func
7970 (cursorPrevious): call needed updateScrollbar
7973 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7976 * src/BufferView.[Ch] (upCB): removed func
7977 (downCB): removed func
7978 (smallUpdate): removed func
7980 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7982 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7983 currentrow, currentrow_y optimization. This did not help a lot and
7984 if we want to do this kind of optimization we should rather use
7985 cursor.row instead of the currentrow.
7987 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7988 buffer spacing and klyx spacing support.
7990 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7992 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7995 2000-04-26 Juergen Vigna <jug@sad.it>
7997 * src/insets/figinset.C: fixes to Lars sstream changes!
7999 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8001 * A lot of files: Added Ascii(ostream &) methods to all inset
8002 classes. Used when exporting to ASCII.
8004 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8005 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8008 * src/text2.C (ToggleFree): Disabled implicit word selection when
8009 there is a change in the language
8011 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8012 no output was generated for end-of-sentence inset.
8014 * src/insets/lyxinset.h
8017 * src/paragraph.C: Removed the insetnumber code
8019 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8021 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8023 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8024 no_babel and no_epsfig completely from the file.
8025 (parseSingleLyXformat2Token): add handling for per-paragraph
8026 spacing as written by klyx.
8028 * src/insets/figinset.C: applied patch by Andre. Made it work with
8031 2000-04-20 Juergen Vigna <jug@sad.it>
8033 * src/insets/insettext.C (cutSelection):
8034 (copySelection): Fixed with selection from right to left.
8035 (draw): now the rows are not recalculated at every draw.
8036 (computeTextRows): for now reset the inset-owner here (this is
8037 important for an undo or copy where the inset-owner is not set
8040 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8041 motion to the_locking_inset screen->first was forgotten, this was
8042 not important till we got multiline insets.
8044 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8046 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8047 code seems to be alright (it is code changed by Dekel, and the
8048 intent is indeed that all macros should be defined \protect'ed)
8050 * NEWS: a bit of reorganisation of the new user-visible features.
8052 2000-04-19 Juergen Vigna <jug@sad.it>
8054 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8055 position. Set the inset_owner of the used paragraph so that it knows
8056 that it is inside an inset. Fixed cursor handling with mouse and
8057 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8058 and cleanups to make TextInsets work better.
8060 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8061 Changed parameters of various functions and added LockInsetInInset().
8063 * src/insets/insettext.C:
8065 * src/insets/insetcollapsable.h:
8066 * src/insets/insetcollapsable.C:
8067 * src/insets/insetfoot.h:
8068 * src/insets/insetfoot.C:
8069 * src/insets/insetert.h:
8070 * src/insets/insetert.C: cleaned up the code so that it works now
8071 correctly with insettext.
8073 * src/insets/inset.C:
8074 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8075 that insets in insets are supported right.
8078 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8080 * src/paragraph.C: some small fixes
8082 * src/debug.h: inserted INSETS debug info
8084 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8085 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8087 * src/commandtags.h:
8088 * src/LyXAction.C: insert code for InsetTabular.
8090 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8091 not Button1MotionMask.
8092 (workAreaButtonRelease): send always a InsetButtonRelease event to
8094 (checkInsetHit): some setCursor fixes (always with insets).
8096 * src/BufferView2.C (lockInset): returns a bool now and extended for
8097 locking insets inside insets.
8098 (showLockedInsetCursor): it is important to have the cursor always
8099 before the locked inset.
8100 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8102 * src/BufferView.h: made lockInset return a bool.
8104 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8106 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8107 that is used also internally but can be called as public to have back
8108 a cursor pos which is not set internally.
8109 (SetCursorIntern): Changed to use above function.
8111 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8113 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8118 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8119 patches for things that should be in or should be changed.
8121 * src/* [insetfiles]: change "usigned char fragile" to bool
8122 fragile. There was only one point that could that be questioned
8123 and that is commented in formulamacro.C. Grep for "CHECK".
8125 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8126 (DeleteBuffer): take it out of CutAndPaste and make it static.
8128 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8130 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8131 output the spacing envir commands. Also the new commands used in
8132 the LaTeX output makes the result better.
8134 * src/Spacing.C (writeEnvirBegin): new method
8135 (writeEnvirEnd): new method
8137 2000-04-18 Juergen Vigna <jug@sad.it>
8139 * src/CutAndPaste.C: made textclass a static member of the class
8140 as otherwise it is not accesed right!!!
8142 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8144 * forms/layout_forms.fd
8145 * src/layout_forms.h
8146 * src/layout_forms.C (create_form_form_character)
8147 * src/lyx_cb.C (UserFreeFont)
8148 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8149 documents (in the layout->character popup).
8151 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8153 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8154 \spell_command was in fact not honored (from Kevin Atkinson).
8156 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8159 * src/lyx_gui.h: make lyxViews private (Angus)
8161 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8163 * src/mathed/math_write.C
8164 (MathMatrixInset::Write) Put \protect before \begin{array} and
8165 \end{array} if fragile
8166 (MathParInset::Write): Put \protect before \\ if fragile
8168 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8170 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8171 initialization if the LyXColorHandler must be done after the
8172 connections to the XServer has been established.
8174 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8175 get the background pixel from the lyxColorhandler so that the
8176 figures are rendered with the correct background color.
8177 (NextToken): removed functions.
8178 (GetPSSizes): use ifs >> string instead of NextToken.
8180 * src/Painter.[Ch]: the color cache moved out of this file.
8182 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8185 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8187 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8188 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8190 * src/BufferView.C (enterView): new func
8191 (leaveView): new func
8193 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8195 (leaveView): new func, undefines xterm cursor when approp.
8197 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8198 (AllowInput): delete the Workarea cursor handling from this func.
8200 * src/Painter.C (underline): draw a slimer underline in most cases.
8202 * src/lyx_main.C (error_handler): use extern "C"
8204 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8206 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8207 sent directly to me.
8209 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8210 to the list by Dekel.
8212 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8215 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8216 methods from lyx_cb.here.
8218 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8221 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8223 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8224 instead of using current_view directly.
8226 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8228 * src/LyXAction.C (init): add the paragraph-spacing command.
8230 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8232 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8234 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8235 different from the documents.
8237 * src/text.C (SetHeightOfRow): take paragraph spacing into
8238 account, paragraph spacing takes precedence over buffer spacing
8239 (GetVisibleRow): ditto
8241 * src/paragraph.C (writeFile): output the spacing parameter too.
8242 (validate): set the correct features if spacing is used in the
8244 (Clear): set spacing to default
8245 (MakeSameLayout): spacing too
8246 (HasSameLayout): spacing too
8247 (SetLayout): spacing too
8248 (TeXOnePar): output the spacing commands
8250 * src/lyxparagraph.h: added a spacing variable for use with
8251 per-paragraph spacing.
8253 * src/Spacing.h: add a Default spacing and a method to check if
8254 the current spacing is default. also added an operator==
8256 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8259 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8261 * src/lyxserver.C (callback): fix dispatch of functions
8263 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8264 printf() into lyxerr call.
8266 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8269 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8270 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8271 the "Float" from each of the subitems.
8272 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8274 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8275 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8276 documented the change so that the workaround can be nuked later.
8278 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8281 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8283 * src/buffer.C (getLatexName): ditto
8284 (setReadonly): ditto
8286 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8288 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8289 avoid some uses of current_view. Added also a bufferParams()
8290 method to get at this.
8292 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8294 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8296 * src/lyxparagraph.[Ch]: removed
8297 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8298 with operators used by lower_bound and
8299 upper_bound in InsetTable's
8300 Make struct InsetTable private again. Used matchpos.
8302 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8304 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8305 document, the language of existing text is changed (unless the
8306 document is multi-lingual)
8308 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8310 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8312 * A lot of files: A rewrite of the Right-to-Left support.
8314 2000-04-10 Juergen Vigna <jug@sad.it>
8316 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8317 misplaced cursor when inset in inset is locked.
8319 * src/insets/insettext.C (LocalDispatch): small fix so that a
8320 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8322 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8323 footnote font should be decreased in size twice when displaying.
8325 * src/insets/insettext.C (GetDrawFont): inserted this function as
8326 the drawing-font may differ from the real paragraph font.
8328 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8329 insets (inset in inset!).
8331 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8332 function here because we don't want footnotes inside footnotes.
8334 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8336 (init): now set the inset_owner in paragraph.C
8337 (LocalDispatch): added some resetPos() in the right position
8340 (pasteSelection): changed to use the new CutAndPaste-Class.
8342 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8343 which tells if it is allowed to insert another inset inside this one.
8345 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8346 SwitchLayoutsBetweenClasses.
8348 * src/text2.C (InsertInset): checking of the new paragraph-function
8350 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8351 is not needed anymore here!
8354 (PasteSelection): redone (also with #ifdef) so that now this uses
8355 the CutAndPaste-Class.
8356 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8359 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8360 from/to text/insets.
8362 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8363 so that the paragraph knows if it is inside an (text)-inset.
8364 (InsertFromMinibuffer): changed return-value to bool as now it
8365 may happen that an inset is not inserted in the paragraph.
8366 (InsertInsetAllowed): this checks if it is allowed to insert an
8367 inset in this paragraph.
8369 (BreakParagraphConservative):
8370 (BreakParagraph) : small change for the above change of the return
8371 value of InsertFromMinibuffer.
8373 * src/lyxparagraph.h: added inset_owner and the functions to handle
8374 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8376 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8378 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8379 functions from BufferView to BufferView::Pimpl to ease maintence.
8381 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8382 correctly. Also use SetCursorIntern instead of SetCursor.
8384 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8387 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8389 * src/WorkArea.C (belowMouse): manually implement below mouse.
8391 * src/*: Add "explicit" on several constructors, I added probably
8392 some unneeded ones. A couple of changes to code because of this.
8394 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8395 implementation and private parts from the users of BufferView. Not
8398 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8399 implementation and private parts from the users of LyXLex. Not
8402 * src/BufferView_pimpl.[Ch]: new files
8404 * src/lyxlex_pimpl.[Ch]: new files
8406 * src/LyXView.[Ch]: some inline functions move out-of-line
8408 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8410 * src/lyxparagraph.h: make struct InsetTable public.
8412 * src/support/lyxstring.h: change lyxstring::difference_type to be
8413 ptrdiff_t. Add std:: modifiers to streams.
8415 * src/font.C: include the <cctype> header, for islower() and
8418 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8420 * src/font.[Ch]: new files. Contains the metric functions for
8421 fonts, takes a LyXFont as parameter. Better separation of concepts.
8423 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8424 changes because of this.
8426 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8428 * src/*: compile with -Winline and move functions that don't
8431 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8434 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8436 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8437 (various files changed because of this)
8439 * src/Painter.C (text): fixed the drawing of smallcaps.
8441 * src/lyxfont.[Ch] (drawText): removed unused member func.
8444 * src/*.C: added needed "using" statements and "std::" qualifiers.
8446 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8448 * src/*.h: removed all use of "using" from header files use
8449 qualifier std:: instead.
8451 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8453 * src/text.C (Backspace): some additional cleanups (we already
8454 know whether cursor.pos is 0 or not).
8456 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8457 automake does not provide one).
8459 * src/bmtable.h: replace C++ comments with C comments.
8461 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8463 * src/screen.C (ShowCursor): Change the shape of the cursor if
8464 the current language is not equal to the language of the document.
8465 (If the cursor change its shape unexpectedly, then you've found a bug)
8467 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8470 * src/insets/insetnumber.[Ch]: New files.
8472 * src/LyXAction.C (init)
8473 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8476 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8478 * src/lyxparagraph.h
8479 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8480 (the vector is kept sorted).
8482 * src/text.C (GetVisibleRow): Draw selection correctly when there
8483 is both LTR and RTL text.
8485 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8486 which is much faster.
8488 * src/text.C (GetVisibleRow and other): Do not draw the last space
8489 in a row if the direction of the last letter is not equal to the
8490 direction of the paragraph.
8492 * src/lyxfont.C (latexWriteStartChanges):
8493 Check that font language is not equal to basefont language.
8494 (latexWriteEndChanges): ditto
8496 * src/lyx_cb.C (StyleReset): Don't change the language while using
8497 the font-default command.
8499 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8500 empty paragraph before a footnote.
8502 * src/insets/insetcommand.C (draw): Increase x correctly.
8504 * src/screen.C (ShowCursor): Change cursor shape if
8505 current language != document language.
8507 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8509 2000-03-31 Juergen Vigna <jug@sad.it>
8511 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8512 (Clone): changed mode how the paragraph-data is copied to the
8513 new clone-paragraph.
8515 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8516 GetInset(pos) with no inset anymore there (in inset UNDO)
8518 * src/insets/insetcommand.C (draw): small fix as here x is
8519 incremented not as much as width() returns (2 before, 2 behind = 4)
8521 2000-03-30 Juergen Vigna <jug@sad.it>
8523 * src/insets/insettext.C (InsetText): small fix in initialize
8524 widthOffset (should not be done in the init() function)
8526 2000-03-29 Amir Karger <karger@lyx.org>
8528 * lib/examples/it_ItemizeBullets.lyx: translation by
8531 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8533 2000-03-29 Juergen Vigna <jug@sad.it>
8535 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8537 * src/insets/insetfoot.C (Clone): small change as for the below
8538 new init function in the text-inset
8540 * src/insets/insettext.C (init): new function as I've seen that
8541 clone did not copy the Paragraph-Data!
8542 (LocalDispatch): Added code so that now we have some sort of Undo
8543 functionality (well actually we HAVE Undo ;)
8545 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8547 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8549 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8552 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8554 * src/main.C: added a runtime check that verifies that the xforms
8555 header used when building LyX and the library used when running
8556 LyX match. Exit with a message if they don't match. This is a
8557 version number check only.
8559 * src/buffer.C (save): Don't allocate memory on the heap for
8560 struct utimbuf times.
8562 * *: some using changes, use iosfwd instead of the real headers.
8564 * src/lyxfont.C use char const * instead of string for the static
8565 strings. Rewrite some functions to use sstream.
8567 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8569 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8572 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8574 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8575 of Geodesy (from Martin Vermeer)
8577 * lib/layouts/svjour.inc: include file for the Springer svjour
8578 class. It can be used to support journals other than JoG.
8580 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8581 Miskiewicz <misiek@pld.org.pl>)
8582 * lib/reLyX/Makefile.am: ditto.
8584 2000-03-27 Juergen Vigna <jug@sad.it>
8586 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8587 also some modifications with operations on selected text.
8589 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8590 problems with clicking on insets (last famous words ;)
8592 * src/insets/insetcommand.C (draw):
8593 (width): Changed to have a bit of space before and after the inset so
8594 that the blinking cursor can be seen (otherwise it was hidden)
8596 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8598 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8599 would not be added to the link list when an installed gettext (not
8600 part of libc) is found.
8602 2000-03-24 Juergen Vigna <jug@sad.it>
8604 * src/insets/insetcollapsable.C (Edit):
8605 * src/mathed/formula.C (InsetButtonRelease):
8606 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8609 * src/BufferView.C (workAreaButtonPress):
8610 (workAreaButtonRelease):
8611 (checkInsetHit): Finally fixed the clicking on insets be handled
8614 * src/insets/insetert.C (Edit): inserted this call so that ERT
8615 insets work always with LaTeX-font
8617 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8619 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8620 caused lyx to startup with no GUI in place, causing in a crash
8621 upon startup when called with arguments.
8623 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8625 * src/FontLoader.C: better initialization of dummyXFontStruct.
8627 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8629 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8630 for linuxdoc and docbook import and export format options.
8632 * lib/lyxrc.example Example of default values for the previous flags.
8634 * src/lyx_cb.C Use those flags instead of the hardwired values for
8635 linuxdoc and docbook export.
8637 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8640 * src/menus.C Added menus entries for the new import/exports formats.
8642 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8644 * src/lyxrc.*: Added support for running without Gui
8647 * src/FontLoader.C: sensible defaults if no fonts are needed
8649 * src/lyx_cb.C: New function ShowMessage (writes either to the
8650 minibuffer or cout in case of no gui
8651 New function AskOverwrite for common stuff
8652 Consequently various changes to call these functions
8654 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8655 wild guess at sensible screen resolution when having no gui
8657 * src/lyxfont.C: no gui, no fonts... set some defaults
8659 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8661 * src/LColor.C: made the command inset background a bit lighter.
8663 2000-03-20 Hartmut Goebel <goebel@noris.net>
8665 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8666 stdstruct.inc. Koma-Script added some title elements which
8667 otherwise have been listed below "bibliography". This split allows
8668 adding title elements to where they belong.
8670 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8671 define the additional title elements and then include
8674 * many other layout files: changed to include stdtitle.inc just
8675 before stdstruct.inc.
8677 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8679 * src/buffer.C: (save) Added the option to store all backup files
8680 in a single directory
8682 * src/lyxrc.[Ch]: Added variable \backupdir_path
8684 * lib/lyxrc.example: Added descriptions of recently added variables
8686 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8687 bibtex inset, not closing the bibtex popup when deleting the inset)
8689 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8691 * src/lyx_cb.C: add a couple using directives.
8693 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8694 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8695 import based on the filename.
8697 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8698 file would be imported at start, if the filename where of a sgml file.
8700 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8702 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8704 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8705 * src/lyxfont.h Replaced the member variable bits.direction by the
8706 member variable lang. Made many changes in other files.
8707 This allows having a multi-lingual document
8709 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8710 that change the current language to <l>.
8711 Removed the command "font-rtl"
8713 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8714 format for Hebrew documents)
8716 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8717 When auto_mathmode is "true", pressing a digit key in normal mode
8718 will cause entering into mathmode.
8719 If auto_mathmode is "rtl" then this behavior will be active only
8720 when writing right-to-left text.
8722 * src/text2.C (InsertStringA) The string is inserted using the
8725 * src/paragraph.C (GetEndLabel) Gives a correct result for
8726 footnote paragraphs.
8728 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8730 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8732 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8733 front of PasteParagraph. Never insert a ' '. This should at least
8734 fix some cause for the segfaults that we have been experiencing,
8735 it also fixes backspace behaviour slightly. (Phu!)
8737 * src/support/lstrings.C (compare_no_case): some change to make it
8738 compile with gcc 2.95.2 and stdlibc++-v3
8740 * src/text2.C (MeltFootnoteEnvironment): change type o
8741 first_footnote_par_is_not_empty to bool.
8743 * src/lyxparagraph.h: make text private. Changes in other files
8745 (fitToSize): new function
8746 (setContentsFromPar): new function
8747 (clearContents): new function
8748 (SetChar): new function
8750 * src/paragraph.C (readSimpleWholeFile): deleted.
8752 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8753 the file, just use a simple string instead. Also read the file in
8754 a more maintainable manner.
8756 * src/text2.C (InsertStringA): deleted.
8757 (InsertStringB): deleted.
8759 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8761 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8762 RedoParagraphs from the doublespace handling part, just set status
8763 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8764 done, but perhaps not like this.)
8766 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8768 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8769 character when inserting an inset.
8771 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8773 * src/bufferparams.C (readLanguage): now takes "default" into
8776 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8777 also initialize the toplevel_keymap with the default bindings from
8780 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8782 * all files using lyxrc: have lyxrc as a real variable and not a
8783 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8786 * src/lyxrc.C: remove double call to defaultKeyBindings
8788 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8789 toolbar defauls using lyxlex. Remove enums, structs, functions
8792 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8793 toolbar defaults. Also store default keybindings in a map.
8795 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8796 storing the toolbar defaults without any xforms dependencies.
8798 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8799 applied. Changed to use iterators.
8801 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8803 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8804 systems that don't have LINGUAS set to begin with.
8806 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8808 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8809 the list by Dekel Tsur.
8811 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8813 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8814 * src/insets/form_graphics.C: ditto.
8816 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8818 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8820 * src/bufferparams.C (readLanguage): use the new language map
8822 * src/intl.C (InitKeyMapper): use the new language map
8824 * src/lyx_gui.C (create_forms): use the new language map
8826 * src/language.[Ch]: New files. Used for holding the information
8827 about each language. Now! Use this new language map enhance it and
8828 make it really usable for our needs.
8830 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8832 * screen.C (ShowCursor): Removed duplicate code.
8833 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8834 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8836 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8839 * src/text.C Added TransformChar method. Used for rendering Arabic
8840 text correctly (change the glyphs of the letter according to the
8841 position in the word)
8846 * src/lyxrc.C Added lyxrc command {language_command_begin,
8847 language_command_end,language_command_ltr,language_command_rtl,
8848 language_package} which allows the use of either arabtex or Omega
8851 * src/lyx_gui.C (init)
8853 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8854 to use encoding for menu fonts which is different than the encoding
8857 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8858 do not load the babel package.
8859 To write an English document with Hebrew/Arabic, change the document
8860 language to "english".
8862 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8863 (alphaCounter): changed to return char
8864 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8866 * lib/lyxrc.example Added examples for Hebrew/Arabic
8869 * src/layout.C Added layout command endlabeltype
8871 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8873 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8875 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8877 * src/mathed/math_delim.C (search_deco): return a
8878 math_deco_struct* instead of index.
8880 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8882 * All files with a USE_OSTREAM_ONLY within: removed all code that
8883 was unused when USE_OSTREAM_ONLY is defined.
8885 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8886 of any less. Removed header and using.
8888 * src/text.C (GetVisibleRow): draw the string "Page Break
8889 (top/bottom)" on screen when drawing a pagebreak line.
8891 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8893 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8895 * src/mathed/math_macro.C (draw): do some cast magic.
8898 * src/mathed/math_defs.h: change byte* argument to byte const*.
8900 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8902 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8903 know it is right to return InsetFoot* too, but cxx does not like
8906 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8908 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8910 * src/mathed/math_delim.C: change == to proper assignment.
8912 2000-03-09 Juergen Vigna <jug@sad.it>
8914 * src/insets/insettext.C (setPos): fixed various cursor positioning
8915 problems (via mouse and cursor-keys)
8916 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8917 inset (still a small display problem but it works ;)
8919 * src/insets/insetcollapsable.C (draw): added button_top_y and
8920 button_bottom_y to have correct values for clicking on the inset.
8922 * src/support/lyxalgo.h: commented out 'using std::less'
8924 2000-03-08 Juergen Vigna <jug@sad.it>
8926 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8927 Button-Release event closes as it is alos the Release-Event
8930 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8932 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8934 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8935 can add multiple spaces in Scrap (literate programming) styles...
8936 which, by the way, is how I got hooked on LyX to begin with.
8938 * src/mathed/formula.C (Write): Added dummy variable to an
8939 inset::Latex() call.
8940 (Latex): Add free_spacing boolean to inset::Latex()
8942 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8944 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8945 virtual function to include the free_spacing boolean from
8946 the containing paragraph's style.
8948 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8949 Added free_spacing boolean arg to match inset.h
8951 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8952 Added free_spacing boolean arg to match inset.h
8954 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8955 Added free_spacing boolean and made sure that if in a free_spacing
8956 paragraph, that we output normal space if there is a protected space.
8958 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8959 Added free_spacing boolean arg to match inset.h
8961 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8962 Added free_spacing boolean arg to match inset.h
8964 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8965 Added free_spacing boolean arg to match inset.h
8967 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8968 Added free_spacing boolean arg to match inset.h
8970 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8971 Added free_spacing boolean arg to match inset.h
8973 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8974 free_spacing boolean arg to match inset.h
8976 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8977 Added free_spacing boolean arg to match inset.h
8979 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8980 Added free_spacing boolean arg to match inset.h
8982 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8983 Added free_spacing boolean arg to match inset.h
8985 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8986 Added free_spacing boolean arg to match inset.h
8988 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8989 Added free_spacing boolean arg to match inset.h
8991 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8992 free_spacing boolean arg to match inset.h
8994 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8995 free_spacing boolean arg to match inset.h
8997 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8998 ignore free_spacing paragraphs. The user's spaces are left
9001 * src/text.C (InsertChar): Fixed the free_spacing layout
9002 attribute behavior. Now, if free_spacing is set, you can
9003 add multiple spaces in a paragraph with impunity (and they
9004 get output verbatim).
9005 (SelectSelectedWord): Added dummy argument to inset::Latex()
9008 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9011 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9012 paragraph layouts now only input a simple space instead.
9013 Special character insets don't make any sense in free-spacing
9016 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9017 hard-spaces in the *input* file to simple spaces if the layout
9018 is free-spacing. This converts old files which had to have
9019 hard-spaces in free-spacing layouts where a simple space was
9021 (writeFileAscii): Added free_spacing check to pass to the newly
9022 reworked inset::Latex(...) methods. The inset::Latex() code
9023 ensures that hard-spaces in free-spacing paragraphs get output
9024 as spaces (rather than "~").
9026 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9028 * src/mathed/math_delim.C (draw): draw the empty placeholder
9029 delims with a onoffdash line.
9030 (struct math_deco_compare): struct that holds the "functors" used
9031 for the sort and the binary search in math_deco_table.
9032 (class init_deco_table): class used for initial sort of the
9034 (search_deco): use lower_bound to do a binary search in the
9037 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9039 * src/lyxrc.C: a small secret thingie...
9041 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9042 and to not flush the stream as often as it used to.
9044 * src/support/lyxalgo.h: new file
9045 (sorted): template function used for checking if a sequence is
9046 sorted or not. Two versions with and without user supplied
9047 compare. Uses same compare as std::sort.
9049 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9050 it and give warning on lyxerr.
9052 (struct compare_tags): struct with function operators used for
9053 checking if sorted, sorting and lower_bound.
9054 (search_kw): use lower_bound instead of manually implemented
9057 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9059 * src/insets/insetcollapsable.h: fix Clone() declaration.
9060 * src/insets/insetfoot.h: ditto.
9062 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9064 2000-03-08 Juergen Vigna <jug@sad.it>
9066 * src/insets/lyxinset.h: added owner call which tells us if
9067 this inset is inside another inset. Changed also the return-type
9068 of Editable to an enum so it tells clearer what the return-value is.
9070 * src/insets/insettext.C (computeTextRows): fixed computing of
9071 textinsets which split automatically on more rows.
9073 * src/insets/insetert.[Ch]: changed this to be of BaseType
9076 * src/insets/insetfoot.[Ch]: added footnote inset
9078 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9079 collapsable insets (like footnote, ert, ...)
9081 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9083 * src/lyxdraw.h: remvoe file
9085 * src/lyxdraw.C: remove file
9087 * src/insets/insettext.C: added <algorithm>.
9089 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9091 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9092 (matrix_cb): case MM_OK use string stream
9094 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9097 * src/mathed/math_macro.C (draw): use string stream
9098 (Metrics): use string stream
9100 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9101 directly to the ostream.
9103 * src/vspace.C (asString): use string stream.
9104 (asString): use string stream
9105 (asLatexString): use string stream
9107 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9108 setting Spacing::Other.
9110 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9111 sprintf when creating the stretch vale.
9113 * src/text2.C (alphaCounter): changed to return a string and to
9114 not use a static variable internally. Also fixed a one-off bug.
9115 (SetCounter): changed the drawing of the labels to use string
9116 streams instead of sprintf.
9118 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9119 manipulator to use a scheme that does not require library support.
9120 This is also the way it is done in the new GNU libstdc++. Should
9121 work with DEC cxx now.
9123 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9125 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9126 end. This fixes a bug.
9128 * src/mathed (all files concerned with file writing): apply the
9129 USE_OSTREAM_ONLY changes to mathed too.
9131 * src/support/DebugStream.h: make the constructor explicit.
9133 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9134 count and ostream squashed.
9136 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9138 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9140 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9141 ostringstream uses STL strings, and we might not.
9143 * src/insets/insetspecialchar.C: add using directive.
9144 * src/insets/insettext.C: ditto.
9146 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9148 * lib/layouts/seminar.layout: feeble attempt at a layout for
9149 seminar.cls, far from completet and could really use some looking
9150 at from people used to write layout files.
9152 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9153 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9154 a lot nicer and works nicely with ostreams.
9156 * src/mathed/formula.C (draw): a slightly different solution that
9157 the one posted to the list, but I think this one works too. (font
9158 size wrong in headers.)
9160 * src/insets/insettext.C (computeTextRows): some fiddling on
9161 Jürgens turf, added some comments that he should read.
9163 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9164 used and it gave compiler warnings.
9165 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9168 * src/lyx_gui.C (create_forms): do the right thing when
9169 show_banner is true/false.
9171 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9172 show_banner is false.
9174 * most file writing files: Now use iostreams to do almost all of
9175 the writing. Also instead of passing string &, we now use
9176 stringstreams. mathed output is still not adapted to iostreams.
9177 This change can be turned off by commenting out all the occurences
9178 of the "#define USE_OSTREAM_ONLY 1" lines.
9180 * src/WorkArea.C (createPixmap): don't output debug messages.
9181 (WorkArea): don't output debug messages.
9183 * lib/lyxrc.example: added a comment about the new variable
9186 * development/Code_rules/Rules: Added some more commente about how
9187 to build class interfaces and on how better encapsulation can be
9190 2000-03-03 Juergen Vigna <jug@sad.it>
9192 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9193 automatically with the width of the LyX-Window
9195 * src/insets/insettext.C (computeTextRows): fixed update bug in
9196 displaying text-insets (scrollvalues where not initialized!)
9198 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9200 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9201 id in the check of the result from lower_bound is not enough since
9202 lower_bound can return last too, and then res->id will not be a
9205 * all insets and some code that use them: I have conditionalized
9206 removed the Latex(string & out, ...) this means that only the
9207 Latex(ostream &, ...) will be used. This is a work in progress to
9208 move towards using streams for all output of files.
9210 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9213 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9215 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9216 routine (this fixes bug where greek letters were surrounded by too
9219 * src/support/filetools.C (findtexfile): change a bit the search
9220 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9221 no longer passed to kpsewhich, we may have to change that later.
9223 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9224 warning options to avoid problems with X header files (from Angus
9226 * acinclude.m4: regenerated.
9228 2000-03-02 Juergen Vigna <jug@sad.it>
9230 * src/insets/insettext.C (WriteParagraphData): Using the
9231 par->writeFile() function for writing paragraph-data.
9232 (Read): Using buffer->parseSingleLyXformat2Token()-function
9233 for parsing paragraph data!
9235 * src/buffer.C (readLyXformat2): removed all parse data and using
9236 the new parseSingleLyXformat2Token()-function.
9237 (parseSingleLyXformat2Token): added this function to parse (read)
9238 lyx-file-format (this is called also from text-insets now!)
9240 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9242 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9245 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9246 directly instead of going through a func. One very bad thing: a
9247 static LyXFindReplace, but I don't know where to place it.
9249 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9250 string instead of char[]. Also changed to static.
9251 (GetSelectionOrWordAtCursor): changed to static inline
9252 (SetSelectionOverLenChars): ditto.
9254 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9255 current_view and global variables. both classes has changed names
9256 and LyXFindReplace is not inherited from SearchForm.
9258 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9259 fl_form_search form.
9261 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9263 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9265 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9266 bound (from Kayvan).
9268 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9270 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9272 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9274 * some things that I should comment but the local pub says head to
9277 * comment out all code that belongs to the Roff code for Ascii
9278 export of tables. (this is unused)
9280 * src/LyXView.C: use correct type for global variable
9281 current_layout. (LyXTextClass::size_type)
9283 * some code to get the new insetgraphics closer to working I'd be
9284 grateful for any help.
9286 * src/BufferView2.C (insertInset): use the return type of
9287 NumberOfLayout properly. (also changes in other files)
9289 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9290 this as a test. I want to know what breaks because of this.
9292 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9294 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9296 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9297 to use a \makebox in the label, this allows proper justification
9298 with out using protected spaces or multiple hfills. Now it is
9299 "label" for left justified, "\hfill label\hfill" for center, and
9300 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9301 should be changed accordingly.
9303 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9305 * src/lyxtext.h: change SetLayout() to take a
9306 LyXTextClass::size_type instead of a char (when there is more than
9307 127 layouts in a class); also change type of copylayouttype.
9308 * src/text2.C (SetLayout): ditto.
9309 * src/LyXView.C (updateLayoutChoice): ditto.
9311 * src/LaTeX.C (scanLogFile): errors where the line number was not
9312 given just after the '!'-line were ignored (from Dekel Tsur).
9314 * lib/lyxrc.example: fix description of \date_insert_format
9316 * lib/layouts/llncs.layout: new layout, contributed by Martin
9319 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9321 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9322 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9323 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9324 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9325 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9326 paragraph.C, text.C, text2.C)
9328 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9330 * src/insets/insettext.C (LocalDispatch): remove extra break
9333 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9334 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9336 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9337 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9339 * src/insets/insetbib.h: move InsetBibkey::Holder and
9340 InsetCitation::Holder in public space.
9342 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9344 * src/insets/insettext.h: small change to get the new files from
9345 Juergen to compile (use "string", not "class string").
9347 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9348 const & as parameter to LocalDispatch, use LyXFont const & as
9349 paramter to some other func. This also had impacto on lyxinsets.h
9350 and the two mathed insets.
9352 2000-02-24 Juergen Vigna <jug@sad.it>
9355 * src/commandtags.h:
9357 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9361 * src/BufferView2.C: added/updated code for various inset-functions
9363 * src/insets/insetert.[Ch]: added implementation of InsetERT
9365 * src/insets/insettext.[Ch]: added implementation of InsetText
9367 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9368 (draw): added preliminary code for inset scrolling not finshed yet
9370 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9371 as it is in lyxfunc.C now
9373 * src/insets/lyxinset.h: Added functions for text-insets
9375 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9377 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9378 BufferView and reimplement the list as a queue put inside its own
9381 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9383 * several files: use the new interface to the "updateinsetlist"
9385 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9387 (work_area_handler): call BufferView::trippleClick on trippleclick.
9389 * src/BufferView.C (doubleClick): new function, selects word on
9391 (trippleClick): new function, selects line on trippleclick.
9393 2000-02-22 Allan Rae <rae@lyx.org>
9395 * lib/bind/xemacs.bind: buffer-previous not supported
9397 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9399 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9402 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9404 * src/bufferlist.C: get rid of current_view from this file
9406 * src/spellchecker.C: get rid of current_view from this file
9408 * src/vspace.C: get rid of current_view from this file
9409 (inPixels): added BufferView parameter for this func
9410 (asLatexCommand): added a BufferParams for this func
9412 * src/text.C src/text2.C: get rid of current_view from these
9415 * src/lyxfont.C (getFontDirection): move this function here from
9418 * src/bufferparams.C (getDocumentDirection): move this function
9421 * src/paragraph.C (getParDirection): move this function here from
9423 (getLetterDirection): ditto
9425 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9427 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9428 resize due to wrong pixmap beeing used. Also took the opurtunity
9429 to make the LyXScreen stateless on regard to WorkArea and some
9430 general cleanup in the same files.
9432 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9434 * src/Makefile.am: add missing direction.h
9436 * src/PainterBase.h: made the width functions const.
9438 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9441 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9443 * src/insets/insetlatexaccent.C (draw): make the accents draw
9444 better, at present this will only work well with iso8859-1.
9446 * several files: remove the old drawing code, now we use the new
9449 * several files: remove support for mono_video, reverse_video and
9452 2000-02-17 Juergen Vigna <jug@sad.it>
9454 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9455 int ** as we have to return the pointer, otherwise we have only
9456 NULL pointers in the returning function.
9458 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9460 * src/LaTeX.C (operator()): quote file name when running latex.
9462 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9464 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9465 (bubble tip), this removes our special handling of this.
9467 * Remove all code that is unused now that we have the new
9468 workarea. (Code that are not active when NEW_WA is defined.)
9470 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9472 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9474 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9475 nonexisting layout; correctly redirect obsoleted layouts.
9477 * lib/lyxrc.example: document \view_dvi_paper_option
9479 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9482 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9483 (PreviewDVI): handle the view_dvi_paper_option variable.
9484 [Both from Roland Krause]
9486 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9488 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9489 char const *, int, LyXFont)
9490 (text(int, int, string, LyXFont)): ditto
9492 * src/text.C (InsertCharInTable): attempt to fix the double-space
9493 feature in tables too.
9494 (BackspaceInTable): ditto.
9495 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9497 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9499 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9501 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9502 newly found text in textcache to this.
9503 (buffer): set the owner of the text put into the textcache to 0
9505 * src/insets/figinset.C (draw): fixed the drawing of figures with
9508 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9509 drawing of mathframe, hfills, protected space, table lines. I have
9510 now no outstanding drawing problems with the new Painter code.
9512 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9514 * src/PainterBase.C (ellipse, circle): do not specify the default
9517 * src/LColor.h: add using directive.
9519 * src/Painter.[Ch]: change return type of methods from Painter& to
9520 PainterBase&. Add a using directive.
9522 * src/WorkArea.C: wrap xforms callbacks in C functions
9525 * lib/layouts/foils.layout: font fix and simplifications from Carl
9528 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9530 * a lot of files: The Painter, LColor and WorkArea from the old
9531 devel branch has been ported to lyx-devel. Some new files and a
9532 lot of #ifdeffed code. The new workarea is enabled by default, but
9533 if you want to test the new Painter and LColor you have to compile
9534 with USE_PAINTER defined (do this in config.h f.ex.) There are
9535 still some rought edges, and I'd like some help to clear those
9536 out. It looks stable (loads and displays the Userguide very well).
9539 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9541 * src/buffer.C (pop_tag): revert to the previous implementation
9542 (use a global variable for both loops).
9544 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9546 * src/lyxrc.C (LyXRC): change slightly default date format.
9548 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9549 there is an English text with a footnote that starts with a Hebrew
9550 paragraph, or vice versa.
9551 (TeXFootnote): ditto.
9553 * src/text.C (LeftMargin): allow for negative values for
9554 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9557 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9558 for input encoding (cyrillic)
9560 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9562 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9565 * src/toolbar.C (set): ditto
9566 * src/insets/insetbib.C (create_form_citation_form): ditto
9568 * lib/CREDITS: added Dekel Tsur.
9570 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9571 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9572 hebrew supports files from Dekel Tsur.
9574 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9575 <tzafrir@technion.ac.il>
9577 * src/lyxrc.C: put \date_insert_format at the right place.
9579 * src/buffer.C (makeLaTeXFile): fix the handling of
9580 BufferParams::sides when writing out latex files.
9582 * src/BufferView2.C: add a "using" directive.
9584 * src/support/lyxsum.C (sum): when we use lyxstring,
9585 ostringstream::str needs an additional .c_str().
9587 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9589 * src/support/filetools.C (ChangeExtension): patch from Etienne
9592 * src/TextCache.C (show): remove const_cast and make second
9593 parameter non-const LyXText *.
9595 * src/TextCache.h: use non const LyXText in show.
9597 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9600 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9602 * src/support/lyxsum.C: rework to be more flexible.
9604 * several places: don't check if a pointer is 0 if you are going
9607 * src/text.C: remove some dead code.
9609 * src/insets/figinset.C: remove some dead code
9611 * src/buffer.C: move the BufferView funcs to BufferView2.C
9612 remove all support for insetlatexdel
9613 remove support for oldpapersize stuff
9614 made some member funcs const
9616 * src/kbmap.C: use a std::list to store the bindings in.
9618 * src/BufferView2.C: new file
9620 * src/kbsequence.[Ch]: new files
9622 * src/LyXAction.C + others: remove all trace of buffer-previous
9624 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9625 only have one copy in the binary of this table.
9627 * hebrew patch: moved some functions from LyXText to more
9628 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9630 * several files: remove support for XForms older than 0.88
9632 remove some #if 0 #endif code
9634 * src/TextCache.[Ch]: new file. Holds the textcache.
9636 * src/BufferView.C: changes to use the new TextCache interface.
9637 (waitForX): remove the now unused code.
9639 * src/BackStack.h: remove some commented code
9641 * lib/bind/emacs.bind: remove binding for buffer-previous
9643 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9645 * applied the hebrew patch.
9647 * src/lyxrow.h: make sure that all Row variables are initialized.
9649 * src/text2.C (TextHandleUndo): comment out a delete, this might
9650 introduce a memory leak, but should also help us to not try to
9651 read freed memory. We need to look at this one.
9653 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9654 (LyXParagraph): initalize footnotekind.
9656 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9657 forgot this when applying the patch. Please heed the warnings.
9659 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9660 (aka. reformat problem)
9662 * src/bufferlist.C (exists): made const, and use const_iterator
9663 (isLoaded): new func.
9664 (release): use std::find to find the correct buffer.
9666 * src/bufferlist.h: made getState a const func.
9667 made empty a const func.
9668 made exists a const func.
9671 2000-02-01 Juergen Vigna <jug@sad.it>
9673 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9675 * po/it.po: updated a bit the italian po file and also changed the
9676 'file nuovo' for newfile to 'filenuovo' without a space, this did
9679 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9680 for the new insert_date command.
9682 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9683 from jdblair, to insert a date into the current text conforming to
9684 a strftime format (for now only considering the locale-set and not
9685 the document-language).
9687 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9689 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9690 Bounds Read error seen by purify. The problem was that islower is
9691 a macros which takes an unsigned char and uses it as an index for
9692 in array of characters properties (and is thus subject to the
9696 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9697 correctly the paper sides radio buttons.
9698 (UpdateDocumentButtons): ditto.
9700 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9702 * src/kbmap.C (getsym + others): change to return unsigned int,
9703 returning a long can give problems on 64 bit systems. (I assume
9704 that int is 32bit on 64bit systems)
9706 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9708 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9709 LyXLookupString to be zero-terminated. Really fixes problems seen
9712 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9714 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9715 write a (char*)0 to the lyxerr stream.
9717 * src/lastfiles.C: move algorithm before the using statemets.
9719 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9721 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9722 complains otherwise).
9723 * src/table.C: ditto
9725 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9728 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9729 that I removed earlier... It is really needed.
9731 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9733 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9735 * INSTALL: update xforms home page URL.
9737 * lib/configure.m4: fix a bug with unreadable layout files.
9739 * src/table.C (calculate_width_of_column): add "using std::max"
9742 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9744 * several files: marked several lines with "DEL LINE", this is
9745 lines that can be deleted without changing anything.
9746 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9747 checks this anyway */
9750 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9752 * src/DepTable.C (update): add a "+" at the end when the checksum
9753 is different. (debugging string only)
9755 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9756 the next inset to not be displayed. This should also fix the list
9757 of labels in the "Insert Crossreference" dialog.
9759 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9761 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9762 when regex was not found.
9764 * src/support/lstrings.C (lowercase): use handcoded transform always.
9767 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9768 old_cursor.par->prev could be 0.
9770 * several files: changed post inc/dec to pre inc/dec
9772 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9773 write the lastfiles to file.
9775 * src/BufferView.C (buffer): only show TextCache info when debugging
9777 (resizeCurrentBuffer): ditto
9778 (workAreaExpose): ditto
9780 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9782 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9784 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9785 a bit better by removing the special case for \i and \j.
9787 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9789 * src/lyx_main.C (easyParse): remove test for bad comand line
9790 options, since this broke all xforms-related parsing.
9792 * src/kbmap.C (getsym): set return type to unsigned long, as
9793 declared in header. On an alpha, long is _not_ the same as int.
9795 * src/support/LOstream.h: add a "using std::flush;"
9797 * src/insets/figinset.C: ditto.
9799 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9801 * src/bufferlist.C (write): use blinding fast file copy instead of
9802 "a char at a time", now we are doing it the C++ way.
9804 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9805 std::list<int> instead.
9806 (addpidwait): reflect move to std::list<int>
9807 (sigchldchecker): ditto
9809 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9812 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9813 that obviously was wrong...
9815 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9816 c, this avoids warnings with purify and islower.
9818 * src/insets/figinset.C: rename struct queue to struct
9819 queue_element and rewrite to use a std::queue. gsqueue is now a
9820 std::queue<queue_element>
9821 (runqueue): reflect move to std::queue
9824 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9825 we would get "1" "0" instead of "true" "false. Also make the tostr
9828 2000-01-21 Juergen Vigna <jug@sad.it>
9830 * src/buffer.C (writeFileAscii): Disabled code for special groff
9831 handling of tabulars till I fix this in table.C
9833 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9835 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9837 * src/support/lyxlib.h: ditto.
9839 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9841 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9842 and 'j' look better. This might fix the "macron" bug that has been
9845 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9846 functions as one template function. Delete the old versions.
9848 * src/support/lyxsum.C: move using std::ifstream inside
9851 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9854 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9856 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9858 * src/insets/figinset.C (InitFigures): use new instead of malloc
9859 to allocate memory for figures and bitmaps.
9860 (DoneFigures): use delete[] instead of free to deallocate memory
9861 for figures and bitmaps.
9862 (runqueue): use new to allocate
9863 (getfigdata): use new/delete[] instead of malloc/free
9864 (RegisterFigure): ditto
9866 * some files: moved some declarations closer to first use, small
9867 whitespace changes use preincrement instead of postincrement where
9868 it does not make a difference.
9870 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9871 step on the way to use stl::containers for key maps.
9873 * src/bufferlist.h: add a typedef for const_iterator and const
9874 versions of begin and end.
9876 * src/bufferlist.[Ch]: change name of member variable _state to
9877 state_. (avoid reserved names)
9879 (getFileNames): returns the filenames of the buffers in a vector.
9881 * configure.in (ALL_LINGUAS): added ro
9883 * src/support/putenv.C: new file
9885 * src/support/mkdir.C: new file
9887 2000-01-20 Allan Rae <rae@lyx.org>
9889 * lib/layouts/IEEEtran.layout: Added several theorem environments
9891 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9892 couple of minor additions.
9894 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9895 (except for those in footnotes of course)
9897 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9899 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9901 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9902 std::sort and std::lower_bound instead of qsort and handwritten
9904 (struct compara): struct that holds the functors used by std::sort
9905 and std::lower_bound in MathedLookupBOP.
9907 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9909 * src/support/LAssert.h: do not do partial specialization. We do
9912 * src/support/lyxlib.h: note that lyx::getUserName() and
9913 lyx::date() are not in use right now. Should these be suppressed?
9915 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9916 (makeLinuxDocFile): do not put date and user name in linuxdoc
9919 * src/support/lyxlib.h (kill): change first argument to long int,
9920 since that's what solaris uses.
9922 * src/support/kill.C (kill): fix declaration to match prototype.
9924 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9925 actually check whether namespaces are supported. This is not what
9928 * src/support/lyxsum.C: add a using directive.
9930 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9932 * src/support/kill.C: if we have namespace support we don't have
9933 to include lyxlib.h.
9935 * src/support/lyxlib.h: use namespace lyx if supported.
9937 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9939 * src/support/date.C: new file
9941 * src/support/chdir.C: new file
9943 * src/support/getUserName.C: new file
9945 * src/support/getcwd.C: new file
9947 * src/support/abort.C: new file
9949 * src/support/kill.C: new file
9951 * src/support/lyxlib.h: moved all the functions in this file
9952 insede struct lyx. Added also kill and abort to this struct. This
9953 is a way to avoid the "kill is not defined in <csignal>", we make
9954 C++ wrappers for functions that are not ANSI C or ANSI C++.
9956 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9957 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9958 lyx it has been renamed to sum.
9960 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9962 * src/text.C: add using directives for std::min and std::max.
9964 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9966 * src/texrow.C (getIdFromRow): actually return something useful in
9967 id and pos. Hopefully fixes the bug with positionning of errorbox
9970 * src/lyx_main.C (easyParse): output an error and exit if an
9971 incorrect command line option has been given.
9973 * src/spellchecker.C (ispell_check_word): document a memory leak.
9975 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9976 where a "struct utimbuf" is allocated with "new" and deleted with
9979 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9981 * src/text2.C (CutSelection): don't delete double spaces.
9982 (PasteSelection): ditto
9983 (CopySelection): ditto
9985 * src/text.C (Backspace): don't delete double spaces.
9987 * src/lyxlex.C (next): fix a bug that were only present with
9988 conformant std::istream::get to read comment lines, use
9989 std::istream::getline instead. This seems to fix the problem.
9991 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9993 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9994 allowed to insert space before space" editing problem. Please read
9995 commends at the beginning of the function. Comments about usage
9998 * src/text.C (InsertChar): fix for the "not allowed to insert
9999 space before space" editing problem.
10001 * src/text2.C (DeleteEmptyParagraphMechanism): when
10002 IsEmptyTableRow can only return false this last "else if" will
10003 always be a no-op. Commented out.
10005 * src/text.C (RedoParagraph): As far as I can understand tmp
10006 cursor is not really needed.
10008 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10009 present it could only return false anyway.
10010 (several functions): Did something not so smart...added a const
10011 specifier on a lot of methods.
10013 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10014 and add a tmp->text.resize. The LyXParagraph constructor does the
10016 (BreakParagraphConservative): ditto
10018 * src/support/path.h (Path): add a define so that the wrong usage
10019 "Path("/tmp") will be flagged as a compilation error:
10020 "`unnamed_Path' undeclared (first use this function)"
10022 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10024 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10025 which was bogus for several reasons.
10027 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10029 (runBibTeX): ditto.
10031 * autogen.sh: do not use "type -path" (what's that anyway?).
10033 * src/support/filetools.C (findtexfile): remove extraneous space
10034 which caused a kpsewhich warning (at least with kpathsea version
10037 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10039 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10041 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10043 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10045 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10047 * src/paragraph.C (BreakParagraph): do not reserve space on text
10048 if we don't need to (otherwise, if pos_end < pos, we end up
10049 reserving huge amounts of memory due to bad unsigned karma).
10050 (BreakParagraphConservative): ditto, although I have not seen
10051 evidence the bug can happen here.
10053 * src/lyxparagraph.h: add a using std::list.
10055 2000-01-11 Juergen Vigna <jug@sad.it>
10057 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10058 could not be found.
10060 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10062 * src/vc-backend.C (doVCCommand): change to be static and take one
10063 more parameter: the path to chdir too be fore executing the command.
10064 (retrive): new function equiv to "co -r"
10066 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10067 file_not_found_hook is true.
10069 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10071 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10072 if a file is readwrite,readonly...anything else.
10074 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10076 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10077 (CreatePostscript): name change from MenuRunDVIPS (or something)
10078 (PreviewPostscript): name change from MenuPreviewPS
10079 (PreviewDVI): name change from MenuPreviewDVI
10081 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10082 \view_pdf_command., \pdf_to_ps_command
10084 * lib/configure.m4: added search for PDF viewer, and search for
10085 PDF to PS converter.
10086 (lyxrc.defaults output): add \pdflatex_command,
10087 \view_pdf_command and \pdf_to_ps_command.
10089 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10091 * src/bufferlist.C (write): we don't use blocksize for anything so
10094 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10096 * src/support/block.h: disable operator T* (), since it causes
10097 problems with both compilers I tried. See comments in the file.
10099 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10102 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10103 variable LYX_DIR_10x to LYX_DIR_11x.
10105 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10107 * INSTALL: document --with-lyxname.
10110 * configure.in: new configure flag --with-lyxname which allows to
10111 choose the name under which lyx is installed. Default is "lyx", of
10112 course. It used to be possible to do this with --program-suffix,
10113 but the later has in fact a different meaning for autoconf.
10115 * src/support/lstrings.h (lstrchr): reformat a bit.
10117 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10118 * src/mathed/math_defs.h: ditto.
10120 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10122 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10123 true, decides if we create a backup file or not when saving. New
10124 tag and variable \pdf_mode, defaults to false. New tag and
10125 variable \pdflatex_command, defaults to pdflatex. New tag and
10126 variable \view_pdf_command, defaults to xpdf. New tag and variable
10127 \pdf_to_ps_command, defaults to pdf2ps.
10129 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10131 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10132 does not have a BufferView.
10133 (unlockInset): ditto + don't access the_locking_inset if the
10134 buffer does not have a BufferView.
10136 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10137 certain circumstances so that we don't continue a keyboard
10138 operation long after the key was released. Try f.ex. to load a
10139 large document, press PageDown for some seconds and then release
10140 it. Before this change the document would contine to scroll for
10141 some time, with this change it stops imidiatly.
10143 * src/support/block.h: don't allocate more space than needed. As
10144 long as we don't try to write to the arr[x] in a array_type arr[x]
10145 it is perfectly ok. (if you write to it you might segfault).
10146 added operator value_type*() so that is possible to pass the array
10147 to functions expecting a C-pointer.
10149 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10152 * intl/*: updated to gettext 0.10.35, tried to add our own
10153 required modifications. Please verify.
10155 * po/*: updated to gettext 0.10.35, tried to add our own required
10156 modifications. Please verify.
10158 * src/support/lstrings.C (tostr): go at fixing the problem with
10159 cxx and stringstream. When stringstream is used return
10160 oss.str().c_str() so that problems with lyxstring and basic_string
10161 are avoided. Note that the best solution would be for cxx to use
10162 basic_string all the way, but it is not conformant yet. (it seems)
10164 * src/lyx_cb.C + other files: moved several global functions to
10165 class BufferView, some have been moved to BufferView.[Ch] others
10166 are still located in lyx_cb.C. Code changes because of this. (part
10167 of "get rid of current_view project".)
10169 * src/buffer.C + other files: moved several Buffer functions to
10170 class BufferView, the functions are still present in buffer.C.
10171 Code changes because of this.
10173 * config/lcmessage.m4: updated to most recent. used when creating
10176 * config/progtest.m4: updated to most recent. used when creating
10179 * config/gettext.m4: updated to most recent. applied patch for
10182 * config/gettext.m4.patch: new file that shows what changes we
10183 have done to the local copy of gettext.m4.
10185 * config/libtool.m4: new file, used in creation of acinclude.m4
10187 * config/lyxinclude.m4: new file, this is the lyx created m4
10188 macros, used in making acinclude.m4.
10190 * autogen.sh: GNU m4 discovered as a separate task not as part of
10191 the lib/configure creation.
10192 Generate acinlucde from files in config. Actually cat
10193 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10194 easier to upgrade .m4 files that really are external.
10196 * src/Spacing.h: moved using std::istringstream to right after
10197 <sstream>. This should fix the problem seen with some compilers.
10199 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10201 * src/lyx_cb.C: began some work to remove the dependency a lot of
10202 functions have on BufferView::text, even if not really needed.
10203 (GetCurrentTextClass): removed this func, it only hid the
10206 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10207 forgot this in last commit.
10209 * src/Bullet.C (bulletEntry): use static char const *[] for the
10210 tables, becuase of this the return arg had to change to string.
10211 (bulletSize): ditto
10212 (~Bullet): removed unneeded destructor
10214 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10215 (insetSleep): moved from Buffer
10216 (insetWakeup): moved from Buffer
10217 (insetUnlock): moved from Buffer
10219 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10220 from Buffer to BufferView.
10222 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10224 * config/ltmain.sh: updated to version 1.3.4 of libtool
10226 * config/ltconfig: updated to version 1.3.4 of libtool
10228 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10231 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10232 Did I get that right?
10234 * src/lyxlex.h: add a "using" directive or two.
10235 * src/Spacing.h: ditto.
10236 * src/insets/figinset.C: ditto.
10237 * src/support/filetools.C: ditto.
10238 * src/support/lstrings.C: ditto.
10239 * src/BufferView.C: ditto.
10240 * src/bufferlist.C: ditto.
10241 * src/lyx_cb.C: ditto.
10242 * src/lyxlex.C: ditto.
10244 * NEWS: add some changes for 1.1.4.
10246 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10248 * src/BufferView.C: first go at a TextCache to speed up switching
10251 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10253 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10254 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10255 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10256 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10259 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10260 members of the struct are correctly initialized to 0 (detected by
10262 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10263 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10265 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10266 pidwait, since it was allocated with "new". This was potentially
10267 very bad. Thanks to Michael Schmitt for running purify for us.
10270 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10272 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10274 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10276 1999-12-30 Allan Rae <rae@lyx.org>
10278 * lib/templates/IEEEtran.lyx: minor change
10280 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10281 src/mathed/formula.C (LocalDispatch): askForText changes
10283 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10284 know when a user has cancelled input. Fixes annoying problems with
10285 inserting labels and version control.
10287 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10289 * src/support/lstrings.C (tostr): rewritten to use strstream and
10292 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10294 * src/support/filetools.C (IsFileWriteable): use fstream to check
10295 (IsDirWriteable): use fileinfo to check
10297 * src/support/filetools.h (FilePtr): whole class deleted
10299 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10301 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10303 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10305 * src/bufferlist.C (write): use ifstream and ofstream instead of
10308 * src/Spacing.h: use istrstream instead of sscanf
10310 * src/mathed/math_defs.h: change first arg to istream from FILE*
10312 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10314 * src/mathed/math_parser.C: have yyis to be an istream
10315 (LexGetArg): use istream (yyis)
10317 (mathed_parse): ditto
10318 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10320 * src/mathed/formula.C (Read): rewritten to use istream
10322 * src/mathed/formulamacro.C (Read): rewritten to use istream
10324 * src/lyxlex.h (~LyXLex): deleted desturctor
10325 (getStream): new function, returns an istream
10326 (getFile): deleted funtion
10327 (IsOK): return is.good();
10329 * src/lyxlex.C (LyXLex): delete file and owns_file
10330 (setFile): open an filebuf and assign that to a istream instead of
10332 (setStream): new function, takes an istream as arg.
10333 (setFile): deleted function
10334 (EatLine): rewritten us use istream instead of FILE*
10338 * src/table.C (LyXTable): use istream instead of FILE*
10339 (Read): rewritten to take an istream instead of FILE*
10341 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10343 * src/buffer.C (Dispatch): remove an extraneous break statement.
10345 * src/support/filetools.C (QuoteName): change to do simple
10346 'quoting'. More work is necessary. Also changed to do nothing
10347 under emx (needs fix too).
10348 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10350 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10351 config.h.in to the AC_DEFINE_UNQUOTED() call.
10352 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10353 needs char * as argument (because Solaris 7 declares it like
10356 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10357 remove definition of BZERO.
10359 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10361 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10362 defined, "lyxregex.h" if not.
10364 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10366 (REGEX): new variable that is set to regex.c lyxregex.h when
10367 AM_CONDITIONAL USE_REGEX is set.
10368 (libsupport_la_SOURCES): add $(REGEX)
10370 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10373 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10376 * configure.in: add call to LYX_REGEX
10378 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10379 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10381 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10383 * lib/bind/fi_menus.bind: new file, from
10384 pauli.virtanen@saunalahti.fi.
10386 * src/buffer.C (getBibkeyList): pass the parameter delim to
10387 InsetInclude::getKeys and InsetBibtex::getKeys.
10389 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10390 is passed to Buffer::getBibkeyList
10392 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10393 instead of the hardcoded comma.
10395 * src/insets/insetbib.C (getKeys): make sure that there are not
10396 leading blanks in bibtex keys. Normal latex does not care, but
10397 harvard.sty seems to dislike blanks at the beginning of citation
10398 keys. In particular, the retturn value of the function is
10400 * INSTALL: make it clear that libstdc++ is needed and that gcc
10401 2.7.x probably does not work.
10403 * src/support/filetools.C (findtexfile): make debug message go to
10405 * src/insets/insetbib.C (getKeys): ditto
10407 * src/debug.C (showTags): make sure that the output is correctly
10410 * configure.in: add a comment for TWO_COLOR_ICON define.
10412 * acconfig.h: remove all the entries that already defined in
10413 configure.in or acinclude.m4.
10415 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10416 to avoid user name, date and copyright.
10418 1999-12-21 Juergen Vigna <jug@sad.it>
10420 * src/table.C (Read): Now read bogus row format informations
10421 if the format is < 5 so that afterwards the table can
10422 be read by lyx but without any format-info. Fixed the
10423 crash we experienced when not doing this.
10425 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10427 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10428 (RedoDrawingOfParagraph): ditto
10429 (RedoParagraphs): ditto
10430 (RemoveTableRow): ditto
10432 * src/text.C (Fill): rename arg paperwidth -> paper_width
10434 * src/buffer.C (insertLyXFile): rename var filename -> fname
10435 (writeFile): rename arg filename -> fname
10436 (writeFileAscii): ditto
10437 (makeLaTeXFile): ditto
10438 (makeLinuxDocFile): ditto
10439 (makeDocBookFile): ditto
10441 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10444 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10446 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10449 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10450 compiled by a C compiler not C++.
10452 * src/layout.h (LyXTextClass): added typedef for const_iterator
10453 (LyXTextClassList): added typedef for const_iterator + member
10454 functions begin and end.
10456 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10457 iterators to fill the choice_class.
10458 (updateLayoutChoice): rewritten to use iterators to fill the
10459 layoutlist in the toolbar.
10461 * src/BufferView.h (BufferView::work_area_width): removed unused
10464 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10466 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10467 (sgmlCloseTag): ditto
10469 * src/support/lstrings.h: return type of countChar changed to
10472 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10473 what version of this func to use. Also made to return unsigned int.
10475 * configure.in: call LYX_STD_COUNT
10477 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10478 conforming std::count.
10480 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10482 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10483 and a subscript would give bad display (patch from Dekel Tsur
10484 <dekel@math.tau.ac.il>).
10486 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10488 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10491 * src/chset.h: add a few 'using' directives
10493 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10494 triggered when no buffer is active
10496 * src/layout.C: removed `break' after `return' in switch(), since
10499 * src/lyx_main.C (init): make sure LyX can be ran in place even
10500 when libtool has done its magic with shared libraries. Fix the
10501 test for the case when the system directory has not been found.
10503 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10504 name for the latex file.
10505 (MenuMakeHTML): ditto
10507 * src/buffer.h: add an optional boolean argument, which is passed
10508 to ChangeExtension.
10510 1999-12-20 Allan Rae <rae@lyx.org>
10512 * lib/templates/IEEEtran.lyx: small correction and update.
10514 * configure.in: Attempted to use LYX_PATH_HEADER
10516 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10518 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10519 input from JMarc. Now use preprocessor to find the header.
10520 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10521 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10522 LYX_STL_STRING_FWD. See comments in file.
10524 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10526 * The global MiniBuffer * minibuffer variable is dead.
10528 * The global FD_form_main * fd_form_main variable is dead.
10530 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10532 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10534 * src/table.h: add the LOstream.h header
10535 * src/debug.h: ditto
10537 * src/LyXAction.h: change the explaination of the ReadOnly
10538 attribute: is indicates that the function _can_ be used.
10540 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10543 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10545 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10551 * src/paragraph.C (GetWord): assert on pos>=0
10554 * src/support/lyxstring.C: condition the use of an invariant on
10556 * src/support/lyxstring.h: ditto
10558 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10559 Use LAssert.h instead of plain assert().
10561 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10563 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10564 * src/support/filetools.C: ditto
10566 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10569 * INSTALL: document the new configure flags
10571 * configure.in: suppress --with-debug; add --enable-assertions
10573 * acinclude.m4: various changes in alignment of help strings.
10575 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10577 * src/kbmap.C: commented out the use of the hash map in kb_map,
10578 beginning of movement to a stl::container.
10580 * several files: removed code that was not in effect when
10581 MOVE_TEXT was defined.
10583 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10584 for escaping should not be used. We can discuss if the string
10585 should be enclosed in f.ex. [] instead of "".
10587 * src/trans_mgr.C (insert): use the new returned value from
10588 encodeString to get deadkeys and keymaps done correctly.
10590 * src/chset.C (encodeString): changed to return a pair, to tell
10591 what to use if we know the string.
10593 * src/lyxscreen.h (fillArc): new function.
10595 * src/FontInfo.C (resize): rewritten to use more std::string like
10596 structore, especially string::replace.
10598 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10601 * configure.in (chmod +x some scripts): remove config/gcc-hack
10603 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10605 * src/buffer.C (writeFile): change once again the top comment in a
10606 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10607 instead of an hardcoded version number.
10608 (makeDocBookFile): ditto
10610 * src/version.h: add new define LYX_DOCVERSION
10612 * po/de.po: update from Pit Sütterlin
10613 * lib/bind/de_menus.bind: ditto.
10615 * src/lyxfunc.C (Dispatch): call MenuExport()
10616 * src/buffer.C (Dispatch): ditto
10618 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10619 LyXFunc::Dispatch().
10620 (MenuExport): new function, moved from
10621 LyXFunc::Dispatch().
10623 * src/trans_mgr.C (insert): small cleanup
10624 * src/chset.C (loadFile): ditto
10626 * lib/kbd/iso8859-1.cdef: add missing backslashes
10628 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10630 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10631 help with placing the manually drawn accents better.
10633 (Draw): x2 and hg changed to float to minimize rounding errors and
10634 help place the accents better.
10636 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10637 unsigned short to char is just wrong...cast the char to unsigned
10638 char instead so that the two values can compare sanely. This
10639 should also make the display of insetlatexaccents better and
10640 perhaps also some other insets.
10642 (lbearing): new function
10645 1999-12-15 Allan Rae <rae@lyx.org>
10647 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10648 header that provides a wrapper around the very annoying SGI STL header
10651 * src/support/lyxstring.C, src/LString.h:
10652 removed old SGI-STL-compatability attempts.
10654 * configure.in: Use LYX_STL_STRING_FWD.
10656 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10657 stl_string_fwd.h is around and try to determine it's location.
10658 Major improvement over previous SGI STL 3.2 compatability.
10659 Three small problems remain with this function due to my zero
10660 knowledge of autoconf. JMarc and lgb see the comments in the code.
10662 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10664 * src/broken_const.h, config/hack-gcc, config/README: removed
10666 * configure.in: remove --with-gcc-hack option; do not call
10669 * INSTALL: remove documentation of --with-broken-const and
10672 * acconfig.h: remove all trace of BROKEN_CONST define
10674 * src/buffer.C (makeDocBookFile): update version number in output
10676 (SimpleDocBookOnePar): fix an assert when trying to a character
10677 access beyond string length
10680 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10682 * po/de.po: fix the Export menu
10684 * lyx.man: update the description of -dbg
10686 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10687 (commandLineHelp): updated
10688 (easyParse): show list of available debug levels if -dbg is passed
10691 * src/Makefile.am: add debug.C
10693 * src/debug.h: moved some code to debug.C
10695 * src/debug.C: new file. Contains code to set and show debug
10698 * src/layout.C: remove 'break' after 'continue' in switch
10699 statements, since these cannot be reached.
10701 1999-12-13 Allan Rae <rae@lyx.org>
10703 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10704 (in_word_set): hash() -> math_hash()
10706 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10708 * acconfig.h: Added a test for whether we are using exceptions in the
10709 current compilation run. If so USING_EXCEPTIONS is defined.
10711 * config.in: Check for existance of stl_string_fwd.h
10712 * src/LString.h: If compiling --with-included-string and SGI's
10713 STL version 3.2 is present (see above test) we need to block their
10714 forward declaration of string and supply a __get_c_string().
10715 However, it turns out this is only necessary if compiling with
10716 exceptions enabled so I've a bit more to add yet.
10718 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10719 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10720 src/support/LRegex.h, src/undo.h:
10721 Shuffle the order of the included files a little to ensure that
10722 LString.h gets included before anything that includes stl_string_fwd.h
10724 * src/support/lyxstring.C: We need to #include LString.h instead of
10725 lyxstring.h to get the necessary definition of __get_c_string.
10726 (__get_c_string): New function. This is defined static just like SGI's
10727 although why they need to do this I'm not sure. Perhaps it should be
10728 in lstrings.C instead.
10730 * lib/templates/IEEEtran.lyx: New template file.
10732 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10734 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10735 * intl/Makefile.in (MKINSTALLDIRS): ditto
10737 * src/LyXAction.C (init): changed to hold the LFUN data in a
10738 automatic array in stead of in callso to newFunc, this speeds up
10739 compilation a lot. Also all the memory used by the array is
10740 returned when the init is completed.
10742 * a lot of files: compiled with -Wold-style-cast, changed most of
10743 the reported offenders to C++ style casts. Did not change the
10744 offenders in C files.
10746 * src/trans.h (Match): change argument type to unsigned int.
10748 * src/support/DebugStream.C: fix some types on the streambufs so
10749 that it works on a conforming implementation.
10751 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10753 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10755 * src/support/lyxstring.C: remove the inline added earlier since
10756 they cause a bunch of unsatisfied symbols when linking with dec
10757 cxx. Cxx likes to have the body of inlines at the place where they
10760 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10761 accessing negative bounds in array. This fixes the crash when
10762 inserting accented characters.
10763 * src/trans.h (Match): ditto
10765 * src/buffer.C (Dispatch): since this is a void, it should not try
10766 to return anything...
10768 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10770 * src/buffer.h: removed the two friends from Buffer. Some changes
10771 because of this. Buffer::getFileName and Buffer::setFileName
10772 renamed to Buffer::fileName() and Buffer::fileName(...).
10774 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10776 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10777 and Buffer::update(short) to BufferView. This move is currently
10778 controlled by a define MOVE_TEXT, this will be removed when all
10779 shows to be ok. This move paves the way for better separation
10780 between buffer contents and buffer view. One side effect is that
10781 the BufferView needs a rebreak when swiching buffers, if we want
10782 to avoid this we can add a cache that holds pointers to LyXText's
10783 that is not currently in use.
10785 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10788 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10790 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10792 * lyx_main.C: new command line option -x (or --execute) and
10793 -e (or --export). Now direct conversion from .lyx to .tex
10794 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10795 Unfortunately, X is still needed and the GUI pops up during the
10798 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10800 * src/Spacing.C: add a using directive to bring stream stuff into
10802 * src/paragraph.C: ditto
10803 * src/buffer.C: ditto
10805 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10806 from Lars' announcement).
10808 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10809 example files from Tino Meinen.
10811 1999-12-06 Allan Rae <rae@lyx.org>
10813 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10815 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10817 * src/support/lyxstring.C: added a lot of inline for no good
10820 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10821 latexWriteEndChanges, they were not used.
10823 * src/layout.h (operator<<): output operator for PageSides
10825 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10827 * some example files: loaded in LyX 1.0.4 and saved again to update
10828 certain constructs (table format)
10830 * a lot of files: did the change to use fstream/iostream for all
10831 writing of files. Done with a close look at Andre Poenitz's patch.
10833 * some files: whitespace changes.
10835 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10837 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10838 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10839 architecture, we provide our own. It is used unconditionnally, but
10840 I do not think this is a performance problem. Thanks to Angus
10841 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10842 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10844 (GetInset): use my_memcpy.
10848 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10849 it is easier to understand, but it uses less TeX-only constructs now.
10851 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10852 elements contain spaces
10854 * lib/configure: regenerated
10856 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10857 elements contain spaces; display the list of programs that are
10860 * autogen.sh: make sure lib/configure is executable
10862 * lib/examples/*: rename the tutorial examples to begin with the
10863 two-letters language code.
10865 * src/lyxfunc.C (getStatus): do not query current font if no
10868 * src/lyx_cb.C (RunScript): use QuoteName
10869 (MenuRunDvips): ditto
10870 (PrintApplyCB): ditto
10872 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10873 around argument, so that it works well with the current shell.
10874 Does not work properly with OS/2 shells currently.
10876 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10877 * src/LyXSendto.C (SendtoApplyCB): ditto
10878 * src/lyxfunc.C (Dispatch): ditto
10879 * src/buffer.C (runLaTeX): ditto
10880 (runLiterate): ditto
10881 (buildProgram): ditto
10883 * src/lyx_cb.C (RunScript): ditto
10884 (MenuMakeLaTeX): ditto
10886 * src/buffer.h (getLatexName): new method
10888 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10890 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10892 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10893 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10894 (create_math_panel): ditto
10896 * src/lyxfunc.C (getStatus): re-activate the code which gets
10897 current font and cursor; add test for export to html.
10899 * src/lyxrc.C (read): remove unreachable break statements; add a
10902 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10904 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10906 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10907 introduced by faulty regex.
10908 * src/buffer.C: ditto
10909 * src/lastfiles.C: ditto
10910 * src/paragraph.C: ditto
10911 * src/table.C: ditto
10912 * src/vspace.C: ditto
10913 * src/insets/figinset.C: ditto
10914 Note: most of these is absolutely harmless, except the one in
10915 src/mathed formula.C.
10917 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10919 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10920 operation, yielding correct results for the reLyX command.
10922 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10924 * src/support/filetools.C (ExpandPath): removed an over eager
10926 (ReplaceEnvironmentPath): ditto
10928 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10929 shows that we are doing something fishy in our code...
10930 (BubblePost): ditto
10933 * src/lyxrc.C (read): use a double switch trick to get more help
10934 from the compiler. (the same trick is used in layout.C)
10935 (write): new function. opens a ofstream and pass that to output
10936 (output): new function, takes a ostream and writes the lyxrc
10937 elemts to it. uses a dummy switch to make sure no elements are
10940 * src/lyxlex.h: added a struct pushpophelper for use in functions
10941 with more than one exit point.
10943 * src/lyxlex.[Ch] (GetInteger): made it const
10947 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10949 * src/layout.[hC] : LayoutTags splitted into several enums, new
10950 methods created, better error handling cleaner use of lyxlex. Read
10953 * src/bmtable.[Ch]: change some member prototypes because of the
10954 image const changes.
10956 * commandtags.h, src/LyXAction.C (init): new function:
10957 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10958 This file is not read automatically but you can add \input
10959 preferences to your lyxrc if you want to. We need to discuss how
10962 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10963 in .aux, also remove .bib and .bst files from dependencies when
10966 * src/BufferView.C, src/LyXView.C: add const_cast several places
10967 because of changes to images.
10969 * lib/images/*: same change as for images/*
10971 * lib/lyxrc.example: Default for accept_compound is false not no.
10973 * images/*: changed to be const, however I have som misgivings
10974 about this change so it might be changed back.
10976 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10978 * lib/configure, po/POTFILES.in: regenerated
10980 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10982 * config/lib_configure.m4: removed
10984 * lib/configure.m4: new file (was config/lib_configure.m4)
10986 * configure.in: do not test for rtti, since we do not use it.
10988 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10990 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10991 doubling of allocated space scheme. This makes it faster for large
10992 strings end to use less memory for small strings. xtra rememoved.
10994 * src/insets/figinset.C (waitalarm): commented out.
10995 (GhostscriptMsg): use static_cast
10996 (GhostscriptMsg): use new instead of malloc to allocate memory for
10997 cmap. also delete the memory after use.
10999 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11001 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11002 for changes in bibtex database or style.
11003 (runBibTeX): remove all .bib and .bst files from dep before we
11005 (run): use scanAuc in when dep file already exist.
11007 * src/DepTable.C (remove_files_with_extension): new method
11008 (exist): new method
11010 * src/DepTable.[Ch]: made many of the methods const.
11012 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11014 * src/bufferparams.C: make sure that the default textclass is
11015 "article". It used to be the first one by description order, but
11016 now the first one is "docbook".
11018 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11019 string; call Debug::value.
11020 (easyParse): pass complete argument to setDebuggingLevel().
11022 * src/debug.h (value): fix the code that parses debug levels.
11024 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11027 * src/LyXAction.C: use Debug::ACTION as debug channel.
11029 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11031 * NEWS: updated for the future 1.1.3 release.
11033 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11034 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11035 it should. This is of course a controversial change (since many
11036 people will find that their lyx workscreen is suddenly full of
11037 red), but done for the sake of correctness.
11039 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11040 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11042 * src/insets/inseterror.h, src/insets/inseturl.h,
11043 src/insets/insetinfo.h, src/insets/figinset.h,
11044 src/mathed/formulamacro.h, src/mathed/math_macro.h
11045 (EditMessage): add a missing const and add _() to make sure that
11046 translation happens
11048 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11049 src/insets/insetbib.C, src/support/filetools.C: add `using'
11050 directives for cxx.
11052 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11053 doing 'Insert index of last word' at the beginning of a paragraph.
11055 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11057 * several files: white-space changes.
11059 * src/mathed/formula.C: removed IsAlpha and IsDigit
11061 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11062 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11065 * src/insets/figinset.C (GetPSSizes): don't break when
11066 "EndComments" is seen. But break when a boundingbox is read.
11068 * all classes inherited from Inset: return value of Clone
11069 changed back to Inset *.
11071 * all classes inherited form MathInset: return value of Clone
11072 changed back to MathedInset *.
11074 * src/insets/figinset.C (runqueue): use a ofstream to output the
11075 gs/ps file. Might need some setpresicion or setw. However I can
11076 see no problem with the current code.
11077 (runqueue): use sleep instead of the alarm/signal code. I just
11078 can't see the difference.
11080 * src/paragraph.C (LyXParagraph): reserve space in the new
11081 paragraph and resize the inserted paragraph to just fit.
11083 * src/lyxfunc.h (operator|=): added operator for func_status.
11085 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11086 check for readable file.
11088 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11089 check for readable file.
11090 (MenuMakeLinuxDoc): ditto
11091 (MenuMakeDocBook): ditto
11092 (MenuMakeAscii): ditto
11093 (InsertAsciiFile): split the test for openable and readable
11095 * src/bmtable.C (draw_bitmaptable): use
11096 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11098 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11099 findtexfile from LaTeX to filetools.
11101 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11102 instead of FilePtr. Needs to be verified by a literate user.
11104 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11106 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11107 (EditMessage): likewise.
11109 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11110 respectively as \textasciitilde and \textasciicircum.
11112 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11114 * src/support/lyxstring.h: made the methods that take iterators
11115 use const_iterator.
11117 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11118 (regexMatch): made is use the real regex class.
11120 * src/support/Makefile.am: changed to use libtool
11122 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11124 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11126 (MathIsInset ++): changed several macros to be inline functions
11129 * src/mathed/Makefile.am: changed to use libtool
11131 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11133 * src/insets/inset* : Clone changed to const and return type is
11134 the true insettype not just Inset*.
11136 * src/insets/Makefile.am: changed to use libtool
11138 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11140 * src/undo.[Ch] : added empty() and changed some of the method
11143 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11145 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11146 setID use block<> for the bullets array, added const several places.
11148 * src/lyxfunc.C (getStatus): new function
11150 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11151 LyXAction, added const to several funtions.
11153 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11154 a std::map, and to store the dir items in a vector.
11156 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11159 * src/LyXView.[Ch] + other files : changed currentView to view.
11161 * src/LyXAction.[Ch] : ported from the old devel branch.
11163 * src/.cvsignore: added .libs and a.out
11165 * configure.in : changes to use libtool.
11167 * acinclude.m4 : inserted libtool.m4
11169 * .cvsignore: added libtool
11171 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11173 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11174 file name in insets and mathed directories (otherwise the
11175 dependency is not taken in account under cygwin).
11177 * src/text2.C (InsertString[AB]): make sure that we do not try to
11178 read characters past the string length.
11180 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11182 * lib/doc/LaTeXConfig.lyx.in,
11183 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11185 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11186 file saying who created them and when this heppened; this is
11187 useless and annoys tools like cvs.
11189 * lib/layouts/g-brief-{en,de}.layout,
11190 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11191 from Thomas Hartkens <thomas@hartkens.de>.
11193 * src/{insets,mathed}/Makefile.am: do not declare an empty
11194 LDFLAGS, so that it can be set at configure time (useful on Irix
11197 * lib/reLyX/configure.in: make sure that the prefix is set
11198 correctly in LYX_DIR.
11200 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11202 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11203 be used by 'command-sequence' this allows to bind a key to a
11204 sequence of LyX-commands
11205 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11207 * src/LyXAction.C: add "command-sequence"
11209 * src/LyXFunction.C: handling of "command-sequence"
11211 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11212 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11214 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11216 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11218 * src/buffer.C (writeFile): Do not output a comment giving user
11219 and date at the beginning of a .lyx file. This is useless and
11220 annoys cvs anyway; update version number to 1.1.
11222 * src/Makefile.am (LYX_DIR): add this definition, so that a
11223 default path is hardcoded in LyX.
11225 * configure.in: Use LYX_GNU_GETTEXT.
11227 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11228 AM_GNU_GETTEXT with a bug fixed.
11230 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11232 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11234 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11235 which is used to point to LyX data is now LYX_DIR_11x.
11237 * lyx.man: convert to a unix text file; small updates.
11239 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11241 * src/support/LSubstring.[Ch]: made the second arg of most of the
11242 constructors be a const reference.
11244 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11247 * src/support/lyxstring.[Ch] (swap): added missing member function
11248 and specialization of swap(str, str);
11250 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11252 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11253 trace of the old one.
11255 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11256 put the member definitions in undo.C.
11258 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11259 NEW_TEXT and have now only code that was included when this was
11262 * src/intl.C (LCombo): use static_cast
11264 (DispatchCallback): ditto
11266 * src/definitions.h: removed whole file
11268 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11270 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11271 parsing and stores in a std:map. a regex defines the file format.
11272 removed unneeded members.
11274 * src/bufferparams.h: added several enums from definitions.h here.
11275 Removed unsused destructor. Changed some types to use proper enum
11276 types. use block to have the temp_bullets and user_defined_bullets
11277 and to make the whole class assignable.
11279 * src/bufferparams.C (Copy): removed this functions, use a default
11280 assignment instead.
11282 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11285 * src/buffer.C (readLyXformat2): commend out all that have with
11286 oldpapersize to do. also comment out all that hve to do with
11287 insetlatex and insetlatexdel.
11288 (setOldPaperStuff): commented out
11290 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11292 * src/LyXAction.C: remove use of inset-latex-insert
11294 * src/mathed/math_panel.C (button_cb): use static_cast
11296 * src/insets/Makefile.am (insets_o_SOURCES): removed
11299 * src/support/lyxstring.C (helper): use the unsigned long
11300 specifier, UL, instead of a static_cast.
11302 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11304 * src/support/block.h: new file. to be used as a c-style array in
11305 classes, so that the class can be assignable.
11307 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11309 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11310 NULL, make sure to return an empty string (it is not possible to
11311 set a string to NULL).
11313 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11315 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11317 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11319 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11320 link line, so that Irix users (for example) can set it explicitely to
11323 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11324 it can be overidden at make time (static or dynamic link, for
11327 * src/vc-backend.C, src/LaTeXFeatures.h,
11328 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11329 statements to bring templates to global namespace.
11331 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11333 * src/support/lyxstring.C (operator[] const): make it standard
11336 * src/minibuffer.C (Init): changed to reflect that more
11337 information is given from the lyxvc and need not be provided here.
11339 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11341 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11343 * src/LyXView.C (UpdateTimerCB): use static_cast
11344 (KeyPressMask_raw_callback): ditto
11346 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11347 buffer_, a lot of changes because of this. currentBuffer() ->
11348 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11349 also changes to other files because of this.
11351 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11353 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11354 have no support for RCS and partial support for CVS, will be
11357 * src/insets/ several files: changes because of function name
11358 changes in Bufferview and LyXView.
11360 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11362 * src/support/LSubstring.[Ch]: new files. These implement a
11363 Substring that can be very convenient to use. i.e. is this
11365 string a = "Mary had a little sheep";
11366 Substring(a, "sheep") = "lamb";
11367 a is now "Mary has a little lamb".
11369 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11370 out patterns and subpatterns of strings. It is used by LSubstring
11371 and also by vc-backend.C
11373 * src/support/lyxstring.C: went over all the assertions used and
11374 tried to correct the wrong ones and flag which of them is required
11375 by the standard. some bugs found because of this. Also removed a
11376 couple of assertions.
11378 * src/support/Makefile.am (libsupport_a_SOURCES): added
11379 LSubstring.[Ch] and LRegex.[Ch]
11381 * src/support/FileInfo.h: have struct stat buf as an object and
11382 not a pointer to one, some changes because of this.
11384 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11385 information in layout when adding the layouts preamble to the
11386 textclass preamble.
11388 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11391 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11392 because of bug in OS/2.
11394 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11396 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11397 \verbatim@font instead of \ttfamily, so that it can be redefined.
11399 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11400 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11401 src/layout.h, src/text2.C: add 'using' directive to bring the
11402 STL templates we need from the std:: namespace to the global one.
11403 Needed by DEC cxx in strict ansi mode.
11405 * src/support/LIstream.h,src/support/LOstream.h,
11406 src/support/lyxstring.h,src/table.h,
11407 src/lyxlookup.h: do not include <config.h> in header
11408 files. This should be done in the .C files only.
11410 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11414 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11416 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11417 from Kayvan to fix the tth invokation.
11419 * development/lyx.spec.in: updates from Kayvan to reflect the
11420 changes of file names.
11422 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11424 * src/text2.C (InsertStringB): use std::copy
11425 (InsertStringA): use std::copy
11427 * src/bufferlist.C: use a vector to store the buffers in. This is
11428 an internal change and should not affect any other thing.
11430 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11433 * src/text.C (Fill): fix potential bug, one off bug.
11435 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11437 * src/Makefile.am (lyx_main.o): add more files it depends on.
11439 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11441 * src/support/lyxstring.C: use size_t for the reference count,
11442 size, reserved memory and xtra.
11443 (internal_compare): new private member function. Now the compare
11444 functions should work for std::strings that have embedded '\0'
11446 (compare): all compare functions rewritten to use
11449 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11451 * src/support/lyxstring.C (compare): pass c_str()
11452 (compare): pass c_str
11453 (compare): pass c_str
11455 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11457 * src/support/DebugStream.C: <config.h> was not included correctly.
11459 * lib/configure: forgot to re-generate it :( I'll make this file
11460 auto generated soon.
11462 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11464 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11467 * src/support/lyxstring.C: some changes from length() to rep->sz.
11468 avoids a function call.
11470 * src/support/filetools.C (SpaceLess): yet another version of the
11471 algorithm...now per Jean-Marc's suggestions.
11473 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11475 * src/layout.C (less_textclass_desc): functor for use in sorting
11477 (LyXTextClass::Read): sort the textclasses after reading.
11479 * src/support/filetools.C (SpaceLess): new version of the
11480 SpaceLess functions. What problems does this one give? Please
11483 * images/banner_bw.xbm: made the arrays unsigned char *
11485 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11487 * src/support/lyxstring.C (find): remove bogus assertion in the
11488 two versions of find where this has not been done yet.
11490 * src/support/lyxlib.h: add missing int return type to
11493 * src/menus.C (ShowFileMenu): disable exporting to html if no
11494 html export command is present.
11496 * config/lib_configure.m4: add a test for an HTML converter. The
11497 programs checked for are, in this order: tth, latex2html and
11500 * lib/configure: generated from config/lib_configure.m4.
11502 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11503 html converter. The parameters are now passed through $$FName and
11504 $$OutName, instead of standard input/output.
11506 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11508 * lib/lyxrc.example: update description of \html_command.
11509 add "quotes" around \screen_font_xxx font setting examples to help
11510 people who use fonts with spaces in their names.
11512 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11514 * Distribution files: updates for v1.1.2
11516 * src/support/lyxstring.C (find): remove bogus assert and return
11517 npos for the same condition.
11519 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11521 * added patch for OS/2 from SMiyata.
11523 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11525 * src/text2.C (CutSelection): make space_wrapped a bool
11526 (CutSelection): dont declare int i until we have to.
11527 (alphaCounter): return a char const *.
11529 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11531 * src/support/syscall.C (Systemcalls::kill):
11532 src/support/filetools.C (PutEnv, PutEnvPath):
11533 src/lyx_cb.C (addNewlineAndDepth):
11534 src/FontInfo.C (FontInfo::resize): condition some #warning
11535 directives with WITH_WARNINGS.
11538 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11540 * src/layout.[Ch] + several files: access to class variables
11541 limited and made accessor functions instead a lot of code changed
11542 becuase of this. Also instead of returning pointers often a const
11543 reference is returned instead.
11545 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11547 * src/Makefile.am (dist-hook): added used to remove the CVS from
11548 cheaders upon creating a dist
11549 (EXTRA_DIST): added cheaders
11551 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11552 a character not as a small integer.
11554 * src/support/lyxstring.C (find): removed Assert and added i >=
11555 rep->sz to the first if.
11557 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11559 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11560 src/LyXView.C src/buffer.C src/bufferparams.C
11561 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11562 src/text2.C src/insets/insetinclude.C:
11563 lyxlayout renamed to textclasslist.
11565 * src/layout.C: some lyxerr changes.
11567 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11568 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11569 (LyXLayoutList): removed all traces of this class.
11570 (LyXTextClass::Read): rewrote LT_STYLE
11571 (LyXTextClass::hasLayout): new function
11572 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11573 both const and nonconst version.
11574 (LyXTextClass::delete_layout): new function.
11575 (LyXTextClassList::Style): bug fix. do the right thing if layout
11577 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11578 (LyXTextClassList::NameOfLayout): ditto
11579 (LyXTextClassList::Load): ditto
11581 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11583 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11585 * src/LyXAction.C (LookupFunc): added a workaround for sun
11586 compiler, on the other hand...we don't know if the current code
11587 compiles on sun at all...
11589 * src/support/filetools.C (CleanupPath): subst fix
11591 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11594 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11595 complained about this one?
11597 * src/insets/insetinclude.C (Latex): subst fix
11599 * src/insets/insetbib.C (getKeys): subst fix
11601 * src/LyXSendto.C (SendtoApplyCB): subst fix
11603 * src/lyx_main.C (init): subst fix
11605 * src/layout.C (Read): subst fix
11607 * src/lyx_sendfax_main.C (button_send): subst fix
11609 * src/buffer.C (RoffAsciiTable): subst fix
11611 * src/lyx_cb.C (MenuFax): subst fix
11612 (PrintApplyCB): subst fix
11614 1999-10-26 Juergen Vigna <jug@sad.it>
11616 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11618 (Read): Cleaned up this code so now we read only format vestion >= 5
11620 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11622 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11623 come nobody has complained about this one?
11625 * src/insets/insetinclude.C (Latex): subst fix
11627 * src/insets/insetbib.C (getKeys): subst fix
11629 * src/lyx_main.C (init): subst fix
11631 * src/layout.C (Read): subst fix
11633 * src/buffer.C (RoffAsciiTable): subst fix
11635 * src/lyx_cb.C (MenuFax): subst fix.
11637 * src/layout.[hC] + some other files: rewrote to use
11638 std::container to store textclasses and layouts in.
11639 Simplified, removed a lot of code. Make all classes
11640 assignable. Further simplifications and review of type
11641 use still to be one.
11643 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11644 lastfiles to create the lastfiles partr of the menu.
11646 * src/lastfiles.[Ch]: rewritten to use deque to store the
11647 lastfiles in. Uses fstream for reading and writing. Simplifies
11650 * src/support/syscall.C: remove explicit cast.
11652 * src/BufferView.C (CursorToggleCB): removed code snippets that
11653 were commented out.
11654 use explicat C++ style casts instead of C style casts. also use
11655 u_vdata instea of passing pointers in longs.
11657 * src/PaperLayout.C: removed code snippets that were commented out.
11659 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11661 * src/lyx_main.C: removed code snippets that wer commented out.
11663 * src/paragraph.C: removed code snippets that were commented out.
11665 * src/lyxvc.C (logClose): use static_cast
11667 (viewLog): remove explicit cast to void*
11668 (showLog): removed old commented code
11670 * src/menus.C: use static_cast instead of C style casts. use
11671 u_vdata instead of u_ldata. remove explicit cast to (long) for
11672 pointers. Removed old code that was commented out.
11674 * src/insets/inset.C: removed old commented func
11676 * src/insets/insetref.C (InsetRef): removed old code that had been
11677 commented out for a long time.
11679 (escape): removed C style cast
11681 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11683 * src/insets/insetlatex.C (Draw): removed old commented code
11684 (Read): rewritten to use string
11686 * src/insets/insetlabel.C (escape): removed C style cast
11688 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11690 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11691 old commented code.
11693 * src/insets/insetinclude.h: removed a couple of stupid bools
11695 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11696 (Clone): remove C style cast
11697 (getKeys): changed list to lst because of std::list
11699 * src/insets/inseterror.C (Draw): removed som old commented code.
11701 * src/insets/insetcommand.C (Draw): removed some old commented code.
11703 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11704 commented out forever.
11705 (bibitem_cb): use static_cast instead of C style cast
11706 use of vdata changed to u_vdata.
11708 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11710 (CloseUrlCB): use static_cast instead of C style cast.
11711 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11713 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11714 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11715 (CloseInfoCB): static_cast from ob->u_vdata instead.
11716 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11719 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11720 (C_InsetError_CloseErrorCB): forward the ob parameter
11721 (CloseErrorCB): static_cast from ob->u_vdata instead.
11723 * src/vspace.h: include LString.h since we use string in this class.
11725 * src/vspace.C (lyx_advance): changed name from advance because of
11726 nameclash with stl. And since we cannot use namespaces yet...I
11727 used a lyx_ prefix instead. Expect this to change when we begin
11730 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11732 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11733 and removed now defunct constructor and deconstructor.
11735 * src/BufferView.h: have backstack as a object not as a pointer.
11736 removed initialization from constructor. added include for BackStack
11738 * development/lyx.spec.in (%build): add CFLAGS also.
11740 * src/screen.C (drawFrame): removed another warning.
11742 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11744 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11745 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11746 README and ANNOUNCE a bit for the next release. More work is
11749 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11750 unbreakable if we are in freespacing mode (LyX-Code), but not in
11753 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11755 * src/BackStack.h: fixed initialization order in constructor
11757 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11759 * acinclude.m4 (VERSION): new rules for when a version is
11760 development, added also a variable for prerelease.
11761 (warnings): we set with_warnings=yes for prereleases
11762 (lyx_opt): prereleases compile with same optimization as development
11763 (CXXFLAGS): only use pedantic if we are a development version
11765 * src/BufferView.C (restorePosition): don't do anything if the
11766 backstack is empty.
11768 * src/BackStack.h: added member empty, use this to test if there
11769 is anything to pop...
11771 1999-10-25 Juergen Vigna <jug@sad.it>
11774 * forms/layout_forms.fd +
11775 * forms/latexoptions.fd +
11776 * lyx.fd: changed for various form resize issues
11778 * src/mathed/math_panel.C +
11779 * src/insets/inseterror.C +
11780 * src/insets/insetinfo.C +
11781 * src/insets/inseturl.C +
11782 * src/insets/inseturl.h +
11784 * src/LyXSendto.C +
11785 * src/PaperLayout.C +
11786 * src/ParagraphExtra.C +
11787 * src/TableLayout.C +
11789 * src/layout_forms.C +
11796 * src/menus.C: fixed various resize issues. So now forms can be
11797 resized savely or not be resized at all.
11799 * forms/form_url.fd +
11800 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11803 * src/insets/Makefile.am: added files form_url.[Ch]
11805 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11807 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11808 (and presumably 6.2).
11810 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11811 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11812 remaining static member callbacks.
11814 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11817 * src/support/lyxstring.h: declare struct Srep as friend of
11818 lyxstring, since DEC cxx complains otherwise.
11820 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11822 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11824 * src/LaTeX.C (run): made run_bibtex also depend on files with
11826 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11827 are put into the dependency file.
11829 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11830 the code has shown itself to work
11831 (create_ispell_pipe): removed another warning, added a comment
11834 * src/minibuffer.C (ExecutingCB): removed code that has been
11835 commented out a long time
11837 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11838 out code + a warning.
11840 * src/support/lyxstring.h: comment out the three private
11841 operators, when compiling with string ansi conforming compilers
11842 they make problems.
11844 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11846 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11847 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11850 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11853 * src/mathed/math_panel.C (create_math_panel): remove explicit
11856 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11859 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11860 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11861 to XCreatePixmapFromBitmapData
11862 (fl_set_bmtable_data): change the last argument to be unsigned
11864 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11865 and bh to be unsigned int, remove explicit casts in call to
11866 XReadBitmapFileData.
11868 * images/arrows.xbm: made the arrays unsigned char *
11869 * images/varsz.xbm: ditto
11870 * images/misc.xbm: ditto
11871 * images/greek.xbm: ditto
11872 * images/dots.xbm: ditto
11873 * images/brel.xbm: ditto
11874 * images/bop.xbm: ditto
11876 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11878 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11879 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11880 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11882 (LYX_CXX_CHEADERS): added <clocale> to the test.
11884 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11886 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11888 * src/support/lyxstring.C (append): fixed something that must be a
11889 bug, rep->assign was used instead of rep->append.
11891 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11894 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11895 lyx insert double chars. Fix spotted by Kayvan.
11897 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11899 * Fixed the tth support. I messed up with the Emacs patch apply feature
11900 and omitted the changes in lyxrc.C.
11902 1999-10-22 Juergen Vigna <jug@sad.it>
11904 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11906 * src/lyx_cb.C (MenuInsertRef) +
11907 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11908 the form cannot be resized under it limits (fixes a segfault)
11910 * src/lyx.C (create_form_form_ref) +
11911 * forms/lyx.fd: Changed Gravity on name input field so that it is
11914 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11916 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11917 <ostream> and <istream>.
11919 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11920 whether <fstream> provides the latest standard features, or if we
11921 have an oldstyle library (like in egcs).
11922 (LYX_CXX_STL_STRING): fix the test.
11924 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11925 code on MODERN_STL_STREAM.
11927 * src/support/lyxstring.h: use L{I,O}stream.h.
11929 * src/support/L{I,O}stream.h: new files, designed to setup
11930 correctly streams for our use
11931 - includes the right header depending on STL capabilities
11932 - puts std::ostream and std::endl (for LOStream.h) or
11933 std::istream (LIStream.h) in toplevel namespace.
11935 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11937 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11938 was a bib file that had been changed we ensure that bibtex is run.
11939 (runBibTeX): enhanced to extract the names of the bib files and
11940 getting their absolute path and enter them into the dep file.
11941 (findtexfile): static func that is used to look for tex-files,
11942 checks for absolute patchs and tries also with kpsewhich.
11943 Alternative ways of finding the correct files are wanted. Will
11945 (do_popen): function that runs a command using popen and returns
11946 the whole output of that command in a string. Should be moved to
11949 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11950 file with extension ext has changed.
11952 * src/insets/figinset.C: added ifdef guards around the fl_free
11953 code that jug commented out. Now it is commented out when
11954 compiling with XForms == 0.89.
11956 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11957 to lyxstring.C, and only keep a forward declaration in
11958 lyxstring.h. Simplifies the header file a bit and should help a
11959 bit on compile time too. Also changes to Srep will not mandate a
11960 recompile of code just using string.
11961 (~lyxstring): definition moved here since it uses srep.
11962 (size): definition moved here since it uses srep.
11964 * src/support/lyxstring.h: removed a couple of "inline" that should
11967 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11969 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11972 1999-10-21 Juergen Vigna <jug@sad.it>
11974 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11975 set to left if I just remove the width entry (or it is empty).
11977 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11978 paragraph when having dummy paragraphs.
11980 1999-10-20 Juergen Vigna <jug@sad.it>
11982 * src/insets/figinset.C: just commented some fl_free_form calls
11983 and added warnings so that this calls should be activated later
11984 again. This avoids for now a segfault, but we have a memory leak!
11986 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11987 'const char * argument' to 'string argument', this should
11988 fix some Asserts() in lyxstring.C.
11990 * src/lyxfunc.h: Removed the function argAsString(const char *)
11991 as it is not used anymore.
11993 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11995 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11998 * src/Literate.h: some funcs moved from public to private to make
11999 interface clearer. Unneeded args removed.
12001 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12003 (scanBuildLogFile): ditto
12005 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12006 normal TeX Error. Still room for improvement.
12008 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12010 * src/buffer.C (insertErrors): changes to make the error
12011 desctription show properly.
12013 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12016 * src/support/lyxstring.C (helper): changed to use
12017 sizeof(object->rep->ref).
12018 (operator>>): changed to use a pointer instead.
12020 * src/support/lyxstring.h: changed const reference & to value_type
12021 const & lets see if that helps.
12023 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12025 * Makefile.am (rpmdist): fixed to have non static package and
12028 * src/support/lyxstring.C: removed the compilation guards
12030 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12033 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12034 conditional compile of lyxstring.Ch
12036 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12037 stupid check, but it is a lot better than the bastring hack.
12038 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12040 * several files: changed string::erase into string::clear. Not
12043 * src/chset.C (encodeString): use a char temporary instead
12045 * src/table.C (TexEndOfCell): added tostr around
12046 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12047 (TexEndOfCell): ditto
12048 (TexEndOfCell): ditto
12049 (TexEndOfCell): ditto
12050 (DocBookEndOfCell): ditto
12051 (DocBookEndOfCell): ditto
12052 (DocBookEndOfCell): ditto
12053 (DocBookEndOfCell): ditto
12055 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12057 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12059 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12060 (MenuBuildProg): added tostr around ret
12061 (MenuRunChktex): added tostr around ret
12062 (DocumentApplyCB): added tostr around ret
12064 * src/chset.C (encodeString): added tostr around t->ic
12066 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12067 (makeLaTeXFile): added tostr around tocdepth
12068 (makeLaTeXFile): added tostr around ftcound - 1
12070 * src/insets/insetbib.C (setCounter): added tostr around counter.
12072 * src/support/lyxstring.h: added an operator+=(int) to catch more
12075 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12076 (lyxstring): We DON'T allow NULL pointers.
12078 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12080 * src/mathed/math_macro.C (MathMacroArgument::Write,
12081 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12082 when writing them out.
12084 * src/LString.C: remove, since it is not used anymore.
12086 * src/support/lyxstring.C: condition the content to
12087 USE_INCLUDED_STRING macro.
12089 * src/mathed/math_symbols.C, src/support/lstrings.C,
12090 src/support/lyxstring.C: add `using' directive to specify what
12091 we need in <algorithm>. I do not think that we need to
12092 conditionalize this, but any thought is appreciated.
12094 * many files: change all callback functions to "C" linkage
12095 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12096 strict_ansi. Those who were static are now global.
12097 The case of callbacks which are static class members is
12098 trickier, since we have to make C wrappers around them (see
12099 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12100 did not finish this yet, since it defeats the purpose of
12101 encapsulation, and I am not sure what the best route is.
12103 1999-10-19 Juergen Vigna <jug@sad.it>
12105 * src/support/lyxstring.C (lyxstring): we permit to have a null
12106 pointer as assignment value and just don't assign it.
12108 * src/vspace.C (nextToken): corrected this function substituting
12109 find_first(_not)_of with find_last_of.
12111 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12112 (TableOptCloseCB) (TableSpeCloseCB):
12113 inserted fl_set_focus call for problem with fl_hide_form() in
12116 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12118 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12121 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12123 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12124 LyXLex::next() and not eatline() to get its argument.
12126 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12128 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12129 instead, use fstreams for io of the depfile, removed unneeded
12130 functions and variables.
12132 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12133 vector instead, removed all functions and variables that is not in
12136 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12138 * src/buffer.C (insertErrors): use new interface to TeXError
12140 * Makefile.am (rpmdist): added a rpmdist target
12142 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12143 per Kayvan's instructions.
12145 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12147 * src/Makefile.am: add a definition for localedir, so that locales
12148 are found after installation (Kayvan)
12150 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12152 * development/.cvsignore: new file.
12154 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12156 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12157 C++ compiler provides wrappers for C headers and use our alternate
12160 * configure.in: use LYX_CXX_CHEADERS.
12162 * src/cheader/: new directory, populated with cname headers from
12163 libstdc++-2.8.1. They are a bit old, but probably good enough for
12164 what we want (support compilers who lack them).
12166 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12167 from includes. It turns out is was stupid.
12169 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12171 * lib/Makefile.am (install-data-local): forgot a ';'
12172 (install-data-local): forgot a '\'
12173 (libinstalldirs): needed after all. reintroduced.
12175 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12177 * configure.in (AC_OUTPUT): added lyx.spec
12179 * development/lyx.spec: removed file
12181 * development/lyx.spec.in: new file
12183 * po/*.po: merged with lyx.pot becuase of make distcheck
12185 * lib/Makefile.am (dist-hook): added dist-hook so that
12186 documentation files will be included when doing a make
12187 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12188 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12190 more: tried to make install do the right thing, exclude CVS dirs
12193 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12194 Path would fit in more nicely.
12196 * all files that used to use pathstack: uses now Path instead.
12197 This change was a lot easier than expected.
12199 * src/support/path.h: new file
12201 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12203 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12205 * src/support/lyxstring.C (getline): Default arg was given for
12208 * Configure.cmd: removed file
12210 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12212 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12213 streams classes and types, add the proper 'using' statements when
12214 MODERN_STL is defined.
12216 * src/debug.h: move the << operator definition after the inclusion
12219 * src/support/filetools.C: include "LAssert.h", which is needed
12222 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12225 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12226 include "debug.h" to define a proper ostream.
12228 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12230 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12231 method to the SystemCall class which can kill a process, but it's
12232 not fully implemented yet.
12234 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12236 * src/support/FileInfo.h: Better documentation
12238 * src/lyxfunc.C: Added support for buffer-export html
12240 * src/menus.C: Added Export->As HTML...
12242 * lib/bind/*.bind: Added short-cut for buffer-export html
12244 * src/lyxrc.*: Added support for new \tth_command
12246 * lib/lyxrc.example: Added stuff for new \tth_command
12248 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12250 * lib/Makefile.am (IMAGES): removed images/README
12251 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12252 installes in correct place. Check permisions is installed
12255 * src/LaTeX.C: some no-op changes moved declaration of some
12258 * src/LaTeX.h (LATEX_H): changed include guard name
12260 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12262 * lib/reLyX/Makefile.am: install noweb2lyx.
12264 * lib/Makefile.am: install configure.
12266 * lib/reLyX/configure.in: declare a config aux dir; set package
12267 name to lyx (not sure what the best solution is); generate noweb2lyx.
12269 * lib/layouts/egs.layout: fix the bibliography layout.
12271 1999-10-08 Jürgen Vigna <jug@sad.it>
12273 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12274 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12275 it returned without continuing to search the path.
12277 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12279 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12280 also fixes a bug. It is not allowed to do tricks with std::strings
12281 like: string a("hei"); &a[e]; this will not give what you
12282 think... Any reason for the complexity in this func?
12284 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12286 * Updated README and INSTALL a bit, mostly to check that my
12287 CVS rights are correctly set up.
12289 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12291 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12292 does not allow '\0' chars but lyxstring and std::string does.
12294 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12296 * autogen.sh (AUTOCONF): let the autogen script create the
12297 POTFILES.in file too. POTFILES.in should perhaps now not be
12298 included in the cvs module.
12300 * some more files changed to use C++ includes instead of C ones.
12302 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12304 (Reread): added tostr to nlink. buggy output otherwise.
12305 (Reread): added a string() around szMode when assigning to Buffer,
12306 without this I got a log of garbled info strings.
12308 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12311 * I have added several ostream & operator<<(ostream &, some_type)
12312 functions. This has been done to avoid casting and warnings when
12313 outputting enums to lyxerr. This as thus eliminated a lot of
12314 explicit casts and has made the code clearer. Among the enums
12315 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12316 mathed enums, some font enum the Debug::type enum.
12318 * src/support/lyxstring.h (clear): missing method. equivalent of
12321 * all files that contained "stderr": rewrote constructs that used
12322 stderr to use lyxerr instead. (except bmtable)
12324 * src/support/DebugStream.h (level): and the passed t with
12325 Debug::ANY to avoid spurious bits set.
12327 * src/debug.h (Debug::type value): made it accept strings of the
12328 type INFO,INIT,KEY.
12330 * configure.in (Check for programs): Added a check for kpsewhich,
12331 the latex generation will use this later to better the dicovery of
12334 * src/BufferView.C (create_view): we don't need to cast this to
12335 (void*) that is done automatically.
12336 (WorkAreaButtonPress): removed some dead code.
12338 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12340 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12341 is not overwritten when translated (David Sua'rez de Lis).
12343 * lib/CREDITS: Added David Sua'rez de Lis
12345 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12347 * src/bufferparams.C (BufferParams): default input encoding is now
12350 * acinclude.m4 (cross_compiling): comment out macro
12351 LYX_GXX_STRENGTH_REDUCE.
12353 * acconfig.h: make sure that const is not defined (to empty) when
12354 we are compiling C++. Remove commented out code using SIZEOF_xx
12357 * configure.in : move the test for const and inline as late as
12358 possible so that these C tests do not interefere with C++ ones.
12359 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12360 has not been proven.
12362 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12364 * src/table.C (getDocBookAlign): remove bad default value for
12365 isColumn parameter.
12367 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12369 (ShowFileMenu2): ditto.
12371 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12372 of files to ignore.
12374 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12376 * Most files: finished the change from the old error code to use
12377 DebugStream for all lyxerr debugging. Only minor changes remain
12378 (e.g. the setting of debug levels using strings instead of number)
12380 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12382 * src/layout.C (Add): Changed to use compare_no_case instead of
12385 * src/FontInfo.C: changed loop variable type too string::size_type.
12387 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12389 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12390 set ETAGS_ARGS to --c++
12392 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12394 * src/table.C (DocBookEndOfCell): commented out two unused variables
12396 * src/paragraph.C: commented out four unused variables.
12398 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12399 insed a if clause with type string::size_type.
12401 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12404 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12406 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12407 variable, also changed loop to go from 0 to lenght + 1, instead of
12408 -1 to length. This should be correct.
12410 * src/LaTeX.C (scanError): use string::size_type as loop variable
12413 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12414 (l.896) since y_tmp and row was not used anyway.
12416 * src/insets/insetref.C (escape): use string::size_type as loop
12419 * src/insets/insetquotes.C (Width): use string::size_type as loop
12421 (Draw): use string::size_type as loop variable type.
12423 * src/insets/insetlatexaccent.C (checkContents): use
12424 string::size_type as loop variable type.
12426 * src/insets/insetlabel.C (escape): use string::size_type as loop
12429 * src/insets/insetinfo.C: added an extern for current_view.
12431 * src/insets/insetcommand.C (scanCommand): use string::size_type
12432 as loop variable type.
12434 * most files: removed the RCS tags. With them we had to recompile
12435 a lot of files after a simple cvs commit. Also we have never used
12436 them for anything meaningful.
12438 * most files: tags-query-replace NULL 0. As adviced several plases
12439 we now use "0" instead of "NULL" in our code.
12441 * src/support/filetools.C (SpaceLess): use string::size_type as
12442 loop variable type.
12444 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12446 * src/paragraph.C: fixed up some more string stuff.
12448 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12450 * src/support/filetools.h: make modestr a std::string.
12452 * src/filetools.C (GetEnv): made ch really const.
12454 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12455 made code that used these use max/min from <algorithm> instead.
12457 * changed several c library include files to their equivalent c++
12458 library include files. All is not changed yet.
12460 * created a support subdir in src, put lyxstring and lstrings
12461 there + the extra files atexit, fileblock, strerror. Created
12462 Makefile.am. edited configure.in and src/Makefile.am to use this
12463 new subdir. More files moved to support.
12465 * imported som of the functions from repository lyx, filetools
12467 * ran tags-query-replace on LString -> string, corrected the bogus
12468 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12469 is still some errors in there. This is errors where too much or
12470 too litle get deleted from strings (string::erase, string::substr,
12471 string::replace), there can also be some off by one errors, or
12472 just plain wrong use of functions from lstrings. Viewing of quotes
12475 * LyX is now running fairly well with string, but there are
12476 certainly some bugs yet (see above) also string is quite different
12477 from LString among others in that it does not allow null pointers
12478 passed in and will abort if it gets any.
12480 * Added the revtex4 files I forgot when setting up the repository.
12482 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12484 * All over: Tried to clean everything up so that only the files
12485 that we really need are included in the cvs repository.
12486 * Switched to use automake.
12487 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12488 * Install has not been checked.
12490 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12492 * po/pt.po: Three errors:
12493 l.533 and l.538 format specification error
12494 l. 402 duplicate entry, I just deleted it.